hexsha
stringlengths
40
40
size
int64
2
1.02M
ext
stringclasses
10 values
lang
stringclasses
1 value
max_stars_repo_path
stringlengths
4
245
max_stars_repo_name
stringlengths
6
130
max_stars_repo_head_hexsha
stringlengths
40
40
max_stars_repo_licenses
listlengths
1
10
max_stars_count
int64
1
191k
max_stars_repo_stars_event_min_datetime
stringlengths
24
24
max_stars_repo_stars_event_max_datetime
stringlengths
24
24
max_issues_repo_path
stringlengths
4
245
max_issues_repo_name
stringlengths
6
130
max_issues_repo_head_hexsha
stringlengths
40
40
max_issues_repo_licenses
listlengths
1
10
max_issues_count
int64
1
67k
max_issues_repo_issues_event_min_datetime
stringlengths
24
24
max_issues_repo_issues_event_max_datetime
stringlengths
24
24
max_forks_repo_path
stringlengths
4
245
max_forks_repo_name
stringlengths
6
130
max_forks_repo_head_hexsha
stringlengths
40
40
max_forks_repo_licenses
listlengths
1
10
max_forks_count
int64
1
105k
max_forks_repo_forks_event_min_datetime
stringlengths
24
24
max_forks_repo_forks_event_max_datetime
stringlengths
24
24
content
stringlengths
2
1.02M
avg_line_length
float64
1
958k
max_line_length
int64
1
987k
alphanum_fraction
float64
0
1
content_no_comment
stringlengths
0
1.01M
is_comment_constant_removed
bool
2 classes
is_sharp_comment_removed
bool
1 class
f72b7f5a198735854caf644778be99b784ac4157
19,981
py
Python
Lib/distutils/sysconfig.py
zgrge/cpython
0e59d247457dde747d84c899e96423647b3da149
[ "PSF-2.0" ]
null
null
null
Lib/distutils/sysconfig.py
zgrge/cpython
0e59d247457dde747d84c899e96423647b3da149
[ "PSF-2.0" ]
null
null
null
Lib/distutils/sysconfig.py
zgrge/cpython
0e59d247457dde747d84c899e96423647b3da149
[ "PSF-2.0" ]
1
2021-09-04T13:33:46.000Z
2021-09-04T13:33:46.000Z
"""Provide access to Python's configuration information. The specific configuration variables available depend heavily on the platform and configuration. The values may be retrieved using get_config_var(name), and the list of variables is available via get_config_vars().keys(). Additional convenience functions are also available. Written by: Fred L. Drake, Jr. Email: <fdrake@acm.org> """ import _imp import os import re import sys from .errors import DistutilsPlatformError # These are needed in a couple of spots, so just compute them once. PREFIX = os.path.normpath(sys.prefix) EXEC_PREFIX = os.path.normpath(sys.exec_prefix) BASE_PREFIX = os.path.normpath(sys.base_prefix) BASE_EXEC_PREFIX = os.path.normpath(sys.base_exec_prefix) # Path to the base directory of the project. On Windows the binary may # live in project/PCBuild/win32 or project/PCBuild/amd64. # set for cross builds if "_PYTHON_PROJECT_BASE" in os.environ: project_base = os.path.abspath(os.environ["_PYTHON_PROJECT_BASE"]) else: project_base = os.path.dirname(os.path.abspath(sys.executable)) if (os.name == 'nt' and project_base.lower().endswith(('\\pcbuild\\win32', '\\pcbuild\\amd64'))): project_base = os.path.dirname(os.path.dirname(project_base)) # python_build: (Boolean) if true, we're either building Python or # building an extension with an un-installed Python, so we use # different (hard-wired) directories. # Setup.local is available for Makefile builds including VPATH builds, # Setup.dist is available on Windows def _is_python_source_dir(d): for fn in ("Setup.dist", "Setup.local"): if os.path.isfile(os.path.join(d, "Modules", fn)): return True return False _sys_home = getattr(sys, '_home', None) if (_sys_home and os.name == 'nt' and _sys_home.lower().endswith(('\\pcbuild\\win32', '\\pcbuild\\amd64'))): _sys_home = os.path.dirname(os.path.dirname(_sys_home)) def _python_build(): if _sys_home: return _is_python_source_dir(_sys_home) return _is_python_source_dir(project_base) python_build = _python_build() # Calculate the build qualifier flags if they are defined. Adding the flags # to the include and lib directories only makes sense for an installation, not # an in-source build. build_flags = '' try: if not python_build: build_flags = sys.abiflags except AttributeError: # It's not a configure-based build, so the sys module doesn't have # this attribute, which is fine. pass def get_python_version(): """Return a string containing the major and minor Python version, leaving off the patchlevel. Sample return values could be '1.5' or '2.2'. """ return '%d.%d' % sys.version_info[:2] def get_python_inc(plat_specific=0, prefix=None): """Return the directory containing installed Python header files. If 'plat_specific' is false (the default), this is the path to the non-platform-specific header files, i.e. Python.h and so on; otherwise, this is the path to platform-specific header files (namely pyconfig.h). If 'prefix' is supplied, use it instead of sys.base_prefix or sys.base_exec_prefix -- i.e., ignore 'plat_specific'. """ if prefix is None: prefix = plat_specific and BASE_EXEC_PREFIX or BASE_PREFIX if os.name == "posix": if python_build: # Assume the executable is in the build directory. The # pyconfig.h file should be in the same directory. Since # the build directory may not be the source directory, we # must use "srcdir" from the makefile to find the "Include" # directory. base = _sys_home or project_base if plat_specific: return base if _sys_home: incdir = os.path.join(_sys_home, get_config_var('AST_H_DIR')) else: incdir = os.path.join(get_config_var('srcdir'), 'Include') return os.path.normpath(incdir) python_dir = 'python' + get_python_version() + build_flags return os.path.join(prefix, "include", python_dir) elif os.name == "nt": return os.path.join(prefix, "include") else: raise DistutilsPlatformError( "I don't know where Python installs its C header files " "on platform '%s'" % os.name) def get_python_lib(plat_specific=0, standard_lib=0, prefix=None): """Return the directory containing the Python library (standard or site additions). If 'plat_specific' is true, return the directory containing platform-specific modules, i.e. any module from a non-pure-Python module distribution; otherwise, return the platform-shared library directory. If 'standard_lib' is true, return the directory containing standard Python library modules; otherwise, return the directory for site-specific modules. If 'prefix' is supplied, use it instead of sys.base_prefix or sys.base_exec_prefix -- i.e., ignore 'plat_specific'. """ if prefix is None: if standard_lib: prefix = plat_specific and BASE_EXEC_PREFIX or BASE_PREFIX else: prefix = plat_specific and EXEC_PREFIX or PREFIX if os.name == "posix": libpython = os.path.join(prefix, "lib", "python" + get_python_version()) if standard_lib: return libpython else: return os.path.join(libpython, "site-packages") elif os.name == "nt": if standard_lib: return os.path.join(prefix, "Lib") else: return os.path.join(prefix, "Lib", "site-packages") else: raise DistutilsPlatformError( "I don't know where Python installs its library " "on platform '%s'" % os.name) def customize_compiler(compiler): """Do any platform-specific customization of a CCompiler instance. Mainly needed on Unix, so we can plug in the information that varies across Unices and is stored in Python's Makefile. """ if compiler.compiler_type == "unix": if sys.platform == "darwin": # Perform first-time customization of compiler-related # config vars on OS X now that we know we need a compiler. # This is primarily to support Pythons from binary # installers. The kind and paths to build tools on # the user system may vary significantly from the system # that Python itself was built on. Also the user OS # version and build tools may not support the same set # of CPU architectures for universal builds. global _config_vars # Use get_config_var() to ensure _config_vars is initialized. if not get_config_var('CUSTOMIZED_OSX_COMPILER'): import _osx_support _osx_support.customize_compiler(_config_vars) _config_vars['CUSTOMIZED_OSX_COMPILER'] = 'True' (cc, cxx, opt, cflags, ccshared, ldshared, shlib_suffix, ar, ar_flags) = \ get_config_vars('CC', 'CXX', 'OPT', 'CFLAGS', 'CCSHARED', 'LDSHARED', 'SHLIB_SUFFIX', 'AR', 'ARFLAGS') if 'CC' in os.environ: newcc = os.environ['CC'] if (sys.platform == 'darwin' and 'LDSHARED' not in os.environ and ldshared.startswith(cc)): # On OS X, if CC is overridden, use that as the default # command for LDSHARED as well ldshared = newcc + ldshared[len(cc):] cc = newcc if 'CXX' in os.environ: cxx = os.environ['CXX'] if 'LDSHARED' in os.environ: ldshared = os.environ['LDSHARED'] if 'CPP' in os.environ: cpp = os.environ['CPP'] else: cpp = cc + " -E" # not always if 'LDFLAGS' in os.environ: ldshared = ldshared + ' ' + os.environ['LDFLAGS'] if 'CFLAGS' in os.environ: cflags = opt + ' ' + os.environ['CFLAGS'] ldshared = ldshared + ' ' + os.environ['CFLAGS'] if 'CPPFLAGS' in os.environ: cpp = cpp + ' ' + os.environ['CPPFLAGS'] cflags = cflags + ' ' + os.environ['CPPFLAGS'] ldshared = ldshared + ' ' + os.environ['CPPFLAGS'] if 'AR' in os.environ: ar = os.environ['AR'] if 'ARFLAGS' in os.environ: archiver = ar + ' ' + os.environ['ARFLAGS'] else: archiver = ar + ' ' + ar_flags cc_cmd = cc + ' ' + cflags compiler.set_executables( preprocessor=cpp, compiler=cc_cmd, compiler_so=cc_cmd + ' ' + ccshared, compiler_cxx=cxx, linker_so=ldshared, linker_exe=cc, archiver=archiver) compiler.shared_lib_extension = shlib_suffix def get_config_h_filename(): """Return full pathname of installed pyconfig.h file.""" if python_build: if os.name == "nt": inc_dir = os.path.join(_sys_home or project_base, "PC") else: inc_dir = _sys_home or project_base else: inc_dir = get_python_inc(plat_specific=1) return os.path.join(inc_dir, 'pyconfig.h') def get_makefile_filename(): """Return full pathname of installed Makefile from the Python build.""" if python_build: return os.path.join(_sys_home or project_base, "Makefile") lib_dir = get_python_lib(plat_specific=0, standard_lib=1) config_file = 'config-{}{}'.format(get_python_version(), build_flags) if hasattr(sys.implementation, '_multiarch'): config_file += '-%s' % sys.implementation._multiarch return os.path.join(lib_dir, config_file, 'Makefile') def parse_config_h(fp, g=None): """Parse a config.h-style file. A dictionary containing name/value pairs is returned. If an optional dictionary is passed in as the second argument, it is used instead of a new dictionary. """ if g is None: g = {} define_rx = re.compile("#define ([A-Z][A-Za-z0-9_]+) (.*)\n") undef_rx = re.compile("/[*] #undef ([A-Z][A-Za-z0-9_]+) [*]/\n") # while True: line = fp.readline() if not line: break m = define_rx.match(line) if m: n, v = m.group(1, 2) try: v = int(v) except ValueError: pass g[n] = v else: m = undef_rx.match(line) if m: g[m.group(1)] = 0 return g # Regexes needed for parsing Makefile (and similar syntaxes, # like old-style Setup files). _variable_rx = re.compile("([a-zA-Z][a-zA-Z0-9_]+)\s*=\s*(.*)") _findvar1_rx = re.compile(r"\$\(([A-Za-z][A-Za-z0-9_]*)\)") _findvar2_rx = re.compile(r"\${([A-Za-z][A-Za-z0-9_]*)}") def parse_makefile(fn, g=None): """Parse a Makefile-style file. A dictionary containing name/value pairs is returned. If an optional dictionary is passed in as the second argument, it is used instead of a new dictionary. """ from distutils.text_file import TextFile fp = TextFile(fn, strip_comments=1, skip_blanks=1, join_lines=1, errors="surrogateescape") if g is None: g = {} done = {} notdone = {} while True: line = fp.readline() if line is None: # eof break m = _variable_rx.match(line) if m: n, v = m.group(1, 2) v = v.strip() # `$$' is a literal `$' in make tmpv = v.replace('$$', '') if "$" in tmpv: notdone[n] = v else: try: v = int(v) except ValueError: # insert literal `$' done[n] = v.replace('$$', '$') else: done[n] = v # Variables with a 'PY_' prefix in the makefile. These need to # be made available without that prefix through sysconfig. # Special care is needed to ensure that variable expansion works, even # if the expansion uses the name without a prefix. renamed_variables = ('CFLAGS', 'LDFLAGS', 'CPPFLAGS') # do variable interpolation here while notdone: for name in list(notdone): value = notdone[name] m = _findvar1_rx.search(value) or _findvar2_rx.search(value) if m: n = m.group(1) found = True if n in done: item = str(done[n]) elif n in notdone: # get it on a subsequent round found = False elif n in os.environ: # do it like make: fall back to environment item = os.environ[n] elif n in renamed_variables: if name.startswith('PY_') and name[3:] in renamed_variables: item = "" elif 'PY_' + n in notdone: found = False else: item = str(done['PY_' + n]) else: done[n] = item = "" if found: after = value[m.end():] value = value[:m.start()] + item + after if "$" in after: notdone[name] = value else: try: value = int(value) except ValueError: done[name] = value.strip() else: done[name] = value del notdone[name] if name.startswith('PY_') \ and name[3:] in renamed_variables: name = name[3:] if name not in done: done[name] = value else: # bogus variable reference; just drop it since we can't deal del notdone[name] fp.close() # strip spurious spaces for k, v in done.items(): if isinstance(v, str): done[k] = v.strip() # save the results in the global dictionary g.update(done) return g def expand_makefile_vars(s, vars): """Expand Makefile-style variables -- "${foo}" or "$(foo)" -- in 'string' according to 'vars' (a dictionary mapping variable names to values). Variables not present in 'vars' are silently expanded to the empty string. The variable values in 'vars' should not contain further variable expansions; if 'vars' is the output of 'parse_makefile()', you're fine. Returns a variable-expanded version of 's'. """ # This algorithm does multiple expansion, so if vars['foo'] contains # "${bar}", it will expand ${foo} to ${bar}, and then expand # ${bar}... and so forth. This is fine as long as 'vars' comes from # 'parse_makefile()', which takes care of such expansions eagerly, # according to make's variable expansion semantics. while True: m = _findvar1_rx.search(s) or _findvar2_rx.search(s) if m: (beg, end) = m.span() s = s[0:beg] + vars.get(m.group(1)) + s[end:] else: break return s _config_vars = None def _init_posix(): """Initialize the module as appropriate for POSIX systems.""" # _sysconfigdata is generated at build time, see the sysconfig module name = '_sysconfigdata_' + sys.abiflags _temp = __import__(name, globals(), locals(), ['build_time_vars'], 0) build_time_vars = _temp.build_time_vars global _config_vars _config_vars = {} _config_vars.update(build_time_vars) def _init_nt(): """Initialize the module as appropriate for NT""" g = {} # set basic install directories g['LIBDEST'] = get_python_lib(plat_specific=0, standard_lib=1) g['BINLIBDEST'] = get_python_lib(plat_specific=1, standard_lib=1) # XXX hmmm.. a normal install puts include files here g['INCLUDEPY'] = get_python_inc(plat_specific=0) g['EXT_SUFFIX'] = _imp.extension_suffixes()[0] g['EXE'] = ".exe" g['VERSION'] = get_python_version().replace(".", "") g['BINDIR'] = os.path.dirname(os.path.abspath(sys.executable)) global _config_vars _config_vars = g def get_config_vars(*args): """With no arguments, return a dictionary of all configuration variables relevant for the current platform. Generally this includes everything needed to build extensions and install both pure modules and extensions. On Unix, this means every variable defined in Python's installed Makefile; on Windows it's a much smaller set. With arguments, return a list of values that result from looking up each argument in the configuration variable dictionary. """ global _config_vars if _config_vars is None: func = globals().get("_init_" + os.name) if func: func() else: _config_vars = {} # Normalized versions of prefix and exec_prefix are handy to have; # in fact, these are the standard versions used most places in the # Distutils. _config_vars['prefix'] = PREFIX _config_vars['exec_prefix'] = EXEC_PREFIX # For backward compatibility, see issue19555 SO = _config_vars.get('EXT_SUFFIX') if SO is not None: _config_vars['SO'] = SO # Always convert srcdir to an absolute path srcdir = _config_vars.get('srcdir', project_base) if os.name == 'posix': if python_build: # If srcdir is a relative path (typically '.' or '..') # then it should be interpreted relative to the directory # containing Makefile. base = os.path.dirname(get_makefile_filename()) srcdir = os.path.join(base, srcdir) else: # srcdir is not meaningful since the installation is # spread about the filesystem. We choose the # directory containing the Makefile since we know it # exists. srcdir = os.path.dirname(get_makefile_filename()) _config_vars['srcdir'] = os.path.abspath(os.path.normpath(srcdir)) # Convert srcdir into an absolute path if it appears necessary. # Normally it is relative to the build directory. However, during # testing, for example, we might be running a non-installed python # from a different directory. if python_build and os.name == "posix": base = project_base if (not os.path.isabs(_config_vars['srcdir']) and base != os.getcwd()): # srcdir is relative and we are not in the same directory # as the executable. Assume executable is in the build # directory and make srcdir absolute. srcdir = os.path.join(base, _config_vars['srcdir']) _config_vars['srcdir'] = os.path.normpath(srcdir) # OS X platforms require special customization to handle # multi-architecture, multi-os-version installers if sys.platform == 'darwin': import _osx_support _osx_support.customize_config_vars(_config_vars) if args: vals = [] for name in args: vals.append(_config_vars.get(name)) return vals else: return _config_vars def get_config_var(name): """Return the value of a single variable using the dictionary returned by 'get_config_vars()'. Equivalent to get_config_vars().get(name) """ if name == 'SO': import warnings warnings.warn('SO is deprecated, use EXT_SUFFIX', DeprecationWarning, 2) return get_config_vars().get(name)
37.629002
94
0.598619
import _imp import os import re import sys from .errors import DistutilsPlatformError PREFIX = os.path.normpath(sys.prefix) EXEC_PREFIX = os.path.normpath(sys.exec_prefix) BASE_PREFIX = os.path.normpath(sys.base_prefix) BASE_EXEC_PREFIX = os.path.normpath(sys.base_exec_prefix) if "_PYTHON_PROJECT_BASE" in os.environ: project_base = os.path.abspath(os.environ["_PYTHON_PROJECT_BASE"]) else: project_base = os.path.dirname(os.path.abspath(sys.executable)) if (os.name == 'nt' and project_base.lower().endswith(('\\pcbuild\\win32', '\\pcbuild\\amd64'))): project_base = os.path.dirname(os.path.dirname(project_base)) # building an extension with an un-installed Python, so we use # different (hard-wired) directories. # Setup.local is available for Makefile builds including VPATH builds, # Setup.dist is available on Windows def _is_python_source_dir(d): for fn in ("Setup.dist", "Setup.local"): if os.path.isfile(os.path.join(d, "Modules", fn)): return True return False _sys_home = getattr(sys, '_home', None) if (_sys_home and os.name == 'nt' and _sys_home.lower().endswith(('\\pcbuild\\win32', '\\pcbuild\\amd64'))): _sys_home = os.path.dirname(os.path.dirname(_sys_home)) def _python_build(): if _sys_home: return _is_python_source_dir(_sys_home) return _is_python_source_dir(project_base) python_build = _python_build() # Calculate the build qualifier flags if they are defined. Adding the flags # to the include and lib directories only makes sense for an installation, not # an in-source build. build_flags = '' try: if not python_build: build_flags = sys.abiflags except AttributeError: # It's not a configure-based build, so the sys module doesn't have # this attribute, which is fine. pass def get_python_version(): return '%d.%d' % sys.version_info[:2] def get_python_inc(plat_specific=0, prefix=None): if prefix is None: prefix = plat_specific and BASE_EXEC_PREFIX or BASE_PREFIX if os.name == "posix": if python_build: # Assume the executable is in the build directory. The # pyconfig.h file should be in the same directory. Since # the build directory may not be the source directory, we # must use "srcdir" from the makefile to find the "Include" # directory. base = _sys_home or project_base if plat_specific: return base if _sys_home: incdir = os.path.join(_sys_home, get_config_var('AST_H_DIR')) else: incdir = os.path.join(get_config_var('srcdir'), 'Include') return os.path.normpath(incdir) python_dir = 'python' + get_python_version() + build_flags return os.path.join(prefix, "include", python_dir) elif os.name == "nt": return os.path.join(prefix, "include") else: raise DistutilsPlatformError( "I don't know where Python installs its C header files " "on platform '%s'" % os.name) def get_python_lib(plat_specific=0, standard_lib=0, prefix=None): if prefix is None: if standard_lib: prefix = plat_specific and BASE_EXEC_PREFIX or BASE_PREFIX else: prefix = plat_specific and EXEC_PREFIX or PREFIX if os.name == "posix": libpython = os.path.join(prefix, "lib", "python" + get_python_version()) if standard_lib: return libpython else: return os.path.join(libpython, "site-packages") elif os.name == "nt": if standard_lib: return os.path.join(prefix, "Lib") else: return os.path.join(prefix, "Lib", "site-packages") else: raise DistutilsPlatformError( "I don't know where Python installs its library " "on platform '%s'" % os.name) def customize_compiler(compiler): if compiler.compiler_type == "unix": if sys.platform == "darwin": # Perform first-time customization of compiler-related # config vars on OS X now that we know we need a compiler. # This is primarily to support Pythons from binary # installers. The kind and paths to build tools on # the user system may vary significantly from the system # that Python itself was built on. Also the user OS # version and build tools may not support the same set # of CPU architectures for universal builds. global _config_vars # Use get_config_var() to ensure _config_vars is initialized. if not get_config_var('CUSTOMIZED_OSX_COMPILER'): import _osx_support _osx_support.customize_compiler(_config_vars) _config_vars['CUSTOMIZED_OSX_COMPILER'] = 'True' (cc, cxx, opt, cflags, ccshared, ldshared, shlib_suffix, ar, ar_flags) = \ get_config_vars('CC', 'CXX', 'OPT', 'CFLAGS', 'CCSHARED', 'LDSHARED', 'SHLIB_SUFFIX', 'AR', 'ARFLAGS') if 'CC' in os.environ: newcc = os.environ['CC'] if (sys.platform == 'darwin' and 'LDSHARED' not in os.environ and ldshared.startswith(cc)): # On OS X, if CC is overridden, use that as the default # command for LDSHARED as well ldshared = newcc + ldshared[len(cc):] cc = newcc if 'CXX' in os.environ: cxx = os.environ['CXX'] if 'LDSHARED' in os.environ: ldshared = os.environ['LDSHARED'] if 'CPP' in os.environ: cpp = os.environ['CPP'] else: cpp = cc + " -E" # not always if 'LDFLAGS' in os.environ: ldshared = ldshared + ' ' + os.environ['LDFLAGS'] if 'CFLAGS' in os.environ: cflags = opt + ' ' + os.environ['CFLAGS'] ldshared = ldshared + ' ' + os.environ['CFLAGS'] if 'CPPFLAGS' in os.environ: cpp = cpp + ' ' + os.environ['CPPFLAGS'] cflags = cflags + ' ' + os.environ['CPPFLAGS'] ldshared = ldshared + ' ' + os.environ['CPPFLAGS'] if 'AR' in os.environ: ar = os.environ['AR'] if 'ARFLAGS' in os.environ: archiver = ar + ' ' + os.environ['ARFLAGS'] else: archiver = ar + ' ' + ar_flags cc_cmd = cc + ' ' + cflags compiler.set_executables( preprocessor=cpp, compiler=cc_cmd, compiler_so=cc_cmd + ' ' + ccshared, compiler_cxx=cxx, linker_so=ldshared, linker_exe=cc, archiver=archiver) compiler.shared_lib_extension = shlib_suffix def get_config_h_filename(): if python_build: if os.name == "nt": inc_dir = os.path.join(_sys_home or project_base, "PC") else: inc_dir = _sys_home or project_base else: inc_dir = get_python_inc(plat_specific=1) return os.path.join(inc_dir, 'pyconfig.h') def get_makefile_filename(): if python_build: return os.path.join(_sys_home or project_base, "Makefile") lib_dir = get_python_lib(plat_specific=0, standard_lib=1) config_file = 'config-{}{}'.format(get_python_version(), build_flags) if hasattr(sys.implementation, '_multiarch'): config_file += '-%s' % sys.implementation._multiarch return os.path.join(lib_dir, config_file, 'Makefile') def parse_config_h(fp, g=None): if g is None: g = {} define_rx = re.compile("#define ([A-Z][A-Za-z0-9_]+) (.*)\n") undef_rx = re.compile("/[*] #undef ([A-Z][A-Za-z0-9_]+) [*]/\n") # while True: line = fp.readline() if not line: break m = define_rx.match(line) if m: n, v = m.group(1, 2) try: v = int(v) except ValueError: pass g[n] = v else: m = undef_rx.match(line) if m: g[m.group(1)] = 0 return g # Regexes needed for parsing Makefile (and similar syntaxes, # like old-style Setup files). _variable_rx = re.compile("([a-zA-Z][a-zA-Z0-9_]+)\s*=\s*(.*)") _findvar1_rx = re.compile(r"\$\(([A-Za-z][A-Za-z0-9_]*)\)") _findvar2_rx = re.compile(r"\${([A-Za-z][A-Za-z0-9_]*)}") def parse_makefile(fn, g=None): from distutils.text_file import TextFile fp = TextFile(fn, strip_comments=1, skip_blanks=1, join_lines=1, errors="surrogateescape") if g is None: g = {} done = {} notdone = {} while True: line = fp.readline() if line is None: # eof break m = _variable_rx.match(line) if m: n, v = m.group(1, 2) v = v.strip() # `$$' is a literal `$' in make tmpv = v.replace('$$', '') if "$" in tmpv: notdone[n] = v else: try: v = int(v) except ValueError: # insert literal `$' done[n] = v.replace('$$', '$') else: done[n] = v renamed_variables = ('CFLAGS', 'LDFLAGS', 'CPPFLAGS') while notdone: for name in list(notdone): value = notdone[name] m = _findvar1_rx.search(value) or _findvar2_rx.search(value) if m: n = m.group(1) found = True if n in done: item = str(done[n]) elif n in notdone: found = False elif n in os.environ: item = os.environ[n] elif n in renamed_variables: if name.startswith('PY_') and name[3:] in renamed_variables: item = "" elif 'PY_' + n in notdone: found = False else: item = str(done['PY_' + n]) else: done[n] = item = "" if found: after = value[m.end():] value = value[:m.start()] + item + after if "$" in after: notdone[name] = value else: try: value = int(value) except ValueError: done[name] = value.strip() else: done[name] = value del notdone[name] if name.startswith('PY_') \ and name[3:] in renamed_variables: name = name[3:] if name not in done: done[name] = value else: del notdone[name] fp.close() # strip spurious spaces for k, v in done.items(): if isinstance(v, str): done[k] = v.strip() # save the results in the global dictionary g.update(done) return g def expand_makefile_vars(s, vars): # This algorithm does multiple expansion, so if vars['foo'] contains # "${bar}", it will expand ${foo} to ${bar}, and then expand # ${bar}... and so forth. This is fine as long as 'vars' comes from # 'parse_makefile()', which takes care of such expansions eagerly, # according to make's variable expansion semantics. while True: m = _findvar1_rx.search(s) or _findvar2_rx.search(s) if m: (beg, end) = m.span() s = s[0:beg] + vars.get(m.group(1)) + s[end:] else: break return s _config_vars = None def _init_posix(): name = '_sysconfigdata_' + sys.abiflags _temp = __import__(name, globals(), locals(), ['build_time_vars'], 0) build_time_vars = _temp.build_time_vars global _config_vars _config_vars = {} _config_vars.update(build_time_vars) def _init_nt(): g = {} g['LIBDEST'] = get_python_lib(plat_specific=0, standard_lib=1) g['BINLIBDEST'] = get_python_lib(plat_specific=1, standard_lib=1) g['INCLUDEPY'] = get_python_inc(plat_specific=0) g['EXT_SUFFIX'] = _imp.extension_suffixes()[0] g['EXE'] = ".exe" g['VERSION'] = get_python_version().replace(".", "") g['BINDIR'] = os.path.dirname(os.path.abspath(sys.executable)) global _config_vars _config_vars = g def get_config_vars(*args): global _config_vars if _config_vars is None: func = globals().get("_init_" + os.name) if func: func() else: _config_vars = {} _config_vars['prefix'] = PREFIX _config_vars['exec_prefix'] = EXEC_PREFIX SO = _config_vars.get('EXT_SUFFIX') if SO is not None: _config_vars['SO'] = SO srcdir = _config_vars.get('srcdir', project_base) if os.name == 'posix': if python_build: base = os.path.dirname(get_makefile_filename()) srcdir = os.path.join(base, srcdir) else: srcdir = os.path.dirname(get_makefile_filename()) _config_vars['srcdir'] = os.path.abspath(os.path.normpath(srcdir)) if python_build and os.name == "posix": base = project_base if (not os.path.isabs(_config_vars['srcdir']) and base != os.getcwd()): srcdir = os.path.join(base, _config_vars['srcdir']) _config_vars['srcdir'] = os.path.normpath(srcdir) if sys.platform == 'darwin': import _osx_support _osx_support.customize_config_vars(_config_vars) if args: vals = [] for name in args: vals.append(_config_vars.get(name)) return vals else: return _config_vars def get_config_var(name): if name == 'SO': import warnings warnings.warn('SO is deprecated, use EXT_SUFFIX', DeprecationWarning, 2) return get_config_vars().get(name)
true
true
f72b80495eb53cc9c695a5f53c6e25c1d550506d
2,820
py
Python
tack/commands/Command.py
moxie0/TACKpy
5cd8ee33b4a6eba4ae9fed3582682e2658e4fee2
[ "Unlicense" ]
15
2015-04-11T03:51:16.000Z
2022-02-01T10:37:47.000Z
tack/commands/Command.py
moxie0/TACKpy
5cd8ee33b4a6eba4ae9fed3582682e2658e4fee2
[ "Unlicense" ]
null
null
null
tack/commands/Command.py
moxie0/TACKpy
5cd8ee33b4a6eba4ae9fed3582682e2658e4fee2
[ "Unlicense" ]
5
2016-09-26T17:50:35.000Z
2022-02-01T10:37:48.000Z
import getopt import getpass import sys import time from tack.structures.TackKeyFile import TackKeyFile from tack.util.Time import Time from tack.version import __version__ from tack.InvalidPasswordException import InvalidPasswordException class Command: def __init__(self, argv, options, flags): try: self.argv = argv self.flags = flags self.options = ":".join(options) + ":" self.values, self.remainder = getopt.getopt(argv, self.options + self.flags) except getopt.GetoptError as e: self.printError(e) def isVerbose(self): return self._containsOption("-v") def getPassword(self): return self._getOptionValue("-p") def getKey(self, password): keyPemFile = self._getOptionValue("-k") if not keyPemFile: self.printError("-k missing (TACK Key)") if not password: password = self._promptPassword() try: keyPemData = open(keyPemFile, "rU").read() while True: try: inKey = TackKeyFile.createFromPem(keyPemData, password) return inKey except InvalidPasswordException, ipe: sys.stderr.write("Password incorrect!\n") password = self._promptPassword() except SyntaxError: self.printError("Error processing TACK Key File") except IOError: self.printError("Error opening TACK Key File: %s" % keyPemFile) def getOutputFile(self): output = None try: output = self._getOptionValue("-o") if output is None: return sys.stdout, None else: return open(output, "w"), output except IOError: self.printError("Error opening output file: %s" % output) def addPemComments(self, inStr): """Add pre-PEM metadata/comments to PEM strings.""" versionStr = __version__ timeStr = Time.posixTimeToStr(time.time(), True) outStr = "Created by tack.py %s\nCreated at %s\n%s" %\ (versionStr, timeStr, inStr) return outStr def _promptPassword(self): return getpass.getpass("Enter password for key file: ") def _getOptionValue(self, flag): for option, value in self.values: if option == flag: return value return None def _containsOption(self, flag): for option, value in self.values: if option == flag: return True def printError(self, error): """Print error message and exit""" sys.stderr.write("ERROR: %s\n" % error) sys.exit(-1)
30
88
0.569858
import getopt import getpass import sys import time from tack.structures.TackKeyFile import TackKeyFile from tack.util.Time import Time from tack.version import __version__ from tack.InvalidPasswordException import InvalidPasswordException class Command: def __init__(self, argv, options, flags): try: self.argv = argv self.flags = flags self.options = ":".join(options) + ":" self.values, self.remainder = getopt.getopt(argv, self.options + self.flags) except getopt.GetoptError as e: self.printError(e) def isVerbose(self): return self._containsOption("-v") def getPassword(self): return self._getOptionValue("-p") def getKey(self, password): keyPemFile = self._getOptionValue("-k") if not keyPemFile: self.printError("-k missing (TACK Key)") if not password: password = self._promptPassword() try: keyPemData = open(keyPemFile, "rU").read() while True: try: inKey = TackKeyFile.createFromPem(keyPemData, password) return inKey except InvalidPasswordException, ipe: sys.stderr.write("Password incorrect!\n") password = self._promptPassword() except SyntaxError: self.printError("Error processing TACK Key File") except IOError: self.printError("Error opening TACK Key File: %s" % keyPemFile) def getOutputFile(self): output = None try: output = self._getOptionValue("-o") if output is None: return sys.stdout, None else: return open(output, "w"), output except IOError: self.printError("Error opening output file: %s" % output) def addPemComments(self, inStr): """Add pre-PEM metadata/comments to PEM strings.""" versionStr = __version__ timeStr = Time.posixTimeToStr(time.time(), True) outStr = "Created by tack.py %s\nCreated at %s\n%s" %\ (versionStr, timeStr, inStr) return outStr def _promptPassword(self): return getpass.getpass("Enter password for key file: ") def _getOptionValue(self, flag): for option, value in self.values: if option == flag: return value return None def _containsOption(self, flag): for option, value in self.values: if option == flag: return True def printError(self, error): """Print error message and exit""" sys.stderr.write("ERROR: %s\n" % error) sys.exit(-1)
false
true
f72b8091065be3b6530f5a20ec604f2dd1b4fe73
5,012
py
Python
core/routine.py
cybert79/Osmedeus
684d853144e2f85343c3367440120142455f296b
[ "MIT" ]
1
2019-07-14T20:48:19.000Z
2019-07-14T20:48:19.000Z
core/routine.py
KbaHaxor/Osmedeus
0894d52ad5949e9151b0fd05d9746ecafc8057b5
[ "MIT" ]
null
null
null
core/routine.py
KbaHaxor/Osmedeus
0894d52ad5949e9151b0fd05d9746ecafc8057b5
[ "MIT" ]
null
null
null
import sys, time from core import utils from pprint import pprint from modules import initials from modules import subdomain from modules import recon from modules import assetfinding from modules import takeover from modules import screenshot from modules import portscan from modules import gitscan from modules import burpstate from modules import brutethings from modules import dirbrute from modules import vulnscan from modules import cors from modules import ipspace from modules import sslscan from modules import headers from modules import conclusion from modules import healcheck # runnning normal routine if none of module specific def normal(options): utils.print_good("Running with {0} speed".format(options['SPEED'])) # Create skeleton json initials.Initials(options) # Finding subdomain subdomain.SubdomainScanning(options) # waiting for previous module utils.just_waiting(options, 'SubdomainScanning') # Scanning for subdomain take over takeover.TakeOverScanning(options) # Screen shot the target on common service screenshot.ScreenShot(options) # Recon recon.Recon(options) # Recon assetfinding.AssetFinding(options) # Scanning for CorsScan cors.CorsScan(options) # Discovery IP space ipspace.IPSpace(options) # SSL Scan sslscan.SSLScan(options) # Headers Scan headers.HeadersScan(options) # Note: From here the module gonna take really long time # for scanning service and stuff like that utils.print_info('This gonna take a while') # Scanning all port using result from subdomain scanning # and also checking vulnerable service based on version portscan.PortScan(options) # Directory scan dirbrute.DirBrute(options) # Starting vulnerable scan vulnscan.VulnScan(options) # brutethings.BruteThings(options) conclusion.Conclusion(options) def specific(options, module): module = module.lower() # checking the tool is installed right or not and exit if 'health' in module: health = healcheck.Healcheck(options) if health.checking(): utils.print_good("All things look fine") else: utils.print_bad("Installing Osmedeus not correctly done") utils.just_shutdown_flask(options) sys.exit(0) initials.Initials(options) if 'sub' in module or 'subdomain' in module: subdomain.SubdomainScanning(options) takeover.TakeOverScanning(options) screenshot.ScreenShot(options) cors.CorsScan(options) recon.Recon(options) assetfinding.AssetFinding(options) if 'ip' in module: # Discovery IP space ipspace.IPSpace(options) if 'screen' in module: # Discovery IP space screenshot.ScreenShot(options) if 'portscan' in module: # scanning port, service and vuln with masscan and nmap portscan.PortScan(options) if 'headers' in module: headers.HeadersScan(options) if 'asset' in module: assetfinding.AssetFinding(options) if 'vuln' in module: # scanning vulnerable service based on version vulnscan.VulnScan(options) if 'dir' in module: # run blind directory brute force directly dirbrute.DirBrute(options) if 'brute' in module or 'force' in module: # running brute force things based on scanning result brutethings.BruteThings(options) if 'git' in module: gitscan.GitScan(options) # if 'burp' in module: # burpstate.BurpState(options) conclusion.Conclusion(options) # just for debug purpose def debug(options): utils.print_good("Debug routine") utils.print_good("Running with {0} speed".format(options['SPEED'])) # Create skeleton json pprint(options) initials.Initials(options) # ##Finding subdomain subdomain.SubdomainScanning(options) # ####waiting for previous module # utils.just_waiting(options, 'SubdomainScanning') # recon.Recon(options) # ###Screen shot the target on common service screenshot.ScreenShot(options) # ###Scanning for subdomain take over # takeover.TakeOverScanning(options) # ##Discovery IP space # ipspace.IPSpace(options) # # # ##Scanning for CorsScan # cors.CorsScan(options) # ### SSL Scan # sslscan.SSLScan(options) # ##Headers Scan # headers.HeadersScan(options) # ##### Note: From here the module gonna take really long time for scanning service and stuff like that # utils.print_info('This gonna take a while') # dirbrute.DirBrute(options) # #Scanning all port using result from subdomain scanning and also checking vulnerable service based on version # portscan.PortScan(options) # # #Starting vulnerable scan # vulnscan.VulnScan(options) # # #Brute force service from port scan result # # brutethings.BruteThings(options) # conclusion.Conclusion(options)
25.441624
115
0.70012
import sys, time from core import utils from pprint import pprint from modules import initials from modules import subdomain from modules import recon from modules import assetfinding from modules import takeover from modules import screenshot from modules import portscan from modules import gitscan from modules import burpstate from modules import brutethings from modules import dirbrute from modules import vulnscan from modules import cors from modules import ipspace from modules import sslscan from modules import headers from modules import conclusion from modules import healcheck def normal(options): utils.print_good("Running with {0} speed".format(options['SPEED'])) initials.Initials(options) subdomain.SubdomainScanning(options) utils.just_waiting(options, 'SubdomainScanning') takeover.TakeOverScanning(options) screenshot.ScreenShot(options) recon.Recon(options) assetfinding.AssetFinding(options) cors.CorsScan(options) ipspace.IPSpace(options) sslscan.SSLScan(options) headers.HeadersScan(options) utils.print_info('This gonna take a while') portscan.PortScan(options) dirbrute.DirBrute(options) vulnscan.VulnScan(options) conclusion.Conclusion(options) def specific(options, module): module = module.lower() if 'health' in module: health = healcheck.Healcheck(options) if health.checking(): utils.print_good("All things look fine") else: utils.print_bad("Installing Osmedeus not correctly done") utils.just_shutdown_flask(options) sys.exit(0) initials.Initials(options) if 'sub' in module or 'subdomain' in module: subdomain.SubdomainScanning(options) takeover.TakeOverScanning(options) screenshot.ScreenShot(options) cors.CorsScan(options) recon.Recon(options) assetfinding.AssetFinding(options) if 'ip' in module: ipspace.IPSpace(options) if 'screen' in module: screenshot.ScreenShot(options) if 'portscan' in module: portscan.PortScan(options) if 'headers' in module: headers.HeadersScan(options) if 'asset' in module: assetfinding.AssetFinding(options) if 'vuln' in module: vulnscan.VulnScan(options) if 'dir' in module: dirbrute.DirBrute(options) if 'brute' in module or 'force' in module: brutethings.BruteThings(options) if 'git' in module: gitscan.GitScan(options) conclusion.Conclusion(options) def debug(options): utils.print_good("Debug routine") utils.print_good("Running with {0} speed".format(options['SPEED'])) pprint(options) initials.Initials(options) ons)
true
true
f72b81d4193fded68a3f2f0d2fc449f357b11230
108,819
py
Python
synapse/handlers/federation.py
V02460/synapse
782dd72037cf71fb3f9e4922b07c56df2f59de75
[ "Apache-2.0" ]
null
null
null
synapse/handlers/federation.py
V02460/synapse
782dd72037cf71fb3f9e4922b07c56df2f59de75
[ "Apache-2.0" ]
null
null
null
synapse/handlers/federation.py
V02460/synapse
782dd72037cf71fb3f9e4922b07c56df2f59de75
[ "Apache-2.0" ]
null
null
null
# -*- coding: utf-8 -*- # Copyright 2014-2016 OpenMarket Ltd # Copyright 2017-2018 New Vector Ltd # Copyright 2019 The Matrix.org Foundation C.I.C. # # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. """Contains handlers for federation events.""" import itertools import logging import six from six import iteritems, itervalues from six.moves import http_client, zip from signedjson.key import decode_verify_key_bytes from signedjson.sign import verify_signed_json from unpaddedbase64 import decode_base64 from twisted.internet import defer from synapse.api.constants import EventTypes, Membership, RejectedReason from synapse.api.errors import ( AuthError, CodeMessageException, Codes, FederationDeniedError, FederationError, RequestSendFailed, StoreError, SynapseError, ) from synapse.api.room_versions import KNOWN_ROOM_VERSIONS, RoomVersions from synapse.crypto.event_signing import compute_event_signature from synapse.event_auth import auth_types_for_event from synapse.events.validator import EventValidator from synapse.logging.context import ( make_deferred_yieldable, nested_logging_context, preserve_fn, run_in_background, ) from synapse.logging.utils import log_function from synapse.replication.http.federation import ( ReplicationCleanRoomRestServlet, ReplicationFederationSendEventsRestServlet, ) from synapse.replication.http.membership import ReplicationUserJoinedLeftRoomRestServlet from synapse.state import StateResolutionStore, resolve_events_with_store from synapse.types import UserID, get_domain_from_id from synapse.util import unwrapFirstError from synapse.util.async_helpers import Linearizer from synapse.util.distributor import user_joined_room from synapse.util.retryutils import NotRetryingDestination from synapse.visibility import filter_events_for_server from ._base import BaseHandler logger = logging.getLogger(__name__) def shortstr(iterable, maxitems=5): """If iterable has maxitems or fewer, return the stringification of a list containing those items. Otherwise, return the stringification of a a list with the first maxitems items, followed by "...". Args: iterable (Iterable): iterable to truncate maxitems (int): number of items to return before truncating Returns: unicode """ items = list(itertools.islice(iterable, maxitems + 1)) if len(items) <= maxitems: return str(items) return "[" + ", ".join(repr(r) for r in items[:maxitems]) + ", ...]" class FederationHandler(BaseHandler): """Handles events that originated from federation. Responsible for: a) handling received Pdus before handing them on as Events to the rest of the home server (including auth and state conflict resoultion) b) converting events that were produced by local clients that may need to be sent to remote home servers. c) doing the necessary dances to invite remote users and join remote rooms. """ def __init__(self, hs): super(FederationHandler, self).__init__(hs) self.hs = hs self.store = hs.get_datastore() self.federation_client = hs.get_federation_client() self.state_handler = hs.get_state_handler() self.server_name = hs.hostname self.keyring = hs.get_keyring() self.action_generator = hs.get_action_generator() self.is_mine_id = hs.is_mine_id self.pusher_pool = hs.get_pusherpool() self.spam_checker = hs.get_spam_checker() self.event_creation_handler = hs.get_event_creation_handler() self._server_notices_mxid = hs.config.server_notices_mxid self.config = hs.config self.http_client = hs.get_simple_http_client() self._send_events_to_master = ReplicationFederationSendEventsRestServlet.make_client( hs ) self._notify_user_membership_change = ReplicationUserJoinedLeftRoomRestServlet.make_client( hs ) self._clean_room_for_join_client = ReplicationCleanRoomRestServlet.make_client( hs ) # When joining a room we need to queue any events for that room up self.room_queues = {} self._room_pdu_linearizer = Linearizer("fed_room_pdu") self.third_party_event_rules = hs.get_third_party_event_rules() @defer.inlineCallbacks def on_receive_pdu(self, origin, pdu, sent_to_us_directly=False): """ Process a PDU received via a federation /send/ transaction, or via backfill of missing prev_events Args: origin (str): server which initiated the /send/ transaction. Will be used to fetch missing events or state. pdu (FrozenEvent): received PDU sent_to_us_directly (bool): True if this event was pushed to us; False if we pulled it as the result of a missing prev_event. Returns (Deferred): completes with None """ room_id = pdu.room_id event_id = pdu.event_id logger.info("[%s %s] handling received PDU: %s", room_id, event_id, pdu) # We reprocess pdus when we have seen them only as outliers existing = yield self.store.get_event( event_id, allow_none=True, allow_rejected=True ) # FIXME: Currently we fetch an event again when we already have it # if it has been marked as an outlier. already_seen = existing and ( not existing.internal_metadata.is_outlier() or pdu.internal_metadata.is_outlier() ) if already_seen: logger.debug("[%s %s]: Already seen pdu", room_id, event_id) return # do some initial sanity-checking of the event. In particular, make # sure it doesn't have hundreds of prev_events or auth_events, which # could cause a huge state resolution or cascade of event fetches. try: self._sanity_check_event(pdu) except SynapseError as err: logger.warn( "[%s %s] Received event failed sanity checks", room_id, event_id ) raise FederationError("ERROR", err.code, err.msg, affected=pdu.event_id) # If we are currently in the process of joining this room, then we # queue up events for later processing. if room_id in self.room_queues: logger.info( "[%s %s] Queuing PDU from %s for now: join in progress", room_id, event_id, origin, ) self.room_queues[room_id].append((pdu, origin)) return # If we're not in the room just ditch the event entirely. This is # probably an old server that has come back and thinks we're still in # the room (or we've been rejoined to the room by a state reset). # # Note that if we were never in the room then we would have already # dropped the event, since we wouldn't know the room version. is_in_room = yield self.auth.check_host_in_room(room_id, self.server_name) if not is_in_room: logger.info( "[%s %s] Ignoring PDU from %s as we're not in the room", room_id, event_id, origin, ) return None state = None auth_chain = [] # Get missing pdus if necessary. if not pdu.internal_metadata.is_outlier(): # We only backfill backwards to the min depth. min_depth = yield self.get_min_depth_for_context(pdu.room_id) logger.debug("[%s %s] min_depth: %d", room_id, event_id, min_depth) prevs = set(pdu.prev_event_ids()) seen = yield self.store.have_seen_events(prevs) if min_depth and pdu.depth < min_depth: # This is so that we don't notify the user about this # message, to work around the fact that some events will # reference really really old events we really don't want to # send to the clients. pdu.internal_metadata.outlier = True elif min_depth and pdu.depth > min_depth: missing_prevs = prevs - seen if sent_to_us_directly and missing_prevs: # If we're missing stuff, ensure we only fetch stuff one # at a time. logger.info( "[%s %s] Acquiring room lock to fetch %d missing prev_events: %s", room_id, event_id, len(missing_prevs), shortstr(missing_prevs), ) with (yield self._room_pdu_linearizer.queue(pdu.room_id)): logger.info( "[%s %s] Acquired room lock to fetch %d missing prev_events", room_id, event_id, len(missing_prevs), ) yield self._get_missing_events_for_pdu( origin, pdu, prevs, min_depth ) # Update the set of things we've seen after trying to # fetch the missing stuff seen = yield self.store.have_seen_events(prevs) if not prevs - seen: logger.info( "[%s %s] Found all missing prev_events", room_id, event_id, ) elif missing_prevs: logger.info( "[%s %s] Not recursively fetching %d missing prev_events: %s", room_id, event_id, len(missing_prevs), shortstr(missing_prevs), ) if prevs - seen: # We've still not been able to get all of the prev_events for this event. # # In this case, we need to fall back to asking another server in the # federation for the state at this event. That's ok provided we then # resolve the state against other bits of the DAG before using it (which # will ensure that you can't just take over a room by sending an event, # withholding its prev_events, and declaring yourself to be an admin in # the subsequent state request). # # Now, if we're pulling this event as a missing prev_event, then clearly # this event is not going to become the only forward-extremity and we are # guaranteed to resolve its state against our existing forward # extremities, so that should be fine. # # On the other hand, if this event was pushed to us, it is possible for # it to become the only forward-extremity in the room, and we would then # trust its state to be the state for the whole room. This is very bad. # Further, if the event was pushed to us, there is no excuse for us not to # have all the prev_events. We therefore reject any such events. # # XXX this really feels like it could/should be merged with the above, # but there is an interaction with min_depth that I'm not really # following. if sent_to_us_directly: logger.warn( "[%s %s] Rejecting: failed to fetch %d prev events: %s", room_id, event_id, len(prevs - seen), shortstr(prevs - seen), ) raise FederationError( "ERROR", 403, ( "Your server isn't divulging details about prev_events " "referenced in this event." ), affected=pdu.event_id, ) # Calculate the state after each of the previous events, and # resolve them to find the correct state at the current event. auth_chains = set() event_map = {event_id: pdu} try: # Get the state of the events we know about ours = yield self.store.get_state_groups_ids(room_id, seen) # state_maps is a list of mappings from (type, state_key) to event_id state_maps = list( ours.values() ) # type: list[dict[tuple[str, str], str]] # we don't need this any more, let's delete it. del ours # Ask the remote server for the states we don't # know about for p in prevs - seen: logger.info( "[%s %s] Requesting state at missing prev_event %s", room_id, event_id, p, ) room_version = yield self.store.get_room_version(room_id) with nested_logging_context(p): # note that if any of the missing prevs share missing state or # auth events, the requests to fetch those events are deduped # by the get_pdu_cache in federation_client. remote_state, got_auth_chain = ( yield self.federation_client.get_state_for_room( origin, room_id, p ) ) # we want the state *after* p; get_state_for_room returns the # state *before* p. remote_event = yield self.federation_client.get_pdu( [origin], p, room_version, outlier=True ) if remote_event is None: raise Exception( "Unable to get missing prev_event %s" % (p,) ) if remote_event.is_state(): remote_state.append(remote_event) # XXX hrm I'm not convinced that duplicate events will compare # for equality, so I'm not sure this does what the author # hoped. auth_chains.update(got_auth_chain) remote_state_map = { (x.type, x.state_key): x.event_id for x in remote_state } state_maps.append(remote_state_map) for x in remote_state: event_map[x.event_id] = x state_map = yield resolve_events_with_store( room_version, state_maps, event_map, state_res_store=StateResolutionStore(self.store), ) # We need to give _process_received_pdu the actual state events # rather than event ids, so generate that now. # First though we need to fetch all the events that are in # state_map, so we can build up the state below. evs = yield self.store.get_events( list(state_map.values()), get_prev_content=False, check_redacted=False, ) event_map.update(evs) state = [event_map[e] for e in six.itervalues(state_map)] auth_chain = list(auth_chains) except Exception: logger.warn( "[%s %s] Error attempting to resolve state at missing " "prev_events", room_id, event_id, exc_info=True, ) raise FederationError( "ERROR", 403, "We can't get valid state history.", affected=event_id, ) yield self._process_received_pdu( origin, pdu, state=state, auth_chain=auth_chain ) @defer.inlineCallbacks def _get_missing_events_for_pdu(self, origin, pdu, prevs, min_depth): """ Args: origin (str): Origin of the pdu. Will be called to get the missing events pdu: received pdu prevs (set(str)): List of event ids which we are missing min_depth (int): Minimum depth of events to return. """ room_id = pdu.room_id event_id = pdu.event_id seen = yield self.store.have_seen_events(prevs) if not prevs - seen: return latest = yield self.store.get_latest_event_ids_in_room(room_id) # We add the prev events that we have seen to the latest # list to ensure the remote server doesn't give them to us latest = set(latest) latest |= seen logger.info( "[%s %s]: Requesting missing events between %s and %s", room_id, event_id, shortstr(latest), event_id, ) # XXX: we set timeout to 10s to help workaround # https://github.com/matrix-org/synapse/issues/1733. # The reason is to avoid holding the linearizer lock # whilst processing inbound /send transactions, causing # FDs to stack up and block other inbound transactions # which empirically can currently take up to 30 minutes. # # N.B. this explicitly disables retry attempts. # # N.B. this also increases our chances of falling back to # fetching fresh state for the room if the missing event # can't be found, which slightly reduces our security. # it may also increase our DAG extremity count for the room, # causing additional state resolution? See #1760. # However, fetching state doesn't hold the linearizer lock # apparently. # # see https://github.com/matrix-org/synapse/pull/1744 # # ---- # # Update richvdh 2018/09/18: There are a number of problems with timing this # request out agressively on the client side: # # - it plays badly with the server-side rate-limiter, which starts tarpitting you # if you send too many requests at once, so you end up with the server carefully # working through the backlog of your requests, which you have already timed # out. # # - for this request in particular, we now (as of # https://github.com/matrix-org/synapse/pull/3456) reject any PDUs where the # server can't produce a plausible-looking set of prev_events - so we becone # much more likely to reject the event. # # - contrary to what it says above, we do *not* fall back to fetching fresh state # for the room if get_missing_events times out. Rather, we give up processing # the PDU whose prevs we are missing, which then makes it much more likely that # we'll end up back here for the *next* PDU in the list, which exacerbates the # problem. # # - the agressive 10s timeout was introduced to deal with incoming federation # requests taking 8 hours to process. It's not entirely clear why that was going # on; certainly there were other issues causing traffic storms which are now # resolved, and I think in any case we may be more sensible about our locking # now. We're *certainly* more sensible about our logging. # # All that said: Let's try increasing the timout to 60s and see what happens. try: missing_events = yield self.federation_client.get_missing_events( origin, room_id, earliest_events_ids=list(latest), latest_events=[pdu], limit=10, min_depth=min_depth, timeout=60000, ) except RequestSendFailed as e: # We failed to get the missing events, but since we need to handle # the case of `get_missing_events` not returning the necessary # events anyway, it is safe to simply log the error and continue. logger.warn("[%s %s]: Failed to get prev_events: %s", room_id, event_id, e) return logger.info( "[%s %s]: Got %d prev_events: %s", room_id, event_id, len(missing_events), shortstr(missing_events), ) # We want to sort these by depth so we process them and # tell clients about them in order. missing_events.sort(key=lambda x: x.depth) for ev in missing_events: logger.info( "[%s %s] Handling received prev_event %s", room_id, event_id, ev.event_id, ) with nested_logging_context(ev.event_id): try: yield self.on_receive_pdu(origin, ev, sent_to_us_directly=False) except FederationError as e: if e.code == 403: logger.warn( "[%s %s] Received prev_event %s failed history check.", room_id, event_id, ev.event_id, ) else: raise @defer.inlineCallbacks def _process_received_pdu(self, origin, event, state, auth_chain): """ Called when we have a new pdu. We need to do auth checks and put it through the StateHandler. """ room_id = event.room_id event_id = event.event_id logger.debug("[%s %s] Processing event: %s", room_id, event_id, event) event_ids = set() if state: event_ids |= {e.event_id for e in state} if auth_chain: event_ids |= {e.event_id for e in auth_chain} seen_ids = yield self.store.have_seen_events(event_ids) if state and auth_chain is not None: # If we have any state or auth_chain given to us by the replication # layer, then we should handle them (if we haven't before.) event_infos = [] for e in itertools.chain(auth_chain, state): if e.event_id in seen_ids: continue e.internal_metadata.outlier = True auth_ids = e.auth_event_ids() auth = { (e.type, e.state_key): e for e in auth_chain if e.event_id in auth_ids or e.type == EventTypes.Create } event_infos.append({"event": e, "auth_events": auth}) seen_ids.add(e.event_id) logger.info( "[%s %s] persisting newly-received auth/state events %s", room_id, event_id, [e["event"].event_id for e in event_infos], ) yield self._handle_new_events(origin, event_infos) try: context = yield self._handle_new_event(origin, event, state=state) except AuthError as e: raise FederationError("ERROR", e.code, e.msg, affected=event.event_id) room = yield self.store.get_room(room_id) if not room: try: yield self.store.store_room( room_id=room_id, room_creator_user_id="", is_public=False ) except StoreError: logger.exception("Failed to store room.") if event.type == EventTypes.Member: if event.membership == Membership.JOIN: # Only fire user_joined_room if the user has acutally # joined the room. Don't bother if the user is just # changing their profile info. newly_joined = True prev_state_ids = yield context.get_prev_state_ids(self.store) prev_state_id = prev_state_ids.get((event.type, event.state_key)) if prev_state_id: prev_state = yield self.store.get_event( prev_state_id, allow_none=True ) if prev_state and prev_state.membership == Membership.JOIN: newly_joined = False if newly_joined: user = UserID.from_string(event.state_key) yield self.user_joined_room(user, room_id) @log_function @defer.inlineCallbacks def backfill(self, dest, room_id, limit, extremities): """ Trigger a backfill request to `dest` for the given `room_id` This will attempt to get more events from the remote. If the other side has no new events to offer, this will return an empty list. As the events are received, we check their signatures, and also do some sanity-checking on them. If any of the backfilled events are invalid, this method throws a SynapseError. TODO: make this more useful to distinguish failures of the remote server from invalid events (there is probably no point in trying to re-fetch invalid events from every other HS in the room.) """ if dest == self.server_name: raise SynapseError(400, "Can't backfill from self.") room_version = yield self.store.get_room_version(room_id) events = yield self.federation_client.backfill( dest, room_id, limit=limit, extremities=extremities ) # ideally we'd sanity check the events here for excess prev_events etc, # but it's hard to reject events at this point without completely # breaking backfill in the same way that it is currently broken by # events whose signature we cannot verify (#3121). # # So for now we accept the events anyway. #3124 tracks this. # # for ev in events: # self._sanity_check_event(ev) # Don't bother processing events we already have. seen_events = yield self.store.have_events_in_timeline( set(e.event_id for e in events) ) events = [e for e in events if e.event_id not in seen_events] if not events: return [] event_map = {e.event_id: e for e in events} event_ids = set(e.event_id for e in events) edges = [ev.event_id for ev in events if set(ev.prev_event_ids()) - event_ids] logger.info("backfill: Got %d events with %d edges", len(events), len(edges)) # For each edge get the current state. auth_events = {} state_events = {} events_to_state = {} for e_id in edges: state, auth = yield self.federation_client.get_state_for_room( destination=dest, room_id=room_id, event_id=e_id ) auth_events.update({a.event_id: a for a in auth}) auth_events.update({s.event_id: s for s in state}) state_events.update({s.event_id: s for s in state}) events_to_state[e_id] = state required_auth = set( a_id for event in events + list(state_events.values()) + list(auth_events.values()) for a_id in event.auth_event_ids() ) auth_events.update( {e_id: event_map[e_id] for e_id in required_auth if e_id in event_map} ) missing_auth = required_auth - set(auth_events) failed_to_fetch = set() # Try and fetch any missing auth events from both DB and remote servers. # We repeatedly do this until we stop finding new auth events. while missing_auth - failed_to_fetch: logger.info("Missing auth for backfill: %r", missing_auth) ret_events = yield self.store.get_events(missing_auth - failed_to_fetch) auth_events.update(ret_events) required_auth.update( a_id for event in ret_events.values() for a_id in event.auth_event_ids() ) missing_auth = required_auth - set(auth_events) if missing_auth - failed_to_fetch: logger.info( "Fetching missing auth for backfill: %r", missing_auth - failed_to_fetch, ) results = yield make_deferred_yieldable( defer.gatherResults( [ run_in_background( self.federation_client.get_pdu, [dest], event_id, room_version=room_version, outlier=True, timeout=10000, ) for event_id in missing_auth - failed_to_fetch ], consumeErrors=True, ) ).addErrback(unwrapFirstError) auth_events.update({a.event_id: a for a in results if a}) required_auth.update( a_id for event in results if event for a_id in event.auth_event_ids() ) missing_auth = required_auth - set(auth_events) failed_to_fetch = missing_auth - set(auth_events) seen_events = yield self.store.have_seen_events( set(auth_events.keys()) | set(state_events.keys()) ) # We now have a chunk of events plus associated state and auth chain to # persist. We do the persistence in two steps: # 1. Auth events and state get persisted as outliers, plus the # backward extremities get persisted (as non-outliers). # 2. The rest of the events in the chunk get persisted one by one, as # each one depends on the previous event for its state. # # The important thing is that events in the chunk get persisted as # non-outliers, including when those events are also in the state or # auth chain. Caution must therefore be taken to ensure that they are # not accidentally marked as outliers. # Step 1a: persist auth events that *don't* appear in the chunk ev_infos = [] for a in auth_events.values(): # We only want to persist auth events as outliers that we haven't # seen and aren't about to persist as part of the backfilled chunk. if a.event_id in seen_events or a.event_id in event_map: continue a.internal_metadata.outlier = True ev_infos.append( { "event": a, "auth_events": { ( auth_events[a_id].type, auth_events[a_id].state_key, ): auth_events[a_id] for a_id in a.auth_event_ids() if a_id in auth_events }, } ) # Step 1b: persist the events in the chunk we fetched state for (i.e. # the backwards extremities) as non-outliers. for e_id in events_to_state: # For paranoia we ensure that these events are marked as # non-outliers ev = event_map[e_id] assert not ev.internal_metadata.is_outlier() ev_infos.append( { "event": ev, "state": events_to_state[e_id], "auth_events": { ( auth_events[a_id].type, auth_events[a_id].state_key, ): auth_events[a_id] for a_id in ev.auth_event_ids() if a_id in auth_events }, } ) yield self._handle_new_events(dest, ev_infos, backfilled=True) # Step 2: Persist the rest of the events in the chunk one by one events.sort(key=lambda e: e.depth) for event in events: if event in events_to_state: continue # For paranoia we ensure that these events are marked as # non-outliers assert not event.internal_metadata.is_outlier() # We store these one at a time since each event depends on the # previous to work out the state. # TODO: We can probably do something more clever here. yield self._handle_new_event(dest, event, backfilled=True) return events @defer.inlineCallbacks def maybe_backfill(self, room_id, current_depth): """Checks the database to see if we should backfill before paginating, and if so do. """ extremities = yield self.store.get_oldest_events_with_depth_in_room(room_id) if not extremities: logger.debug("Not backfilling as no extremeties found.") return # We only want to paginate if we can actually see the events we'll get, # as otherwise we'll just spend a lot of resources to get redacted # events. # # We do this by filtering all the backwards extremities and seeing if # any remain. Given we don't have the extremity events themselves, we # need to actually check the events that reference them. # # *Note*: the spec wants us to keep backfilling until we reach the start # of the room in case we are allowed to see some of the history. However # in practice that causes more issues than its worth, as a) its # relatively rare for there to be any visible history and b) even when # there is its often sufficiently long ago that clients would stop # attempting to paginate before backfill reached the visible history. # # TODO: If we do do a backfill then we should filter the backwards # extremities to only include those that point to visible portions of # history. # # TODO: Correctly handle the case where we are allowed to see the # forward event but not the backward extremity, e.g. in the case of # initial join of the server where we are allowed to see the join # event but not anything before it. This would require looking at the # state *before* the event, ignoring the special casing certain event # types have. forward_events = yield self.store.get_successor_events(list(extremities)) extremities_events = yield self.store.get_events( forward_events, check_redacted=False, get_prev_content=False ) # We set `check_history_visibility_only` as we might otherwise get false # positives from users having been erased. filtered_extremities = yield filter_events_for_server( self.store, self.server_name, list(extremities_events.values()), redact=False, check_history_visibility_only=True, ) if not filtered_extremities: return False # Check if we reached a point where we should start backfilling. sorted_extremeties_tuple = sorted(extremities.items(), key=lambda e: -int(e[1])) max_depth = sorted_extremeties_tuple[0][1] # We don't want to specify too many extremities as it causes the backfill # request URI to be too long. extremities = dict(sorted_extremeties_tuple[:5]) if current_depth > max_depth: logger.debug( "Not backfilling as we don't need to. %d < %d", max_depth, current_depth ) return # Now we need to decide which hosts to hit first. # First we try hosts that are already in the room # TODO: HEURISTIC ALERT. curr_state = yield self.state_handler.get_current_state(room_id) def get_domains_from_state(state): """Get joined domains from state Args: state (dict[tuple, FrozenEvent]): State map from type/state key to event. Returns: list[tuple[str, int]]: Returns a list of servers with the lowest depth of their joins. Sorted by lowest depth first. """ joined_users = [ (state_key, int(event.depth)) for (e_type, state_key), event in iteritems(state) if e_type == EventTypes.Member and event.membership == Membership.JOIN ] joined_domains = {} for u, d in joined_users: try: dom = get_domain_from_id(u) old_d = joined_domains.get(dom) if old_d: joined_domains[dom] = min(d, old_d) else: joined_domains[dom] = d except Exception: pass return sorted(joined_domains.items(), key=lambda d: d[1]) curr_domains = get_domains_from_state(curr_state) likely_domains = [ domain for domain, depth in curr_domains if domain != self.server_name ] @defer.inlineCallbacks def try_backfill(domains): # TODO: Should we try multiple of these at a time? for dom in domains: try: yield self.backfill( dom, room_id, limit=100, extremities=extremities ) # If this succeeded then we probably already have the # appropriate stuff. # TODO: We can probably do something more intelligent here. return True except SynapseError as e: logger.info("Failed to backfill from %s because %s", dom, e) continue except CodeMessageException as e: if 400 <= e.code < 500: raise logger.info("Failed to backfill from %s because %s", dom, e) continue except NotRetryingDestination as e: logger.info(str(e)) continue except RequestSendFailed as e: logger.info("Falied to get backfill from %s because %s", dom, e) continue except FederationDeniedError as e: logger.info(e) continue except Exception as e: logger.exception("Failed to backfill from %s because %s", dom, e) continue return False success = yield try_backfill(likely_domains) if success: return True # Huh, well *those* domains didn't work out. Lets try some domains # from the time. tried_domains = set(likely_domains) tried_domains.add(self.server_name) event_ids = list(extremities.keys()) logger.debug("calling resolve_state_groups in _maybe_backfill") resolve = preserve_fn(self.state_handler.resolve_state_groups_for_events) states = yield make_deferred_yieldable( defer.gatherResults( [resolve(room_id, [e]) for e in event_ids], consumeErrors=True ) ) # dict[str, dict[tuple, str]], a map from event_id to state map of # event_ids. states = dict(zip(event_ids, [s.state for s in states])) state_map = yield self.store.get_events( [e_id for ids in itervalues(states) for e_id in itervalues(ids)], get_prev_content=False, ) states = { key: { k: state_map[e_id] for k, e_id in iteritems(state_dict) if e_id in state_map } for key, state_dict in iteritems(states) } for e_id, _ in sorted_extremeties_tuple: likely_domains = get_domains_from_state(states[e_id]) success = yield try_backfill( [dom for dom, _ in likely_domains if dom not in tried_domains] ) if success: return True tried_domains.update(dom for dom, _ in likely_domains) return False def _sanity_check_event(self, ev): """ Do some early sanity checks of a received event In particular, checks it doesn't have an excessive number of prev_events or auth_events, which could cause a huge state resolution or cascade of event fetches. Args: ev (synapse.events.EventBase): event to be checked Returns: None Raises: SynapseError if the event does not pass muster """ if len(ev.prev_event_ids()) > 20: logger.warn( "Rejecting event %s which has %i prev_events", ev.event_id, len(ev.prev_event_ids()), ) raise SynapseError(http_client.BAD_REQUEST, "Too many prev_events") if len(ev.auth_event_ids()) > 10: logger.warn( "Rejecting event %s which has %i auth_events", ev.event_id, len(ev.auth_event_ids()), ) raise SynapseError(http_client.BAD_REQUEST, "Too many auth_events") @defer.inlineCallbacks def send_invite(self, target_host, event): """ Sends the invite to the remote server for signing. Invites must be signed by the invitee's server before distribution. """ pdu = yield self.federation_client.send_invite( destination=target_host, room_id=event.room_id, event_id=event.event_id, pdu=event, ) return pdu @defer.inlineCallbacks def on_event_auth(self, event_id): event = yield self.store.get_event(event_id) auth = yield self.store.get_auth_chain( [auth_id for auth_id in event.auth_event_ids()], include_given=True ) return [e for e in auth] @log_function @defer.inlineCallbacks def do_invite_join(self, target_hosts, room_id, joinee, content): """ Attempts to join the `joinee` to the room `room_id` via the server `target_host`. This first triggers a /make_join/ request that returns a partial event that we can fill out and sign. This is then sent to the remote server via /send_join/ which responds with the state at that event and the auth_chains. We suspend processing of any received events from this room until we have finished processing the join. """ logger.debug("Joining %s to %s", joinee, room_id) origin, event, event_format_version = yield self._make_and_verify_event( target_hosts, room_id, joinee, "join", content, params={"ver": KNOWN_ROOM_VERSIONS}, ) # This shouldn't happen, because the RoomMemberHandler has a # linearizer lock which only allows one operation per user per room # at a time - so this is just paranoia. assert room_id not in self.room_queues self.room_queues[room_id] = [] yield self._clean_room_for_join(room_id) handled_events = set() try: # Try the host we successfully got a response to /make_join/ # request first. try: target_hosts.remove(origin) target_hosts.insert(0, origin) except ValueError: pass ret = yield self.federation_client.send_join( target_hosts, event, event_format_version ) origin = ret["origin"] state = ret["state"] auth_chain = ret["auth_chain"] auth_chain.sort(key=lambda e: e.depth) handled_events.update([s.event_id for s in state]) handled_events.update([a.event_id for a in auth_chain]) handled_events.add(event.event_id) logger.debug("do_invite_join auth_chain: %s", auth_chain) logger.debug("do_invite_join state: %s", state) logger.debug("do_invite_join event: %s", event) try: yield self.store.store_room( room_id=room_id, room_creator_user_id="", is_public=False ) except Exception: # FIXME pass yield self._persist_auth_tree(origin, auth_chain, state, event) logger.debug("Finished joining %s to %s", joinee, room_id) finally: room_queue = self.room_queues[room_id] del self.room_queues[room_id] # we don't need to wait for the queued events to be processed - # it's just a best-effort thing at this point. We do want to do # them roughly in order, though, otherwise we'll end up making # lots of requests for missing prev_events which we do actually # have. Hence we fire off the deferred, but don't wait for it. run_in_background(self._handle_queued_pdus, room_queue) return True @defer.inlineCallbacks def _handle_queued_pdus(self, room_queue): """Process PDUs which got queued up while we were busy send_joining. Args: room_queue (list[FrozenEvent, str]): list of PDUs to be processed and the servers that sent them """ for p, origin in room_queue: try: logger.info( "Processing queued PDU %s which was received " "while we were joining %s", p.event_id, p.room_id, ) with nested_logging_context(p.event_id): yield self.on_receive_pdu(origin, p, sent_to_us_directly=True) except Exception as e: logger.warn( "Error handling queued PDU %s from %s: %s", p.event_id, origin, e ) @defer.inlineCallbacks @log_function def on_make_join_request(self, origin, room_id, user_id): """ We've received a /make_join/ request, so we create a partial join event for the room and return that. We do *not* persist or process it until the other server has signed it and sent it back. Args: origin (str): The (verified) server name of the requesting server. room_id (str): Room to create join event in user_id (str): The user to create the join for Returns: Deferred[FrozenEvent] """ if get_domain_from_id(user_id) != origin: logger.info( "Got /make_join request for user %r from different origin %s, ignoring", user_id, origin, ) raise SynapseError(403, "User not from origin", Codes.FORBIDDEN) event_content = {"membership": Membership.JOIN} room_version = yield self.store.get_room_version(room_id) builder = self.event_builder_factory.new( room_version, { "type": EventTypes.Member, "content": event_content, "room_id": room_id, "sender": user_id, "state_key": user_id, }, ) try: event, context = yield self.event_creation_handler.create_new_client_event( builder=builder ) except AuthError as e: logger.warn("Failed to create join %r because %s", event, e) raise e event_allowed = yield self.third_party_event_rules.check_event_allowed( event, context ) if not event_allowed: logger.info("Creation of join %s forbidden by third-party rules", event) raise SynapseError( 403, "This event is not allowed in this context", Codes.FORBIDDEN ) # The remote hasn't signed it yet, obviously. We'll do the full checks # when we get the event back in `on_send_join_request` yield self.auth.check_from_context( room_version, event, context, do_sig_check=False ) return event @defer.inlineCallbacks @log_function def on_send_join_request(self, origin, pdu): """ We have received a join event for a room. Fully process it and respond with the current state and auth chains. """ event = pdu logger.debug( "on_send_join_request: Got event: %s, signatures: %s", event.event_id, event.signatures, ) event.internal_metadata.outlier = False # Send this event on behalf of the origin server. # # The reasons we have the destination server rather than the origin # server send it are slightly mysterious: the origin server should have # all the neccessary state once it gets the response to the send_join, # so it could send the event itself if it wanted to. It may be that # doing it this way reduces failure modes, or avoids certain attacks # where a new server selectively tells a subset of the federation that # it has joined. # # The fact is that, as of the current writing, Synapse doesn't send out # the join event over federation after joining, and changing it now # would introduce the danger of backwards-compatibility problems. event.internal_metadata.send_on_behalf_of = origin context = yield self._handle_new_event(origin, event) event_allowed = yield self.third_party_event_rules.check_event_allowed( event, context ) if not event_allowed: logger.info("Sending of join %s forbidden by third-party rules", event) raise SynapseError( 403, "This event is not allowed in this context", Codes.FORBIDDEN ) logger.debug( "on_send_join_request: After _handle_new_event: %s, sigs: %s", event.event_id, event.signatures, ) if event.type == EventTypes.Member: if event.content["membership"] == Membership.JOIN: user = UserID.from_string(event.state_key) yield self.user_joined_room(user, event.room_id) prev_state_ids = yield context.get_prev_state_ids(self.store) state_ids = list(prev_state_ids.values()) auth_chain = yield self.store.get_auth_chain(state_ids) state = yield self.store.get_events(list(prev_state_ids.values())) return {"state": list(state.values()), "auth_chain": auth_chain} @defer.inlineCallbacks def on_invite_request(self, origin, pdu): """ We've got an invite event. Process and persist it. Sign it. Respond with the now signed event. """ event = pdu if event.state_key is None: raise SynapseError(400, "The invite event did not have a state key") is_blocked = yield self.store.is_room_blocked(event.room_id) if is_blocked: raise SynapseError(403, "This room has been blocked on this server") if self.hs.config.block_non_admin_invites: raise SynapseError(403, "This server does not accept room invites") if not self.spam_checker.user_may_invite( event.sender, event.state_key, event.room_id ): raise SynapseError( 403, "This user is not permitted to send invites to this server/user" ) membership = event.content.get("membership") if event.type != EventTypes.Member or membership != Membership.INVITE: raise SynapseError(400, "The event was not an m.room.member invite event") sender_domain = get_domain_from_id(event.sender) if sender_domain != origin: raise SynapseError( 400, "The invite event was not from the server sending it" ) if not self.is_mine_id(event.state_key): raise SynapseError(400, "The invite event must be for this server") # block any attempts to invite the server notices mxid if event.state_key == self._server_notices_mxid: raise SynapseError(http_client.FORBIDDEN, "Cannot invite this user") event.internal_metadata.outlier = True event.internal_metadata.out_of_band_membership = True event.signatures.update( compute_event_signature( event.get_pdu_json(), self.hs.hostname, self.hs.config.signing_key[0] ) ) context = yield self.state_handler.compute_event_context(event) yield self.persist_events_and_notify([(event, context)]) return event @defer.inlineCallbacks def do_remotely_reject_invite(self, target_hosts, room_id, user_id): origin, event, event_format_version = yield self._make_and_verify_event( target_hosts, room_id, user_id, "leave" ) # Mark as outlier as we don't have any state for this event; we're not # even in the room. event.internal_metadata.outlier = True event.internal_metadata.out_of_band_membership = True # Try the host that we succesfully called /make_leave/ on first for # the /send_leave/ request. try: target_hosts.remove(origin) target_hosts.insert(0, origin) except ValueError: pass yield self.federation_client.send_leave(target_hosts, event) context = yield self.state_handler.compute_event_context(event) yield self.persist_events_and_notify([(event, context)]) return event @defer.inlineCallbacks def _make_and_verify_event( self, target_hosts, room_id, user_id, membership, content={}, params=None ): origin, event, format_ver = yield self.federation_client.make_membership_event( target_hosts, room_id, user_id, membership, content, params=params ) logger.debug("Got response to make_%s: %s", membership, event) # We should assert some things. # FIXME: Do this in a nicer way assert event.type == EventTypes.Member assert event.user_id == user_id assert event.state_key == user_id assert event.room_id == room_id return origin, event, format_ver @defer.inlineCallbacks @log_function def on_make_leave_request(self, origin, room_id, user_id): """ We've received a /make_leave/ request, so we create a partial leave event for the room and return that. We do *not* persist or process it until the other server has signed it and sent it back. Args: origin (str): The (verified) server name of the requesting server. room_id (str): Room to create leave event in user_id (str): The user to create the leave for Returns: Deferred[FrozenEvent] """ if get_domain_from_id(user_id) != origin: logger.info( "Got /make_leave request for user %r from different origin %s, ignoring", user_id, origin, ) raise SynapseError(403, "User not from origin", Codes.FORBIDDEN) room_version = yield self.store.get_room_version(room_id) builder = self.event_builder_factory.new( room_version, { "type": EventTypes.Member, "content": {"membership": Membership.LEAVE}, "room_id": room_id, "sender": user_id, "state_key": user_id, }, ) event, context = yield self.event_creation_handler.create_new_client_event( builder=builder ) event_allowed = yield self.third_party_event_rules.check_event_allowed( event, context ) if not event_allowed: logger.warning("Creation of leave %s forbidden by third-party rules", event) raise SynapseError( 403, "This event is not allowed in this context", Codes.FORBIDDEN ) try: # The remote hasn't signed it yet, obviously. We'll do the full checks # when we get the event back in `on_send_leave_request` yield self.auth.check_from_context( room_version, event, context, do_sig_check=False ) except AuthError as e: logger.warn("Failed to create new leave %r because %s", event, e) raise e return event @defer.inlineCallbacks @log_function def on_send_leave_request(self, origin, pdu): """ We have received a leave event for a room. Fully process it.""" event = pdu logger.debug( "on_send_leave_request: Got event: %s, signatures: %s", event.event_id, event.signatures, ) event.internal_metadata.outlier = False context = yield self._handle_new_event(origin, event) event_allowed = yield self.third_party_event_rules.check_event_allowed( event, context ) if not event_allowed: logger.info("Sending of leave %s forbidden by third-party rules", event) raise SynapseError( 403, "This event is not allowed in this context", Codes.FORBIDDEN ) logger.debug( "on_send_leave_request: After _handle_new_event: %s, sigs: %s", event.event_id, event.signatures, ) return None @defer.inlineCallbacks def get_state_for_pdu(self, room_id, event_id): """Returns the state at the event. i.e. not including said event. """ event = yield self.store.get_event( event_id, allow_none=False, check_room_id=room_id ) state_groups = yield self.store.get_state_groups(room_id, [event_id]) if state_groups: _, state = list(iteritems(state_groups)).pop() results = {(e.type, e.state_key): e for e in state} if event.is_state(): # Get previous state if "replaces_state" in event.unsigned: prev_id = event.unsigned["replaces_state"] if prev_id != event.event_id: prev_event = yield self.store.get_event(prev_id) results[(event.type, event.state_key)] = prev_event else: del results[(event.type, event.state_key)] res = list(results.values()) return res else: return [] @defer.inlineCallbacks def get_state_ids_for_pdu(self, room_id, event_id): """Returns the state at the event. i.e. not including said event. """ event = yield self.store.get_event( event_id, allow_none=False, check_room_id=room_id ) state_groups = yield self.store.get_state_groups_ids(room_id, [event_id]) if state_groups: _, state = list(state_groups.items()).pop() results = state if event.is_state(): # Get previous state if "replaces_state" in event.unsigned: prev_id = event.unsigned["replaces_state"] if prev_id != event.event_id: results[(event.type, event.state_key)] = prev_id else: results.pop((event.type, event.state_key), None) return list(results.values()) else: return [] @defer.inlineCallbacks @log_function def on_backfill_request(self, origin, room_id, pdu_list, limit): in_room = yield self.auth.check_host_in_room(room_id, origin) if not in_room: raise AuthError(403, "Host not in room.") events = yield self.store.get_backfill_events(room_id, pdu_list, limit) events = yield filter_events_for_server(self.store, origin, events) return events @defer.inlineCallbacks @log_function def get_persisted_pdu(self, origin, event_id): """Get an event from the database for the given server. Args: origin [str]: hostname of server which is requesting the event; we will check that the server is allowed to see it. event_id [str]: id of the event being requested Returns: Deferred[EventBase|None]: None if we know nothing about the event; otherwise the (possibly-redacted) event. Raises: AuthError if the server is not currently in the room """ event = yield self.store.get_event( event_id, allow_none=True, allow_rejected=True ) if event: in_room = yield self.auth.check_host_in_room(event.room_id, origin) if not in_room: raise AuthError(403, "Host not in room.") events = yield filter_events_for_server(self.store, origin, [event]) event = events[0] return event else: return None def get_min_depth_for_context(self, context): return self.store.get_min_depth(context) @defer.inlineCallbacks def _handle_new_event( self, origin, event, state=None, auth_events=None, backfilled=False ): context = yield self._prep_event( origin, event, state=state, auth_events=auth_events, backfilled=backfilled ) # reraise does not allow inlineCallbacks to preserve the stacktrace, so we # hack around with a try/finally instead. success = False try: if not event.internal_metadata.is_outlier() and not backfilled: yield self.action_generator.handle_push_actions_for_event( event, context ) yield self.persist_events_and_notify( [(event, context)], backfilled=backfilled ) success = True finally: if not success: run_in_background( self.store.remove_push_actions_from_staging, event.event_id ) return context @defer.inlineCallbacks def _handle_new_events(self, origin, event_infos, backfilled=False): """Creates the appropriate contexts and persists events. The events should not depend on one another, e.g. this should be used to persist a bunch of outliers, but not a chunk of individual events that depend on each other for state calculations. Notifies about the events where appropriate. """ @defer.inlineCallbacks def prep(ev_info): event = ev_info["event"] with nested_logging_context(suffix=event.event_id): res = yield self._prep_event( origin, event, state=ev_info.get("state"), auth_events=ev_info.get("auth_events"), backfilled=backfilled, ) return res contexts = yield make_deferred_yieldable( defer.gatherResults( [run_in_background(prep, ev_info) for ev_info in event_infos], consumeErrors=True, ) ) yield self.persist_events_and_notify( [ (ev_info["event"], context) for ev_info, context in zip(event_infos, contexts) ], backfilled=backfilled, ) @defer.inlineCallbacks def _persist_auth_tree(self, origin, auth_events, state, event): """Checks the auth chain is valid (and passes auth checks) for the state and event. Then persists the auth chain and state atomically. Persists the event separately. Notifies about the persisted events where appropriate. Will attempt to fetch missing auth events. Args: origin (str): Where the events came from auth_events (list) state (list) event (Event) Returns: Deferred """ events_to_context = {} for e in itertools.chain(auth_events, state): e.internal_metadata.outlier = True ctx = yield self.state_handler.compute_event_context(e) events_to_context[e.event_id] = ctx event_map = { e.event_id: e for e in itertools.chain(auth_events, state, [event]) } create_event = None for e in auth_events: if (e.type, e.state_key) == (EventTypes.Create, ""): create_event = e break if create_event is None: # If the state doesn't have a create event then the room is # invalid, and it would fail auth checks anyway. raise SynapseError(400, "No create event in state") room_version = create_event.content.get( "room_version", RoomVersions.V1.identifier ) missing_auth_events = set() for e in itertools.chain(auth_events, state, [event]): for e_id in e.auth_event_ids(): if e_id not in event_map: missing_auth_events.add(e_id) for e_id in missing_auth_events: m_ev = yield self.federation_client.get_pdu( [origin], e_id, room_version=room_version, outlier=True, timeout=10000 ) if m_ev and m_ev.event_id == e_id: event_map[e_id] = m_ev else: logger.info("Failed to find auth event %r", e_id) for e in itertools.chain(auth_events, state, [event]): auth_for_e = { (event_map[e_id].type, event_map[e_id].state_key): event_map[e_id] for e_id in e.auth_event_ids() if e_id in event_map } if create_event: auth_for_e[(EventTypes.Create, "")] = create_event try: self.auth.check(room_version, e, auth_events=auth_for_e) except SynapseError as err: # we may get SynapseErrors here as well as AuthErrors. For # instance, there are a couple of (ancient) events in some # rooms whose senders do not have the correct sigil; these # cause SynapseErrors in auth.check. We don't want to give up # the attempt to federate altogether in such cases. logger.warn("Rejecting %s because %s", e.event_id, err.msg) if e == event: raise events_to_context[e.event_id].rejected = RejectedReason.AUTH_ERROR yield self.persist_events_and_notify( [ (e, events_to_context[e.event_id]) for e in itertools.chain(auth_events, state) ] ) new_event_context = yield self.state_handler.compute_event_context( event, old_state=state ) yield self.persist_events_and_notify([(event, new_event_context)]) @defer.inlineCallbacks def _prep_event(self, origin, event, state, auth_events, backfilled): """ Args: origin: event: state: auth_events: backfilled (bool) Returns: Deferred, which resolves to synapse.events.snapshot.EventContext """ context = yield self.state_handler.compute_event_context(event, old_state=state) if not auth_events: prev_state_ids = yield context.get_prev_state_ids(self.store) auth_events_ids = yield self.auth.compute_auth_events( event, prev_state_ids, for_verification=True ) auth_events = yield self.store.get_events(auth_events_ids) auth_events = {(e.type, e.state_key): e for e in auth_events.values()} # This is a hack to fix some old rooms where the initial join event # didn't reference the create event in its auth events. if event.type == EventTypes.Member and not event.auth_event_ids(): if len(event.prev_event_ids()) == 1 and event.depth < 5: c = yield self.store.get_event( event.prev_event_ids()[0], allow_none=True ) if c and c.type == EventTypes.Create: auth_events[(c.type, c.state_key)] = c try: yield self.do_auth(origin, event, context, auth_events=auth_events) except AuthError as e: logger.warn("[%s %s] Rejecting: %s", event.room_id, event.event_id, e.msg) context.rejected = RejectedReason.AUTH_ERROR if not context.rejected: yield self._check_for_soft_fail(event, state, backfilled) if event.type == EventTypes.GuestAccess and not context.rejected: yield self.maybe_kick_guest_users(event) return context @defer.inlineCallbacks def _check_for_soft_fail(self, event, state, backfilled): """Checks if we should soft fail the event, if so marks the event as such. Args: event (FrozenEvent) state (dict|None): The state at the event if we don't have all the event's prev events backfilled (bool): Whether the event is from backfill Returns: Deferred """ # For new (non-backfilled and non-outlier) events we check if the event # passes auth based on the current state. If it doesn't then we # "soft-fail" the event. do_soft_fail_check = not backfilled and not event.internal_metadata.is_outlier() if do_soft_fail_check: extrem_ids = yield self.store.get_latest_event_ids_in_room(event.room_id) extrem_ids = set(extrem_ids) prev_event_ids = set(event.prev_event_ids()) if extrem_ids == prev_event_ids: # If they're the same then the current state is the same as the # state at the event, so no point rechecking auth for soft fail. do_soft_fail_check = False if do_soft_fail_check: room_version = yield self.store.get_room_version(event.room_id) # Calculate the "current state". if state is not None: # If we're explicitly given the state then we won't have all the # prev events, and so we have a gap in the graph. In this case # we want to be a little careful as we might have been down for # a while and have an incorrect view of the current state, # however we still want to do checks as gaps are easy to # maliciously manufacture. # # So we use a "current state" that is actually a state # resolution across the current forward extremities and the # given state at the event. This should correctly handle cases # like bans, especially with state res v2. state_sets = yield self.store.get_state_groups( event.room_id, extrem_ids ) state_sets = list(state_sets.values()) state_sets.append(state) current_state_ids = yield self.state_handler.resolve_events( room_version, state_sets, event ) current_state_ids = { k: e.event_id for k, e in iteritems(current_state_ids) } else: current_state_ids = yield self.state_handler.get_current_state_ids( event.room_id, latest_event_ids=extrem_ids ) logger.debug( "Doing soft-fail check for %s: state %s", event.event_id, current_state_ids, ) # Now check if event pass auth against said current state auth_types = auth_types_for_event(event) current_state_ids = [ e for k, e in iteritems(current_state_ids) if k in auth_types ] current_auth_events = yield self.store.get_events(current_state_ids) current_auth_events = { (e.type, e.state_key): e for e in current_auth_events.values() } try: self.auth.check(room_version, event, auth_events=current_auth_events) except AuthError as e: logger.warn("Soft-failing %r because %s", event, e) event.internal_metadata.soft_failed = True @defer.inlineCallbacks def on_query_auth( self, origin, event_id, room_id, remote_auth_chain, rejects, missing ): in_room = yield self.auth.check_host_in_room(room_id, origin) if not in_room: raise AuthError(403, "Host not in room.") event = yield self.store.get_event( event_id, allow_none=False, check_room_id=room_id ) # Just go through and process each event in `remote_auth_chain`. We # don't want to fall into the trap of `missing` being wrong. for e in remote_auth_chain: try: yield self._handle_new_event(origin, e) except AuthError: pass # Now get the current auth_chain for the event. local_auth_chain = yield self.store.get_auth_chain( [auth_id for auth_id in event.auth_event_ids()], include_given=True ) # TODO: Check if we would now reject event_id. If so we need to tell # everyone. ret = yield self.construct_auth_difference(local_auth_chain, remote_auth_chain) logger.debug("on_query_auth returning: %s", ret) return ret @defer.inlineCallbacks def on_get_missing_events( self, origin, room_id, earliest_events, latest_events, limit ): in_room = yield self.auth.check_host_in_room(room_id, origin) if not in_room: raise AuthError(403, "Host not in room.") limit = min(limit, 20) missing_events = yield self.store.get_missing_events( room_id=room_id, earliest_events=earliest_events, latest_events=latest_events, limit=limit, ) missing_events = yield filter_events_for_server( self.store, origin, missing_events ) return missing_events @defer.inlineCallbacks @log_function def do_auth(self, origin, event, context, auth_events): """ Args: origin (str): event (synapse.events.EventBase): context (synapse.events.snapshot.EventContext): auth_events (dict[(str, str)->synapse.events.EventBase]): Map from (event_type, state_key) to event What we expect the event's auth_events to be, based on the event's position in the dag. I think? maybe?? Also NB that this function adds entries to it. Returns: defer.Deferred[None] """ room_version = yield self.store.get_room_version(event.room_id) try: yield self._update_auth_events_and_context_for_auth( origin, event, context, auth_events ) except Exception: # We don't really mind if the above fails, so lets not fail # processing if it does. However, it really shouldn't fail so # let's still log as an exception since we'll still want to fix # any bugs. logger.exception( "Failed to double check auth events for %s with remote. " "Ignoring failure and continuing processing of event.", event.event_id, ) try: self.auth.check(room_version, event, auth_events=auth_events) except AuthError as e: logger.warn("Failed auth resolution for %r because %s", event, e) raise e @defer.inlineCallbacks def _update_auth_events_and_context_for_auth( self, origin, event, context, auth_events ): """Helper for do_auth. See there for docs. Checks whether a given event has the expected auth events. If it doesn't then we talk to the remote server to compare state to see if we can come to a consensus (e.g. if one server missed some valid state). This attempts to resovle any potential divergence of state between servers, but is not essential and so failures should not block further processing of the event. Args: origin (str): event (synapse.events.EventBase): context (synapse.events.snapshot.EventContext): auth_events (dict[(str, str)->synapse.events.EventBase]): Returns: defer.Deferred[None] """ event_auth_events = set(event.auth_event_ids()) if event.is_state(): event_key = (event.type, event.state_key) else: event_key = None # if the event's auth_events refers to events which are not in our # calculated auth_events, we need to fetch those events from somewhere. # # we start by fetching them from the store, and then try calling /event_auth/. missing_auth = event_auth_events.difference( e.event_id for e in auth_events.values() ) if missing_auth: # TODO: can we use store.have_seen_events here instead? have_events = yield self.store.get_seen_events_with_rejections(missing_auth) logger.debug("Got events %s from store", have_events) missing_auth.difference_update(have_events.keys()) else: have_events = {} have_events.update({e.event_id: "" for e in auth_events.values()}) if missing_auth: # If we don't have all the auth events, we need to get them. logger.info("auth_events contains unknown events: %s", missing_auth) try: try: remote_auth_chain = yield self.federation_client.get_event_auth( origin, event.room_id, event.event_id ) except RequestSendFailed as e: # The other side isn't around or doesn't implement the # endpoint, so lets just bail out. logger.info("Failed to get event auth from remote: %s", e) return seen_remotes = yield self.store.have_seen_events( [e.event_id for e in remote_auth_chain] ) for e in remote_auth_chain: if e.event_id in seen_remotes: continue if e.event_id == event.event_id: continue try: auth_ids = e.auth_event_ids() auth = { (e.type, e.state_key): e for e in remote_auth_chain if e.event_id in auth_ids or e.type == EventTypes.Create } e.internal_metadata.outlier = True logger.debug( "do_auth %s missing_auth: %s", event.event_id, e.event_id ) yield self._handle_new_event(origin, e, auth_events=auth) if e.event_id in event_auth_events: auth_events[(e.type, e.state_key)] = e except AuthError: pass have_events = yield self.store.get_seen_events_with_rejections( event.auth_event_ids() ) except Exception: # FIXME: logger.exception("Failed to get auth chain") if event.internal_metadata.is_outlier(): logger.info("Skipping auth_event fetch for outlier") return # FIXME: Assumes we have and stored all the state for all the # prev_events different_auth = event_auth_events.difference( e.event_id for e in auth_events.values() ) if not different_auth: return logger.info( "auth_events refers to events which are not in our calculated auth " "chain: %s", different_auth, ) room_version = yield self.store.get_room_version(event.room_id) different_events = yield make_deferred_yieldable( defer.gatherResults( [ run_in_background( self.store.get_event, d, allow_none=True, allow_rejected=False ) for d in different_auth if d in have_events and not have_events[d] ], consumeErrors=True, ) ).addErrback(unwrapFirstError) if different_events: local_view = dict(auth_events) remote_view = dict(auth_events) remote_view.update( {(d.type, d.state_key): d for d in different_events if d} ) new_state = yield self.state_handler.resolve_events( room_version, [list(local_view.values()), list(remote_view.values())], event, ) logger.info( "After state res: updating auth_events with new state %s", { (d.type, d.state_key): d.event_id for d in new_state.values() if auth_events.get((d.type, d.state_key)) != d }, ) auth_events.update(new_state) different_auth = event_auth_events.difference( e.event_id for e in auth_events.values() ) yield self._update_context_for_auth_events( event, context, auth_events, event_key ) if not different_auth: # we're done return logger.info( "auth_events still refers to events which are not in the calculated auth " "chain after state resolution: %s", different_auth, ) # Only do auth resolution if we have something new to say. # We can't prove an auth failure. do_resolution = False for e_id in different_auth: if e_id in have_events: if have_events[e_id] == RejectedReason.NOT_ANCESTOR: do_resolution = True break if not do_resolution: logger.info( "Skipping auth resolution due to lack of provable rejection reasons" ) return logger.info("Doing auth resolution") prev_state_ids = yield context.get_prev_state_ids(self.store) # 1. Get what we think is the auth chain. auth_ids = yield self.auth.compute_auth_events(event, prev_state_ids) local_auth_chain = yield self.store.get_auth_chain(auth_ids, include_given=True) try: # 2. Get remote difference. try: result = yield self.federation_client.query_auth( origin, event.room_id, event.event_id, local_auth_chain ) except RequestSendFailed as e: # The other side isn't around or doesn't implement the # endpoint, so lets just bail out. logger.info("Failed to query auth from remote: %s", e) return seen_remotes = yield self.store.have_seen_events( [e.event_id for e in result["auth_chain"]] ) # 3. Process any remote auth chain events we haven't seen. for ev in result["auth_chain"]: if ev.event_id in seen_remotes: continue if ev.event_id == event.event_id: continue try: auth_ids = ev.auth_event_ids() auth = { (e.type, e.state_key): e for e in result["auth_chain"] if e.event_id in auth_ids or event.type == EventTypes.Create } ev.internal_metadata.outlier = True logger.debug( "do_auth %s different_auth: %s", event.event_id, e.event_id ) yield self._handle_new_event(origin, ev, auth_events=auth) if ev.event_id in event_auth_events: auth_events[(ev.type, ev.state_key)] = ev except AuthError: pass except Exception: # FIXME: logger.exception("Failed to query auth chain") # 4. Look at rejects and their proofs. # TODO. yield self._update_context_for_auth_events( event, context, auth_events, event_key ) @defer.inlineCallbacks def _update_context_for_auth_events(self, event, context, auth_events, event_key): """Update the state_ids in an event context after auth event resolution, storing the changes as a new state group. Args: event (Event): The event we're handling the context for context (synapse.events.snapshot.EventContext): event context to be updated auth_events (dict[(str, str)->str]): Events to update in the event context. event_key ((str, str)): (type, state_key) for the current event. this will not be included in the current_state in the context. """ state_updates = { k: a.event_id for k, a in iteritems(auth_events) if k != event_key } current_state_ids = yield context.get_current_state_ids(self.store) current_state_ids = dict(current_state_ids) current_state_ids.update(state_updates) prev_state_ids = yield context.get_prev_state_ids(self.store) prev_state_ids = dict(prev_state_ids) prev_state_ids.update({k: a.event_id for k, a in iteritems(auth_events)}) # create a new state group as a delta from the existing one. prev_group = context.state_group state_group = yield self.store.store_state_group( event.event_id, event.room_id, prev_group=prev_group, delta_ids=state_updates, current_state_ids=current_state_ids, ) yield context.update_state( state_group=state_group, current_state_ids=current_state_ids, prev_state_ids=prev_state_ids, prev_group=prev_group, delta_ids=state_updates, ) @defer.inlineCallbacks def construct_auth_difference(self, local_auth, remote_auth): """ Given a local and remote auth chain, find the differences. This assumes that we have already processed all events in remote_auth Params: local_auth (list) remote_auth (list) Returns: dict """ logger.debug("construct_auth_difference Start!") # TODO: Make sure we are OK with local_auth or remote_auth having more # auth events in them than strictly necessary. def sort_fun(ev): return ev.depth, ev.event_id logger.debug("construct_auth_difference after sort_fun!") # We find the differences by starting at the "bottom" of each list # and iterating up on both lists. The lists are ordered by depth and # then event_id, we iterate up both lists until we find the event ids # don't match. Then we look at depth/event_id to see which side is # missing that event, and iterate only up that list. Repeat. remote_list = list(remote_auth) remote_list.sort(key=sort_fun) local_list = list(local_auth) local_list.sort(key=sort_fun) local_iter = iter(local_list) remote_iter = iter(remote_list) logger.debug("construct_auth_difference before get_next!") def get_next(it, opt=None): try: return next(it) except Exception: return opt current_local = get_next(local_iter) current_remote = get_next(remote_iter) logger.debug("construct_auth_difference before while") missing_remotes = [] missing_locals = [] while current_local or current_remote: if current_remote is None: missing_locals.append(current_local) current_local = get_next(local_iter) continue if current_local is None: missing_remotes.append(current_remote) current_remote = get_next(remote_iter) continue if current_local.event_id == current_remote.event_id: current_local = get_next(local_iter) current_remote = get_next(remote_iter) continue if current_local.depth < current_remote.depth: missing_locals.append(current_local) current_local = get_next(local_iter) continue if current_local.depth > current_remote.depth: missing_remotes.append(current_remote) current_remote = get_next(remote_iter) continue # They have the same depth, so we fall back to the event_id order if current_local.event_id < current_remote.event_id: missing_locals.append(current_local) current_local = get_next(local_iter) if current_local.event_id > current_remote.event_id: missing_remotes.append(current_remote) current_remote = get_next(remote_iter) continue logger.debug("construct_auth_difference after while") # missing locals should be sent to the server # We should find why we are missing remotes, as they will have been # rejected. # Remove events from missing_remotes if they are referencing a missing # remote. We only care about the "root" rejected ones. missing_remote_ids = [e.event_id for e in missing_remotes] base_remote_rejected = list(missing_remotes) for e in missing_remotes: for e_id in e.auth_event_ids(): if e_id in missing_remote_ids: try: base_remote_rejected.remove(e) except ValueError: pass reason_map = {} for e in base_remote_rejected: reason = yield self.store.get_rejection_reason(e.event_id) if reason is None: # TODO: e is not in the current state, so we should # construct some proof of that. continue reason_map[e.event_id] = reason if reason == RejectedReason.AUTH_ERROR: pass elif reason == RejectedReason.REPLACED: # TODO: Get proof pass elif reason == RejectedReason.NOT_ANCESTOR: # TODO: Get proof. pass logger.debug("construct_auth_difference returning") return { "auth_chain": local_auth, "rejects": { e.event_id: {"reason": reason_map[e.event_id], "proof": None} for e in base_remote_rejected }, "missing": [e.event_id for e in missing_locals], } @defer.inlineCallbacks @log_function def exchange_third_party_invite( self, sender_user_id, target_user_id, room_id, signed ): third_party_invite = {"signed": signed} event_dict = { "type": EventTypes.Member, "content": { "membership": Membership.INVITE, "third_party_invite": third_party_invite, }, "room_id": room_id, "sender": sender_user_id, "state_key": target_user_id, } if (yield self.auth.check_host_in_room(room_id, self.hs.hostname)): room_version = yield self.store.get_room_version(room_id) builder = self.event_builder_factory.new(room_version, event_dict) EventValidator().validate_builder(builder) event, context = yield self.event_creation_handler.create_new_client_event( builder=builder ) event_allowed = yield self.third_party_event_rules.check_event_allowed( event, context ) if not event_allowed: logger.info( "Creation of threepid invite %s forbidden by third-party rules", event, ) raise SynapseError( 403, "This event is not allowed in this context", Codes.FORBIDDEN ) event, context = yield self.add_display_name_to_third_party_invite( room_version, event_dict, event, context ) EventValidator().validate_new(event) # We need to tell the transaction queue to send this out, even # though the sender isn't a local user. event.internal_metadata.send_on_behalf_of = self.hs.hostname try: yield self.auth.check_from_context(room_version, event, context) except AuthError as e: logger.warn("Denying new third party invite %r because %s", event, e) raise e yield self._check_signature(event, context) member_handler = self.hs.get_room_member_handler() yield member_handler.send_membership_event(None, event, context) else: destinations = set(x.split(":", 1)[-1] for x in (sender_user_id, room_id)) yield self.federation_client.forward_third_party_invite( destinations, room_id, event_dict ) @defer.inlineCallbacks @log_function def on_exchange_third_party_invite_request(self, room_id, event_dict): """Handle an exchange_third_party_invite request from a remote server The remote server will call this when it wants to turn a 3pid invite into a normal m.room.member invite. Args: room_id (str): The ID of the room. event_dict (dict[str, Any]): Dictionary containing the event body. Returns: Deferred: resolves (to None) """ room_version = yield self.store.get_room_version(room_id) # NB: event_dict has a particular specced format we might need to fudge # if we change event formats too much. builder = self.event_builder_factory.new(room_version, event_dict) event, context = yield self.event_creation_handler.create_new_client_event( builder=builder ) event_allowed = yield self.third_party_event_rules.check_event_allowed( event, context ) if not event_allowed: logger.warning( "Exchange of threepid invite %s forbidden by third-party rules", event ) raise SynapseError( 403, "This event is not allowed in this context", Codes.FORBIDDEN ) event, context = yield self.add_display_name_to_third_party_invite( room_version, event_dict, event, context ) try: self.auth.check_from_context(room_version, event, context) except AuthError as e: logger.warn("Denying third party invite %r because %s", event, e) raise e yield self._check_signature(event, context) # We need to tell the transaction queue to send this out, even # though the sender isn't a local user. event.internal_metadata.send_on_behalf_of = get_domain_from_id(event.sender) member_handler = self.hs.get_room_member_handler() yield member_handler.send_membership_event(None, event, context) @defer.inlineCallbacks def add_display_name_to_third_party_invite( self, room_version, event_dict, event, context ): key = ( EventTypes.ThirdPartyInvite, event.content["third_party_invite"]["signed"]["token"], ) original_invite = None prev_state_ids = yield context.get_prev_state_ids(self.store) original_invite_id = prev_state_ids.get(key) if original_invite_id: original_invite = yield self.store.get_event( original_invite_id, allow_none=True ) if original_invite: display_name = original_invite.content["display_name"] event_dict["content"]["third_party_invite"]["display_name"] = display_name else: logger.info( "Could not find invite event for third_party_invite: %r", event_dict ) # We don't discard here as this is not the appropriate place to do # auth checks. If we need the invite and don't have it then the # auth check code will explode appropriately. builder = self.event_builder_factory.new(room_version, event_dict) EventValidator().validate_builder(builder) event, context = yield self.event_creation_handler.create_new_client_event( builder=builder ) EventValidator().validate_new(event) return (event, context) @defer.inlineCallbacks def _check_signature(self, event, context): """ Checks that the signature in the event is consistent with its invite. Args: event (Event): The m.room.member event to check context (EventContext): Raises: AuthError: if signature didn't match any keys, or key has been revoked, SynapseError: if a transient error meant a key couldn't be checked for revocation. """ signed = event.content["third_party_invite"]["signed"] token = signed["token"] prev_state_ids = yield context.get_prev_state_ids(self.store) invite_event_id = prev_state_ids.get((EventTypes.ThirdPartyInvite, token)) invite_event = None if invite_event_id: invite_event = yield self.store.get_event(invite_event_id, allow_none=True) if not invite_event: raise AuthError(403, "Could not find invite") logger.debug("Checking auth on event %r", event.content) last_exception = None # for each public key in the 3pid invite event for public_key_object in self.hs.get_auth().get_public_keys(invite_event): try: # for each sig on the third_party_invite block of the actual invite for server, signature_block in signed["signatures"].items(): for key_name, encoded_signature in signature_block.items(): if not key_name.startswith("ed25519:"): continue logger.debug( "Attempting to verify sig with key %s from %r " "against pubkey %r", key_name, server, public_key_object, ) try: public_key = public_key_object["public_key"] verify_key = decode_verify_key_bytes( key_name, decode_base64(public_key) ) verify_signed_json(signed, server, verify_key) logger.debug( "Successfully verified sig with key %s from %r " "against pubkey %r", key_name, server, public_key_object, ) except Exception: logger.info( "Failed to verify sig with key %s from %r " "against pubkey %r", key_name, server, public_key_object, ) raise try: if "key_validity_url" in public_key_object: yield self._check_key_revocation( public_key, public_key_object["key_validity_url"] ) except Exception: logger.info( "Failed to query key_validity_url %s", public_key_object["key_validity_url"], ) raise return except Exception as e: last_exception = e raise last_exception @defer.inlineCallbacks def _check_key_revocation(self, public_key, url): """ Checks whether public_key has been revoked. Args: public_key (str): base-64 encoded public key. url (str): Key revocation URL. Raises: AuthError: if they key has been revoked. SynapseError: if a transient error meant a key couldn't be checked for revocation. """ try: response = yield self.http_client.get_json(url, {"public_key": public_key}) except Exception: raise SynapseError(502, "Third party certificate could not be checked") if "valid" not in response or not response["valid"]: raise AuthError(403, "Third party certificate was invalid") @defer.inlineCallbacks def persist_events_and_notify(self, event_and_contexts, backfilled=False): """Persists events and tells the notifier/pushers about them, if necessary. Args: event_and_contexts(list[tuple[FrozenEvent, EventContext]]) backfilled (bool): Whether these events are a result of backfilling or not Returns: Deferred """ if self.config.worker_app: yield self._send_events_to_master( store=self.store, event_and_contexts=event_and_contexts, backfilled=backfilled, ) else: max_stream_id = yield self.store.persist_events( event_and_contexts, backfilled=backfilled ) if not backfilled: # Never notify for backfilled events for event, _ in event_and_contexts: yield self._notify_persisted_event(event, max_stream_id) def _notify_persisted_event(self, event, max_stream_id): """Checks to see if notifier/pushers should be notified about the event or not. Args: event (FrozenEvent) max_stream_id (int): The max_stream_id returned by persist_events """ extra_users = [] if event.type == EventTypes.Member: target_user_id = event.state_key # We notify for memberships if its an invite for one of our # users if event.internal_metadata.is_outlier(): if event.membership != Membership.INVITE: if not self.is_mine_id(target_user_id): return target_user = UserID.from_string(target_user_id) extra_users.append(target_user) elif event.internal_metadata.is_outlier(): return event_stream_id = event.internal_metadata.stream_ordering self.notifier.on_new_room_event( event, event_stream_id, max_stream_id, extra_users=extra_users ) return self.pusher_pool.on_new_notifications(event_stream_id, max_stream_id) def _clean_room_for_join(self, room_id): """Called to clean up any data in DB for a given room, ready for the server to join the room. Args: room_id (str) """ if self.config.worker_app: return self._clean_room_for_join_client(room_id) else: return self.store.clean_room_for_join(room_id) def user_joined_room(self, user, room_id): """Called when a new user has joined the room """ if self.config.worker_app: return self._notify_user_membership_change( room_id=room_id, user_id=user.to_string(), change="joined" ) else: return user_joined_room(self.distributor, user, room_id) @defer.inlineCallbacks def get_room_complexity(self, remote_room_hosts, room_id): """ Fetch the complexity of a remote room over federation. Args: remote_room_hosts (list[str]): The remote servers to ask. room_id (str): The room ID to ask about. Returns: Deferred[dict] or Deferred[None]: Dict contains the complexity metric versions, while None means we could not fetch the complexity. """ for host in remote_room_hosts: res = yield self.federation_client.get_room_complexity(host, room_id) # We got a result, return it. if res: defer.returnValue(res) # We fell off the bottom, couldn't get the complexity from anyone. Oh # well. defer.returnValue(None)
38.411225
99
0.5732
import itertools import logging import six from six import iteritems, itervalues from six.moves import http_client, zip from signedjson.key import decode_verify_key_bytes from signedjson.sign import verify_signed_json from unpaddedbase64 import decode_base64 from twisted.internet import defer from synapse.api.constants import EventTypes, Membership, RejectedReason from synapse.api.errors import ( AuthError, CodeMessageException, Codes, FederationDeniedError, FederationError, RequestSendFailed, StoreError, SynapseError, ) from synapse.api.room_versions import KNOWN_ROOM_VERSIONS, RoomVersions from synapse.crypto.event_signing import compute_event_signature from synapse.event_auth import auth_types_for_event from synapse.events.validator import EventValidator from synapse.logging.context import ( make_deferred_yieldable, nested_logging_context, preserve_fn, run_in_background, ) from synapse.logging.utils import log_function from synapse.replication.http.federation import ( ReplicationCleanRoomRestServlet, ReplicationFederationSendEventsRestServlet, ) from synapse.replication.http.membership import ReplicationUserJoinedLeftRoomRestServlet from synapse.state import StateResolutionStore, resolve_events_with_store from synapse.types import UserID, get_domain_from_id from synapse.util import unwrapFirstError from synapse.util.async_helpers import Linearizer from synapse.util.distributor import user_joined_room from synapse.util.retryutils import NotRetryingDestination from synapse.visibility import filter_events_for_server from ._base import BaseHandler logger = logging.getLogger(__name__) def shortstr(iterable, maxitems=5): items = list(itertools.islice(iterable, maxitems + 1)) if len(items) <= maxitems: return str(items) return "[" + ", ".join(repr(r) for r in items[:maxitems]) + ", ...]" class FederationHandler(BaseHandler): def __init__(self, hs): super(FederationHandler, self).__init__(hs) self.hs = hs self.store = hs.get_datastore() self.federation_client = hs.get_federation_client() self.state_handler = hs.get_state_handler() self.server_name = hs.hostname self.keyring = hs.get_keyring() self.action_generator = hs.get_action_generator() self.is_mine_id = hs.is_mine_id self.pusher_pool = hs.get_pusherpool() self.spam_checker = hs.get_spam_checker() self.event_creation_handler = hs.get_event_creation_handler() self._server_notices_mxid = hs.config.server_notices_mxid self.config = hs.config self.http_client = hs.get_simple_http_client() self._send_events_to_master = ReplicationFederationSendEventsRestServlet.make_client( hs ) self._notify_user_membership_change = ReplicationUserJoinedLeftRoomRestServlet.make_client( hs ) self._clean_room_for_join_client = ReplicationCleanRoomRestServlet.make_client( hs ) self.room_queues = {} self._room_pdu_linearizer = Linearizer("fed_room_pdu") self.third_party_event_rules = hs.get_third_party_event_rules() @defer.inlineCallbacks def on_receive_pdu(self, origin, pdu, sent_to_us_directly=False): room_id = pdu.room_id event_id = pdu.event_id logger.info("[%s %s] handling received PDU: %s", room_id, event_id, pdu) existing = yield self.store.get_event( event_id, allow_none=True, allow_rejected=True ) already_seen = existing and ( not existing.internal_metadata.is_outlier() or pdu.internal_metadata.is_outlier() ) if already_seen: logger.debug("[%s %s]: Already seen pdu", room_id, event_id) return # could cause a huge state resolution or cascade of event fetches. try: self._sanity_check_event(pdu) except SynapseError as err: logger.warn( "[%s %s] Received event failed sanity checks", room_id, event_id ) raise FederationError("ERROR", err.code, err.msg, affected=pdu.event_id) # If we are currently in the process of joining this room, then we # queue up events for later processing. if room_id in self.room_queues: logger.info( "[%s %s] Queuing PDU from %s for now: join in progress", room_id, event_id, origin, ) self.room_queues[room_id].append((pdu, origin)) return # If we're not in the room just ditch the event entirely. This is # the room (or we've been rejoined to the room by a state reset). is_in_room = yield self.auth.check_host_in_room(room_id, self.server_name) if not is_in_room: logger.info( "[%s %s] Ignoring PDU from %s as we're not in the room", room_id, event_id, origin, ) return None state = None auth_chain = [] if not pdu.internal_metadata.is_outlier(): min_depth = yield self.get_min_depth_for_context(pdu.room_id) logger.debug("[%s %s] min_depth: %d", room_id, event_id, min_depth) prevs = set(pdu.prev_event_ids()) seen = yield self.store.have_seen_events(prevs) if min_depth and pdu.depth < min_depth: # message, to work around the fact that some events will # reference really really old events we really don't want to pdu.internal_metadata.outlier = True elif min_depth and pdu.depth > min_depth: missing_prevs = prevs - seen if sent_to_us_directly and missing_prevs: # at a time. logger.info( "[%s %s] Acquiring room lock to fetch %d missing prev_events: %s", room_id, event_id, len(missing_prevs), shortstr(missing_prevs), ) with (yield self._room_pdu_linearizer.queue(pdu.room_id)): logger.info( "[%s %s] Acquired room lock to fetch %d missing prev_events", room_id, event_id, len(missing_prevs), ) yield self._get_missing_events_for_pdu( origin, pdu, prevs, min_depth ) # Update the set of things we've seen after trying to seen = yield self.store.have_seen_events(prevs) if not prevs - seen: logger.info( "[%s %s] Found all missing prev_events", room_id, event_id, ) elif missing_prevs: logger.info( "[%s %s] Not recursively fetching %d missing prev_events: %s", room_id, event_id, len(missing_prevs), shortstr(missing_prevs), ) if prevs - seen: # # In this case, we need to fall back to asking another server in the # federation for the state at this event. That's ok provided we then # withholding its prev_events, and declaring yourself to be an admin in # the subsequent state request). # # Now, if we're pulling this event as a missing prev_event, then clearly # following. if sent_to_us_directly: logger.warn( "[%s %s] Rejecting: failed to fetch %d prev events: %s", room_id, event_id, len(prevs - seen), shortstr(prevs - seen), ) raise FederationError( "ERROR", 403, ( "Your server isn't divulging details about prev_events " "referenced in this event." ), affected=pdu.event_id, ) auth_chains = set() event_map = {event_id: pdu} try: ours = yield self.store.get_state_groups_ids(room_id, seen) state_maps = list( ours.values() ) del ours # know about for p in prevs - seen: logger.info( "[%s %s] Requesting state at missing prev_event %s", room_id, event_id, p, ) room_version = yield self.store.get_room_version(room_id) with nested_logging_context(p): # note that if any of the missing prevs share missing state or # auth events, the requests to fetch those events are deduped # by the get_pdu_cache in federation_client. remote_state, got_auth_chain = ( yield self.federation_client.get_state_for_room( origin, room_id, p ) ) # we want the state *after* p; get_state_for_room returns the # state *before* p. remote_event = yield self.federation_client.get_pdu( [origin], p, room_version, outlier=True ) if remote_event is None: raise Exception( "Unable to get missing prev_event %s" % (p,) ) if remote_event.is_state(): remote_state.append(remote_event) # XXX hrm I'm not convinced that duplicate events will compare # hoped. auth_chains.update(got_auth_chain) remote_state_map = { (x.type, x.state_key): x.event_id for x in remote_state } state_maps.append(remote_state_map) for x in remote_state: event_map[x.event_id] = x state_map = yield resolve_events_with_store( room_version, state_maps, event_map, state_res_store=StateResolutionStore(self.store), ) # We need to give _process_received_pdu the actual state events # rather than event ids, so generate that now. # First though we need to fetch all the events that are in # state_map, so we can build up the state below. evs = yield self.store.get_events( list(state_map.values()), get_prev_content=False, check_redacted=False, ) event_map.update(evs) state = [event_map[e] for e in six.itervalues(state_map)] auth_chain = list(auth_chains) except Exception: logger.warn( "[%s %s] Error attempting to resolve state at missing " "prev_events", room_id, event_id, exc_info=True, ) raise FederationError( "ERROR", 403, "We can't get valid state history.", affected=event_id, ) yield self._process_received_pdu( origin, pdu, state=state, auth_chain=auth_chain ) @defer.inlineCallbacks def _get_missing_events_for_pdu(self, origin, pdu, prevs, min_depth): room_id = pdu.room_id event_id = pdu.event_id seen = yield self.store.have_seen_events(prevs) if not prevs - seen: return latest = yield self.store.get_latest_event_ids_in_room(room_id) latest = set(latest) latest |= seen logger.info( "[%s %s]: Requesting missing events between %s and %s", room_id, event_id, shortstr(latest), event_id, ) # XXX: we set timeout to 10s to help workaround # https://github.com/matrix-org/synapse/issues/1733. # The reason is to avoid holding the linearizer lock # whilst processing inbound /send transactions, causing # FDs to stack up and block other inbound transactions # which empirically can currently take up to 30 minutes. # # N.B. this explicitly disables retry attempts. # # N.B. this also increases our chances of falling back to # fetching fresh state for the room if the missing event # can't be found, which slightly reduces our security. # apparently. # # see https://github.com/matrix-org/synapse/pull/1744 # # ---- # # Update richvdh 2018/09/18: There are a number of problems with timing this # request out agressively on the client side: # # - it plays badly with the server-side rate-limiter, which starts tarpitting you # if you send too many requests at once, so you end up with the server carefully # working through the backlog of your requests, which you have already timed # out. # # - for this request in particular, we now (as of # https://github.com/matrix-org/synapse/pull/3456) reject any PDUs where the # server can't produce a plausible-looking set of prev_events - so we becone # problem. # # - the agressive 10s timeout was introduced to deal with incoming federation # requests taking 8 hours to process. It's not entirely clear why that was going # # All that said: Let's try increasing the timout to 60s and see what happens. try: missing_events = yield self.federation_client.get_missing_events( origin, room_id, earliest_events_ids=list(latest), latest_events=[pdu], limit=10, min_depth=min_depth, timeout=60000, ) except RequestSendFailed as e: logger.warn("[%s %s]: Failed to get prev_events: %s", room_id, event_id, e) return logger.info( "[%s %s]: Got %d prev_events: %s", room_id, event_id, len(missing_events), shortstr(missing_events), ) missing_events.sort(key=lambda x: x.depth) for ev in missing_events: logger.info( "[%s %s] Handling received prev_event %s", room_id, event_id, ev.event_id, ) with nested_logging_context(ev.event_id): try: yield self.on_receive_pdu(origin, ev, sent_to_us_directly=False) except FederationError as e: if e.code == 403: logger.warn( "[%s %s] Received prev_event %s failed history check.", room_id, event_id, ev.event_id, ) else: raise @defer.inlineCallbacks def _process_received_pdu(self, origin, event, state, auth_chain): room_id = event.room_id event_id = event.event_id logger.debug("[%s %s] Processing event: %s", room_id, event_id, event) event_ids = set() if state: event_ids |= {e.event_id for e in state} if auth_chain: event_ids |= {e.event_id for e in auth_chain} seen_ids = yield self.store.have_seen_events(event_ids) if state and auth_chain is not None: event_infos = [] for e in itertools.chain(auth_chain, state): if e.event_id in seen_ids: continue e.internal_metadata.outlier = True auth_ids = e.auth_event_ids() auth = { (e.type, e.state_key): e for e in auth_chain if e.event_id in auth_ids or e.type == EventTypes.Create } event_infos.append({"event": e, "auth_events": auth}) seen_ids.add(e.event_id) logger.info( "[%s %s] persisting newly-received auth/state events %s", room_id, event_id, [e["event"].event_id for e in event_infos], ) yield self._handle_new_events(origin, event_infos) try: context = yield self._handle_new_event(origin, event, state=state) except AuthError as e: raise FederationError("ERROR", e.code, e.msg, affected=event.event_id) room = yield self.store.get_room(room_id) if not room: try: yield self.store.store_room( room_id=room_id, room_creator_user_id="", is_public=False ) except StoreError: logger.exception("Failed to store room.") if event.type == EventTypes.Member: if event.membership == Membership.JOIN: # Only fire user_joined_room if the user has acutally # joined the room. Don't bother if the user is just newly_joined = True prev_state_ids = yield context.get_prev_state_ids(self.store) prev_state_id = prev_state_ids.get((event.type, event.state_key)) if prev_state_id: prev_state = yield self.store.get_event( prev_state_id, allow_none=True ) if prev_state and prev_state.membership == Membership.JOIN: newly_joined = False if newly_joined: user = UserID.from_string(event.state_key) yield self.user_joined_room(user, room_id) @log_function @defer.inlineCallbacks def backfill(self, dest, room_id, limit, extremities): if dest == self.server_name: raise SynapseError(400, "Can't backfill from self.") room_version = yield self.store.get_room_version(room_id) events = yield self.federation_client.backfill( dest, room_id, limit=limit, extremities=extremities ) # ideally we'd sanity check the events here for excess prev_events etc, # breaking backfill in the same way that it is currently broken by # events whose signature we cannot verify (#3121). # # So for now we accept the events anyway. #3124 tracks this. # # for ev in events: # self._sanity_check_event(ev) # Don't bother processing events we already have. seen_events = yield self.store.have_events_in_timeline( set(e.event_id for e in events) ) events = [e for e in events if e.event_id not in seen_events] if not events: return [] event_map = {e.event_id: e for e in events} event_ids = set(e.event_id for e in events) edges = [ev.event_id for ev in events if set(ev.prev_event_ids()) - event_ids] logger.info("backfill: Got %d events with %d edges", len(events), len(edges)) auth_events = {} state_events = {} events_to_state = {} for e_id in edges: state, auth = yield self.federation_client.get_state_for_room( destination=dest, room_id=room_id, event_id=e_id ) auth_events.update({a.event_id: a for a in auth}) auth_events.update({s.event_id: s for s in state}) state_events.update({s.event_id: s for s in state}) events_to_state[e_id] = state required_auth = set( a_id for event in events + list(state_events.values()) + list(auth_events.values()) for a_id in event.auth_event_ids() ) auth_events.update( {e_id: event_map[e_id] for e_id in required_auth if e_id in event_map} ) missing_auth = required_auth - set(auth_events) failed_to_fetch = set() while missing_auth - failed_to_fetch: logger.info("Missing auth for backfill: %r", missing_auth) ret_events = yield self.store.get_events(missing_auth - failed_to_fetch) auth_events.update(ret_events) required_auth.update( a_id for event in ret_events.values() for a_id in event.auth_event_ids() ) missing_auth = required_auth - set(auth_events) if missing_auth - failed_to_fetch: logger.info( "Fetching missing auth for backfill: %r", missing_auth - failed_to_fetch, ) results = yield make_deferred_yieldable( defer.gatherResults( [ run_in_background( self.federation_client.get_pdu, [dest], event_id, room_version=room_version, outlier=True, timeout=10000, ) for event_id in missing_auth - failed_to_fetch ], consumeErrors=True, ) ).addErrback(unwrapFirstError) auth_events.update({a.event_id: a for a in results if a}) required_auth.update( a_id for event in results if event for a_id in event.auth_event_ids() ) missing_auth = required_auth - set(auth_events) failed_to_fetch = missing_auth - set(auth_events) seen_events = yield self.store.have_seen_events( set(auth_events.keys()) | set(state_events.keys()) ) ev_infos = [] for a in auth_events.values(): # We only want to persist auth events as outliers that we haven't if a.event_id in seen_events or a.event_id in event_map: continue a.internal_metadata.outlier = True ev_infos.append( { "event": a, "auth_events": { ( auth_events[a_id].type, auth_events[a_id].state_key, ): auth_events[a_id] for a_id in a.auth_event_ids() if a_id in auth_events }, } ) # Step 1b: persist the events in the chunk we fetched state for (i.e. # the backwards extremities) as non-outliers. for e_id in events_to_state: # For paranoia we ensure that these events are marked as # non-outliers ev = event_map[e_id] assert not ev.internal_metadata.is_outlier() ev_infos.append( { "event": ev, "state": events_to_state[e_id], "auth_events": { ( auth_events[a_id].type, auth_events[a_id].state_key, ): auth_events[a_id] for a_id in ev.auth_event_ids() if a_id in auth_events }, } ) yield self._handle_new_events(dest, ev_infos, backfilled=True) # Step 2: Persist the rest of the events in the chunk one by one events.sort(key=lambda e: e.depth) for event in events: if event in events_to_state: continue # For paranoia we ensure that these events are marked as # non-outliers assert not event.internal_metadata.is_outlier() # We store these one at a time since each event depends on the # previous to work out the state. # TODO: We can probably do something more clever here. yield self._handle_new_event(dest, event, backfilled=True) return events @defer.inlineCallbacks def maybe_backfill(self, room_id, current_depth): extremities = yield self.store.get_oldest_events_with_depth_in_room(room_id) if not extremities: logger.debug("Not backfilling as no extremeties found.") return # We only want to paginate if we can actually see the events we'll get, # events. # # We do this by filtering all the backwards extremities and seeing if # any remain. Given we don't have the extremity events themselves, we forward_events = yield self.store.get_successor_events(list(extremities)) extremities_events = yield self.store.get_events( forward_events, check_redacted=False, get_prev_content=False ) filtered_extremities = yield filter_events_for_server( self.store, self.server_name, list(extremities_events.values()), redact=False, check_history_visibility_only=True, ) if not filtered_extremities: return False sorted_extremeties_tuple = sorted(extremities.items(), key=lambda e: -int(e[1])) max_depth = sorted_extremeties_tuple[0][1] # request URI to be too long. extremities = dict(sorted_extremeties_tuple[:5]) if current_depth > max_depth: logger.debug( "Not backfilling as we don't need to. %d < %d", max_depth, current_depth ) return curr_state = yield self.state_handler.get_current_state(room_id) def get_domains_from_state(state): joined_users = [ (state_key, int(event.depth)) for (e_type, state_key), event in iteritems(state) if e_type == EventTypes.Member and event.membership == Membership.JOIN ] joined_domains = {} for u, d in joined_users: try: dom = get_domain_from_id(u) old_d = joined_domains.get(dom) if old_d: joined_domains[dom] = min(d, old_d) else: joined_domains[dom] = d except Exception: pass return sorted(joined_domains.items(), key=lambda d: d[1]) curr_domains = get_domains_from_state(curr_state) likely_domains = [ domain for domain, depth in curr_domains if domain != self.server_name ] @defer.inlineCallbacks def try_backfill(domains): for dom in domains: try: yield self.backfill( dom, room_id, limit=100, extremities=extremities ) return True except SynapseError as e: logger.info("Failed to backfill from %s because %s", dom, e) continue except CodeMessageException as e: if 400 <= e.code < 500: raise logger.info("Failed to backfill from %s because %s", dom, e) continue except NotRetryingDestination as e: logger.info(str(e)) continue except RequestSendFailed as e: logger.info("Falied to get backfill from %s because %s", dom, e) continue except FederationDeniedError as e: logger.info(e) continue except Exception as e: logger.exception("Failed to backfill from %s because %s", dom, e) continue return False success = yield try_backfill(likely_domains) if success: return True # from the time. tried_domains = set(likely_domains) tried_domains.add(self.server_name) event_ids = list(extremities.keys()) logger.debug("calling resolve_state_groups in _maybe_backfill") resolve = preserve_fn(self.state_handler.resolve_state_groups_for_events) states = yield make_deferred_yieldable( defer.gatherResults( [resolve(room_id, [e]) for e in event_ids], consumeErrors=True ) ) # dict[str, dict[tuple, str]], a map from event_id to state map of # event_ids. states = dict(zip(event_ids, [s.state for s in states])) state_map = yield self.store.get_events( [e_id for ids in itervalues(states) for e_id in itervalues(ids)], get_prev_content=False, ) states = { key: { k: state_map[e_id] for k, e_id in iteritems(state_dict) if e_id in state_map } for key, state_dict in iteritems(states) } for e_id, _ in sorted_extremeties_tuple: likely_domains = get_domains_from_state(states[e_id]) success = yield try_backfill( [dom for dom, _ in likely_domains if dom not in tried_domains] ) if success: return True tried_domains.update(dom for dom, _ in likely_domains) return False def _sanity_check_event(self, ev): if len(ev.prev_event_ids()) > 20: logger.warn( "Rejecting event %s which has %i prev_events", ev.event_id, len(ev.prev_event_ids()), ) raise SynapseError(http_client.BAD_REQUEST, "Too many prev_events") if len(ev.auth_event_ids()) > 10: logger.warn( "Rejecting event %s which has %i auth_events", ev.event_id, len(ev.auth_event_ids()), ) raise SynapseError(http_client.BAD_REQUEST, "Too many auth_events") @defer.inlineCallbacks def send_invite(self, target_host, event): pdu = yield self.federation_client.send_invite( destination=target_host, room_id=event.room_id, event_id=event.event_id, pdu=event, ) return pdu @defer.inlineCallbacks def on_event_auth(self, event_id): event = yield self.store.get_event(event_id) auth = yield self.store.get_auth_chain( [auth_id for auth_id in event.auth_event_ids()], include_given=True ) return [e for e in auth] @log_function @defer.inlineCallbacks def do_invite_join(self, target_hosts, room_id, joinee, content): logger.debug("Joining %s to %s", joinee, room_id) origin, event, event_format_version = yield self._make_and_verify_event( target_hosts, room_id, joinee, "join", content, params={"ver": KNOWN_ROOM_VERSIONS}, ) # This shouldn't happen, because the RoomMemberHandler has a assert room_id not in self.room_queues self.room_queues[room_id] = [] yield self._clean_room_for_join(room_id) handled_events = set() try: try: target_hosts.remove(origin) target_hosts.insert(0, origin) except ValueError: pass ret = yield self.federation_client.send_join( target_hosts, event, event_format_version ) origin = ret["origin"] state = ret["state"] auth_chain = ret["auth_chain"] auth_chain.sort(key=lambda e: e.depth) handled_events.update([s.event_id for s in state]) handled_events.update([a.event_id for a in auth_chain]) handled_events.add(event.event_id) logger.debug("do_invite_join auth_chain: %s", auth_chain) logger.debug("do_invite_join state: %s", state) logger.debug("do_invite_join event: %s", event) try: yield self.store.store_room( room_id=room_id, room_creator_user_id="", is_public=False ) except Exception: pass yield self._persist_auth_tree(origin, auth_chain, state, event) logger.debug("Finished joining %s to %s", joinee, room_id) finally: room_queue = self.room_queues[room_id] del self.room_queues[room_id] # it's just a best-effort thing at this point. We do want to do # lots of requests for missing prev_events which we do actually # have. Hence we fire off the deferred, but don't wait for it. run_in_background(self._handle_queued_pdus, room_queue) return True @defer.inlineCallbacks def _handle_queued_pdus(self, room_queue): for p, origin in room_queue: try: logger.info( "Processing queued PDU %s which was received " "while we were joining %s", p.event_id, p.room_id, ) with nested_logging_context(p.event_id): yield self.on_receive_pdu(origin, p, sent_to_us_directly=True) except Exception as e: logger.warn( "Error handling queued PDU %s from %s: %s", p.event_id, origin, e ) @defer.inlineCallbacks @log_function def on_make_join_request(self, origin, room_id, user_id): if get_domain_from_id(user_id) != origin: logger.info( "Got /make_join request for user %r from different origin %s, ignoring", user_id, origin, ) raise SynapseError(403, "User not from origin", Codes.FORBIDDEN) event_content = {"membership": Membership.JOIN} room_version = yield self.store.get_room_version(room_id) builder = self.event_builder_factory.new( room_version, { "type": EventTypes.Member, "content": event_content, "room_id": room_id, "sender": user_id, "state_key": user_id, }, ) try: event, context = yield self.event_creation_handler.create_new_client_event( builder=builder ) except AuthError as e: logger.warn("Failed to create join %r because %s", event, e) raise e event_allowed = yield self.third_party_event_rules.check_event_allowed( event, context ) if not event_allowed: logger.info("Creation of join %s forbidden by third-party rules", event) raise SynapseError( 403, "This event is not allowed in this context", Codes.FORBIDDEN ) yield self.auth.check_from_context( room_version, event, context, do_sig_check=False ) return event @defer.inlineCallbacks @log_function def on_send_join_request(self, origin, pdu): event = pdu logger.debug( "on_send_join_request: Got event: %s, signatures: %s", event.event_id, event.signatures, ) event.internal_metadata.outlier = False # the join event over federation after joining, and changing it now # would introduce the danger of backwards-compatibility problems. event.internal_metadata.send_on_behalf_of = origin context = yield self._handle_new_event(origin, event) event_allowed = yield self.third_party_event_rules.check_event_allowed( event, context ) if not event_allowed: logger.info("Sending of join %s forbidden by third-party rules", event) raise SynapseError( 403, "This event is not allowed in this context", Codes.FORBIDDEN ) logger.debug( "on_send_join_request: After _handle_new_event: %s, sigs: %s", event.event_id, event.signatures, ) if event.type == EventTypes.Member: if event.content["membership"] == Membership.JOIN: user = UserID.from_string(event.state_key) yield self.user_joined_room(user, event.room_id) prev_state_ids = yield context.get_prev_state_ids(self.store) state_ids = list(prev_state_ids.values()) auth_chain = yield self.store.get_auth_chain(state_ids) state = yield self.store.get_events(list(prev_state_ids.values())) return {"state": list(state.values()), "auth_chain": auth_chain} @defer.inlineCallbacks def on_invite_request(self, origin, pdu): event = pdu if event.state_key is None: raise SynapseError(400, "The invite event did not have a state key") is_blocked = yield self.store.is_room_blocked(event.room_id) if is_blocked: raise SynapseError(403, "This room has been blocked on this server") if self.hs.config.block_non_admin_invites: raise SynapseError(403, "This server does not accept room invites") if not self.spam_checker.user_may_invite( event.sender, event.state_key, event.room_id ): raise SynapseError( 403, "This user is not permitted to send invites to this server/user" ) membership = event.content.get("membership") if event.type != EventTypes.Member or membership != Membership.INVITE: raise SynapseError(400, "The event was not an m.room.member invite event") sender_domain = get_domain_from_id(event.sender) if sender_domain != origin: raise SynapseError( 400, "The invite event was not from the server sending it" ) if not self.is_mine_id(event.state_key): raise SynapseError(400, "The invite event must be for this server") # block any attempts to invite the server notices mxid if event.state_key == self._server_notices_mxid: raise SynapseError(http_client.FORBIDDEN, "Cannot invite this user") event.internal_metadata.outlier = True event.internal_metadata.out_of_band_membership = True event.signatures.update( compute_event_signature( event.get_pdu_json(), self.hs.hostname, self.hs.config.signing_key[0] ) ) context = yield self.state_handler.compute_event_context(event) yield self.persist_events_and_notify([(event, context)]) return event @defer.inlineCallbacks def do_remotely_reject_invite(self, target_hosts, room_id, user_id): origin, event, event_format_version = yield self._make_and_verify_event( target_hosts, room_id, user_id, "leave" ) # Mark as outlier as we don't have any state for this event; we're not # even in the room. event.internal_metadata.outlier = True event.internal_metadata.out_of_band_membership = True # Try the host that we succesfully called /make_leave/ on first for # the /send_leave/ request. try: target_hosts.remove(origin) target_hosts.insert(0, origin) except ValueError: pass yield self.federation_client.send_leave(target_hosts, event) context = yield self.state_handler.compute_event_context(event) yield self.persist_events_and_notify([(event, context)]) return event @defer.inlineCallbacks def _make_and_verify_event( self, target_hosts, room_id, user_id, membership, content={}, params=None ): origin, event, format_ver = yield self.federation_client.make_membership_event( target_hosts, room_id, user_id, membership, content, params=params ) logger.debug("Got response to make_%s: %s", membership, event) # We should assert some things. # FIXME: Do this in a nicer way assert event.type == EventTypes.Member assert event.user_id == user_id assert event.state_key == user_id assert event.room_id == room_id return origin, event, format_ver @defer.inlineCallbacks @log_function def on_make_leave_request(self, origin, room_id, user_id): if get_domain_from_id(user_id) != origin: logger.info( "Got /make_leave request for user %r from different origin %s, ignoring", user_id, origin, ) raise SynapseError(403, "User not from origin", Codes.FORBIDDEN) room_version = yield self.store.get_room_version(room_id) builder = self.event_builder_factory.new( room_version, { "type": EventTypes.Member, "content": {"membership": Membership.LEAVE}, "room_id": room_id, "sender": user_id, "state_key": user_id, }, ) event, context = yield self.event_creation_handler.create_new_client_event( builder=builder ) event_allowed = yield self.third_party_event_rules.check_event_allowed( event, context ) if not event_allowed: logger.warning("Creation of leave %s forbidden by third-party rules", event) raise SynapseError( 403, "This event is not allowed in this context", Codes.FORBIDDEN ) try: # The remote hasn't signed it yet, obviously. We'll do the full checks # when we get the event back in `on_send_leave_request` yield self.auth.check_from_context( room_version, event, context, do_sig_check=False ) except AuthError as e: logger.warn("Failed to create new leave %r because %s", event, e) raise e return event @defer.inlineCallbacks @log_function def on_send_leave_request(self, origin, pdu): event = pdu logger.debug( "on_send_leave_request: Got event: %s, signatures: %s", event.event_id, event.signatures, ) event.internal_metadata.outlier = False context = yield self._handle_new_event(origin, event) event_allowed = yield self.third_party_event_rules.check_event_allowed( event, context ) if not event_allowed: logger.info("Sending of leave %s forbidden by third-party rules", event) raise SynapseError( 403, "This event is not allowed in this context", Codes.FORBIDDEN ) logger.debug( "on_send_leave_request: After _handle_new_event: %s, sigs: %s", event.event_id, event.signatures, ) return None @defer.inlineCallbacks def get_state_for_pdu(self, room_id, event_id): event = yield self.store.get_event( event_id, allow_none=False, check_room_id=room_id ) state_groups = yield self.store.get_state_groups(room_id, [event_id]) if state_groups: _, state = list(iteritems(state_groups)).pop() results = {(e.type, e.state_key): e for e in state} if event.is_state(): # Get previous state if "replaces_state" in event.unsigned: prev_id = event.unsigned["replaces_state"] if prev_id != event.event_id: prev_event = yield self.store.get_event(prev_id) results[(event.type, event.state_key)] = prev_event else: del results[(event.type, event.state_key)] res = list(results.values()) return res else: return [] @defer.inlineCallbacks def get_state_ids_for_pdu(self, room_id, event_id): event = yield self.store.get_event( event_id, allow_none=False, check_room_id=room_id ) state_groups = yield self.store.get_state_groups_ids(room_id, [event_id]) if state_groups: _, state = list(state_groups.items()).pop() results = state if event.is_state(): # Get previous state if "replaces_state" in event.unsigned: prev_id = event.unsigned["replaces_state"] if prev_id != event.event_id: results[(event.type, event.state_key)] = prev_id else: results.pop((event.type, event.state_key), None) return list(results.values()) else: return [] @defer.inlineCallbacks @log_function def on_backfill_request(self, origin, room_id, pdu_list, limit): in_room = yield self.auth.check_host_in_room(room_id, origin) if not in_room: raise AuthError(403, "Host not in room.") events = yield self.store.get_backfill_events(room_id, pdu_list, limit) events = yield filter_events_for_server(self.store, origin, events) return events @defer.inlineCallbacks @log_function def get_persisted_pdu(self, origin, event_id): event = yield self.store.get_event( event_id, allow_none=True, allow_rejected=True ) if event: in_room = yield self.auth.check_host_in_room(event.room_id, origin) if not in_room: raise AuthError(403, "Host not in room.") events = yield filter_events_for_server(self.store, origin, [event]) event = events[0] return event else: return None def get_min_depth_for_context(self, context): return self.store.get_min_depth(context) @defer.inlineCallbacks def _handle_new_event( self, origin, event, state=None, auth_events=None, backfilled=False ): context = yield self._prep_event( origin, event, state=state, auth_events=auth_events, backfilled=backfilled ) # reraise does not allow inlineCallbacks to preserve the stacktrace, so we # hack around with a try/finally instead. success = False try: if not event.internal_metadata.is_outlier() and not backfilled: yield self.action_generator.handle_push_actions_for_event( event, context ) yield self.persist_events_and_notify( [(event, context)], backfilled=backfilled ) success = True finally: if not success: run_in_background( self.store.remove_push_actions_from_staging, event.event_id ) return context @defer.inlineCallbacks def _handle_new_events(self, origin, event_infos, backfilled=False): @defer.inlineCallbacks def prep(ev_info): event = ev_info["event"] with nested_logging_context(suffix=event.event_id): res = yield self._prep_event( origin, event, state=ev_info.get("state"), auth_events=ev_info.get("auth_events"), backfilled=backfilled, ) return res contexts = yield make_deferred_yieldable( defer.gatherResults( [run_in_background(prep, ev_info) for ev_info in event_infos], consumeErrors=True, ) ) yield self.persist_events_and_notify( [ (ev_info["event"], context) for ev_info, context in zip(event_infos, contexts) ], backfilled=backfilled, ) @defer.inlineCallbacks def _persist_auth_tree(self, origin, auth_events, state, event): events_to_context = {} for e in itertools.chain(auth_events, state): e.internal_metadata.outlier = True ctx = yield self.state_handler.compute_event_context(e) events_to_context[e.event_id] = ctx event_map = { e.event_id: e for e in itertools.chain(auth_events, state, [event]) } create_event = None for e in auth_events: if (e.type, e.state_key) == (EventTypes.Create, ""): create_event = e break if create_event is None: # If the state doesn't have a create event then the room is raise SynapseError(400, "No create event in state") room_version = create_event.content.get( "room_version", RoomVersions.V1.identifier ) missing_auth_events = set() for e in itertools.chain(auth_events, state, [event]): for e_id in e.auth_event_ids(): if e_id not in event_map: missing_auth_events.add(e_id) for e_id in missing_auth_events: m_ev = yield self.federation_client.get_pdu( [origin], e_id, room_version=room_version, outlier=True, timeout=10000 ) if m_ev and m_ev.event_id == e_id: event_map[e_id] = m_ev else: logger.info("Failed to find auth event %r", e_id) for e in itertools.chain(auth_events, state, [event]): auth_for_e = { (event_map[e_id].type, event_map[e_id].state_key): event_map[e_id] for e_id in e.auth_event_ids() if e_id in event_map } if create_event: auth_for_e[(EventTypes.Create, "")] = create_event try: self.auth.check(room_version, e, auth_events=auth_for_e) except SynapseError as err: # the attempt to federate altogether in such cases. logger.warn("Rejecting %s because %s", e.event_id, err.msg) if e == event: raise events_to_context[e.event_id].rejected = RejectedReason.AUTH_ERROR yield self.persist_events_and_notify( [ (e, events_to_context[e.event_id]) for e in itertools.chain(auth_events, state) ] ) new_event_context = yield self.state_handler.compute_event_context( event, old_state=state ) yield self.persist_events_and_notify([(event, new_event_context)]) @defer.inlineCallbacks def _prep_event(self, origin, event, state, auth_events, backfilled): context = yield self.state_handler.compute_event_context(event, old_state=state) if not auth_events: prev_state_ids = yield context.get_prev_state_ids(self.store) auth_events_ids = yield self.auth.compute_auth_events( event, prev_state_ids, for_verification=True ) auth_events = yield self.store.get_events(auth_events_ids) auth_events = {(e.type, e.state_key): e for e in auth_events.values()} # This is a hack to fix some old rooms where the initial join event # didn't reference the create event in its auth events. if event.type == EventTypes.Member and not event.auth_event_ids(): if len(event.prev_event_ids()) == 1 and event.depth < 5: c = yield self.store.get_event( event.prev_event_ids()[0], allow_none=True ) if c and c.type == EventTypes.Create: auth_events[(c.type, c.state_key)] = c try: yield self.do_auth(origin, event, context, auth_events=auth_events) except AuthError as e: logger.warn("[%s %s] Rejecting: %s", event.room_id, event.event_id, e.msg) context.rejected = RejectedReason.AUTH_ERROR if not context.rejected: yield self._check_for_soft_fail(event, state, backfilled) if event.type == EventTypes.GuestAccess and not context.rejected: yield self.maybe_kick_guest_users(event) return context @defer.inlineCallbacks def _check_for_soft_fail(self, event, state, backfilled): # "soft-fail" the event. do_soft_fail_check = not backfilled and not event.internal_metadata.is_outlier() if do_soft_fail_check: extrem_ids = yield self.store.get_latest_event_ids_in_room(event.room_id) extrem_ids = set(extrem_ids) prev_event_ids = set(event.prev_event_ids()) if extrem_ids == prev_event_ids: # If they're the same then the current state is the same as the do_soft_fail_check = False if do_soft_fail_check: room_version = yield self.store.get_room_version(event.room_id) if state is not None: state_sets = yield self.store.get_state_groups( event.room_id, extrem_ids ) state_sets = list(state_sets.values()) state_sets.append(state) current_state_ids = yield self.state_handler.resolve_events( room_version, state_sets, event ) current_state_ids = { k: e.event_id for k, e in iteritems(current_state_ids) } else: current_state_ids = yield self.state_handler.get_current_state_ids( event.room_id, latest_event_ids=extrem_ids ) logger.debug( "Doing soft-fail check for %s: state %s", event.event_id, current_state_ids, ) auth_types = auth_types_for_event(event) current_state_ids = [ e for k, e in iteritems(current_state_ids) if k in auth_types ] current_auth_events = yield self.store.get_events(current_state_ids) current_auth_events = { (e.type, e.state_key): e for e in current_auth_events.values() } try: self.auth.check(room_version, event, auth_events=current_auth_events) except AuthError as e: logger.warn("Soft-failing %r because %s", event, e) event.internal_metadata.soft_failed = True @defer.inlineCallbacks def on_query_auth( self, origin, event_id, room_id, remote_auth_chain, rejects, missing ): in_room = yield self.auth.check_host_in_room(room_id, origin) if not in_room: raise AuthError(403, "Host not in room.") event = yield self.store.get_event( event_id, allow_none=False, check_room_id=room_id ) for e in remote_auth_chain: try: yield self._handle_new_event(origin, e) except AuthError: pass # Now get the current auth_chain for the event. local_auth_chain = yield self.store.get_auth_chain( [auth_id for auth_id in event.auth_event_ids()], include_given=True ) # TODO: Check if we would now reject event_id. If so we need to tell # everyone. ret = yield self.construct_auth_difference(local_auth_chain, remote_auth_chain) logger.debug("on_query_auth returning: %s", ret) return ret @defer.inlineCallbacks def on_get_missing_events( self, origin, room_id, earliest_events, latest_events, limit ): in_room = yield self.auth.check_host_in_room(room_id, origin) if not in_room: raise AuthError(403, "Host not in room.") limit = min(limit, 20) missing_events = yield self.store.get_missing_events( room_id=room_id, earliest_events=earliest_events, latest_events=latest_events, limit=limit, ) missing_events = yield filter_events_for_server( self.store, origin, missing_events ) return missing_events @defer.inlineCallbacks @log_function def do_auth(self, origin, event, context, auth_events): room_version = yield self.store.get_room_version(event.room_id) try: yield self._update_auth_events_and_context_for_auth( origin, event, context, auth_events ) except Exception: # We don't really mind if the above fails, so lets not fail # let's still log as an exception since we'll still want to fix # any bugs. logger.exception( "Failed to double check auth events for %s with remote. " "Ignoring failure and continuing processing of event.", event.event_id, ) try: self.auth.check(room_version, event, auth_events=auth_events) except AuthError as e: logger.warn("Failed auth resolution for %r because %s", event, e) raise e @defer.inlineCallbacks def _update_auth_events_and_context_for_auth( self, origin, event, context, auth_events ): event_auth_events = set(event.auth_event_ids()) if event.is_state(): event_key = (event.type, event.state_key) else: event_key = None # if the event's auth_events refers to events which are not in our missing_auth = event_auth_events.difference( e.event_id for e in auth_events.values() ) if missing_auth: have_events = yield self.store.get_seen_events_with_rejections(missing_auth) logger.debug("Got events %s from store", have_events) missing_auth.difference_update(have_events.keys()) else: have_events = {} have_events.update({e.event_id: "" for e in auth_events.values()}) if missing_auth: logger.info("auth_events contains unknown events: %s", missing_auth) try: try: remote_auth_chain = yield self.federation_client.get_event_auth( origin, event.room_id, event.event_id ) except RequestSendFailed as e: # The other side isn't around or doesn't implement the # endpoint, so lets just bail out. logger.info("Failed to get event auth from remote: %s", e) return seen_remotes = yield self.store.have_seen_events( [e.event_id for e in remote_auth_chain] ) for e in remote_auth_chain: if e.event_id in seen_remotes: continue if e.event_id == event.event_id: continue try: auth_ids = e.auth_event_ids() auth = { (e.type, e.state_key): e for e in remote_auth_chain if e.event_id in auth_ids or e.type == EventTypes.Create } e.internal_metadata.outlier = True logger.debug( "do_auth %s missing_auth: %s", event.event_id, e.event_id ) yield self._handle_new_event(origin, e, auth_events=auth) if e.event_id in event_auth_events: auth_events[(e.type, e.state_key)] = e except AuthError: pass have_events = yield self.store.get_seen_events_with_rejections( event.auth_event_ids() ) except Exception: # FIXME: logger.exception("Failed to get auth chain") if event.internal_metadata.is_outlier(): logger.info("Skipping auth_event fetch for outlier") return # FIXME: Assumes we have and stored all the state for all the # prev_events different_auth = event_auth_events.difference( e.event_id for e in auth_events.values() ) if not different_auth: return logger.info( "auth_events refers to events which are not in our calculated auth " "chain: %s", different_auth, ) room_version = yield self.store.get_room_version(event.room_id) different_events = yield make_deferred_yieldable( defer.gatherResults( [ run_in_background( self.store.get_event, d, allow_none=True, allow_rejected=False ) for d in different_auth if d in have_events and not have_events[d] ], consumeErrors=True, ) ).addErrback(unwrapFirstError) if different_events: local_view = dict(auth_events) remote_view = dict(auth_events) remote_view.update( {(d.type, d.state_key): d for d in different_events if d} ) new_state = yield self.state_handler.resolve_events( room_version, [list(local_view.values()), list(remote_view.values())], event, ) logger.info( "After state res: updating auth_events with new state %s", { (d.type, d.state_key): d.event_id for d in new_state.values() if auth_events.get((d.type, d.state_key)) != d }, ) auth_events.update(new_state) different_auth = event_auth_events.difference( e.event_id for e in auth_events.values() ) yield self._update_context_for_auth_events( event, context, auth_events, event_key ) if not different_auth: # we're done return logger.info( "auth_events still refers to events which are not in the calculated auth " "chain after state resolution: %s", different_auth, ) do_resolution = False for e_id in different_auth: if e_id in have_events: if have_events[e_id] == RejectedReason.NOT_ANCESTOR: do_resolution = True break if not do_resolution: logger.info( "Skipping auth resolution due to lack of provable rejection reasons" ) return logger.info("Doing auth resolution") prev_state_ids = yield context.get_prev_state_ids(self.store) # 1. Get what we think is the auth chain. auth_ids = yield self.auth.compute_auth_events(event, prev_state_ids) local_auth_chain = yield self.store.get_auth_chain(auth_ids, include_given=True) try: # 2. Get remote difference. try: result = yield self.federation_client.query_auth( origin, event.room_id, event.event_id, local_auth_chain ) except RequestSendFailed as e: # The other side isn't around or doesn't implement the # endpoint, so lets just bail out. logger.info("Failed to query auth from remote: %s", e) return seen_remotes = yield self.store.have_seen_events( [e.event_id for e in result["auth_chain"]] ) # 3. Process any remote auth chain events we haven't seen. for ev in result["auth_chain"]: if ev.event_id in seen_remotes: continue if ev.event_id == event.event_id: continue try: auth_ids = ev.auth_event_ids() auth = { (e.type, e.state_key): e for e in result["auth_chain"] if e.event_id in auth_ids or event.type == EventTypes.Create } ev.internal_metadata.outlier = True logger.debug( "do_auth %s different_auth: %s", event.event_id, e.event_id ) yield self._handle_new_event(origin, ev, auth_events=auth) if ev.event_id in event_auth_events: auth_events[(ev.type, ev.state_key)] = ev except AuthError: pass except Exception: logger.exception("Failed to query auth chain") yield self._update_context_for_auth_events( event, context, auth_events, event_key ) @defer.inlineCallbacks def _update_context_for_auth_events(self, event, context, auth_events, event_key): state_updates = { k: a.event_id for k, a in iteritems(auth_events) if k != event_key } current_state_ids = yield context.get_current_state_ids(self.store) current_state_ids = dict(current_state_ids) current_state_ids.update(state_updates) prev_state_ids = yield context.get_prev_state_ids(self.store) prev_state_ids = dict(prev_state_ids) prev_state_ids.update({k: a.event_id for k, a in iteritems(auth_events)}) prev_group = context.state_group state_group = yield self.store.store_state_group( event.event_id, event.room_id, prev_group=prev_group, delta_ids=state_updates, current_state_ids=current_state_ids, ) yield context.update_state( state_group=state_group, current_state_ids=current_state_ids, prev_state_ids=prev_state_ids, prev_group=prev_group, delta_ids=state_updates, ) @defer.inlineCallbacks def construct_auth_difference(self, local_auth, remote_auth): logger.debug("construct_auth_difference Start!") def sort_fun(ev): return ev.depth, ev.event_id logger.debug("construct_auth_difference after sort_fun!") # missing that event, and iterate only up that list. Repeat. remote_list = list(remote_auth) remote_list.sort(key=sort_fun) local_list = list(local_auth) local_list.sort(key=sort_fun) local_iter = iter(local_list) remote_iter = iter(remote_list) logger.debug("construct_auth_difference before get_next!") def get_next(it, opt=None): try: return next(it) except Exception: return opt current_local = get_next(local_iter) current_remote = get_next(remote_iter) logger.debug("construct_auth_difference before while") missing_remotes = [] missing_locals = [] while current_local or current_remote: if current_remote is None: missing_locals.append(current_local) current_local = get_next(local_iter) continue if current_local is None: missing_remotes.append(current_remote) current_remote = get_next(remote_iter) continue if current_local.event_id == current_remote.event_id: current_local = get_next(local_iter) current_remote = get_next(remote_iter) continue if current_local.depth < current_remote.depth: missing_locals.append(current_local) current_local = get_next(local_iter) continue if current_local.depth > current_remote.depth: missing_remotes.append(current_remote) current_remote = get_next(remote_iter) continue # They have the same depth, so we fall back to the event_id order if current_local.event_id < current_remote.event_id: missing_locals.append(current_local) current_local = get_next(local_iter) if current_local.event_id > current_remote.event_id: missing_remotes.append(current_remote) current_remote = get_next(remote_iter) continue logger.debug("construct_auth_difference after while") # missing locals should be sent to the server # We should find why we are missing remotes, as they will have been # rejected. # Remove events from missing_remotes if they are referencing a missing # remote. We only care about the "root" rejected ones. missing_remote_ids = [e.event_id for e in missing_remotes] base_remote_rejected = list(missing_remotes) for e in missing_remotes: for e_id in e.auth_event_ids(): if e_id in missing_remote_ids: try: base_remote_rejected.remove(e) except ValueError: pass reason_map = {} for e in base_remote_rejected: reason = yield self.store.get_rejection_reason(e.event_id) if reason is None: # TODO: e is not in the current state, so we should # construct some proof of that. continue reason_map[e.event_id] = reason if reason == RejectedReason.AUTH_ERROR: pass elif reason == RejectedReason.REPLACED: # TODO: Get proof pass elif reason == RejectedReason.NOT_ANCESTOR: # TODO: Get proof. pass logger.debug("construct_auth_difference returning") return { "auth_chain": local_auth, "rejects": { e.event_id: {"reason": reason_map[e.event_id], "proof": None} for e in base_remote_rejected }, "missing": [e.event_id for e in missing_locals], } @defer.inlineCallbacks @log_function def exchange_third_party_invite( self, sender_user_id, target_user_id, room_id, signed ): third_party_invite = {"signed": signed} event_dict = { "type": EventTypes.Member, "content": { "membership": Membership.INVITE, "third_party_invite": third_party_invite, }, "room_id": room_id, "sender": sender_user_id, "state_key": target_user_id, } if (yield self.auth.check_host_in_room(room_id, self.hs.hostname)): room_version = yield self.store.get_room_version(room_id) builder = self.event_builder_factory.new(room_version, event_dict) EventValidator().validate_builder(builder) event, context = yield self.event_creation_handler.create_new_client_event( builder=builder ) event_allowed = yield self.third_party_event_rules.check_event_allowed( event, context ) if not event_allowed: logger.info( "Creation of threepid invite %s forbidden by third-party rules", event, ) raise SynapseError( 403, "This event is not allowed in this context", Codes.FORBIDDEN ) event, context = yield self.add_display_name_to_third_party_invite( room_version, event_dict, event, context ) EventValidator().validate_new(event) # We need to tell the transaction queue to send this out, even # though the sender isn't a local user. event.internal_metadata.send_on_behalf_of = self.hs.hostname try: yield self.auth.check_from_context(room_version, event, context) except AuthError as e: logger.warn("Denying new third party invite %r because %s", event, e) raise e yield self._check_signature(event, context) member_handler = self.hs.get_room_member_handler() yield member_handler.send_membership_event(None, event, context) else: destinations = set(x.split(":", 1)[-1] for x in (sender_user_id, room_id)) yield self.federation_client.forward_third_party_invite( destinations, room_id, event_dict ) @defer.inlineCallbacks @log_function def on_exchange_third_party_invite_request(self, room_id, event_dict): room_version = yield self.store.get_room_version(room_id) builder = self.event_builder_factory.new(room_version, event_dict) event, context = yield self.event_creation_handler.create_new_client_event( builder=builder ) event_allowed = yield self.third_party_event_rules.check_event_allowed( event, context ) if not event_allowed: logger.warning( "Exchange of threepid invite %s forbidden by third-party rules", event ) raise SynapseError( 403, "This event is not allowed in this context", Codes.FORBIDDEN ) event, context = yield self.add_display_name_to_third_party_invite( room_version, event_dict, event, context ) try: self.auth.check_from_context(room_version, event, context) except AuthError as e: logger.warn("Denying third party invite %r because %s", event, e) raise e yield self._check_signature(event, context) event.internal_metadata.send_on_behalf_of = get_domain_from_id(event.sender) member_handler = self.hs.get_room_member_handler() yield member_handler.send_membership_event(None, event, context) @defer.inlineCallbacks def add_display_name_to_third_party_invite( self, room_version, event_dict, event, context ): key = ( EventTypes.ThirdPartyInvite, event.content["third_party_invite"]["signed"]["token"], ) original_invite = None prev_state_ids = yield context.get_prev_state_ids(self.store) original_invite_id = prev_state_ids.get(key) if original_invite_id: original_invite = yield self.store.get_event( original_invite_id, allow_none=True ) if original_invite: display_name = original_invite.content["display_name"] event_dict["content"]["third_party_invite"]["display_name"] = display_name else: logger.info( "Could not find invite event for third_party_invite: %r", event_dict ) # We don't discard here as this is not the appropriate place to do # auth check code will explode appropriately. builder = self.event_builder_factory.new(room_version, event_dict) EventValidator().validate_builder(builder) event, context = yield self.event_creation_handler.create_new_client_event( builder=builder ) EventValidator().validate_new(event) return (event, context) @defer.inlineCallbacks def _check_signature(self, event, context): signed = event.content["third_party_invite"]["signed"] token = signed["token"] prev_state_ids = yield context.get_prev_state_ids(self.store) invite_event_id = prev_state_ids.get((EventTypes.ThirdPartyInvite, token)) invite_event = None if invite_event_id: invite_event = yield self.store.get_event(invite_event_id, allow_none=True) if not invite_event: raise AuthError(403, "Could not find invite") logger.debug("Checking auth on event %r", event.content) last_exception = None # for each public key in the 3pid invite event for public_key_object in self.hs.get_auth().get_public_keys(invite_event): try: # for each sig on the third_party_invite block of the actual invite for server, signature_block in signed["signatures"].items(): for key_name, encoded_signature in signature_block.items(): if not key_name.startswith("ed25519:"): continue logger.debug( "Attempting to verify sig with key %s from %r " "against pubkey %r", key_name, server, public_key_object, ) try: public_key = public_key_object["public_key"] verify_key = decode_verify_key_bytes( key_name, decode_base64(public_key) ) verify_signed_json(signed, server, verify_key) logger.debug( "Successfully verified sig with key %s from %r " "against pubkey %r", key_name, server, public_key_object, ) except Exception: logger.info( "Failed to verify sig with key %s from %r " "against pubkey %r", key_name, server, public_key_object, ) raise try: if "key_validity_url" in public_key_object: yield self._check_key_revocation( public_key, public_key_object["key_validity_url"] ) except Exception: logger.info( "Failed to query key_validity_url %s", public_key_object["key_validity_url"], ) raise return except Exception as e: last_exception = e raise last_exception @defer.inlineCallbacks def _check_key_revocation(self, public_key, url): try: response = yield self.http_client.get_json(url, {"public_key": public_key}) except Exception: raise SynapseError(502, "Third party certificate could not be checked") if "valid" not in response or not response["valid"]: raise AuthError(403, "Third party certificate was invalid") @defer.inlineCallbacks def persist_events_and_notify(self, event_and_contexts, backfilled=False): if self.config.worker_app: yield self._send_events_to_master( store=self.store, event_and_contexts=event_and_contexts, backfilled=backfilled, ) else: max_stream_id = yield self.store.persist_events( event_and_contexts, backfilled=backfilled ) if not backfilled: # Never notify for backfilled events for event, _ in event_and_contexts: yield self._notify_persisted_event(event, max_stream_id) def _notify_persisted_event(self, event, max_stream_id): extra_users = [] if event.type == EventTypes.Member: target_user_id = event.state_key # We notify for memberships if its an invite for one of our # users if event.internal_metadata.is_outlier(): if event.membership != Membership.INVITE: if not self.is_mine_id(target_user_id): return target_user = UserID.from_string(target_user_id) extra_users.append(target_user) elif event.internal_metadata.is_outlier(): return event_stream_id = event.internal_metadata.stream_ordering self.notifier.on_new_room_event( event, event_stream_id, max_stream_id, extra_users=extra_users ) return self.pusher_pool.on_new_notifications(event_stream_id, max_stream_id) def _clean_room_for_join(self, room_id): if self.config.worker_app: return self._clean_room_for_join_client(room_id) else: return self.store.clean_room_for_join(room_id) def user_joined_room(self, user, room_id): if self.config.worker_app: return self._notify_user_membership_change( room_id=room_id, user_id=user.to_string(), change="joined" ) else: return user_joined_room(self.distributor, user, room_id) @defer.inlineCallbacks def get_room_complexity(self, remote_room_hosts, room_id): for host in remote_room_hosts: res = yield self.federation_client.get_room_complexity(host, room_id) # We got a result, return it. if res: defer.returnValue(res) # We fell off the bottom, couldn't get the complexity from anyone. Oh defer.returnValue(None)
true
true
f72b820782f5de6dce810345423aa0c625f54b34
53,798
py
Python
mysql-utilities-1.6.0/mysql/utilities/common/rpl_sync.py
bopopescu/mysql-dbcompare
1e912fd87282be3b3bed48487e6beb0ecb1de339
[ "Apache-2.0" ]
2
2018-03-20T07:42:58.000Z
2018-03-20T07:43:49.000Z
mysql-utilities-1.6.0/mysql/utilities/common/rpl_sync.py
bopopescu/mysql-dbcompare
1e912fd87282be3b3bed48487e6beb0ecb1de339
[ "Apache-2.0" ]
null
null
null
mysql-utilities-1.6.0/mysql/utilities/common/rpl_sync.py
bopopescu/mysql-dbcompare
1e912fd87282be3b3bed48487e6beb0ecb1de339
[ "Apache-2.0" ]
1
2020-07-23T23:07:08.000Z
2020-07-23T23:07:08.000Z
# # Copyright (c) 2014, Oracle and/or its affiliates. All rights reserved. # # This program is free software; you can redistribute it and/or modify # it under the terms of the GNU General Public License as published by # the Free Software Foundation; version 2 of the License. # # This program is distributed in the hope that it will be useful, # but WITHOUT ANY WARRANTY; without even the implied warranty of # MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the # GNU General Public License for more details. # # You should have received a copy of the GNU General Public License # along with this program; if not, write to the Free Software # Foundation, Inc., 51 Franklin St, Fifth Floor, Boston, MA 02110-1301 USA # """ This file contains features to check the data consistency in a replication topology (i.e., between the master and its slaves, or only slaves), providing synchronization features to perform the check over the (supposed) same data of a system with replication active (running). """ import re import sys from multiprocessing.pool import ThreadPool from mysql.utilities.command.dbcompare import diff_objects, get_common_objects from mysql.utilities.common.database import Database from mysql.utilities.common.messages import ERROR_USER_WITHOUT_PRIVILEGES from mysql.utilities.common.pattern_matching import convertSQL_LIKE2REGEXP from mysql.utilities.common.replication import (get_last_server_gtid, gtid_set_cardinality, gtid_set_union) from mysql.utilities.common.sql_transform import quote_with_backticks from mysql.utilities.common.topology import Topology from mysql.utilities.common.user import User from mysql.utilities.exception import UtilError # Regular expression to handle the server version format. _RE_VERSION_FORMAT = r'^(\d+\.\d+(\.\d+)*).*$' class RPLSynchronizer(object): """Class to manage the features of the replication synchronization checker. The RPLSynchronizer class is used to manage synchronization check between servers of a replication topology, namely between the master and its slaves or only between slaves. It provides functions to determine the slaves missing transactions (i.e., missing GTIDs) and check data consistency. """ def __init__(self, master_cnx_dic, slaves_cnx_dic_lst, options): """Constructor. options[in] dictionary of options (e.g., discover, timeouts, verbosity). """ self._verbosity = options.get('verbosity') self._rpl_timeout = options.get('rpl_timeout') self._checksum_timeout = options.get('checksum_timeout') self._interval = options.get('interval') self._rpl_topology = Topology(master_cnx_dic, slaves_cnx_dic_lst, options) self._slaves = self._rpl_topology.get_slaves_dict() # Set base server used as reference for comparisons. self._base_server = None self._base_server_key = None self._set_base_server() # Check user permissions to perform the consistency check. self._check_privileges() # Check usage of replication filters. self._master_rpl_filters = {} self._slaves_rpl_filters = {} self._check_rpl_filters() def _set_base_server(self): """Set the base server used for comparison in the internal state. Set the master if used or the first slave from the topology as the base server. The base server is the one used as a reference for comparison with the others. This method sets two instance variables: _base_server with the Server instance, and _base_server_key with the string identifying the server (format: 'host@port'). Note: base server might need to be changed (set again) if it is removed from the topology for some reason (e.g. GTID disabled). """ master = self._get_master() self._base_server = master if master \ else self._rpl_topology.slaves[0]['instance'] self._base_server_key = "{0}@{1}".format(self._base_server.host, self._base_server.port) def _get_slave(self, slave_key): """Get the slave server instance for the specified key 'host@port'. This function retrieves the Server instance of for a slave from the internal state by specifying the key that uniquely identifies it, i.e. 'host@port'. slave_key[in] String with the format 'host@port' that uniquely identifies a server. Returns a Server instance of the slave with the specified key value (i.e., 'host@port'). """ slave_dict = self._slaves[slave_key] return slave_dict['instance'] def _get_master(self): """Get the master server instance. This function retrieves the Server instance of the master (in the replication topology). Returns a Server instance of the master. """ return self._rpl_topology.master def _check_privileges(self): """Check required privileges to perform the synchronization check. This method check if the used users for the master and slaves possess the required privileges to perform the synchronization check. More specifically, the following privileges are required: - on the master: SUPER or REPLICATION CLIENT, LOCK TABLES and SELECT; - on slaves: SUPER and SELECT. An exception is thrown if users doesn't have enough privileges. """ if self._verbosity: print("# Checking users permission to perform consistency check.\n" "#") # Check privileges for master. master_priv = [('SUPER', 'REPLICATION CLIENT'), ('LOCK TABLES',), ('SELECT',)] master_priv_str = "SUPER or REPLICATION CLIENT, LOCK TABLES and SELECT" if self._get_master(): server = self._get_master() user_obj = User(server, "{0}@{1}".format(server.user, server.host)) for any_priv_tuple in master_priv: has_privilege = any( [user_obj.has_privilege('*', '*', priv) for priv in any_priv_tuple] ) if not has_privilege: raise UtilError(ERROR_USER_WITHOUT_PRIVILEGES.format( user=server.user, host=server.host, port=server.port, operation='perform the synchronization check', req_privileges=master_priv_str )) # Check privileges for slaves. slave_priv = [('SUPER',), ('SELECT',)] slave_priv_str = "SUPER and SELECT" for slave_key in self._slaves: server = self._get_slave(slave_key) user_obj = User(server, "{0}@{1}".format(server.user, server.host)) for any_priv_tuple in slave_priv: has_privilege = any( [user_obj.has_privilege('*', '*', priv) for priv in any_priv_tuple] ) if not has_privilege: raise UtilError( "User '{0}' on '{1}@{2}' does not have sufficient " "privileges to perform the synchronization check " "(required: {3}).".format(server.user, server.host, server.port, slave_priv_str) ) def _check_rpl_filters(self): """Check usage of replication filters. Check the usage of replication filtering option on the master (if defined) and slaves, and set the internal state with the found options (to check later). """ # Get binlog filtering option for the master. if self._get_master(): m_filters = self._get_master().get_binlog_exceptions() if m_filters: # Set filtering option for master. self._master_rpl_filters['binlog_do_db'] = \ m_filters[0][1].split(',') if m_filters[0][1] else None self._master_rpl_filters['binlog_ignore_db'] = \ m_filters[0][2].split(',') if m_filters[0][2] else None # Get replication filtering options for each slave. for slave_key in self._slaves: slave = self._get_slave(slave_key) s_filters = slave.get_slave_rpl_filters() if s_filters: # Handle known server issues with some replication filters, # leading to inconsistent GTID sets. Sync not supported for # server with those issues. issues = [(0, 'replicate_do_db'), (1, 'replicate_ignore_db'), (4, 'replicate_wild_do_table')] for index, rpl_opt in issues: if s_filters[index]: raise UtilError( "Use of {0} option is not supported. There is a " "known issue with the use this replication filter " "and GTID for some server versions. Issue " "detected for '{1}'.".format(rpl_opt, slave_key)) # Set map (dictionary) with the slave filtering options. filters_map = { 'replicate_do_db': s_filters[0].split(',') if s_filters[0] else None, 'replicate_ignore_db': s_filters[1].split(',') if s_filters[1] else None, 'replicate_do_table': s_filters[2].split(',') if s_filters[2] else None, 'replicate_ignore_table': s_filters[3].split(',') if s_filters[3] else None, } # Handle wild-*-table filters differently to create # corresponding regexp. if s_filters[4]: wild_list = s_filters[4].split(',') filters_map['replicate_wild_do_table'] = wild_list # Create auxiliary list with compiled regexp to match. regexp_list = [] for wild in wild_list: regexp = re.compile(convertSQL_LIKE2REGEXP(wild)) regexp_list.append(regexp) filters_map['regexp_do_table'] = regexp_list else: filters_map['replicate_wild_do_table'] = None filters_map['regexp_do_table'] = None if s_filters[5]: wild_list = s_filters[5].split(',') filters_map['replicate_wild_ignore_table'] = wild_list # Create auxiliary list with compiled regexp to match. regexp_list = [] for wild in wild_list: regexp = re.compile(convertSQL_LIKE2REGEXP(wild)) regexp_list.append(regexp) filters_map['regexp_ignore_table'] = regexp_list else: filters_map['replicate_wild_ignore_table'] = None filters_map['regexp_ignore_table'] = None # Set filtering options for the slave. self._slaves_rpl_filters[slave_key] = filters_map # Print warning if filters are found. if self._master_rpl_filters or self._slaves_rpl_filters: print("# WARNING: Replication filters found on checked " "servers. This can lead data consistency issues " "depending on how statements are evaluated.\n" "# More information: " "http://dev.mysql.com/doc/en/replication-rules.html") if self._verbosity: # Print filter options in verbose mode. if self._master_rpl_filters: print("# Master '{0}@{1}':".format( self._get_master().host, self._get_master().port )) for rpl_filter in self._master_rpl_filters: if self._master_rpl_filters[rpl_filter]: print("# - {0}: {1}".format( rpl_filter, ', '.join( self._master_rpl_filters[rpl_filter] ) )) if self._slaves_rpl_filters: for slave_key in self._slaves_rpl_filters: print("# Slave '{0}':".format(slave_key)) filters_map = self._slaves_rpl_filters[slave_key] for rpl_filter in filters_map: if (rpl_filter.startswith('replicate') and filters_map[rpl_filter]): print("# - {0}: {1}".format( rpl_filter, ', '.join(filters_map[rpl_filter]) )) def _is_rpl_filtered(self, db_name, tbl_name=None, slave=None): """ Check if the given object is to be filtered by replication. This method checks if the given database or table name is supposed to be filtered by replication (i.e., not replicated), according to the defined replication filters for the master or the specified slave. db_name[in] Name of the database to check (not backtick quoted) or associated to the table to check.. tbl_name[in] Name of the table to check (not backtick quoted). Table level filtering rules are only checked if this value is not None. By default None, meaning that only the database level rules are checked. slave[in] Identification of the slave in the format 'host@port' to check, determining which filtering rules will be checked. If None only the master filtering rules are checked, otherwise the rule of the specified slaves are used. By default: None. Returns a boolean value indicating if the given database or table is supposed to be filtered by the replication or not. More precisely, if True then updates associated to the object are (supposedly) not replicated, otherwise they are replicated. """ def match_regexp(name, regex_list): """ Check if 'name' matches one of the regex in the given list. """ for regex in regex_list: if regex.match(name): return True return False # Determine object to check and set full qualified name. is_db = tbl_name is None obj_name = db_name if is_db else '{0}.{1}'.format(db_name, tbl_name) # Match replication filter for Master. if not slave and is_db and self._master_rpl_filters: if self._master_rpl_filters['binlog_do_db']: if obj_name in self._master_rpl_filters['binlog_do_db']: return False else: return True elif self._master_rpl_filters['binlog_ignore_db']: if obj_name in self._master_rpl_filters['binlog_ignore_db']: return True # Match replication filters for the specified slave. if slave and slave in self._slaves_rpl_filters: rpl_filter = self._slaves_rpl_filters[slave] if is_db: if rpl_filter['replicate_do_db']: if obj_name in rpl_filter['replicate_do_db']: return False else: return True elif (rpl_filter['replicate_ignore_db'] and obj_name in rpl_filter['replicate_ignore_db']): return True else: if (rpl_filter['replicate_do_table'] and obj_name in rpl_filter['replicate_do_table']): return False if (rpl_filter['replicate_ignore_table'] and obj_name in rpl_filter['replicate_ignore_table']): return True if (rpl_filter['replicate_wild_do_table'] and match_regexp(obj_name, rpl_filter['regexp_do_table'])): return False if (rpl_filter['replicate_wild_ignore_table'] and match_regexp(obj_name, rpl_filter['regexp_ignore_table'])): return True if (rpl_filter['replicate_do_table'] or rpl_filter['replicate_wild_do_table']): return True # Do not filter replication for object (if no filter rule matched). return False def _apply_for_all_slaves(self, slaves, function, args=(), kwargs=None, multithreading=False): """Apply specified function to all given slaves. This function allow the execution (concurrently or not) of the specified function with the given arguments on all the specified slaves. slaves[in] List of slaves to apply the function. It is assumed that the list is composed by strings with the format 'host@port', identifying each slave. function[in] Name of the function (string) to apply on all slaves. args[in] Tuple with all the function arguments (except keyword arguments). kwargs[in] Dictionary with all the function keyword arguments. multithreading[in] Boolean value indicating if the function will be applied concurrently on all slaves. By default False, no concurrency. Return a list of tuples composed by two elements: a string identifying the slave ('host@port') and the result of the execution of the target function for the corresponding slave. """ if kwargs is None: kwargs = {} if multithreading: # Create a pool of threads to execute the method for each slave. pool = ThreadPool(processes=len(slaves)) thread_res_lst = [] for slave_key in slaves: slave = self._get_slave(slave_key) thread_res = pool.apply_async(getattr(slave, function), args, kwargs) thread_res_lst.append((slave_key, thread_res)) pool.close() # Wait for all threads to finish here to avoid RuntimeErrors when # waiting for the result of a thread that is already dead. pool.join() # Get the result from each slave and return the results. res = [] for slave_key, thread_res in thread_res_lst: res.append((slave_key, thread_res.get())) return res else: res = [] for slave_key in slaves: slave = self._get_slave(slave_key) slave_res = getattr(slave, function)(*args, **kwargs) res.append((slave_key, slave_res)) return res def check_server_versions(self): """Check server versions. Check all server versions and report version differences. """ srv_versions = {} # Get the server version of the master if used. master = self._get_master() if master: master_version = master.get_version() match = re.match(_RE_VERSION_FORMAT, master_version.strip()) if match: # Add .0 as release version if not provided. if not match.group(2): master_version = "{0}.0".format(match.group(1)) else: master_version = match.group(1) master_id = '{0}@{1}'.format(master.host, master.port) # Store the master version. srv_versions[master_version] = [master_id] # Get the server version for all slaves. for slave_key in self._slaves: slave = self._get_slave(slave_key) version = slave.get_version() match = re.match(_RE_VERSION_FORMAT, version.strip()) if match: # Add .0 as release version if not provided. if not match.group(2): version = "{0}.0".format(match.group(1)) else: version = match.group(1) # Store the slave version. if version in srv_versions: srv_versions[version].append(slave_key) else: srv_versions[version] = [slave_key] # Check the servers versions and issue a warning if different. if len(srv_versions) > 1: print("# WARNING: Servers using different versions:") for version in srv_versions: servers_str = ",".join(srv_versions[version]) print("# - {0} for {1}.".format(version, servers_str)) print("#") def check_gtid_sync(self): """Check GTIDs synchronization. Perform several GTID checks (enabled and errant transactions). If the master is available (was specified) then it also checks if GTIDs are in sync between master and its slaves and report the amount of transaction (i.e., GTIDs) behind the master for each slave. GTID differences might be an indicator of the existence of data consistency issues. Note: The master may not be specified, its use is not mandatory. """ # Check if GTIDs are enabled on the topology. if self._get_master(): # Use of Master is not mandatory. # GTIDs must be enabled on the master. if self._get_master().supports_gtid().upper() != 'ON': raise UtilError( "Master must support GTIDs and have GTID_MODE=ON." ) # Skip slaves without GTID enabled and warn user. reset_base_srv = False for slave_key, slave_dict in self._slaves.items(): slave = slave_dict['instance'] support_gtid = slave.supports_gtid().upper() if support_gtid != 'ON': reason = "GTID_MODE=OFF" if support_gtid == 'OFF' \ else "not support GTIDs" print("# WARNING: Slave '{0}' will be skipped - " "{1}.".format(slave_key, reason)) print("#") del self._slaves[slave_key] self._rpl_topology.remove_slave(slave_dict) if slave_key == self._base_server_key: reset_base_srv = True # At least on slave must have GTIDs enabled. if len(self._slaves) == 0: raise UtilError("No slaves found with GTID support and " "GTID_MODE=ON.") # Reset base server if needed (it must have GTID_MODE=ON). if reset_base_srv: self._set_base_server() # Check the set of executed GTIDs and report differences, only if the # master is specified. if self._get_master(): master_gtids = self._get_master().get_gtid_executed() slaves_gtids_data = \ self._rpl_topology.slaves_gtid_subtract_executed( master_gtids, multithreading=True ) print("#\n# GTID differences between Master and Slaves:") for host, port, gtids_missing in slaves_gtids_data: slave_key = '{0}@{1}'.format(host, port) gtid_size = gtid_set_cardinality(gtids_missing) if gtid_size: plural = 's' if gtid_size > 1 else '' print("# - Slave '{0}' is {1} transaction{2} behind " "Master.".format(slave_key, gtid_size, plural)) if self._verbosity: print("# Missing GTIDs: " "{0}".format(gtids_missing)) else: print("# - Slave '{0}' is up-to-date.".format(slave_key)) print("#") @staticmethod def _exist_in_obj_list(obj_name, obj_type, obj_list): """Check if object (name and type) exists in the given list. This function checks if the database object for the specified name and type exists in the specified list of database objects. obj_name[in] Name of the object to check. obj_type[in] Type of the object to check. obj_list[in] List of objects to check. It is assumed that the list has the format of the ones returned by the function mysql.utilities.command.dbcompare.get_common_objects(). More precisely with the format: [(obj_type1, (obj_name1,))..(obj_typeN, (obj_nameN,))] Returns a boolean value indicating if object with the specified name and type exists in the specified list of objects. """ for obj_row in obj_list: if obj_row[0] == obj_type and obj_row[1][0] == obj_name: return True return False def _split_active_slaves(self, slaves): """Get the list of slaves with replication running and not. This method separates the list of given slaves into active (with the IO and SQL thread running) and non active slaves (with one of the threads stopped). slaves[in] List of target slaves to separate. Returns a tuple with two elements, first with the list of active slaves and the second with the list of not active ones. """ # Get slaves status. slaves_state = self._apply_for_all_slaves(slaves, 'get_slaves_errors', multithreading=True) # Store IO and SQL thread status. active_slaves = [] not_active_slaves = [] for slave_key, state in slaves_state: # Locally store IO and SQL threads status. io_running = state[3].upper() == 'YES' self._slaves[slave_key]['IO_Running'] = io_running sql_running = state[4].upper() == 'YES' self._slaves[slave_key]['SQL_Running'] = sql_running if io_running and sql_running: active_slaves.append(slave_key) else: not_active_slaves.append(slave_key) print("# WARNING: Slave not active '{0}' - " "Sync skipped.".format(slave_key)) if self._verbosity: # Print warning if slave is stopped due to an error. if not io_running and state[2]: print("# - IO thread stopped: ERROR {0} - " "{1}".format(state[1], state[2])) if not sql_running and state[6]: print("# - SQL thread stopped: ERROR {0} - " "{1}".format(state[5], state[6])) # Return separated list of active and non active replication slaves. return active_slaves, not_active_slaves def _compute_sync_point(self, active_slaves=None): """Compute the GTID synchronization point. This method computes the GTID synchronization point based based on the GTID_EXECUTED set. If a master is available for synchronization the last GTID from the GTID_EXECUTED set is used as sync point If no master is available the union of the GTID_EXECUTED sets among all active slaves is used as the sync point. active_slaves[in] List of active slaves to consider. Only required if the master is not available. It is assumed that the list is composed by strings with the format 'host@port', identifying each slave. Return a GTID set representing to synchronization point (to wait for slaves to catch up and stop). """ if self._get_master(): gtid_set = self._get_master().get_gtid_executed() master_uuid = self._get_master().get_server_uuid() return get_last_server_gtid(gtid_set, master_uuid) else: # Get GTID_EXECUTED on all slaves. all_gtid_executed = self._apply_for_all_slaves( active_slaves, 'get_gtid_executed', multithreading=True ) # Compute the union of all GTID sets for each UUID among slaves. gtid_sets_by_uuid = {} for _, gtid_executed in all_gtid_executed: gtids_list = gtid_executed.split("\n") for gtid in gtids_list: gtid_set = gtid.rstrip(', ') uuid = gtid_set.split(':')[0] if uuid not in gtid_sets_by_uuid: gtid_sets_by_uuid[uuid] = gtid_set else: union_set = gtid_set_union(gtid_sets_by_uuid[uuid], gtid_set) gtid_sets_by_uuid[uuid] = union_set # Return union of all know executed GTID. return ",".join(gtid_sets_by_uuid.itervalues()) def _sync_slaves(self, slaves, gtid): """Set synchronization point (specified GTID set) for the given slaves. The method set the synchronization point for the given slaves by (concurrently) stopping and immediately executing START SLAVE UNTIL on all given slaves in order to stop upon reaching the given GTID set (i.e., committing all corresponding transactions for the given GTID sync point). slaves[in] List of target slaves to synchronize (i.e., instruct to stop upon reaching the synchronization point). gtid[in] GTID set used as the synchronization point. """ # Make running slaves stop until sync point (GTID) is reached. if self._verbosity: print("# Setting data synchronization point for slaves.") # STOP slave (only SQL thread). self._apply_for_all_slaves(slaves, 'stop_sql_thread', multithreading=True) # START slave UNTIL sync point is reached. # Note: Only the SQL thread is stopped when the condition is reached. until_ops = {'until_gtid_set': gtid, 'sql_after_gtid': True, 'only_sql_thread': True} self._apply_for_all_slaves(slaves, 'start', (), until_ops, multithreading=True) def _checksum_and_resume_rpl(self, not_sync_slaves, sync_slave, table): """Checksum table and resume replication on slaves. This method computes (concurrently) the table checksum of the given slaves lists (those synced and not synced). For the list of not synced slaves the table checksum is immediately computed. For the list of synced slaves, first it waits for them to catch up and the sync point and only then compute the table checksum and resume replication. not_sync_slaves[in] List of not synced slaves. sync_slave[in] List of (previously) synced slaves. table[in] Target table to compute the checksum. Returns a list of tuples, each tuple containing the identification of the server and the corresponding checksum result. """ if self._verbosity: print("# Compute checksum on slaves (wait to catch up and resume" " replication).") sys.stdout.flush() not_sync_checksum = [] if not_sync_slaves: not_sync_checksum = self._apply_for_all_slaves( not_sync_slaves, 'checksum_table', (table,), {'exec_timeout': self._checksum_timeout}, multithreading=True ) sync_checksum = [] if sync_slave: sync_checksum = self._apply_for_all_slaves( sync_slave, 'wait_checksum_and_start', (table,), {'wait_timeout': self._rpl_timeout, 'wait_interval': self._interval, 'checksum_timeout': self._checksum_timeout}, multithreading=True ) return not_sync_checksum + sync_checksum def _check_table_data_sync(self, table, slaves): """Check table data synchronization for specified slaves. This method check the data consistency for the specified table between the base server (master or slave) and the specified salves. This operation requires the definition of a "synchronization point" in order to ensure that the "supposed" same data is compared between servers. This coordination process is based on GTIDs (checking that all data until a given GTID has been processed on the slaves). A different algorithm is used to set the "synchronization point" depending if the master is used or not. The data consistency is checked relying on the CHECKSUM TABLE query. If an error occur during this process, any locked table must be unlocked and both master and slaves should resume their previous activity. Important note: this method assumes that the table exists on the base server and all specified slaves, therefore checking the existence of the table as well as other integrity checks (server versions, GTID definitions, etc.) need to be performed outside the scope of this method. table[in] Qualified name of the table to check (quoted with backticks). slaves[in] List of slaves to check. Each element of the list must be a string with the format 'host@port'. Returns the number of data consistency found. """ success = False checksum_issues = 0 # If no master used then add base server (slave) to slaves to sync. if not self._get_master(): slaves = slaves + [self._base_server_key] # Separate active from non active slaves. active_slaves, not_active_slaves = self._split_active_slaves(slaves) if self._get_master(): # Lock the table on the master to get GTID synchronization point # and perform the table checksum. try: self._get_master().exec_query( "LOCK TABLES {0} READ".format(table) ) last_exec_gtid = self._compute_sync_point() if self._verbosity > 2: print("# Sync point GTID: {0}".format(last_exec_gtid)) # Immediately instruct active slaves to stop on sync point. if active_slaves: self._sync_slaves(active_slaves, last_exec_gtid) # Perform table checksum on master. base_server_checksum = self._get_master().checksum_table( table, self._checksum_timeout ) if base_server_checksum[0]: success = True # Successful checksum for base server. if self._verbosity > 2: print("# Checksum on base server (Master): " "{0}".format(base_server_checksum[0][1])) else: print("# [SKIP] {0} checksum on base server (Master) - " "{1}".format(table, base_server_checksum[1])) finally: # Unlock table. self._get_master().exec_query("UNLOCK TABLES") elif active_slaves: # Perform sync without master, only based on active slave (if any). try: # Stop all active slaves to get the GTID synchronization point. self._apply_for_all_slaves( active_slaves, 'stop_sql_thread', multithreading=True ) sync_gtids = self._compute_sync_point(active_slaves) if self._verbosity > 2: print("# Sync point GTID: {0}".format(sync_gtids)) # Instruct active slaves to stop on sync point. self._sync_slaves(active_slaves, sync_gtids) except UtilError: # Try to restart the slaves in case an error occurs. self._apply_for_all_slaves( active_slaves, 'star_sql_thread', multithreading=True ) # Compute checksum on all slaves and return to previous state. slaves_checksum = self._checksum_and_resume_rpl(not_active_slaves, active_slaves, table) # Check if checksum for base server was successfully computed. if not self._get_master(): for slave_key, checksum in slaves_checksum: if slave_key == self._base_server_key: if checksum[0]: success = True # Successful checksum for base server. base_server_checksum = checksum slaves_checksum.remove((slave_key, checksum)) if self._verbosity > 2: print("# Checksum on base server: " "{0}".format(base_server_checksum[0][1])) else: print("# [SKIP] {0} checksum on base server - " "{1}".format(table, checksum[1])) break # Compare checksum and report results. if success and slaves_checksum: for slave_key, checksum_res in slaves_checksum: if checksum_res[0] is None: print("# [SKIP] {0} checksum for Slave '{1}' - " "{2}.".format(table, slave_key, checksum_res[1])) else: if self._verbosity > 2: checksum_val = ': {0}'.format(checksum_res[0][1]) else: checksum_val = '' if checksum_res[0] != base_server_checksum[0]: print("# [DIFF] {0} checksum for server '{1}'" "{2}.".format(table, slave_key, checksum_val)) checksum_issues += 1 else: print("# [OK] {0} checksum for server '{1}'" "{2}.".format(table, slave_key, checksum_val)) return checksum_issues def check_data_sync(self, options, data_to_include, data_to_exclude): """Check data synchronization. Check if the data (in all tables) is in sync between the checked servers (master and its slaves, or only slaves). It reports structure difference database/tables missing or with a different definition and data differences between a base server and the others. Note: A different algorithm is applied to perform the synchronization, depending if the master is specified (available) or not. options[in] Dictionary of options. data_to_include[in] Dictionary of data (set of tables) by database to check. data_to_exclude[in] Dictionary of data (set of tables) by database to exclude from check. Returns the number of consistency issues found (comparing database definitions and data). """ issues_count = 0 # Skip all database objects, except tables. options['skip_views'] = True options['skip_triggers'] = True options['skip_procs'] = True options['skip_funcs'] = True options['skip_events'] = True options['skip_grants'] = True diff_options = {} diff_options.update(options) diff_options['quiet'] = True # Do not print messages. diff_options['suppress_sql'] = True # Do not print SQL statements. diff_options['skip_table_opts'] = True # Ignore AUTO_INCREMENT diffs. # Check the server version requirement to support sync features. # Slave servers of version >= 5.6.14 are required due to a known issue # for START SLAVE UNTIL with the SQL_AFTER_GTIDS option. More info: # https://dev.mysql.com/doc/refman/5.6/en/start-slave.html for slave_key in self._slaves: if not self._get_slave(slave_key).check_version_compat(5, 6, 14): raise UtilError( "Server '{0}' version must be 5.6.14 or greater. Sync is " "not supported for versions prior to 5.6.14 due to a " "known issue with START SLAVE UNTIL and the " "SQL_AFTER_GTIDS option.".format(slave_key)) print("# Checking data consistency.\n#") base_srv_type = 'Master' if self._get_master() else 'Slave' print("# Using {0} '{1}' as base server for comparison." "".format(base_srv_type, self._base_server_key)) # Get all databases from the base server. db_rows = self._base_server.get_all_databases() base_server_dbs = set([row[0] for row in db_rows]) # Process databases to include/exclude from check. db_to_include = set() if data_to_include: db_to_include = set([db for db in data_to_include]) base_server_dbs = base_server_dbs & db_to_include not_exist_db = db_to_include - base_server_dbs if not_exist_db: plurals = ('s', '') if len(not_exist_db) > 1 else ('', 'es') print('# WARNING: specified database{0} to check do{1} not ' 'exist on base server and will be skipped: ' '{2}.'.format(plurals[0], plurals[1], ", ".join(not_exist_db))) db_to_exclude = set() if data_to_exclude: db_to_exclude = set( [db for db in data_to_exclude if not data_to_exclude[db]] ) base_server_dbs = base_server_dbs - db_to_exclude # Check databases on slaves (except the base server). slaves_except_base = [key for key in self._slaves if key != self._base_server_key] for slave_key in slaves_except_base: slave = self._get_slave(slave_key) db_rows = slave.get_all_databases() slave_dbs = set([row[0] for row in db_rows]) # Process databases to include/exclude. if db_to_include: slave_dbs = slave_dbs & db_to_include if db_to_exclude: slave_dbs = slave_dbs - db_to_exclude # Add slave databases set to internal state. self._slaves[slave_key]['databases'] = slave_dbs # Report databases not on base server and filtered by replication. dbs_not_in_base_srv = slave_dbs - base_server_dbs filtered_dbs = set( [db for db in dbs_not_in_base_srv if self._is_rpl_filtered(db, slave=self._base_server_key)] ) dbs_not_in_base_srv -= filtered_dbs for db in filtered_dbs: print("# [SKIP] Database '{0}' - filtered by replication " "rule on base server.".format(db)) if dbs_not_in_base_srv: issues_count += len(dbs_not_in_base_srv) plural = 's' if len(dbs_not_in_base_srv) > 1 else '' print("# [DIFF] Database{0} NOT on base server but found on " "'{1}': {2}".format(plural, slave_key, ",".join(dbs_not_in_base_srv))) # Determine server to check base replication filtering options. filter_srv = None if self._get_master() else self._base_server_key # Check data consistency for each table on the base server. for db_name in base_server_dbs: # Skip database if filtered by defined replication rules. if self._is_rpl_filtered(db_name, slave=filter_srv): print("# [SKIP] Database '{0}' check - filtered by " "replication rule.".format(db_name)) continue print("# Checking '{0}' database...".format(db_name)) slaves_to_check = {} # Check if database exists on slaves (except the base server). for slave_key in slaves_except_base: # Skip database if filtered by defined replication rules. if self._is_rpl_filtered(db_name, slave=slave_key): print("# [SKIP] Database '{0}' check for '{1}' - filtered " "by replication rule.".format(db_name, slave_key)) continue if db_name in self._slaves[slave_key]['databases']: # Store slave database instance and common objects. slave_db = Database(self._get_slave(slave_key), db_name, options) slave_db.init() slave_dic = {'db': slave_db} in_both, in_basesrv, not_in_basesrv = get_common_objects( self._base_server, self._get_slave(slave_key), db_name, db_name, False, options) # Process tables to include/exclude from check (on slaves). if (data_to_include and db_name in data_to_include and data_to_include[db_name]): in_both = [ obj_row for obj_row in in_both if obj_row[1][0] in data_to_include[db_name] ] in_basesrv = [ obj_row for obj_row in in_basesrv if obj_row[1][0] in data_to_include[db_name] ] not_in_basesrv = [ obj_row for obj_row in not_in_basesrv if obj_row[1][0] in data_to_include[db_name] ] if (data_to_exclude and db_name in data_to_exclude and data_to_exclude[db_name]): in_both = [ obj_row for obj_row in in_both if obj_row[1][0] not in data_to_exclude[db_name] ] in_basesrv = [ obj_row for obj_row in in_basesrv if obj_row[1][0] not in data_to_exclude[db_name] ] not_in_basesrv = [ obj_row for obj_row in not_in_basesrv if obj_row[1][0] not in data_to_exclude[db_name] ] slave_dic['in_both'] = in_both slave_dic['in_basesrv'] = in_basesrv slaves_to_check[slave_key] = slave_dic # Report tables not on base server and filtered by # replication. tbls_not_in = set( [obj_row[1][0] for obj_row in not_in_basesrv if obj_row[0] == 'TABLE'] ) filtered_tbls = set( [tbl for tbl in tbls_not_in if self._is_rpl_filtered( db_name, tbl_name=tbl, slave=self._base_server_key )] ) tbls_not_in -= filtered_tbls for tbl in filtered_tbls: print("# [SKIP] Table '{0}' - filtered by replication " "rule on base server.".format(tbl)) if tbls_not_in: plural = 's' if len(tbls_not_in) > 1 else '' print("# [DIFF] Table{0} NOT on base server but " "found on '{1}': " "{2}".format(plural, slave_key, ", ".join(tbls_not_in))) issues_count += len(tbls_not_in) else: print("# [DIFF] Database '{0}' NOT on server " "'{1}'.".format(db_name, slave_key)) issues_count += 1 # Only check database if at least one slave has it. if slaves_to_check: db = Database(self._base_server, db_name, options) db.init() for db_obj in db.get_next_object(): obj_type = db_obj[0] obj_name = db_obj[1][0] # Process tables to include/exclude from check (on base # server). if (data_to_include and data_to_include[db_name] and obj_name not in data_to_include[db_name]): # Skip to the next object if not in data to include. continue if (data_to_exclude and data_to_exclude[db_name] and obj_name in data_to_exclude[db_name]): # Skip to the next object if in data to exclude. continue checksum_task = [] # Check object data on all valid slaves. for slave_key in slaves_to_check: # Skip table if filtered by defined replication rules. if (obj_type == 'TABLE' and self._is_rpl_filtered(db_name, obj_name, slave=slave_key)): print("# [SKIP] Table '{0}' check for '{1}' - " "filtered by replication rule." "".format(obj_name, slave_key)) continue slave_dic = slaves_to_check[slave_key] # Check if object does not exist on Slave. if self._exist_in_obj_list(obj_name, obj_type, slave_dic['in_basesrv']): print("# [DIFF] {0} '{1}.{2}' NOT on server " "'{3}'.".format(obj_type.capitalize(), db_name, obj_name, slave_key)) issues_count += 1 continue # Quote object name with backticks. q_obj = '{0}.{1}'.format( quote_with_backticks(db_name), quote_with_backticks(obj_name) ) # Check object definition. def_diff = diff_objects( self._base_server, self._get_slave(slave_key), q_obj, q_obj, diff_options, obj_type ) if def_diff: print("# [DIFF] {0} {1} definition is " "different on '{2}'." "".format(obj_type.capitalize(), q_obj, slave_key)) issues_count += 1 if self._verbosity: for diff in def_diff[3:]: print("# {0}".format(diff)) continue # Add slave to table checksum task. checksum_task.append(slave_key) # Perform table checksum on valid slaves. if checksum_task and obj_type == 'TABLE': print("# - Checking '{0}' table data..." "".format(obj_name)) num_issues = self._check_table_data_sync(q_obj, checksum_task) issues_count += num_issues print("#\n#...done.\n#") str_issues_count = 'No' if issues_count == 0 else str(issues_count) plural = 's' if issues_count > 1 else '' print("# SUMMARY: {0} data consistency issue{1} found.\n" "#".format(str_issues_count, plural)) return issues_count
48.379496
79
0.549686
import re import sys from multiprocessing.pool import ThreadPool from mysql.utilities.command.dbcompare import diff_objects, get_common_objects from mysql.utilities.common.database import Database from mysql.utilities.common.messages import ERROR_USER_WITHOUT_PRIVILEGES from mysql.utilities.common.pattern_matching import convertSQL_LIKE2REGEXP from mysql.utilities.common.replication import (get_last_server_gtid, gtid_set_cardinality, gtid_set_union) from mysql.utilities.common.sql_transform import quote_with_backticks from mysql.utilities.common.topology import Topology from mysql.utilities.common.user import User from mysql.utilities.exception import UtilError _RE_VERSION_FORMAT = r'^(\d+\.\d+(\.\d+)*).*$' class RPLSynchronizer(object): def __init__(self, master_cnx_dic, slaves_cnx_dic_lst, options): self._verbosity = options.get('verbosity') self._rpl_timeout = options.get('rpl_timeout') self._checksum_timeout = options.get('checksum_timeout') self._interval = options.get('interval') self._rpl_topology = Topology(master_cnx_dic, slaves_cnx_dic_lst, options) self._slaves = self._rpl_topology.get_slaves_dict() self._base_server = None self._base_server_key = None self._set_base_server() self._check_privileges() self._master_rpl_filters = {} self._slaves_rpl_filters = {} self._check_rpl_filters() def _set_base_server(self): master = self._get_master() self._base_server = master if master \ else self._rpl_topology.slaves[0]['instance'] self._base_server_key = "{0}@{1}".format(self._base_server.host, self._base_server.port) def _get_slave(self, slave_key): slave_dict = self._slaves[slave_key] return slave_dict['instance'] def _get_master(self): return self._rpl_topology.master def _check_privileges(self): if self._verbosity: print("# Checking users permission to perform consistency check.\n" "#") master_priv = [('SUPER', 'REPLICATION CLIENT'), ('LOCK TABLES',), ('SELECT',)] master_priv_str = "SUPER or REPLICATION CLIENT, LOCK TABLES and SELECT" if self._get_master(): server = self._get_master() user_obj = User(server, "{0}@{1}".format(server.user, server.host)) for any_priv_tuple in master_priv: has_privilege = any( [user_obj.has_privilege('*', '*', priv) for priv in any_priv_tuple] ) if not has_privilege: raise UtilError(ERROR_USER_WITHOUT_PRIVILEGES.format( user=server.user, host=server.host, port=server.port, operation='perform the synchronization check', req_privileges=master_priv_str )) slave_priv = [('SUPER',), ('SELECT',)] slave_priv_str = "SUPER and SELECT" for slave_key in self._slaves: server = self._get_slave(slave_key) user_obj = User(server, "{0}@{1}".format(server.user, server.host)) for any_priv_tuple in slave_priv: has_privilege = any( [user_obj.has_privilege('*', '*', priv) for priv in any_priv_tuple] ) if not has_privilege: raise UtilError( "User '{0}' on '{1}@{2}' does not have sufficient " "privileges to perform the synchronization check " "(required: {3}).".format(server.user, server.host, server.port, slave_priv_str) ) def _check_rpl_filters(self): if self._get_master(): m_filters = self._get_master().get_binlog_exceptions() if m_filters: self._master_rpl_filters['binlog_do_db'] = \ m_filters[0][1].split(',') if m_filters[0][1] else None self._master_rpl_filters['binlog_ignore_db'] = \ m_filters[0][2].split(',') if m_filters[0][2] else None for slave_key in self._slaves: slave = self._get_slave(slave_key) s_filters = slave.get_slave_rpl_filters() if s_filters: issues = [(0, 'replicate_do_db'), (1, 'replicate_ignore_db'), (4, 'replicate_wild_do_table')] for index, rpl_opt in issues: if s_filters[index]: raise UtilError( "Use of {0} option is not supported. There is a " "known issue with the use this replication filter " "and GTID for some server versions. Issue " "detected for '{1}'.".format(rpl_opt, slave_key)) filters_map = { 'replicate_do_db': s_filters[0].split(',') if s_filters[0] else None, 'replicate_ignore_db': s_filters[1].split(',') if s_filters[1] else None, 'replicate_do_table': s_filters[2].split(',') if s_filters[2] else None, 'replicate_ignore_table': s_filters[3].split(',') if s_filters[3] else None, } if s_filters[4]: wild_list = s_filters[4].split(',') filters_map['replicate_wild_do_table'] = wild_list regexp_list = [] for wild in wild_list: regexp = re.compile(convertSQL_LIKE2REGEXP(wild)) regexp_list.append(regexp) filters_map['regexp_do_table'] = regexp_list else: filters_map['replicate_wild_do_table'] = None filters_map['regexp_do_table'] = None if s_filters[5]: wild_list = s_filters[5].split(',') filters_map['replicate_wild_ignore_table'] = wild_list regexp_list = [] for wild in wild_list: regexp = re.compile(convertSQL_LIKE2REGEXP(wild)) regexp_list.append(regexp) filters_map['regexp_ignore_table'] = regexp_list else: filters_map['replicate_wild_ignore_table'] = None filters_map['regexp_ignore_table'] = None self._slaves_rpl_filters[slave_key] = filters_map if self._master_rpl_filters or self._slaves_rpl_filters: print("# WARNING: Replication filters found on checked " "servers. This can lead data consistency issues " "depending on how statements are evaluated.\n" "# More information: " "http://dev.mysql.com/doc/en/replication-rules.html") if self._verbosity: if self._master_rpl_filters: print("# Master '{0}@{1}':".format( self._get_master().host, self._get_master().port )) for rpl_filter in self._master_rpl_filters: if self._master_rpl_filters[rpl_filter]: print("# - {0}: {1}".format( rpl_filter, ', '.join( self._master_rpl_filters[rpl_filter] ) )) if self._slaves_rpl_filters: for slave_key in self._slaves_rpl_filters: print("# Slave '{0}':".format(slave_key)) filters_map = self._slaves_rpl_filters[slave_key] for rpl_filter in filters_map: if (rpl_filter.startswith('replicate') and filters_map[rpl_filter]): print("# - {0}: {1}".format( rpl_filter, ', '.join(filters_map[rpl_filter]) )) def _is_rpl_filtered(self, db_name, tbl_name=None, slave=None): def match_regexp(name, regex_list): for regex in regex_list: if regex.match(name): return True return False is_db = tbl_name is None obj_name = db_name if is_db else '{0}.{1}'.format(db_name, tbl_name) if not slave and is_db and self._master_rpl_filters: if self._master_rpl_filters['binlog_do_db']: if obj_name in self._master_rpl_filters['binlog_do_db']: return False else: return True elif self._master_rpl_filters['binlog_ignore_db']: if obj_name in self._master_rpl_filters['binlog_ignore_db']: return True if slave and slave in self._slaves_rpl_filters: rpl_filter = self._slaves_rpl_filters[slave] if is_db: if rpl_filter['replicate_do_db']: if obj_name in rpl_filter['replicate_do_db']: return False else: return True elif (rpl_filter['replicate_ignore_db'] and obj_name in rpl_filter['replicate_ignore_db']): return True else: if (rpl_filter['replicate_do_table'] and obj_name in rpl_filter['replicate_do_table']): return False if (rpl_filter['replicate_ignore_table'] and obj_name in rpl_filter['replicate_ignore_table']): return True if (rpl_filter['replicate_wild_do_table'] and match_regexp(obj_name, rpl_filter['regexp_do_table'])): return False if (rpl_filter['replicate_wild_ignore_table'] and match_regexp(obj_name, rpl_filter['regexp_ignore_table'])): return True if (rpl_filter['replicate_do_table'] or rpl_filter['replicate_wild_do_table']): return True return False def _apply_for_all_slaves(self, slaves, function, args=(), kwargs=None, multithreading=False): if kwargs is None: kwargs = {} if multithreading: pool = ThreadPool(processes=len(slaves)) thread_res_lst = [] for slave_key in slaves: slave = self._get_slave(slave_key) thread_res = pool.apply_async(getattr(slave, function), args, kwargs) thread_res_lst.append((slave_key, thread_res)) pool.close() pool.join() res = [] for slave_key, thread_res in thread_res_lst: res.append((slave_key, thread_res.get())) return res else: res = [] for slave_key in slaves: slave = self._get_slave(slave_key) slave_res = getattr(slave, function)(*args, **kwargs) res.append((slave_key, slave_res)) return res def check_server_versions(self): srv_versions = {} master = self._get_master() if master: master_version = master.get_version() match = re.match(_RE_VERSION_FORMAT, master_version.strip()) if match: if not match.group(2): master_version = "{0}.0".format(match.group(1)) else: master_version = match.group(1) master_id = '{0}@{1}'.format(master.host, master.port) srv_versions[master_version] = [master_id] for slave_key in self._slaves: slave = self._get_slave(slave_key) version = slave.get_version() match = re.match(_RE_VERSION_FORMAT, version.strip()) if match: if not match.group(2): version = "{0}.0".format(match.group(1)) else: version = match.group(1) if version in srv_versions: srv_versions[version].append(slave_key) else: srv_versions[version] = [slave_key] if len(srv_versions) > 1: print("# WARNING: Servers using different versions:") for version in srv_versions: servers_str = ",".join(srv_versions[version]) print("# - {0} for {1}.".format(version, servers_str)) print("#") def check_gtid_sync(self): if self._get_master(): if self._get_master().supports_gtid().upper() != 'ON': raise UtilError( "Master must support GTIDs and have GTID_MODE=ON." ) reset_base_srv = False for slave_key, slave_dict in self._slaves.items(): slave = slave_dict['instance'] support_gtid = slave.supports_gtid().upper() if support_gtid != 'ON': reason = "GTID_MODE=OFF" if support_gtid == 'OFF' \ else "not support GTIDs" print("# WARNING: Slave '{0}' will be skipped - " "{1}.".format(slave_key, reason)) print("#") del self._slaves[slave_key] self._rpl_topology.remove_slave(slave_dict) if slave_key == self._base_server_key: reset_base_srv = True if len(self._slaves) == 0: raise UtilError("No slaves found with GTID support and " "GTID_MODE=ON.") if reset_base_srv: self._set_base_server() if self._get_master(): master_gtids = self._get_master().get_gtid_executed() slaves_gtids_data = \ self._rpl_topology.slaves_gtid_subtract_executed( master_gtids, multithreading=True ) print("#\n# GTID differences between Master and Slaves:") for host, port, gtids_missing in slaves_gtids_data: slave_key = '{0}@{1}'.format(host, port) gtid_size = gtid_set_cardinality(gtids_missing) if gtid_size: plural = 's' if gtid_size > 1 else '' print("# - Slave '{0}' is {1} transaction{2} behind " "Master.".format(slave_key, gtid_size, plural)) if self._verbosity: print("# Missing GTIDs: " "{0}".format(gtids_missing)) else: print("# - Slave '{0}' is up-to-date.".format(slave_key)) print("#") @staticmethod def _exist_in_obj_list(obj_name, obj_type, obj_list): for obj_row in obj_list: if obj_row[0] == obj_type and obj_row[1][0] == obj_name: return True return False def _split_active_slaves(self, slaves): slaves_state = self._apply_for_all_slaves(slaves, 'get_slaves_errors', multithreading=True) active_slaves = [] not_active_slaves = [] for slave_key, state in slaves_state: io_running = state[3].upper() == 'YES' self._slaves[slave_key]['IO_Running'] = io_running sql_running = state[4].upper() == 'YES' self._slaves[slave_key]['SQL_Running'] = sql_running if io_running and sql_running: active_slaves.append(slave_key) else: not_active_slaves.append(slave_key) print("# WARNING: Slave not active '{0}' - " "Sync skipped.".format(slave_key)) if self._verbosity: if not io_running and state[2]: print("# - IO thread stopped: ERROR {0} - " "{1}".format(state[1], state[2])) if not sql_running and state[6]: print("# - SQL thread stopped: ERROR {0} - " "{1}".format(state[5], state[6])) return active_slaves, not_active_slaves def _compute_sync_point(self, active_slaves=None): if self._get_master(): gtid_set = self._get_master().get_gtid_executed() master_uuid = self._get_master().get_server_uuid() return get_last_server_gtid(gtid_set, master_uuid) else: all_gtid_executed = self._apply_for_all_slaves( active_slaves, 'get_gtid_executed', multithreading=True ) gtid_sets_by_uuid = {} for _, gtid_executed in all_gtid_executed: gtids_list = gtid_executed.split("\n") for gtid in gtids_list: gtid_set = gtid.rstrip(', ') uuid = gtid_set.split(':')[0] if uuid not in gtid_sets_by_uuid: gtid_sets_by_uuid[uuid] = gtid_set else: union_set = gtid_set_union(gtid_sets_by_uuid[uuid], gtid_set) gtid_sets_by_uuid[uuid] = union_set return ",".join(gtid_sets_by_uuid.itervalues()) def _sync_slaves(self, slaves, gtid): if self._verbosity: print("# Setting data synchronization point for slaves.") self._apply_for_all_slaves(slaves, 'stop_sql_thread', multithreading=True) until_ops = {'until_gtid_set': gtid, 'sql_after_gtid': True, 'only_sql_thread': True} self._apply_for_all_slaves(slaves, 'start', (), until_ops, multithreading=True) def _checksum_and_resume_rpl(self, not_sync_slaves, sync_slave, table): if self._verbosity: print("# Compute checksum on slaves (wait to catch up and resume" " replication).") sys.stdout.flush() not_sync_checksum = [] if not_sync_slaves: not_sync_checksum = self._apply_for_all_slaves( not_sync_slaves, 'checksum_table', (table,), {'exec_timeout': self._checksum_timeout}, multithreading=True ) sync_checksum = [] if sync_slave: sync_checksum = self._apply_for_all_slaves( sync_slave, 'wait_checksum_and_start', (table,), {'wait_timeout': self._rpl_timeout, 'wait_interval': self._interval, 'checksum_timeout': self._checksum_timeout}, multithreading=True ) return not_sync_checksum + sync_checksum def _check_table_data_sync(self, table, slaves): success = False checksum_issues = 0 if not self._get_master(): slaves = slaves + [self._base_server_key] active_slaves, not_active_slaves = self._split_active_slaves(slaves) if self._get_master(): try: self._get_master().exec_query( "LOCK TABLES {0} READ".format(table) ) last_exec_gtid = self._compute_sync_point() if self._verbosity > 2: print("# Sync point GTID: {0}".format(last_exec_gtid)) if active_slaves: self._sync_slaves(active_slaves, last_exec_gtid) base_server_checksum = self._get_master().checksum_table( table, self._checksum_timeout ) if base_server_checksum[0]: success = True if self._verbosity > 2: print("# Checksum on base server (Master): " "{0}".format(base_server_checksum[0][1])) else: print("# [SKIP] {0} checksum on base server (Master) - " "{1}".format(table, base_server_checksum[1])) finally: self._get_master().exec_query("UNLOCK TABLES") elif active_slaves: try: self._apply_for_all_slaves( active_slaves, 'stop_sql_thread', multithreading=True ) sync_gtids = self._compute_sync_point(active_slaves) if self._verbosity > 2: print("# Sync point GTID: {0}".format(sync_gtids)) self._sync_slaves(active_slaves, sync_gtids) except UtilError: self._apply_for_all_slaves( active_slaves, 'star_sql_thread', multithreading=True ) slaves_checksum = self._checksum_and_resume_rpl(not_active_slaves, active_slaves, table) if not self._get_master(): for slave_key, checksum in slaves_checksum: if slave_key == self._base_server_key: if checksum[0]: success = True base_server_checksum = checksum slaves_checksum.remove((slave_key, checksum)) if self._verbosity > 2: print("# Checksum on base server: " "{0}".format(base_server_checksum[0][1])) else: print("# [SKIP] {0} checksum on base server - " "{1}".format(table, checksum[1])) break if success and slaves_checksum: for slave_key, checksum_res in slaves_checksum: if checksum_res[0] is None: print("# [SKIP] {0} checksum for Slave '{1}' - " "{2}.".format(table, slave_key, checksum_res[1])) else: if self._verbosity > 2: checksum_val = ': {0}'.format(checksum_res[0][1]) else: checksum_val = '' if checksum_res[0] != base_server_checksum[0]: print("# [DIFF] {0} checksum for server '{1}'" "{2}.".format(table, slave_key, checksum_val)) checksum_issues += 1 else: print("# [OK] {0} checksum for server '{1}'" "{2}.".format(table, slave_key, checksum_val)) return checksum_issues def check_data_sync(self, options, data_to_include, data_to_exclude): issues_count = 0 options['skip_views'] = True options['skip_triggers'] = True options['skip_procs'] = True options['skip_funcs'] = True options['skip_events'] = True options['skip_grants'] = True diff_options = {} diff_options.update(options) diff_options['quiet'] = True diff_options['suppress_sql'] = True diff_options['skip_table_opts'] = True for slave_key in self._slaves: if not self._get_slave(slave_key).check_version_compat(5, 6, 14): raise UtilError( "Server '{0}' version must be 5.6.14 or greater. Sync is " "not supported for versions prior to 5.6.14 due to a " "known issue with START SLAVE UNTIL and the " "SQL_AFTER_GTIDS option.".format(slave_key)) print("# Checking data consistency.\n#") base_srv_type = 'Master' if self._get_master() else 'Slave' print("# Using {0} '{1}' as base server for comparison." "".format(base_srv_type, self._base_server_key)) db_rows = self._base_server.get_all_databases() base_server_dbs = set([row[0] for row in db_rows]) db_to_include = set() if data_to_include: db_to_include = set([db for db in data_to_include]) base_server_dbs = base_server_dbs & db_to_include not_exist_db = db_to_include - base_server_dbs if not_exist_db: plurals = ('s', '') if len(not_exist_db) > 1 else ('', 'es') print('# WARNING: specified database{0} to check do{1} not ' 'exist on base server and will be skipped: ' '{2}.'.format(plurals[0], plurals[1], ", ".join(not_exist_db))) db_to_exclude = set() if data_to_exclude: db_to_exclude = set( [db for db in data_to_exclude if not data_to_exclude[db]] ) base_server_dbs = base_server_dbs - db_to_exclude slaves_except_base = [key for key in self._slaves if key != self._base_server_key] for slave_key in slaves_except_base: slave = self._get_slave(slave_key) db_rows = slave.get_all_databases() slave_dbs = set([row[0] for row in db_rows]) if db_to_include: slave_dbs = slave_dbs & db_to_include if db_to_exclude: slave_dbs = slave_dbs - db_to_exclude self._slaves[slave_key]['databases'] = slave_dbs dbs_not_in_base_srv = slave_dbs - base_server_dbs filtered_dbs = set( [db for db in dbs_not_in_base_srv if self._is_rpl_filtered(db, slave=self._base_server_key)] ) dbs_not_in_base_srv -= filtered_dbs for db in filtered_dbs: print("# [SKIP] Database '{0}' - filtered by replication " "rule on base server.".format(db)) if dbs_not_in_base_srv: issues_count += len(dbs_not_in_base_srv) plural = 's' if len(dbs_not_in_base_srv) > 1 else '' print("# [DIFF] Database{0} NOT on base server but found on " "'{1}': {2}".format(plural, slave_key, ",".join(dbs_not_in_base_srv))) filter_srv = None if self._get_master() else self._base_server_key for db_name in base_server_dbs: if self._is_rpl_filtered(db_name, slave=filter_srv): print("# [SKIP] Database '{0}' check - filtered by " "replication rule.".format(db_name)) continue print("# Checking '{0}' database...".format(db_name)) slaves_to_check = {} for slave_key in slaves_except_base: if self._is_rpl_filtered(db_name, slave=slave_key): print("# [SKIP] Database '{0}' check for '{1}' - filtered " "by replication rule.".format(db_name, slave_key)) continue if db_name in self._slaves[slave_key]['databases']: slave_db = Database(self._get_slave(slave_key), db_name, options) slave_db.init() slave_dic = {'db': slave_db} in_both, in_basesrv, not_in_basesrv = get_common_objects( self._base_server, self._get_slave(slave_key), db_name, db_name, False, options) if (data_to_include and db_name in data_to_include and data_to_include[db_name]): in_both = [ obj_row for obj_row in in_both if obj_row[1][0] in data_to_include[db_name] ] in_basesrv = [ obj_row for obj_row in in_basesrv if obj_row[1][0] in data_to_include[db_name] ] not_in_basesrv = [ obj_row for obj_row in not_in_basesrv if obj_row[1][0] in data_to_include[db_name] ] if (data_to_exclude and db_name in data_to_exclude and data_to_exclude[db_name]): in_both = [ obj_row for obj_row in in_both if obj_row[1][0] not in data_to_exclude[db_name] ] in_basesrv = [ obj_row for obj_row in in_basesrv if obj_row[1][0] not in data_to_exclude[db_name] ] not_in_basesrv = [ obj_row for obj_row in not_in_basesrv if obj_row[1][0] not in data_to_exclude[db_name] ] slave_dic['in_both'] = in_both slave_dic['in_basesrv'] = in_basesrv slaves_to_check[slave_key] = slave_dic tbls_not_in = set( [obj_row[1][0] for obj_row in not_in_basesrv if obj_row[0] == 'TABLE'] ) filtered_tbls = set( [tbl for tbl in tbls_not_in if self._is_rpl_filtered( db_name, tbl_name=tbl, slave=self._base_server_key )] ) tbls_not_in -= filtered_tbls for tbl in filtered_tbls: print("# [SKIP] Table '{0}' - filtered by replication " "rule on base server.".format(tbl)) if tbls_not_in: plural = 's' if len(tbls_not_in) > 1 else '' print("# [DIFF] Table{0} NOT on base server but " "found on '{1}': " "{2}".format(plural, slave_key, ", ".join(tbls_not_in))) issues_count += len(tbls_not_in) else: print("# [DIFF] Database '{0}' NOT on server " "'{1}'.".format(db_name, slave_key)) issues_count += 1 if slaves_to_check: db = Database(self._base_server, db_name, options) db.init() for db_obj in db.get_next_object(): obj_type = db_obj[0] obj_name = db_obj[1][0] if (data_to_include and data_to_include[db_name] and obj_name not in data_to_include[db_name]): continue if (data_to_exclude and data_to_exclude[db_name] and obj_name in data_to_exclude[db_name]): continue checksum_task = [] for slave_key in slaves_to_check: if (obj_type == 'TABLE' and self._is_rpl_filtered(db_name, obj_name, slave=slave_key)): print("# [SKIP] Table '{0}' check for '{1}' - " "filtered by replication rule." "".format(obj_name, slave_key)) continue slave_dic = slaves_to_check[slave_key] if self._exist_in_obj_list(obj_name, obj_type, slave_dic['in_basesrv']): print("# [DIFF] {0} '{1}.{2}' NOT on server " "'{3}'.".format(obj_type.capitalize(), db_name, obj_name, slave_key)) issues_count += 1 continue q_obj = '{0}.{1}'.format( quote_with_backticks(db_name), quote_with_backticks(obj_name) ) def_diff = diff_objects( self._base_server, self._get_slave(slave_key), q_obj, q_obj, diff_options, obj_type ) if def_diff: print("# [DIFF] {0} {1} definition is " "different on '{2}'." "".format(obj_type.capitalize(), q_obj, slave_key)) issues_count += 1 if self._verbosity: for diff in def_diff[3:]: print("# {0}".format(diff)) continue checksum_task.append(slave_key) if checksum_task and obj_type == 'TABLE': print("# - Checking '{0}' table data..." "".format(obj_name)) num_issues = self._check_table_data_sync(q_obj, checksum_task) issues_count += num_issues print("#\n#...done.\n#") str_issues_count = 'No' if issues_count == 0 else str(issues_count) plural = 's' if issues_count > 1 else '' print("# SUMMARY: {0} data consistency issue{1} found.\n" "#".format(str_issues_count, plural)) return issues_count
true
true
f72b84523234516e230f5570be8f20af24029148
29,913
py
Python
rbc/remotejit.py
guilhermeleobas/rbc
4b568b91c6ce3ef7727fee001169302c3803c4fd
[ "BSD-3-Clause" ]
null
null
null
rbc/remotejit.py
guilhermeleobas/rbc
4b568b91c6ce3ef7727fee001169302c3803c4fd
[ "BSD-3-Clause" ]
null
null
null
rbc/remotejit.py
guilhermeleobas/rbc
4b568b91c6ce3ef7727fee001169302c3803c4fd
[ "BSD-3-Clause" ]
null
null
null
"""RemoteJIT client/server config functions """ __all__ = ['RemoteJIT', 'Signature', 'Caller'] import os import inspect import warnings import ctypes from contextlib import nullcontext from . import irtools from .typesystem import Type, get_signature from .thrift import Server, Dispatcher, dispatchermethod, Data, Client from .utils import get_local_ip from .targetinfo import TargetInfo from .rbclib import tracing_allocator # XXX WIP: the OmnisciCompilerPipeline is no longer omnisci-specific because # we support Arrays even without omnisci, so it must be renamed and moved # somewhere elsef from .omnisci_backend import OmnisciCompilerPipeline def isfunctionlike(obj): """Return True if object is function alike. """ if obj is None or isinstance(obj, (Signature, list, tuple, str, Caller)): return False return True def extract_templates(options): """Extract templates mapping data from options dictionary. If options does not contain "templates", it will be constructed from all unknown options that have list values. Otherwise, the corresponding value is returned with no further processing of options content. Parameters ---------- options : dict Returns ------- options : dict A copy of input without templates mapping data. templates : dict Templates mapping which is a collections of pairs of template name and a list of concrete types. Template name cannot correspond to a concrete type. """ known_options = ['devices', 'local'] new_options = {} templates = options.get('templates') if templates is not None: new_options.update(options) del new_options['templates'] else: templates = {} for k, v in options.items(): if (isinstance(k, str) and isinstance(v, list) and k not in known_options): templates[k] = v else: new_options[k] = v return new_options, templates class Signature(object): """Signature decorator for Python functions. A Signature decorator may contain many signature objects representing the prototypes of functions. Signature decorators are re-usable and composeable. For example: .. highlight:: python .. code-block:: python rjit = RemoteJIT(host='localhost' port=6274) # remotebinaryfunc is Signature instance remotebinaryfunc = rjit('int32(int32, int32)', 'float32(float32, float32)', ...) # add will be Caller instance @remotebinaryfunc def add(a, b): return a + b # sub will be Caller instance @remotebinaryfunc def sub(a, b): return a - b add(1, 2) # returns 3 sub(1.0, 2.0) # returns -1.0 """ def __init__(self, remotejit): assert isinstance(remotejit, RemoteJIT), type(remotejit) self.remotejit = remotejit self.signatures = [] self.signature_devices = {} self.signature_templates = {} @property def debug(self): return self.remotejit.debug @property def local(self): sig = Signature(self.remotejit.local) sig.signatures.extend(self.signatures) assert not self.signature_devices assert not self.signature_templates return sig def __str__(self): lst = ["'%s'" % (s,) for s in self.signatures] return '%s(%s)' % (self.__class__.__name__, ', '.join(lst)) def __call__(self, obj, **options): """Decorate signatures or a function. Parameters ---------- obj : {str, Signature, function, ...} Specify object that represents a function type. Keyword parameters ------------------ devices : list Specify device names for the given set of signatures. templates : dict Specify template types mapping. Returns ------- result : {Signature, Caller} If obj is a function, return Caller. Otherwise return self that is extended with new signatures from obj. Note ---- The validity of the input argument is not checked here. This is because the bit-size of certain C types (e.g. size_t, long, etc) depend on the target device which information will be available at the compile stage. The target dependent signatures can be retrieved using `signature.get_signatures()`. """ if obj is None: return self options, templates = extract_templates(options) devices = options.get('devices') if isinstance(obj, Signature): self.signatures.extend(obj.signatures) self.signature_devices.update(obj.signature_devices) self.remotejit.discard_last_compile() if devices is not None: for s in obj.signatures: self.signature_devices[s] = devices assert not templates for s in obj.signatures: t = obj.signature_templates.get(s) if t is not None: self.signature_templates[s] = t return self if isinstance(obj, Caller): # return new Caller with extended signatures set assert obj.remotejit is self.remotejit final = Signature(self.remotejit) final(self) # copies the signatures from self to final final(obj.signature) # copies the signatures from obj to final assert devices is None assert not templates return Caller(obj.func, final) if isfunctionlike(obj): final = Signature(self.remotejit) final(self) # copies the signatures from self to final assert devices is None assert not templates return Caller(obj, final) self.signatures.append(obj) self.remotejit.discard_last_compile() if devices is not None: self.signature_devices[obj] = devices if templates: self.signature_templates[obj] = templates return self def best_match(self, func, atypes: tuple) -> Type: """Return function type from signatures that matches best with given argument types. If no match is found, raise TypeError. Parameters ---------- atypes : Type-tuple Specify a tuple of argument types. Returns ------- ftype : Type Function type that arguments match best with given argument types. """ ftype = None match_penalty = None available_types = self.normalized(func).signatures for typ in available_types: penalty = typ.match(atypes) if penalty is not None: if ftype is None or penalty < match_penalty: ftype = typ match_penalty = penalty if ftype is None: satypes = ', '.join(map(str, atypes)) available = '; '.join(map(str, available_types)) raise TypeError( f'found no matching function type to given argument types' f' `{satypes}`. Available function types: {available}') return ftype def normalized(self, func=None): """Return a copy of Signature object where all signatures are normalized to Type instances using the current target device information. Parameters ---------- func : {None, callable} Python function that annotations are attached to signature. Returns ------- signature : Signature """ signature = Signature(self.remotejit) fsig = Type.fromcallable(func) if func is not None else None nargs = fsig.arity if func is not None else None target_info = TargetInfo() for sig in self.signatures: devices = self.signature_devices.get(sig) if not target_info.check_enabled(devices): if self.debug: print(f'{type(self).__name__}.normalized: skipping {sig} as' f' not supported by devices: {devices}') continue templates = self.signature_templates.get(sig, {}) sig = Type.fromobject(sig) if not sig.is_complete: warnings.warn(f'Incomplete signature {sig} will be ignored') continue if not sig.is_function: raise ValueError( 'expected signature representing function type,' f' got `{sig}`') if nargs is None: nargs = sig.arity elif sig.arity != nargs: raise ValueError(f'signature `{sig}` must have arity {nargs}' f' but got {len(sig[1])}') if fsig is not None: sig.inherit_annotations(fsig) if not sig.is_concrete: for csig in sig.apply_templates(templates): assert isinstance(csig, Type), (sig, csig, type(csig)) if csig not in signature.signatures: signature.signatures.append(csig) else: if sig not in signature.signatures: signature.signatures.append(sig) if fsig is not None and fsig.is_complete: if fsig not in signature.signatures: signature.signatures.append(fsig) return signature class Caller(object): """Remote JIT caller, holds the decorated function that can be executed remotely. """ def __init__(self, func, signature: Signature): """Construct remote JIT caller instance. Parameters ---------- func : callable Specify a Python function that is used as a template to remotely JIT compiled functions. signature : Signature Specify a collection of signatures. local : bool When True, local process will be interpreted as remote. Useful for debugging. """ self.remotejit = signature.remotejit self.signature = signature func = self.remotejit.preprocess_callable(func) self.func = func self.nargs = len(get_signature(func).parameters) # Attributes used in RBC user-interface self._is_compiled = set() # items are (fname, ftype) self._client = None self.remotejit.add_caller(self) @property def local(self): """Return Caller instance that executes function calls on the local host. Useful for debugging. """ return Caller(self.func, self.signature.local) def __repr__(self): return '%s(%s, %s, local=%s)' % (type(self).__name__, self.func, self.signature, self.local) def __str__(self): return self.describe() def describe(self): """Return LLVM IRs of all target devices. """ lst = [''] fid = 0 for device, target_info in self.remotejit.targets.items(): with Type.alias(**self.remotejit.typesystem_aliases): with target_info: lst.append(f'{device:-^80}') signatures = self.get_signatures() signatures_map = {} for sig in signatures: fid += 1 signatures_map[fid] = sig llvm_module, succesful_fids = irtools.compile_to_LLVM( [(self.func, signatures_map)], target_info, pipeline_class=OmnisciCompilerPipeline, debug=self.remotejit.debug) lst.append(str(llvm_module)) lst.append(f'{"":-^80}') return '\n'.join(lst) def get_signatures(self): """Return a list of normalized signatures for given target device. """ return self.signature.normalized(self.func).signatures # RBC user-interface def __call__(self, *arguments, **options): """Return the result of a remote JIT compiled function call. """ device = options.get('device') targets = self.remotejit.targets if device is None: if len(targets) > 1: raise TypeError( f'specifying device is required when target has more than' f' one device. Available devices: {", ".join(targets)}') device = tuple(targets)[0] target_info = targets[device] with target_info: atypes = tuple(map(Type.fromvalue, arguments)) ftype = self.signature.best_match(self.func, atypes) key = self.func.__name__, ftype if key not in self._is_compiled: self.remotejit.remote_compile(self.func, ftype, target_info) self._is_compiled.add(key) return self.remotejit.remote_call(self.func, ftype, arguments) class RemoteJIT(object): """RemoteJIT is a decorator generator for user functions to be remotely JIT compiled. To use, define .. highlight:: python .. code-block:: python rjit = RemoteJIT(host='localhost', port=6274) @rjit def foo(a: int, b: int) -> int: return a + b @rjit('double(double, double)', 'int64(int64, int64)') def bar(a, b): return a + b # Finally, call c = foo(1, 2) # c = 3 b = bar(7.0, 1.0) # b = 8.0 The sum will be evaluated in the remote host. """ multiplexed = True thrift_content = None typesystem_aliases = dict() def __init__(self, host='localhost', port=11532, local=False, debug=False, use_tracing_allocator=False): """Construct remote JIT function decorator. The decorator is re-usable for different functions. Parameters ---------- host : str Specify the host name of IP of JIT server port : {int, str} Specify the service port of the JIT server local : bool When True, use local client. Useful for debugging. debug : bool When True, output debug messages. use_tracing_allocator : bool When True, enable the automatic detection of memory leaks. """ if host == 'localhost': host = get_local_ip() if use_tracing_allocator and not local: raise ValueError('use_tracing_allocator=True can be used only with local=True') self.debug = debug self.use_tracing_allocator = use_tracing_allocator self.host = host self.port = int(port) self.server_process = None # A collection of Caller instances. Each represents a function # that have many argument type dependent implementations. self._callers = [] self._last_compile = None self._targets = None if local: self._client = LocalClient(debug=debug, use_tracing_allocator=use_tracing_allocator) else: self._client = None @property def local(self): localjit = type(self)(local=True, debug=self.debug) localjit._callers.extend(self._callers) return localjit def add_caller(self, caller): self._callers.append(caller) self.discard_last_compile() def get_callers(self): return self._callers def reset(self): """Drop all callers definitions and compilation results. """ self._callers.clear() self.discard_last_compile() @property def have_last_compile(self): """Check if compile data exists. See `set_last_compile` method for more information. """ return self._last_compile is not None def discard_last_compile(self): """Discard compile data. See `set_last_compile` method for more information. """ self._last_compile = None def set_last_compile(self, compile_data): """Save compile data. The caller is responsible for discarding previous compiler data by calling `discard_last_compile` method. Parameters ---------- compile_data : object Compile data can be any Python object. When None, it is interpreted as no compile data is available. Notes ----- The have/discard/set_last_compile methods provide a way to avoid unnecessary compilations when the remote server supports registration of compiled functions. The corresponding `register` method is expected to use the following pattern: .. code-block:: python def register(self): if self.have_last_compile: return <compile defined functions> self.set_last_compile(<compilation results>) The `discard_last_compile()` method is called when the compile data becomes obsolete or needs to be discarded. For instance, the compile data will be discarded when calling the following methods: `reset`, `add_caller`. Note that the `add_caller` call is triggered when applying the remotejit decorator to a Python function to be compiled. """ assert self._last_compile is None self._last_compile = compile_data def get_pending_names(self): """Return the names of functions that have not been registered to the remote server. """ names = set() if not self.have_last_compile: for caller in reversed(self.get_callers()): names.add(caller.func.__name__) return names def retrieve_targets(self): """Retrieve target device information from remote client. Redefine this method if remote client is not native. Returns ------- targets : dict Map of target device names and informations. """ # TODO: rename thrift API targets to get_device_parameters? response = self.client(remotejit=dict(targets=())) targets = {} for device, data in response['remotejit']['targets'].items(): targets[device] = TargetInfo.fromjson(data) return targets @property def targets(self): """Return device-target_info mapping of the remote server. """ if self._targets is None: self._targets = self.retrieve_targets() return self._targets def __call__(self, *signatures, **options): """Define a remote JIT function signatures and template. Parameters ---------- signatures : tuple Specify signatures of a remote JIT function, or a Python function as a template from which the remote JIT function will be compiled. Keyword parameters ------------------ local : bool devices : list Specify device names for the given set of signatures. templates : dict Specify template types mapping. Returns ------- sig: {Signature, Caller} Signature decorator or Caller Notes ----- The signatures can be strings in the following form: "<return type>(<argument type 1>, <argument type 2>, ...)" or any other object that can be converted to function type, see `Type.fromobject` for more information. """ if options.get('local'): s = Signature(self.local) else: s = Signature(self) devices = options.get('devices') options, templates = extract_templates(options) for sig in signatures: s = s(sig, devices=devices, templates=templates) return s def start_server(self, background=False): """Start remotejit server from client. """ thrift_file = os.path.join(os.path.dirname(__file__), 'remotejit.thrift') print('staring rpc.thrift server: %s' % (thrift_file), end='', flush=True) if self.debug: print(flush=True) dispatcher = DebugDispatcherRJIT else: dispatcher = DispatcherRJIT if background: ps = Server.run_bg(dispatcher, thrift_file, dict(host=self.host, port=self.port, debug=self.debug)) self.server_process = ps else: Server.run(dispatcher, thrift_file, dict(host=self.host, port=self.port, debug=self.debug)) print('... rpc.thrift server stopped', flush=True) def stop_server(self): """Stop remotejit server from client. """ if self.server_process is not None and self.server_process.is_alive(): print('... stopping rpc.thrift server') self.server_process.terminate() self.server_process = None @property def client(self): """Return remote host connection as Client instance. """ if self._client is None: self._client = Client( host=self.host, port=self.port, multiplexed=self.multiplexed, thrift_content=self.thrift_content, socket_timeout=60000) return self._client def remote_compile(self, func, ftype: Type, target_info: TargetInfo): """Remote compile function and signatures to machine code. The input function `func` is compiled to LLVM IR module, the LLVM IR module is sent to remote host where the remote host is expected to complete the compilation process. Return the corresponding LLVM IR module instance which may be useful for debugging. """ if self.debug: print(f'remote_compile({func}, {ftype})') llvm_module, succesful_fids = irtools.compile_to_LLVM( [(func, {0: ftype})], target_info, pipeline_class=OmnisciCompilerPipeline, debug=self.debug) ir = str(llvm_module) mangled_signatures = ';'.join([s.mangle() for s in [ftype]]) response = self.client(remotejit=dict( compile=(func.__name__, mangled_signatures, ir))) assert response['remotejit']['compile'], response return llvm_module def remote_call(self, func, ftype: Type, arguments: tuple): """Call function remotely on given arguments. The input function `func` is called remotely by sending the arguments data to remote host where the previously compiled function (see `remote_compile` method) is applied to the arguments, and the result is returned to local process. """ if self.debug: print(f'remote_call({func}, {ftype}, {arguments})') fullname = func.__name__ + ftype.mangle() response = self.client(remotejit=dict(call=(fullname, arguments))) return response['remotejit']['call'] def python(self, statement): """Execute Python statement remotely. """ response = self.client(remotejit=dict(python=(statement,))) return response['remotejit']['python'] def preprocess_callable(self, func): """Preprocess func to be used as a remotejit function definition. Parameters ---------- func : callable Returns ------- func : callable Preprocessed func. """ return func class DispatcherRJIT(Dispatcher): """Implements remotejit service methods. """ def __init__(self, server, debug=False, use_tracing_allocator=False): super().__init__(server, debug=debug) self.use_tracing_allocator = use_tracing_allocator self.compiled_functions = dict() self.engines = dict() self.python_globals = dict() self.python_locals = dict() @dispatchermethod def targets(self) -> dict: """Retrieve target device information. Returns ------- info : dict Map of target devices and their properties. """ if self.use_tracing_allocator: target_info = TargetInfo.host(name='host_cpu_tracing_allocator', use_tracing_allocator=True) else: target_info = TargetInfo.host() target_info.set('has_numba', True) target_info.set('has_cpython', True) return dict(cpu=target_info.tojson()) @dispatchermethod def compile(self, name: str, signatures: str, ir: str) -> int: """JIT compile function. Parameters ---------- name : str Specify the function name. signatures : str Specify semi-colon separated list of mangled signatures. ir : str Specify LLVM IR representation of the function. """ engine = irtools.compile_IR(ir) for msig in signatures.split(';'): sig = Type.demangle(msig) ctypes_sig = sig.toctypes() assert sig.is_function if sig[0].is_aggregate: raise RuntimeError( f'Functions with aggregate return type values are not supported,' f' got function `{name}` with `{sig}` signature') fullname = name + msig addr = engine.get_function_address(fullname) if self.debug: print(f'compile({name}, {sig}) -> {hex(addr)}') # storing engine as the owner of function addresses if addr: self.compiled_functions[fullname] = engine, ctypes_sig(addr), sig, ctypes_sig else: warnings.warn('No compilation result for {name}|{sig=}') return True @dispatchermethod def call(self, fullname: str, arguments: tuple) -> Data: """Call JIT compiled function Parameters ---------- fullname : str Specify the full name of the function that is in form "<name><mangled signature>" arguments : tuple Specify the arguments to the function. """ # if we are using a tracing allocator, automatically detect memory leaks # at each call. if self.use_tracing_allocator: leak_detector = tracing_allocator.new_leak_detector() else: leak_detector = nullcontext() with leak_detector: return self._do_call(fullname, arguments) def _do_call(self, fullname, arguments): if self.debug: print(f'call({fullname}, {arguments})') ef = self.compiled_functions.get(fullname) if ef is None: raise RuntimeError( f'no such compiled function `{fullname}`. Available functions:\n' f' {"; ".join(list(self.compiled_functions))}\n.') sig = ef[2] ctypes_sig = ef[3] if len(arguments) == 0: assert sig.arity == 1 and sig[1][0].is_void, sig else: assert len(arguments) == sig.arity, (len(arguments), sig.arity) ctypes_arguments = [] for typ, ctypes_typ, value in zip(sig[1], ctypes_sig._argtypes_, arguments): if typ.is_custom: typ = typ.get_struct_type() if typ.is_struct: if isinstance(value, tuple): member_values = [t.toctypes()(value[i]) for i, t in enumerate(typ)] else: member_values = [t.toctypes()(getattr(value, t.name)) for t in typ] ctypes_arguments.extend(member_values) elif typ.is_pointer: if isinstance(value, ctypes.c_void_p): value = ctypes.cast(value, ctypes_typ) else: value = ctypes.cast(value, ctypes_typ) ctypes_arguments.append(value) else: ctypes_arguments.append(value) r = ef[1](*ctypes_arguments) if sig[0].is_pointer and sig[0][0].is_void and isinstance(r, int): r = ctypes.c_void_p(r) if self.debug: print(f'-> {r}') if hasattr(r, 'topython'): return r.topython() return r @dispatchermethod def python(self, statement: str) -> int: """Execute Python statement. """ if self.debug: print(f'python({statement!r})') exec(statement, self.python_globals, self.python_locals) return True class DebugDispatcherRJIT(DispatcherRJIT): """ Enables debug messages. """ debug = True class LocalClient(object): """Pretender of thrift.Client. All calls will be made in a local process. Useful for debbuging. """ def __init__(self, debug=False, use_tracing_allocator=False): self.dispatcher = DispatcherRJIT(None, debug=debug, use_tracing_allocator=use_tracing_allocator) def __call__(self, **services): results = {} for service_name, query_dict in services.items(): results[service_name] = {} for mthname, args in query_dict.items(): mth = getattr(self.dispatcher, mthname) mth = inspect.unwrap(mth) results[service_name][mthname] = mth(self.dispatcher, *args) return results
34.2254
93
0.585063
__all__ = ['RemoteJIT', 'Signature', 'Caller'] import os import inspect import warnings import ctypes from contextlib import nullcontext from . import irtools from .typesystem import Type, get_signature from .thrift import Server, Dispatcher, dispatchermethod, Data, Client from .utils import get_local_ip from .targetinfo import TargetInfo from .rbclib import tracing_allocator from .omnisci_backend import OmnisciCompilerPipeline def isfunctionlike(obj): if obj is None or isinstance(obj, (Signature, list, tuple, str, Caller)): return False return True def extract_templates(options): known_options = ['devices', 'local'] new_options = {} templates = options.get('templates') if templates is not None: new_options.update(options) del new_options['templates'] else: templates = {} for k, v in options.items(): if (isinstance(k, str) and isinstance(v, list) and k not in known_options): templates[k] = v else: new_options[k] = v return new_options, templates class Signature(object): def __init__(self, remotejit): assert isinstance(remotejit, RemoteJIT), type(remotejit) self.remotejit = remotejit self.signatures = [] self.signature_devices = {} self.signature_templates = {} @property def debug(self): return self.remotejit.debug @property def local(self): sig = Signature(self.remotejit.local) sig.signatures.extend(self.signatures) assert not self.signature_devices assert not self.signature_templates return sig def __str__(self): lst = ["'%s'" % (s,) for s in self.signatures] return '%s(%s)' % (self.__class__.__name__, ', '.join(lst)) def __call__(self, obj, **options): if obj is None: return self options, templates = extract_templates(options) devices = options.get('devices') if isinstance(obj, Signature): self.signatures.extend(obj.signatures) self.signature_devices.update(obj.signature_devices) self.remotejit.discard_last_compile() if devices is not None: for s in obj.signatures: self.signature_devices[s] = devices assert not templates for s in obj.signatures: t = obj.signature_templates.get(s) if t is not None: self.signature_templates[s] = t return self if isinstance(obj, Caller): assert obj.remotejit is self.remotejit final = Signature(self.remotejit) final(self) final(obj.signature) assert devices is None assert not templates return Caller(obj.func, final) if isfunctionlike(obj): final = Signature(self.remotejit) final(self) assert devices is None assert not templates return Caller(obj, final) self.signatures.append(obj) self.remotejit.discard_last_compile() if devices is not None: self.signature_devices[obj] = devices if templates: self.signature_templates[obj] = templates return self def best_match(self, func, atypes: tuple) -> Type: ftype = None match_penalty = None available_types = self.normalized(func).signatures for typ in available_types: penalty = typ.match(atypes) if penalty is not None: if ftype is None or penalty < match_penalty: ftype = typ match_penalty = penalty if ftype is None: satypes = ', '.join(map(str, atypes)) available = '; '.join(map(str, available_types)) raise TypeError( f'found no matching function type to given argument types' f' `{satypes}`. Available function types: {available}') return ftype def normalized(self, func=None): signature = Signature(self.remotejit) fsig = Type.fromcallable(func) if func is not None else None nargs = fsig.arity if func is not None else None target_info = TargetInfo() for sig in self.signatures: devices = self.signature_devices.get(sig) if not target_info.check_enabled(devices): if self.debug: print(f'{type(self).__name__}.normalized: skipping {sig} as' f' not supported by devices: {devices}') continue templates = self.signature_templates.get(sig, {}) sig = Type.fromobject(sig) if not sig.is_complete: warnings.warn(f'Incomplete signature {sig} will be ignored') continue if not sig.is_function: raise ValueError( 'expected signature representing function type,' f' got `{sig}`') if nargs is None: nargs = sig.arity elif sig.arity != nargs: raise ValueError(f'signature `{sig}` must have arity {nargs}' f' but got {len(sig[1])}') if fsig is not None: sig.inherit_annotations(fsig) if not sig.is_concrete: for csig in sig.apply_templates(templates): assert isinstance(csig, Type), (sig, csig, type(csig)) if csig not in signature.signatures: signature.signatures.append(csig) else: if sig not in signature.signatures: signature.signatures.append(sig) if fsig is not None and fsig.is_complete: if fsig not in signature.signatures: signature.signatures.append(fsig) return signature class Caller(object): def __init__(self, func, signature: Signature): self.remotejit = signature.remotejit self.signature = signature func = self.remotejit.preprocess_callable(func) self.func = func self.nargs = len(get_signature(func).parameters) self._is_compiled = set() self._client = None self.remotejit.add_caller(self) @property def local(self): return Caller(self.func, self.signature.local) def __repr__(self): return '%s(%s, %s, local=%s)' % (type(self).__name__, self.func, self.signature, self.local) def __str__(self): return self.describe() def describe(self): lst = [''] fid = 0 for device, target_info in self.remotejit.targets.items(): with Type.alias(**self.remotejit.typesystem_aliases): with target_info: lst.append(f'{device:-^80}') signatures = self.get_signatures() signatures_map = {} for sig in signatures: fid += 1 signatures_map[fid] = sig llvm_module, succesful_fids = irtools.compile_to_LLVM( [(self.func, signatures_map)], target_info, pipeline_class=OmnisciCompilerPipeline, debug=self.remotejit.debug) lst.append(str(llvm_module)) lst.append(f'{"":-^80}') return '\n'.join(lst) def get_signatures(self): return self.signature.normalized(self.func).signatures def __call__(self, *arguments, **options): device = options.get('device') targets = self.remotejit.targets if device is None: if len(targets) > 1: raise TypeError( f'specifying device is required when target has more than' f' one device. Available devices: {", ".join(targets)}') device = tuple(targets)[0] target_info = targets[device] with target_info: atypes = tuple(map(Type.fromvalue, arguments)) ftype = self.signature.best_match(self.func, atypes) key = self.func.__name__, ftype if key not in self._is_compiled: self.remotejit.remote_compile(self.func, ftype, target_info) self._is_compiled.add(key) return self.remotejit.remote_call(self.func, ftype, arguments) class RemoteJIT(object): multiplexed = True thrift_content = None typesystem_aliases = dict() def __init__(self, host='localhost', port=11532, local=False, debug=False, use_tracing_allocator=False): if host == 'localhost': host = get_local_ip() if use_tracing_allocator and not local: raise ValueError('use_tracing_allocator=True can be used only with local=True') self.debug = debug self.use_tracing_allocator = use_tracing_allocator self.host = host self.port = int(port) self.server_process = None self._callers = [] self._last_compile = None self._targets = None if local: self._client = LocalClient(debug=debug, use_tracing_allocator=use_tracing_allocator) else: self._client = None @property def local(self): localjit = type(self)(local=True, debug=self.debug) localjit._callers.extend(self._callers) return localjit def add_caller(self, caller): self._callers.append(caller) self.discard_last_compile() def get_callers(self): return self._callers def reset(self): self._callers.clear() self.discard_last_compile() @property def have_last_compile(self): return self._last_compile is not None def discard_last_compile(self): self._last_compile = None def set_last_compile(self, compile_data): assert self._last_compile is None self._last_compile = compile_data def get_pending_names(self): names = set() if not self.have_last_compile: for caller in reversed(self.get_callers()): names.add(caller.func.__name__) return names def retrieve_targets(self): response = self.client(remotejit=dict(targets=())) targets = {} for device, data in response['remotejit']['targets'].items(): targets[device] = TargetInfo.fromjson(data) return targets @property def targets(self): if self._targets is None: self._targets = self.retrieve_targets() return self._targets def __call__(self, *signatures, **options): if options.get('local'): s = Signature(self.local) else: s = Signature(self) devices = options.get('devices') options, templates = extract_templates(options) for sig in signatures: s = s(sig, devices=devices, templates=templates) return s def start_server(self, background=False): thrift_file = os.path.join(os.path.dirname(__file__), 'remotejit.thrift') print('staring rpc.thrift server: %s' % (thrift_file), end='', flush=True) if self.debug: print(flush=True) dispatcher = DebugDispatcherRJIT else: dispatcher = DispatcherRJIT if background: ps = Server.run_bg(dispatcher, thrift_file, dict(host=self.host, port=self.port, debug=self.debug)) self.server_process = ps else: Server.run(dispatcher, thrift_file, dict(host=self.host, port=self.port, debug=self.debug)) print('... rpc.thrift server stopped', flush=True) def stop_server(self): if self.server_process is not None and self.server_process.is_alive(): print('... stopping rpc.thrift server') self.server_process.terminate() self.server_process = None @property def client(self): if self._client is None: self._client = Client( host=self.host, port=self.port, multiplexed=self.multiplexed, thrift_content=self.thrift_content, socket_timeout=60000) return self._client def remote_compile(self, func, ftype: Type, target_info: TargetInfo): if self.debug: print(f'remote_compile({func}, {ftype})') llvm_module, succesful_fids = irtools.compile_to_LLVM( [(func, {0: ftype})], target_info, pipeline_class=OmnisciCompilerPipeline, debug=self.debug) ir = str(llvm_module) mangled_signatures = ';'.join([s.mangle() for s in [ftype]]) response = self.client(remotejit=dict( compile=(func.__name__, mangled_signatures, ir))) assert response['remotejit']['compile'], response return llvm_module def remote_call(self, func, ftype: Type, arguments: tuple): if self.debug: print(f'remote_call({func}, {ftype}, {arguments})') fullname = func.__name__ + ftype.mangle() response = self.client(remotejit=dict(call=(fullname, arguments))) return response['remotejit']['call'] def python(self, statement): response = self.client(remotejit=dict(python=(statement,))) return response['remotejit']['python'] def preprocess_callable(self, func): return func class DispatcherRJIT(Dispatcher): def __init__(self, server, debug=False, use_tracing_allocator=False): super().__init__(server, debug=debug) self.use_tracing_allocator = use_tracing_allocator self.compiled_functions = dict() self.engines = dict() self.python_globals = dict() self.python_locals = dict() @dispatchermethod def targets(self) -> dict: if self.use_tracing_allocator: target_info = TargetInfo.host(name='host_cpu_tracing_allocator', use_tracing_allocator=True) else: target_info = TargetInfo.host() target_info.set('has_numba', True) target_info.set('has_cpython', True) return dict(cpu=target_info.tojson()) @dispatchermethod def compile(self, name: str, signatures: str, ir: str) -> int: engine = irtools.compile_IR(ir) for msig in signatures.split(';'): sig = Type.demangle(msig) ctypes_sig = sig.toctypes() assert sig.is_function if sig[0].is_aggregate: raise RuntimeError( f'Functions with aggregate return type values are not supported,' f' got function `{name}` with `{sig}` signature') fullname = name + msig addr = engine.get_function_address(fullname) if self.debug: print(f'compile({name}, {sig}) -> {hex(addr)}') if addr: self.compiled_functions[fullname] = engine, ctypes_sig(addr), sig, ctypes_sig else: warnings.warn('No compilation result for {name}|{sig=}') return True @dispatchermethod def call(self, fullname: str, arguments: tuple) -> Data: if self.use_tracing_allocator: leak_detector = tracing_allocator.new_leak_detector() else: leak_detector = nullcontext() with leak_detector: return self._do_call(fullname, arguments) def _do_call(self, fullname, arguments): if self.debug: print(f'call({fullname}, {arguments})') ef = self.compiled_functions.get(fullname) if ef is None: raise RuntimeError( f'no such compiled function `{fullname}`. Available functions:\n' f' {"; ".join(list(self.compiled_functions))}\n.') sig = ef[2] ctypes_sig = ef[3] if len(arguments) == 0: assert sig.arity == 1 and sig[1][0].is_void, sig else: assert len(arguments) == sig.arity, (len(arguments), sig.arity) ctypes_arguments = [] for typ, ctypes_typ, value in zip(sig[1], ctypes_sig._argtypes_, arguments): if typ.is_custom: typ = typ.get_struct_type() if typ.is_struct: if isinstance(value, tuple): member_values = [t.toctypes()(value[i]) for i, t in enumerate(typ)] else: member_values = [t.toctypes()(getattr(value, t.name)) for t in typ] ctypes_arguments.extend(member_values) elif typ.is_pointer: if isinstance(value, ctypes.c_void_p): value = ctypes.cast(value, ctypes_typ) else: value = ctypes.cast(value, ctypes_typ) ctypes_arguments.append(value) else: ctypes_arguments.append(value) r = ef[1](*ctypes_arguments) if sig[0].is_pointer and sig[0][0].is_void and isinstance(r, int): r = ctypes.c_void_p(r) if self.debug: print(f'-> {r}') if hasattr(r, 'topython'): return r.topython() return r @dispatchermethod def python(self, statement: str) -> int: if self.debug: print(f'python({statement!r})') exec(statement, self.python_globals, self.python_locals) return True class DebugDispatcherRJIT(DispatcherRJIT): debug = True class LocalClient(object): def __init__(self, debug=False, use_tracing_allocator=False): self.dispatcher = DispatcherRJIT(None, debug=debug, use_tracing_allocator=use_tracing_allocator) def __call__(self, **services): results = {} for service_name, query_dict in services.items(): results[service_name] = {} for mthname, args in query_dict.items(): mth = getattr(self.dispatcher, mthname) mth = inspect.unwrap(mth) results[service_name][mthname] = mth(self.dispatcher, *args) return results
true
true
f72b8471d48e46d56ffa1ffa9f9a1797ba37c49a
521
py
Python
objectivec/test/testdata/single_add_gen.py
kimjungwow/onnxruntime-riscv
3c21abef03190648fe68a6633ac026725e6dfc58
[ "MIT" ]
18
2020-05-19T12:48:07.000Z
2021-04-28T06:41:57.000Z
objectivec/test/testdata/single_add_gen.py
kimjungwow/onnxruntime-riscv
3c21abef03190648fe68a6633ac026725e6dfc58
[ "MIT" ]
61
2021-05-31T05:15:41.000Z
2022-03-29T22:34:33.000Z
objectivec/test/testdata/single_add_gen.py
ekmixon/onnxruntime
1ab8a95eb6675afb6d0ad9d93600ef0022e2ddb5
[ "MIT" ]
9
2021-05-14T20:17:26.000Z
2022-03-20T11:44:29.000Z
import onnx from onnx import helper from onnx import TensorProto graph = helper.make_graph( [ # nodes helper.make_node("Add", ["A", "B"], ["C"], "Add"), ], "SingleAdd", # name [ # inputs helper.make_tensor_value_info('A', TensorProto.FLOAT, [1]), helper.make_tensor_value_info('B', TensorProto.FLOAT, [1]), ], [ # outputs helper.make_tensor_value_info('C', TensorProto.FLOAT, [1]), ]) model = helper.make_model(graph) onnx.save(model, r'single_add.onnx')
26.05
67
0.619962
import onnx from onnx import helper from onnx import TensorProto graph = helper.make_graph( [ helper.make_node("Add", ["A", "B"], ["C"], "Add"), ], "SingleAdd", [ helper.make_tensor_value_info('A', TensorProto.FLOAT, [1]), helper.make_tensor_value_info('B', TensorProto.FLOAT, [1]), ], [ helper.make_tensor_value_info('C', TensorProto.FLOAT, [1]), ]) model = helper.make_model(graph) onnx.save(model, r'single_add.onnx')
true
true
f72b855250840e726278906521e0e8944c433f43
426
py
Python
src/ploomber/sources/__init__.py
MarcoJHB/ploomber
4849ef6915572f7934392443b4faf138172b9596
[ "Apache-2.0" ]
2,141
2020-02-14T02:34:34.000Z
2022-03-31T22:43:20.000Z
src/ploomber/sources/__init__.py
MarcoJHB/ploomber
4849ef6915572f7934392443b4faf138172b9596
[ "Apache-2.0" ]
660
2020-02-06T16:15:57.000Z
2022-03-31T22:55:01.000Z
src/ploomber/sources/__init__.py
MarcoJHB/ploomber
4849ef6915572f7934392443b4faf138172b9596
[ "Apache-2.0" ]
122
2020-02-14T18:53:05.000Z
2022-03-27T22:33:24.000Z
from ploomber.sources.sources import (SQLScriptSource, SQLQuerySource, GenericSource, FileSource, EmptySource) from ploomber.sources.notebooksource import NotebookSource from ploomber.sources.pythoncallablesource import PythonCallableSource __all__ = [ 'PythonCallableSource', 'SQLScriptSource', 'SQLQuerySource', 'GenericSource', 'FileSource', 'NotebookSource', 'EmptySource' ]
42.6
77
0.744131
from ploomber.sources.sources import (SQLScriptSource, SQLQuerySource, GenericSource, FileSource, EmptySource) from ploomber.sources.notebooksource import NotebookSource from ploomber.sources.pythoncallablesource import PythonCallableSource __all__ = [ 'PythonCallableSource', 'SQLScriptSource', 'SQLQuerySource', 'GenericSource', 'FileSource', 'NotebookSource', 'EmptySource' ]
true
true
f72b86570c3337610eec48f13a1fb108a1bdff30
21,794
py
Python
sdk/network/azure-mgmt-network/azure/mgmt/network/v2019_08_01/operations/_vpn_connections_operations.py
beltr0n/azure-sdk-for-python
2f7fb8bee881b0fc0386a0ad5385755ceedd0453
[ "MIT" ]
2
2021-03-24T06:26:11.000Z
2021-04-18T15:55:59.000Z
sdk/network/azure-mgmt-network/azure/mgmt/network/v2019_08_01/operations/_vpn_connections_operations.py
beltr0n/azure-sdk-for-python
2f7fb8bee881b0fc0386a0ad5385755ceedd0453
[ "MIT" ]
4
2019-04-17T17:57:49.000Z
2020-04-24T21:11:22.000Z
sdk/network/azure-mgmt-network/azure/mgmt/network/v2019_08_01/operations/_vpn_connections_operations.py
beltr0n/azure-sdk-for-python
2f7fb8bee881b0fc0386a0ad5385755ceedd0453
[ "MIT" ]
2
2021-05-23T16:46:31.000Z
2021-05-26T23:51:09.000Z
# coding=utf-8 # -------------------------------------------------------------------------- # Copyright (c) Microsoft Corporation. All rights reserved. # Licensed under the MIT License. See License.txt in the project root for license information. # Code generated by Microsoft (R) AutoRest Code Generator. # Changes may cause incorrect behavior and will be lost if the code is regenerated. # -------------------------------------------------------------------------- from typing import TYPE_CHECKING import warnings from azure.core.exceptions import ClientAuthenticationError, HttpResponseError, ResourceExistsError, ResourceNotFoundError, map_error from azure.core.paging import ItemPaged from azure.core.pipeline import PipelineResponse from azure.core.pipeline.transport import HttpRequest, HttpResponse from azure.core.polling import LROPoller, NoPolling, PollingMethod from azure.mgmt.core.exceptions import ARMErrorFormat from azure.mgmt.core.polling.arm_polling import ARMPolling from .. import models as _models if TYPE_CHECKING: # pylint: disable=unused-import,ungrouped-imports from typing import Any, Callable, Dict, Generic, Iterable, Optional, TypeVar, Union T = TypeVar('T') ClsType = Optional[Callable[[PipelineResponse[HttpRequest, HttpResponse], T, Dict[str, Any]], Any]] class VpnConnectionsOperations(object): """VpnConnectionsOperations operations. You should not instantiate this class directly. Instead, you should create a Client instance that instantiates it for you and attaches it as an attribute. :ivar models: Alias to model classes used in this operation group. :type models: ~azure.mgmt.network.v2019_08_01.models :param client: Client for service requests. :param config: Configuration of service client. :param serializer: An object model serializer. :param deserializer: An object model deserializer. """ models = _models def __init__(self, client, config, serializer, deserializer): self._client = client self._serialize = serializer self._deserialize = deserializer self._config = config def get( self, resource_group_name, # type: str gateway_name, # type: str connection_name, # type: str **kwargs # type: Any ): # type: (...) -> "_models.VpnConnection" """Retrieves the details of a vpn connection. :param resource_group_name: The resource group name of the VpnGateway. :type resource_group_name: str :param gateway_name: The name of the gateway. :type gateway_name: str :param connection_name: The name of the vpn connection. :type connection_name: str :keyword callable cls: A custom type or function that will be passed the direct response :return: VpnConnection, or the result of cls(response) :rtype: ~azure.mgmt.network.v2019_08_01.models.VpnConnection :raises: ~azure.core.exceptions.HttpResponseError """ cls = kwargs.pop('cls', None) # type: ClsType["_models.VpnConnection"] error_map = { 401: ClientAuthenticationError, 404: ResourceNotFoundError, 409: ResourceExistsError } error_map.update(kwargs.pop('error_map', {})) api_version = "2019-08-01" accept = "application/json" # Construct URL url = self.get.metadata['url'] # type: ignore path_format_arguments = { 'subscriptionId': self._serialize.url("self._config.subscription_id", self._config.subscription_id, 'str'), 'resourceGroupName': self._serialize.url("resource_group_name", resource_group_name, 'str'), 'gatewayName': self._serialize.url("gateway_name", gateway_name, 'str'), 'connectionName': self._serialize.url("connection_name", connection_name, 'str'), } url = self._client.format_url(url, **path_format_arguments) # Construct parameters query_parameters = {} # type: Dict[str, Any] query_parameters['api-version'] = self._serialize.query("api_version", api_version, 'str') # Construct headers header_parameters = {} # type: Dict[str, Any] header_parameters['Accept'] = self._serialize.header("accept", accept, 'str') request = self._client.get(url, query_parameters, header_parameters) pipeline_response = self._client._pipeline.run(request, stream=False, **kwargs) response = pipeline_response.http_response if response.status_code not in [200]: map_error(status_code=response.status_code, response=response, error_map=error_map) raise HttpResponseError(response=response, error_format=ARMErrorFormat) deserialized = self._deserialize('VpnConnection', pipeline_response) if cls: return cls(pipeline_response, deserialized, {}) return deserialized get.metadata = {'url': '/subscriptions/{subscriptionId}/resourceGroups/{resourceGroupName}/providers/Microsoft.Network/vpnGateways/{gatewayName}/vpnConnections/{connectionName}'} # type: ignore def _create_or_update_initial( self, resource_group_name, # type: str gateway_name, # type: str connection_name, # type: str vpn_connection_parameters, # type: "_models.VpnConnection" **kwargs # type: Any ): # type: (...) -> "_models.VpnConnection" cls = kwargs.pop('cls', None) # type: ClsType["_models.VpnConnection"] error_map = { 401: ClientAuthenticationError, 404: ResourceNotFoundError, 409: ResourceExistsError } error_map.update(kwargs.pop('error_map', {})) api_version = "2019-08-01" content_type = kwargs.pop("content_type", "application/json") accept = "application/json" # Construct URL url = self._create_or_update_initial.metadata['url'] # type: ignore path_format_arguments = { 'subscriptionId': self._serialize.url("self._config.subscription_id", self._config.subscription_id, 'str'), 'resourceGroupName': self._serialize.url("resource_group_name", resource_group_name, 'str'), 'gatewayName': self._serialize.url("gateway_name", gateway_name, 'str'), 'connectionName': self._serialize.url("connection_name", connection_name, 'str'), } url = self._client.format_url(url, **path_format_arguments) # Construct parameters query_parameters = {} # type: Dict[str, Any] query_parameters['api-version'] = self._serialize.query("api_version", api_version, 'str') # Construct headers header_parameters = {} # type: Dict[str, Any] header_parameters['Content-Type'] = self._serialize.header("content_type", content_type, 'str') header_parameters['Accept'] = self._serialize.header("accept", accept, 'str') body_content_kwargs = {} # type: Dict[str, Any] body_content = self._serialize.body(vpn_connection_parameters, 'VpnConnection') body_content_kwargs['content'] = body_content request = self._client.put(url, query_parameters, header_parameters, **body_content_kwargs) pipeline_response = self._client._pipeline.run(request, stream=False, **kwargs) response = pipeline_response.http_response if response.status_code not in [200, 201]: map_error(status_code=response.status_code, response=response, error_map=error_map) raise HttpResponseError(response=response, error_format=ARMErrorFormat) if response.status_code == 200: deserialized = self._deserialize('VpnConnection', pipeline_response) if response.status_code == 201: deserialized = self._deserialize('VpnConnection', pipeline_response) if cls: return cls(pipeline_response, deserialized, {}) return deserialized _create_or_update_initial.metadata = {'url': '/subscriptions/{subscriptionId}/resourceGroups/{resourceGroupName}/providers/Microsoft.Network/vpnGateways/{gatewayName}/vpnConnections/{connectionName}'} # type: ignore def begin_create_or_update( self, resource_group_name, # type: str gateway_name, # type: str connection_name, # type: str vpn_connection_parameters, # type: "_models.VpnConnection" **kwargs # type: Any ): # type: (...) -> LROPoller["_models.VpnConnection"] """Creates a vpn connection to a scalable vpn gateway if it doesn't exist else updates the existing connection. :param resource_group_name: The resource group name of the VpnGateway. :type resource_group_name: str :param gateway_name: The name of the gateway. :type gateway_name: str :param connection_name: The name of the connection. :type connection_name: str :param vpn_connection_parameters: Parameters supplied to create or Update a VPN Connection. :type vpn_connection_parameters: ~azure.mgmt.network.v2019_08_01.models.VpnConnection :keyword callable cls: A custom type or function that will be passed the direct response :keyword str continuation_token: A continuation token to restart a poller from a saved state. :keyword polling: True for ARMPolling, False for no polling, or a polling object for personal polling strategy :paramtype polling: bool or ~azure.core.polling.PollingMethod :keyword int polling_interval: Default waiting time between two polls for LRO operations if no Retry-After header is present. :return: An instance of LROPoller that returns either VpnConnection or the result of cls(response) :rtype: ~azure.core.polling.LROPoller[~azure.mgmt.network.v2019_08_01.models.VpnConnection] :raises ~azure.core.exceptions.HttpResponseError: """ polling = kwargs.pop('polling', True) # type: Union[bool, PollingMethod] cls = kwargs.pop('cls', None) # type: ClsType["_models.VpnConnection"] lro_delay = kwargs.pop( 'polling_interval', self._config.polling_interval ) cont_token = kwargs.pop('continuation_token', None) # type: Optional[str] if cont_token is None: raw_result = self._create_or_update_initial( resource_group_name=resource_group_name, gateway_name=gateway_name, connection_name=connection_name, vpn_connection_parameters=vpn_connection_parameters, cls=lambda x,y,z: x, **kwargs ) kwargs.pop('error_map', None) kwargs.pop('content_type', None) def get_long_running_output(pipeline_response): deserialized = self._deserialize('VpnConnection', pipeline_response) if cls: return cls(pipeline_response, deserialized, {}) return deserialized path_format_arguments = { 'subscriptionId': self._serialize.url("self._config.subscription_id", self._config.subscription_id, 'str'), 'resourceGroupName': self._serialize.url("resource_group_name", resource_group_name, 'str'), 'gatewayName': self._serialize.url("gateway_name", gateway_name, 'str'), 'connectionName': self._serialize.url("connection_name", connection_name, 'str'), } if polling is True: polling_method = ARMPolling(lro_delay, lro_options={'final-state-via': 'azure-async-operation'}, path_format_arguments=path_format_arguments, **kwargs) elif polling is False: polling_method = NoPolling() else: polling_method = polling if cont_token: return LROPoller.from_continuation_token( polling_method=polling_method, continuation_token=cont_token, client=self._client, deserialization_callback=get_long_running_output ) else: return LROPoller(self._client, raw_result, get_long_running_output, polling_method) begin_create_or_update.metadata = {'url': '/subscriptions/{subscriptionId}/resourceGroups/{resourceGroupName}/providers/Microsoft.Network/vpnGateways/{gatewayName}/vpnConnections/{connectionName}'} # type: ignore def _delete_initial( self, resource_group_name, # type: str gateway_name, # type: str connection_name, # type: str **kwargs # type: Any ): # type: (...) -> None cls = kwargs.pop('cls', None) # type: ClsType[None] error_map = { 401: ClientAuthenticationError, 404: ResourceNotFoundError, 409: ResourceExistsError } error_map.update(kwargs.pop('error_map', {})) api_version = "2019-08-01" accept = "application/json" # Construct URL url = self._delete_initial.metadata['url'] # type: ignore path_format_arguments = { 'subscriptionId': self._serialize.url("self._config.subscription_id", self._config.subscription_id, 'str'), 'resourceGroupName': self._serialize.url("resource_group_name", resource_group_name, 'str'), 'gatewayName': self._serialize.url("gateway_name", gateway_name, 'str'), 'connectionName': self._serialize.url("connection_name", connection_name, 'str'), } url = self._client.format_url(url, **path_format_arguments) # Construct parameters query_parameters = {} # type: Dict[str, Any] query_parameters['api-version'] = self._serialize.query("api_version", api_version, 'str') # Construct headers header_parameters = {} # type: Dict[str, Any] header_parameters['Accept'] = self._serialize.header("accept", accept, 'str') request = self._client.delete(url, query_parameters, header_parameters) pipeline_response = self._client._pipeline.run(request, stream=False, **kwargs) response = pipeline_response.http_response if response.status_code not in [200, 202, 204]: map_error(status_code=response.status_code, response=response, error_map=error_map) raise HttpResponseError(response=response, error_format=ARMErrorFormat) if cls: return cls(pipeline_response, None, {}) _delete_initial.metadata = {'url': '/subscriptions/{subscriptionId}/resourceGroups/{resourceGroupName}/providers/Microsoft.Network/vpnGateways/{gatewayName}/vpnConnections/{connectionName}'} # type: ignore def begin_delete( self, resource_group_name, # type: str gateway_name, # type: str connection_name, # type: str **kwargs # type: Any ): # type: (...) -> LROPoller[None] """Deletes a vpn connection. :param resource_group_name: The resource group name of the VpnGateway. :type resource_group_name: str :param gateway_name: The name of the gateway. :type gateway_name: str :param connection_name: The name of the connection. :type connection_name: str :keyword callable cls: A custom type or function that will be passed the direct response :keyword str continuation_token: A continuation token to restart a poller from a saved state. :keyword polling: True for ARMPolling, False for no polling, or a polling object for personal polling strategy :paramtype polling: bool or ~azure.core.polling.PollingMethod :keyword int polling_interval: Default waiting time between two polls for LRO operations if no Retry-After header is present. :return: An instance of LROPoller that returns either None or the result of cls(response) :rtype: ~azure.core.polling.LROPoller[None] :raises ~azure.core.exceptions.HttpResponseError: """ polling = kwargs.pop('polling', True) # type: Union[bool, PollingMethod] cls = kwargs.pop('cls', None) # type: ClsType[None] lro_delay = kwargs.pop( 'polling_interval', self._config.polling_interval ) cont_token = kwargs.pop('continuation_token', None) # type: Optional[str] if cont_token is None: raw_result = self._delete_initial( resource_group_name=resource_group_name, gateway_name=gateway_name, connection_name=connection_name, cls=lambda x,y,z: x, **kwargs ) kwargs.pop('error_map', None) kwargs.pop('content_type', None) def get_long_running_output(pipeline_response): if cls: return cls(pipeline_response, None, {}) path_format_arguments = { 'subscriptionId': self._serialize.url("self._config.subscription_id", self._config.subscription_id, 'str'), 'resourceGroupName': self._serialize.url("resource_group_name", resource_group_name, 'str'), 'gatewayName': self._serialize.url("gateway_name", gateway_name, 'str'), 'connectionName': self._serialize.url("connection_name", connection_name, 'str'), } if polling is True: polling_method = ARMPolling(lro_delay, lro_options={'final-state-via': 'location'}, path_format_arguments=path_format_arguments, **kwargs) elif polling is False: polling_method = NoPolling() else: polling_method = polling if cont_token: return LROPoller.from_continuation_token( polling_method=polling_method, continuation_token=cont_token, client=self._client, deserialization_callback=get_long_running_output ) else: return LROPoller(self._client, raw_result, get_long_running_output, polling_method) begin_delete.metadata = {'url': '/subscriptions/{subscriptionId}/resourceGroups/{resourceGroupName}/providers/Microsoft.Network/vpnGateways/{gatewayName}/vpnConnections/{connectionName}'} # type: ignore def list_by_vpn_gateway( self, resource_group_name, # type: str gateway_name, # type: str **kwargs # type: Any ): # type: (...) -> Iterable["_models.ListVpnConnectionsResult"] """Retrieves all vpn connections for a particular virtual wan vpn gateway. :param resource_group_name: The resource group name of the VpnGateway. :type resource_group_name: str :param gateway_name: The name of the gateway. :type gateway_name: str :keyword callable cls: A custom type or function that will be passed the direct response :return: An iterator like instance of either ListVpnConnectionsResult or the result of cls(response) :rtype: ~azure.core.paging.ItemPaged[~azure.mgmt.network.v2019_08_01.models.ListVpnConnectionsResult] :raises: ~azure.core.exceptions.HttpResponseError """ cls = kwargs.pop('cls', None) # type: ClsType["_models.ListVpnConnectionsResult"] error_map = { 401: ClientAuthenticationError, 404: ResourceNotFoundError, 409: ResourceExistsError } error_map.update(kwargs.pop('error_map', {})) api_version = "2019-08-01" accept = "application/json" def prepare_request(next_link=None): # Construct headers header_parameters = {} # type: Dict[str, Any] header_parameters['Accept'] = self._serialize.header("accept", accept, 'str') if not next_link: # Construct URL url = self.list_by_vpn_gateway.metadata['url'] # type: ignore path_format_arguments = { 'subscriptionId': self._serialize.url("self._config.subscription_id", self._config.subscription_id, 'str'), 'resourceGroupName': self._serialize.url("resource_group_name", resource_group_name, 'str'), 'gatewayName': self._serialize.url("gateway_name", gateway_name, 'str'), } url = self._client.format_url(url, **path_format_arguments) # Construct parameters query_parameters = {} # type: Dict[str, Any] query_parameters['api-version'] = self._serialize.query("api_version", api_version, 'str') request = self._client.get(url, query_parameters, header_parameters) else: url = next_link query_parameters = {} # type: Dict[str, Any] request = self._client.get(url, query_parameters, header_parameters) return request def extract_data(pipeline_response): deserialized = self._deserialize('ListVpnConnectionsResult', pipeline_response) list_of_elem = deserialized.value if cls: list_of_elem = cls(list_of_elem) return deserialized.next_link or None, iter(list_of_elem) def get_next(next_link=None): request = prepare_request(next_link) pipeline_response = self._client._pipeline.run(request, stream=False, **kwargs) response = pipeline_response.http_response if response.status_code not in [200]: map_error(status_code=response.status_code, response=response, error_map=error_map) raise HttpResponseError(response=response, error_format=ARMErrorFormat) return pipeline_response return ItemPaged( get_next, extract_data ) list_by_vpn_gateway.metadata = {'url': '/subscriptions/{subscriptionId}/resourceGroups/{resourceGroupName}/providers/Microsoft.Network/vpnGateways/{gatewayName}/vpnConnections'} # type: ignore
49.307692
220
0.663944
from typing import TYPE_CHECKING import warnings from azure.core.exceptions import ClientAuthenticationError, HttpResponseError, ResourceExistsError, ResourceNotFoundError, map_error from azure.core.paging import ItemPaged from azure.core.pipeline import PipelineResponse from azure.core.pipeline.transport import HttpRequest, HttpResponse from azure.core.polling import LROPoller, NoPolling, PollingMethod from azure.mgmt.core.exceptions import ARMErrorFormat from azure.mgmt.core.polling.arm_polling import ARMPolling from .. import models as _models if TYPE_CHECKING: from typing import Any, Callable, Dict, Generic, Iterable, Optional, TypeVar, Union T = TypeVar('T') ClsType = Optional[Callable[[PipelineResponse[HttpRequest, HttpResponse], T, Dict[str, Any]], Any]] class VpnConnectionsOperations(object): models = _models def __init__(self, client, config, serializer, deserializer): self._client = client self._serialize = serializer self._deserialize = deserializer self._config = config def get( self, resource_group_name, gateway_name, connection_name, **kwargs ): cls = kwargs.pop('cls', None) error_map = { 401: ClientAuthenticationError, 404: ResourceNotFoundError, 409: ResourceExistsError } error_map.update(kwargs.pop('error_map', {})) api_version = "2019-08-01" accept = "application/json" url = self.get.metadata['url'] path_format_arguments = { 'subscriptionId': self._serialize.url("self._config.subscription_id", self._config.subscription_id, 'str'), 'resourceGroupName': self._serialize.url("resource_group_name", resource_group_name, 'str'), 'gatewayName': self._serialize.url("gateway_name", gateway_name, 'str'), 'connectionName': self._serialize.url("connection_name", connection_name, 'str'), } url = self._client.format_url(url, **path_format_arguments) query_parameters = {} query_parameters['api-version'] = self._serialize.query("api_version", api_version, 'str') header_parameters = {} header_parameters['Accept'] = self._serialize.header("accept", accept, 'str') request = self._client.get(url, query_parameters, header_parameters) pipeline_response = self._client._pipeline.run(request, stream=False, **kwargs) response = pipeline_response.http_response if response.status_code not in [200]: map_error(status_code=response.status_code, response=response, error_map=error_map) raise HttpResponseError(response=response, error_format=ARMErrorFormat) deserialized = self._deserialize('VpnConnection', pipeline_response) if cls: return cls(pipeline_response, deserialized, {}) return deserialized get.metadata = {'url': '/subscriptions/{subscriptionId}/resourceGroups/{resourceGroupName}/providers/Microsoft.Network/vpnGateways/{gatewayName}/vpnConnections/{connectionName}'} def _create_or_update_initial( self, resource_group_name, gateway_name, connection_name, vpn_connection_parameters, **kwargs ): cls = kwargs.pop('cls', None) error_map = { 401: ClientAuthenticationError, 404: ResourceNotFoundError, 409: ResourceExistsError } error_map.update(kwargs.pop('error_map', {})) api_version = "2019-08-01" content_type = kwargs.pop("content_type", "application/json") accept = "application/json" url = self._create_or_update_initial.metadata['url'] path_format_arguments = { 'subscriptionId': self._serialize.url("self._config.subscription_id", self._config.subscription_id, 'str'), 'resourceGroupName': self._serialize.url("resource_group_name", resource_group_name, 'str'), 'gatewayName': self._serialize.url("gateway_name", gateway_name, 'str'), 'connectionName': self._serialize.url("connection_name", connection_name, 'str'), } url = self._client.format_url(url, **path_format_arguments) query_parameters = {} query_parameters['api-version'] = self._serialize.query("api_version", api_version, 'str') header_parameters = {} header_parameters['Content-Type'] = self._serialize.header("content_type", content_type, 'str') header_parameters['Accept'] = self._serialize.header("accept", accept, 'str') body_content_kwargs = {} body_content = self._serialize.body(vpn_connection_parameters, 'VpnConnection') body_content_kwargs['content'] = body_content request = self._client.put(url, query_parameters, header_parameters, **body_content_kwargs) pipeline_response = self._client._pipeline.run(request, stream=False, **kwargs) response = pipeline_response.http_response if response.status_code not in [200, 201]: map_error(status_code=response.status_code, response=response, error_map=error_map) raise HttpResponseError(response=response, error_format=ARMErrorFormat) if response.status_code == 200: deserialized = self._deserialize('VpnConnection', pipeline_response) if response.status_code == 201: deserialized = self._deserialize('VpnConnection', pipeline_response) if cls: return cls(pipeline_response, deserialized, {}) return deserialized _create_or_update_initial.metadata = {'url': '/subscriptions/{subscriptionId}/resourceGroups/{resourceGroupName}/providers/Microsoft.Network/vpnGateways/{gatewayName}/vpnConnections/{connectionName}'} def begin_create_or_update( self, resource_group_name, gateway_name, connection_name, vpn_connection_parameters, **kwargs ): polling = kwargs.pop('polling', True) cls = kwargs.pop('cls', None) lro_delay = kwargs.pop( 'polling_interval', self._config.polling_interval ) cont_token = kwargs.pop('continuation_token', None) if cont_token is None: raw_result = self._create_or_update_initial( resource_group_name=resource_group_name, gateway_name=gateway_name, connection_name=connection_name, vpn_connection_parameters=vpn_connection_parameters, cls=lambda x,y,z: x, **kwargs ) kwargs.pop('error_map', None) kwargs.pop('content_type', None) def get_long_running_output(pipeline_response): deserialized = self._deserialize('VpnConnection', pipeline_response) if cls: return cls(pipeline_response, deserialized, {}) return deserialized path_format_arguments = { 'subscriptionId': self._serialize.url("self._config.subscription_id", self._config.subscription_id, 'str'), 'resourceGroupName': self._serialize.url("resource_group_name", resource_group_name, 'str'), 'gatewayName': self._serialize.url("gateway_name", gateway_name, 'str'), 'connectionName': self._serialize.url("connection_name", connection_name, 'str'), } if polling is True: polling_method = ARMPolling(lro_delay, lro_options={'final-state-via': 'azure-async-operation'}, path_format_arguments=path_format_arguments, **kwargs) elif polling is False: polling_method = NoPolling() else: polling_method = polling if cont_token: return LROPoller.from_continuation_token( polling_method=polling_method, continuation_token=cont_token, client=self._client, deserialization_callback=get_long_running_output ) else: return LROPoller(self._client, raw_result, get_long_running_output, polling_method) begin_create_or_update.metadata = {'url': '/subscriptions/{subscriptionId}/resourceGroups/{resourceGroupName}/providers/Microsoft.Network/vpnGateways/{gatewayName}/vpnConnections/{connectionName}'} def _delete_initial( self, resource_group_name, gateway_name, connection_name, **kwargs ): cls = kwargs.pop('cls', None) error_map = { 401: ClientAuthenticationError, 404: ResourceNotFoundError, 409: ResourceExistsError } error_map.update(kwargs.pop('error_map', {})) api_version = "2019-08-01" accept = "application/json" url = self._delete_initial.metadata['url'] path_format_arguments = { 'subscriptionId': self._serialize.url("self._config.subscription_id", self._config.subscription_id, 'str'), 'resourceGroupName': self._serialize.url("resource_group_name", resource_group_name, 'str'), 'gatewayName': self._serialize.url("gateway_name", gateway_name, 'str'), 'connectionName': self._serialize.url("connection_name", connection_name, 'str'), } url = self._client.format_url(url, **path_format_arguments) query_parameters = {} query_parameters['api-version'] = self._serialize.query("api_version", api_version, 'str') header_parameters = {} header_parameters['Accept'] = self._serialize.header("accept", accept, 'str') request = self._client.delete(url, query_parameters, header_parameters) pipeline_response = self._client._pipeline.run(request, stream=False, **kwargs) response = pipeline_response.http_response if response.status_code not in [200, 202, 204]: map_error(status_code=response.status_code, response=response, error_map=error_map) raise HttpResponseError(response=response, error_format=ARMErrorFormat) if cls: return cls(pipeline_response, None, {}) _delete_initial.metadata = {'url': '/subscriptions/{subscriptionId}/resourceGroups/{resourceGroupName}/providers/Microsoft.Network/vpnGateways/{gatewayName}/vpnConnections/{connectionName}'} def begin_delete( self, resource_group_name, gateway_name, connection_name, **kwargs ): polling = kwargs.pop('polling', True) cls = kwargs.pop('cls', None) lro_delay = kwargs.pop( 'polling_interval', self._config.polling_interval ) cont_token = kwargs.pop('continuation_token', None) if cont_token is None: raw_result = self._delete_initial( resource_group_name=resource_group_name, gateway_name=gateway_name, connection_name=connection_name, cls=lambda x,y,z: x, **kwargs ) kwargs.pop('error_map', None) kwargs.pop('content_type', None) def get_long_running_output(pipeline_response): if cls: return cls(pipeline_response, None, {}) path_format_arguments = { 'subscriptionId': self._serialize.url("self._config.subscription_id", self._config.subscription_id, 'str'), 'resourceGroupName': self._serialize.url("resource_group_name", resource_group_name, 'str'), 'gatewayName': self._serialize.url("gateway_name", gateway_name, 'str'), 'connectionName': self._serialize.url("connection_name", connection_name, 'str'), } if polling is True: polling_method = ARMPolling(lro_delay, lro_options={'final-state-via': 'location'}, path_format_arguments=path_format_arguments, **kwargs) elif polling is False: polling_method = NoPolling() else: polling_method = polling if cont_token: return LROPoller.from_continuation_token( polling_method=polling_method, continuation_token=cont_token, client=self._client, deserialization_callback=get_long_running_output ) else: return LROPoller(self._client, raw_result, get_long_running_output, polling_method) begin_delete.metadata = {'url': '/subscriptions/{subscriptionId}/resourceGroups/{resourceGroupName}/providers/Microsoft.Network/vpnGateways/{gatewayName}/vpnConnections/{connectionName}'} def list_by_vpn_gateway( self, resource_group_name, gateway_name, **kwargs ): cls = kwargs.pop('cls', None) error_map = { 401: ClientAuthenticationError, 404: ResourceNotFoundError, 409: ResourceExistsError } error_map.update(kwargs.pop('error_map', {})) api_version = "2019-08-01" accept = "application/json" def prepare_request(next_link=None): header_parameters = {} header_parameters['Accept'] = self._serialize.header("accept", accept, 'str') if not next_link: url = self.list_by_vpn_gateway.metadata['url'] path_format_arguments = { 'subscriptionId': self._serialize.url("self._config.subscription_id", self._config.subscription_id, 'str'), 'resourceGroupName': self._serialize.url("resource_group_name", resource_group_name, 'str'), 'gatewayName': self._serialize.url("gateway_name", gateway_name, 'str'), } url = self._client.format_url(url, **path_format_arguments) query_parameters = {} query_parameters['api-version'] = self._serialize.query("api_version", api_version, 'str') request = self._client.get(url, query_parameters, header_parameters) else: url = next_link query_parameters = {} request = self._client.get(url, query_parameters, header_parameters) return request def extract_data(pipeline_response): deserialized = self._deserialize('ListVpnConnectionsResult', pipeline_response) list_of_elem = deserialized.value if cls: list_of_elem = cls(list_of_elem) return deserialized.next_link or None, iter(list_of_elem) def get_next(next_link=None): request = prepare_request(next_link) pipeline_response = self._client._pipeline.run(request, stream=False, **kwargs) response = pipeline_response.http_response if response.status_code not in [200]: map_error(status_code=response.status_code, response=response, error_map=error_map) raise HttpResponseError(response=response, error_format=ARMErrorFormat) return pipeline_response return ItemPaged( get_next, extract_data ) list_by_vpn_gateway.metadata = {'url': '/subscriptions/{subscriptionId}/resourceGroups/{resourceGroupName}/providers/Microsoft.Network/vpnGateways/{gatewayName}/vpnConnections'}
true
true
f72b87aee4ad934ef97feead34023c03afde9798
1,084
py
Python
cloudfunc/client.py
jadbin/cloudfunc
6d54bd993a784d20baba34e8ff897401efb12a22
[ "MIT" ]
2
2020-08-03T11:39:29.000Z
2020-08-05T07:09:17.000Z
cloudfunc/client.py
jadbin/cloudfunc
6d54bd993a784d20baba34e8ff897401efb12a22
[ "MIT" ]
null
null
null
cloudfunc/client.py
jadbin/cloudfunc
6d54bd993a784d20baba34e8ff897401efb12a22
[ "MIT" ]
null
null
null
# coding=utf-8 import os import pickle import requests from .errors import CloudFuncError class CloudFuncClient: def __init__(self, serve_address: str = None): if serve_address is None: serve_address = os.environ['CLOUDFUNC_SERVE_ADDRESS'] assert serve_address is not None, 'cloudfunc-serve address is not given' self.serve_address = serve_address self.session = requests.Session() def run(self, cloud_func_name: str, *args, **kwargs): data = pickle.dumps((args, kwargs)) try: resp = self.session.post( f'http://{self.serve_address}/cloud-funcs/run', params={'name': cloud_func_name}, data=data, headers={'Content-Type': 'application/octet-stream'} ) except Exception as e: raise CloudFuncError(e) else: try: resp.raise_for_status() except requests.HTTPError: raise CloudFuncError(resp.text) return pickle.loads(resp.content)
30.111111
80
0.595941
import os import pickle import requests from .errors import CloudFuncError class CloudFuncClient: def __init__(self, serve_address: str = None): if serve_address is None: serve_address = os.environ['CLOUDFUNC_SERVE_ADDRESS'] assert serve_address is not None, 'cloudfunc-serve address is not given' self.serve_address = serve_address self.session = requests.Session() def run(self, cloud_func_name: str, *args, **kwargs): data = pickle.dumps((args, kwargs)) try: resp = self.session.post( f'http://{self.serve_address}/cloud-funcs/run', params={'name': cloud_func_name}, data=data, headers={'Content-Type': 'application/octet-stream'} ) except Exception as e: raise CloudFuncError(e) else: try: resp.raise_for_status() except requests.HTTPError: raise CloudFuncError(resp.text) return pickle.loads(resp.content)
true
true
f72b87c6dad7aa35765c68a88cffd6f561ea82e6
3,138
py
Python
tests/beta_tests/test_shorted_ipv6_address.py
the-zebulan/CodeWars
1eafd1247d60955a5dfb63e4882e8ce86019f43a
[ "MIT" ]
40
2016-03-09T12:26:20.000Z
2022-03-23T08:44:51.000Z
tests/beta_tests/test_shorted_ipv6_address.py
akalynych/CodeWars
1eafd1247d60955a5dfb63e4882e8ce86019f43a
[ "MIT" ]
null
null
null
tests/beta_tests/test_shorted_ipv6_address.py
akalynych/CodeWars
1eafd1247d60955a5dfb63e4882e8ce86019f43a
[ "MIT" ]
36
2016-11-07T19:59:58.000Z
2022-03-31T11:18:27.000Z
import unittest from katas.beta.shorten_ipv6_address import shorten class ShortenIPv6TestCase(unittest.TestCase): def test_equal_1(self): self.assertEqual(shorten('2642:0006:0006:0000:0000:0000:0000:9147'), '2642:6:6::9147') def test_equal_2(self): self.assertEqual(shorten('1234:0000:5678:0000:0000:90AB:0000:CDEF'), '1234:0:5678::90AB:0:CDEF') def test_equal_3(self): self.assertEqual(shorten('1111:0000:0000:2222:0000:0000:3333:4444'), '1111::2222:0:0:3333:4444') def test_equal_4(self): self.assertEqual(shorten('A43B:1CF6:541C:98AA:CC43:1092:E932:90AD'), 'A43B:1CF6:541C:98AA:CC43:1092:E932:90AD') def test_equal_5(self): self.assertEqual(shorten('9000:B004:C13A:594C:19CD:102D:394F:FCD1'), '9000:B004:C13A:594C:19CD:102D:394F:FCD1') def test_equal_6(self): self.assertEqual(shorten('043B:00F6:541C:08AA:0003:1092:000D:90AD'), '43B:F6:541C:8AA:3:1092:D:90AD') def test_equal_7(self): self.assertEqual(shorten('9000:0004:000A:094C:00CD:102D:394F:0001'), '9000:4:A:94C:CD:102D:394F:1') def test_equal_8(self): self.assertEqual(shorten('3BDF:000E:0004:0ECD:0000:0009:3C7F:734F'), '3BDF:E:4:ECD::9:3C7F:734F') def test_equal_9(self): self.assertEqual(shorten('0388:0B7B:004D:0000:00D3:FDC1:E0E8:08D7'), '388:B7B:4D::D3:FDC1:E0E8:8D7') def test_equal_10(self): self.assertEqual(shorten('0018:000A:0F0C:10B2:668D:0000:0000:009B'), '18:A:F0C:10B2:668D::9B') def test_equal_11(self): self.assertEqual(shorten('00AF:0000:0000:0000:0000:704E:EC20:3DAA'), 'AF::704E:EC20:3DAA') def test_equal_12(self): self.assertEqual(shorten('A2A5:03DB:0000:60A5:0000:0005:BD22:0000'), 'A2A5:3DB::60A5:0:5:BD22:0') def test_equal_13(self): self.assertEqual(shorten('0000:0FBA:0000:0000:0000:0000:057E:AFFD'), '0:FBA::57E:AFFD') def test_equal_14(self): self.assertEqual(shorten('0000:0000:0000:0000:0000:0C30:00DA:29CB'), '::C30:DA:29CB') def test_equal_15(self): self.assertEqual(shorten('97CA:4C84:B62B:C3A8:00F4:0000:0000:0000'), '97CA:4C84:B62B:C3A8:F4::') def test_equal_16(self): self.assertEqual(shorten('0000:0391:F08E:0F28:0000:0003:0037:0006'), '::391:F08E:F28:0:3:37:6') def test_equal_17(self): self.assertEqual(shorten('00C8:0000:0243:0050:ED26:008F:0000:0000'), 'C8:0:243:50:ED26:8F::') def test_equal_18(self): self.assertEqual(shorten('0000:0000:0001:0007:0F63:0000:4FF7:0000'), '::1:7:F63:0:4FF7:0') def test_equal_19(self): self.assertEqual(shorten('0000:0000:6B6F:63B3:0000:0001:0000:0000'), '::6B6F:63B3:0:1:0:0')
38.268293
76
0.581899
import unittest from katas.beta.shorten_ipv6_address import shorten class ShortenIPv6TestCase(unittest.TestCase): def test_equal_1(self): self.assertEqual(shorten('2642:0006:0006:0000:0000:0000:0000:9147'), '2642:6:6::9147') def test_equal_2(self): self.assertEqual(shorten('1234:0000:5678:0000:0000:90AB:0000:CDEF'), '1234:0:5678::90AB:0:CDEF') def test_equal_3(self): self.assertEqual(shorten('1111:0000:0000:2222:0000:0000:3333:4444'), '1111::2222:0:0:3333:4444') def test_equal_4(self): self.assertEqual(shorten('A43B:1CF6:541C:98AA:CC43:1092:E932:90AD'), 'A43B:1CF6:541C:98AA:CC43:1092:E932:90AD') def test_equal_5(self): self.assertEqual(shorten('9000:B004:C13A:594C:19CD:102D:394F:FCD1'), '9000:B004:C13A:594C:19CD:102D:394F:FCD1') def test_equal_6(self): self.assertEqual(shorten('043B:00F6:541C:08AA:0003:1092:000D:90AD'), '43B:F6:541C:8AA:3:1092:D:90AD') def test_equal_7(self): self.assertEqual(shorten('9000:0004:000A:094C:00CD:102D:394F:0001'), '9000:4:A:94C:CD:102D:394F:1') def test_equal_8(self): self.assertEqual(shorten('3BDF:000E:0004:0ECD:0000:0009:3C7F:734F'), '3BDF:E:4:ECD::9:3C7F:734F') def test_equal_9(self): self.assertEqual(shorten('0388:0B7B:004D:0000:00D3:FDC1:E0E8:08D7'), '388:B7B:4D::D3:FDC1:E0E8:8D7') def test_equal_10(self): self.assertEqual(shorten('0018:000A:0F0C:10B2:668D:0000:0000:009B'), '18:A:F0C:10B2:668D::9B') def test_equal_11(self): self.assertEqual(shorten('00AF:0000:0000:0000:0000:704E:EC20:3DAA'), 'AF::704E:EC20:3DAA') def test_equal_12(self): self.assertEqual(shorten('A2A5:03DB:0000:60A5:0000:0005:BD22:0000'), 'A2A5:3DB::60A5:0:5:BD22:0') def test_equal_13(self): self.assertEqual(shorten('0000:0FBA:0000:0000:0000:0000:057E:AFFD'), '0:FBA::57E:AFFD') def test_equal_14(self): self.assertEqual(shorten('0000:0000:0000:0000:0000:0C30:00DA:29CB'), '::C30:DA:29CB') def test_equal_15(self): self.assertEqual(shorten('97CA:4C84:B62B:C3A8:00F4:0000:0000:0000'), '97CA:4C84:B62B:C3A8:F4::') def test_equal_16(self): self.assertEqual(shorten('0000:0391:F08E:0F28:0000:0003:0037:0006'), '::391:F08E:F28:0:3:37:6') def test_equal_17(self): self.assertEqual(shorten('00C8:0000:0243:0050:ED26:008F:0000:0000'), 'C8:0:243:50:ED26:8F::') def test_equal_18(self): self.assertEqual(shorten('0000:0000:0001:0007:0F63:0000:4FF7:0000'), '::1:7:F63:0:4FF7:0') def test_equal_19(self): self.assertEqual(shorten('0000:0000:6B6F:63B3:0000:0001:0000:0000'), '::6B6F:63B3:0:1:0:0')
true
true
f72b8813889944a82a8a131828595a1454d68cd2
116,092
py
Python
electrum/lnworker.py
vhn0912/electrum
a65b97d25c3e37c0e77484f1846e537f9d5be274
[ "MIT" ]
1
2022-02-24T14:05:49.000Z
2022-02-24T14:05:49.000Z
electrum/lnworker.py
vhn0912/electrum
a65b97d25c3e37c0e77484f1846e537f9d5be274
[ "MIT" ]
null
null
null
electrum/lnworker.py
vhn0912/electrum
a65b97d25c3e37c0e77484f1846e537f9d5be274
[ "MIT" ]
null
null
null
# Copyright (C) 2018 The Electrum developers # Distributed under the MIT software license, see the accompanying # file LICENCE or http://www.opensource.org/licenses/mit-license.php import asyncio import os from decimal import Decimal import random import time from typing import (Optional, Sequence, Tuple, List, Set, Dict, TYPE_CHECKING, NamedTuple, Union, Mapping, Any, Iterable, AsyncGenerator, DefaultDict) import threading import socket import aiohttp import json from datetime import datetime, timezone from functools import partial from collections import defaultdict import concurrent from concurrent import futures import urllib.parse import dns.resolver import dns.exception from aiorpcx import run_in_thread, NetAddress, ignore_after from . import constants, util from . import keystore from .util import profiler, chunks, OldTaskGroup from .invoices import PR_TYPE_LN, PR_UNPAID, PR_EXPIRED, PR_PAID, PR_INFLIGHT, PR_FAILED, PR_ROUTING, LNInvoice, LN_EXPIRY_NEVER from .util import NetworkRetryManager, JsonRPCClient from .lnutil import LN_MAX_FUNDING_SAT from .keystore import BIP32_KeyStore from .bitcoin import COIN from .bitcoin import opcodes, make_op_return, address_to_scripthash from .transaction import Transaction from .transaction import get_script_type_from_output_script from .crypto import sha256 from .bip32 import BIP32Node from .util import bh2u, bfh, InvoiceError, resolve_dns_srv, is_ip_address, log_exceptions from .crypto import chacha20_encrypt, chacha20_decrypt from .util import ignore_exceptions, make_aiohttp_session from .util import timestamp_to_datetime, random_shuffled_copy from .util import MyEncoder, is_private_netaddress, UnrelatedTransactionException from .logging import Logger from .lntransport import LNTransport, LNResponderTransport, LNTransportBase from .lnpeer import Peer, LN_P2P_NETWORK_TIMEOUT from .lnaddr import lnencode, LnAddr, lndecode from .ecc import der_sig_from_sig_string from .lnchannel import Channel, AbstractChannel from .lnchannel import ChannelState, PeerState, HTLCWithStatus from .lnrater import LNRater from . import lnutil from .lnutil import funding_output_script from .bitcoin import redeem_script_to_address from .lnutil import (Outpoint, LNPeerAddr, get_compressed_pubkey_from_bech32, extract_nodeid, PaymentFailure, split_host_port, ConnStringFormatError, generate_keypair, LnKeyFamily, LOCAL, REMOTE, MIN_FINAL_CLTV_EXPIRY_FOR_INVOICE, NUM_MAX_EDGES_IN_PAYMENT_PATH, SENT, RECEIVED, HTLCOwner, UpdateAddHtlc, Direction, LnFeatures, ShortChannelID, HtlcLog, derive_payment_secret_from_payment_preimage, NoPathFound, InvalidGossipMsg) from .lnutil import ln_dummy_address, ln_compare_features, IncompatibleLightningFeatures from .transaction import PartialTxOutput, PartialTransaction, PartialTxInput from .lnonion import OnionFailureCode, OnionRoutingFailure from .lnmsg import decode_msg from .i18n import _ from .lnrouter import (RouteEdge, LNPaymentRoute, LNPaymentPath, is_route_sane_to_use, NoChannelPolicy, LNPathInconsistent) from .address_synchronizer import TX_HEIGHT_LOCAL from . import lnsweep from .lnwatcher import LNWalletWatcher from .crypto import pw_encode_with_version_and_mac, pw_decode_with_version_and_mac from .lnutil import ImportedChannelBackupStorage, OnchainChannelBackupStorage from .lnchannel import ChannelBackup from .channel_db import UpdateStatus from .channel_db import get_mychannel_info, get_mychannel_policy from .submarine_swaps import SwapManager from .channel_db import ChannelInfo, Policy from .mpp_split import suggest_splits from .trampoline import create_trampoline_route_and_onion, TRAMPOLINE_FEES, is_legacy_relay if TYPE_CHECKING: from .network import Network from .wallet import Abstract_Wallet from .channel_db import ChannelDB from .simple_config import SimpleConfig SAVED_PR_STATUS = [PR_PAID, PR_UNPAID] # status that are persisted NUM_PEERS_TARGET = 4 # onchain channel backup data CB_VERSION = 0 CB_MAGIC_BYTES = bytes([0, 0, 0, CB_VERSION]) FALLBACK_NODE_LIST_TESTNET = ( LNPeerAddr(host='203.132.95.10', port=9735, pubkey=bfh('038863cf8ab91046230f561cd5b386cbff8309fa02e3f0c3ed161a3aeb64a643b9')), LNPeerAddr(host='2401:d002:4402:0:bf1d:986a:7598:6d49', port=9735, pubkey=bfh('038863cf8ab91046230f561cd5b386cbff8309fa02e3f0c3ed161a3aeb64a643b9')), LNPeerAddr(host='50.116.3.223', port=9734, pubkey=bfh('03236a685d30096b26692dce0cf0fa7c8528bdf61dbf5363a3ef6d5c92733a3016')), LNPeerAddr(host='3.16.119.191', port=9735, pubkey=bfh('03d5e17a3c213fe490e1b0c389f8cfcfcea08a29717d50a9f453735e0ab2a7c003')), LNPeerAddr(host='34.250.234.192', port=9735, pubkey=bfh('03933884aaf1d6b108397e5efe5c86bcf2d8ca8d2f700eda99db9214fc2712b134')), LNPeerAddr(host='88.99.209.230', port=9735, pubkey=bfh('0260d9119979caedc570ada883ff614c6efb93f7f7382e25d73ecbeba0b62df2d7')), LNPeerAddr(host='160.16.233.215', port=9735, pubkey=bfh('023ea0a53af875580899da0ab0a21455d9c19160c4ea1b7774c9d4be6810b02d2c')), LNPeerAddr(host='197.155.6.173', port=9735, pubkey=bfh('0269a94e8b32c005e4336bfb743c08a6e9beb13d940d57c479d95c8e687ccbdb9f')), LNPeerAddr(host='2c0f:fb18:406::4', port=9735, pubkey=bfh('0269a94e8b32c005e4336bfb743c08a6e9beb13d940d57c479d95c8e687ccbdb9f')), LNPeerAddr(host='163.172.94.64', port=9735, pubkey=bfh('030f0bf260acdbd3edcad84d7588ec7c5df4711e87e6a23016f989b8d3a4147230')), LNPeerAddr(host='23.237.77.12', port=9735, pubkey=bfh('02312627fdf07fbdd7e5ddb136611bdde9b00d26821d14d94891395452f67af248')), LNPeerAddr(host='197.155.6.172', port=9735, pubkey=bfh('02ae2f22b02375e3e9b4b4a2db4f12e1b50752b4062dbefd6e01332acdaf680379')), LNPeerAddr(host='2c0f:fb18:406::3', port=9735, pubkey=bfh('02ae2f22b02375e3e9b4b4a2db4f12e1b50752b4062dbefd6e01332acdaf680379')), LNPeerAddr(host='23.239.23.44', port=9740, pubkey=bfh('034fe52e98a0e9d3c21b767e1b371881265d8c7578c21f5afd6d6438da10348b36')), LNPeerAddr(host='2600:3c01::f03c:91ff:fe05:349c', port=9740, pubkey=bfh('034fe52e98a0e9d3c21b767e1b371881265d8c7578c21f5afd6d6438da10348b36')), ) FALLBACK_NODE_LIST_MAINNET = [ LNPeerAddr(host='172.81.181.3', port=9735, pubkey=bfh('0214382bdce7750dfcb8126df8e2b12de38536902dc36abcebdaeefdeca1df8284')), LNPeerAddr(host='35.230.100.60', port=9735, pubkey=bfh('023f5e3582716bed96f6f26cfcd8037e07474d7b4743afdc8b07e692df63464d7e')), LNPeerAddr(host='40.69.71.114', port=9735, pubkey=bfh('028303182c9885da93b3b25c9621d22cf34475e63c123942e402ab530c0556e675')), LNPeerAddr(host='94.177.171.73', port=9735, pubkey=bfh('0276e09a267592e7451a939c932cf685f0754de382a3ca85d2fb3a864d4c365ad5')), LNPeerAddr(host='34.236.113.58', port=9735, pubkey=bfh('02fa50c72ee1e2eb5f1b6d9c3032080c4c864373c4201dfa2966aa34eee1051f97')), LNPeerAddr(host='52.50.244.44', port=9735, pubkey=bfh('030c3f19d742ca294a55c00376b3b355c3c90d61c6b6b39554dbc7ac19b141c14f')), LNPeerAddr(host='157.245.68.47', port=9735, pubkey=bfh('03c2abfa93eacec04721c019644584424aab2ba4dff3ac9bdab4e9c97007491dda')), LNPeerAddr(host='18.221.23.28', port=9735, pubkey=bfh('03abf6f44c355dec0d5aa155bdbdd6e0c8fefe318eff402de65c6eb2e1be55dc3e')), LNPeerAddr(host='52.224.178.244', port=9735, pubkey=bfh('026b105ac13212c48714c6be9b11577a9ce10f10e1c88a45ce217e6331209faf8b')), LNPeerAddr(host='34.239.230.56', port=9735, pubkey=bfh('03864ef025fde8fb587d989186ce6a4a186895ee44a926bfc370e2c366597a3f8f')), LNPeerAddr(host='46.229.165.136', port=9735, pubkey=bfh('0390b5d4492dc2f5318e5233ab2cebf6d48914881a33ef6a9c6bcdbb433ad986d0')), LNPeerAddr(host='157.230.28.160', port=9735, pubkey=bfh('0279c22ed7a068d10dc1a38ae66d2d6461e269226c60258c021b1ddcdfe4b00bc4')), LNPeerAddr(host='74.108.13.152', port=9735, pubkey=bfh('0331f80652fb840239df8dc99205792bba2e559a05469915804c08420230e23c7c')), LNPeerAddr(host='167.172.44.148', port=9735, pubkey=bfh('0395033b252c6f40e3756984162d68174e2bd8060a129c0d3462a9370471c6d28f')), LNPeerAddr(host='138.68.14.104', port=9735, pubkey=bfh('03bb88ccc444534da7b5b64b4f7b15e1eccb18e102db0e400d4b9cfe93763aa26d')), LNPeerAddr(host='3.124.63.44', port=9735, pubkey=bfh('0242a4ae0c5bef18048fbecf995094b74bfb0f7391418d71ed394784373f41e4f3')), LNPeerAddr(host='2001:470:8:2e1::43', port=9735, pubkey=bfh('03baa70886d9200af0ffbd3f9e18d96008331c858456b16e3a9b41e735c6208fef')), LNPeerAddr(host='2601:186:c100:6bcd:219:d1ff:fe75:dc2f', port=9735, pubkey=bfh('0298f6074a454a1f5345cb2a7c6f9fce206cd0bf675d177cdbf0ca7508dd28852f')), LNPeerAddr(host='2001:41d0:e:734::1', port=9735, pubkey=bfh('03a503d8e30f2ff407096d235b5db63b4fcf3f89a653acb6f43d3fc492a7674019')), LNPeerAddr(host='2a01:4f9:2b:2254::2', port=9735, pubkey=bfh('02f3069a342ae2883a6f29e275f06f28a56a6ea2e2d96f5888a3266444dcf542b6')), LNPeerAddr(host='2a02:8070:24c1:100:528c:2997:6dbc:a054', port=9735, pubkey=bfh('02a45def9ae014fdd2603dd7033d157faa3a55a72b06a63ae22ef46d9fafdc6e8d')), LNPeerAddr(host='2600:3c01::f03c:91ff:fe05:349c', port=9736, pubkey=bfh('02731b798b39a09f9f14e90ee601afb6ebb796d6e5797de14582a978770b33700f')), LNPeerAddr(host='2a00:8a60:e012:a00::21', port=9735, pubkey=bfh('027ce055380348d7812d2ae7745701c9f93e70c1adeb2657f053f91df4f2843c71')), LNPeerAddr(host='2604:a880:400:d1::8bd:1001', port=9735, pubkey=bfh('03649c72a4816f0cd546f84aafbd657e92a30ab474de7ab795e8b5650a427611f7')), LNPeerAddr(host='2a01:4f8:c0c:7b31::1', port=9735, pubkey=bfh('02c16cca44562b590dd279c942200bdccfd4f990c3a69fad620c10ef2f8228eaff')), LNPeerAddr(host='2001:41d0:1:b40d::1', port=9735, pubkey=bfh('026726a4b043d413b45b334876d17b8a98848129604429ec65532ba286a42efeac')), ] from .trampoline import trampolines_by_id, hardcoded_trampoline_nodes, is_hardcoded_trampoline class PaymentInfo(NamedTuple): payment_hash: bytes amount_msat: Optional[int] direction: int status: int class ErrorAddingPeer(Exception): pass # set some feature flags as baseline for both LNWallet and LNGossip # note that e.g. DATA_LOSS_PROTECT is needed for LNGossip as many peers require it BASE_FEATURES = LnFeatures(0)\ | LnFeatures.OPTION_DATA_LOSS_PROTECT_OPT\ | LnFeatures.OPTION_STATIC_REMOTEKEY_OPT\ | LnFeatures.VAR_ONION_OPT\ | LnFeatures.PAYMENT_SECRET_OPT\ | LnFeatures.OPTION_UPFRONT_SHUTDOWN_SCRIPT_OPT\ # we do not want to receive unrequested gossip (see lnpeer.maybe_save_remote_update) LNWALLET_FEATURES = BASE_FEATURES\ | LnFeatures.OPTION_DATA_LOSS_PROTECT_REQ\ | LnFeatures.OPTION_STATIC_REMOTEKEY_REQ\ | LnFeatures.GOSSIP_QUERIES_REQ\ | LnFeatures.BASIC_MPP_OPT\ | LnFeatures.OPTION_TRAMPOLINE_ROUTING_OPT\ | LnFeatures.OPTION_SHUTDOWN_ANYSEGWIT_OPT\ | LnFeatures.OPTION_CHANNEL_TYPE_OPT\ LNGOSSIP_FEATURES = BASE_FEATURES\ | LnFeatures.GOSSIP_QUERIES_OPT\ | LnFeatures.GOSSIP_QUERIES_REQ\ class LNWorker(Logger, NetworkRetryManager[LNPeerAddr]): INITIAL_TRAMPOLINE_FEE_LEVEL = 1 # only used for trampoline payments. set to 0 in tests. def __init__(self, xprv, features: LnFeatures): Logger.__init__(self) NetworkRetryManager.__init__( self, max_retry_delay_normal=3600, init_retry_delay_normal=600, max_retry_delay_urgent=300, init_retry_delay_urgent=4, ) self.lock = threading.RLock() self.node_keypair = generate_keypair(BIP32Node.from_xkey(xprv), LnKeyFamily.NODE_KEY) self.backup_key = generate_keypair(BIP32Node.from_xkey(xprv), LnKeyFamily.BACKUP_CIPHER).privkey self._peers = {} # type: Dict[bytes, Peer] # pubkey -> Peer # needs self.lock self.taskgroup = OldTaskGroup() self.listen_server = None # type: Optional[asyncio.AbstractServer] self.features = features self.network = None # type: Optional[Network] self.config = None # type: Optional[SimpleConfig] self.stopping_soon = False # whether we are being shut down util.register_callback(self.on_proxy_changed, ['proxy_set']) @property def channel_db(self): return self.network.channel_db if self.network else None @property def peers(self) -> Mapping[bytes, Peer]: """Returns a read-only copy of peers.""" with self.lock: return self._peers.copy() def channels_for_peer(self, node_id: bytes) -> Dict[bytes, Channel]: return {} def get_node_alias(self, node_id: bytes) -> Optional[str]: """Returns the alias of the node, or None if unknown.""" node_alias = None if self.channel_db: node_info = self.channel_db.get_node_info_for_node_id(node_id) if node_info: node_alias = node_info.alias else: for k, v in hardcoded_trampoline_nodes().items(): if v.pubkey == node_id: node_alias = k break return node_alias async def maybe_listen(self): # FIXME: only one LNWorker can listen at a time (single port) listen_addr = self.config.get('lightning_listen') if listen_addr: self.logger.info(f'lightning_listen enabled. will try to bind: {listen_addr!r}') try: netaddr = NetAddress.from_string(listen_addr) except Exception as e: self.logger.error(f"failed to parse config key 'lightning_listen'. got: {e!r}") return addr = str(netaddr.host) async def cb(reader, writer): transport = LNResponderTransport(self.node_keypair.privkey, reader, writer) try: node_id = await transport.handshake() except Exception as e: self.logger.info(f'handshake failure from incoming connection: {e!r}') return await self._add_peer_from_transport(node_id=node_id, transport=transport) try: self.listen_server = await asyncio.start_server(cb, addr, netaddr.port) except OSError as e: self.logger.error(f"cannot listen for lightning p2p. error: {e!r}") @ignore_exceptions # don't kill outer taskgroup async def main_loop(self): self.logger.info("starting taskgroup.") try: async with self.taskgroup as group: await group.spawn(self._maintain_connectivity()) except Exception as e: self.logger.exception("taskgroup died.") finally: self.logger.info("taskgroup stopped.") async def _maintain_connectivity(self): while True: await asyncio.sleep(1) if self.stopping_soon: return now = time.time() if len(self._peers) >= NUM_PEERS_TARGET: continue peers = await self._get_next_peers_to_try() for peer in peers: if self._can_retry_addr(peer, now=now): try: await self._add_peer(peer.host, peer.port, peer.pubkey) except ErrorAddingPeer as e: self.logger.info(f"failed to add peer: {peer}. exc: {e!r}") async def _add_peer(self, host: str, port: int, node_id: bytes) -> Peer: if node_id in self._peers: return self._peers[node_id] port = int(port) peer_addr = LNPeerAddr(host, port, node_id) self._trying_addr_now(peer_addr) self.logger.info(f"adding peer {peer_addr}") if node_id == self.node_keypair.pubkey: raise ErrorAddingPeer("cannot connect to self") transport = LNTransport(self.node_keypair.privkey, peer_addr, proxy=self.network.proxy) peer = await self._add_peer_from_transport(node_id=node_id, transport=transport) return peer async def _add_peer_from_transport(self, *, node_id: bytes, transport: LNTransportBase) -> Peer: peer = Peer(self, node_id, transport) with self.lock: existing_peer = self._peers.get(node_id) if existing_peer: existing_peer.close_and_cleanup() assert node_id not in self._peers self._peers[node_id] = peer await self.taskgroup.spawn(peer.main_loop()) return peer def peer_closed(self, peer: Peer) -> None: with self.lock: peer2 = self._peers.get(peer.pubkey) if peer2 is peer: self._peers.pop(peer.pubkey) def num_peers(self) -> int: return sum([p.is_initialized() for p in self.peers.values()]) def start_network(self, network: 'Network'): assert network self.network = network self.config = network.config self._add_peers_from_config() asyncio.run_coroutine_threadsafe(self.main_loop(), self.network.asyncio_loop) async def stop(self): if self.listen_server: self.listen_server.close() util.unregister_callback(self.on_proxy_changed) await self.taskgroup.cancel_remaining() def _add_peers_from_config(self): peer_list = self.config.get('lightning_peers', []) for host, port, pubkey in peer_list: asyncio.run_coroutine_threadsafe( self._add_peer(host, int(port), bfh(pubkey)), self.network.asyncio_loop) def is_good_peer(self, peer: LNPeerAddr) -> bool: # the purpose of this method is to filter peers that advertise the desired feature bits # it is disabled for now, because feature bits published in node announcements seem to be unreliable return True node_id = peer.pubkey node = self.channel_db._nodes.get(node_id) if not node: return False try: ln_compare_features(self.features, node.features) except IncompatibleLightningFeatures: return False #self.logger.info(f'is_good {peer.host}') return True def on_peer_successfully_established(self, peer: Peer) -> None: if isinstance(peer.transport, LNTransport): peer_addr = peer.transport.peer_addr # reset connection attempt count self._on_connection_successfully_established(peer_addr) # add into channel db if self.channel_db: self.channel_db.add_recent_peer(peer_addr) # save network address into channels we might have with peer for chan in peer.channels.values(): chan.add_or_update_peer_addr(peer_addr) async def _get_next_peers_to_try(self) -> Sequence[LNPeerAddr]: now = time.time() await self.channel_db.data_loaded.wait() # first try from recent peers recent_peers = self.channel_db.get_recent_peers() for peer in recent_peers: if not peer: continue if peer.pubkey in self._peers: continue if not self._can_retry_addr(peer, now=now): continue if not self.is_good_peer(peer): continue return [peer] # try random peer from graph unconnected_nodes = self.channel_db.get_200_randomly_sorted_nodes_not_in(self.peers.keys()) if unconnected_nodes: for node_id in unconnected_nodes: addrs = self.channel_db.get_node_addresses(node_id) if not addrs: continue host, port, timestamp = self.choose_preferred_address(list(addrs)) try: peer = LNPeerAddr(host, port, node_id) except ValueError: continue if not self._can_retry_addr(peer, now=now): continue if not self.is_good_peer(peer): continue #self.logger.info('taking random ln peer from our channel db') return [peer] # getting desperate... let's try hardcoded fallback list of peers if constants.net in (constants.BitcoinTestnet,): fallback_list = FALLBACK_NODE_LIST_TESTNET elif constants.net in (constants.BitcoinMainnet,): fallback_list = FALLBACK_NODE_LIST_MAINNET else: return [] # regtest?? fallback_list = [peer for peer in fallback_list if self._can_retry_addr(peer, now=now)] if fallback_list: return [random.choice(fallback_list)] # last resort: try dns seeds (BOLT-10) return await run_in_thread(self._get_peers_from_dns_seeds) def _get_peers_from_dns_seeds(self) -> Sequence[LNPeerAddr]: # NOTE: potentially long blocking call, do not run directly on asyncio event loop. # Return several peers to reduce the number of dns queries. if not constants.net.LN_DNS_SEEDS: return [] dns_seed = random.choice(constants.net.LN_DNS_SEEDS) self.logger.info('asking dns seed "{}" for ln peers'.format(dns_seed)) try: # note: this might block for several seconds # this will include bech32-encoded-pubkeys and ports srv_answers = resolve_dns_srv('r{}.{}'.format( constants.net.LN_REALM_BYTE, dns_seed)) except dns.exception.DNSException as e: self.logger.info(f'failed querying (1) dns seed "{dns_seed}" for ln peers: {repr(e)}') return [] random.shuffle(srv_answers) num_peers = 2 * NUM_PEERS_TARGET srv_answers = srv_answers[:num_peers] # we now have pubkeys and ports but host is still needed peers = [] for srv_ans in srv_answers: try: # note: this might block for several seconds answers = dns.resolver.resolve(srv_ans['host']) except dns.exception.DNSException as e: self.logger.info(f'failed querying (2) dns seed "{dns_seed}" for ln peers: {repr(e)}') continue try: ln_host = str(answers[0]) port = int(srv_ans['port']) bech32_pubkey = srv_ans['host'].split('.')[0] pubkey = get_compressed_pubkey_from_bech32(bech32_pubkey) peers.append(LNPeerAddr(ln_host, port, pubkey)) except Exception as e: self.logger.info(f'error with parsing peer from dns seed: {repr(e)}') continue self.logger.info(f'got {len(peers)} ln peers from dns seed') return peers @staticmethod def choose_preferred_address(addr_list: Sequence[Tuple[str, int, int]]) -> Tuple[str, int, int]: assert len(addr_list) >= 1 # choose first one that is an IP for host, port, timestamp in addr_list: if is_ip_address(host): return host, port, timestamp # otherwise choose one at random # TODO maybe filter out onion if not on tor? choice = random.choice(addr_list) return choice def on_proxy_changed(self, event, *args): for peer in self.peers.values(): peer.close_and_cleanup() self._clear_addr_retry_times() @log_exceptions async def add_peer(self, connect_str: str) -> Peer: node_id, rest = extract_nodeid(connect_str) peer = self._peers.get(node_id) if not peer: if rest is not None: host, port = split_host_port(rest) else: if not self.channel_db: addr = trampolines_by_id().get(node_id) if not addr: raise ConnStringFormatError(_('Address unknown for node:') + ' ' + bh2u(node_id)) host, port = addr.host, addr.port else: addrs = self.channel_db.get_node_addresses(node_id) if not addrs: raise ConnStringFormatError(_('Don\'t know any addresses for node:') + ' ' + bh2u(node_id)) host, port, timestamp = self.choose_preferred_address(list(addrs)) port = int(port) # Try DNS-resolving the host (if needed). This is simply so that # the caller gets a nice exception if it cannot be resolved. try: await asyncio.get_event_loop().getaddrinfo(host, port) except socket.gaierror: raise ConnStringFormatError(_('Hostname does not resolve (getaddrinfo failed)')) # add peer peer = await self._add_peer(host, port, node_id) return peer class LNGossip(LNWorker): max_age = 14*24*3600 LOGGING_SHORTCUT = 'g' def __init__(self): seed = os.urandom(32) node = BIP32Node.from_rootseed(seed, xtype='standard') xprv = node.to_xprv() super().__init__(xprv, LNGOSSIP_FEATURES) self.unknown_ids = set() def start_network(self, network: 'Network'): assert network super().start_network(network) asyncio.run_coroutine_threadsafe(self.taskgroup.spawn(self.maintain_db()), self.network.asyncio_loop) async def maintain_db(self): await self.channel_db.data_loaded.wait() while True: if len(self.unknown_ids) == 0: self.channel_db.prune_old_policies(self.max_age) self.channel_db.prune_orphaned_channels() await asyncio.sleep(120) async def add_new_ids(self, ids: Iterable[bytes]): known = self.channel_db.get_channel_ids() new = set(ids) - set(known) self.unknown_ids.update(new) util.trigger_callback('unknown_channels', len(self.unknown_ids)) util.trigger_callback('gossip_peers', self.num_peers()) util.trigger_callback('ln_gossip_sync_progress') def get_ids_to_query(self) -> Sequence[bytes]: N = 500 l = list(self.unknown_ids) self.unknown_ids = set(l[N:]) util.trigger_callback('unknown_channels', len(self.unknown_ids)) util.trigger_callback('ln_gossip_sync_progress') return l[0:N] def get_sync_progress_estimate(self) -> Tuple[Optional[int], Optional[int], Optional[int]]: """Estimates the gossip synchronization process and returns the number of synchronized channels, the total channels in the network and a rescaled percentage of the synchronization process.""" if self.num_peers() == 0: return None, None, None nchans_with_0p, nchans_with_1p, nchans_with_2p = self.channel_db.get_num_channels_partitioned_by_policy_count() num_db_channels = nchans_with_0p + nchans_with_1p + nchans_with_2p # some channels will never have two policies (only one is in gossip?...) # so if we have at least 1 policy for a channel, we consider that channel "complete" here current_est = num_db_channels - nchans_with_0p total_est = len(self.unknown_ids) + num_db_channels progress = current_est / total_est if total_est and current_est else 0 progress_percent = (1.0 / 0.95 * progress) * 100 progress_percent = min(progress_percent, 100) progress_percent = round(progress_percent) # take a minimal number of synchronized channels to get a more accurate # percentage estimate if current_est < 200: progress_percent = 0 return current_est, total_est, progress_percent async def process_gossip(self, chan_anns, node_anns, chan_upds): # note: we run in the originating peer's TaskGroup, so we can safely raise here # and disconnect only from that peer await self.channel_db.data_loaded.wait() self.logger.debug(f'process_gossip {len(chan_anns)} {len(node_anns)} {len(chan_upds)}') # channel announcements def process_chan_anns(): for payload in chan_anns: self.channel_db.verify_channel_announcement(payload) self.channel_db.add_channel_announcements(chan_anns) await run_in_thread(process_chan_anns) # node announcements def process_node_anns(): for payload in node_anns: self.channel_db.verify_node_announcement(payload) self.channel_db.add_node_announcements(node_anns) await run_in_thread(process_node_anns) # channel updates categorized_chan_upds = await run_in_thread(partial( self.channel_db.add_channel_updates, chan_upds, max_age=self.max_age)) orphaned = categorized_chan_upds.orphaned if orphaned: self.logger.info(f'adding {len(orphaned)} unknown channel ids') orphaned_ids = [c['short_channel_id'] for c in orphaned] await self.add_new_ids(orphaned_ids) if categorized_chan_upds.good: self.logger.debug(f'on_channel_update: {len(categorized_chan_upds.good)}/{len(chan_upds)}') class LNWallet(LNWorker): lnwatcher: Optional['LNWalletWatcher'] MPP_EXPIRY = 120 TIMEOUT_SHUTDOWN_FAIL_PENDING_HTLCS = 3 # seconds def __init__(self, wallet: 'Abstract_Wallet', xprv): self.wallet = wallet self.db = wallet.db Logger.__init__(self) LNWorker.__init__(self, xprv, LNWALLET_FEATURES) self.config = wallet.config self.lnwatcher = None self.lnrater: LNRater = None self.payments = self.db.get_dict('lightning_payments') # RHASH -> amount, direction, is_paid self.preimages = self.db.get_dict('lightning_preimages') # RHASH -> preimage # note: this sweep_address is only used as fallback; as it might result in address-reuse self.sweep_address = wallet.get_new_sweep_address_for_channel() self.logs = defaultdict(list) # type: Dict[str, List[HtlcLog]] # key is RHASH # (not persisted) # used in tests self.enable_htlc_settle = True self.enable_htlc_forwarding = True # note: accessing channels (besides simple lookup) needs self.lock! self._channels = {} # type: Dict[bytes, Channel] channels = self.db.get_dict("channels") for channel_id, c in random_shuffled_copy(channels.items()): self._channels[bfh(channel_id)] = Channel(c, sweep_address=self.sweep_address, lnworker=self) self._channel_backups = {} # type: Dict[bytes, ChannelBackup] # order is important: imported should overwrite onchain for name in ["onchain_channel_backups", "imported_channel_backups"]: channel_backups = self.db.get_dict(name) for channel_id, storage in channel_backups.items(): self._channel_backups[bfh(channel_id)] = ChannelBackup(storage, sweep_address=self.sweep_address, lnworker=self) self.sent_htlcs = defaultdict(asyncio.Queue) # type: Dict[bytes, asyncio.Queue[HtlcLog]] self.sent_htlcs_info = dict() # (RHASH, scid, htlc_id) -> route, payment_secret, amount_msat, bucket_msat, trampoline_fee_level self.sent_buckets = dict() # payment_secret -> (amount_sent, amount_failed) self.received_mpp_htlcs = dict() # RHASH -> mpp_status, htlc_set self.swap_manager = SwapManager(wallet=self.wallet, lnworker=self) # detect inflight payments self.inflight_payments = set() # (not persisted) keys of invoices that are in PR_INFLIGHT state for payment_hash in self.get_payments(status='inflight').keys(): self.set_invoice_status(payment_hash.hex(), PR_INFLIGHT) self.trampoline_forwarding_failures = {} # todo: should be persisted # map forwarded htlcs (fw_info=(scid_hex, htlc_id)) to originating peer pubkeys self.downstream_htlc_to_upstream_peer_map = {} # type: Dict[Tuple[str, int], bytes] def has_deterministic_node_id(self) -> bool: return bool(self.db.get('lightning_xprv')) def can_have_recoverable_channels(self) -> bool: return (self.has_deterministic_node_id() and not (self.config.get('lightning_listen'))) def has_recoverable_channels(self) -> bool: """Whether *future* channels opened by this wallet would be recoverable from seed (via putting OP_RETURN outputs into funding txs). """ return (self.can_have_recoverable_channels() and self.config.get('use_recoverable_channels', True)) @property def channels(self) -> Mapping[bytes, Channel]: """Returns a read-only copy of channels.""" with self.lock: return self._channels.copy() @property def channel_backups(self) -> Mapping[bytes, ChannelBackup]: """Returns a read-only copy of channels.""" with self.lock: return self._channel_backups.copy() def get_channel_by_id(self, channel_id: bytes) -> Optional[Channel]: return self._channels.get(channel_id, None) def diagnostic_name(self): return self.wallet.diagnostic_name() @ignore_exceptions @log_exceptions async def sync_with_local_watchtower(self): watchtower = self.network.local_watchtower if watchtower: while True: for chan in self.channels.values(): await self.sync_channel_with_watchtower(chan, watchtower.sweepstore) await asyncio.sleep(5) @ignore_exceptions @log_exceptions async def sync_with_remote_watchtower(self): while True: # periodically poll if the user updated 'watchtower_url' await asyncio.sleep(5) watchtower_url = self.config.get('watchtower_url') if not watchtower_url: continue parsed_url = urllib.parse.urlparse(watchtower_url) if not (parsed_url.scheme == 'https' or is_private_netaddress(parsed_url.hostname)): self.logger.warning(f"got watchtower URL for remote tower but we won't use it! " f"can only use HTTPS (except if private IP): not using {watchtower_url!r}") continue # try to sync with the remote watchtower try: async with make_aiohttp_session(proxy=self.network.proxy) as session: watchtower = JsonRPCClient(session, watchtower_url) watchtower.add_method('get_ctn') watchtower.add_method('add_sweep_tx') for chan in self.channels.values(): await self.sync_channel_with_watchtower(chan, watchtower) except aiohttp.client_exceptions.ClientConnectorError: self.logger.info(f'could not contact remote watchtower {watchtower_url}') async def sync_channel_with_watchtower(self, chan: Channel, watchtower): outpoint = chan.funding_outpoint.to_str() addr = chan.get_funding_address() current_ctn = chan.get_oldest_unrevoked_ctn(REMOTE) watchtower_ctn = await watchtower.get_ctn(outpoint, addr) for ctn in range(watchtower_ctn + 1, current_ctn): sweeptxs = chan.create_sweeptxs(ctn) for tx in sweeptxs: await watchtower.add_sweep_tx(outpoint, ctn, tx.inputs()[0].prevout.to_str(), tx.serialize()) def start_network(self, network: 'Network'): assert network self.network = network self.config = network.config self.lnwatcher = LNWalletWatcher(self, network) self.lnwatcher.start_network(network) self.swap_manager.start_network(network=network, lnwatcher=self.lnwatcher) self.lnrater = LNRater(self, network) for chan in self.channels.values(): self.lnwatcher.add_channel(chan.funding_outpoint.to_str(), chan.get_funding_address()) for cb in self.channel_backups.values(): self.lnwatcher.add_channel(cb.funding_outpoint.to_str(), cb.get_funding_address()) for coro in [ self.maybe_listen(), self.lnwatcher.on_network_update('network_updated'), # shortcut (don't block) if funding tx locked and verified self.reestablish_peers_and_channels(), self.sync_with_local_watchtower(), self.sync_with_remote_watchtower(), ]: tg_coro = self.taskgroup.spawn(coro) asyncio.run_coroutine_threadsafe(tg_coro, self.network.asyncio_loop) async def stop(self): self.stopping_soon = True if self.listen_server: # stop accepting new peers self.listen_server.close() async with ignore_after(self.TIMEOUT_SHUTDOWN_FAIL_PENDING_HTLCS): await self.wait_for_received_pending_htlcs_to_get_removed() await LNWorker.stop(self) if self.lnwatcher: await self.lnwatcher.stop() self.lnwatcher = None async def wait_for_received_pending_htlcs_to_get_removed(self): assert self.stopping_soon is True # We try to fail pending MPP HTLCs, and wait a bit for them to get removed. # Note: even without MPP, if we just failed/fulfilled an HTLC, it is good # to wait a bit for it to become irrevocably removed. # Note: we don't wait for *all htlcs* to get removed, only for those # that we can already fail/fulfill. e.g. forwarded htlcs cannot be removed async with OldTaskGroup() as group: for peer in self.peers.values(): await group.spawn(peer.wait_one_htlc_switch_iteration()) while True: if all(not peer.received_htlcs_pending_removal for peer in self.peers.values()): break async with OldTaskGroup(wait=any) as group: for peer in self.peers.values(): await group.spawn(peer.received_htlc_removed_event.wait()) def peer_closed(self, peer): for chan in self.channels_for_peer(peer.pubkey).values(): chan.peer_state = PeerState.DISCONNECTED util.trigger_callback('channel', self.wallet, chan) super().peer_closed(peer) def get_payments(self, *, status=None) -> Mapping[bytes, List[HTLCWithStatus]]: out = defaultdict(list) for chan in self.channels.values(): d = chan.get_payments(status=status) for payment_hash, plist in d.items(): out[payment_hash] += plist return out def get_payment_value( self, info: Optional['PaymentInfo'], plist: List[HTLCWithStatus], ) -> Tuple[int, int, int]: assert plist amount_msat = 0 fee_msat = None for htlc_with_status in plist: htlc = htlc_with_status.htlc _direction = htlc_with_status.direction amount_msat += int(_direction) * htlc.amount_msat if _direction == SENT and info and info.amount_msat: fee_msat = (fee_msat or 0) - info.amount_msat - amount_msat timestamp = min([htlc_with_status.htlc.timestamp for htlc_with_status in plist]) return amount_msat, fee_msat, timestamp def get_lightning_history(self): out = {} for payment_hash, plist in self.get_payments(status='settled').items(): if len(plist) == 0: continue key = payment_hash.hex() info = self.get_payment_info(payment_hash) amount_msat, fee_msat, timestamp = self.get_payment_value(info, plist) if info is not None: label = self.wallet.get_label(key) direction = ('sent' if info.direction == SENT else 'received') if len(plist)==1 else 'self-payment' else: direction = 'forwarding' label = _('Forwarding') preimage = self.get_preimage(payment_hash).hex() item = { 'type': 'payment', 'label': label, 'timestamp': timestamp or 0, 'date': timestamp_to_datetime(timestamp), 'direction': direction, 'amount_msat': amount_msat, 'fee_msat': fee_msat, 'payment_hash': key, 'preimage': preimage, } # add group_id to swap transactions swap = self.swap_manager.get_swap(payment_hash) if swap: if swap.is_reverse: item['group_id'] = swap.spending_txid item['group_label'] = 'Reverse swap' + ' ' + self.config.format_amount_and_units(swap.lightning_amount) else: item['group_id'] = swap.funding_txid item['group_label'] = 'Forward swap' + ' ' + self.config.format_amount_and_units(swap.onchain_amount) # done out[payment_hash] = item return out def get_onchain_history(self): current_height = self.wallet.get_local_height() out = {} # add funding events for chan in self.channels.values(): item = chan.get_funding_height() if item is None: continue if not self.lnwatcher: continue # lnwatcher not available with --offline (its data is not persisted) funding_txid, funding_height, funding_timestamp = item tx_height = self.lnwatcher.get_tx_height(funding_txid) item = { 'channel_id': bh2u(chan.channel_id), 'type': 'channel_opening', 'label': self.wallet.get_label_for_txid(funding_txid) or (_('Open channel') + ' ' + chan.get_id_for_log()), 'txid': funding_txid, 'amount_msat': chan.balance(LOCAL, ctn=0), 'direction': 'received', 'timestamp': tx_height.timestamp, 'date': timestamp_to_datetime(tx_height.timestamp), 'fee_sat': None, 'fee_msat': None, 'height': tx_height.height, 'confirmations': tx_height.conf, } out[funding_txid] = item item = chan.get_closing_height() if item is None: continue closing_txid, closing_height, closing_timestamp = item tx_height = self.lnwatcher.get_tx_height(closing_txid) item = { 'channel_id': bh2u(chan.channel_id), 'txid': closing_txid, 'label': self.wallet.get_label_for_txid(closing_txid) or (_('Close channel') + ' ' + chan.get_id_for_log()), 'type': 'channel_closure', 'amount_msat': -chan.balance_minus_outgoing_htlcs(LOCAL), 'direction': 'sent', 'timestamp': tx_height.timestamp, 'date': timestamp_to_datetime(tx_height.timestamp), 'fee_sat': None, 'fee_msat': None, 'height': tx_height.height, 'confirmations': tx_height.conf, } out[closing_txid] = item # add info about submarine swaps settled_payments = self.get_payments(status='settled') for payment_hash_hex, swap in self.swap_manager.swaps.items(): txid = swap.spending_txid if swap.is_reverse else swap.funding_txid if txid is None: continue payment_hash = bytes.fromhex(payment_hash_hex) if payment_hash in settled_payments: plist = settled_payments[payment_hash] info = self.get_payment_info(payment_hash) amount_msat, fee_msat, timestamp = self.get_payment_value(info, plist) else: amount_msat = 0 label = 'Reverse swap' if swap.is_reverse else 'Forward swap' delta = current_height - swap.locktime if not swap.is_redeemed and swap.spending_txid is None and delta < 0: label += f' (refundable in {-delta} blocks)' # fixme: only if unspent out[txid] = { 'txid': txid, 'group_id': txid, 'amount_msat': 0, #'amount_msat': amount_msat, # must not be added 'type': 'swap', 'label': self.wallet.get_label_for_txid(txid) or label, } return out def get_history(self): out = list(self.get_lightning_history().values()) + list(self.get_onchain_history().values()) # sort by timestamp out.sort(key=lambda x: (x.get('timestamp') or float("inf"))) balance_msat = 0 for item in out: balance_msat += item['amount_msat'] item['balance_msat'] = balance_msat return out def channel_peers(self) -> List[bytes]: node_ids = [chan.node_id for chan in self.channels.values() if not chan.is_closed()] return node_ids def channels_for_peer(self, node_id): assert type(node_id) is bytes return {chan_id: chan for (chan_id, chan) in self.channels.items() if chan.node_id == node_id} def channel_state_changed(self, chan: Channel): if type(chan) is Channel: self.save_channel(chan) util.trigger_callback('channel', self.wallet, chan) def save_channel(self, chan: Channel): assert type(chan) is Channel if chan.config[REMOTE].next_per_commitment_point == chan.config[REMOTE].current_per_commitment_point: raise Exception("Tried to save channel with next_point == current_point, this should not happen") self.wallet.save_db() util.trigger_callback('channel', self.wallet, chan) def channel_by_txo(self, txo: str) -> Optional[AbstractChannel]: for chan in self.channels.values(): if chan.funding_outpoint.to_str() == txo: return chan for chan in self.channel_backups.values(): if chan.funding_outpoint.to_str() == txo: return chan async def on_channel_update(self, chan: Channel): if type(chan) is ChannelBackup: util.trigger_callback('channel', self.wallet, chan) return if chan.get_state() == ChannelState.OPEN and chan.should_be_closed_due_to_expiring_htlcs(self.network.get_local_height()): self.logger.info(f"force-closing due to expiring htlcs") await self.schedule_force_closing(chan.channel_id) elif chan.get_state() == ChannelState.FUNDED: peer = self._peers.get(chan.node_id) if peer and peer.is_initialized(): peer.send_funding_locked(chan) elif chan.get_state() == ChannelState.OPEN: peer = self._peers.get(chan.node_id) if peer: await peer.maybe_update_fee(chan) conf = self.lnwatcher.get_tx_height(chan.funding_outpoint.txid).conf peer.on_network_update(chan, conf) elif chan.get_state() == ChannelState.FORCE_CLOSING: force_close_tx = chan.force_close_tx() txid = force_close_tx.txid() height = self.lnwatcher.get_tx_height(txid).height if height == TX_HEIGHT_LOCAL: self.logger.info('REBROADCASTING CLOSING TX') await self.network.try_broadcasting(force_close_tx, 'force-close') @log_exceptions async def _open_channel_coroutine( self, *, connect_str: str, funding_tx: PartialTransaction, funding_sat: int, push_sat: int, password: Optional[str]) -> Tuple[Channel, PartialTransaction]: peer = await self.add_peer(connect_str) coro = peer.channel_establishment_flow( funding_tx=funding_tx, funding_sat=funding_sat, push_msat=push_sat * 1000, temp_channel_id=os.urandom(32)) chan, funding_tx = await asyncio.wait_for(coro, LN_P2P_NETWORK_TIMEOUT) util.trigger_callback('channels_updated', self.wallet) self.wallet.add_transaction(funding_tx) # save tx as local into the wallet self.wallet.sign_transaction(funding_tx, password) self.wallet.set_label(funding_tx.txid(), _('Open channel')) if funding_tx.is_complete(): await self.network.try_broadcasting(funding_tx, 'open_channel') return chan, funding_tx def add_channel(self, chan: Channel): with self.lock: self._channels[chan.channel_id] = chan self.lnwatcher.add_channel(chan.funding_outpoint.to_str(), chan.get_funding_address()) def add_new_channel(self, chan: Channel): self.add_channel(chan) channels_db = self.db.get_dict('channels') channels_db[chan.channel_id.hex()] = chan.storage for addr in chan.get_wallet_addresses_channel_might_want_reserved(): self.wallet.set_reserved_state_of_address(addr, reserved=True) try: self.save_channel(chan) backup_dir = self.config.get_backup_dir() if backup_dir is not None: self.wallet.save_backup(backup_dir) except: chan.set_state(ChannelState.REDEEMED) self.remove_channel(chan.channel_id) raise def cb_data(self, node_id): return CB_MAGIC_BYTES + node_id[0:16] def decrypt_cb_data(self, encrypted_data, funding_address): funding_scripthash = bytes.fromhex(address_to_scripthash(funding_address)) nonce = funding_scripthash[0:12] return chacha20_decrypt(key=self.backup_key, data=encrypted_data, nonce=nonce) def encrypt_cb_data(self, data, funding_address): funding_scripthash = bytes.fromhex(address_to_scripthash(funding_address)) nonce = funding_scripthash[0:12] return chacha20_encrypt(key=self.backup_key, data=data, nonce=nonce) def mktx_for_open_channel( self, *, coins: Sequence[PartialTxInput], funding_sat: int, node_id: bytes, fee_est=None) -> PartialTransaction: outputs = [PartialTxOutput.from_address_and_value(ln_dummy_address(), funding_sat)] if self.has_recoverable_channels(): dummy_scriptpubkey = make_op_return(self.cb_data(node_id)) outputs.append(PartialTxOutput(scriptpubkey=dummy_scriptpubkey, value=0)) tx = self.wallet.make_unsigned_transaction( coins=coins, outputs=outputs, fee=fee_est) tx.set_rbf(False) return tx def open_channel(self, *, connect_str: str, funding_tx: PartialTransaction, funding_sat: int, push_amt_sat: int, password: str = None) -> Tuple[Channel, PartialTransaction]: if funding_sat > LN_MAX_FUNDING_SAT: raise Exception(_("Requested channel capacity is over protocol allowed maximum.")) coro = self._open_channel_coroutine( connect_str=connect_str, funding_tx=funding_tx, funding_sat=funding_sat, push_sat=push_amt_sat, password=password) fut = asyncio.run_coroutine_threadsafe(coro, self.network.asyncio_loop) try: chan, funding_tx = fut.result() except concurrent.futures.TimeoutError: raise Exception(_("open_channel timed out")) return chan, funding_tx def get_channel_by_short_id(self, short_channel_id: bytes) -> Optional[Channel]: for chan in self.channels.values(): if chan.short_channel_id == short_channel_id: return chan @log_exceptions async def pay_invoice( self, invoice: str, *, amount_msat: int = None, attempts: int = 1, full_path: LNPaymentPath = None) -> Tuple[bool, List[HtlcLog]]: lnaddr = self._check_invoice(invoice, amount_msat=amount_msat) min_cltv_expiry = lnaddr.get_min_final_cltv_expiry() payment_hash = lnaddr.paymenthash key = payment_hash.hex() payment_secret = lnaddr.payment_secret invoice_pubkey = lnaddr.pubkey.serialize() invoice_features = lnaddr.get_features() r_tags = lnaddr.get_routing_info('r') amount_to_pay = lnaddr.get_amount_msat() status = self.get_payment_status(payment_hash) if status == PR_PAID: raise PaymentFailure(_("This invoice has been paid already")) if status == PR_INFLIGHT: raise PaymentFailure(_("A payment was already initiated for this invoice")) if payment_hash in self.get_payments(status='inflight'): raise PaymentFailure(_("A previous attempt to pay this invoice did not clear")) info = PaymentInfo(payment_hash, amount_to_pay, SENT, PR_UNPAID) self.save_payment_info(info) self.wallet.set_label(key, lnaddr.get_description()) self.set_invoice_status(key, PR_INFLIGHT) try: await self.pay_to_node( node_pubkey=invoice_pubkey, payment_hash=payment_hash, payment_secret=payment_secret, amount_to_pay=amount_to_pay, min_cltv_expiry=min_cltv_expiry, r_tags=r_tags, invoice_features=invoice_features, attempts=attempts, full_path=full_path) success = True except PaymentFailure as e: self.logger.info(f'payment failure: {e!r}') success = False reason = str(e) if success: self.set_invoice_status(key, PR_PAID) util.trigger_callback('payment_succeeded', self.wallet, key) else: self.set_invoice_status(key, PR_UNPAID) util.trigger_callback('payment_failed', self.wallet, key, reason) log = self.logs[key] return success, log async def pay_to_node( self, *, node_pubkey: bytes, payment_hash: bytes, payment_secret: Optional[bytes], amount_to_pay: int, # in msat min_cltv_expiry: int, r_tags, invoice_features: int, attempts: int = 1, full_path: LNPaymentPath = None, fwd_trampoline_onion=None, fwd_trampoline_fee=None, fwd_trampoline_cltv_delta=None) -> None: if fwd_trampoline_onion: # todo: compare to the fee of the actual route we found if fwd_trampoline_fee < 1000: raise OnionRoutingFailure(code=OnionFailureCode.TRAMPOLINE_FEE_INSUFFICIENT, data=b'') if fwd_trampoline_cltv_delta < 576: raise OnionRoutingFailure(code=OnionFailureCode.TRAMPOLINE_EXPIRY_TOO_SOON, data=b'') self.logs[payment_hash.hex()] = log = [] # when encountering trampoline forwarding difficulties in the legacy case, we # sometimes need to fall back to a single trampoline forwarder, at the expense # of privacy use_two_trampolines = True trampoline_fee_level = self.INITIAL_TRAMPOLINE_FEE_LEVEL amount_inflight = 0 # what we sent in htlcs (that receiver gets, without fees) while True: amount_to_send = amount_to_pay - amount_inflight if amount_to_send > 0: # 1. create a set of routes for remaining amount. # note: path-finding runs in a separate thread so that we don't block the asyncio loop # graph updates might occur during the computation routes = self.create_routes_for_payment( amount_msat=amount_to_send, final_total_msat=amount_to_pay, invoice_pubkey=node_pubkey, min_cltv_expiry=min_cltv_expiry, r_tags=r_tags, invoice_features=invoice_features, full_path=full_path, payment_hash=payment_hash, payment_secret=payment_secret, trampoline_fee_level=trampoline_fee_level, use_two_trampolines=use_two_trampolines, fwd_trampoline_onion=fwd_trampoline_onion ) # 2. send htlcs async for route, amount_msat, total_msat, amount_receiver_msat, cltv_delta, bucket_payment_secret, trampoline_onion in routes: amount_inflight += amount_receiver_msat if amount_inflight > amount_to_pay: # safety belts raise Exception(f"amount_inflight={amount_inflight} > amount_to_pay={amount_to_pay}") await self.pay_to_route( route=route, amount_msat=amount_msat, total_msat=total_msat, amount_receiver_msat=amount_receiver_msat, payment_hash=payment_hash, payment_secret=bucket_payment_secret, min_cltv_expiry=cltv_delta, trampoline_onion=trampoline_onion, trampoline_fee_level=trampoline_fee_level) util.trigger_callback('invoice_status', self.wallet, payment_hash.hex()) # 3. await a queue self.logger.info(f"amount inflight {amount_inflight}") htlc_log = await self.sent_htlcs[payment_hash].get() amount_inflight -= htlc_log.amount_msat if amount_inflight < 0: raise Exception(f"amount_inflight={amount_inflight} < 0") log.append(htlc_log) if htlc_log.success: if self.network.path_finder: # TODO: report every route to liquidity hints for mpp # in the case of success, we report channels of the # route as being able to send the same amount in the future, # as we assume to not know the capacity self.network.path_finder.update_liquidity_hints(htlc_log.route, htlc_log.amount_msat) # remove inflight htlcs from liquidity hints self.network.path_finder.update_inflight_htlcs(htlc_log.route, add_htlcs=False) return # htlc failed if len(log) >= attempts: raise PaymentFailure('Giving up after %d attempts'%len(log)) # if we get a tmp channel failure, it might work to split the amount and try more routes # if we get a channel update, we might retry the same route and amount route = htlc_log.route sender_idx = htlc_log.sender_idx erring_node_id = route[sender_idx].node_id failure_msg = htlc_log.failure_msg code, data = failure_msg.code, failure_msg.data self.logger.info(f"UPDATE_FAIL_HTLC. code={repr(code)}. " f"decoded_data={failure_msg.decode_data()}. data={data.hex()!r}") self.logger.info(f"error reported by {bh2u(erring_node_id)}") if code == OnionFailureCode.MPP_TIMEOUT: raise PaymentFailure(failure_msg.code_name()) # trampoline if not self.channel_db: # FIXME The trampoline nodes in the path are chosen randomly. # Some of the errors might depend on how we have chosen them. # Having more attempts is currently useful in part because of the randomness, # instead we should give feedback to create_routes_for_payment. if code in (OnionFailureCode.TRAMPOLINE_FEE_INSUFFICIENT, OnionFailureCode.TRAMPOLINE_EXPIRY_TOO_SOON): # TODO: parse the node policy here (not returned by eclair yet) # TODO: erring node is always the first trampoline even if second # trampoline demands more fees, we can't influence this if htlc_log.trampoline_fee_level == trampoline_fee_level: trampoline_fee_level += 1 self.logger.info(f'raising trampoline fee level {trampoline_fee_level}') else: self.logger.info(f'NOT raising trampoline fee level, already at {trampoline_fee_level}') continue elif use_two_trampolines: use_two_trampolines = False elif code in (OnionFailureCode.UNKNOWN_NEXT_PEER, OnionFailureCode.TEMPORARY_NODE_FAILURE): continue else: raise PaymentFailure(failure_msg.code_name()) else: self.handle_error_code_from_failed_htlc( route=route, sender_idx=sender_idx, failure_msg=failure_msg, amount=htlc_log.amount_msat) async def pay_to_route( self, *, route: LNPaymentRoute, amount_msat: int, total_msat: int, amount_receiver_msat:int, payment_hash: bytes, payment_secret: Optional[bytes], min_cltv_expiry: int, trampoline_onion: bytes = None, trampoline_fee_level: int) -> None: # send a single htlc short_channel_id = route[0].short_channel_id chan = self.get_channel_by_short_id(short_channel_id) peer = self._peers.get(route[0].node_id) if not peer: raise PaymentFailure('Dropped peer') await peer.initialized htlc = peer.pay( route=route, chan=chan, amount_msat=amount_msat, total_msat=total_msat, payment_hash=payment_hash, min_final_cltv_expiry=min_cltv_expiry, payment_secret=payment_secret, trampoline_onion=trampoline_onion) key = (payment_hash, short_channel_id, htlc.htlc_id) self.sent_htlcs_info[key] = route, payment_secret, amount_msat, total_msat, amount_receiver_msat, trampoline_fee_level # if we sent MPP to a trampoline, add item to sent_buckets if not self.channel_db and amount_msat != total_msat: if payment_secret not in self.sent_buckets: self.sent_buckets[payment_secret] = (0, 0) amount_sent, amount_failed = self.sent_buckets[payment_secret] amount_sent += amount_receiver_msat self.sent_buckets[payment_secret] = amount_sent, amount_failed if self.network.path_finder: # add inflight htlcs to liquidity hints self.network.path_finder.update_inflight_htlcs(route, add_htlcs=True) util.trigger_callback('htlc_added', chan, htlc, SENT) def handle_error_code_from_failed_htlc( self, *, route: LNPaymentRoute, sender_idx: int, failure_msg: OnionRoutingFailure, amount: int) -> None: assert self.channel_db # cannot be in trampoline mode assert self.network.path_finder # remove inflight htlcs from liquidity hints self.network.path_finder.update_inflight_htlcs(route, add_htlcs=False) code, data = failure_msg.code, failure_msg.data # TODO can we use lnmsg.OnionWireSerializer here? # TODO update onion_wire.csv # handle some specific error codes failure_codes = { OnionFailureCode.TEMPORARY_CHANNEL_FAILURE: 0, OnionFailureCode.AMOUNT_BELOW_MINIMUM: 8, OnionFailureCode.FEE_INSUFFICIENT: 8, OnionFailureCode.INCORRECT_CLTV_EXPIRY: 4, OnionFailureCode.EXPIRY_TOO_SOON: 0, OnionFailureCode.CHANNEL_DISABLED: 2, } # determine a fallback channel to blacklist if we don't get the erring # channel via the payload if sender_idx is None: raise PaymentFailure(failure_msg.code_name()) try: fallback_channel = route[sender_idx + 1].short_channel_id except IndexError: raise PaymentFailure(f'payment destination reported error: {failure_msg.code_name()}') from None # TODO: handle unknown next peer? # handle failure codes that include a channel update if code in failure_codes: offset = failure_codes[code] channel_update_len = int.from_bytes(data[offset:offset+2], byteorder="big") channel_update_as_received = data[offset+2: offset+2+channel_update_len] payload = self._decode_channel_update_msg(channel_update_as_received) if payload is None: self.logger.info(f'could not decode channel_update for failed htlc: ' f'{channel_update_as_received.hex()}') self.network.path_finder.liquidity_hints.add_to_blacklist(fallback_channel) else: # apply the channel update or get blacklisted blacklist, update = self._handle_chanupd_from_failed_htlc( payload, route=route, sender_idx=sender_idx) # we interpret a temporary channel failure as a liquidity issue # in the channel and update our liquidity hints accordingly if code == OnionFailureCode.TEMPORARY_CHANNEL_FAILURE: self.network.path_finder.update_liquidity_hints( route, amount, failing_channel=ShortChannelID(payload['short_channel_id'])) elif blacklist: self.network.path_finder.liquidity_hints.add_to_blacklist( payload['short_channel_id']) # if we can't decide on some action, we are stuck if not (blacklist or update): raise PaymentFailure(failure_msg.code_name()) # for errors that do not include a channel update else: self.network.path_finder.liquidity_hints.add_to_blacklist(fallback_channel) def _handle_chanupd_from_failed_htlc(self, payload, *, route, sender_idx) -> Tuple[bool, bool]: blacklist = False update = False try: r = self.channel_db.add_channel_update(payload, verify=True) except InvalidGossipMsg: return True, False # blacklist short_channel_id = ShortChannelID(payload['short_channel_id']) if r == UpdateStatus.GOOD: self.logger.info(f"applied channel update to {short_channel_id}") # TODO: add test for this # FIXME: this does not work for our own unannounced channels. for chan in self.channels.values(): if chan.short_channel_id == short_channel_id: chan.set_remote_update(payload) update = True elif r == UpdateStatus.ORPHANED: # maybe it is a private channel (and data in invoice was outdated) self.logger.info(f"Could not find {short_channel_id}. maybe update is for private channel?") start_node_id = route[sender_idx].node_id update = self.channel_db.add_channel_update_for_private_channel(payload, start_node_id) blacklist = not update elif r == UpdateStatus.EXPIRED: blacklist = True elif r == UpdateStatus.DEPRECATED: self.logger.info(f'channel update is not more recent.') blacklist = True elif r == UpdateStatus.UNCHANGED: blacklist = True return blacklist, update @classmethod def _decode_channel_update_msg(cls, chan_upd_msg: bytes) -> Optional[Dict[str, Any]]: channel_update_as_received = chan_upd_msg channel_update_typed = (258).to_bytes(length=2, byteorder="big") + channel_update_as_received # note: some nodes put channel updates in error msgs with the leading msg_type already there. # we try decoding both ways here. try: message_type, payload = decode_msg(channel_update_typed) if payload['chain_hash'] != constants.net.rev_genesis_bytes(): raise Exception() payload['raw'] = channel_update_typed return payload except: # FIXME: too broad try: message_type, payload = decode_msg(channel_update_as_received) if payload['chain_hash'] != constants.net.rev_genesis_bytes(): raise Exception() payload['raw'] = channel_update_as_received return payload except: return None @staticmethod def _check_invoice(invoice: str, *, amount_msat: int = None) -> LnAddr: addr = lndecode(invoice) if addr.is_expired(): raise InvoiceError(_("This invoice has expired")) if amount_msat: # replace amt in invoice. main usecase is paying zero amt invoices existing_amt_msat = addr.get_amount_msat() if existing_amt_msat and amount_msat < existing_amt_msat: raise Exception("cannot pay lower amt than what is originally in LN invoice") addr.amount = Decimal(amount_msat) / COIN / 1000 if addr.amount is None: raise InvoiceError(_("Missing amount")) if addr.get_min_final_cltv_expiry() > lnutil.NBLOCK_CLTV_EXPIRY_TOO_FAR_INTO_FUTURE: raise InvoiceError("{}\n{}".format( _("Invoice wants us to risk locking funds for unreasonably long."), f"min_final_cltv_expiry: {addr.get_min_final_cltv_expiry()}")) return addr def is_trampoline_peer(self, node_id: bytes) -> bool: # until trampoline is advertised in lnfeatures, check against hardcoded list if is_hardcoded_trampoline(node_id): return True peer = self._peers.get(node_id) if peer and peer.their_features.supports(LnFeatures.OPTION_TRAMPOLINE_ROUTING_OPT): return True return False def suggest_peer(self) -> Optional[bytes]: if self.channel_db: return self.lnrater.suggest_peer() else: return random.choice(list(hardcoded_trampoline_nodes().values())).pubkey async def create_routes_for_payment( self, *, amount_msat: int, # part of payment amount we want routes for now final_total_msat: int, # total payment amount final receiver will get invoice_pubkey, min_cltv_expiry, r_tags, invoice_features: int, payment_hash, payment_secret, trampoline_fee_level: int, use_two_trampolines: bool, fwd_trampoline_onion=None, full_path: LNPaymentPath = None) -> AsyncGenerator[Tuple[LNPaymentRoute, int], None]: """Creates multiple routes for splitting a payment over the available private channels. We first try to conduct the payment over a single channel. If that fails and mpp is supported by the receiver, we will split the payment.""" invoice_features = LnFeatures(invoice_features) trampoline_features = LnFeatures.VAR_ONION_OPT local_height = self.network.get_local_height() my_active_channels = [chan for chan in self.channels.values() if chan.is_active() and not chan.is_frozen_for_sending()] try: self.logger.info("trying single-part payment") # try to send over a single channel if not self.channel_db: for chan in my_active_channels: if not self.is_trampoline_peer(chan.node_id): continue if chan.node_id == invoice_pubkey: trampoline_onion = None trampoline_payment_secret = payment_secret trampoline_total_msat = final_total_msat amount_with_fees = amount_msat cltv_delta = min_cltv_expiry else: trampoline_onion, amount_with_fees, cltv_delta = create_trampoline_route_and_onion( amount_msat=amount_msat, total_msat=final_total_msat, min_cltv_expiry=min_cltv_expiry, my_pubkey=self.node_keypair.pubkey, invoice_pubkey=invoice_pubkey, invoice_features=invoice_features, node_id=chan.node_id, r_tags=r_tags, payment_hash=payment_hash, payment_secret=payment_secret, local_height=local_height, trampoline_fee_level=trampoline_fee_level, use_two_trampolines=use_two_trampolines) trampoline_payment_secret = os.urandom(32) trampoline_total_msat = amount_with_fees if chan.available_to_spend(LOCAL, strict=True) < amount_with_fees: continue route = [ RouteEdge( start_node=self.node_keypair.pubkey, end_node=chan.node_id, short_channel_id=chan.short_channel_id, fee_base_msat=0, fee_proportional_millionths=0, cltv_expiry_delta=0, node_features=trampoline_features) ] yield route, amount_with_fees, trampoline_total_msat, amount_msat, cltv_delta, trampoline_payment_secret, trampoline_onion break else: raise NoPathFound() else: # local single-part route computation route = await run_in_thread( partial( self.create_route_for_payment, amount_msat=amount_msat, invoice_pubkey=invoice_pubkey, min_cltv_expiry=min_cltv_expiry, r_tags=r_tags, invoice_features=invoice_features, my_sending_channels=my_active_channels, full_path=full_path ) ) yield route, amount_msat, final_total_msat, amount_msat, min_cltv_expiry, payment_secret, fwd_trampoline_onion except NoPathFound: # fall back to payment splitting self.logger.info("no path found, trying multi-part payment") if not invoice_features.supports(LnFeatures.BASIC_MPP_OPT): raise channels_with_funds = {(chan.channel_id, chan.node_id): int(chan.available_to_spend(HTLCOwner.LOCAL)) for chan in my_active_channels} self.logger.info(f"channels_with_funds: {channels_with_funds}") if not self.channel_db: # in the case of a legacy payment, we don't allow splitting via different # trampoline nodes, as currently no forwarder supports this use_single_node, _ = is_legacy_relay(invoice_features, r_tags) split_configurations = suggest_splits( amount_msat, channels_with_funds, exclude_multinode_payments=use_single_node, exclude_single_part_payments=True, # we don't split within a channel when sending to a trampoline node, # the trampoline node will split for us exclude_single_channel_splits=True, ) self.logger.info(f'suggest_split {amount_msat} returned {len(split_configurations)} configurations') for sc in split_configurations: try: self.logger.info(f"trying split configuration: {sc.config.values()} rating: {sc.rating}") per_trampoline_channel_amounts = defaultdict(list) # categorize by trampoline nodes for trampolin mpp construction for (chan_id, _), part_amounts_msat in sc.config.items(): chan = self.channels[chan_id] for part_amount_msat in part_amounts_msat: per_trampoline_channel_amounts[chan.node_id].append((chan_id, part_amount_msat)) # for each trampoline forwarder, construct mpp trampoline routes = [] for trampoline_node_id, trampoline_parts in per_trampoline_channel_amounts.items(): per_trampoline_amount = sum([x[1] for x in trampoline_parts]) trampoline_onion, per_trampoline_amount_with_fees, per_trampoline_cltv_delta = create_trampoline_route_and_onion( amount_msat=per_trampoline_amount, total_msat=final_total_msat, min_cltv_expiry=min_cltv_expiry, my_pubkey=self.node_keypair.pubkey, invoice_pubkey=invoice_pubkey, invoice_features=invoice_features, node_id=trampoline_node_id, r_tags=r_tags, payment_hash=payment_hash, payment_secret=payment_secret, local_height=local_height, trampoline_fee_level=trampoline_fee_level, use_two_trampolines=use_two_trampolines) # node_features is only used to determine is_tlv per_trampoline_secret = os.urandom(32) per_trampoline_fees = per_trampoline_amount_with_fees - per_trampoline_amount self.logger.info(f'per trampoline fees: {per_trampoline_fees}') for chan_id, part_amount_msat in trampoline_parts: chan = self.channels[chan_id] margin = chan.available_to_spend(LOCAL, strict=True) - part_amount_msat delta_fee = min(per_trampoline_fees, margin) # TODO: distribute trampoline fee over several channels? part_amount_msat_with_fees = part_amount_msat + delta_fee per_trampoline_fees -= delta_fee route = [ RouteEdge( start_node=self.node_keypair.pubkey, end_node=trampoline_node_id, short_channel_id=chan.short_channel_id, fee_base_msat=0, fee_proportional_millionths=0, cltv_expiry_delta=0, node_features=trampoline_features) ] self.logger.info(f'adding route {part_amount_msat} {delta_fee} {margin}') routes.append((route, part_amount_msat_with_fees, per_trampoline_amount_with_fees, part_amount_msat, per_trampoline_cltv_delta, per_trampoline_secret, trampoline_onion)) if per_trampoline_fees != 0: self.logger.info('not enough margin to pay trampoline fee') raise NoPathFound() for route in routes: yield route return except NoPathFound: continue else: split_configurations = suggest_splits( amount_msat, channels_with_funds, exclude_single_part_payments=True, ) # We atomically loop through a split configuration. If there was # a failure to find a path for a single part, we give back control # after exhausting the split configuration. yielded_from_split_configuration = False self.logger.info(f'suggest_split {amount_msat} returned {len(split_configurations)} configurations') for sc in split_configurations: self.logger.info(f"trying split configuration: {list(sc.config.values())} rating: {sc.rating}") for (chan_id, _), part_amounts_msat in sc.config.items(): for part_amount_msat in part_amounts_msat: channel = self.channels[chan_id] try: route = await run_in_thread( partial( self.create_route_for_payment, amount_msat=part_amount_msat, invoice_pubkey=invoice_pubkey, min_cltv_expiry=min_cltv_expiry, r_tags=r_tags, invoice_features=invoice_features, my_sending_channels=[channel], full_path=None ) ) yield route, part_amount_msat, final_total_msat, part_amount_msat, min_cltv_expiry, payment_secret, fwd_trampoline_onion yielded_from_split_configuration = True except NoPathFound: continue if yielded_from_split_configuration: return raise NoPathFound() @profiler def create_route_for_payment( self, *, amount_msat: int, invoice_pubkey: bytes, min_cltv_expiry: int, r_tags, invoice_features: int, my_sending_channels: List[Channel], full_path: Optional[LNPaymentPath]) -> LNPaymentRoute: my_sending_channels = {chan.short_channel_id: chan for chan in my_sending_channels if chan.short_channel_id is not None} # Collect all private edges from route hints. # Note: if some route hints are multiple edges long, and these paths cross each other, # we allow our path finding to cross the paths; i.e. the route hints are not isolated. private_route_edges = {} # type: Dict[ShortChannelID, RouteEdge] for private_path in r_tags: # we need to shift the node pubkey by one towards the destination: private_path_nodes = [edge[0] for edge in private_path][1:] + [invoice_pubkey] private_path_rest = [edge[1:] for edge in private_path] start_node = private_path[0][0] for end_node, edge_rest in zip(private_path_nodes, private_path_rest): short_channel_id, fee_base_msat, fee_proportional_millionths, cltv_expiry_delta = edge_rest short_channel_id = ShortChannelID(short_channel_id) # if we have a routing policy for this edge in the db, that takes precedence, # as it is likely from a previous failure channel_policy = self.channel_db.get_policy_for_node( short_channel_id=short_channel_id, node_id=start_node, my_channels=my_sending_channels) if channel_policy: fee_base_msat = channel_policy.fee_base_msat fee_proportional_millionths = channel_policy.fee_proportional_millionths cltv_expiry_delta = channel_policy.cltv_expiry_delta node_info = self.channel_db.get_node_info_for_node_id(node_id=end_node) route_edge = RouteEdge( start_node=start_node, end_node=end_node, short_channel_id=short_channel_id, fee_base_msat=fee_base_msat, fee_proportional_millionths=fee_proportional_millionths, cltv_expiry_delta=cltv_expiry_delta, node_features=node_info.features if node_info else 0) private_route_edges[route_edge.short_channel_id] = route_edge start_node = end_node # now find a route, end to end: between us and the recipient try: route = self.network.path_finder.find_route( nodeA=self.node_keypair.pubkey, nodeB=invoice_pubkey, invoice_amount_msat=amount_msat, path=full_path, my_sending_channels=my_sending_channels, private_route_edges=private_route_edges) except NoChannelPolicy as e: raise NoPathFound() from e if not route: raise NoPathFound() # test sanity if not is_route_sane_to_use(route, amount_msat, min_cltv_expiry): self.logger.info(f"rejecting insane route {route}") raise NoPathFound() assert len(route) > 0 if route[-1].end_node != invoice_pubkey: raise LNPathInconsistent("last node_id != invoice pubkey") # add features from invoice route[-1].node_features |= invoice_features return route def add_request(self, amount_sat, message, expiry) -> str: coro = self._add_request_coro(amount_sat, message, expiry) fut = asyncio.run_coroutine_threadsafe(coro, self.network.asyncio_loop) try: return fut.result(timeout=5) except concurrent.futures.TimeoutError: raise Exception(_("add invoice timed out")) @log_exceptions async def create_invoice( self, *, amount_msat: Optional[int], message: str, expiry: int, write_to_disk: bool = True, ) -> Tuple[LnAddr, str]: timestamp = int(time.time()) routing_hints = await self._calc_routing_hints_for_invoice(amount_msat) if not routing_hints: self.logger.info( "Warning. No routing hints added to invoice. " "Other clients will likely not be able to send to us.") # if not all hints are trampoline, do not create trampoline invoice invoice_features = self.features.for_invoice() trampoline_hints = [] for r in routing_hints: node_id, short_channel_id, fee_base_msat, fee_proportional_millionths, cltv_expiry_delta = r[1][0] if len(r[1])== 1 and self.is_trampoline_peer(node_id): trampoline_hints.append(('t', (node_id, fee_base_msat, fee_proportional_millionths, cltv_expiry_delta))) payment_preimage = os.urandom(32) payment_hash = sha256(payment_preimage) info = PaymentInfo(payment_hash, amount_msat, RECEIVED, PR_UNPAID) amount_btc = amount_msat/Decimal(COIN*1000) if amount_msat else None if expiry == 0: expiry = LN_EXPIRY_NEVER lnaddr = LnAddr( paymenthash=payment_hash, amount=amount_btc, tags=[ ('d', message), ('c', MIN_FINAL_CLTV_EXPIRY_FOR_INVOICE), ('x', expiry), ('9', invoice_features)] + routing_hints + trampoline_hints, date=timestamp, payment_secret=derive_payment_secret_from_payment_preimage(payment_preimage)) invoice = lnencode(lnaddr, self.node_keypair.privkey) self.save_preimage(payment_hash, payment_preimage, write_to_disk=False) self.save_payment_info(info, write_to_disk=False) if write_to_disk: self.wallet.save_db() return lnaddr, invoice async def _add_request_coro(self, amount_sat: Optional[int], message, expiry: int) -> str: amount_msat = amount_sat * 1000 if amount_sat is not None else None lnaddr, invoice = await self.create_invoice( amount_msat=amount_msat, message=message, expiry=expiry, write_to_disk=False, ) key = bh2u(lnaddr.paymenthash) req = LNInvoice.from_bech32(invoice) self.wallet.add_payment_request(req, write_to_disk=False) self.wallet.set_label(key, message) self.wallet.save_db() return key def save_preimage(self, payment_hash: bytes, preimage: bytes, *, write_to_disk: bool = True): assert sha256(preimage) == payment_hash self.preimages[bh2u(payment_hash)] = bh2u(preimage) if write_to_disk: self.wallet.save_db() def get_preimage(self, payment_hash: bytes) -> Optional[bytes]: r = self.preimages.get(bh2u(payment_hash)) return bfh(r) if r else None def get_payment_info(self, payment_hash: bytes) -> Optional[PaymentInfo]: """returns None if payment_hash is a payment we are forwarding""" key = payment_hash.hex() with self.lock: if key in self.payments: amount_msat, direction, status = self.payments[key] return PaymentInfo(payment_hash, amount_msat, direction, status) def save_payment_info(self, info: PaymentInfo, *, write_to_disk: bool = True) -> None: key = info.payment_hash.hex() assert info.status in SAVED_PR_STATUS with self.lock: self.payments[key] = info.amount_msat, info.direction, info.status if write_to_disk: self.wallet.save_db() def check_received_mpp_htlc(self, payment_secret, short_channel_id, htlc: UpdateAddHtlc, expected_msat: int) -> Optional[bool]: """ return MPP status: True (accepted), False (expired) or None """ payment_hash = htlc.payment_hash is_expired, is_accepted, htlc_set = self.received_mpp_htlcs.get(payment_secret, (False, False, set())) if self.get_payment_status(payment_hash) == PR_PAID: # payment_status is persisted is_accepted = True is_expired = False key = (short_channel_id, htlc) if key not in htlc_set: htlc_set.add(key) if not is_accepted and not is_expired: total = sum([_htlc.amount_msat for scid, _htlc in htlc_set]) first_timestamp = min([_htlc.timestamp for scid, _htlc in htlc_set]) if self.stopping_soon: is_expired = True # try to time out pending HTLCs before shutting down elif time.time() - first_timestamp > self.MPP_EXPIRY: is_expired = True elif total == expected_msat: is_accepted = True if is_accepted or is_expired: htlc_set.remove(key) if len(htlc_set) > 0: self.received_mpp_htlcs[payment_secret] = is_expired, is_accepted, htlc_set elif payment_secret in self.received_mpp_htlcs: self.received_mpp_htlcs.pop(payment_secret) return True if is_accepted else (False if is_expired else None) def get_payment_status(self, payment_hash: bytes) -> int: info = self.get_payment_info(payment_hash) return info.status if info else PR_UNPAID def get_invoice_status(self, invoice: LNInvoice) -> int: key = invoice.rhash log = self.logs[key] if key in self.inflight_payments: return PR_INFLIGHT # status may be PR_FAILED status = self.get_payment_status(bfh(key)) if status == PR_UNPAID and log: status = PR_FAILED return status def set_invoice_status(self, key: str, status: int) -> None: if status == PR_INFLIGHT: self.inflight_payments.add(key) elif key in self.inflight_payments: self.inflight_payments.remove(key) if status in SAVED_PR_STATUS: self.set_payment_status(bfh(key), status) util.trigger_callback('invoice_status', self.wallet, key) def set_request_status(self, payment_hash: bytes, status: int) -> None: if self.get_payment_status(payment_hash) != status: self.set_payment_status(payment_hash, status) util.trigger_callback('request_status', self.wallet, payment_hash.hex(), status) def set_payment_status(self, payment_hash: bytes, status: int) -> None: info = self.get_payment_info(payment_hash) if info is None: # if we are forwarding return info = info._replace(status=status) self.save_payment_info(info) def _on_maybe_forwarded_htlc_resolved(self, chan: Channel, htlc_id: int) -> None: """Called when an HTLC we offered on chan gets irrevocably fulfilled or failed. If we find this was a forwarded HTLC, the upstream peer is notified. """ fw_info = chan.short_channel_id.hex(), htlc_id upstream_peer_pubkey = self.downstream_htlc_to_upstream_peer_map.get(fw_info) if not upstream_peer_pubkey: return upstream_peer = self.peers.get(upstream_peer_pubkey) if not upstream_peer: return upstream_peer.downstream_htlc_resolved_event.set() upstream_peer.downstream_htlc_resolved_event.clear() def htlc_fulfilled(self, chan: Channel, payment_hash: bytes, htlc_id: int): util.trigger_callback('htlc_fulfilled', payment_hash, chan, htlc_id) self._on_maybe_forwarded_htlc_resolved(chan=chan, htlc_id=htlc_id) q = self.sent_htlcs.get(payment_hash) if q: route, payment_secret, amount_msat, bucket_msat, amount_receiver_msat, trampoline_fee_level = self.sent_htlcs_info[(payment_hash, chan.short_channel_id, htlc_id)] htlc_log = HtlcLog( success=True, route=route, amount_msat=amount_receiver_msat, trampoline_fee_level=trampoline_fee_level) q.put_nowait(htlc_log) else: key = payment_hash.hex() self.set_invoice_status(key, PR_PAID) util.trigger_callback('payment_succeeded', self.wallet, key) def htlc_failed( self, chan: Channel, payment_hash: bytes, htlc_id: int, error_bytes: Optional[bytes], failure_message: Optional['OnionRoutingFailure']): util.trigger_callback('htlc_failed', payment_hash, chan, htlc_id) self._on_maybe_forwarded_htlc_resolved(chan=chan, htlc_id=htlc_id) q = self.sent_htlcs.get(payment_hash) if q: # detect if it is part of a bucket # if yes, wait until the bucket completely failed key = (payment_hash, chan.short_channel_id, htlc_id) route, payment_secret, amount_msat, bucket_msat, amount_receiver_msat, trampoline_fee_level = self.sent_htlcs_info[key] if error_bytes: # TODO "decode_onion_error" might raise, catch and maybe blacklist/penalise someone? try: failure_message, sender_idx = chan.decode_onion_error(error_bytes, route, htlc_id) except Exception as e: sender_idx = None failure_message = OnionRoutingFailure(-1, str(e)) else: # probably got "update_fail_malformed_htlc". well... who to penalise now? assert failure_message is not None sender_idx = None self.logger.info(f"htlc_failed {failure_message}") # check sent_buckets if we use trampoline if not self.channel_db and payment_secret in self.sent_buckets: amount_sent, amount_failed = self.sent_buckets[payment_secret] amount_failed += amount_receiver_msat self.sent_buckets[payment_secret] = amount_sent, amount_failed if amount_sent != amount_failed: self.logger.info('bucket still active...') return self.logger.info('bucket failed') amount_receiver_msat = amount_sent htlc_log = HtlcLog( success=False, route=route, amount_msat=amount_receiver_msat, error_bytes=error_bytes, failure_msg=failure_message, sender_idx=sender_idx, trampoline_fee_level=trampoline_fee_level) q.put_nowait(htlc_log) else: self.logger.info(f"received unknown htlc_failed, probably from previous session") key = payment_hash.hex() self.set_invoice_status(key, PR_UNPAID) util.trigger_callback('payment_failed', self.wallet, key, '') async def _calc_routing_hints_for_invoice(self, amount_msat: Optional[int]): """calculate routing hints (BOLT-11 'r' field)""" routing_hints = [] channels = list(self.channels.values()) # do minimal filtering of channels. # we include channels that cannot *right now* receive (e.g. peer disconnected or balance insufficient) channels = [chan for chan in channels if (chan.is_open() and not chan.is_frozen_for_receiving())] # Filter out channels that have very low receive capacity compared to invoice amt. # Even with MPP, below a certain threshold, including these channels probably # hurts more than help, as they lead to many failed attempts for the sender. channels = [chan for chan in channels if chan.available_to_spend(REMOTE) > (amount_msat or 0) * 0.05] # cap max channels to include to keep QR code reasonably scannable channels = sorted(channels, key=lambda chan: (not chan.is_active(), -chan.available_to_spend(REMOTE))) channels = channels[:15] random.shuffle(channels) # let's not leak channel order scid_to_my_channels = {chan.short_channel_id: chan for chan in channels if chan.short_channel_id is not None} for chan in channels: chan_id = chan.short_channel_id assert isinstance(chan_id, bytes), chan_id channel_info = get_mychannel_info(chan_id, scid_to_my_channels) # note: as a fallback, if we don't have a channel update for the # incoming direction of our private channel, we fill the invoice with garbage. # the sender should still be able to pay us, but will incur an extra round trip # (they will get the channel update from the onion error) # at least, that's the theory. https://github.com/lightningnetwork/lnd/issues/2066 fee_base_msat = fee_proportional_millionths = 0 cltv_expiry_delta = 1 # lnd won't even try with zero missing_info = True if channel_info: policy = get_mychannel_policy(channel_info.short_channel_id, chan.node_id, scid_to_my_channels) if policy: fee_base_msat = policy.fee_base_msat fee_proportional_millionths = policy.fee_proportional_millionths cltv_expiry_delta = policy.cltv_expiry_delta missing_info = False if missing_info: self.logger.info( f"Warning. Missing channel update for our channel {chan_id}; " f"filling invoice with incorrect data.") routing_hints.append(('r', [( chan.node_id, chan_id, fee_base_msat, fee_proportional_millionths, cltv_expiry_delta)])) return routing_hints def delete_payment(self, payment_hash_hex: str): try: with self.lock: del self.payments[payment_hash_hex] except KeyError: return self.wallet.save_db() def get_balance(self): with self.lock: return Decimal(sum( chan.balance(LOCAL) if not chan.is_closed() else 0 for chan in self.channels.values())) / 1000 def num_sats_can_send(self) -> Decimal: can_send = 0 with self.lock: if self.channels: for c in self.channels.values(): if c.is_active() and not c.is_frozen_for_sending(): can_send += c.available_to_spend(LOCAL) # Here we have to guess a fee, because some callers (submarine swaps) # use this method to initiate a payment, which would otherwise fail. fee_base_msat = TRAMPOLINE_FEES[3]['fee_base_msat'] fee_proportional_millionths = TRAMPOLINE_FEES[3]['fee_proportional_millionths'] # inverse of fee_for_edge_msat can_send_minus_fees = (can_send - fee_base_msat) * 1_000_000 // ( 1_000_000 + fee_proportional_millionths) can_send_minus_fees = max(0, can_send_minus_fees) return Decimal(can_send_minus_fees) / 1000 def num_sats_can_receive(self) -> Decimal: with self.lock: channels = [ c for c in self.channels.values() if c.is_active() and not c.is_frozen_for_receiving() ] can_receive = sum([c.available_to_spend(REMOTE) for c in channels]) if channels else 0 return Decimal(can_receive) / 1000 def num_sats_can_receive_no_mpp(self) -> Decimal: with self.lock: channels = [ c for c in self.channels.values() if c.is_active() and not c.is_frozen_for_receiving() ] can_receive = max([c.available_to_spend(REMOTE) for c in channels]) if channels else 0 return Decimal(can_receive) / 1000 def can_pay_invoice(self, invoice: LNInvoice) -> bool: return invoice.get_amount_sat() <= self.num_sats_can_send() def can_receive_invoice(self, invoice: LNInvoice) -> bool: return invoice.get_amount_sat() <= self.num_sats_can_receive() async def close_channel(self, chan_id): chan = self._channels[chan_id] peer = self._peers[chan.node_id] return await peer.close_channel(chan_id) def _force_close_channel(self, chan_id: bytes) -> Transaction: chan = self._channels[chan_id] tx = chan.force_close_tx() # We set the channel state to make sure we won't sign new commitment txs. # We expect the caller to try to broadcast this tx, after which it is # not safe to keep using the channel even if the broadcast errors (server could be lying). # Until the tx is seen in the mempool, there will be automatic rebroadcasts. chan.set_state(ChannelState.FORCE_CLOSING) # Add local tx to wallet to also allow manual rebroadcasts. try: self.wallet.add_transaction(tx) except UnrelatedTransactionException: pass # this can happen if (~all the balance goes to REMOTE) return tx async def force_close_channel(self, chan_id: bytes) -> str: """Force-close the channel. Network-related exceptions are propagated to the caller. (automatic rebroadcasts will be scheduled) """ # note: as we are async, it can take a few event loop iterations between the caller # "calling us" and us getting to run, and we only set the channel state now: tx = self._force_close_channel(chan_id) await self.network.broadcast_transaction(tx) return tx.txid() def schedule_force_closing(self, chan_id: bytes) -> 'asyncio.Task[None]': """Schedules a task to force-close the channel and returns it. Network-related exceptions are suppressed. (automatic rebroadcasts will be scheduled) Note: this method is intentionally not async so that callers have a guarantee that the channel state is set immediately. """ tx = self._force_close_channel(chan_id) return asyncio.create_task(self.network.try_broadcasting(tx, 'force-close')) def remove_channel(self, chan_id): chan = self.channels[chan_id] assert chan.can_be_deleted() with self.lock: self._channels.pop(chan_id) self.db.get('channels').pop(chan_id.hex()) for addr in chan.get_wallet_addresses_channel_might_want_reserved(): self.wallet.set_reserved_state_of_address(addr, reserved=False) util.trigger_callback('channels_updated', self.wallet) util.trigger_callback('wallet_updated', self.wallet) @ignore_exceptions @log_exceptions async def reestablish_peer_for_given_channel(self, chan: Channel) -> None: now = time.time() peer_addresses = [] if not self.channel_db: addr = trampolines_by_id().get(chan.node_id) if addr: peer_addresses.append(addr) else: # will try last good address first, from gossip last_good_addr = self.channel_db.get_last_good_address(chan.node_id) if last_good_addr: peer_addresses.append(last_good_addr) # will try addresses for node_id from gossip addrs_from_gossip = self.channel_db.get_node_addresses(chan.node_id) or [] for host, port, ts in addrs_from_gossip: peer_addresses.append(LNPeerAddr(host, port, chan.node_id)) # will try addresses stored in channel storage peer_addresses += list(chan.get_peer_addresses()) # Done gathering addresses. # Now select first one that has not failed recently. for peer in peer_addresses: if self._can_retry_addr(peer, urgent=True, now=now): await self._add_peer(peer.host, peer.port, peer.pubkey) return async def reestablish_peers_and_channels(self): while True: await asyncio.sleep(1) if self.stopping_soon: return for chan in self.channels.values(): if chan.is_closed(): continue # reestablish if not chan.should_try_to_reestablish_peer(): continue peer = self._peers.get(chan.node_id, None) if peer: await peer.taskgroup.spawn(peer.reestablish_channel(chan)) else: await self.taskgroup.spawn(self.reestablish_peer_for_given_channel(chan)) def current_feerate_per_kw(self): from .simple_config import FEE_LN_ETA_TARGET, FEERATE_FALLBACK_STATIC_FEE, FEERATE_REGTEST_HARDCODED from .simple_config import FEERATE_PER_KW_MIN_RELAY_LIGHTNING if constants.net is constants.BitcoinRegtest: return FEERATE_REGTEST_HARDCODED // 4 feerate_per_kvbyte = self.network.config.eta_target_to_fee(FEE_LN_ETA_TARGET) if feerate_per_kvbyte is None: feerate_per_kvbyte = FEERATE_FALLBACK_STATIC_FEE return max(FEERATE_PER_KW_MIN_RELAY_LIGHTNING, feerate_per_kvbyte // 4) def create_channel_backup(self, channel_id): chan = self._channels[channel_id] # do not backup old-style channels assert chan.is_static_remotekey_enabled() peer_addresses = list(chan.get_peer_addresses()) peer_addr = peer_addresses[0] return ImportedChannelBackupStorage( node_id = chan.node_id, privkey = self.node_keypair.privkey, funding_txid = chan.funding_outpoint.txid, funding_index = chan.funding_outpoint.output_index, funding_address = chan.get_funding_address(), host = peer_addr.host, port = peer_addr.port, is_initiator = chan.constraints.is_initiator, channel_seed = chan.config[LOCAL].channel_seed, local_delay = chan.config[LOCAL].to_self_delay, remote_delay = chan.config[REMOTE].to_self_delay, remote_revocation_pubkey = chan.config[REMOTE].revocation_basepoint.pubkey, remote_payment_pubkey = chan.config[REMOTE].payment_basepoint.pubkey) def export_channel_backup(self, channel_id): xpub = self.wallet.get_fingerprint() backup_bytes = self.create_channel_backup(channel_id).to_bytes() assert backup_bytes == ImportedChannelBackupStorage.from_bytes(backup_bytes).to_bytes(), "roundtrip failed" encrypted = pw_encode_with_version_and_mac(backup_bytes, xpub) assert backup_bytes == pw_decode_with_version_and_mac(encrypted, xpub), "encrypt failed" return 'channel_backup:' + encrypted async def request_force_close(self, channel_id: bytes, *, connect_str=None) -> None: if channel_id in self.channels: chan = self.channels[channel_id] peer = self._peers.get(chan.node_id) if not peer: raise Exception('Peer not found') chan.should_request_force_close = True peer.close_and_cleanup() elif connect_str: peer = await self.add_peer(connect_str) await peer.trigger_force_close(channel_id) elif channel_id in self.channel_backups: await self._request_force_close_from_backup(channel_id) else: raise Exception(f'Unknown channel {channel_id.hex()}') def import_channel_backup(self, data): assert data.startswith('channel_backup:') encrypted = data[15:] xpub = self.wallet.get_fingerprint() decrypted = pw_decode_with_version_and_mac(encrypted, xpub) cb_storage = ImportedChannelBackupStorage.from_bytes(decrypted) channel_id = cb_storage.channel_id() if channel_id.hex() in self.db.get_dict("channels"): raise Exception('Channel already in wallet') self.logger.info(f'importing channel backup: {channel_id.hex()}') d = self.db.get_dict("imported_channel_backups") d[channel_id.hex()] = cb_storage with self.lock: cb = ChannelBackup(cb_storage, sweep_address=self.sweep_address, lnworker=self) self._channel_backups[channel_id] = cb self.wallet.save_db() util.trigger_callback('channels_updated', self.wallet) self.lnwatcher.add_channel(cb.funding_outpoint.to_str(), cb.get_funding_address()) def has_conflicting_backup_with(self, remote_node_id: bytes): """ Returns whether we have an active channel with this node on another device, using same local node id. """ channel_backup_peers = [ cb.node_id for cb in self.channel_backups.values() if (not cb.is_closed() and cb.get_local_pubkey() == self.node_keypair.pubkey)] return any(remote_node_id.startswith(cb_peer_nodeid) for cb_peer_nodeid in channel_backup_peers) def remove_channel_backup(self, channel_id): chan = self.channel_backups[channel_id] assert chan.can_be_deleted() onchain_backups = self.db.get_dict("onchain_channel_backups") imported_backups = self.db.get_dict("imported_channel_backups") if channel_id.hex() in onchain_backups: onchain_backups.pop(channel_id.hex()) elif channel_id.hex() in imported_backups: imported_backups.pop(channel_id.hex()) else: raise Exception('Channel not found') with self.lock: self._channel_backups.pop(channel_id) self.wallet.save_db() util.trigger_callback('channels_updated', self.wallet) @log_exceptions async def _request_force_close_from_backup(self, channel_id: bytes): cb = self.channel_backups.get(channel_id) if not cb: raise Exception(f'channel backup not found {self.channel_backups}') cb = cb.cb # storage self.logger.info(f'requesting channel force close: {channel_id.hex()}') if isinstance(cb, ImportedChannelBackupStorage): node_id = cb.node_id privkey = cb.privkey addresses = [(cb.host, cb.port, 0)] # TODO also try network addresses from gossip db (as it might have changed) else: assert isinstance(cb, OnchainChannelBackupStorage) if not self.channel_db: raise Exception('Enable gossip first') node_id = self.network.channel_db.get_node_by_prefix(cb.node_id_prefix) privkey = self.node_keypair.privkey addresses = self.network.channel_db.get_node_addresses(node_id) if not addresses: raise Exception('Peer not found in gossip database') for host, port, timestamp in addresses: peer_addr = LNPeerAddr(host, port, node_id) transport = LNTransport(privkey, peer_addr, proxy=self.network.proxy) peer = Peer(self, node_id, transport, is_channel_backup=True) try: async with OldTaskGroup(wait=any) as group: await group.spawn(peer._message_loop()) await group.spawn(peer.trigger_force_close(channel_id)) return except Exception as e: self.logger.info(f'failed to connect {host} {e}') continue else: raise Exception('failed to connect') def maybe_add_backup_from_tx(self, tx): funding_address = None node_id_prefix = None for i, o in enumerate(tx.outputs()): script_type = get_script_type_from_output_script(o.scriptpubkey) if script_type == 'p2wsh': funding_index = i funding_address = o.address for o2 in tx.outputs(): if o2.scriptpubkey.startswith(bytes([opcodes.OP_RETURN])): encrypted_data = o2.scriptpubkey[2:] data = self.decrypt_cb_data(encrypted_data, funding_address) if data.startswith(CB_MAGIC_BYTES): node_id_prefix = data[4:] if node_id_prefix is None: return funding_txid = tx.txid() cb_storage = OnchainChannelBackupStorage( node_id_prefix = node_id_prefix, funding_txid = funding_txid, funding_index = funding_index, funding_address = funding_address, is_initiator = True) channel_id = cb_storage.channel_id().hex() if channel_id in self.db.get_dict("channels"): return self.logger.info(f"adding backup from tx") d = self.db.get_dict("onchain_channel_backups") d[channel_id] = cb_storage cb = ChannelBackup(cb_storage, sweep_address=self.sweep_address, lnworker=self) self.wallet.save_db() with self.lock: self._channel_backups[bfh(channel_id)] = cb util.trigger_callback('channels_updated', self.wallet) self.lnwatcher.add_channel(cb.funding_outpoint.to_str(), cb.get_funding_address())
49.358844
201
0.631671
import asyncio import os from decimal import Decimal import random import time from typing import (Optional, Sequence, Tuple, List, Set, Dict, TYPE_CHECKING, NamedTuple, Union, Mapping, Any, Iterable, AsyncGenerator, DefaultDict) import threading import socket import aiohttp import json from datetime import datetime, timezone from functools import partial from collections import defaultdict import concurrent from concurrent import futures import urllib.parse import dns.resolver import dns.exception from aiorpcx import run_in_thread, NetAddress, ignore_after from . import constants, util from . import keystore from .util import profiler, chunks, OldTaskGroup from .invoices import PR_TYPE_LN, PR_UNPAID, PR_EXPIRED, PR_PAID, PR_INFLIGHT, PR_FAILED, PR_ROUTING, LNInvoice, LN_EXPIRY_NEVER from .util import NetworkRetryManager, JsonRPCClient from .lnutil import LN_MAX_FUNDING_SAT from .keystore import BIP32_KeyStore from .bitcoin import COIN from .bitcoin import opcodes, make_op_return, address_to_scripthash from .transaction import Transaction from .transaction import get_script_type_from_output_script from .crypto import sha256 from .bip32 import BIP32Node from .util import bh2u, bfh, InvoiceError, resolve_dns_srv, is_ip_address, log_exceptions from .crypto import chacha20_encrypt, chacha20_decrypt from .util import ignore_exceptions, make_aiohttp_session from .util import timestamp_to_datetime, random_shuffled_copy from .util import MyEncoder, is_private_netaddress, UnrelatedTransactionException from .logging import Logger from .lntransport import LNTransport, LNResponderTransport, LNTransportBase from .lnpeer import Peer, LN_P2P_NETWORK_TIMEOUT from .lnaddr import lnencode, LnAddr, lndecode from .ecc import der_sig_from_sig_string from .lnchannel import Channel, AbstractChannel from .lnchannel import ChannelState, PeerState, HTLCWithStatus from .lnrater import LNRater from . import lnutil from .lnutil import funding_output_script from .bitcoin import redeem_script_to_address from .lnutil import (Outpoint, LNPeerAddr, get_compressed_pubkey_from_bech32, extract_nodeid, PaymentFailure, split_host_port, ConnStringFormatError, generate_keypair, LnKeyFamily, LOCAL, REMOTE, MIN_FINAL_CLTV_EXPIRY_FOR_INVOICE, NUM_MAX_EDGES_IN_PAYMENT_PATH, SENT, RECEIVED, HTLCOwner, UpdateAddHtlc, Direction, LnFeatures, ShortChannelID, HtlcLog, derive_payment_secret_from_payment_preimage, NoPathFound, InvalidGossipMsg) from .lnutil import ln_dummy_address, ln_compare_features, IncompatibleLightningFeatures from .transaction import PartialTxOutput, PartialTransaction, PartialTxInput from .lnonion import OnionFailureCode, OnionRoutingFailure from .lnmsg import decode_msg from .i18n import _ from .lnrouter import (RouteEdge, LNPaymentRoute, LNPaymentPath, is_route_sane_to_use, NoChannelPolicy, LNPathInconsistent) from .address_synchronizer import TX_HEIGHT_LOCAL from . import lnsweep from .lnwatcher import LNWalletWatcher from .crypto import pw_encode_with_version_and_mac, pw_decode_with_version_and_mac from .lnutil import ImportedChannelBackupStorage, OnchainChannelBackupStorage from .lnchannel import ChannelBackup from .channel_db import UpdateStatus from .channel_db import get_mychannel_info, get_mychannel_policy from .submarine_swaps import SwapManager from .channel_db import ChannelInfo, Policy from .mpp_split import suggest_splits from .trampoline import create_trampoline_route_and_onion, TRAMPOLINE_FEES, is_legacy_relay if TYPE_CHECKING: from .network import Network from .wallet import Abstract_Wallet from .channel_db import ChannelDB from .simple_config import SimpleConfig SAVED_PR_STATUS = [PR_PAID, PR_UNPAID] NUM_PEERS_TARGET = 4 CB_VERSION = 0 CB_MAGIC_BYTES = bytes([0, 0, 0, CB_VERSION]) FALLBACK_NODE_LIST_TESTNET = ( LNPeerAddr(host='203.132.95.10', port=9735, pubkey=bfh('038863cf8ab91046230f561cd5b386cbff8309fa02e3f0c3ed161a3aeb64a643b9')), LNPeerAddr(host='2401:d002:4402:0:bf1d:986a:7598:6d49', port=9735, pubkey=bfh('038863cf8ab91046230f561cd5b386cbff8309fa02e3f0c3ed161a3aeb64a643b9')), LNPeerAddr(host='50.116.3.223', port=9734, pubkey=bfh('03236a685d30096b26692dce0cf0fa7c8528bdf61dbf5363a3ef6d5c92733a3016')), LNPeerAddr(host='3.16.119.191', port=9735, pubkey=bfh('03d5e17a3c213fe490e1b0c389f8cfcfcea08a29717d50a9f453735e0ab2a7c003')), LNPeerAddr(host='34.250.234.192', port=9735, pubkey=bfh('03933884aaf1d6b108397e5efe5c86bcf2d8ca8d2f700eda99db9214fc2712b134')), LNPeerAddr(host='88.99.209.230', port=9735, pubkey=bfh('0260d9119979caedc570ada883ff614c6efb93f7f7382e25d73ecbeba0b62df2d7')), LNPeerAddr(host='160.16.233.215', port=9735, pubkey=bfh('023ea0a53af875580899da0ab0a21455d9c19160c4ea1b7774c9d4be6810b02d2c')), LNPeerAddr(host='197.155.6.173', port=9735, pubkey=bfh('0269a94e8b32c005e4336bfb743c08a6e9beb13d940d57c479d95c8e687ccbdb9f')), LNPeerAddr(host='2c0f:fb18:406::4', port=9735, pubkey=bfh('0269a94e8b32c005e4336bfb743c08a6e9beb13d940d57c479d95c8e687ccbdb9f')), LNPeerAddr(host='163.172.94.64', port=9735, pubkey=bfh('030f0bf260acdbd3edcad84d7588ec7c5df4711e87e6a23016f989b8d3a4147230')), LNPeerAddr(host='23.237.77.12', port=9735, pubkey=bfh('02312627fdf07fbdd7e5ddb136611bdde9b00d26821d14d94891395452f67af248')), LNPeerAddr(host='197.155.6.172', port=9735, pubkey=bfh('02ae2f22b02375e3e9b4b4a2db4f12e1b50752b4062dbefd6e01332acdaf680379')), LNPeerAddr(host='2c0f:fb18:406::3', port=9735, pubkey=bfh('02ae2f22b02375e3e9b4b4a2db4f12e1b50752b4062dbefd6e01332acdaf680379')), LNPeerAddr(host='23.239.23.44', port=9740, pubkey=bfh('034fe52e98a0e9d3c21b767e1b371881265d8c7578c21f5afd6d6438da10348b36')), LNPeerAddr(host='2600:3c01::f03c:91ff:fe05:349c', port=9740, pubkey=bfh('034fe52e98a0e9d3c21b767e1b371881265d8c7578c21f5afd6d6438da10348b36')), ) FALLBACK_NODE_LIST_MAINNET = [ LNPeerAddr(host='172.81.181.3', port=9735, pubkey=bfh('0214382bdce7750dfcb8126df8e2b12de38536902dc36abcebdaeefdeca1df8284')), LNPeerAddr(host='35.230.100.60', port=9735, pubkey=bfh('023f5e3582716bed96f6f26cfcd8037e07474d7b4743afdc8b07e692df63464d7e')), LNPeerAddr(host='40.69.71.114', port=9735, pubkey=bfh('028303182c9885da93b3b25c9621d22cf34475e63c123942e402ab530c0556e675')), LNPeerAddr(host='94.177.171.73', port=9735, pubkey=bfh('0276e09a267592e7451a939c932cf685f0754de382a3ca85d2fb3a864d4c365ad5')), LNPeerAddr(host='34.236.113.58', port=9735, pubkey=bfh('02fa50c72ee1e2eb5f1b6d9c3032080c4c864373c4201dfa2966aa34eee1051f97')), LNPeerAddr(host='52.50.244.44', port=9735, pubkey=bfh('030c3f19d742ca294a55c00376b3b355c3c90d61c6b6b39554dbc7ac19b141c14f')), LNPeerAddr(host='157.245.68.47', port=9735, pubkey=bfh('03c2abfa93eacec04721c019644584424aab2ba4dff3ac9bdab4e9c97007491dda')), LNPeerAddr(host='18.221.23.28', port=9735, pubkey=bfh('03abf6f44c355dec0d5aa155bdbdd6e0c8fefe318eff402de65c6eb2e1be55dc3e')), LNPeerAddr(host='52.224.178.244', port=9735, pubkey=bfh('026b105ac13212c48714c6be9b11577a9ce10f10e1c88a45ce217e6331209faf8b')), LNPeerAddr(host='34.239.230.56', port=9735, pubkey=bfh('03864ef025fde8fb587d989186ce6a4a186895ee44a926bfc370e2c366597a3f8f')), LNPeerAddr(host='46.229.165.136', port=9735, pubkey=bfh('0390b5d4492dc2f5318e5233ab2cebf6d48914881a33ef6a9c6bcdbb433ad986d0')), LNPeerAddr(host='157.230.28.160', port=9735, pubkey=bfh('0279c22ed7a068d10dc1a38ae66d2d6461e269226c60258c021b1ddcdfe4b00bc4')), LNPeerAddr(host='74.108.13.152', port=9735, pubkey=bfh('0331f80652fb840239df8dc99205792bba2e559a05469915804c08420230e23c7c')), LNPeerAddr(host='167.172.44.148', port=9735, pubkey=bfh('0395033b252c6f40e3756984162d68174e2bd8060a129c0d3462a9370471c6d28f')), LNPeerAddr(host='138.68.14.104', port=9735, pubkey=bfh('03bb88ccc444534da7b5b64b4f7b15e1eccb18e102db0e400d4b9cfe93763aa26d')), LNPeerAddr(host='3.124.63.44', port=9735, pubkey=bfh('0242a4ae0c5bef18048fbecf995094b74bfb0f7391418d71ed394784373f41e4f3')), LNPeerAddr(host='2001:470:8:2e1::43', port=9735, pubkey=bfh('03baa70886d9200af0ffbd3f9e18d96008331c858456b16e3a9b41e735c6208fef')), LNPeerAddr(host='2601:186:c100:6bcd:219:d1ff:fe75:dc2f', port=9735, pubkey=bfh('0298f6074a454a1f5345cb2a7c6f9fce206cd0bf675d177cdbf0ca7508dd28852f')), LNPeerAddr(host='2001:41d0:e:734::1', port=9735, pubkey=bfh('03a503d8e30f2ff407096d235b5db63b4fcf3f89a653acb6f43d3fc492a7674019')), LNPeerAddr(host='2a01:4f9:2b:2254::2', port=9735, pubkey=bfh('02f3069a342ae2883a6f29e275f06f28a56a6ea2e2d96f5888a3266444dcf542b6')), LNPeerAddr(host='2a02:8070:24c1:100:528c:2997:6dbc:a054', port=9735, pubkey=bfh('02a45def9ae014fdd2603dd7033d157faa3a55a72b06a63ae22ef46d9fafdc6e8d')), LNPeerAddr(host='2600:3c01::f03c:91ff:fe05:349c', port=9736, pubkey=bfh('02731b798b39a09f9f14e90ee601afb6ebb796d6e5797de14582a978770b33700f')), LNPeerAddr(host='2a00:8a60:e012:a00::21', port=9735, pubkey=bfh('027ce055380348d7812d2ae7745701c9f93e70c1adeb2657f053f91df4f2843c71')), LNPeerAddr(host='2604:a880:400:d1::8bd:1001', port=9735, pubkey=bfh('03649c72a4816f0cd546f84aafbd657e92a30ab474de7ab795e8b5650a427611f7')), LNPeerAddr(host='2a01:4f8:c0c:7b31::1', port=9735, pubkey=bfh('02c16cca44562b590dd279c942200bdccfd4f990c3a69fad620c10ef2f8228eaff')), LNPeerAddr(host='2001:41d0:1:b40d::1', port=9735, pubkey=bfh('026726a4b043d413b45b334876d17b8a98848129604429ec65532ba286a42efeac')), ] from .trampoline import trampolines_by_id, hardcoded_trampoline_nodes, is_hardcoded_trampoline class PaymentInfo(NamedTuple): payment_hash: bytes amount_msat: Optional[int] direction: int status: int class ErrorAddingPeer(Exception): pass BASE_FEATURES = LnFeatures(0)\ | LnFeatures.OPTION_DATA_LOSS_PROTECT_OPT\ | LnFeatures.OPTION_STATIC_REMOTEKEY_OPT\ | LnFeatures.VAR_ONION_OPT\ | LnFeatures.PAYMENT_SECRET_OPT\ | LnFeatures.OPTION_UPFRONT_SHUTDOWN_SCRIPT_OPT\ LNWALLET_FEATURES = BASE_FEATURES\ | LnFeatures.OPTION_DATA_LOSS_PROTECT_REQ\ | LnFeatures.OPTION_STATIC_REMOTEKEY_REQ\ | LnFeatures.GOSSIP_QUERIES_REQ\ | LnFeatures.BASIC_MPP_OPT\ | LnFeatures.OPTION_TRAMPOLINE_ROUTING_OPT\ | LnFeatures.OPTION_SHUTDOWN_ANYSEGWIT_OPT\ | LnFeatures.OPTION_CHANNEL_TYPE_OPT\ LNGOSSIP_FEATURES = BASE_FEATURES\ | LnFeatures.GOSSIP_QUERIES_OPT\ | LnFeatures.GOSSIP_QUERIES_REQ\ class LNWorker(Logger, NetworkRetryManager[LNPeerAddr]): INITIAL_TRAMPOLINE_FEE_LEVEL = 1 def __init__(self, xprv, features: LnFeatures): Logger.__init__(self) NetworkRetryManager.__init__( self, max_retry_delay_normal=3600, init_retry_delay_normal=600, max_retry_delay_urgent=300, init_retry_delay_urgent=4, ) self.lock = threading.RLock() self.node_keypair = generate_keypair(BIP32Node.from_xkey(xprv), LnKeyFamily.NODE_KEY) self.backup_key = generate_keypair(BIP32Node.from_xkey(xprv), LnKeyFamily.BACKUP_CIPHER).privkey self._peers = {} f.listen_server = None self.features = features self.network = None self.config = None self.stopping_soon = False util.register_callback(self.on_proxy_changed, ['proxy_set']) @property def channel_db(self): return self.network.channel_db if self.network else None @property def peers(self) -> Mapping[bytes, Peer]: with self.lock: return self._peers.copy() def channels_for_peer(self, node_id: bytes) -> Dict[bytes, Channel]: return {} def get_node_alias(self, node_id: bytes) -> Optional[str]: node_alias = None if self.channel_db: node_info = self.channel_db.get_node_info_for_node_id(node_id) if node_info: node_alias = node_info.alias else: for k, v in hardcoded_trampoline_nodes().items(): if v.pubkey == node_id: node_alias = k break return node_alias async def maybe_listen(self): listen_addr = self.config.get('lightning_listen') if listen_addr: self.logger.info(f'lightning_listen enabled. will try to bind: {listen_addr!r}') try: netaddr = NetAddress.from_string(listen_addr) except Exception as e: self.logger.error(f"failed to parse config key 'lightning_listen'. got: {e!r}") return addr = str(netaddr.host) async def cb(reader, writer): transport = LNResponderTransport(self.node_keypair.privkey, reader, writer) try: node_id = await transport.handshake() except Exception as e: self.logger.info(f'handshake failure from incoming connection: {e!r}') return await self._add_peer_from_transport(node_id=node_id, transport=transport) try: self.listen_server = await asyncio.start_server(cb, addr, netaddr.port) except OSError as e: self.logger.error(f"cannot listen for lightning p2p. error: {e!r}") @ignore_exceptions async def main_loop(self): self.logger.info("starting taskgroup.") try: async with self.taskgroup as group: await group.spawn(self._maintain_connectivity()) except Exception as e: self.logger.exception("taskgroup died.") finally: self.logger.info("taskgroup stopped.") async def _maintain_connectivity(self): while True: await asyncio.sleep(1) if self.stopping_soon: return now = time.time() if len(self._peers) >= NUM_PEERS_TARGET: continue peers = await self._get_next_peers_to_try() for peer in peers: if self._can_retry_addr(peer, now=now): try: await self._add_peer(peer.host, peer.port, peer.pubkey) except ErrorAddingPeer as e: self.logger.info(f"failed to add peer: {peer}. exc: {e!r}") async def _add_peer(self, host: str, port: int, node_id: bytes) -> Peer: if node_id in self._peers: return self._peers[node_id] port = int(port) peer_addr = LNPeerAddr(host, port, node_id) self._trying_addr_now(peer_addr) self.logger.info(f"adding peer {peer_addr}") if node_id == self.node_keypair.pubkey: raise ErrorAddingPeer("cannot connect to self") transport = LNTransport(self.node_keypair.privkey, peer_addr, proxy=self.network.proxy) peer = await self._add_peer_from_transport(node_id=node_id, transport=transport) return peer async def _add_peer_from_transport(self, *, node_id: bytes, transport: LNTransportBase) -> Peer: peer = Peer(self, node_id, transport) with self.lock: existing_peer = self._peers.get(node_id) if existing_peer: existing_peer.close_and_cleanup() assert node_id not in self._peers self._peers[node_id] = peer await self.taskgroup.spawn(peer.main_loop()) return peer def peer_closed(self, peer: Peer) -> None: with self.lock: peer2 = self._peers.get(peer.pubkey) if peer2 is peer: self._peers.pop(peer.pubkey) def num_peers(self) -> int: return sum([p.is_initialized() for p in self.peers.values()]) def start_network(self, network: 'Network'): assert network self.network = network self.config = network.config self._add_peers_from_config() asyncio.run_coroutine_threadsafe(self.main_loop(), self.network.asyncio_loop) async def stop(self): if self.listen_server: self.listen_server.close() util.unregister_callback(self.on_proxy_changed) await self.taskgroup.cancel_remaining() def _add_peers_from_config(self): peer_list = self.config.get('lightning_peers', []) for host, port, pubkey in peer_list: asyncio.run_coroutine_threadsafe( self._add_peer(host, int(port), bfh(pubkey)), self.network.asyncio_loop) def is_good_peer(self, peer: LNPeerAddr) -> bool: # the purpose of this method is to filter peers that advertise the desired feature bits # it is disabled for now, because feature bits published in node announcements seem to be unreliable return True node_id = peer.pubkey node = self.channel_db._nodes.get(node_id) if not node: return False try: ln_compare_features(self.features, node.features) except IncompatibleLightningFeatures: return False #self.logger.info(f'is_good {peer.host}') return True def on_peer_successfully_established(self, peer: Peer) -> None: if isinstance(peer.transport, LNTransport): peer_addr = peer.transport.peer_addr # reset connection attempt count self._on_connection_successfully_established(peer_addr) # add into channel db if self.channel_db: self.channel_db.add_recent_peer(peer_addr) # save network address into channels we might have with peer for chan in peer.channels.values(): chan.add_or_update_peer_addr(peer_addr) async def _get_next_peers_to_try(self) -> Sequence[LNPeerAddr]: now = time.time() await self.channel_db.data_loaded.wait() # first try from recent peers recent_peers = self.channel_db.get_recent_peers() for peer in recent_peers: if not peer: continue if peer.pubkey in self._peers: continue if not self._can_retry_addr(peer, now=now): continue if not self.is_good_peer(peer): continue return [peer] # try random peer from graph unconnected_nodes = self.channel_db.get_200_randomly_sorted_nodes_not_in(self.peers.keys()) if unconnected_nodes: for node_id in unconnected_nodes: addrs = self.channel_db.get_node_addresses(node_id) if not addrs: continue host, port, timestamp = self.choose_preferred_address(list(addrs)) try: peer = LNPeerAddr(host, port, node_id) except ValueError: continue if not self._can_retry_addr(peer, now=now): continue if not self.is_good_peer(peer): continue #self.logger.info('taking random ln peer from our channel db') return [peer] # getting desperate... let's try hardcoded fallback list of peers if constants.net in (constants.BitcoinTestnet,): fallback_list = FALLBACK_NODE_LIST_TESTNET elif constants.net in (constants.BitcoinMainnet,): fallback_list = FALLBACK_NODE_LIST_MAINNET else: return [] fallback_list = [peer for peer in fallback_list if self._can_retry_addr(peer, now=now)] if fallback_list: return [random.choice(fallback_list)] return await run_in_thread(self._get_peers_from_dns_seeds) def _get_peers_from_dns_seeds(self) -> Sequence[LNPeerAddr]: if not constants.net.LN_DNS_SEEDS: return [] dns_seed = random.choice(constants.net.LN_DNS_SEEDS) self.logger.info('asking dns seed "{}" for ln peers'.format(dns_seed)) try: srv_answers = resolve_dns_srv('r{}.{}'.format( constants.net.LN_REALM_BYTE, dns_seed)) except dns.exception.DNSException as e: self.logger.info(f'failed querying (1) dns seed "{dns_seed}" for ln peers: {repr(e)}') return [] random.shuffle(srv_answers) num_peers = 2 * NUM_PEERS_TARGET srv_answers = srv_answers[:num_peers] peers = [] for srv_ans in srv_answers: try: answers = dns.resolver.resolve(srv_ans['host']) except dns.exception.DNSException as e: self.logger.info(f'failed querying (2) dns seed "{dns_seed}" for ln peers: {repr(e)}') continue try: ln_host = str(answers[0]) port = int(srv_ans['port']) bech32_pubkey = srv_ans['host'].split('.')[0] pubkey = get_compressed_pubkey_from_bech32(bech32_pubkey) peers.append(LNPeerAddr(ln_host, port, pubkey)) except Exception as e: self.logger.info(f'error with parsing peer from dns seed: {repr(e)}') continue self.logger.info(f'got {len(peers)} ln peers from dns seed') return peers @staticmethod def choose_preferred_address(addr_list: Sequence[Tuple[str, int, int]]) -> Tuple[str, int, int]: assert len(addr_list) >= 1 for host, port, timestamp in addr_list: if is_ip_address(host): return host, port, timestamp choice = random.choice(addr_list) return choice def on_proxy_changed(self, event, *args): for peer in self.peers.values(): peer.close_and_cleanup() self._clear_addr_retry_times() @log_exceptions async def add_peer(self, connect_str: str) -> Peer: node_id, rest = extract_nodeid(connect_str) peer = self._peers.get(node_id) if not peer: if rest is not None: host, port = split_host_port(rest) else: if not self.channel_db: addr = trampolines_by_id().get(node_id) if not addr: raise ConnStringFormatError(_('Address unknown for node:') + ' ' + bh2u(node_id)) host, port = addr.host, addr.port else: addrs = self.channel_db.get_node_addresses(node_id) if not addrs: raise ConnStringFormatError(_('Don\'t know any addresses for node:') + ' ' + bh2u(node_id)) host, port, timestamp = self.choose_preferred_address(list(addrs)) port = int(port) # Try DNS-resolving the host (if needed). This is simply so that # the caller gets a nice exception if it cannot be resolved. try: await asyncio.get_event_loop().getaddrinfo(host, port) except socket.gaierror: raise ConnStringFormatError(_('Hostname does not resolve (getaddrinfo failed)')) # add peer peer = await self._add_peer(host, port, node_id) return peer class LNGossip(LNWorker): max_age = 14*24*3600 LOGGING_SHORTCUT = 'g' def __init__(self): seed = os.urandom(32) node = BIP32Node.from_rootseed(seed, xtype='standard') xprv = node.to_xprv() super().__init__(xprv, LNGOSSIP_FEATURES) self.unknown_ids = set() def start_network(self, network: 'Network'): assert network super().start_network(network) asyncio.run_coroutine_threadsafe(self.taskgroup.spawn(self.maintain_db()), self.network.asyncio_loop) async def maintain_db(self): await self.channel_db.data_loaded.wait() while True: if len(self.unknown_ids) == 0: self.channel_db.prune_old_policies(self.max_age) self.channel_db.prune_orphaned_channels() await asyncio.sleep(120) async def add_new_ids(self, ids: Iterable[bytes]): known = self.channel_db.get_channel_ids() new = set(ids) - set(known) self.unknown_ids.update(new) util.trigger_callback('unknown_channels', len(self.unknown_ids)) util.trigger_callback('gossip_peers', self.num_peers()) util.trigger_callback('ln_gossip_sync_progress') def get_ids_to_query(self) -> Sequence[bytes]: N = 500 l = list(self.unknown_ids) self.unknown_ids = set(l[N:]) util.trigger_callback('unknown_channels', len(self.unknown_ids)) util.trigger_callback('ln_gossip_sync_progress') return l[0:N] def get_sync_progress_estimate(self) -> Tuple[Optional[int], Optional[int], Optional[int]]: if self.num_peers() == 0: return None, None, None nchans_with_0p, nchans_with_1p, nchans_with_2p = self.channel_db.get_num_channels_partitioned_by_policy_count() num_db_channels = nchans_with_0p + nchans_with_1p + nchans_with_2p # some channels will never have two policies (only one is in gossip?...) # so if we have at least 1 policy for a channel, we consider that channel "complete" here current_est = num_db_channels - nchans_with_0p total_est = len(self.unknown_ids) + num_db_channels progress = current_est / total_est if total_est and current_est else 0 progress_percent = (1.0 / 0.95 * progress) * 100 progress_percent = min(progress_percent, 100) progress_percent = round(progress_percent) # take a minimal number of synchronized channels to get a more accurate # percentage estimate if current_est < 200: progress_percent = 0 return current_est, total_est, progress_percent async def process_gossip(self, chan_anns, node_anns, chan_upds): # note: we run in the originating peer's TaskGroup, so we can safely raise here await self.channel_db.data_loaded.wait() self.logger.debug(f'process_gossip {len(chan_anns)} {len(node_anns)} {len(chan_upds)}') def process_chan_anns(): for payload in chan_anns: self.channel_db.verify_channel_announcement(payload) self.channel_db.add_channel_announcements(chan_anns) await run_in_thread(process_chan_anns) def process_node_anns(): for payload in node_anns: self.channel_db.verify_node_announcement(payload) self.channel_db.add_node_announcements(node_anns) await run_in_thread(process_node_anns) categorized_chan_upds = await run_in_thread(partial( self.channel_db.add_channel_updates, chan_upds, max_age=self.max_age)) orphaned = categorized_chan_upds.orphaned if orphaned: self.logger.info(f'adding {len(orphaned)} unknown channel ids') orphaned_ids = [c['short_channel_id'] for c in orphaned] await self.add_new_ids(orphaned_ids) if categorized_chan_upds.good: self.logger.debug(f'on_channel_update: {len(categorized_chan_upds.good)}/{len(chan_upds)}') class LNWallet(LNWorker): lnwatcher: Optional['LNWalletWatcher'] MPP_EXPIRY = 120 TIMEOUT_SHUTDOWN_FAIL_PENDING_HTLCS = 3 def __init__(self, wallet: 'Abstract_Wallet', xprv): self.wallet = wallet self.db = wallet.db Logger.__init__(self) LNWorker.__init__(self, xprv, LNWALLET_FEATURES) self.config = wallet.config self.lnwatcher = None self.lnrater: LNRater = None self.payments = self.db.get_dict('lightning_payments') self.preimages = self.db.get_dict('lightning_preimages') self.sweep_address = wallet.get_new_sweep_address_for_channel() self.logs = defaultdict(list) self.enable_htlc_forwarding = True self._channels = {} channels = self.db.get_dict("channels") for channel_id, c in random_shuffled_copy(channels.items()): self._channels[bfh(channel_id)] = Channel(c, sweep_address=self.sweep_address, lnworker=self) self._channel_backups = {} for name in ["onchain_channel_backups", "imported_channel_backups"]: channel_backups = self.db.get_dict(name) for channel_id, storage in channel_backups.items(): self._channel_backups[bfh(channel_id)] = ChannelBackup(storage, sweep_address=self.sweep_address, lnworker=self) self.sent_htlcs = defaultdict(asyncio.Queue) self.sent_htlcs_info = dict() self.sent_buckets = dict() self.received_mpp_htlcs = dict() self.swap_manager = SwapManager(wallet=self.wallet, lnworker=self) self.inflight_payments = set() for payment_hash in self.get_payments(status='inflight').keys(): self.set_invoice_status(payment_hash.hex(), PR_INFLIGHT) self.trampoline_forwarding_failures = {} self.downstream_htlc_to_upstream_peer_map = {} def has_deterministic_node_id(self) -> bool: return bool(self.db.get('lightning_xprv')) def can_have_recoverable_channels(self) -> bool: return (self.has_deterministic_node_id() and not (self.config.get('lightning_listen'))) def has_recoverable_channels(self) -> bool: return (self.can_have_recoverable_channels() and self.config.get('use_recoverable_channels', True)) @property def channels(self) -> Mapping[bytes, Channel]: with self.lock: return self._channels.copy() @property def channel_backups(self) -> Mapping[bytes, ChannelBackup]: with self.lock: return self._channel_backups.copy() def get_channel_by_id(self, channel_id: bytes) -> Optional[Channel]: return self._channels.get(channel_id, None) def diagnostic_name(self): return self.wallet.diagnostic_name() @ignore_exceptions @log_exceptions async def sync_with_local_watchtower(self): watchtower = self.network.local_watchtower if watchtower: while True: for chan in self.channels.values(): await self.sync_channel_with_watchtower(chan, watchtower.sweepstore) await asyncio.sleep(5) @ignore_exceptions @log_exceptions async def sync_with_remote_watchtower(self): while True: await asyncio.sleep(5) watchtower_url = self.config.get('watchtower_url') if not watchtower_url: continue parsed_url = urllib.parse.urlparse(watchtower_url) if not (parsed_url.scheme == 'https' or is_private_netaddress(parsed_url.hostname)): self.logger.warning(f"got watchtower URL for remote tower but we won't use it! " f"can only use HTTPS (except if private IP): not using {watchtower_url!r}") continue # try to sync with the remote watchtower try: async with make_aiohttp_session(proxy=self.network.proxy) as session: watchtower = JsonRPCClient(session, watchtower_url) watchtower.add_method('get_ctn') watchtower.add_method('add_sweep_tx') for chan in self.channels.values(): await self.sync_channel_with_watchtower(chan, watchtower) except aiohttp.client_exceptions.ClientConnectorError: self.logger.info(f'could not contact remote watchtower {watchtower_url}') async def sync_channel_with_watchtower(self, chan: Channel, watchtower): outpoint = chan.funding_outpoint.to_str() addr = chan.get_funding_address() current_ctn = chan.get_oldest_unrevoked_ctn(REMOTE) watchtower_ctn = await watchtower.get_ctn(outpoint, addr) for ctn in range(watchtower_ctn + 1, current_ctn): sweeptxs = chan.create_sweeptxs(ctn) for tx in sweeptxs: await watchtower.add_sweep_tx(outpoint, ctn, tx.inputs()[0].prevout.to_str(), tx.serialize()) def start_network(self, network: 'Network'): assert network self.network = network self.config = network.config self.lnwatcher = LNWalletWatcher(self, network) self.lnwatcher.start_network(network) self.swap_manager.start_network(network=network, lnwatcher=self.lnwatcher) self.lnrater = LNRater(self, network) for chan in self.channels.values(): self.lnwatcher.add_channel(chan.funding_outpoint.to_str(), chan.get_funding_address()) for cb in self.channel_backups.values(): self.lnwatcher.add_channel(cb.funding_outpoint.to_str(), cb.get_funding_address()) for coro in [ self.maybe_listen(), self.lnwatcher.on_network_update('network_updated'), # shortcut (don't block) if funding tx locked and verified self.reestablish_peers_and_channels(), self.sync_with_local_watchtower(), self.sync_with_remote_watchtower(), ]: tg_coro = self.taskgroup.spawn(coro) asyncio.run_coroutine_threadsafe(tg_coro, self.network.asyncio_loop) async def stop(self): self.stopping_soon = True if self.listen_server: self.listen_server.close() async with ignore_after(self.TIMEOUT_SHUTDOWN_FAIL_PENDING_HTLCS): await self.wait_for_received_pending_htlcs_to_get_removed() await LNWorker.stop(self) if self.lnwatcher: await self.lnwatcher.stop() self.lnwatcher = None async def wait_for_received_pending_htlcs_to_get_removed(self): assert self.stopping_soon is True # that we can already fail/fulfill. e.g. forwarded htlcs cannot be removed async with OldTaskGroup() as group: for peer in self.peers.values(): await group.spawn(peer.wait_one_htlc_switch_iteration()) while True: if all(not peer.received_htlcs_pending_removal for peer in self.peers.values()): break async with OldTaskGroup(wait=any) as group: for peer in self.peers.values(): await group.spawn(peer.received_htlc_removed_event.wait()) def peer_closed(self, peer): for chan in self.channels_for_peer(peer.pubkey).values(): chan.peer_state = PeerState.DISCONNECTED util.trigger_callback('channel', self.wallet, chan) super().peer_closed(peer) def get_payments(self, *, status=None) -> Mapping[bytes, List[HTLCWithStatus]]: out = defaultdict(list) for chan in self.channels.values(): d = chan.get_payments(status=status) for payment_hash, plist in d.items(): out[payment_hash] += plist return out def get_payment_value( self, info: Optional['PaymentInfo'], plist: List[HTLCWithStatus], ) -> Tuple[int, int, int]: assert plist amount_msat = 0 fee_msat = None for htlc_with_status in plist: htlc = htlc_with_status.htlc _direction = htlc_with_status.direction amount_msat += int(_direction) * htlc.amount_msat if _direction == SENT and info and info.amount_msat: fee_msat = (fee_msat or 0) - info.amount_msat - amount_msat timestamp = min([htlc_with_status.htlc.timestamp for htlc_with_status in plist]) return amount_msat, fee_msat, timestamp def get_lightning_history(self): out = {} for payment_hash, plist in self.get_payments(status='settled').items(): if len(plist) == 0: continue key = payment_hash.hex() info = self.get_payment_info(payment_hash) amount_msat, fee_msat, timestamp = self.get_payment_value(info, plist) if info is not None: label = self.wallet.get_label(key) direction = ('sent' if info.direction == SENT else 'received') if len(plist)==1 else 'self-payment' else: direction = 'forwarding' label = _('Forwarding') preimage = self.get_preimage(payment_hash).hex() item = { 'type': 'payment', 'label': label, 'timestamp': timestamp or 0, 'date': timestamp_to_datetime(timestamp), 'direction': direction, 'amount_msat': amount_msat, 'fee_msat': fee_msat, 'payment_hash': key, 'preimage': preimage, } # add group_id to swap transactions swap = self.swap_manager.get_swap(payment_hash) if swap: if swap.is_reverse: item['group_id'] = swap.spending_txid item['group_label'] = 'Reverse swap' + ' ' + self.config.format_amount_and_units(swap.lightning_amount) else: item['group_id'] = swap.funding_txid item['group_label'] = 'Forward swap' + ' ' + self.config.format_amount_and_units(swap.onchain_amount) # done out[payment_hash] = item return out def get_onchain_history(self): current_height = self.wallet.get_local_height() out = {} # add funding events for chan in self.channels.values(): item = chan.get_funding_height() if item is None: continue if not self.lnwatcher: continue # lnwatcher not available with --offline (its data is not persisted) funding_txid, funding_height, funding_timestamp = item tx_height = self.lnwatcher.get_tx_height(funding_txid) item = { 'channel_id': bh2u(chan.channel_id), 'type': 'channel_opening', 'label': self.wallet.get_label_for_txid(funding_txid) or (_('Open channel') + ' ' + chan.get_id_for_log()), 'txid': funding_txid, 'amount_msat': chan.balance(LOCAL, ctn=0), 'direction': 'received', 'timestamp': tx_height.timestamp, 'date': timestamp_to_datetime(tx_height.timestamp), 'fee_sat': None, 'fee_msat': None, 'height': tx_height.height, 'confirmations': tx_height.conf, } out[funding_txid] = item item = chan.get_closing_height() if item is None: continue closing_txid, closing_height, closing_timestamp = item tx_height = self.lnwatcher.get_tx_height(closing_txid) item = { 'channel_id': bh2u(chan.channel_id), 'txid': closing_txid, 'label': self.wallet.get_label_for_txid(closing_txid) or (_('Close channel') + ' ' + chan.get_id_for_log()), 'type': 'channel_closure', 'amount_msat': -chan.balance_minus_outgoing_htlcs(LOCAL), 'direction': 'sent', 'timestamp': tx_height.timestamp, 'date': timestamp_to_datetime(tx_height.timestamp), 'fee_sat': None, 'fee_msat': None, 'height': tx_height.height, 'confirmations': tx_height.conf, } out[closing_txid] = item # add info about submarine swaps settled_payments = self.get_payments(status='settled') for payment_hash_hex, swap in self.swap_manager.swaps.items(): txid = swap.spending_txid if swap.is_reverse else swap.funding_txid if txid is None: continue payment_hash = bytes.fromhex(payment_hash_hex) if payment_hash in settled_payments: plist = settled_payments[payment_hash] info = self.get_payment_info(payment_hash) amount_msat, fee_msat, timestamp = self.get_payment_value(info, plist) else: amount_msat = 0 label = 'Reverse swap' if swap.is_reverse else 'Forward swap' delta = current_height - swap.locktime if not swap.is_redeemed and swap.spending_txid is None and delta < 0: label += f' (refundable in {-delta} blocks)' # fixme: only if unspent out[txid] = { 'txid': txid, 'group_id': txid, 'amount_msat': 0, #'amount_msat': amount_msat, # must not be added 'type': 'swap', 'label': self.wallet.get_label_for_txid(txid) or label, } return out def get_history(self): out = list(self.get_lightning_history().values()) + list(self.get_onchain_history().values()) # sort by timestamp out.sort(key=lambda x: (x.get('timestamp') or float("inf"))) balance_msat = 0 for item in out: balance_msat += item['amount_msat'] item['balance_msat'] = balance_msat return out def channel_peers(self) -> List[bytes]: node_ids = [chan.node_id for chan in self.channels.values() if not chan.is_closed()] return node_ids def channels_for_peer(self, node_id): assert type(node_id) is bytes return {chan_id: chan for (chan_id, chan) in self.channels.items() if chan.node_id == node_id} def channel_state_changed(self, chan: Channel): if type(chan) is Channel: self.save_channel(chan) util.trigger_callback('channel', self.wallet, chan) def save_channel(self, chan: Channel): assert type(chan) is Channel if chan.config[REMOTE].next_per_commitment_point == chan.config[REMOTE].current_per_commitment_point: raise Exception("Tried to save channel with next_point == current_point, this should not happen") self.wallet.save_db() util.trigger_callback('channel', self.wallet, chan) def channel_by_txo(self, txo: str) -> Optional[AbstractChannel]: for chan in self.channels.values(): if chan.funding_outpoint.to_str() == txo: return chan for chan in self.channel_backups.values(): if chan.funding_outpoint.to_str() == txo: return chan async def on_channel_update(self, chan: Channel): if type(chan) is ChannelBackup: util.trigger_callback('channel', self.wallet, chan) return if chan.get_state() == ChannelState.OPEN and chan.should_be_closed_due_to_expiring_htlcs(self.network.get_local_height()): self.logger.info(f"force-closing due to expiring htlcs") await self.schedule_force_closing(chan.channel_id) elif chan.get_state() == ChannelState.FUNDED: peer = self._peers.get(chan.node_id) if peer and peer.is_initialized(): peer.send_funding_locked(chan) elif chan.get_state() == ChannelState.OPEN: peer = self._peers.get(chan.node_id) if peer: await peer.maybe_update_fee(chan) conf = self.lnwatcher.get_tx_height(chan.funding_outpoint.txid).conf peer.on_network_update(chan, conf) elif chan.get_state() == ChannelState.FORCE_CLOSING: force_close_tx = chan.force_close_tx() txid = force_close_tx.txid() height = self.lnwatcher.get_tx_height(txid).height if height == TX_HEIGHT_LOCAL: self.logger.info('REBROADCASTING CLOSING TX') await self.network.try_broadcasting(force_close_tx, 'force-close') @log_exceptions async def _open_channel_coroutine( self, *, connect_str: str, funding_tx: PartialTransaction, funding_sat: int, push_sat: int, password: Optional[str]) -> Tuple[Channel, PartialTransaction]: peer = await self.add_peer(connect_str) coro = peer.channel_establishment_flow( funding_tx=funding_tx, funding_sat=funding_sat, push_msat=push_sat * 1000, temp_channel_id=os.urandom(32)) chan, funding_tx = await asyncio.wait_for(coro, LN_P2P_NETWORK_TIMEOUT) util.trigger_callback('channels_updated', self.wallet) self.wallet.add_transaction(funding_tx) # save tx as local into the wallet self.wallet.sign_transaction(funding_tx, password) self.wallet.set_label(funding_tx.txid(), _('Open channel')) if funding_tx.is_complete(): await self.network.try_broadcasting(funding_tx, 'open_channel') return chan, funding_tx def add_channel(self, chan: Channel): with self.lock: self._channels[chan.channel_id] = chan self.lnwatcher.add_channel(chan.funding_outpoint.to_str(), chan.get_funding_address()) def add_new_channel(self, chan: Channel): self.add_channel(chan) channels_db = self.db.get_dict('channels') channels_db[chan.channel_id.hex()] = chan.storage for addr in chan.get_wallet_addresses_channel_might_want_reserved(): self.wallet.set_reserved_state_of_address(addr, reserved=True) try: self.save_channel(chan) backup_dir = self.config.get_backup_dir() if backup_dir is not None: self.wallet.save_backup(backup_dir) except: chan.set_state(ChannelState.REDEEMED) self.remove_channel(chan.channel_id) raise def cb_data(self, node_id): return CB_MAGIC_BYTES + node_id[0:16] def decrypt_cb_data(self, encrypted_data, funding_address): funding_scripthash = bytes.fromhex(address_to_scripthash(funding_address)) nonce = funding_scripthash[0:12] return chacha20_decrypt(key=self.backup_key, data=encrypted_data, nonce=nonce) def encrypt_cb_data(self, data, funding_address): funding_scripthash = bytes.fromhex(address_to_scripthash(funding_address)) nonce = funding_scripthash[0:12] return chacha20_encrypt(key=self.backup_key, data=data, nonce=nonce) def mktx_for_open_channel( self, *, coins: Sequence[PartialTxInput], funding_sat: int, node_id: bytes, fee_est=None) -> PartialTransaction: outputs = [PartialTxOutput.from_address_and_value(ln_dummy_address(), funding_sat)] if self.has_recoverable_channels(): dummy_scriptpubkey = make_op_return(self.cb_data(node_id)) outputs.append(PartialTxOutput(scriptpubkey=dummy_scriptpubkey, value=0)) tx = self.wallet.make_unsigned_transaction( coins=coins, outputs=outputs, fee=fee_est) tx.set_rbf(False) return tx def open_channel(self, *, connect_str: str, funding_tx: PartialTransaction, funding_sat: int, push_amt_sat: int, password: str = None) -> Tuple[Channel, PartialTransaction]: if funding_sat > LN_MAX_FUNDING_SAT: raise Exception(_("Requested channel capacity is over protocol allowed maximum.")) coro = self._open_channel_coroutine( connect_str=connect_str, funding_tx=funding_tx, funding_sat=funding_sat, push_sat=push_amt_sat, password=password) fut = asyncio.run_coroutine_threadsafe(coro, self.network.asyncio_loop) try: chan, funding_tx = fut.result() except concurrent.futures.TimeoutError: raise Exception(_("open_channel timed out")) return chan, funding_tx def get_channel_by_short_id(self, short_channel_id: bytes) -> Optional[Channel]: for chan in self.channels.values(): if chan.short_channel_id == short_channel_id: return chan @log_exceptions async def pay_invoice( self, invoice: str, *, amount_msat: int = None, attempts: int = 1, full_path: LNPaymentPath = None) -> Tuple[bool, List[HtlcLog]]: lnaddr = self._check_invoice(invoice, amount_msat=amount_msat) min_cltv_expiry = lnaddr.get_min_final_cltv_expiry() payment_hash = lnaddr.paymenthash key = payment_hash.hex() payment_secret = lnaddr.payment_secret invoice_pubkey = lnaddr.pubkey.serialize() invoice_features = lnaddr.get_features() r_tags = lnaddr.get_routing_info('r') amount_to_pay = lnaddr.get_amount_msat() status = self.get_payment_status(payment_hash) if status == PR_PAID: raise PaymentFailure(_("This invoice has been paid already")) if status == PR_INFLIGHT: raise PaymentFailure(_("A payment was already initiated for this invoice")) if payment_hash in self.get_payments(status='inflight'): raise PaymentFailure(_("A previous attempt to pay this invoice did not clear")) info = PaymentInfo(payment_hash, amount_to_pay, SENT, PR_UNPAID) self.save_payment_info(info) self.wallet.set_label(key, lnaddr.get_description()) self.set_invoice_status(key, PR_INFLIGHT) try: await self.pay_to_node( node_pubkey=invoice_pubkey, payment_hash=payment_hash, payment_secret=payment_secret, amount_to_pay=amount_to_pay, min_cltv_expiry=min_cltv_expiry, r_tags=r_tags, invoice_features=invoice_features, attempts=attempts, full_path=full_path) success = True except PaymentFailure as e: self.logger.info(f'payment failure: {e!r}') success = False reason = str(e) if success: self.set_invoice_status(key, PR_PAID) util.trigger_callback('payment_succeeded', self.wallet, key) else: self.set_invoice_status(key, PR_UNPAID) util.trigger_callback('payment_failed', self.wallet, key, reason) log = self.logs[key] return success, log async def pay_to_node( self, *, node_pubkey: bytes, payment_hash: bytes, payment_secret: Optional[bytes], amount_to_pay: int, # in msat min_cltv_expiry: int, r_tags, invoice_features: int, attempts: int = 1, full_path: LNPaymentPath = None, fwd_trampoline_onion=None, fwd_trampoline_fee=None, fwd_trampoline_cltv_delta=None) -> None: if fwd_trampoline_onion: # todo: compare to the fee of the actual route we found if fwd_trampoline_fee < 1000: raise OnionRoutingFailure(code=OnionFailureCode.TRAMPOLINE_FEE_INSUFFICIENT, data=b'') if fwd_trampoline_cltv_delta < 576: raise OnionRoutingFailure(code=OnionFailureCode.TRAMPOLINE_EXPIRY_TOO_SOON, data=b'') self.logs[payment_hash.hex()] = log = [] # when encountering trampoline forwarding difficulties in the legacy case, we # sometimes need to fall back to a single trampoline forwarder, at the expense # of privacy use_two_trampolines = True trampoline_fee_level = self.INITIAL_TRAMPOLINE_FEE_LEVEL amount_inflight = 0 # what we sent in htlcs (that receiver gets, without fees) while True: amount_to_send = amount_to_pay - amount_inflight if amount_to_send > 0: # 1. create a set of routes for remaining amount. # note: path-finding runs in a separate thread so that we don't block the asyncio loop routes = self.create_routes_for_payment( amount_msat=amount_to_send, final_total_msat=amount_to_pay, invoice_pubkey=node_pubkey, min_cltv_expiry=min_cltv_expiry, r_tags=r_tags, invoice_features=invoice_features, full_path=full_path, payment_hash=payment_hash, payment_secret=payment_secret, trampoline_fee_level=trampoline_fee_level, use_two_trampolines=use_two_trampolines, fwd_trampoline_onion=fwd_trampoline_onion ) async for route, amount_msat, total_msat, amount_receiver_msat, cltv_delta, bucket_payment_secret, trampoline_onion in routes: amount_inflight += amount_receiver_msat if amount_inflight > amount_to_pay: raise Exception(f"amount_inflight={amount_inflight} > amount_to_pay={amount_to_pay}") await self.pay_to_route( route=route, amount_msat=amount_msat, total_msat=total_msat, amount_receiver_msat=amount_receiver_msat, payment_hash=payment_hash, payment_secret=bucket_payment_secret, min_cltv_expiry=cltv_delta, trampoline_onion=trampoline_onion, trampoline_fee_level=trampoline_fee_level) util.trigger_callback('invoice_status', self.wallet, payment_hash.hex()) self.logger.info(f"amount inflight {amount_inflight}") htlc_log = await self.sent_htlcs[payment_hash].get() amount_inflight -= htlc_log.amount_msat if amount_inflight < 0: raise Exception(f"amount_inflight={amount_inflight} < 0") log.append(htlc_log) if htlc_log.success: if self.network.path_finder: self.network.path_finder.update_liquidity_hints(htlc_log.route, htlc_log.amount_msat) self.network.path_finder.update_inflight_htlcs(htlc_log.route, add_htlcs=False) return if len(log) >= attempts: raise PaymentFailure('Giving up after %d attempts'%len(log)) route = htlc_log.route sender_idx = htlc_log.sender_idx erring_node_id = route[sender_idx].node_id failure_msg = htlc_log.failure_msg code, data = failure_msg.code, failure_msg.data self.logger.info(f"UPDATE_FAIL_HTLC. code={repr(code)}. " f"decoded_data={failure_msg.decode_data()}. data={data.hex()!r}") self.logger.info(f"error reported by {bh2u(erring_node_id)}") if code == OnionFailureCode.MPP_TIMEOUT: raise PaymentFailure(failure_msg.code_name()) if not self.channel_db: if code in (OnionFailureCode.TRAMPOLINE_FEE_INSUFFICIENT, OnionFailureCode.TRAMPOLINE_EXPIRY_TOO_SOON): if htlc_log.trampoline_fee_level == trampoline_fee_level: trampoline_fee_level += 1 self.logger.info(f'raising trampoline fee level {trampoline_fee_level}') else: self.logger.info(f'NOT raising trampoline fee level, already at {trampoline_fee_level}') continue elif use_two_trampolines: use_two_trampolines = False elif code in (OnionFailureCode.UNKNOWN_NEXT_PEER, OnionFailureCode.TEMPORARY_NODE_FAILURE): continue else: raise PaymentFailure(failure_msg.code_name()) else: self.handle_error_code_from_failed_htlc( route=route, sender_idx=sender_idx, failure_msg=failure_msg, amount=htlc_log.amount_msat) async def pay_to_route( self, *, route: LNPaymentRoute, amount_msat: int, total_msat: int, amount_receiver_msat:int, payment_hash: bytes, payment_secret: Optional[bytes], min_cltv_expiry: int, trampoline_onion: bytes = None, trampoline_fee_level: int) -> None: # send a single htlc short_channel_id = route[0].short_channel_id chan = self.get_channel_by_short_id(short_channel_id) peer = self._peers.get(route[0].node_id) if not peer: raise PaymentFailure('Dropped peer') await peer.initialized htlc = peer.pay( route=route, chan=chan, amount_msat=amount_msat, total_msat=total_msat, payment_hash=payment_hash, min_final_cltv_expiry=min_cltv_expiry, payment_secret=payment_secret, trampoline_onion=trampoline_onion) key = (payment_hash, short_channel_id, htlc.htlc_id) self.sent_htlcs_info[key] = route, payment_secret, amount_msat, total_msat, amount_receiver_msat, trampoline_fee_level # if we sent MPP to a trampoline, add item to sent_buckets if not self.channel_db and amount_msat != total_msat: if payment_secret not in self.sent_buckets: self.sent_buckets[payment_secret] = (0, 0) amount_sent, amount_failed = self.sent_buckets[payment_secret] amount_sent += amount_receiver_msat self.sent_buckets[payment_secret] = amount_sent, amount_failed if self.network.path_finder: # add inflight htlcs to liquidity hints self.network.path_finder.update_inflight_htlcs(route, add_htlcs=True) util.trigger_callback('htlc_added', chan, htlc, SENT) def handle_error_code_from_failed_htlc( self, *, route: LNPaymentRoute, sender_idx: int, failure_msg: OnionRoutingFailure, amount: int) -> None: assert self.channel_db # cannot be in trampoline mode assert self.network.path_finder # remove inflight htlcs from liquidity hints self.network.path_finder.update_inflight_htlcs(route, add_htlcs=False) code, data = failure_msg.code, failure_msg.data # TODO can we use lnmsg.OnionWireSerializer here? # TODO update onion_wire.csv # handle some specific error codes failure_codes = { OnionFailureCode.TEMPORARY_CHANNEL_FAILURE: 0, OnionFailureCode.AMOUNT_BELOW_MINIMUM: 8, OnionFailureCode.FEE_INSUFFICIENT: 8, OnionFailureCode.INCORRECT_CLTV_EXPIRY: 4, OnionFailureCode.EXPIRY_TOO_SOON: 0, OnionFailureCode.CHANNEL_DISABLED: 2, } # determine a fallback channel to blacklist if we don't get the erring if sender_idx is None: raise PaymentFailure(failure_msg.code_name()) try: fallback_channel = route[sender_idx + 1].short_channel_id except IndexError: raise PaymentFailure(f'payment destination reported error: {failure_msg.code_name()}') from None if code in failure_codes: offset = failure_codes[code] channel_update_len = int.from_bytes(data[offset:offset+2], byteorder="big") channel_update_as_received = data[offset+2: offset+2+channel_update_len] payload = self._decode_channel_update_msg(channel_update_as_received) if payload is None: self.logger.info(f'could not decode channel_update for failed htlc: ' f'{channel_update_as_received.hex()}') self.network.path_finder.liquidity_hints.add_to_blacklist(fallback_channel) else: blacklist, update = self._handle_chanupd_from_failed_htlc( payload, route=route, sender_idx=sender_idx) if code == OnionFailureCode.TEMPORARY_CHANNEL_FAILURE: self.network.path_finder.update_liquidity_hints( route, amount, failing_channel=ShortChannelID(payload['short_channel_id'])) elif blacklist: self.network.path_finder.liquidity_hints.add_to_blacklist( payload['short_channel_id']) if not (blacklist or update): raise PaymentFailure(failure_msg.code_name()) # for errors that do not include a channel update else: self.network.path_finder.liquidity_hints.add_to_blacklist(fallback_channel) def _handle_chanupd_from_failed_htlc(self, payload, *, route, sender_idx) -> Tuple[bool, bool]: blacklist = False update = False try: r = self.channel_db.add_channel_update(payload, verify=True) except InvalidGossipMsg: return True, False # blacklist short_channel_id = ShortChannelID(payload['short_channel_id']) if r == UpdateStatus.GOOD: self.logger.info(f"applied channel update to {short_channel_id}") # TODO: add test for this # FIXME: this does not work for our own unannounced channels. for chan in self.channels.values(): if chan.short_channel_id == short_channel_id: chan.set_remote_update(payload) update = True elif r == UpdateStatus.ORPHANED: # maybe it is a private channel (and data in invoice was outdated) self.logger.info(f"Could not find {short_channel_id}. maybe update is for private channel?") start_node_id = route[sender_idx].node_id update = self.channel_db.add_channel_update_for_private_channel(payload, start_node_id) blacklist = not update elif r == UpdateStatus.EXPIRED: blacklist = True elif r == UpdateStatus.DEPRECATED: self.logger.info(f'channel update is not more recent.') blacklist = True elif r == UpdateStatus.UNCHANGED: blacklist = True return blacklist, update @classmethod def _decode_channel_update_msg(cls, chan_upd_msg: bytes) -> Optional[Dict[str, Any]]: channel_update_as_received = chan_upd_msg channel_update_typed = (258).to_bytes(length=2, byteorder="big") + channel_update_as_received # note: some nodes put channel updates in error msgs with the leading msg_type already there. # we try decoding both ways here. try: message_type, payload = decode_msg(channel_update_typed) if payload['chain_hash'] != constants.net.rev_genesis_bytes(): raise Exception() payload['raw'] = channel_update_typed return payload except: # FIXME: too broad try: message_type, payload = decode_msg(channel_update_as_received) if payload['chain_hash'] != constants.net.rev_genesis_bytes(): raise Exception() payload['raw'] = channel_update_as_received return payload except: return None @staticmethod def _check_invoice(invoice: str, *, amount_msat: int = None) -> LnAddr: addr = lndecode(invoice) if addr.is_expired(): raise InvoiceError(_("This invoice has expired")) if amount_msat: # replace amt in invoice. main usecase is paying zero amt invoices existing_amt_msat = addr.get_amount_msat() if existing_amt_msat and amount_msat < existing_amt_msat: raise Exception("cannot pay lower amt than what is originally in LN invoice") addr.amount = Decimal(amount_msat) / COIN / 1000 if addr.amount is None: raise InvoiceError(_("Missing amount")) if addr.get_min_final_cltv_expiry() > lnutil.NBLOCK_CLTV_EXPIRY_TOO_FAR_INTO_FUTURE: raise InvoiceError("{}\n{}".format( _("Invoice wants us to risk locking funds for unreasonably long."), f"min_final_cltv_expiry: {addr.get_min_final_cltv_expiry()}")) return addr def is_trampoline_peer(self, node_id: bytes) -> bool: # until trampoline is advertised in lnfeatures, check against hardcoded list if is_hardcoded_trampoline(node_id): return True peer = self._peers.get(node_id) if peer and peer.their_features.supports(LnFeatures.OPTION_TRAMPOLINE_ROUTING_OPT): return True return False def suggest_peer(self) -> Optional[bytes]: if self.channel_db: return self.lnrater.suggest_peer() else: return random.choice(list(hardcoded_trampoline_nodes().values())).pubkey async def create_routes_for_payment( self, *, amount_msat: int, # part of payment amount we want routes for now final_total_msat: int, # total payment amount final receiver will get invoice_pubkey, min_cltv_expiry, r_tags, invoice_features: int, payment_hash, payment_secret, trampoline_fee_level: int, use_two_trampolines: bool, fwd_trampoline_onion=None, full_path: LNPaymentPath = None) -> AsyncGenerator[Tuple[LNPaymentRoute, int], None]: invoice_features = LnFeatures(invoice_features) trampoline_features = LnFeatures.VAR_ONION_OPT local_height = self.network.get_local_height() my_active_channels = [chan for chan in self.channels.values() if chan.is_active() and not chan.is_frozen_for_sending()] try: self.logger.info("trying single-part payment") # try to send over a single channel if not self.channel_db: for chan in my_active_channels: if not self.is_trampoline_peer(chan.node_id): continue if chan.node_id == invoice_pubkey: trampoline_onion = None trampoline_payment_secret = payment_secret trampoline_total_msat = final_total_msat amount_with_fees = amount_msat cltv_delta = min_cltv_expiry else: trampoline_onion, amount_with_fees, cltv_delta = create_trampoline_route_and_onion( amount_msat=amount_msat, total_msat=final_total_msat, min_cltv_expiry=min_cltv_expiry, my_pubkey=self.node_keypair.pubkey, invoice_pubkey=invoice_pubkey, invoice_features=invoice_features, node_id=chan.node_id, r_tags=r_tags, payment_hash=payment_hash, payment_secret=payment_secret, local_height=local_height, trampoline_fee_level=trampoline_fee_level, use_two_trampolines=use_two_trampolines) trampoline_payment_secret = os.urandom(32) trampoline_total_msat = amount_with_fees if chan.available_to_spend(LOCAL, strict=True) < amount_with_fees: continue route = [ RouteEdge( start_node=self.node_keypair.pubkey, end_node=chan.node_id, short_channel_id=chan.short_channel_id, fee_base_msat=0, fee_proportional_millionths=0, cltv_expiry_delta=0, node_features=trampoline_features) ] yield route, amount_with_fees, trampoline_total_msat, amount_msat, cltv_delta, trampoline_payment_secret, trampoline_onion break else: raise NoPathFound() else: # local single-part route computation route = await run_in_thread( partial( self.create_route_for_payment, amount_msat=amount_msat, invoice_pubkey=invoice_pubkey, min_cltv_expiry=min_cltv_expiry, r_tags=r_tags, invoice_features=invoice_features, my_sending_channels=my_active_channels, full_path=full_path ) ) yield route, amount_msat, final_total_msat, amount_msat, min_cltv_expiry, payment_secret, fwd_trampoline_onion except NoPathFound: # fall back to payment splitting self.logger.info("no path found, trying multi-part payment") if not invoice_features.supports(LnFeatures.BASIC_MPP_OPT): raise channels_with_funds = {(chan.channel_id, chan.node_id): int(chan.available_to_spend(HTLCOwner.LOCAL)) for chan in my_active_channels} self.logger.info(f"channels_with_funds: {channels_with_funds}") if not self.channel_db: # in the case of a legacy payment, we don't allow splitting via different use_single_node, _ = is_legacy_relay(invoice_features, r_tags) split_configurations = suggest_splits( amount_msat, channels_with_funds, exclude_multinode_payments=use_single_node, exclude_single_part_payments=True, # the trampoline node will split for us exclude_single_channel_splits=True, ) self.logger.info(f'suggest_split {amount_msat} returned {len(split_configurations)} configurations') for sc in split_configurations: try: self.logger.info(f"trying split configuration: {sc.config.values()} rating: {sc.rating}") per_trampoline_channel_amounts = defaultdict(list) # categorize by trampoline nodes for trampolin mpp construction for (chan_id, _), part_amounts_msat in sc.config.items(): chan = self.channels[chan_id] for part_amount_msat in part_amounts_msat: per_trampoline_channel_amounts[chan.node_id].append((chan_id, part_amount_msat)) # for each trampoline forwarder, construct mpp trampoline routes = [] for trampoline_node_id, trampoline_parts in per_trampoline_channel_amounts.items(): per_trampoline_amount = sum([x[1] for x in trampoline_parts]) trampoline_onion, per_trampoline_amount_with_fees, per_trampoline_cltv_delta = create_trampoline_route_and_onion( amount_msat=per_trampoline_amount, total_msat=final_total_msat, min_cltv_expiry=min_cltv_expiry, my_pubkey=self.node_keypair.pubkey, invoice_pubkey=invoice_pubkey, invoice_features=invoice_features, node_id=trampoline_node_id, r_tags=r_tags, payment_hash=payment_hash, payment_secret=payment_secret, local_height=local_height, trampoline_fee_level=trampoline_fee_level, use_two_trampolines=use_two_trampolines) # node_features is only used to determine is_tlv per_trampoline_secret = os.urandom(32) per_trampoline_fees = per_trampoline_amount_with_fees - per_trampoline_amount self.logger.info(f'per trampoline fees: {per_trampoline_fees}') for chan_id, part_amount_msat in trampoline_parts: chan = self.channels[chan_id] margin = chan.available_to_spend(LOCAL, strict=True) - part_amount_msat delta_fee = min(per_trampoline_fees, margin) # TODO: distribute trampoline fee over several channels? part_amount_msat_with_fees = part_amount_msat + delta_fee per_trampoline_fees -= delta_fee route = [ RouteEdge( start_node=self.node_keypair.pubkey, end_node=trampoline_node_id, short_channel_id=chan.short_channel_id, fee_base_msat=0, fee_proportional_millionths=0, cltv_expiry_delta=0, node_features=trampoline_features) ] self.logger.info(f'adding route {part_amount_msat} {delta_fee} {margin}') routes.append((route, part_amount_msat_with_fees, per_trampoline_amount_with_fees, part_amount_msat, per_trampoline_cltv_delta, per_trampoline_secret, trampoline_onion)) if per_trampoline_fees != 0: self.logger.info('not enough margin to pay trampoline fee') raise NoPathFound() for route in routes: yield route return except NoPathFound: continue else: split_configurations = suggest_splits( amount_msat, channels_with_funds, exclude_single_part_payments=True, ) # We atomically loop through a split configuration. If there was # a failure to find a path for a single part, we give back control # after exhausting the split configuration. yielded_from_split_configuration = False self.logger.info(f'suggest_split {amount_msat} returned {len(split_configurations)} configurations') for sc in split_configurations: self.logger.info(f"trying split configuration: {list(sc.config.values())} rating: {sc.rating}") for (chan_id, _), part_amounts_msat in sc.config.items(): for part_amount_msat in part_amounts_msat: channel = self.channels[chan_id] try: route = await run_in_thread( partial( self.create_route_for_payment, amount_msat=part_amount_msat, invoice_pubkey=invoice_pubkey, min_cltv_expiry=min_cltv_expiry, r_tags=r_tags, invoice_features=invoice_features, my_sending_channels=[channel], full_path=None ) ) yield route, part_amount_msat, final_total_msat, part_amount_msat, min_cltv_expiry, payment_secret, fwd_trampoline_onion yielded_from_split_configuration = True except NoPathFound: continue if yielded_from_split_configuration: return raise NoPathFound() @profiler def create_route_for_payment( self, *, amount_msat: int, invoice_pubkey: bytes, min_cltv_expiry: int, r_tags, invoice_features: int, my_sending_channels: List[Channel], full_path: Optional[LNPaymentPath]) -> LNPaymentRoute: my_sending_channels = {chan.short_channel_id: chan for chan in my_sending_channels if chan.short_channel_id is not None} # Collect all private edges from route hints. # Note: if some route hints are multiple edges long, and these paths cross each other, # we allow our path finding to cross the paths; i.e. the route hints are not isolated. private_route_edges = {} # type: Dict[ShortChannelID, RouteEdge] for private_path in r_tags: # we need to shift the node pubkey by one towards the destination: private_path_nodes = [edge[0] for edge in private_path][1:] + [invoice_pubkey] private_path_rest = [edge[1:] for edge in private_path] start_node = private_path[0][0] for end_node, edge_rest in zip(private_path_nodes, private_path_rest): short_channel_id, fee_base_msat, fee_proportional_millionths, cltv_expiry_delta = edge_rest short_channel_id = ShortChannelID(short_channel_id) # if we have a routing policy for this edge in the db, that takes precedence, # as it is likely from a previous failure channel_policy = self.channel_db.get_policy_for_node( short_channel_id=short_channel_id, node_id=start_node, my_channels=my_sending_channels) if channel_policy: fee_base_msat = channel_policy.fee_base_msat fee_proportional_millionths = channel_policy.fee_proportional_millionths cltv_expiry_delta = channel_policy.cltv_expiry_delta node_info = self.channel_db.get_node_info_for_node_id(node_id=end_node) route_edge = RouteEdge( start_node=start_node, end_node=end_node, short_channel_id=short_channel_id, fee_base_msat=fee_base_msat, fee_proportional_millionths=fee_proportional_millionths, cltv_expiry_delta=cltv_expiry_delta, node_features=node_info.features if node_info else 0) private_route_edges[route_edge.short_channel_id] = route_edge start_node = end_node # now find a route, end to end: between us and the recipient try: route = self.network.path_finder.find_route( nodeA=self.node_keypair.pubkey, nodeB=invoice_pubkey, invoice_amount_msat=amount_msat, path=full_path, my_sending_channels=my_sending_channels, private_route_edges=private_route_edges) except NoChannelPolicy as e: raise NoPathFound() from e if not route: raise NoPathFound() # test sanity if not is_route_sane_to_use(route, amount_msat, min_cltv_expiry): self.logger.info(f"rejecting insane route {route}") raise NoPathFound() assert len(route) > 0 if route[-1].end_node != invoice_pubkey: raise LNPathInconsistent("last node_id != invoice pubkey") # add features from invoice route[-1].node_features |= invoice_features return route def add_request(self, amount_sat, message, expiry) -> str: coro = self._add_request_coro(amount_sat, message, expiry) fut = asyncio.run_coroutine_threadsafe(coro, self.network.asyncio_loop) try: return fut.result(timeout=5) except concurrent.futures.TimeoutError: raise Exception(_("add invoice timed out")) @log_exceptions async def create_invoice( self, *, amount_msat: Optional[int], message: str, expiry: int, write_to_disk: bool = True, ) -> Tuple[LnAddr, str]: timestamp = int(time.time()) routing_hints = await self._calc_routing_hints_for_invoice(amount_msat) if not routing_hints: self.logger.info( "Warning. No routing hints added to invoice. " "Other clients will likely not be able to send to us.") # if not all hints are trampoline, do not create trampoline invoice invoice_features = self.features.for_invoice() trampoline_hints = [] for r in routing_hints: node_id, short_channel_id, fee_base_msat, fee_proportional_millionths, cltv_expiry_delta = r[1][0] if len(r[1])== 1 and self.is_trampoline_peer(node_id): trampoline_hints.append(('t', (node_id, fee_base_msat, fee_proportional_millionths, cltv_expiry_delta))) payment_preimage = os.urandom(32) payment_hash = sha256(payment_preimage) info = PaymentInfo(payment_hash, amount_msat, RECEIVED, PR_UNPAID) amount_btc = amount_msat/Decimal(COIN*1000) if amount_msat else None if expiry == 0: expiry = LN_EXPIRY_NEVER lnaddr = LnAddr( paymenthash=payment_hash, amount=amount_btc, tags=[ ('d', message), ('c', MIN_FINAL_CLTV_EXPIRY_FOR_INVOICE), ('x', expiry), ('9', invoice_features)] + routing_hints + trampoline_hints, date=timestamp, payment_secret=derive_payment_secret_from_payment_preimage(payment_preimage)) invoice = lnencode(lnaddr, self.node_keypair.privkey) self.save_preimage(payment_hash, payment_preimage, write_to_disk=False) self.save_payment_info(info, write_to_disk=False) if write_to_disk: self.wallet.save_db() return lnaddr, invoice async def _add_request_coro(self, amount_sat: Optional[int], message, expiry: int) -> str: amount_msat = amount_sat * 1000 if amount_sat is not None else None lnaddr, invoice = await self.create_invoice( amount_msat=amount_msat, message=message, expiry=expiry, write_to_disk=False, ) key = bh2u(lnaddr.paymenthash) req = LNInvoice.from_bech32(invoice) self.wallet.add_payment_request(req, write_to_disk=False) self.wallet.set_label(key, message) self.wallet.save_db() return key def save_preimage(self, payment_hash: bytes, preimage: bytes, *, write_to_disk: bool = True): assert sha256(preimage) == payment_hash self.preimages[bh2u(payment_hash)] = bh2u(preimage) if write_to_disk: self.wallet.save_db() def get_preimage(self, payment_hash: bytes) -> Optional[bytes]: r = self.preimages.get(bh2u(payment_hash)) return bfh(r) if r else None def get_payment_info(self, payment_hash: bytes) -> Optional[PaymentInfo]: key = payment_hash.hex() with self.lock: if key in self.payments: amount_msat, direction, status = self.payments[key] return PaymentInfo(payment_hash, amount_msat, direction, status) def save_payment_info(self, info: PaymentInfo, *, write_to_disk: bool = True) -> None: key = info.payment_hash.hex() assert info.status in SAVED_PR_STATUS with self.lock: self.payments[key] = info.amount_msat, info.direction, info.status if write_to_disk: self.wallet.save_db() def check_received_mpp_htlc(self, payment_secret, short_channel_id, htlc: UpdateAddHtlc, expected_msat: int) -> Optional[bool]: payment_hash = htlc.payment_hash is_expired, is_accepted, htlc_set = self.received_mpp_htlcs.get(payment_secret, (False, False, set())) if self.get_payment_status(payment_hash) == PR_PAID: # payment_status is persisted is_accepted = True is_expired = False key = (short_channel_id, htlc) if key not in htlc_set: htlc_set.add(key) if not is_accepted and not is_expired: total = sum([_htlc.amount_msat for scid, _htlc in htlc_set]) first_timestamp = min([_htlc.timestamp for scid, _htlc in htlc_set]) if self.stopping_soon: is_expired = True # try to time out pending HTLCs before shutting down elif time.time() - first_timestamp > self.MPP_EXPIRY: is_expired = True elif total == expected_msat: is_accepted = True if is_accepted or is_expired: htlc_set.remove(key) if len(htlc_set) > 0: self.received_mpp_htlcs[payment_secret] = is_expired, is_accepted, htlc_set elif payment_secret in self.received_mpp_htlcs: self.received_mpp_htlcs.pop(payment_secret) return True if is_accepted else (False if is_expired else None) def get_payment_status(self, payment_hash: bytes) -> int: info = self.get_payment_info(payment_hash) return info.status if info else PR_UNPAID def get_invoice_status(self, invoice: LNInvoice) -> int: key = invoice.rhash log = self.logs[key] if key in self.inflight_payments: return PR_INFLIGHT # status may be PR_FAILED status = self.get_payment_status(bfh(key)) if status == PR_UNPAID and log: status = PR_FAILED return status def set_invoice_status(self, key: str, status: int) -> None: if status == PR_INFLIGHT: self.inflight_payments.add(key) elif key in self.inflight_payments: self.inflight_payments.remove(key) if status in SAVED_PR_STATUS: self.set_payment_status(bfh(key), status) util.trigger_callback('invoice_status', self.wallet, key) def set_request_status(self, payment_hash: bytes, status: int) -> None: if self.get_payment_status(payment_hash) != status: self.set_payment_status(payment_hash, status) util.trigger_callback('request_status', self.wallet, payment_hash.hex(), status) def set_payment_status(self, payment_hash: bytes, status: int) -> None: info = self.get_payment_info(payment_hash) if info is None: # if we are forwarding return info = info._replace(status=status) self.save_payment_info(info) def _on_maybe_forwarded_htlc_resolved(self, chan: Channel, htlc_id: int) -> None: fw_info = chan.short_channel_id.hex(), htlc_id upstream_peer_pubkey = self.downstream_htlc_to_upstream_peer_map.get(fw_info) if not upstream_peer_pubkey: return upstream_peer = self.peers.get(upstream_peer_pubkey) if not upstream_peer: return upstream_peer.downstream_htlc_resolved_event.set() upstream_peer.downstream_htlc_resolved_event.clear() def htlc_fulfilled(self, chan: Channel, payment_hash: bytes, htlc_id: int): util.trigger_callback('htlc_fulfilled', payment_hash, chan, htlc_id) self._on_maybe_forwarded_htlc_resolved(chan=chan, htlc_id=htlc_id) q = self.sent_htlcs.get(payment_hash) if q: route, payment_secret, amount_msat, bucket_msat, amount_receiver_msat, trampoline_fee_level = self.sent_htlcs_info[(payment_hash, chan.short_channel_id, htlc_id)] htlc_log = HtlcLog( success=True, route=route, amount_msat=amount_receiver_msat, trampoline_fee_level=trampoline_fee_level) q.put_nowait(htlc_log) else: key = payment_hash.hex() self.set_invoice_status(key, PR_PAID) util.trigger_callback('payment_succeeded', self.wallet, key) def htlc_failed( self, chan: Channel, payment_hash: bytes, htlc_id: int, error_bytes: Optional[bytes], failure_message: Optional['OnionRoutingFailure']): util.trigger_callback('htlc_failed', payment_hash, chan, htlc_id) self._on_maybe_forwarded_htlc_resolved(chan=chan, htlc_id=htlc_id) q = self.sent_htlcs.get(payment_hash) if q: # detect if it is part of a bucket # if yes, wait until the bucket completely failed key = (payment_hash, chan.short_channel_id, htlc_id) route, payment_secret, amount_msat, bucket_msat, amount_receiver_msat, trampoline_fee_level = self.sent_htlcs_info[key] if error_bytes: # TODO "decode_onion_error" might raise, catch and maybe blacklist/penalise someone? try: failure_message, sender_idx = chan.decode_onion_error(error_bytes, route, htlc_id) except Exception as e: sender_idx = None failure_message = OnionRoutingFailure(-1, str(e)) else: # probably got "update_fail_malformed_htlc". well... who to penalise now? assert failure_message is not None sender_idx = None self.logger.info(f"htlc_failed {failure_message}") # check sent_buckets if we use trampoline if not self.channel_db and payment_secret in self.sent_buckets: amount_sent, amount_failed = self.sent_buckets[payment_secret] amount_failed += amount_receiver_msat self.sent_buckets[payment_secret] = amount_sent, amount_failed if amount_sent != amount_failed: self.logger.info('bucket still active...') return self.logger.info('bucket failed') amount_receiver_msat = amount_sent htlc_log = HtlcLog( success=False, route=route, amount_msat=amount_receiver_msat, error_bytes=error_bytes, failure_msg=failure_message, sender_idx=sender_idx, trampoline_fee_level=trampoline_fee_level) q.put_nowait(htlc_log) else: self.logger.info(f"received unknown htlc_failed, probably from previous session") key = payment_hash.hex() self.set_invoice_status(key, PR_UNPAID) util.trigger_callback('payment_failed', self.wallet, key, '') async def _calc_routing_hints_for_invoice(self, amount_msat: Optional[int]): routing_hints = [] channels = list(self.channels.values()) # do minimal filtering of channels. # we include channels that cannot *right now* receive (e.g. peer disconnected or balance insufficient) channels = [chan for chan in channels if (chan.is_open() and not chan.is_frozen_for_receiving())] # Filter out channels that have very low receive capacity compared to invoice amt. # Even with MPP, below a certain threshold, including these channels probably # hurts more than help, as they lead to many failed attempts for the sender. channels = [chan for chan in channels if chan.available_to_spend(REMOTE) > (amount_msat or 0) * 0.05] # cap max channels to include to keep QR code reasonably scannable channels = sorted(channels, key=lambda chan: (not chan.is_active(), -chan.available_to_spend(REMOTE))) channels = channels[:15] random.shuffle(channels) # let's not leak channel order scid_to_my_channels = {chan.short_channel_id: chan for chan in channels if chan.short_channel_id is not None} for chan in channels: chan_id = chan.short_channel_id assert isinstance(chan_id, bytes), chan_id channel_info = get_mychannel_info(chan_id, scid_to_my_channels) # incoming direction of our private channel, we fill the invoice with garbage. # the sender should still be able to pay us, but will incur an extra round trip # (they will get the channel update from the onion error) # at least, that's the theory. https://github.com/lightningnetwork/lnd/issues/2066 fee_base_msat = fee_proportional_millionths = 0 cltv_expiry_delta = 1 missing_info = True if channel_info: policy = get_mychannel_policy(channel_info.short_channel_id, chan.node_id, scid_to_my_channels) if policy: fee_base_msat = policy.fee_base_msat fee_proportional_millionths = policy.fee_proportional_millionths cltv_expiry_delta = policy.cltv_expiry_delta missing_info = False if missing_info: self.logger.info( f"Warning. Missing channel update for our channel {chan_id}; " f"filling invoice with incorrect data.") routing_hints.append(('r', [( chan.node_id, chan_id, fee_base_msat, fee_proportional_millionths, cltv_expiry_delta)])) return routing_hints def delete_payment(self, payment_hash_hex: str): try: with self.lock: del self.payments[payment_hash_hex] except KeyError: return self.wallet.save_db() def get_balance(self): with self.lock: return Decimal(sum( chan.balance(LOCAL) if not chan.is_closed() else 0 for chan in self.channels.values())) / 1000 def num_sats_can_send(self) -> Decimal: can_send = 0 with self.lock: if self.channels: for c in self.channels.values(): if c.is_active() and not c.is_frozen_for_sending(): can_send += c.available_to_spend(LOCAL) # Here we have to guess a fee, because some callers (submarine swaps) # use this method to initiate a payment, which would otherwise fail. fee_base_msat = TRAMPOLINE_FEES[3]['fee_base_msat'] fee_proportional_millionths = TRAMPOLINE_FEES[3]['fee_proportional_millionths'] # inverse of fee_for_edge_msat can_send_minus_fees = (can_send - fee_base_msat) * 1_000_000 // ( 1_000_000 + fee_proportional_millionths) can_send_minus_fees = max(0, can_send_minus_fees) return Decimal(can_send_minus_fees) / 1000 def num_sats_can_receive(self) -> Decimal: with self.lock: channels = [ c for c in self.channels.values() if c.is_active() and not c.is_frozen_for_receiving() ] can_receive = sum([c.available_to_spend(REMOTE) for c in channels]) if channels else 0 return Decimal(can_receive) / 1000 def num_sats_can_receive_no_mpp(self) -> Decimal: with self.lock: channels = [ c for c in self.channels.values() if c.is_active() and not c.is_frozen_for_receiving() ] can_receive = max([c.available_to_spend(REMOTE) for c in channels]) if channels else 0 return Decimal(can_receive) / 1000 def can_pay_invoice(self, invoice: LNInvoice) -> bool: return invoice.get_amount_sat() <= self.num_sats_can_send() def can_receive_invoice(self, invoice: LNInvoice) -> bool: return invoice.get_amount_sat() <= self.num_sats_can_receive() async def close_channel(self, chan_id): chan = self._channels[chan_id] peer = self._peers[chan.node_id] return await peer.close_channel(chan_id) def _force_close_channel(self, chan_id: bytes) -> Transaction: chan = self._channels[chan_id] tx = chan.force_close_tx() # We set the channel state to make sure we won't sign new commitment txs. chan.set_state(ChannelState.FORCE_CLOSING) try: self.wallet.add_transaction(tx) except UnrelatedTransactionException: pass return tx async def force_close_channel(self, chan_id: bytes) -> str: tx = self._force_close_channel(chan_id) await self.network.broadcast_transaction(tx) return tx.txid() def schedule_force_closing(self, chan_id: bytes) -> 'asyncio.Task[None]': tx = self._force_close_channel(chan_id) return asyncio.create_task(self.network.try_broadcasting(tx, 'force-close')) def remove_channel(self, chan_id): chan = self.channels[chan_id] assert chan.can_be_deleted() with self.lock: self._channels.pop(chan_id) self.db.get('channels').pop(chan_id.hex()) for addr in chan.get_wallet_addresses_channel_might_want_reserved(): self.wallet.set_reserved_state_of_address(addr, reserved=False) util.trigger_callback('channels_updated', self.wallet) util.trigger_callback('wallet_updated', self.wallet) @ignore_exceptions @log_exceptions async def reestablish_peer_for_given_channel(self, chan: Channel) -> None: now = time.time() peer_addresses = [] if not self.channel_db: addr = trampolines_by_id().get(chan.node_id) if addr: peer_addresses.append(addr) else: last_good_addr = self.channel_db.get_last_good_address(chan.node_id) if last_good_addr: peer_addresses.append(last_good_addr) addrs_from_gossip = self.channel_db.get_node_addresses(chan.node_id) or [] for host, port, ts in addrs_from_gossip: peer_addresses.append(LNPeerAddr(host, port, chan.node_id)) peer_addresses += list(chan.get_peer_addresses()) for peer in peer_addresses: if self._can_retry_addr(peer, urgent=True, now=now): await self._add_peer(peer.host, peer.port, peer.pubkey) return async def reestablish_peers_and_channels(self): while True: await asyncio.sleep(1) if self.stopping_soon: return for chan in self.channels.values(): if chan.is_closed(): continue if not chan.should_try_to_reestablish_peer(): continue peer = self._peers.get(chan.node_id, None) if peer: await peer.taskgroup.spawn(peer.reestablish_channel(chan)) else: await self.taskgroup.spawn(self.reestablish_peer_for_given_channel(chan)) def current_feerate_per_kw(self): from .simple_config import FEE_LN_ETA_TARGET, FEERATE_FALLBACK_STATIC_FEE, FEERATE_REGTEST_HARDCODED from .simple_config import FEERATE_PER_KW_MIN_RELAY_LIGHTNING if constants.net is constants.BitcoinRegtest: return FEERATE_REGTEST_HARDCODED // 4 feerate_per_kvbyte = self.network.config.eta_target_to_fee(FEE_LN_ETA_TARGET) if feerate_per_kvbyte is None: feerate_per_kvbyte = FEERATE_FALLBACK_STATIC_FEE return max(FEERATE_PER_KW_MIN_RELAY_LIGHTNING, feerate_per_kvbyte // 4) def create_channel_backup(self, channel_id): chan = self._channels[channel_id] assert chan.is_static_remotekey_enabled() peer_addresses = list(chan.get_peer_addresses()) peer_addr = peer_addresses[0] return ImportedChannelBackupStorage( node_id = chan.node_id, privkey = self.node_keypair.privkey, funding_txid = chan.funding_outpoint.txid, funding_index = chan.funding_outpoint.output_index, funding_address = chan.get_funding_address(), host = peer_addr.host, port = peer_addr.port, is_initiator = chan.constraints.is_initiator, channel_seed = chan.config[LOCAL].channel_seed, local_delay = chan.config[LOCAL].to_self_delay, remote_delay = chan.config[REMOTE].to_self_delay, remote_revocation_pubkey = chan.config[REMOTE].revocation_basepoint.pubkey, remote_payment_pubkey = chan.config[REMOTE].payment_basepoint.pubkey) def export_channel_backup(self, channel_id): xpub = self.wallet.get_fingerprint() backup_bytes = self.create_channel_backup(channel_id).to_bytes() assert backup_bytes == ImportedChannelBackupStorage.from_bytes(backup_bytes).to_bytes(), "roundtrip failed" encrypted = pw_encode_with_version_and_mac(backup_bytes, xpub) assert backup_bytes == pw_decode_with_version_and_mac(encrypted, xpub), "encrypt failed" return 'channel_backup:' + encrypted async def request_force_close(self, channel_id: bytes, *, connect_str=None) -> None: if channel_id in self.channels: chan = self.channels[channel_id] peer = self._peers.get(chan.node_id) if not peer: raise Exception('Peer not found') chan.should_request_force_close = True peer.close_and_cleanup() elif connect_str: peer = await self.add_peer(connect_str) await peer.trigger_force_close(channel_id) elif channel_id in self.channel_backups: await self._request_force_close_from_backup(channel_id) else: raise Exception(f'Unknown channel {channel_id.hex()}') def import_channel_backup(self, data): assert data.startswith('channel_backup:') encrypted = data[15:] xpub = self.wallet.get_fingerprint() decrypted = pw_decode_with_version_and_mac(encrypted, xpub) cb_storage = ImportedChannelBackupStorage.from_bytes(decrypted) channel_id = cb_storage.channel_id() if channel_id.hex() in self.db.get_dict("channels"): raise Exception('Channel already in wallet') self.logger.info(f'importing channel backup: {channel_id.hex()}') d = self.db.get_dict("imported_channel_backups") d[channel_id.hex()] = cb_storage with self.lock: cb = ChannelBackup(cb_storage, sweep_address=self.sweep_address, lnworker=self) self._channel_backups[channel_id] = cb self.wallet.save_db() util.trigger_callback('channels_updated', self.wallet) self.lnwatcher.add_channel(cb.funding_outpoint.to_str(), cb.get_funding_address()) def has_conflicting_backup_with(self, remote_node_id: bytes): channel_backup_peers = [ cb.node_id for cb in self.channel_backups.values() if (not cb.is_closed() and cb.get_local_pubkey() == self.node_keypair.pubkey)] return any(remote_node_id.startswith(cb_peer_nodeid) for cb_peer_nodeid in channel_backup_peers) def remove_channel_backup(self, channel_id): chan = self.channel_backups[channel_id] assert chan.can_be_deleted() onchain_backups = self.db.get_dict("onchain_channel_backups") imported_backups = self.db.get_dict("imported_channel_backups") if channel_id.hex() in onchain_backups: onchain_backups.pop(channel_id.hex()) elif channel_id.hex() in imported_backups: imported_backups.pop(channel_id.hex()) else: raise Exception('Channel not found') with self.lock: self._channel_backups.pop(channel_id) self.wallet.save_db() util.trigger_callback('channels_updated', self.wallet) @log_exceptions async def _request_force_close_from_backup(self, channel_id: bytes): cb = self.channel_backups.get(channel_id) if not cb: raise Exception(f'channel backup not found {self.channel_backups}') cb = cb.cb self.logger.info(f'requesting channel force close: {channel_id.hex()}') if isinstance(cb, ImportedChannelBackupStorage): node_id = cb.node_id privkey = cb.privkey addresses = [(cb.host, cb.port, 0)] else: assert isinstance(cb, OnchainChannelBackupStorage) if not self.channel_db: raise Exception('Enable gossip first') node_id = self.network.channel_db.get_node_by_prefix(cb.node_id_prefix) privkey = self.node_keypair.privkey addresses = self.network.channel_db.get_node_addresses(node_id) if not addresses: raise Exception('Peer not found in gossip database') for host, port, timestamp in addresses: peer_addr = LNPeerAddr(host, port, node_id) transport = LNTransport(privkey, peer_addr, proxy=self.network.proxy) peer = Peer(self, node_id, transport, is_channel_backup=True) try: async with OldTaskGroup(wait=any) as group: await group.spawn(peer._message_loop()) await group.spawn(peer.trigger_force_close(channel_id)) return except Exception as e: self.logger.info(f'failed to connect {host} {e}') continue else: raise Exception('failed to connect') def maybe_add_backup_from_tx(self, tx): funding_address = None node_id_prefix = None for i, o in enumerate(tx.outputs()): script_type = get_script_type_from_output_script(o.scriptpubkey) if script_type == 'p2wsh': funding_index = i funding_address = o.address for o2 in tx.outputs(): if o2.scriptpubkey.startswith(bytes([opcodes.OP_RETURN])): encrypted_data = o2.scriptpubkey[2:] data = self.decrypt_cb_data(encrypted_data, funding_address) if data.startswith(CB_MAGIC_BYTES): node_id_prefix = data[4:] if node_id_prefix is None: return funding_txid = tx.txid() cb_storage = OnchainChannelBackupStorage( node_id_prefix = node_id_prefix, funding_txid = funding_txid, funding_index = funding_index, funding_address = funding_address, is_initiator = True) channel_id = cb_storage.channel_id().hex() if channel_id in self.db.get_dict("channels"): return self.logger.info(f"adding backup from tx") d = self.db.get_dict("onchain_channel_backups") d[channel_id] = cb_storage cb = ChannelBackup(cb_storage, sweep_address=self.sweep_address, lnworker=self) self.wallet.save_db() with self.lock: self._channel_backups[bfh(channel_id)] = cb util.trigger_callback('channels_updated', self.wallet) self.lnwatcher.add_channel(cb.funding_outpoint.to_str(), cb.get_funding_address())
true
true
f72b88a082eaa6db2a20df009f1b14a4cabb69cb
355
py
Python
unified_api/utils/utils.py
campos537/deep-fashion-system
1de31dd6260cc967e1832cff63ae7e537a3a4e9d
[ "Unlicense" ]
1
2021-04-06T00:43:26.000Z
2021-04-06T00:43:26.000Z
unified_api/utils/utils.py
campos537/deep-fashion-system
1de31dd6260cc967e1832cff63ae7e537a3a4e9d
[ "Unlicense" ]
null
null
null
unified_api/utils/utils.py
campos537/deep-fashion-system
1de31dd6260cc967e1832cff63ae7e537a3a4e9d
[ "Unlicense" ]
null
null
null
def valid_pubsub(config): if (config.get("topic_id") is not None and config.get("project_id") is not None and config.get("subscription_id") is not None): return True return False def valid_kafka(config): if config.get("bootstrap_server") is not None and config.get("port") is not None: return True return False
35.5
85
0.673239
def valid_pubsub(config): if (config.get("topic_id") is not None and config.get("project_id") is not None and config.get("subscription_id") is not None): return True return False def valid_kafka(config): if config.get("bootstrap_server") is not None and config.get("port") is not None: return True return False
true
true
f72b8a6bcb330314847fdb6f9ab7b88b743e3aa1
3,094
py
Python
sdk/python/kfp/cli/diagnose_me/kubernetes_cluster_test.py
ConverJens/pipelines
a1d453af214ec9eebad73fb05845dd3499d60d00
[ "Apache-2.0" ]
6
2020-05-19T02:35:11.000Z
2020-05-29T17:58:42.000Z
sdk/python/kfp/cli/diagnose_me/kubernetes_cluster_test.py
ConverJens/pipelines
a1d453af214ec9eebad73fb05845dd3499d60d00
[ "Apache-2.0" ]
1,932
2021-01-25T11:23:37.000Z
2022-03-31T17:10:18.000Z
sdk/python/kfp/cli/diagnose_me/kubernetes_cluster_test.py
ConverJens/pipelines
a1d453af214ec9eebad73fb05845dd3499d60d00
[ "Apache-2.0" ]
11
2020-05-19T22:26:41.000Z
2021-01-25T09:56:21.000Z
# Lint as: python3 # Copyright 2019 Google LLC. All Rights Reserved. # # Licensed under the Apache License,Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing,software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND,either express or implied. # See the License for the specific language governing permissions and # limitations under the License. """Tests for diagnose_me.kubernetes_cluster.""" from typing import Text import unittest from unittest import mock from . import kubernetes_cluster as dkc from . import utility class KubernetesClusterTest(unittest.TestCase): @mock.patch.object(dkc, 'execute_kubectl_command', autospec=True) def test_project_configuration_gcloud(self, mock_execute_kubectl_command): """Tests gcloud commands.""" dkc.get_kubectl_configuration(dkc.Commands.GET_PODS) mock_execute_kubectl_command.assert_called_once_with( ['get', 'pods', '--all-namespaces'], human_readable=False) dkc.get_kubectl_configuration(dkc.Commands.GET_CONFIGURED_CONTEXT) mock_execute_kubectl_command.assert_called_with(['config', 'view'], human_readable=False) dkc.get_kubectl_configuration(dkc.Commands.GET_KUBECTL_VERSION) mock_execute_kubectl_command.assert_called_with(['version'], human_readable=False) dkc.get_kubectl_configuration( dkc.Commands.GET_PODS, kubernetes_context='test_context') mock_execute_kubectl_command.assert_called_with( ['get', 'pods', '--context', 'test_context', '--all-namespaces'], human_readable=False) dkc.get_kubectl_configuration( dkc.Commands.GET_PODS, kubernetes_context='test_context') mock_execute_kubectl_command.assert_called_with( ['get', 'pods', '--context', 'test_context', '--all-namespaces'], human_readable=False) def test_Commands(self): """Verify commands are formaated properly.""" for command in dkc.Commands: self.assertIsInstance(dkc._command_string[command], Text) self.assertNotIn('\t', dkc._command_string[command]) self.assertNotIn('\n', dkc._command_string[command]) @mock.patch.object(utility, 'ExecutorResponse', autospec=True) def test_execute_kubectl_command(self, mock_executor_response): """Test execute_gsutil_command.""" dkc.execute_kubectl_command( [dkc._command_string[dkc.Commands.GET_KUBECTL_VERSION]]) mock_executor_response().execute_command.assert_called_once_with( ['kubectl', 'version', '-o', 'json']) dkc.execute_kubectl_command( [dkc._command_string[dkc.Commands.GET_KUBECTL_VERSION]], human_readable=True) mock_executor_response().execute_command.assert_called_with( ['kubectl', 'version']) if __name__ == '__main__': unittest.main()
40.181818
76
0.724952
from typing import Text import unittest from unittest import mock from . import kubernetes_cluster as dkc from . import utility class KubernetesClusterTest(unittest.TestCase): @mock.patch.object(dkc, 'execute_kubectl_command', autospec=True) def test_project_configuration_gcloud(self, mock_execute_kubectl_command): dkc.get_kubectl_configuration(dkc.Commands.GET_PODS) mock_execute_kubectl_command.assert_called_once_with( ['get', 'pods', '--all-namespaces'], human_readable=False) dkc.get_kubectl_configuration(dkc.Commands.GET_CONFIGURED_CONTEXT) mock_execute_kubectl_command.assert_called_with(['config', 'view'], human_readable=False) dkc.get_kubectl_configuration(dkc.Commands.GET_KUBECTL_VERSION) mock_execute_kubectl_command.assert_called_with(['version'], human_readable=False) dkc.get_kubectl_configuration( dkc.Commands.GET_PODS, kubernetes_context='test_context') mock_execute_kubectl_command.assert_called_with( ['get', 'pods', '--context', 'test_context', '--all-namespaces'], human_readable=False) dkc.get_kubectl_configuration( dkc.Commands.GET_PODS, kubernetes_context='test_context') mock_execute_kubectl_command.assert_called_with( ['get', 'pods', '--context', 'test_context', '--all-namespaces'], human_readable=False) def test_Commands(self): for command in dkc.Commands: self.assertIsInstance(dkc._command_string[command], Text) self.assertNotIn('\t', dkc._command_string[command]) self.assertNotIn('\n', dkc._command_string[command]) @mock.patch.object(utility, 'ExecutorResponse', autospec=True) def test_execute_kubectl_command(self, mock_executor_response): dkc.execute_kubectl_command( [dkc._command_string[dkc.Commands.GET_KUBECTL_VERSION]]) mock_executor_response().execute_command.assert_called_once_with( ['kubectl', 'version', '-o', 'json']) dkc.execute_kubectl_command( [dkc._command_string[dkc.Commands.GET_KUBECTL_VERSION]], human_readable=True) mock_executor_response().execute_command.assert_called_with( ['kubectl', 'version']) if __name__ == '__main__': unittest.main()
true
true
f72b8a7bda68abbe8202a4c1804acb456c64dc74
1,096
py
Python
synth.py
athakor/java-monitoring
6c013839c5b349e4402a3fa87245930d8d1cc20b
[ "Apache-2.0" ]
null
null
null
synth.py
athakor/java-monitoring
6c013839c5b349e4402a3fa87245930d8d1cc20b
[ "Apache-2.0" ]
null
null
null
synth.py
athakor/java-monitoring
6c013839c5b349e4402a3fa87245930d8d1cc20b
[ "Apache-2.0" ]
null
null
null
# Copyright 2018 Google LLC # # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. """This script is used to synthesize generated parts of this library.""" import synthtool as s import synthtool.gcp as gcp import synthtool.languages.java as java gapic = gcp.GAPICGenerator() service = 'monitoring' versions = ['v3'] config_pattern = '/google/monitoring/artman_monitoring.yaml' for version in versions: java.gapic_library( service=service, version=version, config_pattern=config_pattern, package_pattern='com.google.{service}.{version}', gapic=gapic ) java.common_templates()
29.621622
74
0.756387
import synthtool as s import synthtool.gcp as gcp import synthtool.languages.java as java gapic = gcp.GAPICGenerator() service = 'monitoring' versions = ['v3'] config_pattern = '/google/monitoring/artman_monitoring.yaml' for version in versions: java.gapic_library( service=service, version=version, config_pattern=config_pattern, package_pattern='com.google.{service}.{version}', gapic=gapic ) java.common_templates()
true
true
f72b8af740fb1cc78203d79551f725c340162fdf
49
py
Python
typings/bl_rna_utils/__init__.py
Argmaster/PyR3
6786bcb6a101fe4bd4cc50fe43767b8178504b15
[ "MIT" ]
2
2021-12-12T18:51:52.000Z
2022-02-23T09:49:16.000Z
typings/bl_rna_utils/__init__.py
Argmaster/PyR3
6786bcb6a101fe4bd4cc50fe43767b8178504b15
[ "MIT" ]
2
2021-11-08T12:09:02.000Z
2021-12-12T23:01:12.000Z
typings/bl_rna_utils/__init__.py
Argmaster/PyR3
6786bcb6a101fe4bd4cc50fe43767b8178504b15
[ "MIT" ]
null
null
null
import sys import typing from . import data_path
12.25
23
0.816327
import sys import typing from . import data_path
true
true
f72b8b472726026675a7b89a1c670dce52cfa9b7
2,274
py
Python
tests/model/model_discovery_test.py
nickgaya/bravado-core
16e752963bfceb4adfa43724085bc4127eefcd59
[ "BSD-3-Clause" ]
122
2015-04-22T17:31:18.000Z
2021-11-08T10:29:57.000Z
tests/model/model_discovery_test.py
nickgaya/bravado-core
16e752963bfceb4adfa43724085bc4127eefcd59
[ "BSD-3-Clause" ]
364
2015-04-10T22:19:23.000Z
2022-02-25T08:55:10.000Z
tests/model/model_discovery_test.py
nickgaya/bravado-core
16e752963bfceb4adfa43724085bc4127eefcd59
[ "BSD-3-Clause" ]
118
2015-04-20T15:11:53.000Z
2021-12-09T10:03:34.000Z
# -*- coding: utf-8 -*- import mock import pytest from bravado_core.model import _run_post_processing from bravado_core.model import model_discovery from bravado_core.spec import Spec @pytest.fixture def wrap__run_post_processing(): with mock.patch( 'bravado_core.model._run_post_processing', wraps=_run_post_processing, ) as _wrap__run_post_processing: yield _wrap__run_post_processing def test_model_discovery_flow_no_ref_dereference(wrap__run_post_processing, minimal_swagger_dict): spec = Spec( spec_dict=minimal_swagger_dict, config={ 'internally_dereference_refs': False, }, ) model_discovery(swagger_spec=spec) wrap__run_post_processing.assert_called_once_with(spec) def test_model_discovery_flow_with_ref_dereference(wrap__run_post_processing, minimal_swagger_dict): spec = Spec( spec_dict=dict(minimal_swagger_dict, definitions={'model': {'type': 'object'}}), config={ 'internally_dereference_refs': True, }, origin_url='', ) model_discovery(swagger_spec=spec) # _run_post_processing is called 3 times # 1. post processing on initial specs # 2. post processing on on bravado_core.spec_flattening.flattened_spec # 3. post processing to rebuild definitions to remove possible references in the model specs assert wrap__run_post_processing.call_count == 3 @pytest.mark.parametrize( 'model_dict', [ { 'properties': { 'allOf': { 'type': 'string', }, 'title': {'type': 'string'}, 'type': {'type': 'string'}, }, 'type': 'object', }, ], ) def test_model_discovery_for_models_with_not_string_title_x_model(minimal_swagger_dict, model_dict): # This test case has been extracted from the Kubernetes Swagger specs # https://raw.githubusercontent.com/kubernetes/kubernetes/release-1.15/api/openapi-spec/swagger.json#/definitions/io.k8s.apiextensions-apiserver.pkg.apis.apiextensions.v1beta1.JSONSchemaProps spec = Spec.from_dict(spec_dict=dict(minimal_swagger_dict, definitions={'Model': model_dict})) assert set(spec.definitions) == {'Model'}
33.940299
195
0.690413
import mock import pytest from bravado_core.model import _run_post_processing from bravado_core.model import model_discovery from bravado_core.spec import Spec @pytest.fixture def wrap__run_post_processing(): with mock.patch( 'bravado_core.model._run_post_processing', wraps=_run_post_processing, ) as _wrap__run_post_processing: yield _wrap__run_post_processing def test_model_discovery_flow_no_ref_dereference(wrap__run_post_processing, minimal_swagger_dict): spec = Spec( spec_dict=minimal_swagger_dict, config={ 'internally_dereference_refs': False, }, ) model_discovery(swagger_spec=spec) wrap__run_post_processing.assert_called_once_with(spec) def test_model_discovery_flow_with_ref_dereference(wrap__run_post_processing, minimal_swagger_dict): spec = Spec( spec_dict=dict(minimal_swagger_dict, definitions={'model': {'type': 'object'}}), config={ 'internally_dereference_refs': True, }, origin_url='', ) model_discovery(swagger_spec=spec) assert wrap__run_post_processing.call_count == 3 @pytest.mark.parametrize( 'model_dict', [ { 'properties': { 'allOf': { 'type': 'string', }, 'title': {'type': 'string'}, 'type': {'type': 'string'}, }, 'type': 'object', }, ], ) def test_model_discovery_for_models_with_not_string_title_x_model(minimal_swagger_dict, model_dict): _dict})) assert set(spec.definitions) == {'Model'}
true
true
f72b8df9aa69d2cc28657e451f4a61aca75b3217
2,091
py
Python
toys/sqlalchemy_bakery.py
mikegreen7892003/PythonToy
e9218cdee4a38835fdbebad0e429ddf52bb444b4
[ "MIT" ]
null
null
null
toys/sqlalchemy_bakery.py
mikegreen7892003/PythonToy
e9218cdee4a38835fdbebad0e429ddf52bb444b4
[ "MIT" ]
null
null
null
toys/sqlalchemy_bakery.py
mikegreen7892003/PythonToy
e9218cdee4a38835fdbebad0e429ddf52bb444b4
[ "MIT" ]
null
null
null
""" Just for Python 3 """ import logging import pprint import tornado.web import tornado.httpserver from tornado.options import define, options, parse_command_line from sqlalchemy import create_engine, Column, Integer, String from sqlalchemy.ext.declarative import declarative_base from sqlalchemy.ext import baked from sqlalchemy.orm import Session # models BAKERY = baked.bakery() Base = declarative_base() ENGINE = create_engine('sqlite:///:memory:', echo=False) class User(Base): __tablename__ = 'users' id = Column(Integer, primary_key=True) name = Column(String) fullname = Column(String) password = Column(String) def __repr__(self): return "<User(name='%s', fullname='%s', password='%s')>" % ( self.name, self.fullname, self.password) # request class MainHandler(tornado.web.RequestHandler): @property def session(self): return Session(bind=ENGINE) def get(self): uid = self.get_argument("uid") def fn(session): logging.warn("call fn %s", fn) return session.query(User).filter(User.id == uid) baked_query = BAKERY(fn) logging.info("fn %s", fn.__code__) logging.warn("baked_query _cache_key: %s", baked_query._cache_key) user_list = baked_query(self.session).all() self.write("user_list:\n{}\n".format(pprint.pformat(user_list))) def main(): Base.metadata.create_all(ENGINE) # add test user session = Session(bind=ENGINE) for uid in range(20): user = User(name='ed {}'.format(uid), fullname='Ed Jones {}'.format(uid), password='edspassword') session.add(user) session.commit() # start application application = tornado.web.Application([ (r"/", MainHandler), ], ) http_server = tornado.httpserver.HTTPServer(application) http_server.listen(options.port) tornado.ioloop.IOLoop.current().start() if __name__ == "__main__": define("port", default=8888, help="run on the given port", type=int) parse_command_line() main()
23.761364
105
0.659971
import logging import pprint import tornado.web import tornado.httpserver from tornado.options import define, options, parse_command_line from sqlalchemy import create_engine, Column, Integer, String from sqlalchemy.ext.declarative import declarative_base from sqlalchemy.ext import baked from sqlalchemy.orm import Session BAKERY = baked.bakery() Base = declarative_base() ENGINE = create_engine('sqlite:///:memory:', echo=False) class User(Base): __tablename__ = 'users' id = Column(Integer, primary_key=True) name = Column(String) fullname = Column(String) password = Column(String) def __repr__(self): return "<User(name='%s', fullname='%s', password='%s')>" % ( self.name, self.fullname, self.password) class MainHandler(tornado.web.RequestHandler): @property def session(self): return Session(bind=ENGINE) def get(self): uid = self.get_argument("uid") def fn(session): logging.warn("call fn %s", fn) return session.query(User).filter(User.id == uid) baked_query = BAKERY(fn) logging.info("fn %s", fn.__code__) logging.warn("baked_query _cache_key: %s", baked_query._cache_key) user_list = baked_query(self.session).all() self.write("user_list:\n{}\n".format(pprint.pformat(user_list))) def main(): Base.metadata.create_all(ENGINE) session = Session(bind=ENGINE) for uid in range(20): user = User(name='ed {}'.format(uid), fullname='Ed Jones {}'.format(uid), password='edspassword') session.add(user) session.commit() application = tornado.web.Application([ (r"/", MainHandler), ], ) http_server = tornado.httpserver.HTTPServer(application) http_server.listen(options.port) tornado.ioloop.IOLoop.current().start() if __name__ == "__main__": define("port", default=8888, help="run on the given port", type=int) parse_command_line() main()
true
true
f72b8dfa12eefecf24dc259425f0b7961d8f210a
28,498
py
Python
tests/gce_virtual_machine_test.py
mikeweng/PerfKitBenchmarker
e929a69f04e2f91a0fed7da8db8a321edf58f403
[ "Apache-2.0" ]
null
null
null
tests/gce_virtual_machine_test.py
mikeweng/PerfKitBenchmarker
e929a69f04e2f91a0fed7da8db8a321edf58f403
[ "Apache-2.0" ]
null
null
null
tests/gce_virtual_machine_test.py
mikeweng/PerfKitBenchmarker
e929a69f04e2f91a0fed7da8db8a321edf58f403
[ "Apache-2.0" ]
null
null
null
# Copyright 2019 PerfKitBenchmarker Authors. All rights reserved. # # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. """Tests for perfkitbenchmarker.providers.gcp.gce_virtual_machine.""" import contextlib import copy import json import re import unittest from absl import flags import builtins import mock from perfkitbenchmarker import benchmark_spec from perfkitbenchmarker import context from perfkitbenchmarker import errors from perfkitbenchmarker import os_types from perfkitbenchmarker import providers from perfkitbenchmarker import virtual_machine from perfkitbenchmarker import vm_util from perfkitbenchmarker.configs import benchmark_config_spec from perfkitbenchmarker.providers.gcp import gce_network from perfkitbenchmarker.providers.gcp import gce_virtual_machine from perfkitbenchmarker.providers.gcp import util from tests import pkb_common_test_case FLAGS = flags.FLAGS _BENCHMARK_NAME = 'name' _BENCHMARK_UID = 'benchmark_uid' _COMPONENT = 'test_component' _FLAGS = None _FAKE_INSTANCE_METADATA = { 'id': '123456', 'networkInterfaces': [ { 'accessConfigs': [ { 'natIP': '1.2.3.4' } ], 'networkIP': '1.2.3.4' } ] } _FAKE_DISK_METADATA = { 'id': '123456', 'kind': 'compute#disk', 'name': 'fakedisk', 'sizeGb': '10', 'sourceImage': '', 'type': 'pd-standard' } @contextlib.contextmanager def PatchCriticalObjects(retvals=None): """A context manager that patches a few critical objects with mocks.""" def ReturnVal(*unused_arg, **unused_kwargs): del unused_arg del unused_kwargs return ('', '', 0) if retvals is None else retvals.pop(0) with mock.patch( vm_util.__name__ + '.IssueCommand', side_effect=ReturnVal) as issue_command, mock.patch( builtins.__name__ + '.open'), mock.patch( vm_util.__name__ + '.NamedTemporaryFile'), mock.patch(util.__name__ + '.GetDefaultProject'): yield issue_command class GceVmSpecTestCase(pkb_common_test_case.PkbCommonTestCase): def testStringMachineType(self): result = gce_virtual_machine.GceVmSpec(_COMPONENT, machine_type='n1-standard-8') self.assertEqual(result.machine_type, 'n1-standard-8') self.assertEqual(result.cpus, None) self.assertEqual(result.memory, None) def testStringMachineTypeWithGpus(self): gpu_count = 2 gpu_type = 'k80' result = gce_virtual_machine.GceVmSpec(_COMPONENT, machine_type='n1-standard-8', gpu_count=gpu_count, gpu_type=gpu_type) self.assertEqual(result.machine_type, 'n1-standard-8') self.assertEqual(result.gpu_type, 'k80') self.assertEqual(result.gpu_count, 2) def testCustomMachineType(self): result = gce_virtual_machine.GceVmSpec(_COMPONENT, machine_type={ 'cpus': 1, 'memory': '7.5GiB'}) self.assertEqual(result.machine_type, None) self.assertEqual(result.cpus, 1) self.assertEqual(result.memory, 7680) def testCustomMachineTypeWithGpus(self): gpu_count = 2 gpu_type = 'k80' result = gce_virtual_machine.GceVmSpec(_COMPONENT, machine_type={ 'cpus': 1, 'memory': '7.5GiB' }, gpu_count=gpu_count, gpu_type=gpu_type) self.assertEqual(result.cpus, 1) self.assertEqual(result.memory, 7680) self.assertEqual(result.gpu_type, 'k80') self.assertEqual(result.gpu_count, 2) def testStringMachineTypeFlagOverride(self): FLAGS['machine_type'].parse('n1-standard-8') result = gce_virtual_machine.GceVmSpec( _COMPONENT, flag_values=FLAGS, machine_type={ 'cpus': 1, 'memory': '7.5GiB' }) self.assertEqual(result.machine_type, 'n1-standard-8') self.assertEqual(result.cpus, None) self.assertEqual(result.memory, None) def testCustomMachineTypeFlagOverride(self): FLAGS['machine_type'].parse('{cpus: 1, memory: 7.5GiB}') result = gce_virtual_machine.GceVmSpec( _COMPONENT, flag_values=FLAGS, machine_type='n1-standard-8') self.assertEqual(result.machine_type, None) self.assertEqual(result.cpus, 1) self.assertEqual(result.memory, 7680) class GceVirtualMachineTestCase(pkb_common_test_case.PkbCommonTestCase): def setUp(self): super(GceVirtualMachineTestCase, self).setUp() p = mock.patch(gce_virtual_machine.__name__ + '.gce_network.GceNetwork.GetNetwork') self.mock_get_network = p.start() self.addCleanup(p.stop) p = mock.patch(gce_virtual_machine.__name__ + '.gce_network.GceFirewall.GetFirewall') self.mock_get_firewall = p.start() self.addCleanup(p.stop) get_tmp_dir_mock = mock.patch( vm_util.__name__ + '.GetTempDir', return_value='TempDir') get_tmp_dir_mock.start() self.addCleanup(get_tmp_dir_mock.stop) def testVmWithMachineTypeNonPreemptible(self): spec = gce_virtual_machine.GceVmSpec( _COMPONENT, machine_type='test_machine_type', project='p') vm = pkb_common_test_case.TestGceVirtualMachine(spec) vm.created = True self.assertDictContainsSubset( {'dedicated_host': False, 'machine_type': 'test_machine_type', 'project': 'p'}, vm.GetResourceMetadata() ) def testVmWithMachineTypePreemptible(self): spec = gce_virtual_machine.GceVmSpec( _COMPONENT, machine_type='test_machine_type', preemptible=True, project='p') vm = pkb_common_test_case.TestGceVirtualMachine(spec) vm.created = True self.assertDictContainsSubset( {'dedicated_host': False, 'machine_type': 'test_machine_type', 'preemptible': True, 'project': 'p'}, vm.GetResourceMetadata() ) def testCustomVmNonPreemptible(self): spec = gce_virtual_machine.GceVmSpec(_COMPONENT, machine_type={ 'cpus': 1, 'memory': '1.0GiB'}, project='p') vm = pkb_common_test_case.TestGceVirtualMachine(spec) vm.created = True self.assertDictContainsSubset( {'cpus': 1, 'memory_mib': 1024, 'project': 'p', 'dedicated_host': False}, vm.GetResourceMetadata()) def testCustomVmPreemptible(self): spec = gce_virtual_machine.GceVmSpec( _COMPONENT, machine_type={'cpus': 1, 'memory': '1.0GiB'}, preemptible=True, project='fakeproject') vm = pkb_common_test_case.TestGceVirtualMachine(spec) vm.created = True self.assertDictContainsSubset({ 'cpus': 1, 'memory_mib': 1024, 'project': 'fakeproject', 'dedicated_host': False, 'preemptible': True}, vm.GetResourceMetadata()) def testCustomVmWithGpus(self): spec = gce_virtual_machine.GceVmSpec( _COMPONENT, machine_type={'cpus': 1, 'memory': '1.0GiB'}, gpu_count=2, gpu_type='k80', project='fakeproject') vm = pkb_common_test_case.TestGceVirtualMachine(spec) vm.created = True self.assertDictContainsSubset({ 'cpus': 1, 'memory_mib': 1024, 'project': 'fakeproject', 'dedicated_host': False, 'gpu_count': 2, 'gpu_type': 'k80' }, vm.GetResourceMetadata()) def _CreateFakeDiskMetadata(image): fake_disk = copy.copy(_FAKE_DISK_METADATA) fake_disk['sourceImage'] = image return fake_disk class GceVirtualMachineOsTypesTestCase(pkb_common_test_case.PkbCommonTestCase): def setUp(self): super(GceVirtualMachineOsTypesTestCase, self).setUp() FLAGS.gcp_instance_metadata_from_file = '' FLAGS.gcp_instance_metadata = '' FLAGS.gcloud_path = 'gcloud' p = mock.patch(gce_virtual_machine.__name__ + '.gce_network.GceNetwork.GetNetwork') self.mock_get_network = p.start() self.addCleanup(p.stop) p = mock.patch(gce_virtual_machine.__name__ + '.gce_network.GceFirewall.GetFirewall') self.mock_get_firewall = p.start() self.addCleanup(p.stop) self.spec = gce_virtual_machine.GceVmSpec(_COMPONENT, machine_type='fake-machine-type') p = mock.patch(gce_virtual_machine.__name__ + '.linux_vm.BaseLinuxMixin._GetNumCpus') self.mock_get_num_cpus = p.start() self.addCleanup(p.stop) get_tmp_dir_mock = mock.patch( vm_util.__name__ + '.GetTempDir', return_value='TempDir') get_tmp_dir_mock.start() self.addCleanup(get_tmp_dir_mock.stop) def _CreateFakeReturnValues(self, fake_image=''): fake_rets = [('', '', 0), (json.dumps(_FAKE_INSTANCE_METADATA), '', 0)] if fake_image: fake_rets.append((json.dumps(_CreateFakeDiskMetadata(fake_image)), '', 0)) return fake_rets def testCreateUbuntu1604(self): vm_class = virtual_machine.GetVmClass(providers.GCP, os_types.UBUNTU1604) fake_image = 'fake-ubuntu1604' with PatchCriticalObjects( self._CreateFakeReturnValues(fake_image)) as issue_command: vm = vm_class(self.spec) vm._Create() vm.created = True command_string = ' '.join(issue_command.call_args[0][0]) self.assertEqual(issue_command.call_count, 1) self.assertIn('gcloud compute instances create', command_string) self.assertIn( '--image-family ubuntu-1604-lts --image-project ubuntu-os-cloud', command_string) self.assertNotIn('--boot-disk-size', command_string) self.assertNotIn('--boot-disk-type', command_string) vm._PostCreate() self.assertEqual(issue_command.call_count, 3) self.assertDictContainsSubset({'image': fake_image, 'image_family': 'ubuntu-1604-lts', 'image_project': 'ubuntu-os-cloud', 'boot_disk_size': '10', 'boot_disk_type': 'pd-standard'}, vm.GetResourceMetadata()) def testCreateUbuntuInCustomProject(self): """Test simulating passing --image and --image_project.""" vm_class = virtual_machine.GetVmClass(providers.GCP, os_types.UBUNTU1604) fake_image = 'fake-ubuntu1604' fake_image_project = 'fake-project' spec = gce_virtual_machine.GceVmSpec(_COMPONENT, machine_type='fake-machine-type', image=fake_image, image_project=fake_image_project) with PatchCriticalObjects( self._CreateFakeReturnValues(fake_image)) as issue_command: vm = vm_class(spec) vm._Create() vm.created = True command_string = ' '.join(issue_command.call_args[0][0]) self.assertEqual(issue_command.call_count, 1) self.assertIn('gcloud compute instances create', command_string) self.assertIn( '--image fake-ubuntu1604 --image-project fake-project', command_string) self.assertNotIn('--image-family', command_string) vm._PostCreate() self.assertEqual(issue_command.call_count, 3) vm_metadata = vm.GetResourceMetadata() self.assertDictContainsSubset({'image': fake_image, 'image_project': 'fake-project'}, vm_metadata) self.assertNotIn('image_family', vm_metadata) def testCreateUbuntuInCustomDisk(self): """Test simulating passing --image and --image_project.""" vm_class = virtual_machine.GetVmClass(providers.GCP, os_types.UBUNTU1604) fake_image = 'fake-ubuntu1604' fake_image_project = 'fake-project' spec = gce_virtual_machine.GceVmSpec(_COMPONENT, machine_type='fake-machine-type', image=fake_image, image_project=fake_image_project, boot_disk_size=20, boot_disk_type='fake-disk-type') with PatchCriticalObjects( self._CreateFakeReturnValues(fake_image)) as issue_command: vm = vm_class(spec) vm._Create() vm.created = True command_string = ' '.join(issue_command.call_args[0][0]) self.assertEqual(issue_command.call_count, 1) self.assertIn('gcloud compute instances create', command_string) self.assertIn('--boot-disk-size 20', command_string) self.assertIn('--boot-disk-type fake-disk-type', command_string) vm._PostCreate() self.assertEqual(issue_command.call_count, 2) vm_metadata = vm.GetResourceMetadata() self.assertDictContainsSubset({'image': fake_image, 'image_project': 'fake-project', 'boot_disk_size': 20, 'boot_disk_type': 'fake-disk-type'}, vm_metadata) self.assertNotIn('image_family', vm_metadata) def testCreateUbuntu1804(self): vm_class = virtual_machine.GetVmClass(providers.GCP, os_types.UBUNTU1804) fake_image = 'fake-ubuntu1804' with PatchCriticalObjects( self._CreateFakeReturnValues(fake_image)) as issue_command: vm = vm_class(self.spec) vm._Create() vm.created = True command_string = ' '.join(issue_command.call_args[0][0]) self.assertEqual(issue_command.call_count, 1) self.assertIn('gcloud compute instances create', command_string) self.assertIn( '--image-family ubuntu-1804-lts --image-project ubuntu-os-cloud', command_string) vm._PostCreate() self.assertEqual(issue_command.call_count, 3) self.assertDictContainsSubset({'image': fake_image, 'image_family': 'ubuntu-1804-lts', 'image_project': 'ubuntu-os-cloud'}, vm.GetResourceMetadata()) def testCreateRhel7CustomImage(self): vm_class = virtual_machine.GetVmClass(providers.GCP, os_types.RHEL7) fake_image = 'fake-custom-rhel-image' spec = gce_virtual_machine.GceVmSpec(_COMPONENT, machine_type='fake-machine-type', image=fake_image) with PatchCriticalObjects( self._CreateFakeReturnValues(fake_image)) as issue_command: vm = vm_class(spec) vm._Create() vm.created = True command_string = ' '.join(issue_command.call_args[0][0]) self.assertEqual(issue_command.call_count, 1) self.assertIn('gcloud compute instances create', command_string) self.assertIn('--image ' + fake_image, command_string) self.assertIn('--image-project rhel-cloud', command_string) vm._PostCreate() self.assertEqual(issue_command.call_count, 3) vm_metadata = vm.GetResourceMetadata() self.assertDictContainsSubset({'image': fake_image, 'image_project': 'rhel-cloud'}, vm_metadata) self.assertNotIn('image_family', vm_metadata) def testCreateCentOs7CustomImage(self): vm_class = virtual_machine.GetVmClass(providers.GCP, os_types.CENTOS7) fake_image = 'fake-custom-centos7-image' spec = gce_virtual_machine.GceVmSpec(_COMPONENT, machine_type='fake-machine-type', image=fake_image) with PatchCriticalObjects( self._CreateFakeReturnValues(fake_image)) as issue_command: vm = vm_class(spec) vm._Create() vm.created = True command_string = ' '.join(issue_command.call_args[0][0]) self.assertEqual(issue_command.call_count, 1) self.assertIn('gcloud compute instances create', command_string) self.assertIn('--image ' + fake_image, command_string) self.assertIn('--image-project centos-cloud', command_string) vm._PostCreate() self.assertEqual(issue_command.call_count, 3) vm_metadata = vm.GetResourceMetadata() self.assertDictContainsSubset({'image': fake_image, 'image_project': 'centos-cloud'}, vm_metadata) self.assertNotIn('image_family', vm_metadata) class GCEVMFlagsTestCase(pkb_common_test_case.PkbCommonTestCase): def setUp(self): super(GCEVMFlagsTestCase, self).setUp() FLAGS.cloud = providers.GCP FLAGS.gcloud_path = 'test_gcloud' FLAGS.run_uri = 'aaaaaa' FLAGS.gcp_instance_metadata = [] FLAGS.gcp_instance_metadata_from_file = [] # Creating a VM object causes network objects to be added to the current # thread's benchmark spec. Create such a benchmark spec for these tests. self.addCleanup(context.SetThreadBenchmarkSpec, None) config_spec = benchmark_config_spec.BenchmarkConfigSpec( _BENCHMARK_NAME, flag_values=FLAGS, vm_groups={}) self._benchmark_spec = benchmark_spec.BenchmarkSpec( mock.MagicMock(), config_spec, _BENCHMARK_UID) get_tmp_dir_mock = mock.patch( vm_util.__name__ + '.GetTempDir', return_value='TempDir') get_tmp_dir_mock.start() self.addCleanup(get_tmp_dir_mock.stop) def _CreateVmCommand(self, **flag_kwargs): with PatchCriticalObjects() as issue_command: for key, value in flag_kwargs.items(): FLAGS[key].parse(value) vm_spec = gce_virtual_machine.GceVmSpec( 'test_vm_spec.GCP', FLAGS, image='image', machine_type='test_machine_type') vm = pkb_common_test_case.TestGceVirtualMachine(vm_spec) vm._Create() return ' '.join(issue_command.call_args[0][0]), issue_command.call_count def testPreemptibleVMFlag(self): cmd, call_count = self._CreateVmCommand(gce_preemptible_vms=True) self.assertEqual(call_count, 1) self.assertIn('--preemptible', cmd) def testMigrateOnMaintenanceFlagTrueWithGpus(self): with self.assertRaises(errors.Config.InvalidValue) as cm: self._CreateVmCommand( gce_migrate_on_maintenance=True, gpu_count=1, gpu_type='k80') self.assertEqual(str(cm.exception), ( 'Cannot set flag gce_migrate_on_maintenance on ' 'instances with GPUs, as it is not supported by GCP.')) def testMigrateOnMaintenanceFlagFalseWithGpus(self): _, call_count = self._CreateVmCommand( gce_migrate_on_maintenance=False, gpu_count=1, gpu_type='k80') self.assertEqual(call_count, 1) def testAcceleratorTypeOverrideFlag(self): cmd, call_count = self._CreateVmCommand( gce_accelerator_type_override='fake_type', gpu_count=1, gpu_type='k80') self.assertEqual(call_count, 1) self.assertIn('--accelerator', cmd) self.assertIn('type=fake_type,count=1', cmd) def testImageProjectFlag(self): """Tests that custom image_project flag is supported.""" cmd, call_count = self._CreateVmCommand(image_project='bar') self.assertEqual(call_count, 1) self.assertIn('--image-project bar', cmd) def testNetworkTierFlagPremium(self): """Tests that the premium network tier flag is supported.""" cmd, call_count = self._CreateVmCommand(gce_network_tier='premium') self.assertEqual(call_count, 1) self.assertIn('--network-tier PREMIUM', cmd) def testNetworkTierFlagStandard(self): """Tests that the standard network tier flag is supported.""" cmd, call_count = self._CreateVmCommand(gce_network_tier='standard') self.assertEqual(call_count, 1) self.assertIn('--network-tier STANDARD', cmd) def testGcpInstanceMetadataFlag(self): cmd, call_count = self._CreateVmCommand( gcp_instance_metadata=['k1:v1', 'k2:v2,k3:v3'], owner='test-owner') self.assertEqual(call_count, 1) actual_metadata = re.compile( r'--metadata\s+(.*)(\s+--)?').search(cmd).group(1) self.assertIn('k1=v1', actual_metadata) self.assertIn('k2=v2', actual_metadata) self.assertIn('k3=v3', actual_metadata) # Assert that FLAGS.owner is honored and added to instance metadata. self.assertIn('owner=test-owner', actual_metadata) def testGcpInstanceMetadataFromFileFlag(self): cmd, call_count = self._CreateVmCommand( gcp_instance_metadata_from_file=['k1:p1', 'k2:p2,k3:p3']) self.assertEqual(call_count, 1) actual_metadata_from_file = re.compile( r'--metadata-from-file\s+(.*)(\s+--)?').search(cmd).group(1) self.assertIn('k1=p1', actual_metadata_from_file) self.assertIn('k2=p2', actual_metadata_from_file) self.assertIn('k3=p3', actual_metadata_from_file) def testGceTags(self): self.assertIn('--tags perfkitbenchmarker', self._CreateVmCommand()[0]) self.assertIn('--tags perfkitbenchmarker,testtag', self._CreateVmCommand(gce_tags=['testtag'])[0]) def testShieldedSecureBootFlag(self): """Tests that the custom shielded secure boot flag is supported.""" cmd, call_count = self._CreateVmCommand( gce_shielded_secure_boot=True) self.assertEqual(call_count, 1) self.assertIn('--shielded-secure-boot', cmd) class GCEVMCreateTestCase(pkb_common_test_case.PkbCommonTestCase): def setUp(self): super(GCEVMCreateTestCase, self).setUp() p = mock.patch(gce_virtual_machine.__name__ + '.gce_network.GceNetwork.GetNetwork') self.mock_get_network = p.start() self.addCleanup(p.stop) p = mock.patch(gce_virtual_machine.__name__ + '.gce_network.GceFirewall.GetFirewall') self.mock_get_firewall = p.start() self.addCleanup(p.stop) get_tmp_dir_mock = mock.patch( vm_util.__name__ + '.GetTempDir', return_value='TempDir') get_tmp_dir_mock.start() self.addCleanup(get_tmp_dir_mock.stop) @mock.patch('time.sleep', side_effect=lambda _: None) def testCreateRateLimitedMachineCreated(self, mock_cmd): fake_rets = [('stdout', 'Rate Limit Exceeded', 1), ('stdout', 'Rate Limit Exceeded', 1), ('stdout', 'Rate Limit Exceeded', 1), ('stdout', 'Rate Limit Exceeded', 1), ('stdout', 'The resource already exists', 1)] with PatchCriticalObjects(fake_rets) as issue_command: spec = gce_virtual_machine.GceVmSpec( _COMPONENT, machine_type={ 'cpus': 1, 'memory': '1.0GiB', }) vm = pkb_common_test_case.TestGceVirtualMachine(spec) vm._Create() # No error should be thrown. self.assertEqual(issue_command.call_count, 5) @mock.patch('time.sleep', side_effect=lambda _: None) def testCreateRateLimitedMachineCreatedFailure(self, mock_cmd): fake_rets = [] for _ in range(0, 100): fake_rets.append(('stdout', 'Rate Limit Exceeded', 1)) with PatchCriticalObjects(fake_rets) as issue_command: spec = gce_virtual_machine.GceVmSpec( _COMPONENT, machine_type={ 'cpus': 1, 'memory': '1.0GiB', }) vm = pkb_common_test_case.TestGceVirtualMachine(spec) with self.assertRaises( errors.Benchmarks.QuotaFailure.RateLimitExceededError): vm._Create() self.assertEqual(issue_command.call_count, util.RATE_LIMITED_MAX_RETRIES + 1) def testCreateVMAlreadyExists(self): fake_rets = [('stdout', 'The resource already exists', 1)] with PatchCriticalObjects(fake_rets): spec = gce_virtual_machine.GceVmSpec( _COMPONENT, machine_type={ 'cpus': 1, 'memory': '1.0GiB', }) vm = pkb_common_test_case.TestGceVirtualMachine(spec) with self.assertRaises(errors.Resource.CreationError): vm._Create() def testVmWithoutGpu(self): with PatchCriticalObjects() as issue_command: spec = gce_virtual_machine.GceVmSpec( _COMPONENT, machine_type={ 'cpus': 1, 'memory': '1.0GiB', }) vm = pkb_common_test_case.TestGceVirtualMachine(spec) vm._Create() self.assertEqual(issue_command.call_count, 1) self.assertNotIn('--accelerator', issue_command.call_args[0][0]) def testVmWithGpu(self): with PatchCriticalObjects() as issue_command: spec = gce_virtual_machine.GceVmSpec( _COMPONENT, machine_type='n1-standard-8', gpu_count=2, gpu_type='k80') vm = pkb_common_test_case.TestGceVirtualMachine(spec) vm._Create() self.assertEqual(issue_command.call_count, 1) self.assertIn('--accelerator', issue_command.call_args[0][0]) self.assertIn('type=nvidia-tesla-k80,count=2', issue_command.call_args[0][0]) self.assertIn('--maintenance-policy', issue_command.call_args[0][0]) self.assertIn('TERMINATE', issue_command.call_args[0][0]) class GceFirewallRuleTest(pkb_common_test_case.PkbCommonTestCase): @mock.patch('time.sleep', side_effect=lambda _: None) def testGceFirewallRuleSuccessfulAfterRateLimited(self, mock_cmd): fake_rets = [('stdout', 'Rate Limit Exceeded', 1), ('stdout', 'some warning perhaps', 0)] with PatchCriticalObjects(fake_rets) as issue_command: fr = gce_network.GceFirewallRule('name', 'project', 'allow', 'network_name') fr._Create() self.assertEqual(issue_command.call_count, 2) @mock.patch('time.sleep', side_effect=lambda _: None) def testGceFirewallRuleGenericErrorAfterRateLimited(self, mock_cmd): fake_rets = [('stdout', 'Rate Limit Exceeded', 1), ('stdout', 'Rate Limit Exceeded', 1), ('stdout', 'some random firewall error', 1)] with PatchCriticalObjects(fake_rets) as issue_command: with self.assertRaises(errors.VmUtil.IssueCommandError): fr = gce_network.GceFirewallRule('name', 'project', 'allow', 'network_name') fr._Create() self.assertEqual(issue_command.call_count, 3) @mock.patch('time.sleep', side_effect=lambda _: None) def testGceFirewallRuleAlreadyExistsAfterRateLimited(self, mock_cmd): fake_rets = [('stdout', 'Rate Limit Exceeded', 1), ('stdout', 'Rate Limit Exceeded', 1), ('stdout', 'firewall already exists', 1)] with PatchCriticalObjects(fake_rets) as issue_command: fr = gce_network.GceFirewallRule('name', 'project', 'allow', 'network_name') fr._Create() self.assertEqual(issue_command.call_count, 3) @mock.patch('time.sleep', side_effect=lambda _: None) def testGceFirewallRuleGenericError(self, mock_cmd): fake_rets = [('stdout', 'some random firewall error', 1)] with PatchCriticalObjects(fake_rets) as issue_command: with self.assertRaises(errors.VmUtil.IssueCommandError): fr = gce_network.GceFirewallRule('name', 'project', 'allow', 'network_name') fr._Create() self.assertEqual(issue_command.call_count, 1) class GceNetworkTest(pkb_common_test_case.PkbCommonTestCase): def setUp(self): super(GceNetworkTest, self).setUp() # need a benchmarkspec in the context to run config_spec = benchmark_config_spec.BenchmarkConfigSpec( 'cluster_boot', flag_values=FLAGS) benchmark_spec.BenchmarkSpec(mock.Mock(), config_spec, 'uid') def testGetNetwork(self): project = 'myproject' zone = 'us-east1-a' vm = mock.Mock(zone=zone, project=project, cidr=None) net = gce_network.GceNetwork.GetNetwork(vm) self.assertEqual(project, net.project) self.assertEqual(zone, net.zone) if __name__ == '__main__': unittest.main()
40.422695
80
0.65573
import contextlib import copy import json import re import unittest from absl import flags import builtins import mock from perfkitbenchmarker import benchmark_spec from perfkitbenchmarker import context from perfkitbenchmarker import errors from perfkitbenchmarker import os_types from perfkitbenchmarker import providers from perfkitbenchmarker import virtual_machine from perfkitbenchmarker import vm_util from perfkitbenchmarker.configs import benchmark_config_spec from perfkitbenchmarker.providers.gcp import gce_network from perfkitbenchmarker.providers.gcp import gce_virtual_machine from perfkitbenchmarker.providers.gcp import util from tests import pkb_common_test_case FLAGS = flags.FLAGS _BENCHMARK_NAME = 'name' _BENCHMARK_UID = 'benchmark_uid' _COMPONENT = 'test_component' _FLAGS = None _FAKE_INSTANCE_METADATA = { 'id': '123456', 'networkInterfaces': [ { 'accessConfigs': [ { 'natIP': '1.2.3.4' } ], 'networkIP': '1.2.3.4' } ] } _FAKE_DISK_METADATA = { 'id': '123456', 'kind': 'compute#disk', 'name': 'fakedisk', 'sizeGb': '10', 'sourceImage': '', 'type': 'pd-standard' } @contextlib.contextmanager def PatchCriticalObjects(retvals=None): def ReturnVal(*unused_arg, **unused_kwargs): del unused_arg del unused_kwargs return ('', '', 0) if retvals is None else retvals.pop(0) with mock.patch( vm_util.__name__ + '.IssueCommand', side_effect=ReturnVal) as issue_command, mock.patch( builtins.__name__ + '.open'), mock.patch( vm_util.__name__ + '.NamedTemporaryFile'), mock.patch(util.__name__ + '.GetDefaultProject'): yield issue_command class GceVmSpecTestCase(pkb_common_test_case.PkbCommonTestCase): def testStringMachineType(self): result = gce_virtual_machine.GceVmSpec(_COMPONENT, machine_type='n1-standard-8') self.assertEqual(result.machine_type, 'n1-standard-8') self.assertEqual(result.cpus, None) self.assertEqual(result.memory, None) def testStringMachineTypeWithGpus(self): gpu_count = 2 gpu_type = 'k80' result = gce_virtual_machine.GceVmSpec(_COMPONENT, machine_type='n1-standard-8', gpu_count=gpu_count, gpu_type=gpu_type) self.assertEqual(result.machine_type, 'n1-standard-8') self.assertEqual(result.gpu_type, 'k80') self.assertEqual(result.gpu_count, 2) def testCustomMachineType(self): result = gce_virtual_machine.GceVmSpec(_COMPONENT, machine_type={ 'cpus': 1, 'memory': '7.5GiB'}) self.assertEqual(result.machine_type, None) self.assertEqual(result.cpus, 1) self.assertEqual(result.memory, 7680) def testCustomMachineTypeWithGpus(self): gpu_count = 2 gpu_type = 'k80' result = gce_virtual_machine.GceVmSpec(_COMPONENT, machine_type={ 'cpus': 1, 'memory': '7.5GiB' }, gpu_count=gpu_count, gpu_type=gpu_type) self.assertEqual(result.cpus, 1) self.assertEqual(result.memory, 7680) self.assertEqual(result.gpu_type, 'k80') self.assertEqual(result.gpu_count, 2) def testStringMachineTypeFlagOverride(self): FLAGS['machine_type'].parse('n1-standard-8') result = gce_virtual_machine.GceVmSpec( _COMPONENT, flag_values=FLAGS, machine_type={ 'cpus': 1, 'memory': '7.5GiB' }) self.assertEqual(result.machine_type, 'n1-standard-8') self.assertEqual(result.cpus, None) self.assertEqual(result.memory, None) def testCustomMachineTypeFlagOverride(self): FLAGS['machine_type'].parse('{cpus: 1, memory: 7.5GiB}') result = gce_virtual_machine.GceVmSpec( _COMPONENT, flag_values=FLAGS, machine_type='n1-standard-8') self.assertEqual(result.machine_type, None) self.assertEqual(result.cpus, 1) self.assertEqual(result.memory, 7680) class GceVirtualMachineTestCase(pkb_common_test_case.PkbCommonTestCase): def setUp(self): super(GceVirtualMachineTestCase, self).setUp() p = mock.patch(gce_virtual_machine.__name__ + '.gce_network.GceNetwork.GetNetwork') self.mock_get_network = p.start() self.addCleanup(p.stop) p = mock.patch(gce_virtual_machine.__name__ + '.gce_network.GceFirewall.GetFirewall') self.mock_get_firewall = p.start() self.addCleanup(p.stop) get_tmp_dir_mock = mock.patch( vm_util.__name__ + '.GetTempDir', return_value='TempDir') get_tmp_dir_mock.start() self.addCleanup(get_tmp_dir_mock.stop) def testVmWithMachineTypeNonPreemptible(self): spec = gce_virtual_machine.GceVmSpec( _COMPONENT, machine_type='test_machine_type', project='p') vm = pkb_common_test_case.TestGceVirtualMachine(spec) vm.created = True self.assertDictContainsSubset( {'dedicated_host': False, 'machine_type': 'test_machine_type', 'project': 'p'}, vm.GetResourceMetadata() ) def testVmWithMachineTypePreemptible(self): spec = gce_virtual_machine.GceVmSpec( _COMPONENT, machine_type='test_machine_type', preemptible=True, project='p') vm = pkb_common_test_case.TestGceVirtualMachine(spec) vm.created = True self.assertDictContainsSubset( {'dedicated_host': False, 'machine_type': 'test_machine_type', 'preemptible': True, 'project': 'p'}, vm.GetResourceMetadata() ) def testCustomVmNonPreemptible(self): spec = gce_virtual_machine.GceVmSpec(_COMPONENT, machine_type={ 'cpus': 1, 'memory': '1.0GiB'}, project='p') vm = pkb_common_test_case.TestGceVirtualMachine(spec) vm.created = True self.assertDictContainsSubset( {'cpus': 1, 'memory_mib': 1024, 'project': 'p', 'dedicated_host': False}, vm.GetResourceMetadata()) def testCustomVmPreemptible(self): spec = gce_virtual_machine.GceVmSpec( _COMPONENT, machine_type={'cpus': 1, 'memory': '1.0GiB'}, preemptible=True, project='fakeproject') vm = pkb_common_test_case.TestGceVirtualMachine(spec) vm.created = True self.assertDictContainsSubset({ 'cpus': 1, 'memory_mib': 1024, 'project': 'fakeproject', 'dedicated_host': False, 'preemptible': True}, vm.GetResourceMetadata()) def testCustomVmWithGpus(self): spec = gce_virtual_machine.GceVmSpec( _COMPONENT, machine_type={'cpus': 1, 'memory': '1.0GiB'}, gpu_count=2, gpu_type='k80', project='fakeproject') vm = pkb_common_test_case.TestGceVirtualMachine(spec) vm.created = True self.assertDictContainsSubset({ 'cpus': 1, 'memory_mib': 1024, 'project': 'fakeproject', 'dedicated_host': False, 'gpu_count': 2, 'gpu_type': 'k80' }, vm.GetResourceMetadata()) def _CreateFakeDiskMetadata(image): fake_disk = copy.copy(_FAKE_DISK_METADATA) fake_disk['sourceImage'] = image return fake_disk class GceVirtualMachineOsTypesTestCase(pkb_common_test_case.PkbCommonTestCase): def setUp(self): super(GceVirtualMachineOsTypesTestCase, self).setUp() FLAGS.gcp_instance_metadata_from_file = '' FLAGS.gcp_instance_metadata = '' FLAGS.gcloud_path = 'gcloud' p = mock.patch(gce_virtual_machine.__name__ + '.gce_network.GceNetwork.GetNetwork') self.mock_get_network = p.start() self.addCleanup(p.stop) p = mock.patch(gce_virtual_machine.__name__ + '.gce_network.GceFirewall.GetFirewall') self.mock_get_firewall = p.start() self.addCleanup(p.stop) self.spec = gce_virtual_machine.GceVmSpec(_COMPONENT, machine_type='fake-machine-type') p = mock.patch(gce_virtual_machine.__name__ + '.linux_vm.BaseLinuxMixin._GetNumCpus') self.mock_get_num_cpus = p.start() self.addCleanup(p.stop) get_tmp_dir_mock = mock.patch( vm_util.__name__ + '.GetTempDir', return_value='TempDir') get_tmp_dir_mock.start() self.addCleanup(get_tmp_dir_mock.stop) def _CreateFakeReturnValues(self, fake_image=''): fake_rets = [('', '', 0), (json.dumps(_FAKE_INSTANCE_METADATA), '', 0)] if fake_image: fake_rets.append((json.dumps(_CreateFakeDiskMetadata(fake_image)), '', 0)) return fake_rets def testCreateUbuntu1604(self): vm_class = virtual_machine.GetVmClass(providers.GCP, os_types.UBUNTU1604) fake_image = 'fake-ubuntu1604' with PatchCriticalObjects( self._CreateFakeReturnValues(fake_image)) as issue_command: vm = vm_class(self.spec) vm._Create() vm.created = True command_string = ' '.join(issue_command.call_args[0][0]) self.assertEqual(issue_command.call_count, 1) self.assertIn('gcloud compute instances create', command_string) self.assertIn( '--image-family ubuntu-1604-lts --image-project ubuntu-os-cloud', command_string) self.assertNotIn('--boot-disk-size', command_string) self.assertNotIn('--boot-disk-type', command_string) vm._PostCreate() self.assertEqual(issue_command.call_count, 3) self.assertDictContainsSubset({'image': fake_image, 'image_family': 'ubuntu-1604-lts', 'image_project': 'ubuntu-os-cloud', 'boot_disk_size': '10', 'boot_disk_type': 'pd-standard'}, vm.GetResourceMetadata()) def testCreateUbuntuInCustomProject(self): vm_class = virtual_machine.GetVmClass(providers.GCP, os_types.UBUNTU1604) fake_image = 'fake-ubuntu1604' fake_image_project = 'fake-project' spec = gce_virtual_machine.GceVmSpec(_COMPONENT, machine_type='fake-machine-type', image=fake_image, image_project=fake_image_project) with PatchCriticalObjects( self._CreateFakeReturnValues(fake_image)) as issue_command: vm = vm_class(spec) vm._Create() vm.created = True command_string = ' '.join(issue_command.call_args[0][0]) self.assertEqual(issue_command.call_count, 1) self.assertIn('gcloud compute instances create', command_string) self.assertIn( '--image fake-ubuntu1604 --image-project fake-project', command_string) self.assertNotIn('--image-family', command_string) vm._PostCreate() self.assertEqual(issue_command.call_count, 3) vm_metadata = vm.GetResourceMetadata() self.assertDictContainsSubset({'image': fake_image, 'image_project': 'fake-project'}, vm_metadata) self.assertNotIn('image_family', vm_metadata) def testCreateUbuntuInCustomDisk(self): vm_class = virtual_machine.GetVmClass(providers.GCP, os_types.UBUNTU1604) fake_image = 'fake-ubuntu1604' fake_image_project = 'fake-project' spec = gce_virtual_machine.GceVmSpec(_COMPONENT, machine_type='fake-machine-type', image=fake_image, image_project=fake_image_project, boot_disk_size=20, boot_disk_type='fake-disk-type') with PatchCriticalObjects( self._CreateFakeReturnValues(fake_image)) as issue_command: vm = vm_class(spec) vm._Create() vm.created = True command_string = ' '.join(issue_command.call_args[0][0]) self.assertEqual(issue_command.call_count, 1) self.assertIn('gcloud compute instances create', command_string) self.assertIn('--boot-disk-size 20', command_string) self.assertIn('--boot-disk-type fake-disk-type', command_string) vm._PostCreate() self.assertEqual(issue_command.call_count, 2) vm_metadata = vm.GetResourceMetadata() self.assertDictContainsSubset({'image': fake_image, 'image_project': 'fake-project', 'boot_disk_size': 20, 'boot_disk_type': 'fake-disk-type'}, vm_metadata) self.assertNotIn('image_family', vm_metadata) def testCreateUbuntu1804(self): vm_class = virtual_machine.GetVmClass(providers.GCP, os_types.UBUNTU1804) fake_image = 'fake-ubuntu1804' with PatchCriticalObjects( self._CreateFakeReturnValues(fake_image)) as issue_command: vm = vm_class(self.spec) vm._Create() vm.created = True command_string = ' '.join(issue_command.call_args[0][0]) self.assertEqual(issue_command.call_count, 1) self.assertIn('gcloud compute instances create', command_string) self.assertIn( '--image-family ubuntu-1804-lts --image-project ubuntu-os-cloud', command_string) vm._PostCreate() self.assertEqual(issue_command.call_count, 3) self.assertDictContainsSubset({'image': fake_image, 'image_family': 'ubuntu-1804-lts', 'image_project': 'ubuntu-os-cloud'}, vm.GetResourceMetadata()) def testCreateRhel7CustomImage(self): vm_class = virtual_machine.GetVmClass(providers.GCP, os_types.RHEL7) fake_image = 'fake-custom-rhel-image' spec = gce_virtual_machine.GceVmSpec(_COMPONENT, machine_type='fake-machine-type', image=fake_image) with PatchCriticalObjects( self._CreateFakeReturnValues(fake_image)) as issue_command: vm = vm_class(spec) vm._Create() vm.created = True command_string = ' '.join(issue_command.call_args[0][0]) self.assertEqual(issue_command.call_count, 1) self.assertIn('gcloud compute instances create', command_string) self.assertIn('--image ' + fake_image, command_string) self.assertIn('--image-project rhel-cloud', command_string) vm._PostCreate() self.assertEqual(issue_command.call_count, 3) vm_metadata = vm.GetResourceMetadata() self.assertDictContainsSubset({'image': fake_image, 'image_project': 'rhel-cloud'}, vm_metadata) self.assertNotIn('image_family', vm_metadata) def testCreateCentOs7CustomImage(self): vm_class = virtual_machine.GetVmClass(providers.GCP, os_types.CENTOS7) fake_image = 'fake-custom-centos7-image' spec = gce_virtual_machine.GceVmSpec(_COMPONENT, machine_type='fake-machine-type', image=fake_image) with PatchCriticalObjects( self._CreateFakeReturnValues(fake_image)) as issue_command: vm = vm_class(spec) vm._Create() vm.created = True command_string = ' '.join(issue_command.call_args[0][0]) self.assertEqual(issue_command.call_count, 1) self.assertIn('gcloud compute instances create', command_string) self.assertIn('--image ' + fake_image, command_string) self.assertIn('--image-project centos-cloud', command_string) vm._PostCreate() self.assertEqual(issue_command.call_count, 3) vm_metadata = vm.GetResourceMetadata() self.assertDictContainsSubset({'image': fake_image, 'image_project': 'centos-cloud'}, vm_metadata) self.assertNotIn('image_family', vm_metadata) class GCEVMFlagsTestCase(pkb_common_test_case.PkbCommonTestCase): def setUp(self): super(GCEVMFlagsTestCase, self).setUp() FLAGS.cloud = providers.GCP FLAGS.gcloud_path = 'test_gcloud' FLAGS.run_uri = 'aaaaaa' FLAGS.gcp_instance_metadata = [] FLAGS.gcp_instance_metadata_from_file = [] self.addCleanup(context.SetThreadBenchmarkSpec, None) config_spec = benchmark_config_spec.BenchmarkConfigSpec( _BENCHMARK_NAME, flag_values=FLAGS, vm_groups={}) self._benchmark_spec = benchmark_spec.BenchmarkSpec( mock.MagicMock(), config_spec, _BENCHMARK_UID) get_tmp_dir_mock = mock.patch( vm_util.__name__ + '.GetTempDir', return_value='TempDir') get_tmp_dir_mock.start() self.addCleanup(get_tmp_dir_mock.stop) def _CreateVmCommand(self, **flag_kwargs): with PatchCriticalObjects() as issue_command: for key, value in flag_kwargs.items(): FLAGS[key].parse(value) vm_spec = gce_virtual_machine.GceVmSpec( 'test_vm_spec.GCP', FLAGS, image='image', machine_type='test_machine_type') vm = pkb_common_test_case.TestGceVirtualMachine(vm_spec) vm._Create() return ' '.join(issue_command.call_args[0][0]), issue_command.call_count def testPreemptibleVMFlag(self): cmd, call_count = self._CreateVmCommand(gce_preemptible_vms=True) self.assertEqual(call_count, 1) self.assertIn('--preemptible', cmd) def testMigrateOnMaintenanceFlagTrueWithGpus(self): with self.assertRaises(errors.Config.InvalidValue) as cm: self._CreateVmCommand( gce_migrate_on_maintenance=True, gpu_count=1, gpu_type='k80') self.assertEqual(str(cm.exception), ( 'Cannot set flag gce_migrate_on_maintenance on ' 'instances with GPUs, as it is not supported by GCP.')) def testMigrateOnMaintenanceFlagFalseWithGpus(self): _, call_count = self._CreateVmCommand( gce_migrate_on_maintenance=False, gpu_count=1, gpu_type='k80') self.assertEqual(call_count, 1) def testAcceleratorTypeOverrideFlag(self): cmd, call_count = self._CreateVmCommand( gce_accelerator_type_override='fake_type', gpu_count=1, gpu_type='k80') self.assertEqual(call_count, 1) self.assertIn('--accelerator', cmd) self.assertIn('type=fake_type,count=1', cmd) def testImageProjectFlag(self): cmd, call_count = self._CreateVmCommand(image_project='bar') self.assertEqual(call_count, 1) self.assertIn('--image-project bar', cmd) def testNetworkTierFlagPremium(self): cmd, call_count = self._CreateVmCommand(gce_network_tier='premium') self.assertEqual(call_count, 1) self.assertIn('--network-tier PREMIUM', cmd) def testNetworkTierFlagStandard(self): cmd, call_count = self._CreateVmCommand(gce_network_tier='standard') self.assertEqual(call_count, 1) self.assertIn('--network-tier STANDARD', cmd) def testGcpInstanceMetadataFlag(self): cmd, call_count = self._CreateVmCommand( gcp_instance_metadata=['k1:v1', 'k2:v2,k3:v3'], owner='test-owner') self.assertEqual(call_count, 1) actual_metadata = re.compile( r'--metadata\s+(.*)(\s+--)?').search(cmd).group(1) self.assertIn('k1=v1', actual_metadata) self.assertIn('k2=v2', actual_metadata) self.assertIn('k3=v3', actual_metadata) # Assert that FLAGS.owner is honored and added to instance metadata. self.assertIn('owner=test-owner', actual_metadata) def testGcpInstanceMetadataFromFileFlag(self): cmd, call_count = self._CreateVmCommand( gcp_instance_metadata_from_file=['k1:p1', 'k2:p2,k3:p3']) self.assertEqual(call_count, 1) actual_metadata_from_file = re.compile( r'--metadata-from-file\s+(.*)(\s+--)?').search(cmd).group(1) self.assertIn('k1=p1', actual_metadata_from_file) self.assertIn('k2=p2', actual_metadata_from_file) self.assertIn('k3=p3', actual_metadata_from_file) def testGceTags(self): self.assertIn('--tags perfkitbenchmarker', self._CreateVmCommand()[0]) self.assertIn('--tags perfkitbenchmarker,testtag', self._CreateVmCommand(gce_tags=['testtag'])[0]) def testShieldedSecureBootFlag(self): cmd, call_count = self._CreateVmCommand( gce_shielded_secure_boot=True) self.assertEqual(call_count, 1) self.assertIn('--shielded-secure-boot', cmd) class GCEVMCreateTestCase(pkb_common_test_case.PkbCommonTestCase): def setUp(self): super(GCEVMCreateTestCase, self).setUp() p = mock.patch(gce_virtual_machine.__name__ + '.gce_network.GceNetwork.GetNetwork') self.mock_get_network = p.start() self.addCleanup(p.stop) p = mock.patch(gce_virtual_machine.__name__ + '.gce_network.GceFirewall.GetFirewall') self.mock_get_firewall = p.start() self.addCleanup(p.stop) get_tmp_dir_mock = mock.patch( vm_util.__name__ + '.GetTempDir', return_value='TempDir') get_tmp_dir_mock.start() self.addCleanup(get_tmp_dir_mock.stop) @mock.patch('time.sleep', side_effect=lambda _: None) def testCreateRateLimitedMachineCreated(self, mock_cmd): fake_rets = [('stdout', 'Rate Limit Exceeded', 1), ('stdout', 'Rate Limit Exceeded', 1), ('stdout', 'Rate Limit Exceeded', 1), ('stdout', 'Rate Limit Exceeded', 1), ('stdout', 'The resource already exists', 1)] with PatchCriticalObjects(fake_rets) as issue_command: spec = gce_virtual_machine.GceVmSpec( _COMPONENT, machine_type={ 'cpus': 1, 'memory': '1.0GiB', }) vm = pkb_common_test_case.TestGceVirtualMachine(spec) vm._Create() # No error should be thrown. self.assertEqual(issue_command.call_count, 5) @mock.patch('time.sleep', side_effect=lambda _: None) def testCreateRateLimitedMachineCreatedFailure(self, mock_cmd): fake_rets = [] for _ in range(0, 100): fake_rets.append(('stdout', 'Rate Limit Exceeded', 1)) with PatchCriticalObjects(fake_rets) as issue_command: spec = gce_virtual_machine.GceVmSpec( _COMPONENT, machine_type={ 'cpus': 1, 'memory': '1.0GiB', }) vm = pkb_common_test_case.TestGceVirtualMachine(spec) with self.assertRaises( errors.Benchmarks.QuotaFailure.RateLimitExceededError): vm._Create() self.assertEqual(issue_command.call_count, util.RATE_LIMITED_MAX_RETRIES + 1) def testCreateVMAlreadyExists(self): fake_rets = [('stdout', 'The resource already exists', 1)] with PatchCriticalObjects(fake_rets): spec = gce_virtual_machine.GceVmSpec( _COMPONENT, machine_type={ 'cpus': 1, 'memory': '1.0GiB', }) vm = pkb_common_test_case.TestGceVirtualMachine(spec) with self.assertRaises(errors.Resource.CreationError): vm._Create() def testVmWithoutGpu(self): with PatchCriticalObjects() as issue_command: spec = gce_virtual_machine.GceVmSpec( _COMPONENT, machine_type={ 'cpus': 1, 'memory': '1.0GiB', }) vm = pkb_common_test_case.TestGceVirtualMachine(spec) vm._Create() self.assertEqual(issue_command.call_count, 1) self.assertNotIn('--accelerator', issue_command.call_args[0][0]) def testVmWithGpu(self): with PatchCriticalObjects() as issue_command: spec = gce_virtual_machine.GceVmSpec( _COMPONENT, machine_type='n1-standard-8', gpu_count=2, gpu_type='k80') vm = pkb_common_test_case.TestGceVirtualMachine(spec) vm._Create() self.assertEqual(issue_command.call_count, 1) self.assertIn('--accelerator', issue_command.call_args[0][0]) self.assertIn('type=nvidia-tesla-k80,count=2', issue_command.call_args[0][0]) self.assertIn('--maintenance-policy', issue_command.call_args[0][0]) self.assertIn('TERMINATE', issue_command.call_args[0][0]) class GceFirewallRuleTest(pkb_common_test_case.PkbCommonTestCase): @mock.patch('time.sleep', side_effect=lambda _: None) def testGceFirewallRuleSuccessfulAfterRateLimited(self, mock_cmd): fake_rets = [('stdout', 'Rate Limit Exceeded', 1), ('stdout', 'some warning perhaps', 0)] with PatchCriticalObjects(fake_rets) as issue_command: fr = gce_network.GceFirewallRule('name', 'project', 'allow', 'network_name') fr._Create() self.assertEqual(issue_command.call_count, 2) @mock.patch('time.sleep', side_effect=lambda _: None) def testGceFirewallRuleGenericErrorAfterRateLimited(self, mock_cmd): fake_rets = [('stdout', 'Rate Limit Exceeded', 1), ('stdout', 'Rate Limit Exceeded', 1), ('stdout', 'some random firewall error', 1)] with PatchCriticalObjects(fake_rets) as issue_command: with self.assertRaises(errors.VmUtil.IssueCommandError): fr = gce_network.GceFirewallRule('name', 'project', 'allow', 'network_name') fr._Create() self.assertEqual(issue_command.call_count, 3) @mock.patch('time.sleep', side_effect=lambda _: None) def testGceFirewallRuleAlreadyExistsAfterRateLimited(self, mock_cmd): fake_rets = [('stdout', 'Rate Limit Exceeded', 1), ('stdout', 'Rate Limit Exceeded', 1), ('stdout', 'firewall already exists', 1)] with PatchCriticalObjects(fake_rets) as issue_command: fr = gce_network.GceFirewallRule('name', 'project', 'allow', 'network_name') fr._Create() self.assertEqual(issue_command.call_count, 3) @mock.patch('time.sleep', side_effect=lambda _: None) def testGceFirewallRuleGenericError(self, mock_cmd): fake_rets = [('stdout', 'some random firewall error', 1)] with PatchCriticalObjects(fake_rets) as issue_command: with self.assertRaises(errors.VmUtil.IssueCommandError): fr = gce_network.GceFirewallRule('name', 'project', 'allow', 'network_name') fr._Create() self.assertEqual(issue_command.call_count, 1) class GceNetworkTest(pkb_common_test_case.PkbCommonTestCase): def setUp(self): super(GceNetworkTest, self).setUp() # need a benchmarkspec in the context to run config_spec = benchmark_config_spec.BenchmarkConfigSpec( 'cluster_boot', flag_values=FLAGS) benchmark_spec.BenchmarkSpec(mock.Mock(), config_spec, 'uid') def testGetNetwork(self): project = 'myproject' zone = 'us-east1-a' vm = mock.Mock(zone=zone, project=project, cidr=None) net = gce_network.GceNetwork.GetNetwork(vm) self.assertEqual(project, net.project) self.assertEqual(zone, net.zone) if __name__ == '__main__': unittest.main()
true
true
f72b8e84fb1e9a3b3bd3404c7c3d64a53cc6b63f
4,233
py
Python
Chapter 05/enc_dec/model.py
bpbpublications/Time-Series-Forecasting-using-Deep-Learning
fd84553d33e912edb4a1400af0f9374e72747457
[ "MIT" ]
7
2021-12-13T20:00:05.000Z
2022-03-11T08:44:43.000Z
Chapter 05/enc_dec/model.py
bpbpublications/Time-Series-Forecasting-using-Deep-Learning
fd84553d33e912edb4a1400af0f9374e72747457
[ "MIT" ]
1
2022-02-22T10:39:12.000Z
2022-02-22T10:39:12.000Z
Chapter 05/enc_dec/model.py
bpbpublications/Time-Series-Forecasting-using-Deep-Learning
fd84553d33e912edb4a1400af0f9374e72747457
[ "MIT" ]
null
null
null
import numpy as np import random import torch import torch.nn as nn from torch import optim class Encoder(nn.Module): def __init__(self, input_size, hidden_size, num_layers = 1): super(Encoder, self).__init__() self.input_size = input_size self.hidden_size = hidden_size self.num_layers = num_layers self.lstm = nn.LSTM(input_size = input_size, hidden_size = hidden_size, num_layers = num_layers) def forward(self, x): flat = x.view(x.shape[0], x.shape[1], self.input_size) out, h = self.lstm(flat) return out, h class Decoder(nn.Module): def __init__(self, input_size, hidden_size, output_size = 1, num_layers = 1): super(Decoder, self).__init__() self.input_size = input_size self.hidden_size = hidden_size self.num_layers = num_layers self.output_size = output_size self.lstm = nn.LSTM(input_size = input_size, hidden_size = hidden_size, num_layers = num_layers) self.linear = nn.Linear(hidden_size, output_size) def forward(self, x, h): out, h = self.lstm(x.unsqueeze(0), h) y = self.linear(out.squeeze(0)) return y, h class EncoderDecoder(nn.Module): def __init__(self, hidden_size, input_size = 1, output_size = 1): super(EncoderDecoder, self).__init__() self.input_size = input_size self.hidden_size = hidden_size self.encoder = Encoder(input_size = input_size, hidden_size = hidden_size) self.decoder = Decoder(input_size = input_size, hidden_size = hidden_size, output_size = output_size) def train_model( self, train, target, epochs, target_len, method = 'recursive', tfr = 0.5, lr = 0.01, dynamic_tf = False ): losses = np.full(epochs, np.nan) optimizer = optim.Adam(self.parameters(), lr = lr) criterion = nn.MSELoss() for e in range(epochs): predicted = torch.zeros(target_len, train.shape[1], train.shape[2]) optimizer.zero_grad() _, enc_h = self.encoder(train) dec_in = train[-1, :, :] dec_h = enc_h if method == 'recursive': for t in range(target_len): dec_out, dec_h = self.decoder(dec_in, dec_h) predicted[t] = dec_out dec_in = dec_out if method == 'teacher_forcing': # use teacher forcing if random.random() < tfr: for t in range(target_len): dec_out, dec_h = self.decoder(dec_in, dec_h) predicted[t] = dec_out dec_in = target[t, :, :] # predict recursively else: for t in range(target_len): dec_out, dec_h = self.decoder(dec_in, dec_h) predicted[t] = dec_out dec_in = dec_out if method == 'mixed_teacher_forcing': # predict using mixed teacher forcing for t in range(target_len): dec_out, dec_h = self.decoder(dec_in, dec_h) predicted[t] = dec_out # predict with teacher forcing if random.random() < tfr: dec_in = target[t, :, :] # predict recursively else: dec_in = dec_out loss = criterion(predicted, target) loss.backward() optimizer.step() losses[e] = loss.item() if e % 10 == 0: print(f'Epoch {e}/{epochs}: {round(loss.item(), 4)}') # dynamic teacher forcing if dynamic_tf and tfr > 0: tfr = tfr - 0.02 return losses def predict(self, x, target_len): y = torch.zeros(target_len, x.shape[1], x.shape[2]) _, enc_h = self.encoder(x) dec_in = x[-1, :, :] dec_h = enc_h for t in range(target_len): dec_out, dec_h = self.decoder(dec_in, dec_h) y[t] = dec_out dec_in = dec_out return y
33.070313
109
0.541932
import numpy as np import random import torch import torch.nn as nn from torch import optim class Encoder(nn.Module): def __init__(self, input_size, hidden_size, num_layers = 1): super(Encoder, self).__init__() self.input_size = input_size self.hidden_size = hidden_size self.num_layers = num_layers self.lstm = nn.LSTM(input_size = input_size, hidden_size = hidden_size, num_layers = num_layers) def forward(self, x): flat = x.view(x.shape[0], x.shape[1], self.input_size) out, h = self.lstm(flat) return out, h class Decoder(nn.Module): def __init__(self, input_size, hidden_size, output_size = 1, num_layers = 1): super(Decoder, self).__init__() self.input_size = input_size self.hidden_size = hidden_size self.num_layers = num_layers self.output_size = output_size self.lstm = nn.LSTM(input_size = input_size, hidden_size = hidden_size, num_layers = num_layers) self.linear = nn.Linear(hidden_size, output_size) def forward(self, x, h): out, h = self.lstm(x.unsqueeze(0), h) y = self.linear(out.squeeze(0)) return y, h class EncoderDecoder(nn.Module): def __init__(self, hidden_size, input_size = 1, output_size = 1): super(EncoderDecoder, self).__init__() self.input_size = input_size self.hidden_size = hidden_size self.encoder = Encoder(input_size = input_size, hidden_size = hidden_size) self.decoder = Decoder(input_size = input_size, hidden_size = hidden_size, output_size = output_size) def train_model( self, train, target, epochs, target_len, method = 'recursive', tfr = 0.5, lr = 0.01, dynamic_tf = False ): losses = np.full(epochs, np.nan) optimizer = optim.Adam(self.parameters(), lr = lr) criterion = nn.MSELoss() for e in range(epochs): predicted = torch.zeros(target_len, train.shape[1], train.shape[2]) optimizer.zero_grad() _, enc_h = self.encoder(train) dec_in = train[-1, :, :] dec_h = enc_h if method == 'recursive': for t in range(target_len): dec_out, dec_h = self.decoder(dec_in, dec_h) predicted[t] = dec_out dec_in = dec_out if method == 'teacher_forcing': if random.random() < tfr: for t in range(target_len): dec_out, dec_h = self.decoder(dec_in, dec_h) predicted[t] = dec_out dec_in = target[t, :, :] else: for t in range(target_len): dec_out, dec_h = self.decoder(dec_in, dec_h) predicted[t] = dec_out dec_in = dec_out if method == 'mixed_teacher_forcing': for t in range(target_len): dec_out, dec_h = self.decoder(dec_in, dec_h) predicted[t] = dec_out if random.random() < tfr: dec_in = target[t, :, :] else: dec_in = dec_out loss = criterion(predicted, target) loss.backward() optimizer.step() losses[e] = loss.item() if e % 10 == 0: print(f'Epoch {e}/{epochs}: {round(loss.item(), 4)}') if dynamic_tf and tfr > 0: tfr = tfr - 0.02 return losses def predict(self, x, target_len): y = torch.zeros(target_len, x.shape[1], x.shape[2]) _, enc_h = self.encoder(x) dec_in = x[-1, :, :] dec_h = enc_h for t in range(target_len): dec_out, dec_h = self.decoder(dec_in, dec_h) y[t] = dec_out dec_in = dec_out return y
true
true
f72b917ba1bfdb505c6c57281ee679daa562ced3
4,564
py
Python
galaxy/tools/deps/__init__.py
jmchilton/pulsar
783b90cf0bce893a11c347fcaf6778b98e0bb062
[ "Apache-2.0" ]
null
null
null
galaxy/tools/deps/__init__.py
jmchilton/pulsar
783b90cf0bce893a11c347fcaf6778b98e0bb062
[ "Apache-2.0" ]
1
2015-02-21T18:48:19.000Z
2015-02-27T15:50:32.000Z
galaxy/tools/deps/__init__.py
jmchilton/pulsar
783b90cf0bce893a11c347fcaf6778b98e0bb062
[ "Apache-2.0" ]
3
2015-02-22T13:34:16.000Z
2020-10-01T01:28:04.000Z
""" Dependency management for tools. """ import os.path import logging log = logging.getLogger( __name__ ) from .resolvers import INDETERMINATE_DEPENDENCY from .resolvers.galaxy_packages import GalaxyPackageDependencyResolver from .resolvers.tool_shed_packages import ToolShedPackageDependencyResolver from galaxy.util import plugin_config def build_dependency_manager( config ): if getattr( config, "use_tool_dependencies", False ): dependency_manager_kwds = { 'default_base_path': config.tool_dependency_dir, 'conf_file': config.dependency_resolvers_config_file, } dependency_manager = DependencyManager( **dependency_manager_kwds ) else: dependency_manager = NullDependencyManager() return dependency_manager class NullDependencyManager( object ): def uses_tool_shed_dependencies(self): return False def dependency_shell_commands( self, requirements, **kwds ): return [] def find_dep( self, name, version=None, type='package', **kwds ): return INDETERMINATE_DEPENDENCY class DependencyManager( object ): """ A DependencyManager attempts to resolve named and versioned dependencies by searching for them under a list of directories. Directories should be of the form: $BASE/name/version/... and should each contain a file 'env.sh' which can be sourced to make the dependency available in the current shell environment. """ def __init__( self, default_base_path, conf_file=None ): """ Create a new dependency manager looking for packages under the paths listed in `base_paths`. The default base path is app.config.tool_dependency_dir. """ if not os.path.exists( default_base_path ): log.warn( "Path '%s' does not exist, ignoring", default_base_path ) if not os.path.isdir( default_base_path ): log.warn( "Path '%s' is not directory, ignoring", default_base_path ) self.default_base_path = os.path.abspath( default_base_path ) self.resolver_classes = self.__resolvers_dict() self.dependency_resolvers = self.__build_dependency_resolvers( conf_file ) def dependency_shell_commands( self, requirements, **kwds ): commands = [] for requirement in requirements: log.debug( "Building dependency shell command for dependency '%s'", requirement.name ) dependency = INDETERMINATE_DEPENDENCY if requirement.type in [ 'package', 'set_environment' ]: dependency = self.find_dep( name=requirement.name, version=requirement.version, type=requirement.type, **kwds ) dependency_commands = dependency.shell_commands( requirement ) if not dependency_commands: log.warn( "Failed to resolve dependency on '%s', ignoring", requirement.name ) else: commands.append( dependency_commands ) return commands def uses_tool_shed_dependencies(self): return any( map( lambda r: isinstance( r, ToolShedPackageDependencyResolver ), self.dependency_resolvers ) ) def find_dep( self, name, version=None, type='package', **kwds ): for resolver in self.dependency_resolvers: dependency = resolver.resolve( name, version, type, **kwds ) if dependency != INDETERMINATE_DEPENDENCY: return dependency return INDETERMINATE_DEPENDENCY def __build_dependency_resolvers( self, conf_file ): if not conf_file or not os.path.exists( conf_file ): return self.__default_dependency_resolvers() plugin_source = plugin_config.plugin_source_from_path( conf_file ) return self.__parse_resolver_conf_xml( plugin_source ) def __default_dependency_resolvers( self ): return [ ToolShedPackageDependencyResolver(self), GalaxyPackageDependencyResolver(self), GalaxyPackageDependencyResolver(self, versionless=True), ] def __parse_resolver_conf_xml(self, plugin_source): """ """ extra_kwds = dict( dependency_manager=self ) return plugin_config.load_plugins( self.resolver_classes, plugin_source, extra_kwds ) def __resolvers_dict( self ): import galaxy.tools.deps.resolvers return plugin_config.plugins_dict( galaxy.tools.deps.resolvers, 'resolver_type' )
40.035088
116
0.675066
import os.path import logging log = logging.getLogger( __name__ ) from .resolvers import INDETERMINATE_DEPENDENCY from .resolvers.galaxy_packages import GalaxyPackageDependencyResolver from .resolvers.tool_shed_packages import ToolShedPackageDependencyResolver from galaxy.util import plugin_config def build_dependency_manager( config ): if getattr( config, "use_tool_dependencies", False ): dependency_manager_kwds = { 'default_base_path': config.tool_dependency_dir, 'conf_file': config.dependency_resolvers_config_file, } dependency_manager = DependencyManager( **dependency_manager_kwds ) else: dependency_manager = NullDependencyManager() return dependency_manager class NullDependencyManager( object ): def uses_tool_shed_dependencies(self): return False def dependency_shell_commands( self, requirements, **kwds ): return [] def find_dep( self, name, version=None, type='package', **kwds ): return INDETERMINATE_DEPENDENCY class DependencyManager( object ): def __init__( self, default_base_path, conf_file=None ): if not os.path.exists( default_base_path ): log.warn( "Path '%s' does not exist, ignoring", default_base_path ) if not os.path.isdir( default_base_path ): log.warn( "Path '%s' is not directory, ignoring", default_base_path ) self.default_base_path = os.path.abspath( default_base_path ) self.resolver_classes = self.__resolvers_dict() self.dependency_resolvers = self.__build_dependency_resolvers( conf_file ) def dependency_shell_commands( self, requirements, **kwds ): commands = [] for requirement in requirements: log.debug( "Building dependency shell command for dependency '%s'", requirement.name ) dependency = INDETERMINATE_DEPENDENCY if requirement.type in [ 'package', 'set_environment' ]: dependency = self.find_dep( name=requirement.name, version=requirement.version, type=requirement.type, **kwds ) dependency_commands = dependency.shell_commands( requirement ) if not dependency_commands: log.warn( "Failed to resolve dependency on '%s', ignoring", requirement.name ) else: commands.append( dependency_commands ) return commands def uses_tool_shed_dependencies(self): return any( map( lambda r: isinstance( r, ToolShedPackageDependencyResolver ), self.dependency_resolvers ) ) def find_dep( self, name, version=None, type='package', **kwds ): for resolver in self.dependency_resolvers: dependency = resolver.resolve( name, version, type, **kwds ) if dependency != INDETERMINATE_DEPENDENCY: return dependency return INDETERMINATE_DEPENDENCY def __build_dependency_resolvers( self, conf_file ): if not conf_file or not os.path.exists( conf_file ): return self.__default_dependency_resolvers() plugin_source = plugin_config.plugin_source_from_path( conf_file ) return self.__parse_resolver_conf_xml( plugin_source ) def __default_dependency_resolvers( self ): return [ ToolShedPackageDependencyResolver(self), GalaxyPackageDependencyResolver(self), GalaxyPackageDependencyResolver(self, versionless=True), ] def __parse_resolver_conf_xml(self, plugin_source): extra_kwds = dict( dependency_manager=self ) return plugin_config.load_plugins( self.resolver_classes, plugin_source, extra_kwds ) def __resolvers_dict( self ): import galaxy.tools.deps.resolvers return plugin_config.plugins_dict( galaxy.tools.deps.resolvers, 'resolver_type' )
true
true
f72b91de3aa8e38ef7f1435603855433b8cce9c5
6,254
py
Python
python/fate_arch/protobuf/python/model_service_pb2_grpc.py
hubert-he/FATE
6758e150bd7ca7d6f788f9a7a8c8aea7e6500363
[ "Apache-2.0" ]
3,787
2019-08-30T04:55:10.000Z
2022-03-31T23:30:07.000Z
python/fate_arch/protobuf/python/model_service_pb2_grpc.py
JavaGreenHands/FATE
ea1e94b6be50c70c354d1861093187e523af32f2
[ "Apache-2.0" ]
1,439
2019-08-29T16:35:52.000Z
2022-03-31T11:55:31.000Z
python/fate_arch/protobuf/python/model_service_pb2_grpc.py
JavaGreenHands/FATE
ea1e94b6be50c70c354d1861093187e523af32f2
[ "Apache-2.0" ]
1,179
2019-08-29T16:18:32.000Z
2022-03-31T12:55:38.000Z
# # Copyright 2019 The FATE Authors. All Rights Reserved. # # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. # # Generated by the gRPC Python protocol compiler plugin. DO NOT EDIT! import grpc import model_service_pb2 as model__service__pb2 class ModelServiceStub(object): # missing associated documentation comment in .proto file pass def __init__(self, channel): """Constructor. Args: channel: A grpc.Channel. """ self.publishLoad = channel.unary_unary( '/com.webank.ai.fate.api.mlmodel.manager.ModelService/publishLoad', request_serializer=model__service__pb2.PublishRequest.SerializeToString, response_deserializer=model__service__pb2.PublishResponse.FromString, ) self.publishBind = channel.unary_unary( '/com.webank.ai.fate.api.mlmodel.manager.ModelService/publishBind', request_serializer=model__service__pb2.PublishRequest.SerializeToString, response_deserializer=model__service__pb2.PublishResponse.FromString, ) self.publishOnline = channel.unary_unary( '/com.webank.ai.fate.api.mlmodel.manager.ModelService/publishOnline', request_serializer=model__service__pb2.PublishRequest.SerializeToString, response_deserializer=model__service__pb2.PublishResponse.FromString, ) self.queryModel = channel.unary_unary( '/com.webank.ai.fate.api.mlmodel.manager.ModelService/queryModel', request_serializer=model__service__pb2.QueryModelRequest.SerializeToString, response_deserializer=model__service__pb2.QueryModelResponse.FromString, ) self.unload = channel.unary_unary( '/com.webank.ai.fate.api.mlmodel.manager.ModelService/unload', request_serializer=model__service__pb2.UnloadRequest.SerializeToString, response_deserializer=model__service__pb2.UnloadResponse.FromString, ) self.unbind = channel.unary_unary( '/com.webank.ai.fate.api.mlmodel.manager.ModelService/unbind', request_serializer=model__service__pb2.UnbindRequest.SerializeToString, response_deserializer=model__service__pb2.UnbindResponse.FromString, ) class ModelServiceServicer(object): # missing associated documentation comment in .proto file pass def publishLoad(self, request, context): # missing associated documentation comment in .proto file pass context.set_code(grpc.StatusCode.UNIMPLEMENTED) context.set_details('Method not implemented!') raise NotImplementedError('Method not implemented!') def publishBind(self, request, context): # missing associated documentation comment in .proto file pass context.set_code(grpc.StatusCode.UNIMPLEMENTED) context.set_details('Method not implemented!') raise NotImplementedError('Method not implemented!') def publishOnline(self, request, context): # missing associated documentation comment in .proto file pass context.set_code(grpc.StatusCode.UNIMPLEMENTED) context.set_details('Method not implemented!') raise NotImplementedError('Method not implemented!') def queryModel(self, request, context): # missing associated documentation comment in .proto file pass context.set_code(grpc.StatusCode.UNIMPLEMENTED) context.set_details('Method not implemented!') raise NotImplementedError('Method not implemented!') def unload(self, request, context): # missing associated documentation comment in .proto file pass context.set_code(grpc.StatusCode.UNIMPLEMENTED) context.set_details('Method not implemented!') raise NotImplementedError('Method not implemented!') def unbind(self, request, context): # missing associated documentation comment in .proto file pass context.set_code(grpc.StatusCode.UNIMPLEMENTED) context.set_details('Method not implemented!') raise NotImplementedError('Method not implemented!') def add_ModelServiceServicer_to_server(servicer, server): rpc_method_handlers = { 'publishLoad': grpc.unary_unary_rpc_method_handler( servicer.publishLoad, request_deserializer=model__service__pb2.PublishRequest.FromString, response_serializer=model__service__pb2.PublishResponse.SerializeToString, ), 'publishBind': grpc.unary_unary_rpc_method_handler( servicer.publishBind, request_deserializer=model__service__pb2.PublishRequest.FromString, response_serializer=model__service__pb2.PublishResponse.SerializeToString, ), 'publishOnline': grpc.unary_unary_rpc_method_handler( servicer.publishOnline, request_deserializer=model__service__pb2.PublishRequest.FromString, response_serializer=model__service__pb2.PublishResponse.SerializeToString, ), 'queryModel': grpc.unary_unary_rpc_method_handler( servicer.queryModel, request_deserializer=model__service__pb2.QueryModelRequest.FromString, response_serializer=model__service__pb2.QueryModelResponse.SerializeToString, ), 'unload': grpc.unary_unary_rpc_method_handler( servicer.unload, request_deserializer=model__service__pb2.UnloadRequest.FromString, response_serializer=model__service__pb2.UnloadResponse.SerializeToString, ), 'unbind': grpc.unary_unary_rpc_method_handler( servicer.unbind, request_deserializer=model__service__pb2.UnbindRequest.FromString, response_serializer=model__service__pb2.UnbindResponse.SerializeToString, ), } generic_handler = grpc.method_handlers_generic_handler( 'com.webank.ai.fate.api.mlmodel.manager.ModelService', rpc_method_handlers) server.add_generic_rpc_handlers((generic_handler,))
42.544218
87
0.756316
import grpc import model_service_pb2 as model__service__pb2 class ModelServiceStub(object): pass def __init__(self, channel): self.publishLoad = channel.unary_unary( '/com.webank.ai.fate.api.mlmodel.manager.ModelService/publishLoad', request_serializer=model__service__pb2.PublishRequest.SerializeToString, response_deserializer=model__service__pb2.PublishResponse.FromString, ) self.publishBind = channel.unary_unary( '/com.webank.ai.fate.api.mlmodel.manager.ModelService/publishBind', request_serializer=model__service__pb2.PublishRequest.SerializeToString, response_deserializer=model__service__pb2.PublishResponse.FromString, ) self.publishOnline = channel.unary_unary( '/com.webank.ai.fate.api.mlmodel.manager.ModelService/publishOnline', request_serializer=model__service__pb2.PublishRequest.SerializeToString, response_deserializer=model__service__pb2.PublishResponse.FromString, ) self.queryModel = channel.unary_unary( '/com.webank.ai.fate.api.mlmodel.manager.ModelService/queryModel', request_serializer=model__service__pb2.QueryModelRequest.SerializeToString, response_deserializer=model__service__pb2.QueryModelResponse.FromString, ) self.unload = channel.unary_unary( '/com.webank.ai.fate.api.mlmodel.manager.ModelService/unload', request_serializer=model__service__pb2.UnloadRequest.SerializeToString, response_deserializer=model__service__pb2.UnloadResponse.FromString, ) self.unbind = channel.unary_unary( '/com.webank.ai.fate.api.mlmodel.manager.ModelService/unbind', request_serializer=model__service__pb2.UnbindRequest.SerializeToString, response_deserializer=model__service__pb2.UnbindResponse.FromString, ) class ModelServiceServicer(object): pass def publishLoad(self, request, context): pass context.set_code(grpc.StatusCode.UNIMPLEMENTED) context.set_details('Method not implemented!') raise NotImplementedError('Method not implemented!') def publishBind(self, request, context): pass context.set_code(grpc.StatusCode.UNIMPLEMENTED) context.set_details('Method not implemented!') raise NotImplementedError('Method not implemented!') def publishOnline(self, request, context): pass context.set_code(grpc.StatusCode.UNIMPLEMENTED) context.set_details('Method not implemented!') raise NotImplementedError('Method not implemented!') def queryModel(self, request, context): pass context.set_code(grpc.StatusCode.UNIMPLEMENTED) context.set_details('Method not implemented!') raise NotImplementedError('Method not implemented!') def unload(self, request, context): pass context.set_code(grpc.StatusCode.UNIMPLEMENTED) context.set_details('Method not implemented!') raise NotImplementedError('Method not implemented!') def unbind(self, request, context): pass context.set_code(grpc.StatusCode.UNIMPLEMENTED) context.set_details('Method not implemented!') raise NotImplementedError('Method not implemented!') def add_ModelServiceServicer_to_server(servicer, server): rpc_method_handlers = { 'publishLoad': grpc.unary_unary_rpc_method_handler( servicer.publishLoad, request_deserializer=model__service__pb2.PublishRequest.FromString, response_serializer=model__service__pb2.PublishResponse.SerializeToString, ), 'publishBind': grpc.unary_unary_rpc_method_handler( servicer.publishBind, request_deserializer=model__service__pb2.PublishRequest.FromString, response_serializer=model__service__pb2.PublishResponse.SerializeToString, ), 'publishOnline': grpc.unary_unary_rpc_method_handler( servicer.publishOnline, request_deserializer=model__service__pb2.PublishRequest.FromString, response_serializer=model__service__pb2.PublishResponse.SerializeToString, ), 'queryModel': grpc.unary_unary_rpc_method_handler( servicer.queryModel, request_deserializer=model__service__pb2.QueryModelRequest.FromString, response_serializer=model__service__pb2.QueryModelResponse.SerializeToString, ), 'unload': grpc.unary_unary_rpc_method_handler( servicer.unload, request_deserializer=model__service__pb2.UnloadRequest.FromString, response_serializer=model__service__pb2.UnloadResponse.SerializeToString, ), 'unbind': grpc.unary_unary_rpc_method_handler( servicer.unbind, request_deserializer=model__service__pb2.UnbindRequest.FromString, response_serializer=model__service__pb2.UnbindResponse.SerializeToString, ), } generic_handler = grpc.method_handlers_generic_handler( 'com.webank.ai.fate.api.mlmodel.manager.ModelService', rpc_method_handlers) server.add_generic_rpc_handlers((generic_handler,))
true
true
f72b929b8804ad874d618eb5b43b2fb64fdfe7ad
123
py
Python
app/api/__init__.py
oyasr/mudawen
6f0161ab783536d7c5d695225ef28ce4947a46e3
[ "MIT" ]
null
null
null
app/api/__init__.py
oyasr/mudawen
6f0161ab783536d7c5d695225ef28ce4947a46e3
[ "MIT" ]
null
null
null
app/api/__init__.py
oyasr/mudawen
6f0161ab783536d7c5d695225ef28ce4947a46e3
[ "MIT" ]
null
null
null
from flask import Blueprint api = Blueprint('api', __name__) from . import authentication, comments, errors, posts, users
24.6
60
0.772358
from flask import Blueprint api = Blueprint('api', __name__) from . import authentication, comments, errors, posts, users
true
true
f72b92ac89e1858b89e04e9891a5197b9c3b4cbe
112,673
py
Python
youtube_dl/YoutubeDL.py
hylinktree/youtube-dl
e4cc49f0c0cd9939c4d7992ba54ab0737fdaa9b0
[ "Unlicense" ]
null
null
null
youtube_dl/YoutubeDL.py
hylinktree/youtube-dl
e4cc49f0c0cd9939c4d7992ba54ab0737fdaa9b0
[ "Unlicense" ]
null
null
null
youtube_dl/YoutubeDL.py
hylinktree/youtube-dl
e4cc49f0c0cd9939c4d7992ba54ab0737fdaa9b0
[ "Unlicense" ]
null
null
null
#!/usr/bin/env python # coding: utf-8 from __future__ import absolute_import, unicode_literals import collections import contextlib import copy import datetime import errno import fileinput import io import itertools import json import locale import operator import os import platform import re import shutil import subprocess import socket import sys import time import tokenize import traceback import random from string import ascii_letters from .compat import ( compat_basestring, compat_cookiejar, compat_get_terminal_size, compat_http_client, compat_kwargs, compat_numeric_types, compat_os_name, compat_str, compat_tokenize_tokenize, compat_urllib_error, compat_urllib_request, compat_urllib_request_DataHandler, ) from .utils import ( age_restricted, args_to_str, ContentTooShortError, date_from_str, DateRange, DEFAULT_OUTTMPL, determine_ext, determine_protocol, DownloadError, encode_compat_str, encodeFilename, error_to_compat_str, expand_path, ExtractorError, format_bytes, formatSeconds, GeoRestrictedError, int_or_none, ISO3166Utils, locked_file, make_HTTPS_handler, MaxDownloadsReached, orderedSet, PagedList, parse_filesize, PerRequestProxyHandler, platform_name, PostProcessingError, preferredencoding, prepend_extension, register_socks_protocols, render_table, replace_extension, SameFileError, sanitize_filename, sanitize_path, sanitize_url, sanitized_Request, std_headers, str_or_none, subtitles_filename, UnavailableVideoError, url_basename, version_tuple, write_json_file, write_string, YoutubeDLCookieJar, YoutubeDLCookieProcessor, YoutubeDLHandler, YoutubeDLRedirectHandler, ) from .cache import Cache from .extractor import get_info_extractor, gen_extractor_classes, _LAZY_LOADER from .extractor.openload import PhantomJSwrapper from .downloader import get_suitable_downloader from .downloader.rtmp import rtmpdump_version from .postprocessor import ( FFmpegFixupM3u8PP, FFmpegFixupM4aPP, FFmpegFixupStretchedPP, FFmpegMergerPP, FFmpegPostProcessor, get_postprocessor, ) from .version import __version__ if compat_os_name == 'nt': import ctypes class YoutubeDL(object): """YoutubeDL class. YoutubeDL objects are the ones responsible of downloading the actual video file and writing it to disk if the user has requested it, among some other tasks. In most cases there should be one per program. As, given a video URL, the downloader doesn't know how to extract all the needed information, task that InfoExtractors do, it has to pass the URL to one of them. For this, YoutubeDL objects have a method that allows InfoExtractors to be registered in a given order. When it is passed a URL, the YoutubeDL object handles it to the first InfoExtractor it finds that reports being able to handle it. The InfoExtractor extracts all the information about the video or videos the URL refers to, and YoutubeDL process the extracted information, possibly using a File Downloader to download the video. YoutubeDL objects accept a lot of parameters. In order not to saturate the object constructor with arguments, it receives a dictionary of options instead. These options are available through the params attribute for the InfoExtractors to use. The YoutubeDL also registers itself as the downloader in charge for the InfoExtractors that are added to it, so this is a "mutual registration". Available options: username: Username for authentication purposes. password: Password for authentication purposes. videopassword: Password for accessing a video. ap_mso: Adobe Pass multiple-system operator identifier. ap_username: Multiple-system operator account username. ap_password: Multiple-system operator account password. usenetrc: Use netrc for authentication instead. verbose: Print additional info to stdout. quiet: Do not print messages to stdout. no_warnings: Do not print out anything for warnings. forceurl: Force printing final URL. forcetitle: Force printing title. forceid: Force printing ID. forcethumbnail: Force printing thumbnail URL. forcedescription: Force printing description. forcefilename: Force printing final filename. forceduration: Force printing duration. forcejson: Force printing info_dict as JSON. dump_single_json: Force printing the info_dict of the whole playlist (or video) as a single JSON line. simulate: Do not download the video files. format: Video format code. See options.py for more information. outtmpl: Template for output names. outtmpl_na_placeholder: Placeholder for unavailable meta fields. restrictfilenames: Do not allow "&" and spaces in file names ignoreerrors: Do not stop on download errors. force_generic_extractor: Force downloader to use the generic extractor nooverwrites: Prevent overwriting files. playliststart: Playlist item to start at. playlistend: Playlist item to end at. playlist_items: Specific indices of playlist to download. playlistreverse: Download playlist items in reverse order. playlistrandom: Download playlist items in random order. matchtitle: Download only matching titles. rejecttitle: Reject downloads for matching titles. logger: Log messages to a logging.Logger instance. logtostderr: Log messages to stderr instead of stdout. writedescription: Write the video description to a .description file writeinfojson: Write the video description to a .info.json file writeannotations: Write the video annotations to a .annotations.xml file writethumbnail: Write the thumbnail image to a file write_all_thumbnails: Write all thumbnail formats to files writesubtitles: Write the video subtitles to a file writeautomaticsub: Write the automatically generated subtitles to a file allsubtitles: Downloads all the subtitles of the video (requires writesubtitles or writeautomaticsub) listsubtitles: Lists all available subtitles for the video subtitlesformat: The format code for subtitles subtitleslangs: List of languages of the subtitles to download keepvideo: Keep the video file after post-processing daterange: A DateRange object, download only if the upload_date is in the range. skip_download: Skip the actual download of the video file cachedir: Location of the cache files in the filesystem. False to disable filesystem cache. noplaylist: Download single video instead of a playlist if in doubt. age_limit: An integer representing the user's age in years. Unsuitable videos for the given age are skipped. min_views: An integer representing the minimum view count the video must have in order to not be skipped. Videos without view count information are always downloaded. None for no limit. max_views: An integer representing the maximum view count. Videos that are more popular than that are not downloaded. Videos without view count information are always downloaded. None for no limit. download_archive: File name of a file where all downloads are recorded. Videos already present in the file are not downloaded again. cookiefile: File name where cookies should be read from and dumped to. nocheckcertificate:Do not verify SSL certificates prefer_insecure: Use HTTP instead of HTTPS to retrieve information. At the moment, this is only supported by YouTube. proxy: URL of the proxy server to use geo_verification_proxy: URL of the proxy to use for IP address verification on geo-restricted sites. socket_timeout: Time to wait for unresponsive hosts, in seconds bidi_workaround: Work around buggy terminals without bidirectional text support, using fridibi debug_printtraffic:Print out sent and received HTTP traffic include_ads: Download ads as well default_search: Prepend this string if an input url is not valid. 'auto' for elaborate guessing encoding: Use this encoding instead of the system-specified. extract_flat: Do not resolve URLs, return the immediate result. Pass in 'in_playlist' to only show this behavior for playlist items. postprocessors: A list of dictionaries, each with an entry * key: The name of the postprocessor. See youtube_dl/postprocessor/__init__.py for a list. as well as any further keyword arguments for the postprocessor. progress_hooks: A list of functions that get called on download progress, with a dictionary with the entries * status: One of "downloading", "error", or "finished". Check this first and ignore unknown values. If status is one of "downloading", or "finished", the following properties may also be present: * filename: The final filename (always present) * tmpfilename: The filename we're currently writing to * downloaded_bytes: Bytes on disk * total_bytes: Size of the whole file, None if unknown * total_bytes_estimate: Guess of the eventual file size, None if unavailable. * elapsed: The number of seconds since download started. * eta: The estimated time in seconds, None if unknown * speed: The download speed in bytes/second, None if unknown * fragment_index: The counter of the currently downloaded video fragment. * fragment_count: The number of fragments (= individual files that will be merged) Progress hooks are guaranteed to be called at least once (with status "finished") if the download is successful. merge_output_format: Extension to use when merging formats. fixup: Automatically correct known faults of the file. One of: - "never": do nothing - "warn": only emit a warning - "detect_or_warn": check whether we can do anything about it, warn otherwise (default) source_address: Client-side IP address to bind to. call_home: Boolean, true iff we are allowed to contact the youtube-dl servers for debugging. sleep_interval: Number of seconds to sleep before each download when used alone or a lower bound of a range for randomized sleep before each download (minimum possible number of seconds to sleep) when used along with max_sleep_interval. max_sleep_interval:Upper bound of a range for randomized sleep before each download (maximum possible number of seconds to sleep). Must only be used along with sleep_interval. Actual sleep time will be a random float from range [sleep_interval; max_sleep_interval]. listformats: Print an overview of available video formats and exit. list_thumbnails: Print a table of all thumbnails and exit. match_filter: A function that gets called with the info_dict of every video. If it returns a message, the video is ignored. If it returns None, the video is downloaded. match_filter_func in utils.py is one example for this. no_color: Do not emit color codes in output. geo_bypass: Bypass geographic restriction via faking X-Forwarded-For HTTP header geo_bypass_country: Two-letter ISO 3166-2 country code that will be used for explicit geographic restriction bypassing via faking X-Forwarded-For HTTP header geo_bypass_ip_block: IP range in CIDR notation that will be used similarly to geo_bypass_country The following options determine which downloader is picked: external_downloader: Executable of the external downloader to call. None or unset for standard (built-in) downloader. hls_prefer_native: Use the native HLS downloader instead of ffmpeg/avconv if True, otherwise use ffmpeg/avconv if False, otherwise use downloader suggested by extractor if None. The following parameters are not used by YoutubeDL itself, they are used by the downloader (see youtube_dl/downloader/common.py): nopart, updatetime, buffersize, ratelimit, min_filesize, max_filesize, test, noresizebuffer, retries, continuedl, noprogress, consoletitle, xattr_set_filesize, external_downloader_args, hls_use_mpegts, http_chunk_size. The following options are used by the post processors: prefer_ffmpeg: If False, use avconv instead of ffmpeg if both are available, otherwise prefer ffmpeg. ffmpeg_location: Location of the ffmpeg/avconv binary; either the path to the binary or its containing directory. postprocessor_args: A list of additional command-line arguments for the postprocessor. The following options are used by the Youtube extractor: youtube_include_dash_manifest: If True (default), DASH manifests and related data will be downloaded and processed by extractor. You can reduce network I/O by disabling it if you don't care about DASH. """ _NUMERIC_FIELDS = set(( 'width', 'height', 'tbr', 'abr', 'asr', 'vbr', 'fps', 'filesize', 'filesize_approx', 'timestamp', 'upload_year', 'upload_month', 'upload_day', 'duration', 'view_count', 'like_count', 'dislike_count', 'repost_count', 'average_rating', 'comment_count', 'age_limit', 'start_time', 'end_time', 'chapter_number', 'season_number', 'episode_number', 'track_number', 'disc_number', 'release_year', 'playlist_index', )) params = None _ies = [] _pps = [] _download_retcode = None _num_downloads = None _playlist_level = 0 _playlist_urls = set() _screen_file = None def __init__(self, params=None, auto_init=True): """Create a FileDownloader object with the given options.""" if params is None: params = {} self._ies = [] self._ies_instances = {} self._pps = [] self._progress_hooks = [] self._download_retcode = 0 self._num_downloads = 0 self._screen_file = [sys.stdout, sys.stderr][params.get('logtostderr', False)] self._err_file = sys.stderr self.params = { # Default parameters 'nocheckcertificate': False, } self.params.update(params) self.cache = Cache(self) def check_deprecated(param, option, suggestion): if self.params.get(param) is not None: self.report_warning( '%s is deprecated. Use %s instead.' % (option, suggestion)) return True return False if check_deprecated('cn_verification_proxy', '--cn-verification-proxy', '--geo-verification-proxy'): if self.params.get('geo_verification_proxy') is None: self.params['geo_verification_proxy'] = self.params['cn_verification_proxy'] check_deprecated('autonumber_size', '--autonumber-size', 'output template with %(autonumber)0Nd, where N in the number of digits') check_deprecated('autonumber', '--auto-number', '-o "%(autonumber)s-%(title)s.%(ext)s"') check_deprecated('usetitle', '--title', '-o "%(title)s-%(id)s.%(ext)s"') if params.get('bidi_workaround', False): try: import pty master, slave = pty.openpty() width = compat_get_terminal_size().columns if width is None: width_args = [] else: width_args = ['-w', str(width)] sp_kwargs = dict( stdin=subprocess.PIPE, stdout=slave, stderr=self._err_file) try: self._output_process = subprocess.Popen( ['bidiv'] + width_args, **sp_kwargs ) except OSError: self._output_process = subprocess.Popen( ['fribidi', '-c', 'UTF-8'] + width_args, **sp_kwargs) self._output_channel = os.fdopen(master, 'rb') except OSError as ose: if ose.errno == errno.ENOENT: self.report_warning('Could not find fribidi executable, ignoring --bidi-workaround . Make sure that fribidi is an executable file in one of the directories in your $PATH.') else: raise if (sys.platform != 'win32' and sys.getfilesystemencoding() in ['ascii', 'ANSI_X3.4-1968'] and not params.get('restrictfilenames', False)): # Unicode filesystem API will throw errors (#1474, #13027) self.report_warning( 'Assuming --restrict-filenames since file system encoding ' 'cannot encode all characters. ' 'Set the LC_ALL environment variable to fix this.') self.params['restrictfilenames'] = True if isinstance(params.get('outtmpl'), bytes): self.report_warning( 'Parameter outtmpl is bytes, but should be a unicode string. ' 'Put from __future__ import unicode_literals at the top of your code file or consider switching to Python 3.x.') self._setup_opener() if auto_init: self.print_debug_header() self.add_default_info_extractors() for pp_def_raw in self.params.get('postprocessors', []): pp_class = get_postprocessor(pp_def_raw['key']) pp_def = dict(pp_def_raw) del pp_def['key'] pp = pp_class(self, **compat_kwargs(pp_def)) self.add_post_processor(pp) for ph in self.params.get('progress_hooks', []): self.add_progress_hook(ph) register_socks_protocols() def warn_if_short_id(self, argv): # short YouTube ID starting with dash? idxs = [ i for i, a in enumerate(argv) if re.match(r'^-[0-9A-Za-z_-]{10}$', a)] if idxs: correct_argv = ( ['youtube-dl'] + [a for i, a in enumerate(argv) if i not in idxs] + ['--'] + [argv[i] for i in idxs] ) self.report_warning( 'Long argument string detected. ' 'Use -- to separate parameters and URLs, like this:\n%s\n' % args_to_str(correct_argv)) def add_info_extractor(self, ie): """Add an InfoExtractor object to the end of the list.""" self._ies.append(ie) if not isinstance(ie, type): self._ies_instances[ie.ie_key()] = ie ie.set_downloader(self) def get_info_extractor(self, ie_key): """ Get an instance of an IE with name ie_key, it will try to get one from the _ies list, if there's no instance it will create a new one and add it to the extractor list. """ ie = self._ies_instances.get(ie_key) if ie is None: ie = get_info_extractor(ie_key)() self.add_info_extractor(ie) return ie def add_default_info_extractors(self): """ Add the InfoExtractors returned by gen_extractors to the end of the list """ for ie in gen_extractor_classes(): self.add_info_extractor(ie) def add_post_processor(self, pp): """Add a PostProcessor object to the end of the chain.""" self._pps.append(pp) pp.set_downloader(self) def add_progress_hook(self, ph): """Add the progress hook (currently only for the file downloader)""" self._progress_hooks.append(ph) def _bidi_workaround(self, message): if not hasattr(self, '_output_channel'): return message assert hasattr(self, '_output_process') assert isinstance(message, compat_str) line_count = message.count('\n') + 1 self._output_process.stdin.write((message + '\n').encode('utf-8')) self._output_process.stdin.flush() res = ''.join(self._output_channel.readline().decode('utf-8') for _ in range(line_count)) return res[:-len('\n')] def to_screen(self, message, skip_eol=False): """Print message to stdout if not in quiet mode.""" return self.to_stdout(message, skip_eol, check_quiet=True) def _write_string(self, s, out=None): write_string(s, out=out, encoding=self.params.get('encoding')) def to_stdout(self, message, skip_eol=False, check_quiet=False): """Print message to stdout if not in quiet mode.""" if self.params.get('logger'): self.params['logger'].debug(message) elif not check_quiet or not self.params.get('quiet', False): message = self._bidi_workaround(message) terminator = ['\n', ''][skip_eol] output = message + terminator self._write_string(output, self._screen_file) def to_stderr(self, message): """Print message to stderr.""" assert isinstance(message, compat_str) if self.params.get('logger'): self.params['logger'].error(message) else: message = self._bidi_workaround(message) output = message + '\n' self._write_string(output, self._err_file) def to_console_title(self, message): if not self.params.get('consoletitle', False): return if compat_os_name == 'nt': if ctypes.windll.kernel32.GetConsoleWindow(): # c_wchar_p() might not be necessary if `message` is # already of type unicode() ctypes.windll.kernel32.SetConsoleTitleW(ctypes.c_wchar_p(message)) elif 'TERM' in os.environ: self._write_string('\033]0;%s\007' % message, self._screen_file) def save_console_title(self): if not self.params.get('consoletitle', False): return if self.params.get('simulate', False): return if compat_os_name != 'nt' and 'TERM' in os.environ: # Save the title on stack self._write_string('\033[22;0t', self._screen_file) def restore_console_title(self): if not self.params.get('consoletitle', False): return if self.params.get('simulate', False): return if compat_os_name != 'nt' and 'TERM' in os.environ: # Restore the title from stack self._write_string('\033[23;0t', self._screen_file) def __enter__(self): self.save_console_title() return self def __exit__(self, *args): self.restore_console_title() if self.params.get('cookiefile') is not None: self.cookiejar.save(ignore_discard=True, ignore_expires=True) def trouble(self, message=None, tb=None): """Determine action to take when a download problem appears. Depending on if the downloader has been configured to ignore download errors or not, this method may throw an exception or not when errors are found, after printing the message. tb, if given, is additional traceback information. """ if message is not None: self.to_stderr(message) if self.params.get('verbose'): if tb is None: if sys.exc_info()[0]: # if .trouble has been called from an except block tb = '' if hasattr(sys.exc_info()[1], 'exc_info') and sys.exc_info()[1].exc_info[0]: tb += ''.join(traceback.format_exception(*sys.exc_info()[1].exc_info)) tb += encode_compat_str(traceback.format_exc()) else: tb_data = traceback.format_list(traceback.extract_stack()) tb = ''.join(tb_data) self.to_stderr(tb) if not self.params.get('ignoreerrors', False): if sys.exc_info()[0] and hasattr(sys.exc_info()[1], 'exc_info') and sys.exc_info()[1].exc_info[0]: exc_info = sys.exc_info()[1].exc_info else: exc_info = sys.exc_info() raise DownloadError(message, exc_info) self._download_retcode = 1 def report_warning(self, message): ''' Print the message to stderr, it will be prefixed with 'WARNING:' If stderr is a tty file the 'WARNING:' will be colored ''' if self.params.get('logger') is not None: self.params['logger'].warning(message) else: if self.params.get('no_warnings'): return if not self.params.get('no_color') and self._err_file.isatty() and compat_os_name != 'nt': _msg_header = '\033[0;33mWARNING:\033[0m' else: _msg_header = 'WARNING:' warning_message = '%s %s' % (_msg_header, message) self.to_stderr(warning_message) def report_error(self, message, tb=None): ''' Do the same as trouble, but prefixes the message with 'ERROR:', colored in red if stderr is a tty file. ''' if not self.params.get('no_color') and self._err_file.isatty() and compat_os_name != 'nt': _msg_header = '\033[0;31mERROR:\033[0m' else: _msg_header = 'ERROR:' error_message = '%s %s' % (_msg_header, message) self.trouble(error_message, tb) def report_file_already_downloaded(self, file_name): """Report file has already been fully downloaded.""" try: self.to_screen('[download] %s has already been downloaded' % file_name) except UnicodeEncodeError: self.to_screen('[download] The file has already been downloaded') def prepare_filename(self, info_dict): """Generate the output filename.""" try: template_dict = dict(info_dict) template_dict['epoch'] = int(time.time()) autonumber_size = self.params.get('autonumber_size') if autonumber_size is None: autonumber_size = 5 template_dict['autonumber'] = self.params.get('autonumber_start', 1) - 1 + self._num_downloads if template_dict.get('resolution') is None: if template_dict.get('width') and template_dict.get('height'): template_dict['resolution'] = '%dx%d' % (template_dict['width'], template_dict['height']) elif template_dict.get('height'): template_dict['resolution'] = '%sp' % template_dict['height'] elif template_dict.get('width'): template_dict['resolution'] = '%dx?' % template_dict['width'] sanitize = lambda k, v: sanitize_filename( compat_str(v), restricted=self.params.get('restrictfilenames'), is_id=(k == 'id' or k.endswith('_id'))) template_dict = dict((k, v if isinstance(v, compat_numeric_types) else sanitize(k, v)) for k, v in template_dict.items() if v is not None and not isinstance(v, (list, tuple, dict))) template_dict = collections.defaultdict(lambda: self.params.get('outtmpl_na_placeholder', 'NA'), template_dict) outtmpl = self.params.get('outtmpl', DEFAULT_OUTTMPL) # For fields playlist_index and autonumber convert all occurrences # of %(field)s to %(field)0Nd for backward compatibility field_size_compat_map = { 'playlist_index': len(str(template_dict['n_entries'])), 'autonumber': autonumber_size, } FIELD_SIZE_COMPAT_RE = r'(?<!%)%\((?P<field>autonumber|playlist_index)\)s' mobj = re.search(FIELD_SIZE_COMPAT_RE, outtmpl) if mobj: outtmpl = re.sub( FIELD_SIZE_COMPAT_RE, r'%%(\1)0%dd' % field_size_compat_map[mobj.group('field')], outtmpl) # Missing numeric fields used together with integer presentation types # in format specification will break the argument substitution since # string NA placeholder is returned for missing fields. We will patch # output template for missing fields to meet string presentation type. for numeric_field in self._NUMERIC_FIELDS: if numeric_field not in template_dict: # As of [1] format syntax is: # %[mapping_key][conversion_flags][minimum_width][.precision][length_modifier]type # 1. https://docs.python.org/2/library/stdtypes.html#string-formatting FORMAT_RE = r'''(?x) (?<!%) % \({0}\) # mapping key (?:[#0\-+ ]+)? # conversion flags (optional) (?:\d+)? # minimum field width (optional) (?:\.\d+)? # precision (optional) [hlL]? # length modifier (optional) [diouxXeEfFgGcrs%] # conversion type ''' outtmpl = re.sub( FORMAT_RE.format(numeric_field), r'%({0})s'.format(numeric_field), outtmpl) # expand_path translates '%%' into '%' and '$$' into '$' # correspondingly that is not what we want since we need to keep # '%%' intact for template dict substitution step. Working around # with boundary-alike separator hack. sep = ''.join([random.choice(ascii_letters) for _ in range(32)]) # print('hychu, {%s}' % outtmpl) outtmpl = outtmpl.replace('%%', '%{0}%'.format(sep)).replace('$$', '${0}$'.format(sep)) # outtmpl should be expand_path'ed before template dict substitution # because meta fields may contain env variables we don't want to # be expanded. For example, for outtmpl "%(title)s.%(ext)s" and # title "Hello $PATH", we don't want `$PATH` to be expanded. filename = expand_path(outtmpl).replace(sep, '') % template_dict # filename = os.path.join('out', filename) # print('hychu, The filename is {%s}.{%s}' % (outtmpl, filename)) # Temporary fix for #4787 # 'Treat' all problem characters by passing filename through preferredencoding # to workaround encoding issues with subprocess on python2 @ Windows if sys.version_info < (3, 0) and sys.platform == 'win32': filename = encodeFilename(filename, True).decode(preferredencoding()) return sanitize_path(filename) except ValueError as err: self.report_error('Error in output template: ' + str(err) + ' (encoding: ' + repr(preferredencoding()) + ')') return None def _match_entry(self, info_dict, incomplete): """ Returns None iff the file should be downloaded """ video_title = info_dict.get('title', info_dict.get('id', 'video')) if 'title' in info_dict: # This can happen when we're just evaluating the playlist title = info_dict['title'] matchtitle = self.params.get('matchtitle', False) if matchtitle: if not re.search(matchtitle, title, re.IGNORECASE): return '"' + title + '" title did not match pattern "' + matchtitle + '"' rejecttitle = self.params.get('rejecttitle', False) if rejecttitle: if re.search(rejecttitle, title, re.IGNORECASE): return '"' + title + '" title matched reject pattern "' + rejecttitle + '"' date = info_dict.get('upload_date') if date is not None: dateRange = self.params.get('daterange', DateRange()) if date not in dateRange: return '%s upload date is not in range %s' % (date_from_str(date).isoformat(), dateRange) view_count = info_dict.get('view_count') if view_count is not None: min_views = self.params.get('min_views') if min_views is not None and view_count < min_views: return 'Skipping %s, because it has not reached minimum view count (%d/%d)' % (video_title, view_count, min_views) max_views = self.params.get('max_views') if max_views is not None and view_count > max_views: return 'Skipping %s, because it has exceeded the maximum view count (%d/%d)' % (video_title, view_count, max_views) if age_restricted(info_dict.get('age_limit'), self.params.get('age_limit')): return 'Skipping "%s" because it is age restricted' % video_title if self.in_download_archive(info_dict): return '%s has already been recorded in archive' % video_title if not incomplete: match_filter = self.params.get('match_filter') if match_filter is not None: ret = match_filter(info_dict) if ret is not None: return ret return None @staticmethod def add_extra_info(info_dict, extra_info): '''Set the keys from extra_info in info dict if they are missing''' for key, value in extra_info.items(): info_dict.setdefault(key, value) def extract_info(self, url, download=True, ie_key=None, extra_info={}, process=True, force_generic_extractor=False): ''' Returns a list with a dictionary for each video we find. If 'download', also downloads the videos. extra_info is a dict containing the extra values to add to each result ''' if not ie_key and force_generic_extractor: ie_key = 'Generic' if ie_key: ies = [self.get_info_extractor(ie_key)] else: ies = self._ies for ie in ies: if not ie.suitable(url): continue ie = self.get_info_extractor(ie.ie_key()) if not ie.working(): self.report_warning('The program functionality for this site has been marked as broken, ' 'and will probably not work.') return self.__extract_info(url, ie, download, extra_info, process) else: self.report_error('no suitable InfoExtractor for URL %s' % url) def __handle_extraction_exceptions(func): def wrapper(self, *args, **kwargs): try: return func(self, *args, **kwargs) except GeoRestrictedError as e: msg = e.msg if e.countries: msg += '\nThis video is available in %s.' % ', '.join( map(ISO3166Utils.short2full, e.countries)) msg += '\nYou might want to use a VPN or a proxy server (with --proxy) to workaround.' self.report_error(msg) except ExtractorError as e: # An error we somewhat expected self.report_error(compat_str(e), e.format_traceback()) except MaxDownloadsReached: raise except Exception as e: if self.params.get('ignoreerrors', False): self.report_error(error_to_compat_str(e), tb=encode_compat_str(traceback.format_exc())) else: raise return wrapper @__handle_extraction_exceptions def __extract_info(self, url, ie, download, extra_info, process): ie_result = ie.extract(url) if ie_result is None: # Finished already (backwards compatibility; listformats and friends should be moved here) return if isinstance(ie_result, list): # Backwards compatibility: old IE result format ie_result = { '_type': 'compat_list', 'entries': ie_result, } self.add_default_extra_info(ie_result, ie, url) if process: return self.process_ie_result(ie_result, download, extra_info) else: return ie_result def add_default_extra_info(self, ie_result, ie, url): self.add_extra_info(ie_result, { 'extractor': ie.IE_NAME, 'webpage_url': url, 'webpage_url_basename': url_basename(url), 'extractor_key': ie.ie_key(), }) def process_ie_result(self, ie_result, download=True, extra_info={}): """ Take the result of the ie(may be modified) and resolve all unresolved references (URLs, playlist items). It will also download the videos if 'download'. Returns the resolved ie_result. """ result_type = ie_result.get('_type', 'video') if result_type in ('url', 'url_transparent'): ie_result['url'] = sanitize_url(ie_result['url']) extract_flat = self.params.get('extract_flat', False) if ((extract_flat == 'in_playlist' and 'playlist' in extra_info) or extract_flat is True): self.__forced_printings( ie_result, self.prepare_filename(ie_result), incomplete=True) return ie_result if result_type == 'video': self.add_extra_info(ie_result, extra_info) return self.process_video_result(ie_result, download=download) elif result_type == 'url': # We have to add extra_info to the results because it may be # contained in a playlist return self.extract_info(ie_result['url'], download, ie_key=ie_result.get('ie_key'), extra_info=extra_info) elif result_type == 'url_transparent': # Use the information from the embedding page info = self.extract_info( ie_result['url'], ie_key=ie_result.get('ie_key'), extra_info=extra_info, download=False, process=False) # extract_info may return None when ignoreerrors is enabled and # extraction failed with an error, don't crash and return early # in this case if not info: return info force_properties = dict( (k, v) for k, v in ie_result.items() if v is not None) for f in ('_type', 'url', 'id', 'extractor', 'extractor_key', 'ie_key'): if f in force_properties: del force_properties[f] new_result = info.copy() new_result.update(force_properties) # Extracted info may not be a video result (i.e. # info.get('_type', 'video') != video) but rather an url or # url_transparent. In such cases outer metadata (from ie_result) # should be propagated to inner one (info). For this to happen # _type of info should be overridden with url_transparent. This # fixes issue from https://github.com/ytdl-org/youtube-dl/pull/11163. if new_result.get('_type') == 'url': new_result['_type'] = 'url_transparent' return self.process_ie_result( new_result, download=download, extra_info=extra_info) elif result_type in ('playlist', 'multi_video'): # Protect from infinite recursion due to recursively nested playlists # (see https://github.com/ytdl-org/youtube-dl/issues/27833) webpage_url = ie_result['webpage_url'] if webpage_url in self._playlist_urls: self.to_screen( '[download] Skipping already downloaded playlist: %s' % ie_result.get('title') or ie_result.get('id')) return self._playlist_level += 1 self._playlist_urls.add(webpage_url) try: return self.__process_playlist(ie_result, download) finally: self._playlist_level -= 1 if not self._playlist_level: self._playlist_urls.clear() elif result_type == 'compat_list': self.report_warning( 'Extractor %s returned a compat_list result. ' 'It needs to be updated.' % ie_result.get('extractor')) def _fixup(r): self.add_extra_info( r, { 'extractor': ie_result['extractor'], 'webpage_url': ie_result['webpage_url'], 'webpage_url_basename': url_basename(ie_result['webpage_url']), 'extractor_key': ie_result['extractor_key'], } ) return r ie_result['entries'] = [ self.process_ie_result(_fixup(r), download, extra_info) for r in ie_result['entries'] ] return ie_result else: raise Exception('Invalid result type: %s' % result_type) def __process_playlist(self, ie_result, download): # We process each entry in the playlist playlist = ie_result.get('title') or ie_result.get('id') self.to_screen('[download] Downloading playlist: %s' % playlist) playlist_results = [] playliststart = self.params.get('playliststart', 1) - 1 playlistend = self.params.get('playlistend') # For backwards compatibility, interpret -1 as whole list if playlistend == -1: playlistend = None playlistitems_str = self.params.get('playlist_items') playlistitems = None if playlistitems_str is not None: def iter_playlistitems(format): for string_segment in format.split(','): if '-' in string_segment: start, end = string_segment.split('-') for item in range(int(start), int(end) + 1): yield int(item) else: yield int(string_segment) playlistitems = orderedSet(iter_playlistitems(playlistitems_str)) ie_entries = ie_result['entries'] def make_playlistitems_entries(list_ie_entries): num_entries = len(list_ie_entries) return [ list_ie_entries[i - 1] for i in playlistitems if -num_entries <= i - 1 < num_entries] def report_download(num_entries): self.to_screen( '[%s] playlist %s: Downloading %d videos' % (ie_result['extractor'], playlist, num_entries)) if isinstance(ie_entries, list): n_all_entries = len(ie_entries) if playlistitems: entries = make_playlistitems_entries(ie_entries) else: entries = ie_entries[playliststart:playlistend] n_entries = len(entries) self.to_screen( '[%s] playlist %s: Collected %d video ids (downloading %d of them)' % (ie_result['extractor'], playlist, n_all_entries, n_entries)) elif isinstance(ie_entries, PagedList): if playlistitems: entries = [] for item in playlistitems: entries.extend(ie_entries.getslice( item - 1, item )) else: entries = ie_entries.getslice( playliststart, playlistend) n_entries = len(entries) report_download(n_entries) else: # iterable if playlistitems: entries = make_playlistitems_entries(list(itertools.islice( ie_entries, 0, max(playlistitems)))) else: entries = list(itertools.islice( ie_entries, playliststart, playlistend)) n_entries = len(entries) report_download(n_entries) if self.params.get('playlistreverse', False): entries = entries[::-1] if self.params.get('playlistrandom', False): random.shuffle(entries) x_forwarded_for = ie_result.get('__x_forwarded_for_ip') for i, entry in enumerate(entries, 1): self.to_screen('[download] Downloading video %s of %s' % (i, n_entries)) # This __x_forwarded_for_ip thing is a bit ugly but requires # minimal changes if x_forwarded_for: entry['__x_forwarded_for_ip'] = x_forwarded_for extra = { 'n_entries': n_entries, 'playlist': playlist, 'playlist_id': ie_result.get('id'), 'playlist_title': ie_result.get('title'), 'playlist_uploader': ie_result.get('uploader'), 'playlist_uploader_id': ie_result.get('uploader_id'), 'playlist_index': playlistitems[i - 1] if playlistitems else i + playliststart, 'extractor': ie_result['extractor'], 'webpage_url': ie_result['webpage_url'], 'webpage_url_basename': url_basename(ie_result['webpage_url']), 'extractor_key': ie_result['extractor_key'], } reason = self._match_entry(entry, incomplete=True) if reason is not None: self.to_screen('[download] ' + reason) continue entry_result = self.__process_iterable_entry(entry, download, extra) # TODO: skip failed (empty) entries? playlist_results.append(entry_result) ie_result['entries'] = playlist_results self.to_screen('[download] Finished downloading playlist: %s' % playlist) return ie_result @__handle_extraction_exceptions def __process_iterable_entry(self, entry, download, extra_info): return self.process_ie_result( entry, download=download, extra_info=extra_info) def _build_format_filter(self, filter_spec): " Returns a function to filter the formats according to the filter_spec " OPERATORS = { '<': operator.lt, '<=': operator.le, '>': operator.gt, '>=': operator.ge, '=': operator.eq, '!=': operator.ne, } operator_rex = re.compile(r'''(?x)\s* (?P<key>width|height|tbr|abr|vbr|asr|filesize|filesize_approx|fps) \s*(?P<op>%s)(?P<none_inclusive>\s*\?)?\s* (?P<value>[0-9.]+(?:[kKmMgGtTpPeEzZyY]i?[Bb]?)?) $ ''' % '|'.join(map(re.escape, OPERATORS.keys()))) m = operator_rex.search(filter_spec) if m: try: comparison_value = int(m.group('value')) except ValueError: comparison_value = parse_filesize(m.group('value')) if comparison_value is None: comparison_value = parse_filesize(m.group('value') + 'B') if comparison_value is None: raise ValueError( 'Invalid value %r in format specification %r' % ( m.group('value'), filter_spec)) op = OPERATORS[m.group('op')] if not m: STR_OPERATORS = { '=': operator.eq, '^=': lambda attr, value: attr.startswith(value), '$=': lambda attr, value: attr.endswith(value), '*=': lambda attr, value: value in attr, } str_operator_rex = re.compile(r'''(?x) \s*(?P<key>ext|acodec|vcodec|container|protocol|format_id|language) \s*(?P<negation>!\s*)?(?P<op>%s)(?P<none_inclusive>\s*\?)? \s*(?P<value>[a-zA-Z0-9._-]+) \s*$ ''' % '|'.join(map(re.escape, STR_OPERATORS.keys()))) m = str_operator_rex.search(filter_spec) if m: comparison_value = m.group('value') str_op = STR_OPERATORS[m.group('op')] if m.group('negation'): op = lambda attr, value: not str_op(attr, value) else: op = str_op if not m: raise ValueError('Invalid filter specification %r' % filter_spec) def _filter(f): actual_value = f.get(m.group('key')) if actual_value is None: return m.group('none_inclusive') return op(actual_value, comparison_value) return _filter def _default_format_spec(self, info_dict, download=True): def can_merge(): merger = FFmpegMergerPP(self) return merger.available and merger.can_merge() def prefer_best(): if self.params.get('simulate', False): return False if not download: return False if self.params.get('outtmpl', DEFAULT_OUTTMPL) == '-': return True if info_dict.get('is_live'): return True if not can_merge(): return True return False req_format_list = ['bestvideo+bestaudio', 'best'] if prefer_best(): req_format_list.reverse() return '/'.join(req_format_list) def build_format_selector(self, format_spec): def syntax_error(note, start): message = ( 'Invalid format specification: ' '{0}\n\t{1}\n\t{2}^'.format(note, format_spec, ' ' * start[1])) return SyntaxError(message) PICKFIRST = 'PICKFIRST' MERGE = 'MERGE' SINGLE = 'SINGLE' GROUP = 'GROUP' FormatSelector = collections.namedtuple('FormatSelector', ['type', 'selector', 'filters']) def _parse_filter(tokens): filter_parts = [] for type, string, start, _, _ in tokens: if type == tokenize.OP and string == ']': return ''.join(filter_parts) else: filter_parts.append(string) def _remove_unused_ops(tokens): # Remove operators that we don't use and join them with the surrounding strings # for example: 'mp4' '-' 'baseline' '-' '16x9' is converted to 'mp4-baseline-16x9' ALLOWED_OPS = ('/', '+', ',', '(', ')') last_string, last_start, last_end, last_line = None, None, None, None for type, string, start, end, line in tokens: if type == tokenize.OP and string == '[': if last_string: yield tokenize.NAME, last_string, last_start, last_end, last_line last_string = None yield type, string, start, end, line # everything inside brackets will be handled by _parse_filter for type, string, start, end, line in tokens: yield type, string, start, end, line if type == tokenize.OP and string == ']': break elif type == tokenize.OP and string in ALLOWED_OPS: if last_string: yield tokenize.NAME, last_string, last_start, last_end, last_line last_string = None yield type, string, start, end, line elif type in [tokenize.NAME, tokenize.NUMBER, tokenize.OP]: if not last_string: last_string = string last_start = start last_end = end else: last_string += string if last_string: yield tokenize.NAME, last_string, last_start, last_end, last_line def _parse_format_selection(tokens, inside_merge=False, inside_choice=False, inside_group=False): selectors = [] current_selector = None for type, string, start, _, _ in tokens: # ENCODING is only defined in python 3.x if type == getattr(tokenize, 'ENCODING', None): continue elif type in [tokenize.NAME, tokenize.NUMBER]: current_selector = FormatSelector(SINGLE, string, []) elif type == tokenize.OP: if string == ')': if not inside_group: # ')' will be handled by the parentheses group tokens.restore_last_token() break elif inside_merge and string in ['/', ',']: tokens.restore_last_token() break elif inside_choice and string == ',': tokens.restore_last_token() break elif string == ',': if not current_selector: raise syntax_error('"," must follow a format selector', start) selectors.append(current_selector) current_selector = None elif string == '/': if not current_selector: raise syntax_error('"/" must follow a format selector', start) first_choice = current_selector second_choice = _parse_format_selection(tokens, inside_choice=True) current_selector = FormatSelector(PICKFIRST, (first_choice, second_choice), []) elif string == '[': if not current_selector: current_selector = FormatSelector(SINGLE, 'best', []) format_filter = _parse_filter(tokens) current_selector.filters.append(format_filter) elif string == '(': if current_selector: raise syntax_error('Unexpected "("', start) group = _parse_format_selection(tokens, inside_group=True) current_selector = FormatSelector(GROUP, group, []) elif string == '+': if inside_merge: raise syntax_error('Unexpected "+"', start) video_selector = current_selector audio_selector = _parse_format_selection(tokens, inside_merge=True) if not video_selector or not audio_selector: raise syntax_error('"+" must be between two format selectors', start) current_selector = FormatSelector(MERGE, (video_selector, audio_selector), []) else: raise syntax_error('Operator not recognized: "{0}"'.format(string), start) elif type == tokenize.ENDMARKER: break if current_selector: selectors.append(current_selector) return selectors def _build_selector_function(selector): if isinstance(selector, list): fs = [_build_selector_function(s) for s in selector] def selector_function(ctx): for f in fs: for format in f(ctx): yield format return selector_function elif selector.type == GROUP: selector_function = _build_selector_function(selector.selector) elif selector.type == PICKFIRST: fs = [_build_selector_function(s) for s in selector.selector] def selector_function(ctx): for f in fs: picked_formats = list(f(ctx)) if picked_formats: return picked_formats return [] elif selector.type == SINGLE: format_spec = selector.selector def selector_function(ctx): formats = list(ctx['formats']) if not formats: return if format_spec == 'all': for f in formats: yield f elif format_spec in ['best', 'worst', None]: format_idx = 0 if format_spec == 'worst' else -1 audiovideo_formats = [ f for f in formats if f.get('vcodec') != 'none' and f.get('acodec') != 'none'] if audiovideo_formats: yield audiovideo_formats[format_idx] # for extractors with incomplete formats (audio only (soundcloud) # or video only (imgur)) we will fallback to best/worst # {video,audio}-only format elif ctx['incomplete_formats']: yield formats[format_idx] elif format_spec == 'bestaudio': audio_formats = [ f for f in formats if f.get('vcodec') == 'none'] if audio_formats: yield audio_formats[-1] elif format_spec == 'worstaudio': audio_formats = [ f for f in formats if f.get('vcodec') == 'none'] if audio_formats: yield audio_formats[0] elif format_spec == 'bestvideo': video_formats = [ f for f in formats if f.get('acodec') == 'none'] if video_formats: yield video_formats[-1] elif format_spec == 'worstvideo': video_formats = [ f for f in formats if f.get('acodec') == 'none'] if video_formats: yield video_formats[0] else: extensions = ['mp4', 'flv', 'webm', '3gp', 'm4a', 'mp3', 'ogg', 'aac', 'wav'] if format_spec in extensions: filter_f = lambda f: f['ext'] == format_spec else: filter_f = lambda f: f['format_id'] == format_spec matches = list(filter(filter_f, formats)) if matches: yield matches[-1] elif selector.type == MERGE: def _merge(formats_info): format_1, format_2 = [f['format_id'] for f in formats_info] # The first format must contain the video and the # second the audio if formats_info[0].get('vcodec') == 'none': self.report_error('The first format must ' 'contain the video, try using ' '"-f %s+%s"' % (format_2, format_1)) return # Formats must be opposite (video+audio) if formats_info[0].get('acodec') == 'none' and formats_info[1].get('acodec') == 'none': self.report_error( 'Both formats %s and %s are video-only, you must specify "-f video+audio"' % (format_1, format_2)) return output_ext = ( formats_info[0]['ext'] if self.params.get('merge_output_format') is None else self.params['merge_output_format']) return { 'requested_formats': formats_info, 'format': '%s+%s' % (formats_info[0].get('format'), formats_info[1].get('format')), 'format_id': '%s+%s' % (formats_info[0].get('format_id'), formats_info[1].get('format_id')), 'width': formats_info[0].get('width'), 'height': formats_info[0].get('height'), 'resolution': formats_info[0].get('resolution'), 'fps': formats_info[0].get('fps'), 'vcodec': formats_info[0].get('vcodec'), 'vbr': formats_info[0].get('vbr'), 'stretched_ratio': formats_info[0].get('stretched_ratio'), 'acodec': formats_info[1].get('acodec'), 'abr': formats_info[1].get('abr'), 'ext': output_ext, } video_selector, audio_selector = map(_build_selector_function, selector.selector) def selector_function(ctx): for pair in itertools.product( video_selector(copy.deepcopy(ctx)), audio_selector(copy.deepcopy(ctx))): yield _merge(pair) filters = [self._build_format_filter(f) for f in selector.filters] def final_selector(ctx): ctx_copy = copy.deepcopy(ctx) for _filter in filters: ctx_copy['formats'] = list(filter(_filter, ctx_copy['formats'])) return selector_function(ctx_copy) return final_selector stream = io.BytesIO(format_spec.encode('utf-8')) try: tokens = list(_remove_unused_ops(compat_tokenize_tokenize(stream.readline))) except tokenize.TokenError: raise syntax_error('Missing closing/opening brackets or parenthesis', (0, len(format_spec))) class TokenIterator(object): def __init__(self, tokens): self.tokens = tokens self.counter = 0 def __iter__(self): return self def __next__(self): if self.counter >= len(self.tokens): raise StopIteration() value = self.tokens[self.counter] self.counter += 1 return value next = __next__ def restore_last_token(self): self.counter -= 1 parsed_selector = _parse_format_selection(iter(TokenIterator(tokens))) return _build_selector_function(parsed_selector) def _calc_headers(self, info_dict): res = std_headers.copy() add_headers = info_dict.get('http_headers') if add_headers: res.update(add_headers) cookies = self._calc_cookies(info_dict) if cookies: res['Cookie'] = cookies if 'X-Forwarded-For' not in res: x_forwarded_for_ip = info_dict.get('__x_forwarded_for_ip') if x_forwarded_for_ip: res['X-Forwarded-For'] = x_forwarded_for_ip return res def _calc_cookies(self, info_dict): pr = sanitized_Request(info_dict['url']) self.cookiejar.add_cookie_header(pr) return pr.get_header('Cookie') def process_video_result(self, info_dict, download=True): assert info_dict.get('_type', 'video') == 'video' if 'id' not in info_dict: raise ExtractorError('Missing "id" field in extractor result') if 'title' not in info_dict: raise ExtractorError('Missing "title" field in extractor result') def report_force_conversion(field, field_not, conversion): self.report_warning( '"%s" field is not %s - forcing %s conversion, there is an error in extractor' % (field, field_not, conversion)) def sanitize_string_field(info, string_field): field = info.get(string_field) if field is None or isinstance(field, compat_str): return report_force_conversion(string_field, 'a string', 'string') info[string_field] = compat_str(field) def sanitize_numeric_fields(info): for numeric_field in self._NUMERIC_FIELDS: field = info.get(numeric_field) if field is None or isinstance(field, compat_numeric_types): continue report_force_conversion(numeric_field, 'numeric', 'int') info[numeric_field] = int_or_none(field) sanitize_string_field(info_dict, 'id') sanitize_numeric_fields(info_dict) if 'playlist' not in info_dict: # It isn't part of a playlist info_dict['playlist'] = None info_dict['playlist_index'] = None thumbnails = info_dict.get('thumbnails') if thumbnails is None: thumbnail = info_dict.get('thumbnail') if thumbnail: info_dict['thumbnails'] = thumbnails = [{'url': thumbnail}] if thumbnails: thumbnails.sort(key=lambda t: ( t.get('preference') if t.get('preference') is not None else -1, t.get('width') if t.get('width') is not None else -1, t.get('height') if t.get('height') is not None else -1, t.get('id') if t.get('id') is not None else '', t.get('url'))) for i, t in enumerate(thumbnails): t['url'] = sanitize_url(t['url']) if t.get('width') and t.get('height'): t['resolution'] = '%dx%d' % (t['width'], t['height']) if t.get('id') is None: t['id'] = '%d' % i if self.params.get('list_thumbnails'): self.list_thumbnails(info_dict) return thumbnail = info_dict.get('thumbnail') if thumbnail: info_dict['thumbnail'] = sanitize_url(thumbnail) elif thumbnails: info_dict['thumbnail'] = thumbnails[-1]['url'] if 'display_id' not in info_dict and 'id' in info_dict: info_dict['display_id'] = info_dict['id'] for ts_key, date_key in ( ('timestamp', 'upload_date'), ('release_timestamp', 'release_date'), ): if info_dict.get(date_key) is None and info_dict.get(ts_key) is not None: # Working around out-of-range timestamp values (e.g. negative ones on Windows, # see http://bugs.python.org/issue1646728) try: upload_date = datetime.datetime.utcfromtimestamp(info_dict[ts_key]) info_dict[date_key] = upload_date.strftime('%Y%m%d') except (ValueError, OverflowError, OSError): pass # Auto generate title fields corresponding to the *_number fields when missing # in order to always have clean titles. This is very common for TV series. for field in ('chapter', 'season', 'episode'): if info_dict.get('%s_number' % field) is not None and not info_dict.get(field): info_dict[field] = '%s %d' % (field.capitalize(), info_dict['%s_number' % field]) for cc_kind in ('subtitles', 'automatic_captions'): cc = info_dict.get(cc_kind) if cc: for _, subtitle in cc.items(): for subtitle_format in subtitle: if subtitle_format.get('url'): subtitle_format['url'] = sanitize_url(subtitle_format['url']) if subtitle_format.get('ext') is None: subtitle_format['ext'] = determine_ext(subtitle_format['url']).lower() automatic_captions = info_dict.get('automatic_captions') subtitles = info_dict.get('subtitles') if self.params.get('listsubtitles', False): if 'automatic_captions' in info_dict: self.list_subtitles( info_dict['id'], automatic_captions, 'automatic captions') self.list_subtitles(info_dict['id'], subtitles, 'subtitles') return info_dict['requested_subtitles'] = self.process_subtitles( info_dict['id'], subtitles, automatic_captions) # We now pick which formats have to be downloaded if info_dict.get('formats') is None: # There's only one format available formats = [info_dict] else: formats = info_dict['formats'] if not formats: raise ExtractorError('No video formats found!') def is_wellformed(f): url = f.get('url') if not url: self.report_warning( '"url" field is missing or empty - skipping format, ' 'there is an error in extractor') return False if isinstance(url, bytes): sanitize_string_field(f, 'url') return True # Filter out malformed formats for better extraction robustness formats = list(filter(is_wellformed, formats)) formats_dict = {} # We check that all the formats have the format and format_id fields for i, format in enumerate(formats): sanitize_string_field(format, 'format_id') sanitize_numeric_fields(format) format['url'] = sanitize_url(format['url']) if not format.get('format_id'): format['format_id'] = compat_str(i) else: # Sanitize format_id from characters used in format selector expression format['format_id'] = re.sub(r'[\s,/+\[\]()]', '_', format['format_id']) format_id = format['format_id'] if format_id not in formats_dict: formats_dict[format_id] = [] formats_dict[format_id].append(format) # Make sure all formats have unique format_id for format_id, ambiguous_formats in formats_dict.items(): if len(ambiguous_formats) > 1: for i, format in enumerate(ambiguous_formats): format['format_id'] = '%s-%d' % (format_id, i) for i, format in enumerate(formats): if format.get('format') is None: format['format'] = '{id} - {res}{note}'.format( id=format['format_id'], res=self.format_resolution(format), note=' ({0})'.format(format['format_note']) if format.get('format_note') is not None else '', ) # Automatically determine file extension if missing if format.get('ext') is None: format['ext'] = determine_ext(format['url']).lower() # Automatically determine protocol if missing (useful for format # selection purposes) if format.get('protocol') is None: format['protocol'] = determine_protocol(format) # Add HTTP headers, so that external programs can use them from the # json output full_format_info = info_dict.copy() full_format_info.update(format) format['http_headers'] = self._calc_headers(full_format_info) # Remove private housekeeping stuff if '__x_forwarded_for_ip' in info_dict: del info_dict['__x_forwarded_for_ip'] # TODO Central sorting goes here if formats[0] is not info_dict: # only set the 'formats' fields if the original info_dict list them # otherwise we end up with a circular reference, the first (and unique) # element in the 'formats' field in info_dict is info_dict itself, # which can't be exported to json info_dict['formats'] = formats if self.params.get('listformats'): self.list_formats(info_dict) return req_format = self.params.get('format') if req_format is None: req_format = self._default_format_spec(info_dict, download=download) if self.params.get('verbose'): self._write_string('[debug] Default format spec: %s\n' % req_format) format_selector = self.build_format_selector(req_format) # While in format selection we may need to have an access to the original # format set in order to calculate some metrics or do some processing. # For now we need to be able to guess whether original formats provided # by extractor are incomplete or not (i.e. whether extractor provides only # video-only or audio-only formats) for proper formats selection for # extractors with such incomplete formats (see # https://github.com/ytdl-org/youtube-dl/pull/5556). # Since formats may be filtered during format selection and may not match # the original formats the results may be incorrect. Thus original formats # or pre-calculated metrics should be passed to format selection routines # as well. # We will pass a context object containing all necessary additional data # instead of just formats. # This fixes incorrect format selection issue (see # https://github.com/ytdl-org/youtube-dl/issues/10083). incomplete_formats = ( # All formats are video-only or all(f.get('vcodec') != 'none' and f.get('acodec') == 'none' for f in formats) # all formats are audio-only or all(f.get('vcodec') == 'none' and f.get('acodec') != 'none' for f in formats)) ctx = { 'formats': formats, 'incomplete_formats': incomplete_formats, } formats_to_download = list(format_selector(ctx)) if not formats_to_download: raise ExtractorError('requested format not available', expected=True) if download: if len(formats_to_download) > 1: self.to_screen('[info] %s: downloading video in %s formats' % (info_dict['id'], len(formats_to_download))) for format in formats_to_download: new_info = dict(info_dict) new_info.update(format) self.process_info(new_info) # We update the info dict with the best quality format (backwards compatibility) info_dict.update(formats_to_download[-1]) return info_dict def process_subtitles(self, video_id, normal_subtitles, automatic_captions): """Select the requested subtitles and their format""" available_subs = {} if normal_subtitles and self.params.get('writesubtitles'): available_subs.update(normal_subtitles) if automatic_captions and self.params.get('writeautomaticsub'): for lang, cap_info in automatic_captions.items(): if lang not in available_subs: available_subs[lang] = cap_info if (not self.params.get('writesubtitles') and not self.params.get('writeautomaticsub') or not available_subs): return None if self.params.get('allsubtitles', False): requested_langs = available_subs.keys() else: if self.params.get('subtitleslangs', False): requested_langs = self.params.get('subtitleslangs') elif 'en' in available_subs: requested_langs = ['en'] else: requested_langs = [list(available_subs.keys())[0]] formats_query = self.params.get('subtitlesformat', 'best') formats_preference = formats_query.split('/') if formats_query else [] subs = {} for lang in requested_langs: formats = available_subs.get(lang) if formats is None: self.report_warning('%s subtitles not available for %s' % (lang, video_id)) continue for ext in formats_preference: if ext == 'best': f = formats[-1] break matches = list(filter(lambda f: f['ext'] == ext, formats)) if matches: f = matches[-1] break else: f = formats[-1] self.report_warning( 'No subtitle format found matching "%s" for language %s, ' 'using %s' % (formats_query, lang, f['ext'])) subs[lang] = f return subs def __forced_printings(self, info_dict, filename, incomplete): def print_mandatory(field): if (self.params.get('force%s' % field, False) and (not incomplete or info_dict.get(field) is not None)): self.to_stdout(info_dict[field]) def print_optional(field): if (self.params.get('force%s' % field, False) and info_dict.get(field) is not None): self.to_stdout(info_dict[field]) print_mandatory('title') print_mandatory('id') if self.params.get('forceurl', False) and not incomplete: if info_dict.get('requested_formats') is not None: for f in info_dict['requested_formats']: self.to_stdout(f['url'] + f.get('play_path', '')) else: # For RTMP URLs, also include the playpath self.to_stdout(info_dict['url'] + info_dict.get('play_path', '')) print_optional('thumbnail') print_optional('description') if self.params.get('forcefilename', False) and filename is not None: self.to_stdout(filename) if self.params.get('forceduration', False) and info_dict.get('duration') is not None: self.to_stdout(formatSeconds(info_dict['duration'])) print_mandatory('format') if self.params.get('forcejson', False): self.to_stdout(json.dumps(info_dict)) def process_info(self, info_dict): """Process a single resolved IE result.""" assert info_dict.get('_type', 'video') == 'video' max_downloads = self.params.get('max_downloads') if max_downloads is not None: if self._num_downloads >= int(max_downloads): raise MaxDownloadsReached() # TODO: backward compatibility, to be removed info_dict['fulltitle'] = info_dict['title'] if 'format' not in info_dict: info_dict['format'] = info_dict['ext'] reason = self._match_entry(info_dict, incomplete=False) if reason is not None: self.to_screen('[download] ' + reason) return self._num_downloads += 1 info_dict['_filename'] = filename = self.prepare_filename(info_dict) # Forced printings self.__forced_printings(info_dict, filename, incomplete=False) # Do nothing else if in simulate mode if self.params.get('simulate', False): return if filename is None: return def ensure_dir_exists(path): try: dn = os.path.dirname(path) if dn and not os.path.exists(dn): os.makedirs(dn) return True except (OSError, IOError) as err: if isinstance(err, OSError) and err.errno == errno.EEXIST: return True self.report_error('unable to create directory ' + error_to_compat_str(err)) return False if not ensure_dir_exists(sanitize_path(encodeFilename(filename))): return if self.params.get('writedescription', False): descfn = replace_extension(filename, 'description', info_dict.get('ext')) if self.params.get('nooverwrites', False) and os.path.exists(encodeFilename(descfn)): self.to_screen('[info] Video description is already present') elif info_dict.get('description') is None: self.report_warning('There\'s no description to write.') else: try: self.to_screen('[info] Writing video description to: ' + descfn) with io.open(encodeFilename(descfn), 'w', encoding='utf-8') as descfile: descfile.write(info_dict['description']) except (OSError, IOError): self.report_error('Cannot write description file ' + descfn) return if self.params.get('writeannotations', False): annofn = replace_extension(filename, 'annotations.xml', info_dict.get('ext')) if self.params.get('nooverwrites', False) and os.path.exists(encodeFilename(annofn)): self.to_screen('[info] Video annotations are already present') elif not info_dict.get('annotations'): self.report_warning('There are no annotations to write.') else: try: self.to_screen('[info] Writing video annotations to: ' + annofn) with io.open(encodeFilename(annofn), 'w', encoding='utf-8') as annofile: annofile.write(info_dict['annotations']) except (KeyError, TypeError): self.report_warning('There are no annotations to write.') except (OSError, IOError): self.report_error('Cannot write annotations file: ' + annofn) return subtitles_are_requested = any([self.params.get('writesubtitles', False), self.params.get('writeautomaticsub')]) if subtitles_are_requested and info_dict.get('requested_subtitles'): # subtitles download errors are already managed as troubles in relevant IE # that way it will silently go on when used with unsupporting IE subtitles = info_dict['requested_subtitles'] ie = self.get_info_extractor(info_dict['extractor_key']) for sub_lang, sub_info in subtitles.items(): sub_format = sub_info['ext'] sub_filename = subtitles_filename(filename, sub_lang, sub_format, info_dict.get('ext')) if self.params.get('nooverwrites', False) and os.path.exists(encodeFilename(sub_filename)): self.to_screen('[info] Video subtitle %s.%s is already present' % (sub_lang, sub_format)) else: self.to_screen('[info] Writing video subtitles to: ' + sub_filename) if sub_info.get('data') is not None: try: # Use newline='' to prevent conversion of newline characters # See https://github.com/ytdl-org/youtube-dl/issues/10268 with io.open(encodeFilename(sub_filename), 'w', encoding='utf-8', newline='') as subfile: subfile.write(sub_info['data']) except (OSError, IOError): self.report_error('Cannot write subtitles file ' + sub_filename) return else: try: sub_data = ie._request_webpage( sub_info['url'], info_dict['id'], note=False).read() with io.open(encodeFilename(sub_filename), 'wb') as subfile: subfile.write(sub_data) except (ExtractorError, IOError, OSError, ValueError) as err: self.report_warning('Unable to download subtitle for "%s": %s' % (sub_lang, error_to_compat_str(err))) continue if self.params.get('writeinfojson', False): infofn = replace_extension(filename, 'info.json', info_dict.get('ext')) if self.params.get('nooverwrites', False) and os.path.exists(encodeFilename(infofn)): self.to_screen('[info] Video description metadata is already present') else: self.to_screen('[info] Writing video description metadata as JSON to: ' + infofn) try: write_json_file(self.filter_requested_info(info_dict), infofn) except (OSError, IOError): self.report_error('Cannot write metadata to JSON file ' + infofn) return self._write_thumbnails(info_dict, filename) if not self.params.get('skip_download', False): try: def dl(name, info): fd = get_suitable_downloader(info, self.params)(self, self.params) for ph in self._progress_hooks: fd.add_progress_hook(ph) if self.params.get('verbose'): self.to_screen('[debug] Invoking downloader on %r' % info.get('url')) return fd.download(name, info) if info_dict.get('requested_formats') is not None: downloaded = [] success = True merger = FFmpegMergerPP(self) if not merger.available: postprocessors = [] self.report_warning('You have requested multiple ' 'formats but ffmpeg or avconv are not installed.' ' The formats won\'t be merged.') else: postprocessors = [merger] def compatible_formats(formats): video, audio = formats # Check extension video_ext, audio_ext = video.get('ext'), audio.get('ext') if video_ext and audio_ext: COMPATIBLE_EXTS = ( ('mp3', 'mp4', 'm4a', 'm4p', 'm4b', 'm4r', 'm4v', 'ismv', 'isma'), ('webm') ) for exts in COMPATIBLE_EXTS: if video_ext in exts and audio_ext in exts: return True # TODO: Check acodec/vcodec return False filename_real_ext = os.path.splitext(filename)[1][1:] filename_wo_ext = ( os.path.splitext(filename)[0] if filename_real_ext == info_dict['ext'] else filename) requested_formats = info_dict['requested_formats'] if self.params.get('merge_output_format') is None and not compatible_formats(requested_formats): info_dict['ext'] = 'mkv' self.report_warning( 'Requested formats are incompatible for merge and will be merged into mkv.') # Ensure filename always has a correct extension for successful merge filename = '%s.%s' % (filename_wo_ext, info_dict['ext']) if os.path.exists(encodeFilename(filename)): self.to_screen( '[download] %s has already been downloaded and ' 'merged' % filename) else: for f in requested_formats: new_info = dict(info_dict) new_info.update(f) fname = prepend_extension( self.prepare_filename(new_info), 'f%s' % f['format_id'], new_info['ext']) if not ensure_dir_exists(fname): return downloaded.append(fname) partial_success = dl(fname, new_info) success = success and partial_success info_dict['__postprocessors'] = postprocessors info_dict['__files_to_merge'] = downloaded else: # Just a single file success = dl(filename, info_dict) except (compat_urllib_error.URLError, compat_http_client.HTTPException, socket.error) as err: self.report_error('unable to download video data: %s' % error_to_compat_str(err)) return except (OSError, IOError) as err: raise UnavailableVideoError(err) except (ContentTooShortError, ) as err: self.report_error('content too short (expected %s bytes and served %s)' % (err.expected, err.downloaded)) return if success and filename != '-': # Fixup content fixup_policy = self.params.get('fixup') if fixup_policy is None: fixup_policy = 'detect_or_warn' INSTALL_FFMPEG_MESSAGE = 'Install ffmpeg or avconv to fix this automatically.' stretched_ratio = info_dict.get('stretched_ratio') if stretched_ratio is not None and stretched_ratio != 1: if fixup_policy == 'warn': self.report_warning('%s: Non-uniform pixel ratio (%s)' % ( info_dict['id'], stretched_ratio)) elif fixup_policy == 'detect_or_warn': stretched_pp = FFmpegFixupStretchedPP(self) if stretched_pp.available: info_dict.setdefault('__postprocessors', []) info_dict['__postprocessors'].append(stretched_pp) else: self.report_warning( '%s: Non-uniform pixel ratio (%s). %s' % (info_dict['id'], stretched_ratio, INSTALL_FFMPEG_MESSAGE)) else: assert fixup_policy in ('ignore', 'never') if (info_dict.get('requested_formats') is None and info_dict.get('container') == 'm4a_dash'): if fixup_policy == 'warn': self.report_warning( '%s: writing DASH m4a. ' 'Only some players support this container.' % info_dict['id']) elif fixup_policy == 'detect_or_warn': fixup_pp = FFmpegFixupM4aPP(self) if fixup_pp.available: info_dict.setdefault('__postprocessors', []) info_dict['__postprocessors'].append(fixup_pp) else: self.report_warning( '%s: writing DASH m4a. ' 'Only some players support this container. %s' % (info_dict['id'], INSTALL_FFMPEG_MESSAGE)) else: assert fixup_policy in ('ignore', 'never') if (info_dict.get('protocol') == 'm3u8_native' or info_dict.get('protocol') == 'm3u8' and self.params.get('hls_prefer_native')): if fixup_policy == 'warn': self.report_warning('%s: malformed AAC bitstream detected.' % ( info_dict['id'])) elif fixup_policy == 'detect_or_warn': fixup_pp = FFmpegFixupM3u8PP(self) if fixup_pp.available: info_dict.setdefault('__postprocessors', []) info_dict['__postprocessors'].append(fixup_pp) else: self.report_warning( '%s: malformed AAC bitstream detected. %s' % (info_dict['id'], INSTALL_FFMPEG_MESSAGE)) else: assert fixup_policy in ('ignore', 'never') try: self.post_process(filename, info_dict) except (PostProcessingError) as err: self.report_error('postprocessing: %s' % str(err)) return self.record_download_archive(info_dict) def download(self, url_list): """Download a given list of URLs.""" outtmpl = self.params.get('outtmpl', DEFAULT_OUTTMPL) if (len(url_list) > 1 and outtmpl != '-' and '%' not in outtmpl and self.params.get('max_downloads') != 1): raise SameFileError(outtmpl) for url in url_list: try: # It also downloads the videos res = self.extract_info( url, force_generic_extractor=self.params.get('force_generic_extractor', False)) except UnavailableVideoError: self.report_error('unable to download video') except MaxDownloadsReached: self.to_screen('[info] Maximum number of downloaded files reached.') raise else: if self.params.get('dump_single_json', False): self.to_stdout(json.dumps(res)) return self._download_retcode def download_with_info_file(self, info_filename): with contextlib.closing(fileinput.FileInput( [info_filename], mode='r', openhook=fileinput.hook_encoded('utf-8'))) as f: # FileInput doesn't have a read method, we can't call json.load info = self.filter_requested_info(json.loads('\n'.join(f))) try: self.process_ie_result(info, download=True) except DownloadError: webpage_url = info.get('webpage_url') if webpage_url is not None: self.report_warning('The info failed to download, trying with "%s"' % webpage_url) return self.download([webpage_url]) else: raise return self._download_retcode @staticmethod def filter_requested_info(info_dict): return dict( (k, v) for k, v in info_dict.items() if k not in ['requested_formats', 'requested_subtitles']) def post_process(self, filename, ie_info): """Run all the postprocessors on the given file.""" info = dict(ie_info) info['filepath'] = filename pps_chain = [] if ie_info.get('__postprocessors') is not None: pps_chain.extend(ie_info['__postprocessors']) pps_chain.extend(self._pps) for pp in pps_chain: files_to_delete = [] try: files_to_delete, info = pp.run(info) except PostProcessingError as e: self.report_error(e.msg) if files_to_delete and not self.params.get('keepvideo', False): for old_filename in files_to_delete: self.to_screen('Deleting original file %s (pass -k to keep)' % old_filename) try: os.remove(encodeFilename(old_filename)) except (IOError, OSError): self.report_warning('Unable to remove downloaded original file') def _make_archive_id(self, info_dict): video_id = info_dict.get('id') if not video_id: return # Future-proof against any change in case # and backwards compatibility with prior versions extractor = info_dict.get('extractor_key') or info_dict.get('ie_key') # key in a playlist if extractor is None: url = str_or_none(info_dict.get('url')) if not url: return # Try to find matching extractor for the URL and take its ie_key for ie in self._ies: if ie.suitable(url): extractor = ie.ie_key() break else: return return extractor.lower() + ' ' + video_id def in_download_archive(self, info_dict): fn = self.params.get('download_archive') if fn is None: return False vid_id = self._make_archive_id(info_dict) if not vid_id: return False # Incomplete video information try: with locked_file(fn, 'r', encoding='utf-8') as archive_file: for line in archive_file: if line.strip() == vid_id: return True except IOError as ioe: if ioe.errno != errno.ENOENT: raise return False def record_download_archive(self, info_dict): fn = self.params.get('download_archive') if fn is None: return vid_id = self._make_archive_id(info_dict) assert vid_id with locked_file(fn, 'a', encoding='utf-8') as archive_file: archive_file.write(vid_id + '\n') @staticmethod def format_resolution(format, default='unknown'): if format.get('vcodec') == 'none': return 'audio only' if format.get('resolution') is not None: return format['resolution'] if format.get('height') is not None: if format.get('width') is not None: res = '%sx%s' % (format['width'], format['height']) else: res = '%sp' % format['height'] elif format.get('width') is not None: res = '%dx?' % format['width'] else: res = default return res def _format_note(self, fdict): res = '' if fdict.get('ext') in ['f4f', 'f4m']: res += '(unsupported) ' if fdict.get('language'): if res: res += ' ' res += '[%s] ' % fdict['language'] if fdict.get('format_note') is not None: res += fdict['format_note'] + ' ' if fdict.get('tbr') is not None: res += '%4dk ' % fdict['tbr'] if fdict.get('container') is not None: if res: res += ', ' res += '%s container' % fdict['container'] if (fdict.get('vcodec') is not None and fdict.get('vcodec') != 'none'): if res: res += ', ' res += fdict['vcodec'] if fdict.get('vbr') is not None: res += '@' elif fdict.get('vbr') is not None and fdict.get('abr') is not None: res += 'video@' if fdict.get('vbr') is not None: res += '%4dk' % fdict['vbr'] if fdict.get('fps') is not None: if res: res += ', ' res += '%sfps' % fdict['fps'] if fdict.get('acodec') is not None: if res: res += ', ' if fdict['acodec'] == 'none': res += 'video only' else: res += '%-5s' % fdict['acodec'] elif fdict.get('abr') is not None: if res: res += ', ' res += 'audio' if fdict.get('abr') is not None: res += '@%3dk' % fdict['abr'] if fdict.get('asr') is not None: res += ' (%5dHz)' % fdict['asr'] if fdict.get('filesize') is not None: if res: res += ', ' res += format_bytes(fdict['filesize']) elif fdict.get('filesize_approx') is not None: if res: res += ', ' res += '~' + format_bytes(fdict['filesize_approx']) return res def list_formats(self, info_dict): formats = info_dict.get('formats', [info_dict]) table = [ [f['format_id'], f['ext'], self.format_resolution(f), self._format_note(f)] for f in formats if f.get('preference') is None or f['preference'] >= -1000] if len(formats) > 1: table[-1][-1] += (' ' if table[-1][-1] else '') + '(best)' header_line = ['format code', 'extension', 'resolution', 'note'] self.to_screen( '[info] Available formats for %s:\n%s' % (info_dict['id'], render_table(header_line, table))) def list_thumbnails(self, info_dict): thumbnails = info_dict.get('thumbnails') if not thumbnails: self.to_screen('[info] No thumbnails present for %s' % info_dict['id']) return self.to_screen( '[info] Thumbnails for %s:' % info_dict['id']) self.to_screen(render_table( ['ID', 'width', 'height', 'URL'], [[t['id'], t.get('width', 'unknown'), t.get('height', 'unknown'), t['url']] for t in thumbnails])) def list_subtitles(self, video_id, subtitles, name='subtitles'): if not subtitles: self.to_screen('%s has no %s' % (video_id, name)) return self.to_screen( 'Available %s for %s:' % (name, video_id)) self.to_screen(render_table( ['Language', 'formats'], [[lang, ', '.join(f['ext'] for f in reversed(formats))] for lang, formats in subtitles.items()])) def urlopen(self, req): """ Start an HTTP download """ if isinstance(req, compat_basestring): req = sanitized_Request(req) return self._opener.open(req, timeout=self._socket_timeout) def print_debug_header(self): if not self.params.get('verbose'): return if type('') is not compat_str: # Python 2.6 on SLES11 SP1 (https://github.com/ytdl-org/youtube-dl/issues/3326) self.report_warning( 'Your Python is broken! Update to a newer and supported version') stdout_encoding = getattr( sys.stdout, 'encoding', 'missing (%s)' % type(sys.stdout).__name__) encoding_str = ( '[debug] Encodings: locale %s, fs %s, out %s, pref %s\n' % ( locale.getpreferredencoding(), sys.getfilesystemencoding(), stdout_encoding, self.get_encoding())) write_string(encoding_str, encoding=None) self._write_string('[debug] youtube-dl version ' + __version__ + '\n') if _LAZY_LOADER: self._write_string('[debug] Lazy loading extractors enabled' + '\n') try: sp = subprocess.Popen( ['git', 'rev-parse', '--short', 'HEAD'], stdout=subprocess.PIPE, stderr=subprocess.PIPE, cwd=os.path.dirname(os.path.abspath(__file__))) out, err = sp.communicate() out = out.decode().strip() if re.match('[0-9a-f]+', out): self._write_string('[debug] Git HEAD: ' + out + '\n') except Exception: try: sys.exc_clear() except Exception: pass def python_implementation(): impl_name = platform.python_implementation() if impl_name == 'PyPy' and hasattr(sys, 'pypy_version_info'): return impl_name + ' version %d.%d.%d' % sys.pypy_version_info[:3] return impl_name self._write_string('[debug] Python version %s (%s) - %s\n' % ( platform.python_version(), python_implementation(), platform_name())) exe_versions = FFmpegPostProcessor.get_versions(self) exe_versions['rtmpdump'] = rtmpdump_version() exe_versions['phantomjs'] = PhantomJSwrapper._version() exe_str = ', '.join( '%s %s' % (exe, v) for exe, v in sorted(exe_versions.items()) if v ) if not exe_str: exe_str = 'none' self._write_string('[debug] exe versions: %s\n' % exe_str) proxy_map = {} for handler in self._opener.handlers: if hasattr(handler, 'proxies'): proxy_map.update(handler.proxies) self._write_string('[debug] Proxy map: ' + compat_str(proxy_map) + '\n') if self.params.get('call_home', False): ipaddr = self.urlopen('https://yt-dl.org/ip').read().decode('utf-8') self._write_string('[debug] Public IP address: %s\n' % ipaddr) latest_version = self.urlopen( 'https://yt-dl.org/latest/version').read().decode('utf-8') if version_tuple(latest_version) > version_tuple(__version__): self.report_warning( 'You are using an outdated version (newest version: %s)! ' 'See https://yt-dl.org/update if you need help updating.' % latest_version) def _setup_opener(self): timeout_val = self.params.get('socket_timeout') self._socket_timeout = 600 if timeout_val is None else float(timeout_val) opts_cookiefile = self.params.get('cookiefile') opts_proxy = self.params.get('proxy') if opts_cookiefile is None: self.cookiejar = compat_cookiejar.CookieJar() else: opts_cookiefile = expand_path(opts_cookiefile) self.cookiejar = YoutubeDLCookieJar(opts_cookiefile) if os.access(opts_cookiefile, os.R_OK): self.cookiejar.load(ignore_discard=True, ignore_expires=True) cookie_processor = YoutubeDLCookieProcessor(self.cookiejar) if opts_proxy is not None: if opts_proxy == '': proxies = {} else: proxies = {'http': opts_proxy, 'https': opts_proxy} else: proxies = compat_urllib_request.getproxies() # Set HTTPS proxy to HTTP one if given (https://github.com/ytdl-org/youtube-dl/issues/805) if 'http' in proxies and 'https' not in proxies: proxies['https'] = proxies['http'] proxy_handler = PerRequestProxyHandler(proxies) debuglevel = 1 if self.params.get('debug_printtraffic') else 0 https_handler = make_HTTPS_handler(self.params, debuglevel=debuglevel) ydlh = YoutubeDLHandler(self.params, debuglevel=debuglevel) redirect_handler = YoutubeDLRedirectHandler() data_handler = compat_urllib_request_DataHandler() # When passing our own FileHandler instance, build_opener won't add the # default FileHandler and allows us to disable the file protocol, which # can be used for malicious purposes (see # https://github.com/ytdl-org/youtube-dl/issues/8227) file_handler = compat_urllib_request.FileHandler() def file_open(*args, **kwargs): raise compat_urllib_error.URLError('file:// scheme is explicitly disabled in youtube-dl for security reasons') file_handler.file_open = file_open opener = compat_urllib_request.build_opener( proxy_handler, https_handler, cookie_processor, ydlh, redirect_handler, data_handler, file_handler) # Delete the default user-agent header, which would otherwise apply in # cases where our custom HTTP handler doesn't come into play # (See https://github.com/ytdl-org/youtube-dl/issues/1309 for details) opener.addheaders = [] self._opener = opener def encode(self, s): if isinstance(s, bytes): return s # Already encoded try: return s.encode(self.get_encoding()) except UnicodeEncodeError as err: err.reason = err.reason + '. Check your system encoding configuration or use the --encoding option.' raise def get_encoding(self): encoding = self.params.get('encoding') if encoding is None: encoding = preferredencoding() return encoding def _write_thumbnails(self, info_dict, filename): if self.params.get('writethumbnail', False): thumbnails = info_dict.get('thumbnails') if thumbnails: thumbnails = [thumbnails[-1]] elif self.params.get('write_all_thumbnails', False): thumbnails = info_dict.get('thumbnails') else: return if not thumbnails: # No thumbnails present, so return immediately return for t in thumbnails: thumb_ext = determine_ext(t['url'], 'jpg') suffix = '_%s' % t['id'] if len(thumbnails) > 1 else '' thumb_display_id = '%s ' % t['id'] if len(thumbnails) > 1 else '' t['filename'] = thumb_filename = replace_extension(filename + suffix, thumb_ext, info_dict.get('ext')) if self.params.get('nooverwrites', False) and os.path.exists(encodeFilename(thumb_filename)): self.to_screen('[%s] %s: Thumbnail %sis already present' % (info_dict['extractor'], info_dict['id'], thumb_display_id)) else: self.to_screen('[%s] %s: Downloading thumbnail %s...' % (info_dict['extractor'], info_dict['id'], thumb_display_id)) try: uf = self.urlopen(t['url']) with open(encodeFilename(thumb_filename), 'wb') as thumbf: shutil.copyfileobj(uf, thumbf) self.to_screen('[%s] %s: Writing thumbnail %sto: %s' % (info_dict['extractor'], info_dict['id'], thumb_display_id, thumb_filename)) except (compat_urllib_error.URLError, compat_http_client.HTTPException, socket.error) as err: self.report_warning('Unable to download thumbnail "%s": %s' % (t['url'], error_to_compat_str(err)))
45.727679
194
0.557267
from __future__ import absolute_import, unicode_literals import collections import contextlib import copy import datetime import errno import fileinput import io import itertools import json import locale import operator import os import platform import re import shutil import subprocess import socket import sys import time import tokenize import traceback import random from string import ascii_letters from .compat import ( compat_basestring, compat_cookiejar, compat_get_terminal_size, compat_http_client, compat_kwargs, compat_numeric_types, compat_os_name, compat_str, compat_tokenize_tokenize, compat_urllib_error, compat_urllib_request, compat_urllib_request_DataHandler, ) from .utils import ( age_restricted, args_to_str, ContentTooShortError, date_from_str, DateRange, DEFAULT_OUTTMPL, determine_ext, determine_protocol, DownloadError, encode_compat_str, encodeFilename, error_to_compat_str, expand_path, ExtractorError, format_bytes, formatSeconds, GeoRestrictedError, int_or_none, ISO3166Utils, locked_file, make_HTTPS_handler, MaxDownloadsReached, orderedSet, PagedList, parse_filesize, PerRequestProxyHandler, platform_name, PostProcessingError, preferredencoding, prepend_extension, register_socks_protocols, render_table, replace_extension, SameFileError, sanitize_filename, sanitize_path, sanitize_url, sanitized_Request, std_headers, str_or_none, subtitles_filename, UnavailableVideoError, url_basename, version_tuple, write_json_file, write_string, YoutubeDLCookieJar, YoutubeDLCookieProcessor, YoutubeDLHandler, YoutubeDLRedirectHandler, ) from .cache import Cache from .extractor import get_info_extractor, gen_extractor_classes, _LAZY_LOADER from .extractor.openload import PhantomJSwrapper from .downloader import get_suitable_downloader from .downloader.rtmp import rtmpdump_version from .postprocessor import ( FFmpegFixupM3u8PP, FFmpegFixupM4aPP, FFmpegFixupStretchedPP, FFmpegMergerPP, FFmpegPostProcessor, get_postprocessor, ) from .version import __version__ if compat_os_name == 'nt': import ctypes class YoutubeDL(object): _NUMERIC_FIELDS = set(( 'width', 'height', 'tbr', 'abr', 'asr', 'vbr', 'fps', 'filesize', 'filesize_approx', 'timestamp', 'upload_year', 'upload_month', 'upload_day', 'duration', 'view_count', 'like_count', 'dislike_count', 'repost_count', 'average_rating', 'comment_count', 'age_limit', 'start_time', 'end_time', 'chapter_number', 'season_number', 'episode_number', 'track_number', 'disc_number', 'release_year', 'playlist_index', )) params = None _ies = [] _pps = [] _download_retcode = None _num_downloads = None _playlist_level = 0 _playlist_urls = set() _screen_file = None def __init__(self, params=None, auto_init=True): if params is None: params = {} self._ies = [] self._ies_instances = {} self._pps = [] self._progress_hooks = [] self._download_retcode = 0 self._num_downloads = 0 self._screen_file = [sys.stdout, sys.stderr][params.get('logtostderr', False)] self._err_file = sys.stderr self.params = { 'nocheckcertificate': False, } self.params.update(params) self.cache = Cache(self) def check_deprecated(param, option, suggestion): if self.params.get(param) is not None: self.report_warning( '%s is deprecated. Use %s instead.' % (option, suggestion)) return True return False if check_deprecated('cn_verification_proxy', '--cn-verification-proxy', '--geo-verification-proxy'): if self.params.get('geo_verification_proxy') is None: self.params['geo_verification_proxy'] = self.params['cn_verification_proxy'] check_deprecated('autonumber_size', '--autonumber-size', 'output template with %(autonumber)0Nd, where N in the number of digits') check_deprecated('autonumber', '--auto-number', '-o "%(autonumber)s-%(title)s.%(ext)s"') check_deprecated('usetitle', '--title', '-o "%(title)s-%(id)s.%(ext)s"') if params.get('bidi_workaround', False): try: import pty master, slave = pty.openpty() width = compat_get_terminal_size().columns if width is None: width_args = [] else: width_args = ['-w', str(width)] sp_kwargs = dict( stdin=subprocess.PIPE, stdout=slave, stderr=self._err_file) try: self._output_process = subprocess.Popen( ['bidiv'] + width_args, **sp_kwargs ) except OSError: self._output_process = subprocess.Popen( ['fribidi', '-c', 'UTF-8'] + width_args, **sp_kwargs) self._output_channel = os.fdopen(master, 'rb') except OSError as ose: if ose.errno == errno.ENOENT: self.report_warning('Could not find fribidi executable, ignoring --bidi-workaround . Make sure that fribidi is an executable file in one of the directories in your $PATH.') else: raise if (sys.platform != 'win32' and sys.getfilesystemencoding() in ['ascii', 'ANSI_X3.4-1968'] and not params.get('restrictfilenames', False)): ort_warning( 'Assuming --restrict-filenames since file system encoding ' 'cannot encode all characters. ' 'Set the LC_ALL environment variable to fix this.') self.params['restrictfilenames'] = True if isinstance(params.get('outtmpl'), bytes): self.report_warning( 'Parameter outtmpl is bytes, but should be a unicode string. ' 'Put from __future__ import unicode_literals at the top of your code file or consider switching to Python 3.x.') self._setup_opener() if auto_init: self.print_debug_header() self.add_default_info_extractors() for pp_def_raw in self.params.get('postprocessors', []): pp_class = get_postprocessor(pp_def_raw['key']) pp_def = dict(pp_def_raw) del pp_def['key'] pp = pp_class(self, **compat_kwargs(pp_def)) self.add_post_processor(pp) for ph in self.params.get('progress_hooks', []): self.add_progress_hook(ph) register_socks_protocols() def warn_if_short_id(self, argv): idxs = [ i for i, a in enumerate(argv) if re.match(r'^-[0-9A-Za-z_-]{10}$', a)] if idxs: correct_argv = ( ['youtube-dl'] + [a for i, a in enumerate(argv) if i not in idxs] + ['--'] + [argv[i] for i in idxs] ) self.report_warning( 'Long argument string detected. ' 'Use -- to separate parameters and URLs, like this:\n%s\n' % args_to_str(correct_argv)) def add_info_extractor(self, ie): self._ies.append(ie) if not isinstance(ie, type): self._ies_instances[ie.ie_key()] = ie ie.set_downloader(self) def get_info_extractor(self, ie_key): ie = self._ies_instances.get(ie_key) if ie is None: ie = get_info_extractor(ie_key)() self.add_info_extractor(ie) return ie def add_default_info_extractors(self): for ie in gen_extractor_classes(): self.add_info_extractor(ie) def add_post_processor(self, pp): self._pps.append(pp) pp.set_downloader(self) def add_progress_hook(self, ph): self._progress_hooks.append(ph) def _bidi_workaround(self, message): if not hasattr(self, '_output_channel'): return message assert hasattr(self, '_output_process') assert isinstance(message, compat_str) line_count = message.count('\n') + 1 self._output_process.stdin.write((message + '\n').encode('utf-8')) self._output_process.stdin.flush() res = ''.join(self._output_channel.readline().decode('utf-8') for _ in range(line_count)) return res[:-len('\n')] def to_screen(self, message, skip_eol=False): return self.to_stdout(message, skip_eol, check_quiet=True) def _write_string(self, s, out=None): write_string(s, out=out, encoding=self.params.get('encoding')) def to_stdout(self, message, skip_eol=False, check_quiet=False): if self.params.get('logger'): self.params['logger'].debug(message) elif not check_quiet or not self.params.get('quiet', False): message = self._bidi_workaround(message) terminator = ['\n', ''][skip_eol] output = message + terminator self._write_string(output, self._screen_file) def to_stderr(self, message): assert isinstance(message, compat_str) if self.params.get('logger'): self.params['logger'].error(message) else: message = self._bidi_workaround(message) output = message + '\n' self._write_string(output, self._err_file) def to_console_title(self, message): if not self.params.get('consoletitle', False): return if compat_os_name == 'nt': if ctypes.windll.kernel32.GetConsoleWindow(): ctypes.windll.kernel32.SetConsoleTitleW(ctypes.c_wchar_p(message)) elif 'TERM' in os.environ: self._write_string('\033]0;%s\007' % message, self._screen_file) def save_console_title(self): if not self.params.get('consoletitle', False): return if self.params.get('simulate', False): return if compat_os_name != 'nt' and 'TERM' in os.environ: self._write_string('\033[22;0t', self._screen_file) def restore_console_title(self): if not self.params.get('consoletitle', False): return if self.params.get('simulate', False): return if compat_os_name != 'nt' and 'TERM' in os.environ: self._write_string('\033[23;0t', self._screen_file) def __enter__(self): self.save_console_title() return self def __exit__(self, *args): self.restore_console_title() if self.params.get('cookiefile') is not None: self.cookiejar.save(ignore_discard=True, ignore_expires=True) def trouble(self, message=None, tb=None): if message is not None: self.to_stderr(message) if self.params.get('verbose'): if tb is None: if sys.exc_info()[0]: tb = '' if hasattr(sys.exc_info()[1], 'exc_info') and sys.exc_info()[1].exc_info[0]: tb += ''.join(traceback.format_exception(*sys.exc_info()[1].exc_info)) tb += encode_compat_str(traceback.format_exc()) else: tb_data = traceback.format_list(traceback.extract_stack()) tb = ''.join(tb_data) self.to_stderr(tb) if not self.params.get('ignoreerrors', False): if sys.exc_info()[0] and hasattr(sys.exc_info()[1], 'exc_info') and sys.exc_info()[1].exc_info[0]: exc_info = sys.exc_info()[1].exc_info else: exc_info = sys.exc_info() raise DownloadError(message, exc_info) self._download_retcode = 1 def report_warning(self, message): if self.params.get('logger') is not None: self.params['logger'].warning(message) else: if self.params.get('no_warnings'): return if not self.params.get('no_color') and self._err_file.isatty() and compat_os_name != 'nt': _msg_header = '\033[0;33mWARNING:\033[0m' else: _msg_header = 'WARNING:' warning_message = '%s %s' % (_msg_header, message) self.to_stderr(warning_message) def report_error(self, message, tb=None): if not self.params.get('no_color') and self._err_file.isatty() and compat_os_name != 'nt': _msg_header = '\033[0;31mERROR:\033[0m' else: _msg_header = 'ERROR:' error_message = '%s %s' % (_msg_header, message) self.trouble(error_message, tb) def report_file_already_downloaded(self, file_name): try: self.to_screen('[download] %s has already been downloaded' % file_name) except UnicodeEncodeError: self.to_screen('[download] The file has already been downloaded') def prepare_filename(self, info_dict): try: template_dict = dict(info_dict) template_dict['epoch'] = int(time.time()) autonumber_size = self.params.get('autonumber_size') if autonumber_size is None: autonumber_size = 5 template_dict['autonumber'] = self.params.get('autonumber_start', 1) - 1 + self._num_downloads if template_dict.get('resolution') is None: if template_dict.get('width') and template_dict.get('height'): template_dict['resolution'] = '%dx%d' % (template_dict['width'], template_dict['height']) elif template_dict.get('height'): template_dict['resolution'] = '%sp' % template_dict['height'] elif template_dict.get('width'): template_dict['resolution'] = '%dx?' % template_dict['width'] sanitize = lambda k, v: sanitize_filename( compat_str(v), restricted=self.params.get('restrictfilenames'), is_id=(k == 'id' or k.endswith('_id'))) template_dict = dict((k, v if isinstance(v, compat_numeric_types) else sanitize(k, v)) for k, v in template_dict.items() if v is not None and not isinstance(v, (list, tuple, dict))) template_dict = collections.defaultdict(lambda: self.params.get('outtmpl_na_placeholder', 'NA'), template_dict) outtmpl = self.params.get('outtmpl', DEFAULT_OUTTMPL) field_size_compat_map = { 'playlist_index': len(str(template_dict['n_entries'])), 'autonumber': autonumber_size, } FIELD_SIZE_COMPAT_RE = r'(?<!%)%\((?P<field>autonumber|playlist_index)\)s' mobj = re.search(FIELD_SIZE_COMPAT_RE, outtmpl) if mobj: outtmpl = re.sub( FIELD_SIZE_COMPAT_RE, r'%%(\1)0%dd' % field_size_compat_map[mobj.group('field')], outtmpl) for numeric_field in self._NUMERIC_FIELDS: if numeric_field not in template_dict: FORMAT_RE = r'''(?x) (?<!%) % \({0}\) # mapping key (?:[#0\-+ ]+)? # conversion flags (optional) (?:\d+)? # minimum field width (optional) (?:\.\d+)? # precision (optional) [hlL]? # length modifier (optional) [diouxXeEfFgGcrs%] # conversion type ''' outtmpl = re.sub( FORMAT_RE.format(numeric_field), r'%({0})s'.format(numeric_field), outtmpl) sep = ''.join([random.choice(ascii_letters) for _ in range(32)]) outtmpl = outtmpl.replace('%%', '%{0}%'.format(sep)).replace('$$', '${0}$'.format(sep)) # because meta fields may contain env variables we don't want to filename = expand_path(outtmpl).replace(sep, '') % template_dict # filename = os.path.join('out', filename) # print('hychu, The filename is {%s}.{%s}' % (outtmpl, filename)) # Temporary fix for #4787 # 'Treat' all problem characters by passing filename through preferredencoding # to workaround encoding issues with subprocess on python2 @ Windows if sys.version_info < (3, 0) and sys.platform == 'win32': filename = encodeFilename(filename, True).decode(preferredencoding()) return sanitize_path(filename) except ValueError as err: self.report_error('Error in output template: ' + str(err) + ' (encoding: ' + repr(preferredencoding()) + ')') return None def _match_entry(self, info_dict, incomplete): video_title = info_dict.get('title', info_dict.get('id', 'video')) if 'title' in info_dict: # This can happen when we're just evaluating the playlist title = info_dict['title'] matchtitle = self.params.get('matchtitle', False) if matchtitle: if not re.search(matchtitle, title, re.IGNORECASE): return '"' + title + '" title did not match pattern "' + matchtitle + '"' rejecttitle = self.params.get('rejecttitle', False) if rejecttitle: if re.search(rejecttitle, title, re.IGNORECASE): return '"' + title + '" title matched reject pattern "' + rejecttitle + '"' date = info_dict.get('upload_date') if date is not None: dateRange = self.params.get('daterange', DateRange()) if date not in dateRange: return '%s upload date is not in range %s' % (date_from_str(date).isoformat(), dateRange) view_count = info_dict.get('view_count') if view_count is not None: min_views = self.params.get('min_views') if min_views is not None and view_count < min_views: return 'Skipping %s, because it has not reached minimum view count (%d/%d)' % (video_title, view_count, min_views) max_views = self.params.get('max_views') if max_views is not None and view_count > max_views: return 'Skipping %s, because it has exceeded the maximum view count (%d/%d)' % (video_title, view_count, max_views) if age_restricted(info_dict.get('age_limit'), self.params.get('age_limit')): return 'Skipping "%s" because it is age restricted' % video_title if self.in_download_archive(info_dict): return '%s has already been recorded in archive' % video_title if not incomplete: match_filter = self.params.get('match_filter') if match_filter is not None: ret = match_filter(info_dict) if ret is not None: return ret return None @staticmethod def add_extra_info(info_dict, extra_info): for key, value in extra_info.items(): info_dict.setdefault(key, value) def extract_info(self, url, download=True, ie_key=None, extra_info={}, process=True, force_generic_extractor=False): if not ie_key and force_generic_extractor: ie_key = 'Generic' if ie_key: ies = [self.get_info_extractor(ie_key)] else: ies = self._ies for ie in ies: if not ie.suitable(url): continue ie = self.get_info_extractor(ie.ie_key()) if not ie.working(): self.report_warning('The program functionality for this site has been marked as broken, ' 'and will probably not work.') return self.__extract_info(url, ie, download, extra_info, process) else: self.report_error('no suitable InfoExtractor for URL %s' % url) def __handle_extraction_exceptions(func): def wrapper(self, *args, **kwargs): try: return func(self, *args, **kwargs) except GeoRestrictedError as e: msg = e.msg if e.countries: msg += '\nThis video is available in %s.' % ', '.join( map(ISO3166Utils.short2full, e.countries)) msg += '\nYou might want to use a VPN or a proxy server (with --proxy) to workaround.' self.report_error(msg) except ExtractorError as e: self.report_error(compat_str(e), e.format_traceback()) except MaxDownloadsReached: raise except Exception as e: if self.params.get('ignoreerrors', False): self.report_error(error_to_compat_str(e), tb=encode_compat_str(traceback.format_exc())) else: raise return wrapper @__handle_extraction_exceptions def __extract_info(self, url, ie, download, extra_info, process): ie_result = ie.extract(url) if ie_result is None: return if isinstance(ie_result, list): ie_result = { '_type': 'compat_list', 'entries': ie_result, } self.add_default_extra_info(ie_result, ie, url) if process: return self.process_ie_result(ie_result, download, extra_info) else: return ie_result def add_default_extra_info(self, ie_result, ie, url): self.add_extra_info(ie_result, { 'extractor': ie.IE_NAME, 'webpage_url': url, 'webpage_url_basename': url_basename(url), 'extractor_key': ie.ie_key(), }) def process_ie_result(self, ie_result, download=True, extra_info={}): result_type = ie_result.get('_type', 'video') if result_type in ('url', 'url_transparent'): ie_result['url'] = sanitize_url(ie_result['url']) extract_flat = self.params.get('extract_flat', False) if ((extract_flat == 'in_playlist' and 'playlist' in extra_info) or extract_flat is True): self.__forced_printings( ie_result, self.prepare_filename(ie_result), incomplete=True) return ie_result if result_type == 'video': self.add_extra_info(ie_result, extra_info) return self.process_video_result(ie_result, download=download) elif result_type == 'url': return self.extract_info(ie_result['url'], download, ie_key=ie_result.get('ie_key'), extra_info=extra_info) elif result_type == 'url_transparent': info = self.extract_info( ie_result['url'], ie_key=ie_result.get('ie_key'), extra_info=extra_info, download=False, process=False) # in this case if not info: return info force_properties = dict( (k, v) for k, v in ie_result.items() if v is not None) for f in ('_type', 'url', 'id', 'extractor', 'extractor_key', 'ie_key'): if f in force_properties: del force_properties[f] new_result = info.copy() new_result.update(force_properties) # Extracted info may not be a video result (i.e. # info.get('_type', 'video') != video) but rather an url or # url_transparent. In such cases outer metadata (from ie_result) # should be propagated to inner one (info). For this to happen # _type of info should be overridden with url_transparent. This # fixes issue from https://github.com/ytdl-org/youtube-dl/pull/11163. if new_result.get('_type') == 'url': new_result['_type'] = 'url_transparent' return self.process_ie_result( new_result, download=download, extra_info=extra_info) elif result_type in ('playlist', 'multi_video'): # Protect from infinite recursion due to recursively nested playlists # (see https://github.com/ytdl-org/youtube-dl/issues/27833) webpage_url = ie_result['webpage_url'] if webpage_url in self._playlist_urls: self.to_screen( '[download] Skipping already downloaded playlist: %s' % ie_result.get('title') or ie_result.get('id')) return self._playlist_level += 1 self._playlist_urls.add(webpage_url) try: return self.__process_playlist(ie_result, download) finally: self._playlist_level -= 1 if not self._playlist_level: self._playlist_urls.clear() elif result_type == 'compat_list': self.report_warning( 'Extractor %s returned a compat_list result. ' 'It needs to be updated.' % ie_result.get('extractor')) def _fixup(r): self.add_extra_info( r, { 'extractor': ie_result['extractor'], 'webpage_url': ie_result['webpage_url'], 'webpage_url_basename': url_basename(ie_result['webpage_url']), 'extractor_key': ie_result['extractor_key'], } ) return r ie_result['entries'] = [ self.process_ie_result(_fixup(r), download, extra_info) for r in ie_result['entries'] ] return ie_result else: raise Exception('Invalid result type: %s' % result_type) def __process_playlist(self, ie_result, download): # We process each entry in the playlist playlist = ie_result.get('title') or ie_result.get('id') self.to_screen('[download] Downloading playlist: %s' % playlist) playlist_results = [] playliststart = self.params.get('playliststart', 1) - 1 playlistend = self.params.get('playlistend') # For backwards compatibility, interpret -1 as whole list if playlistend == -1: playlistend = None playlistitems_str = self.params.get('playlist_items') playlistitems = None if playlistitems_str is not None: def iter_playlistitems(format): for string_segment in format.split(','): if '-' in string_segment: start, end = string_segment.split('-') for item in range(int(start), int(end) + 1): yield int(item) else: yield int(string_segment) playlistitems = orderedSet(iter_playlistitems(playlistitems_str)) ie_entries = ie_result['entries'] def make_playlistitems_entries(list_ie_entries): num_entries = len(list_ie_entries) return [ list_ie_entries[i - 1] for i in playlistitems if -num_entries <= i - 1 < num_entries] def report_download(num_entries): self.to_screen( '[%s] playlist %s: Downloading %d videos' % (ie_result['extractor'], playlist, num_entries)) if isinstance(ie_entries, list): n_all_entries = len(ie_entries) if playlistitems: entries = make_playlistitems_entries(ie_entries) else: entries = ie_entries[playliststart:playlistend] n_entries = len(entries) self.to_screen( '[%s] playlist %s: Collected %d video ids (downloading %d of them)' % (ie_result['extractor'], playlist, n_all_entries, n_entries)) elif isinstance(ie_entries, PagedList): if playlistitems: entries = [] for item in playlistitems: entries.extend(ie_entries.getslice( item - 1, item )) else: entries = ie_entries.getslice( playliststart, playlistend) n_entries = len(entries) report_download(n_entries) else: # iterable if playlistitems: entries = make_playlistitems_entries(list(itertools.islice( ie_entries, 0, max(playlistitems)))) else: entries = list(itertools.islice( ie_entries, playliststart, playlistend)) n_entries = len(entries) report_download(n_entries) if self.params.get('playlistreverse', False): entries = entries[::-1] if self.params.get('playlistrandom', False): random.shuffle(entries) x_forwarded_for = ie_result.get('__x_forwarded_for_ip') for i, entry in enumerate(entries, 1): self.to_screen('[download] Downloading video %s of %s' % (i, n_entries)) # This __x_forwarded_for_ip thing is a bit ugly but requires # minimal changes if x_forwarded_for: entry['__x_forwarded_for_ip'] = x_forwarded_for extra = { 'n_entries': n_entries, 'playlist': playlist, 'playlist_id': ie_result.get('id'), 'playlist_title': ie_result.get('title'), 'playlist_uploader': ie_result.get('uploader'), 'playlist_uploader_id': ie_result.get('uploader_id'), 'playlist_index': playlistitems[i - 1] if playlistitems else i + playliststart, 'extractor': ie_result['extractor'], 'webpage_url': ie_result['webpage_url'], 'webpage_url_basename': url_basename(ie_result['webpage_url']), 'extractor_key': ie_result['extractor_key'], } reason = self._match_entry(entry, incomplete=True) if reason is not None: self.to_screen('[download] ' + reason) continue entry_result = self.__process_iterable_entry(entry, download, extra) # TODO: skip failed (empty) entries? playlist_results.append(entry_result) ie_result['entries'] = playlist_results self.to_screen('[download] Finished downloading playlist: %s' % playlist) return ie_result @__handle_extraction_exceptions def __process_iterable_entry(self, entry, download, extra_info): return self.process_ie_result( entry, download=download, extra_info=extra_info) def _build_format_filter(self, filter_spec): OPERATORS = { '<': operator.lt, '<=': operator.le, '>': operator.gt, '>=': operator.ge, '=': operator.eq, '!=': operator.ne, } operator_rex = re.compile(r'''(?x)\s* (?P<key>width|height|tbr|abr|vbr|asr|filesize|filesize_approx|fps) \s*(?P<op>%s)(?P<none_inclusive>\s*\?)?\s* (?P<value>[0-9.]+(?:[kKmMgGtTpPeEzZyY]i?[Bb]?)?) $ ''' % '|'.join(map(re.escape, OPERATORS.keys()))) m = operator_rex.search(filter_spec) if m: try: comparison_value = int(m.group('value')) except ValueError: comparison_value = parse_filesize(m.group('value')) if comparison_value is None: comparison_value = parse_filesize(m.group('value') + 'B') if comparison_value is None: raise ValueError( 'Invalid value %r in format specification %r' % ( m.group('value'), filter_spec)) op = OPERATORS[m.group('op')] if not m: STR_OPERATORS = { '=': operator.eq, '^=': lambda attr, value: attr.startswith(value), '$=': lambda attr, value: attr.endswith(value), '*=': lambda attr, value: value in attr, } str_operator_rex = re.compile(r'''(?x) \s*(?P<key>ext|acodec|vcodec|container|protocol|format_id|language) \s*(?P<negation>!\s*)?(?P<op>%s)(?P<none_inclusive>\s*\?)? \s*(?P<value>[a-zA-Z0-9._-]+) \s*$ ''' % '|'.join(map(re.escape, STR_OPERATORS.keys()))) m = str_operator_rex.search(filter_spec) if m: comparison_value = m.group('value') str_op = STR_OPERATORS[m.group('op')] if m.group('negation'): op = lambda attr, value: not str_op(attr, value) else: op = str_op if not m: raise ValueError('Invalid filter specification %r' % filter_spec) def _filter(f): actual_value = f.get(m.group('key')) if actual_value is None: return m.group('none_inclusive') return op(actual_value, comparison_value) return _filter def _default_format_spec(self, info_dict, download=True): def can_merge(): merger = FFmpegMergerPP(self) return merger.available and merger.can_merge() def prefer_best(): if self.params.get('simulate', False): return False if not download: return False if self.params.get('outtmpl', DEFAULT_OUTTMPL) == '-': return True if info_dict.get('is_live'): return True if not can_merge(): return True return False req_format_list = ['bestvideo+bestaudio', 'best'] if prefer_best(): req_format_list.reverse() return '/'.join(req_format_list) def build_format_selector(self, format_spec): def syntax_error(note, start): message = ( 'Invalid format specification: ' '{0}\n\t{1}\n\t{2}^'.format(note, format_spec, ' ' * start[1])) return SyntaxError(message) PICKFIRST = 'PICKFIRST' MERGE = 'MERGE' SINGLE = 'SINGLE' GROUP = 'GROUP' FormatSelector = collections.namedtuple('FormatSelector', ['type', 'selector', 'filters']) def _parse_filter(tokens): filter_parts = [] for type, string, start, _, _ in tokens: if type == tokenize.OP and string == ']': return ''.join(filter_parts) else: filter_parts.append(string) def _remove_unused_ops(tokens): # Remove operators that we don't use and join them with the surrounding strings ALLOWED_OPS = ('/', '+', ',', '(', ')') last_string, last_start, last_end, last_line = None, None, None, None for type, string, start, end, line in tokens: if type == tokenize.OP and string == '[': if last_string: yield tokenize.NAME, last_string, last_start, last_end, last_line last_string = None yield type, string, start, end, line for type, string, start, end, line in tokens: yield type, string, start, end, line if type == tokenize.OP and string == ']': break elif type == tokenize.OP and string in ALLOWED_OPS: if last_string: yield tokenize.NAME, last_string, last_start, last_end, last_line last_string = None yield type, string, start, end, line elif type in [tokenize.NAME, tokenize.NUMBER, tokenize.OP]: if not last_string: last_string = string last_start = start last_end = end else: last_string += string if last_string: yield tokenize.NAME, last_string, last_start, last_end, last_line def _parse_format_selection(tokens, inside_merge=False, inside_choice=False, inside_group=False): selectors = [] current_selector = None for type, string, start, _, _ in tokens: if type == getattr(tokenize, 'ENCODING', None): continue elif type in [tokenize.NAME, tokenize.NUMBER]: current_selector = FormatSelector(SINGLE, string, []) elif type == tokenize.OP: if string == ')': if not inside_group: tokens.restore_last_token() break elif inside_merge and string in ['/', ',']: tokens.restore_last_token() break elif inside_choice and string == ',': tokens.restore_last_token() break elif string == ',': if not current_selector: raise syntax_error('"," must follow a format selector', start) selectors.append(current_selector) current_selector = None elif string == '/': if not current_selector: raise syntax_error('"/" must follow a format selector', start) first_choice = current_selector second_choice = _parse_format_selection(tokens, inside_choice=True) current_selector = FormatSelector(PICKFIRST, (first_choice, second_choice), []) elif string == '[': if not current_selector: current_selector = FormatSelector(SINGLE, 'best', []) format_filter = _parse_filter(tokens) current_selector.filters.append(format_filter) elif string == '(': if current_selector: raise syntax_error('Unexpected "("', start) group = _parse_format_selection(tokens, inside_group=True) current_selector = FormatSelector(GROUP, group, []) elif string == '+': if inside_merge: raise syntax_error('Unexpected "+"', start) video_selector = current_selector audio_selector = _parse_format_selection(tokens, inside_merge=True) if not video_selector or not audio_selector: raise syntax_error('"+" must be between two format selectors', start) current_selector = FormatSelector(MERGE, (video_selector, audio_selector), []) else: raise syntax_error('Operator not recognized: "{0}"'.format(string), start) elif type == tokenize.ENDMARKER: break if current_selector: selectors.append(current_selector) return selectors def _build_selector_function(selector): if isinstance(selector, list): fs = [_build_selector_function(s) for s in selector] def selector_function(ctx): for f in fs: for format in f(ctx): yield format return selector_function elif selector.type == GROUP: selector_function = _build_selector_function(selector.selector) elif selector.type == PICKFIRST: fs = [_build_selector_function(s) for s in selector.selector] def selector_function(ctx): for f in fs: picked_formats = list(f(ctx)) if picked_formats: return picked_formats return [] elif selector.type == SINGLE: format_spec = selector.selector def selector_function(ctx): formats = list(ctx['formats']) if not formats: return if format_spec == 'all': for f in formats: yield f elif format_spec in ['best', 'worst', None]: format_idx = 0 if format_spec == 'worst' else -1 audiovideo_formats = [ f for f in formats if f.get('vcodec') != 'none' and f.get('acodec') != 'none'] if audiovideo_formats: yield audiovideo_formats[format_idx] elif ctx['incomplete_formats']: yield formats[format_idx] elif format_spec == 'bestaudio': audio_formats = [ f for f in formats if f.get('vcodec') == 'none'] if audio_formats: yield audio_formats[-1] elif format_spec == 'worstaudio': audio_formats = [ f for f in formats if f.get('vcodec') == 'none'] if audio_formats: yield audio_formats[0] elif format_spec == 'bestvideo': video_formats = [ f for f in formats if f.get('acodec') == 'none'] if video_formats: yield video_formats[-1] elif format_spec == 'worstvideo': video_formats = [ f for f in formats if f.get('acodec') == 'none'] if video_formats: yield video_formats[0] else: extensions = ['mp4', 'flv', 'webm', '3gp', 'm4a', 'mp3', 'ogg', 'aac', 'wav'] if format_spec in extensions: filter_f = lambda f: f['ext'] == format_spec else: filter_f = lambda f: f['format_id'] == format_spec matches = list(filter(filter_f, formats)) if matches: yield matches[-1] elif selector.type == MERGE: def _merge(formats_info): format_1, format_2 = [f['format_id'] for f in formats_info] if formats_info[0].get('vcodec') == 'none': self.report_error('The first format must ' 'contain the video, try using ' '"-f %s+%s"' % (format_2, format_1)) return if formats_info[0].get('acodec') == 'none' and formats_info[1].get('acodec') == 'none': self.report_error( 'Both formats %s and %s are video-only, you must specify "-f video+audio"' % (format_1, format_2)) return output_ext = ( formats_info[0]['ext'] if self.params.get('merge_output_format') is None else self.params['merge_output_format']) return { 'requested_formats': formats_info, 'format': '%s+%s' % (formats_info[0].get('format'), formats_info[1].get('format')), 'format_id': '%s+%s' % (formats_info[0].get('format_id'), formats_info[1].get('format_id')), 'width': formats_info[0].get('width'), 'height': formats_info[0].get('height'), 'resolution': formats_info[0].get('resolution'), 'fps': formats_info[0].get('fps'), 'vcodec': formats_info[0].get('vcodec'), 'vbr': formats_info[0].get('vbr'), 'stretched_ratio': formats_info[0].get('stretched_ratio'), 'acodec': formats_info[1].get('acodec'), 'abr': formats_info[1].get('abr'), 'ext': output_ext, } video_selector, audio_selector = map(_build_selector_function, selector.selector) def selector_function(ctx): for pair in itertools.product( video_selector(copy.deepcopy(ctx)), audio_selector(copy.deepcopy(ctx))): yield _merge(pair) filters = [self._build_format_filter(f) for f in selector.filters] def final_selector(ctx): ctx_copy = copy.deepcopy(ctx) for _filter in filters: ctx_copy['formats'] = list(filter(_filter, ctx_copy['formats'])) return selector_function(ctx_copy) return final_selector stream = io.BytesIO(format_spec.encode('utf-8')) try: tokens = list(_remove_unused_ops(compat_tokenize_tokenize(stream.readline))) except tokenize.TokenError: raise syntax_error('Missing closing/opening brackets or parenthesis', (0, len(format_spec))) class TokenIterator(object): def __init__(self, tokens): self.tokens = tokens self.counter = 0 def __iter__(self): return self def __next__(self): if self.counter >= len(self.tokens): raise StopIteration() value = self.tokens[self.counter] self.counter += 1 return value next = __next__ def restore_last_token(self): self.counter -= 1 parsed_selector = _parse_format_selection(iter(TokenIterator(tokens))) return _build_selector_function(parsed_selector) def _calc_headers(self, info_dict): res = std_headers.copy() add_headers = info_dict.get('http_headers') if add_headers: res.update(add_headers) cookies = self._calc_cookies(info_dict) if cookies: res['Cookie'] = cookies if 'X-Forwarded-For' not in res: x_forwarded_for_ip = info_dict.get('__x_forwarded_for_ip') if x_forwarded_for_ip: res['X-Forwarded-For'] = x_forwarded_for_ip return res def _calc_cookies(self, info_dict): pr = sanitized_Request(info_dict['url']) self.cookiejar.add_cookie_header(pr) return pr.get_header('Cookie') def process_video_result(self, info_dict, download=True): assert info_dict.get('_type', 'video') == 'video' if 'id' not in info_dict: raise ExtractorError('Missing "id" field in extractor result') if 'title' not in info_dict: raise ExtractorError('Missing "title" field in extractor result') def report_force_conversion(field, field_not, conversion): self.report_warning( '"%s" field is not %s - forcing %s conversion, there is an error in extractor' % (field, field_not, conversion)) def sanitize_string_field(info, string_field): field = info.get(string_field) if field is None or isinstance(field, compat_str): return report_force_conversion(string_field, 'a string', 'string') info[string_field] = compat_str(field) def sanitize_numeric_fields(info): for numeric_field in self._NUMERIC_FIELDS: field = info.get(numeric_field) if field is None or isinstance(field, compat_numeric_types): continue report_force_conversion(numeric_field, 'numeric', 'int') info[numeric_field] = int_or_none(field) sanitize_string_field(info_dict, 'id') sanitize_numeric_fields(info_dict) if 'playlist' not in info_dict: info_dict['playlist'] = None info_dict['playlist_index'] = None thumbnails = info_dict.get('thumbnails') if thumbnails is None: thumbnail = info_dict.get('thumbnail') if thumbnail: info_dict['thumbnails'] = thumbnails = [{'url': thumbnail}] if thumbnails: thumbnails.sort(key=lambda t: ( t.get('preference') if t.get('preference') is not None else -1, t.get('width') if t.get('width') is not None else -1, t.get('height') if t.get('height') is not None else -1, t.get('id') if t.get('id') is not None else '', t.get('url'))) for i, t in enumerate(thumbnails): t['url'] = sanitize_url(t['url']) if t.get('width') and t.get('height'): t['resolution'] = '%dx%d' % (t['width'], t['height']) if t.get('id') is None: t['id'] = '%d' % i if self.params.get('list_thumbnails'): self.list_thumbnails(info_dict) return thumbnail = info_dict.get('thumbnail') if thumbnail: info_dict['thumbnail'] = sanitize_url(thumbnail) elif thumbnails: info_dict['thumbnail'] = thumbnails[-1]['url'] if 'display_id' not in info_dict and 'id' in info_dict: info_dict['display_id'] = info_dict['id'] for ts_key, date_key in ( ('timestamp', 'upload_date'), ('release_timestamp', 'release_date'), ): if info_dict.get(date_key) is None and info_dict.get(ts_key) is not None: # Working around out-of-range timestamp values (e.g. negative ones on Windows, # see http://bugs.python.org/issue1646728) try: upload_date = datetime.datetime.utcfromtimestamp(info_dict[ts_key]) info_dict[date_key] = upload_date.strftime('%Y%m%d') except (ValueError, OverflowError, OSError): pass # Auto generate title fields corresponding to the *_number fields when missing # in order to always have clean titles. This is very common for TV series. for field in ('chapter', 'season', 'episode'): if info_dict.get('%s_number' % field) is not None and not info_dict.get(field): info_dict[field] = '%s %d' % (field.capitalize(), info_dict['%s_number' % field]) for cc_kind in ('subtitles', 'automatic_captions'): cc = info_dict.get(cc_kind) if cc: for _, subtitle in cc.items(): for subtitle_format in subtitle: if subtitle_format.get('url'): subtitle_format['url'] = sanitize_url(subtitle_format['url']) if subtitle_format.get('ext') is None: subtitle_format['ext'] = determine_ext(subtitle_format['url']).lower() automatic_captions = info_dict.get('automatic_captions') subtitles = info_dict.get('subtitles') if self.params.get('listsubtitles', False): if 'automatic_captions' in info_dict: self.list_subtitles( info_dict['id'], automatic_captions, 'automatic captions') self.list_subtitles(info_dict['id'], subtitles, 'subtitles') return info_dict['requested_subtitles'] = self.process_subtitles( info_dict['id'], subtitles, automatic_captions) # We now pick which formats have to be downloaded if info_dict.get('formats') is None: # There's only one format available formats = [info_dict] else: formats = info_dict['formats'] if not formats: raise ExtractorError('No video formats found!') def is_wellformed(f): url = f.get('url') if not url: self.report_warning( '"url" field is missing or empty - skipping format, ' 'there is an error in extractor') return False if isinstance(url, bytes): sanitize_string_field(f, 'url') return True formats = list(filter(is_wellformed, formats)) formats_dict = {} for i, format in enumerate(formats): sanitize_string_field(format, 'format_id') sanitize_numeric_fields(format) format['url'] = sanitize_url(format['url']) if not format.get('format_id'): format['format_id'] = compat_str(i) else: format['format_id'] = re.sub(r'[\s,/+\[\]()]', '_', format['format_id']) format_id = format['format_id'] if format_id not in formats_dict: formats_dict[format_id] = [] formats_dict[format_id].append(format) for format_id, ambiguous_formats in formats_dict.items(): if len(ambiguous_formats) > 1: for i, format in enumerate(ambiguous_formats): format['format_id'] = '%s-%d' % (format_id, i) for i, format in enumerate(formats): if format.get('format') is None: format['format'] = '{id} - {res}{note}'.format( id=format['format_id'], res=self.format_resolution(format), note=' ({0})'.format(format['format_note']) if format.get('format_note') is not None else '', ) if format.get('ext') is None: format['ext'] = determine_ext(format['url']).lower() if format.get('protocol') is None: format['protocol'] = determine_protocol(format) full_format_info = info_dict.copy() full_format_info.update(format) format['http_headers'] = self._calc_headers(full_format_info) if '__x_forwarded_for_ip' in info_dict: del info_dict['__x_forwarded_for_ip'] if formats[0] is not info_dict: info_dict['formats'] = formats if self.params.get('listformats'): self.list_formats(info_dict) return req_format = self.params.get('format') if req_format is None: req_format = self._default_format_spec(info_dict, download=download) if self.params.get('verbose'): self._write_string('[debug] Default format spec: %s\n' % req_format) format_selector = self.build_format_selector(req_format) # While in format selection we may need to have an access to the original # format set in order to calculate some metrics or do some processing. # For now we need to be able to guess whether original formats provided # by extractor are incomplete or not (i.e. whether extractor provides only # video-only or audio-only formats) for proper formats selection for # extractors with such incomplete formats (see # https://github.com/ytdl-org/youtube-dl/pull/5556). # Since formats may be filtered during format selection and may not match # the original formats the results may be incorrect. Thus original formats # or pre-calculated metrics should be passed to format selection routines # as well. # We will pass a context object containing all necessary additional data # instead of just formats. # This fixes incorrect format selection issue (see # https://github.com/ytdl-org/youtube-dl/issues/10083). incomplete_formats = ( # All formats are video-only or all(f.get('vcodec') != 'none' and f.get('acodec') == 'none' for f in formats) # all formats are audio-only or all(f.get('vcodec') == 'none' and f.get('acodec') != 'none' for f in formats)) ctx = { 'formats': formats, 'incomplete_formats': incomplete_formats, } formats_to_download = list(format_selector(ctx)) if not formats_to_download: raise ExtractorError('requested format not available', expected=True) if download: if len(formats_to_download) > 1: self.to_screen('[info] %s: downloading video in %s formats' % (info_dict['id'], len(formats_to_download))) for format in formats_to_download: new_info = dict(info_dict) new_info.update(format) self.process_info(new_info) # We update the info dict with the best quality format (backwards compatibility) info_dict.update(formats_to_download[-1]) return info_dict def process_subtitles(self, video_id, normal_subtitles, automatic_captions): available_subs = {} if normal_subtitles and self.params.get('writesubtitles'): available_subs.update(normal_subtitles) if automatic_captions and self.params.get('writeautomaticsub'): for lang, cap_info in automatic_captions.items(): if lang not in available_subs: available_subs[lang] = cap_info if (not self.params.get('writesubtitles') and not self.params.get('writeautomaticsub') or not available_subs): return None if self.params.get('allsubtitles', False): requested_langs = available_subs.keys() else: if self.params.get('subtitleslangs', False): requested_langs = self.params.get('subtitleslangs') elif 'en' in available_subs: requested_langs = ['en'] else: requested_langs = [list(available_subs.keys())[0]] formats_query = self.params.get('subtitlesformat', 'best') formats_preference = formats_query.split('/') if formats_query else [] subs = {} for lang in requested_langs: formats = available_subs.get(lang) if formats is None: self.report_warning('%s subtitles not available for %s' % (lang, video_id)) continue for ext in formats_preference: if ext == 'best': f = formats[-1] break matches = list(filter(lambda f: f['ext'] == ext, formats)) if matches: f = matches[-1] break else: f = formats[-1] self.report_warning( 'No subtitle format found matching "%s" for language %s, ' 'using %s' % (formats_query, lang, f['ext'])) subs[lang] = f return subs def __forced_printings(self, info_dict, filename, incomplete): def print_mandatory(field): if (self.params.get('force%s' % field, False) and (not incomplete or info_dict.get(field) is not None)): self.to_stdout(info_dict[field]) def print_optional(field): if (self.params.get('force%s' % field, False) and info_dict.get(field) is not None): self.to_stdout(info_dict[field]) print_mandatory('title') print_mandatory('id') if self.params.get('forceurl', False) and not incomplete: if info_dict.get('requested_formats') is not None: for f in info_dict['requested_formats']: self.to_stdout(f['url'] + f.get('play_path', '')) else: # For RTMP URLs, also include the playpath self.to_stdout(info_dict['url'] + info_dict.get('play_path', '')) print_optional('thumbnail') print_optional('description') if self.params.get('forcefilename', False) and filename is not None: self.to_stdout(filename) if self.params.get('forceduration', False) and info_dict.get('duration') is not None: self.to_stdout(formatSeconds(info_dict['duration'])) print_mandatory('format') if self.params.get('forcejson', False): self.to_stdout(json.dumps(info_dict)) def process_info(self, info_dict): assert info_dict.get('_type', 'video') == 'video' max_downloads = self.params.get('max_downloads') if max_downloads is not None: if self._num_downloads >= int(max_downloads): raise MaxDownloadsReached() # TODO: backward compatibility, to be removed info_dict['fulltitle'] = info_dict['title'] if 'format' not in info_dict: info_dict['format'] = info_dict['ext'] reason = self._match_entry(info_dict, incomplete=False) if reason is not None: self.to_screen('[download] ' + reason) return self._num_downloads += 1 info_dict['_filename'] = filename = self.prepare_filename(info_dict) # Forced printings self.__forced_printings(info_dict, filename, incomplete=False) # Do nothing else if in simulate mode if self.params.get('simulate', False): return if filename is None: return def ensure_dir_exists(path): try: dn = os.path.dirname(path) if dn and not os.path.exists(dn): os.makedirs(dn) return True except (OSError, IOError) as err: if isinstance(err, OSError) and err.errno == errno.EEXIST: return True self.report_error('unable to create directory ' + error_to_compat_str(err)) return False if not ensure_dir_exists(sanitize_path(encodeFilename(filename))): return if self.params.get('writedescription', False): descfn = replace_extension(filename, 'description', info_dict.get('ext')) if self.params.get('nooverwrites', False) and os.path.exists(encodeFilename(descfn)): self.to_screen('[info] Video description is already present') elif info_dict.get('description') is None: self.report_warning('There\'s no description to write.') else: try: self.to_screen('[info] Writing video description to: ' + descfn) with io.open(encodeFilename(descfn), 'w', encoding='utf-8') as descfile: descfile.write(info_dict['description']) except (OSError, IOError): self.report_error('Cannot write description file ' + descfn) return if self.params.get('writeannotations', False): annofn = replace_extension(filename, 'annotations.xml', info_dict.get('ext')) if self.params.get('nooverwrites', False) and os.path.exists(encodeFilename(annofn)): self.to_screen('[info] Video annotations are already present') elif not info_dict.get('annotations'): self.report_warning('There are no annotations to write.') else: try: self.to_screen('[info] Writing video annotations to: ' + annofn) with io.open(encodeFilename(annofn), 'w', encoding='utf-8') as annofile: annofile.write(info_dict['annotations']) except (KeyError, TypeError): self.report_warning('There are no annotations to write.') except (OSError, IOError): self.report_error('Cannot write annotations file: ' + annofn) return subtitles_are_requested = any([self.params.get('writesubtitles', False), self.params.get('writeautomaticsub')]) if subtitles_are_requested and info_dict.get('requested_subtitles'): subtitles = info_dict['requested_subtitles'] ie = self.get_info_extractor(info_dict['extractor_key']) for sub_lang, sub_info in subtitles.items(): sub_format = sub_info['ext'] sub_filename = subtitles_filename(filename, sub_lang, sub_format, info_dict.get('ext')) if self.params.get('nooverwrites', False) and os.path.exists(encodeFilename(sub_filename)): self.to_screen('[info] Video subtitle %s.%s is already present' % (sub_lang, sub_format)) else: self.to_screen('[info] Writing video subtitles to: ' + sub_filename) if sub_info.get('data') is not None: try: with io.open(encodeFilename(sub_filename), 'w', encoding='utf-8', newline='') as subfile: subfile.write(sub_info['data']) except (OSError, IOError): self.report_error('Cannot write subtitles file ' + sub_filename) return else: try: sub_data = ie._request_webpage( sub_info['url'], info_dict['id'], note=False).read() with io.open(encodeFilename(sub_filename), 'wb') as subfile: subfile.write(sub_data) except (ExtractorError, IOError, OSError, ValueError) as err: self.report_warning('Unable to download subtitle for "%s": %s' % (sub_lang, error_to_compat_str(err))) continue if self.params.get('writeinfojson', False): infofn = replace_extension(filename, 'info.json', info_dict.get('ext')) if self.params.get('nooverwrites', False) and os.path.exists(encodeFilename(infofn)): self.to_screen('[info] Video description metadata is already present') else: self.to_screen('[info] Writing video description metadata as JSON to: ' + infofn) try: write_json_file(self.filter_requested_info(info_dict), infofn) except (OSError, IOError): self.report_error('Cannot write metadata to JSON file ' + infofn) return self._write_thumbnails(info_dict, filename) if not self.params.get('skip_download', False): try: def dl(name, info): fd = get_suitable_downloader(info, self.params)(self, self.params) for ph in self._progress_hooks: fd.add_progress_hook(ph) if self.params.get('verbose'): self.to_screen('[debug] Invoking downloader on %r' % info.get('url')) return fd.download(name, info) if info_dict.get('requested_formats') is not None: downloaded = [] success = True merger = FFmpegMergerPP(self) if not merger.available: postprocessors = [] self.report_warning('You have requested multiple ' 'formats but ffmpeg or avconv are not installed.' ' The formats won\'t be merged.') else: postprocessors = [merger] def compatible_formats(formats): video, audio = formats # Check extension video_ext, audio_ext = video.get('ext'), audio.get('ext') if video_ext and audio_ext: COMPATIBLE_EXTS = ( ('mp3', 'mp4', 'm4a', 'm4p', 'm4b', 'm4r', 'm4v', 'ismv', 'isma'), ('webm') ) for exts in COMPATIBLE_EXTS: if video_ext in exts and audio_ext in exts: return True # TODO: Check acodec/vcodec return False filename_real_ext = os.path.splitext(filename)[1][1:] filename_wo_ext = ( os.path.splitext(filename)[0] if filename_real_ext == info_dict['ext'] else filename) requested_formats = info_dict['requested_formats'] if self.params.get('merge_output_format') is None and not compatible_formats(requested_formats): info_dict['ext'] = 'mkv' self.report_warning( 'Requested formats are incompatible for merge and will be merged into mkv.') # Ensure filename always has a correct extension for successful merge filename = '%s.%s' % (filename_wo_ext, info_dict['ext']) if os.path.exists(encodeFilename(filename)): self.to_screen( '[download] %s has already been downloaded and ' 'merged' % filename) else: for f in requested_formats: new_info = dict(info_dict) new_info.update(f) fname = prepend_extension( self.prepare_filename(new_info), 'f%s' % f['format_id'], new_info['ext']) if not ensure_dir_exists(fname): return downloaded.append(fname) partial_success = dl(fname, new_info) success = success and partial_success info_dict['__postprocessors'] = postprocessors info_dict['__files_to_merge'] = downloaded else: # Just a single file success = dl(filename, info_dict) except (compat_urllib_error.URLError, compat_http_client.HTTPException, socket.error) as err: self.report_error('unable to download video data: %s' % error_to_compat_str(err)) return except (OSError, IOError) as err: raise UnavailableVideoError(err) except (ContentTooShortError, ) as err: self.report_error('content too short (expected %s bytes and served %s)' % (err.expected, err.downloaded)) return if success and filename != '-': # Fixup content fixup_policy = self.params.get('fixup') if fixup_policy is None: fixup_policy = 'detect_or_warn' INSTALL_FFMPEG_MESSAGE = 'Install ffmpeg or avconv to fix this automatically.' stretched_ratio = info_dict.get('stretched_ratio') if stretched_ratio is not None and stretched_ratio != 1: if fixup_policy == 'warn': self.report_warning('%s: Non-uniform pixel ratio (%s)' % ( info_dict['id'], stretched_ratio)) elif fixup_policy == 'detect_or_warn': stretched_pp = FFmpegFixupStretchedPP(self) if stretched_pp.available: info_dict.setdefault('__postprocessors', []) info_dict['__postprocessors'].append(stretched_pp) else: self.report_warning( '%s: Non-uniform pixel ratio (%s). %s' % (info_dict['id'], stretched_ratio, INSTALL_FFMPEG_MESSAGE)) else: assert fixup_policy in ('ignore', 'never') if (info_dict.get('requested_formats') is None and info_dict.get('container') == 'm4a_dash'): if fixup_policy == 'warn': self.report_warning( '%s: writing DASH m4a. ' 'Only some players support this container.' % info_dict['id']) elif fixup_policy == 'detect_or_warn': fixup_pp = FFmpegFixupM4aPP(self) if fixup_pp.available: info_dict.setdefault('__postprocessors', []) info_dict['__postprocessors'].append(fixup_pp) else: self.report_warning( '%s: writing DASH m4a. ' 'Only some players support this container. %s' % (info_dict['id'], INSTALL_FFMPEG_MESSAGE)) else: assert fixup_policy in ('ignore', 'never') if (info_dict.get('protocol') == 'm3u8_native' or info_dict.get('protocol') == 'm3u8' and self.params.get('hls_prefer_native')): if fixup_policy == 'warn': self.report_warning('%s: malformed AAC bitstream detected.' % ( info_dict['id'])) elif fixup_policy == 'detect_or_warn': fixup_pp = FFmpegFixupM3u8PP(self) if fixup_pp.available: info_dict.setdefault('__postprocessors', []) info_dict['__postprocessors'].append(fixup_pp) else: self.report_warning( '%s: malformed AAC bitstream detected. %s' % (info_dict['id'], INSTALL_FFMPEG_MESSAGE)) else: assert fixup_policy in ('ignore', 'never') try: self.post_process(filename, info_dict) except (PostProcessingError) as err: self.report_error('postprocessing: %s' % str(err)) return self.record_download_archive(info_dict) def download(self, url_list): outtmpl = self.params.get('outtmpl', DEFAULT_OUTTMPL) if (len(url_list) > 1 and outtmpl != '-' and '%' not in outtmpl and self.params.get('max_downloads') != 1): raise SameFileError(outtmpl) for url in url_list: try: # It also downloads the videos res = self.extract_info( url, force_generic_extractor=self.params.get('force_generic_extractor', False)) except UnavailableVideoError: self.report_error('unable to download video') except MaxDownloadsReached: self.to_screen('[info] Maximum number of downloaded files reached.') raise else: if self.params.get('dump_single_json', False): self.to_stdout(json.dumps(res)) return self._download_retcode def download_with_info_file(self, info_filename): with contextlib.closing(fileinput.FileInput( [info_filename], mode='r', openhook=fileinput.hook_encoded('utf-8'))) as f: # FileInput doesn't have a read method, we can't call json.load info = self.filter_requested_info(json.loads('\n'.join(f))) try: self.process_ie_result(info, download=True) except DownloadError: webpage_url = info.get('webpage_url') if webpage_url is not None: self.report_warning('The info failed to download, trying with "%s"' % webpage_url) return self.download([webpage_url]) else: raise return self._download_retcode @staticmethod def filter_requested_info(info_dict): return dict( (k, v) for k, v in info_dict.items() if k not in ['requested_formats', 'requested_subtitles']) def post_process(self, filename, ie_info): info = dict(ie_info) info['filepath'] = filename pps_chain = [] if ie_info.get('__postprocessors') is not None: pps_chain.extend(ie_info['__postprocessors']) pps_chain.extend(self._pps) for pp in pps_chain: files_to_delete = [] try: files_to_delete, info = pp.run(info) except PostProcessingError as e: self.report_error(e.msg) if files_to_delete and not self.params.get('keepvideo', False): for old_filename in files_to_delete: self.to_screen('Deleting original file %s (pass -k to keep)' % old_filename) try: os.remove(encodeFilename(old_filename)) except (IOError, OSError): self.report_warning('Unable to remove downloaded original file') def _make_archive_id(self, info_dict): video_id = info_dict.get('id') if not video_id: return # Future-proof against any change in case # and backwards compatibility with prior versions extractor = info_dict.get('extractor_key') or info_dict.get('ie_key') # key in a playlist if extractor is None: url = str_or_none(info_dict.get('url')) if not url: return # Try to find matching extractor for the URL and take its ie_key for ie in self._ies: if ie.suitable(url): extractor = ie.ie_key() break else: return return extractor.lower() + ' ' + video_id def in_download_archive(self, info_dict): fn = self.params.get('download_archive') if fn is None: return False vid_id = self._make_archive_id(info_dict) if not vid_id: return False # Incomplete video information try: with locked_file(fn, 'r', encoding='utf-8') as archive_file: for line in archive_file: if line.strip() == vid_id: return True except IOError as ioe: if ioe.errno != errno.ENOENT: raise return False def record_download_archive(self, info_dict): fn = self.params.get('download_archive') if fn is None: return vid_id = self._make_archive_id(info_dict) assert vid_id with locked_file(fn, 'a', encoding='utf-8') as archive_file: archive_file.write(vid_id + '\n') @staticmethod def format_resolution(format, default='unknown'): if format.get('vcodec') == 'none': return 'audio only' if format.get('resolution') is not None: return format['resolution'] if format.get('height') is not None: if format.get('width') is not None: res = '%sx%s' % (format['width'], format['height']) else: res = '%sp' % format['height'] elif format.get('width') is not None: res = '%dx?' % format['width'] else: res = default return res def _format_note(self, fdict): res = '' if fdict.get('ext') in ['f4f', 'f4m']: res += '(unsupported) ' if fdict.get('language'): if res: res += ' ' res += '[%s] ' % fdict['language'] if fdict.get('format_note') is not None: res += fdict['format_note'] + ' ' if fdict.get('tbr') is not None: res += '%4dk ' % fdict['tbr'] if fdict.get('container') is not None: if res: res += ', ' res += '%s container' % fdict['container'] if (fdict.get('vcodec') is not None and fdict.get('vcodec') != 'none'): if res: res += ', ' res += fdict['vcodec'] if fdict.get('vbr') is not None: res += '@' elif fdict.get('vbr') is not None and fdict.get('abr') is not None: res += 'video@' if fdict.get('vbr') is not None: res += '%4dk' % fdict['vbr'] if fdict.get('fps') is not None: if res: res += ', ' res += '%sfps' % fdict['fps'] if fdict.get('acodec') is not None: if res: res += ', ' if fdict['acodec'] == 'none': res += 'video only' else: res += '%-5s' % fdict['acodec'] elif fdict.get('abr') is not None: if res: res += ', ' res += 'audio' if fdict.get('abr') is not None: res += '@%3dk' % fdict['abr'] if fdict.get('asr') is not None: res += ' (%5dHz)' % fdict['asr'] if fdict.get('filesize') is not None: if res: res += ', ' res += format_bytes(fdict['filesize']) elif fdict.get('filesize_approx') is not None: if res: res += ', ' res += '~' + format_bytes(fdict['filesize_approx']) return res def list_formats(self, info_dict): formats = info_dict.get('formats', [info_dict]) table = [ [f['format_id'], f['ext'], self.format_resolution(f), self._format_note(f)] for f in formats if f.get('preference') is None or f['preference'] >= -1000] if len(formats) > 1: table[-1][-1] += (' ' if table[-1][-1] else '') + '(best)' header_line = ['format code', 'extension', 'resolution', 'note'] self.to_screen( '[info] Available formats for %s:\n%s' % (info_dict['id'], render_table(header_line, table))) def list_thumbnails(self, info_dict): thumbnails = info_dict.get('thumbnails') if not thumbnails: self.to_screen('[info] No thumbnails present for %s' % info_dict['id']) return self.to_screen( '[info] Thumbnails for %s:' % info_dict['id']) self.to_screen(render_table( ['ID', 'width', 'height', 'URL'], [[t['id'], t.get('width', 'unknown'), t.get('height', 'unknown'), t['url']] for t in thumbnails])) def list_subtitles(self, video_id, subtitles, name='subtitles'): if not subtitles: self.to_screen('%s has no %s' % (video_id, name)) return self.to_screen( 'Available %s for %s:' % (name, video_id)) self.to_screen(render_table( ['Language', 'formats'], [[lang, ', '.join(f['ext'] for f in reversed(formats))] for lang, formats in subtitles.items()])) def urlopen(self, req): if isinstance(req, compat_basestring): req = sanitized_Request(req) return self._opener.open(req, timeout=self._socket_timeout) def print_debug_header(self): if not self.params.get('verbose'): return if type('') is not compat_str: # Python 2.6 on SLES11 SP1 (https://github.com/ytdl-org/youtube-dl/issues/3326) self.report_warning( 'Your Python is broken! Update to a newer and supported version') stdout_encoding = getattr( sys.stdout, 'encoding', 'missing (%s)' % type(sys.stdout).__name__) encoding_str = ( '[debug] Encodings: locale %s, fs %s, out %s, pref %s\n' % ( locale.getpreferredencoding(), sys.getfilesystemencoding(), stdout_encoding, self.get_encoding())) write_string(encoding_str, encoding=None) self._write_string('[debug] youtube-dl version ' + __version__ + '\n') if _LAZY_LOADER: self._write_string('[debug] Lazy loading extractors enabled' + '\n') try: sp = subprocess.Popen( ['git', 'rev-parse', '--short', 'HEAD'], stdout=subprocess.PIPE, stderr=subprocess.PIPE, cwd=os.path.dirname(os.path.abspath(__file__))) out, err = sp.communicate() out = out.decode().strip() if re.match('[0-9a-f]+', out): self._write_string('[debug] Git HEAD: ' + out + '\n') except Exception: try: sys.exc_clear() except Exception: pass def python_implementation(): impl_name = platform.python_implementation() if impl_name == 'PyPy' and hasattr(sys, 'pypy_version_info'): return impl_name + ' version %d.%d.%d' % sys.pypy_version_info[:3] return impl_name self._write_string('[debug] Python version %s (%s) - %s\n' % ( platform.python_version(), python_implementation(), platform_name())) exe_versions = FFmpegPostProcessor.get_versions(self) exe_versions['rtmpdump'] = rtmpdump_version() exe_versions['phantomjs'] = PhantomJSwrapper._version() exe_str = ', '.join( '%s %s' % (exe, v) for exe, v in sorted(exe_versions.items()) if v ) if not exe_str: exe_str = 'none' self._write_string('[debug] exe versions: %s\n' % exe_str) proxy_map = {} for handler in self._opener.handlers: if hasattr(handler, 'proxies'): proxy_map.update(handler.proxies) self._write_string('[debug] Proxy map: ' + compat_str(proxy_map) + '\n') if self.params.get('call_home', False): ipaddr = self.urlopen('https://yt-dl.org/ip').read().decode('utf-8') self._write_string('[debug] Public IP address: %s\n' % ipaddr) latest_version = self.urlopen( 'https://yt-dl.org/latest/version').read().decode('utf-8') if version_tuple(latest_version) > version_tuple(__version__): self.report_warning( 'You are using an outdated version (newest version: %s)! ' 'See https://yt-dl.org/update if you need help updating.' % latest_version) def _setup_opener(self): timeout_val = self.params.get('socket_timeout') self._socket_timeout = 600 if timeout_val is None else float(timeout_val) opts_cookiefile = self.params.get('cookiefile') opts_proxy = self.params.get('proxy') if opts_cookiefile is None: self.cookiejar = compat_cookiejar.CookieJar() else: opts_cookiefile = expand_path(opts_cookiefile) self.cookiejar = YoutubeDLCookieJar(opts_cookiefile) if os.access(opts_cookiefile, os.R_OK): self.cookiejar.load(ignore_discard=True, ignore_expires=True) cookie_processor = YoutubeDLCookieProcessor(self.cookiejar) if opts_proxy is not None: if opts_proxy == '': proxies = {} else: proxies = {'http': opts_proxy, 'https': opts_proxy} else: proxies = compat_urllib_request.getproxies() # Set HTTPS proxy to HTTP one if given (https://github.com/ytdl-org/youtube-dl/issues/805) if 'http' in proxies and 'https' not in proxies: proxies['https'] = proxies['http'] proxy_handler = PerRequestProxyHandler(proxies) debuglevel = 1 if self.params.get('debug_printtraffic') else 0 https_handler = make_HTTPS_handler(self.params, debuglevel=debuglevel) ydlh = YoutubeDLHandler(self.params, debuglevel=debuglevel) redirect_handler = YoutubeDLRedirectHandler() data_handler = compat_urllib_request_DataHandler() # When passing our own FileHandler instance, build_opener won't add the file_handler = compat_urllib_request.FileHandler() def file_open(*args, **kwargs): raise compat_urllib_error.URLError('file:// scheme is explicitly disabled in youtube-dl for security reasons') file_handler.file_open = file_open opener = compat_urllib_request.build_opener( proxy_handler, https_handler, cookie_processor, ydlh, redirect_handler, data_handler, file_handler) # (See https://github.com/ytdl-org/youtube-dl/issues/1309 for details) opener.addheaders = [] self._opener = opener def encode(self, s): if isinstance(s, bytes): return s # Already encoded try: return s.encode(self.get_encoding()) except UnicodeEncodeError as err: err.reason = err.reason + '. Check your system encoding configuration or use the --encoding option.' raise def get_encoding(self): encoding = self.params.get('encoding') if encoding is None: encoding = preferredencoding() return encoding def _write_thumbnails(self, info_dict, filename): if self.params.get('writethumbnail', False): thumbnails = info_dict.get('thumbnails') if thumbnails: thumbnails = [thumbnails[-1]] elif self.params.get('write_all_thumbnails', False): thumbnails = info_dict.get('thumbnails') else: return if not thumbnails: # No thumbnails present, so return immediately return for t in thumbnails: thumb_ext = determine_ext(t['url'], 'jpg') suffix = '_%s' % t['id'] if len(thumbnails) > 1 else '' thumb_display_id = '%s ' % t['id'] if len(thumbnails) > 1 else '' t['filename'] = thumb_filename = replace_extension(filename + suffix, thumb_ext, info_dict.get('ext')) if self.params.get('nooverwrites', False) and os.path.exists(encodeFilename(thumb_filename)): self.to_screen('[%s] %s: Thumbnail %sis already present' % (info_dict['extractor'], info_dict['id'], thumb_display_id)) else: self.to_screen('[%s] %s: Downloading thumbnail %s...' % (info_dict['extractor'], info_dict['id'], thumb_display_id)) try: uf = self.urlopen(t['url']) with open(encodeFilename(thumb_filename), 'wb') as thumbf: shutil.copyfileobj(uf, thumbf) self.to_screen('[%s] %s: Writing thumbnail %sto: %s' % (info_dict['extractor'], info_dict['id'], thumb_display_id, thumb_filename)) except (compat_urllib_error.URLError, compat_http_client.HTTPException, socket.error) as err: self.report_warning('Unable to download thumbnail "%s": %s' % (t['url'], error_to_compat_str(err)))
true
true
f72b941393c5f93b8853905303a2c759da17e1f7
9,291
py
Python
invenio_app_ils/circulation/api.py
topless/invenio-app-ils
38f5a6b61cdeaf5fa5776613073fa46af28737a9
[ "MIT" ]
null
null
null
invenio_app_ils/circulation/api.py
topless/invenio-app-ils
38f5a6b61cdeaf5fa5776613073fa46af28737a9
[ "MIT" ]
21
2018-11-02T14:19:53.000Z
2021-06-25T15:16:42.000Z
invenio_app_ils/circulation/api.py
topless/invenio-app-ils
38f5a6b61cdeaf5fa5776613073fa46af28737a9
[ "MIT" ]
null
null
null
# -*- coding: utf-8 -*- # # Copyright (C) 2018-2020 CERN. # # invenio-app-ils is free software; you can redistribute it and/or modify it # under the terms of the MIT License; see LICENSE file for more details. """Invenio App ILS Circulation APIs.""" import uuid from copy import copy, deepcopy from datetime import date, timedelta from functools import partial from elasticsearch import VERSION as ES_VERSION from flask import current_app from flask_login import current_user from invenio_circulation.api import Loan from invenio_circulation.config import (CIRCULATION_STATES_LOAN_ACTIVE, CIRCULATION_STATES_LOAN_COMPLETED) from invenio_circulation.pidstore.pids import CIRCULATION_LOAN_PID_TYPE from invenio_circulation.proxies import current_circulation from invenio_circulation.search.api import search_by_patron_item_or_document from invenio_db import db from invenio_pidstore.models import PIDStatus from invenio_pidstore.providers.recordid_v2 import RecordIdProviderV2 from invenio_app_ils.errors import (IlsException, InvalidParameterError, MissingRequiredParameterError, PatronHasLoanOnDocumentError, PatronHasLoanOnItemError, PatronHasRequestOnDocumentError) from invenio_app_ils.fetchers import pid_fetcher from invenio_app_ils.items.api import Item from invenio_app_ils.minters import pid_minter from invenio_app_ils.proxies import current_app_ils lt_es7 = ES_VERSION[0] < 7 # override default `invenio-circulation` minters to use the base32 PIDs # CIRCULATION_LOAN_PID_TYPE is already defined in `invenio-circulation` ILS_CIRCULATION_LOAN_MINTER = "ilsloanid" ILS_CIRCULATION_LOAN_FETCHER = "ilsloanid" IlsCirculationLoanIdProvider = type( "IlsCirculationLoanIdProvider", (RecordIdProviderV2,), dict( pid_type=CIRCULATION_LOAN_PID_TYPE, default_status=PIDStatus.REGISTERED ), ) ils_circulation_loan_pid_minter = partial( pid_minter, provider_cls=IlsCirculationLoanIdProvider ) ils_circulation_loan_pid_fetcher = partial( pid_fetcher, provider_cls=IlsCirculationLoanIdProvider ) def _validate_delivery(delivery): """Validate `delivery` param.""" methods = list( current_app.config.get("ILS_CIRCULATION_DELIVERY_METHODS", {}).keys() ) if methods: if not delivery or delivery["method"] not in methods: raise MissingRequiredParameterError( description="A valid 'delivery' is required on loan request" ) def _set_item_to_can_circulate(item_pid): """Change the item status to CAN_CIRCULATE.""" item = Item.get_record_by_pid(item_pid["value"]) if item["status"] != "CAN_CIRCULATE": item["status"] = "CAN_CIRCULATE" item.commit() db.session.commit() current_app_ils.item_indexer.index(item) def patron_has_active_loan_or_request_on_document(patron_pid, document_pid): """Return True if patron has an active loan/request for given document.""" states = ( current_app.config["CIRCULATION_STATES_LOAN_REQUEST"] + current_app.config["CIRCULATION_STATES_LOAN_ACTIVE"] ) search = search_by_patron_item_or_document( patron_pid=patron_pid, document_pid=document_pid, filter_states=states ) search_result = search.execute() return ( search_result, search_result.hits.total > 0 if lt_es7 else search_result.hits.total.value > 0, ) def request_loan( document_pid, patron_pid, transaction_location_pid, transaction_user_pid=None, **kwargs ): """Create a new loan and trigger the first transition to PENDING.""" search_result, loan_found = patron_has_active_loan_or_request_on_document( patron_pid, document_pid ) if loan_found: if ( search_result.hits[0].state in current_app.config["CIRCULATION_STATES_LOAN_REQUEST"] ): raise PatronHasRequestOnDocumentError(patron_pid, document_pid) raise PatronHasLoanOnDocumentError(patron_pid, document_pid) _validate_delivery(kwargs.get("delivery")) transaction_user_pid = transaction_user_pid or str(current_user.id) # create a new loan record_uuid = uuid.uuid4() new_loan = dict( patron_pid=patron_pid, transaction_location_pid=transaction_location_pid, transaction_user_pid=transaction_user_pid, ) pid = ils_circulation_loan_pid_minter(record_uuid, data=new_loan) loan = Loan.create(data=new_loan, id_=record_uuid) params = deepcopy(loan) params.update(document_pid=document_pid, **kwargs) # trigger the transition to request loan = current_circulation.circulation.trigger( loan, **dict(params, trigger="request") ) return pid, loan def patron_has_active_loan_on_item(patron_pid, item_pid): """Return True if patron has a active Loan for given item.""" search = search_by_patron_item_or_document( patron_pid=patron_pid, item_pid=item_pid, filter_states=current_app.config["CIRCULATION_STATES_LOAN_ACTIVE"], ) search_result = search.execute() return ( search_result.hits.total > 0 if lt_es7 else search_result.hits.total.value > 0 ) def checkout_loan( item_pid, patron_pid, transaction_location_pid, transaction_user_pid=None, force=False, **kwargs ): """Create a new loan and trigger the first transition to ITEM_ON_LOAN. :param item_pid: a dict containing `value` and `type` fields to uniquely identify the item. :param patron_pid: the PID value of the patron :param transaction_location_pid: the PID value of the location where the checkout is performed :param transaction_user_pid: the PID value of the user that performed the checkout :param force: if True, ignore the current status of the item and do perform the checkout. If False, the checkout will fail when the item cannot circulate. """ if patron_has_active_loan_on_item( patron_pid=patron_pid, item_pid=item_pid ): raise PatronHasLoanOnItemError(patron_pid, item_pid) optional_delivery = kwargs.get("delivery") if optional_delivery: _validate_delivery(optional_delivery) if force: _set_item_to_can_circulate(item_pid) transaction_user_pid = transaction_user_pid or str(current_user.id) # create a new loan record_uuid = uuid.uuid4() new_loan = dict( patron_pid=patron_pid, transaction_location_pid=transaction_location_pid, transaction_user_pid=transaction_user_pid, ) pid = ils_circulation_loan_pid_minter(record_uuid, data=new_loan) loan = Loan.create(data=new_loan, id_=record_uuid) params = deepcopy(loan) params.update(item_pid=item_pid, **kwargs) # trigger the transition to request loan = current_circulation.circulation.trigger( loan, **dict(params, trigger="checkout") ) return pid, loan def update_dates_loan(record, start_date=None, end_date=None, request_start_date=None, request_expire_date=None): """Updates the dates of a loan.""" state = record["state"] is_active_or_completed = state in CIRCULATION_STATES_LOAN_ACTIVE \ or state in CIRCULATION_STATES_LOAN_COMPLETED data = copy(record) if is_active_or_completed: today = date.today().strftime("%Y-%m-%d") if request_start_date or request_expire_date: raise IlsException(description="Cannot modify request dates of an active or completed loan.") if start_date: if start_date > today: raise InvalidParameterError(description="Start date cannot be in the future for active loans.") data["start_date"] = start_date if end_date: data["end_date"] = end_date if data["end_date"] < data["start_date"]: raise InvalidParameterError(description="Negative date range.") else: # Pending or cancelled if start_date or end_date: raise IlsException(description="Cannot modify dates of a pending or cancelled loan.") if request_start_date: data["request_start_date"] = request_start_date if request_expire_date: data["request_expire_date"] = request_expire_date if data["request_expire_date"] < data["request_start_date"]: raise InvalidParameterError(description="Negative date range.") record.update(data) record.commit() db.session.commit() current_circulation.loan_indexer().index(record) return record def circulation_default_loan_duration_for_item(item): """Transform circulation restrictions to timedelta for the given item.""" value = item.get("circulation_restriction", "NO_RESTRICTION") if value == "ONE_WEEK": return timedelta(weeks=1) elif value == "TWO_WEEKS": return timedelta(weeks=2) elif value == "THREE_WEEKS": return timedelta(weeks=3) elif value == "FOUR_WEEKS": return timedelta(weeks=4) else: # default: NO_RESTRICTION return timedelta(weeks=4)
34.66791
113
0.708966
import uuid from copy import copy, deepcopy from datetime import date, timedelta from functools import partial from elasticsearch import VERSION as ES_VERSION from flask import current_app from flask_login import current_user from invenio_circulation.api import Loan from invenio_circulation.config import (CIRCULATION_STATES_LOAN_ACTIVE, CIRCULATION_STATES_LOAN_COMPLETED) from invenio_circulation.pidstore.pids import CIRCULATION_LOAN_PID_TYPE from invenio_circulation.proxies import current_circulation from invenio_circulation.search.api import search_by_patron_item_or_document from invenio_db import db from invenio_pidstore.models import PIDStatus from invenio_pidstore.providers.recordid_v2 import RecordIdProviderV2 from invenio_app_ils.errors import (IlsException, InvalidParameterError, MissingRequiredParameterError, PatronHasLoanOnDocumentError, PatronHasLoanOnItemError, PatronHasRequestOnDocumentError) from invenio_app_ils.fetchers import pid_fetcher from invenio_app_ils.items.api import Item from invenio_app_ils.minters import pid_minter from invenio_app_ils.proxies import current_app_ils lt_es7 = ES_VERSION[0] < 7 ILS_CIRCULATION_LOAN_MINTER = "ilsloanid" ILS_CIRCULATION_LOAN_FETCHER = "ilsloanid" IlsCirculationLoanIdProvider = type( "IlsCirculationLoanIdProvider", (RecordIdProviderV2,), dict( pid_type=CIRCULATION_LOAN_PID_TYPE, default_status=PIDStatus.REGISTERED ), ) ils_circulation_loan_pid_minter = partial( pid_minter, provider_cls=IlsCirculationLoanIdProvider ) ils_circulation_loan_pid_fetcher = partial( pid_fetcher, provider_cls=IlsCirculationLoanIdProvider ) def _validate_delivery(delivery): methods = list( current_app.config.get("ILS_CIRCULATION_DELIVERY_METHODS", {}).keys() ) if methods: if not delivery or delivery["method"] not in methods: raise MissingRequiredParameterError( description="A valid 'delivery' is required on loan request" ) def _set_item_to_can_circulate(item_pid): item = Item.get_record_by_pid(item_pid["value"]) if item["status"] != "CAN_CIRCULATE": item["status"] = "CAN_CIRCULATE" item.commit() db.session.commit() current_app_ils.item_indexer.index(item) def patron_has_active_loan_or_request_on_document(patron_pid, document_pid): states = ( current_app.config["CIRCULATION_STATES_LOAN_REQUEST"] + current_app.config["CIRCULATION_STATES_LOAN_ACTIVE"] ) search = search_by_patron_item_or_document( patron_pid=patron_pid, document_pid=document_pid, filter_states=states ) search_result = search.execute() return ( search_result, search_result.hits.total > 0 if lt_es7 else search_result.hits.total.value > 0, ) def request_loan( document_pid, patron_pid, transaction_location_pid, transaction_user_pid=None, **kwargs ): search_result, loan_found = patron_has_active_loan_or_request_on_document( patron_pid, document_pid ) if loan_found: if ( search_result.hits[0].state in current_app.config["CIRCULATION_STATES_LOAN_REQUEST"] ): raise PatronHasRequestOnDocumentError(patron_pid, document_pid) raise PatronHasLoanOnDocumentError(patron_pid, document_pid) _validate_delivery(kwargs.get("delivery")) transaction_user_pid = transaction_user_pid or str(current_user.id) record_uuid = uuid.uuid4() new_loan = dict( patron_pid=patron_pid, transaction_location_pid=transaction_location_pid, transaction_user_pid=transaction_user_pid, ) pid = ils_circulation_loan_pid_minter(record_uuid, data=new_loan) loan = Loan.create(data=new_loan, id_=record_uuid) params = deepcopy(loan) params.update(document_pid=document_pid, **kwargs) loan = current_circulation.circulation.trigger( loan, **dict(params, trigger="request") ) return pid, loan def patron_has_active_loan_on_item(patron_pid, item_pid): search = search_by_patron_item_or_document( patron_pid=patron_pid, item_pid=item_pid, filter_states=current_app.config["CIRCULATION_STATES_LOAN_ACTIVE"], ) search_result = search.execute() return ( search_result.hits.total > 0 if lt_es7 else search_result.hits.total.value > 0 ) def checkout_loan( item_pid, patron_pid, transaction_location_pid, transaction_user_pid=None, force=False, **kwargs ): if patron_has_active_loan_on_item( patron_pid=patron_pid, item_pid=item_pid ): raise PatronHasLoanOnItemError(patron_pid, item_pid) optional_delivery = kwargs.get("delivery") if optional_delivery: _validate_delivery(optional_delivery) if force: _set_item_to_can_circulate(item_pid) transaction_user_pid = transaction_user_pid or str(current_user.id) record_uuid = uuid.uuid4() new_loan = dict( patron_pid=patron_pid, transaction_location_pid=transaction_location_pid, transaction_user_pid=transaction_user_pid, ) pid = ils_circulation_loan_pid_minter(record_uuid, data=new_loan) loan = Loan.create(data=new_loan, id_=record_uuid) params = deepcopy(loan) params.update(item_pid=item_pid, **kwargs) loan = current_circulation.circulation.trigger( loan, **dict(params, trigger="checkout") ) return pid, loan def update_dates_loan(record, start_date=None, end_date=None, request_start_date=None, request_expire_date=None): state = record["state"] is_active_or_completed = state in CIRCULATION_STATES_LOAN_ACTIVE \ or state in CIRCULATION_STATES_LOAN_COMPLETED data = copy(record) if is_active_or_completed: today = date.today().strftime("%Y-%m-%d") if request_start_date or request_expire_date: raise IlsException(description="Cannot modify request dates of an active or completed loan.") if start_date: if start_date > today: raise InvalidParameterError(description="Start date cannot be in the future for active loans.") data["start_date"] = start_date if end_date: data["end_date"] = end_date if data["end_date"] < data["start_date"]: raise InvalidParameterError(description="Negative date range.") else: if start_date or end_date: raise IlsException(description="Cannot modify dates of a pending or cancelled loan.") if request_start_date: data["request_start_date"] = request_start_date if request_expire_date: data["request_expire_date"] = request_expire_date if data["request_expire_date"] < data["request_start_date"]: raise InvalidParameterError(description="Negative date range.") record.update(data) record.commit() db.session.commit() current_circulation.loan_indexer().index(record) return record def circulation_default_loan_duration_for_item(item): value = item.get("circulation_restriction", "NO_RESTRICTION") if value == "ONE_WEEK": return timedelta(weeks=1) elif value == "TWO_WEEKS": return timedelta(weeks=2) elif value == "THREE_WEEKS": return timedelta(weeks=3) elif value == "FOUR_WEEKS": return timedelta(weeks=4) else: return timedelta(weeks=4)
true
true
f72b9483d7b40b72fb27e1e57c80b24dc691d800
6,368
py
Python
tests/functional/testplan/testing/test_tagging.py
raoyitao/testplan
aae3e9cee597ca3d01b6d64eed2642c421c56cbb
[ "Apache-2.0" ]
96
2018-03-14T13:14:50.000Z
2021-01-14T08:26:08.000Z
tests/functional/testplan/testing/test_tagging.py
raoyitao/testplan
aae3e9cee597ca3d01b6d64eed2642c421c56cbb
[ "Apache-2.0" ]
135
2018-06-28T02:41:05.000Z
2021-01-19T02:16:58.000Z
tests/functional/testplan/testing/test_tagging.py
raoyitao/testplan
aae3e9cee597ca3d01b6d64eed2642c421c56cbb
[ "Apache-2.0" ]
53
2018-03-17T14:39:15.000Z
2021-01-21T10:54:13.000Z
import pytest from testplan.common.utils.testing import check_report from testplan.report import TestReport, TestGroupReport, TestCaseReport from testplan.testing.multitest import MultiTest, testsuite, testcase @testsuite(tags={"color": ["red", "blue"]}) class AlphaSuite(object): @testcase def test_method_0(self, env, result): pass @testcase(tags=("foo", "bar")) def test_method_1(self, env, result): pass @testcase(tags={"color": "green"}) def test_method_2(self, env, result): pass @testsuite(tags={"color": "yellow"}) class BetaSuite(object): @testcase def test_method_0(self, env, result): pass @testcase(tags="foo") def test_method_1(self, env, result): pass @testcase(tags={"color": "red"}) def test_method_2(self, env, result): pass @testsuite class GammaSuite(object): @testcase def test_method_0(self, env, result): pass @testcase( parameters=("AAA", "BBB"), tag_func=lambda kwargs: {"symbol": kwargs["value"].lower()}, tags={"speed": "slow"}, ) def test_param(self, env, result, value): pass @testcase(parameters=("XXX", "YYY"), tags={"speed": "fast"}) def test_param_2(self, env, result, value): pass report_for_multitest_without_tags = TestGroupReport( name="MyMultitest", category="multitest", entries=[ TestGroupReport( name="AlphaSuite", category="testsuite", tags={"color": {"red", "blue"}}, entries=[ TestCaseReport(name="test_method_0"), TestCaseReport( name="test_method_1", tags={"simple": {"foo", "bar"}} ), TestCaseReport( name="test_method_2", tags={"color": {"green"}} ), ], ), TestGroupReport( name="BetaSuite", category="testsuite", tags={"color": {"yellow"}}, entries=[ TestCaseReport(name="test_method_0"), TestCaseReport(name="test_method_1", tags={"simple": {"foo"}}), TestCaseReport(name="test_method_2", tags={"color": {"red"}}), ], ), TestGroupReport( name="GammaSuite", category="testsuite", entries=[ TestCaseReport(name="test_method_0"), TestGroupReport( name="test_param", category="parametrization", tags={"speed": {"slow"}}, entries=[ TestCaseReport( name="test_param <value='AAA'>", tags={"symbol": {"aaa"}}, ), TestCaseReport( name="test_param <value='BBB'>", tags={"symbol": {"bbb"}}, ), ], ), TestGroupReport( name="test_param_2", category="parametrization", tags={"speed": {"fast"}}, entries=[ TestCaseReport(name="test_param_2 <value='XXX'>"), TestCaseReport(name="test_param_2 <value='YYY'>"), ], ), ], ), ], ) report_for_multitest_with_tags = TestGroupReport( name="MyMultitest", category="multitest", tags={"color": {"orange"}, "environment": {"server"}}, entries=[ TestGroupReport( name="AlphaSuite", category="testsuite", tags={"color": {"red", "blue"}}, entries=[ TestCaseReport(name="test_method_0"), TestCaseReport( name="test_method_1", tags={"simple": {"foo", "bar"}} ), TestCaseReport( name="test_method_2", tags={"color": {"green"}} ), ], ), TestGroupReport( name="BetaSuite", category="testsuite", tags={"color": {"yellow"}}, entries=[ TestCaseReport(name="test_method_0"), TestCaseReport(name="test_method_1", tags={"simple": {"foo"}}), TestCaseReport(name="test_method_2", tags={"color": {"red"}}), ], ), TestGroupReport( name="GammaSuite", category="testsuite", entries=[ TestCaseReport(name="test_method_0"), TestGroupReport( name="test_param", category="parametrization", tags={"speed": {"slow"}}, entries=[ TestCaseReport( name="test_param <value='AAA'>", tags={"symbol": {"aaa"}}, ), TestCaseReport( name="test_param <value='BBB'>", tags={"symbol": {"bbb"}}, ), ], ), TestGroupReport( name="test_param_2", category="parametrization", tags={"speed": {"fast"}}, entries=[ TestCaseReport(name="test_param_2 <value='XXX'>"), TestCaseReport(name="test_param_2 <value='YYY'>"), ], ), ], ), ], ) @pytest.mark.parametrize( "multitest_tags,expected_report", ( ({}, report_for_multitest_without_tags), ( {"color": "orange", "environment": "server"}, report_for_multitest_with_tags, ), ), ) def test_multitest_tagging(mockplan, multitest_tags, expected_report): multitest = MultiTest( name="MyMultitest", suites=[AlphaSuite(), BetaSuite(), GammaSuite()], tags=multitest_tags, ) mockplan.add(multitest) mockplan.run() check_report( expected=TestReport(name="plan", entries=[expected_report]), actual=mockplan.report, )
30.4689
79
0.468907
import pytest from testplan.common.utils.testing import check_report from testplan.report import TestReport, TestGroupReport, TestCaseReport from testplan.testing.multitest import MultiTest, testsuite, testcase @testsuite(tags={"color": ["red", "blue"]}) class AlphaSuite(object): @testcase def test_method_0(self, env, result): pass @testcase(tags=("foo", "bar")) def test_method_1(self, env, result): pass @testcase(tags={"color": "green"}) def test_method_2(self, env, result): pass @testsuite(tags={"color": "yellow"}) class BetaSuite(object): @testcase def test_method_0(self, env, result): pass @testcase(tags="foo") def test_method_1(self, env, result): pass @testcase(tags={"color": "red"}) def test_method_2(self, env, result): pass @testsuite class GammaSuite(object): @testcase def test_method_0(self, env, result): pass @testcase( parameters=("AAA", "BBB"), tag_func=lambda kwargs: {"symbol": kwargs["value"].lower()}, tags={"speed": "slow"}, ) def test_param(self, env, result, value): pass @testcase(parameters=("XXX", "YYY"), tags={"speed": "fast"}) def test_param_2(self, env, result, value): pass report_for_multitest_without_tags = TestGroupReport( name="MyMultitest", category="multitest", entries=[ TestGroupReport( name="AlphaSuite", category="testsuite", tags={"color": {"red", "blue"}}, entries=[ TestCaseReport(name="test_method_0"), TestCaseReport( name="test_method_1", tags={"simple": {"foo", "bar"}} ), TestCaseReport( name="test_method_2", tags={"color": {"green"}} ), ], ), TestGroupReport( name="BetaSuite", category="testsuite", tags={"color": {"yellow"}}, entries=[ TestCaseReport(name="test_method_0"), TestCaseReport(name="test_method_1", tags={"simple": {"foo"}}), TestCaseReport(name="test_method_2", tags={"color": {"red"}}), ], ), TestGroupReport( name="GammaSuite", category="testsuite", entries=[ TestCaseReport(name="test_method_0"), TestGroupReport( name="test_param", category="parametrization", tags={"speed": {"slow"}}, entries=[ TestCaseReport( name="test_param <value='AAA'>", tags={"symbol": {"aaa"}}, ), TestCaseReport( name="test_param <value='BBB'>", tags={"symbol": {"bbb"}}, ), ], ), TestGroupReport( name="test_param_2", category="parametrization", tags={"speed": {"fast"}}, entries=[ TestCaseReport(name="test_param_2 <value='XXX'>"), TestCaseReport(name="test_param_2 <value='YYY'>"), ], ), ], ), ], ) report_for_multitest_with_tags = TestGroupReport( name="MyMultitest", category="multitest", tags={"color": {"orange"}, "environment": {"server"}}, entries=[ TestGroupReport( name="AlphaSuite", category="testsuite", tags={"color": {"red", "blue"}}, entries=[ TestCaseReport(name="test_method_0"), TestCaseReport( name="test_method_1", tags={"simple": {"foo", "bar"}} ), TestCaseReport( name="test_method_2", tags={"color": {"green"}} ), ], ), TestGroupReport( name="BetaSuite", category="testsuite", tags={"color": {"yellow"}}, entries=[ TestCaseReport(name="test_method_0"), TestCaseReport(name="test_method_1", tags={"simple": {"foo"}}), TestCaseReport(name="test_method_2", tags={"color": {"red"}}), ], ), TestGroupReport( name="GammaSuite", category="testsuite", entries=[ TestCaseReport(name="test_method_0"), TestGroupReport( name="test_param", category="parametrization", tags={"speed": {"slow"}}, entries=[ TestCaseReport( name="test_param <value='AAA'>", tags={"symbol": {"aaa"}}, ), TestCaseReport( name="test_param <value='BBB'>", tags={"symbol": {"bbb"}}, ), ], ), TestGroupReport( name="test_param_2", category="parametrization", tags={"speed": {"fast"}}, entries=[ TestCaseReport(name="test_param_2 <value='XXX'>"), TestCaseReport(name="test_param_2 <value='YYY'>"), ], ), ], ), ], ) @pytest.mark.parametrize( "multitest_tags,expected_report", ( ({}, report_for_multitest_without_tags), ( {"color": "orange", "environment": "server"}, report_for_multitest_with_tags, ), ), ) def test_multitest_tagging(mockplan, multitest_tags, expected_report): multitest = MultiTest( name="MyMultitest", suites=[AlphaSuite(), BetaSuite(), GammaSuite()], tags=multitest_tags, ) mockplan.add(multitest) mockplan.run() check_report( expected=TestReport(name="plan", entries=[expected_report]), actual=mockplan.report, )
true
true
f72b94a2fc75245f4a10ca168ed20ceaddbee478
12,107
py
Python
test/functional/mining_basic.py
onixcoin-io/onix
37c158a6229fa98c1a86f8b65e91226e36355fd6
[ "MIT" ]
6
2021-10-31T04:53:09.000Z
2021-12-16T08:27:06.000Z
test/functional/mining_basic.py
onixcoin-io/onix
37c158a6229fa98c1a86f8b65e91226e36355fd6
[ "MIT" ]
1
2021-11-29T08:45:38.000Z
2021-11-29T08:45:38.000Z
test/functional/mining_basic.py
onixcoin-io/onix
37c158a6229fa98c1a86f8b65e91226e36355fd6
[ "MIT" ]
null
null
null
#!/usr/bin/env python3 # Copyright (c) 2014-2019 The Bitcoin Core developers # Distributed under the MIT software license, see the accompanying # file COPYING or http://www.opensource.org/licenses/mit-license.php. """Test mining RPCs - getmininginfo - getblocktemplate proposal mode - submitblock""" import copy from decimal import Decimal from test_framework.blocktools import ( create_coinbase, TIME_GENESIS_BLOCK, ) from test_framework.messages import ( CBlock, CBlockHeader ) from test_framework.mininode import ( P2PDataStore, ) from test_framework.test_framework import BitcoinTestFramework from test_framework.util import ( assert_equal, assert_raises_rpc_error, connect_nodes, ) from test_framework.script import CScriptNum BLOCK_HEADER_SIZE = len(CBlockHeader().serialize()) def assert_template(node, block, expect, rehash=True): if rehash: block.hashMerkleRoot = block.calc_merkle_root() rsp = node.getblocktemplate(template_request={'data': block.serialize().hex(), 'mode': 'proposal', 'rules': ['segwit']}) assert_equal(rsp, expect) class MiningTest(BitcoinTestFramework): def set_test_params(self): self.num_nodes = 2 self.setup_clean_chain = True self.supports_cli = False def mine_chain(self): self.log.info('Create some old blocks') for t in range(TIME_GENESIS_BLOCK, TIME_GENESIS_BLOCK + 600 * 600, 600): self.nodes[0].setmocktime(t) self.nodes[0].generate(1) mining_info = self.nodes[0].getmininginfo() assert_equal(mining_info['blocks'], 600) assert_equal(mining_info['currentblocktx'], 0) assert_equal(mining_info['currentblockweight'], 4000) self.restart_node(0) connect_nodes(self.nodes[0], 1) def run_test(self): self.mine_chain() node = self.nodes[0] def assert_submitblock(block, result_str_1, result_str_2=None): block.solve() result_str_2 = result_str_2 or 'duplicate-invalid' assert_equal(result_str_1, node.submitblock(hexdata=block.serialize().hex())) assert_equal(result_str_2, node.submitblock(hexdata=block.serialize().hex())) self.log.info('getmininginfo') mining_info = node.getmininginfo() assert_equal(mining_info['blocks'], 600) assert_equal(mining_info['chain'], self.chain) assert 'currentblocktx' not in mining_info assert 'currentblockweight' not in mining_info assert_equal(mining_info['difficulty']['proof-of-work'], Decimal('4.656542373906925E-10')) assert_equal(mining_info['networkhashps'], Decimal('0.003333333333333334')) assert_equal(mining_info['pooledtx'], 0) # Mine a block to leave initial block download node.generatetoaddress(1, node.get_deterministic_priv_key().address) tmpl = node.getblocktemplate({'rules': ['segwit']}) self.log.info("getblocktemplate: Test capability advertised") assert 'proposal' in tmpl['capabilities'] assert 'coinbasetxn' not in tmpl coinbase_tx = create_coinbase(height=int(tmpl["height"])) # sequence numbers must not be max for nLockTime to have effect coinbase_tx.vin[0].nSequence = 2 ** 32 - 2 coinbase_tx.rehash() # round-trip the encoded bip34 block height commitment assert_equal(CScriptNum.decode(coinbase_tx.vin[0].scriptSig), 602) # round-trip negative and multi-byte CScriptNums to catch python regression assert_equal(CScriptNum.decode(CScriptNum.encode(CScriptNum(1500))), 1500) assert_equal(CScriptNum.decode(CScriptNum.encode(CScriptNum(-1500))), -1500) assert_equal(CScriptNum.decode(CScriptNum.encode(CScriptNum(-1))), -1) block = CBlock() block.nVersion = tmpl["version"] block.hashPrevBlock = int(tmpl["previousblockhash"], 16) block.nTime = tmpl["curtime"] block.nBits = int(tmpl["bits"], 16) block.nNonce = 0 block.vtx = [coinbase_tx] self.log.info("getblocktemplate: segwit rule must be set") assert_raises_rpc_error(-8, "getblocktemplate must be called with the segwit rule set", node.getblocktemplate) self.log.info("getblocktemplate: Test valid block") assert_template(node, block, None) self.log.info("submitblock: Test block decode failure") assert_raises_rpc_error(-22, "Block decode failed", node.submitblock, block.serialize()[:-15].hex()) self.log.info("getblocktemplate: Test bad input hash for coinbase transaction") bad_block = copy.deepcopy(block) bad_block.vtx[0].vin[0].prevout.hash += 1 bad_block.vtx[0].rehash() assert_template(node, bad_block, 'bad-cb-missing') self.log.info("submitblock: Test invalid coinbase transaction") assert_raises_rpc_error(-22, "Block does not start with a coinbase", node.submitblock, bad_block.serialize().hex()) self.log.info("getblocktemplate: Test truncated final transaction") assert_raises_rpc_error(-22, "Block decode failed", node.getblocktemplate, {'data': block.serialize()[:-1].hex(), 'mode': 'proposal', 'rules': ['segwit']}) self.log.info("getblocktemplate: Test duplicate transaction") bad_block = copy.deepcopy(block) bad_block.vtx.append(bad_block.vtx[0]) assert_template(node, bad_block, 'bad-txns-duplicate') assert_submitblock(bad_block, 'bad-txns-duplicate', 'bad-txns-duplicate') self.log.info("getblocktemplate: Test invalid transaction") bad_block = copy.deepcopy(block) bad_tx = copy.deepcopy(bad_block.vtx[0]) bad_tx.vin[0].prevout.hash = 255 bad_tx.rehash() bad_block.vtx.append(bad_tx) assert_template(node, bad_block, 'bad-txns-inputs-missingorspent') assert_submitblock(bad_block, 'bad-txns-inputs-missingorspent') self.log.info("getblocktemplate: Test nonfinal transaction") bad_block = copy.deepcopy(block) bad_block.vtx[0].nLockTime = 2 ** 32 - 1 bad_block.vtx[0].rehash() assert_template(node, bad_block, 'bad-txns-nonfinal') assert_submitblock(bad_block, 'bad-txns-nonfinal') self.log.info("getblocktemplate: Test bad tx count") # The tx count is immediately after the block header TX_COUNT_OFFSET = 181 bad_block_sn = bytearray(block.serialize()) assert_equal(bad_block_sn[BLOCK_HEADER_SIZE], 1) bad_block_sn[BLOCK_HEADER_SIZE] += 1 assert_raises_rpc_error(-22, "Block decode failed", node.getblocktemplate, {'data': bad_block_sn.hex(), 'mode': 'proposal', 'rules': ['segwit']}) self.log.info("getblocktemplate: Test bad bits") bad_block = copy.deepcopy(block) bad_block.nBits = 469762303 # impossible in the real world assert_template(node, bad_block, 'bad-diffbits') self.log.info("getblocktemplate: Test bad merkle root") bad_block = copy.deepcopy(block) bad_block.hashMerkleRoot += 1 assert_template(node, bad_block, 'bad-txnmrklroot', False) assert_submitblock(bad_block, 'bad-txnmrklroot', 'bad-txnmrklroot') #self.log.info("getblocktemplate: Test bad timestamps") #bad_block = copy.deepcopy(block) #bad_block.nTime = 2 ** 31 - 1 #assert_template(node, bad_block, 'time-too-new') #assert_submitblock(bad_block, 'time-too-new', 'time-too-new') #bad_block.nTime = 0 #assert_template(node, bad_block, 'time-too-old') #assert_submitblock(bad_block, 'time-too-old', 'time-too-old') self.log.info("getblocktemplate: Test not best block") bad_block = copy.deepcopy(block) bad_block.hashPrevBlock = 123 assert_template(node, bad_block, 'inconclusive-not-best-prevblk') assert_submitblock(bad_block, 'prev-blk-not-found', 'prev-blk-not-found') self.log.info('submitheader tests') assert_raises_rpc_error(-22, 'Block header decode failed', lambda: node.submitheader(hexdata='xx' * BLOCK_HEADER_SIZE)) assert_raises_rpc_error(-22, 'Block header decode failed', lambda: node.submitheader(hexdata='ff' * (BLOCK_HEADER_SIZE-2))) assert_raises_rpc_error(-25, 'Must submit previous header', lambda: node.submitheader(hexdata=super(CBlock, bad_block).serialize().hex())) block.nTime += 1 block.solve() def chain_tip(b_hash, *, status='headers-only', branchlen=1): return {'hash': b_hash, 'height': 602, 'branchlen': branchlen, 'status': status} assert chain_tip(block.hash) not in node.getchaintips() node.submitheader(hexdata=block.serialize().hex()) assert chain_tip(block.hash) in node.getchaintips() node.submitheader(hexdata=CBlockHeader(block).serialize().hex()) # Noop assert chain_tip(block.hash) in node.getchaintips() bad_block_root = copy.deepcopy(block) bad_block_root.hashMerkleRoot += 2 bad_block_root.solve() assert chain_tip(bad_block_root.hash) not in node.getchaintips() node.submitheader(hexdata=CBlockHeader(bad_block_root).serialize().hex()) assert chain_tip(bad_block_root.hash) in node.getchaintips() # Should still reject invalid blocks, even if we have the header: assert_equal(node.submitblock(hexdata=bad_block_root.serialize().hex()), 'bad-txnmrklroot') assert_equal(node.submitblock(hexdata=bad_block_root.serialize().hex()), 'bad-txnmrklroot') assert chain_tip(bad_block_root.hash) in node.getchaintips() # We know the header for this invalid block, so should just return early without error: node.submitheader(hexdata=CBlockHeader(bad_block_root).serialize().hex()) assert chain_tip(bad_block_root.hash) in node.getchaintips() bad_block_lock = copy.deepcopy(block) bad_block_lock.vtx[0].nLockTime = 2**32 - 1 bad_block_lock.vtx[0].rehash() bad_block_lock.hashMerkleRoot = bad_block_lock.calc_merkle_root() bad_block_lock.solve() assert_equal(node.submitblock(hexdata=bad_block_lock.serialize().hex()), 'bad-txns-nonfinal') assert_equal(node.submitblock(hexdata=bad_block_lock.serialize().hex()), 'duplicate-invalid') # Build a "good" block on top of the submitted bad block bad_block2 = copy.deepcopy(block) bad_block2.hashPrevBlock = bad_block_lock.sha256 bad_block2.solve() assert_raises_rpc_error(-25, 'bad-prevblk', lambda: node.submitheader(hexdata=CBlockHeader(bad_block2).serialize().hex())) # Should reject invalid header right away, only applies to PoS blocks in onix. #bad_block_time = copy.deepcopy(block) #bad_block_time.nTime = 1 #bad_block_time.solve() #assert_raises_rpc_error(-25, 'time-too-old', lambda: node.submitheader(hexdata=CBlockHeader(bad_block_time).serialize().hex())) # Should ask for the block from a p2p node, if they announce the header as well: node.add_p2p_connection(P2PDataStore()) node.p2p.wait_for_getheaders(timeout=5) # Drop the first getheaders node.p2p.send_blocks_and_test(blocks=[block], node=node) # Must be active now: assert chain_tip(block.hash, status='active', branchlen=0) in node.getchaintips() # Building a few blocks should give the same results node.generatetoaddress(10, node.get_deterministic_priv_key().address) #assert_raises_rpc_error(-25, 'time-too-old', lambda: node.submitheader(hexdata=CBlockHeader(bad_block_time).serialize().hex())) assert_raises_rpc_error(-25, 'bad-prevblk', lambda: node.submitheader(hexdata=CBlockHeader(bad_block2).serialize().hex())) node.submitheader(hexdata=CBlockHeader(block).serialize().hex()) node.submitheader(hexdata=CBlockHeader(bad_block_root).serialize().hex()) assert_equal(node.submitblock(hexdata=block.serialize().hex()), 'duplicate') # valid if __name__ == '__main__': MiningTest().main()
48.043651
163
0.690262
import copy from decimal import Decimal from test_framework.blocktools import ( create_coinbase, TIME_GENESIS_BLOCK, ) from test_framework.messages import ( CBlock, CBlockHeader ) from test_framework.mininode import ( P2PDataStore, ) from test_framework.test_framework import BitcoinTestFramework from test_framework.util import ( assert_equal, assert_raises_rpc_error, connect_nodes, ) from test_framework.script import CScriptNum BLOCK_HEADER_SIZE = len(CBlockHeader().serialize()) def assert_template(node, block, expect, rehash=True): if rehash: block.hashMerkleRoot = block.calc_merkle_root() rsp = node.getblocktemplate(template_request={'data': block.serialize().hex(), 'mode': 'proposal', 'rules': ['segwit']}) assert_equal(rsp, expect) class MiningTest(BitcoinTestFramework): def set_test_params(self): self.num_nodes = 2 self.setup_clean_chain = True self.supports_cli = False def mine_chain(self): self.log.info('Create some old blocks') for t in range(TIME_GENESIS_BLOCK, TIME_GENESIS_BLOCK + 600 * 600, 600): self.nodes[0].setmocktime(t) self.nodes[0].generate(1) mining_info = self.nodes[0].getmininginfo() assert_equal(mining_info['blocks'], 600) assert_equal(mining_info['currentblocktx'], 0) assert_equal(mining_info['currentblockweight'], 4000) self.restart_node(0) connect_nodes(self.nodes[0], 1) def run_test(self): self.mine_chain() node = self.nodes[0] def assert_submitblock(block, result_str_1, result_str_2=None): block.solve() result_str_2 = result_str_2 or 'duplicate-invalid' assert_equal(result_str_1, node.submitblock(hexdata=block.serialize().hex())) assert_equal(result_str_2, node.submitblock(hexdata=block.serialize().hex())) self.log.info('getmininginfo') mining_info = node.getmininginfo() assert_equal(mining_info['blocks'], 600) assert_equal(mining_info['chain'], self.chain) assert 'currentblocktx' not in mining_info assert 'currentblockweight' not in mining_info assert_equal(mining_info['difficulty']['proof-of-work'], Decimal('4.656542373906925E-10')) assert_equal(mining_info['networkhashps'], Decimal('0.003333333333333334')) assert_equal(mining_info['pooledtx'], 0) node.generatetoaddress(1, node.get_deterministic_priv_key().address) tmpl = node.getblocktemplate({'rules': ['segwit']}) self.log.info("getblocktemplate: Test capability advertised") assert 'proposal' in tmpl['capabilities'] assert 'coinbasetxn' not in tmpl coinbase_tx = create_coinbase(height=int(tmpl["height"])) coinbase_tx.vin[0].nSequence = 2 ** 32 - 2 coinbase_tx.rehash() assert_equal(CScriptNum.decode(coinbase_tx.vin[0].scriptSig), 602) assert_equal(CScriptNum.decode(CScriptNum.encode(CScriptNum(1500))), 1500) assert_equal(CScriptNum.decode(CScriptNum.encode(CScriptNum(-1500))), -1500) assert_equal(CScriptNum.decode(CScriptNum.encode(CScriptNum(-1))), -1) block = CBlock() block.nVersion = tmpl["version"] block.hashPrevBlock = int(tmpl["previousblockhash"], 16) block.nTime = tmpl["curtime"] block.nBits = int(tmpl["bits"], 16) block.nNonce = 0 block.vtx = [coinbase_tx] self.log.info("getblocktemplate: segwit rule must be set") assert_raises_rpc_error(-8, "getblocktemplate must be called with the segwit rule set", node.getblocktemplate) self.log.info("getblocktemplate: Test valid block") assert_template(node, block, None) self.log.info("submitblock: Test block decode failure") assert_raises_rpc_error(-22, "Block decode failed", node.submitblock, block.serialize()[:-15].hex()) self.log.info("getblocktemplate: Test bad input hash for coinbase transaction") bad_block = copy.deepcopy(block) bad_block.vtx[0].vin[0].prevout.hash += 1 bad_block.vtx[0].rehash() assert_template(node, bad_block, 'bad-cb-missing') self.log.info("submitblock: Test invalid coinbase transaction") assert_raises_rpc_error(-22, "Block does not start with a coinbase", node.submitblock, bad_block.serialize().hex()) self.log.info("getblocktemplate: Test truncated final transaction") assert_raises_rpc_error(-22, "Block decode failed", node.getblocktemplate, {'data': block.serialize()[:-1].hex(), 'mode': 'proposal', 'rules': ['segwit']}) self.log.info("getblocktemplate: Test duplicate transaction") bad_block = copy.deepcopy(block) bad_block.vtx.append(bad_block.vtx[0]) assert_template(node, bad_block, 'bad-txns-duplicate') assert_submitblock(bad_block, 'bad-txns-duplicate', 'bad-txns-duplicate') self.log.info("getblocktemplate: Test invalid transaction") bad_block = copy.deepcopy(block) bad_tx = copy.deepcopy(bad_block.vtx[0]) bad_tx.vin[0].prevout.hash = 255 bad_tx.rehash() bad_block.vtx.append(bad_tx) assert_template(node, bad_block, 'bad-txns-inputs-missingorspent') assert_submitblock(bad_block, 'bad-txns-inputs-missingorspent') self.log.info("getblocktemplate: Test nonfinal transaction") bad_block = copy.deepcopy(block) bad_block.vtx[0].nLockTime = 2 ** 32 - 1 bad_block.vtx[0].rehash() assert_template(node, bad_block, 'bad-txns-nonfinal') assert_submitblock(bad_block, 'bad-txns-nonfinal') self.log.info("getblocktemplate: Test bad tx count") TX_COUNT_OFFSET = 181 bad_block_sn = bytearray(block.serialize()) assert_equal(bad_block_sn[BLOCK_HEADER_SIZE], 1) bad_block_sn[BLOCK_HEADER_SIZE] += 1 assert_raises_rpc_error(-22, "Block decode failed", node.getblocktemplate, {'data': bad_block_sn.hex(), 'mode': 'proposal', 'rules': ['segwit']}) self.log.info("getblocktemplate: Test bad bits") bad_block = copy.deepcopy(block) bad_block.nBits = 469762303 assert_template(node, bad_block, 'bad-diffbits') self.log.info("getblocktemplate: Test bad merkle root") bad_block = copy.deepcopy(block) bad_block.hashMerkleRoot += 1 assert_template(node, bad_block, 'bad-txnmrklroot', False) assert_submitblock(bad_block, 'bad-txnmrklroot', 'bad-txnmrklroot') self.log.info("getblocktemplate: Test not best block") bad_block = copy.deepcopy(block) bad_block.hashPrevBlock = 123 assert_template(node, bad_block, 'inconclusive-not-best-prevblk') assert_submitblock(bad_block, 'prev-blk-not-found', 'prev-blk-not-found') self.log.info('submitheader tests') assert_raises_rpc_error(-22, 'Block header decode failed', lambda: node.submitheader(hexdata='xx' * BLOCK_HEADER_SIZE)) assert_raises_rpc_error(-22, 'Block header decode failed', lambda: node.submitheader(hexdata='ff' * (BLOCK_HEADER_SIZE-2))) assert_raises_rpc_error(-25, 'Must submit previous header', lambda: node.submitheader(hexdata=super(CBlock, bad_block).serialize().hex())) block.nTime += 1 block.solve() def chain_tip(b_hash, *, status='headers-only', branchlen=1): return {'hash': b_hash, 'height': 602, 'branchlen': branchlen, 'status': status} assert chain_tip(block.hash) not in node.getchaintips() node.submitheader(hexdata=block.serialize().hex()) assert chain_tip(block.hash) in node.getchaintips() node.submitheader(hexdata=CBlockHeader(block).serialize().hex()) assert chain_tip(block.hash) in node.getchaintips() bad_block_root = copy.deepcopy(block) bad_block_root.hashMerkleRoot += 2 bad_block_root.solve() assert chain_tip(bad_block_root.hash) not in node.getchaintips() node.submitheader(hexdata=CBlockHeader(bad_block_root).serialize().hex()) assert chain_tip(bad_block_root.hash) in node.getchaintips() assert_equal(node.submitblock(hexdata=bad_block_root.serialize().hex()), 'bad-txnmrklroot') assert_equal(node.submitblock(hexdata=bad_block_root.serialize().hex()), 'bad-txnmrklroot') assert chain_tip(bad_block_root.hash) in node.getchaintips() node.submitheader(hexdata=CBlockHeader(bad_block_root).serialize().hex()) assert chain_tip(bad_block_root.hash) in node.getchaintips() bad_block_lock = copy.deepcopy(block) bad_block_lock.vtx[0].nLockTime = 2**32 - 1 bad_block_lock.vtx[0].rehash() bad_block_lock.hashMerkleRoot = bad_block_lock.calc_merkle_root() bad_block_lock.solve() assert_equal(node.submitblock(hexdata=bad_block_lock.serialize().hex()), 'bad-txns-nonfinal') assert_equal(node.submitblock(hexdata=bad_block_lock.serialize().hex()), 'duplicate-invalid') bad_block2 = copy.deepcopy(block) bad_block2.hashPrevBlock = bad_block_lock.sha256 bad_block2.solve() assert_raises_rpc_error(-25, 'bad-prevblk', lambda: node.submitheader(hexdata=CBlockHeader(bad_block2).serialize().hex())) node.add_p2p_connection(P2PDataStore()) node.p2p.wait_for_getheaders(timeout=5) node.p2p.send_blocks_and_test(blocks=[block], node=node) assert chain_tip(block.hash, status='active', branchlen=0) in node.getchaintips() node.generatetoaddress(10, node.get_deterministic_priv_key().address) assert_raises_rpc_error(-25, 'bad-prevblk', lambda: node.submitheader(hexdata=CBlockHeader(bad_block2).serialize().hex())) node.submitheader(hexdata=CBlockHeader(block).serialize().hex()) node.submitheader(hexdata=CBlockHeader(bad_block_root).serialize().hex()) assert_equal(node.submitblock(hexdata=block.serialize().hex()), 'duplicate') if __name__ == '__main__': MiningTest().main()
true
true
f72b9664774aac869ec7bb4e09b59f25f377508a
3,245
py
Python
twikoto3/mainwindow.py
azyobuzin/twikoto3
8a4efc4ff7280a559f448234cbc3a0bc740e8388
[ "Apache-2.0" ]
1
2017-12-27T09:50:47.000Z
2017-12-27T09:50:47.000Z
twikoto3/mainwindow.py
azyobuzin/twikoto3
8a4efc4ff7280a559f448234cbc3a0bc740e8388
[ "Apache-2.0" ]
null
null
null
twikoto3/mainwindow.py
azyobuzin/twikoto3
8a4efc4ff7280a559f448234cbc3a0bc740e8388
[ "Apache-2.0" ]
null
null
null
# -*- coding: utf-8 -*- """ twikoto3 - Twitter Client Copyright (C) 2012 azyobuzin This program is free software: you can redistribute it and/or modify it under the terms of the GNU General Public License as published by the Free Software Foundation, either version 3 of the License, or (at your option) any later version. This program is distributed in the hope that it will be useful, but WITHOUT ANY WARRANTY; without even the implied warranty of MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU General Public License for more details. You should have received a copy of the GNU General Public License along with this program. If not, see <http://www.gnu.org/licenses/>. """ from PyQt4 import QtCore, QtGui import twikoto3 from twikoto3.extension import * from twikoto3.twittertext import validator class TweetTextEdit(QtGui.QTextEdit): def __init__(self, parent = None): super(TweetTextEdit, self).__init__(parent) self.tweetaction = None def keyPressEvent(self, e): if e.key() == QtCore.Qt.Key_Return and (e.modifiers() and QtCore.Qt.ControlModifier): self.tweetaction() else: super(TweetTextEdit, self).keyPressEvent(e) class MainWindow(QtGui.QMainWindow): def __init__(self, parent = None): super(MainWindow, self).__init__(parent) self.setWindowTitle("ついこと 3") self.layout = QtGui.QVBoxLayout() self.textedit_tweet = TweetTextEdit() self.textedit_tweet.setMinimumHeight(46) self.textedit_tweet.textChanged.connect(self.textedit_tweet_textChanged) self.textedit_tweet.tweetaction = self.button_tweet_clicked self.layout.addWidget(self.textedit_tweet) self.layout_tweetbutton = QtGui.QHBoxLayout() self.layout.addLayout(self.layout_tweetbutton) self.label_textcount = QtGui.QLabel("140") self.layout_tweetbutton.addWidget(self.label_textcount) self.button_tweet = QtGui.QPushButton("Tweet") self.button_tweet.clicked.connect(self.button_tweet_clicked) self.layout_tweetbutton.addWidget(self.button_tweet) self.centralWidget = QtGui.QWidget() self.centralWidget.setLayout(self.layout) self.setCentralWidget(self.centralWidget) def button_tweet_clicked(self): status = self.textedit_tweet.toPlainText() if status | noneoremptystr(): return self.button_tweet.setEnabled(False) thread = twikoto3.twitter.updatestatus(status) def finished(): self.button_tweet.setEnabled(True) if thread.response is not None: self.textedit_tweet.setPlainText("") else: QtGui.QMessageBox.critical(self, "投稿失敗", str(thread.exception)) thread.finished.connect(finished) thread.start() def textedit_tweet_textChanged(self): self.label_textcount.setText(str(validator.MAX_TWEET_LENGTH - validator.getTweetLength(self.textedit_tweet.toPlainText()))) instance = None def getinstance(): if MainWindow.instance is None: MainWindow.instance = MainWindow() return MainWindow.instance
35.659341
131
0.693991
from PyQt4 import QtCore, QtGui import twikoto3 from twikoto3.extension import * from twikoto3.twittertext import validator class TweetTextEdit(QtGui.QTextEdit): def __init__(self, parent = None): super(TweetTextEdit, self).__init__(parent) self.tweetaction = None def keyPressEvent(self, e): if e.key() == QtCore.Qt.Key_Return and (e.modifiers() and QtCore.Qt.ControlModifier): self.tweetaction() else: super(TweetTextEdit, self).keyPressEvent(e) class MainWindow(QtGui.QMainWindow): def __init__(self, parent = None): super(MainWindow, self).__init__(parent) self.setWindowTitle("ついこと 3") self.layout = QtGui.QVBoxLayout() self.textedit_tweet = TweetTextEdit() self.textedit_tweet.setMinimumHeight(46) self.textedit_tweet.textChanged.connect(self.textedit_tweet_textChanged) self.textedit_tweet.tweetaction = self.button_tweet_clicked self.layout.addWidget(self.textedit_tweet) self.layout_tweetbutton = QtGui.QHBoxLayout() self.layout.addLayout(self.layout_tweetbutton) self.label_textcount = QtGui.QLabel("140") self.layout_tweetbutton.addWidget(self.label_textcount) self.button_tweet = QtGui.QPushButton("Tweet") self.button_tweet.clicked.connect(self.button_tweet_clicked) self.layout_tweetbutton.addWidget(self.button_tweet) self.centralWidget = QtGui.QWidget() self.centralWidget.setLayout(self.layout) self.setCentralWidget(self.centralWidget) def button_tweet_clicked(self): status = self.textedit_tweet.toPlainText() if status | noneoremptystr(): return self.button_tweet.setEnabled(False) thread = twikoto3.twitter.updatestatus(status) def finished(): self.button_tweet.setEnabled(True) if thread.response is not None: self.textedit_tweet.setPlainText("") else: QtGui.QMessageBox.critical(self, "投稿失敗", str(thread.exception)) thread.finished.connect(finished) thread.start() def textedit_tweet_textChanged(self): self.label_textcount.setText(str(validator.MAX_TWEET_LENGTH - validator.getTweetLength(self.textedit_tweet.toPlainText()))) instance = None def getinstance(): if MainWindow.instance is None: MainWindow.instance = MainWindow() return MainWindow.instance
true
true
f72b96bf64c72a7aab50945832a74f43bbe2503a
517
py
Python
conclusions/1-intro/Basics.py
balajisomasale/Udacity_Data-Structures-and-algorithms
aa9a58e62c488e32920308ae14faad84e735a0dd
[ "MIT" ]
null
null
null
conclusions/1-intro/Basics.py
balajisomasale/Udacity_Data-Structures-and-algorithms
aa9a58e62c488e32920308ae14faad84e735a0dd
[ "MIT" ]
null
null
null
conclusions/1-intro/Basics.py
balajisomasale/Udacity_Data-Structures-and-algorithms
aa9a58e62c488e32920308ae14faad84e735a0dd
[ "MIT" ]
null
null
null
# Write a function called "show_excitement" where the string # "I am super excited for this course!" is returned exactly # 5 times, where each sentence is separated by a single space. # Return the string with "return". # You can only have the string once in your code. # Don't just copy/paste it 5 times into a single variable! def show_excitement(): # Your code goes here! here = '' for i in range(5): here += "I am super excited for this course! " return here[:-1] print show_excitement()s
34.466667
62
0.700193
def show_excitement(): # Your code goes here! here = '' for i in range(5): here += "I am super excited for this course! " return here[:-1] print show_excitement()s
false
true
f72b96fd84fbba9e15af0f1cd90ccc4befda2a17
519
py
Python
dataset/processes/make_center_points.py
Challenging6/YoloDB
bdc1c4239ec112c21a65df64b9f4dc8447b739fa
[ "MIT" ]
null
null
null
dataset/processes/make_center_points.py
Challenging6/YoloDB
bdc1c4239ec112c21a65df64b9f4dc8447b739fa
[ "MIT" ]
null
null
null
dataset/processes/make_center_points.py
Challenging6/YoloDB
bdc1c4239ec112c21a65df64b9f4dc8447b739fa
[ "MIT" ]
null
null
null
import numpy as np #from concern.config import State from .data_process import DataProcess class MakeCenterPoints(DataProcess): box_key = 'charboxes' size = 32 def process(self, data): shape = data['image'].shape[:2] points = np.zeros((self.size, 2), dtype=np.float32) boxes = np.array(data[self.box_key])[:self.size] size = boxes.shape[0] points[:size] = boxes.mean(axis=1) data['points'] = (points / shape[::-1]).astype(np.float32) return data
25.95
66
0.626204
import numpy as np from .data_process import DataProcess class MakeCenterPoints(DataProcess): box_key = 'charboxes' size = 32 def process(self, data): shape = data['image'].shape[:2] points = np.zeros((self.size, 2), dtype=np.float32) boxes = np.array(data[self.box_key])[:self.size] size = boxes.shape[0] points[:size] = boxes.mean(axis=1) data['points'] = (points / shape[::-1]).astype(np.float32) return data
true
true
f72b995a0c976a846d2650b3d530e5ff685e31e0
1,456
py
Python
setup.py
ammurdoch/graphql-core
03c2b06e4636ed8a89c7a4c7e56d244fd9d00bde
[ "MIT" ]
1
2021-07-27T20:47:34.000Z
2021-07-27T20:47:34.000Z
setup.py
vpetrovykh/graphql-core
7af97e22afb27861fc1b7d7ca0292095f8427ecb
[ "MIT" ]
null
null
null
setup.py
vpetrovykh/graphql-core
7af97e22afb27861fc1b7d7ca0292095f8427ecb
[ "MIT" ]
null
null
null
from re import search from setuptools import setup, find_packages with open("src/graphql/version.py") as version_file: version = search('version = "(.*)"', version_file.read()).group(1) with open("README.md") as readme_file: readme = readme_file.read() setup( name="graphql-core", version=version, description="GraphQL implementation for Python, a port of GraphQL.js," " the JavaScript reference implementation for GraphQL.", long_description=readme, long_description_content_type="text/markdown", keywords="graphql", url="https://github.com/graphql-python/graphql-core", author="Christoph Zwerschke", author_email="cito@online.de", license="MIT license", classifiers=[ "Development Status :: 5 - Production/Stable", "Intended Audience :: Developers", "Topic :: Software Development :: Libraries", "License :: OSI Approved :: MIT License", "Programming Language :: Python :: 3", "Programming Language :: Python :: 3.6", "Programming Language :: Python :: 3.7", "Programming Language :: Python :: 3.8", "Programming Language :: Python :: 3.9", ], install_requires=[], python_requires=">=3.6,<4", packages=find_packages("src"), package_dir={"": "src"}, # PEP-561: https://www.python.org/dev/peps/pep-0561/ package_data={"graphql": ["py.typed"]}, include_package_data=True, zip_safe=False, )
34.666667
74
0.651099
from re import search from setuptools import setup, find_packages with open("src/graphql/version.py") as version_file: version = search('version = "(.*)"', version_file.read()).group(1) with open("README.md") as readme_file: readme = readme_file.read() setup( name="graphql-core", version=version, description="GraphQL implementation for Python, a port of GraphQL.js," " the JavaScript reference implementation for GraphQL.", long_description=readme, long_description_content_type="text/markdown", keywords="graphql", url="https://github.com/graphql-python/graphql-core", author="Christoph Zwerschke", author_email="cito@online.de", license="MIT license", classifiers=[ "Development Status :: 5 - Production/Stable", "Intended Audience :: Developers", "Topic :: Software Development :: Libraries", "License :: OSI Approved :: MIT License", "Programming Language :: Python :: 3", "Programming Language :: Python :: 3.6", "Programming Language :: Python :: 3.7", "Programming Language :: Python :: 3.8", "Programming Language :: Python :: 3.9", ], install_requires=[], python_requires=">=3.6,<4", packages=find_packages("src"), package_dir={"": "src"}, package_data={"graphql": ["py.typed"]}, include_package_data=True, zip_safe=False, )
true
true
f72b99ae1a3457bb9180b67219d05ac2ccfc50cd
1,200
py
Python
Noise Elimination/mean_elimination_script.py
BAD-Classifier/Signal-Processing
8163657fb8b8e1ec32ea299a5b4cda9473b91fd0
[ "MIT" ]
null
null
null
Noise Elimination/mean_elimination_script.py
BAD-Classifier/Signal-Processing
8163657fb8b8e1ec32ea299a5b4cda9473b91fd0
[ "MIT" ]
null
null
null
Noise Elimination/mean_elimination_script.py
BAD-Classifier/Signal-Processing
8163657fb8b8e1ec32ea299a5b4cda9473b91fd0
[ "MIT" ]
null
null
null
import numpy import librosa import glob import os import shutil full_clips = glob.glob("Full_Clips/*.mp3") print("Number of full clips: " + str(len(full_clips))) for clip in full_clips: clip_name = clip[11:] print("Current clip: " + clip_name) signal, fs = librosa.load(clip) signal_abs = numpy.absolute(signal) search_name = "Cut_Clips/" + clip_name[:-4] + "*[0-9].*" cut_clips = glob.glob(search_name) print("Number of clip segments: " + str(len(cut_clips))) total_mean = numpy.mean(signal_abs) print("Signal Total mean: " + str(total_mean)) condition = total_mean*0.25 for record in cut_clips: signal_segment, sample_rate_segment = librosa.load(record) mean = numpy.mean(numpy.abs(signal_segment)) if mean < condition: print(record) print("Segment mean: " + str(mean)) shutil.move(record,"Rejected_noise/") rejected_clips = glob.glob("Rejected_noise/*.wav") print(rejected_clips) for item in rejected_clips: name = item[15:] new_name = "All_MFCCs/" + name[:-3] + "png" if os.path.isfile(new_name): shutil.move(new_name, "Rejected_MFCCS/")
30.769231
66
0.643333
import numpy import librosa import glob import os import shutil full_clips = glob.glob("Full_Clips/*.mp3") print("Number of full clips: " + str(len(full_clips))) for clip in full_clips: clip_name = clip[11:] print("Current clip: " + clip_name) signal, fs = librosa.load(clip) signal_abs = numpy.absolute(signal) search_name = "Cut_Clips/" + clip_name[:-4] + "*[0-9].*" cut_clips = glob.glob(search_name) print("Number of clip segments: " + str(len(cut_clips))) total_mean = numpy.mean(signal_abs) print("Signal Total mean: " + str(total_mean)) condition = total_mean*0.25 for record in cut_clips: signal_segment, sample_rate_segment = librosa.load(record) mean = numpy.mean(numpy.abs(signal_segment)) if mean < condition: print(record) print("Segment mean: " + str(mean)) shutil.move(record,"Rejected_noise/") rejected_clips = glob.glob("Rejected_noise/*.wav") print(rejected_clips) for item in rejected_clips: name = item[15:] new_name = "All_MFCCs/" + name[:-3] + "png" if os.path.isfile(new_name): shutil.move(new_name, "Rejected_MFCCS/")
true
true
f72b9a83a149804ec5bf2fd5f521cbb2d63c0d98
1,384
py
Python
tests/parser/syntax/test_functions_call.py
Solexplorer/vyper
135edd6a91d47c72de105066d6e6c1bdfe9ea66e
[ "MIT" ]
1
2021-04-23T21:48:20.000Z
2021-04-23T21:48:20.000Z
tests/parser/syntax/test_functions_call.py
Solexplorer/vyper
135edd6a91d47c72de105066d6e6c1bdfe9ea66e
[ "MIT" ]
null
null
null
tests/parser/syntax/test_functions_call.py
Solexplorer/vyper
135edd6a91d47c72de105066d6e6c1bdfe9ea66e
[ "MIT" ]
1
2020-01-27T05:21:46.000Z
2020-01-27T05:21:46.000Z
import pytest from pytest import ( raises, ) from vyper import ( compiler, ) from vyper.exceptions import ( ParserException, StructureException, ) fail_list = [ """ @public def foo() -> uint256: doesnotexist(2, uint256) return convert(2, uint256) """, """ @public def foo() -> uint256: convert(2, uint256) return convert(2, uint256) """, (""" @private def test(a : uint256): pass @public def burn(_value: uint256): self.test(msg.sender._value) """, ParserException) ] @pytest.mark.parametrize('bad_code', fail_list) def test_functions_call_fail(bad_code): if isinstance(bad_code, tuple): with raises(bad_code[1]): compiler.compile_code(bad_code[0]) else: with raises(StructureException): compiler.compile_code(bad_code) valid_list = [ """ @public def foo() -> uint256: return convert(2, uint256) """, """ from vyper.interfaces import ERC20 contract Factory: def getExchange(token_addr: address) -> address: constant token: ERC20 factory: Factory @public def setup(token_addr: address): self.token = ERC20(token_addr) assert self.factory.getExchange(self.token) == self """ ] @pytest.mark.parametrize('good_code', valid_list) def test_functions_call_success(good_code): assert compiler.compile_code(good_code) is not None
17.74359
61
0.664017
import pytest from pytest import ( raises, ) from vyper import ( compiler, ) from vyper.exceptions import ( ParserException, StructureException, ) fail_list = [ """ @public def foo() -> uint256: doesnotexist(2, uint256) return convert(2, uint256) """, """ @public def foo() -> uint256: convert(2, uint256) return convert(2, uint256) """, (""" @private def test(a : uint256): pass @public def burn(_value: uint256): self.test(msg.sender._value) """, ParserException) ] @pytest.mark.parametrize('bad_code', fail_list) def test_functions_call_fail(bad_code): if isinstance(bad_code, tuple): with raises(bad_code[1]): compiler.compile_code(bad_code[0]) else: with raises(StructureException): compiler.compile_code(bad_code) valid_list = [ """ @public def foo() -> uint256: return convert(2, uint256) """, """ from vyper.interfaces import ERC20 contract Factory: def getExchange(token_addr: address) -> address: constant token: ERC20 factory: Factory @public def setup(token_addr: address): self.token = ERC20(token_addr) assert self.factory.getExchange(self.token) == self """ ] @pytest.mark.parametrize('good_code', valid_list) def test_functions_call_success(good_code): assert compiler.compile_code(good_code) is not None
true
true
f72b9b0270340672ef3e38e9ca7507f43250ba2a
222
py
Python
aws_test/testapp/views.py
shivavh123/django
1f94b50d0f5cf5b0b90dcf86afbc267500a3732b
[ "MIT" ]
null
null
null
aws_test/testapp/views.py
shivavh123/django
1f94b50d0f5cf5b0b90dcf86afbc267500a3732b
[ "MIT" ]
null
null
null
aws_test/testapp/views.py
shivavh123/django
1f94b50d0f5cf5b0b90dcf86afbc267500a3732b
[ "MIT" ]
null
null
null
from django.shortcuts import render from django.http import * # Create your views here. def test_view(request,name): data = "Hi, Welcome {}, this is first view in AWS....".format(name) return HttpResponse(data)
22.2
71
0.711712
from django.shortcuts import render from django.http import * def test_view(request,name): data = "Hi, Welcome {}, this is first view in AWS....".format(name) return HttpResponse(data)
true
true
f72b9b18157277dd97c650ac9b1513b389eba29b
1,411
py
Python
channels_graphql_ws/__init__.py
hozblok/DjangoChannelsGraphqlWs
77b406fb19053fcb9220a5bb23e1349fde4fbda3
[ "MIT" ]
null
null
null
channels_graphql_ws/__init__.py
hozblok/DjangoChannelsGraphqlWs
77b406fb19053fcb9220a5bb23e1349fde4fbda3
[ "MIT" ]
null
null
null
channels_graphql_ws/__init__.py
hozblok/DjangoChannelsGraphqlWs
77b406fb19053fcb9220a5bb23e1349fde4fbda3
[ "MIT" ]
null
null
null
# # coding: utf-8 # Copyright (c) 2019 DATADVANCE # # Permission is hereby granted, free of charge, to any person obtaining # a copy of this software and associated documentation files (the # "Software"), to deal in the Software without restriction, including # without limitation the rights to use, copy, modify, merge, publish, # distribute, sublicense, and/or sell copies of the Software, and to # permit persons to whom the Software is furnished to do so, subject to # the following conditions: # # The above copyright notice and this permission notice shall be # included in all copies or substantial portions of the Software. # # THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, # EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF # MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. # IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY # CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, # TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE # SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. """Websocket GraphQL server with subscriptions. Django Channels based WebSocket GraphQL server with Graphene-like subscriptions. """ from .client import GraphqlWsClient, GraphqlWsResponseError from .graphql_ws import GraphqlWsConsumer, Subscription from .transport import GraphqlWsTransportAiohttp
41.5
72
0.79022
from .client import GraphqlWsClient, GraphqlWsResponseError from .graphql_ws import GraphqlWsConsumer, Subscription from .transport import GraphqlWsTransportAiohttp
true
true
f72b9b237c832c25f3a47690b75b5f4398085165
4,558
py
Python
alphazero/mcts.py
bartekx43/AlphaTTT
a01c38833a7f841483146bebeef73323d527d812
[ "MIT" ]
null
null
null
alphazero/mcts.py
bartekx43/AlphaTTT
a01c38833a7f841483146bebeef73323d527d812
[ "MIT" ]
null
null
null
alphazero/mcts.py
bartekx43/AlphaTTT
a01c38833a7f841483146bebeef73323d527d812
[ "MIT" ]
null
null
null
import os import sys import math import random import numpy as np from copy import deepcopy sys.path.append(os.path.join(os.environ["HOME"], "AlphaTTT")) from environment import Environment from alphazero.database import prepare_state np.random.seed(80085) random.seed(80085) def PUCT_score(child_value, child_prior, parent_visit_count, child_visit_count, c_puct): pb_c = child_prior * math.sqrt(parent_visit_count) / (child_visit_count + 1) return child_value + c_puct * pb_c class MCTS(): def __init__(self, model, root_state, args): ''' model - class with predict method that returns a valid policy and value root_state - board_len x board_len array with the initial state of the game args: num_simulations - number of leaf node expansions per search alpha - mixing constant between policy and dirichlet noise dirichlet_alpha - dirichlet constant for generating dirichlet distribution c_puct - exploration constant in PUCT score ''' self.model = model self.root = deepcopy(root_state) self.args = args self.Qsa = {} # self.Qsa(s, a) = Q value for (s, a) self.Nsa = {} # self.Nsa(s, a) = (s, a) visit count self.Ns = {} # self.Ns(s) = s visit count self.Ps = {} # self.Ps(s) = list of available actions in s and corresponding raw probabilities self.Es = {} # terminal states, potentially going to do this if not too computationally expensive and dirty # Add dirichlet noise to initial root node self.add_dirichlet() def add_dirichlet(self): rs = self.root.tobytes() if rs not in self.Ps: self.find_leaf(deepcopy(self.root)) if self.Es[rs] == 10: dirichlet = np.random.dirichlet([self.args["dirichlet_alpha"]]*len(self.Ps[rs])) for i, (move, prob) in enumerate(self.Ps[rs]): self.Ps[rs][i] = (move, (1 - self.args["alpha"]) * prob + dirichlet[i] * self.args["alpha"]) def search(self): # builds the search tree from the root node for i in range(self.args["num_simulations"]): self.find_leaf(deepcopy(self.root)) return def find_leaf(self, state): s = state.tobytes() if s not in self.Es: self.Es[s] = Environment.game_over(state) if self.Es[s] != 10: # terminal state return -self.Es[s] if s not in self.Ps: # expand leaf node p, v = self.model.predict(prepare_state(state)) availability_mask = (state == 0) p *= availability_mask if np.sum(p) > 0.0: p /= np.sum(p) # re-normalize move_probs = [] for i, row in enumerate(p): for j, prob in enumerate(row): if state[i][j] == 0: move_probs.append(((i, j), prob)) self.Ps[s] = move_probs self.Ns[s] = 1 return -v max_puct = -float('inf') max_action = None for move, prob in self.Ps[s]: (Nc, Qc) = (self.Nsa[(s, move)], self.Qsa[(s, move)]) if (s, move) in self.Nsa else (0, 0.0) puct = PUCT_score(Qc, prob, self.Ns[s], Nc, self.args["c_puct"]) if puct > max_puct: max_puct = puct max_action = move a = max_action state[a] = 1 state *= -1 v = self.find_leaf(state) if (s, a) in self.Nsa: self.Nsa[(s, a)] += 1 self.Qsa[(s, a)] = (self.Nsa[(s, a)] * self.Qsa[(s, a)] + v) / (self.Nsa[(s, a)] + 1) else: self.Nsa[(s, a)] = 1 self.Qsa[(s, a)] = v self.Ns[s] += 1 return -v def get_pi(self, tau=1.0, as_prob=True): move_dist = np.zeros((len(self.root), len(self.root))) rs = self.root.tobytes() for move, _ in self.Ps[rs]: move_dist[move] = self.Nsa[(rs, move)] if (rs, move) in self.Nsa else 0 if as_prob is True: if tau < 0.1: # protecting from numerical overflow z = np.zeros(move_dist.shape) move = np.unravel_index(np.argmax(move_dist), move_dist.shape) z[move[0]][move[1]] = 1.0 move_dist = z else: move_dist = np.power(move_dist, 1.0/tau) if np.sum(move_dist) > 0.0: move_dist /= np.sum(move_dist) return move_dist def select_move(self, tau=1.0, external_move=None): if external_move is None: probas = self.get_pi(tau) selected_move = int(np.random.choice(len(probas.flatten()), 1, p=probas.flatten())) selected_move = np.unravel_index(selected_move, probas.shape) else: selected_move = external_move self.root[selected_move] = 1 self.root *= -1 # Add dirichlet noise to new root node: self.add_dirichlet() return selected_move
31.006803
111
0.623958
import os import sys import math import random import numpy as np from copy import deepcopy sys.path.append(os.path.join(os.environ["HOME"], "AlphaTTT")) from environment import Environment from alphazero.database import prepare_state np.random.seed(80085) random.seed(80085) def PUCT_score(child_value, child_prior, parent_visit_count, child_visit_count, c_puct): pb_c = child_prior * math.sqrt(parent_visit_count) / (child_visit_count + 1) return child_value + c_puct * pb_c class MCTS(): def __init__(self, model, root_state, args): self.model = model self.root = deepcopy(root_state) self.args = args self.Qsa = {} self.Nsa = {} self.Ns = {} self.Ps = {} self.Es = {} self.add_dirichlet() def add_dirichlet(self): rs = self.root.tobytes() if rs not in self.Ps: self.find_leaf(deepcopy(self.root)) if self.Es[rs] == 10: dirichlet = np.random.dirichlet([self.args["dirichlet_alpha"]]*len(self.Ps[rs])) for i, (move, prob) in enumerate(self.Ps[rs]): self.Ps[rs][i] = (move, (1 - self.args["alpha"]) * prob + dirichlet[i] * self.args["alpha"]) def search(self): for i in range(self.args["num_simulations"]): self.find_leaf(deepcopy(self.root)) return def find_leaf(self, state): s = state.tobytes() if s not in self.Es: self.Es[s] = Environment.game_over(state) if self.Es[s] != 10: return -self.Es[s] if s not in self.Ps: p, v = self.model.predict(prepare_state(state)) availability_mask = (state == 0) p *= availability_mask if np.sum(p) > 0.0: p /= np.sum(p) move_probs = [] for i, row in enumerate(p): for j, prob in enumerate(row): if state[i][j] == 0: move_probs.append(((i, j), prob)) self.Ps[s] = move_probs self.Ns[s] = 1 return -v max_puct = -float('inf') max_action = None for move, prob in self.Ps[s]: (Nc, Qc) = (self.Nsa[(s, move)], self.Qsa[(s, move)]) if (s, move) in self.Nsa else (0, 0.0) puct = PUCT_score(Qc, prob, self.Ns[s], Nc, self.args["c_puct"]) if puct > max_puct: max_puct = puct max_action = move a = max_action state[a] = 1 state *= -1 v = self.find_leaf(state) if (s, a) in self.Nsa: self.Nsa[(s, a)] += 1 self.Qsa[(s, a)] = (self.Nsa[(s, a)] * self.Qsa[(s, a)] + v) / (self.Nsa[(s, a)] + 1) else: self.Nsa[(s, a)] = 1 self.Qsa[(s, a)] = v self.Ns[s] += 1 return -v def get_pi(self, tau=1.0, as_prob=True): move_dist = np.zeros((len(self.root), len(self.root))) rs = self.root.tobytes() for move, _ in self.Ps[rs]: move_dist[move] = self.Nsa[(rs, move)] if (rs, move) in self.Nsa else 0 if as_prob is True: if tau < 0.1: z = np.zeros(move_dist.shape) move = np.unravel_index(np.argmax(move_dist), move_dist.shape) z[move[0]][move[1]] = 1.0 move_dist = z else: move_dist = np.power(move_dist, 1.0/tau) if np.sum(move_dist) > 0.0: move_dist /= np.sum(move_dist) return move_dist def select_move(self, tau=1.0, external_move=None): if external_move is None: probas = self.get_pi(tau) selected_move = int(np.random.choice(len(probas.flatten()), 1, p=probas.flatten())) selected_move = np.unravel_index(selected_move, probas.shape) else: selected_move = external_move self.root[selected_move] = 1 self.root *= -1 self.add_dirichlet() return selected_move
true
true
f72b9b71cfe4c76f04ff852319ec57e7120fbde7
70
py
Python
tests/test_graph_container.py
harangju/wikinet
903cf94e30f6dae3de3a3615ce6cd67091f512dc
[ "MIT" ]
9
2020-10-19T12:36:49.000Z
2021-09-07T02:31:52.000Z
tests/test_graph_container.py
harangju/wikinet
903cf94e30f6dae3de3a3615ce6cd67091f512dc
[ "MIT" ]
1
2022-03-30T09:34:56.000Z
2022-03-30T14:08:48.000Z
tests/test_graph_container.py
harangju/wikinet
903cf94e30f6dae3de3a3615ce6cd67091f512dc
[ "MIT" ]
5
2020-10-20T01:39:14.000Z
2022-03-30T17:12:30.000Z
import wikinet print('hello world') print(wikinet.GraphContainer())
11.666667
31
0.771429
import wikinet print('hello world') print(wikinet.GraphContainer())
true
true
f72b9c283b7d0547ed71c29c45e273ec49018748
876
py
Python
paneldata_dash/resources/category.py
clarencejlee/jdp
d3d31db0138ff06f2f5ec592d85317941af4f280
[ "MIT" ]
null
null
null
paneldata_dash/resources/category.py
clarencejlee/jdp
d3d31db0138ff06f2f5ec592d85317941af4f280
[ "MIT" ]
null
null
null
paneldata_dash/resources/category.py
clarencejlee/jdp
d3d31db0138ff06f2f5ec592d85317941af4f280
[ "MIT" ]
null
null
null
from flask import request from flask_restful import Resource from models.category import CategoryModel from schemas.category import CategorySchema category_schema = CategorySchema() category_list_schema = CategorySchema(many=True) class Category(Resource): @classmethod def get(cls, name: str): category = CategoryModel.find_by_name(name) if category: return category_schema.dump(category), 200 return {"message": "Category not found"}, 404 class CategoryList(Resource): @classmethod def get(cls): page = 1 if (request.args.get("page") is None or request.args.get("page") == 0) \ else int(request.args.get("page")) + 1 size = 10 if request.args.get("size") is None else int(request.args.get("size")) return {"categories": category_list_schema.dump(CategoryModel.find_all())}, 200
30.206897
89
0.692922
from flask import request from flask_restful import Resource from models.category import CategoryModel from schemas.category import CategorySchema category_schema = CategorySchema() category_list_schema = CategorySchema(many=True) class Category(Resource): @classmethod def get(cls, name: str): category = CategoryModel.find_by_name(name) if category: return category_schema.dump(category), 200 return {"message": "Category not found"}, 404 class CategoryList(Resource): @classmethod def get(cls): page = 1 if (request.args.get("page") is None or request.args.get("page") == 0) \ else int(request.args.get("page")) + 1 size = 10 if request.args.get("size") is None else int(request.args.get("size")) return {"categories": category_list_schema.dump(CategoryModel.find_all())}, 200
true
true
f72b9e6674fbda39b41025e89556f609b84326ea
2,699
py
Python
masonite/drivers/UploadS3Driver.py
w3x10e8/core
d8f0ca29c2bd5e86d199391fa916ce2f5c9b0f49
[ "MIT" ]
null
null
null
masonite/drivers/UploadS3Driver.py
w3x10e8/core
d8f0ca29c2bd5e86d199391fa916ce2f5c9b0f49
[ "MIT" ]
null
null
null
masonite/drivers/UploadS3Driver.py
w3x10e8/core
d8f0ca29c2bd5e86d199391fa916ce2f5c9b0f49
[ "MIT" ]
null
null
null
""" Upload S3 Driver """ from masonite.contracts import UploadContract from masonite.drivers import BaseUploadDriver from masonite.exceptions import DriverLibraryNotFound from masonite.managers import UploadManager from masonite.app import App class UploadS3Driver(BaseUploadDriver, UploadContract): """ Amazon S3 Upload driver """ def __init__(self, upload: UploadManager, app: App): """Upload Disk Driver Constructor Arguments: UploadManager {masonite.managers.UploadManager} -- The Upload Manager object. StorageConfig {config.storage} -- Storage configuration. """ self.upload = upload self.config = app.make('StorageConfig') def store(self, fileitem, location=None): """Store the file into Amazon S3 server. Arguments: fileitem {cgi.Storage} -- Storage object. Keyword Arguments: location {string} -- The location on disk you would like to store the file. (default: {None}) Raises: DriverLibraryNotFound -- Raises when the boto3 library is not installed. Returns: string -- Returns the file name just saved. """ driver = self.upload.driver('disk') driver.store(fileitem, location) file_location = driver.file_location # Check if is a valid extension self.validate_extension(fileitem.filename) try: import boto3 except ImportError: raise DriverLibraryNotFound( 'Could not find the "boto3" library. Please pip install this library by running "pip install boto3"') session = boto3.Session( aws_access_key_id=self.config.DRIVERS['s3']['client'], aws_secret_access_key=self.config.DRIVERS['s3']['secret'], ) s3 = session.resource('s3') s3.meta.client.upload_file( file_location, self.config.DRIVERS['s3']['bucket'], fileitem.filename ) return fileitem.filename def store_prepend(self, fileitem, prepend, location=None): """Store the file onto the Amazon S3 server but with a prepended file name. Arguments: fileitem {cgi.Storage} -- Storage object. prepend {string} -- The prefix you want to prepend to the file name. Keyword Arguments: location {string} -- The location on disk you would like to store the file. (default: {None}) Returns: string -- Returns the file name just saved. """ fileitem.filename = prepend + fileitem.filename return self.store(fileitem, location=location)
31.022989
117
0.632086
from masonite.contracts import UploadContract from masonite.drivers import BaseUploadDriver from masonite.exceptions import DriverLibraryNotFound from masonite.managers import UploadManager from masonite.app import App class UploadS3Driver(BaseUploadDriver, UploadContract): def __init__(self, upload: UploadManager, app: App): self.upload = upload self.config = app.make('StorageConfig') def store(self, fileitem, location=None): driver = self.upload.driver('disk') driver.store(fileitem, location) file_location = driver.file_location self.validate_extension(fileitem.filename) try: import boto3 except ImportError: raise DriverLibraryNotFound( 'Could not find the "boto3" library. Please pip install this library by running "pip install boto3"') session = boto3.Session( aws_access_key_id=self.config.DRIVERS['s3']['client'], aws_secret_access_key=self.config.DRIVERS['s3']['secret'], ) s3 = session.resource('s3') s3.meta.client.upload_file( file_location, self.config.DRIVERS['s3']['bucket'], fileitem.filename ) return fileitem.filename def store_prepend(self, fileitem, prepend, location=None): fileitem.filename = prepend + fileitem.filename return self.store(fileitem, location=location)
true
true
f72b9ebf1fe11a999e122be4418851c61b594f29
9,487
py
Python
ensemble/control/operational/TestOperationalLayerEnsembleVissim.py
licit-lab/ensemble
7a78ef0d69610d4fcfc5e008f931ade15e35acbf
[ "Linux-OpenIB" ]
null
null
null
ensemble/control/operational/TestOperationalLayerEnsembleVissim.py
licit-lab/ensemble
7a78ef0d69610d4fcfc5e008f931ade15e35acbf
[ "Linux-OpenIB" ]
null
null
null
ensemble/control/operational/TestOperationalLayerEnsembleVissim.py
licit-lab/ensemble
7a78ef0d69610d4fcfc5e008f931ade15e35acbf
[ "Linux-OpenIB" ]
null
null
null
import os import sys import ctypes import platform import os import numpy as np from random import gauss import win32com.client as com def get_acceleration(lead_veh_acceleration,lead_veh_id,lead_veh_rel_velocity,lead_veh_type,timestep, veh_id,veh_setspeed,veh_type,veh_used_distance_headway,veh_used_rel_vel,veh_velocity, veh_distance_headway,prev_veh_executed_acceleration, prev_veh_cc_setpoint,prev_veh_cruisecontrol_acceleration): if platform.system() == 'Windows': print('Running on win') filepath = "L:\\UserData\\Kingsley\\PythonEnsembleTestBed" file_dll = os.path.join(filepath, 'OperationalDLL.dll') #file_dll = './OperationalDLL.dll' elif platform.system() == 'Darwin': print('Running on mac') file_dll = 'OperationalDLL.dylib' else: print('System not supported') sys.exit() # Load operational DLL lib = None try: lib = ctypes.cdll.LoadLibrary(file_dll) except: print('Error: DLL file could not be found') quit() # Set input values: Write value's for current vehicle, in current timestep curr_lead_veh_acceleration = ctypes.c_double(lead_veh_acceleration) #2.0 curr_lead_veh_id = ctypes.c_long(lead_veh_id) #40 curr_lead_veh_rel_velocity = ctypes.c_double(lead_veh_rel_velocity ) #-1.0 curr_lead_veh_type = ctypes.c_long(lead_veh_type) #10 curr_timestep = ctypes.c_double(timestep) #55.0 curr_ts_length = ctypes.c_double(0.1) curr_veh_id = ctypes.c_long(veh_id) #10 curr_veh_setspeed = ctypes.c_double(veh_setspeed) #88/3.6 curr_veh_type = ctypes.c_long(veh_type) #10 curr_veh_controller_in_use = ctypes.c_long(1) # from tactical layer 1=ACC,2=CACC curr_veh_ACC_h = ctypes.c_double(1.6) curr_veh_CACC_h = ctypes.c_double(0.6) curr_veh_used_distance_headway = ctypes.c_double(veh_used_distance_headway)#20.0 curr_veh_used_rel_vel = ctypes.c_double(veh_used_rel_vel) #-1.0 curr_veh_velocity = ctypes.c_double(veh_velocity) #85/3.6 curr_veh_autonomous_operational_warning = ctypes.c_long(10) curr_veh_platooning_max_acceleration = ctypes.c_double(2.0) prev_veh_cc_setpoint = ctypes.c_double(prev_veh_cc_setpoint) prev_veh_cruisecontrol_acceleration = ctypes.c_double(prev_veh_cruisecontrol_acceleration) prev_veh_distance_headway = ctypes.c_double(veh_distance_headway) #20.0 prev_veh_executed_acceleration = ctypes.c_double(prev_veh_executed_acceleration) #-2.0 # Define variables for return values: These are placeholders, no action required veh_autonomous_operational_acceleration = ctypes.c_double(1) veh_autonomous_operational_mixingmode = ctypes.c_long(1) veh_autonomous_operational_warning = ctypes.c_double(1) veh_cc_setpoint = ctypes.c_double(1) veh_cruisecontrol_acceleration = ctypes.c_double(1) success = ctypes.c_int(0) print("Now call the OL itself...") # Call operational controller lib.operational_controller( curr_lead_veh_acceleration, curr_lead_veh_id, curr_lead_veh_rel_velocity, curr_lead_veh_type, curr_timestep, curr_ts_length, curr_veh_id, curr_veh_setspeed, curr_veh_type, curr_veh_controller_in_use, curr_veh_ACC_h, curr_veh_CACC_h, curr_veh_used_distance_headway, curr_veh_used_rel_vel, curr_veh_velocity, curr_veh_autonomous_operational_warning, curr_veh_platooning_max_acceleration, prev_veh_cc_setpoint, prev_veh_cruisecontrol_acceleration, prev_veh_distance_headway, prev_veh_executed_acceleration, ctypes.byref(veh_autonomous_operational_acceleration), ctypes.byref(veh_autonomous_operational_mixingmode), ctypes.byref(veh_autonomous_operational_warning), ctypes.byref(veh_cc_setpoint), ctypes.byref(veh_cruisecontrol_acceleration), ctypes.byref(success)) # Print the return values if success.value > 0: veh_acceleration=veh_autonomous_operational_acceleration.value #print(veh_autonomous_operational_mixingmode.value) #print(veh_autonomous_operational_warning.value) veh_cc_set_point=veh_cc_setpoint.value veh_cruise_control_acceleration=veh_cruisecontrol_acceleration.value else: veh_acceleration=-999 veh_cc_setpoint=-999 veh_cruise_control_acceleration=-999 print('An error occurred while calling DLL') return veh_acceleration,veh_cc_setpoint,veh_cruise_control_acceleration Vissim = com.gencache.EnsureDispatch("Vissim.Vissim") GlosaNetworkPath='D:\\Projects\\ENSEMBLE\\Vissim_networks\\Pipeline'#'L:\\UserData\\Kingsley\\Ensemble' #'L:\\UserData\\Kingsley\\SafeDriving' #'L:\\UserData\\Kingsley\\Ensemble'#'C:\\Users\\Public\\Documents\\GLOSA\\GlosaTrafficLight' Filename= os.path.join(GlosaNetworkPath, 'Pipeline.inpx') #os.path.join(GlosaNetworkPath, 'KnooppuntZonzeelBackup.inpx') #os.path.join(GlosaNetworkPath, 'GlosaTestNetwork2.inpx') #os.path.join(GlosaNetworkPath, 'TestNetwork.inpx') flag_read_additionally = False # you can read network(elements) additionally, in this case set "flag_read_additionally" to true Vissim.LoadNet(Filename, flag_read_additionally) ## Load a Layout: Filename = os.path.join(GlosaNetworkPath, 'Pipeline.layx') #os.path.join(GlosaNetworkPath, 'KnooppuntZonzeelBackup.layx') #os.path.join(GlosaNetworkPath, 'TestNetwork.layx') #os.path.join(GlosaNetworkPath, 'KnooppuntZonzeelBackup.layx')#os.path.join(GlosaNetworkPath, 'GlosaTestNetwork2.layx') Vissim.LoadLayout(Filename) End_of_simulation = 6000 # simulation second [s] Simulation_Resolution = 10 # simulation second [s] Number_Runs=4 Simulation_Period=300 Vissim.Simulation.SetAttValue('SimRes', Simulation_Resolution) Vissim.Simulation.SetAttValue('NumRuns', Number_Runs) Vissim.Simulation.SetAttValue('SimPeriod', Simulation_Period) #UDA6 #Vissim.Net.UserDefinedAttributes.AddUserDefinedDataAttribute(6,'Vehicle','vehAcceleration','vehAcceleration',2,0) #Vissim.Net.UserDefinedAttributes.ItemByKey(6).SetAttValue('DefValue',-1) #UDA6 Vissim.Net.UserDefinedAttributes.AddUserDefinedDataAttribute(3,'Vehicle','COM_cruise_control_Ac','COM_cruise_control_Ac',2,0) Vissim.Net.UserDefinedAttributes.ItemByKey(3).SetAttValue('DefValue',-1) #UDA Vissim.Net.UserDefinedAttributes.AddUserDefinedDataAttribute(4,'Vehicle','COM_cc_setpoint','COM_cc_setpoint',2,0) Vissim.Net.UserDefinedAttributes.ItemByKey(4).SetAttValue('DefValue',-1) def get_leader_info(Vehicle): lead_veh_id = Vehicle.AttValue('LeadTargNo') lead_veh_type = Vehicle.AttValue('LeadTargType') if lead_veh_type == 'VEHICLE' and lead_veh_id != None: try: front_vehicle = Vissim.Net.Vehicles.ItemByKey(lead_veh_id) except: front_vehicle = -1 else: front_vehicle=-1 return front_vehicle #prev_veh_cc_setpoint = np.zeros(number_of_vehicles) for i in range(6000): for Vehicle in Vissim.Net.Vehicles.FilteredBy("[VEHTYPE\\NO]=210"): lead_veh=get_leader_info(Vehicle) if lead_veh!=-1 and (Vehicle.AttValue('Lane')==lead_veh.AttValue('Lane')): #simulation info timestep=Vehicle.AttValue('SimSec') #Ego Info print((Vehicle.AttValue('Lane'))) veh_id=Vehicle.AttValue('No') veh_setspeed=Vehicle.AttValue('DesSpeed')/3.6 veh_type=Vehicle.AttValue('VehType\\No') veh_used_distance_headway=Vehicle.AttValue('FollowDistNet') veh_used_rel_vel=(Vehicle.AttValue('Speed')-lead_veh.AttValue('Speed'))/3.6 veh_velocity=Vehicle.AttValue('Speed')/3.6 veh_distance_headway=Vehicle.AttValue('FollowDistNet') prev_veh_executed_acceleration = Vehicle.AttValue('COM_Ac') prev_veh_cc_setpoint = Vehicle.AttValue('COM_cc_setpoint') prev_veh_cruisecontrol_acceleration=Vehicle.AttValue('COM_cruise_control_Ac') #veh_executed_acceleration=a_prev[veh_id] #veh_cc_setpoint=prev_veh_cc_setpoint[veh_id] # Leader Info lead_veh_acceleration=lead_veh.AttValue('Acceleration') lead_veh_id=lead_veh.AttValue('No') lead_veh_rel_velocity=(Vehicle.AttValue('Speed')-lead_veh.AttValue('Speed'))/3.6 lead_veh_type=lead_veh.AttValue('VehType\\No') curr_veh_executed_acceleration,curr_veh_cc_set_point,curr_veh_cruisecontrol_acceleration=get_acceleration(lead_veh_acceleration,lead_veh_id,lead_veh_rel_velocity,lead_veh_type,timestep, veh_id,veh_setspeed,veh_type,veh_used_distance_headway,veh_used_rel_vel,veh_velocity, veh_distance_headway,prev_veh_executed_acceleration, prev_veh_cc_setpoint,prev_veh_cruisecontrol_acceleration) # a=call vehicle_model(curr_veh_executed_acceleration) write_file('file_variables.txt') Vehicle.SetAttValue('COM_Ac',curr_veh_executed_acceleration) #Vehicle.SetAttValue('COM_Ac', a) Vehicle.SetAttValue('COM_At',3) Vehicle.SetAttValue('COM_cc_setpoint', curr_veh_cc_set_point) Vehicle.SetAttValue('COM_cruise_control_Ac', curr_veh_cruisecontrol_acceleration) else: continue Vissim.Simulation.RunSingleStep()
47.673367
197
0.733214
import os import sys import ctypes import platform import os import numpy as np from random import gauss import win32com.client as com def get_acceleration(lead_veh_acceleration,lead_veh_id,lead_veh_rel_velocity,lead_veh_type,timestep, veh_id,veh_setspeed,veh_type,veh_used_distance_headway,veh_used_rel_vel,veh_velocity, veh_distance_headway,prev_veh_executed_acceleration, prev_veh_cc_setpoint,prev_veh_cruisecontrol_acceleration): if platform.system() == 'Windows': print('Running on win') filepath = "L:\\UserData\\Kingsley\\PythonEnsembleTestBed" file_dll = os.path.join(filepath, 'OperationalDLL.dll') elif platform.system() == 'Darwin': print('Running on mac') file_dll = 'OperationalDLL.dylib' else: print('System not supported') sys.exit() lib = None try: lib = ctypes.cdll.LoadLibrary(file_dll) except: print('Error: DLL file could not be found') quit() curr_lead_veh_acceleration = ctypes.c_double(lead_veh_acceleration) #2.0 curr_lead_veh_id = ctypes.c_long(lead_veh_id) #40 curr_lead_veh_rel_velocity = ctypes.c_double(lead_veh_rel_velocity ) #-1.0 curr_lead_veh_type = ctypes.c_long(lead_veh_type) #10 curr_timestep = ctypes.c_double(timestep) #55.0 curr_ts_length = ctypes.c_double(0.1) curr_veh_id = ctypes.c_long(veh_id) #10 curr_veh_setspeed = ctypes.c_double(veh_setspeed) #88/3.6 curr_veh_type = ctypes.c_long(veh_type) #10 curr_veh_controller_in_use = ctypes.c_long(1) # from tactical layer 1=ACC,2=CACC curr_veh_ACC_h = ctypes.c_double(1.6) curr_veh_CACC_h = ctypes.c_double(0.6) curr_veh_used_distance_headway = ctypes.c_double(veh_used_distance_headway)#20.0 curr_veh_used_rel_vel = ctypes.c_double(veh_used_rel_vel) #-1.0 curr_veh_velocity = ctypes.c_double(veh_velocity) #85/3.6 curr_veh_autonomous_operational_warning = ctypes.c_long(10) curr_veh_platooning_max_acceleration = ctypes.c_double(2.0) prev_veh_cc_setpoint = ctypes.c_double(prev_veh_cc_setpoint) prev_veh_cruisecontrol_acceleration = ctypes.c_double(prev_veh_cruisecontrol_acceleration) prev_veh_distance_headway = ctypes.c_double(veh_distance_headway) #20.0 prev_veh_executed_acceleration = ctypes.c_double(prev_veh_executed_acceleration) #-2.0 # Define variables for return values: These are placeholders, no action required veh_autonomous_operational_acceleration = ctypes.c_double(1) veh_autonomous_operational_mixingmode = ctypes.c_long(1) veh_autonomous_operational_warning = ctypes.c_double(1) veh_cc_setpoint = ctypes.c_double(1) veh_cruisecontrol_acceleration = ctypes.c_double(1) success = ctypes.c_int(0) print("Now call the OL itself...") # Call operational controller lib.operational_controller( curr_lead_veh_acceleration, curr_lead_veh_id, curr_lead_veh_rel_velocity, curr_lead_veh_type, curr_timestep, curr_ts_length, curr_veh_id, curr_veh_setspeed, curr_veh_type, curr_veh_controller_in_use, curr_veh_ACC_h, curr_veh_CACC_h, curr_veh_used_distance_headway, curr_veh_used_rel_vel, curr_veh_velocity, curr_veh_autonomous_operational_warning, curr_veh_platooning_max_acceleration, prev_veh_cc_setpoint, prev_veh_cruisecontrol_acceleration, prev_veh_distance_headway, prev_veh_executed_acceleration, ctypes.byref(veh_autonomous_operational_acceleration), ctypes.byref(veh_autonomous_operational_mixingmode), ctypes.byref(veh_autonomous_operational_warning), ctypes.byref(veh_cc_setpoint), ctypes.byref(veh_cruisecontrol_acceleration), ctypes.byref(success)) # Print the return values if success.value > 0: veh_acceleration=veh_autonomous_operational_acceleration.value #print(veh_autonomous_operational_mixingmode.value) #print(veh_autonomous_operational_warning.value) veh_cc_set_point=veh_cc_setpoint.value veh_cruise_control_acceleration=veh_cruisecontrol_acceleration.value else: veh_acceleration=-999 veh_cc_setpoint=-999 veh_cruise_control_acceleration=-999 print('An error occurred while calling DLL') return veh_acceleration,veh_cc_setpoint,veh_cruise_control_acceleration Vissim = com.gencache.EnsureDispatch("Vissim.Vissim") GlosaNetworkPath='D:\\Projects\\ENSEMBLE\\Vissim_networks\\Pipeline'#'L:\\UserData\\Kingsley\\Ensemble' #'L:\\UserData\\Kingsley\\SafeDriving' #'L:\\UserData\\Kingsley\\Ensemble'#'C:\\Users\\Public\\Documents\\GLOSA\\GlosaTrafficLight' Filename= os.path.join(GlosaNetworkPath, 'Pipeline.inpx') #os.path.join(GlosaNetworkPath, 'KnooppuntZonzeelBackup.inpx') #os.path.join(GlosaNetworkPath, 'GlosaTestNetwork2.inpx') #os.path.join(GlosaNetworkPath, 'TestNetwork.inpx') flag_read_additionally = False # you can read network(elements) additionally, in this case set "flag_read_additionally" to true Vissim.LoadNet(Filename, flag_read_additionally) ## Load a Layout: Filename = os.path.join(GlosaNetworkPath, 'Pipeline.layx') #os.path.join(GlosaNetworkPath, 'KnooppuntZonzeelBackup.layx') #os.path.join(GlosaNetworkPath, 'TestNetwork.layx') #os.path.join(GlosaNetworkPath, 'KnooppuntZonzeelBackup.layx')#os.path.join(GlosaNetworkPath, 'GlosaTestNetwork2.layx') Vissim.LoadLayout(Filename) End_of_simulation = 6000 # simulation second [s] Simulation_Resolution = 10 # simulation second [s] Number_Runs=4 Simulation_Period=300 Vissim.Simulation.SetAttValue('SimRes', Simulation_Resolution) Vissim.Simulation.SetAttValue('NumRuns', Number_Runs) Vissim.Simulation.SetAttValue('SimPeriod', Simulation_Period) #UDA6 #Vissim.Net.UserDefinedAttributes.AddUserDefinedDataAttribute(6,'Vehicle','vehAcceleration','vehAcceleration',2,0) #Vissim.Net.UserDefinedAttributes.ItemByKey(6).SetAttValue('DefValue',-1) #UDA6 Vissim.Net.UserDefinedAttributes.AddUserDefinedDataAttribute(3,'Vehicle','COM_cruise_control_Ac','COM_cruise_control_Ac',2,0) Vissim.Net.UserDefinedAttributes.ItemByKey(3).SetAttValue('DefValue',-1) #UDA Vissim.Net.UserDefinedAttributes.AddUserDefinedDataAttribute(4,'Vehicle','COM_cc_setpoint','COM_cc_setpoint',2,0) Vissim.Net.UserDefinedAttributes.ItemByKey(4).SetAttValue('DefValue',-1) def get_leader_info(Vehicle): lead_veh_id = Vehicle.AttValue('LeadTargNo') lead_veh_type = Vehicle.AttValue('LeadTargType') if lead_veh_type == 'VEHICLE' and lead_veh_id != None: try: front_vehicle = Vissim.Net.Vehicles.ItemByKey(lead_veh_id) except: front_vehicle = -1 else: front_vehicle=-1 return front_vehicle #prev_veh_cc_setpoint = np.zeros(number_of_vehicles) for i in range(6000): for Vehicle in Vissim.Net.Vehicles.FilteredBy("[VEHTYPE\\NO]=210"): lead_veh=get_leader_info(Vehicle) if lead_veh!=-1 and (Vehicle.AttValue('Lane')==lead_veh.AttValue('Lane')): #simulation info timestep=Vehicle.AttValue('SimSec') #Ego Info print((Vehicle.AttValue('Lane'))) veh_id=Vehicle.AttValue('No') veh_setspeed=Vehicle.AttValue('DesSpeed')/3.6 veh_type=Vehicle.AttValue('VehType\\No') veh_used_distance_headway=Vehicle.AttValue('FollowDistNet') veh_used_rel_vel=(Vehicle.AttValue('Speed')-lead_veh.AttValue('Speed'))/3.6 veh_velocity=Vehicle.AttValue('Speed')/3.6 veh_distance_headway=Vehicle.AttValue('FollowDistNet') prev_veh_executed_acceleration = Vehicle.AttValue('COM_Ac') prev_veh_cc_setpoint = Vehicle.AttValue('COM_cc_setpoint') prev_veh_cruisecontrol_acceleration=Vehicle.AttValue('COM_cruise_control_Ac') #veh_executed_acceleration=a_prev[veh_id] #veh_cc_setpoint=prev_veh_cc_setpoint[veh_id] # Leader Info lead_veh_acceleration=lead_veh.AttValue('Acceleration') lead_veh_id=lead_veh.AttValue('No') lead_veh_rel_velocity=(Vehicle.AttValue('Speed')-lead_veh.AttValue('Speed'))/3.6 lead_veh_type=lead_veh.AttValue('VehType\\No') curr_veh_executed_acceleration,curr_veh_cc_set_point,curr_veh_cruisecontrol_acceleration=get_acceleration(lead_veh_acceleration,lead_veh_id,lead_veh_rel_velocity,lead_veh_type,timestep, veh_id,veh_setspeed,veh_type,veh_used_distance_headway,veh_used_rel_vel,veh_velocity, veh_distance_headway,prev_veh_executed_acceleration, prev_veh_cc_setpoint,prev_veh_cruisecontrol_acceleration) # a=call vehicle_model(curr_veh_executed_acceleration) write_file('file_variables.txt') Vehicle.SetAttValue('COM_Ac',curr_veh_executed_acceleration) #Vehicle.SetAttValue('COM_Ac', a) Vehicle.SetAttValue('COM_At',3) Vehicle.SetAttValue('COM_cc_setpoint', curr_veh_cc_set_point) Vehicle.SetAttValue('COM_cruise_control_Ac', curr_veh_cruisecontrol_acceleration) else: continue Vissim.Simulation.RunSingleStep()
true
true
f72b9f3d90e40913efdff7e7d1f1b70359588488
15,361
py
Python
main.py
SultanAbuGhazal/3detr
f9725ae655c6ced290c3ec2c53c07566350270f4
[ "Apache-2.0" ]
null
null
null
main.py
SultanAbuGhazal/3detr
f9725ae655c6ced290c3ec2c53c07566350270f4
[ "Apache-2.0" ]
null
null
null
main.py
SultanAbuGhazal/3detr
f9725ae655c6ced290c3ec2c53c07566350270f4
[ "Apache-2.0" ]
null
null
null
# Copyright (c) Facebook, Inc. and its affiliates. import argparse import os import sys import pickle import numpy as np import torch from torch.multiprocessing import set_start_method from torch.utils.data import DataLoader, DistributedSampler # 3DETR codebase specific imports from datasets import build_dataset from engine import evaluate, train_one_epoch from models import build_model from optimizer import build_optimizer from criterion import build_criterion from utils.dist import init_distributed, is_distributed, is_primary, get_rank, barrier from utils.misc import my_worker_init_fn from utils.io import save_checkpoint, resume_if_possible from utils.logger import Logger def make_args_parser(): parser = argparse.ArgumentParser("3D Detection Using Transformers", add_help=False) ##### Optimizer ##### parser.add_argument("--base_lr", default=5e-4, type=float) parser.add_argument("--warm_lr", default=1e-6, type=float) parser.add_argument("--warm_lr_epochs", default=9, type=int) parser.add_argument("--final_lr", default=1e-6, type=float) parser.add_argument("--lr_scheduler", default="cosine", type=str) parser.add_argument("--weight_decay", default=0.1, type=float) parser.add_argument("--filter_biases_wd", default=False, action="store_true") parser.add_argument( "--clip_gradient", default=0.1, type=float, help="Max L2 norm of the gradient" ) ##### Model ##### parser.add_argument( "--model_name", default="3detr", type=str, help="Name of the model", choices=["3detr"], ) ### Encoder parser.add_argument( "--enc_type", default="vanilla", choices=["masked", "maskedv2", "vanilla"] ) # Below options are only valid for vanilla encoder parser.add_argument("--enc_nlayers", default=3, type=int) parser.add_argument("--enc_dim", default=256, type=int) parser.add_argument("--enc_ffn_dim", default=128, type=int) parser.add_argument("--enc_dropout", default=0.1, type=float) parser.add_argument("--enc_nhead", default=4, type=int) parser.add_argument("--enc_pos_embed", default=None, type=str) parser.add_argument("--enc_activation", default="relu", type=str) ### Decoder parser.add_argument("--dec_nlayers", default=8, type=int) parser.add_argument("--dec_dim", default=256, type=int) parser.add_argument("--dec_ffn_dim", default=256, type=int) parser.add_argument("--dec_dropout", default=0.1, type=float) parser.add_argument("--dec_nhead", default=4, type=int) ### MLP heads for predicting bounding boxes parser.add_argument("--mlp_dropout", default=0.3, type=float) parser.add_argument( "--nsemcls", default=-1, type=int, help="Number of semantic object classes. Can be inferred from dataset", ) ### Other model params parser.add_argument("--preenc_npoints", default=2048, type=int) parser.add_argument( "--pos_embed", default="fourier", type=str, choices=["fourier", "sine"] ) parser.add_argument("--nqueries", default=256, type=int) parser.add_argument("--use_color", default=False, action="store_true") ##### Set Loss ##### ### Matcher parser.add_argument("--matcher_giou_cost", default=2, type=float) parser.add_argument("--matcher_cls_cost", default=1, type=float) parser.add_argument("--matcher_center_cost", default=0, type=float) parser.add_argument("--matcher_objectness_cost", default=0, type=float) ### Loss Weights parser.add_argument("--loss_giou_weight", default=0, type=float) parser.add_argument("--loss_sem_cls_weight", default=1, type=float) parser.add_argument( "--loss_no_object_weight", default=0.2, type=float ) # "no object" or "background" class for detection parser.add_argument("--loss_angle_cls_weight", default=0.1, type=float) parser.add_argument("--loss_angle_reg_weight", default=0.5, type=float) parser.add_argument("--loss_center_weight", default=5.0, type=float) parser.add_argument("--loss_size_weight", default=1.0, type=float) ##### Dataset ##### parser.add_argument( "--dataset_name", required=True, type=str, choices=["scannet", "sunrgbd"] ) parser.add_argument( "--dataset_root_dir", type=str, default=None, help="Root directory containing the dataset files. \ If None, default values from scannet.py/sunrgbd.py are used", ) # parser.add_argument( # "--meta_data_dir", # type=str, # default=None, # help="Root directory containing the metadata files. \ # If None, default values from scannet.py/sunrgbd.py are used", # ) parser.add_argument("--dataset_num_workers", default=4, type=int) parser.add_argument("--batchsize_per_gpu", default=8, type=int) ##### Training ##### parser.add_argument("--start_epoch", default=-1, type=int) parser.add_argument("--max_epoch", default=720, type=int) parser.add_argument("--eval_every_epoch", default=10, type=int) parser.add_argument("--seed", default=0, type=int) ##### Testing ##### parser.add_argument("--test_only", default=False, action="store_true") parser.add_argument("--test_ckpt", default=None, type=str) ##### I/O ##### parser.add_argument("--checkpoint_dir", default=None, type=str) parser.add_argument("--log_every", default=10, type=int) parser.add_argument("--log_metrics_every", default=20, type=int) parser.add_argument("--save_separate_checkpoint_every_epoch", default=100, type=int) ##### Distributed Training ##### parser.add_argument("--ngpus", default=1, type=int) parser.add_argument("--dist_url", default="tcp://localhost:12345", type=str) return parser def do_train( args, model, model_no_ddp, optimizer, criterion, dataset_config, dataloaders, best_val_metrics, ): """ Main training loop. This trains the model for `args.max_epoch` epochs and tests the model after every `args.eval_every_epoch`. We always evaluate the final checkpoint and report both the final AP and best AP on the val set. """ num_iters_per_epoch = len(dataloaders["train"]) num_iters_per_eval_epoch = len(dataloaders["test"]) print(f"Model is {model}") print(f"Training started at epoch {args.start_epoch} until {args.max_epoch}.") print(f"One training epoch = {num_iters_per_epoch} iters.") print(f"One eval epoch = {num_iters_per_eval_epoch} iters.") final_eval = os.path.join(args.checkpoint_dir, "final_eval.txt") final_eval_pkl = os.path.join(args.checkpoint_dir, "final_eval.pkl") if os.path.isfile(final_eval): print(f"Found final eval file {final_eval}. Skipping training.") return logger = Logger(args.checkpoint_dir) for epoch in range(args.start_epoch, args.max_epoch): if is_distributed(): dataloaders["train_sampler"].set_epoch(epoch) aps = train_one_epoch( args, epoch, model, optimizer, criterion, dataset_config, dataloaders["train"], logger, ) # latest checkpoint is always stored in checkpoint.pth save_checkpoint( args.checkpoint_dir, model_no_ddp, optimizer, epoch, args, best_val_metrics, filename="checkpoint.pth", ) metrics = aps.compute_metrics() metric_str = aps.metrics_to_str(metrics, per_class=False) metrics_dict = aps.metrics_to_dict(metrics) curr_iter = epoch * len(dataloaders["train"]) if is_primary(): print("==" * 10) print(f"Epoch [{epoch}/{args.max_epoch}]; Metrics {metric_str}") print("==" * 10) logger.log_scalars(metrics_dict, curr_iter, prefix="Train/") if ( epoch > 0 and args.save_separate_checkpoint_every_epoch > 0 and epoch % args.save_separate_checkpoint_every_epoch == 0 ): # separate checkpoints are stored as checkpoint_{epoch}.pth save_checkpoint( args.checkpoint_dir, model_no_ddp, optimizer, epoch, args, best_val_metrics, ) if epoch % args.eval_every_epoch == 0 or epoch == (args.max_epoch - 1): ap_calculator = evaluate( args, epoch, model, criterion, dataset_config, dataloaders["test"], logger, curr_iter, ) metrics = ap_calculator.compute_metrics() ap25 = metrics[0.25]["mAP"] metric_str = ap_calculator.metrics_to_str(metrics, per_class=True) metrics_dict = ap_calculator.metrics_to_dict(metrics) if is_primary(): print("==" * 10) print(f"Evaluate Epoch [{epoch}/{args.max_epoch}]; Metrics {metric_str}") print("==" * 10) logger.log_scalars(metrics_dict, curr_iter, prefix="Test/") if is_primary() and ( len(best_val_metrics) == 0 or best_val_metrics[0.25]["mAP"] < ap25 ): best_val_metrics = metrics filename = "checkpoint_best.pth" save_checkpoint( args.checkpoint_dir, model_no_ddp, optimizer, epoch, args, best_val_metrics, filename=filename, ) print( f"Epoch [{epoch}/{args.max_epoch}] saved current best val checkpoint at {filename}; ap25 {ap25}" ) # always evaluate last checkpoint epoch = args.max_epoch - 1 curr_iter = epoch * len(dataloaders["train"]) ap_calculator = evaluate( args, epoch, model, criterion, dataset_config, dataloaders["test"], logger, curr_iter, ) metrics = ap_calculator.compute_metrics() metric_str = ap_calculator.metrics_to_str(metrics) if is_primary(): print("==" * 10) print(f"Evaluate Final [{epoch}/{args.max_epoch}]; Metrics {metric_str}") print("==" * 10) with open(final_eval, "w") as fh: fh.write("Training Finished.\n") fh.write("==" * 10) fh.write("Final Eval Numbers.\n") fh.write(metric_str) fh.write("\n") fh.write("==" * 10) fh.write("Best Eval Numbers.\n") fh.write(ap_calculator.metrics_to_str(best_val_metrics)) fh.write("\n") with open(final_eval_pkl, "wb") as fh: pickle.dump(metrics, fh) def test_model(args, model, model_no_ddp, criterion, dataset_config, dataloaders): if args.test_ckpt is None or not os.path.isfile(args.test_ckpt): f"Please specify a test checkpoint using --test_ckpt. Found invalid value {args.test_ckpt}" sys.exit(1) sd = torch.load(args.test_ckpt, map_location=torch.device("cpu")) model_no_ddp.load_state_dict(sd["model"]) logger = Logger() criterion = None # do not compute loss for speed-up; Comment out to see test loss epoch = -1 curr_iter = 0 ap_calculator = evaluate( args, epoch, model, criterion, dataset_config, dataloaders["test"], logger, curr_iter, ) metrics = ap_calculator.compute_metrics() metric_str = ap_calculator.metrics_to_str(metrics) if is_primary(): print("==" * 10) print(f"Test model; Metrics {metric_str}") print("==" * 10) def main(local_rank, args): if args.ngpus > 1: print( "Initializing Distributed Training. This is in BETA mode and hasn't been tested thoroughly. Use at your own risk :)" ) print("To get the maximum speed-up consider reducing evaluations on val set by setting --eval_every_epoch to greater than 50") init_distributed( local_rank, global_rank=local_rank, world_size=args.ngpus, dist_url=args.dist_url, dist_backend="nccl", ) print(f"Called with args: {args}") torch.cuda.set_device(local_rank) np.random.seed(args.seed + get_rank()) torch.manual_seed(args.seed + get_rank()) if torch.cuda.is_available(): torch.cuda.manual_seed_all(args.seed + get_rank()) datasets, dataset_config = build_dataset(args) model, _ = build_model(args, dataset_config) model = model.cuda(local_rank) model_no_ddp = model if is_distributed(): model = torch.nn.SyncBatchNorm.convert_sync_batchnorm(model) model = torch.nn.parallel.DistributedDataParallel( model, device_ids=[local_rank] ) criterion = build_criterion(args, dataset_config) criterion = criterion.cuda(local_rank) dataloaders = {} if args.test_only: dataset_splits = ["test"] else: dataset_splits = ["train", "test"] for split in dataset_splits: if split == "train": shuffle = True else: shuffle = False if is_distributed(): sampler = DistributedSampler(datasets[split], shuffle=shuffle) elif shuffle: sampler = torch.utils.data.RandomSampler(datasets[split]) else: sampler = torch.utils.data.SequentialSampler(datasets[split]) dataloaders[split] = DataLoader( datasets[split], sampler=sampler, batch_size=args.batchsize_per_gpu, num_workers=args.dataset_num_workers, worker_init_fn=my_worker_init_fn, ) dataloaders[split + "_sampler"] = sampler if args.test_only: criterion = None # faster evaluation test_model(args, model, model_no_ddp, criterion, dataset_config, dataloaders) else: assert ( args.checkpoint_dir is not None ), f"Please specify a checkpoint dir using --checkpoint_dir" if is_primary() and not os.path.isdir(args.checkpoint_dir): os.makedirs(args.checkpoint_dir, exist_ok=True) optimizer = build_optimizer(args, model_no_ddp) loaded_epoch, best_val_metrics = resume_if_possible( args.checkpoint_dir, model_no_ddp, optimizer ) args.start_epoch = loaded_epoch + 1 do_train( args, model, model_no_ddp, optimizer, criterion, dataset_config, dataloaders, best_val_metrics, ) def launch_distributed(args): world_size = args.ngpus if world_size == 1: main(local_rank=0, args=args) else: torch.multiprocessing.spawn(main, nprocs=world_size, args=(args,)) if __name__ == "__main__": parser = make_args_parser() args = parser.parse_args() try: set_start_method("spawn") except RuntimeError: pass launch_distributed(args)
35.312644
134
0.621639
import argparse import os import sys import pickle import numpy as np import torch from torch.multiprocessing import set_start_method from torch.utils.data import DataLoader, DistributedSampler from datasets import build_dataset from engine import evaluate, train_one_epoch from models import build_model from optimizer import build_optimizer from criterion import build_criterion from utils.dist import init_distributed, is_distributed, is_primary, get_rank, barrier from utils.misc import my_worker_init_fn from utils.io import save_checkpoint, resume_if_possible from utils.logger import Logger def make_args_parser(): parser = argparse.ArgumentParser("3D Detection Using Transformers", add_help=False) --warm_lr", default=1e-6, type=float) parser.add_argument("--warm_lr_epochs", default=9, type=int) parser.add_argument("--final_lr", default=1e-6, type=float) parser.add_argument("--lr_scheduler", default="cosine", type=str) parser.add_argument("--weight_decay", default=0.1, type=float) parser.add_argument("--filter_biases_wd", default=False, action="store_true") parser.add_argument( "--clip_gradient", default=0.1, type=float, help="Max L2 norm of the gradient" ) , type=str, help="Name of the model", choices=["3detr"], ) ument( "--enc_type", default="vanilla", choices=["masked", "maskedv2", "vanilla"] ) parser.add_argument("--enc_nlayers", default=3, type=int) parser.add_argument("--enc_dim", default=256, type=int) parser.add_argument("--enc_ffn_dim", default=128, type=int) parser.add_argument("--enc_dropout", default=0.1, type=float) parser.add_argument("--enc_nhead", default=4, type=int) parser.add_argument("--enc_pos_embed", default=None, type=str) parser.add_argument("--enc_activation", default="relu", type=str) ument("--dec_nlayers", default=8, type=int) parser.add_argument("--dec_dim", default=256, type=int) parser.add_argument("--dec_ffn_dim", default=256, type=int) parser.add_argument("--dec_dropout", default=0.1, type=float) parser.add_argument("--dec_nhead", default=4, type=int) rgument( "--nsemcls", default=-1, type=int, help="Number of semantic object classes. Can be inferred from dataset", ) s", default=2048, type=int) parser.add_argument( "--pos_embed", default="fourier", type=str, choices=["fourier", "sine"] ) parser.add_argument("--nqueries", default=256, type=int) parser.add_argument("--use_color", default=False, action="store_true") atcher_cls_cost", default=1, type=float) parser.add_argument("--matcher_center_cost", default=0, type=float) parser.add_argument("--matcher_objectness_cost", default=0, type=float) oss_giou_weight", default=0, type=float) parser.add_argument("--loss_sem_cls_weight", default=1, type=float) parser.add_argument( "--loss_no_object_weight", default=0.2, type=float ) parser.add_argument("--loss_angle_cls_weight", default=0.1, type=float) parser.add_argument("--loss_angle_reg_weight", default=0.5, type=float) parser.add_argument("--loss_center_weight", default=5.0, type=float) parser.add_argument("--loss_size_weight", default=1.0, type=float) ces=["scannet", "sunrgbd"] ) parser.add_argument( "--dataset_root_dir", type=str, default=None, help="Root directory containing the dataset files. \ If None, default values from scannet.py/sunrgbd.py are used", ) # If None, default values from scannet.py/sunrgbd.py are used", parser.add_argument("--dataset_num_workers", default=4, type=int) parser.add_argument("--batchsize_per_gpu", default=8, type=int) nt("--max_epoch", default=720, type=int) parser.add_argument("--eval_every_epoch", default=10, type=int) parser.add_argument("--seed", default=0, type=int) arser.add_argument("--test_ckpt", default=None, type=str) tr) parser.add_argument("--log_every", default=10, type=int) parser.add_argument("--log_metrics_every", default=20, type=int) parser.add_argument("--save_separate_checkpoint_every_epoch", default=100, type=int) str) return parser def do_train( args, model, model_no_ddp, optimizer, criterion, dataset_config, dataloaders, best_val_metrics, ): num_iters_per_epoch = len(dataloaders["train"]) num_iters_per_eval_epoch = len(dataloaders["test"]) print(f"Model is {model}") print(f"Training started at epoch {args.start_epoch} until {args.max_epoch}.") print(f"One training epoch = {num_iters_per_epoch} iters.") print(f"One eval epoch = {num_iters_per_eval_epoch} iters.") final_eval = os.path.join(args.checkpoint_dir, "final_eval.txt") final_eval_pkl = os.path.join(args.checkpoint_dir, "final_eval.pkl") if os.path.isfile(final_eval): print(f"Found final eval file {final_eval}. Skipping training.") return logger = Logger(args.checkpoint_dir) for epoch in range(args.start_epoch, args.max_epoch): if is_distributed(): dataloaders["train_sampler"].set_epoch(epoch) aps = train_one_epoch( args, epoch, model, optimizer, criterion, dataset_config, dataloaders["train"], logger, ) save_checkpoint( args.checkpoint_dir, model_no_ddp, optimizer, epoch, args, best_val_metrics, filename="checkpoint.pth", ) metrics = aps.compute_metrics() metric_str = aps.metrics_to_str(metrics, per_class=False) metrics_dict = aps.metrics_to_dict(metrics) curr_iter = epoch * len(dataloaders["train"]) if is_primary(): print("==" * 10) print(f"Epoch [{epoch}/{args.max_epoch}]; Metrics {metric_str}") print("==" * 10) logger.log_scalars(metrics_dict, curr_iter, prefix="Train/") if ( epoch > 0 and args.save_separate_checkpoint_every_epoch > 0 and epoch % args.save_separate_checkpoint_every_epoch == 0 ): save_checkpoint( args.checkpoint_dir, model_no_ddp, optimizer, epoch, args, best_val_metrics, ) if epoch % args.eval_every_epoch == 0 or epoch == (args.max_epoch - 1): ap_calculator = evaluate( args, epoch, model, criterion, dataset_config, dataloaders["test"], logger, curr_iter, ) metrics = ap_calculator.compute_metrics() ap25 = metrics[0.25]["mAP"] metric_str = ap_calculator.metrics_to_str(metrics, per_class=True) metrics_dict = ap_calculator.metrics_to_dict(metrics) if is_primary(): print("==" * 10) print(f"Evaluate Epoch [{epoch}/{args.max_epoch}]; Metrics {metric_str}") print("==" * 10) logger.log_scalars(metrics_dict, curr_iter, prefix="Test/") if is_primary() and ( len(best_val_metrics) == 0 or best_val_metrics[0.25]["mAP"] < ap25 ): best_val_metrics = metrics filename = "checkpoint_best.pth" save_checkpoint( args.checkpoint_dir, model_no_ddp, optimizer, epoch, args, best_val_metrics, filename=filename, ) print( f"Epoch [{epoch}/{args.max_epoch}] saved current best val checkpoint at {filename}; ap25 {ap25}" ) epoch = args.max_epoch - 1 curr_iter = epoch * len(dataloaders["train"]) ap_calculator = evaluate( args, epoch, model, criterion, dataset_config, dataloaders["test"], logger, curr_iter, ) metrics = ap_calculator.compute_metrics() metric_str = ap_calculator.metrics_to_str(metrics) if is_primary(): print("==" * 10) print(f"Evaluate Final [{epoch}/{args.max_epoch}]; Metrics {metric_str}") print("==" * 10) with open(final_eval, "w") as fh: fh.write("Training Finished.\n") fh.write("==" * 10) fh.write("Final Eval Numbers.\n") fh.write(metric_str) fh.write("\n") fh.write("==" * 10) fh.write("Best Eval Numbers.\n") fh.write(ap_calculator.metrics_to_str(best_val_metrics)) fh.write("\n") with open(final_eval_pkl, "wb") as fh: pickle.dump(metrics, fh) def test_model(args, model, model_no_ddp, criterion, dataset_config, dataloaders): if args.test_ckpt is None or not os.path.isfile(args.test_ckpt): f"Please specify a test checkpoint using --test_ckpt. Found invalid value {args.test_ckpt}" sys.exit(1) sd = torch.load(args.test_ckpt, map_location=torch.device("cpu")) model_no_ddp.load_state_dict(sd["model"]) logger = Logger() criterion = None epoch = -1 curr_iter = 0 ap_calculator = evaluate( args, epoch, model, criterion, dataset_config, dataloaders["test"], logger, curr_iter, ) metrics = ap_calculator.compute_metrics() metric_str = ap_calculator.metrics_to_str(metrics) if is_primary(): print("==" * 10) print(f"Test model; Metrics {metric_str}") print("==" * 10) def main(local_rank, args): if args.ngpus > 1: print( "Initializing Distributed Training. This is in BETA mode and hasn't been tested thoroughly. Use at your own risk :)" ) print("To get the maximum speed-up consider reducing evaluations on val set by setting --eval_every_epoch to greater than 50") init_distributed( local_rank, global_rank=local_rank, world_size=args.ngpus, dist_url=args.dist_url, dist_backend="nccl", ) print(f"Called with args: {args}") torch.cuda.set_device(local_rank) np.random.seed(args.seed + get_rank()) torch.manual_seed(args.seed + get_rank()) if torch.cuda.is_available(): torch.cuda.manual_seed_all(args.seed + get_rank()) datasets, dataset_config = build_dataset(args) model, _ = build_model(args, dataset_config) model = model.cuda(local_rank) model_no_ddp = model if is_distributed(): model = torch.nn.SyncBatchNorm.convert_sync_batchnorm(model) model = torch.nn.parallel.DistributedDataParallel( model, device_ids=[local_rank] ) criterion = build_criterion(args, dataset_config) criterion = criterion.cuda(local_rank) dataloaders = {} if args.test_only: dataset_splits = ["test"] else: dataset_splits = ["train", "test"] for split in dataset_splits: if split == "train": shuffle = True else: shuffle = False if is_distributed(): sampler = DistributedSampler(datasets[split], shuffle=shuffle) elif shuffle: sampler = torch.utils.data.RandomSampler(datasets[split]) else: sampler = torch.utils.data.SequentialSampler(datasets[split]) dataloaders[split] = DataLoader( datasets[split], sampler=sampler, batch_size=args.batchsize_per_gpu, num_workers=args.dataset_num_workers, worker_init_fn=my_worker_init_fn, ) dataloaders[split + "_sampler"] = sampler if args.test_only: criterion = None # faster evaluation test_model(args, model, model_no_ddp, criterion, dataset_config, dataloaders) else: assert ( args.checkpoint_dir is not None ), f"Please specify a checkpoint dir using --checkpoint_dir" if is_primary() and not os.path.isdir(args.checkpoint_dir): os.makedirs(args.checkpoint_dir, exist_ok=True) optimizer = build_optimizer(args, model_no_ddp) loaded_epoch, best_val_metrics = resume_if_possible( args.checkpoint_dir, model_no_ddp, optimizer ) args.start_epoch = loaded_epoch + 1 do_train( args, model, model_no_ddp, optimizer, criterion, dataset_config, dataloaders, best_val_metrics, ) def launch_distributed(args): world_size = args.ngpus if world_size == 1: main(local_rank=0, args=args) else: torch.multiprocessing.spawn(main, nprocs=world_size, args=(args,)) if __name__ == "__main__": parser = make_args_parser() args = parser.parse_args() try: set_start_method("spawn") except RuntimeError: pass launch_distributed(args)
true
true
f72ba096355b4c9e07406e66b05f1d1a8c1dce09
9,312
py
Python
metadata-ingestion/src/datahub/ingestion/source/ldap.py
zhongjinhan/datahub
3bf5ffab5db02bed21d9b04fd65860927fce8088
[ "Apache-2.0" ]
null
null
null
metadata-ingestion/src/datahub/ingestion/source/ldap.py
zhongjinhan/datahub
3bf5ffab5db02bed21d9b04fd65860927fce8088
[ "Apache-2.0" ]
1
2021-03-09T19:40:53.000Z
2021-03-15T17:36:26.000Z
metadata-ingestion/src/datahub/ingestion/source/ldap.py
zhongjinhan/datahub
3bf5ffab5db02bed21d9b04fd65860927fce8088
[ "Apache-2.0" ]
null
null
null
"""LDAP Source""" from dataclasses import dataclass from typing import Any, Dict, Iterable, List, Optional import ldap from ldap.controls import SimplePagedResultsControl from datahub.configuration.common import ConfigModel, ConfigurationError from datahub.ingestion.api.common import PipelineContext from datahub.ingestion.api.source import Source, SourceReport from datahub.ingestion.source.metadata_common import MetadataWorkUnit from datahub.metadata.com.linkedin.pegasus2avro.mxe import MetadataChangeEvent from datahub.metadata.schema_classes import ( CorpGroupInfoClass, CorpGroupSnapshotClass, CorpUserInfoClass, CorpUserSnapshotClass, ) def create_controls(pagesize: int) -> SimplePagedResultsControl: """ Create an LDAP control with a page size of "pagesize". """ return SimplePagedResultsControl(True, size=pagesize, cookie="") def get_pctrls( serverctrls: List[SimplePagedResultsControl], ) -> List[SimplePagedResultsControl]: """ Lookup an LDAP paged control object from the returned controls. """ return [ c for c in serverctrls if c.controlType == SimplePagedResultsControl.controlType ] def set_cookie( lc_object: SimplePagedResultsControl, pctrls: List[SimplePagedResultsControl], ) -> bool: """ Push latest cookie back into the page control. """ cookie = pctrls[0].cookie lc_object.cookie = cookie return bool(cookie) def guess_person_ldap(attrs: Dict[str, Any]) -> Optional[str]: """Determine the user's LDAP based on the DN and attributes.""" if "sAMAccountName" in attrs: return attrs["sAMAccountName"][0].decode() if "uid" in attrs: return attrs["uid"][0].decode() return None class LDAPSourceConfig(ConfigModel): """Config used by the LDAP Source.""" # Server configuration. ldap_server: str ldap_user: str ldap_password: str # Extraction configuration. base_dn: str filter: str = "(objectClass=*)" page_size: int = 20 @dataclass class LDAPSource(Source): """LDAP Source Class.""" config: LDAPSourceConfig report: SourceReport def __init__(self, ctx: PipelineContext, config: LDAPSourceConfig): """Constructor.""" super().__init__(ctx) self.config = config self.report = SourceReport() ldap.set_option(ldap.OPT_X_TLS_REQUIRE_CERT, ldap.OPT_X_TLS_ALLOW) ldap.set_option(ldap.OPT_REFERRALS, 0) self.ldap_client = ldap.initialize(self.config.ldap_server) self.ldap_client.protocol_version = 3 try: self.ldap_client.simple_bind_s( self.config.ldap_user, self.config.ldap_password ) except ldap.LDAPError as e: raise ConfigurationError("LDAP connection failed") from e self.lc = create_controls(self.config.page_size) @classmethod def create(cls, config_dict: Dict[str, Any], ctx: PipelineContext) -> "LDAPSource": """Factory method.""" config = LDAPSourceConfig.parse_obj(config_dict) return cls(ctx, config) def get_workunits(self) -> Iterable[MetadataWorkUnit]: """Returns an Iterable containing the workunits to ingest LDAP users or groups.""" cookie = True while cookie: try: msgid = self.ldap_client.search_ext( self.config.base_dn, ldap.SCOPE_SUBTREE, self.config.filter, serverctrls=[self.lc], ) _rtype, rdata, _rmsgid, serverctrls = self.ldap_client.result3(msgid) except ldap.LDAPError as e: self.report.report_failure( "ldap-control", "LDAP search failed: {}".format(e) ) break for dn, attrs in rdata: if ( b"inetOrgPerson" in attrs["objectClass"] or b"posixAccount" in attrs["objectClass"] ): yield from self.handle_user(dn, attrs) if ( b"posixGroup" in attrs["objectClass"] or b"organizationalUnit" in attrs["objectClass"] ): yield from self.handle_group(dn, attrs) pctrls = get_pctrls(serverctrls) if not pctrls: self.report.report_failure( "ldap-control", "Server ignores RFC 2696 control." ) break cookie = set_cookie(self.lc, pctrls) def handle_user(self, dn: str, attrs: Dict[str, Any]) -> Iterable[MetadataWorkUnit]: """ Handle a DN and attributes by adding manager info and constructing a work unit based on the information. """ manager_ldap = None if "manager" in attrs: try: m_cn = attrs["manager"][0].split(b",")[0] manager_msgid = self.ldap_client.search_ext( self.config.base_dn, ldap.SCOPE_SUBTREE, f"({m_cn.decode()})", serverctrls=[self.lc], ) _m_dn, m_attrs = self.ldap_client.result3(manager_msgid)[1][0] manager_ldap = guess_person_ldap(m_attrs) except ldap.LDAPError as e: self.report.report_warning( dn, "manager LDAP search failed: {}".format(e) ) mce = self.build_corp_user_mce(dn, attrs, manager_ldap) if mce: wu = MetadataWorkUnit(dn, mce) self.report.report_workunit(wu) yield wu yield from [] def handle_group( self, dn: str, attrs: Dict[str, Any] ) -> Iterable[MetadataWorkUnit]: """Creates a workunit for LDAP groups.""" mce = self.build_corp_group_mce(attrs) if mce: wu = MetadataWorkUnit(dn, mce) self.report.report_workunit(wu) yield wu yield from [] def build_corp_user_mce( self, dn: str, attrs: dict, manager_ldap: Optional[str] ) -> Optional[MetadataChangeEvent]: """ Create the MetadataChangeEvent via DN and attributes. """ ldap_user = guess_person_ldap(attrs) full_name = attrs["cn"][0].decode() first_name = attrs["givenName"][0].decode() last_name = attrs["sn"][0].decode() email = (attrs["mail"][0]).decode() if "mail" in attrs else ldap_user display_name = ( (attrs["displayName"][0]).decode() if "displayName" in attrs else full_name ) department = ( (attrs["departmentNumber"][0]).decode() if "departmentNumber" in attrs else None ) title = attrs["title"][0].decode() if "title" in attrs else None manager_urn = f"urn:li:corpuser:{manager_ldap}" if manager_ldap else None return MetadataChangeEvent( proposedSnapshot=CorpUserSnapshotClass( urn=f"urn:li:corpuser:{ldap_user}", aspects=[ CorpUserInfoClass( active=True, email=email, fullName=full_name, firstName=first_name, lastName=last_name, departmentName=department, displayName=display_name, title=title, managerUrn=manager_urn, ) ], ) ) def build_corp_group_mce(self, attrs: dict) -> Optional[MetadataChangeEvent]: """Creates a MetadataChangeEvent for LDAP groups.""" cn = attrs.get("cn") if cn: full_name = cn[0].decode() owners = parse_from_attrs(attrs, "owner") members = parse_from_attrs(attrs, "uniqueMember") email = attrs["mail"][0].decode() if "mail" in attrs else full_name return MetadataChangeEvent( proposedSnapshot=CorpGroupSnapshotClass( urn=f"urn:li:corpGroup:{full_name}", aspects=[ CorpGroupInfoClass( email=email, admins=owners, members=members, groups=[], ) ], ) ) return None def get_report(self) -> SourceReport: """Returns the sourcereport.""" return self.report def close(self) -> None: """Closes the Source.""" self.ldap_client.unbind() def parse_from_attrs(attrs: Dict[str, Any], filter_key: str) -> List[str]: """Converts a list of LDAP formats to Datahub corpuser strings.""" if filter_key in attrs: return [ f"urn:li:corpuser:{strip_ldap_info(ldap_user)}" for ldap_user in attrs[filter_key] ] return [] def strip_ldap_info(input_clean: bytes) -> str: """Converts a b'uid=username,ou=Groups,dc=internal,dc=machines' format to username""" return input_clean.decode().split(",")[0].lstrip("uid=")
33.376344
90
0.575387
from dataclasses import dataclass from typing import Any, Dict, Iterable, List, Optional import ldap from ldap.controls import SimplePagedResultsControl from datahub.configuration.common import ConfigModel, ConfigurationError from datahub.ingestion.api.common import PipelineContext from datahub.ingestion.api.source import Source, SourceReport from datahub.ingestion.source.metadata_common import MetadataWorkUnit from datahub.metadata.com.linkedin.pegasus2avro.mxe import MetadataChangeEvent from datahub.metadata.schema_classes import ( CorpGroupInfoClass, CorpGroupSnapshotClass, CorpUserInfoClass, CorpUserSnapshotClass, ) def create_controls(pagesize: int) -> SimplePagedResultsControl: return SimplePagedResultsControl(True, size=pagesize, cookie="") def get_pctrls( serverctrls: List[SimplePagedResultsControl], ) -> List[SimplePagedResultsControl]: return [ c for c in serverctrls if c.controlType == SimplePagedResultsControl.controlType ] def set_cookie( lc_object: SimplePagedResultsControl, pctrls: List[SimplePagedResultsControl], ) -> bool: cookie = pctrls[0].cookie lc_object.cookie = cookie return bool(cookie) def guess_person_ldap(attrs: Dict[str, Any]) -> Optional[str]: if "sAMAccountName" in attrs: return attrs["sAMAccountName"][0].decode() if "uid" in attrs: return attrs["uid"][0].decode() return None class LDAPSourceConfig(ConfigModel): ldap_server: str ldap_user: str ldap_password: str base_dn: str filter: str = "(objectClass=*)" page_size: int = 20 @dataclass class LDAPSource(Source): config: LDAPSourceConfig report: SourceReport def __init__(self, ctx: PipelineContext, config: LDAPSourceConfig): super().__init__(ctx) self.config = config self.report = SourceReport() ldap.set_option(ldap.OPT_X_TLS_REQUIRE_CERT, ldap.OPT_X_TLS_ALLOW) ldap.set_option(ldap.OPT_REFERRALS, 0) self.ldap_client = ldap.initialize(self.config.ldap_server) self.ldap_client.protocol_version = 3 try: self.ldap_client.simple_bind_s( self.config.ldap_user, self.config.ldap_password ) except ldap.LDAPError as e: raise ConfigurationError("LDAP connection failed") from e self.lc = create_controls(self.config.page_size) @classmethod def create(cls, config_dict: Dict[str, Any], ctx: PipelineContext) -> "LDAPSource": config = LDAPSourceConfig.parse_obj(config_dict) return cls(ctx, config) def get_workunits(self) -> Iterable[MetadataWorkUnit]: cookie = True while cookie: try: msgid = self.ldap_client.search_ext( self.config.base_dn, ldap.SCOPE_SUBTREE, self.config.filter, serverctrls=[self.lc], ) _rtype, rdata, _rmsgid, serverctrls = self.ldap_client.result3(msgid) except ldap.LDAPError as e: self.report.report_failure( "ldap-control", "LDAP search failed: {}".format(e) ) break for dn, attrs in rdata: if ( b"inetOrgPerson" in attrs["objectClass"] or b"posixAccount" in attrs["objectClass"] ): yield from self.handle_user(dn, attrs) if ( b"posixGroup" in attrs["objectClass"] or b"organizationalUnit" in attrs["objectClass"] ): yield from self.handle_group(dn, attrs) pctrls = get_pctrls(serverctrls) if not pctrls: self.report.report_failure( "ldap-control", "Server ignores RFC 2696 control." ) break cookie = set_cookie(self.lc, pctrls) def handle_user(self, dn: str, attrs: Dict[str, Any]) -> Iterable[MetadataWorkUnit]: manager_ldap = None if "manager" in attrs: try: m_cn = attrs["manager"][0].split(b",")[0] manager_msgid = self.ldap_client.search_ext( self.config.base_dn, ldap.SCOPE_SUBTREE, f"({m_cn.decode()})", serverctrls=[self.lc], ) _m_dn, m_attrs = self.ldap_client.result3(manager_msgid)[1][0] manager_ldap = guess_person_ldap(m_attrs) except ldap.LDAPError as e: self.report.report_warning( dn, "manager LDAP search failed: {}".format(e) ) mce = self.build_corp_user_mce(dn, attrs, manager_ldap) if mce: wu = MetadataWorkUnit(dn, mce) self.report.report_workunit(wu) yield wu yield from [] def handle_group( self, dn: str, attrs: Dict[str, Any] ) -> Iterable[MetadataWorkUnit]: mce = self.build_corp_group_mce(attrs) if mce: wu = MetadataWorkUnit(dn, mce) self.report.report_workunit(wu) yield wu yield from [] def build_corp_user_mce( self, dn: str, attrs: dict, manager_ldap: Optional[str] ) -> Optional[MetadataChangeEvent]: ldap_user = guess_person_ldap(attrs) full_name = attrs["cn"][0].decode() first_name = attrs["givenName"][0].decode() last_name = attrs["sn"][0].decode() email = (attrs["mail"][0]).decode() if "mail" in attrs else ldap_user display_name = ( (attrs["displayName"][0]).decode() if "displayName" in attrs else full_name ) department = ( (attrs["departmentNumber"][0]).decode() if "departmentNumber" in attrs else None ) title = attrs["title"][0].decode() if "title" in attrs else None manager_urn = f"urn:li:corpuser:{manager_ldap}" if manager_ldap else None return MetadataChangeEvent( proposedSnapshot=CorpUserSnapshotClass( urn=f"urn:li:corpuser:{ldap_user}", aspects=[ CorpUserInfoClass( active=True, email=email, fullName=full_name, firstName=first_name, lastName=last_name, departmentName=department, displayName=display_name, title=title, managerUrn=manager_urn, ) ], ) ) def build_corp_group_mce(self, attrs: dict) -> Optional[MetadataChangeEvent]: cn = attrs.get("cn") if cn: full_name = cn[0].decode() owners = parse_from_attrs(attrs, "owner") members = parse_from_attrs(attrs, "uniqueMember") email = attrs["mail"][0].decode() if "mail" in attrs else full_name return MetadataChangeEvent( proposedSnapshot=CorpGroupSnapshotClass( urn=f"urn:li:corpGroup:{full_name}", aspects=[ CorpGroupInfoClass( email=email, admins=owners, members=members, groups=[], ) ], ) ) return None def get_report(self) -> SourceReport: return self.report def close(self) -> None: self.ldap_client.unbind() def parse_from_attrs(attrs: Dict[str, Any], filter_key: str) -> List[str]: if filter_key in attrs: return [ f"urn:li:corpuser:{strip_ldap_info(ldap_user)}" for ldap_user in attrs[filter_key] ] return [] def strip_ldap_info(input_clean: bytes) -> str: return input_clean.decode().split(",")[0].lstrip("uid=")
true
true
f72ba1d7778091106a4581741203288c6ae24e0e
1,378
py
Python
tests/benchmarks/constructs/LocalVariableAssign.py
Mortal/Nuitka
5150eeff7ff845ed4993c773449cd81b7f127c6b
[ "Apache-2.0" ]
null
null
null
tests/benchmarks/constructs/LocalVariableAssign.py
Mortal/Nuitka
5150eeff7ff845ed4993c773449cd81b7f127c6b
[ "Apache-2.0" ]
null
null
null
tests/benchmarks/constructs/LocalVariableAssign.py
Mortal/Nuitka
5150eeff7ff845ed4993c773449cd81b7f127c6b
[ "Apache-2.0" ]
1
2018-12-16T23:51:18.000Z
2018-12-16T23:51:18.000Z
# Copyright 2018, Kay Hayen, mailto:kay.hayen@gmail.com # # Python test originally created or extracted from other peoples work. The # parts from me are licensed as below. It is at least Free Software where # it's copied from other people. In these cases, that will normally be # indicated. # # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. # module_value1 = 1000 module_value2 = 50 def calledRepeatedly(): # Force frame and eliminate forward propagation (currently). module_value1 local_value = module_value1 local_value2 = module_value2 # construct_begin local_value2 = local_value * 2 # construct_alternative local_value * 2 # construct_end local_value2 = local_value * 4 return local_value import itertools for x in itertools.repeat(None, 50000): calledRepeatedly() print("OK.")
30.622222
78
0.722787
# indicated. # # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. # module_value1 = 1000 module_value2 = 50 def calledRepeatedly(): # Force frame and eliminate forward propagation (currently). module_value1 local_value = module_value1 local_value2 = module_value2 # construct_begin local_value2 = local_value * 2 # construct_alternative local_value * 2 # construct_end local_value2 = local_value * 4 return local_value import itertools for x in itertools.repeat(None, 50000): calledRepeatedly() print("OK.")
true
true
f72ba2b63d4ac4e8dc4c0d2dd40a513c05d534df
3,551
py
Python
tests/test_graph.py
arky/followthemoney
e6e4f5749aadc51893d131aac9744e1184d12f92
[ "MIT" ]
137
2017-10-20T09:36:32.000Z
2022-03-24T18:49:16.000Z
tests/test_graph.py
arky/followthemoney
e6e4f5749aadc51893d131aac9744e1184d12f92
[ "MIT" ]
505
2017-10-24T13:14:06.000Z
2022-03-28T20:21:45.000Z
tests/test_graph.py
malteos/followthemoney
7fde00488b4f2bf6acc69d922bd0ca9d2defbe0f
[ "MIT" ]
32
2017-12-19T15:22:07.000Z
2022-02-18T11:01:28.000Z
from unittest import TestCase from followthemoney import model from followthemoney.types import registry from followthemoney.graph import Graph, Node ENTITY = { "id": "ralph", "schema": "Person", "properties": { "name": ["Ralph Tester"], "birthDate": ["1972-05-01"], "idNumber": ["9177171", "8e839023"], "website": ["https://ralphtester.me"], "phone": ["+12025557612"], "email": ["info@ralphtester.me"], "topics": ["role.spy"], }, } ENTITY2 = { "id": "jodie", "schema": "Person", "properties": {"name": ["Jodie Tester"], "birthDate": ["1972-05-01"]}, } REL = { "id": "jodie2ralph", "schema": "Family", "properties": {"person": ["jodie"], "relative": ["ralph"]}, } PASS = { "id": "passpoat", "schema": "Passport", "properties": {"holder": ["jodie"], "passportNumber": ["HJSJHAS"]}, } class GraphTestCase(TestCase): def test_basic_graph(self): proxy = model.get_proxy(ENTITY, cleaned=False) graph = Graph(edge_types=registry.pivots) graph.add(proxy) assert len(graph.iternodes()) > 1, graph.to_dict() assert len(graph.proxies) == 1, graph.proxies assert len(graph.queued) == 0, graph.proxies graph.add(None) assert len(graph.proxies) == 1, graph.proxies assert len(graph.queued) == 0, graph.proxies def test_adjacent(self): graph = Graph(edge_types=registry.pivots) graph.add(model.get_proxy(ENTITY, cleaned=False)) graph.add(model.get_proxy(ENTITY2, cleaned=False)) graph.add(model.get_proxy(REL, cleaned=False)) graph.add(model.get_proxy(PASS, cleaned=False)) node = Node(registry.entity, "jodie") adj = list(graph.get_adjacent(node)) assert len(adj) == 3, adj node = Node(registry.entity, "ralph") adj = list(graph.get_adjacent(node)) assert len(adj) == 7, adj node = Node(registry.entity, "passpoat") adj = list(graph.get_adjacent(node)) assert len(adj) == 2, adj node = Node(registry.entity, "passpoat") prop = model.get_qname("Identification:holder") adj = list(graph.get_adjacent(node, prop)) assert len(adj) == 1, adj assert adj[0].source_prop == prop, adj[0].source_prop assert adj[0].target_prop == prop.reverse, adj[0].target_prop node = Node(registry.entity, "jodie") prop = model.get_qname("Person:familyPerson") adj = list(graph.get_adjacent(node, prop)) assert len(adj) == 1, adj assert adj[0].source_prop == prop, adj[0].source_prop node = Node(registry.entity, "ralph") prop = model.get_qname("Person:familyRelative") adj2 = list(graph.get_adjacent(node, prop)) assert len(adj2) == 1, adj2 assert adj2[0].target_prop == prop, adj2[0].target_prop assert adj[0] == adj2[0], (adj[0], adj2[0]) assert adj[0].id in repr(adj[0]), repr(adj[0]) def test_to_dict(self): proxy = model.get_proxy(ENTITY, cleaned=False) graph = Graph(edge_types=registry.pivots) graph.add(proxy) data = graph.to_dict() assert "nodes" in data, data assert "edges" in data, data def test_nodes(self): node = Node(registry.phone, "+4917778271717") assert "+49177" in repr(node), repr(node) assert node == node, repr(node) assert node.caption == str(node), str(node) assert hash(node) == hash(node.id), repr(node)
33.819048
74
0.599549
from unittest import TestCase from followthemoney import model from followthemoney.types import registry from followthemoney.graph import Graph, Node ENTITY = { "id": "ralph", "schema": "Person", "properties": { "name": ["Ralph Tester"], "birthDate": ["1972-05-01"], "idNumber": ["9177171", "8e839023"], "website": ["https://ralphtester.me"], "phone": ["+12025557612"], "email": ["info@ralphtester.me"], "topics": ["role.spy"], }, } ENTITY2 = { "id": "jodie", "schema": "Person", "properties": {"name": ["Jodie Tester"], "birthDate": ["1972-05-01"]}, } REL = { "id": "jodie2ralph", "schema": "Family", "properties": {"person": ["jodie"], "relative": ["ralph"]}, } PASS = { "id": "passpoat", "schema": "Passport", "properties": {"holder": ["jodie"], "passportNumber": ["HJSJHAS"]}, } class GraphTestCase(TestCase): def test_basic_graph(self): proxy = model.get_proxy(ENTITY, cleaned=False) graph = Graph(edge_types=registry.pivots) graph.add(proxy) assert len(graph.iternodes()) > 1, graph.to_dict() assert len(graph.proxies) == 1, graph.proxies assert len(graph.queued) == 0, graph.proxies graph.add(None) assert len(graph.proxies) == 1, graph.proxies assert len(graph.queued) == 0, graph.proxies def test_adjacent(self): graph = Graph(edge_types=registry.pivots) graph.add(model.get_proxy(ENTITY, cleaned=False)) graph.add(model.get_proxy(ENTITY2, cleaned=False)) graph.add(model.get_proxy(REL, cleaned=False)) graph.add(model.get_proxy(PASS, cleaned=False)) node = Node(registry.entity, "jodie") adj = list(graph.get_adjacent(node)) assert len(adj) == 3, adj node = Node(registry.entity, "ralph") adj = list(graph.get_adjacent(node)) assert len(adj) == 7, adj node = Node(registry.entity, "passpoat") adj = list(graph.get_adjacent(node)) assert len(adj) == 2, adj node = Node(registry.entity, "passpoat") prop = model.get_qname("Identification:holder") adj = list(graph.get_adjacent(node, prop)) assert len(adj) == 1, adj assert adj[0].source_prop == prop, adj[0].source_prop assert adj[0].target_prop == prop.reverse, adj[0].target_prop node = Node(registry.entity, "jodie") prop = model.get_qname("Person:familyPerson") adj = list(graph.get_adjacent(node, prop)) assert len(adj) == 1, adj assert adj[0].source_prop == prop, adj[0].source_prop node = Node(registry.entity, "ralph") prop = model.get_qname("Person:familyRelative") adj2 = list(graph.get_adjacent(node, prop)) assert len(adj2) == 1, adj2 assert adj2[0].target_prop == prop, adj2[0].target_prop assert adj[0] == adj2[0], (adj[0], adj2[0]) assert adj[0].id in repr(adj[0]), repr(adj[0]) def test_to_dict(self): proxy = model.get_proxy(ENTITY, cleaned=False) graph = Graph(edge_types=registry.pivots) graph.add(proxy) data = graph.to_dict() assert "nodes" in data, data assert "edges" in data, data def test_nodes(self): node = Node(registry.phone, "+4917778271717") assert "+49177" in repr(node), repr(node) assert node == node, repr(node) assert node.caption == str(node), str(node) assert hash(node) == hash(node.id), repr(node)
true
true
f72ba3d5f708cc3f9400d201f0cc2f6315f72c8b
832
py
Python
tests_no_pytest/test_write.py
jzuhone/xija
1e423d0c48056cc4ea9e4993d28e34794c1420fa
[ "BSD-3-Clause" ]
2
2016-01-05T19:20:43.000Z
2021-06-04T08:23:08.000Z
tests_no_pytest/test_write.py
jzuhone/xija
1e423d0c48056cc4ea9e4993d28e34794c1420fa
[ "BSD-3-Clause" ]
61
2015-02-24T02:27:11.000Z
2022-03-23T13:52:15.000Z
tests_no_pytest/test_write.py
jzuhone/xija
1e423d0c48056cc4ea9e4993d28e34794c1420fa
[ "BSD-3-Clause" ]
1
2016-01-04T21:08:17.000Z
2016-01-04T21:08:17.000Z
# Licensed under a 3-clause BSD style license - see LICENSE.rst import os import json import numpy as np import xija mdl = xija.ThermalModel(start='2010:001', stop='2010:004') tephin = mdl.add(xija.Node, 'tephin') tcylaft6 = mdl.add(xija.Node, 'tcylaft6', predict=False) coup_tephin_tcylaft6 = mdl.add(xija.Coupling, tephin, tcylaft6, tau=20) aosares1 = mdl.add(xija.TelemData, 'aosares1') tephin_solar = mdl.add(xija.SolarHeat, tephin, aosares1, Ps=[0.1, 0.5, 1.0, 1.5, 2.0], dPs=[0.01, 0.02, 0.03, 0.04, 0.05]) tephin_heatsink = mdl.add(xija.HeatSink, tephin, T=0.0, tau=20.0) mdl.make() mdl.write('test_write.json') model_spec = json.load(open('test_write.json')) mdl2 = xija.ThermalModel(start='2010:001', stop='2010:004', model_spec=model_spec) os.unlink('test_write.json')
30.814815
82
0.68149
import os import json import numpy as np import xija mdl = xija.ThermalModel(start='2010:001', stop='2010:004') tephin = mdl.add(xija.Node, 'tephin') tcylaft6 = mdl.add(xija.Node, 'tcylaft6', predict=False) coup_tephin_tcylaft6 = mdl.add(xija.Coupling, tephin, tcylaft6, tau=20) aosares1 = mdl.add(xija.TelemData, 'aosares1') tephin_solar = mdl.add(xija.SolarHeat, tephin, aosares1, Ps=[0.1, 0.5, 1.0, 1.5, 2.0], dPs=[0.01, 0.02, 0.03, 0.04, 0.05]) tephin_heatsink = mdl.add(xija.HeatSink, tephin, T=0.0, tau=20.0) mdl.make() mdl.write('test_write.json') model_spec = json.load(open('test_write.json')) mdl2 = xija.ThermalModel(start='2010:001', stop='2010:004', model_spec=model_spec) os.unlink('test_write.json')
true
true
f72ba4bad6d7541d57491bf18fb1649b5f900db5
17,871
py
Python
src/tests/test_api_functions.py
ArieLevs/NalkinsCloud-Django
3fab970e4545db2e0b3e63a4bc8a5a1488a4a2bf
[ "Apache-2.0" ]
6
2019-01-07T15:34:27.000Z
2020-05-16T14:40:38.000Z
src/tests/test_api_functions.py
ArieLevs/NalkinsCloud-Django
3fab970e4545db2e0b3e63a4bc8a5a1488a4a2bf
[ "Apache-2.0" ]
9
2019-12-28T12:08:36.000Z
2021-09-22T17:44:41.000Z
src/tests/test_api_functions.py
ArieLevs/NalkinsCloud-Django-Backend
3fab970e4545db2e0b3e63a4bc8a5a1488a4a2bf
[ "Apache-2.0" ]
null
null
null
from django.utils.crypto import get_random_string from django.urls import reverse from django.utils import timezone from rest_framework.test import APITestCase from oauth2_provider.models import AccessToken from oauth2_provider.models import Application from nalkinscloud_mosquitto.models import Device, DeviceType, DeviceModel, CustomerDevice from django_user_email_extension.models import User import datetime import logging from nalkinscloud_django.settings import PROJECT_NAME # Define logger logger = logging.getLogger(PROJECT_NAME) class APIViewsTestCase(APITestCase): def setUp(self): # Create OAuth application self.oauth_client_id = 'some_client_id' self.oauth_client_secret = 'some_client_secret' self.oauth_client = Application.objects.create(client_id=self.oauth_client_id, client_secret=self.oauth_client_secret) self.email = "test@nalkins.cloud" self.password = "nalkinscloud" # Generate basic test user self.user = User.objects.create_user( email=self.email, password=self.password, is_active=True ) # Generate access token (oauth) for test user expires = timezone.now() + datetime.timedelta(seconds=36000) self.access_token = AccessToken.objects.create( user=self.user, application=self.oauth_client, scope='', token=get_random_string(length=32), expires=expires) self.access_token.save() # Generate test device self.device_id = 'api_test_device_id' self.device_password = 'nalkinscloud' self.device_model = 'esp8266' self.device_type = 'dht' self.device = Device.objects.create_device(device_id=self.device_id, password=self.device_password, model=DeviceModel.objects.get(model=self.device_model), type=DeviceType.objects.get(type=self.device_type)) # Generate users device self.user_device_id = self.user.email self.user_device_model = 'application' self.user_device_type = 'user' self.user_device = Device.objects.create_device(device_id=self.user_device_id, password=self.device_password, model=DeviceModel.objects.get(model=self.user_device_model), type=DeviceType.objects.get(type=self.user_device_type)) # Set current client with a token fot authentication self.client.credentials(HTTP_AUTHORIZATION='Bearer ' + str(self.access_token)) self.health_check_url = reverse('nalkinscloud_api:health_check') self.registration_url = reverse('nalkinscloud_api:register') self.device_activation_url = reverse('nalkinscloud_api:device_activation') self.device_list_url = reverse('nalkinscloud_api:device_list') self.forgot_password_url = reverse('nalkinscloud_api:forgot_password') self.get_device_pass_url = reverse('nalkinscloud_api:get_device_pass') self.remove_device_url = reverse('nalkinscloud_api:remove_device') self.reset_password_url = reverse('nalkinscloud_api:reset_password') self.update_device_pass_url = reverse('nalkinscloud_api:update_device_pass') def test_registration(self): """ Test Registration view """ post_body = { 'client_secret': self.oauth_client_secret, 'email': 'arielev@nalkins.cloud', 'password': self.password, 'first_name': 'Arie', 'last_name': 'Lev' } response = self.client.post(self.registration_url, data=post_body, format='json') logger.debug("test_registration response: " + str(response.json())) self.assertEqual(201, response.status_code, "Should return 201, register new user successfully") # Perform same registration process again response = self.client.post(self.registration_url, data=post_body, format='json') self.assertEqual(409, response.status_code, "Should return 409 conflict, email already exists") # Change client_secret to non valid value post_body['client_secret'] = 'some_non_existing_client_id' response = self.client.post(self.registration_url, data=post_body, format='json') self.assertEqual(401, response.status_code, "Should return not authorized") self.assertEqual(User.objects.count(), 2, "Two users should be present in the system by this point") def test_health_check_view(self): """ Test Health Check view :return: """ response = self.client.post(self.health_check_url) logger.debug('test_health_check_view response: ' + str(response.json())) self.assertEqual(200, response.status_code, "Should return username") def test_device_activation_view_204(self): """ Test case when trying to attach a device that does not exists :return: """ post_body = { 'device_id': 'non_existing_device', 'device_name': 'device_activation_test' } response = self.client.post(self.device_activation_url, data=post_body) self.assertEqual(204, response.status_code, "Should return 204 since device does not exists") def test_device_activation_view_400_1(self): """ Test case when calling the api with no data :return: """ response = self.client.post(self.device_activation_url) logger.debug('test_device_activation_view_400_1 response: ' + str(response.json())) self.assertEqual(400, response.status_code, "Should return error 400 since there are missing values") def test_device_activation_view_400_2(self): """ Test case when one of data parameters empty :return: """ post_body = { 'device_id': '', 'device_name': 'device_activation_test' } response = self.client.post(self.device_activation_url, data=post_body) logger.debug('test_device_activation_view_400_2 response: ' + str(response.json())) self.assertEqual(400, response.status_code, "Should return 400 since 'device_id' is blank") self.assertEqual(response.json(), {'device_id': ['This field may not be blank.']}, "Should return blank field not allowed") def test_device_activation_view_409(self): """ Test case when a device has an owner and its not the current user :return: """ # Generate another test user user = User.objects.create_user( email='device@activate.test', password=self.password, is_active=True ) # Generate another test device device = Device.objects.create_device(device_id='device_activation_test_id', password=self.device_password, model=DeviceModel.objects.get(model=self.device_model), type=DeviceType.objects.get(type=self.device_type)) # Attach just created user and device CustomerDevice.objects.create(user_id=user, device_id=device) # Test attaching other users device to current user post_body = { 'device_id': device, 'device_name': 'device_activation_test' } response = self.client.post(self.device_activation_url, data=post_body) logger.debug('test_device_activation_view_409 response: ' + str(response.json())) self.assertEqual(409, response.status_code, "Should return 409 conflict, device owned by other user") def test_device_activation_view_200_1(self): """ Test case when all is OK and an non owned device attached to current user :return: """ post_body = { 'device_id': self.device_id, 'device_name': 'device_activation_test' } response = self.client.post(self.device_activation_url, data=post_body) logger.debug('test_device_activation_view_200_1 response: ' + str(response.json())) self.assertEqual(200, response.status_code, "Should return 200, device attached") def test_device_activation_view_200_2(self): """ Test case when trying to attach a device that is already attached :return: """ CustomerDevice.objects.create(user_id=self.user, device_id=self.device) post_body = { 'device_id': self.device_id, 'device_name': 'test_device_activation_view_200_2' } response = self.client.post(self.device_activation_url, data=post_body) logger.debug('test_device_activation_view_200_2 response: ' + str(response.json())) self.assertEqual(200, response.status_code, "Should return 200, device already attached to current user") CustomerDevice.objects.filter(user_id=self.user, device_id=self.user_device).delete() def test_device_list_view_204(self): """ Test case that should return an empty device list :return: """ response = self.client.post(self.device_list_url) self.assertEqual(204, response.status_code, "Should return empty list") def test_device_list_view_200(self): """ Test case that should return at least 1 length device list :return: """ CustomerDevice.objects.create(user_id=self.user, device_id=self.device) response = self.client.post(self.device_list_url) logger.debug('test_device_list_view_200 response: ' + str(response.json())) self.assertEqual(200, response.status_code, "Should return devices list") CustomerDevice.objects.filter(user_id=self.user, device_id=self.user_device).delete() def test_forgot_password_view_400(self): """ Test case when no data provided :return: """ response = self.client.post(self.forgot_password_url) logger.debug('test_forgot_password_view_400 response: ' + str(response.json())) self.assertEqual(400, response.status_code, "Should return 400, since missing data") def test_forgot_password_view_401(self): """ Test case when wrong client secret used :return: """ post_data = { 'client_secret': 'some_non_valid_client_secret', 'email': self.user.email } response = self.client.post(self.forgot_password_url, data=post_data) logger.debug('test_forgot_password_view_401 response: ' + str(response.json())) self.assertEqual(401, response.status_code, "Should return 401, since client secret not exists") def test_forgot_password_view_200_1(self): """ Test case when non existing email requested forgot password :return: """ post_body = { 'client_secret': self.oauth_client_secret, 'email': 'some@not_existing.email', } response = self.client.post(self.forgot_password_url, data=post_body, format='json') self.assertEqual(200, response.status_code, "Should return 200, although email does not exists") def test_forgot_password_view_200_2(self): """ Test case when process should pass successfully :return: """ post_data = { 'client_secret': self.oauth_client_secret, 'email': self.user.email, } response = self.client.post(self.forgot_password_url, data=post_data, format='json') logger.debug('test_forgot_password_view_200_2 response: ' + str(response.json())) self.assertEqual(200, response.status_code, "Should return 200, process completed") def test_get_device_pass_view_400(self): """ Test case when no data received :return: """ response = self.client.post(self.get_device_pass_url) logger.debug('test_get_device_pass_view_400 response: ' + str(response.json())) self.assertEqual(400, response.status_code, "Should return 400, since missing data") def test_get_device_pass_view_204(self): """ Test case when non existing device id received :return: """ post_data = { 'device_id': 'some_non_existing_device_id' } response = self.client.post(self.get_device_pass_url, data=post_data) self.assertEqual(204, response.status_code, "Should return 204, since device id does not exists") def test_get_device_pass_view_409(self): """ Test case when trying to update password for a device that's owned by another user :return: """ # Generate another test user user = User.objects.create_user( email='device@get_pass.test', password=self.password, is_active=True ) # Generate another test device device = Device.objects.create_device(device_id='get_device_pass_test_id', password=self.device_password, model=DeviceModel.objects.get(model=self.device_model), type=DeviceType.objects.get(type=self.device_type)) # Attach just created user and device CustomerDevice.objects.create(user_id=user, device_id=device) post_data = { 'device_id': device.device_id } response = self.client.post(self.get_device_pass_url, data=post_data) self.assertEqual(409, response.status_code, "Should return 409, since device belongs to another user") def test_get_device_pass_view_200(self): """ Test case when process should pass successfully :return: """ CustomerDevice.objects.create(user_id=self.user, device_id=self.device) post_data = { 'device_id': self.device.device_id } response = self.client.post(self.get_device_pass_url, data=post_data) self.assertEqual(200, response.status_code, "Should return 200, process succeeded") def test_remove_device_view_400(self): """ Test case when no data received :return: """ response = self.client.post(self.remove_device_url) logger.debug('test_remove_device_view_400 response: ' + str(response.json())) self.assertEqual(400, response.status_code, "Should return 400, since missing data") def test_remove_device_view_409_200(self): """ Test case when no data received :return: """ # Generate another test device device = Device.objects.create_device(device_id='remove_device_test_id', password=self.device_password, model=DeviceModel.objects.get(model=self.device_model), type=DeviceType.objects.get(type=self.device_type)) post_data = { 'device_id': device.device_id } response = self.client.post(self.remove_device_url, data=post_data) logger.debug('test_remove_device_view_409_200 response: ' + str(response.json())) self.assertEqual(409, response.status_code, "Should return 409, since device is not owned by current user") # Attach just created device to current user CustomerDevice.objects.create(user_id=self.user, device_id=device) response = self.client.post(self.remove_device_url, data=post_data) logger.debug('test_remove_device_view_409_200 response: ' + str(response.json())) self.assertEqual(200, response.status_code, "Should return 200, since device owned by current user") def test_reset_password_view_400(self): """ Test case when no data received :return: """ post_data = { 'current_password': '', 'new_password': self.password } response = self.client.post(self.reset_password_url, data=post_data) logger.debug('test_reset_password_view_400 response: ' + str(response.json())) self.assertEqual(400, response.status_code, "Should return 400, since missing data") def test_reset_password_view_422(self): """ Test case when wrong incorrect password received :return: """ post_data = { 'current_password': 'somE_RandOm_PassWorD', 'new_password': self.password } response = self.client.post(self.reset_password_url, data=post_data) logger.debug('test_reset_password_view_422 response: ' + str(response.json())) self.assertEqual(422, response.status_code, "Should return 422, since current password is incorrect") def test_reset_password_view_200(self): """ Test case when wrong correct password received :return: """ post_data = { 'current_password': self.password, 'new_password': self.password } response = self.client.post(self.reset_password_url, data=post_data) logger.debug('test_reset_password_view_200 response: ' + str(response.json())) self.assertEqual(200, response.status_code, "Should return 200, since current password is correct") def test_update_mqtt_user_pass_view_200(self): """ Test case when pass updates successfully :return: """ response = self.client.post(self.update_device_pass_url) logger.debug('test_update_mqtt_user_pass_view_200 response: ' + str(response.json())) self.assertEqual(200, response.status_code, "Should return 200")
43.587805
117
0.650607
from django.utils.crypto import get_random_string from django.urls import reverse from django.utils import timezone from rest_framework.test import APITestCase from oauth2_provider.models import AccessToken from oauth2_provider.models import Application from nalkinscloud_mosquitto.models import Device, DeviceType, DeviceModel, CustomerDevice from django_user_email_extension.models import User import datetime import logging from nalkinscloud_django.settings import PROJECT_NAME logger = logging.getLogger(PROJECT_NAME) class APIViewsTestCase(APITestCase): def setUp(self): self.oauth_client_id = 'some_client_id' self.oauth_client_secret = 'some_client_secret' self.oauth_client = Application.objects.create(client_id=self.oauth_client_id, client_secret=self.oauth_client_secret) self.email = "test@nalkins.cloud" self.password = "nalkinscloud" self.user = User.objects.create_user( email=self.email, password=self.password, is_active=True ) expires = timezone.now() + datetime.timedelta(seconds=36000) self.access_token = AccessToken.objects.create( user=self.user, application=self.oauth_client, scope='', token=get_random_string(length=32), expires=expires) self.access_token.save() self.device_id = 'api_test_device_id' self.device_password = 'nalkinscloud' self.device_model = 'esp8266' self.device_type = 'dht' self.device = Device.objects.create_device(device_id=self.device_id, password=self.device_password, model=DeviceModel.objects.get(model=self.device_model), type=DeviceType.objects.get(type=self.device_type)) self.user_device_id = self.user.email self.user_device_model = 'application' self.user_device_type = 'user' self.user_device = Device.objects.create_device(device_id=self.user_device_id, password=self.device_password, model=DeviceModel.objects.get(model=self.user_device_model), type=DeviceType.objects.get(type=self.user_device_type)) self.client.credentials(HTTP_AUTHORIZATION='Bearer ' + str(self.access_token)) self.health_check_url = reverse('nalkinscloud_api:health_check') self.registration_url = reverse('nalkinscloud_api:register') self.device_activation_url = reverse('nalkinscloud_api:device_activation') self.device_list_url = reverse('nalkinscloud_api:device_list') self.forgot_password_url = reverse('nalkinscloud_api:forgot_password') self.get_device_pass_url = reverse('nalkinscloud_api:get_device_pass') self.remove_device_url = reverse('nalkinscloud_api:remove_device') self.reset_password_url = reverse('nalkinscloud_api:reset_password') self.update_device_pass_url = reverse('nalkinscloud_api:update_device_pass') def test_registration(self): post_body = { 'client_secret': self.oauth_client_secret, 'email': 'arielev@nalkins.cloud', 'password': self.password, 'first_name': 'Arie', 'last_name': 'Lev' } response = self.client.post(self.registration_url, data=post_body, format='json') logger.debug("test_registration response: " + str(response.json())) self.assertEqual(201, response.status_code, "Should return 201, register new user successfully") response = self.client.post(self.registration_url, data=post_body, format='json') self.assertEqual(409, response.status_code, "Should return 409 conflict, email already exists") post_body['client_secret'] = 'some_non_existing_client_id' response = self.client.post(self.registration_url, data=post_body, format='json') self.assertEqual(401, response.status_code, "Should return not authorized") self.assertEqual(User.objects.count(), 2, "Two users should be present in the system by this point") def test_health_check_view(self): response = self.client.post(self.health_check_url) logger.debug('test_health_check_view response: ' + str(response.json())) self.assertEqual(200, response.status_code, "Should return username") def test_device_activation_view_204(self): post_body = { 'device_id': 'non_existing_device', 'device_name': 'device_activation_test' } response = self.client.post(self.device_activation_url, data=post_body) self.assertEqual(204, response.status_code, "Should return 204 since device does not exists") def test_device_activation_view_400_1(self): response = self.client.post(self.device_activation_url) logger.debug('test_device_activation_view_400_1 response: ' + str(response.json())) self.assertEqual(400, response.status_code, "Should return error 400 since there are missing values") def test_device_activation_view_400_2(self): post_body = { 'device_id': '', 'device_name': 'device_activation_test' } response = self.client.post(self.device_activation_url, data=post_body) logger.debug('test_device_activation_view_400_2 response: ' + str(response.json())) self.assertEqual(400, response.status_code, "Should return 400 since 'device_id' is blank") self.assertEqual(response.json(), {'device_id': ['This field may not be blank.']}, "Should return blank field not allowed") def test_device_activation_view_409(self): user = User.objects.create_user( email='device@activate.test', password=self.password, is_active=True ) device = Device.objects.create_device(device_id='device_activation_test_id', password=self.device_password, model=DeviceModel.objects.get(model=self.device_model), type=DeviceType.objects.get(type=self.device_type)) CustomerDevice.objects.create(user_id=user, device_id=device) post_body = { 'device_id': device, 'device_name': 'device_activation_test' } response = self.client.post(self.device_activation_url, data=post_body) logger.debug('test_device_activation_view_409 response: ' + str(response.json())) self.assertEqual(409, response.status_code, "Should return 409 conflict, device owned by other user") def test_device_activation_view_200_1(self): post_body = { 'device_id': self.device_id, 'device_name': 'device_activation_test' } response = self.client.post(self.device_activation_url, data=post_body) logger.debug('test_device_activation_view_200_1 response: ' + str(response.json())) self.assertEqual(200, response.status_code, "Should return 200, device attached") def test_device_activation_view_200_2(self): CustomerDevice.objects.create(user_id=self.user, device_id=self.device) post_body = { 'device_id': self.device_id, 'device_name': 'test_device_activation_view_200_2' } response = self.client.post(self.device_activation_url, data=post_body) logger.debug('test_device_activation_view_200_2 response: ' + str(response.json())) self.assertEqual(200, response.status_code, "Should return 200, device already attached to current user") CustomerDevice.objects.filter(user_id=self.user, device_id=self.user_device).delete() def test_device_list_view_204(self): response = self.client.post(self.device_list_url) self.assertEqual(204, response.status_code, "Should return empty list") def test_device_list_view_200(self): CustomerDevice.objects.create(user_id=self.user, device_id=self.device) response = self.client.post(self.device_list_url) logger.debug('test_device_list_view_200 response: ' + str(response.json())) self.assertEqual(200, response.status_code, "Should return devices list") CustomerDevice.objects.filter(user_id=self.user, device_id=self.user_device).delete() def test_forgot_password_view_400(self): response = self.client.post(self.forgot_password_url) logger.debug('test_forgot_password_view_400 response: ' + str(response.json())) self.assertEqual(400, response.status_code, "Should return 400, since missing data") def test_forgot_password_view_401(self): post_data = { 'client_secret': 'some_non_valid_client_secret', 'email': self.user.email } response = self.client.post(self.forgot_password_url, data=post_data) logger.debug('test_forgot_password_view_401 response: ' + str(response.json())) self.assertEqual(401, response.status_code, "Should return 401, since client secret not exists") def test_forgot_password_view_200_1(self): post_body = { 'client_secret': self.oauth_client_secret, 'email': 'some@not_existing.email', } response = self.client.post(self.forgot_password_url, data=post_body, format='json') self.assertEqual(200, response.status_code, "Should return 200, although email does not exists") def test_forgot_password_view_200_2(self): post_data = { 'client_secret': self.oauth_client_secret, 'email': self.user.email, } response = self.client.post(self.forgot_password_url, data=post_data, format='json') logger.debug('test_forgot_password_view_200_2 response: ' + str(response.json())) self.assertEqual(200, response.status_code, "Should return 200, process completed") def test_get_device_pass_view_400(self): response = self.client.post(self.get_device_pass_url) logger.debug('test_get_device_pass_view_400 response: ' + str(response.json())) self.assertEqual(400, response.status_code, "Should return 400, since missing data") def test_get_device_pass_view_204(self): post_data = { 'device_id': 'some_non_existing_device_id' } response = self.client.post(self.get_device_pass_url, data=post_data) self.assertEqual(204, response.status_code, "Should return 204, since device id does not exists") def test_get_device_pass_view_409(self): user = User.objects.create_user( email='device@get_pass.test', password=self.password, is_active=True ) device = Device.objects.create_device(device_id='get_device_pass_test_id', password=self.device_password, model=DeviceModel.objects.get(model=self.device_model), type=DeviceType.objects.get(type=self.device_type)) CustomerDevice.objects.create(user_id=user, device_id=device) post_data = { 'device_id': device.device_id } response = self.client.post(self.get_device_pass_url, data=post_data) self.assertEqual(409, response.status_code, "Should return 409, since device belongs to another user") def test_get_device_pass_view_200(self): CustomerDevice.objects.create(user_id=self.user, device_id=self.device) post_data = { 'device_id': self.device.device_id } response = self.client.post(self.get_device_pass_url, data=post_data) self.assertEqual(200, response.status_code, "Should return 200, process succeeded") def test_remove_device_view_400(self): response = self.client.post(self.remove_device_url) logger.debug('test_remove_device_view_400 response: ' + str(response.json())) self.assertEqual(400, response.status_code, "Should return 400, since missing data") def test_remove_device_view_409_200(self): device = Device.objects.create_device(device_id='remove_device_test_id', password=self.device_password, model=DeviceModel.objects.get(model=self.device_model), type=DeviceType.objects.get(type=self.device_type)) post_data = { 'device_id': device.device_id } response = self.client.post(self.remove_device_url, data=post_data) logger.debug('test_remove_device_view_409_200 response: ' + str(response.json())) self.assertEqual(409, response.status_code, "Should return 409, since device is not owned by current user") CustomerDevice.objects.create(user_id=self.user, device_id=device) response = self.client.post(self.remove_device_url, data=post_data) logger.debug('test_remove_device_view_409_200 response: ' + str(response.json())) self.assertEqual(200, response.status_code, "Should return 200, since device owned by current user") def test_reset_password_view_400(self): post_data = { 'current_password': '', 'new_password': self.password } response = self.client.post(self.reset_password_url, data=post_data) logger.debug('test_reset_password_view_400 response: ' + str(response.json())) self.assertEqual(400, response.status_code, "Should return 400, since missing data") def test_reset_password_view_422(self): post_data = { 'current_password': 'somE_RandOm_PassWorD', 'new_password': self.password } response = self.client.post(self.reset_password_url, data=post_data) logger.debug('test_reset_password_view_422 response: ' + str(response.json())) self.assertEqual(422, response.status_code, "Should return 422, since current password is incorrect") def test_reset_password_view_200(self): post_data = { 'current_password': self.password, 'new_password': self.password } response = self.client.post(self.reset_password_url, data=post_data) logger.debug('test_reset_password_view_200 response: ' + str(response.json())) self.assertEqual(200, response.status_code, "Should return 200, since current password is correct") def test_update_mqtt_user_pass_view_200(self): response = self.client.post(self.update_device_pass_url) logger.debug('test_update_mqtt_user_pass_view_200 response: ' + str(response.json())) self.assertEqual(200, response.status_code, "Should return 200")
true
true
f72ba7d3fb86b7009f80264071c2ffe104766198
4,051
py
Python
events/desucon2018/migrations/0001_initial.py
darkismus/kompassi
35dea2c7af2857a69cae5c5982b48f01ba56da1f
[ "CC-BY-3.0" ]
13
2015-11-29T12:19:12.000Z
2021-02-21T15:42:11.000Z
events/desucon2018/migrations/0001_initial.py
darkismus/kompassi
35dea2c7af2857a69cae5c5982b48f01ba56da1f
[ "CC-BY-3.0" ]
23
2015-04-29T19:43:34.000Z
2021-02-10T05:50:17.000Z
events/desucon2018/migrations/0001_initial.py
darkismus/kompassi
35dea2c7af2857a69cae5c5982b48f01ba56da1f
[ "CC-BY-3.0" ]
11
2015-09-20T18:59:00.000Z
2020-02-07T08:47:34.000Z
# -*- coding: utf-8 -*- # Generated by Django 1.10.8 on 2018-01-28 15:36 from django.db import migrations, models import django.db.models.deletion import labour.models.signup_extras class Migration(migrations.Migration): initial = True dependencies = [ ('core', '0029_auto_20170827_1818'), ] operations = [ migrations.CreateModel( name='SignupExtra', fields=[ ('id', models.AutoField(auto_created=True, primary_key=True, serialize=False, verbose_name='ID')), ('is_active', models.BooleanField(default=True)), ('shift_type', models.CharField(choices=[('none', 'Ei väliä'), ('4h', 'Pari pitkää vuoroa'), ('yli4h', 'Useita lyhyitä vuoroja')], help_text='Haluatko tehdä yhden pitkän työvuoron vaiko monta lyhyempää vuoroa?', max_length=15, verbose_name='Toivottu työvuoron pituus')), ('prior_experience', models.TextField(blank=True, help_text='Kerro tässä kentässä, jos sinulla on aiempaa kokemusta vastaavista tehtävistä tai muuta sellaista työkokemusta, josta arvioit olevan hyötyä hakemassasi tehtävässä.', verbose_name='Työkokemus')), ('free_text', models.TextField(blank=True, help_text='Jos haluat sanoa hakemuksesi käsittelijöille jotain sellaista, jolle ei ole omaa kenttää yllä, käytä tätä kenttää. Jos haet valokuvaajaksi, kerro lisäksi millaista kuvauskalustoa sinulla on käytettävissäsi ja listaamuutamia gallerialinkkejä, joista pääsemme ihailemaan ottamiasi kuvia. ', verbose_name='Vapaa alue')), ('special_diet_other', models.TextField(blank=True, help_text='Jos noudatat erikoisruokavaliota, jota ei ole yllä olevassa listassa, ilmoita se tässä. Tapahtuman järjestäjä pyrkii ottamaan erikoisruokavaliot huomioon, mutta kaikkia erikoisruokavalioita ei välttämättä pystytä järjestämään.', verbose_name='Muu erikoisruokavalio')), ('shirt_size', models.CharField(choices=[('NO_SHIRT', 'Ei paitaa'), ('XS', 'XS Unisex'), ('S', 'S Unisex'), ('M', 'M Unisex'), ('L', 'L Unisex'), ('XL', 'XL Unisex'), ('XXL', 'XXL Unisex'), ('3XL', '3XL Unisex'), ('4XL', '4XL Unisex'), ('5XL', '5XL Unisex'), ('LF_XS', 'XS Ladyfit'), ('LF_S', 'S Ladyfit'), ('LF_M', 'M Ladyfit'), ('LF_L', 'L Ladyfit'), ('LF_XL', 'XL Ladyfit')], default='NO_SHIRT', help_text='Ajoissa ilmoittautuneet saavat maksuttoman työvoimapaidan. Kokotaulukot: <a href="http://www.bc-collection.eu/uploads/sizes/TU004.jpg" target="_blank">unisex-paita</a>, <a href="http://www.bc-collection.eu/uploads/sizes/TW040.jpg" target="_blank">ladyfit-paita</a>', max_length=8, verbose_name='Paidan koko')), ('shirt_type', models.CharField(choices=[('STAFF', 'Staff'), ('DESURITY', 'Desurity'), ('KUVAAJA', 'Kuvaaja'), ('VENDOR', 'Myynti'), ('TOOLATE', 'Myöhästyi paitatilauksesta')], default='TOOLATE', max_length=8, verbose_name='Paidan tyyppi')), ('night_work', models.BooleanField(default=False, verbose_name='Olen valmis tekemään yötöitä')), ('event', models.ForeignKey(on_delete=django.db.models.deletion.CASCADE, related_name='desucon2018_signup_extras', to='core.Event')), ('person', models.OneToOneField(on_delete=django.db.models.deletion.CASCADE, related_name='desucon2018_signup_extra', to='core.Person')), ], options={ 'abstract': False, }, bases=(labour.models.signup_extras.SignupExtraMixin, models.Model), ), migrations.CreateModel( name='SpecialDiet', fields=[ ('id', models.AutoField(auto_created=True, primary_key=True, serialize=False, verbose_name='ID')), ('name', models.CharField(max_length=63)), ], ), migrations.AddField( model_name='signupextra', name='special_diet', field=models.ManyToManyField(blank=True, related_name='_signupextra_special_diet_+', to='desucon2018.SpecialDiet', verbose_name='Erikoisruokavalio'), ), ]
81.02
736
0.671933
from django.db import migrations, models import django.db.models.deletion import labour.models.signup_extras class Migration(migrations.Migration): initial = True dependencies = [ ('core', '0029_auto_20170827_1818'), ] operations = [ migrations.CreateModel( name='SignupExtra', fields=[ ('id', models.AutoField(auto_created=True, primary_key=True, serialize=False, verbose_name='ID')), ('is_active', models.BooleanField(default=True)), ('shift_type', models.CharField(choices=[('none', 'Ei väliä'), ('4h', 'Pari pitkää vuoroa'), ('yli4h', 'Useita lyhyitä vuoroja')], help_text='Haluatko tehdä yhden pitkän työvuoron vaiko monta lyhyempää vuoroa?', max_length=15, verbose_name='Toivottu työvuoron pituus')), ('prior_experience', models.TextField(blank=True, help_text='Kerro tässä kentässä, jos sinulla on aiempaa kokemusta vastaavista tehtävistä tai muuta sellaista työkokemusta, josta arvioit olevan hyötyä hakemassasi tehtävässä.', verbose_name='Työkokemus')), ('free_text', models.TextField(blank=True, help_text='Jos haluat sanoa hakemuksesi käsittelijöille jotain sellaista, jolle ei ole omaa kenttää yllä, käytä tätä kenttää. Jos haet valokuvaajaksi, kerro lisäksi millaista kuvauskalustoa sinulla on käytettävissäsi ja listaamuutamia gallerialinkkejä, joista pääsemme ihailemaan ottamiasi kuvia. ', verbose_name='Vapaa alue')), ('special_diet_other', models.TextField(blank=True, help_text='Jos noudatat erikoisruokavaliota, jota ei ole yllä olevassa listassa, ilmoita se tässä. Tapahtuman järjestäjä pyrkii ottamaan erikoisruokavaliot huomioon, mutta kaikkia erikoisruokavalioita ei välttämättä pystytä järjestämään.', verbose_name='Muu erikoisruokavalio')), ('shirt_size', models.CharField(choices=[('NO_SHIRT', 'Ei paitaa'), ('XS', 'XS Unisex'), ('S', 'S Unisex'), ('M', 'M Unisex'), ('L', 'L Unisex'), ('XL', 'XL Unisex'), ('XXL', 'XXL Unisex'), ('3XL', '3XL Unisex'), ('4XL', '4XL Unisex'), ('5XL', '5XL Unisex'), ('LF_XS', 'XS Ladyfit'), ('LF_S', 'S Ladyfit'), ('LF_M', 'M Ladyfit'), ('LF_L', 'L Ladyfit'), ('LF_XL', 'XL Ladyfit')], default='NO_SHIRT', help_text='Ajoissa ilmoittautuneet saavat maksuttoman työvoimapaidan. Kokotaulukot: <a href="http://www.bc-collection.eu/uploads/sizes/TU004.jpg" target="_blank">unisex-paita</a>, <a href="http://www.bc-collection.eu/uploads/sizes/TW040.jpg" target="_blank">ladyfit-paita</a>', max_length=8, verbose_name='Paidan koko')), ('shirt_type', models.CharField(choices=[('STAFF', 'Staff'), ('DESURITY', 'Desurity'), ('KUVAAJA', 'Kuvaaja'), ('VENDOR', 'Myynti'), ('TOOLATE', 'Myöhästyi paitatilauksesta')], default='TOOLATE', max_length=8, verbose_name='Paidan tyyppi')), ('night_work', models.BooleanField(default=False, verbose_name='Olen valmis tekemään yötöitä')), ('event', models.ForeignKey(on_delete=django.db.models.deletion.CASCADE, related_name='desucon2018_signup_extras', to='core.Event')), ('person', models.OneToOneField(on_delete=django.db.models.deletion.CASCADE, related_name='desucon2018_signup_extra', to='core.Person')), ], options={ 'abstract': False, }, bases=(labour.models.signup_extras.SignupExtraMixin, models.Model), ), migrations.CreateModel( name='SpecialDiet', fields=[ ('id', models.AutoField(auto_created=True, primary_key=True, serialize=False, verbose_name='ID')), ('name', models.CharField(max_length=63)), ], ), migrations.AddField( model_name='signupextra', name='special_diet', field=models.ManyToManyField(blank=True, related_name='_signupextra_special_diet_+', to='desucon2018.SpecialDiet', verbose_name='Erikoisruokavalio'), ), ]
true
true
f72ba8a9a4446d79a62e8b823b38942abbb5f5f3
232
py
Python
my_awesome_project/users/serializers.py
mikejuliano/drf-react-native
71d40dd168407096e213157c0141588d474ae3d0
[ "MIT" ]
null
null
null
my_awesome_project/users/serializers.py
mikejuliano/drf-react-native
71d40dd168407096e213157c0141588d474ae3d0
[ "MIT" ]
null
null
null
my_awesome_project/users/serializers.py
mikejuliano/drf-react-native
71d40dd168407096e213157c0141588d474ae3d0
[ "MIT" ]
null
null
null
from rest_framework import serializers # from django.contrib.auth.models import User from .models import User class UserSerializer(serializers.ModelSerializer): class Meta: model = User fields = ('username',)
21.090909
50
0.728448
from rest_framework import serializers from .models import User class UserSerializer(serializers.ModelSerializer): class Meta: model = User fields = ('username',)
true
true
f72ba8c520fc112f474edccb7228fd1f7e57e095
5,326
py
Python
PythonAPI/carissma_project/lib/python3.5/site-packages/matplotlib/tri/tripcolor.py
AbdulHoffmann/carla_carissma
8d382769ffa02a6c61a22c57160285505f5ff0a4
[ "MIT" ]
445
2019-01-26T13:50:26.000Z
2022-03-18T05:17:38.000Z
venv/lib/python3.7/site-packages/matplotlib/tri/tripcolor.py
John1001Song/Big-Data-Robo-Adviser
9444dce96954c546333d5aecc92a06c3bfd19aa5
[ "MIT" ]
242
2019-01-29T15:48:27.000Z
2022-03-31T22:09:21.000Z
venv/lib/python3.7/site-packages/matplotlib/tri/tripcolor.py
John1001Song/Big-Data-Robo-Adviser
9444dce96954c546333d5aecc92a06c3bfd19aa5
[ "MIT" ]
64
2018-04-25T08:51:57.000Z
2022-01-29T14:13:57.000Z
import numpy as np from matplotlib.collections import PolyCollection, TriMesh from matplotlib.colors import Normalize from matplotlib.tri.triangulation import Triangulation def tripcolor(ax, *args, alpha=1.0, norm=None, cmap=None, vmin=None, vmax=None, shading='flat', facecolors=None, **kwargs): """ Create a pseudocolor plot of an unstructured triangular grid. The triangulation can be specified in one of two ways; either:: tripcolor(triangulation, ...) where triangulation is a :class:`matplotlib.tri.Triangulation` object, or :: tripcolor(x, y, ...) tripcolor(x, y, triangles, ...) tripcolor(x, y, triangles=triangles, ...) tripcolor(x, y, mask=mask, ...) tripcolor(x, y, triangles, mask=mask, ...) in which case a Triangulation object will be created. See :class:`~matplotlib.tri.Triangulation` for a explanation of these possibilities. The next argument must be *C*, the array of color values, either one per point in the triangulation if color values are defined at points, or one per triangle in the triangulation if color values are defined at triangles. If there are the same number of points and triangles in the triangulation it is assumed that color values are defined at points; to force the use of color values at triangles use the kwarg ``facecolors=C`` instead of just ``C``. *shading* may be 'flat' (the default) or 'gouraud'. If *shading* is 'flat' and C values are defined at points, the color values used for each triangle are from the mean C of the triangle's three points. If *shading* is 'gouraud' then color values must be defined at points. The remaining kwargs are the same as for :meth:`~matplotlib.axes.Axes.pcolor`. """ if shading not in ['flat', 'gouraud']: raise ValueError("shading must be one of ['flat', 'gouraud'] " "not {0}".format(shading)) tri, args, kwargs = Triangulation.get_from_args_and_kwargs(*args, **kwargs) # C is the colors array defined at either points or faces (i.e. triangles). # If facecolors is None, C are defined at points. # If facecolors is not None, C are defined at faces. if facecolors is not None: C = facecolors else: C = np.asarray(args[0]) # If there are a different number of points and triangles in the # triangulation, can omit facecolors kwarg as it is obvious from # length of C whether it refers to points or faces. # Do not do this for gouraud shading. if (facecolors is None and len(C) == len(tri.triangles) and len(C) != len(tri.x) and shading != 'gouraud'): facecolors = C # Check length of C is OK. if ((facecolors is None and len(C) != len(tri.x)) or (facecolors is not None and len(C) != len(tri.triangles))): raise ValueError('Length of color values array must be the same ' 'as either the number of triangulation points ' 'or triangles') # Handling of linewidths, shading, edgecolors and antialiased as # in Axes.pcolor linewidths = (0.25,) if 'linewidth' in kwargs: kwargs['linewidths'] = kwargs.pop('linewidth') kwargs.setdefault('linewidths', linewidths) edgecolors = 'none' if 'edgecolor' in kwargs: kwargs['edgecolors'] = kwargs.pop('edgecolor') ec = kwargs.setdefault('edgecolors', edgecolors) if 'antialiased' in kwargs: kwargs['antialiaseds'] = kwargs.pop('antialiased') if 'antialiaseds' not in kwargs and ec.lower() == "none": kwargs['antialiaseds'] = False if shading == 'gouraud': if facecolors is not None: raise ValueError('Gouraud shading does not support the use ' 'of facecolors kwarg') if len(C) != len(tri.x): raise ValueError('For gouraud shading, the length of color ' 'values array must be the same as the ' 'number of triangulation points') collection = TriMesh(tri, **kwargs) else: # Vertices of triangles. maskedTris = tri.get_masked_triangles() verts = np.stack((tri.x[maskedTris], tri.y[maskedTris]), axis=-1) # Color values. if facecolors is None: # One color per triangle, the mean of the 3 vertex color values. C = C[maskedTris].mean(axis=1) elif tri.mask is not None: # Remove color values of masked triangles. C = C.compress(1-tri.mask) collection = PolyCollection(verts, **kwargs) collection.set_alpha(alpha) collection.set_array(C) if norm is not None and not isinstance(norm, Normalize): raise ValueError("'norm' must be an instance of 'Normalize'") collection.set_cmap(cmap) collection.set_norm(norm) if vmin is not None or vmax is not None: collection.set_clim(vmin, vmax) else: collection.autoscale_None() ax.grid(False) minx = tri.x.min() maxx = tri.x.max() miny = tri.y.min() maxy = tri.y.max() corners = (minx, miny), (maxx, maxy) ax.update_datalim(corners) ax.autoscale_view() ax.add_collection(collection) return collection
38.042857
79
0.639504
import numpy as np from matplotlib.collections import PolyCollection, TriMesh from matplotlib.colors import Normalize from matplotlib.tri.triangulation import Triangulation def tripcolor(ax, *args, alpha=1.0, norm=None, cmap=None, vmin=None, vmax=None, shading='flat', facecolors=None, **kwargs): if shading not in ['flat', 'gouraud']: raise ValueError("shading must be one of ['flat', 'gouraud'] " "not {0}".format(shading)) tri, args, kwargs = Triangulation.get_from_args_and_kwargs(*args, **kwargs) if facecolors is not None: C = facecolors else: C = np.asarray(args[0]) if (facecolors is None and len(C) == len(tri.triangles) and len(C) != len(tri.x) and shading != 'gouraud'): facecolors = C if ((facecolors is None and len(C) != len(tri.x)) or (facecolors is not None and len(C) != len(tri.triangles))): raise ValueError('Length of color values array must be the same ' 'as either the number of triangulation points ' 'or triangles') linewidths = (0.25,) if 'linewidth' in kwargs: kwargs['linewidths'] = kwargs.pop('linewidth') kwargs.setdefault('linewidths', linewidths) edgecolors = 'none' if 'edgecolor' in kwargs: kwargs['edgecolors'] = kwargs.pop('edgecolor') ec = kwargs.setdefault('edgecolors', edgecolors) if 'antialiased' in kwargs: kwargs['antialiaseds'] = kwargs.pop('antialiased') if 'antialiaseds' not in kwargs and ec.lower() == "none": kwargs['antialiaseds'] = False if shading == 'gouraud': if facecolors is not None: raise ValueError('Gouraud shading does not support the use ' 'of facecolors kwarg') if len(C) != len(tri.x): raise ValueError('For gouraud shading, the length of color ' 'values array must be the same as the ' 'number of triangulation points') collection = TriMesh(tri, **kwargs) else: maskedTris = tri.get_masked_triangles() verts = np.stack((tri.x[maskedTris], tri.y[maskedTris]), axis=-1) if facecolors is None: C = C[maskedTris].mean(axis=1) elif tri.mask is not None: C = C.compress(1-tri.mask) collection = PolyCollection(verts, **kwargs) collection.set_alpha(alpha) collection.set_array(C) if norm is not None and not isinstance(norm, Normalize): raise ValueError("'norm' must be an instance of 'Normalize'") collection.set_cmap(cmap) collection.set_norm(norm) if vmin is not None or vmax is not None: collection.set_clim(vmin, vmax) else: collection.autoscale_None() ax.grid(False) minx = tri.x.min() maxx = tri.x.max() miny = tri.y.min() maxy = tri.y.max() corners = (minx, miny), (maxx, maxy) ax.update_datalim(corners) ax.autoscale_view() ax.add_collection(collection) return collection
true
true
f72ba8feede17a2888058de31640869ebe5db2d9
1,794
py
Python
app/features/steps/value_propagation_test.py
muglyon/https-github.com-muglyon-DCOP-Decentralised-Control-of-Intelligent-Devices
68cb868a0875f5e119ac0dbea024c17d241347ac
[ "MIT" ]
3
2020-04-10T09:13:17.000Z
2021-04-08T07:14:03.000Z
app/features/steps/value_propagation_test.py
muglyon/https-github.com-muglyon-DCOP-Decentralised-Control-of-Intelligent-Devices
68cb868a0875f5e119ac0dbea024c17d241347ac
[ "MIT" ]
8
2020-09-26T00:55:30.000Z
2022-01-13T02:32:04.000Z
app/features/steps/value_propagation_test.py
muglyon/https-github.com-muglyon-DCOP-Decentralised-Control-of-Intelligent-Devices
68cb868a0875f5e119ac0dbea024c17d241347ac
[ "MIT" ]
2
2020-04-12T10:08:15.000Z
2022-01-20T09:34:50.000Z
#! python3 # value_propagation_test.py - Test the VALUE Propagation behavior from behave import * from hamcrest import * import numpy @when('get VALUE from parent after UTIL propagation') def step_impl(context): set_up(context) context.dpop_to_test.util_manager.JOIN = context.util_matrix @then('should select the optimal assignment') def step_impl(context): index = context.dpop_to_test.value_manager.get_index_of_best_value_with( context.data, context.dpop_to_test.util_manager.matrix_dimensions_order, context.dpop_to_test.util_manager.JOIN ) assert_that(index, equal_to(2)) @when('parent send values to wrong format') def step_impl(context): set_up(context) context.data = 'wrong format' @when('matrix is Null') def step_impl(context): set_up(context) context.util_matrix = None @then('should raise an exception') def step_impl(context): assert_that(calling(context.dpop_to_test.value_manager.get_index_of_best_value_with) .with_args(context.data, context.util_matrix), raises(Exception)) @when('matrix has 1 dimension') def step_impl(context): set_up(context) context.dpop_to_test.util_manager.JOIN = numpy.asmatrix([[1], [0], [1]]) @then('should return the min value index') def step_impl(context): index = context.dpop_to_test.value_manager.get_index_of_best_value_with( context.data, context.dpop_to_test.util_manager.matrix_dimensions_order, context.dpop_to_test.util_manager.JOIN ) assert_that(index, equal_to(1)) ### # Privates Methods ### def set_up(context): context.dpop_to_test.util_manager.matrix_dimensions_order = [1] context.util_matrix = numpy.arange(start=11, stop=2, step=-1).reshape(3, 3) context.data = {"1": 1}
26.382353
88
0.731884
from behave import * from hamcrest import * import numpy @when('get VALUE from parent after UTIL propagation') def step_impl(context): set_up(context) context.dpop_to_test.util_manager.JOIN = context.util_matrix @then('should select the optimal assignment') def step_impl(context): index = context.dpop_to_test.value_manager.get_index_of_best_value_with( context.data, context.dpop_to_test.util_manager.matrix_dimensions_order, context.dpop_to_test.util_manager.JOIN ) assert_that(index, equal_to(2)) @when('parent send values to wrong format') def step_impl(context): set_up(context) context.data = 'wrong format' @when('matrix is Null') def step_impl(context): set_up(context) context.util_matrix = None @then('should raise an exception') def step_impl(context): assert_that(calling(context.dpop_to_test.value_manager.get_index_of_best_value_with) .with_args(context.data, context.util_matrix), raises(Exception)) @when('matrix has 1 dimension') def step_impl(context): set_up(context) context.dpop_to_test.util_manager.JOIN = numpy.asmatrix([[1], [0], [1]]) @then('should return the min value index') def step_impl(context): index = context.dpop_to_test.value_manager.get_index_of_best_value_with( context.data, context.dpop_to_test.util_manager.matrix_dimensions_order, context.dpop_to_test.util_manager.JOIN ) assert_that(index, equal_to(1)) ef set_up(context): context.dpop_to_test.util_manager.matrix_dimensions_order = [1] context.util_matrix = numpy.arange(start=11, stop=2, step=-1).reshape(3, 3) context.data = {"1": 1}
true
true
f72baab36e3a21c7ba43e643724c016ec8ee0837
8,858
py
Python
cinder/openstack/common/config/generator.py
sombrafam/cinder
60ffb0eedf41b56f3c6af5b301400ced95762194
[ "Apache-2.0" ]
null
null
null
cinder/openstack/common/config/generator.py
sombrafam/cinder
60ffb0eedf41b56f3c6af5b301400ced95762194
[ "Apache-2.0" ]
null
null
null
cinder/openstack/common/config/generator.py
sombrafam/cinder
60ffb0eedf41b56f3c6af5b301400ced95762194
[ "Apache-2.0" ]
null
null
null
# Copyright 2012 SINA Corporation # All Rights Reserved. # # Licensed under the Apache License, Version 2.0 (the "License"); you may # not use this file except in compliance with the License. You may obtain # a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, WITHOUT # WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the # License for the specific language governing permissions and limitations # under the License. # """Extracts OpenStack config option info from module(s).""" from __future__ import print_function import imp import os import re import socket import sys import textwrap from oslo.config import cfg import six from cinder.openstack.common import gettextutils from cinder.openstack.common import importutils gettextutils.install('cinder') STROPT = "StrOpt" BOOLOPT = "BoolOpt" INTOPT = "IntOpt" FLOATOPT = "FloatOpt" LISTOPT = "ListOpt" MULTISTROPT = "MultiStrOpt" OPT_TYPES = { STROPT: 'string value', BOOLOPT: 'boolean value', INTOPT: 'integer value', FLOATOPT: 'floating point value', LISTOPT: 'list value', MULTISTROPT: 'multi valued', } OPTION_REGEX = re.compile(r"(%s)" % "|".join([STROPT, BOOLOPT, INTOPT, FLOATOPT, LISTOPT, MULTISTROPT])) PY_EXT = ".py" BASEDIR = os.path.abspath(os.path.join(os.path.dirname(__file__), "../../../../")) WORDWRAP_WIDTH = 60 def generate(srcfiles): mods_by_pkg = dict() for filepath in srcfiles: pkg_name = filepath.split(os.sep)[1] mod_str = '.'.join(['.'.join(filepath.split(os.sep)[:-1]), os.path.basename(filepath).split('.')[0]]) mods_by_pkg.setdefault(pkg_name, list()).append(mod_str) # NOTE(lzyeval): place top level modules before packages pkg_names = filter(lambda x: x.endswith(PY_EXT), mods_by_pkg.keys()) pkg_names.sort() ext_names = filter(lambda x: x not in pkg_names, mods_by_pkg.keys()) ext_names.sort() pkg_names.extend(ext_names) # opts_by_group is a mapping of group name to an options list # The options list is a list of (module, options) tuples opts_by_group = {'DEFAULT': []} extra_modules = os.getenv("OSLO_CONFIG_GENERATOR_EXTRA_MODULES", "") if extra_modules: for module_name in extra_modules.split(','): module_name = module_name.strip() module = _import_module(module_name) if module: for group, opts in _list_opts(module): opts_by_group.setdefault(group, []).append((module_name, opts)) for pkg_name in pkg_names: mods = mods_by_pkg.get(pkg_name) mods.sort() for mod_str in mods: if mod_str.endswith('.__init__'): mod_str = mod_str[:mod_str.rfind(".")] mod_obj = _import_module(mod_str) if not mod_obj: raise RuntimeError("Unable to import module %s" % mod_str) for group, opts in _list_opts(mod_obj): opts_by_group.setdefault(group, []).append((mod_str, opts)) print_group_opts('DEFAULT', opts_by_group.pop('DEFAULT', [])) for group, opts in opts_by_group.items(): print_group_opts(group, opts) def _import_module(mod_str): try: if mod_str.startswith('bin.'): imp.load_source(mod_str[4:], os.path.join('bin', mod_str[4:])) return sys.modules[mod_str[4:]] else: return importutils.import_module(mod_str) except Exception as e: sys.stderr.write("Error importing module %s: %s\n" % (mod_str, str(e))) return None def _is_in_group(opt, group): "Check if opt is in group." for key, value in group._opts.items(): if value['opt'] == opt: return True return False def _guess_groups(opt, mod_obj): # is it in the DEFAULT group? if _is_in_group(opt, cfg.CONF): return 'DEFAULT' # what other groups is it in? for key, value in cfg.CONF.items(): if isinstance(value, cfg.CONF.GroupAttr): if _is_in_group(opt, value._group): return value._group.name raise RuntimeError( "Unable to find group for option %s, " "maybe it's defined twice in the same group?" % opt.name ) def _list_opts(obj): def is_opt(o): return (isinstance(o, cfg.Opt) and not isinstance(o, cfg.SubCommandOpt)) opts = list() for attr_str in dir(obj): attr_obj = getattr(obj, attr_str) if is_opt(attr_obj): opts.append(attr_obj) elif (isinstance(attr_obj, list) and all(map(lambda x: is_opt(x), attr_obj))): opts.extend(attr_obj) ret = {} for opt in opts: ret.setdefault(_guess_groups(opt, obj), []).append(opt) return ret.items() def print_group_opts(group, opts_by_module): print("[%s]" % group) print('') for mod, opts in opts_by_module: print('#') print('# Options defined in %s' % mod) print('#') print('') for opt in opts: _print_opt(opt) print('') def _get_my_ip(): try: csock = socket.socket(socket.AF_INET, socket.SOCK_DGRAM) csock.connect(('8.8.8.8', 80)) (addr, port) = csock.getsockname() csock.close() return addr except socket.error: return None def _sanitize_default(name, value): """Set up a reasonably sensible default for pybasedir, my_ip and host.""" if value.startswith(sys.prefix): # NOTE(jd) Don't use os.path.join, because it is likely to think the # second part is an absolute pathname and therefore drop the first # part. value = os.path.normpath("/usr/" + value[len(sys.prefix):]) elif value.startswith(BASEDIR): return value.replace(BASEDIR, '/usr/lib/python/site-packages') elif BASEDIR in value: return value.replace(BASEDIR, '') elif value == _get_my_ip(): return '10.0.0.1' elif value == socket.gethostname() and 'host' in name: return 'cinder' elif value.strip() != value: return '"%s"' % value return value def _print_opt(opt): opt_name, opt_default, opt_help = opt.dest, opt.default, opt.help if not opt_help: sys.stderr.write('WARNING: "%s" is missing help string.\n' % opt_name) opt_help = "" opt_type = None try: opt_type = OPTION_REGEX.search(str(type(opt))).group(0) except (ValueError, AttributeError) as err: sys.stderr.write("%s\n" % str(err)) sys.exit(1) opt_help += ' (' + OPT_TYPES[opt_type] + ')' print('#', "\n# ".join(textwrap.wrap(opt_help, WORDWRAP_WIDTH))) if opt.deprecated_opts: for deprecated_opt in opt.deprecated_opts: if deprecated_opt.name: deprecated_group = (deprecated_opt.group if deprecated_opt.group else "DEFAULT") print('# Deprecated group/name - [%s]/%s' % (deprecated_group, deprecated_opt.name)) try: if opt_default is None: print('#%s=<None>' % opt_name) elif opt_type == STROPT: assert(isinstance(opt_default, six.string_types)) print('#%s=%s' % (opt_name, _sanitize_default(opt_name, opt_default))) elif opt_type == BOOLOPT: assert(isinstance(opt_default, bool)) print('#%s=%s' % (opt_name, str(opt_default).lower())) elif opt_type == INTOPT: assert(isinstance(opt_default, int) and not isinstance(opt_default, bool)) print('#%s=%s' % (opt_name, opt_default)) elif opt_type == FLOATOPT: assert(isinstance(opt_default, float)) print('#%s=%s' % (opt_name, opt_default)) elif opt_type == LISTOPT: assert(isinstance(opt_default, list)) print('#%s=%s' % (opt_name, ','.join(opt_default))) elif opt_type == MULTISTROPT: assert(isinstance(opt_default, list)) if not opt_default: opt_default = [''] for default in opt_default: print('#%s=%s' % (opt_name, default)) print('') except Exception: sys.stderr.write('Error in option "%s"\n' % opt_name) sys.exit(1) def main(): generate(sys.argv[1:]) if __name__ == '__main__': main()
32.929368
79
0.593362
from __future__ import print_function import imp import os import re import socket import sys import textwrap from oslo.config import cfg import six from cinder.openstack.common import gettextutils from cinder.openstack.common import importutils gettextutils.install('cinder') STROPT = "StrOpt" BOOLOPT = "BoolOpt" INTOPT = "IntOpt" FLOATOPT = "FloatOpt" LISTOPT = "ListOpt" MULTISTROPT = "MultiStrOpt" OPT_TYPES = { STROPT: 'string value', BOOLOPT: 'boolean value', INTOPT: 'integer value', FLOATOPT: 'floating point value', LISTOPT: 'list value', MULTISTROPT: 'multi valued', } OPTION_REGEX = re.compile(r"(%s)" % "|".join([STROPT, BOOLOPT, INTOPT, FLOATOPT, LISTOPT, MULTISTROPT])) PY_EXT = ".py" BASEDIR = os.path.abspath(os.path.join(os.path.dirname(__file__), "../../../../")) WORDWRAP_WIDTH = 60 def generate(srcfiles): mods_by_pkg = dict() for filepath in srcfiles: pkg_name = filepath.split(os.sep)[1] mod_str = '.'.join(['.'.join(filepath.split(os.sep)[:-1]), os.path.basename(filepath).split('.')[0]]) mods_by_pkg.setdefault(pkg_name, list()).append(mod_str) pkg_names = filter(lambda x: x.endswith(PY_EXT), mods_by_pkg.keys()) pkg_names.sort() ext_names = filter(lambda x: x not in pkg_names, mods_by_pkg.keys()) ext_names.sort() pkg_names.extend(ext_names) opts_by_group = {'DEFAULT': []} extra_modules = os.getenv("OSLO_CONFIG_GENERATOR_EXTRA_MODULES", "") if extra_modules: for module_name in extra_modules.split(','): module_name = module_name.strip() module = _import_module(module_name) if module: for group, opts in _list_opts(module): opts_by_group.setdefault(group, []).append((module_name, opts)) for pkg_name in pkg_names: mods = mods_by_pkg.get(pkg_name) mods.sort() for mod_str in mods: if mod_str.endswith('.__init__'): mod_str = mod_str[:mod_str.rfind(".")] mod_obj = _import_module(mod_str) if not mod_obj: raise RuntimeError("Unable to import module %s" % mod_str) for group, opts in _list_opts(mod_obj): opts_by_group.setdefault(group, []).append((mod_str, opts)) print_group_opts('DEFAULT', opts_by_group.pop('DEFAULT', [])) for group, opts in opts_by_group.items(): print_group_opts(group, opts) def _import_module(mod_str): try: if mod_str.startswith('bin.'): imp.load_source(mod_str[4:], os.path.join('bin', mod_str[4:])) return sys.modules[mod_str[4:]] else: return importutils.import_module(mod_str) except Exception as e: sys.stderr.write("Error importing module %s: %s\n" % (mod_str, str(e))) return None def _is_in_group(opt, group): for key, value in group._opts.items(): if value['opt'] == opt: return True return False def _guess_groups(opt, mod_obj): if _is_in_group(opt, cfg.CONF): return 'DEFAULT' for key, value in cfg.CONF.items(): if isinstance(value, cfg.CONF.GroupAttr): if _is_in_group(opt, value._group): return value._group.name raise RuntimeError( "Unable to find group for option %s, " "maybe it's defined twice in the same group?" % opt.name ) def _list_opts(obj): def is_opt(o): return (isinstance(o, cfg.Opt) and not isinstance(o, cfg.SubCommandOpt)) opts = list() for attr_str in dir(obj): attr_obj = getattr(obj, attr_str) if is_opt(attr_obj): opts.append(attr_obj) elif (isinstance(attr_obj, list) and all(map(lambda x: is_opt(x), attr_obj))): opts.extend(attr_obj) ret = {} for opt in opts: ret.setdefault(_guess_groups(opt, obj), []).append(opt) return ret.items() def print_group_opts(group, opts_by_module): print("[%s]" % group) print('') for mod, opts in opts_by_module: print(' print(' print(' print('') for opt in opts: _print_opt(opt) print('') def _get_my_ip(): try: csock = socket.socket(socket.AF_INET, socket.SOCK_DGRAM) csock.connect(('8.8.8.8', 80)) (addr, port) = csock.getsockname() csock.close() return addr except socket.error: return None def _sanitize_default(name, value): if value.startswith(sys.prefix): # NOTE(jd) Don't use os.path.join, because it is likely to think the value = os.path.normpath("/usr/" + value[len(sys.prefix):]) elif value.startswith(BASEDIR): return value.replace(BASEDIR, '/usr/lib/python/site-packages') elif BASEDIR in value: return value.replace(BASEDIR, '') elif value == _get_my_ip(): return '10.0.0.1' elif value == socket.gethostname() and 'host' in name: return 'cinder' elif value.strip() != value: return '"%s"' % value return value def _print_opt(opt): opt_name, opt_default, opt_help = opt.dest, opt.default, opt.help if not opt_help: sys.stderr.write('WARNING: "%s" is missing help string.\n' % opt_name) opt_help = "" opt_type = None try: opt_type = OPTION_REGEX.search(str(type(opt))).group(0) except (ValueError, AttributeError) as err: sys.stderr.write("%s\n" % str(err)) sys.exit(1) opt_help += ' (' + OPT_TYPES[opt_type] + ')' print('#', "\n# ".join(textwrap.wrap(opt_help, WORDWRAP_WIDTH))) if opt.deprecated_opts: for deprecated_opt in opt.deprecated_opts: if deprecated_opt.name: deprecated_group = (deprecated_opt.group if deprecated_opt.group else "DEFAULT") print('# Deprecated group/name - [%s]/%s' % (deprecated_group, deprecated_opt.name)) try: if opt_default is None: print('#%s=<None>' % opt_name) elif opt_type == STROPT: assert(isinstance(opt_default, six.string_types)) print('#%s=%s' % (opt_name, _sanitize_default(opt_name, opt_default))) elif opt_type == BOOLOPT: assert(isinstance(opt_default, bool)) print('#%s=%s' % (opt_name, str(opt_default).lower())) elif opt_type == INTOPT: assert(isinstance(opt_default, int) and not isinstance(opt_default, bool)) print('#%s=%s' % (opt_name, opt_default)) elif opt_type == FLOATOPT: assert(isinstance(opt_default, float)) print('#%s=%s' % (opt_name, opt_default)) elif opt_type == LISTOPT: assert(isinstance(opt_default, list)) print('#%s=%s' % (opt_name, ','.join(opt_default))) elif opt_type == MULTISTROPT: assert(isinstance(opt_default, list)) if not opt_default: opt_default = [''] for default in opt_default: print('#%s=%s' % (opt_name, default)) print('') except Exception: sys.stderr.write('Error in option "%s"\n' % opt_name) sys.exit(1) def main(): generate(sys.argv[1:]) if __name__ == '__main__': main()
true
true
f72bab7ab1bca3789121e05f9da664664eeab617
3,732
py
Python
GitHubUploader.py
ytyaru/GitHub.Uploader.AddFunction.Contributions.201705141424
06e44308b0eb132f0ce1e547cedc6b0f6e566c93
[ "CC0-1.0" ]
null
null
null
GitHubUploader.py
ytyaru/GitHub.Uploader.AddFunction.Contributions.201705141424
06e44308b0eb132f0ce1e547cedc6b0f6e566c93
[ "CC0-1.0" ]
null
null
null
GitHubUploader.py
ytyaru/GitHub.Uploader.AddFunction.Contributions.201705141424
06e44308b0eb132f0ce1e547cedc6b0f6e566c93
[ "CC0-1.0" ]
null
null
null
#!/usr/bin/python3 #!python3 #encoding:utf-8 import sys import os.path import subprocess import configparser import argparse import web.service.github.api.v3.AuthenticationsCreator import web.service.github.api.v3.AuthenticationData #import web.service.github.api.v3.CurrentUser import web.service.github.api.v3.CurrentRepository import web.service.github.api.v3.Client import database.src.Database import cui.uploader.Main import web.log.Log import database.src.contributions.Main class Main: def __init__(self): pass def Run(self): parser = argparse.ArgumentParser( description='GitHub Repository Uploader.', ) parser.add_argument('path_dir_pj') parser.add_argument('-u', '--username') parser.add_argument('-d', '--description') parser.add_argument('-l', '--homepage', '--link', '--url') args = parser.parse_args() # print(args) # print('path_dir_pj: {0}'.format(args.path_dir_pj)) # print('-u: {0}'.format(args.username)) # print('-d: {0}'.format(args.description)) # print('-l: {0}'.format(args.homepage)) config = configparser.ConfigParser() config.read(os.path.join(os.path.abspath(os.path.dirname(__file__)), 'config.ini')) # path_dir_db = os.path.abspath(config['Path']['DB']) # 相対パスなら if config['Path']['DB'].startswith('./'): # python起動パスでなく、このファイルをrootとする path_dir_db = os.path.join(os.path.abspath(os.path.dirname(__file__)), config['Path']['DB'][2:]) else: path_dir_db = os.path.abspath(config['Path']['DB']) # print(path_dir_db) web.log.Log.Log().Logger.debug(path_dir_db) if None is args.username: args.username = config['GitHub']['User'] # print('default-username: {0}'.format(args.username)) # print(os.path.join(path_dir_db, 'GitHub.Accounts.sqlite3')) # print(os.path.join(path_dir_db, 'GitHub.Repositories.{0}.sqlite3'.format(args.username))) # self.__db = database.src.Database.Database() self.__db = database.src.Database.Database(os.path.abspath(os.path.dirname(__file__))) self.__db.Initialize() if None is self.__db.Accounts['Accounts'].find_one(Username=args.username): # print('指定したユーザ {0} はDBに存在しません。GitHubUserRegister.pyで登録してください。') web.log.Log.Log().Logger.warning('指定したユーザ {0} はDBに存在しません。GitHubUserRegister.pyで登録してください。'.format(args.username)) return # Contributionsバックアップ self.__UpdateAllUserContributions(path_dir_db, username=args.username) # アップローダ起動 creator = web.service.github.api.v3.AuthenticationsCreator.AuthenticationsCreator(self.__db, args.username) authentications = creator.Create() # user = web.service.github.api.v3.CurrentUser.CurrentUser(self.__db, args.username) repo = web.service.github.api.v3.CurrentRepository.CurrentRepository(self.__db, args.path_dir_pj, description=args.description, homepage=args.homepage) authData = web.service.github.api.v3.AuthenticationData.AuthenticationData() authData.Load(self.__db.Accounts, args.username) client = web.service.github.api.v3.Client.Client(self.__db, authentications, authData=authData, repo=repo) main = cui.uploader.Main.Main(self.__db, client, authData, repo) main.Run() def __UpdateAllUserContributions(self, path_dir_db, username=None): m = database.src.contributions.Main.Main(path_dir_db) for a in self.__db.Accounts['Accounts'].find(): m.Run(a['Username']) if __name__ == '__main__': main = Main() main.Run()
42.409091
159
0.665327
import sys import os.path import subprocess import configparser import argparse import web.service.github.api.v3.AuthenticationsCreator import web.service.github.api.v3.AuthenticationData import web.service.github.api.v3.CurrentRepository import web.service.github.api.v3.Client import database.src.Database import cui.uploader.Main import web.log.Log import database.src.contributions.Main class Main: def __init__(self): pass def Run(self): parser = argparse.ArgumentParser( description='GitHub Repository Uploader.', ) parser.add_argument('path_dir_pj') parser.add_argument('-u', '--username') parser.add_argument('-d', '--description') parser.add_argument('-l', '--homepage', '--link', '--url') args = parser.parse_args() config = configparser.ConfigParser() config.read(os.path.join(os.path.abspath(os.path.dirname(__file__)), 'config.ini')) if config['Path']['DB'].startswith('./'): path_dir_db = os.path.join(os.path.abspath(os.path.dirname(__file__)), config['Path']['DB'][2:]) else: path_dir_db = os.path.abspath(config['Path']['DB']) web.log.Log.Log().Logger.debug(path_dir_db) if None is args.username: args.username = config['GitHub']['User'] self.__db = database.src.Database.Database(os.path.abspath(os.path.dirname(__file__))) self.__db.Initialize() if None is self.__db.Accounts['Accounts'].find_one(Username=args.username): web.log.Log.Log().Logger.warning('指定したユーザ {0} はDBに存在しません。GitHubUserRegister.pyで登録してください。'.format(args.username)) return self.__UpdateAllUserContributions(path_dir_db, username=args.username) creator = web.service.github.api.v3.AuthenticationsCreator.AuthenticationsCreator(self.__db, args.username) authentications = creator.Create() repo = web.service.github.api.v3.CurrentRepository.CurrentRepository(self.__db, args.path_dir_pj, description=args.description, homepage=args.homepage) authData = web.service.github.api.v3.AuthenticationData.AuthenticationData() authData.Load(self.__db.Accounts, args.username) client = web.service.github.api.v3.Client.Client(self.__db, authentications, authData=authData, repo=repo) main = cui.uploader.Main.Main(self.__db, client, authData, repo) main.Run() def __UpdateAllUserContributions(self, path_dir_db, username=None): m = database.src.contributions.Main.Main(path_dir_db) for a in self.__db.Accounts['Accounts'].find(): m.Run(a['Username']) if __name__ == '__main__': main = Main() main.Run()
true
true
f72bac46a7bf89e92fd86af932bfe8a7135e61d2
13,197
py
Python
src/sardana/util/funcgenerator.py
schooft/sardana
76287b416650f40da79871ee3849340d0ff31f1d
[ "CC-BY-3.0" ]
null
null
null
src/sardana/util/funcgenerator.py
schooft/sardana
76287b416650f40da79871ee3849340d0ff31f1d
[ "CC-BY-3.0" ]
null
null
null
src/sardana/util/funcgenerator.py
schooft/sardana
76287b416650f40da79871ee3849340d0ff31f1d
[ "CC-BY-3.0" ]
null
null
null
############################################################################## ## # This file is part of Sardana ## # http://www.sardana-controls.org/ ## # Copyright 2011 CELLS / ALBA Synchrotron, Bellaterra, Spain ## # Sardana is free software: you can redistribute it and/or modify # it under the terms of the GNU Lesser General Public License as published by # the Free Software Foundation, either version 3 of the License, or # (at your option) any later version. ## # Sardana is distributed in the hope that it will be useful, # but WITHOUT ANY WARRANTY; without even the implied warranty of # MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the # GNU Lesser General Public License for more details. ## # You should have received a copy of the GNU Lesser General Public License # along with Sardana. If not, see <http://www.gnu.org/licenses/>. ## ############################################################################## import time import threading import math import copy import numpy import traceback from sardana import State from sardana.sardanaevent import EventGenerator, EventType from sardana.pool.pooldefs import SynchParam, SynchDomain from taurus.core.util.log import Logger def strictly_increasing(l): """Check whether list l has strictly increasing values""" return all(x < y for x, y in zip(l, l[1:])) def strictly_decreasing(l): """Check whether list l has strictly deacreasing values""" return all(x > y for x, y in zip(l, l[1:])) class FunctionGenerator(EventGenerator, Logger): """Generator of active and passive events describing a rectangular function. .. note:: The FunctionGenerator class has been included in Sardana on a provisional basis. Backwards incompatible changes (up to and including removal of the module) may occur if deemed necessary by the core developers. """ MAX_NAP_TIME = 0.1 def __init__(self, name="FunctionGenerator"): EventGenerator.__init__(self) Logger.__init__(self, name) self._name = name self._initial_domain = None self._active_domain = None self._position_event = threading.Event() self._position = None self._initial_domain_in_use = None self._active_domain_in_use = None self._active_events = list() self._passive_events = list() self._started = False self._stopped = False self._running = False self._start_time = None self._direction = None self._condition = None self._id = None self._start_fired = False def get_name(self): return self._name name = property(get_name) def set_initial_domain(self, domain): self._initial_domain = domain def get_initial_domain(self): return self._initial_domain initial_domain = property(get_initial_domain, set_initial_domain) def set_active_domain(self, domain): self._active_domain = domain def get_active_domain(self): return self._active_domain active_domain = property(get_active_domain, set_active_domain) def set_initial_domain_in_use(self, domain): self._initial_domain_in_use = domain def get_initial_domain_in_use(self): return self._initial_domain_in_use initial_domain_in_use = property(get_initial_domain_in_use, set_initial_domain_in_use) def set_active_domain_in_use(self, domain): self._active_domain_in_use = domain def get_active_domain_in_use(self): return self._active_domain_in_use active_domain_in_use = property(get_active_domain_in_use, set_active_domain_in_use) def add_active_event(self, event): self._active_events.append(event) def set_active_events(self, events): self._active_events = events def get_active_events(self): return self._active_events active_events = property(get_active_events, set_active_events) def add_passive_event(self, event): self._passive_events.append(event) def set_passive_events(self, events): self._passive_events = events def get_passive_events(self): return self._passive_events passive_events = property(get_passive_events, set_passive_events) def set_direction(self, direction): self._direction = direction if direction == 1: self._condition = numpy.greater_equal elif direction == -1: self._condition = numpy.less_equal else: raise ValueError("direction can be -1 or 1 (negative or positive)") def get_direction(self): return self._direction direction = property(get_direction, set_direction) def event_received(self, *args, **kwargs): _, _, v = args if v.error: exc_info = v.exc_info self.error("Synchronization base attribute in error") msg = "Details: " + "".join(traceback.format_exception(*exc_info)) self.debug(msg) return self._position = v.value self._position_event.set() def start(self): self._start_time = time.time() self._stopped = False self._started = True self._position = None self._start_fired = False self._position_event.clear() self._id = 0 self.fire_event(EventType("state"), State.Moving) def stop(self): self._stopped = True def is_started(self): return self._started def is_stopped(self): return self._stopped def is_running(self): return self._running def run(self): self._running = True try: while len(self.active_events) > 0 and not self.is_stopped(): self.wait_active() self.fire_active() self.wait_passive() self.fire_passive() self._id += 1 finally: self._started = False self._running = False self._stopped = False self.fire_event(EventType("state"), State.On) def sleep(self, period): if period <= 0: return necessary_naps = int(math.ceil(period / self.MAX_NAP_TIME)) if necessary_naps == 0: # avoid zero ZeroDivisionError nap = 0 else: nap = period / necessary_naps for _ in xrange(necessary_naps): if self.is_stopped(): break time.sleep(nap) def fire_start(self): self.fire_event(EventType("start"), self._id) self._start_fired = True if self._id > 0: msg = "start was fired with {0} delay".format(self._id) self.warning(msg) def wait_active(self): candidate = self.active_events[0] if self.initial_domain_in_use == SynchDomain.Time: now = time.time() candidate += self._start_time self.sleep(candidate - now) else: while True: if self.is_stopped(): break if self._position_event.isSet(): self._position_event.clear() now = self._position if self._condition(now, candidate): break else: self._position_event.wait(self.MAX_NAP_TIME) def fire_active(self): # check if some events needs to be skipped i = 0 while i < len(self.active_events) - 1: candidate = self.active_events[i + 1] if self.initial_domain_in_use is SynchDomain.Time: candidate += self._start_time now = time.time() elif self.initial_domain_in_use is SynchDomain.Position: now = self._position if self._condition(now, candidate): i += 1 else: break self._id += i if not self._start_fired: self.fire_start() self.fire_event(EventType("active"), self._id) self.active_events = self.active_events[i + 1:] self.passive_events = self.passive_events[i:] def wait_passive(self): if self.active_domain_in_use == SynchDomain.Time: now = time.time() candidate = self._start_time + self.passive_events[0] self.sleep(candidate - now) else: while True: if self._position_event.isSet(): self._position_event.clear() if self._condition(self._position, self.passive_events[0]): break else: self._position_event.wait(self.MAX_NAP_TIME) if self.is_stopped(): break def fire_passive(self): self.fire_event(EventType("passive"), self._id) self.set_passive_events(self.passive_events[1:]) if len(self.passive_events) == 0: self.fire_end() def fire_end(self): self.fire_event(EventType("end"), self._id) def set_configuration(self, configuration): # make a copy since we may inject the initial time configuration = copy.deepcopy(configuration) active_events = [] passive_events = [] self._direction = None # create short variables for commodity Time = SynchDomain.Time Position = SynchDomain.Position Initial = SynchParam.Initial Delay = SynchParam.Delay Active = SynchParam.Active Total = SynchParam.Total Repeats = SynchParam.Repeats for i, group in enumerate(configuration): # inject delay as initial time - generation will be # relative to the start time initial_param = group.get(Initial) if initial_param is None: initial_param = dict() if Time not in initial_param: delay_param = group.get(Delay) if Time in delay_param: initial_param[Time] = delay_param[Time] group[Initial] = initial_param # determine active domain in use msg = "no initial value in group %d" % i if self.initial_domain in initial_param: self.initial_domain_in_use = self.initial_domain elif Position in initial_param: self.initial_domain_in_use = Position elif Time in initial_param: self.initial_domain_in_use = Time else: raise ValueError(msg) # determine passive domain in use active_param = group.get(Active) msg = "no active value in group %d" % i if self.active_domain is None: if Time in active_param: self.active_domain_in_use = Time elif Position in active_param: self.active_domain_in_use = Position else: raise ValueError(msg) elif self.active_domain in active_param: self.active_domain_in_use = self.active_domain else: raise ValueError(msg) # create short variables for commodity initial_domain_in_use = self.initial_domain_in_use active_domain_in_use = self.active_domain_in_use repeats = group.get(Repeats, 1) active = active_param[active_domain_in_use] initial_in_initial_domain = initial_param[initial_domain_in_use] initial_in_active_domain = initial_param[active_domain_in_use] active_event_in_initial_domain = initial_in_initial_domain active_event_in_active_domain = initial_in_active_domain if repeats > 1: total_param = group[Total] total_in_initial_domain = total_param[initial_domain_in_use] total_in_active_domain = total_param[active_domain_in_use] for _ in xrange(repeats): passive_event = active_event_in_active_domain + active active_events.append(active_event_in_initial_domain) passive_events.append(passive_event) active_event_in_initial_domain += total_in_initial_domain active_event_in_active_domain += total_in_active_domain else: active_events.append(active_event_in_initial_domain) passive_event = active_event_in_active_domain + active passive_events.append(passive_event) # determine direction if self.direction is None: if strictly_increasing(active_events): self.direction = 1 elif strictly_decreasing(active_events): self.direction = -1 else: msg = "active values indicate contradictory directions" raise ValueError(msg) self.active_events = active_events self.passive_events = passive_events
35.286096
79
0.608169
elf._position_event.wait(self.MAX_NAP_TIME) def fire_active(self): i = 0 while i < len(self.active_events) - 1: candidate = self.active_events[i + 1] if self.initial_domain_in_use is SynchDomain.Time: candidate += self._start_time now = time.time() elif self.initial_domain_in_use is SynchDomain.Position: now = self._position if self._condition(now, candidate): i += 1 else: break self._id += i if not self._start_fired: self.fire_start() self.fire_event(EventType("active"), self._id) self.active_events = self.active_events[i + 1:] self.passive_events = self.passive_events[i:] def wait_passive(self): if self.active_domain_in_use == SynchDomain.Time: now = time.time() candidate = self._start_time + self.passive_events[0] self.sleep(candidate - now) else: while True: if self._position_event.isSet(): self._position_event.clear() if self._condition(self._position, self.passive_events[0]): break else: self._position_event.wait(self.MAX_NAP_TIME) if self.is_stopped(): break def fire_passive(self): self.fire_event(EventType("passive"), self._id) self.set_passive_events(self.passive_events[1:]) if len(self.passive_events) == 0: self.fire_end() def fire_end(self): self.fire_event(EventType("end"), self._id) def set_configuration(self, configuration): configuration = copy.deepcopy(configuration) active_events = [] passive_events = [] self._direction = None Time = SynchDomain.Time Position = SynchDomain.Position Initial = SynchParam.Initial Delay = SynchParam.Delay Active = SynchParam.Active Total = SynchParam.Total Repeats = SynchParam.Repeats for i, group in enumerate(configuration): initial_param = group.get(Initial) if initial_param is None: initial_param = dict() if Time not in initial_param: delay_param = group.get(Delay) if Time in delay_param: initial_param[Time] = delay_param[Time] group[Initial] = initial_param msg = "no initial value in group %d" % i if self.initial_domain in initial_param: self.initial_domain_in_use = self.initial_domain elif Position in initial_param: self.initial_domain_in_use = Position elif Time in initial_param: self.initial_domain_in_use = Time else: raise ValueError(msg) active_param = group.get(Active) msg = "no active value in group %d" % i if self.active_domain is None: if Time in active_param: self.active_domain_in_use = Time elif Position in active_param: self.active_domain_in_use = Position else: raise ValueError(msg) elif self.active_domain in active_param: self.active_domain_in_use = self.active_domain else: raise ValueError(msg) initial_domain_in_use = self.initial_domain_in_use active_domain_in_use = self.active_domain_in_use repeats = group.get(Repeats, 1) active = active_param[active_domain_in_use] initial_in_initial_domain = initial_param[initial_domain_in_use] initial_in_active_domain = initial_param[active_domain_in_use] active_event_in_initial_domain = initial_in_initial_domain active_event_in_active_domain = initial_in_active_domain if repeats > 1: total_param = group[Total] total_in_initial_domain = total_param[initial_domain_in_use] total_in_active_domain = total_param[active_domain_in_use] for _ in xrange(repeats): passive_event = active_event_in_active_domain + active active_events.append(active_event_in_initial_domain) passive_events.append(passive_event) active_event_in_initial_domain += total_in_initial_domain active_event_in_active_domain += total_in_active_domain else: active_events.append(active_event_in_initial_domain) passive_event = active_event_in_active_domain + active passive_events.append(passive_event) if self.direction is None: if strictly_increasing(active_events): self.direction = 1 elif strictly_decreasing(active_events): self.direction = -1 else: msg = "active values indicate contradictory directions" raise ValueError(msg) self.active_events = active_events self.passive_events = passive_events
true
true
f72bac8581667e7935b4584979b404c4fdca5866
468
py
Python
examples/trap.py
fthyssen/aiosnmp
667a166214e2e70c333510a6d24208dd772a1f26
[ "MIT" ]
null
null
null
examples/trap.py
fthyssen/aiosnmp
667a166214e2e70c333510a6d24208dd772a1f26
[ "MIT" ]
null
null
null
examples/trap.py
fthyssen/aiosnmp
667a166214e2e70c333510a6d24208dd772a1f26
[ "MIT" ]
null
null
null
import asyncio import aiosnmp async def handler(host: str, port: int, message: aiosnmp.SnmpV2TrapMessage) -> None: print(f"got packet from {host}:{port}") for d in message.data.varbinds: print(f"oid: {d.oid}, value: {d.value}") async def main(): p = aiosnmp.SnmpV2TrapServer( host="127.0.0.1", port=162, communities=("public",), handler=handler ) await p.run() loop = asyncio.get_event_loop() loop.run_until_complete(main())
22.285714
84
0.662393
import asyncio import aiosnmp async def handler(host: str, port: int, message: aiosnmp.SnmpV2TrapMessage) -> None: print(f"got packet from {host}:{port}") for d in message.data.varbinds: print(f"oid: {d.oid}, value: {d.value}") async def main(): p = aiosnmp.SnmpV2TrapServer( host="127.0.0.1", port=162, communities=("public",), handler=handler ) await p.run() loop = asyncio.get_event_loop() loop.run_until_complete(main())
true
true
f72bacd78c4c106ed1626a1724d718b3f8d317dc
481
py
Python
_unittests/ut_plotting/test_dummy.py
sdpython/manyapi
dc2aadc58a5d72904f95424dbe57bb832d3ccd73
[ "MIT" ]
1
2020-08-08T13:38:45.000Z
2020-08-08T13:38:45.000Z
_unittests/ut_plotting/test_dummy.py
sdpython/manyapi
dc2aadc58a5d72904f95424dbe57bb832d3ccd73
[ "MIT" ]
8
2018-05-05T10:03:04.000Z
2019-06-08T10:21:30.000Z
_unittests/ut_plotting/test_dummy.py
sdpython/manyapi
dc2aadc58a5d72904f95424dbe57bb832d3ccd73
[ "MIT" ]
null
null
null
""" @brief test log(time=13s) """ import unittest from pyquickhelper.pycode import ExtTestCase from manydataapi.plotting import plot_aggregated_ts, daily_timeseries class TestDummm(ExtTestCase): def test_agg_raise(self): df = daily_timeseries() from matplotlib import pyplot as plt _, ax = plt.subplots(1, 1) plot_aggregated_ts(df, ax=ax, value='X', agg='year') plt.close('all') if __name__ == "__main__": unittest.main()
21.863636
69
0.675676
import unittest from pyquickhelper.pycode import ExtTestCase from manydataapi.plotting import plot_aggregated_ts, daily_timeseries class TestDummm(ExtTestCase): def test_agg_raise(self): df = daily_timeseries() from matplotlib import pyplot as plt _, ax = plt.subplots(1, 1) plot_aggregated_ts(df, ax=ax, value='X', agg='year') plt.close('all') if __name__ == "__main__": unittest.main()
true
true
f72bacee48dd612bab37d2f97351e60521569498
6,673
py
Python
tests/test_lammps_cycle.py
irisTa56/ease4lmp
0ad69632fbe0d8c2a55e58af13efd7be1d566394
[ "MIT" ]
null
null
null
tests/test_lammps_cycle.py
irisTa56/ease4lmp
0ad69632fbe0d8c2a55e58af13efd7be1d566394
[ "MIT" ]
2
2019-03-06T04:33:27.000Z
2019-07-27T08:30:28.000Z
tests/test_lammps_cycle.py
irisTa56/ease4lmp
0ad69632fbe0d8c2a55e58af13efd7be1d566394
[ "MIT" ]
null
null
null
import unittest from ease4lmp import ( BondedAtoms, LammpsWriter, create_atoms_from_data, create_atoms_from_molecule) from ase.build import bulk, molecule import numpy as np import os import itertools def write_files(atoms): writer = LammpsWriter(atoms, atom_style="molecular") writer.set_atom_data(mol=[0]*len(atoms)) writer.set_bond_types({ seq: i+1 for i, seq in enumerate(writer.get_bond_patterns()) }) writer.set_angle_types({ seq: i+1 for i, seq in enumerate(writer.get_angle_patterns()) }) writer.set_dihedral_types({ seq: i+1 for i, seq in enumerate(writer.get_dihedral_patterns()) }) writer.set_improper_types({ seq: i+1 for i, seq in enumerate(writer.get_improper_patterns()) }) writer.write_lammps_data("data.tmp", mass=True) writer.write_lammps_molecule("molecule.tmp", mass=True) def remove_files(): os.remove("data.tmp") os.remove("molecule.tmp") class TestLammpsCycle(unittest.TestCase): def test_methanol(self): """Test for equivalence between original and written/read data.""" atoms = BondedAtoms(molecule("CH3OH")) # confirm atomic numbers self.assertTrue(np.allclose( atoms.get_atomic_numbers(), np.array([6, 8, 1, 1, 1, 1]))) # confirm O-H distance self.assertTrue(np.allclose(atoms.get_distance(1, 3), 0.97)) atoms.set_types([1, 2, 3, 4, 3, 3]) positions = atoms.get_positions() bonded_pairs = [ (i, j) for i, j in itertools.combinations(range(len(atoms)), 2) if np.linalg.norm(positions[i] - positions[j]) < 1.5] # there are five bonds in CH3OH self.assertEqual(len(bonded_pairs), 5) for pair in bonded_pairs: atoms.add_bond(*pair) atoms.sort_bonds() atoms.set_cell([[5., 0., 0.], [0., 5., 0.], [0., 0., 5.]]) atoms.center() write_files(atoms) atoms_from_data = create_atoms_from_data("data.tmp", "molecular") atoms_from_molecule = create_atoms_from_molecule("molecule.tmp") # atoms from Lammps' data and molecule file must be eaqual. self.assertTrue(np.allclose( atoms_from_data.get_positions(), atoms_from_molecule.get_positions())) self.assertTrue(np.allclose( atoms_from_data.get_masses(), atoms_from_molecule.get_masses())) self.assertTrue(np.allclose( atoms_from_data.get_types(), atoms_from_molecule.get_types())) self.assertTrue(np.allclose( atoms_from_data.get_bonds(), atoms_from_molecule.get_bonds())) # comparison with original atoms self.assertTrue(np.allclose( atoms_from_data.get_positions(), atoms.get_positions())) self.assertTrue(np.allclose( atoms_from_data.get_masses(), atoms.get_masses())) self.assertTrue(np.allclose( atoms_from_data.get_types(), atoms.get_types())) # storing order of bonds might be changed atoms_from_data.sort_bonds() self.assertTrue(np.allclose( atoms_from_data.get_bonds(), atoms.get_bonds())) remove_files() def test_acetic(self): """Test for equivalence between original and written/read data.""" atoms = BondedAtoms(molecule("CH3COOH")) # confirm atomic numbers self.assertTrue(np.allclose( atoms.get_atomic_numbers(), np.array([6, 8, 8, 1, 6, 1, 1, 1]))) # confirm O-H distance < C=H distance self.assertTrue(all( atoms.get_distance(2, 3) < atoms.get_distance(i, j) for i, j in [(4, 5), (4, 6), (4, 7)])) atoms.set_types([1, 2, 3, 4, 5, 6, 6, 6]) positions = atoms.get_positions() bonded_pairs = [ (i, j) for i, j in itertools.combinations(range(len(atoms)), 2) if np.linalg.norm(positions[i] - positions[j]) < 1.5] # there are seven bonds in CH3COOH self.assertEqual(len(bonded_pairs), 7) for pair in bonded_pairs: atoms.add_bond(*pair) atoms.sort_bonds() atoms.set_cell([[5., 0., 0.], [0., 5., 0.], [0., 0., 5.]]) atoms.center() write_files(atoms) atoms_from_data = create_atoms_from_data("data.tmp", "molecular") atoms_from_molecule = create_atoms_from_molecule("molecule.tmp") # atoms from Lammps' data and molecule file must be eaqual. self.assertTrue(np.allclose( atoms_from_data.get_positions(), atoms_from_molecule.get_positions())) self.assertTrue(np.allclose( atoms_from_data.get_masses(), atoms_from_molecule.get_masses())) self.assertTrue(np.allclose( atoms_from_data.get_types(), atoms_from_molecule.get_types())) self.assertTrue(np.allclose( atoms_from_data.get_bonds(), atoms_from_molecule.get_bonds())) # comparison with original atoms self.assertTrue(np.allclose( atoms_from_data.get_positions(), atoms.get_positions())) self.assertTrue(np.allclose( atoms_from_data.get_masses(), atoms.get_masses())) self.assertTrue(np.allclose( atoms_from_data.get_types(), atoms.get_types())) # storing order of bonds might be changed atoms_from_data.sort_bonds() self.assertTrue(np.allclose( atoms_from_data.get_bonds(), atoms.get_bonds())) remove_files() def test_nacl(self): """Test for equivalence between original and written/read data.""" atoms = BondedAtoms(bulk("NaCl", "rocksalt", a=5.64, orthorhombic=True)) # confirm atomic numbers self.assertTrue(np.allclose( atoms.get_atomic_numbers(), np.array([11, 17, 11, 17]))) atoms.set_types([1, 2, 1, 2]) atoms.change_max_bonds(6) cell = atoms.get_cell() positions = atoms.get_positions() for i, j in itertools.combinations(range(len(atoms)), 2): r_original = positions[j] - positions[i] for ix, iy, iz in itertools.product(*[(-1, 0, 1)]*3): r = r_original + ix * cell[0] + iy * cell[1] + iz * cell[2] if np.isclose(np.linalg.norm(r), 2.82): atoms.add_bond(i, j, img2=(ix, iy, iz)) atoms *= 5 atoms.sort_bonds() write_files(atoms) atoms_from_data = create_atoms_from_data( "data.tmp", "molecular", pbc=True) # comparison with original atoms self.assertTrue(np.allclose( atoms_from_data.get_positions(), atoms.get_positions())) self.assertTrue(np.allclose( atoms_from_data.get_masses(), atoms.get_masses())) self.assertTrue(np.allclose( atoms_from_data.get_types(), atoms.get_types())) # storing order of bonds might be changed atoms_from_data.sort_bonds() self.assertTrue(np.allclose( atoms_from_data.get_bonds(), atoms.get_bonds())) remove_files() def suite(): suite = unittest.TestSuite() suite.addTest(TestLammpsCycle("test_methanol")) suite.addTest(TestLammpsCycle("test_acetic")) suite.addTest(TestLammpsCycle("test_nacl")) return suite
30.47032
76
0.683051
import unittest from ease4lmp import ( BondedAtoms, LammpsWriter, create_atoms_from_data, create_atoms_from_molecule) from ase.build import bulk, molecule import numpy as np import os import itertools def write_files(atoms): writer = LammpsWriter(atoms, atom_style="molecular") writer.set_atom_data(mol=[0]*len(atoms)) writer.set_bond_types({ seq: i+1 for i, seq in enumerate(writer.get_bond_patterns()) }) writer.set_angle_types({ seq: i+1 for i, seq in enumerate(writer.get_angle_patterns()) }) writer.set_dihedral_types({ seq: i+1 for i, seq in enumerate(writer.get_dihedral_patterns()) }) writer.set_improper_types({ seq: i+1 for i, seq in enumerate(writer.get_improper_patterns()) }) writer.write_lammps_data("data.tmp", mass=True) writer.write_lammps_molecule("molecule.tmp", mass=True) def remove_files(): os.remove("data.tmp") os.remove("molecule.tmp") class TestLammpsCycle(unittest.TestCase): def test_methanol(self): atoms = BondedAtoms(molecule("CH3OH")) self.assertTrue(np.allclose( atoms.get_atomic_numbers(), np.array([6, 8, 1, 1, 1, 1]))) self.assertTrue(np.allclose(atoms.get_distance(1, 3), 0.97)) atoms.set_types([1, 2, 3, 4, 3, 3]) positions = atoms.get_positions() bonded_pairs = [ (i, j) for i, j in itertools.combinations(range(len(atoms)), 2) if np.linalg.norm(positions[i] - positions[j]) < 1.5] self.assertEqual(len(bonded_pairs), 5) for pair in bonded_pairs: atoms.add_bond(*pair) atoms.sort_bonds() atoms.set_cell([[5., 0., 0.], [0., 5., 0.], [0., 0., 5.]]) atoms.center() write_files(atoms) atoms_from_data = create_atoms_from_data("data.tmp", "molecular") atoms_from_molecule = create_atoms_from_molecule("molecule.tmp") self.assertTrue(np.allclose( atoms_from_data.get_positions(), atoms_from_molecule.get_positions())) self.assertTrue(np.allclose( atoms_from_data.get_masses(), atoms_from_molecule.get_masses())) self.assertTrue(np.allclose( atoms_from_data.get_types(), atoms_from_molecule.get_types())) self.assertTrue(np.allclose( atoms_from_data.get_bonds(), atoms_from_molecule.get_bonds())) # comparison with original atoms self.assertTrue(np.allclose( atoms_from_data.get_positions(), atoms.get_positions())) self.assertTrue(np.allclose( atoms_from_data.get_masses(), atoms.get_masses())) self.assertTrue(np.allclose( atoms_from_data.get_types(), atoms.get_types())) # storing order of bonds might be changed atoms_from_data.sort_bonds() self.assertTrue(np.allclose( atoms_from_data.get_bonds(), atoms.get_bonds())) remove_files() def test_acetic(self): atoms = BondedAtoms(molecule("CH3COOH")) # confirm atomic numbers self.assertTrue(np.allclose( atoms.get_atomic_numbers(), np.array([6, 8, 8, 1, 6, 1, 1, 1]))) # confirm O-H distance < C=H distance self.assertTrue(all( atoms.get_distance(2, 3) < atoms.get_distance(i, j) for i, j in [(4, 5), (4, 6), (4, 7)])) atoms.set_types([1, 2, 3, 4, 5, 6, 6, 6]) positions = atoms.get_positions() bonded_pairs = [ (i, j) for i, j in itertools.combinations(range(len(atoms)), 2) if np.linalg.norm(positions[i] - positions[j]) < 1.5] # there are seven bonds in CH3COOH self.assertEqual(len(bonded_pairs), 7) for pair in bonded_pairs: atoms.add_bond(*pair) atoms.sort_bonds() atoms.set_cell([[5., 0., 0.], [0., 5., 0.], [0., 0., 5.]]) atoms.center() write_files(atoms) atoms_from_data = create_atoms_from_data("data.tmp", "molecular") atoms_from_molecule = create_atoms_from_molecule("molecule.tmp") # atoms from Lammps' data and molecule file must be eaqual. self.assertTrue(np.allclose( atoms_from_data.get_positions(), atoms_from_molecule.get_positions())) self.assertTrue(np.allclose( atoms_from_data.get_masses(), atoms_from_molecule.get_masses())) self.assertTrue(np.allclose( atoms_from_data.get_types(), atoms_from_molecule.get_types())) self.assertTrue(np.allclose( atoms_from_data.get_bonds(), atoms_from_molecule.get_bonds())) self.assertTrue(np.allclose( atoms_from_data.get_positions(), atoms.get_positions())) self.assertTrue(np.allclose( atoms_from_data.get_masses(), atoms.get_masses())) self.assertTrue(np.allclose( atoms_from_data.get_types(), atoms.get_types())) atoms_from_data.sort_bonds() self.assertTrue(np.allclose( atoms_from_data.get_bonds(), atoms.get_bonds())) remove_files() def test_nacl(self): atoms = BondedAtoms(bulk("NaCl", "rocksalt", a=5.64, orthorhombic=True)) self.assertTrue(np.allclose( atoms.get_atomic_numbers(), np.array([11, 17, 11, 17]))) atoms.set_types([1, 2, 1, 2]) atoms.change_max_bonds(6) cell = atoms.get_cell() positions = atoms.get_positions() for i, j in itertools.combinations(range(len(atoms)), 2): r_original = positions[j] - positions[i] for ix, iy, iz in itertools.product(*[(-1, 0, 1)]*3): r = r_original + ix * cell[0] + iy * cell[1] + iz * cell[2] if np.isclose(np.linalg.norm(r), 2.82): atoms.add_bond(i, j, img2=(ix, iy, iz)) atoms *= 5 atoms.sort_bonds() write_files(atoms) atoms_from_data = create_atoms_from_data( "data.tmp", "molecular", pbc=True) self.assertTrue(np.allclose( atoms_from_data.get_positions(), atoms.get_positions())) self.assertTrue(np.allclose( atoms_from_data.get_masses(), atoms.get_masses())) self.assertTrue(np.allclose( atoms_from_data.get_types(), atoms.get_types())) atoms_from_data.sort_bonds() self.assertTrue(np.allclose( atoms_from_data.get_bonds(), atoms.get_bonds())) remove_files() def suite(): suite = unittest.TestSuite() suite.addTest(TestLammpsCycle("test_methanol")) suite.addTest(TestLammpsCycle("test_acetic")) suite.addTest(TestLammpsCycle("test_nacl")) return suite
true
true
f72bacff2befd45529dc6156485e5eaa617d18a2
611
py
Python
api/models/post_rank/migrations/0001_initial.py
eggmoid/GalleryManage-FastAPI
fa50cef623a03aed2d7b4ac9c76d74cfb9d898eb
[ "MIT" ]
null
null
null
api/models/post_rank/migrations/0001_initial.py
eggmoid/GalleryManage-FastAPI
fa50cef623a03aed2d7b4ac9c76d74cfb9d898eb
[ "MIT" ]
6
2021-08-06T16:30:03.000Z
2021-12-11T05:30:02.000Z
api/models/post_rank/migrations/0001_initial.py
eggmoid/GalleryManage-FastAPI
fa50cef623a03aed2d7b4ac9c76d74cfb9d898eb
[ "MIT" ]
null
null
null
# Generated by Django 3.2.5 on 2021-08-25 04:03 from django.db import migrations class Migration(migrations.Migration): initial = True dependencies = [ ('post', '0005_alter_post_options'), ] operations = [ migrations.CreateModel( name='PostRank', fields=[ ], options={ 'verbose_name': '8월 갤창랭킹', 'verbose_name_plural': '8월 갤창랭킹', 'proxy': True, 'indexes': [], 'constraints': [], }, bases=('post.post',), ), ]
21.068966
49
0.464812
from django.db import migrations class Migration(migrations.Migration): initial = True dependencies = [ ('post', '0005_alter_post_options'), ] operations = [ migrations.CreateModel( name='PostRank', fields=[ ], options={ 'verbose_name': '8월 갤창랭킹', 'verbose_name_plural': '8월 갤창랭킹', 'proxy': True, 'indexes': [], 'constraints': [], }, bases=('post.post',), ), ]
true
true
f72bad3d0b4002ad1cb2fcc9489978b3fa4f88bf
3,577
py
Python
checkers/utils.py
gbravoi/monte-carlo-tree-search
578df8df925e5f569e7354daff6642e1781389b6
[ "MIT" ]
null
null
null
checkers/utils.py
gbravoi/monte-carlo-tree-search
578df8df925e5f569e7354daff6642e1781389b6
[ "MIT" ]
null
null
null
checkers/utils.py
gbravoi/monte-carlo-tree-search
578df8df925e5f569e7354daff6642e1781389b6
[ "MIT" ]
null
null
null
""" Martin Kersner, m.kersner@gmail.com seoulai.com 2018 Adapted by Gabriela B. to work with python 2.7 and ROS """ import random import numpy as np from base import Constants from rules import Rules class BoardEncoding(object): def __init__(self): self._constants = Constants() self._encoding = {} self.empty = 0 self.dark = 20 self.dark_king = 21 self.light = 10 self.light_king = 11 def __getitem__(self, name): return self._encoding[name] @property def empty(self): return self._encoding[self._constants.EMPTY] @empty.setter def empty(self, value): self._encoding[self._constants.EMPTY] = value @property def dark(self): return self._encoding[self._constants.DARK] @dark.setter def dark(self, value): self._encoding[self._constants.DARK] = value @property def dark_king(self): return self._encoding[self._constants.DARK_KING] @dark_king.setter def dark_king(self, value): self._encoding[self._constants.DARK_KING] = value @property def light(self): return self._encoding[self._constants.LIGHT] @light.setter def light(self, value): self._encoding[self._constants.LIGHT] = value @property def light_king(self): return self._encoding[self._constants.LIGHT_KING] @light_king.setter def light_king(self, value): self._encoding[self._constants.LIGHT_KING] = value def board_list2numpy( board_list, encoding) : """Convert the state of game (`board_list`) into 2D NumPy Array using `encoding`. Args: board_list: (List[List[Piece]]) State of the game. encoding: (BoardEncoding) Optional argument. If not given default encoding will be utilized. Returns: board_numpy: (np.array) """ board_size = len(board_list) constants = Constants() board_numpy = encoding[constants.EMPTY] * np.ones((board_size, board_size)) for row in range(board_size): for col in range(board_size): if board_list[row][col] is not None: ptype = board_list[row][col].ptype king = board_list[row][col].king if ptype == constants.LIGHT: if king: piece_type = constants.LIGHT_KING else: piece_type = constants.LIGHT else: # DARK if king: piece_type = constants.DARK_KING else: piece_type = constants.DARK board_numpy[row][col] = encoding[piece_type] return board_numpy def generate_random_move( board, ptype, board_size): """Generate random move from all `ptype` valid moves but does not execute it. Args: board: (List[List[Piece]]) State of the game. ptype: (int) type of piece for which random move will be generated board_size: (int) size of board """ valid_moves = Rules.generate_valid_moves(board, ptype, board_size) rand_from_row, rand_from_col = random.choice(list(valid_moves.keys())) rand_to_row, rand_to_col = random.choice(valid_moves[(rand_from_row, rand_from_col)]) return rand_from_row, rand_from_col, rand_to_row, rand_to_col #new functions def print_board(board_list): """ print board for debugging putposes receives board as a board_list: List[List], """ numpy_board=board_list2numpy(board_list) print(numpy_board)
26.496296
100
0.632933
import random import numpy as np from base import Constants from rules import Rules class BoardEncoding(object): def __init__(self): self._constants = Constants() self._encoding = {} self.empty = 0 self.dark = 20 self.dark_king = 21 self.light = 10 self.light_king = 11 def __getitem__(self, name): return self._encoding[name] @property def empty(self): return self._encoding[self._constants.EMPTY] @empty.setter def empty(self, value): self._encoding[self._constants.EMPTY] = value @property def dark(self): return self._encoding[self._constants.DARK] @dark.setter def dark(self, value): self._encoding[self._constants.DARK] = value @property def dark_king(self): return self._encoding[self._constants.DARK_KING] @dark_king.setter def dark_king(self, value): self._encoding[self._constants.DARK_KING] = value @property def light(self): return self._encoding[self._constants.LIGHT] @light.setter def light(self, value): self._encoding[self._constants.LIGHT] = value @property def light_king(self): return self._encoding[self._constants.LIGHT_KING] @light_king.setter def light_king(self, value): self._encoding[self._constants.LIGHT_KING] = value def board_list2numpy( board_list, encoding) : board_size = len(board_list) constants = Constants() board_numpy = encoding[constants.EMPTY] * np.ones((board_size, board_size)) for row in range(board_size): for col in range(board_size): if board_list[row][col] is not None: ptype = board_list[row][col].ptype king = board_list[row][col].king if ptype == constants.LIGHT: if king: piece_type = constants.LIGHT_KING else: piece_type = constants.LIGHT else: if king: piece_type = constants.DARK_KING else: piece_type = constants.DARK board_numpy[row][col] = encoding[piece_type] return board_numpy def generate_random_move( board, ptype, board_size): valid_moves = Rules.generate_valid_moves(board, ptype, board_size) rand_from_row, rand_from_col = random.choice(list(valid_moves.keys())) rand_to_row, rand_to_col = random.choice(valid_moves[(rand_from_row, rand_from_col)]) return rand_from_row, rand_from_col, rand_to_row, rand_to_col def print_board(board_list): numpy_board=board_list2numpy(board_list) print(numpy_board)
true
true
f72bad4faefc64d772b991b54a1874f2f71d5c3b
1,267
py
Python
modules/AppTheme.py
Fa1c0n35/RootTheBoxs
4f2a9886c8eedca3039604b93929c8c09866115e
[ "Apache-2.0" ]
1
2019-06-29T08:40:54.000Z
2019-06-29T08:40:54.000Z
modules/AppTheme.py
Fa1c0n35/RootTheBoxs
4f2a9886c8eedca3039604b93929c8c09866115e
[ "Apache-2.0" ]
null
null
null
modules/AppTheme.py
Fa1c0n35/RootTheBoxs
4f2a9886c8eedca3039604b93929c8c09866115e
[ "Apache-2.0" ]
null
null
null
# -*- coding: utf-8 -*- """ Created on Mar 14, 2012 @author: moloch Copyright 2012 Root the Box Licensed under the Apache License, Version 2.0 (the "License"); you may not use this file except in compliance with the License. You may obtain a copy of the License at http://www.apache.org/licenses/LICENSE-2.0 Unless required by applicable law or agreed to in writing, software distributed under the License is distributed on an "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the License for the specific language governing permissions and limitations under the License. """ from tornado.web import UIModule from tornado.options import options from models.Theme import Theme class AppTheme(UIModule): theme = Theme.by_name(options.default_theme) def render(self, *args, **kwargs): """ Includes different CSS themes based on user prefs """ if options.allow_user_to_change_theme and (self.handler.session is not None): return self.render_string( "theme/theme.html", theme_files=self.handler.session["theme"] ) else: return self.render_string("theme/theme.html", theme_files=self.theme)
30.902439
85
0.697711
from tornado.web import UIModule from tornado.options import options from models.Theme import Theme class AppTheme(UIModule): theme = Theme.by_name(options.default_theme) def render(self, *args, **kwargs): if options.allow_user_to_change_theme and (self.handler.session is not None): return self.render_string( "theme/theme.html", theme_files=self.handler.session["theme"] ) else: return self.render_string("theme/theme.html", theme_files=self.theme)
true
true
f72bad64f0a9f77a3272ef388210f662dc6820c7
749
py
Python
smbl/prog/plugins/picard.py
karel-brinda/snakemake-lib
5922fa2fc4060d86172e991361a1cceb0af51af8
[ "MIT" ]
26
2015-03-16T03:37:02.000Z
2021-01-18T17:34:16.000Z
smbl/prog/plugins/picard.py
karel-brinda/smbl
5922fa2fc4060d86172e991361a1cceb0af51af8
[ "MIT" ]
12
2015-02-05T10:57:16.000Z
2016-06-07T18:09:57.000Z
smbl/prog/plugins/picard.py
karel-brinda/snakemake-lib
5922fa2fc4060d86172e991361a1cceb0af51af8
[ "MIT" ]
6
2015-06-03T20:06:49.000Z
2020-12-13T09:48:03.000Z
import smbl import snakemake import os from ._program import * PICARD = get_bin_file_path("picard.jar") ########################################## ########################################## class Picard(Program): @classmethod def get_installation_files(cls): return [ PICARD, ] @classmethod def install(cls): ver="1.140" fn=cls.download_file("https://github.com/broadinstitute/picard/releases/download/{ver}/picard-tools-{ver}.zip".format(ver=ver),"picard.zip") dir=os.path.dirname(fn) smbl.utils.shell('(cd "{dir}" && unzip -j picard.zip) > /dev/null'.format(dir=dir)) cls.install_file("picard.jar",PICARD) @classmethod def supported_platforms(cls): return ["osx","linux","cygwin"]
23.40625
143
0.599466
import smbl import snakemake import os from ._program import * PICARD = get_bin_file_path("picard.jar")
true
true
f72badcfec08b1a7904807f002fbd7e59e89878d
2,519
py
Python
ckan/tests/cli/test_config_tool.py
jbrown-xentity/ckan
ecd9ac6bc6cfb5bb4fcbec82c431f4564ef649ed
[ "BSD-3-Clause" ]
2,805
2015-01-02T18:13:15.000Z
2022-03-31T03:35:01.000Z
ckan/tests/cli/test_config_tool.py
jbrown-xentity/ckan
ecd9ac6bc6cfb5bb4fcbec82c431f4564ef649ed
[ "BSD-3-Clause" ]
3,801
2015-01-02T11:05:36.000Z
2022-03-31T19:24:37.000Z
ckan/tests/cli/test_config_tool.py
jbrown-xentity/ckan
ecd9ac6bc6cfb5bb4fcbec82c431f4564ef649ed
[ "BSD-3-Clause" ]
1,689
2015-01-02T19:46:43.000Z
2022-03-28T14:59:43.000Z
# -*- coding: utf-8 -*- import os import pytest from ckan.cli.cli import ckan from configparser import ConfigParser, NoOptionError @pytest.fixture def config_file(tmp_path): dest = tmp_path / u'config.ini' tpl = os.path.join( os.path.dirname(__file__), u'templates/config_tool.ini.tpl') with open(tpl, u'rb') as data: dest.write_bytes(data.read()) return dest def _parse(config_file): parser = ConfigParser() parser.read([str(config_file)]) return parser def test_config_no_params(cli, config_file): """test-config requires some params for update. """ result = cli.invoke(ckan, [u'config-tool', str(config_file)]) assert result.exit_code def test_config_unset_debug(cli, config_file): """Existing values can be updated. """ assert _parse(config_file).get(u'app:main', u'debug') == u'true' result = cli.invoke( ckan, [u'config-tool', str(config_file), u'debug=false'] ) assert not result.exit_code, result.output assert _parse(config_file).get(u'app:main', u'debug') == u'false' def test_config_create_custom_debug(cli, config_file): """New values can be added """ with pytest.raises(NoOptionError): _parse(config_file).get(u'app:main', u'custom_debug') result = cli.invoke( ckan, [u'config-tool', str(config_file), u'custom_debug=false']) assert not result.exit_code, result.output assert _parse(config_file).get(u'app:main', u'custom_debug') == u'false' def test_config_custom_section(cli, config_file): """Custom section updated when specified. """ assert _parse(config_file).get(u'server:main', u'port') == u'5000' result = cli.invoke(ckan, [ u'config-tool', str(config_file), u'-s', u'server:main', u'port=8000' ]) assert not result.exit_code, result.output assert _parse(config_file).get(u'server:main', u'port') == u'8000' def test_merge_into_new_file(cli, config_file, tmp_path): """New file can be created without updating old one. """ dest = tmp_path / u'new_config.ini' dest.touch() assert _parse(config_file).get(u'app:main', u'debug') == u'true' result = cli.invoke( ckan, [u'config-tool', str(dest), u'-f', str(config_file), u'debug=false']) assert not result.exit_code, result.output assert _parse(config_file).get(u'app:main', u'debug') == u'true' assert _parse(dest).get(u'app:main', u'debug') == u'false'
29.988095
76
0.653831
import os import pytest from ckan.cli.cli import ckan from configparser import ConfigParser, NoOptionError @pytest.fixture def config_file(tmp_path): dest = tmp_path / u'config.ini' tpl = os.path.join( os.path.dirname(__file__), u'templates/config_tool.ini.tpl') with open(tpl, u'rb') as data: dest.write_bytes(data.read()) return dest def _parse(config_file): parser = ConfigParser() parser.read([str(config_file)]) return parser def test_config_no_params(cli, config_file): result = cli.invoke(ckan, [u'config-tool', str(config_file)]) assert result.exit_code def test_config_unset_debug(cli, config_file): assert _parse(config_file).get(u'app:main', u'debug') == u'true' result = cli.invoke( ckan, [u'config-tool', str(config_file), u'debug=false'] ) assert not result.exit_code, result.output assert _parse(config_file).get(u'app:main', u'debug') == u'false' def test_config_create_custom_debug(cli, config_file): with pytest.raises(NoOptionError): _parse(config_file).get(u'app:main', u'custom_debug') result = cli.invoke( ckan, [u'config-tool', str(config_file), u'custom_debug=false']) assert not result.exit_code, result.output assert _parse(config_file).get(u'app:main', u'custom_debug') == u'false' def test_config_custom_section(cli, config_file): assert _parse(config_file).get(u'server:main', u'port') == u'5000' result = cli.invoke(ckan, [ u'config-tool', str(config_file), u'-s', u'server:main', u'port=8000' ]) assert not result.exit_code, result.output assert _parse(config_file).get(u'server:main', u'port') == u'8000' def test_merge_into_new_file(cli, config_file, tmp_path): dest = tmp_path / u'new_config.ini' dest.touch() assert _parse(config_file).get(u'app:main', u'debug') == u'true' result = cli.invoke( ckan, [u'config-tool', str(dest), u'-f', str(config_file), u'debug=false']) assert not result.exit_code, result.output assert _parse(config_file).get(u'app:main', u'debug') == u'true' assert _parse(dest).get(u'app:main', u'debug') == u'false'
true
true
f72badfdcc7c9b8294a786b553d4648ee517ad6c
12,634
py
Python
tests/python/pants_test/util/test_contextutil.py
ghthor/pants
450de702414f87f563081ddefaefd8a554de07a3
[ "Apache-2.0" ]
null
null
null
tests/python/pants_test/util/test_contextutil.py
ghthor/pants
450de702414f87f563081ddefaefd8a554de07a3
[ "Apache-2.0" ]
null
null
null
tests/python/pants_test/util/test_contextutil.py
ghthor/pants
450de702414f87f563081ddefaefd8a554de07a3
[ "Apache-2.0" ]
null
null
null
# coding=utf-8 # Copyright 2014 Pants project contributors (see CONTRIBUTORS.md). # Licensed under the Apache License, Version 2.0 (see LICENSE). from __future__ import absolute_import, division, print_function, unicode_literals import os import pstats import shutil import signal import sys import unittest import uuid import zipfile from builtins import next, object, range, str from contextlib import contextmanager import mock from pants.util.contextutil import (HardSystemExit, InvalidZipPath, Timer, environment_as, exception_logging, hard_exit_handler, hermetic_environment_as, maybe_profiled, open_zip, pushd, signal_handler_as, stdio_as, temporary_dir, temporary_file) from pants.util.process_handler import subprocess PATCH_OPTS = dict(autospec=True, spec_set=True) class ContextutilTest(unittest.TestCase): def test_empty_environment(self): with environment_as(): pass def test_override_single_variable(self): with temporary_file() as output: # test that the override takes place with environment_as(HORK='BORK'): subprocess.Popen([sys.executable, '-c', 'import os; print(os.environ["HORK"])'], stdout=output).wait() output.seek(0) self.assertEquals('BORK\n', output.read()) # test that the variable is cleared with temporary_file() as new_output: subprocess.Popen([sys.executable, '-c', 'import os; print("HORK" in os.environ)'], stdout=new_output).wait() new_output.seek(0) self.assertEquals('False\n', new_output.read()) def test_environment_negation(self): with temporary_file() as output: with environment_as(HORK='BORK'): with environment_as(HORK=None): # test that the variable is cleared subprocess.Popen([sys.executable, '-c', 'import os; print("HORK" in os.environ)'], stdout=output).wait() output.seek(0) self.assertEquals('False\n', output.read()) def test_hermetic_environment(self): self.assertIn('USER', os.environ) with hermetic_environment_as(**{}): self.assertNotIn('USER', os.environ) def test_hermetic_environment_subprocesses(self): self.assertIn('USER', os.environ) with hermetic_environment_as(**dict(AAA='333')): output = subprocess.check_output('env', shell=True) self.assertNotIn('USER=', output) self.assertIn('AAA', os.environ) self.assertEquals(os.environ['AAA'], '333') self.assertIn('USER', os.environ) self.assertNotIn('AAA', os.environ) def test_hermetic_environment_unicode(self): UNICODE_CHAR = '¡' ENCODED_CHAR = UNICODE_CHAR.encode('utf-8') with environment_as(**dict(XXX=UNICODE_CHAR)): self.assertEquals(os.environ['XXX'], ENCODED_CHAR) with hermetic_environment_as(**dict(AAA=UNICODE_CHAR)): self.assertIn('AAA', os.environ) self.assertEquals(os.environ['AAA'], ENCODED_CHAR) self.assertEquals(os.environ['XXX'], ENCODED_CHAR) def test_simple_pushd(self): pre_cwd = os.getcwd() with temporary_dir() as tempdir: with pushd(tempdir) as path: self.assertEquals(tempdir, path) self.assertEquals(os.path.realpath(tempdir), os.getcwd()) self.assertEquals(pre_cwd, os.getcwd()) self.assertEquals(pre_cwd, os.getcwd()) def test_nested_pushd(self): pre_cwd = os.getcwd() with temporary_dir() as tempdir1: with pushd(tempdir1): self.assertEquals(os.path.realpath(tempdir1), os.getcwd()) with temporary_dir(root_dir=tempdir1) as tempdir2: with pushd(tempdir2): self.assertEquals(os.path.realpath(tempdir2), os.getcwd()) self.assertEquals(os.path.realpath(tempdir1), os.getcwd()) self.assertEquals(os.path.realpath(tempdir1), os.getcwd()) self.assertEquals(pre_cwd, os.getcwd()) self.assertEquals(pre_cwd, os.getcwd()) def test_temporary_file_no_args(self): with temporary_file() as fp: self.assertTrue(os.path.exists(fp.name), 'Temporary file should exist within the context.') self.assertTrue(os.path.exists(fp.name) == False, 'Temporary file should not exist outside of the context.') def test_temporary_file_without_cleanup(self): with temporary_file(cleanup=False) as fp: self.assertTrue(os.path.exists(fp.name), 'Temporary file should exist within the context.') self.assertTrue(os.path.exists(fp.name), 'Temporary file should exist outside of context if cleanup=False.') os.unlink(fp.name) def test_temporary_file_within_other_dir(self): with temporary_dir() as path: with temporary_file(root_dir=path) as f: self.assertTrue(os.path.realpath(f.name).startswith(os.path.realpath(path)), 'file should be created in root_dir if specified.') def test_temporary_dir_no_args(self): with temporary_dir() as path: self.assertTrue(os.path.exists(path), 'Temporary dir should exist within the context.') self.assertTrue(os.path.isdir(path), 'Temporary dir should be a dir and not a file.') self.assertFalse(os.path.exists(path), 'Temporary dir should not exist outside of the context.') def test_temporary_dir_without_cleanup(self): with temporary_dir(cleanup=False) as path: self.assertTrue(os.path.exists(path), 'Temporary dir should exist within the context.') self.assertTrue(os.path.exists(path), 'Temporary dir should exist outside of context if cleanup=False.') shutil.rmtree(path) def test_temporary_dir_with_root_dir(self): with temporary_dir() as path1: with temporary_dir(root_dir=path1) as path2: self.assertTrue(os.path.realpath(path2).startswith(os.path.realpath(path1)), 'Nested temporary dir should be created within outer dir.') def test_timer(self): class FakeClock(object): def __init__(self): self._time = 0.0 def time(self): ret = self._time self._time += 0.0001 # Force a little time to elapse. return ret def sleep(self, duration): self._time += duration clock = FakeClock() # Note: to test with the real system clock, use this instead: # import time # clock = time with Timer(clock=clock) as t: self.assertLess(t.start, clock.time()) self.assertGreater(t.elapsed, 0) clock.sleep(0.1) self.assertGreater(t.elapsed, 0.1) clock.sleep(0.1) self.assertTrue(t.finish is None) self.assertGreater(t.elapsed, 0.2) self.assertLess(t.finish, clock.time()) def test_open_zipDefault(self): with temporary_dir() as tempdir: with open_zip(os.path.join(tempdir, 'test'), 'w') as zf: self.assertTrue(zf._allowZip64) def test_open_zipTrue(self): with temporary_dir() as tempdir: with open_zip(os.path.join(tempdir, 'test'), 'w', allowZip64=True) as zf: self.assertTrue(zf._allowZip64) def test_open_zipFalse(self): with temporary_dir() as tempdir: with open_zip(os.path.join(tempdir, 'test'), 'w', allowZip64=False) as zf: self.assertFalse(zf._allowZip64) def test_open_zip_raises_exception_on_falsey_paths(self): falsey = (None, '', False) for invalid in falsey: with self.assertRaises(InvalidZipPath): next(open_zip(invalid).gen) def test_open_zip_returns_realpath_on_badzipfile(self): # In case of file corruption, deleting a Pants-constructed symlink would not resolve the error. with temporary_file() as not_zip: with temporary_dir() as tempdir: file_symlink = os.path.join(tempdir, 'foo') os.symlink(not_zip.name, file_symlink) self.assertEquals(os.path.realpath(file_symlink), os.path.realpath(not_zip.name)) with self.assertRaisesRegexp(zipfile.BadZipfile, r'{}'.format(not_zip.name)): next(open_zip(file_symlink).gen) @contextmanager def _stdio_as_tempfiles(self): """Harness to replace `sys.std*` with tempfiles. Validates that all files are read/written/flushed correctly, and acts as a contextmanager to allow for recursive tests. """ # Prefix contents written within this instance with a unique string to differentiate # them from other instances. uuid_str = str(uuid.uuid4()) def u(string): return '{}#{}'.format(uuid_str, string) stdin_data = u('stdio') stdout_data = u('stdout') stderr_data = u('stderr') with temporary_file() as tmp_stdin,\ temporary_file() as tmp_stdout,\ temporary_file() as tmp_stderr: print(stdin_data, file=tmp_stdin) tmp_stdin.seek(0) # Read prepared content from stdin, and write content to stdout/stderr. with stdio_as(stdout_fd=tmp_stdout.fileno(), stderr_fd=tmp_stderr.fileno(), stdin_fd=tmp_stdin.fileno()): self.assertEquals(sys.stdin.fileno(), 0) self.assertEquals(sys.stdout.fileno(), 1) self.assertEquals(sys.stderr.fileno(), 2) self.assertEquals(stdin_data, sys.stdin.read().strip()) print(stdout_data, file=sys.stdout) yield print(stderr_data, file=sys.stderr) tmp_stdout.seek(0) tmp_stderr.seek(0) self.assertEquals(stdout_data, tmp_stdout.read().strip()) self.assertEquals(stderr_data, tmp_stderr.read().strip()) def test_stdio_as(self): self.assertTrue(sys.stderr.fileno() > 2, "Expected a pseudofile as stderr, got: {}".format(sys.stderr)) old_stdout, old_stderr, old_stdin = sys.stdout, sys.stderr, sys.stdin # The first level tests that when `sys.std*` are file-likes (in particular, the ones set up in # pytest's harness) rather than actual files, we stash and restore them properly. with self._stdio_as_tempfiles(): # The second level stashes the first level's actual file objects and then re-opens them. with self._stdio_as_tempfiles(): pass # Validate that after the second level completes, the first level still sees valid # fds on `sys.std*`. self.assertEquals(sys.stdin.fileno(), 0) self.assertEquals(sys.stdout.fileno(), 1) self.assertEquals(sys.stderr.fileno(), 2) self.assertEquals(sys.stdout, old_stdout) self.assertEquals(sys.stderr, old_stderr) self.assertEquals(sys.stdin, old_stdin) def test_stdio_as_dev_null(self): # Capture output to tempfiles. with self._stdio_as_tempfiles(): # Read/write from/to `/dev/null`, which will be validated by the harness as not # affecting the tempfiles. with stdio_as(stdout_fd=-1, stderr_fd=-1, stdin_fd=-1): self.assertEquals(b'', sys.stdin.read()) print('garbage', file=sys.stdout) print('garbage', file=sys.stderr) def test_signal_handler_as(self): mock_initial_handler = 1 mock_new_handler = 2 with mock.patch('signal.signal', **PATCH_OPTS) as mock_signal: mock_signal.return_value = mock_initial_handler try: with signal_handler_as(signal.SIGUSR2, mock_new_handler): raise NotImplementedError('blah') except NotImplementedError: pass self.assertEquals(mock_signal.call_count, 2) mock_signal.assert_has_calls([ mock.call(signal.SIGUSR2, mock_new_handler), mock.call(signal.SIGUSR2, mock_initial_handler) ]) def test_permissions(self): with temporary_file(permissions=0o700) as f: self.assertEquals(0o700, os.stat(f.name)[0] & 0o777) with temporary_dir(permissions=0o644) as path: self.assertEquals(0o644, os.stat(path)[0] & 0o777) def test_exception_logging(self): fake_logger = mock.Mock() with self.assertRaises(AssertionError): with exception_logging(fake_logger, 'error!'): assert True is False fake_logger.exception.assert_called_once_with('error!') def test_maybe_profiled(self): with temporary_dir() as td: profile_path = os.path.join(td, 'profile.prof') with maybe_profiled(profile_path): for _ in range(5): print('test') # Ensure the profile data was written. self.assertTrue(os.path.exists(profile_path)) # Ensure the profile data is valid. pstats.Stats(profile_path).print_stats() def test_hard_exit_handler(self): with mock.patch('os._exit', **PATCH_OPTS) as mock_exit: with hard_exit_handler(): raise HardSystemExit() mock_exit.assert_called_once_with(0)
37.93994
100
0.679516
from __future__ import absolute_import, division, print_function, unicode_literals import os import pstats import shutil import signal import sys import unittest import uuid import zipfile from builtins import next, object, range, str from contextlib import contextmanager import mock from pants.util.contextutil import (HardSystemExit, InvalidZipPath, Timer, environment_as, exception_logging, hard_exit_handler, hermetic_environment_as, maybe_profiled, open_zip, pushd, signal_handler_as, stdio_as, temporary_dir, temporary_file) from pants.util.process_handler import subprocess PATCH_OPTS = dict(autospec=True, spec_set=True) class ContextutilTest(unittest.TestCase): def test_empty_environment(self): with environment_as(): pass def test_override_single_variable(self): with temporary_file() as output: with environment_as(HORK='BORK'): subprocess.Popen([sys.executable, '-c', 'import os; print(os.environ["HORK"])'], stdout=output).wait() output.seek(0) self.assertEquals('BORK\n', output.read()) with temporary_file() as new_output: subprocess.Popen([sys.executable, '-c', 'import os; print("HORK" in os.environ)'], stdout=new_output).wait() new_output.seek(0) self.assertEquals('False\n', new_output.read()) def test_environment_negation(self): with temporary_file() as output: with environment_as(HORK='BORK'): with environment_as(HORK=None): subprocess.Popen([sys.executable, '-c', 'import os; print("HORK" in os.environ)'], stdout=output).wait() output.seek(0) self.assertEquals('False\n', output.read()) def test_hermetic_environment(self): self.assertIn('USER', os.environ) with hermetic_environment_as(**{}): self.assertNotIn('USER', os.environ) def test_hermetic_environment_subprocesses(self): self.assertIn('USER', os.environ) with hermetic_environment_as(**dict(AAA='333')): output = subprocess.check_output('env', shell=True) self.assertNotIn('USER=', output) self.assertIn('AAA', os.environ) self.assertEquals(os.environ['AAA'], '333') self.assertIn('USER', os.environ) self.assertNotIn('AAA', os.environ) def test_hermetic_environment_unicode(self): UNICODE_CHAR = '¡' ENCODED_CHAR = UNICODE_CHAR.encode('utf-8') with environment_as(**dict(XXX=UNICODE_CHAR)): self.assertEquals(os.environ['XXX'], ENCODED_CHAR) with hermetic_environment_as(**dict(AAA=UNICODE_CHAR)): self.assertIn('AAA', os.environ) self.assertEquals(os.environ['AAA'], ENCODED_CHAR) self.assertEquals(os.environ['XXX'], ENCODED_CHAR) def test_simple_pushd(self): pre_cwd = os.getcwd() with temporary_dir() as tempdir: with pushd(tempdir) as path: self.assertEquals(tempdir, path) self.assertEquals(os.path.realpath(tempdir), os.getcwd()) self.assertEquals(pre_cwd, os.getcwd()) self.assertEquals(pre_cwd, os.getcwd()) def test_nested_pushd(self): pre_cwd = os.getcwd() with temporary_dir() as tempdir1: with pushd(tempdir1): self.assertEquals(os.path.realpath(tempdir1), os.getcwd()) with temporary_dir(root_dir=tempdir1) as tempdir2: with pushd(tempdir2): self.assertEquals(os.path.realpath(tempdir2), os.getcwd()) self.assertEquals(os.path.realpath(tempdir1), os.getcwd()) self.assertEquals(os.path.realpath(tempdir1), os.getcwd()) self.assertEquals(pre_cwd, os.getcwd()) self.assertEquals(pre_cwd, os.getcwd()) def test_temporary_file_no_args(self): with temporary_file() as fp: self.assertTrue(os.path.exists(fp.name), 'Temporary file should exist within the context.') self.assertTrue(os.path.exists(fp.name) == False, 'Temporary file should not exist outside of the context.') def test_temporary_file_without_cleanup(self): with temporary_file(cleanup=False) as fp: self.assertTrue(os.path.exists(fp.name), 'Temporary file should exist within the context.') self.assertTrue(os.path.exists(fp.name), 'Temporary file should exist outside of context if cleanup=False.') os.unlink(fp.name) def test_temporary_file_within_other_dir(self): with temporary_dir() as path: with temporary_file(root_dir=path) as f: self.assertTrue(os.path.realpath(f.name).startswith(os.path.realpath(path)), 'file should be created in root_dir if specified.') def test_temporary_dir_no_args(self): with temporary_dir() as path: self.assertTrue(os.path.exists(path), 'Temporary dir should exist within the context.') self.assertTrue(os.path.isdir(path), 'Temporary dir should be a dir and not a file.') self.assertFalse(os.path.exists(path), 'Temporary dir should not exist outside of the context.') def test_temporary_dir_without_cleanup(self): with temporary_dir(cleanup=False) as path: self.assertTrue(os.path.exists(path), 'Temporary dir should exist within the context.') self.assertTrue(os.path.exists(path), 'Temporary dir should exist outside of context if cleanup=False.') shutil.rmtree(path) def test_temporary_dir_with_root_dir(self): with temporary_dir() as path1: with temporary_dir(root_dir=path1) as path2: self.assertTrue(os.path.realpath(path2).startswith(os.path.realpath(path1)), 'Nested temporary dir should be created within outer dir.') def test_timer(self): class FakeClock(object): def __init__(self): self._time = 0.0 def time(self): ret = self._time self._time += 0.0001 return ret def sleep(self, duration): self._time += duration clock = FakeClock() with Timer(clock=clock) as t: self.assertLess(t.start, clock.time()) self.assertGreater(t.elapsed, 0) clock.sleep(0.1) self.assertGreater(t.elapsed, 0.1) clock.sleep(0.1) self.assertTrue(t.finish is None) self.assertGreater(t.elapsed, 0.2) self.assertLess(t.finish, clock.time()) def test_open_zipDefault(self): with temporary_dir() as tempdir: with open_zip(os.path.join(tempdir, 'test'), 'w') as zf: self.assertTrue(zf._allowZip64) def test_open_zipTrue(self): with temporary_dir() as tempdir: with open_zip(os.path.join(tempdir, 'test'), 'w', allowZip64=True) as zf: self.assertTrue(zf._allowZip64) def test_open_zipFalse(self): with temporary_dir() as tempdir: with open_zip(os.path.join(tempdir, 'test'), 'w', allowZip64=False) as zf: self.assertFalse(zf._allowZip64) def test_open_zip_raises_exception_on_falsey_paths(self): falsey = (None, '', False) for invalid in falsey: with self.assertRaises(InvalidZipPath): next(open_zip(invalid).gen) def test_open_zip_returns_realpath_on_badzipfile(self): with temporary_file() as not_zip: with temporary_dir() as tempdir: file_symlink = os.path.join(tempdir, 'foo') os.symlink(not_zip.name, file_symlink) self.assertEquals(os.path.realpath(file_symlink), os.path.realpath(not_zip.name)) with self.assertRaisesRegexp(zipfile.BadZipfile, r'{}'.format(not_zip.name)): next(open_zip(file_symlink).gen) @contextmanager def _stdio_as_tempfiles(self): uuid_str = str(uuid.uuid4()) def u(string): return '{}#{}'.format(uuid_str, string) stdin_data = u('stdio') stdout_data = u('stdout') stderr_data = u('stderr') with temporary_file() as tmp_stdin,\ temporary_file() as tmp_stdout,\ temporary_file() as tmp_stderr: print(stdin_data, file=tmp_stdin) tmp_stdin.seek(0) with stdio_as(stdout_fd=tmp_stdout.fileno(), stderr_fd=tmp_stderr.fileno(), stdin_fd=tmp_stdin.fileno()): self.assertEquals(sys.stdin.fileno(), 0) self.assertEquals(sys.stdout.fileno(), 1) self.assertEquals(sys.stderr.fileno(), 2) self.assertEquals(stdin_data, sys.stdin.read().strip()) print(stdout_data, file=sys.stdout) yield print(stderr_data, file=sys.stderr) tmp_stdout.seek(0) tmp_stderr.seek(0) self.assertEquals(stdout_data, tmp_stdout.read().strip()) self.assertEquals(stderr_data, tmp_stderr.read().strip()) def test_stdio_as(self): self.assertTrue(sys.stderr.fileno() > 2, "Expected a pseudofile as stderr, got: {}".format(sys.stderr)) old_stdout, old_stderr, old_stdin = sys.stdout, sys.stderr, sys.stdin with self._stdio_as_tempfiles(): # The second level stashes the first level's actual file objects and then re-opens them. with self._stdio_as_tempfiles(): pass self.assertEquals(sys.stdin.fileno(), 0) self.assertEquals(sys.stdout.fileno(), 1) self.assertEquals(sys.stderr.fileno(), 2) self.assertEquals(sys.stdout, old_stdout) self.assertEquals(sys.stderr, old_stderr) self.assertEquals(sys.stdin, old_stdin) def test_stdio_as_dev_null(self): with self._stdio_as_tempfiles(): with stdio_as(stdout_fd=-1, stderr_fd=-1, stdin_fd=-1): self.assertEquals(b'', sys.stdin.read()) print('garbage', file=sys.stdout) print('garbage', file=sys.stderr) def test_signal_handler_as(self): mock_initial_handler = 1 mock_new_handler = 2 with mock.patch('signal.signal', **PATCH_OPTS) as mock_signal: mock_signal.return_value = mock_initial_handler try: with signal_handler_as(signal.SIGUSR2, mock_new_handler): raise NotImplementedError('blah') except NotImplementedError: pass self.assertEquals(mock_signal.call_count, 2) mock_signal.assert_has_calls([ mock.call(signal.SIGUSR2, mock_new_handler), mock.call(signal.SIGUSR2, mock_initial_handler) ]) def test_permissions(self): with temporary_file(permissions=0o700) as f: self.assertEquals(0o700, os.stat(f.name)[0] & 0o777) with temporary_dir(permissions=0o644) as path: self.assertEquals(0o644, os.stat(path)[0] & 0o777) def test_exception_logging(self): fake_logger = mock.Mock() with self.assertRaises(AssertionError): with exception_logging(fake_logger, 'error!'): assert True is False fake_logger.exception.assert_called_once_with('error!') def test_maybe_profiled(self): with temporary_dir() as td: profile_path = os.path.join(td, 'profile.prof') with maybe_profiled(profile_path): for _ in range(5): print('test') self.assertTrue(os.path.exists(profile_path)) pstats.Stats(profile_path).print_stats() def test_hard_exit_handler(self): with mock.patch('os._exit', **PATCH_OPTS) as mock_exit: with hard_exit_handler(): raise HardSystemExit() mock_exit.assert_called_once_with(0)
true
true
f72bae6a1e0213eb229c54b75687299a18759829
1,090
py
Python
IntroProPython/aula10-poo/ex10_9.py
SweydAbdul/estudos-python
b052708d0566a0afb9a1c04d035467d45f820879
[ "MIT" ]
null
null
null
IntroProPython/aula10-poo/ex10_9.py
SweydAbdul/estudos-python
b052708d0566a0afb9a1c04d035467d45f820879
[ "MIT" ]
null
null
null
IntroProPython/aula10-poo/ex10_9.py
SweydAbdul/estudos-python
b052708d0566a0afb9a1c04d035467d45f820879
[ "MIT" ]
null
null
null
#Nilo soluction class Estado: def __init__(self, nome, sigla): self.nome = nome self.sigla = sigla self.cidades = [] def adiciona_cidades(self, cidade): cidade.estado = self self.cidades.append(cidade) def populacao(self): return sum([c.populacao for c in self.cidades]) class Cidade: def __init__(self, nome, populacao): self.nome = nome self.populacao = populacao self.estado = None def __str__(self): return f'''Cidade (nome={self.nome}, populacao={self.populacao}, estado={self.estado})''' # Populacoes obtidas no site da wikipedia # IBGE estimativa 2012 am = Estado('Amazonas', 'AM') am.adiciona_cidades(Cidade('manaus', 1861838)) am.adiciona_cidades(Cidade('Parintins', 103828)) am.adiciona_cidades(Cidade('Itacoatiara', 89064)) for estado in [am]: print(f'Estado: {estado.nome} Sigla: {estado.sigla}') for cidade in estado.cidades: print(f'Cidade: {cidade.nome}, Populacao: {cidade.populacao}') print(f'Populacaodo Estado: {estado.populacao()}\n')
28.684211
72
0.655963
class Estado: def __init__(self, nome, sigla): self.nome = nome self.sigla = sigla self.cidades = [] def adiciona_cidades(self, cidade): cidade.estado = self self.cidades.append(cidade) def populacao(self): return sum([c.populacao for c in self.cidades]) class Cidade: def __init__(self, nome, populacao): self.nome = nome self.populacao = populacao self.estado = None def __str__(self): return f'''Cidade (nome={self.nome}, populacao={self.populacao}, estado={self.estado})''' am = Estado('Amazonas', 'AM') am.adiciona_cidades(Cidade('manaus', 1861838)) am.adiciona_cidades(Cidade('Parintins', 103828)) am.adiciona_cidades(Cidade('Itacoatiara', 89064)) for estado in [am]: print(f'Estado: {estado.nome} Sigla: {estado.sigla}') for cidade in estado.cidades: print(f'Cidade: {cidade.nome}, Populacao: {cidade.populacao}') print(f'Populacaodo Estado: {estado.populacao()}\n')
true
true
f72baec4eeaab524e7f16dca567ab548d635f3bb
3,949
py
Python
samples/basic/crud/models/cisco-ios-xr/Cisco-IOS-XR-shellutil-oper/nc-read-xr-shellutil-oper-20-ydk.py
maccioni/ydk-py-samples
d1758694bef97327c5477e65649326c7595ce499
[ "Apache-2.0" ]
104
2016-03-15T17:04:01.000Z
2021-12-31T06:09:35.000Z
samples/basic/crud/models/cisco-ios-xr/Cisco-IOS-XR-shellutil-oper/nc-read-xr-shellutil-oper-20-ydk.py
https-maxus-github-com/ydk-py-samples
1ad6cc2b798f358ff835df93d12924df308b85fc
[ "Apache-2.0" ]
15
2016-03-15T23:09:47.000Z
2020-08-13T12:13:18.000Z
samples/basic/crud/models/cisco-ios-xr/Cisco-IOS-XR-shellutil-oper/nc-read-xr-shellutil-oper-20-ydk.py
https-maxus-github-com/ydk-py-samples
1ad6cc2b798f358ff835df93d12924df308b85fc
[ "Apache-2.0" ]
87
2016-04-15T16:59:23.000Z
2021-09-18T18:05:47.000Z
#!/usr/bin/env python # # Copyright 2016 Cisco Systems, Inc. # # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. # """ Read all data for model Cisco-IOS-XR-shellutil-oper. usage: nc-read-xr-shellutil-oper-20-ydk.py [-h] [-v] device positional arguments: device NETCONF device (ssh://user:password@host:port) optional arguments: -h, --help show this help message and exit -v, --verbose print debugging messages """ from argparse import ArgumentParser from urlparse import urlparse from ydk.services import CRUDService from ydk.providers import NetconfServiceProvider from ydk.models.cisco_ios_xr import Cisco_IOS_XR_shellutil_oper \ as xr_shellutil_oper import datetime import textwrap import logging def process_system_time(system_time): """Process data in system_time object.""" # format string for system time show_system_time = textwrap.dedent(""" Host: {host} System time: {time} {tzone} {date} Time source: {source} System uptime: {uptime} """).strip() # create time object clock_time = datetime.time(system_time.clock.hour, system_time.clock.minute, system_time.clock.second, system_time.clock.millisecond / 1000) # create date object clock_date = datetime.date(system_time.clock.year, system_time.clock.month, system_time.clock.day) # convert uptime from seconds clock_delta = datetime.timedelta(seconds=system_time.uptime.uptime) # return formatted string return(show_system_time.format(host=system_time.uptime.host_name, time=clock_time, tzone=system_time.clock.time_zone, date=clock_date, source=system_time.clock.time_source.name, uptime=clock_delta)) if __name__ == "__main__": """Execute main program.""" parser = ArgumentParser() parser.add_argument("-v", "--verbose", help="print debugging messages", action="store_true") parser.add_argument("device", help="NETCONF device (ssh://user:password@host:port)") args = parser.parse_args() device = urlparse(args.device) # log debug messages if verbose argument specified if args.verbose: logger = logging.getLogger("ydk") logger.setLevel(logging.INFO) handler = logging.StreamHandler() formatter = logging.Formatter(("%(asctime)s - %(name)s - " "%(levelname)s - %(message)s")) handler.setFormatter(formatter) logger.addHandler(handler) # create NETCONF provider provider = NetconfServiceProvider(address=device.hostname, port=device.port, username=device.username, password=device.password, protocol=device.scheme) # create CRUD service crud = CRUDService() system_time = xr_shellutil_oper.SystemTime() # create object # read data from NETCONF device system_time = crud.read(provider, system_time) print(process_system_time(system_time)) # process object data exit() # End of script
34.946903
78
0.622436
from argparse import ArgumentParser from urlparse import urlparse from ydk.services import CRUDService from ydk.providers import NetconfServiceProvider from ydk.models.cisco_ios_xr import Cisco_IOS_XR_shellutil_oper \ as xr_shellutil_oper import datetime import textwrap import logging def process_system_time(system_time): show_system_time = textwrap.dedent(""" Host: {host} System time: {time} {tzone} {date} Time source: {source} System uptime: {uptime} """).strip() clock_time = datetime.time(system_time.clock.hour, system_time.clock.minute, system_time.clock.second, system_time.clock.millisecond / 1000) clock_date = datetime.date(system_time.clock.year, system_time.clock.month, system_time.clock.day) clock_delta = datetime.timedelta(seconds=system_time.uptime.uptime) return(show_system_time.format(host=system_time.uptime.host_name, time=clock_time, tzone=system_time.clock.time_zone, date=clock_date, source=system_time.clock.time_source.name, uptime=clock_delta)) if __name__ == "__main__": parser = ArgumentParser() parser.add_argument("-v", "--verbose", help="print debugging messages", action="store_true") parser.add_argument("device", help="NETCONF device (ssh://user:password@host:port)") args = parser.parse_args() device = urlparse(args.device) if args.verbose: logger = logging.getLogger("ydk") logger.setLevel(logging.INFO) handler = logging.StreamHandler() formatter = logging.Formatter(("%(asctime)s - %(name)s - " "%(levelname)s - %(message)s")) handler.setFormatter(formatter) logger.addHandler(handler) provider = NetconfServiceProvider(address=device.hostname, port=device.port, username=device.username, password=device.password, protocol=device.scheme) crud = CRUDService() system_time = xr_shellutil_oper.SystemTime() system_time = crud.read(provider, system_time) print(process_system_time(system_time)) exit()
true
true
f72baf0f5132719036a4523e688ff00bace31589
6,130
py
Python
scrape_mars.py
darrenluc93/web-scraping-challenge
50a9a21161ab0920038c8e0d6a9390bb8e35c5f5
[ "ADSL" ]
null
null
null
scrape_mars.py
darrenluc93/web-scraping-challenge
50a9a21161ab0920038c8e0d6a9390bb8e35c5f5
[ "ADSL" ]
null
null
null
scrape_mars.py
darrenluc93/web-scraping-challenge
50a9a21161ab0920038c8e0d6a9390bb8e35c5f5
[ "ADSL" ]
null
null
null
#Import Libraries #Web Scraping tools from bs4 import BeautifulSoup as bs from selenium import webdriver #from splinter import Browser #DataFrame tools import pandas as pd #Misc tools for web scraping import time import requests #Function to initianilze browser. def init_browser(): #Settings for headless mode. options = webdriver.ChromeOptions() options.add_argument('headless') #path to the driver and load the options. browser = webdriver.Chrome("/usr/local/bin/chromedriver",chrome_options = options) #returns the brower. return browser def scrapper(): #Call browser function browser = init_browser() #Dictionary to store all the results. marsInfo_dict = {} #Code to get NASA Mars News ---------------------------------------------------------------------------------------------- try: url = "https://mars.nasa.gov/news/?page=0&per_page=40&order=publish_date+desc%2Ccreated_at+desc&search=&year=2020%3Apublish_date&category=19%2C165%2C184%2C204&blank_scope=Latest" #splinter option - open url #browser.visit(url) #Open url. browser.get(url) #Time to let the website load all the elements time.sleep(4) #splinter option - save HTML #html = browser.html #save the html source. html = browser.page_source #Use bs4 to parse the html response. soup = bs(html, "html.parser") #Collect the latest news title news_title = soup.find_all('li', class_="slide")[0].find(class_="content_title").text news_p = soup.find_all('li', class_="slide")[0].text marsInfo_dict['news_title'] = news_title marsInfo_dict['news_p'] = news_p except : print(f"Problem at website {url}") #Code to get JPL Mars Space Images - Featured Image --------------------------------------------------------------------------------- try: url = "https://www.jpl.nasa.gov/spaceimages/?search=&category=Mars" #splinter option - open url #browser.visit(url) #Opens the url. browser.get(url) #splinter option - FULL IMAGE BUTTON #browser.click_link_by_id("full_image") #Interact with the FULL IMAGE BUTTON browser.find_element_by_id("full_image").click() time.sleep(4) #splinter option - save HTML #html = browser.html #save the html source. html = browser.page_source #Use bs4 to parse the html response. soup = bs(html, "html.parser") featured_image_url = "https://www.jpl.nasa.gov/" + soup.find_all('img', class_="fancybox-image")[0]['src'] marsInfo_dict['featured_image_url'] = featured_image_url except : print(f"Problem at website {url}") #Mars Weather ------------------------------------------------------------------------------------------------------------------------ try: url = "https://twitter.com/marswxreport?lang=en" #splinter option - open url #browser.visit(url) #Open the url. browser.get(url) #Time to let the website load all the elements time.sleep(4) #splinter option - save HTML #html = browser.html #save the html source. html = browser.page_source #Use bs4 to parse the html response. soup = bs(html, "html.parser") mars_weather = soup.find_all('article', class_="css-1dbjc4n r-1loqt21 r-18u37iz r-1ny4l3l r-o7ynqc r-6416eg")[0].text.strip().replace('Mars Weather@MarsWxReport·19hInSight ','') marsInfo_dict['mars_weather'] = mars_weather except : print(mars_weather) print(f"Problem at website {url}") # Mars Facts-------------------------------------------------------------------------------------------------------------------------------------------------------------------------------- try: url = 'http://space-facts.com/mars/' #Load url to pandas read html. tables = pd.read_html(url) #Tables marsFacts_df = tables[0] earthMars_df = tables[1] #Rename columns marsFacts_df.columns = ['Facts', 'Values'] #Outpout html_outputFacts = marsFacts_df.to_html(index = False) html_outputFacts = html_outputFacts.replace('\n', '') html_outputMarsEarth = earthMars_df.to_html(index = False) html_outputMarsEarth = html_outputMarsEarth.replace('\n', '') marsInfo_dict['html_outputFacts'] = html_outputFacts marsInfo_dict['html_outputMarsEarth'] = html_outputMarsEarth except : print(f"Problem at website {url}") #hemisphereImages ---------------------------------------------------------------------------------------------------------------------------------------------------------------------------- try: temp_list = [] url = "https://astrogeology.usgs.gov/search/results?q=hemisphere+enhanced&k1=target&v1=Mars" #splinter option - open url #browser.visit(url) #Opens the url. browser.get(url) time.sleep(4) #splinter option - save HTML #html = browser.html #save the html source. html = browser.page_source # close web browser browser.close() #Use bs4 to parse the html response. soup = bs(html, "html.parser") links = soup.find_all('div', class_="description") for link in links: highDef_url = f"https://astrogeology.usgs.gov{link.find('a')['href']}" responseHighDef = requests.get(highDef_url) soupHighDef = bs(responseHighDef.text, 'html.parser') highDef_url = soupHighDef.find_all("div", class_="downloads")[0].find('a')['href'] title = link.find('h3').text temp_list.append({"title" : title, "img_url" : highDef_url}) marsInfo_dict['hemisphere_image_urls'] = temp_list except : print(f"Problem at website {url}") return marsInfo_dict
29.471154
194
0.556444
from bs4 import BeautifulSoup as bs from selenium import webdriver import pandas as pd import time import requests def init_browser(): options = webdriver.ChromeOptions() options.add_argument('headless') browser = webdriver.Chrome("/usr/local/bin/chromedriver",chrome_options = options) return browser def scrapper(): browser = init_browser() marsInfo_dict = {} try: url = "https://mars.nasa.gov/news/?page=0&per_page=40&order=publish_date+desc%2Ccreated_at+desc&search=&year=2020%3Apublish_date&category=19%2C165%2C184%2C204&blank_scope=Latest" browser.get(url) time.sleep(4) html = browser.page_source soup = bs(html, "html.parser") news_title = soup.find_all('li', class_="slide")[0].find(class_="content_title").text news_p = soup.find_all('li', class_="slide")[0].text marsInfo_dict['news_title'] = news_title marsInfo_dict['news_p'] = news_p except : print(f"Problem at website {url}") try: url = "https://www.jpl.nasa.gov/spaceimages/?search=&category=Mars" browser.get(url) browser.find_element_by_id("full_image").click() time.sleep(4) html = browser.page_source soup = bs(html, "html.parser") featured_image_url = "https://www.jpl.nasa.gov/" + soup.find_all('img', class_="fancybox-image")[0]['src'] marsInfo_dict['featured_image_url'] = featured_image_url except : print(f"Problem at website {url}") try: url = "https://twitter.com/marswxreport?lang=en" browser.get(url) time.sleep(4) html = browser.page_source soup = bs(html, "html.parser") mars_weather = soup.find_all('article', class_="css-1dbjc4n r-1loqt21 r-18u37iz r-1ny4l3l r-o7ynqc r-6416eg")[0].text.strip().replace('Mars Weather@MarsWxReport·19hInSight ','') marsInfo_dict['mars_weather'] = mars_weather except : print(mars_weather) print(f"Problem at website {url}") try: url = 'http://space-facts.com/mars/' tables = pd.read_html(url) marsFacts_df = tables[0] earthMars_df = tables[1] marsFacts_df.columns = ['Facts', 'Values'] html_outputFacts = marsFacts_df.to_html(index = False) html_outputFacts = html_outputFacts.replace('\n', '') html_outputMarsEarth = earthMars_df.to_html(index = False) html_outputMarsEarth = html_outputMarsEarth.replace('\n', '') marsInfo_dict['html_outputFacts'] = html_outputFacts marsInfo_dict['html_outputMarsEarth'] = html_outputMarsEarth except : print(f"Problem at website {url}") try: temp_list = [] url = "https://astrogeology.usgs.gov/search/results?q=hemisphere+enhanced&k1=target&v1=Mars" browser.get(url) time.sleep(4) html = browser.page_source browser.close() soup = bs(html, "html.parser") links = soup.find_all('div', class_="description") for link in links: highDef_url = f"https://astrogeology.usgs.gov{link.find('a')['href']}" responseHighDef = requests.get(highDef_url) soupHighDef = bs(responseHighDef.text, 'html.parser') highDef_url = soupHighDef.find_all("div", class_="downloads")[0].find('a')['href'] title = link.find('h3').text temp_list.append({"title" : title, "img_url" : highDef_url}) marsInfo_dict['hemisphere_image_urls'] = temp_list except : print(f"Problem at website {url}") return marsInfo_dict
true
true
f72bb0dfab67291261f8d64decce38b078e31dc2
1,812
py
Python
API/client/python-client-generated/test/test_model_flow_chart_node_component_api.py
zhuofusong/machine-fault-diagnosis
4c35885e3fbb3c552f526019313a8eae9df28905
[ "MIT" ]
2
2020-04-30T01:06:55.000Z
2020-06-08T04:11:28.000Z
API/client/python-client-generated/test/test_model_flow_chart_node_component_api.py
zhuofusong/machine-fault-diagnosis
4c35885e3fbb3c552f526019313a8eae9df28905
[ "MIT" ]
5
2020-04-13T14:13:53.000Z
2021-08-24T17:16:30.000Z
API/client/python-client-generated/test/test_model_flow_chart_node_component_api.py
zhuofusong/machine-fault-diagnosis
4c35885e3fbb3c552f526019313a8eae9df28905
[ "MIT" ]
null
null
null
# coding: utf-8 """ Machine fault diagnosis List of top level server APIs # noqa: E501 OpenAPI spec version: 1.0.0 Generated by: https://github.com/swagger-api/swagger-codegen.git """ from __future__ import absolute_import import unittest import swagger_client from api.model_flow_chart_node_component_api import ModelFlowChartNodeComponentApi # noqa: E501 from swagger_client.rest import ApiException class TestModelFlowChartNodeComponentApi(unittest.TestCase): """ModelFlowChartNodeComponentApi unit test stubs""" def setUp(self): self.api = api.model_flow_chart_node_component_api.ModelFlowChartNodeComponentApi() # noqa: E501 def tearDown(self): pass def test_model_flow_node_model_flow_id_node_id_component_delete(self): """Test case for model_flow_node_model_flow_id_node_id_component_delete delete a node's components information in a model flow chart # noqa: E501 """ pass def test_model_flow_node_model_flow_id_node_id_component_get(self): """Test case for model_flow_node_model_flow_id_node_id_component_get retrieve a node's components information in a model flow chart # noqa: E501 """ pass def test_model_flow_node_model_flow_id_node_id_component_post(self): """Test case for model_flow_node_model_flow_id_node_id_component_post create a node's components information in a model flow chart # noqa: E501 """ pass def test_model_flow_node_model_flow_id_node_id_component_put(self): """Test case for model_flow_node_model_flow_id_node_id_component_put update a node's components information in a model flow chart # noqa: E501 """ pass if __name__ == '__main__': unittest.main()
29.225806
105
0.734547
from __future__ import absolute_import import unittest import swagger_client from api.model_flow_chart_node_component_api import ModelFlowChartNodeComponentApi from swagger_client.rest import ApiException class TestModelFlowChartNodeComponentApi(unittest.TestCase): def setUp(self): self.api = api.model_flow_chart_node_component_api.ModelFlowChartNodeComponentApi() def tearDown(self): pass def test_model_flow_node_model_flow_id_node_id_component_delete(self): pass def test_model_flow_node_model_flow_id_node_id_component_get(self): pass def test_model_flow_node_model_flow_id_node_id_component_post(self): pass def test_model_flow_node_model_flow_id_node_id_component_put(self): pass if __name__ == '__main__': unittest.main()
true
true
f72bb188e19f59d4f42c726c98471832b4cf7c08
62
py
Python
run_ai_api.py
datesann0109/D_2117
07a94c65c622cf2aa9f2a852f1f28e647a5823bd
[ "MIT" ]
1
2021-10-19T02:43:30.000Z
2021-10-19T02:43:30.000Z
run_ai_api.py
datesann0109/D_2117
07a94c65c622cf2aa9f2a852f1f28e647a5823bd
[ "MIT" ]
1
2021-10-30T04:46:00.000Z
2021-10-30T04:46:00.000Z
run_ai_api.py
datesann0109/D_2117
07a94c65c622cf2aa9f2a852f1f28e647a5823bd
[ "MIT" ]
2
2021-10-30T22:58:39.000Z
2021-11-01T10:19:45.000Z
from ai.api import main if __name__ == "__main__": main()
15.5
26
0.66129
from ai.api import main if __name__ == "__main__": main()
true
true
f72bb1d1d668b0faf7a48161762de174a03e8bff
154
py
Python
Cours-3/Programmes-Python/M3-2.py
Naereen/Introduction-au-Numerique-avec-Python-dpt-DEM-2020
ee935f67970acbb3c8ba0373f57c21826340c3aa
[ "MIT" ]
1
2020-10-07T19:44:29.000Z
2020-10-07T19:44:29.000Z
Cours-3/Programmes-Python/M3-2.py
Naereen/Introduction-au-Num-rique-avec-Python-dpt-DEM-2020
ee935f67970acbb3c8ba0373f57c21826340c3aa
[ "MIT" ]
null
null
null
Cours-3/Programmes-Python/M3-2.py
Naereen/Introduction-au-Num-rique-avec-Python-dpt-DEM-2020
ee935f67970acbb3c8ba0373f57c21826340c3aa
[ "MIT" ]
null
null
null
somme = 0 n = 5 # valeur quelconque i = 1 while i <= n: somme = somme + i i = i + 1 print("La somme des", n, "premiers entiers est :", somme)
19.25
57
0.558442
somme = 0 n = 5 i = 1 while i <= n: somme = somme + i i = i + 1 print("La somme des", n, "premiers entiers est :", somme)
true
true
f72bb320c80fb2f7343a4f0f36be5c6b322a7a94
107,134
py
Python
bigquery/google/cloud/bigquery/job.py
erikwebb/google-cloud-python
288a878e9a07239015c78a193eca1cc15e926127
[ "Apache-2.0" ]
1
2019-01-23T21:54:51.000Z
2019-01-23T21:54:51.000Z
bigquery/google/cloud/bigquery/job.py
erikwebb/google-cloud-python
288a878e9a07239015c78a193eca1cc15e926127
[ "Apache-2.0" ]
null
null
null
bigquery/google/cloud/bigquery/job.py
erikwebb/google-cloud-python
288a878e9a07239015c78a193eca1cc15e926127
[ "Apache-2.0" ]
1
2020-11-15T11:44:36.000Z
2020-11-15T11:44:36.000Z
# Copyright 2015 Google LLC # # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. """Define API Jobs.""" import copy import threading from six.moves import http_client import google.api_core.future.polling from google.cloud import exceptions from google.cloud.exceptions import NotFound from google.cloud.bigquery.dataset import DatasetReference from google.cloud.bigquery.external_config import ExternalConfig from google.cloud.bigquery.query import _query_param_from_api_repr from google.cloud.bigquery.query import ArrayQueryParameter from google.cloud.bigquery.query import ScalarQueryParameter from google.cloud.bigquery.query import StructQueryParameter from google.cloud.bigquery.query import UDFResource from google.cloud.bigquery.retry import DEFAULT_RETRY from google.cloud.bigquery.schema import SchemaField from google.cloud.bigquery.table import _EmptyRowIterator from google.cloud.bigquery.table import EncryptionConfiguration from google.cloud.bigquery.table import TableReference from google.cloud.bigquery.table import Table from google.cloud.bigquery.table import TimePartitioning from google.cloud.bigquery import _helpers _DONE_STATE = "DONE" _STOPPED_REASON = "stopped" _TIMEOUT_BUFFER_SECS = 0.1 _ERROR_REASON_TO_EXCEPTION = { "accessDenied": http_client.FORBIDDEN, "backendError": http_client.INTERNAL_SERVER_ERROR, "billingNotEnabled": http_client.FORBIDDEN, "billingTierLimitExceeded": http_client.BAD_REQUEST, "blocked": http_client.FORBIDDEN, "duplicate": http_client.CONFLICT, "internalError": http_client.INTERNAL_SERVER_ERROR, "invalid": http_client.BAD_REQUEST, "invalidQuery": http_client.BAD_REQUEST, "notFound": http_client.NOT_FOUND, "notImplemented": http_client.NOT_IMPLEMENTED, "quotaExceeded": http_client.FORBIDDEN, "rateLimitExceeded": http_client.FORBIDDEN, "resourceInUse": http_client.BAD_REQUEST, "resourcesExceeded": http_client.BAD_REQUEST, "responseTooLarge": http_client.FORBIDDEN, "stopped": http_client.OK, "tableUnavailable": http_client.BAD_REQUEST, } def _error_result_to_exception(error_result): """Maps BigQuery error reasons to an exception. The reasons and their matching HTTP status codes are documented on the `troubleshooting errors`_ page. .. _troubleshooting errors: https://cloud.google.com/bigquery\ /troubleshooting-errors :type error_result: Mapping[str, str] :param error_result: The error result from BigQuery. :rtype google.cloud.exceptions.GoogleCloudError: :returns: The mapped exception. """ reason = error_result.get("reason") status_code = _ERROR_REASON_TO_EXCEPTION.get( reason, http_client.INTERNAL_SERVER_ERROR ) return exceptions.from_http_status( status_code, error_result.get("message", ""), errors=[error_result] ) class Compression(object): """The compression type to use for exported files. The default value is :attr:`NONE`. :attr:`DEFLATE` and :attr:`SNAPPY` are only supported for Avro. """ GZIP = "GZIP" """Specifies GZIP format.""" DEFLATE = "DEFLATE" """Specifies DEFLATE format.""" SNAPPY = "SNAPPY" """Specifies SNAPPY format.""" NONE = "NONE" """Specifies no compression.""" class CreateDisposition(object): """Specifies whether the job is allowed to create new tables. The default value is :attr:`CREATE_IF_NEEDED`. Creation, truncation and append actions occur as one atomic update upon job completion. """ CREATE_IF_NEEDED = "CREATE_IF_NEEDED" """If the table does not exist, BigQuery creates the table.""" CREATE_NEVER = "CREATE_NEVER" """The table must already exist. If it does not, a 'notFound' error is returned in the job result.""" class DestinationFormat(object): """The exported file format. The default value is :attr:`CSV`. Tables with nested or repeated fields cannot be exported as CSV. """ CSV = "CSV" """Specifies CSV format.""" NEWLINE_DELIMITED_JSON = "NEWLINE_DELIMITED_JSON" """Specifies newline delimited JSON format.""" AVRO = "AVRO" """Specifies Avro format.""" class Encoding(object): """The character encoding of the data. The default is :attr:`UTF_8`. BigQuery decodes the data after the raw, binary data has been split using the values of the quote and fieldDelimiter properties. """ UTF_8 = "UTF-8" """Specifies UTF-8 encoding.""" ISO_8859_1 = "ISO-8859-1" """Specifies ISO-8859-1 encoding.""" class QueryPriority(object): """Specifies a priority for the query. The default value is :attr:`INTERACTIVE`. """ INTERACTIVE = "INTERACTIVE" """Specifies interactive priority.""" BATCH = "BATCH" """Specifies batch priority.""" class SourceFormat(object): """The format of the data files. The default value is :attr:`CSV`. Note that the set of allowed values for loading data is different than the set used for external data sources (see :class:`~google.cloud.bigquery.external_config.ExternalSourceFormat`). """ CSV = "CSV" """Specifies CSV format.""" DATASTORE_BACKUP = "DATASTORE_BACKUP" """Specifies datastore backup format""" NEWLINE_DELIMITED_JSON = "NEWLINE_DELIMITED_JSON" """Specifies newline delimited JSON format.""" AVRO = "AVRO" """Specifies Avro format.""" PARQUET = "PARQUET" """Specifies Parquet format.""" ORC = "ORC" """Specifies Orc format.""" class WriteDisposition(object): """Specifies the action that occurs if destination table already exists. The default value is :attr:`WRITE_APPEND`. Each action is atomic and only occurs if BigQuery is able to complete the job successfully. Creation, truncation and append actions occur as one atomic update upon job completion. """ WRITE_APPEND = "WRITE_APPEND" """If the table already exists, BigQuery appends the data to the table.""" WRITE_TRUNCATE = "WRITE_TRUNCATE" """If the table already exists, BigQuery overwrites the table data.""" WRITE_EMPTY = "WRITE_EMPTY" """If the table already exists and contains data, a 'duplicate' error is returned in the job result.""" class SchemaUpdateOption(object): """Specifies an update to the destination table schema as a side effect of a load job. """ ALLOW_FIELD_ADDITION = "ALLOW_FIELD_ADDITION" """Allow adding a nullable field to the schema.""" ALLOW_FIELD_RELAXATION = "ALLOW_FIELD_RELAXATION" """Allow relaxing a required field in the original schema to nullable.""" class _JobReference(object): """A reference to a job. Arguments: job_id (str): ID of the job to run. project (str): ID of the project where the job runs. location (str): Location of where the job runs. """ def __init__(self, job_id, project, location): self._properties = {"jobId": job_id, "projectId": project} # The location field must not be populated if it is None. if location: self._properties["location"] = location @property def job_id(self): """str: ID of the job.""" return self._properties.get("jobId") @property def project(self): """str: ID of the project where the job runs.""" return self._properties.get("projectId") @property def location(self): """str: Location where the job runs.""" return self._properties.get("location") def _to_api_repr(self): """Returns the API resource representation of the job reference.""" return copy.deepcopy(self._properties) @classmethod def _from_api_repr(cls, resource): """Returns a job reference for an API resource representation.""" job_id = resource.get("jobId") project = resource.get("projectId") location = resource.get("location") job_ref = cls(job_id, project, location) return job_ref class _AsyncJob(google.api_core.future.polling.PollingFuture): """Base class for asynchronous jobs. Arguments: job_id (Union[str, _JobReference]): Job's ID in the project associated with the client or a fully-qualified job reference. client (google.cloud.bigquery.client.Client): Client which holds credentials and project configuration. """ def __init__(self, job_id, client): super(_AsyncJob, self).__init__() # The job reference can be either a plain job ID or the full resource. # Populate the properties dictionary consistently depending on what has # been passed in. job_ref = job_id if not isinstance(job_id, _JobReference): job_ref = _JobReference(job_id, client.project, None) self._properties = {"jobReference": job_ref._to_api_repr()} self._client = client self._result_set = False self._completion_lock = threading.Lock() @property def job_id(self): """str: ID of the job.""" return _helpers._get_sub_prop(self._properties, ["jobReference", "jobId"]) @property def project(self): """Project bound to the job. :rtype: str :returns: the project (derived from the client). """ return _helpers._get_sub_prop(self._properties, ["jobReference", "projectId"]) @property def location(self): """str: Location where the job runs.""" return _helpers._get_sub_prop(self._properties, ["jobReference", "location"]) def _require_client(self, client): """Check client or verify over-ride. :type client: :class:`~google.cloud.bigquery.client.Client` or ``NoneType`` :param client: the client to use. If not passed, falls back to the ``client`` stored on the current dataset. :rtype: :class:`google.cloud.bigquery.client.Client` :returns: The client passed in or the currently bound client. """ if client is None: client = self._client return client @property def job_type(self): """Type of job :rtype: str :returns: one of 'load', 'copy', 'extract', 'query' """ return self._JOB_TYPE @property def path(self): """URL path for the job's APIs. :rtype: str :returns: the path based on project and job ID. """ return "/projects/%s/jobs/%s" % (self.project, self.job_id) @property def labels(self): """Dict[str, str]: Labels for the job.""" return self._properties.setdefault("labels", {}) @property def etag(self): """ETag for the job resource. :rtype: str, or ``NoneType`` :returns: the ETag (None until set from the server). """ return self._properties.get("etag") @property def self_link(self): """URL for the job resource. :rtype: str, or ``NoneType`` :returns: the URL (None until set from the server). """ return self._properties.get("selfLink") @property def user_email(self): """E-mail address of user who submitted the job. :rtype: str, or ``NoneType`` :returns: the URL (None until set from the server). """ return self._properties.get("user_email") @property def created(self): """Datetime at which the job was created. :rtype: ``datetime.datetime``, or ``NoneType`` :returns: the creation time (None until set from the server). """ statistics = self._properties.get("statistics") if statistics is not None: millis = statistics.get("creationTime") if millis is not None: return _helpers._datetime_from_microseconds(millis * 1000.0) @property def started(self): """Datetime at which the job was started. :rtype: ``datetime.datetime``, or ``NoneType`` :returns: the start time (None until set from the server). """ statistics = self._properties.get("statistics") if statistics is not None: millis = statistics.get("startTime") if millis is not None: return _helpers._datetime_from_microseconds(millis * 1000.0) @property def ended(self): """Datetime at which the job finished. :rtype: ``datetime.datetime``, or ``NoneType`` :returns: the end time (None until set from the server). """ statistics = self._properties.get("statistics") if statistics is not None: millis = statistics.get("endTime") if millis is not None: return _helpers._datetime_from_microseconds(millis * 1000.0) def _job_statistics(self): """Helper for job-type specific statistics-based properties.""" statistics = self._properties.get("statistics", {}) return statistics.get(self._JOB_TYPE, {}) @property def error_result(self): """Error information about the job as a whole. :rtype: mapping, or ``NoneType`` :returns: the error information (None until set from the server). """ status = self._properties.get("status") if status is not None: return status.get("errorResult") @property def errors(self): """Information about individual errors generated by the job. :rtype: list of mappings, or ``NoneType`` :returns: the error information (None until set from the server). """ status = self._properties.get("status") if status is not None: return status.get("errors") @property def state(self): """Status of the job. :rtype: str, or ``NoneType`` :returns: the state (None until set from the server). """ status = self._properties.get("status") if status is not None: return status.get("state") def _scrub_local_properties(self, cleaned): """Helper: handle subclass properties in cleaned.""" pass def _copy_configuration_properties(self, configuration): """Helper: assign subclass configuration properties in cleaned.""" raise NotImplementedError("Abstract") def _set_properties(self, api_response): """Update properties from resource in body of ``api_response`` :type api_response: dict :param api_response: response returned from an API call """ cleaned = api_response.copy() self._scrub_local_properties(cleaned) statistics = cleaned.get("statistics", {}) if "creationTime" in statistics: statistics["creationTime"] = float(statistics["creationTime"]) if "startTime" in statistics: statistics["startTime"] = float(statistics["startTime"]) if "endTime" in statistics: statistics["endTime"] = float(statistics["endTime"]) self._properties.clear() self._properties.update(cleaned) self._copy_configuration_properties(cleaned.get("configuration", {})) # For Future interface self._set_future_result() @classmethod def _get_resource_config(cls, resource): """Helper for :meth:`from_api_repr` :type resource: dict :param resource: resource for the job :rtype: dict :returns: tuple (string, dict), where the first element is the job ID and the second contains job-specific configuration. :raises: :class:`KeyError` if the resource has no identifier, or is missing the appropriate configuration. """ if "jobReference" not in resource or "jobId" not in resource["jobReference"]: raise KeyError( "Resource lacks required identity information: " '["jobReference"]["jobId"]' ) job_id = resource["jobReference"]["jobId"] if ( "configuration" not in resource or cls._JOB_TYPE not in resource["configuration"] ): raise KeyError( "Resource lacks required configuration: " '["configuration"]["%s"]' % cls._JOB_TYPE ) return job_id, resource["configuration"] def to_api_repr(self): """Generate a resource for the job.""" raise NotImplementedError("Abstract") _build_resource = to_api_repr # backward-compatibility alias def _begin(self, client=None, retry=DEFAULT_RETRY): """API call: begin the job via a POST request See https://cloud.google.com/bigquery/docs/reference/rest/v2/jobs/insert :type client: :class:`~google.cloud.bigquery.client.Client` or ``NoneType`` :param client: the client to use. If not passed, falls back to the ``client`` stored on the current dataset. :type retry: :class:`google.api_core.retry.Retry` :param retry: (Optional) How to retry the RPC. :raises: :exc:`ValueError` if the job has already begin. """ if self.state is not None: raise ValueError("Job already begun.") client = self._require_client(client) path = "/projects/%s/jobs" % (self.project,) # jobs.insert is idempotent because we ensure that every new # job has an ID. api_response = client._call_api( retry, method="POST", path=path, data=self.to_api_repr() ) self._set_properties(api_response) def exists(self, client=None, retry=DEFAULT_RETRY): """API call: test for the existence of the job via a GET request See https://cloud.google.com/bigquery/docs/reference/rest/v2/jobs/get :type client: :class:`~google.cloud.bigquery.client.Client` or ``NoneType`` :param client: the client to use. If not passed, falls back to the ``client`` stored on the current dataset. :type retry: :class:`google.api_core.retry.Retry` :param retry: (Optional) How to retry the RPC. :rtype: bool :returns: Boolean indicating existence of the job. """ client = self._require_client(client) extra_params = {"fields": "id"} if self.location: extra_params["location"] = self.location try: client._call_api( retry, method="GET", path=self.path, query_params=extra_params ) except NotFound: return False else: return True def reload(self, client=None, retry=DEFAULT_RETRY): """API call: refresh job properties via a GET request. See https://cloud.google.com/bigquery/docs/reference/rest/v2/jobs/get :type client: :class:`~google.cloud.bigquery.client.Client` or ``NoneType`` :param client: the client to use. If not passed, falls back to the ``client`` stored on the current dataset. :type retry: :class:`google.api_core.retry.Retry` :param retry: (Optional) How to retry the RPC. """ client = self._require_client(client) extra_params = {} if self.location: extra_params["location"] = self.location api_response = client._call_api( retry, method="GET", path=self.path, query_params=extra_params ) self._set_properties(api_response) def cancel(self, client=None): """API call: cancel job via a POST request See https://cloud.google.com/bigquery/docs/reference/rest/v2/jobs/cancel :type client: :class:`~google.cloud.bigquery.client.Client` or ``NoneType`` :param client: the client to use. If not passed, falls back to the ``client`` stored on the current dataset. :rtype: bool :returns: Boolean indicating that the cancel request was sent. """ client = self._require_client(client) extra_params = {} if self.location: extra_params["location"] = self.location api_response = client._connection.api_request( method="POST", path="%s/cancel" % (self.path,), query_params=extra_params ) self._set_properties(api_response["job"]) # The Future interface requires that we return True if the *attempt* # to cancel was successful. return True # The following methods implement the PollingFuture interface. Note that # the methods above are from the pre-Future interface and are left for # compatibility. The only "overloaded" method is :meth:`cancel`, which # satisfies both interfaces. def _set_future_result(self): """Set the result or exception from the job if it is complete.""" # This must be done in a lock to prevent the polling thread # and main thread from both executing the completion logic # at the same time. with self._completion_lock: # If the operation isn't complete or if the result has already been # set, do not call set_result/set_exception again. # Note: self._result_set is set to True in set_result and # set_exception, in case those methods are invoked directly. if self.state != _DONE_STATE or self._result_set: return if self.error_result is not None: exception = _error_result_to_exception(self.error_result) self.set_exception(exception) else: self.set_result(self) def done(self, retry=DEFAULT_RETRY): """Refresh the job and checks if it is complete. :type retry: :class:`google.api_core.retry.Retry` :param retry: (Optional) How to retry the RPC. :rtype: bool :returns: True if the job is complete, False otherwise. """ # Do not refresh is the state is already done, as the job will not # change once complete. if self.state != _DONE_STATE: self.reload(retry=retry) return self.state == _DONE_STATE def result(self, timeout=None, retry=DEFAULT_RETRY): """Start the job and wait for it to complete and get the result. :type timeout: float :param timeout: How long (in seconds) to wait for job to complete before raising a :class:`concurrent.futures.TimeoutError`. :type retry: :class:`google.api_core.retry.Retry` :param retry: (Optional) How to retry the RPC. :rtype: _AsyncJob :returns: This instance. :raises: :class:`~google.cloud.exceptions.GoogleCloudError` if the job failed or :class:`concurrent.futures.TimeoutError` if the job did not complete in the given timeout. """ if self.state is None: self._begin(retry=retry) # TODO: modify PollingFuture so it can pass a retry argument to done(). return super(_AsyncJob, self).result(timeout=timeout) def cancelled(self): """Check if the job has been cancelled. This always returns False. It's not possible to check if a job was cancelled in the API. This method is here to satisfy the interface for :class:`google.api_core.future.Future`. :rtype: bool :returns: False """ return ( self.error_result is not None and self.error_result.get("reason") == _STOPPED_REASON ) class _JobConfig(object): """Abstract base class for job configuration objects. Arguments: job_type (str): The key to use for the job configuration. """ def __init__(self, job_type, **kwargs): self._job_type = job_type self._properties = {job_type: {}} for prop, val in kwargs.items(): setattr(self, prop, val) @property def labels(self): """Dict[str, str]: Labels for the job. This method always returns a dict. To change a job's labels, modify the dict, then call ``Client.update_job``. To delete a label, set its value to :data:`None` before updating. Raises: ValueError: If ``value`` type is invalid. """ return self._properties.setdefault("labels", {}) @labels.setter def labels(self, value): if not isinstance(value, dict): raise ValueError("Pass a dict") self._properties["labels"] = value def _get_sub_prop(self, key, default=None): """Get a value in the ``self._properties[self._job_type]`` dictionary. Most job properties are inside the dictionary related to the job type (e.g. 'copy', 'extract', 'load', 'query'). Use this method to access those properties:: self._get_sub_prop('destinationTable') This is equivalent to using the ``_helpers._get_sub_prop`` function:: _helpers._get_sub_prop( self._properties, ['query', 'destinationTable']) Arguments: key (str): Key for the value to get in the ``self._properties[self._job_type]`` dictionary. default (object): (Optional) Default value to return if the key is not found. Defaults to :data:`None`. Returns: object: The value if present or the default. """ return _helpers._get_sub_prop( self._properties, [self._job_type, key], default=default ) def _set_sub_prop(self, key, value): """Set a value in the ``self._properties[self._job_type]`` dictionary. Most job properties are inside the dictionary related to the job type (e.g. 'copy', 'extract', 'load', 'query'). Use this method to set those properties:: self._set_sub_prop('useLegacySql', False) This is equivalent to using the ``_helper._set_sub_prop`` function:: _helper._set_sub_prop( self._properties, ['query', 'useLegacySql'], False) Arguments: key (str): Key to set in the ``self._properties[self._job_type]`` dictionary. value (object): Value to set. """ _helpers._set_sub_prop(self._properties, [self._job_type, key], value) def _del_sub_prop(self, key): """Remove ``key`` from the ``self._properties[self._job_type]`` dict. Most job properties are inside the dictionary related to the job type (e.g. 'copy', 'extract', 'load', 'query'). Use this method to clear those properties:: self._del_sub_prop('useLegacySql') This is equivalent to using the ``_helper._del_sub_prop`` function:: _helper._del_sub_prop( self._properties, ['query', 'useLegacySql']) Arguments: key (str): Key to remove in the ``self._properties[self._job_type]`` dictionary. """ _helpers._del_sub_prop(self._properties, [self._job_type, key]) def to_api_repr(self): """Build an API representation of the job config. :rtype: dict :returns: A dictionary in the format used by the BigQuery API. """ return copy.deepcopy(self._properties) def _fill_from_default(self, default_job_config): """Merge this job config with a default job config. The keys in this object take precedence over the keys in the default config. The merge is done at the top-level as well as for keys one level below the job type. Arguments: default_job_config (google.cloud.bigquery.job._JobConfig): The default job config that will be used to fill in self. Returns: google.cloud.bigquery.job._JobConfig A new (merged) job config. """ if self._job_type != default_job_config._job_type: raise TypeError( "attempted to merge two incompatible job types: " + repr(self._job_type) + ", " + repr(default_job_config._job_type) ) new_job_config = self.__class__() default_job_properties = copy.deepcopy(default_job_config._properties) for key in self._properties: if key != self._job_type: default_job_properties[key] = self._properties[key] default_job_properties[self._job_type].update(self._properties[self._job_type]) new_job_config._properties = default_job_properties return new_job_config @classmethod def from_api_repr(cls, resource): """Factory: construct a job configuration given its API representation :type resource: dict :param resource: An extract job configuration in the same representation as is returned from the API. :rtype: :class:`google.cloud.bigquery.job._JobConfig` :returns: Configuration parsed from ``resource``. """ config = cls() config._properties = copy.deepcopy(resource) return config class LoadJobConfig(_JobConfig): """Configuration options for load jobs. All properties in this class are optional. Values which are :data:`None` -> server defaults. Set properties on the constructed configuration by using the property name as the name of a keyword argument. """ def __init__(self, **kwargs): super(LoadJobConfig, self).__init__("load", **kwargs) @property def allow_jagged_rows(self): """bool: Allow missing trailing optional columns (CSV only). See https://cloud.google.com/bigquery/docs/reference/rest/v2/jobs#configuration.load.allowJaggedRows """ return self._get_sub_prop("allowJaggedRows") @allow_jagged_rows.setter def allow_jagged_rows(self, value): self._set_sub_prop("allowJaggedRows", value) @property def allow_quoted_newlines(self): """bool: Allow quoted data containing newline characters (CSV only). See https://cloud.google.com/bigquery/docs/reference/rest/v2/jobs#configuration.load.allowQuotedNewlines """ return self._get_sub_prop("allowQuotedNewlines") @allow_quoted_newlines.setter def allow_quoted_newlines(self, value): self._set_sub_prop("allowQuotedNewlines", value) @property def autodetect(self): """bool: Automatically infer the schema from a sample of the data. See https://cloud.google.com/bigquery/docs/reference/rest/v2/jobs#configuration.load.autodetect """ return self._get_sub_prop("autodetect") @autodetect.setter def autodetect(self, value): self._set_sub_prop("autodetect", value) @property def clustering_fields(self): """Union[List[str], None]: Fields defining clustering for the table (Defaults to :data:`None`). Clustering fields are immutable after table creation. .. note:: As of 2018-06-29, clustering fields cannot be set on a table which does not also have time partioning defined. """ prop = self._get_sub_prop("clustering") if prop is not None: return list(prop.get("fields", ())) @clustering_fields.setter def clustering_fields(self, value): """Union[List[str], None]: Fields defining clustering for the table (Defaults to :data:`None`). """ if value is not None: self._set_sub_prop("clustering", {"fields": value}) else: self._del_sub_prop("clustering") @property def create_disposition(self): """google.cloud.bigquery.job.CreateDisposition: Specifies behavior for creating tables. See https://cloud.google.com/bigquery/docs/reference/rest/v2/jobs#configuration.load.createDisposition """ return self._get_sub_prop("createDisposition") @create_disposition.setter def create_disposition(self, value): self._set_sub_prop("createDisposition", value) @property def destination_encryption_configuration(self): """google.cloud.bigquery.table.EncryptionConfiguration: Custom encryption configuration for the destination table. Custom encryption configuration (e.g., Cloud KMS keys) or :data:`None` if using default encryption. See https://cloud.google.com/bigquery/docs/reference/rest/v2/jobs#configuration.load.destinationEncryptionConfiguration """ prop = self._get_sub_prop("destinationEncryptionConfiguration") if prop is not None: prop = EncryptionConfiguration.from_api_repr(prop) return prop @destination_encryption_configuration.setter def destination_encryption_configuration(self, value): api_repr = value if value is not None: api_repr = value.to_api_repr() self._set_sub_prop("destinationEncryptionConfiguration", api_repr) else: self._del_sub_prop("destinationEncryptionConfiguration") @property def destination_table_description(self): """Union[str, None] name given to destination table. See: https://cloud.google.com/bigquery/docs/reference/rest/v2/jobs#configuration.load.destinationTableProperties.description """ prop = self._get_sub_prop("destinationTableProperties") if prop is not None: return prop["description"] @destination_table_description.setter def destination_table_description(self, value): keys = [self._job_type, "destinationTableProperties", "description"] if value is not None: _helpers._set_sub_prop(self._properties, keys, value) else: _helpers._del_sub_prop(self._properties, keys) @property def destination_table_friendly_name(self): """Union[str, None] name given to destination table. See: https://cloud.google.com/bigquery/docs/reference/rest/v2/jobs#configuration.load.destinationTableProperties.friendlyName """ prop = self._get_sub_prop("destinationTableProperties") if prop is not None: return prop["friendlyName"] @destination_table_friendly_name.setter def destination_table_friendly_name(self, value): keys = [self._job_type, "destinationTableProperties", "friendlyName"] if value is not None: _helpers._set_sub_prop(self._properties, keys, value) else: _helpers._del_sub_prop(self._properties, keys) @property def encoding(self): """google.cloud.bigquery.job.Encoding: The character encoding of the data. See https://cloud.google.com/bigquery/docs/reference/rest/v2/jobs#configuration.load.encoding """ return self._get_sub_prop("encoding") @encoding.setter def encoding(self, value): self._set_sub_prop("encoding", value) @property def field_delimiter(self): """str: The separator for fields in a CSV file. See https://cloud.google.com/bigquery/docs/reference/rest/v2/jobs#configuration.load.fieldDelimiter """ return self._get_sub_prop("fieldDelimiter") @field_delimiter.setter def field_delimiter(self, value): self._set_sub_prop("fieldDelimiter", value) @property def ignore_unknown_values(self): """bool: Ignore extra values not represented in the table schema. See https://cloud.google.com/bigquery/docs/reference/rest/v2/jobs#configuration.load.ignoreUnknownValues """ return self._get_sub_prop("ignoreUnknownValues") @ignore_unknown_values.setter def ignore_unknown_values(self, value): self._set_sub_prop("ignoreUnknownValues", value) @property def max_bad_records(self): """int: Number of invalid rows to ignore. See https://cloud.google.com/bigquery/docs/reference/rest/v2/jobs#configuration.load.maxBadRecords """ return _helpers._int_or_none(self._get_sub_prop("maxBadRecords")) @max_bad_records.setter def max_bad_records(self, value): self._set_sub_prop("maxBadRecords", value) @property def null_marker(self): """str: Represents a null value (CSV only). See https://cloud.google.com/bigquery/docs/reference/rest/v2/jobs#configuration.load.nullMarker """ return self._get_sub_prop("nullMarker") @null_marker.setter def null_marker(self, value): self._set_sub_prop("nullMarker", value) @property def quote_character(self): """str: Character used to quote data sections (CSV only). See https://cloud.google.com/bigquery/docs/reference/rest/v2/jobs#configuration.load.quote """ return self._get_sub_prop("quote") @quote_character.setter def quote_character(self, value): self._set_sub_prop("quote", value) @property def schema(self): """List[google.cloud.bigquery.schema.SchemaField]: Schema of the destination table. See https://cloud.google.com/bigquery/docs/reference/rest/v2/jobs#configuration.load.schema """ schema = _helpers._get_sub_prop(self._properties, ["load", "schema", "fields"]) if schema is None: return return [SchemaField.from_api_repr(field) for field in schema] @schema.setter def schema(self, value): if not all(hasattr(field, "to_api_repr") for field in value): raise ValueError("Schema items must be fields") _helpers._set_sub_prop( self._properties, ["load", "schema", "fields"], [field.to_api_repr() for field in value], ) @property def schema_update_options(self): """List[google.cloud.bigquery.job.SchemaUpdateOption]: Specifies updates to the destination table schema to allow as a side effect of the load job. """ return self._get_sub_prop("schemaUpdateOptions") @schema_update_options.setter def schema_update_options(self, values): self._set_sub_prop("schemaUpdateOptions", values) @property def skip_leading_rows(self): """int: Number of rows to skip when reading data (CSV only). See https://cloud.google.com/bigquery/docs/reference/rest/v2/jobs#configuration.load.skipLeadingRows """ return _helpers._int_or_none(self._get_sub_prop("skipLeadingRows")) @skip_leading_rows.setter def skip_leading_rows(self, value): self._set_sub_prop("skipLeadingRows", str(value)) @property def source_format(self): """google.cloud.bigquery.job.SourceFormat: File format of the data. See https://cloud.google.com/bigquery/docs/reference/rest/v2/jobs#configuration.load.sourceFormat """ return self._get_sub_prop("sourceFormat") @source_format.setter def source_format(self, value): self._set_sub_prop("sourceFormat", value) @property def time_partitioning(self): """google.cloud.bigquery.table.TimePartitioning: Specifies time-based partitioning for the destination table. """ prop = self._get_sub_prop("timePartitioning") if prop is not None: prop = TimePartitioning.from_api_repr(prop) return prop @time_partitioning.setter def time_partitioning(self, value): api_repr = value if value is not None: api_repr = value.to_api_repr() self._set_sub_prop("timePartitioning", api_repr) else: self._del_sub_prop("timePartitioning") @property def use_avro_logical_types(self): """bool: For loads of Avro data, governs whether Avro logical types are converted to their corresponding BigQuery types(e.g. TIMESTAMP) rather than raw types (e.g. INTEGER). """ return self._get_sub_prop("useAvroLogicalTypes") @use_avro_logical_types.setter def use_avro_logical_types(self, value): self._set_sub_prop("useAvroLogicalTypes", bool(value)) @property def write_disposition(self): """google.cloud.bigquery.job.WriteDisposition: Action that occurs if the destination table already exists. See https://cloud.google.com/bigquery/docs/reference/rest/v2/jobs#configuration.load.writeDisposition """ return self._get_sub_prop("writeDisposition") @write_disposition.setter def write_disposition(self, value): self._set_sub_prop("writeDisposition", value) class LoadJob(_AsyncJob): """Asynchronous job for loading data into a table. Can load from Google Cloud Storage URIs or from a file. :type job_id: str :param job_id: the job's ID :type source_uris: sequence of string or ``NoneType`` :param source_uris: URIs of one or more data files to be loaded. See https://cloud.google.com/bigquery/docs/reference/rest/v2/jobs#configuration.load.sourceUris for supported URI formats. Pass None for jobs that load from a file. :type destination: :class:`google.cloud.bigquery.table.TableReference` :param destination: reference to table into which data is to be loaded. :type client: :class:`google.cloud.bigquery.client.Client` :param client: A client which holds credentials and project configuration for the dataset (which requires a project). """ _JOB_TYPE = "load" def __init__(self, job_id, source_uris, destination, client, job_config=None): super(LoadJob, self).__init__(job_id, client) if job_config is None: job_config = LoadJobConfig() self.source_uris = source_uris self.destination = destination self._configuration = job_config @property def allow_jagged_rows(self): """See :attr:`google.cloud.bigquery.job.LoadJobConfig.allow_jagged_rows`. """ return self._configuration.allow_jagged_rows @property def allow_quoted_newlines(self): """See :attr:`google.cloud.bigquery.job.LoadJobConfig.allow_quoted_newlines`. """ return self._configuration.allow_quoted_newlines @property def autodetect(self): """See :attr:`google.cloud.bigquery.job.LoadJobConfig.autodetect`. """ return self._configuration.autodetect @property def create_disposition(self): """See :attr:`google.cloud.bigquery.job.LoadJobConfig.create_disposition`. """ return self._configuration.create_disposition @property def encoding(self): """See :attr:`google.cloud.bigquery.job.LoadJobConfig.encoding`. """ return self._configuration.encoding @property def field_delimiter(self): """See :attr:`google.cloud.bigquery.job.LoadJobConfig.field_delimiter`. """ return self._configuration.field_delimiter @property def ignore_unknown_values(self): """See :attr:`google.cloud.bigquery.job.LoadJobConfig.ignore_unknown_values`. """ return self._configuration.ignore_unknown_values @property def max_bad_records(self): """See :attr:`google.cloud.bigquery.job.LoadJobConfig.max_bad_records`. """ return self._configuration.max_bad_records @property def null_marker(self): """See :attr:`google.cloud.bigquery.job.LoadJobConfig.null_marker`. """ return self._configuration.null_marker @property def quote_character(self): """See :attr:`google.cloud.bigquery.job.LoadJobConfig.quote_character`. """ return self._configuration.quote_character @property def skip_leading_rows(self): """See :attr:`google.cloud.bigquery.job.LoadJobConfig.skip_leading_rows`. """ return self._configuration.skip_leading_rows @property def source_format(self): """See :attr:`google.cloud.bigquery.job.LoadJobConfig.source_format`. """ return self._configuration.source_format @property def write_disposition(self): """See :attr:`google.cloud.bigquery.job.LoadJobConfig.write_disposition`. """ return self._configuration.write_disposition @property def schema(self): """See :attr:`google.cloud.bigquery.job.LoadJobConfig.schema`. """ return self._configuration.schema @property def destination_encryption_configuration(self): """google.cloud.bigquery.table.EncryptionConfiguration: Custom encryption configuration for the destination table. Custom encryption configuration (e.g., Cloud KMS keys) or :data:`None` if using default encryption. See :attr:`google.cloud.bigquery.job.LoadJobConfig.destination_encryption_configuration`. """ return self._configuration.destination_encryption_configuration @property def time_partitioning(self): """See :attr:`google.cloud.bigquery.job.LoadJobConfig.time_partitioning`. """ return self._configuration.time_partitioning @property def use_avro_logical_types(self): """See :attr:`google.cloud.bigquery.job.LoadJobConfig.use_avro_logical_types`. """ return self._configuration.use_avro_logical_types @property def clustering_fields(self): """See :attr:`google.cloud.bigquery.job.LoadJobConfig.clustering_fields`. """ return self._configuration.clustering_fields @property def schema_update_options(self): """See :attr:`google.cloud.bigquery.job.LoadJobConfig.schema_update_options`. """ return self._configuration.schema_update_options @property def input_file_bytes(self): """Count of bytes loaded from source files. :rtype: int, or ``NoneType`` :returns: the count (None until set from the server). :raises: ValueError for invalid value types. """ return _helpers._int_or_none( _helpers._get_sub_prop( self._properties, ["statistics", "load", "inputFileBytes"] ) ) @property def input_files(self): """Count of source files. :rtype: int, or ``NoneType`` :returns: the count (None until set from the server). """ return _helpers._int_or_none( _helpers._get_sub_prop( self._properties, ["statistics", "load", "inputFiles"] ) ) @property def output_bytes(self): """Count of bytes saved to destination table. :rtype: int, or ``NoneType`` :returns: the count (None until set from the server). """ return _helpers._int_or_none( _helpers._get_sub_prop( self._properties, ["statistics", "load", "outputBytes"] ) ) @property def output_rows(self): """Count of rows saved to destination table. :rtype: int, or ``NoneType`` :returns: the count (None until set from the server). """ return _helpers._int_or_none( _helpers._get_sub_prop( self._properties, ["statistics", "load", "outputRows"] ) ) def to_api_repr(self): """Generate a resource for :meth:`_begin`.""" configuration = self._configuration.to_api_repr() if self.source_uris is not None: _helpers._set_sub_prop( configuration, ["load", "sourceUris"], self.source_uris ) _helpers._set_sub_prop( configuration, ["load", "destinationTable"], self.destination.to_api_repr() ) return { "jobReference": self._properties["jobReference"], "configuration": configuration, } def _copy_configuration_properties(self, configuration): """Helper: assign subclass configuration properties in cleaned.""" self._configuration._properties = copy.deepcopy(configuration) @classmethod def from_api_repr(cls, resource, client): """Factory: construct a job given its API representation .. note: This method assumes that the project found in the resource matches the client's project. :type resource: dict :param resource: dataset job representation returned from the API :type client: :class:`google.cloud.bigquery.client.Client` :param client: Client which holds credentials and project configuration for the dataset. :rtype: :class:`google.cloud.bigquery.job.LoadJob` :returns: Job parsed from ``resource``. """ config_resource = resource.get("configuration", {}) config = LoadJobConfig.from_api_repr(config_resource) # A load job requires a destination table. dest_config = config_resource["load"]["destinationTable"] ds_ref = DatasetReference(dest_config["projectId"], dest_config["datasetId"]) destination = TableReference(ds_ref, dest_config["tableId"]) # sourceUris will be absent if this is a file upload. source_uris = _helpers._get_sub_prop(config_resource, ["load", "sourceUris"]) job_ref = _JobReference._from_api_repr(resource["jobReference"]) job = cls(job_ref, source_uris, destination, client, config) job._set_properties(resource) return job class CopyJobConfig(_JobConfig): """Configuration options for copy jobs. All properties in this class are optional. Values which are :data:`None` -> server defaults. Set properties on the constructed configuration by using the property name as the name of a keyword argument. """ def __init__(self, **kwargs): super(CopyJobConfig, self).__init__("copy", **kwargs) @property def create_disposition(self): """google.cloud.bigquery.job.CreateDisposition: Specifies behavior for creating tables. See https://cloud.google.com/bigquery/docs/reference/rest/v2/jobs#configuration.copy.createDisposition """ return self._get_sub_prop("createDisposition") @create_disposition.setter def create_disposition(self, value): self._set_sub_prop("createDisposition", value) @property def write_disposition(self): """google.cloud.bigquery.job.WriteDisposition: Action that occurs if the destination table already exists. See https://cloud.google.com/bigquery/docs/reference/rest/v2/jobs#configuration.copy.writeDisposition """ return self._get_sub_prop("writeDisposition") @write_disposition.setter def write_disposition(self, value): self._set_sub_prop("writeDisposition", value) @property def destination_encryption_configuration(self): """google.cloud.bigquery.table.EncryptionConfiguration: Custom encryption configuration for the destination table. Custom encryption configuration (e.g., Cloud KMS keys) or :data:`None` if using default encryption. See https://cloud.google.com/bigquery/docs/reference/rest/v2/jobs#configuration.copy.destinationEncryptionConfiguration """ prop = self._get_sub_prop("destinationEncryptionConfiguration") if prop is not None: prop = EncryptionConfiguration.from_api_repr(prop) return prop @destination_encryption_configuration.setter def destination_encryption_configuration(self, value): api_repr = value if value is not None: api_repr = value.to_api_repr() self._set_sub_prop("destinationEncryptionConfiguration", api_repr) class CopyJob(_AsyncJob): """Asynchronous job: copy data into a table from other tables. :type job_id: str :param job_id: the job's ID, within the project belonging to ``client``. :type sources: list of :class:`google.cloud.bigquery.table.TableReference` :param sources: Table from which data is to be loaded. :type destination: :class:`google.cloud.bigquery.table.TableReference` :param destination: Table into which data is to be loaded. :type client: :class:`google.cloud.bigquery.client.Client` :param client: A client which holds credentials and project configuration for the dataset (which requires a project). :type job_config: :class:`~google.cloud.bigquery.job.CopyJobConfig` :param job_config: (Optional) Extra configuration options for the copy job. """ _JOB_TYPE = "copy" def __init__(self, job_id, sources, destination, client, job_config=None): super(CopyJob, self).__init__(job_id, client) if job_config is None: job_config = CopyJobConfig() self.destination = destination self.sources = sources self._configuration = job_config @property def create_disposition(self): """See :attr:`google.cloud.bigquery.job.CopyJobConfig.create_disposition`. """ return self._configuration.create_disposition @property def write_disposition(self): """See :attr:`google.cloud.bigquery.job.CopyJobConfig.write_disposition`. """ return self._configuration.write_disposition @property def destination_encryption_configuration(self): """google.cloud.bigquery.table.EncryptionConfiguration: Custom encryption configuration for the destination table. Custom encryption configuration (e.g., Cloud KMS keys) or :data:`None` if using default encryption. See :attr:`google.cloud.bigquery.job.CopyJobConfig.destination_encryption_configuration`. """ return self._configuration.destination_encryption_configuration def to_api_repr(self): """Generate a resource for :meth:`_begin`.""" source_refs = [ { "projectId": table.project, "datasetId": table.dataset_id, "tableId": table.table_id, } for table in self.sources ] configuration = self._configuration.to_api_repr() _helpers._set_sub_prop(configuration, ["copy", "sourceTables"], source_refs) _helpers._set_sub_prop( configuration, ["copy", "destinationTable"], { "projectId": self.destination.project, "datasetId": self.destination.dataset_id, "tableId": self.destination.table_id, }, ) return { "jobReference": self._properties["jobReference"], "configuration": configuration, } def _copy_configuration_properties(self, configuration): """Helper: assign subclass configuration properties in cleaned.""" self._configuration._properties = copy.deepcopy(configuration) @classmethod def from_api_repr(cls, resource, client): """Factory: construct a job given its API representation .. note: This method assumes that the project found in the resource matches the client's project. :type resource: dict :param resource: dataset job representation returned from the API :type client: :class:`google.cloud.bigquery.client.Client` :param client: Client which holds credentials and project configuration for the dataset. :rtype: :class:`google.cloud.bigquery.job.CopyJob` :returns: Job parsed from ``resource``. """ job_id, config_resource = cls._get_resource_config(resource) config = CopyJobConfig.from_api_repr(config_resource) # Copy required fields to the job. copy_resource = config_resource["copy"] destination = TableReference.from_api_repr(copy_resource["destinationTable"]) sources = [] source_configs = copy_resource.get("sourceTables") if source_configs is None: single = copy_resource.get("sourceTable") if single is None: raise KeyError("Resource missing 'sourceTables' / 'sourceTable'") source_configs = [single] for source_config in source_configs: table_ref = TableReference.from_api_repr(source_config) sources.append(table_ref) job = cls(job_id, sources, destination, client=client, job_config=config) job._set_properties(resource) return job class ExtractJobConfig(_JobConfig): """Configuration options for extract jobs. All properties in this class are optional. Values which are :data:`None` -> server defaults. Set properties on the constructed configuration by using the property name as the name of a keyword argument. """ def __init__(self, **kwargs): super(ExtractJobConfig, self).__init__("extract", **kwargs) @property def compression(self): """google.cloud.bigquery.job.Compression: Compression type to use for exported files. See https://cloud.google.com/bigquery/docs/reference/rest/v2/jobs#configuration.extract.compression """ return self._get_sub_prop("compression") @compression.setter def compression(self, value): self._set_sub_prop("compression", value) @property def destination_format(self): """google.cloud.bigquery.job.DestinationFormat: Exported file format. See https://cloud.google.com/bigquery/docs/reference/rest/v2/jobs#configuration.extract.destinationFormat """ return self._get_sub_prop("destinationFormat") @destination_format.setter def destination_format(self, value): self._set_sub_prop("destinationFormat", value) @property def field_delimiter(self): """str: Delimiter to use between fields in the exported data. See https://cloud.google.com/bigquery/docs/reference/rest/v2/jobs#configuration.extract.fieldDelimiter """ return self._get_sub_prop("fieldDelimiter") @field_delimiter.setter def field_delimiter(self, value): self._set_sub_prop("fieldDelimiter", value) @property def print_header(self): """bool: Print a header row in the exported data. See https://cloud.google.com/bigquery/docs/reference/rest/v2/jobs#configuration.extract.printHeader """ return self._get_sub_prop("printHeader") @print_header.setter def print_header(self, value): self._set_sub_prop("printHeader", value) class ExtractJob(_AsyncJob): """Asynchronous job: extract data from a table into Cloud Storage. :type job_id: str :param job_id: the job's ID :type source: :class:`google.cloud.bigquery.table.TableReference` :param source: Table into which data is to be loaded. :type destination_uris: list of string :param destination_uris: URIs describing where the extracted data will be written in Cloud Storage, using the format ``gs://<bucket_name>/<object_name_or_glob>``. :type client: :class:`google.cloud.bigquery.client.Client` :param client: A client which holds credentials and project configuration. :type job_config: :class:`~google.cloud.bigquery.job.ExtractJobConfig` :param job_config: (Optional) Extra configuration options for the extract job. """ _JOB_TYPE = "extract" def __init__(self, job_id, source, destination_uris, client, job_config=None): super(ExtractJob, self).__init__(job_id, client) if job_config is None: job_config = ExtractJobConfig() self.source = source self.destination_uris = destination_uris self._configuration = job_config @property def compression(self): """See :attr:`google.cloud.bigquery.job.ExtractJobConfig.compression`. """ return self._configuration.compression @property def destination_format(self): """See :attr:`google.cloud.bigquery.job.ExtractJobConfig.destination_format`. """ return self._configuration.destination_format @property def field_delimiter(self): """See :attr:`google.cloud.bigquery.job.ExtractJobConfig.field_delimiter`. """ return self._configuration.field_delimiter @property def print_header(self): """See :attr:`google.cloud.bigquery.job.ExtractJobConfig.print_header`. """ return self._configuration.print_header @property def destination_uri_file_counts(self): """Return file counts from job statistics, if present. See: https://cloud.google.com/bigquery/docs/reference/rest/v2/jobs#statistics.extract.destinationUriFileCounts Returns: a list of integer counts, each representing the number of files per destination URI or URI pattern specified in the extract configuration. These values will be in the same order as the URIs specified in the 'destinationUris' field. Returns None if job is not yet complete. """ counts = self._job_statistics().get("destinationUriFileCounts") if counts is not None: return [int(count) for count in counts] return None def to_api_repr(self): """Generate a resource for :meth:`_begin`.""" source_ref = { "projectId": self.source.project, "datasetId": self.source.dataset_id, "tableId": self.source.table_id, } configuration = self._configuration.to_api_repr() _helpers._set_sub_prop(configuration, ["extract", "sourceTable"], source_ref) _helpers._set_sub_prop( configuration, ["extract", "destinationUris"], self.destination_uris ) return { "jobReference": self._properties["jobReference"], "configuration": configuration, } def _copy_configuration_properties(self, configuration): """Helper: assign subclass configuration properties in cleaned.""" self._configuration._properties = copy.deepcopy(configuration) @classmethod def from_api_repr(cls, resource, client): """Factory: construct a job given its API representation .. note: This method assumes that the project found in the resource matches the client's project. :type resource: dict :param resource: dataset job representation returned from the API :type client: :class:`google.cloud.bigquery.client.Client` :param client: Client which holds credentials and project configuration for the dataset. :rtype: :class:`google.cloud.bigquery.job.ExtractJob` :returns: Job parsed from ``resource``. """ job_id, config_resource = cls._get_resource_config(resource) config = ExtractJobConfig.from_api_repr(config_resource) source_config = _helpers._get_sub_prop( config_resource, ["extract", "sourceTable"] ) dataset = DatasetReference( source_config["projectId"], source_config["datasetId"] ) source = dataset.table(source_config["tableId"]) destination_uris = _helpers._get_sub_prop( config_resource, ["extract", "destinationUris"] ) job = cls(job_id, source, destination_uris, client=client, job_config=config) job._set_properties(resource) return job def _from_api_repr_query_parameters(resource): return [_query_param_from_api_repr(mapping) for mapping in resource] def _to_api_repr_query_parameters(value): return [query_parameter.to_api_repr() for query_parameter in value] def _from_api_repr_udf_resources(resource): udf_resources = [] for udf_mapping in resource: for udf_type, udf_value in udf_mapping.items(): udf_resources.append(UDFResource(udf_type, udf_value)) return udf_resources def _to_api_repr_udf_resources(value): return [{udf_resource.udf_type: udf_resource.value} for udf_resource in value] def _from_api_repr_table_defs(resource): return {k: ExternalConfig.from_api_repr(v) for k, v in resource.items()} def _to_api_repr_table_defs(value): return {k: ExternalConfig.to_api_repr(v) for k, v in value.items()} class QueryJobConfig(_JobConfig): """Configuration options for query jobs. All properties in this class are optional. Values which are :data:`None` -> server defaults. Set properties on the constructed configuration by using the property name as the name of a keyword argument. """ def __init__(self, **kwargs): super(QueryJobConfig, self).__init__("query", **kwargs) @property def destination_encryption_configuration(self): """google.cloud.bigquery.table.EncryptionConfiguration: Custom encryption configuration for the destination table. Custom encryption configuration (e.g., Cloud KMS keys) or :data:`None` if using default encryption. See https://cloud.google.com/bigquery/docs/reference/rest/v2/jobs#configuration.query.destinationEncryptionConfiguration """ prop = self._get_sub_prop("destinationEncryptionConfiguration") if prop is not None: prop = EncryptionConfiguration.from_api_repr(prop) return prop @destination_encryption_configuration.setter def destination_encryption_configuration(self, value): api_repr = value if value is not None: api_repr = value.to_api_repr() self._set_sub_prop("destinationEncryptionConfiguration", api_repr) @property def allow_large_results(self): """bool: Allow large query results tables (legacy SQL, only) See https://g.co/cloud/bigquery/docs/reference/rest/v2/jobs#configuration.query.allowLargeResults """ return self._get_sub_prop("allowLargeResults") @allow_large_results.setter def allow_large_results(self, value): self._set_sub_prop("allowLargeResults", value) @property def create_disposition(self): """google.cloud.bigquery.job.CreateDisposition: Specifies behavior for creating tables. See https://g.co/cloud/bigquery/docs/reference/rest/v2/jobs#configuration.query.createDisposition """ return self._get_sub_prop("createDisposition") @create_disposition.setter def create_disposition(self, value): self._set_sub_prop("createDisposition", value) @property def default_dataset(self): """google.cloud.bigquery.dataset.DatasetReference: the default dataset to use for unqualified table names in the query or :data:`None` if not set. See https://g.co/cloud/bigquery/docs/reference/v2/jobs#configuration.query.defaultDataset """ prop = self._get_sub_prop("defaultDataset") if prop is not None: prop = DatasetReference.from_api_repr(prop) return prop @default_dataset.setter def default_dataset(self, value): resource = None if value is not None: resource = value.to_api_repr() self._set_sub_prop("defaultDataset", resource) @property def destination(self): """google.cloud.bigquery.table.TableReference: table where results are written or :data:`None` if not set. See https://g.co/cloud/bigquery/docs/reference/rest/v2/jobs#configuration.query.destinationTable """ prop = self._get_sub_prop("destinationTable") if prop is not None: prop = TableReference.from_api_repr(prop) return prop @destination.setter def destination(self, value): resource = None if value is not None: resource = value.to_api_repr() self._set_sub_prop("destinationTable", resource) @property def dry_run(self): """bool: :data:`True` if this query should be a dry run to estimate costs. See https://g.co/cloud/bigquery/docs/reference/v2/jobs#configuration.dryRun """ return self._properties.get("dryRun") @dry_run.setter def dry_run(self, value): self._properties["dryRun"] = value @property def flatten_results(self): """bool: Flatten nested/repeated fields in results. (Legacy SQL only) See https://g.co/cloud/bigquery/docs/reference/rest/v2/jobs#configuration.query.flattenResults """ return self._get_sub_prop("flattenResults") @flatten_results.setter def flatten_results(self, value): self._set_sub_prop("flattenResults", value) @property def maximum_billing_tier(self): """int: Deprecated. Changes the billing tier to allow high-compute queries. See https://g.co/cloud/bigquery/docs/reference/rest/v2/jobs#configuration.query.maximumBillingTier """ return self._get_sub_prop("maximumBillingTier") @maximum_billing_tier.setter def maximum_billing_tier(self, value): self._set_sub_prop("maximumBillingTier", value) @property def maximum_bytes_billed(self): """int: Maximum bytes to be billed for this job or :data:`None` if not set. See https://g.co/cloud/bigquery/docs/reference/rest/v2/jobs#configuration.query.maximumBytesBilled """ return _helpers._int_or_none(self._get_sub_prop("maximumBytesBilled")) @maximum_bytes_billed.setter def maximum_bytes_billed(self, value): self._set_sub_prop("maximumBytesBilled", str(value)) @property def priority(self): """google.cloud.bigquery.job.QueryPriority: Priority of the query. See https://g.co/cloud/bigquery/docs/reference/rest/v2/jobs#configuration.query.priority """ return self._get_sub_prop("priority") @priority.setter def priority(self, value): self._set_sub_prop("priority", value) @property def query_parameters(self): """List[Union[google.cloud.bigquery.query.ArrayQueryParameter, \ google.cloud.bigquery.query.ScalarQueryParameter, \ google.cloud.bigquery.query.StructQueryParameter]]: list of parameters for parameterized query (empty by default) See: https://g.co/cloud/bigquery/docs/reference/rest/v2/jobs#configuration.query.queryParameters """ prop = self._get_sub_prop("queryParameters", default=[]) return _from_api_repr_query_parameters(prop) @query_parameters.setter def query_parameters(self, values): self._set_sub_prop("queryParameters", _to_api_repr_query_parameters(values)) @property def udf_resources(self): """List[google.cloud.bigquery.query.UDFResource]: user defined function resources (empty by default) See: https://g.co/cloud/bigquery/docs/reference/rest/v2/jobs#configuration.query.userDefinedFunctionResources """ prop = self._get_sub_prop("userDefinedFunctionResources", default=[]) return _from_api_repr_udf_resources(prop) @udf_resources.setter def udf_resources(self, values): self._set_sub_prop( "userDefinedFunctionResources", _to_api_repr_udf_resources(values) ) @property def use_legacy_sql(self): """bool: Use legacy SQL syntax. See https://g.co/cloud/bigquery/docs/reference/v2/jobs#configuration.query.useLegacySql """ return self._get_sub_prop("useLegacySql") @use_legacy_sql.setter def use_legacy_sql(self, value): self._set_sub_prop("useLegacySql", value) @property def use_query_cache(self): """bool: Look for the query result in the cache. See https://cloud.google.com/bigquery/docs/reference/rest/v2/jobs#configuration.query.useQueryCache """ return self._get_sub_prop("useQueryCache") @use_query_cache.setter def use_query_cache(self, value): self._set_sub_prop("useQueryCache", value) @property def write_disposition(self): """google.cloud.bigquery.job.WriteDisposition: Action that occurs if the destination table already exists. See https://cloud.google.com/bigquery/docs/reference/rest/v2/jobs#configuration.query.writeDisposition """ return self._get_sub_prop("writeDisposition") @write_disposition.setter def write_disposition(self, value): self._set_sub_prop("writeDisposition", value) @property def table_definitions(self): """Dict[str, google.cloud.bigquery.external_config.ExternalConfig]: Definitions for external tables or :data:`None` if not set. See https://g.co/cloud/bigquery/docs/reference/rest/v2/jobs#configuration.query.tableDefinitions """ prop = self._get_sub_prop("tableDefinitions") if prop is not None: prop = _from_api_repr_table_defs(prop) return prop @table_definitions.setter def table_definitions(self, values): self._set_sub_prop("tableDefinitions", _to_api_repr_table_defs(values)) @property def time_partitioning(self): """google.cloud.bigquery.table.TimePartitioning: Specifies time-based partitioning for the destination table. """ prop = self._get_sub_prop("timePartitioning") if prop is not None: prop = TimePartitioning.from_api_repr(prop) return prop @time_partitioning.setter def time_partitioning(self, value): api_repr = value if value is not None: api_repr = value.to_api_repr() self._set_sub_prop("timePartitioning", api_repr) @property def clustering_fields(self): """Union[List[str], None]: Fields defining clustering for the table (Defaults to :data:`None`). Clustering fields are immutable after table creation. .. note:: As of 2018-06-29, clustering fields cannot be set on a table which does not also have time partioning defined. """ prop = self._get_sub_prop("clustering") if prop is not None: return list(prop.get("fields", ())) @clustering_fields.setter def clustering_fields(self, value): """Union[List[str], None]: Fields defining clustering for the table (Defaults to :data:`None`). """ if value is not None: self._set_sub_prop("clustering", {"fields": value}) else: self._del_sub_prop("clustering") @property def schema_update_options(self): """List[google.cloud.bigquery.job.SchemaUpdateOption]: Specifies updates to the destination table schema to allow as a side effect of the query job. """ return self._get_sub_prop("schemaUpdateOptions") @schema_update_options.setter def schema_update_options(self, values): self._set_sub_prop("schemaUpdateOptions", values) def to_api_repr(self): """Build an API representation of the query job config. Returns: dict: A dictionary in the format used by the BigQuery API. """ resource = copy.deepcopy(self._properties) # Query parameters have an addition property associated with them # to indicate if the query is using named or positional parameters. query_parameters = resource["query"].get("queryParameters") if query_parameters: if query_parameters[0].get("name") is None: resource["query"]["parameterMode"] = "POSITIONAL" else: resource["query"]["parameterMode"] = "NAMED" return resource class QueryJob(_AsyncJob): """Asynchronous job: query tables. :type job_id: str :param job_id: the job's ID, within the project belonging to ``client``. :type query: str :param query: SQL query string :type client: :class:`google.cloud.bigquery.client.Client` :param client: A client which holds credentials and project configuration for the dataset (which requires a project). :type job_config: :class:`~google.cloud.bigquery.job.QueryJobConfig` :param job_config: (Optional) Extra configuration options for the query job. """ _JOB_TYPE = "query" _UDF_KEY = "userDefinedFunctionResources" def __init__(self, job_id, query, client, job_config=None): super(QueryJob, self).__init__(job_id, client) if job_config is None: job_config = QueryJobConfig() if job_config.use_legacy_sql is None: job_config.use_legacy_sql = False self.query = query self._configuration = job_config self._query_results = None self._done_timeout = None @property def allow_large_results(self): """See :attr:`google.cloud.bigquery.job.QueryJobConfig.allow_large_results`. """ return self._configuration.allow_large_results @property def create_disposition(self): """See :attr:`google.cloud.bigquery.job.QueryJobConfig.create_disposition`. """ return self._configuration.create_disposition @property def default_dataset(self): """See :attr:`google.cloud.bigquery.job.QueryJobConfig.default_dataset`. """ return self._configuration.default_dataset @property def destination(self): """See :attr:`google.cloud.bigquery.job.QueryJobConfig.destination`. """ return self._configuration.destination @property def destination_encryption_configuration(self): """google.cloud.bigquery.table.EncryptionConfiguration: Custom encryption configuration for the destination table. Custom encryption configuration (e.g., Cloud KMS keys) or :data:`None` if using default encryption. See :attr:`google.cloud.bigquery.job.QueryJobConfig.destination_encryption_configuration`. """ return self._configuration.destination_encryption_configuration @property def dry_run(self): """See :attr:`google.cloud.bigquery.job.QueryJobConfig.dry_run`. """ return self._configuration.dry_run @property def flatten_results(self): """See :attr:`google.cloud.bigquery.job.QueryJobConfig.flatten_results`. """ return self._configuration.flatten_results @property def priority(self): """See :attr:`google.cloud.bigquery.job.QueryJobConfig.priority`. """ return self._configuration.priority @property def query_parameters(self): """See :attr:`google.cloud.bigquery.job.QueryJobConfig.query_parameters`. """ return self._configuration.query_parameters @property def udf_resources(self): """See :attr:`google.cloud.bigquery.job.QueryJobConfig.udf_resources`. """ return self._configuration.udf_resources @property def use_legacy_sql(self): """See :attr:`google.cloud.bigquery.job.QueryJobConfig.use_legacy_sql`. """ return self._configuration.use_legacy_sql @property def use_query_cache(self): """See :attr:`google.cloud.bigquery.job.QueryJobConfig.use_query_cache`. """ return self._configuration.use_query_cache @property def write_disposition(self): """See :attr:`google.cloud.bigquery.job.QueryJobConfig.write_disposition`. """ return self._configuration.write_disposition @property def maximum_billing_tier(self): """See :attr:`google.cloud.bigquery.job.QueryJobConfig.maximum_billing_tier`. """ return self._configuration.maximum_billing_tier @property def maximum_bytes_billed(self): """See :attr:`google.cloud.bigquery.job.QueryJobConfig.maximum_bytes_billed`. """ return self._configuration.maximum_bytes_billed @property def table_definitions(self): """See :attr:`google.cloud.bigquery.job.QueryJobConfig.table_definitions`. """ return self._configuration.table_definitions @property def time_partitioning(self): """See :attr:`google.cloud.bigquery.job.QueryJobConfig.time_partitioning`. """ return self._configuration.time_partitioning @property def clustering_fields(self): """See :attr:`google.cloud.bigquery.job.QueryJobConfig.clustering_fields`. """ return self._configuration.clustering_fields @property def schema_update_options(self): """See :attr:`google.cloud.bigquery.job.QueryJobConfig.schema_update_options`. """ return self._configuration.schema_update_options def to_api_repr(self): """Generate a resource for :meth:`_begin`.""" configuration = self._configuration.to_api_repr() resource = { "jobReference": self._properties["jobReference"], "configuration": configuration, } configuration["query"]["query"] = self.query return resource def _copy_configuration_properties(self, configuration): """Helper: assign subclass configuration properties in cleaned.""" self._configuration._properties = copy.deepcopy(configuration) self.query = _helpers._get_sub_prop(configuration, ["query", "query"]) @classmethod def from_api_repr(cls, resource, client): """Factory: construct a job given its API representation :type resource: dict :param resource: dataset job representation returned from the API :type client: :class:`google.cloud.bigquery.client.Client` :param client: Client which holds credentials and project configuration for the dataset. :rtype: :class:`google.cloud.bigquery.job.QueryJob` :returns: Job parsed from ``resource``. """ job_id, config = cls._get_resource_config(resource) query = config["query"]["query"] job = cls(job_id, query, client=client) job._set_properties(resource) return job @property def query_plan(self): """Return query plan from job statistics, if present. See: https://cloud.google.com/bigquery/docs/reference/rest/v2/jobs#statistics.query.queryPlan :rtype: list of :class:`QueryPlanEntry` :returns: mappings describing the query plan, or an empty list if the query has not yet completed. """ plan_entries = self._job_statistics().get("queryPlan", ()) return [QueryPlanEntry.from_api_repr(entry) for entry in plan_entries] @property def timeline(self): """List(TimelineEntry): Return the query execution timeline from job statistics. """ raw = self._job_statistics().get("timeline", ()) return [TimelineEntry.from_api_repr(entry) for entry in raw] @property def total_bytes_processed(self): """Return total bytes processed from job statistics, if present. See: https://cloud.google.com/bigquery/docs/reference/rest/v2/jobs#statistics.query.totalBytesProcessed :rtype: int or None :returns: total bytes processed by the job, or None if job is not yet complete. """ result = self._job_statistics().get("totalBytesProcessed") if result is not None: result = int(result) return result @property def total_bytes_billed(self): """Return total bytes billed from job statistics, if present. See: https://cloud.google.com/bigquery/docs/reference/rest/v2/jobs#statistics.query.totalBytesBilled :rtype: int or None :returns: total bytes processed by the job, or None if job is not yet complete. """ result = self._job_statistics().get("totalBytesBilled") if result is not None: result = int(result) return result @property def billing_tier(self): """Return billing tier from job statistics, if present. See: https://cloud.google.com/bigquery/docs/reference/rest/v2/jobs#statistics.query.billingTier :rtype: int or None :returns: billing tier used by the job, or None if job is not yet complete. """ return self._job_statistics().get("billingTier") @property def cache_hit(self): """Return whether or not query results were served from cache. See: https://cloud.google.com/bigquery/docs/reference/rest/v2/jobs#statistics.query.cacheHit :rtype: bool or None :returns: whether the query results were returned from cache, or None if job is not yet complete. """ return self._job_statistics().get("cacheHit") @property def ddl_operation_performed(self): """Optional[str]: Return the DDL operation performed. See: https://cloud.google.com/bigquery/docs/reference/rest/v2/jobs#statistics.query.ddlOperationPerformed """ return self._job_statistics().get("ddlOperationPerformed") @property def ddl_target_table(self): """Optional[TableReference]: Return the DDL target table, present for CREATE/DROP TABLE/VIEW queries. See: https://cloud.google.com/bigquery/docs/reference/rest/v2/jobs#statistics.query.ddlTargetTable """ prop = self._job_statistics().get("ddlTargetTable") if prop is not None: prop = TableReference.from_api_repr(prop) return prop @property def num_dml_affected_rows(self): """Return the number of DML rows affected by the job. See: https://cloud.google.com/bigquery/docs/reference/rest/v2/jobs#statistics.query.numDmlAffectedRows :rtype: int or None :returns: number of DML rows affected by the job, or None if job is not yet complete. """ result = self._job_statistics().get("numDmlAffectedRows") if result is not None: result = int(result) return result @property def slot_millis(self): """Union[int, None]: Slot-milliseconds used by this query job.""" return _helpers._int_or_none(self._job_statistics().get("totalSlotMs")) @property def statement_type(self): """Return statement type from job statistics, if present. See: https://cloud.google.com/bigquery/docs/reference/rest/v2/jobs#statistics.query.statementType :rtype: str or None :returns: type of statement used by the job, or None if job is not yet complete. """ return self._job_statistics().get("statementType") @property def referenced_tables(self): """Return referenced tables from job statistics, if present. See: https://cloud.google.com/bigquery/docs/reference/rest/v2/jobs#statistics.query.referencedTables :rtype: list of dict :returns: mappings describing the query plan, or an empty list if the query has not yet completed. """ tables = [] datasets_by_project_name = {} for table in self._job_statistics().get("referencedTables", ()): t_project = table["projectId"] ds_id = table["datasetId"] t_dataset = datasets_by_project_name.get((t_project, ds_id)) if t_dataset is None: t_dataset = DatasetReference(t_project, ds_id) datasets_by_project_name[(t_project, ds_id)] = t_dataset t_name = table["tableId"] tables.append(t_dataset.table(t_name)) return tables @property def undeclared_query_parameters(self): """Return undeclared query parameters from job statistics, if present. See: https://cloud.google.com/bigquery/docs/reference/rest/v2/jobs#statistics.query.undeclaredQueryParameters :rtype: list of :class:`~google.cloud.bigquery.ArrayQueryParameter`, :class:`~google.cloud.bigquery.ScalarQueryParameter`, or :class:`~google.cloud.bigquery.StructQueryParameter` :returns: undeclared parameters, or an empty list if the query has not yet completed. """ parameters = [] undeclared = self._job_statistics().get("undeclaredQueryParameters", ()) for parameter in undeclared: p_type = parameter["parameterType"] if "arrayType" in p_type: klass = ArrayQueryParameter elif "structTypes" in p_type: klass = StructQueryParameter else: klass = ScalarQueryParameter parameters.append(klass.from_api_repr(parameter)) return parameters @property def estimated_bytes_processed(self): """Return the estimated number of bytes processed by the query. See: https://cloud.google.com/bigquery/docs/reference/rest/v2/jobs#statistics.query.estimatedBytesProcessed :rtype: int or None :returns: number of DML rows affected by the job, or None if job is not yet complete. """ result = self._job_statistics().get("estimatedBytesProcessed") if result is not None: result = int(result) return result def done(self, retry=DEFAULT_RETRY): """Refresh the job and checks if it is complete. :rtype: bool :returns: True if the job is complete, False otherwise. """ # Since the API to getQueryResults can hang up to the timeout value # (default of 10 seconds), set the timeout parameter to ensure that # the timeout from the futures API is respected. See: # https://github.com/GoogleCloudPlatform/google-cloud-python/issues/4135 timeout_ms = None if self._done_timeout is not None: # Subtract a buffer for context switching, network latency, etc. timeout = self._done_timeout - _TIMEOUT_BUFFER_SECS timeout = max(min(timeout, 10), 0) self._done_timeout -= timeout self._done_timeout = max(0, self._done_timeout) timeout_ms = int(timeout * 1000) # Do not refresh is the state is already done, as the job will not # change once complete. if self.state != _DONE_STATE: self._query_results = self._client._get_query_results( self.job_id, retry, project=self.project, timeout_ms=timeout_ms, location=self.location, ) # Only reload the job once we know the query is complete. # This will ensure that fields such as the destination table are # correctly populated. if self._query_results.complete: self.reload(retry=retry) return self.state == _DONE_STATE def _blocking_poll(self, timeout=None): self._done_timeout = timeout super(QueryJob, self)._blocking_poll(timeout=timeout) def result(self, timeout=None, retry=DEFAULT_RETRY): """Start the job and wait for it to complete and get the result. :type timeout: float :param timeout: How long (in seconds) to wait for job to complete before raising a :class:`concurrent.futures.TimeoutError`. :type retry: :class:`google.api_core.retry.Retry` :param retry: (Optional) How to retry the call that retrieves rows. :rtype: :class:`~google.cloud.bigquery.table.RowIterator` :returns: Iterator of row data :class:`~google.cloud.bigquery.table.Row`-s. During each page, the iterator will have the ``total_rows`` attribute set, which counts the total number of rows **in the result set** (this is distinct from the total number of rows in the current page: ``iterator.page.num_items``). :raises: :class:`~google.cloud.exceptions.GoogleCloudError` if the job failed or :class:`concurrent.futures.TimeoutError` if the job did not complete in the given timeout. """ super(QueryJob, self).result(timeout=timeout) # Return an iterator instead of returning the job. if not self._query_results: self._query_results = self._client._get_query_results( self.job_id, retry, project=self.project, location=self.location ) # If the query job is complete but there are no query results, this was # special job, such as a DDL query. Return an empty result set to # indicate success and avoid calling tabledata.list on a table which # can't be read (such as a view table). if self._query_results.total_rows is None: return _EmptyRowIterator() schema = self._query_results.schema dest_table_ref = self.destination dest_table = Table(dest_table_ref, schema=schema) return self._client.list_rows(dest_table, retry=retry) def to_dataframe(self): """Return a pandas DataFrame from a QueryJob Returns: A :class:`~pandas.DataFrame` populated with row data and column headers from the query results. The column headers are derived from the destination table's schema. Raises: ValueError: If the `pandas` library cannot be imported. """ return self.result().to_dataframe() def __iter__(self): return iter(self.result()) class QueryPlanEntryStep(object): """Map a single step in a query plan entry. :type kind: str :param kind: step type :type substeps: :param substeps: names of substeps """ def __init__(self, kind, substeps): self.kind = kind self.substeps = list(substeps) @classmethod def from_api_repr(cls, resource): """Factory: construct instance from the JSON repr. :type resource: dict :param resource: JSON representation of the entry :rtype: :class:`QueryPlanEntryStep` :return: new instance built from the resource """ return cls(kind=resource.get("kind"), substeps=resource.get("substeps", ())) def __eq__(self, other): if not isinstance(other, self.__class__): return NotImplemented return self.kind == other.kind and self.substeps == other.substeps class QueryPlanEntry(object): """QueryPlanEntry represents a single stage of a query execution plan. See https://cloud.google.com/bigquery/docs/reference/rest/v2/jobs for the underlying API representation within query statistics. """ def __init__(self): self._properties = {} @classmethod def from_api_repr(cls, resource): """Factory: construct instance from the JSON repr. Args: resource(Dict[str: object]): ExplainQueryStage representation returned from API Returns: google.cloud.bigquery.QueryPlanEntry: Query plan entry parsed from ``resource`` """ entry = cls() entry._properties = resource return entry @property def name(self): """Union[str, None]: Human-readable name of the stage.""" return self._properties.get("name") @property def entry_id(self): """Union[str, None]: Unique ID for the stage within the plan.""" return self._properties.get("id") @property def start(self): """Union[Datetime, None]: Datetime when the stage started.""" if self._properties.get("startMs") is None: return None return _helpers._datetime_from_microseconds( int(self._properties.get("startMs")) * 1000.0 ) @property def end(self): """Union[Datetime, None]: Datetime when the stage ended.""" if self._properties.get("endMs") is None: return None return _helpers._datetime_from_microseconds( int(self._properties.get("endMs")) * 1000.0 ) @property def input_stages(self): """List(int): Entry IDs for stages that were inputs for this stage.""" if self._properties.get("inputStages") is None: return [] return [ _helpers._int_or_none(entry) for entry in self._properties.get("inputStages") ] @property def parallel_inputs(self): """Union[int, None]: Number of parallel input segments within the stage. """ return _helpers._int_or_none(self._properties.get("parallelInputs")) @property def completed_parallel_inputs(self): """Union[int, None]: Number of parallel input segments completed.""" return _helpers._int_or_none(self._properties.get("completedParallelInputs")) @property def wait_ms_avg(self): """Union[int, None]: Milliseconds the average worker spent waiting to be scheduled. """ return _helpers._int_or_none(self._properties.get("waitMsAvg")) @property def wait_ms_max(self): """Union[int, None]: Milliseconds the slowest worker spent waiting to be scheduled. """ return _helpers._int_or_none(self._properties.get("waitMsMax")) @property def wait_ratio_avg(self): """Union[float, None]: Ratio of time the average worker spent waiting to be scheduled, relative to the longest time spent by any worker in any stage of the overall plan. """ return self._properties.get("waitRatioAvg") @property def wait_ratio_max(self): """Union[float, None]: Ratio of time the slowest worker spent waiting to be scheduled, relative to the longest time spent by any worker in any stage of the overall plan. """ return self._properties.get("waitRatioMax") @property def read_ms_avg(self): """Union[int, None]: Milliseconds the average worker spent reading input. """ return _helpers._int_or_none(self._properties.get("readMsAvg")) @property def read_ms_max(self): """Union[int, None]: Milliseconds the slowest worker spent reading input. """ return _helpers._int_or_none(self._properties.get("readMsMax")) @property def read_ratio_avg(self): """Union[float, None]: Ratio of time the average worker spent reading input, relative to the longest time spent by any worker in any stage of the overall plan. """ return self._properties.get("readRatioAvg") @property def read_ratio_max(self): """Union[float, None]: Ratio of time the slowest worker spent reading to be scheduled, relative to the longest time spent by any worker in any stage of the overall plan. """ return self._properties.get("readRatioMax") @property def compute_ms_avg(self): """Union[int, None]: Milliseconds the average worker spent on CPU-bound processing. """ return _helpers._int_or_none(self._properties.get("computeMsAvg")) @property def compute_ms_max(self): """Union[int, None]: Milliseconds the slowest worker spent on CPU-bound processing. """ return _helpers._int_or_none(self._properties.get("computeMsMax")) @property def compute_ratio_avg(self): """Union[float, None]: Ratio of time the average worker spent on CPU-bound processing, relative to the longest time spent by any worker in any stage of the overall plan. """ return self._properties.get("computeRatioAvg") @property def compute_ratio_max(self): """Union[float, None]: Ratio of time the slowest worker spent on CPU-bound processing, relative to the longest time spent by any worker in any stage of the overall plan. """ return self._properties.get("computeRatioMax") @property def write_ms_avg(self): """Union[int, None]: Milliseconds the average worker spent writing output data. """ return _helpers._int_or_none(self._properties.get("writeMsAvg")) @property def write_ms_max(self): """Union[int, None]: Milliseconds the slowest worker spent writing output data. """ return _helpers._int_or_none(self._properties.get("writeMsMax")) @property def write_ratio_avg(self): """Union[float, None]: Ratio of time the average worker spent writing output data, relative to the longest time spent by any worker in any stage of the overall plan. """ return self._properties.get("writeRatioAvg") @property def write_ratio_max(self): """Union[float, None]: Ratio of time the slowest worker spent writing output data, relative to the longest time spent by any worker in any stage of the overall plan. """ return self._properties.get("writeRatioMax") @property def records_read(self): """Union[int, None]: Number of records read by this stage.""" return _helpers._int_or_none(self._properties.get("recordsRead")) @property def records_written(self): """Union[int, None]: Number of records written by this stage.""" return _helpers._int_or_none(self._properties.get("recordsWritten")) @property def status(self): """Union[str, None]: status of this stage.""" return self._properties.get("status") @property def shuffle_output_bytes(self): """Union[int, None]: Number of bytes written by this stage to intermediate shuffle. """ return _helpers._int_or_none(self._properties.get("shuffleOutputBytes")) @property def shuffle_output_bytes_spilled(self): """Union[int, None]: Number of bytes written by this stage to intermediate shuffle and spilled to disk. """ return _helpers._int_or_none(self._properties.get("shuffleOutputBytesSpilled")) @property def steps(self): """List(QueryPlanEntryStep): List of step operations performed by each worker in the stage. """ return [ QueryPlanEntryStep.from_api_repr(step) for step in self._properties.get("steps", []) ] class TimelineEntry(object): """TimelineEntry represents progress of a query job at a particular point in time. See https://cloud.google.com/bigquery/docs/reference/rest/v2/jobs for the underlying API representation within query statistics. """ def __init__(self): self._properties = {} @classmethod def from_api_repr(cls, resource): """Factory: construct instance from the JSON repr. Args: resource(Dict[str: object]): QueryTimelineSample representation returned from API Returns: google.cloud.bigquery.TimelineEntry: Timeline sample parsed from ``resource`` """ entry = cls() entry._properties = resource return entry @property def elapsed_ms(self): """Union[int, None]: Milliseconds elapsed since start of query execution.""" return _helpers._int_or_none(self._properties.get("elapsedMs")) @property def active_units(self): """Union[int, None]: Current number of input units being processed by workers, reported as largest value since the last sample.""" return _helpers._int_or_none(self._properties.get("activeUnits")) @property def pending_units(self): """Union[int, None]: Current number of input units remaining for query stages active at this sample time.""" return _helpers._int_or_none(self._properties.get("pendingUnits")) @property def completed_units(self): """Union[int, None]: Current number of input units completed by this query.""" return _helpers._int_or_none(self._properties.get("completedUnits")) @property def slot_millis(self): """Union[int, None]: Cumulative slot-milliseconds consumed by this query.""" return _helpers._int_or_none(self._properties.get("totalSlotMs")) class UnknownJob(_AsyncJob): """A job whose type cannot be determined.""" @classmethod def from_api_repr(cls, resource, client): """Construct an UnknownJob from the JSON representation. Args: resource (dict): JSON representation of a job. client (google.cloud.bigquery.client.Client): Client connected to BigQuery API. Returns: UnknownJob: Job corresponding to the resource. """ job_ref_properties = resource.get("jobReference", {"projectId": client.project}) job_ref = _JobReference._from_api_repr(job_ref_properties) job = cls(job_ref, client) # Populate the job reference with the project, even if it has been # redacted, because we know it should equal that of the request. resource["jobReference"] = job_ref_properties job._properties = resource return job
34
128
0.647908
import copy import threading from six.moves import http_client import google.api_core.future.polling from google.cloud import exceptions from google.cloud.exceptions import NotFound from google.cloud.bigquery.dataset import DatasetReference from google.cloud.bigquery.external_config import ExternalConfig from google.cloud.bigquery.query import _query_param_from_api_repr from google.cloud.bigquery.query import ArrayQueryParameter from google.cloud.bigquery.query import ScalarQueryParameter from google.cloud.bigquery.query import StructQueryParameter from google.cloud.bigquery.query import UDFResource from google.cloud.bigquery.retry import DEFAULT_RETRY from google.cloud.bigquery.schema import SchemaField from google.cloud.bigquery.table import _EmptyRowIterator from google.cloud.bigquery.table import EncryptionConfiguration from google.cloud.bigquery.table import TableReference from google.cloud.bigquery.table import Table from google.cloud.bigquery.table import TimePartitioning from google.cloud.bigquery import _helpers _DONE_STATE = "DONE" _STOPPED_REASON = "stopped" _TIMEOUT_BUFFER_SECS = 0.1 _ERROR_REASON_TO_EXCEPTION = { "accessDenied": http_client.FORBIDDEN, "backendError": http_client.INTERNAL_SERVER_ERROR, "billingNotEnabled": http_client.FORBIDDEN, "billingTierLimitExceeded": http_client.BAD_REQUEST, "blocked": http_client.FORBIDDEN, "duplicate": http_client.CONFLICT, "internalError": http_client.INTERNAL_SERVER_ERROR, "invalid": http_client.BAD_REQUEST, "invalidQuery": http_client.BAD_REQUEST, "notFound": http_client.NOT_FOUND, "notImplemented": http_client.NOT_IMPLEMENTED, "quotaExceeded": http_client.FORBIDDEN, "rateLimitExceeded": http_client.FORBIDDEN, "resourceInUse": http_client.BAD_REQUEST, "resourcesExceeded": http_client.BAD_REQUEST, "responseTooLarge": http_client.FORBIDDEN, "stopped": http_client.OK, "tableUnavailable": http_client.BAD_REQUEST, } def _error_result_to_exception(error_result): reason = error_result.get("reason") status_code = _ERROR_REASON_TO_EXCEPTION.get( reason, http_client.INTERNAL_SERVER_ERROR ) return exceptions.from_http_status( status_code, error_result.get("message", ""), errors=[error_result] ) class Compression(object): GZIP = "GZIP" DEFLATE = "DEFLATE" SNAPPY = "SNAPPY" NONE = "NONE" class CreateDisposition(object): CREATE_IF_NEEDED = "CREATE_IF_NEEDED" CREATE_NEVER = "CREATE_NEVER" class DestinationFormat(object): CSV = "CSV" NEWLINE_DELIMITED_JSON = "NEWLINE_DELIMITED_JSON" AVRO = "AVRO" class Encoding(object): UTF_8 = "UTF-8" ISO_8859_1 = "ISO-8859-1" class QueryPriority(object): INTERACTIVE = "INTERACTIVE" BATCH = "BATCH" class SourceFormat(object): CSV = "CSV" DATASTORE_BACKUP = "DATASTORE_BACKUP" NEWLINE_DELIMITED_JSON = "NEWLINE_DELIMITED_JSON" AVRO = "AVRO" PARQUET = "PARQUET" ORC = "ORC" class WriteDisposition(object): WRITE_APPEND = "WRITE_APPEND" WRITE_TRUNCATE = "WRITE_TRUNCATE" WRITE_EMPTY = "WRITE_EMPTY" class SchemaUpdateOption(object): ALLOW_FIELD_ADDITION = "ALLOW_FIELD_ADDITION" ALLOW_FIELD_RELAXATION = "ALLOW_FIELD_RELAXATION" class _JobReference(object): def __init__(self, job_id, project, location): self._properties = {"jobId": job_id, "projectId": project} if location: self._properties["location"] = location @property def job_id(self): return self._properties.get("jobId") @property def project(self): return self._properties.get("projectId") @property def location(self): return self._properties.get("location") def _to_api_repr(self): return copy.deepcopy(self._properties) @classmethod def _from_api_repr(cls, resource): job_id = resource.get("jobId") project = resource.get("projectId") location = resource.get("location") job_ref = cls(job_id, project, location) return job_ref class _AsyncJob(google.api_core.future.polling.PollingFuture): def __init__(self, job_id, client): super(_AsyncJob, self).__init__() job_ref = job_id if not isinstance(job_id, _JobReference): job_ref = _JobReference(job_id, client.project, None) self._properties = {"jobReference": job_ref._to_api_repr()} self._client = client self._result_set = False self._completion_lock = threading.Lock() @property def job_id(self): return _helpers._get_sub_prop(self._properties, ["jobReference", "jobId"]) @property def project(self): return _helpers._get_sub_prop(self._properties, ["jobReference", "projectId"]) @property def location(self): return _helpers._get_sub_prop(self._properties, ["jobReference", "location"]) def _require_client(self, client): if client is None: client = self._client return client @property def job_type(self): return self._JOB_TYPE @property def path(self): return "/projects/%s/jobs/%s" % (self.project, self.job_id) @property def labels(self): return self._properties.setdefault("labels", {}) @property def etag(self): return self._properties.get("etag") @property def self_link(self): return self._properties.get("selfLink") @property def user_email(self): return self._properties.get("user_email") @property def created(self): statistics = self._properties.get("statistics") if statistics is not None: millis = statistics.get("creationTime") if millis is not None: return _helpers._datetime_from_microseconds(millis * 1000.0) @property def started(self): statistics = self._properties.get("statistics") if statistics is not None: millis = statistics.get("startTime") if millis is not None: return _helpers._datetime_from_microseconds(millis * 1000.0) @property def ended(self): statistics = self._properties.get("statistics") if statistics is not None: millis = statistics.get("endTime") if millis is not None: return _helpers._datetime_from_microseconds(millis * 1000.0) def _job_statistics(self): statistics = self._properties.get("statistics", {}) return statistics.get(self._JOB_TYPE, {}) @property def error_result(self): status = self._properties.get("status") if status is not None: return status.get("errorResult") @property def errors(self): status = self._properties.get("status") if status is not None: return status.get("errors") @property def state(self): status = self._properties.get("status") if status is not None: return status.get("state") def _scrub_local_properties(self, cleaned): pass def _copy_configuration_properties(self, configuration): raise NotImplementedError("Abstract") def _set_properties(self, api_response): cleaned = api_response.copy() self._scrub_local_properties(cleaned) statistics = cleaned.get("statistics", {}) if "creationTime" in statistics: statistics["creationTime"] = float(statistics["creationTime"]) if "startTime" in statistics: statistics["startTime"] = float(statistics["startTime"]) if "endTime" in statistics: statistics["endTime"] = float(statistics["endTime"]) self._properties.clear() self._properties.update(cleaned) self._copy_configuration_properties(cleaned.get("configuration", {})) self._set_future_result() @classmethod def _get_resource_config(cls, resource): if "jobReference" not in resource or "jobId" not in resource["jobReference"]: raise KeyError( "Resource lacks required identity information: " '["jobReference"]["jobId"]' ) job_id = resource["jobReference"]["jobId"] if ( "configuration" not in resource or cls._JOB_TYPE not in resource["configuration"] ): raise KeyError( "Resource lacks required configuration: " '["configuration"]["%s"]' % cls._JOB_TYPE ) return job_id, resource["configuration"] def to_api_repr(self): raise NotImplementedError("Abstract") _build_resource = to_api_repr def _begin(self, client=None, retry=DEFAULT_RETRY): if self.state is not None: raise ValueError("Job already begun.") client = self._require_client(client) path = "/projects/%s/jobs" % (self.project,) api_response = client._call_api( retry, method="POST", path=path, data=self.to_api_repr() ) self._set_properties(api_response) def exists(self, client=None, retry=DEFAULT_RETRY): client = self._require_client(client) extra_params = {"fields": "id"} if self.location: extra_params["location"] = self.location try: client._call_api( retry, method="GET", path=self.path, query_params=extra_params ) except NotFound: return False else: return True def reload(self, client=None, retry=DEFAULT_RETRY): client = self._require_client(client) extra_params = {} if self.location: extra_params["location"] = self.location api_response = client._call_api( retry, method="GET", path=self.path, query_params=extra_params ) self._set_properties(api_response) def cancel(self, client=None): client = self._require_client(client) extra_params = {} if self.location: extra_params["location"] = self.location api_response = client._connection.api_request( method="POST", path="%s/cancel" % (self.path,), query_params=extra_params ) self._set_properties(api_response["job"]) return True def _set_future_result(self): with self._completion_lock: # set, do not call set_result/set_exception again. # Note: self._result_set is set to True in set_result and # set_exception, in case those methods are invoked directly. if self.state != _DONE_STATE or self._result_set: return if self.error_result is not None: exception = _error_result_to_exception(self.error_result) self.set_exception(exception) else: self.set_result(self) def done(self, retry=DEFAULT_RETRY): # Do not refresh is the state is already done, as the job will not # change once complete. if self.state != _DONE_STATE: self.reload(retry=retry) return self.state == _DONE_STATE def result(self, timeout=None, retry=DEFAULT_RETRY): if self.state is None: self._begin(retry=retry) # TODO: modify PollingFuture so it can pass a retry argument to done(). return super(_AsyncJob, self).result(timeout=timeout) def cancelled(self): return ( self.error_result is not None and self.error_result.get("reason") == _STOPPED_REASON ) class _JobConfig(object): def __init__(self, job_type, **kwargs): self._job_type = job_type self._properties = {job_type: {}} for prop, val in kwargs.items(): setattr(self, prop, val) @property def labels(self): return self._properties.setdefault("labels", {}) @labels.setter def labels(self, value): if not isinstance(value, dict): raise ValueError("Pass a dict") self._properties["labels"] = value def _get_sub_prop(self, key, default=None): return _helpers._get_sub_prop( self._properties, [self._job_type, key], default=default ) def _set_sub_prop(self, key, value): _helpers._set_sub_prop(self._properties, [self._job_type, key], value) def _del_sub_prop(self, key): _helpers._del_sub_prop(self._properties, [self._job_type, key]) def to_api_repr(self): return copy.deepcopy(self._properties) def _fill_from_default(self, default_job_config): if self._job_type != default_job_config._job_type: raise TypeError( "attempted to merge two incompatible job types: " + repr(self._job_type) + ", " + repr(default_job_config._job_type) ) new_job_config = self.__class__() default_job_properties = copy.deepcopy(default_job_config._properties) for key in self._properties: if key != self._job_type: default_job_properties[key] = self._properties[key] default_job_properties[self._job_type].update(self._properties[self._job_type]) new_job_config._properties = default_job_properties return new_job_config @classmethod def from_api_repr(cls, resource): config = cls() config._properties = copy.deepcopy(resource) return config class LoadJobConfig(_JobConfig): def __init__(self, **kwargs): super(LoadJobConfig, self).__init__("load", **kwargs) @property def allow_jagged_rows(self): return self._get_sub_prop("allowJaggedRows") @allow_jagged_rows.setter def allow_jagged_rows(self, value): self._set_sub_prop("allowJaggedRows", value) @property def allow_quoted_newlines(self): return self._get_sub_prop("allowQuotedNewlines") @allow_quoted_newlines.setter def allow_quoted_newlines(self, value): self._set_sub_prop("allowQuotedNewlines", value) @property def autodetect(self): return self._get_sub_prop("autodetect") @autodetect.setter def autodetect(self, value): self._set_sub_prop("autodetect", value) @property def clustering_fields(self): prop = self._get_sub_prop("clustering") if prop is not None: return list(prop.get("fields", ())) @clustering_fields.setter def clustering_fields(self, value): if value is not None: self._set_sub_prop("clustering", {"fields": value}) else: self._del_sub_prop("clustering") @property def create_disposition(self): return self._get_sub_prop("createDisposition") @create_disposition.setter def create_disposition(self, value): self._set_sub_prop("createDisposition", value) @property def destination_encryption_configuration(self): prop = self._get_sub_prop("destinationEncryptionConfiguration") if prop is not None: prop = EncryptionConfiguration.from_api_repr(prop) return prop @destination_encryption_configuration.setter def destination_encryption_configuration(self, value): api_repr = value if value is not None: api_repr = value.to_api_repr() self._set_sub_prop("destinationEncryptionConfiguration", api_repr) else: self._del_sub_prop("destinationEncryptionConfiguration") @property def destination_table_description(self): prop = self._get_sub_prop("destinationTableProperties") if prop is not None: return prop["description"] @destination_table_description.setter def destination_table_description(self, value): keys = [self._job_type, "destinationTableProperties", "description"] if value is not None: _helpers._set_sub_prop(self._properties, keys, value) else: _helpers._del_sub_prop(self._properties, keys) @property def destination_table_friendly_name(self): prop = self._get_sub_prop("destinationTableProperties") if prop is not None: return prop["friendlyName"] @destination_table_friendly_name.setter def destination_table_friendly_name(self, value): keys = [self._job_type, "destinationTableProperties", "friendlyName"] if value is not None: _helpers._set_sub_prop(self._properties, keys, value) else: _helpers._del_sub_prop(self._properties, keys) @property def encoding(self): return self._get_sub_prop("encoding") @encoding.setter def encoding(self, value): self._set_sub_prop("encoding", value) @property def field_delimiter(self): return self._get_sub_prop("fieldDelimiter") @field_delimiter.setter def field_delimiter(self, value): self._set_sub_prop("fieldDelimiter", value) @property def ignore_unknown_values(self): return self._get_sub_prop("ignoreUnknownValues") @ignore_unknown_values.setter def ignore_unknown_values(self, value): self._set_sub_prop("ignoreUnknownValues", value) @property def max_bad_records(self): return _helpers._int_or_none(self._get_sub_prop("maxBadRecords")) @max_bad_records.setter def max_bad_records(self, value): self._set_sub_prop("maxBadRecords", value) @property def null_marker(self): return self._get_sub_prop("nullMarker") @null_marker.setter def null_marker(self, value): self._set_sub_prop("nullMarker", value) @property def quote_character(self): return self._get_sub_prop("quote") @quote_character.setter def quote_character(self, value): self._set_sub_prop("quote", value) @property def schema(self): schema = _helpers._get_sub_prop(self._properties, ["load", "schema", "fields"]) if schema is None: return return [SchemaField.from_api_repr(field) for field in schema] @schema.setter def schema(self, value): if not all(hasattr(field, "to_api_repr") for field in value): raise ValueError("Schema items must be fields") _helpers._set_sub_prop( self._properties, ["load", "schema", "fields"], [field.to_api_repr() for field in value], ) @property def schema_update_options(self): return self._get_sub_prop("schemaUpdateOptions") @schema_update_options.setter def schema_update_options(self, values): self._set_sub_prop("schemaUpdateOptions", values) @property def skip_leading_rows(self): return _helpers._int_or_none(self._get_sub_prop("skipLeadingRows")) @skip_leading_rows.setter def skip_leading_rows(self, value): self._set_sub_prop("skipLeadingRows", str(value)) @property def source_format(self): return self._get_sub_prop("sourceFormat") @source_format.setter def source_format(self, value): self._set_sub_prop("sourceFormat", value) @property def time_partitioning(self): prop = self._get_sub_prop("timePartitioning") if prop is not None: prop = TimePartitioning.from_api_repr(prop) return prop @time_partitioning.setter def time_partitioning(self, value): api_repr = value if value is not None: api_repr = value.to_api_repr() self._set_sub_prop("timePartitioning", api_repr) else: self._del_sub_prop("timePartitioning") @property def use_avro_logical_types(self): return self._get_sub_prop("useAvroLogicalTypes") @use_avro_logical_types.setter def use_avro_logical_types(self, value): self._set_sub_prop("useAvroLogicalTypes", bool(value)) @property def write_disposition(self): return self._get_sub_prop("writeDisposition") @write_disposition.setter def write_disposition(self, value): self._set_sub_prop("writeDisposition", value) class LoadJob(_AsyncJob): _JOB_TYPE = "load" def __init__(self, job_id, source_uris, destination, client, job_config=None): super(LoadJob, self).__init__(job_id, client) if job_config is None: job_config = LoadJobConfig() self.source_uris = source_uris self.destination = destination self._configuration = job_config @property def allow_jagged_rows(self): return self._configuration.allow_jagged_rows @property def allow_quoted_newlines(self): return self._configuration.allow_quoted_newlines @property def autodetect(self): return self._configuration.autodetect @property def create_disposition(self): return self._configuration.create_disposition @property def encoding(self): return self._configuration.encoding @property def field_delimiter(self): return self._configuration.field_delimiter @property def ignore_unknown_values(self): return self._configuration.ignore_unknown_values @property def max_bad_records(self): return self._configuration.max_bad_records @property def null_marker(self): return self._configuration.null_marker @property def quote_character(self): return self._configuration.quote_character @property def skip_leading_rows(self): return self._configuration.skip_leading_rows @property def source_format(self): return self._configuration.source_format @property def write_disposition(self): return self._configuration.write_disposition @property def schema(self): return self._configuration.schema @property def destination_encryption_configuration(self): return self._configuration.destination_encryption_configuration @property def time_partitioning(self): return self._configuration.time_partitioning @property def use_avro_logical_types(self): return self._configuration.use_avro_logical_types @property def clustering_fields(self): return self._configuration.clustering_fields @property def schema_update_options(self): return self._configuration.schema_update_options @property def input_file_bytes(self): return _helpers._int_or_none( _helpers._get_sub_prop( self._properties, ["statistics", "load", "inputFileBytes"] ) ) @property def input_files(self): return _helpers._int_or_none( _helpers._get_sub_prop( self._properties, ["statistics", "load", "inputFiles"] ) ) @property def output_bytes(self): return _helpers._int_or_none( _helpers._get_sub_prop( self._properties, ["statistics", "load", "outputBytes"] ) ) @property def output_rows(self): return _helpers._int_or_none( _helpers._get_sub_prop( self._properties, ["statistics", "load", "outputRows"] ) ) def to_api_repr(self): configuration = self._configuration.to_api_repr() if self.source_uris is not None: _helpers._set_sub_prop( configuration, ["load", "sourceUris"], self.source_uris ) _helpers._set_sub_prop( configuration, ["load", "destinationTable"], self.destination.to_api_repr() ) return { "jobReference": self._properties["jobReference"], "configuration": configuration, } def _copy_configuration_properties(self, configuration): self._configuration._properties = copy.deepcopy(configuration) @classmethod def from_api_repr(cls, resource, client): config_resource = resource.get("configuration", {}) config = LoadJobConfig.from_api_repr(config_resource) # A load job requires a destination table. dest_config = config_resource["load"]["destinationTable"] ds_ref = DatasetReference(dest_config["projectId"], dest_config["datasetId"]) destination = TableReference(ds_ref, dest_config["tableId"]) # sourceUris will be absent if this is a file upload. source_uris = _helpers._get_sub_prop(config_resource, ["load", "sourceUris"]) job_ref = _JobReference._from_api_repr(resource["jobReference"]) job = cls(job_ref, source_uris, destination, client, config) job._set_properties(resource) return job class CopyJobConfig(_JobConfig): def __init__(self, **kwargs): super(CopyJobConfig, self).__init__("copy", **kwargs) @property def create_disposition(self): return self._get_sub_prop("createDisposition") @create_disposition.setter def create_disposition(self, value): self._set_sub_prop("createDisposition", value) @property def write_disposition(self): return self._get_sub_prop("writeDisposition") @write_disposition.setter def write_disposition(self, value): self._set_sub_prop("writeDisposition", value) @property def destination_encryption_configuration(self): prop = self._get_sub_prop("destinationEncryptionConfiguration") if prop is not None: prop = EncryptionConfiguration.from_api_repr(prop) return prop @destination_encryption_configuration.setter def destination_encryption_configuration(self, value): api_repr = value if value is not None: api_repr = value.to_api_repr() self._set_sub_prop("destinationEncryptionConfiguration", api_repr) class CopyJob(_AsyncJob): _JOB_TYPE = "copy" def __init__(self, job_id, sources, destination, client, job_config=None): super(CopyJob, self).__init__(job_id, client) if job_config is None: job_config = CopyJobConfig() self.destination = destination self.sources = sources self._configuration = job_config @property def create_disposition(self): return self._configuration.create_disposition @property def write_disposition(self): return self._configuration.write_disposition @property def destination_encryption_configuration(self): return self._configuration.destination_encryption_configuration def to_api_repr(self): source_refs = [ { "projectId": table.project, "datasetId": table.dataset_id, "tableId": table.table_id, } for table in self.sources ] configuration = self._configuration.to_api_repr() _helpers._set_sub_prop(configuration, ["copy", "sourceTables"], source_refs) _helpers._set_sub_prop( configuration, ["copy", "destinationTable"], { "projectId": self.destination.project, "datasetId": self.destination.dataset_id, "tableId": self.destination.table_id, }, ) return { "jobReference": self._properties["jobReference"], "configuration": configuration, } def _copy_configuration_properties(self, configuration): self._configuration._properties = copy.deepcopy(configuration) @classmethod def from_api_repr(cls, resource, client): job_id, config_resource = cls._get_resource_config(resource) config = CopyJobConfig.from_api_repr(config_resource) # Copy required fields to the job. copy_resource = config_resource["copy"] destination = TableReference.from_api_repr(copy_resource["destinationTable"]) sources = [] source_configs = copy_resource.get("sourceTables") if source_configs is None: single = copy_resource.get("sourceTable") if single is None: raise KeyError("Resource missing 'sourceTables' / 'sourceTable'") source_configs = [single] for source_config in source_configs: table_ref = TableReference.from_api_repr(source_config) sources.append(table_ref) job = cls(job_id, sources, destination, client=client, job_config=config) job._set_properties(resource) return job class ExtractJobConfig(_JobConfig): def __init__(self, **kwargs): super(ExtractJobConfig, self).__init__("extract", **kwargs) @property def compression(self): return self._get_sub_prop("compression") @compression.setter def compression(self, value): self._set_sub_prop("compression", value) @property def destination_format(self): return self._get_sub_prop("destinationFormat") @destination_format.setter def destination_format(self, value): self._set_sub_prop("destinationFormat", value) @property def field_delimiter(self): return self._get_sub_prop("fieldDelimiter") @field_delimiter.setter def field_delimiter(self, value): self._set_sub_prop("fieldDelimiter", value) @property def print_header(self): return self._get_sub_prop("printHeader") @print_header.setter def print_header(self, value): self._set_sub_prop("printHeader", value) class ExtractJob(_AsyncJob): _JOB_TYPE = "extract" def __init__(self, job_id, source, destination_uris, client, job_config=None): super(ExtractJob, self).__init__(job_id, client) if job_config is None: job_config = ExtractJobConfig() self.source = source self.destination_uris = destination_uris self._configuration = job_config @property def compression(self): return self._configuration.compression @property def destination_format(self): return self._configuration.destination_format @property def field_delimiter(self): return self._configuration.field_delimiter @property def print_header(self): return self._configuration.print_header @property def destination_uri_file_counts(self): counts = self._job_statistics().get("destinationUriFileCounts") if counts is not None: return [int(count) for count in counts] return None def to_api_repr(self): source_ref = { "projectId": self.source.project, "datasetId": self.source.dataset_id, "tableId": self.source.table_id, } configuration = self._configuration.to_api_repr() _helpers._set_sub_prop(configuration, ["extract", "sourceTable"], source_ref) _helpers._set_sub_prop( configuration, ["extract", "destinationUris"], self.destination_uris ) return { "jobReference": self._properties["jobReference"], "configuration": configuration, } def _copy_configuration_properties(self, configuration): self._configuration._properties = copy.deepcopy(configuration) @classmethod def from_api_repr(cls, resource, client): job_id, config_resource = cls._get_resource_config(resource) config = ExtractJobConfig.from_api_repr(config_resource) source_config = _helpers._get_sub_prop( config_resource, ["extract", "sourceTable"] ) dataset = DatasetReference( source_config["projectId"], source_config["datasetId"] ) source = dataset.table(source_config["tableId"]) destination_uris = _helpers._get_sub_prop( config_resource, ["extract", "destinationUris"] ) job = cls(job_id, source, destination_uris, client=client, job_config=config) job._set_properties(resource) return job def _from_api_repr_query_parameters(resource): return [_query_param_from_api_repr(mapping) for mapping in resource] def _to_api_repr_query_parameters(value): return [query_parameter.to_api_repr() for query_parameter in value] def _from_api_repr_udf_resources(resource): udf_resources = [] for udf_mapping in resource: for udf_type, udf_value in udf_mapping.items(): udf_resources.append(UDFResource(udf_type, udf_value)) return udf_resources def _to_api_repr_udf_resources(value): return [{udf_resource.udf_type: udf_resource.value} for udf_resource in value] def _from_api_repr_table_defs(resource): return {k: ExternalConfig.from_api_repr(v) for k, v in resource.items()} def _to_api_repr_table_defs(value): return {k: ExternalConfig.to_api_repr(v) for k, v in value.items()} class QueryJobConfig(_JobConfig): def __init__(self, **kwargs): super(QueryJobConfig, self).__init__("query", **kwargs) @property def destination_encryption_configuration(self): prop = self._get_sub_prop("destinationEncryptionConfiguration") if prop is not None: prop = EncryptionConfiguration.from_api_repr(prop) return prop @destination_encryption_configuration.setter def destination_encryption_configuration(self, value): api_repr = value if value is not None: api_repr = value.to_api_repr() self._set_sub_prop("destinationEncryptionConfiguration", api_repr) @property def allow_large_results(self): return self._get_sub_prop("allowLargeResults") @allow_large_results.setter def allow_large_results(self, value): self._set_sub_prop("allowLargeResults", value) @property def create_disposition(self): return self._get_sub_prop("createDisposition") @create_disposition.setter def create_disposition(self, value): self._set_sub_prop("createDisposition", value) @property def default_dataset(self): prop = self._get_sub_prop("defaultDataset") if prop is not None: prop = DatasetReference.from_api_repr(prop) return prop @default_dataset.setter def default_dataset(self, value): resource = None if value is not None: resource = value.to_api_repr() self._set_sub_prop("defaultDataset", resource) @property def destination(self): prop = self._get_sub_prop("destinationTable") if prop is not None: prop = TableReference.from_api_repr(prop) return prop @destination.setter def destination(self, value): resource = None if value is not None: resource = value.to_api_repr() self._set_sub_prop("destinationTable", resource) @property def dry_run(self): return self._properties.get("dryRun") @dry_run.setter def dry_run(self, value): self._properties["dryRun"] = value @property def flatten_results(self): return self._get_sub_prop("flattenResults") @flatten_results.setter def flatten_results(self, value): self._set_sub_prop("flattenResults", value) @property def maximum_billing_tier(self): return self._get_sub_prop("maximumBillingTier") @maximum_billing_tier.setter def maximum_billing_tier(self, value): self._set_sub_prop("maximumBillingTier", value) @property def maximum_bytes_billed(self): return _helpers._int_or_none(self._get_sub_prop("maximumBytesBilled")) @maximum_bytes_billed.setter def maximum_bytes_billed(self, value): self._set_sub_prop("maximumBytesBilled", str(value)) @property def priority(self): return self._get_sub_prop("priority") @priority.setter def priority(self, value): self._set_sub_prop("priority", value) @property def query_parameters(self): prop = self._get_sub_prop("queryParameters", default=[]) return _from_api_repr_query_parameters(prop) @query_parameters.setter def query_parameters(self, values): self._set_sub_prop("queryParameters", _to_api_repr_query_parameters(values)) @property def udf_resources(self): prop = self._get_sub_prop("userDefinedFunctionResources", default=[]) return _from_api_repr_udf_resources(prop) @udf_resources.setter def udf_resources(self, values): self._set_sub_prop( "userDefinedFunctionResources", _to_api_repr_udf_resources(values) ) @property def use_legacy_sql(self): return self._get_sub_prop("useLegacySql") @use_legacy_sql.setter def use_legacy_sql(self, value): self._set_sub_prop("useLegacySql", value) @property def use_query_cache(self): return self._get_sub_prop("useQueryCache") @use_query_cache.setter def use_query_cache(self, value): self._set_sub_prop("useQueryCache", value) @property def write_disposition(self): return self._get_sub_prop("writeDisposition") @write_disposition.setter def write_disposition(self, value): self._set_sub_prop("writeDisposition", value) @property def table_definitions(self): prop = self._get_sub_prop("tableDefinitions") if prop is not None: prop = _from_api_repr_table_defs(prop) return prop @table_definitions.setter def table_definitions(self, values): self._set_sub_prop("tableDefinitions", _to_api_repr_table_defs(values)) @property def time_partitioning(self): prop = self._get_sub_prop("timePartitioning") if prop is not None: prop = TimePartitioning.from_api_repr(prop) return prop @time_partitioning.setter def time_partitioning(self, value): api_repr = value if value is not None: api_repr = value.to_api_repr() self._set_sub_prop("timePartitioning", api_repr) @property def clustering_fields(self): prop = self._get_sub_prop("clustering") if prop is not None: return list(prop.get("fields", ())) @clustering_fields.setter def clustering_fields(self, value): if value is not None: self._set_sub_prop("clustering", {"fields": value}) else: self._del_sub_prop("clustering") @property def schema_update_options(self): return self._get_sub_prop("schemaUpdateOptions") @schema_update_options.setter def schema_update_options(self, values): self._set_sub_prop("schemaUpdateOptions", values) def to_api_repr(self): resource = copy.deepcopy(self._properties) # Query parameters have an addition property associated with them # to indicate if the query is using named or positional parameters. query_parameters = resource["query"].get("queryParameters") if query_parameters: if query_parameters[0].get("name") is None: resource["query"]["parameterMode"] = "POSITIONAL" else: resource["query"]["parameterMode"] = "NAMED" return resource class QueryJob(_AsyncJob): _JOB_TYPE = "query" _UDF_KEY = "userDefinedFunctionResources" def __init__(self, job_id, query, client, job_config=None): super(QueryJob, self).__init__(job_id, client) if job_config is None: job_config = QueryJobConfig() if job_config.use_legacy_sql is None: job_config.use_legacy_sql = False self.query = query self._configuration = job_config self._query_results = None self._done_timeout = None @property def allow_large_results(self): return self._configuration.allow_large_results @property def create_disposition(self): return self._configuration.create_disposition @property def default_dataset(self): return self._configuration.default_dataset @property def destination(self): return self._configuration.destination @property def destination_encryption_configuration(self): return self._configuration.destination_encryption_configuration @property def dry_run(self): return self._configuration.dry_run @property def flatten_results(self): return self._configuration.flatten_results @property def priority(self): return self._configuration.priority @property def query_parameters(self): return self._configuration.query_parameters @property def udf_resources(self): return self._configuration.udf_resources @property def use_legacy_sql(self): return self._configuration.use_legacy_sql @property def use_query_cache(self): return self._configuration.use_query_cache @property def write_disposition(self): return self._configuration.write_disposition @property def maximum_billing_tier(self): return self._configuration.maximum_billing_tier @property def maximum_bytes_billed(self): return self._configuration.maximum_bytes_billed @property def table_definitions(self): return self._configuration.table_definitions @property def time_partitioning(self): return self._configuration.time_partitioning @property def clustering_fields(self): return self._configuration.clustering_fields @property def schema_update_options(self): return self._configuration.schema_update_options def to_api_repr(self): configuration = self._configuration.to_api_repr() resource = { "jobReference": self._properties["jobReference"], "configuration": configuration, } configuration["query"]["query"] = self.query return resource def _copy_configuration_properties(self, configuration): self._configuration._properties = copy.deepcopy(configuration) self.query = _helpers._get_sub_prop(configuration, ["query", "query"]) @classmethod def from_api_repr(cls, resource, client): job_id, config = cls._get_resource_config(resource) query = config["query"]["query"] job = cls(job_id, query, client=client) job._set_properties(resource) return job @property def query_plan(self): plan_entries = self._job_statistics().get("queryPlan", ()) return [QueryPlanEntry.from_api_repr(entry) for entry in plan_entries] @property def timeline(self): raw = self._job_statistics().get("timeline", ()) return [TimelineEntry.from_api_repr(entry) for entry in raw] @property def total_bytes_processed(self): result = self._job_statistics().get("totalBytesProcessed") if result is not None: result = int(result) return result @property def total_bytes_billed(self): result = self._job_statistics().get("totalBytesBilled") if result is not None: result = int(result) return result @property def billing_tier(self): return self._job_statistics().get("billingTier") @property def cache_hit(self): return self._job_statistics().get("cacheHit") @property def ddl_operation_performed(self): return self._job_statistics().get("ddlOperationPerformed") @property def ddl_target_table(self): prop = self._job_statistics().get("ddlTargetTable") if prop is not None: prop = TableReference.from_api_repr(prop) return prop @property def num_dml_affected_rows(self): result = self._job_statistics().get("numDmlAffectedRows") if result is not None: result = int(result) return result @property def slot_millis(self): return _helpers._int_or_none(self._job_statistics().get("totalSlotMs")) @property def statement_type(self): return self._job_statistics().get("statementType") @property def referenced_tables(self): tables = [] datasets_by_project_name = {} for table in self._job_statistics().get("referencedTables", ()): t_project = table["projectId"] ds_id = table["datasetId"] t_dataset = datasets_by_project_name.get((t_project, ds_id)) if t_dataset is None: t_dataset = DatasetReference(t_project, ds_id) datasets_by_project_name[(t_project, ds_id)] = t_dataset t_name = table["tableId"] tables.append(t_dataset.table(t_name)) return tables @property def undeclared_query_parameters(self): parameters = [] undeclared = self._job_statistics().get("undeclaredQueryParameters", ()) for parameter in undeclared: p_type = parameter["parameterType"] if "arrayType" in p_type: klass = ArrayQueryParameter elif "structTypes" in p_type: klass = StructQueryParameter else: klass = ScalarQueryParameter parameters.append(klass.from_api_repr(parameter)) return parameters @property def estimated_bytes_processed(self): result = self._job_statistics().get("estimatedBytesProcessed") if result is not None: result = int(result) return result def done(self, retry=DEFAULT_RETRY): # Since the API to getQueryResults can hang up to the timeout value # (default of 10 seconds), set the timeout parameter to ensure that # the timeout from the futures API is respected. See: # https://github.com/GoogleCloudPlatform/google-cloud-python/issues/4135 timeout_ms = None if self._done_timeout is not None: # Subtract a buffer for context switching, network latency, etc. timeout = self._done_timeout - _TIMEOUT_BUFFER_SECS timeout = max(min(timeout, 10), 0) self._done_timeout -= timeout self._done_timeout = max(0, self._done_timeout) timeout_ms = int(timeout * 1000) # Do not refresh is the state is already done, as the job will not # change once complete. if self.state != _DONE_STATE: self._query_results = self._client._get_query_results( self.job_id, retry, project=self.project, timeout_ms=timeout_ms, location=self.location, ) # Only reload the job once we know the query is complete. # This will ensure that fields such as the destination table are # correctly populated. if self._query_results.complete: self.reload(retry=retry) return self.state == _DONE_STATE def _blocking_poll(self, timeout=None): self._done_timeout = timeout super(QueryJob, self)._blocking_poll(timeout=timeout) def result(self, timeout=None, retry=DEFAULT_RETRY): super(QueryJob, self).result(timeout=timeout) # Return an iterator instead of returning the job. if not self._query_results: self._query_results = self._client._get_query_results( self.job_id, retry, project=self.project, location=self.location ) # If the query job is complete but there are no query results, this was # special job, such as a DDL query. Return an empty result set to # indicate success and avoid calling tabledata.list on a table which # can't be read (such as a view table). if self._query_results.total_rows is None: return _EmptyRowIterator() schema = self._query_results.schema dest_table_ref = self.destination dest_table = Table(dest_table_ref, schema=schema) return self._client.list_rows(dest_table, retry=retry) def to_dataframe(self): return self.result().to_dataframe() def __iter__(self): return iter(self.result()) class QueryPlanEntryStep(object): def __init__(self, kind, substeps): self.kind = kind self.substeps = list(substeps) @classmethod def from_api_repr(cls, resource): return cls(kind=resource.get("kind"), substeps=resource.get("substeps", ())) def __eq__(self, other): if not isinstance(other, self.__class__): return NotImplemented return self.kind == other.kind and self.substeps == other.substeps class QueryPlanEntry(object): def __init__(self): self._properties = {} @classmethod def from_api_repr(cls, resource): entry = cls() entry._properties = resource return entry @property def name(self): return self._properties.get("name") @property def entry_id(self): return self._properties.get("id") @property def start(self): if self._properties.get("startMs") is None: return None return _helpers._datetime_from_microseconds( int(self._properties.get("startMs")) * 1000.0 ) @property def end(self): if self._properties.get("endMs") is None: return None return _helpers._datetime_from_microseconds( int(self._properties.get("endMs")) * 1000.0 ) @property def input_stages(self): if self._properties.get("inputStages") is None: return [] return [ _helpers._int_or_none(entry) for entry in self._properties.get("inputStages") ] @property def parallel_inputs(self): return _helpers._int_or_none(self._properties.get("parallelInputs")) @property def completed_parallel_inputs(self): return _helpers._int_or_none(self._properties.get("completedParallelInputs")) @property def wait_ms_avg(self): return _helpers._int_or_none(self._properties.get("waitMsAvg")) @property def wait_ms_max(self): return _helpers._int_or_none(self._properties.get("waitMsMax")) @property def wait_ratio_avg(self): return self._properties.get("waitRatioAvg") @property def wait_ratio_max(self): return self._properties.get("waitRatioMax") @property def read_ms_avg(self): return _helpers._int_or_none(self._properties.get("readMsAvg")) @property def read_ms_max(self): return _helpers._int_or_none(self._properties.get("readMsMax")) @property def read_ratio_avg(self): return self._properties.get("readRatioAvg") @property def read_ratio_max(self): return self._properties.get("readRatioMax") @property def compute_ms_avg(self): return _helpers._int_or_none(self._properties.get("computeMsAvg")) @property def compute_ms_max(self): return _helpers._int_or_none(self._properties.get("computeMsMax")) @property def compute_ratio_avg(self): return self._properties.get("computeRatioAvg") @property def compute_ratio_max(self): return self._properties.get("computeRatioMax") @property def write_ms_avg(self): return _helpers._int_or_none(self._properties.get("writeMsAvg")) @property def write_ms_max(self): return _helpers._int_or_none(self._properties.get("writeMsMax")) @property def write_ratio_avg(self): return self._properties.get("writeRatioAvg") @property def write_ratio_max(self): return self._properties.get("writeRatioMax") @property def records_read(self): return _helpers._int_or_none(self._properties.get("recordsRead")) @property def records_written(self): return _helpers._int_or_none(self._properties.get("recordsWritten")) @property def status(self): return self._properties.get("status") @property def shuffle_output_bytes(self): return _helpers._int_or_none(self._properties.get("shuffleOutputBytes")) @property def shuffle_output_bytes_spilled(self): return _helpers._int_or_none(self._properties.get("shuffleOutputBytesSpilled")) @property def steps(self): return [ QueryPlanEntryStep.from_api_repr(step) for step in self._properties.get("steps", []) ] class TimelineEntry(object): def __init__(self): self._properties = {} @classmethod def from_api_repr(cls, resource): entry = cls() entry._properties = resource return entry @property def elapsed_ms(self): return _helpers._int_or_none(self._properties.get("elapsedMs")) @property def active_units(self): return _helpers._int_or_none(self._properties.get("activeUnits")) @property def pending_units(self): return _helpers._int_or_none(self._properties.get("pendingUnits")) @property def completed_units(self): return _helpers._int_or_none(self._properties.get("completedUnits")) @property def slot_millis(self): return _helpers._int_or_none(self._properties.get("totalSlotMs")) class UnknownJob(_AsyncJob): @classmethod def from_api_repr(cls, resource, client): job_ref_properties = resource.get("jobReference", {"projectId": client.project}) job_ref = _JobReference._from_api_repr(job_ref_properties) job = cls(job_ref, client) resource["jobReference"] = job_ref_properties job._properties = resource return job
true
true
f72bb4debf4ce516c6fa1d5f7294e9cce53c4b79
4,826
py
Python
cccp/__init__.py
sloev/cccp
829c359a8607d3f3fb2e1e82f2114bb1c8404ce3
[ "MIT" ]
1
2020-03-14T11:56:09.000Z
2020-03-14T11:56:09.000Z
cccp/__init__.py
sloev/cccp
829c359a8607d3f3fb2e1e82f2114bb1c8404ce3
[ "MIT" ]
null
null
null
cccp/__init__.py
sloev/cccp
829c359a8607d3f3fb2e1e82f2114bb1c8404ce3
[ "MIT" ]
3
2020-03-08T13:23:37.000Z
2021-12-06T19:46:27.000Z
from string import Template from dominate.tags import script, link, style from dominate.util import raw import json REQUIRED = [ script( src="https://unpkg.com/axios@0.19.0/dist/axios.min.js", crossorigin="anonymous" ), script( src="https://code.jquery.com/jquery-3.3.1.slim.min.js", integrity="sha384-q8i/X+965DzO0rT7abK41JStQIAqVgRVzpbzo5smXKp4YfRvH+8abtTE1Pi6jizo", crossorigin="anonymous", ), ] BOOTSTRAP = [ link( rel="stylesheet", href="https://stackpath.bootstrapcdn.com/bootstrap/4.3.1/css/bootstrap.min.css", integrity="sha384-ggOyR0iXCbMQv3Xipma34MD+dH/1fQ784/j6cY/iJTQUOhcWr7x9JvoRxT2MZw1T", crossorigin="anonymous", ), script( src="https://cdnjs.cloudflare.com/ajax/libs/popper.js/1.14.7/umd/popper.min.js", integrity="sha384-UO2eT0CpHqdSJQ6hJty5KVphtPhzWj9WO1clHTMGa3JDZwrnQq4sF86dIHNDz0W1", crossorigin="anonymous", ), script( src="https://stackpath.bootstrapcdn.com/bootstrap/4.3.1/js/bootstrap.min.js", integrity="sha384-JjSmVgyd0p3pXB1rRibZUAYoIIy6OrQ6VrjIEaFf/nJGzIxFDsf4x0xIM+B07jRM", crossorigin="anonymous", ), ] CHARTJS = script( src="https://cdnjs.cloudflare.com/ajax/libs/Chart.js/2.8.0/Chart.bundle.min.js" ) def render(x): if isinstance(x, list): return "".join(e.render(pretty=False) for e in x) return x.render(pretty=False) class CustomTemplate(Template): delimiter = "$$" class JavaScript: defaults = None js_source = "" def render(self, values, with_script_tag=True): template = CustomTemplate(self.js_source) rendered = raw(template.substitute(values).strip()) if with_script_tag: return script(rendered, type="text/javascript") else: return rendered def __new__(cls, with_script_tag=True, **kwargs): values = cls.defaults or {} values.update(kwargs) inst = super(JavaScript, cls).__new__(cls) return inst.render(values, with_script_tag) class CreateReplaceOuterHtmlFunc(JavaScript): js_source = """ function ReplaceOuterHtml(url, id, params){ axios.get(url, {params: params === undefined ? {} : params}) .then(function (response) { document.getElementById(id).outerHTML = response.data; }); }; """ def replaceOuterHtml(url, id, **kwargs): params = json.dumps(kwargs) return f"ReplaceOuterHtml('{url}', '{id}', {params})" class CreateReplaceInnerHtmlFunc(JavaScript): js_source = """ function ReplaceInnerHtml(url, id, params){ axios.get(url, {params: params === undefined ? {} : params}) .then(function (response) { document.getElementById(id).innerHTML = response.data; }); }; """ def replaceInnerHtml(url, id, **kwargs): params = json.dumps(kwargs) return f"ReplaceInnerHtml('{url}', '{id}', {params})" # backwards compatibility replaceHtml = replaceInnerHtml class CreateAppendHtmlFunc(JavaScript): js_source = """ function AppendHtml(url, id, params){ axios.get(url, {params: params === undefined ? {} : params}) .then( function (response) { $("#"+id).append(response.data); }); }; """ def appendHtml(url, id, **kwargs): params = json.dumps(kwargs) return f"AppendHtml('{url}', '{id}', {params})" class CreatePrependHtmlFunc(JavaScript): js_source = """ function PrependHtml(url, id, params){ axios.get(url, {params: params === undefined ? {} : params}) .then( function(response) { $("#"+id).prepend(response.data); }); }; """ def prependHtml(url, id, **kwargs): params = json.dumps(kwargs) return f"PrependHtml('{url}', '{id}', {params})" class CreateRemoveHtmlFunc(JavaScript): js_source = """ function RemoveHtml(id){ $("#"+id).remove(); }; """ class CreateSetAttributeFunction(JavaScript): js_source = """ function SetAttribute(id, attribute, value){ $("#"+id).attr(attribute, value) }; """ def removeHtml(id): return f"RemoveHtml('{id}')" def chain_functions(*function_strings): return "; ".join(function_strings) + ";" def style_tag_with_css(css): return style(raw(css)) class LineChart(JavaScript): js_source = """ const canvas$$id = $('#$$id') const lineChart$$id = new Chart(canvas$$id, { type: "line", data: { labels: $$xlabels, datasets: $$datasets }, options: $$options }); """ def line_chart(id, xlabels, datasets, options): return LineChart(id=id, xlabels=json.dumps(xlabels), datasets=json.dumps(datasets), options=json.dumps(options or {}))
26.371585
122
0.623291
from string import Template from dominate.tags import script, link, style from dominate.util import raw import json REQUIRED = [ script( src="https://unpkg.com/axios@0.19.0/dist/axios.min.js", crossorigin="anonymous" ), script( src="https://code.jquery.com/jquery-3.3.1.slim.min.js", integrity="sha384-q8i/X+965DzO0rT7abK41JStQIAqVgRVzpbzo5smXKp4YfRvH+8abtTE1Pi6jizo", crossorigin="anonymous", ), ] BOOTSTRAP = [ link( rel="stylesheet", href="https://stackpath.bootstrapcdn.com/bootstrap/4.3.1/css/bootstrap.min.css", integrity="sha384-ggOyR0iXCbMQv3Xipma34MD+dH/1fQ784/j6cY/iJTQUOhcWr7x9JvoRxT2MZw1T", crossorigin="anonymous", ), script( src="https://cdnjs.cloudflare.com/ajax/libs/popper.js/1.14.7/umd/popper.min.js", integrity="sha384-UO2eT0CpHqdSJQ6hJty5KVphtPhzWj9WO1clHTMGa3JDZwrnQq4sF86dIHNDz0W1", crossorigin="anonymous", ), script( src="https://stackpath.bootstrapcdn.com/bootstrap/4.3.1/js/bootstrap.min.js", integrity="sha384-JjSmVgyd0p3pXB1rRibZUAYoIIy6OrQ6VrjIEaFf/nJGzIxFDsf4x0xIM+B07jRM", crossorigin="anonymous", ), ] CHARTJS = script( src="https://cdnjs.cloudflare.com/ajax/libs/Chart.js/2.8.0/Chart.bundle.min.js" ) def render(x): if isinstance(x, list): return "".join(e.render(pretty=False) for e in x) return x.render(pretty=False) class CustomTemplate(Template): delimiter = "$$" class JavaScript: defaults = None js_source = "" def render(self, values, with_script_tag=True): template = CustomTemplate(self.js_source) rendered = raw(template.substitute(values).strip()) if with_script_tag: return script(rendered, type="text/javascript") else: return rendered def __new__(cls, with_script_tag=True, **kwargs): values = cls.defaults or {} values.update(kwargs) inst = super(JavaScript, cls).__new__(cls) return inst.render(values, with_script_tag) class CreateReplaceOuterHtmlFunc(JavaScript): js_source = """ function ReplaceOuterHtml(url, id, params){ axios.get(url, {params: params === undefined ? {} : params}) .then(function (response) { document.getElementById(id).outerHTML = response.data; }); }; """ def replaceOuterHtml(url, id, **kwargs): params = json.dumps(kwargs) return f"ReplaceOuterHtml('{url}', '{id}', {params})" class CreateReplaceInnerHtmlFunc(JavaScript): js_source = """ function ReplaceInnerHtml(url, id, params){ axios.get(url, {params: params === undefined ? {} : params}) .then(function (response) { document.getElementById(id).innerHTML = response.data; }); }; """ def replaceInnerHtml(url, id, **kwargs): params = json.dumps(kwargs) return f"ReplaceInnerHtml('{url}', '{id}', {params})" replaceHtml = replaceInnerHtml class CreateAppendHtmlFunc(JavaScript): js_source = """ function AppendHtml(url, id, params){ axios.get(url, {params: params === undefined ? {} : params}) .then( function (response) { $("#"+id).append(response.data); }); }; """ def appendHtml(url, id, **kwargs): params = json.dumps(kwargs) return f"AppendHtml('{url}', '{id}', {params})" class CreatePrependHtmlFunc(JavaScript): js_source = """ function PrependHtml(url, id, params){ axios.get(url, {params: params === undefined ? {} : params}) .then( function(response) { $("#"+id).prepend(response.data); }); }; """ def prependHtml(url, id, **kwargs): params = json.dumps(kwargs) return f"PrependHtml('{url}', '{id}', {params})" class CreateRemoveHtmlFunc(JavaScript): js_source = """ function RemoveHtml(id){ $("#"+id).remove(); }; """ class CreateSetAttributeFunction(JavaScript): js_source = """ function SetAttribute(id, attribute, value){ $("#"+id).attr(attribute, value) }; """ def removeHtml(id): return f"RemoveHtml('{id}')" def chain_functions(*function_strings): return "; ".join(function_strings) + ";" def style_tag_with_css(css): return style(raw(css)) class LineChart(JavaScript): js_source = """ const canvas$$id = $('#$$id') const lineChart$$id = new Chart(canvas$$id, { type: "line", data: { labels: $$xlabels, datasets: $$datasets }, options: $$options }); """ def line_chart(id, xlabels, datasets, options): return LineChart(id=id, xlabels=json.dumps(xlabels), datasets=json.dumps(datasets), options=json.dumps(options or {}))
true
true
f72bb5154ac3efc57f3e05c96a98460ac4436137
4,661
py
Python
lbrynet/core/PaymentRateManager.py
anon4040/lbry
1f1b34863805f4954fbef3f163ef65268a66771a
[ "MIT" ]
1
2018-12-08T04:42:11.000Z
2018-12-08T04:42:11.000Z
lbrynet/core/PaymentRateManager.py
mrlucky9/lbry
bf6bc02828ed55e98a3002f487041acbd7841883
[ "MIT" ]
null
null
null
lbrynet/core/PaymentRateManager.py
mrlucky9/lbry
bf6bc02828ed55e98a3002f487041acbd7841883
[ "MIT" ]
1
2018-05-01T09:28:52.000Z
2018-05-01T09:28:52.000Z
from lbrynet.core.Strategy import get_default_strategy, OnlyFreeStrategy from lbrynet import conf from decimal import Decimal class BasePaymentRateManager(object): def __init__(self, rate=None, info_rate=None): self.min_blob_data_payment_rate = rate if rate is not None else conf.settings['data_rate'] self.min_blob_info_payment_rate = ( info_rate if info_rate is not None else conf.settings['min_info_rate']) class PaymentRateManager(object): def __init__(self, base, rate=None): """ @param base: a BasePaymentRateManager @param rate: the min blob data payment rate """ self.base = base self.min_blob_data_payment_rate = rate self.points_paid = 0.0 def get_rate_blob_data(self, peer): return self.get_effective_min_blob_data_payment_rate() def accept_rate_blob_data(self, peer, payment_rate): return payment_rate >= self.get_effective_min_blob_data_payment_rate() def get_effective_min_blob_data_payment_rate(self): if self.min_blob_data_payment_rate is None: return self.base.min_blob_data_payment_rate return self.min_blob_data_payment_rate def record_points_paid(self, amount): self.points_paid += amount class NegotiatedPaymentRateManager(object): def __init__(self, base, availability_tracker, generous=None): """ @param base: a BasePaymentRateManager @param availability_tracker: a BlobAvailabilityTracker @param rate: the min blob data payment rate """ self.base = base self.min_blob_data_payment_rate = base.min_blob_data_payment_rate self.points_paid = 0.0 self.blob_tracker = availability_tracker self.generous = generous if generous is not None else conf.settings['is_generous_host'] self.strategy = get_default_strategy(self.blob_tracker, base_price=self.base.min_blob_data_payment_rate, is_generous=generous) def get_rate_blob_data(self, peer, blobs): response = self.strategy.make_offer(peer, blobs) return response.rate def accept_rate_blob_data(self, peer, blobs, offer): offer = self.strategy.respond_to_offer(offer, peer, blobs) self.strategy.update_accepted_offers(peer, offer) return offer.is_accepted def reply_to_offer(self, peer, blobs, offer): reply = self.strategy.respond_to_offer(offer, peer, blobs) self.strategy.update_accepted_offers(peer, reply) return reply def get_rate_for_peer(self, peer): return self.strategy.accepted_offers.get(peer, False) def record_points_paid(self, amount): self.points_paid += amount def record_offer_reply(self, peer, offer): self.strategy.update_accepted_offers(peer, offer) def price_limit_reached(self, peer): if peer in self.strategy.pending_sent_offers: offer = self.strategy.pending_sent_offers[peer] return (offer.is_too_low and round(Decimal.from_float(offer.rate), 5) >= round(self.strategy.max_rate, 5)) return False class OnlyFreePaymentsManager(object): def __init__(self, **kwargs): """ A payment rate manager that will only ever accept and offer a rate of 0.0, Used for testing """ self.base = BasePaymentRateManager(0.0, 0.0) self.points_paid = 0.0 self.generous = True self.strategy = OnlyFreeStrategy() def get_rate_blob_data(self, peer, blobs): response = self.strategy.make_offer(peer, blobs) return response.rate def accept_rate_blob_data(self, peer, blobs, offer): offer = self.strategy.respond_to_offer(offer, peer, blobs) self.strategy.update_accepted_offers(peer, offer) return offer.is_accepted def reply_to_offer(self, peer, blobs, offer): reply = self.strategy.respond_to_offer(offer, peer, blobs) self.strategy.update_accepted_offers(peer, reply) return reply def get_rate_for_peer(self, peer): return self.strategy.accepted_offers.get(peer, False) def record_points_paid(self, amount): self.points_paid += amount def record_offer_reply(self, peer, offer): self.strategy.update_accepted_offers(peer, offer) def price_limit_reached(self, peer): if peer in self.strategy.pending_sent_offers: offer = self.strategy.pending_sent_offers[peer] if offer.rate > 0.0: return True return False
36.414063
98
0.679897
from lbrynet.core.Strategy import get_default_strategy, OnlyFreeStrategy from lbrynet import conf from decimal import Decimal class BasePaymentRateManager(object): def __init__(self, rate=None, info_rate=None): self.min_blob_data_payment_rate = rate if rate is not None else conf.settings['data_rate'] self.min_blob_info_payment_rate = ( info_rate if info_rate is not None else conf.settings['min_info_rate']) class PaymentRateManager(object): def __init__(self, base, rate=None): self.base = base self.min_blob_data_payment_rate = rate self.points_paid = 0.0 def get_rate_blob_data(self, peer): return self.get_effective_min_blob_data_payment_rate() def accept_rate_blob_data(self, peer, payment_rate): return payment_rate >= self.get_effective_min_blob_data_payment_rate() def get_effective_min_blob_data_payment_rate(self): if self.min_blob_data_payment_rate is None: return self.base.min_blob_data_payment_rate return self.min_blob_data_payment_rate def record_points_paid(self, amount): self.points_paid += amount class NegotiatedPaymentRateManager(object): def __init__(self, base, availability_tracker, generous=None): self.base = base self.min_blob_data_payment_rate = base.min_blob_data_payment_rate self.points_paid = 0.0 self.blob_tracker = availability_tracker self.generous = generous if generous is not None else conf.settings['is_generous_host'] self.strategy = get_default_strategy(self.blob_tracker, base_price=self.base.min_blob_data_payment_rate, is_generous=generous) def get_rate_blob_data(self, peer, blobs): response = self.strategy.make_offer(peer, blobs) return response.rate def accept_rate_blob_data(self, peer, blobs, offer): offer = self.strategy.respond_to_offer(offer, peer, blobs) self.strategy.update_accepted_offers(peer, offer) return offer.is_accepted def reply_to_offer(self, peer, blobs, offer): reply = self.strategy.respond_to_offer(offer, peer, blobs) self.strategy.update_accepted_offers(peer, reply) return reply def get_rate_for_peer(self, peer): return self.strategy.accepted_offers.get(peer, False) def record_points_paid(self, amount): self.points_paid += amount def record_offer_reply(self, peer, offer): self.strategy.update_accepted_offers(peer, offer) def price_limit_reached(self, peer): if peer in self.strategy.pending_sent_offers: offer = self.strategy.pending_sent_offers[peer] return (offer.is_too_low and round(Decimal.from_float(offer.rate), 5) >= round(self.strategy.max_rate, 5)) return False class OnlyFreePaymentsManager(object): def __init__(self, **kwargs): self.base = BasePaymentRateManager(0.0, 0.0) self.points_paid = 0.0 self.generous = True self.strategy = OnlyFreeStrategy() def get_rate_blob_data(self, peer, blobs): response = self.strategy.make_offer(peer, blobs) return response.rate def accept_rate_blob_data(self, peer, blobs, offer): offer = self.strategy.respond_to_offer(offer, peer, blobs) self.strategy.update_accepted_offers(peer, offer) return offer.is_accepted def reply_to_offer(self, peer, blobs, offer): reply = self.strategy.respond_to_offer(offer, peer, blobs) self.strategy.update_accepted_offers(peer, reply) return reply def get_rate_for_peer(self, peer): return self.strategy.accepted_offers.get(peer, False) def record_points_paid(self, amount): self.points_paid += amount def record_offer_reply(self, peer, offer): self.strategy.update_accepted_offers(peer, offer) def price_limit_reached(self, peer): if peer in self.strategy.pending_sent_offers: offer = self.strategy.pending_sent_offers[peer] if offer.rate > 0.0: return True return False
true
true
f72bb56ed6f1866f992171ab177c9a2074f78328
1,005
py
Python
cea/examples/extract_reference_case.py
AlexJew/CityEnergyAnalyst
6eb372c79e5100a2d0abce78561ae368fb409cd1
[ "MIT" ]
null
null
null
cea/examples/extract_reference_case.py
AlexJew/CityEnergyAnalyst
6eb372c79e5100a2d0abce78561ae368fb409cd1
[ "MIT" ]
null
null
null
cea/examples/extract_reference_case.py
AlexJew/CityEnergyAnalyst
6eb372c79e5100a2d0abce78561ae368fb409cd1
[ "MIT" ]
null
null
null
""" Extract the reference case (``cea/examples/reference-case-open.zip``). """ from __future__ import division import os import zipfile import cea.examples import cea.config import cea.inputlocator # list the sections in the configuration file that are used by this script # this value is used to generate the help menu for the command-line interface CEA_CONFIG_SECTIONS = ['extract-reference-case'] def main(config): """ Extract the reference case in ``reference-case-open.zip`` to the destination folder. :param config: Contains the PathParameter ``config.extract_reference_case.destination`` :type config: cea.config.Configuration :return: """ reference_case = 'reference-case-{case}.zip'.format(case=config.extract_reference_case.case) archive = zipfile.ZipFile(os.path.join(os.path.dirname(cea.examples.__file__), reference_case)) archive.extractall(config.extract_reference_case.destination) if __name__ == '__main__': main(cea.config.Configuration())
31.40625
99
0.758209
from __future__ import division import os import zipfile import cea.examples import cea.config import cea.inputlocator CEA_CONFIG_SECTIONS = ['extract-reference-case'] def main(config): reference_case = 'reference-case-{case}.zip'.format(case=config.extract_reference_case.case) archive = zipfile.ZipFile(os.path.join(os.path.dirname(cea.examples.__file__), reference_case)) archive.extractall(config.extract_reference_case.destination) if __name__ == '__main__': main(cea.config.Configuration())
true
true
f72bb6f0058e6022c5654db644c4f3a8d1350c2a
18,976
py
Python
ssd/modeling/backbone/basic.py
Sethan/deeplearning-graphics
ce164847a323d3f07cfe241f4bbed6029777c58d
[ "MIT" ]
null
null
null
ssd/modeling/backbone/basic.py
Sethan/deeplearning-graphics
ce164847a323d3f07cfe241f4bbed6029777c58d
[ "MIT" ]
null
null
null
ssd/modeling/backbone/basic.py
Sethan/deeplearning-graphics
ce164847a323d3f07cfe241f4bbed6029777c58d
[ "MIT" ]
null
null
null
import torch class BasicModel(torch.nn.Module): """ This is a basic backbone for SSD. The feature extractor outputs a list of 6 feature maps, with the sizes: [shape(-1, output_channels[0], 38, 38), shape(-1, output_channels[1], 19, 19), shape(-1, output_channels[2], 10, 10), shape(-1, output_channels[3], 5, 5), shape(-1, output_channels[3], 3, 3), shape(-1, output_channels[4], 1, 1)] where "output_channels" is the same as cfg.BACKBONE.OUT_CHANNELS """ def __init__(self, cfg): super().__init__() image_size = cfg.INPUT.IMAGE_SIZE output_channels = cfg.MODEL.BACKBONE.OUT_CHANNELS self.output_channels = output_channels image_channels = cfg.MODEL.BACKBONE.INPUT_CHANNELS self.output_feature_size = cfg.MODEL.PRIORS.FEATURE_MAPS self.num_filters = [32,64] self.feature_extractor38 = torch.nn.Sequential( #part 1 38x38 torch.nn.Conv2d( in_channels=image_channels, out_channels=self.num_filters[0], kernel_size=3, stride=1, padding=1 ), torch.nn.BatchNorm2d(self.num_filters[0]), torch.nn.MaxPool2d(2, stride=2), torch.nn.ELU(), torch.nn.Dropout2d(0.05), torch.nn.Conv2d( in_channels=self.num_filters[0], out_channels=self.num_filters[1], kernel_size=3, stride=1, padding=1 ), torch.nn.BatchNorm2d(self.num_filters[1]), torch.nn.ELU(), torch.nn.Dropout2d(0.06), torch.nn.Conv2d( in_channels=self.num_filters[1], out_channels=self.num_filters[1], kernel_size=3, stride=1, padding=1 ), torch.nn.BatchNorm2d(self.num_filters[1]), torch.nn.ELU(), torch.nn.Dropout2d(0.07), torch.nn.Conv2d( in_channels=self.num_filters[1], out_channels=self.num_filters[1], kernel_size=3, stride=1, padding=1 ), torch.nn.BatchNorm2d(self.num_filters[1]), torch.nn.ELU(), torch.nn.Dropout2d(0.08), torch.nn.Conv2d( in_channels=self.num_filters[1], out_channels=self.num_filters[1], kernel_size=3, stride=1, padding=1 ), torch.nn.BatchNorm2d(self.num_filters[1]), torch.nn.ELU(), torch.nn.Dropout2d(0.09), torch.nn.Conv2d( in_channels=self.num_filters[1], out_channels=self.num_filters[1], kernel_size=3, stride=1, padding=1 ), torch.nn.BatchNorm2d(self.num_filters[1]), torch.nn.ELU(), torch.nn.Dropout2d(0.01), torch.nn.Conv2d( in_channels=self.num_filters[1], out_channels=self.num_filters[1], kernel_size=3, stride=1, padding=1 ), torch.nn.BatchNorm2d(self.num_filters[1]), torch.nn.MaxPool2d(2, stride=2), torch.nn.ELU(), torch.nn.Dropout2d(0.11), torch.nn.Conv2d( in_channels=self.num_filters[1], out_channels=self.num_filters[1], kernel_size=3, stride=1, padding=1 ), torch.nn.BatchNorm2d(self.num_filters[1]), torch.nn.ELU(), torch.nn.Dropout2d(0.12), torch.nn.Conv2d( in_channels=self.num_filters[1], out_channels=self.num_filters[1], kernel_size=3, stride=1, padding=1 ), torch.nn.BatchNorm2d(self.num_filters[1]), torch.nn.ELU(), torch.nn.Dropout2d(0.13), torch.nn.Conv2d( in_channels=self.num_filters[1], out_channels=self.num_filters[1], kernel_size=3, stride=1, padding=1 ), torch.nn.BatchNorm2d(self.num_filters[1]), torch.nn.ELU(), torch.nn.Dropout2d(0.14), torch.nn.Conv2d( in_channels=self.num_filters[1], out_channels=self.output_channels[0], kernel_size=3, stride=2, padding=1 ) ) self.feature_extractor19 = torch.nn.Sequential( #part 2 19x19 torch.nn.BatchNorm2d(self.output_channels[0]), torch.nn.ELU(), torch.nn.Dropout2d(0.15), torch.nn.Conv2d( in_channels=self.output_channels[0], out_channels=self.output_channels[0], kernel_size=3, stride=1, padding=1 ), torch.nn.BatchNorm2d(self.output_channels[0]), torch.nn.ELU(), torch.nn.Dropout2d(0.16), torch.nn.Conv2d( in_channels=self.output_channels[0], out_channels=self.output_channels[0], kernel_size=3, stride=1, padding=1 ), torch.nn.BatchNorm2d(self.output_channels[0]), torch.nn.ELU(), torch.nn.Dropout2d(0.17), torch.nn.Conv2d( in_channels=self.output_channels[0], out_channels=self.output_channels[0], kernel_size=3, stride=1, padding=1 ), torch.nn.BatchNorm2d(self.output_channels[0]), torch.nn.ELU(), torch.nn.Dropout2d(0.18), torch.nn.Conv2d( in_channels=self.output_channels[0], out_channels=self.output_channels[0], kernel_size=3, stride=1, padding=1 ), torch.nn.BatchNorm2d(self.output_channels[0]), torch.nn.ELU(), torch.nn.Dropout2d(0.19), torch.nn.Conv2d( in_channels=self.output_channels[0], out_channels=self.output_channels[0], kernel_size=3, stride=1, padding=1 ), torch.nn.BatchNorm2d(self.output_channels[0]), torch.nn.ELU(), torch.nn.Dropout2d(0.2), torch.nn.Conv2d( in_channels=self.output_channels[0], out_channels=self.output_channels[0], kernel_size=3, stride=1, padding=1 ), torch.nn.BatchNorm2d(self.output_channels[0]), torch.nn.ELU(), torch.nn.Dropout2d(0.21), torch.nn.Conv2d( in_channels=self.output_channels[0], out_channels=self.output_channels[0], kernel_size=3, stride=1, padding=1 ), torch.nn.BatchNorm2d(self.output_channels[0]), torch.nn.ELU(), torch.nn.Dropout2d(0.22), torch.nn.Conv2d( in_channels=self.output_channels[0], out_channels=self.output_channels[1], kernel_size=3, stride=2, padding=1 )) self.feature_extractor9 = torch.nn.Sequential( #part 3 10x10 torch.nn.BatchNorm2d(self.output_channels[1]), torch.nn.ELU(), torch.nn.Dropout2d(0.23), torch.nn.Conv2d( in_channels=self.output_channels[1], out_channels=self.output_channels[1], kernel_size=3, stride=1, padding=1 ), torch.nn.BatchNorm2d(self.output_channels[1]), torch.nn.ELU(), torch.nn.Dropout2d(0.24), torch.nn.Conv2d( in_channels=self.output_channels[1], out_channels=self.output_channels[1], kernel_size=3, stride=1, padding=1 ), torch.nn.BatchNorm2d(self.output_channels[1]), torch.nn.ELU(), torch.nn.Dropout2d(0.25), torch.nn.Conv2d( in_channels=self.output_channels[1], out_channels=self.output_channels[1], kernel_size=3, stride=1, padding=1 ), torch.nn.BatchNorm2d(self.output_channels[1]), torch.nn.ELU(), torch.nn.Dropout2d(0.26), torch.nn.Conv2d( in_channels=self.output_channels[1], out_channels=self.output_channels[1], kernel_size=3, stride=1, padding=1 ), torch.nn.BatchNorm2d(self.output_channels[1]), torch.nn.ELU(), torch.nn.Dropout2d(0.27), torch.nn.Conv2d( in_channels=self.output_channels[1], out_channels=self.output_channels[1], kernel_size=3, stride=1, padding=1 ), torch.nn.BatchNorm2d(self.output_channels[1]), torch.nn.ELU(), torch.nn.Dropout2d(0.28), torch.nn.Conv2d( in_channels=self.output_channels[1], out_channels=self.output_channels[1], kernel_size=3, stride=1, padding=1 ), torch.nn.BatchNorm2d(self.output_channels[1]), torch.nn.ELU(), torch.nn.Dropout2d(0.29), torch.nn.Conv2d( in_channels=self.output_channels[1], out_channels=self.output_channels[1], kernel_size=3, stride=1, padding=1 ), torch.nn.BatchNorm2d(self.output_channels[1]), torch.nn.ELU(), torch.nn.Dropout2d(0.30), torch.nn.Conv2d( in_channels=self.output_channels[1], out_channels=self.output_channels[2], kernel_size=3, stride=2, padding=1 )) self.feature_extractor5 = torch.nn.Sequential( #part 4 5x5 torch.nn.BatchNorm2d(self.output_channels[2]), torch.nn.ELU(), torch.nn.Dropout2d(0.31), torch.nn.Conv2d( in_channels=self.output_channels[2], out_channels=self.output_channels[2], kernel_size=3, stride=1, padding=1 ), torch.nn.BatchNorm2d(self.output_channels[2]), torch.nn.ELU(), torch.nn.Dropout2d(0.32), torch.nn.Conv2d( in_channels=self.output_channels[2], out_channels=self.output_channels[2], kernel_size=3, stride=1, padding=1 ), torch.nn.BatchNorm2d(self.output_channels[2]), torch.nn.ELU(), torch.nn.Dropout2d(0.33), torch.nn.Conv2d( in_channels=self.output_channels[2], out_channels=self.output_channels[2], kernel_size=3, stride=1, padding=1 ), torch.nn.BatchNorm2d(self.output_channels[2]), torch.nn.ELU(), torch.nn.Dropout2d(0.34), torch.nn.Conv2d( in_channels=self.output_channels[2], out_channels=self.output_channels[2], kernel_size=3, stride=1, padding=1 ), torch.nn.BatchNorm2d(self.output_channels[2]), torch.nn.ELU(), torch.nn.Dropout2d(0.35), torch.nn.Conv2d( in_channels=self.output_channels[2], out_channels=self.output_channels[2], kernel_size=3, stride=1, padding=1 ), torch.nn.BatchNorm2d(self.output_channels[2]), torch.nn.ELU(), torch.nn.Dropout2d(0.36), torch.nn.Conv2d( in_channels=self.output_channels[2], out_channels=self.output_channels[2], kernel_size=3, stride=1, padding=1 ), torch.nn.BatchNorm2d(self.output_channels[2]), torch.nn.ELU(), torch.nn.Dropout2d(0.37), torch.nn.Conv2d( in_channels=self.output_channels[2], out_channels=self.output_channels[2], kernel_size=3, stride=1, padding=1 ), torch.nn.BatchNorm2d(self.output_channels[2]), torch.nn.ELU(), torch.nn.Dropout2d(0.38), torch.nn.Conv2d( in_channels=self.output_channels[2], out_channels=self.output_channels[3], kernel_size=3, stride=2, padding=1 )) self.feature_extractor3 = torch.nn.Sequential( #part 5 3x3 torch.nn.BatchNorm2d(self.output_channels[3]), torch.nn.ELU(), torch.nn.Dropout2d(0.39), torch.nn.Conv2d( in_channels=self.output_channels[3], out_channels=self.output_channels[3], kernel_size=3, stride=1, padding=1 ), torch.nn.BatchNorm2d(self.output_channels[3]), torch.nn.ELU(), torch.nn.Dropout2d(0.40), torch.nn.Conv2d( in_channels=self.output_channels[3], out_channels=self.output_channels[3], kernel_size=3, stride=1, padding=1 ), torch.nn.ELU(), torch.nn.Dropout2d(0.41), torch.nn.Conv2d( in_channels=self.output_channels[3], out_channels=self.output_channels[3], kernel_size=3, stride=1, padding=1 ), torch.nn.BatchNorm2d(self.output_channels[3]), torch.nn.ELU(), torch.nn.Dropout2d(0.42), torch.nn.Conv2d( in_channels=self.output_channels[3], out_channels=self.output_channels[3], kernel_size=3, stride=1, padding=1 ), torch.nn.BatchNorm2d(self.output_channels[3]), torch.nn.ELU(), torch.nn.Dropout2d(0.43), torch.nn.Conv2d( in_channels=self.output_channels[3], out_channels=self.output_channels[3], kernel_size=3, stride=1, padding=1 ), torch.nn.BatchNorm2d(self.output_channels[3]), torch.nn.ELU(), torch.nn.Dropout2d(0.44), torch.nn.Conv2d( in_channels=self.output_channels[3], out_channels=self.output_channels[3], kernel_size=3, stride=1, padding=1 ), torch.nn.BatchNorm2d(self.output_channels[3]), torch.nn.ELU(), torch.nn.Dropout2d(0.45), torch.nn.Conv2d( in_channels=self.output_channels[3], out_channels=self.output_channels[3], kernel_size=3, stride=1, padding=1 ), torch.nn.BatchNorm2d(self.output_channels[3]), torch.nn.ELU(), torch.nn.Dropout2d(0.46), torch.nn.Conv2d( in_channels=self.output_channels[3], out_channels=self.output_channels[4], kernel_size=3, stride=2, padding=1 )) self.feature_extractor1 = torch.nn.Sequential( #part 6 1x1 torch.nn.BatchNorm2d(self.output_channels[4]), torch.nn.ELU(), torch.nn.Dropout2d(0.48), torch.nn.Conv2d( in_channels=self.output_channels[4], out_channels=self.output_channels[4], kernel_size=3, stride=1, padding=1 ), torch.nn.BatchNorm2d(self.output_channels[4]), torch.nn.ELU(), torch.nn.Dropout2d(0.49), torch.nn.Conv2d( in_channels=self.output_channels[4], out_channels=self.output_channels[4], kernel_size=3, stride=1, padding=1 ), torch.nn.BatchNorm2d(self.output_channels[4]), torch.nn.ELU(), torch.nn.Dropout2d(0.50), torch.nn.Conv2d( in_channels=self.output_channels[4], out_channels=self.output_channels[4], kernel_size=3, stride=1, padding=1 ), torch.nn.BatchNorm2d(self.output_channels[4]), torch.nn.ELU(), torch.nn.Dropout2d(0.51), torch.nn.Conv2d( in_channels=self.output_channels[4], out_channels=self.output_channels[4], kernel_size=3, stride=1, padding=1 ), torch.nn.BatchNorm2d(self.output_channels[4]), torch.nn.ELU(), torch.nn.Dropout2d(0.52), torch.nn.Conv2d( in_channels=self.output_channels[4], out_channels=self.output_channels[4], kernel_size=3, stride=1, padding=1 ), torch.nn.BatchNorm2d(self.output_channels[4]), torch.nn.ELU(), torch.nn.Dropout2d(0.53), torch.nn.Conv2d( in_channels=self.output_channels[4], out_channels=self.output_channels[4], kernel_size=3, stride=1, padding=1 ), torch.nn.BatchNorm2d(self.output_channels[4]), torch.nn.ELU(), torch.nn.Dropout2d(0.54), torch.nn.Conv2d( in_channels=self.output_channels[4], out_channels=self.output_channels[4], kernel_size=3, stride=1, padding=1 ), torch.nn.BatchNorm2d(self.output_channels[4]), torch.nn.ELU(), torch.nn.Dropout2d(0.55), torch.nn.Conv2d( in_channels=self.output_channels[4], out_channels=self.output_channels[5], kernel_size=3, stride=1, padding=0 )) def forward(self, x): """ The forward functiom should output features with shape: [shape(-1, output_channels[0], 38, 38), shape(-1, output_channels[1], 19, 19), shape(-1, output_channels[2], 10, 10), shape(-1, output_channels[3], 5, 5), shape(-1, output_channels[3], 3, 3), shape(-1, output_channels[4], 1, 1)] We have added assertion tests to check this, iteration through out_features, where out_features[0] should have the shape: shape(-1, output_channels[0], 38, 38), """ out_features = [] out = self.feature_extractor38(x) out_features.append(out) out = self.feature_extractor19(out) out_features.append(out) out = self.feature_extractor9(out) out_features.append(out) out = self.feature_extractor5(out) out_features.append(out) out = self.feature_extractor3(out) out_features.append(out) out = self.feature_extractor1(out) out_features.append(out) feature_list = [38,19,10,5,3,1] for idx, feature in enumerate(out_features): expected_shape = (self.output_channels[idx], feature_list[idx], feature_list[idx]) assert feature.shape[1:] == expected_shape, \ f"Expected shape: {expected_shape}, got: {feature.shape[1:]} at output IDX: {idx}" return tuple(out_features)
32.108291
98
0.539155
import torch class BasicModel(torch.nn.Module): def __init__(self, cfg): super().__init__() image_size = cfg.INPUT.IMAGE_SIZE output_channels = cfg.MODEL.BACKBONE.OUT_CHANNELS self.output_channels = output_channels image_channels = cfg.MODEL.BACKBONE.INPUT_CHANNELS self.output_feature_size = cfg.MODEL.PRIORS.FEATURE_MAPS self.num_filters = [32,64] self.feature_extractor38 = torch.nn.Sequential( torch.nn.Conv2d( in_channels=image_channels, out_channels=self.num_filters[0], kernel_size=3, stride=1, padding=1 ), torch.nn.BatchNorm2d(self.num_filters[0]), torch.nn.MaxPool2d(2, stride=2), torch.nn.ELU(), torch.nn.Dropout2d(0.05), torch.nn.Conv2d( in_channels=self.num_filters[0], out_channels=self.num_filters[1], kernel_size=3, stride=1, padding=1 ), torch.nn.BatchNorm2d(self.num_filters[1]), torch.nn.ELU(), torch.nn.Dropout2d(0.06), torch.nn.Conv2d( in_channels=self.num_filters[1], out_channels=self.num_filters[1], kernel_size=3, stride=1, padding=1 ), torch.nn.BatchNorm2d(self.num_filters[1]), torch.nn.ELU(), torch.nn.Dropout2d(0.07), torch.nn.Conv2d( in_channels=self.num_filters[1], out_channels=self.num_filters[1], kernel_size=3, stride=1, padding=1 ), torch.nn.BatchNorm2d(self.num_filters[1]), torch.nn.ELU(), torch.nn.Dropout2d(0.08), torch.nn.Conv2d( in_channels=self.num_filters[1], out_channels=self.num_filters[1], kernel_size=3, stride=1, padding=1 ), torch.nn.BatchNorm2d(self.num_filters[1]), torch.nn.ELU(), torch.nn.Dropout2d(0.09), torch.nn.Conv2d( in_channels=self.num_filters[1], out_channels=self.num_filters[1], kernel_size=3, stride=1, padding=1 ), torch.nn.BatchNorm2d(self.num_filters[1]), torch.nn.ELU(), torch.nn.Dropout2d(0.01), torch.nn.Conv2d( in_channels=self.num_filters[1], out_channels=self.num_filters[1], kernel_size=3, stride=1, padding=1 ), torch.nn.BatchNorm2d(self.num_filters[1]), torch.nn.MaxPool2d(2, stride=2), torch.nn.ELU(), torch.nn.Dropout2d(0.11), torch.nn.Conv2d( in_channels=self.num_filters[1], out_channels=self.num_filters[1], kernel_size=3, stride=1, padding=1 ), torch.nn.BatchNorm2d(self.num_filters[1]), torch.nn.ELU(), torch.nn.Dropout2d(0.12), torch.nn.Conv2d( in_channels=self.num_filters[1], out_channels=self.num_filters[1], kernel_size=3, stride=1, padding=1 ), torch.nn.BatchNorm2d(self.num_filters[1]), torch.nn.ELU(), torch.nn.Dropout2d(0.13), torch.nn.Conv2d( in_channels=self.num_filters[1], out_channels=self.num_filters[1], kernel_size=3, stride=1, padding=1 ), torch.nn.BatchNorm2d(self.num_filters[1]), torch.nn.ELU(), torch.nn.Dropout2d(0.14), torch.nn.Conv2d( in_channels=self.num_filters[1], out_channels=self.output_channels[0], kernel_size=3, stride=2, padding=1 ) ) self.feature_extractor19 = torch.nn.Sequential( torch.nn.BatchNorm2d(self.output_channels[0]), torch.nn.ELU(), torch.nn.Dropout2d(0.15), torch.nn.Conv2d( in_channels=self.output_channels[0], out_channels=self.output_channels[0], kernel_size=3, stride=1, padding=1 ), torch.nn.BatchNorm2d(self.output_channels[0]), torch.nn.ELU(), torch.nn.Dropout2d(0.16), torch.nn.Conv2d( in_channels=self.output_channels[0], out_channels=self.output_channels[0], kernel_size=3, stride=1, padding=1 ), torch.nn.BatchNorm2d(self.output_channels[0]), torch.nn.ELU(), torch.nn.Dropout2d(0.17), torch.nn.Conv2d( in_channels=self.output_channels[0], out_channels=self.output_channels[0], kernel_size=3, stride=1, padding=1 ), torch.nn.BatchNorm2d(self.output_channels[0]), torch.nn.ELU(), torch.nn.Dropout2d(0.18), torch.nn.Conv2d( in_channels=self.output_channels[0], out_channels=self.output_channels[0], kernel_size=3, stride=1, padding=1 ), torch.nn.BatchNorm2d(self.output_channels[0]), torch.nn.ELU(), torch.nn.Dropout2d(0.19), torch.nn.Conv2d( in_channels=self.output_channels[0], out_channels=self.output_channels[0], kernel_size=3, stride=1, padding=1 ), torch.nn.BatchNorm2d(self.output_channels[0]), torch.nn.ELU(), torch.nn.Dropout2d(0.2), torch.nn.Conv2d( in_channels=self.output_channels[0], out_channels=self.output_channels[0], kernel_size=3, stride=1, padding=1 ), torch.nn.BatchNorm2d(self.output_channels[0]), torch.nn.ELU(), torch.nn.Dropout2d(0.21), torch.nn.Conv2d( in_channels=self.output_channels[0], out_channels=self.output_channels[0], kernel_size=3, stride=1, padding=1 ), torch.nn.BatchNorm2d(self.output_channels[0]), torch.nn.ELU(), torch.nn.Dropout2d(0.22), torch.nn.Conv2d( in_channels=self.output_channels[0], out_channels=self.output_channels[1], kernel_size=3, stride=2, padding=1 )) self.feature_extractor9 = torch.nn.Sequential( torch.nn.BatchNorm2d(self.output_channels[1]), torch.nn.ELU(), torch.nn.Dropout2d(0.23), torch.nn.Conv2d( in_channels=self.output_channels[1], out_channels=self.output_channels[1], kernel_size=3, stride=1, padding=1 ), torch.nn.BatchNorm2d(self.output_channels[1]), torch.nn.ELU(), torch.nn.Dropout2d(0.24), torch.nn.Conv2d( in_channels=self.output_channels[1], out_channels=self.output_channels[1], kernel_size=3, stride=1, padding=1 ), torch.nn.BatchNorm2d(self.output_channels[1]), torch.nn.ELU(), torch.nn.Dropout2d(0.25), torch.nn.Conv2d( in_channels=self.output_channels[1], out_channels=self.output_channels[1], kernel_size=3, stride=1, padding=1 ), torch.nn.BatchNorm2d(self.output_channels[1]), torch.nn.ELU(), torch.nn.Dropout2d(0.26), torch.nn.Conv2d( in_channels=self.output_channels[1], out_channels=self.output_channels[1], kernel_size=3, stride=1, padding=1 ), torch.nn.BatchNorm2d(self.output_channels[1]), torch.nn.ELU(), torch.nn.Dropout2d(0.27), torch.nn.Conv2d( in_channels=self.output_channels[1], out_channels=self.output_channels[1], kernel_size=3, stride=1, padding=1 ), torch.nn.BatchNorm2d(self.output_channels[1]), torch.nn.ELU(), torch.nn.Dropout2d(0.28), torch.nn.Conv2d( in_channels=self.output_channels[1], out_channels=self.output_channels[1], kernel_size=3, stride=1, padding=1 ), torch.nn.BatchNorm2d(self.output_channels[1]), torch.nn.ELU(), torch.nn.Dropout2d(0.29), torch.nn.Conv2d( in_channels=self.output_channels[1], out_channels=self.output_channels[1], kernel_size=3, stride=1, padding=1 ), torch.nn.BatchNorm2d(self.output_channels[1]), torch.nn.ELU(), torch.nn.Dropout2d(0.30), torch.nn.Conv2d( in_channels=self.output_channels[1], out_channels=self.output_channels[2], kernel_size=3, stride=2, padding=1 )) self.feature_extractor5 = torch.nn.Sequential( torch.nn.BatchNorm2d(self.output_channels[2]), torch.nn.ELU(), torch.nn.Dropout2d(0.31), torch.nn.Conv2d( in_channels=self.output_channels[2], out_channels=self.output_channels[2], kernel_size=3, stride=1, padding=1 ), torch.nn.BatchNorm2d(self.output_channels[2]), torch.nn.ELU(), torch.nn.Dropout2d(0.32), torch.nn.Conv2d( in_channels=self.output_channels[2], out_channels=self.output_channels[2], kernel_size=3, stride=1, padding=1 ), torch.nn.BatchNorm2d(self.output_channels[2]), torch.nn.ELU(), torch.nn.Dropout2d(0.33), torch.nn.Conv2d( in_channels=self.output_channels[2], out_channels=self.output_channels[2], kernel_size=3, stride=1, padding=1 ), torch.nn.BatchNorm2d(self.output_channels[2]), torch.nn.ELU(), torch.nn.Dropout2d(0.34), torch.nn.Conv2d( in_channels=self.output_channels[2], out_channels=self.output_channels[2], kernel_size=3, stride=1, padding=1 ), torch.nn.BatchNorm2d(self.output_channels[2]), torch.nn.ELU(), torch.nn.Dropout2d(0.35), torch.nn.Conv2d( in_channels=self.output_channels[2], out_channels=self.output_channels[2], kernel_size=3, stride=1, padding=1 ), torch.nn.BatchNorm2d(self.output_channels[2]), torch.nn.ELU(), torch.nn.Dropout2d(0.36), torch.nn.Conv2d( in_channels=self.output_channels[2], out_channels=self.output_channels[2], kernel_size=3, stride=1, padding=1 ), torch.nn.BatchNorm2d(self.output_channels[2]), torch.nn.ELU(), torch.nn.Dropout2d(0.37), torch.nn.Conv2d( in_channels=self.output_channels[2], out_channels=self.output_channels[2], kernel_size=3, stride=1, padding=1 ), torch.nn.BatchNorm2d(self.output_channels[2]), torch.nn.ELU(), torch.nn.Dropout2d(0.38), torch.nn.Conv2d( in_channels=self.output_channels[2], out_channels=self.output_channels[3], kernel_size=3, stride=2, padding=1 )) self.feature_extractor3 = torch.nn.Sequential( torch.nn.BatchNorm2d(self.output_channels[3]), torch.nn.ELU(), torch.nn.Dropout2d(0.39), torch.nn.Conv2d( in_channels=self.output_channels[3], out_channels=self.output_channels[3], kernel_size=3, stride=1, padding=1 ), torch.nn.BatchNorm2d(self.output_channels[3]), torch.nn.ELU(), torch.nn.Dropout2d(0.40), torch.nn.Conv2d( in_channels=self.output_channels[3], out_channels=self.output_channels[3], kernel_size=3, stride=1, padding=1 ), torch.nn.ELU(), torch.nn.Dropout2d(0.41), torch.nn.Conv2d( in_channels=self.output_channels[3], out_channels=self.output_channels[3], kernel_size=3, stride=1, padding=1 ), torch.nn.BatchNorm2d(self.output_channels[3]), torch.nn.ELU(), torch.nn.Dropout2d(0.42), torch.nn.Conv2d( in_channels=self.output_channels[3], out_channels=self.output_channels[3], kernel_size=3, stride=1, padding=1 ), torch.nn.BatchNorm2d(self.output_channels[3]), torch.nn.ELU(), torch.nn.Dropout2d(0.43), torch.nn.Conv2d( in_channels=self.output_channels[3], out_channels=self.output_channels[3], kernel_size=3, stride=1, padding=1 ), torch.nn.BatchNorm2d(self.output_channels[3]), torch.nn.ELU(), torch.nn.Dropout2d(0.44), torch.nn.Conv2d( in_channels=self.output_channels[3], out_channels=self.output_channels[3], kernel_size=3, stride=1, padding=1 ), torch.nn.BatchNorm2d(self.output_channels[3]), torch.nn.ELU(), torch.nn.Dropout2d(0.45), torch.nn.Conv2d( in_channels=self.output_channels[3], out_channels=self.output_channels[3], kernel_size=3, stride=1, padding=1 ), torch.nn.BatchNorm2d(self.output_channels[3]), torch.nn.ELU(), torch.nn.Dropout2d(0.46), torch.nn.Conv2d( in_channels=self.output_channels[3], out_channels=self.output_channels[4], kernel_size=3, stride=2, padding=1 )) self.feature_extractor1 = torch.nn.Sequential( torch.nn.BatchNorm2d(self.output_channels[4]), torch.nn.ELU(), torch.nn.Dropout2d(0.48), torch.nn.Conv2d( in_channels=self.output_channels[4], out_channels=self.output_channels[4], kernel_size=3, stride=1, padding=1 ), torch.nn.BatchNorm2d(self.output_channels[4]), torch.nn.ELU(), torch.nn.Dropout2d(0.49), torch.nn.Conv2d( in_channels=self.output_channels[4], out_channels=self.output_channels[4], kernel_size=3, stride=1, padding=1 ), torch.nn.BatchNorm2d(self.output_channels[4]), torch.nn.ELU(), torch.nn.Dropout2d(0.50), torch.nn.Conv2d( in_channels=self.output_channels[4], out_channels=self.output_channels[4], kernel_size=3, stride=1, padding=1 ), torch.nn.BatchNorm2d(self.output_channels[4]), torch.nn.ELU(), torch.nn.Dropout2d(0.51), torch.nn.Conv2d( in_channels=self.output_channels[4], out_channels=self.output_channels[4], kernel_size=3, stride=1, padding=1 ), torch.nn.BatchNorm2d(self.output_channels[4]), torch.nn.ELU(), torch.nn.Dropout2d(0.52), torch.nn.Conv2d( in_channels=self.output_channels[4], out_channels=self.output_channels[4], kernel_size=3, stride=1, padding=1 ), torch.nn.BatchNorm2d(self.output_channels[4]), torch.nn.ELU(), torch.nn.Dropout2d(0.53), torch.nn.Conv2d( in_channels=self.output_channels[4], out_channels=self.output_channels[4], kernel_size=3, stride=1, padding=1 ), torch.nn.BatchNorm2d(self.output_channels[4]), torch.nn.ELU(), torch.nn.Dropout2d(0.54), torch.nn.Conv2d( in_channels=self.output_channels[4], out_channels=self.output_channels[4], kernel_size=3, stride=1, padding=1 ), torch.nn.BatchNorm2d(self.output_channels[4]), torch.nn.ELU(), torch.nn.Dropout2d(0.55), torch.nn.Conv2d( in_channels=self.output_channels[4], out_channels=self.output_channels[5], kernel_size=3, stride=1, padding=0 )) def forward(self, x): out_features = [] out = self.feature_extractor38(x) out_features.append(out) out = self.feature_extractor19(out) out_features.append(out) out = self.feature_extractor9(out) out_features.append(out) out = self.feature_extractor5(out) out_features.append(out) out = self.feature_extractor3(out) out_features.append(out) out = self.feature_extractor1(out) out_features.append(out) feature_list = [38,19,10,5,3,1] for idx, feature in enumerate(out_features): expected_shape = (self.output_channels[idx], feature_list[idx], feature_list[idx]) assert feature.shape[1:] == expected_shape, \ f"Expected shape: {expected_shape}, got: {feature.shape[1:]} at output IDX: {idx}" return tuple(out_features)
true
true
f72bb74728607daee649873c96466e293323f858
400
py
Python
packages/pytea/pytest/unit_tests/passes/pass_argmax_dim01.py
lego0901/pytea
8ede650def2e68f4610ba816451d8b9e28f09f76
[ "MIT" ]
null
null
null
packages/pytea/pytest/unit_tests/passes/pass_argmax_dim01.py
lego0901/pytea
8ede650def2e68f4610ba816451d8b9e28f09f76
[ "MIT" ]
null
null
null
packages/pytea/pytest/unit_tests/passes/pass_argmax_dim01.py
lego0901/pytea
8ede650def2e68f4610ba816451d8b9e28f09f76
[ "MIT" ]
null
null
null
''' pass_argmax_dim01.py Copyright (c) Seoul National University Licensed under the MIT license. Author: Woo Sung Song torch.Tensor.argmax with dim parameter. ! This is not available since maximum stack size exceeding error has been occured ''' import torch import torch.nn as nn import torch.nn.functional as F a = torch.rand(2, 3) #m = a.argmax(dim=1) # shape assertion #m + torch.rand(2, 4, 5)
21.052632
81
0.75
import torch import torch.nn as nn import torch.nn.functional as F a = torch.rand(2, 3)
true
true
f72bb761694ffb3a80f6774d7de879a210505611
5,192
py
Python
backend/game.py
KatrichKostiantin/CheckersGame
3a552335d3ce344b203129a230d64db303491bb2
[ "MIT" ]
null
null
null
backend/game.py
KatrichKostiantin/CheckersGame
3a552335d3ce344b203129a230d64db303491bb2
[ "MIT" ]
null
null
null
backend/game.py
KatrichKostiantin/CheckersGame
3a552335d3ce344b203129a230d64db303491bb2
[ "MIT" ]
null
null
null
import asyncio import datetime import logging import secrets from main import game class GameError(Exception): pass class ForbiddenMoveError(GameError): pass class MoveIsNotPossible(GameError): pass class Game: def __init__(self): self._game = game self._is_started = False self._is_finished = False self._available_move_time = 2.2 # 200 ms plus, cause for network latency self._available_current_move_time = self._available_move_time self._players = {} self._lost_time_player = None self._last_move = None self._colors_table = { 1: 'RED', 2: 'BLACK', None: 'None' } def _whose_turn(self): return self._colors_table[self._game.whose_turn()] def _status(self): if not self._is_started: return 'Not yet started' if self._lost_time_player: return f'Player {self._colors_table[self._lost_time_player]} reached time limit' return 'Game is over' if self._game.is_over() else 'Game is playing' def _winner(self): if self._lost_time_player: return self._colors_table[1] \ if self._lost_time_player == 2 \ else self._colors_table[2] return self._colors_table[self._game.get_winner()] if self._game.get_winner() else None def _board(self): output = [] for piece in self._game.board.pieces: if not piece.captured: output.append({ 'color': 'RED' if piece.player == 1 else 'BLACK', 'row': piece.get_row(), 'column': piece.get_column(), 'king': piece.king, 'position': piece.position }) return output def add_player(self, team_name): if self._is_started: return player_num = 2 if 1 in self._players else 1 token = secrets.token_hex(16) self._players[player_num] = { 'token': token, 'team_name': team_name } if 1 in self._players and 2 in self._players: asyncio.ensure_future(self.start()) return { 'color': self._colors_table[player_num], 'token': token } async def start(self): logging.info(f'...GAME IS STARTED at {datetime.datetime.now().isoformat()}...') logging.info( f'1 player, color: {self._colors_table[1]}, team name: {self._players[1]["team_name"]}' ) logging.info( f'2 player, color: {self._colors_table[2]}, team name: {self._players[2]["team_name"]}' ) self._is_started = True while True: logging.info( f'Available time for player "{self._colors_table[self._game.whose_turn()]}" ' f'move: {self._available_current_move_time}' ) await asyncio.sleep(0.05) self._available_current_move_time -= 0.05 if self._available_current_move_time < 0: self._lost_time_player = self._game.whose_turn() self._is_finished = True break if self._game.is_over(): self._is_finished = True break if self._lost_time_player == 1: winner = 2 elif self._lost_time_player == 2: winner = 1 else: winner = self._game.get_winner() self._game.set_winner({ 'color': self._colors_table[winner], 'team_name': self._players[winner]['team_name'] }) logging.info( f'...GAME WAS FINISHED at {datetime.datetime.now().isoformat()}, winner: {self._game.get_board_winner()}' ) def move(self, token, move): player = self._players[self._game.whose_turn()] if player['token'] != token: raise ForbiddenMoveError try: if self._last_move is not None and self._last_move['player'] == self._whose_turn(): self._last_move['last_moves'].append(move) else: self._last_move = { 'player': self._whose_turn(), 'last_moves': [move] } self._game.move(move) logging.info( f'{player["team_name"]} made move ({move}) at {datetime.datetime.now().isoformat()}' ) self._available_current_move_time = self._available_move_time except ValueError as e: raise MoveIsNotPossible(str(e)) def is_started(self): return self._is_started def is_finished(self): return self._is_finished @property def json(self): return { 'status': self._status(), 'whose_turn': self._whose_turn(), 'winner': self._winner(), 'board': self._board(), 'available_time': self._available_current_move_time, 'last_move': self._last_move, 'is_started': self.is_started(), 'is_finished': self.is_finished() }
30.011561
117
0.55624
import asyncio import datetime import logging import secrets from main import game class GameError(Exception): pass class ForbiddenMoveError(GameError): pass class MoveIsNotPossible(GameError): pass class Game: def __init__(self): self._game = game self._is_started = False self._is_finished = False self._available_move_time = 2.2 self._available_current_move_time = self._available_move_time self._players = {} self._lost_time_player = None self._last_move = None self._colors_table = { 1: 'RED', 2: 'BLACK', None: 'None' } def _whose_turn(self): return self._colors_table[self._game.whose_turn()] def _status(self): if not self._is_started: return 'Not yet started' if self._lost_time_player: return f'Player {self._colors_table[self._lost_time_player]} reached time limit' return 'Game is over' if self._game.is_over() else 'Game is playing' def _winner(self): if self._lost_time_player: return self._colors_table[1] \ if self._lost_time_player == 2 \ else self._colors_table[2] return self._colors_table[self._game.get_winner()] if self._game.get_winner() else None def _board(self): output = [] for piece in self._game.board.pieces: if not piece.captured: output.append({ 'color': 'RED' if piece.player == 1 else 'BLACK', 'row': piece.get_row(), 'column': piece.get_column(), 'king': piece.king, 'position': piece.position }) return output def add_player(self, team_name): if self._is_started: return player_num = 2 if 1 in self._players else 1 token = secrets.token_hex(16) self._players[player_num] = { 'token': token, 'team_name': team_name } if 1 in self._players and 2 in self._players: asyncio.ensure_future(self.start()) return { 'color': self._colors_table[player_num], 'token': token } async def start(self): logging.info(f'...GAME IS STARTED at {datetime.datetime.now().isoformat()}...') logging.info( f'1 player, color: {self._colors_table[1]}, team name: {self._players[1]["team_name"]}' ) logging.info( f'2 player, color: {self._colors_table[2]}, team name: {self._players[2]["team_name"]}' ) self._is_started = True while True: logging.info( f'Available time for player "{self._colors_table[self._game.whose_turn()]}" ' f'move: {self._available_current_move_time}' ) await asyncio.sleep(0.05) self._available_current_move_time -= 0.05 if self._available_current_move_time < 0: self._lost_time_player = self._game.whose_turn() self._is_finished = True break if self._game.is_over(): self._is_finished = True break if self._lost_time_player == 1: winner = 2 elif self._lost_time_player == 2: winner = 1 else: winner = self._game.get_winner() self._game.set_winner({ 'color': self._colors_table[winner], 'team_name': self._players[winner]['team_name'] }) logging.info( f'...GAME WAS FINISHED at {datetime.datetime.now().isoformat()}, winner: {self._game.get_board_winner()}' ) def move(self, token, move): player = self._players[self._game.whose_turn()] if player['token'] != token: raise ForbiddenMoveError try: if self._last_move is not None and self._last_move['player'] == self._whose_turn(): self._last_move['last_moves'].append(move) else: self._last_move = { 'player': self._whose_turn(), 'last_moves': [move] } self._game.move(move) logging.info( f'{player["team_name"]} made move ({move}) at {datetime.datetime.now().isoformat()}' ) self._available_current_move_time = self._available_move_time except ValueError as e: raise MoveIsNotPossible(str(e)) def is_started(self): return self._is_started def is_finished(self): return self._is_finished @property def json(self): return { 'status': self._status(), 'whose_turn': self._whose_turn(), 'winner': self._winner(), 'board': self._board(), 'available_time': self._available_current_move_time, 'last_move': self._last_move, 'is_started': self.is_started(), 'is_finished': self.is_finished() }
true
true
f72bb7c009ac666bf6b4d3d4ca6e8865981ed9cf
3,079
py
Python
model/app/LearnTfidfCNB.py
jgharris7/DocClass
9ef62e655272cca8374187040eb3dd73f3f82b72
[ "MIT" ]
null
null
null
model/app/LearnTfidfCNB.py
jgharris7/DocClass
9ef62e655272cca8374187040eb3dd73f3f82b72
[ "MIT" ]
null
null
null
model/app/LearnTfidfCNB.py
jgharris7/DocClass
9ef62e655272cca8374187040eb3dd73f3f82b72
[ "MIT" ]
null
null
null
# -*- coding: utf-8 -*- """ Created on Mon Mar 22 22:43:22 2021 @author: jgharris """ # -*- coding: utf-8 -*- """ Created on Mon Mar 22 21:09:34 2021 @author: jgharris """ root='C:/Users/jgharris/DocClass/' dataFile='/data/shuffled-full-set-hashed.csv' import statistics as stat import pandas as pd from sklearn.model_selection import train_test_split from sklearn.metrics import accuracy_score import matplotlib import matplotlib.pyplot as plt import numpy as np import pickle from DocClfTfidfCNB import DocClfTfidfCNB from Documents import Documents #dataFile='/test/testshort.csv' modelName="nbtfidfv0" maxlines=80000000 testsize=.3 random_state=45 MAXSTRINGLENGH=4000 FIRSTSTRINGLENGTH=80 conf_mat=[] def main(): # Set up corpus for training corpus=Documents() corpus.readFromFile(root+dataFile,maxline=maxlines) ''' model1=DocClfComplNB(maxStringLength=MAXSTRINGLENGH, \ firstStringLength=FIRSTSTRINGLENGTH) ''' model1=DocClfTfidfCNB(maxStringLength=MAXSTRINGLENGH, \ firstStringLength=FIRSTSTRINGLENGTH) print() # split into test and training sets xtrain,xtest,ytrain,ytest=\ train_test_split(corpus.words,corpus.y,test_size=testsize, \ random_state=random_state) ytrainpred=model1.fit(xtrain,ytrain) ytestpred=model1.predict(xtest) trainAccuracy=accuracy_score(ytrain,ytrainpred) testAccuracy=accuracy_score(ytest,ytestpred) controlAccuracy=accuracy_score(np.random.permutation(ytest),ytestpred) global conf_mat conf_mat =model1.confidence(ytest, ytestpred) print(model1.confidence) print() print( np.unique(ytestpred,return_counts=True)) print() [print("%-20s" % key +" %5.3f" % value) for key,value in model1.confidence.items()] for row in range(0,conf_mat.shape[0]): print( [" %4d" % conf_mat[row,col] for col in range(0,conf_mat.shape[1])]) rowsum=conf_mat.sum(axis=0) colsum=conf_mat.sum(axis=1) labels=[] [labels.append(key) for key in model1.confidence.keys()] print("item rowsum colsum") for ic in range(0,conf_mat.shape[0]): print("%-25s" % labels[ic] + " %5d" % rowsum[ic]+ " %5d" % colsum[ic]) print("") print('train=%6.2f test=%6.2f control=%6.2f' % (trainAccuracy,testAccuracy,controlAccuracy)) # compute accuracy given predicted value pickle.dump(model1,open(root+modelName+".pckmdl","wb")) print(ytestpred[0]) print(xtest[0][0:20]) testfile=open(root+modelName+"testdata.txt","wt") testfile.write(ytestpred[0]) testfile.write("\n") testfile.write(xtest[0]) testfile.write("\n") testfile.write(ytestpred[10]) testfile.write("\n") testfile.write(xtest[10]) testfile.write("\n") testfile.close() print( model1.message) if __name__=='__main__': main()
27.008772
88
0.642416
root='C:/Users/jgharris/DocClass/' dataFile='/data/shuffled-full-set-hashed.csv' import statistics as stat import pandas as pd from sklearn.model_selection import train_test_split from sklearn.metrics import accuracy_score import matplotlib import matplotlib.pyplot as plt import numpy as np import pickle from DocClfTfidfCNB import DocClfTfidfCNB from Documents import Documents modelName="nbtfidfv0" maxlines=80000000 testsize=.3 random_state=45 MAXSTRINGLENGH=4000 FIRSTSTRINGLENGTH=80 conf_mat=[] def main(): corpus=Documents() corpus.readFromFile(root+dataFile,maxline=maxlines) model1=DocClfTfidfCNB(maxStringLength=MAXSTRINGLENGH, \ firstStringLength=FIRSTSTRINGLENGTH) print() xtrain,xtest,ytrain,ytest=\ train_test_split(corpus.words,corpus.y,test_size=testsize, \ random_state=random_state) ytrainpred=model1.fit(xtrain,ytrain) ytestpred=model1.predict(xtest) trainAccuracy=accuracy_score(ytrain,ytrainpred) testAccuracy=accuracy_score(ytest,ytestpred) controlAccuracy=accuracy_score(np.random.permutation(ytest),ytestpred) global conf_mat conf_mat =model1.confidence(ytest, ytestpred) print(model1.confidence) print() print( np.unique(ytestpred,return_counts=True)) print() [print("%-20s" % key +" %5.3f" % value) for key,value in model1.confidence.items()] for row in range(0,conf_mat.shape[0]): print( [" %4d" % conf_mat[row,col] for col in range(0,conf_mat.shape[1])]) rowsum=conf_mat.sum(axis=0) colsum=conf_mat.sum(axis=1) labels=[] [labels.append(key) for key in model1.confidence.keys()] print("item rowsum colsum") for ic in range(0,conf_mat.shape[0]): print("%-25s" % labels[ic] + " %5d" % rowsum[ic]+ " %5d" % colsum[ic]) print("") print('train=%6.2f test=%6.2f control=%6.2f' % (trainAccuracy,testAccuracy,controlAccuracy)) pickle.dump(model1,open(root+modelName+".pckmdl","wb")) print(ytestpred[0]) print(xtest[0][0:20]) testfile=open(root+modelName+"testdata.txt","wt") testfile.write(ytestpred[0]) testfile.write("\n") testfile.write(xtest[0]) testfile.write("\n") testfile.write(ytestpred[10]) testfile.write("\n") testfile.write(xtest[10]) testfile.write("\n") testfile.close() print( model1.message) if __name__=='__main__': main()
true
true
f72bb7e51487a16740709aa74b453a9e4b4dfec5
1,107
py
Python
sortByWeather.py
LeahGabrielle/Clothes
72a829358ad6a60aef26b7fce80d854451124a32
[ "Apache-2.0" ]
null
null
null
sortByWeather.py
LeahGabrielle/Clothes
72a829358ad6a60aef26b7fce80d854451124a32
[ "Apache-2.0" ]
null
null
null
sortByWeather.py
LeahGabrielle/Clothes
72a829358ad6a60aef26b7fce80d854451124a32
[ "Apache-2.0" ]
null
null
null
#clothes by weather import random def pickTop(clothesList): return random.choice(clothesList[0]) def pickBottoms(clothesList): return random.choice(clothesList[1]) #sorts clothes into weather type and returns a list of clothes of the correct weather def sortWeather(clothesList, weather): #eventually combine the two loops ''' for i in range(0,len(clothesList)): for j in range(0, len(clothesList[i]): ''' #change to switch later #go through tops i=0 for top in clothesList[0]: if top[2] != weather: clothesList[0].pop(i) i+=1 #go through bottoms i=0 for bottom in clothesList[1]: if bottom[2] != weather: clothesList[1].pop(i) i+=1 return clothesList #Asks user for their weather choice def requestWeather(clothesList): weather = input("Is the weather hot or cold?\n") clothesList = sortWeather(clothesList, weather) finalChoice = [] finalChoice.append(pickTop(clothesList)) finalChoice.append(pickBottoms(clothesList)) return finalChoice
27
85
0.65673
import random def pickTop(clothesList): return random.choice(clothesList[0]) def pickBottoms(clothesList): return random.choice(clothesList[1]) def sortWeather(clothesList, weather): i=0 for top in clothesList[0]: if top[2] != weather: clothesList[0].pop(i) i+=1 i=0 for bottom in clothesList[1]: if bottom[2] != weather: clothesList[1].pop(i) i+=1 return clothesList def requestWeather(clothesList): weather = input("Is the weather hot or cold?\n") clothesList = sortWeather(clothesList, weather) finalChoice = [] finalChoice.append(pickTop(clothesList)) finalChoice.append(pickBottoms(clothesList)) return finalChoice
true
true
f72bb87a2474ba7c90c9d75c1d943aae0014a860
403
py
Python
core/mixon_core.py
onuratakan/MIXON
74d8b1fc7ec2e84dbe4e29f411ae09d701838579
[ "MIT" ]
14
2021-01-22T20:39:43.000Z
2022-02-20T00:30:41.000Z
core/mixon_core.py
onuratakan/MIXON
74d8b1fc7ec2e84dbe4e29f411ae09d701838579
[ "MIT" ]
null
null
null
core/mixon_core.py
onuratakan/MIXON
74d8b1fc7ec2e84dbe4e29f411ae09d701838579
[ "MIT" ]
3
2021-03-20T00:02:24.000Z
2021-03-22T07:36:49.000Z
import sys import os def start_tojas(): os.system("cd tojas && python3 tojas.py -nb && cd ..") def start_tojas_gui(): os.system("python3 lib/tojas_gui.py -nb") def start_scanizen(): os.system("cd scanizen && python3 scanizen.py -nb && cd ..") def start_doser(): os.system("cd doser && python3 doser.py -nb && cd ..") def start_routersploit(): os.system("python3 routersploit/rsf.py")
16.791667
62
0.667494
import sys import os def start_tojas(): os.system("cd tojas && python3 tojas.py -nb && cd ..") def start_tojas_gui(): os.system("python3 lib/tojas_gui.py -nb") def start_scanizen(): os.system("cd scanizen && python3 scanizen.py -nb && cd ..") def start_doser(): os.system("cd doser && python3 doser.py -nb && cd ..") def start_routersploit(): os.system("python3 routersploit/rsf.py")
true
true
f72bb9cc461f8b012834228510d2ae37ee6fc7a0
2,184
py
Python
p130_surrounded_regions.py
feigaochn/leetcode
abf0877fae02aa9c2549051f0b68df0ace952512
[ "MIT" ]
null
null
null
p130_surrounded_regions.py
feigaochn/leetcode
abf0877fae02aa9c2549051f0b68df0ace952512
[ "MIT" ]
null
null
null
p130_surrounded_regions.py
feigaochn/leetcode
abf0877fae02aa9c2549051f0b68df0ace952512
[ "MIT" ]
null
null
null
# Surrounded Regions # Total Accepted: 7716 Total Submissions: 56446 My Submissions # # Given a 2D board containing 'X' and 'O', capture all regions surrounded by # 'X'. A region is captured by flipping all 'O's into 'X's in that surrounded # region. # # For example, # X X X X # X O O X # X X O X # X O X X # # After running your function, the board should be: # X X X X # X X X X # X X X X # X O X X class Solution: # @param board, a 2D array # Capture all regions by modifying the input board in-place. # Do not return any value. def solve(self, board): if len(board) is 0: return q = [] # first row for j in range(len(board[0])): if board[0][j] is 'O': q.append((0, j)) board[0][j] = 'o' # last row for j in range(len(board[-1])): if board[len(board)-1][j] is 'O': q.append((len(board)-1, j)) board[len(board)-1][j] = 'o' for i in range(len(board)): n = len(board[i]) if n > 0: # first column if board[i][0] is 'O': board[i][0] = 'o' q.append((i, 0)) # last column if board[i][n-1] is 'O': board[i][n-1] = 'o' q.append((i, n-1)) while len(q) > 0: i, j = q.pop(0) for di, dj in [(1, 0), (-1, 0), (0, 1), (0, -1)]: if 0 <= i+di < len(board) and 0 <= j+dj < len(board[i+di]) \ and board[i+di][j+dj] is 'O': board[i+di][j+dj] = 'o' q.append((i+di, j+dj)) for row in board: for j in range(len(row)): if row[j] is 'o': row[j] = 'O' elif row[j] is 'O': row[j] = 'X' if __name__ == '__main__': board = [['X', 'X', 'X', 'X'], ['X', 'O', 'O', 'X'], ['X', 'X', 'O', 'X'], ['X', 'O', 'X', 'X']] Solution().solve(board) print(board) board = [] Solution().solve(board) print(board)
28.736842
77
0.422619
class Solution: def solve(self, board): if len(board) is 0: return q = [] for j in range(len(board[0])): if board[0][j] is 'O': q.append((0, j)) board[0][j] = 'o' for j in range(len(board[-1])): if board[len(board)-1][j] is 'O': q.append((len(board)-1, j)) board[len(board)-1][j] = 'o' for i in range(len(board)): n = len(board[i]) if n > 0: if board[i][0] is 'O': board[i][0] = 'o' q.append((i, 0)) if board[i][n-1] is 'O': board[i][n-1] = 'o' q.append((i, n-1)) while len(q) > 0: i, j = q.pop(0) for di, dj in [(1, 0), (-1, 0), (0, 1), (0, -1)]: if 0 <= i+di < len(board) and 0 <= j+dj < len(board[i+di]) \ and board[i+di][j+dj] is 'O': board[i+di][j+dj] = 'o' q.append((i+di, j+dj)) for row in board: for j in range(len(row)): if row[j] is 'o': row[j] = 'O' elif row[j] is 'O': row[j] = 'X' if __name__ == '__main__': board = [['X', 'X', 'X', 'X'], ['X', 'O', 'O', 'X'], ['X', 'X', 'O', 'X'], ['X', 'O', 'X', 'X']] Solution().solve(board) print(board) board = [] Solution().solve(board) print(board)
true
true
f72bb9ed94ed86bf9e276452065cfabb93084887
647
py
Python
4.py
Michanix/Math-Stat-Homework
18f4f915ea0f2dd7fa14ebaeb0d357510aef4808
[ "MIT" ]
null
null
null
4.py
Michanix/Math-Stat-Homework
18f4f915ea0f2dd7fa14ebaeb0d357510aef4808
[ "MIT" ]
null
null
null
4.py
Michanix/Math-Stat-Homework
18f4f915ea0f2dd7fa14ebaeb0d357510aef4808
[ "MIT" ]
null
null
null
from math import sqrt from random import randrange arr1 = [i for i in range(1, 11)] arr2 = [i for i in range(1, 11)] arr3 = [randrange(i) for i in range(1, 11)] arr4 = [randrange(i) for i in range(1, 11)] def avg(data): return sum(data) / len(data) def std(data): mu = avg(data) std = (sum([(i - mu)**2 for i in data]) / len(data))**0.5 return std def koef_pirsona(x, y): # x,y - list of values avg_x = avg(x) avg_y = avg(y) std_x = std(x) std_y = std(y) avg_xy = avg([i*j for i,j in zip(x,y)]) result = (avg_xy - avg_x * avg_y) / (std_x * std_y) return result print(koef_pirsona(arr3, arr4))
22.310345
61
0.591963
from math import sqrt from random import randrange arr1 = [i for i in range(1, 11)] arr2 = [i for i in range(1, 11)] arr3 = [randrange(i) for i in range(1, 11)] arr4 = [randrange(i) for i in range(1, 11)] def avg(data): return sum(data) / len(data) def std(data): mu = avg(data) std = (sum([(i - mu)**2 for i in data]) / len(data))**0.5 return std def koef_pirsona(x, y): avg_x = avg(x) avg_y = avg(y) std_x = std(x) std_y = std(y) avg_xy = avg([i*j for i,j in zip(x,y)]) result = (avg_xy - avg_x * avg_y) / (std_x * std_y) return result print(koef_pirsona(arr3, arr4))
true
true
f72bba260dbdc0d48d601f070334e34f0095da0b
6,016
py
Python
scripts/gdc_req_legacy.py
dampierch/herv
9f1ce0e676977b6c8d25fdf446c0807826b80bea
[ "MIT" ]
null
null
null
scripts/gdc_req_legacy.py
dampierch/herv
9f1ce0e676977b6c8d25fdf446c0807826b80bea
[ "MIT" ]
null
null
null
scripts/gdc_req_legacy.py
dampierch/herv
9f1ce0e676977b6c8d25fdf446c0807826b80bea
[ "MIT" ]
null
null
null
''' this script queries the gdc legacy archive via the search and retrieve api and returns msi_status object (from files endpoint on legacy) -- get uuids of xml files with the msi annotations from legacy server -- download each xml file -- parse xml files to extract msi annotations for each subject script should be called from within gdc_ann_make, which itself should be called as part of snakemake pipeline -- usage: snakemake setup_tcga ''' import io import json import os import pandas as pd import requests import re import subprocess import glob import xml.etree.ElementTree as ET modname = 'gdc_req_legacy' def set_filters(): ''' set filters for gdc legacy files endpoint search -- json format -- for files.data_type, values for MSI status are 'Auxiliary test' and 'Microsatellite instability' -- here use 'Auxiliary test' per TCGAbiolinks examples ''' filters = { 'op':'and', 'content':[ {'op':'or', 'content':[ {'op':'in', 'content':{ 'field':'cases.project.project_id', 'value':'TCGA-COAD' } }, {'op':'in', 'content':{ 'field':'cases.project.project_id', 'value':'TCGA-READ' } } ] }, {'op':'and', 'content':[ {'op':'in', 'content':{ 'field':'files.data_category', 'value':'Other' } }, {'op':'in', 'content':{ 'field':'files.data_type', 'value':'Auxiliary test' } }, {'op':'in', 'content':{ 'field':'files.access', 'value':'open' } } ] } ] } filters = json.dumps(filters) return filters def set_fields(): ''' set fields for extraction from endpoint ''' fields = [ 'file_name', 'file_id', 'md5sum', 'file_size', 'state' ] fields = ','.join(fields) return fields def set_params(filters,fields): ''' set parameters for https get request to endpoint -- set size parameter empirically to a level greater than number of target cases to get all records at once ''' params = { 'filters': filters, 'fields': fields, 'format': 'TSV', 'size': '1500' } return params def get_results(endpoint,params): ''' given an endpoint and parameters, execute https GET request for xml file_id entities and build results dataframe with msi results ''' response = requests.get(endpoint, params=params) object = io.StringIO(response.content.decode('utf-8')) results = pd.read_table(object) return results def download_xml_uuid(files_res,dest): ''' download xml files one at a time by uuid ''' file_count = 0 for uuid in files_res.id: cmd = ' '.join(['gdc-client download',uuid,'-d',dest]) subprocess.call(cmd, shell=True) print(' '.join([uuid,'downloaded'])) file_count = file_count + 1 print(' '.join([str(file_count),'files downloaded'])) def download_xml_manifest(files_res,dest): ''' -- create manifest object -- write manifest to file -- use manifest for bulk download ''' select = ['file_id', 'file_name', 'md5sum', 'file_size', 'state'] manifest = files_res[select] manifest.columns = ['id', 'filename', 'md5', 'size', 'state'] manifest = manifest.sort_values(by=['id']) out_file = dest + 'manifest.tsv' manifest.to_csv(out_file, sep='\t', index=False) cmd = ' '.join(['gdc-client download','-m',out_file,'-d',dest]) subprocess.call(cmd, shell=True) print('manifest downloaded') def parse_xml(files_res,dest): ''' parse xml files to extract msi status ''' msi_dict = {} msi_dict['subject_id'] = [] msi_dict['msi_status'] = [] tag1 = 'mononucleotide_and_dinucleotide_marker_panel_analysis_status' tag2 = 'mononucleotide_marker_panel_analysis_status' file_count = 0 for uuid in files_res.id: pattern = dest + uuid + '/*.xml' fn = glob.glob(pattern)[0] tree = ET.parse(fn) for elem in tree.getiterator(): if 'bcr_patient_barcode' in elem.tag: subject_id = elem.text if tag1 in elem.tag and elem.text != None: msi_status = elem.text elif tag2 in elem.tag and elem.text != None: msi_status = elem.text msi_dict['subject_id'].append(subject_id) msi_dict['msi_status'].append(msi_status) file_count = file_count + 1 print(' '.join([str(file_count),'files parsed'])) msi_res = pd.DataFrame.from_dict(msi_dict) return msi_res def check_outpath(out_path): ''' check for presence of absence of out_path and make directory if absent ''' l = out_path.strip('/').split('/') d = '' for e in l: d = d + '/' + e if os.path.exists(d): print(d,'present') else: print(d,'absent') print('making',d,'now') os.mkdir(d) def main(): endpoint = 'https://api.gdc.cancer.gov/legacy/files/' filters = set_filters() fields = set_fields() params = set_params(filters, fields) files_res = get_results(endpoint, params) dest = os.environ['ann_dir'] + 'tcga/msi/' check_outpath(dest) download_xml_manifest(files_res, dest) msi_res = parse_xml(files_res, dest) return msi_res if __name__ == '__main__': print('This script is not meant to be run as main. See usage statment:') print('usage: snakemake setup_tcga') else: msi_res = main()
27.723502
79
0.562001
import io import json import os import pandas as pd import requests import re import subprocess import glob import xml.etree.ElementTree as ET modname = 'gdc_req_legacy' def set_filters(): filters = { 'op':'and', 'content':[ {'op':'or', 'content':[ {'op':'in', 'content':{ 'field':'cases.project.project_id', 'value':'TCGA-COAD' } }, {'op':'in', 'content':{ 'field':'cases.project.project_id', 'value':'TCGA-READ' } } ] }, {'op':'and', 'content':[ {'op':'in', 'content':{ 'field':'files.data_category', 'value':'Other' } }, {'op':'in', 'content':{ 'field':'files.data_type', 'value':'Auxiliary test' } }, {'op':'in', 'content':{ 'field':'files.access', 'value':'open' } } ] } ] } filters = json.dumps(filters) return filters def set_fields(): fields = [ 'file_name', 'file_id', 'md5sum', 'file_size', 'state' ] fields = ','.join(fields) return fields def set_params(filters,fields): params = { 'filters': filters, 'fields': fields, 'format': 'TSV', 'size': '1500' } return params def get_results(endpoint,params): response = requests.get(endpoint, params=params) object = io.StringIO(response.content.decode('utf-8')) results = pd.read_table(object) return results def download_xml_uuid(files_res,dest): file_count = 0 for uuid in files_res.id: cmd = ' '.join(['gdc-client download',uuid,'-d',dest]) subprocess.call(cmd, shell=True) print(' '.join([uuid,'downloaded'])) file_count = file_count + 1 print(' '.join([str(file_count),'files downloaded'])) def download_xml_manifest(files_res,dest): select = ['file_id', 'file_name', 'md5sum', 'file_size', 'state'] manifest = files_res[select] manifest.columns = ['id', 'filename', 'md5', 'size', 'state'] manifest = manifest.sort_values(by=['id']) out_file = dest + 'manifest.tsv' manifest.to_csv(out_file, sep='\t', index=False) cmd = ' '.join(['gdc-client download','-m',out_file,'-d',dest]) subprocess.call(cmd, shell=True) print('manifest downloaded') def parse_xml(files_res,dest): msi_dict = {} msi_dict['subject_id'] = [] msi_dict['msi_status'] = [] tag1 = 'mononucleotide_and_dinucleotide_marker_panel_analysis_status' tag2 = 'mononucleotide_marker_panel_analysis_status' file_count = 0 for uuid in files_res.id: pattern = dest + uuid + '/*.xml' fn = glob.glob(pattern)[0] tree = ET.parse(fn) for elem in tree.getiterator(): if 'bcr_patient_barcode' in elem.tag: subject_id = elem.text if tag1 in elem.tag and elem.text != None: msi_status = elem.text elif tag2 in elem.tag and elem.text != None: msi_status = elem.text msi_dict['subject_id'].append(subject_id) msi_dict['msi_status'].append(msi_status) file_count = file_count + 1 print(' '.join([str(file_count),'files parsed'])) msi_res = pd.DataFrame.from_dict(msi_dict) return msi_res def check_outpath(out_path): l = out_path.strip('/').split('/') d = '' for e in l: d = d + '/' + e if os.path.exists(d): print(d,'present') else: print(d,'absent') print('making',d,'now') os.mkdir(d) def main(): endpoint = 'https://api.gdc.cancer.gov/legacy/files/' filters = set_filters() fields = set_fields() params = set_params(filters, fields) files_res = get_results(endpoint, params) dest = os.environ['ann_dir'] + 'tcga/msi/' check_outpath(dest) download_xml_manifest(files_res, dest) msi_res = parse_xml(files_res, dest) return msi_res if __name__ == '__main__': print('This script is not meant to be run as main. See usage statment:') print('usage: snakemake setup_tcga') else: msi_res = main()
true
true
f72bba363e60dcda05c1e3254d05eaf5e83fbdac
10,188
py
Python
esse3api/esse3api.py
hpsc-smartlab/esse3api
416c52149f28c886cab72671b20b209b40857edf
[ "MIT" ]
2
2018-04-04T15:56:40.000Z
2018-05-23T11:46:06.000Z
esse3api/esse3api.py
hpsc-smartlab/esse3api
416c52149f28c886cab72671b20b209b40857edf
[ "MIT" ]
null
null
null
esse3api/esse3api.py
hpsc-smartlab/esse3api
416c52149f28c886cab72671b20b209b40857edf
[ "MIT" ]
null
null
null
import json, sys, re, urllib, urllib2, socket, json, pydoc, cgi, os, time, inspect from hashlib import md5 from datetime import datetime import time import csv from scraper import Scraper from flask import Flask from flask import Response from flask import request from flask import jsonify from flask import current_app from flask import make_response from flask import session from flask import url_for from flask import redirect from flask import render_template from flask import abort from flask import g from flask import flash from flask import _app_ctx_stack from flask_restplus import Resource, Api from flask_restplus import fields from functools import wraps from functools import update_wrapper import logging import traceback log = logging.getLogger(__name__) app = Flask(__name__) api = Api(app) app.config.from_object(__name__) # load config from this file , esse3api.py # Load default config and override config from an environment variable app.config.update(dict( SECRET_KEY='development key', USERNAME='admin', PASSWORD='default' )) app.config.from_envvar('ESSE3API_SETTINGS', silent=True) @api.errorhandler def default_error_handler(e): message = 'An unhandled exception occurred.' log.exception(message) if not settings.FLASK_DEBUG: return {'message': message}, 500 #### CROSSDOMAIN DECORATOR #### def crossdomain(origin=None, methods=None, headers=None, max_age=21600, attach_to_all=True, automatic_options=True): if methods is not None: methods = ', '.join(sorted(x.upper() for x in methods)) if headers is not None and not isinstance(headers, basestring): headers = ', '.join(x.upper() for x in headers) if not isinstance(origin, basestring): origin = ', '.join(origin) if isinstance(max_age, timedelta): max_age = max_age.total_seconds() def get_methods(): if methods is not None: return methods options_resp = current_app.make_default_options_response() return options_resp.headers['allow'] def decorator(f): def wrapped_function(*args, **kwargs): if automatic_options and request.method == 'OPTIONS': resp = current_app.make_default_options_response() else: resp = make_response(f(*args, **kwargs)) if not attach_to_all and request.method != 'OPTIONS': return resp h = resp.headers h['Access-Control-Allow-Origin'] = origin h['Access-Control-Allow-Methods'] = get_methods() h['Access-Control-Max-Age'] = str(max_age) h['Access-Control-Allow-Credentials'] = 'true' h['Access-Control-Allow-Headers'] = "Origin, X-Requested-With, Content-Type, Accept, Authorization" if headers is not None: h['Access-Control-Allow-Headers'] = headers return resp f.provide_automatic_options = False return update_wrapper(wrapped_function, f) return decorator #### JSONP DECORATOR #### def jsonp(func): """ Wrap json as jsonp """ @wraps(func) def decorated_function(*args, **kwargs): callback = request.args.get('callback', False) if callback: data = str(func(*args, **kwargs).data) content = str(callback) + '(' + data + ')' mimetype = 'application/javascript' return current_app.response_class(content, mimetype=mimetype) else: return func(*args, **kwargs) return decorated_function parser = api.parser() parser.add_argument('username', help='The username', location='form') parser.add_argument('password', help='The passowrd', location='form') @api.route('/dati_anagrafici') class DatiAnagrafici(Resource): @api.doc(parser=parser) def post(self): """Recuper i dati anagrafici :param: username: Nome utente :param: password: Password :example: /dati_anagrafici :returns: json -- I dati personali ------------------------------------------------------------------------------------------- """ args = parser.parse_args(strict=True) username = args['username'] password = args['password'] log.info(username) s = Scraper(username, password) return jsonify(s.dati_anagrafici()) @api.route('/login') class Login(Resource): @api.doc(parser=parser) def post(self): """Permette il login al portale esse3 :param: username: Nome utente :param: password: Password :example: /login :returns: json -- Risultato del login ------------------------------------------------------------------------------------------- """ args = parser.parse_args(strict=True) username = args['username'] password = args['password'] s = Scraper(username, password) return jsonify(s.login()) @api.route('/riepilogo_esami') class RiepilogoEsami(Resource): @api.doc(parser=parser) def post(self) : """Restituisce il riepilogo degli esami effettuati dallo studente :param: username: Nome utente :param: password: Password :example: /riepilogo_esami :returns: json -- Lista degli esami sostenuti ------------------------------------------------------------------------------------------- """ args = parser.parse_args(strict=True) username = args['username'] password = args['password'] s = Scraper(username, password) return jsonify(s.riepilogo_esami()) @api.route('/residenza') class Residenza(Resource): @api.doc(parser=parser) def post(self) : """Restituisce la residenza dello studente :param: username: Nome utente :param: password: Password :example: /residenza :returns: json -- Residenza dello studente ------------------------------------------------------------------------------------------- """ args = parser.parse_args(strict=True) username = args['username'] password = args['password'] s = Scraper(username, password) return jsonify(s.residenza()) @api.route('/domicilio') class Domicilio(Resource): @api.doc(parser=parser) def post(self) : """Restituisce il domicilio dello studente :param: username: Nome utente :param: password: Password :example: /domicilio :returns: json -- Domicilio dello studente ------------------------------------------------------------------------------------------- """ args = parser.parse_args(strict=True) username = args['username'] password = args['password'] s = Scraper(username, password) return jsonify(s.domicilio()) @api.route('/libretto') class Libretto(Resource): @api.doc(parser=parser) def post(self) : """Restituisce il libretto universitario dello studente :param: username: Nome utente :param: password: Password :example: /libretto :returns: json -- Libretto dello studente ------------------------------------------------------------------------------------------- """ args = parser.parse_args(strict=True) username = args['username'] password = args['password'] s = Scraper(username, password) return jsonify(s.libretto()) @api.route('/pagamenti') class Pagamenti(Resource): @api.doc(parser=parser) def post(self) : """Restituisce i pagamenti effettuati dello studente :param: username: Nome utente :param: password: Password :example: /pagamenti :returns: json -- Pagamenti effettuati dallo studente ------------------------------------------------------------------------------------------- """ args = parser.parse_args(strict=True) username = args['username'] password = args['password'] s = Scraper(username, password) return jsonify(s.pagamenti()) @api.route('/prenotazioni_effettuate') class PrenotazioniEffettuate(Resource): @api.doc(parser=parser) def post(self) : """Restituisce le prenotazioni alle sedute d'esame effettuati dello studente :param: username: Nome utente :param: password: Password :example: /prenotazioni_effettuate :returns: json -- Prenotazioni effettuate dallo studente ------------------------------------------------------------------------------------------- """ args = parser.parse_args(strict=True) username = args['username'] password = args['password'] s = Scraper(username, password) return jsonify(s.prenotazioni_effettuate()) @api.route('/piano') class Piano(Resource): @api.doc(parser=parser) def post(self) : """Restituisce il piano di studio dello studente :param: username: Nome utente :param: password: Password :example: /piano :returns: json -- Lista degli esami sostenuti ------------------------------------------------------------------------------------------- """ args = parser.parse_args(strict=True) username = args['username'] password = args['password'] s = Scraper(username, password) return jsonify(s.piano()) @api.route('/pannello') class Pannello(Resource): @api.doc(parser=parser) def post(self) : """Restituisce il pannello di controllo dello studente :param: username: Nome utente :param: password: Password :example: /pannello :returns: json -- Lista degli esami sostenuti ------------------------------------------------------------------------------------------- """ args = parser.parse_args(strict=True) username = args['username'] password = args['password'] s = Scraper(username, password) return jsonify(s.pannello_di_controllo()) if __name__ == '__main__': app.debug = True app.run()
31.060976
116
0.575775
import json, sys, re, urllib, urllib2, socket, json, pydoc, cgi, os, time, inspect from hashlib import md5 from datetime import datetime import time import csv from scraper import Scraper from flask import Flask from flask import Response from flask import request from flask import jsonify from flask import current_app from flask import make_response from flask import session from flask import url_for from flask import redirect from flask import render_template from flask import abort from flask import g from flask import flash from flask import _app_ctx_stack from flask_restplus import Resource, Api from flask_restplus import fields from functools import wraps from functools import update_wrapper import logging import traceback log = logging.getLogger(__name__) app = Flask(__name__) api = Api(app) app.config.from_object(__name__) app.config.update(dict( SECRET_KEY='development key', USERNAME='admin', PASSWORD='default' )) app.config.from_envvar('ESSE3API_SETTINGS', silent=True) @api.errorhandler def default_error_handler(e): message = 'An unhandled exception occurred.' log.exception(message) if not settings.FLASK_DEBUG: return {'message': message}, 500 matic_options=True): if methods is not None: methods = ', '.join(sorted(x.upper() for x in methods)) if headers is not None and not isinstance(headers, basestring): headers = ', '.join(x.upper() for x in headers) if not isinstance(origin, basestring): origin = ', '.join(origin) if isinstance(max_age, timedelta): max_age = max_age.total_seconds() def get_methods(): if methods is not None: return methods options_resp = current_app.make_default_options_response() return options_resp.headers['allow'] def decorator(f): def wrapped_function(*args, **kwargs): if automatic_options and request.method == 'OPTIONS': resp = current_app.make_default_options_response() else: resp = make_response(f(*args, **kwargs)) if not attach_to_all and request.method != 'OPTIONS': return resp h = resp.headers h['Access-Control-Allow-Origin'] = origin h['Access-Control-Allow-Methods'] = get_methods() h['Access-Control-Max-Age'] = str(max_age) h['Access-Control-Allow-Credentials'] = 'true' h['Access-Control-Allow-Headers'] = "Origin, X-Requested-With, Content-Type, Accept, Authorization" if headers is not None: h['Access-Control-Allow-Headers'] = headers return resp f.provide_automatic_options = False return update_wrapper(wrapped_function, f) return decorator callback = request.args.get('callback', False) if callback: data = str(func(*args, **kwargs).data) content = str(callback) + '(' + data + ')' mimetype = 'application/javascript' return current_app.response_class(content, mimetype=mimetype) else: return func(*args, **kwargs) return decorated_function parser = api.parser() parser.add_argument('username', help='The username', location='form') parser.add_argument('password', help='The passowrd', location='form') @api.route('/dati_anagrafici') class DatiAnagrafici(Resource): @api.doc(parser=parser) def post(self): args = parser.parse_args(strict=True) username = args['username'] password = args['password'] log.info(username) s = Scraper(username, password) return jsonify(s.dati_anagrafici()) @api.route('/login') class Login(Resource): @api.doc(parser=parser) def post(self): args = parser.parse_args(strict=True) username = args['username'] password = args['password'] s = Scraper(username, password) return jsonify(s.login()) @api.route('/riepilogo_esami') class RiepilogoEsami(Resource): @api.doc(parser=parser) def post(self) : args = parser.parse_args(strict=True) username = args['username'] password = args['password'] s = Scraper(username, password) return jsonify(s.riepilogo_esami()) @api.route('/residenza') class Residenza(Resource): @api.doc(parser=parser) def post(self) : args = parser.parse_args(strict=True) username = args['username'] password = args['password'] s = Scraper(username, password) return jsonify(s.residenza()) @api.route('/domicilio') class Domicilio(Resource): @api.doc(parser=parser) def post(self) : args = parser.parse_args(strict=True) username = args['username'] password = args['password'] s = Scraper(username, password) return jsonify(s.domicilio()) @api.route('/libretto') class Libretto(Resource): @api.doc(parser=parser) def post(self) : args = parser.parse_args(strict=True) username = args['username'] password = args['password'] s = Scraper(username, password) return jsonify(s.libretto()) @api.route('/pagamenti') class Pagamenti(Resource): @api.doc(parser=parser) def post(self) : args = parser.parse_args(strict=True) username = args['username'] password = args['password'] s = Scraper(username, password) return jsonify(s.pagamenti()) @api.route('/prenotazioni_effettuate') class PrenotazioniEffettuate(Resource): @api.doc(parser=parser) def post(self) : args = parser.parse_args(strict=True) username = args['username'] password = args['password'] s = Scraper(username, password) return jsonify(s.prenotazioni_effettuate()) @api.route('/piano') class Piano(Resource): @api.doc(parser=parser) def post(self) : args = parser.parse_args(strict=True) username = args['username'] password = args['password'] s = Scraper(username, password) return jsonify(s.piano()) @api.route('/pannello') class Pannello(Resource): @api.doc(parser=parser) def post(self) : args = parser.parse_args(strict=True) username = args['username'] password = args['password'] s = Scraper(username, password) return jsonify(s.pannello_di_controllo()) if __name__ == '__main__': app.debug = True app.run()
true
true
f72bba8e3526c1ea6ffcb838cd2c3598c2a72e30
3,094
py
Python
app/forms.py
credwood/bitplayers
4ca6b6c6a21bb21d7cd963c64028415559c3dcc4
[ "MIT" ]
1
2020-06-26T21:49:14.000Z
2020-06-26T21:49:14.000Z
app/forms.py
credwood/bitplayers
4ca6b6c6a21bb21d7cd963c64028415559c3dcc4
[ "MIT" ]
2
2020-03-31T11:11:04.000Z
2021-12-13T20:38:48.000Z
app/forms.py
credwood/bitplayers
4ca6b6c6a21bb21d7cd963c64028415559c3dcc4
[ "MIT" ]
null
null
null
from flask_wtf import FlaskForm, RecaptchaField from wtforms import BooleanField, TextAreaField from wtforms import PasswordField from wtforms import StringField from wtforms import SubmitField, TextField from wtforms import Form, BooleanField, validators from wtforms.validators import DataRequired, InputRequired, EqualTo, Length, Email, ValidationError from wtforms.fields.html5 import EmailField from wtf_tinymce.forms.fields import TinyMceField from .models import Blog, User class NewPost(FlaskForm): blog_title = StringField('Title', validators=[DataRequired(message="All posts must have a title")]) blog_slug = StringField('Slug', validators=[DataRequired()]) blog_author = StringField('By', validators=[DataRequired()]) blog_content = TextAreaField(validators=[DataRequired()]) submit = SubmitField('submit', validators=[DataRequired()]) class LoginForm(FlaskForm): username = StringField('Username', validators=[DataRequired()]) password = PasswordField('Password', validators=[DataRequired()]) submit = SubmitField('Login') remember_me = BooleanField('Remember Me') class RequestResetForm(FlaskForm): email = EmailField('Email address', [validators.DataRequired(), validators.Email()]) submit = SubmitField('Request Password Reset') def validate_email(self, email): user = User.query.filter_by(email=email.data).first() if not user: raise ValidationError("No account registered with that email. ") class RegistrationForm(FlaskForm): username = StringField('Username', validators=[DataRequired()]) password = PasswordField('Password', validators=[DataRequired()]) confirm = PasswordField('Confirm Password', validators=[DataRequired(),InputRequired(), EqualTo('password', message='Passwords must match')]) email = EmailField('Email address', [validators.DataRequired(), validators.Email()]) submit = SubmitField('Register') def validate_username(self, username): user = User.query.filter_by(username=username.data).first() if user: raise ValidationError("That username is already taken. Please try another") def validate_email(self, email): user = User.query.filter_by(email=email.data).first() if user is not None: raise ValidationError("There is an account associated with this email address already.") class ResetPassword(FlaskForm): password = PasswordField('Password', validators=[DataRequired()]) confirm = PasswordField('Confirm Password', validators=[DataRequired(),InputRequired(), EqualTo('password', message='Passwords must match')]) submit = SubmitField('Reset Password') class ContactForm(FlaskForm): """Contact form.""" name = StringField('Name', [ DataRequired()]) email = StringField('Email', [ Email(message=('Not a valid email address.')), DataRequired()]) body = TextField('Message', [ DataRequired(), Length(min=4, message=('Your message is too short.'))]) #recaptcha = RecaptchaField() submit = SubmitField('Submit')
44.84058
145
0.72075
from flask_wtf import FlaskForm, RecaptchaField from wtforms import BooleanField, TextAreaField from wtforms import PasswordField from wtforms import StringField from wtforms import SubmitField, TextField from wtforms import Form, BooleanField, validators from wtforms.validators import DataRequired, InputRequired, EqualTo, Length, Email, ValidationError from wtforms.fields.html5 import EmailField from wtf_tinymce.forms.fields import TinyMceField from .models import Blog, User class NewPost(FlaskForm): blog_title = StringField('Title', validators=[DataRequired(message="All posts must have a title")]) blog_slug = StringField('Slug', validators=[DataRequired()]) blog_author = StringField('By', validators=[DataRequired()]) blog_content = TextAreaField(validators=[DataRequired()]) submit = SubmitField('submit', validators=[DataRequired()]) class LoginForm(FlaskForm): username = StringField('Username', validators=[DataRequired()]) password = PasswordField('Password', validators=[DataRequired()]) submit = SubmitField('Login') remember_me = BooleanField('Remember Me') class RequestResetForm(FlaskForm): email = EmailField('Email address', [validators.DataRequired(), validators.Email()]) submit = SubmitField('Request Password Reset') def validate_email(self, email): user = User.query.filter_by(email=email.data).first() if not user: raise ValidationError("No account registered with that email. ") class RegistrationForm(FlaskForm): username = StringField('Username', validators=[DataRequired()]) password = PasswordField('Password', validators=[DataRequired()]) confirm = PasswordField('Confirm Password', validators=[DataRequired(),InputRequired(), EqualTo('password', message='Passwords must match')]) email = EmailField('Email address', [validators.DataRequired(), validators.Email()]) submit = SubmitField('Register') def validate_username(self, username): user = User.query.filter_by(username=username.data).first() if user: raise ValidationError("That username is already taken. Please try another") def validate_email(self, email): user = User.query.filter_by(email=email.data).first() if user is not None: raise ValidationError("There is an account associated with this email address already.") class ResetPassword(FlaskForm): password = PasswordField('Password', validators=[DataRequired()]) confirm = PasswordField('Confirm Password', validators=[DataRequired(),InputRequired(), EqualTo('password', message='Passwords must match')]) submit = SubmitField('Reset Password') class ContactForm(FlaskForm): name = StringField('Name', [ DataRequired()]) email = StringField('Email', [ Email(message=('Not a valid email address.')), DataRequired()]) body = TextField('Message', [ DataRequired(), Length(min=4, message=('Your message is too short.'))]) submit = SubmitField('Submit')
true
true
f72bba9d57d9b9c86ad129995eaf5cd82c8bbdc8
5,764
py
Python
test/integration/ggrc/proposal/test_proposal_email.py
MikalaiMikalalai/ggrc-core
f0f83b3638574bb64de474f3b70ed27436ca812a
[ "ECL-2.0", "Apache-2.0" ]
1
2019-01-12T23:46:00.000Z
2019-01-12T23:46:00.000Z
test/integration/ggrc/proposal/test_proposal_email.py
MikalaiMikalalai/ggrc-core
f0f83b3638574bb64de474f3b70ed27436ca812a
[ "ECL-2.0", "Apache-2.0" ]
null
null
null
test/integration/ggrc/proposal/test_proposal_email.py
MikalaiMikalalai/ggrc-core
f0f83b3638574bb64de474f3b70ed27436ca812a
[ "ECL-2.0", "Apache-2.0" ]
null
null
null
# Copyright (C) 2020 Google Inc. # Licensed under http://www.apache.org/licenses/LICENSE-2.0 <see LICENSE file> """This module contains test about sending emails for proposals.""" import ddt import mock from ggrc.notifications import fast_digest from integration.ggrc import TestCase from integration.ggrc.api_helper import Api from integration.ggrc.models import factories @ddt.ddt class TestProposalEmail(TestCase): """Test case about email sending and email presenting for proposals.""" def setUp(self): super(TestProposalEmail, self).setUp() self.api = Api() self.client.get("/login") @ddt.data(True, False) def test_email_presentation(self, is_admin): """Test presentation of proposal digest email if is_admin is {0}.""" person = factories.PersonFactory() self.api.set_user(person=person) with mock.patch("ggrc.rbac.permissions.is_admin", return_value=is_admin): resp = self.client.get("/_notifications/show_fast_digest") if is_admin: self.assert200(resp) else: self.assert403(resp) def test_email_sending(self): """Test sending emails about proposals.""" role_1 = factories.AccessControlRoleFactory(object_type="Program", notify_about_proposal=True) role_2 = factories.AccessControlRoleFactory(object_type="Program", notify_about_proposal=True) role_3 = factories.AccessControlRoleFactory(object_type="Program", notify_about_proposal=False) with factories.single_commit(): program = factories.ProgramFactory() person_1 = factories.PersonFactory() # has 1 role person_2 = factories.PersonFactory() # has no roles person_3 = factories.PersonFactory() # has 2 roles factories.PersonFactory() # not related to program at all factories.AccessControlPersonFactory( ac_list=program.acr_acl_map[role_1], person=person_1 ) factories.AccessControlPersonFactory( ac_list=program.acr_acl_map[role_1], person=person_3 ) factories.AccessControlPersonFactory( ac_list=program.acr_acl_map[role_2], person=person_3 ) factories.AccessControlPersonFactory( ac_list=program.acr_acl_map[role_3], person=person_2 ) proposal_1 = factories.ProposalFactory( instance=program, content={ "fields": {"title": "a"}, "access_control_list": {}, "custom_attribute_values": {}, "mapping_fields": {}, "mapping_list_fields": {}, }, agenda="agenda 1") proposal_2 = factories.ProposalFactory( instance=program, content={ "fields": {"title": "b"}, "access_control_list": {}, "custom_attribute_values": {}, "mapping_fields": {}, "mapping_list_fields": {}, }, agenda="agenda 2") self.assertIsNone(proposal_1.proposed_notified_datetime) self.assertIsNone(proposal_2.proposed_notified_datetime) with mock.patch("ggrc.notifications.common.send_email") as send_email_mock: with mock.patch.object(fast_digest.DIGEST_TMPL, "render") as bodybuilder_mock: fast_digest.send_notification() self.assertIsNotNone(proposal_1.proposed_notified_datetime) self.assertIsNotNone(proposal_2.proposed_notified_datetime) self.assertEqual(2, len(bodybuilder_mock.call_args_list)) self.assertEqual(2, len(send_email_mock.call_args_list)) # email to each required person self.assertListEqual( sorted([person_1.email, person_3.email]), sorted([a[1]["user_email"] for a in send_email_mock.call_args_list])) # no matter how many roles each proposal should be otified # only once for that person self.assertListEqual( [2] * 2, [len(a[1]["proposals"]) for a in bodybuilder_mock.call_args_list]) @ddt.data( 'Program Managers', 'Program Editors', 'Primary Contacts' ) def test_email_proposal_program(self, role_name): """Test sending email to Program manager/Editor/Primary Contacts""" from ggrc.models import all_models role_1 = all_models.AccessControlRole.query.filter( all_models.AccessControlRole.name == role_name, all_models.AccessControlRole.object_type == 'Program', ).one() with factories.single_commit(): program = factories.ProgramFactory() person_1 = factories.PersonFactory() # has 1 role factories.AccessControlPersonFactory( ac_list=program.acr_acl_map[role_1], person=person_1 ) proposal_1 = factories.ProposalFactory( instance=program, content={ "fields": {"title": "a"}, "access_control_list": {}, "custom_attribute_values": {}, "mapping_fields": {}, "mapping_list_fields": {}, }, agenda="agenda 1") self.assertIsNone(proposal_1.proposed_notified_datetime) with mock.patch("ggrc.notifications.common.send_email") as send_email_mock: with mock.patch.object(fast_digest.DIGEST_TMPL, "render") as bodybuilder_mock: fast_digest.send_notification() self.assertIsNotNone(proposal_1.proposed_notified_datetime) self.assertEqual(1, len(bodybuilder_mock.call_args_list)) self.assertEqual(1, len(send_email_mock.call_args_list)) # email to each required person self.assertEqual( [person_1.email], [a[1]["user_email"] for a in send_email_mock.call_args_list])
39.479452
79
0.653539
import ddt import mock from ggrc.notifications import fast_digest from integration.ggrc import TestCase from integration.ggrc.api_helper import Api from integration.ggrc.models import factories @ddt.ddt class TestProposalEmail(TestCase): def setUp(self): super(TestProposalEmail, self).setUp() self.api = Api() self.client.get("/login") @ddt.data(True, False) def test_email_presentation(self, is_admin): person = factories.PersonFactory() self.api.set_user(person=person) with mock.patch("ggrc.rbac.permissions.is_admin", return_value=is_admin): resp = self.client.get("/_notifications/show_fast_digest") if is_admin: self.assert200(resp) else: self.assert403(resp) def test_email_sending(self): role_1 = factories.AccessControlRoleFactory(object_type="Program", notify_about_proposal=True) role_2 = factories.AccessControlRoleFactory(object_type="Program", notify_about_proposal=True) role_3 = factories.AccessControlRoleFactory(object_type="Program", notify_about_proposal=False) with factories.single_commit(): program = factories.ProgramFactory() person_1 = factories.PersonFactory() person_2 = factories.PersonFactory() person_3 = factories.PersonFactory() factories.PersonFactory() factories.AccessControlPersonFactory( ac_list=program.acr_acl_map[role_1], person=person_1 ) factories.AccessControlPersonFactory( ac_list=program.acr_acl_map[role_1], person=person_3 ) factories.AccessControlPersonFactory( ac_list=program.acr_acl_map[role_2], person=person_3 ) factories.AccessControlPersonFactory( ac_list=program.acr_acl_map[role_3], person=person_2 ) proposal_1 = factories.ProposalFactory( instance=program, content={ "fields": {"title": "a"}, "access_control_list": {}, "custom_attribute_values": {}, "mapping_fields": {}, "mapping_list_fields": {}, }, agenda="agenda 1") proposal_2 = factories.ProposalFactory( instance=program, content={ "fields": {"title": "b"}, "access_control_list": {}, "custom_attribute_values": {}, "mapping_fields": {}, "mapping_list_fields": {}, }, agenda="agenda 2") self.assertIsNone(proposal_1.proposed_notified_datetime) self.assertIsNone(proposal_2.proposed_notified_datetime) with mock.patch("ggrc.notifications.common.send_email") as send_email_mock: with mock.patch.object(fast_digest.DIGEST_TMPL, "render") as bodybuilder_mock: fast_digest.send_notification() self.assertIsNotNone(proposal_1.proposed_notified_datetime) self.assertIsNotNone(proposal_2.proposed_notified_datetime) self.assertEqual(2, len(bodybuilder_mock.call_args_list)) self.assertEqual(2, len(send_email_mock.call_args_list)) self.assertListEqual( sorted([person_1.email, person_3.email]), sorted([a[1]["user_email"] for a in send_email_mock.call_args_list])) self.assertListEqual( [2] * 2, [len(a[1]["proposals"]) for a in bodybuilder_mock.call_args_list]) @ddt.data( 'Program Managers', 'Program Editors', 'Primary Contacts' ) def test_email_proposal_program(self, role_name): from ggrc.models import all_models role_1 = all_models.AccessControlRole.query.filter( all_models.AccessControlRole.name == role_name, all_models.AccessControlRole.object_type == 'Program', ).one() with factories.single_commit(): program = factories.ProgramFactory() person_1 = factories.PersonFactory() factories.AccessControlPersonFactory( ac_list=program.acr_acl_map[role_1], person=person_1 ) proposal_1 = factories.ProposalFactory( instance=program, content={ "fields": {"title": "a"}, "access_control_list": {}, "custom_attribute_values": {}, "mapping_fields": {}, "mapping_list_fields": {}, }, agenda="agenda 1") self.assertIsNone(proposal_1.proposed_notified_datetime) with mock.patch("ggrc.notifications.common.send_email") as send_email_mock: with mock.patch.object(fast_digest.DIGEST_TMPL, "render") as bodybuilder_mock: fast_digest.send_notification() self.assertIsNotNone(proposal_1.proposed_notified_datetime) self.assertEqual(1, len(bodybuilder_mock.call_args_list)) self.assertEqual(1, len(send_email_mock.call_args_list)) self.assertEqual( [person_1.email], [a[1]["user_email"] for a in send_email_mock.call_args_list])
true
true
f72bbb6109eb7cd126564a721c3685fff15dd47b
1,919
py
Python
pyretrommo/gen/player_stats.py
snwhd/pyretrommo
fabb523d9b4385ed8a1ff0b2ac787cc5d88a23b7
[ "blessing" ]
1
2021-11-25T09:33:30.000Z
2021-11-25T09:33:30.000Z
pyretrommo/gen/player_stats.py
snwhd/pyretrommo
fabb523d9b4385ed8a1ff0b2ac787cc5d88a23b7
[ "blessing" ]
null
null
null
pyretrommo/gen/player_stats.py
snwhd/pyretrommo
fabb523d9b4385ed8a1ff0b2ac787cc5d88a23b7
[ "blessing" ]
null
null
null
#!/usr/bin/env python3 # this file is auto-generated by gen_from_wiki.py from __future__ import annotations from .player_class import PlayerClass from ..stats import Stats STATS_BY_PLAYER_CLASS = { PlayerClass.Cleric: [ Stats(*(0, 0, 0, 0, 0, 0, 0, 0)), Stats(*(17, 11, 8, 9, 12, 12, 10, 11)), Stats(*(23, 15, 9, 11, 15, 14, 12, 13)), Stats(*(29, 19, 11, 12, 17, 16, 14, 16)), Stats(*(35, 23, 12, 14, 20, 19, 16, 18)), Stats(*(40, 26, 14, 16, 22, 21, 18, 20)), Stats(*(46, 30, 16, 18, 25, 23, 20, 22)), Stats(*(52, 34, 17, 20, 27, 26, 22, 24)), Stats(*(58, 38, 19, 21, 30, 28, 23, 27)), Stats(*(63, 41, 20, 23, 32, 30, 25, 29)), Stats(*(69, 45, 22, 25, 35, 33, 27, 31)), ], PlayerClass.Warrior: [ Stats(*(0, 0, 0, 0, 0, 0, 0, 0)), Stats(*(17, 11, 8, 9, 12, 12, 10, 11)), Stats(*(23, 15, 9, 11, 15, 14, 12, 13)), Stats(*(29, 19, 11, 12, 17, 16, 14, 16)), Stats(*(35, 23, 12, 14, 20, 19, 16, 18)), Stats(*(40, 26, 14, 16, 22, 21, 18, 20)), Stats(*(46, 30, 16, 18, 25, 23, 20, 22)), Stats(*(52, 34, 17, 20, 27, 26, 22, 24)), Stats(*(58, 38, 19, 21, 30, 28, 23, 27)), Stats(*(63, 41, 20, 23, 32, 30, 25, 29)), Stats(*(69, 45, 22, 25, 35, 33, 27, 31)), ], PlayerClass.Wizard: [ Stats(*(0, 0, 0, 0, 0, 0, 0, 0)), Stats(*(17, 11, 8, 9, 12, 12, 10, 11)), Stats(*(23, 15, 9, 11, 15, 14, 12, 13)), Stats(*(29, 19, 11, 12, 17, 16, 14, 16)), Stats(*(35, 23, 12, 14, 20, 19, 16, 18)), Stats(*(40, 26, 14, 16, 22, 21, 18, 20)), Stats(*(46, 30, 16, 18, 25, 23, 20, 22)), Stats(*(52, 34, 17, 20, 27, 26, 22, 24)), Stats(*(58, 38, 19, 21, 30, 28, 23, 27)), Stats(*(63, 41, 20, 23, 32, 30, 25, 29)), Stats(*(69, 45, 22, 25, 35, 33, 27, 31)), ], }
39.163265
49
0.454924
from __future__ import annotations from .player_class import PlayerClass from ..stats import Stats STATS_BY_PLAYER_CLASS = { PlayerClass.Cleric: [ Stats(*(0, 0, 0, 0, 0, 0, 0, 0)), Stats(*(17, 11, 8, 9, 12, 12, 10, 11)), Stats(*(23, 15, 9, 11, 15, 14, 12, 13)), Stats(*(29, 19, 11, 12, 17, 16, 14, 16)), Stats(*(35, 23, 12, 14, 20, 19, 16, 18)), Stats(*(40, 26, 14, 16, 22, 21, 18, 20)), Stats(*(46, 30, 16, 18, 25, 23, 20, 22)), Stats(*(52, 34, 17, 20, 27, 26, 22, 24)), Stats(*(58, 38, 19, 21, 30, 28, 23, 27)), Stats(*(63, 41, 20, 23, 32, 30, 25, 29)), Stats(*(69, 45, 22, 25, 35, 33, 27, 31)), ], PlayerClass.Warrior: [ Stats(*(0, 0, 0, 0, 0, 0, 0, 0)), Stats(*(17, 11, 8, 9, 12, 12, 10, 11)), Stats(*(23, 15, 9, 11, 15, 14, 12, 13)), Stats(*(29, 19, 11, 12, 17, 16, 14, 16)), Stats(*(35, 23, 12, 14, 20, 19, 16, 18)), Stats(*(40, 26, 14, 16, 22, 21, 18, 20)), Stats(*(46, 30, 16, 18, 25, 23, 20, 22)), Stats(*(52, 34, 17, 20, 27, 26, 22, 24)), Stats(*(58, 38, 19, 21, 30, 28, 23, 27)), Stats(*(63, 41, 20, 23, 32, 30, 25, 29)), Stats(*(69, 45, 22, 25, 35, 33, 27, 31)), ], PlayerClass.Wizard: [ Stats(*(0, 0, 0, 0, 0, 0, 0, 0)), Stats(*(17, 11, 8, 9, 12, 12, 10, 11)), Stats(*(23, 15, 9, 11, 15, 14, 12, 13)), Stats(*(29, 19, 11, 12, 17, 16, 14, 16)), Stats(*(35, 23, 12, 14, 20, 19, 16, 18)), Stats(*(40, 26, 14, 16, 22, 21, 18, 20)), Stats(*(46, 30, 16, 18, 25, 23, 20, 22)), Stats(*(52, 34, 17, 20, 27, 26, 22, 24)), Stats(*(58, 38, 19, 21, 30, 28, 23, 27)), Stats(*(63, 41, 20, 23, 32, 30, 25, 29)), Stats(*(69, 45, 22, 25, 35, 33, 27, 31)), ], }
true
true
f72bbba8b340d6dadd4bd602a0a79cc67d8d633b
236
py
Python
src/silicium/scene.py
PH-KDX/silicium
813e8719a4ba381691d3d1b11ea5738bb2ee2d36
[ "MIT" ]
2
2021-12-12T12:06:46.000Z
2021-12-12T12:21:18.000Z
src/silicium/scene.py
PH-KDX/silicium
813e8719a4ba381691d3d1b11ea5738bb2ee2d36
[ "MIT" ]
1
2021-12-12T12:21:43.000Z
2021-12-12T22:49:46.000Z
src/silicium/scene.py
PH-KDX/silicium
813e8719a4ba381691d3d1b11ea5738bb2ee2d36
[ "MIT" ]
2
2021-12-12T15:13:54.000Z
2021-12-21T09:08:42.000Z
from dataclasses import dataclass from abc import ABC, abstractmethod from .builder import AbstractBuilder @dataclass class AbstractScene(ABC): builder: AbstractBuilder @abstractmethod def run(self) -> None: ...
16.857143
36
0.728814
from dataclasses import dataclass from abc import ABC, abstractmethod from .builder import AbstractBuilder @dataclass class AbstractScene(ABC): builder: AbstractBuilder @abstractmethod def run(self) -> None: ...
true
true
f72bbc0a917dfbe976b673ecf7b7fb9a01ec6ce3
1,391
py
Python
app/user/serializers.py
faridos/my_delivery_app_django
87b487a064b190bfb8e71ba40e6edb9ebc9bd817
[ "MIT" ]
null
null
null
app/user/serializers.py
faridos/my_delivery_app_django
87b487a064b190bfb8e71ba40e6edb9ebc9bd817
[ "MIT" ]
null
null
null
app/user/serializers.py
faridos/my_delivery_app_django
87b487a064b190bfb8e71ba40e6edb9ebc9bd817
[ "MIT" ]
null
null
null
from django.contrib.auth import get_user_model, authenticate from django.utils.translation import ugettext_lazy as _ from rest_framework import serializers class UserSerializer(serializers.ModelSerializer): """Serializer for the users object""" class Meta: model = get_user_model() fields = ('email', 'password', 'name') extra_kwargs = {'password': {'write_only': True, 'min_length': 5}} def create(self, validated_data): """Create a new user with encrypted password and return it""" return get_user_model().objects.create_user(**validated_data) class AuthTokenSerializer(serializers.Serializer): """Serializer for the user authentication object""" email = serializers.CharField() password = serializers.CharField( style={'input_type': 'password'}, trim_whitespace=False ) def validate(self, attrs): """Validate and authenticate the user""" email = attrs.get('email') password = attrs.get('password') user = authenticate( request=self.context.get('request'), username=email, password=password ) if not user: msg = _('Unable to authenticate with provided credentials') raise serializers.ValidationError(msg, code='authorization') attrs['user'] = user return attrs
33.119048
74
0.65133
from django.contrib.auth import get_user_model, authenticate from django.utils.translation import ugettext_lazy as _ from rest_framework import serializers class UserSerializer(serializers.ModelSerializer): class Meta: model = get_user_model() fields = ('email', 'password', 'name') extra_kwargs = {'password': {'write_only': True, 'min_length': 5}} def create(self, validated_data): return get_user_model().objects.create_user(**validated_data) class AuthTokenSerializer(serializers.Serializer): email = serializers.CharField() password = serializers.CharField( style={'input_type': 'password'}, trim_whitespace=False ) def validate(self, attrs): email = attrs.get('email') password = attrs.get('password') user = authenticate( request=self.context.get('request'), username=email, password=password ) if not user: msg = _('Unable to authenticate with provided credentials') raise serializers.ValidationError(msg, code='authorization') attrs['user'] = user return attrs
true
true
f72bbc4cec7a7d7ee13488d5aad10549c5740f87
171
py
Python
tests/model_control/detailed/transf_Anscombe/model_control_one_enabled_Anscombe_MovingAverage_Seasonal_MonthOfYear_ARX.py
jmabry/pyaf
afbc15a851a2445a7824bf255af612dc429265af
[ "BSD-3-Clause" ]
null
null
null
tests/model_control/detailed/transf_Anscombe/model_control_one_enabled_Anscombe_MovingAverage_Seasonal_MonthOfYear_ARX.py
jmabry/pyaf
afbc15a851a2445a7824bf255af612dc429265af
[ "BSD-3-Clause" ]
1
2019-11-30T23:39:38.000Z
2019-12-01T04:34:35.000Z
tests/model_control/detailed/transf_Anscombe/model_control_one_enabled_Anscombe_MovingAverage_Seasonal_MonthOfYear_ARX.py
jmabry/pyaf
afbc15a851a2445a7824bf255af612dc429265af
[ "BSD-3-Clause" ]
null
null
null
import pyaf.tests.model_control.test_ozone_custom_models_enabled as testmod testmod.build_model( ['Anscombe'] , ['MovingAverage'] , ['Seasonal_MonthOfYear'] , ['ARX'] );
42.75
93
0.766082
import pyaf.tests.model_control.test_ozone_custom_models_enabled as testmod testmod.build_model( ['Anscombe'] , ['MovingAverage'] , ['Seasonal_MonthOfYear'] , ['ARX'] );
true
true
f72bbca3b2e8a2f4ec524e851e80d4cf38f9ab9d
4,759
py
Python
David and Pooja/++Validating Linked Mods/Python-3.0/Lib/lib2to3/pgen2/driver.py
LinkedModernismProject/web_code
4cf6bf53d5c3249e52a75f0a3f57d106e31daf9e
[ "Apache-2.0" ]
1
2015-05-21T23:47:54.000Z
2015-05-21T23:47:54.000Z
front-end/testsuite-python-lib/Python-3.0/Lib/lib2to3/pgen2/driver.py
MalloyPower/parsing-python
b2bca5eed07ea2af7a2001cd4f63becdfb0570be
[ "MIT" ]
1
2015-10-29T20:51:31.000Z
2015-10-29T20:51:31.000Z
front-end/testsuite-python-lib/Python-3.0/Lib/lib2to3/pgen2/driver.py
MalloyPower/parsing-python
b2bca5eed07ea2af7a2001cd4f63becdfb0570be
[ "MIT" ]
1
2019-04-11T11:27:01.000Z
2019-04-11T11:27:01.000Z
# Copyright 2004-2005 Elemental Security, Inc. All Rights Reserved. # Licensed to PSF under a Contributor Agreement. # Modifications: # Copyright 2006 Google, Inc. All Rights Reserved. # Licensed to PSF under a Contributor Agreement. """Parser driver. This provides a high-level interface to parse a file into a syntax tree. """ __author__ = "Guido van Rossum <guido@python.org>" __all__ = ["Driver", "load_grammar"] # Python imports import os import logging import sys # Pgen imports from . import grammar, parse, token, tokenize, pgen class Driver(object): def __init__(self, grammar, convert=None, logger=None): self.grammar = grammar if logger is None: logger = logging.getLogger() self.logger = logger self.convert = convert def parse_tokens(self, tokens, debug=False): """Parse a series of tokens and return the syntax tree.""" # XXX Move the prefix computation into a wrapper around tokenize. p = parse.Parser(self.grammar, self.convert) p.setup() lineno = 1 column = 0 type = value = start = end = line_text = None prefix = "" for quintuple in tokens: type, value, start, end, line_text = quintuple if start != (lineno, column): assert (lineno, column) <= start, ((lineno, column), start) s_lineno, s_column = start if lineno < s_lineno: prefix += "\n" * (s_lineno - lineno) lineno = s_lineno column = 0 if column < s_column: prefix += line_text[column:s_column] column = s_column if type in (tokenize.COMMENT, tokenize.NL): prefix += value lineno, column = end if value.endswith("\n"): lineno += 1 column = 0 continue if type == token.OP: type = grammar.opmap[value] if debug: self.logger.debug("%s %r (prefix=%r)", token.tok_name[type], value, prefix) if p.addtoken(type, value, (prefix, start)): if debug: self.logger.debug("Stop.") break prefix = "" lineno, column = end if value.endswith("\n"): lineno += 1 column = 0 else: # We never broke out -- EOF is too soon (how can this happen???) raise parse.ParseError("incomplete input", t, v, x) return p.rootnode def parse_stream_raw(self, stream, debug=False): """Parse a stream and return the syntax tree.""" tokens = tokenize.generate_tokens(stream.readline) return self.parse_tokens(tokens, debug) def parse_stream(self, stream, debug=False): """Parse a stream and return the syntax tree.""" return self.parse_stream_raw(stream, debug) def parse_file(self, filename, debug=False): """Parse a file and return the syntax tree.""" stream = open(filename) try: return self.parse_stream(stream, debug) finally: stream.close() def parse_string(self, text, debug=False): """Parse a string and return the syntax tree.""" tokens = tokenize.generate_tokens(generate_lines(text).__next__) return self.parse_tokens(tokens, debug) def generate_lines(text): """Generator that behaves like readline without using StringIO.""" for line in text.splitlines(True): yield line while True: yield "" def load_grammar(gt="Grammar.txt", gp=None, save=True, force=False, logger=None): """Load the grammar (maybe from a pickle).""" if logger is None: logger = logging.getLogger() if gp is None: head, tail = os.path.splitext(gt) if tail == ".txt": tail = "" gp = head + tail + ".".join(map(str, sys.version_info)) + ".pickle" if force or not _newer(gp, gt): logger.info("Generating grammar tables from %s", gt) g = pgen.generate_grammar(gt) if save: logger.info("Writing grammar tables to %s", gp) try: g.dump(gp) except IOError as e: logger.info("Writing failed:"+str(e)) else: g = grammar.Grammar() g.load(gp) return g def _newer(a, b): """Inquire whether file a was written since file b.""" if not os.path.exists(a): return False if not os.path.exists(b): return True return os.path.getmtime(a) >= os.path.getmtime(b)
32.59589
76
0.562093
__author__ = "Guido van Rossum <guido@python.org>" __all__ = ["Driver", "load_grammar"] import os import logging import sys from . import grammar, parse, token, tokenize, pgen class Driver(object): def __init__(self, grammar, convert=None, logger=None): self.grammar = grammar if logger is None: logger = logging.getLogger() self.logger = logger self.convert = convert def parse_tokens(self, tokens, debug=False): p = parse.Parser(self.grammar, self.convert) p.setup() lineno = 1 column = 0 type = value = start = end = line_text = None prefix = "" for quintuple in tokens: type, value, start, end, line_text = quintuple if start != (lineno, column): assert (lineno, column) <= start, ((lineno, column), start) s_lineno, s_column = start if lineno < s_lineno: prefix += "\n" * (s_lineno - lineno) lineno = s_lineno column = 0 if column < s_column: prefix += line_text[column:s_column] column = s_column if type in (tokenize.COMMENT, tokenize.NL): prefix += value lineno, column = end if value.endswith("\n"): lineno += 1 column = 0 continue if type == token.OP: type = grammar.opmap[value] if debug: self.logger.debug("%s %r (prefix=%r)", token.tok_name[type], value, prefix) if p.addtoken(type, value, (prefix, start)): if debug: self.logger.debug("Stop.") break prefix = "" lineno, column = end if value.endswith("\n"): lineno += 1 column = 0 else: raise parse.ParseError("incomplete input", t, v, x) return p.rootnode def parse_stream_raw(self, stream, debug=False): tokens = tokenize.generate_tokens(stream.readline) return self.parse_tokens(tokens, debug) def parse_stream(self, stream, debug=False): return self.parse_stream_raw(stream, debug) def parse_file(self, filename, debug=False): stream = open(filename) try: return self.parse_stream(stream, debug) finally: stream.close() def parse_string(self, text, debug=False): tokens = tokenize.generate_tokens(generate_lines(text).__next__) return self.parse_tokens(tokens, debug) def generate_lines(text): for line in text.splitlines(True): yield line while True: yield "" def load_grammar(gt="Grammar.txt", gp=None, save=True, force=False, logger=None): if logger is None: logger = logging.getLogger() if gp is None: head, tail = os.path.splitext(gt) if tail == ".txt": tail = "" gp = head + tail + ".".join(map(str, sys.version_info)) + ".pickle" if force or not _newer(gp, gt): logger.info("Generating grammar tables from %s", gt) g = pgen.generate_grammar(gt) if save: logger.info("Writing grammar tables to %s", gp) try: g.dump(gp) except IOError as e: logger.info("Writing failed:"+str(e)) else: g = grammar.Grammar() g.load(gp) return g def _newer(a, b): if not os.path.exists(a): return False if not os.path.exists(b): return True return os.path.getmtime(a) >= os.path.getmtime(b)
true
true
f72bbd8a0db5fae809ca9c1b2443d5383f6ae83e
5,635
py
Python
sdk/python/pulumi_azure_native/devtestlab/v20180915/list_service_fabric_applicable_schedules.py
pulumi-bot/pulumi-azure-native
f7b9490b5211544318e455e5cceafe47b628e12c
[ "Apache-2.0" ]
null
null
null
sdk/python/pulumi_azure_native/devtestlab/v20180915/list_service_fabric_applicable_schedules.py
pulumi-bot/pulumi-azure-native
f7b9490b5211544318e455e5cceafe47b628e12c
[ "Apache-2.0" ]
null
null
null
sdk/python/pulumi_azure_native/devtestlab/v20180915/list_service_fabric_applicable_schedules.py
pulumi-bot/pulumi-azure-native
f7b9490b5211544318e455e5cceafe47b628e12c
[ "Apache-2.0" ]
null
null
null
# coding=utf-8 # *** WARNING: this file was generated by the Pulumi SDK Generator. *** # *** Do not edit by hand unless you're certain you know what you are doing! *** import warnings import pulumi import pulumi.runtime from typing import Any, Mapping, Optional, Sequence, Union from ... import _utilities, _tables from . import outputs __all__ = [ 'ListServiceFabricApplicableSchedulesResult', 'AwaitableListServiceFabricApplicableSchedulesResult', 'list_service_fabric_applicable_schedules', ] @pulumi.output_type class ListServiceFabricApplicableSchedulesResult: """ Schedules applicable to a virtual machine. The schedules may have been defined on a VM or on lab level. """ def __init__(__self__, id=None, lab_vms_shutdown=None, lab_vms_startup=None, location=None, name=None, tags=None, type=None): if id and not isinstance(id, str): raise TypeError("Expected argument 'id' to be a str") pulumi.set(__self__, "id", id) if lab_vms_shutdown and not isinstance(lab_vms_shutdown, dict): raise TypeError("Expected argument 'lab_vms_shutdown' to be a dict") pulumi.set(__self__, "lab_vms_shutdown", lab_vms_shutdown) if lab_vms_startup and not isinstance(lab_vms_startup, dict): raise TypeError("Expected argument 'lab_vms_startup' to be a dict") pulumi.set(__self__, "lab_vms_startup", lab_vms_startup) if location and not isinstance(location, str): raise TypeError("Expected argument 'location' to be a str") pulumi.set(__self__, "location", location) if name and not isinstance(name, str): raise TypeError("Expected argument 'name' to be a str") pulumi.set(__self__, "name", name) if tags and not isinstance(tags, dict): raise TypeError("Expected argument 'tags' to be a dict") pulumi.set(__self__, "tags", tags) if type and not isinstance(type, str): raise TypeError("Expected argument 'type' to be a str") pulumi.set(__self__, "type", type) @property @pulumi.getter def id(self) -> str: """ The identifier of the resource. """ return pulumi.get(self, "id") @property @pulumi.getter(name="labVmsShutdown") def lab_vms_shutdown(self) -> Optional['outputs.ScheduleResponse']: """ The auto-shutdown schedule, if one has been set at the lab or lab resource level. """ return pulumi.get(self, "lab_vms_shutdown") @property @pulumi.getter(name="labVmsStartup") def lab_vms_startup(self) -> Optional['outputs.ScheduleResponse']: """ The auto-startup schedule, if one has been set at the lab or lab resource level. """ return pulumi.get(self, "lab_vms_startup") @property @pulumi.getter def location(self) -> Optional[str]: """ The location of the resource. """ return pulumi.get(self, "location") @property @pulumi.getter def name(self) -> str: """ The name of the resource. """ return pulumi.get(self, "name") @property @pulumi.getter def tags(self) -> Optional[Mapping[str, str]]: """ The tags of the resource. """ return pulumi.get(self, "tags") @property @pulumi.getter def type(self) -> str: """ The type of the resource. """ return pulumi.get(self, "type") class AwaitableListServiceFabricApplicableSchedulesResult(ListServiceFabricApplicableSchedulesResult): # pylint: disable=using-constant-test def __await__(self): if False: yield self return ListServiceFabricApplicableSchedulesResult( id=self.id, lab_vms_shutdown=self.lab_vms_shutdown, lab_vms_startup=self.lab_vms_startup, location=self.location, name=self.name, tags=self.tags, type=self.type) def list_service_fabric_applicable_schedules(lab_name: Optional[str] = None, name: Optional[str] = None, resource_group_name: Optional[str] = None, user_name: Optional[str] = None, opts: Optional[pulumi.InvokeOptions] = None) -> AwaitableListServiceFabricApplicableSchedulesResult: """ Schedules applicable to a virtual machine. The schedules may have been defined on a VM or on lab level. :param str lab_name: The name of the lab. :param str name: The name of the service fabric. :param str resource_group_name: The name of the resource group. :param str user_name: The name of the user profile. """ __args__ = dict() __args__['labName'] = lab_name __args__['name'] = name __args__['resourceGroupName'] = resource_group_name __args__['userName'] = user_name if opts is None: opts = pulumi.InvokeOptions() if opts.version is None: opts.version = _utilities.get_version() __ret__ = pulumi.runtime.invoke('azure-native:devtestlab/v20180915:listServiceFabricApplicableSchedules', __args__, opts=opts, typ=ListServiceFabricApplicableSchedulesResult).value return AwaitableListServiceFabricApplicableSchedulesResult( id=__ret__.id, lab_vms_shutdown=__ret__.lab_vms_shutdown, lab_vms_startup=__ret__.lab_vms_startup, location=__ret__.location, name=__ret__.name, tags=__ret__.tags, type=__ret__.type)
37.317881
184
0.644898
import warnings import pulumi import pulumi.runtime from typing import Any, Mapping, Optional, Sequence, Union from ... import _utilities, _tables from . import outputs __all__ = [ 'ListServiceFabricApplicableSchedulesResult', 'AwaitableListServiceFabricApplicableSchedulesResult', 'list_service_fabric_applicable_schedules', ] @pulumi.output_type class ListServiceFabricApplicableSchedulesResult: def __init__(__self__, id=None, lab_vms_shutdown=None, lab_vms_startup=None, location=None, name=None, tags=None, type=None): if id and not isinstance(id, str): raise TypeError("Expected argument 'id' to be a str") pulumi.set(__self__, "id", id) if lab_vms_shutdown and not isinstance(lab_vms_shutdown, dict): raise TypeError("Expected argument 'lab_vms_shutdown' to be a dict") pulumi.set(__self__, "lab_vms_shutdown", lab_vms_shutdown) if lab_vms_startup and not isinstance(lab_vms_startup, dict): raise TypeError("Expected argument 'lab_vms_startup' to be a dict") pulumi.set(__self__, "lab_vms_startup", lab_vms_startup) if location and not isinstance(location, str): raise TypeError("Expected argument 'location' to be a str") pulumi.set(__self__, "location", location) if name and not isinstance(name, str): raise TypeError("Expected argument 'name' to be a str") pulumi.set(__self__, "name", name) if tags and not isinstance(tags, dict): raise TypeError("Expected argument 'tags' to be a dict") pulumi.set(__self__, "tags", tags) if type and not isinstance(type, str): raise TypeError("Expected argument 'type' to be a str") pulumi.set(__self__, "type", type) @property @pulumi.getter def id(self) -> str: return pulumi.get(self, "id") @property @pulumi.getter(name="labVmsShutdown") def lab_vms_shutdown(self) -> Optional['outputs.ScheduleResponse']: return pulumi.get(self, "lab_vms_shutdown") @property @pulumi.getter(name="labVmsStartup") def lab_vms_startup(self) -> Optional['outputs.ScheduleResponse']: return pulumi.get(self, "lab_vms_startup") @property @pulumi.getter def location(self) -> Optional[str]: return pulumi.get(self, "location") @property @pulumi.getter def name(self) -> str: return pulumi.get(self, "name") @property @pulumi.getter def tags(self) -> Optional[Mapping[str, str]]: return pulumi.get(self, "tags") @property @pulumi.getter def type(self) -> str: return pulumi.get(self, "type") class AwaitableListServiceFabricApplicableSchedulesResult(ListServiceFabricApplicableSchedulesResult): # pylint: disable=using-constant-test def __await__(self): if False: yield self return ListServiceFabricApplicableSchedulesResult( id=self.id, lab_vms_shutdown=self.lab_vms_shutdown, lab_vms_startup=self.lab_vms_startup, location=self.location, name=self.name, tags=self.tags, type=self.type) def list_service_fabric_applicable_schedules(lab_name: Optional[str] = None, name: Optional[str] = None, resource_group_name: Optional[str] = None, user_name: Optional[str] = None, opts: Optional[pulumi.InvokeOptions] = None) -> AwaitableListServiceFabricApplicableSchedulesResult: __args__ = dict() __args__['labName'] = lab_name __args__['name'] = name __args__['resourceGroupName'] = resource_group_name __args__['userName'] = user_name if opts is None: opts = pulumi.InvokeOptions() if opts.version is None: opts.version = _utilities.get_version() __ret__ = pulumi.runtime.invoke('azure-native:devtestlab/v20180915:listServiceFabricApplicableSchedules', __args__, opts=opts, typ=ListServiceFabricApplicableSchedulesResult).value return AwaitableListServiceFabricApplicableSchedulesResult( id=__ret__.id, lab_vms_shutdown=__ret__.lab_vms_shutdown, lab_vms_startup=__ret__.lab_vms_startup, location=__ret__.location, name=__ret__.name, tags=__ret__.tags, type=__ret__.type)
true
true
f72bbedeed16b94339a910792bc18059766dde94
5,337
py
Python
alacrity/core.py
OLeoghain/alacrity
d49453f5f998dbaf36006fe7ec6c6753cd5ef4c1
[ "MIT" ]
null
null
null
alacrity/core.py
OLeoghain/alacrity
d49453f5f998dbaf36006fe7ec6c6753cd5ef4c1
[ "MIT" ]
null
null
null
alacrity/core.py
OLeoghain/alacrity
d49453f5f998dbaf36006fe7ec6c6753cd5ef4c1
[ "MIT" ]
null
null
null
#!/bin/python import importlib import logging import os import sys import argparse import shutil from clint.textui import colored try: from alacrity import lib except ImportError: lib = importlib.import_module('lib', '../alacrity') def main(): """ Entry point for the package, alacrity.exe in win and alacrity in linux :return: None """ # Start the process try: from alacrity import version except ImportError: version = importlib.import_module('version', '../alacrity') # Get version information from version.py v = version.version() parser = argparse.ArgumentParser(description="Alacrity : " "Quickstart your Python " "package from a terminal") parser.add_argument('--make', action='store_true', help="Rebuild " "persistence") parser.add_argument('--debug', action='store_true', help="Display verbose " "debug messages") parser.add_argument('--version', action="version", version=v) parser.add_argument('package_name') args = parser.parse_args() if args.make: lib.rebuild_persistence() if not args.package_name: logging.error(" package_name is a required argument") sys.exit() # Initialize logging depending on debug mode if args.debug: logging.basicConfig(level=logging.DEBUG) else: logging.basicConfig(level=logging.CRITICAL) # Initialise status dictionary status = { 'structure_created': False, 'gitignore_created': False, 'setup_created': False, 'license_created': False, 'manifest_created': False, 'readme_created': False, 'requirements_created': False, 'tests_created': False, 'git_initialized': False, 'venv_created': False, 'sphinx_created': False } try: try: package_name = args.package_name # Check if the package already exists logging.debug("[-] Checking if the package already exists") check_is_file = os.path.isfile( "{0}/{0}/__init__.py".format(package_name)) # Check for clean_make if os.path.isdir(package_name) or check_is_file: logging.debug("[-] Package already exists, " "launching clean make prompt") print(colored.red("[!] A package by that name already exists, " "destroy and clean make? (y/n) : "), end="") choice = input() logging.debug("[-] Choice prompt input : {}".format(choice)) if choice == 'y': logging.debug("[-] Removing existing package") lib.remove_package(package_name) elif choice == 'n': logging.debug("[-] Clean make cancelled") print(colored.red("[!] Please pick a different package " "name, aborting.")) sys.exit() else: logging.error(colored.red(" Invalid choice")) print(colored.red("[!] Invalid choice, aborting")) sys.exit() # Create the initial structure logging.debug("[-] Creating package structure") lib.create_package_structure(package_name, status) # Create starter files logging.debug("[-] Creating starter files in package") author, version = lib.create_starter_files(package_name, status) # Create tests directory logging.debug("[-] Creating tests package in structure") lib.create_tests_package(package_name, status) # Initialize git if required and available logging.debug("[-] Launching git init submodule") lib.git_init(package_name, status) # Initialize venv if required and available logging.debug("[-] Launching venv init submodule") lib.venv_init(package_name, status) # Initialize sphinx docs if required and available logging.debug("[-] Launching sphinx init submodule") lib.sphinx_init(package_name, author, version, status) logging.debug("[-] Launching status reporter submodule") lib.report_status(status) print(colored.green("[|]")) print(colored.green("[*] Package {} was created " "successfully.".format(package_name))) except EOFError: # Catch error thrown by clint.main print(colored.yellow("\n[!] Ctrl+C : Aborting package creation.")) sys.exit() except KeyboardInterrupt: print(colored.yellow("\n[!] Ctrl+C : Aborting package creation.")) # Rollback changes if os.path.isdir(args.package_name): logging.debug("[-] Rolling back committed changes, deleting files") shutil.rmtree(args.package_name) logging.debug("[-] alacrity:ROOT :: quiting") sys.exit() if __name__ == '__main__': main()
36.554795
79
0.564737
import importlib import logging import os import sys import argparse import shutil from clint.textui import colored try: from alacrity import lib except ImportError: lib = importlib.import_module('lib', '../alacrity') def main(): try: from alacrity import version except ImportError: version = importlib.import_module('version', '../alacrity') v = version.version() parser = argparse.ArgumentParser(description="Alacrity : " "Quickstart your Python " "package from a terminal") parser.add_argument('--make', action='store_true', help="Rebuild " "persistence") parser.add_argument('--debug', action='store_true', help="Display verbose " "debug messages") parser.add_argument('--version', action="version", version=v) parser.add_argument('package_name') args = parser.parse_args() if args.make: lib.rebuild_persistence() if not args.package_name: logging.error(" package_name is a required argument") sys.exit() if args.debug: logging.basicConfig(level=logging.DEBUG) else: logging.basicConfig(level=logging.CRITICAL) status = { 'structure_created': False, 'gitignore_created': False, 'setup_created': False, 'license_created': False, 'manifest_created': False, 'readme_created': False, 'requirements_created': False, 'tests_created': False, 'git_initialized': False, 'venv_created': False, 'sphinx_created': False } try: try: package_name = args.package_name logging.debug("[-] Checking if the package already exists") check_is_file = os.path.isfile( "{0}/{0}/__init__.py".format(package_name)) if os.path.isdir(package_name) or check_is_file: logging.debug("[-] Package already exists, " "launching clean make prompt") print(colored.red("[!] A package by that name already exists, " "destroy and clean make? (y/n) : "), end="") choice = input() logging.debug("[-] Choice prompt input : {}".format(choice)) if choice == 'y': logging.debug("[-] Removing existing package") lib.remove_package(package_name) elif choice == 'n': logging.debug("[-] Clean make cancelled") print(colored.red("[!] Please pick a different package " "name, aborting.")) sys.exit() else: logging.error(colored.red(" Invalid choice")) print(colored.red("[!] Invalid choice, aborting")) sys.exit() logging.debug("[-] Creating package structure") lib.create_package_structure(package_name, status) logging.debug("[-] Creating starter files in package") author, version = lib.create_starter_files(package_name, status) logging.debug("[-] Creating tests package in structure") lib.create_tests_package(package_name, status) logging.debug("[-] Launching git init submodule") lib.git_init(package_name, status) logging.debug("[-] Launching venv init submodule") lib.venv_init(package_name, status) logging.debug("[-] Launching sphinx init submodule") lib.sphinx_init(package_name, author, version, status) logging.debug("[-] Launching status reporter submodule") lib.report_status(status) print(colored.green("[|]")) print(colored.green("[*] Package {} was created " "successfully.".format(package_name))) except EOFError: print(colored.yellow("\n[!] Ctrl+C : Aborting package creation.")) sys.exit() except KeyboardInterrupt: print(colored.yellow("\n[!] Ctrl+C : Aborting package creation.")) if os.path.isdir(args.package_name): logging.debug("[-] Rolling back committed changes, deleting files") shutil.rmtree(args.package_name) logging.debug("[-] alacrity:ROOT :: quiting") sys.exit() if __name__ == '__main__': main()
true
true
f72bbf8d0fa245c9c5a1214dc4f10dd0bf1f40bc
56,360
py
Python
release/stubs.min/System/Windows/Forms/__init___parts/NumericUpDown.py
htlcnn/ironpython-stubs
780d829e2104b2789d5f4d6f32b0ec9f2930ca03
[ "MIT" ]
182
2017-06-27T02:26:15.000Z
2022-03-30T18:53:43.000Z
release/stubs.min/System/Windows/Forms/__init___parts/NumericUpDown.py
htlcnn/ironpython-stubs
780d829e2104b2789d5f4d6f32b0ec9f2930ca03
[ "MIT" ]
28
2017-06-27T13:38:23.000Z
2022-03-15T11:19:44.000Z
release/stubs.min/System/Windows/Forms/__init___parts/NumericUpDown.py
htlcnn/ironpython-stubs
780d829e2104b2789d5f4d6f32b0ec9f2930ca03
[ "MIT" ]
67
2017-06-28T09:43:59.000Z
2022-03-20T21:17:10.000Z
class NumericUpDown(UpDownBase,IComponent,IDisposable,IOleControl,IOleObject,IOleInPlaceObject,IOleInPlaceActiveObject,IOleWindow,IViewObject,IViewObject2,IPersist,IPersistStreamInit,IPersistPropertyBag,IPersistStorage,IQuickActivate,ISupportOleDropSource,IDropTarget,ISynchronizeInvoke,IWin32Window,IArrangedElement,IBindableComponent,IContainerControl,ISupportInitialize): """ Represents a Windows spin box (also known as an up-down control) that displays numeric values. NumericUpDown() """ def AccessibilityNotifyClients(self,*args): """ AccessibilityNotifyClients(self: Control,accEvent: AccessibleEvents,objectID: int,childID: int) Notifies the accessibility client applications of the specified System.Windows.Forms.AccessibleEvents for the specified child control . accEvent: The System.Windows.Forms.AccessibleEvents to notify the accessibility client applications of. objectID: The identifier of the System.Windows.Forms.AccessibleObject. childID: The child System.Windows.Forms.Control to notify of the accessible event. AccessibilityNotifyClients(self: Control,accEvent: AccessibleEvents,childID: int) Notifies the accessibility client applications of the specified System.Windows.Forms.AccessibleEvents for the specified child control. accEvent: The System.Windows.Forms.AccessibleEvents to notify the accessibility client applications of. childID: The child System.Windows.Forms.Control to notify of the accessible event. """ pass def AdjustFormScrollbars(self,*args): """ AdjustFormScrollbars(self: ContainerControl,displayScrollbars: bool) displayScrollbars: true to show the scroll bars; otherwise,false. """ pass def BeginInit(self): """ BeginInit(self: NumericUpDown) Begins the initialization of a System.Windows.Forms.NumericUpDown control that is used on a form or used by another component. The initialization occurs at run time. """ pass def CreateAccessibilityInstance(self,*args): """ CreateAccessibilityInstance(self: NumericUpDown) -> AccessibleObject Returns: A new System.Windows.Forms.AccessibleObject for the control. """ pass def CreateControlsInstance(self,*args): """ CreateControlsInstance(self: Control) -> ControlCollection Creates a new instance of the control collection for the control. Returns: A new instance of System.Windows.Forms.Control.ControlCollection assigned to the control. """ pass def CreateHandle(self,*args): """ CreateHandle(self: Control) Creates a handle for the control. """ pass def DefWndProc(self,*args): """ DefWndProc(self: Control,m: Message) -> Message Sends the specified message to the default window procedure. m: The Windows System.Windows.Forms.Message to process. """ pass def DestroyHandle(self,*args): """ DestroyHandle(self: Control) Destroys the handle associated with the control. """ pass def Dispose(self): """ Dispose(self: ContainerControl,disposing: bool) disposing: true to release both managed and unmanaged resources; false to release only unmanaged resources. """ pass def DownButton(self): """ DownButton(self: NumericUpDown) Decrements the value of the spin box (also known as an up-down control). """ pass def EndInit(self): """ EndInit(self: NumericUpDown) Ends the initialization of a System.Windows.Forms.NumericUpDown control that is used on a form or used by another component. The initialization occurs at run time. """ pass def GetAccessibilityObjectById(self,*args): """ GetAccessibilityObjectById(self: Control,objectId: int) -> AccessibleObject Retrieves the specified System.Windows.Forms.AccessibleObject. objectId: An Int32 that identifies the System.Windows.Forms.AccessibleObject to retrieve. Returns: An System.Windows.Forms.AccessibleObject. """ pass def GetAutoSizeMode(self,*args): """ GetAutoSizeMode(self: Control) -> AutoSizeMode Retrieves a value indicating how a control will behave when its System.Windows.Forms.Control.AutoSize property is enabled. Returns: One of the System.Windows.Forms.AutoSizeMode values. """ pass def GetScaledBounds(self,*args): """ GetScaledBounds(self: Control,bounds: Rectangle,factor: SizeF,specified: BoundsSpecified) -> Rectangle Retrieves the bounds within which the control is scaled. bounds: A System.Drawing.Rectangle that specifies the area for which to retrieve the display bounds. factor: The height and width of the control's bounds. specified: One of the values of System.Windows.Forms.BoundsSpecified that specifies the bounds of the control to use when defining its size and position. Returns: A System.Drawing.Rectangle representing the bounds within which the control is scaled. """ pass def GetScrollState(self,*args): """ GetScrollState(self: ScrollableControl,bit: int) -> bool Determines whether the specified flag has been set. bit: The flag to check. Returns: true if the specified flag has been set; otherwise,false. """ pass def GetService(self,*args): """ GetService(self: Component,service: Type) -> object Returns an object that represents a service provided by the System.ComponentModel.Component or by its System.ComponentModel.Container. service: A service provided by the System.ComponentModel.Component. Returns: An System.Object that represents a service provided by the System.ComponentModel.Component,or null if the System.ComponentModel.Component does not provide the specified service. """ pass def GetStyle(self,*args): """ GetStyle(self: Control,flag: ControlStyles) -> bool Retrieves the value of the specified control style bit for the control. flag: The System.Windows.Forms.ControlStyles bit to return the value from. Returns: true if the specified control style bit is set to true; otherwise,false. """ pass def GetTopLevel(self,*args): """ GetTopLevel(self: Control) -> bool Determines if the control is a top-level control. Returns: true if the control is a top-level control; otherwise,false. """ pass def InitLayout(self,*args): """ InitLayout(self: Control) Called after the control has been added to another container. """ pass def InvokeGotFocus(self,*args): """ InvokeGotFocus(self: Control,toInvoke: Control,e: EventArgs) Raises the System.Windows.Forms.Control.GotFocus event for the specified control. toInvoke: The System.Windows.Forms.Control to assign the event to. e: An System.EventArgs that contains the event data. """ pass def InvokeLostFocus(self,*args): """ InvokeLostFocus(self: Control,toInvoke: Control,e: EventArgs) Raises the System.Windows.Forms.Control.LostFocus event for the specified control. toInvoke: The System.Windows.Forms.Control to assign the event to. e: An System.EventArgs that contains the event data. """ pass def InvokeOnClick(self,*args): """ InvokeOnClick(self: Control,toInvoke: Control,e: EventArgs) Raises the System.Windows.Forms.Control.Click event for the specified control. toInvoke: The System.Windows.Forms.Control to assign the System.Windows.Forms.Control.Click event to. e: An System.EventArgs that contains the event data. """ pass def InvokePaint(self,*args): """ InvokePaint(self: Control,c: Control,e: PaintEventArgs) Raises the System.Windows.Forms.Control.Paint event for the specified control. c: The System.Windows.Forms.Control to assign the System.Windows.Forms.Control.Paint event to. e: An System.Windows.Forms.PaintEventArgs that contains the event data. """ pass def InvokePaintBackground(self,*args): """ InvokePaintBackground(self: Control,c: Control,e: PaintEventArgs) Raises the PaintBackground event for the specified control. c: The System.Windows.Forms.Control to assign the System.Windows.Forms.Control.Paint event to. e: An System.Windows.Forms.PaintEventArgs that contains the event data. """ pass def IsInputChar(self,*args): """ IsInputChar(self: Control,charCode: Char) -> bool Determines if a character is an input character that the control recognizes. charCode: The character to test. Returns: true if the character should be sent directly to the control and not preprocessed; otherwise, false. """ pass def IsInputKey(self,*args): """ IsInputKey(self: Control,keyData: Keys) -> bool Determines whether the specified key is a regular input key or a special key that requires preprocessing. keyData: One of the System.Windows.Forms.Keys values. Returns: true if the specified key is a regular input key; otherwise,false. """ pass def MemberwiseClone(self,*args): """ MemberwiseClone(self: MarshalByRefObject,cloneIdentity: bool) -> MarshalByRefObject Creates a shallow copy of the current System.MarshalByRefObject object. cloneIdentity: false to delete the current System.MarshalByRefObject object's identity,which will cause the object to be assigned a new identity when it is marshaled across a remoting boundary. A value of false is usually appropriate. true to copy the current System.MarshalByRefObject object's identity to its clone,which will cause remoting client calls to be routed to the remote server object. Returns: A shallow copy of the current System.MarshalByRefObject object. MemberwiseClone(self: object) -> object Creates a shallow copy of the current System.Object. Returns: A shallow copy of the current System.Object. """ pass def NotifyInvalidate(self,*args): """ NotifyInvalidate(self: Control,invalidatedArea: Rectangle) Raises the System.Windows.Forms.Control.Invalidated event with a specified region of the control to invalidate. invalidatedArea: A System.Drawing.Rectangle representing the area to invalidate. """ pass def OnAutoSizeChanged(self,*args): """ OnAutoSizeChanged(self: Control,e: EventArgs) Raises the System.Windows.Forms.Control.AutoSizeChanged event. e: An System.EventArgs that contains the event data. """ pass def OnAutoValidateChanged(self,*args): """ OnAutoValidateChanged(self: ContainerControl,e: EventArgs) Raises the System.Windows.Forms.ContainerControl.AutoValidateChanged event. e: An System.EventArgs that contains the event data. """ pass def OnBackColorChanged(self,*args): """ OnBackColorChanged(self: Control,e: EventArgs) Raises the System.Windows.Forms.Control.BackColorChanged event. e: An System.EventArgs that contains the event data. """ pass def OnBackgroundImageChanged(self,*args): """ OnBackgroundImageChanged(self: Control,e: EventArgs) Raises the System.Windows.Forms.Control.BackgroundImageChanged event. e: An System.EventArgs that contains the event data. """ pass def OnBackgroundImageLayoutChanged(self,*args): """ OnBackgroundImageLayoutChanged(self: Control,e: EventArgs) Raises the System.Windows.Forms.Control.BackgroundImageLayoutChanged event. e: An System.EventArgs that contains the event data. """ pass def OnBindingContextChanged(self,*args): """ OnBindingContextChanged(self: Control,e: EventArgs) Raises the System.Windows.Forms.Control.BindingContextChanged event. e: An System.EventArgs that contains the event data. """ pass def OnCausesValidationChanged(self,*args): """ OnCausesValidationChanged(self: Control,e: EventArgs) Raises the System.Windows.Forms.Control.CausesValidationChanged event. e: An System.EventArgs that contains the event data. """ pass def OnChanged(self,*args): """ OnChanged(self: UpDownBase,source: object,e: EventArgs) When overridden in a derived class,raises the Changed event. source: The source of the event. e: An System.EventArgs that contains the event data. """ pass def OnChangeUICues(self,*args): """ OnChangeUICues(self: Control,e: UICuesEventArgs) Raises the System.Windows.Forms.Control.ChangeUICues event. e: A System.Windows.Forms.UICuesEventArgs that contains the event data. """ pass def OnClick(self,*args): """ OnClick(self: Control,e: EventArgs) Raises the System.Windows.Forms.Control.Click event. e: An System.EventArgs that contains the event data. """ pass def OnClientSizeChanged(self,*args): """ OnClientSizeChanged(self: Control,e: EventArgs) Raises the System.Windows.Forms.Control.ClientSizeChanged event. e: An System.EventArgs that contains the event data. """ pass def OnContextMenuChanged(self,*args): """ OnContextMenuChanged(self: Control,e: EventArgs) Raises the System.Windows.Forms.Control.ContextMenuChanged event. e: An System.EventArgs that contains the event data. """ pass def OnContextMenuStripChanged(self,*args): """ OnContextMenuStripChanged(self: Control,e: EventArgs) Raises the System.Windows.Forms.Control.ContextMenuStripChanged event. e: An System.EventArgs that contains the event data. """ pass def OnControlAdded(self,*args): """ OnControlAdded(self: Control,e: ControlEventArgs) Raises the System.Windows.Forms.Control.ControlAdded event. e: A System.Windows.Forms.ControlEventArgs that contains the event data. """ pass def OnControlRemoved(self,*args): """ OnControlRemoved(self: Control,e: ControlEventArgs) Raises the System.Windows.Forms.Control.ControlRemoved event. e: A System.Windows.Forms.ControlEventArgs that contains the event data. """ pass def OnCreateControl(self,*args): """ OnCreateControl(self: ContainerControl) """ pass def OnCursorChanged(self,*args): """ OnCursorChanged(self: Control,e: EventArgs) Raises the System.Windows.Forms.Control.CursorChanged event. e: An System.EventArgs that contains the event data. """ pass def OnDockChanged(self,*args): """ OnDockChanged(self: Control,e: EventArgs) Raises the System.Windows.Forms.Control.DockChanged event. e: An System.EventArgs that contains the event data. """ pass def OnDoubleClick(self,*args): """ OnDoubleClick(self: Control,e: EventArgs) Raises the System.Windows.Forms.Control.DoubleClick event. e: An System.EventArgs that contains the event data. """ pass def OnDpiChangedAfterParent(self,*args): """ OnDpiChangedAfterParent(self: Control,e: EventArgs) """ pass def OnDpiChangedBeforeParent(self,*args): """ OnDpiChangedBeforeParent(self: Control,e: EventArgs) """ pass def OnDragDrop(self,*args): """ OnDragDrop(self: Control,drgevent: DragEventArgs) Raises the System.Windows.Forms.Control.DragDrop event. drgevent: A System.Windows.Forms.DragEventArgs that contains the event data. """ pass def OnDragEnter(self,*args): """ OnDragEnter(self: Control,drgevent: DragEventArgs) Raises the System.Windows.Forms.Control.DragEnter event. drgevent: A System.Windows.Forms.DragEventArgs that contains the event data. """ pass def OnDragLeave(self,*args): """ OnDragLeave(self: Control,e: EventArgs) Raises the System.Windows.Forms.Control.DragLeave event. e: An System.EventArgs that contains the event data. """ pass def OnDragOver(self,*args): """ OnDragOver(self: Control,drgevent: DragEventArgs) Raises the System.Windows.Forms.Control.DragOver event. drgevent: A System.Windows.Forms.DragEventArgs that contains the event data. """ pass def OnEnabledChanged(self,*args): """ OnEnabledChanged(self: Control,e: EventArgs) Raises the System.Windows.Forms.Control.EnabledChanged event. e: An System.EventArgs that contains the event data. """ pass def OnEnter(self,*args): """ OnEnter(self: Control,e: EventArgs) Raises the System.Windows.Forms.Control.Enter event. e: An System.EventArgs that contains the event data. """ pass def OnFontChanged(self,*args): """ OnFontChanged(self: UpDownBase,e: EventArgs) Raises the System.Windows.Forms.Control.FontChanged event. e: An System.EventArgs that contains the event data. """ pass def OnForeColorChanged(self,*args): """ OnForeColorChanged(self: Control,e: EventArgs) Raises the System.Windows.Forms.Control.ForeColorChanged event. e: An System.EventArgs that contains the event data. """ pass def OnGiveFeedback(self,*args): """ OnGiveFeedback(self: Control,gfbevent: GiveFeedbackEventArgs) Raises the System.Windows.Forms.Control.GiveFeedback event. gfbevent: A System.Windows.Forms.GiveFeedbackEventArgs that contains the event data. """ pass def OnGotFocus(self,*args): """ OnGotFocus(self: Control,e: EventArgs) Raises the System.Windows.Forms.Control.GotFocus event. e: An System.EventArgs that contains the event data. """ pass def OnHandleCreated(self,*args): """ OnHandleCreated(self: UpDownBase,e: EventArgs) Raises the System.Windows.Forms.Control.HandleCreated event. e: An System.EventArgs that contains the event data. """ pass def OnHandleDestroyed(self,*args): """ OnHandleDestroyed(self: UpDownBase,e: EventArgs) Raises the System.Windows.Forms.Control.HandleDestroyed event. e: An System.EventArgs that contains the event data. """ pass def OnHelpRequested(self,*args): """ OnHelpRequested(self: Control,hevent: HelpEventArgs) Raises the System.Windows.Forms.Control.HelpRequested event. hevent: A System.Windows.Forms.HelpEventArgs that contains the event data. """ pass def OnImeModeChanged(self,*args): """ OnImeModeChanged(self: Control,e: EventArgs) Raises the System.Windows.Forms.Control.ImeModeChanged event. e: An System.EventArgs that contains the event data. """ pass def OnInvalidated(self,*args): """ OnInvalidated(self: Control,e: InvalidateEventArgs) Raises the System.Windows.Forms.Control.Invalidated event. e: An System.Windows.Forms.InvalidateEventArgs that contains the event data. """ pass def OnKeyDown(self,*args): """ OnKeyDown(self: NumericUpDown,e: KeyEventArgs) Raises the System.Windows.Forms.Control.KeyDown event. e: A System.Windows.Forms.KeyEventArgs that contains the event data. """ pass def OnKeyPress(self,*args): """ OnKeyPress(self: Control,e: KeyPressEventArgs) Raises the System.Windows.Forms.Control.KeyPress event. e: A System.Windows.Forms.KeyPressEventArgs that contains the event data. """ pass def OnKeyUp(self,*args): """ OnKeyUp(self: NumericUpDown,e: KeyEventArgs) Raises the System.Windows.Forms.Control.KeyUp event. e: A System.Windows.Forms.KeyEventArgs that contains the event data. """ pass def OnLayout(self,*args): """ OnLayout(self: UpDownBase,e: LayoutEventArgs) Raises the System.Windows.Forms.Control.Layout event. e: A System.Windows.Forms.LayoutEventArgs that contains the event data. """ pass def OnLeave(self,*args): """ OnLeave(self: Control,e: EventArgs) Raises the System.Windows.Forms.Control.Leave event. e: An System.EventArgs that contains the event data. """ pass def OnLocationChanged(self,*args): """ OnLocationChanged(self: Control,e: EventArgs) Raises the System.Windows.Forms.Control.LocationChanged event. e: An System.EventArgs that contains the event data. """ pass def OnLostFocus(self,*args): """ OnLostFocus(self: NumericUpDown,e: EventArgs) Raises the System.Windows.Forms.Control.LostFocus event. e: An System.EventArgs that contains the event data. """ pass def OnMarginChanged(self,*args): """ OnMarginChanged(self: Control,e: EventArgs) Raises the System.Windows.Forms.Control.MarginChanged event. e: A System.EventArgs that contains the event data. """ pass def OnMouseCaptureChanged(self,*args): """ OnMouseCaptureChanged(self: Control,e: EventArgs) Raises the System.Windows.Forms.Control.MouseCaptureChanged event. e: An System.EventArgs that contains the event data. """ pass def OnMouseClick(self,*args): """ OnMouseClick(self: Control,e: MouseEventArgs) Raises the System.Windows.Forms.Control.MouseClick event. e: An System.Windows.Forms.MouseEventArgs that contains the event data. """ pass def OnMouseDoubleClick(self,*args): """ OnMouseDoubleClick(self: Control,e: MouseEventArgs) Raises the System.Windows.Forms.Control.MouseDoubleClick event. e: An System.Windows.Forms.MouseEventArgs that contains the event data. """ pass def OnMouseDown(self,*args): """ OnMouseDown(self: UpDownBase,e: MouseEventArgs) Raises the System.Windows.Forms.Control.MouseDown event. e: A System.Windows.Forms.MouseEventArgs that contains the event data. """ pass def OnMouseEnter(self,*args): """ OnMouseEnter(self: Control,e: EventArgs) Raises the System.Windows.Forms.Control.MouseEnter event. e: An System.EventArgs that contains the event data. """ pass def OnMouseHover(self,*args): """ OnMouseHover(self: Control,e: EventArgs) Raises the System.Windows.Forms.Control.MouseHover event. e: An System.EventArgs that contains the event data. """ pass def OnMouseLeave(self,*args): """ OnMouseLeave(self: Control,e: EventArgs) Raises the System.Windows.Forms.Control.MouseLeave event. e: An System.EventArgs that contains the event data. """ pass def OnMouseMove(self,*args): """ OnMouseMove(self: Control,e: MouseEventArgs) Raises the System.Windows.Forms.Control.MouseMove event. e: A System.Windows.Forms.MouseEventArgs that contains the event data. """ pass def OnMouseUp(self,*args): """ OnMouseUp(self: UpDownBase,mevent: MouseEventArgs) Raises the System.Windows.Forms.Control.MouseUp event. mevent: A System.Windows.Forms.MouseEventArgs that contains the event data. """ pass def OnMouseWheel(self,*args): """ OnMouseWheel(self: UpDownBase,e: MouseEventArgs) Raises the System.Windows.Forms.Control.MouseWheel event. e: A System.Windows.Forms.MouseEventArgs that contains the event data. """ pass def OnMove(self,*args): """ OnMove(self: Control,e: EventArgs) Raises the System.Windows.Forms.Control.Move event. e: An System.EventArgs that contains the event data. """ pass def OnNotifyMessage(self,*args): """ OnNotifyMessage(self: Control,m: Message) Notifies the control of Windows messages. m: A System.Windows.Forms.Message that represents the Windows message. """ pass def OnPaddingChanged(self,*args): """ OnPaddingChanged(self: ScrollableControl,e: EventArgs) Raises the System.Windows.Forms.Control.PaddingChanged event. e: An System.EventArgs that contains the event data. """ pass def OnPaint(self,*args): """ OnPaint(self: UpDownBase,e: PaintEventArgs) Raises the System.Windows.Forms.Control.Paint event. e: A System.Windows.Forms.PaintEventArgs that contains the event data. """ pass def OnPaintBackground(self,*args): """ OnPaintBackground(self: ScrollableControl,e: PaintEventArgs) Paints the background of the control. e: A System.Windows.Forms.PaintEventArgs that contains the event data. """ pass def OnParentBackColorChanged(self,*args): """ OnParentBackColorChanged(self: Control,e: EventArgs) Raises the System.Windows.Forms.Control.BackColorChanged event when the System.Windows.Forms.Control.BackColor property value of the control's container changes. e: An System.EventArgs that contains the event data. """ pass def OnParentBackgroundImageChanged(self,*args): """ OnParentBackgroundImageChanged(self: Control,e: EventArgs) Raises the System.Windows.Forms.Control.BackgroundImageChanged event when the System.Windows.Forms.Control.BackgroundImage property value of the control's container changes. e: An System.EventArgs that contains the event data. """ pass def OnParentBindingContextChanged(self,*args): """ OnParentBindingContextChanged(self: Control,e: EventArgs) Raises the System.Windows.Forms.Control.BindingContextChanged event when the System.Windows.Forms.Control.BindingContext property value of the control's container changes. e: An System.EventArgs that contains the event data. """ pass def OnParentChanged(self,*args): """ OnParentChanged(self: ContainerControl,e: EventArgs) e: An System.EventArgs that contains the event data. """ pass def OnParentCursorChanged(self,*args): """ OnParentCursorChanged(self: Control,e: EventArgs) Raises the System.Windows.Forms.Control.CursorChanged event. e: An System.EventArgs that contains the event data. """ pass def OnParentEnabledChanged(self,*args): """ OnParentEnabledChanged(self: Control,e: EventArgs) Raises the System.Windows.Forms.Control.EnabledChanged event when the System.Windows.Forms.Control.Enabled property value of the control's container changes. e: An System.EventArgs that contains the event data. """ pass def OnParentFontChanged(self,*args): """ OnParentFontChanged(self: Control,e: EventArgs) Raises the System.Windows.Forms.Control.FontChanged event when the System.Windows.Forms.Control.Font property value of the control's container changes. e: An System.EventArgs that contains the event data. """ pass def OnParentForeColorChanged(self,*args): """ OnParentForeColorChanged(self: Control,e: EventArgs) Raises the System.Windows.Forms.Control.ForeColorChanged event when the System.Windows.Forms.Control.ForeColor property value of the control's container changes. e: An System.EventArgs that contains the event data. """ pass def OnParentRightToLeftChanged(self,*args): """ OnParentRightToLeftChanged(self: Control,e: EventArgs) Raises the System.Windows.Forms.Control.RightToLeftChanged event when the System.Windows.Forms.Control.RightToLeft property value of the control's container changes. e: An System.EventArgs that contains the event data. """ pass def OnParentVisibleChanged(self,*args): """ OnParentVisibleChanged(self: Control,e: EventArgs) Raises the System.Windows.Forms.Control.VisibleChanged event when the System.Windows.Forms.Control.Visible property value of the control's container changes. e: An System.EventArgs that contains the event data. """ pass def OnPreviewKeyDown(self,*args): """ OnPreviewKeyDown(self: Control,e: PreviewKeyDownEventArgs) Raises the System.Windows.Forms.Control.PreviewKeyDown event. e: A System.Windows.Forms.PreviewKeyDownEventArgs that contains the event data. """ pass def OnPrint(self,*args): """ OnPrint(self: Control,e: PaintEventArgs) Raises the System.Windows.Forms.Control.Paint event. e: A System.Windows.Forms.PaintEventArgs that contains the event data. """ pass def OnQueryContinueDrag(self,*args): """ OnQueryContinueDrag(self: Control,qcdevent: QueryContinueDragEventArgs) Raises the System.Windows.Forms.Control.QueryContinueDrag event. qcdevent: A System.Windows.Forms.QueryContinueDragEventArgs that contains the event data. """ pass def OnRegionChanged(self,*args): """ OnRegionChanged(self: Control,e: EventArgs) Raises the System.Windows.Forms.Control.RegionChanged event. e: An System.EventArgs that contains the event data. """ pass def OnResize(self,*args): """ OnResize(self: Control,e: EventArgs) Raises the System.Windows.Forms.Control.Resize event. e: An System.EventArgs that contains the event data. """ pass def OnRightToLeftChanged(self,*args): """ OnRightToLeftChanged(self: ScrollableControl,e: EventArgs) e: An System.EventArgs that contains the event data. """ pass def OnScroll(self,*args): """ OnScroll(self: ScrollableControl,se: ScrollEventArgs) Raises the System.Windows.Forms.ScrollableControl.Scroll event. se: A System.Windows.Forms.ScrollEventArgs that contains the event data. """ pass def OnSizeChanged(self,*args): """ OnSizeChanged(self: Control,e: EventArgs) Raises the System.Windows.Forms.Control.SizeChanged event. e: An System.EventArgs that contains the event data. """ pass def OnStyleChanged(self,*args): """ OnStyleChanged(self: Control,e: EventArgs) Raises the System.Windows.Forms.Control.StyleChanged event. e: An System.EventArgs that contains the event data. """ pass def OnSystemColorsChanged(self,*args): """ OnSystemColorsChanged(self: Control,e: EventArgs) Raises the System.Windows.Forms.Control.SystemColorsChanged event. e: An System.EventArgs that contains the event data. """ pass def OnTabIndexChanged(self,*args): """ OnTabIndexChanged(self: Control,e: EventArgs) Raises the System.Windows.Forms.Control.TabIndexChanged event. e: An System.EventArgs that contains the event data. """ pass def OnTabStopChanged(self,*args): """ OnTabStopChanged(self: Control,e: EventArgs) Raises the System.Windows.Forms.Control.TabStopChanged event. e: An System.EventArgs that contains the event data. """ pass def OnTextBoxKeyDown(self,*args): """ OnTextBoxKeyDown(self: UpDownBase,source: object,e: KeyEventArgs) Raises the System.Windows.Forms.Control.KeyDown event. source: The source of the event. e: A System.Windows.Forms.KeyEventArgs that contains the event data. """ pass def OnTextBoxKeyPress(self,*args): """ OnTextBoxKeyPress(self: NumericUpDown,source: object,e: KeyPressEventArgs) Raises the System.Windows.Forms.Control.KeyPress event. source: The source of the event. e: A System.Windows.Forms.KeyPressEventArgs that contains the event data. """ pass def OnTextBoxLostFocus(self,*args): """ OnTextBoxLostFocus(self: UpDownBase,source: object,e: EventArgs) Raises the System.Windows.Forms.Control.LostFocus event. source: The source of the event. e: An System.EventArgs that contains the event data. """ pass def OnTextBoxResize(self,*args): """ OnTextBoxResize(self: UpDownBase,source: object,e: EventArgs) Raises the System.Windows.Forms.Control.Resize event. source: The source of the event. e: An System.EventArgs that contains the event data. """ pass def OnTextBoxTextChanged(self,*args): """ OnTextBoxTextChanged(self: UpDownBase,source: object,e: EventArgs) Raises the System.Windows.Forms.Control.TextChanged event. source: The source of the event. e: An System.EventArgs that contains the event data. """ pass def OnTextChanged(self,*args): """ OnTextChanged(self: Control,e: EventArgs) Raises the System.Windows.Forms.Control.TextChanged event. e: An System.EventArgs that contains the event data. """ pass def OnValidated(self,*args): """ OnValidated(self: Control,e: EventArgs) Raises the System.Windows.Forms.Control.Validated event. e: An System.EventArgs that contains the event data. """ pass def OnValidating(self,*args): """ OnValidating(self: Control,e: CancelEventArgs) Raises the System.Windows.Forms.Control.Validating event. e: A System.ComponentModel.CancelEventArgs that contains the event data. """ pass def OnValueChanged(self,*args): """ OnValueChanged(self: NumericUpDown,e: EventArgs) Raises the System.Windows.Forms.NumericUpDown.ValueChanged event. e: An System.EventArgs that contains the event data. """ pass def OnVisibleChanged(self,*args): """ OnVisibleChanged(self: ScrollableControl,e: EventArgs) e: An System.EventArgs that contains the event data. """ pass def ParseEditText(self,*args): """ ParseEditText(self: NumericUpDown) Converts the text displayed in the spin box (also known as an up-down control) to a numeric value and evaluates it. """ pass def ProcessCmdKey(self,*args): """ ProcessCmdKey(self: ContainerControl,msg: Message,keyData: Keys) -> (bool,Message) msg: A System.Windows.Forms.Message,passed by reference,that represents the window message to process. keyData: One of the System.Windows.Forms.Keys values that represents the key to process. Returns: true if the character was processed by the control; otherwise,false. """ pass def ProcessDialogChar(self,*args): """ ProcessDialogChar(self: ContainerControl,charCode: Char) -> bool charCode: The character to process. Returns: true if the character was processed by the control; otherwise,false. """ pass def ProcessDialogKey(self,*args): """ ProcessDialogKey(self: ContainerControl,keyData: Keys) -> bool keyData: One of the System.Windows.Forms.Keys values that represents the key to process. Returns: true if the key was processed by the control; otherwise,false. """ pass def ProcessKeyEventArgs(self,*args): """ ProcessKeyEventArgs(self: Control,m: Message) -> (bool,Message) Processes a key message and generates the appropriate control events. m: A System.Windows.Forms.Message,passed by reference,that represents the window message to process. Returns: true if the message was processed by the control; otherwise,false. """ pass def ProcessKeyMessage(self,*args): """ ProcessKeyMessage(self: Control,m: Message) -> (bool,Message) Processes a keyboard message. m: A System.Windows.Forms.Message,passed by reference,that represents the window message to process. Returns: true if the message was processed by the control; otherwise,false. """ pass def ProcessKeyPreview(self,*args): """ ProcessKeyPreview(self: Control,m: Message) -> (bool,Message) Previews a keyboard message. m: A System.Windows.Forms.Message,passed by reference,that represents the window message to process. Returns: true if the message was processed by the control; otherwise,false. """ pass def ProcessMnemonic(self,*args): """ ProcessMnemonic(self: ContainerControl,charCode: Char) -> bool charCode: The character to process. Returns: true if the character was processed as a mnemonic by the control; otherwise,false. """ pass def ProcessTabKey(self,*args): """ ProcessTabKey(self: ContainerControl,forward: bool) -> bool Selects the next available control and makes it the active control. forward: true to cycle forward through the controls in the System.Windows.Forms.ContainerControl; otherwise,false. Returns: true if a control is selected; otherwise,false. """ pass def RaiseDragEvent(self,*args): """ RaiseDragEvent(self: Control,key: object,e: DragEventArgs) Raises the appropriate drag event. key: The event to raise. e: A System.Windows.Forms.DragEventArgs that contains the event data. """ pass def RaiseKeyEvent(self,*args): """ RaiseKeyEvent(self: Control,key: object,e: KeyEventArgs) Raises the appropriate key event. key: The event to raise. e: A System.Windows.Forms.KeyEventArgs that contains the event data. """ pass def RaiseMouseEvent(self,*args): """ RaiseMouseEvent(self: Control,key: object,e: MouseEventArgs) Raises the appropriate mouse event. key: The event to raise. e: A System.Windows.Forms.MouseEventArgs that contains the event data. """ pass def RaisePaintEvent(self,*args): """ RaisePaintEvent(self: Control,key: object,e: PaintEventArgs) Raises the appropriate paint event. key: The event to raise. e: A System.Windows.Forms.PaintEventArgs that contains the event data. """ pass def RecreateHandle(self,*args): """ RecreateHandle(self: Control) Forces the re-creation of the handle for the control. """ pass def RescaleConstantsForDpi(self,*args): """ RescaleConstantsForDpi(self: UpDownBase,deviceDpiOld: int,deviceDpiNew: int) """ pass def ResetMouseEventArgs(self,*args): """ ResetMouseEventArgs(self: Control) Resets the control to handle the System.Windows.Forms.Control.MouseLeave event. """ pass def RtlTranslateAlignment(self,*args): """ RtlTranslateAlignment(self: Control,align: ContentAlignment) -> ContentAlignment Converts the specified System.Drawing.ContentAlignment to the appropriate System.Drawing.ContentAlignment to support right-to-left text. align: One of the System.Drawing.ContentAlignment values. Returns: One of the System.Drawing.ContentAlignment values. RtlTranslateAlignment(self: Control,align: LeftRightAlignment) -> LeftRightAlignment Converts the specified System.Windows.Forms.LeftRightAlignment to the appropriate System.Windows.Forms.LeftRightAlignment to support right-to-left text. align: One of the System.Windows.Forms.LeftRightAlignment values. Returns: One of the System.Windows.Forms.LeftRightAlignment values. RtlTranslateAlignment(self: Control,align: HorizontalAlignment) -> HorizontalAlignment Converts the specified System.Windows.Forms.HorizontalAlignment to the appropriate System.Windows.Forms.HorizontalAlignment to support right-to-left text. align: One of the System.Windows.Forms.HorizontalAlignment values. Returns: One of the System.Windows.Forms.HorizontalAlignment values. """ pass def RtlTranslateContent(self,*args): """ RtlTranslateContent(self: Control,align: ContentAlignment) -> ContentAlignment Converts the specified System.Drawing.ContentAlignment to the appropriate System.Drawing.ContentAlignment to support right-to-left text. align: One of the System.Drawing.ContentAlignment values. Returns: One of the System.Drawing.ContentAlignment values. """ pass def RtlTranslateHorizontal(self,*args): """ RtlTranslateHorizontal(self: Control,align: HorizontalAlignment) -> HorizontalAlignment Converts the specified System.Windows.Forms.HorizontalAlignment to the appropriate System.Windows.Forms.HorizontalAlignment to support right-to-left text. align: One of the System.Windows.Forms.HorizontalAlignment values. Returns: One of the System.Windows.Forms.HorizontalAlignment values. """ pass def RtlTranslateLeftRight(self,*args): """ RtlTranslateLeftRight(self: Control,align: LeftRightAlignment) -> LeftRightAlignment Converts the specified System.Windows.Forms.LeftRightAlignment to the appropriate System.Windows.Forms.LeftRightAlignment to support right-to-left text. align: One of the System.Windows.Forms.LeftRightAlignment values. Returns: One of the System.Windows.Forms.LeftRightAlignment values. """ pass def ScaleControl(self,*args): """ ScaleControl(self: ScrollableControl,factor: SizeF,specified: BoundsSpecified) factor: The factor by which the height and width of the control will be scaled. specified: A System.Windows.Forms.BoundsSpecified value that specifies the bounds of the control to use when defining its size and position. """ pass def ScaleCore(self,*args): """ ScaleCore(self: ScrollableControl,dx: Single,dy: Single) dx: The horizontal scaling factor. dy: The vertical scaling factor. """ pass def ScrollToControl(self,*args): """ ScrollToControl(self: ScrollableControl,activeControl: Control) -> Point Calculates the scroll offset to the specified child control. activeControl: The child control to scroll into view. Returns: The upper-left hand System.Drawing.Point of the display area relative to the client area required to scroll the control into view. """ pass def Select(self,start=None,length=None): """ Select(self: ContainerControl,directed: bool,forward: bool) directed: true to specify the direction of the control to select; otherwise,false. forward: true to move forward in the tab order; false to move backward in the tab order. """ pass def SetAutoSizeMode(self,*args): """ SetAutoSizeMode(self: Control,mode: AutoSizeMode) Sets a value indicating how a control will behave when its System.Windows.Forms.Control.AutoSize property is enabled. mode: One of the System.Windows.Forms.AutoSizeMode values. """ pass def SetBoundsCore(self,*args): """ SetBoundsCore(self: Control,x: int,y: int,width: int,height: int,specified: BoundsSpecified) Performs the work of setting the specified bounds of this control. x: The new System.Windows.Forms.Control.Left property value of the control. y: The new System.Windows.Forms.Control.Top property value of the control. width: The new System.Windows.Forms.Control.Width property value of the control. height: The new System.Windows.Forms.Control.Height property value of the control. specified: A bitwise combination of the System.Windows.Forms.BoundsSpecified values. """ pass def SetClientSizeCore(self,*args): """ SetClientSizeCore(self: Control,x: int,y: int) Sets the size of the client area of the control. x: The client area width,in pixels. y: The client area height,in pixels. """ pass def SetDisplayRectLocation(self,*args): """ SetDisplayRectLocation(self: ScrollableControl,x: int,y: int) Positions the display window to the specified value. x: The horizontal offset at which to position the System.Windows.Forms.ScrollableControl. y: The vertical offset at which to position the System.Windows.Forms.ScrollableControl. """ pass def SetScrollState(self,*args): """ SetScrollState(self: ScrollableControl,bit: int,value: bool) Sets the specified scroll state flag. bit: The scroll state flag to set. value: The value to set the flag. """ pass def SetStyle(self,*args): """ SetStyle(self: Control,flag: ControlStyles,value: bool) Sets a specified System.Windows.Forms.ControlStyles flag to either true or false. flag: The System.Windows.Forms.ControlStyles bit to set. value: true to apply the specified style to the control; otherwise,false. """ pass def SetTopLevel(self,*args): """ SetTopLevel(self: Control,value: bool) Sets the control as the top-level control. value: true to set the control as the top-level control; otherwise,false. """ pass def SetVisibleCore(self,*args): """ SetVisibleCore(self: Control,value: bool) Sets the control to the specified visible state. value: true to make the control visible; otherwise,false. """ pass def SizeFromClientSize(self,*args): """ SizeFromClientSize(self: Control,clientSize: Size) -> Size Determines the size of the entire control from the height and width of its client area. clientSize: A System.Drawing.Size value representing the height and width of the control's client area. Returns: A System.Drawing.Size value representing the height and width of the entire control. """ pass def ToString(self): """ ToString(self: NumericUpDown) -> str Returns a string that represents the System.Windows.Forms.NumericUpDown control. Returns: A string that represents the current System.Windows.Forms.NumericUpDown. """ pass def UpButton(self): """ UpButton(self: NumericUpDown) Increments the value of the spin box (also known as an up-down control). """ pass def UpdateBounds(self,*args): """ UpdateBounds(self: Control,x: int,y: int,width: int,height: int,clientWidth: int,clientHeight: int) Updates the bounds of the control with the specified size,location,and client size. x: The System.Drawing.Point.X coordinate of the control. y: The System.Drawing.Point.Y coordinate of the control. width: The System.Drawing.Size.Width of the control. height: The System.Drawing.Size.Height of the control. clientWidth: The client System.Drawing.Size.Width of the control. clientHeight: The client System.Drawing.Size.Height of the control. UpdateBounds(self: Control,x: int,y: int,width: int,height: int) Updates the bounds of the control with the specified size and location. x: The System.Drawing.Point.X coordinate of the control. y: The System.Drawing.Point.Y coordinate of the control. width: The System.Drawing.Size.Width of the control. height: The System.Drawing.Size.Height of the control. UpdateBounds(self: Control) Updates the bounds of the control with the current size and location. """ pass def UpdateDefaultButton(self,*args): """ UpdateDefaultButton(self: ContainerControl) When overridden by a derived class,updates which button is the default button. """ pass def UpdateEditText(self,*args): """ UpdateEditText(self: NumericUpDown) Displays the current value of the spin box (also known as an up-down control) in the appropriate format. """ pass def UpdateStyles(self,*args): """ UpdateStyles(self: Control) Forces the assigned styles to be reapplied to the control. """ pass def UpdateZOrder(self,*args): """ UpdateZOrder(self: Control) Updates the control in its parent's z-order. """ pass def ValidateEditText(self,*args): """ ValidateEditText(self: NumericUpDown) Validates and updates the text displayed in the spin box (also known as an up-down control). """ pass def WndProc(self,*args): """ WndProc(self: UpDownBase,m: Message) -> Message Processes Windows messages. m: The Windows System.Windows.Forms.Message to process. """ pass def __enter__(self,*args): """ __enter__(self: IDisposable) -> object Provides the implementation of __enter__ for objects which implement IDisposable. """ pass def __exit__(self,*args): """ __exit__(self: IDisposable,exc_type: object,exc_value: object,exc_back: object) Provides the implementation of __exit__ for objects which implement IDisposable. """ pass def __init__(self,*args): """ x.__init__(...) initializes x; see x.__class__.__doc__ for signaturex.__init__(...) initializes x; see x.__class__.__doc__ for signaturex.__init__(...) initializes x; see x.__class__.__doc__ for signature """ pass def __str__(self,*args): pass Accelerations=property(lambda self: object(),lambda self,v: None,lambda self: None) """Gets a collection of sorted acceleration objects for the System.Windows.Forms.NumericUpDown control. Get: Accelerations(self: NumericUpDown) -> NumericUpDownAccelerationCollection """ AutoScaleFactor=property(lambda self: object(),lambda self,v: None,lambda self: None) """Gets the scaling factor between the current and design-time automatic scaling dimensions. """ CanEnableIme=property(lambda self: object(),lambda self,v: None,lambda self: None) """Gets a value indicating whether the System.Windows.Forms.Control.ImeMode property can be set to an active value,to enable IME support. """ CanRaiseEvents=property(lambda self: object(),lambda self,v: None,lambda self: None) """Determines if events can be raised on the control. """ ChangingText=property(lambda self: object(),lambda self,v: None,lambda self: None) """Gets or sets a value indicating whether the text property is being changed internally by its parent class. """ CreateParams=property(lambda self: object(),lambda self,v: None,lambda self: None) """Gets the required creation parameters when the control handle is created. """ DecimalPlaces=property(lambda self: object(),lambda self,v: None,lambda self: None) """Gets or sets the number of decimal places to display in the spin box (also known as an up-down control). Get: DecimalPlaces(self: NumericUpDown) -> int Set: DecimalPlaces(self: NumericUpDown)=value """ DefaultCursor=property(lambda self: object(),lambda self,v: None,lambda self: None) """Gets or sets the default cursor for the control. """ DefaultImeMode=property(lambda self: object(),lambda self,v: None,lambda self: None) """Gets the default Input Method Editor (IME) mode supported by the control. """ DefaultMargin=property(lambda self: object(),lambda self,v: None,lambda self: None) """Gets the space,in pixels,that is specified by default between controls. """ DefaultMaximumSize=property(lambda self: object(),lambda self,v: None,lambda self: None) """Gets the length and height,in pixels,that is specified as the default maximum size of a control. """ DefaultMinimumSize=property(lambda self: object(),lambda self,v: None,lambda self: None) """Gets the length and height,in pixels,that is specified as the default minimum size of a control. """ DefaultPadding=property(lambda self: object(),lambda self,v: None,lambda self: None) """Gets the internal spacing,in pixels,of the contents of a control. """ DefaultSize=property(lambda self: object(),lambda self,v: None,lambda self: None) """Gets the default size of the control. """ DesignMode=property(lambda self: object(),lambda self,v: None,lambda self: None) """Gets a value that indicates whether the System.ComponentModel.Component is currently in design mode. """ DoubleBuffered=property(lambda self: object(),lambda self,v: None,lambda self: None) """Gets or sets a value indicating whether this control should redraw its surface using a secondary buffer to reduce or prevent flicker. """ Events=property(lambda self: object(),lambda self,v: None,lambda self: None) """Gets the list of event handlers that are attached to this System.ComponentModel.Component. """ FontHeight=property(lambda self: object(),lambda self,v: None,lambda self: None) """Gets or sets the height of the font of the control. """ Hexadecimal=property(lambda self: object(),lambda self,v: None,lambda self: None) """Gets or sets a value indicating whether the spin box (also known as an up-down control) should display the value it contains in hexadecimal format. Get: Hexadecimal(self: NumericUpDown) -> bool Set: Hexadecimal(self: NumericUpDown)=value """ HScroll=property(lambda self: object(),lambda self,v: None,lambda self: None) """Gets or sets a value indicating whether the horizontal scroll bar is visible. """ ImeModeBase=property(lambda self: object(),lambda self,v: None,lambda self: None) """Gets or sets the IME mode of a control. """ Increment=property(lambda self: object(),lambda self,v: None,lambda self: None) """Gets or sets the value to increment or decrement the spin box (also known as an up-down control) when the up or down buttons are clicked. Get: Increment(self: NumericUpDown) -> Decimal Set: Increment(self: NumericUpDown)=value """ Maximum=property(lambda self: object(),lambda self,v: None,lambda self: None) """Gets or sets the maximum value for the spin box (also known as an up-down control). Get: Maximum(self: NumericUpDown) -> Decimal Set: Maximum(self: NumericUpDown)=value """ Minimum=property(lambda self: object(),lambda self,v: None,lambda self: None) """Gets or sets the minimum allowed value for the spin box (also known as an up-down control). Get: Minimum(self: NumericUpDown) -> Decimal Set: Minimum(self: NumericUpDown)=value """ Padding=property(lambda self: object(),lambda self,v: None,lambda self: None) """Gets or sets the space between the edges of a System.Windows.Forms.NumericUpDown control and its contents. Get: Padding(self: NumericUpDown) -> Padding Set: Padding(self: NumericUpDown)=value """ RenderRightToLeft=property(lambda self: object(),lambda self,v: None,lambda self: None) """This property is now obsolete. """ ResizeRedraw=property(lambda self: object(),lambda self,v: None,lambda self: None) """Gets or sets a value indicating whether the control redraws itself when resized. """ ScaleChildren=property(lambda self: object(),lambda self,v: None,lambda self: None) """Gets a value that determines the scaling of child controls. """ ShowFocusCues=property(lambda self: object(),lambda self,v: None,lambda self: None) """Gets a value indicating whether the control should display focus rectangles. """ ShowKeyboardCues=property(lambda self: object(),lambda self,v: None,lambda self: None) """Gets a value indicating whether the user interface is in the appropriate state to show or hide keyboard accelerators. """ Text=property(lambda self: object(),lambda self,v: None,lambda self: None) """Gets or sets the text to be displayed in the System.Windows.Forms.NumericUpDown control. Get: Text(self: NumericUpDown) -> str Set: Text(self: NumericUpDown)=value """ ThousandsSeparator=property(lambda self: object(),lambda self,v: None,lambda self: None) """Gets or sets a value indicating whether a thousands separator is displayed in the spin box (also known as an up-down control) when appropriate. Get: ThousandsSeparator(self: NumericUpDown) -> bool Set: ThousandsSeparator(self: NumericUpDown)=value """ UserEdit=property(lambda self: object(),lambda self,v: None,lambda self: None) """Gets or sets a value indicating whether a value has been entered by the user. """ Value=property(lambda self: object(),lambda self,v: None,lambda self: None) """Gets or sets the value assigned to the spin box (also known as an up-down control). Get: Value(self: NumericUpDown) -> Decimal Set: Value(self: NumericUpDown)=value """ VScroll=property(lambda self: object(),lambda self,v: None,lambda self: None) """Gets or sets a value indicating whether the vertical scroll bar is visible. """ PaddingChanged=None TextChanged=None ValueChanged=None
24.261731
375
0.700053
class NumericUpDown(UpDownBase,IComponent,IDisposable,IOleControl,IOleObject,IOleInPlaceObject,IOleInPlaceActiveObject,IOleWindow,IViewObject,IViewObject2,IPersist,IPersistStreamInit,IPersistPropertyBag,IPersistStorage,IQuickActivate,ISupportOleDropSource,IDropTarget,ISynchronizeInvoke,IWin32Window,IArrangedElement,IBindableComponent,IContainerControl,ISupportInitialize): def AccessibilityNotifyClients(self,*args): pass def AdjustFormScrollbars(self,*args): pass def BeginInit(self): pass def CreateAccessibilityInstance(self,*args): pass def CreateControlsInstance(self,*args): pass def CreateHandle(self,*args): pass def DefWndProc(self,*args): pass def DestroyHandle(self,*args): pass def Dispose(self): pass def DownButton(self): pass def EndInit(self): pass def GetAccessibilityObjectById(self,*args): pass def GetAutoSizeMode(self,*args): pass def GetScaledBounds(self,*args): pass def GetScrollState(self,*args): pass def GetService(self,*args): pass def GetStyle(self,*args): pass def GetTopLevel(self,*args): pass def InitLayout(self,*args): pass def InvokeGotFocus(self,*args): pass def InvokeLostFocus(self,*args): pass def InvokeOnClick(self,*args): pass def InvokePaint(self,*args): pass def InvokePaintBackground(self,*args): pass def IsInputChar(self,*args): pass def IsInputKey(self,*args): pass def MemberwiseClone(self,*args): pass def NotifyInvalidate(self,*args): pass def OnAutoSizeChanged(self,*args): pass def OnAutoValidateChanged(self,*args): pass def OnBackColorChanged(self,*args): pass def OnBackgroundImageChanged(self,*args): pass def OnBackgroundImageLayoutChanged(self,*args): pass def OnBindingContextChanged(self,*args): pass def OnCausesValidationChanged(self,*args): pass def OnChanged(self,*args): pass def OnChangeUICues(self,*args): pass def OnClick(self,*args): pass def OnClientSizeChanged(self,*args): pass def OnContextMenuChanged(self,*args): pass def OnContextMenuStripChanged(self,*args): pass def OnControlAdded(self,*args): pass def OnControlRemoved(self,*args): pass def OnCreateControl(self,*args): pass def OnCursorChanged(self,*args): pass def OnDockChanged(self,*args): pass def OnDoubleClick(self,*args): pass def OnDpiChangedAfterParent(self,*args): pass def OnDpiChangedBeforeParent(self,*args): pass def OnDragDrop(self,*args): pass def OnDragEnter(self,*args): pass def OnDragLeave(self,*args): pass def OnDragOver(self,*args): pass def OnEnabledChanged(self,*args): pass def OnEnter(self,*args): pass def OnFontChanged(self,*args): pass def OnForeColorChanged(self,*args): pass def OnGiveFeedback(self,*args): pass def OnGotFocus(self,*args): pass def OnHandleCreated(self,*args): pass def OnHandleDestroyed(self,*args): pass def OnHelpRequested(self,*args): pass def OnImeModeChanged(self,*args): pass def OnInvalidated(self,*args): pass def OnKeyDown(self,*args): pass def OnKeyPress(self,*args): pass def OnKeyUp(self,*args): pass def OnLayout(self,*args): pass def OnLeave(self,*args): pass def OnLocationChanged(self,*args): pass def OnLostFocus(self,*args): pass def OnMarginChanged(self,*args): pass def OnMouseCaptureChanged(self,*args): pass def OnMouseClick(self,*args): pass def OnMouseDoubleClick(self,*args): pass def OnMouseDown(self,*args): pass def OnMouseEnter(self,*args): pass def OnMouseHover(self,*args): pass def OnMouseLeave(self,*args): pass def OnMouseMove(self,*args): pass def OnMouseUp(self,*args): pass def OnMouseWheel(self,*args): pass def OnMove(self,*args): pass def OnNotifyMessage(self,*args): pass def OnPaddingChanged(self,*args): pass def OnPaint(self,*args): pass def OnPaintBackground(self,*args): pass def OnParentBackColorChanged(self,*args): pass def OnParentBackgroundImageChanged(self,*args): pass def OnParentBindingContextChanged(self,*args): pass def OnParentChanged(self,*args): pass def OnParentCursorChanged(self,*args): pass def OnParentEnabledChanged(self,*args): pass def OnParentFontChanged(self,*args): pass def OnParentForeColorChanged(self,*args): pass def OnParentRightToLeftChanged(self,*args): pass def OnParentVisibleChanged(self,*args): pass def OnPreviewKeyDown(self,*args): pass def OnPrint(self,*args): pass def OnQueryContinueDrag(self,*args): pass def OnRegionChanged(self,*args): pass def OnResize(self,*args): pass def OnRightToLeftChanged(self,*args): pass def OnScroll(self,*args): pass def OnSizeChanged(self,*args): pass def OnStyleChanged(self,*args): pass def OnSystemColorsChanged(self,*args): pass def OnTabIndexChanged(self,*args): pass def OnTabStopChanged(self,*args): pass def OnTextBoxKeyDown(self,*args): pass def OnTextBoxKeyPress(self,*args): pass def OnTextBoxLostFocus(self,*args): pass def OnTextBoxResize(self,*args): pass def OnTextBoxTextChanged(self,*args): pass def OnTextChanged(self,*args): pass def OnValidated(self,*args): pass def OnValidating(self,*args): pass def OnValueChanged(self,*args): pass def OnVisibleChanged(self,*args): pass def ParseEditText(self,*args): pass def ProcessCmdKey(self,*args): pass def ProcessDialogChar(self,*args): pass def ProcessDialogKey(self,*args): pass def ProcessKeyEventArgs(self,*args): pass def ProcessKeyMessage(self,*args): pass def ProcessKeyPreview(self,*args): pass def ProcessMnemonic(self,*args): pass def ProcessTabKey(self,*args): pass def RaiseDragEvent(self,*args): pass def RaiseKeyEvent(self,*args): pass def RaiseMouseEvent(self,*args): pass def RaisePaintEvent(self,*args): pass def RecreateHandle(self,*args): pass def RescaleConstantsForDpi(self,*args): pass def ResetMouseEventArgs(self,*args): pass def RtlTranslateAlignment(self,*args): pass def RtlTranslateContent(self,*args): pass def RtlTranslateHorizontal(self,*args): pass def RtlTranslateLeftRight(self,*args): pass def ScaleControl(self,*args): pass def ScaleCore(self,*args): pass def ScrollToControl(self,*args): pass def Select(self,start=None,length=None): pass def SetAutoSizeMode(self,*args): pass def SetBoundsCore(self,*args): pass def SetClientSizeCore(self,*args): pass def SetDisplayRectLocation(self,*args): pass def SetScrollState(self,*args): pass def SetStyle(self,*args): pass def SetTopLevel(self,*args): pass def SetVisibleCore(self,*args): pass def SizeFromClientSize(self,*args): pass def ToString(self): pass def UpButton(self): pass def UpdateBounds(self,*args): pass def UpdateDefaultButton(self,*args): pass def UpdateEditText(self,*args): pass def UpdateStyles(self,*args): pass def UpdateZOrder(self,*args): pass def ValidateEditText(self,*args): pass def WndProc(self,*args): pass def __enter__(self,*args): pass def __exit__(self,*args): pass def __init__(self,*args): pass def __str__(self,*args): pass Accelerations=property(lambda self: object(),lambda self,v: None,lambda self: None) AutoScaleFactor=property(lambda self: object(),lambda self,v: None,lambda self: None) CanEnableIme=property(lambda self: object(),lambda self,v: None,lambda self: None) CanRaiseEvents=property(lambda self: object(),lambda self,v: None,lambda self: None) ChangingText=property(lambda self: object(),lambda self,v: None,lambda self: None) CreateParams=property(lambda self: object(),lambda self,v: None,lambda self: None) DecimalPlaces=property(lambda self: object(),lambda self,v: None,lambda self: None) DefaultCursor=property(lambda self: object(),lambda self,v: None,lambda self: None) DefaultImeMode=property(lambda self: object(),lambda self,v: None,lambda self: None) DefaultMargin=property(lambda self: object(),lambda self,v: None,lambda self: None) DefaultMaximumSize=property(lambda self: object(),lambda self,v: None,lambda self: None) DefaultMinimumSize=property(lambda self: object(),lambda self,v: None,lambda self: None) DefaultPadding=property(lambda self: object(),lambda self,v: None,lambda self: None) DefaultSize=property(lambda self: object(),lambda self,v: None,lambda self: None) DesignMode=property(lambda self: object(),lambda self,v: None,lambda self: None) DoubleBuffered=property(lambda self: object(),lambda self,v: None,lambda self: None) Events=property(lambda self: object(),lambda self,v: None,lambda self: None) FontHeight=property(lambda self: object(),lambda self,v: None,lambda self: None) Hexadecimal=property(lambda self: object(),lambda self,v: None,lambda self: None) HScroll=property(lambda self: object(),lambda self,v: None,lambda self: None) ImeModeBase=property(lambda self: object(),lambda self,v: None,lambda self: None) Increment=property(lambda self: object(),lambda self,v: None,lambda self: None) Maximum=property(lambda self: object(),lambda self,v: None,lambda self: None) Minimum=property(lambda self: object(),lambda self,v: None,lambda self: None) Padding=property(lambda self: object(),lambda self,v: None,lambda self: None) RenderRightToLeft=property(lambda self: object(),lambda self,v: None,lambda self: None) ResizeRedraw=property(lambda self: object(),lambda self,v: None,lambda self: None) ScaleChildren=property(lambda self: object(),lambda self,v: None,lambda self: None) ShowFocusCues=property(lambda self: object(),lambda self,v: None,lambda self: None) ShowKeyboardCues=property(lambda self: object(),lambda self,v: None,lambda self: None) Text=property(lambda self: object(),lambda self,v: None,lambda self: None) ThousandsSeparator=property(lambda self: object(),lambda self,v: None,lambda self: None) UserEdit=property(lambda self: object(),lambda self,v: None,lambda self: None) Value=property(lambda self: object(),lambda self,v: None,lambda self: None) VScroll=property(lambda self: object(),lambda self,v: None,lambda self: None) PaddingChanged=None TextChanged=None ValueChanged=None
true
true
f72bc0bbb4aca05776043b6a2bbf09555f2323ed
498
py
Python
barberShopControl/core/migrations/0017_reserva_res_servicos.py
YohaneSilva/Barbearia-Amizades
8550cc5de7a0055be78f9e539de9e5c72a8c3a61
[ "Apache-2.0" ]
1
2020-03-19T21:09:24.000Z
2020-03-19T21:09:24.000Z
barberShopControl/core/migrations/0017_reserva_res_servicos.py
YohaneSilva/Barbearia-Amizades
8550cc5de7a0055be78f9e539de9e5c72a8c3a61
[ "Apache-2.0" ]
null
null
null
barberShopControl/core/migrations/0017_reserva_res_servicos.py
YohaneSilva/Barbearia-Amizades
8550cc5de7a0055be78f9e539de9e5c72a8c3a61
[ "Apache-2.0" ]
null
null
null
# Generated by Django 3.0.5 on 2020-05-18 04:14 from django.db import migrations, models import django.utils.timezone class Migration(migrations.Migration): dependencies = [ ('core', '0016_auto_20200516_0338'), ] operations = [ migrations.AddField( model_name='reserva', name='res_servicos', field=models.TextField(default=django.utils.timezone.now, verbose_name='Servicos'), preserve_default=False, ), ]
23.714286
95
0.634538
from django.db import migrations, models import django.utils.timezone class Migration(migrations.Migration): dependencies = [ ('core', '0016_auto_20200516_0338'), ] operations = [ migrations.AddField( model_name='reserva', name='res_servicos', field=models.TextField(default=django.utils.timezone.now, verbose_name='Servicos'), preserve_default=False, ), ]
true
true
f72bc16d4a055439bb4d5c75416bba366abd7fa1
21,675
py
Python
generated/nidcpower/nidcpower/_converters.py
AlexHearnNI/nimi-python
39d7c4d9aa66d826c60a5d700982eff173e051e5
[ "MIT" ]
null
null
null
generated/nidcpower/nidcpower/_converters.py
AlexHearnNI/nimi-python
39d7c4d9aa66d826c60a5d700982eff173e051e5
[ "MIT" ]
null
null
null
generated/nidcpower/nidcpower/_converters.py
AlexHearnNI/nimi-python
39d7c4d9aa66d826c60a5d700982eff173e051e5
[ "MIT" ]
null
null
null
# -*- coding: utf-8 -*- # This file was generated import nidcpower._visatype as _visatype import nidcpower.errors as errors import array import datetime import numbers from functools import singledispatch @singledispatch def _convert_repeated_capabilities(arg, prefix): # noqa: F811 '''Base version that should not be called Overall purpose is to convert the repeated capabilities to a list of strings with prefix from what ever form Supported types: - str - List (comma delimited) - str - Range (using '-' or ':') - str - single item - int - tuple - range - slice Each instance should return a list of strings, without prefix - '0' --> ['0'] - 0 --> ['0'] - '0, 1' --> ['0', '1'] - 'ScriptTrigger0, ScriptTrigger1' --> ['0', '1'] - '0-1' --> ['0', '1'] - '0:1' --> ['0', '1'] - '0-1,4' --> ['0', '1', '4'] - range(0, 2) --> ['0', '1'] - slice(0, 2) --> ['0', '1'] - (0, 1, 4) --> ['0', '1', '4'] - ('0-1', 4) --> ['0', '1', '4'] - (slice(0, 1), '2', [4, '5-6'], '7-9', '11:14', '16, 17') --> ['0', '2', '4', '5', '6', '7', '8', '9', '11', '12', '13', '14', '16', '17'] ''' raise errors.InvalidRepeatedCapabilityError('Invalid type', type(arg)) @_convert_repeated_capabilities.register(numbers.Integral) # noqa: F811 def _(repeated_capability, prefix): '''Integer version''' return [str(repeated_capability)] # This parsing function duplicate the parsing in the driver, so if changes to the allowed format are made there, they will need to be replicated here. @_convert_repeated_capabilities.register(str) # noqa: F811 def _(repeated_capability, prefix): '''String version (this is the most complex) We need to deal with a range ('0-3' or '0:3'), a list ('0,1,2,3') and a single item ''' # First we deal with a list rep_cap_list = repeated_capability.split(',') if len(rep_cap_list) > 1: # We have a list so call ourselves again to let the iterable instance handle it return _convert_repeated_capabilities(rep_cap_list, prefix) # Now we deal with ranges # We remove any prefix and change ':' to '-' r = repeated_capability.strip().replace(prefix, '').replace(':', '-') rc = r.split('-') if len(rc) > 1: if len(rc) > 2: raise errors.InvalidRepeatedCapabilityError("Multiple '-' or ':'", repeated_capability) start = int(rc[0]) end = int(rc[1]) if end < start: rng = range(start, end - 1, -1) else: rng = range(start, end + 1) return _convert_repeated_capabilities(rng, prefix) # If we made it here, it must be a simple item so we remove any prefix and return return [repeated_capability.replace(prefix, '').strip()] # We cannot use collections.abc.Iterable here because strings are also iterable and then this # instance is what gets called instead of the string one. @_convert_repeated_capabilities.register(list) # noqa: F811 @_convert_repeated_capabilities.register(range) # noqa: F811 @_convert_repeated_capabilities.register(tuple) # noqa: F811 def _(repeated_capability, prefix): '''Iterable version - can handle lists, ranges, and tuples''' rep_cap_list = [] for r in repeated_capability: rep_cap_list += _convert_repeated_capabilities(r, prefix) return rep_cap_list @_convert_repeated_capabilities.register(slice) # noqa: F811 def _(repeated_capability, prefix): '''slice version''' def ifnone(a, b): return b if a is None else a # Turn the slice into a list and call ourselves again to let the iterable instance handle it rng = range(ifnone(repeated_capability.start, 0), repeated_capability.stop, ifnone(repeated_capability.step, 1)) return _convert_repeated_capabilities(rng, prefix) def convert_repeated_capabilities(repeated_capability, prefix=''): '''Convert a repeated capabilities object to a comma delimited list Args: repeated_capability (str, list, tuple, slice, None) - prefix (str) - common prefix for all strings Returns: rep_cal_list (list of str) - list of each repeated capability item with ranges expanded and prefix added ''' # We need to explicitly handle None here. Everything else we can pass on to the singledispatch functions if repeated_capability is None: return [] return [prefix + r for r in _convert_repeated_capabilities(repeated_capability, prefix)] def convert_repeated_capabilities_from_init(repeated_capability): '''Convert a repeated capabilities object to a comma delimited list Parameter list is so it can be called from the code generated __init__(). We know it is for channels when called this was so we use a prefix of '' Args: repeated_capability (str, list, tuple, slice, None) - Returns: rep_cal (str) - comma delimited string of each repeated capability item with ranges expanded ''' return ','.join(convert_repeated_capabilities(repeated_capability, '')) def _convert_timedelta(value, library_type, scaling): try: # We first assume it is a datetime.timedelta object scaled_value = value.total_seconds() * scaling except AttributeError: # If that doesn't work, assume it is a value in seconds # cast to float so scaled_value is always a float. This allows `timeout=10` to work as expected scaled_value = float(value) * scaling # ctype integer types don't convert to int from float so we need to if library_type in [_visatype.ViInt64, _visatype.ViInt32, _visatype.ViUInt32, _visatype.ViInt16, _visatype.ViUInt16, _visatype.ViInt8]: scaled_value = int(scaled_value) return library_type(scaled_value) def convert_timedelta_to_seconds_real64(value): return _convert_timedelta(value, _visatype.ViReal64, 1) def convert_timedelta_to_milliseconds_int32(value): return _convert_timedelta(value, _visatype.ViInt32, 1000) def convert_timedeltas_to_seconds_real64(values): return [convert_timedelta_to_seconds_real64(i) for i in values] def convert_seconds_real64_to_timedeltas(seconds): return [datetime.timedelta(seconds=i) for i in seconds] def convert_month_to_timedelta(months): return datetime.timedelta(days=(30.4167 * months)) # This converter is not called from the normal codegen path for function. Instead it is # call from init and is a special case. def convert_init_with_options_dictionary(values): if type(values) is str: init_with_options_string = values else: good_keys = { 'rangecheck': 'RangeCheck', 'queryinstrstatus': 'QueryInstrStatus', 'cache': 'Cache', 'simulate': 'Simulate', 'recordcoercions': 'RecordCoercions', 'interchangecheck': 'InterchangeCheck', 'driversetup': 'DriverSetup', 'range_check': 'RangeCheck', 'query_instr_status': 'QueryInstrStatus', 'record_coercions': 'RecordCoercions', 'interchange_check': 'InterchangeCheck', 'driver_setup': 'DriverSetup', } init_with_options = [] for k in sorted(values.keys()): value = None if k.lower() in good_keys and not good_keys[k.lower()] == 'DriverSetup': value = good_keys[k.lower()] + ('=1' if values[k] is True else '=0') elif k.lower() in good_keys and good_keys[k.lower()] == 'DriverSetup': if not isinstance(values[k], dict): raise TypeError('DriverSetup must be a dictionary') value = 'DriverSetup=' + (';'.join([key + ':' + values[k][key] for key in sorted(values[k])])) else: value = k + ('=1' if values[k] is True else '=0') init_with_options.append(value) init_with_options_string = ','.join(init_with_options) return init_with_options_string # convert value to bytes @singledispatch def _convert_to_bytes(value): # noqa: F811 pass @_convert_to_bytes.register(list) # noqa: F811 @_convert_to_bytes.register(bytes) # noqa: F811 @_convert_to_bytes.register(bytearray) # noqa: F811 @_convert_to_bytes.register(array.array) # noqa: F811 def _(value): return value @_convert_to_bytes.register(str) # noqa: F811 def _(value): return value.encode() def convert_to_bytes(value): # noqa: F811 return bytes(_convert_to_bytes(value)) # Let's run some tests def test_convert_init_with_options_dictionary(): assert convert_init_with_options_dictionary('') == '' assert convert_init_with_options_dictionary('Simulate=1') == 'Simulate=1' assert convert_init_with_options_dictionary({'Simulate': True, }) == 'Simulate=1' assert convert_init_with_options_dictionary({'Simulate': False, }) == 'Simulate=0' assert convert_init_with_options_dictionary({'Simulate': True, 'Cache': False}) == 'Cache=0,Simulate=1' assert convert_init_with_options_dictionary({'DriverSetup': {'Model': '5162 (4CH)', 'Bitfile': 'CustomProcessing'}}) == 'DriverSetup=Bitfile:CustomProcessing;Model:5162 (4CH)' assert convert_init_with_options_dictionary({'Simulate': True, 'DriverSetup': {'Model': '5162 (4CH)', 'Bitfile': 'CustomProcessing'}}) == 'DriverSetup=Bitfile:CustomProcessing;Model:5162 (4CH),Simulate=1' assert convert_init_with_options_dictionary({'simulate': True, 'cache': False}) == 'Cache=0,Simulate=1' assert convert_init_with_options_dictionary({'driver_setup': {'Model': '5162 (4CH)', 'Bitfile': 'CustomProcessing'}}) == 'DriverSetup=Bitfile:CustomProcessing;Model:5162 (4CH)' assert convert_init_with_options_dictionary({'simulate': True, 'driver_setup': {'Model': '5162 (4CH)', 'Bitfile': 'CustomProcessing'}}) == 'DriverSetup=Bitfile:CustomProcessing;Model:5162 (4CH),Simulate=1' # Tests - time def test_convert_timedelta_to_seconds_double(): test_result = convert_timedelta_to_seconds_real64(datetime.timedelta(seconds=10)) assert test_result.value == 10.0 assert isinstance(test_result, _visatype.ViReal64) test_result = convert_timedelta_to_seconds_real64(datetime.timedelta(seconds=-1)) assert test_result.value == -1 assert isinstance(test_result, _visatype.ViReal64) test_result = convert_timedelta_to_seconds_real64(10.5) assert test_result.value == 10.5 assert isinstance(test_result, _visatype.ViReal64) test_result = convert_timedelta_to_seconds_real64(-1) assert test_result.value == -1 assert isinstance(test_result, _visatype.ViReal64) def test_convert_timedelta_to_milliseconds_int32(): test_result = convert_timedelta_to_milliseconds_int32(datetime.timedelta(seconds=10)) assert test_result.value == 10000 assert isinstance(test_result, _visatype.ViInt32) test_result = convert_timedelta_to_milliseconds_int32(datetime.timedelta(seconds=-1)) assert test_result.value == -1000 assert isinstance(test_result, _visatype.ViInt32) test_result = convert_timedelta_to_milliseconds_int32(10.5) assert test_result.value == 10500 assert isinstance(test_result, _visatype.ViInt32) test_result = convert_timedelta_to_milliseconds_int32(-1) assert test_result.value == -1000 assert isinstance(test_result, _visatype.ViInt32) def test_convert_timedeltas_to_seconds_real64(): time_values = [10.5, -1] test_result = convert_timedeltas_to_seconds_real64(time_values) assert all([actual.value == expected for actual, expected in zip(test_result, time_values)]) assert all([isinstance(i, _visatype.ViReal64) for i in test_result]) timedeltas = [datetime.timedelta(seconds=s, milliseconds=ms) for s, ms in zip([10, -1], [500, 0])] test_result = convert_timedeltas_to_seconds_real64(timedeltas) assert all([actual.value == expected for actual, expected in zip(test_result, time_values)]) assert all([isinstance(i, _visatype.ViReal64) for i in test_result]) def test_convert_seconds_real64_to_timedeltas(): time_values = [10.5, -1] timedeltas = convert_seconds_real64_to_timedeltas(time_values) assert all([actual.total_seconds() == expected for actual, expected in zip(timedeltas, time_values)]) # Tests - repeated capabilities def test_repeated_capabilies_string_channel(): test_result_list = convert_repeated_capabilities('0') assert test_result_list == ['0'] test_result_list = convert_repeated_capabilities('r0') assert test_result_list == ['r0'] test_result_list = convert_repeated_capabilities('0,1') assert test_result_list == ['0', '1'] def test_repeated_capabilies_string_prefix(): test_result_list = convert_repeated_capabilities('0', prefix='ScriptTrigger') assert test_result_list == ['ScriptTrigger0'] def test_repeated_capabilies_list_channel(): test_result_list = convert_repeated_capabilities(['0']) assert test_result_list == ['0'] test_result_list = convert_repeated_capabilities(['r0']) assert test_result_list == ['r0'] test_result_list = convert_repeated_capabilities(['0', '1']) assert test_result_list == ['0', '1'] test_result_list = convert_repeated_capabilities([0, 1]) assert test_result_list == ['0', '1'] test_result_list = convert_repeated_capabilities([0, 1, '3']) assert test_result_list == ['0', '1', '3'] def test_repeated_capabilies_list_prefix(): test_result_list = convert_repeated_capabilities(['ScriptTrigger0', 'ScriptTrigger1'], prefix='ScriptTrigger') assert test_result_list == ['ScriptTrigger0', 'ScriptTrigger1'] test_result_list = convert_repeated_capabilities(['0'], prefix='ScriptTrigger') assert test_result_list == ['ScriptTrigger0'] test_result_list = convert_repeated_capabilities(['0', '1'], prefix='ScriptTrigger') assert test_result_list == ['ScriptTrigger0', 'ScriptTrigger1'] test_result_list = convert_repeated_capabilities([0, 1], prefix='ScriptTrigger') assert test_result_list == ['ScriptTrigger0', 'ScriptTrigger1'] def test_repeated_capabilies_tuple_channel(): test_result_list = convert_repeated_capabilities(('0')) assert test_result_list == ['0'] test_result_list = convert_repeated_capabilities(('0,1')) assert test_result_list == ['0', '1'] test_result_list = convert_repeated_capabilities(('0', '1')) assert test_result_list == ['0', '1'] test_result_list = convert_repeated_capabilities((0, 1)) assert test_result_list == ['0', '1'] test_result_list = convert_repeated_capabilities((0, 1, '3')) assert test_result_list == ['0', '1', '3'] def test_repeated_capabilies_tuple_prefix(): test_result_list = convert_repeated_capabilities(('ScriptTrigger0,ScriptTrigger1'), prefix='ScriptTrigger') assert test_result_list == ['ScriptTrigger0', 'ScriptTrigger1'] test_result_list = convert_repeated_capabilities(('0'), prefix='ScriptTrigger') assert test_result_list == ['ScriptTrigger0'] test_result_list = convert_repeated_capabilities(('0', '1'), prefix='ScriptTrigger') assert test_result_list == ['ScriptTrigger0', 'ScriptTrigger1'] test_result_list = convert_repeated_capabilities((0, 1), prefix='ScriptTrigger') assert test_result_list == ['ScriptTrigger0', 'ScriptTrigger1'] def test_repeated_capabilies_unicode(): test_result_list = convert_repeated_capabilities(u'ScriptTrigger0,ScriptTrigger1', prefix='ScriptTrigger') assert test_result_list == ['ScriptTrigger0', 'ScriptTrigger1'] test_result_list = convert_repeated_capabilities(u'ScriptTrigger0,ScriptTrigger1', prefix=u'ScriptTrigger') assert test_result_list == ['ScriptTrigger0', 'ScriptTrigger1'] test_result_list = convert_repeated_capabilities('ScriptTrigger0,ScriptTrigger1', prefix=u'ScriptTrigger') assert test_result_list == ['ScriptTrigger0', 'ScriptTrigger1'] def test_repeated_capabilies_raw(): test_result_list = convert_repeated_capabilities(r'ScriptTrigger0,ScriptTrigger1', prefix='ScriptTrigger') assert test_result_list == ['ScriptTrigger0', 'ScriptTrigger1'] test_result_list = convert_repeated_capabilities(r'ScriptTrigger0,ScriptTrigger1', prefix=r'ScriptTrigger') assert test_result_list == ['ScriptTrigger0', 'ScriptTrigger1'] test_result_list = convert_repeated_capabilities('ScriptTrigger0,ScriptTrigger1', prefix=r'ScriptTrigger') assert test_result_list == ['ScriptTrigger0', 'ScriptTrigger1'] test_result_list = convert_repeated_capabilities(r'ScriptTrigger0,ScriptTrigger1', prefix=u'ScriptTrigger') assert test_result_list == ['ScriptTrigger0', 'ScriptTrigger1'] test_result_list = convert_repeated_capabilities(r'ScriptTrigger0,ScriptTrigger1', prefix=r'ScriptTrigger') assert test_result_list == ['ScriptTrigger0', 'ScriptTrigger1'] test_result_list = convert_repeated_capabilities(u'ScriptTrigger0,ScriptTrigger1', prefix=r'ScriptTrigger') assert test_result_list == ['ScriptTrigger0', 'ScriptTrigger1'] def test_repeated_capabilies_slice_channel(): test_result_list = convert_repeated_capabilities(slice(0, 1)) assert test_result_list == ['0'] test_result_list = convert_repeated_capabilities(slice(0, 2)) assert test_result_list == ['0', '1'] test_result_list = convert_repeated_capabilities(slice(None, 2)) assert test_result_list == ['0', '1'] def test_repeated_capabilies_mixed_channel(): test_result_list = convert_repeated_capabilities((slice(0, 1), '2', [4, '5-6'], '7-9', '11:14', '16, 17')) assert test_result_list == ['0', '2', '4', '5', '6', '7', '8', '9', '11', '12', '13', '14', '16', '17'] test_result_list = convert_repeated_capabilities([slice(0, 1), '2', [4, '5-6'], '7-9', '11:14', '16, 17']) assert test_result_list == ['0', '2', '4', '5', '6', '7', '8', '9', '11', '12', '13', '14', '16', '17'] def test_repeated_capabilies_mixed_prefix(): test_result_list = convert_repeated_capabilities((slice(0, 1), '2', [4, '5-6'], '7-9', '11:14', '16, 17'), prefix='ScriptTrigger') assert test_result_list == ['ScriptTrigger0', 'ScriptTrigger2', 'ScriptTrigger4', 'ScriptTrigger5', 'ScriptTrigger6', 'ScriptTrigger7', 'ScriptTrigger8', 'ScriptTrigger9', 'ScriptTrigger11', 'ScriptTrigger12', 'ScriptTrigger13', 'ScriptTrigger14', 'ScriptTrigger16', 'ScriptTrigger17'] test_result_list = convert_repeated_capabilities([slice(0, 1), '2', [4, '5-6'], '7-9', '11:14', '16, 17'], prefix='ScriptTrigger') assert test_result_list == ['ScriptTrigger0', 'ScriptTrigger2', 'ScriptTrigger4', 'ScriptTrigger5', 'ScriptTrigger6', 'ScriptTrigger7', 'ScriptTrigger8', 'ScriptTrigger9', 'ScriptTrigger11', 'ScriptTrigger12', 'ScriptTrigger13', 'ScriptTrigger14', 'ScriptTrigger16', 'ScriptTrigger17'] def test_invalid_repeated_capabilies(): try: convert_repeated_capabilities('6-8-10') assert False except errors.InvalidRepeatedCapabilityError: pass try: convert_repeated_capabilities(['5', '6-8-10']) assert False except errors.InvalidRepeatedCapabilityError: pass try: convert_repeated_capabilities(('5', '6-8-10')) assert False except errors.InvalidRepeatedCapabilityError: pass try: convert_repeated_capabilities('5,6-8-10') assert False except errors.InvalidRepeatedCapabilityError: pass try: convert_repeated_capabilities(5.0) assert False except errors.InvalidRepeatedCapabilityError: pass try: convert_repeated_capabilities([5.0, '0']) assert False except errors.InvalidRepeatedCapabilityError: pass try: convert_repeated_capabilities((5.0, '0')) assert False except errors.InvalidRepeatedCapabilityError: pass def test_repeated_capabilies_slice_prefix(): test_result_list = convert_repeated_capabilities(slice(0, 1), prefix='ScriptTrigger') assert test_result_list == ['ScriptTrigger0'] test_result_list = convert_repeated_capabilities(slice(0, 2), prefix='ScriptTrigger') assert test_result_list == ['ScriptTrigger0', 'ScriptTrigger1'] test_result_list = convert_repeated_capabilities(slice(None, 2), prefix='ScriptTrigger') assert test_result_list == ['ScriptTrigger0', 'ScriptTrigger1'] def test_repeated_capabilies_from_init(): test_result = convert_repeated_capabilities_from_init((slice(0, 1), '2', [4, '5-6'], '7-9', '11:14', '16, 17')) assert test_result == '0,2,4,5,6,7,8,9,11,12,13,14,16,17' def test_string_to_list_channel(): test_result = _convert_repeated_capabilities('r0', '') assert test_result == ['r0'] test_result = _convert_repeated_capabilities(['0-2'], '') assert test_result == ['0', '1', '2'] test_result = _convert_repeated_capabilities(['3:7'], '') assert test_result == ['3', '4', '5', '6', '7'] test_result = _convert_repeated_capabilities(['2-0'], '') assert test_result == ['2', '1', '0'] test_result = _convert_repeated_capabilities(['2:0'], '') assert test_result == ['2', '1', '0'] def test_string_to_list_prefix(): test_result = _convert_repeated_capabilities(['ScriptTrigger3-ScriptTrigger7'], 'ScriptTrigger') assert test_result == ['3', '4', '5', '6', '7'] test_result = _convert_repeated_capabilities(['ScriptTrigger3:ScriptTrigger7'], 'ScriptTrigger') assert test_result == ['3', '4', '5', '6', '7'] test_result = _convert_repeated_capabilities(['ScriptTrigger2-ScriptTrigger0'], 'ScriptTrigger') assert test_result == ['2', '1', '0'] test_result = _convert_repeated_capabilities(['ScriptTrigger2:ScriptTrigger0'], 'ScriptTrigger') assert test_result == ['2', '1', '0']
44.875776
289
0.705421
import nidcpower._visatype as _visatype import nidcpower.errors as errors import array import datetime import numbers from functools import singledispatch @singledispatch def _convert_repeated_capabilities(arg, prefix): raise errors.InvalidRepeatedCapabilityError('Invalid type', type(arg)) @_convert_repeated_capabilities.register(numbers.Integral) def _(repeated_capability, prefix): return [str(repeated_capability)] @_convert_repeated_capabilities.register(str) def _(repeated_capability, prefix): rep_cap_list = repeated_capability.split(',') if len(rep_cap_list) > 1: return _convert_repeated_capabilities(rep_cap_list, prefix) r = repeated_capability.strip().replace(prefix, '').replace(':', '-') rc = r.split('-') if len(rc) > 1: if len(rc) > 2: raise errors.InvalidRepeatedCapabilityError("Multiple '-' or ':'", repeated_capability) start = int(rc[0]) end = int(rc[1]) if end < start: rng = range(start, end - 1, -1) else: rng = range(start, end + 1) return _convert_repeated_capabilities(rng, prefix) return [repeated_capability.replace(prefix, '').strip()] @_convert_repeated_capabilities.register(list) @_convert_repeated_capabilities.register(range) @_convert_repeated_capabilities.register(tuple) def _(repeated_capability, prefix): rep_cap_list = [] for r in repeated_capability: rep_cap_list += _convert_repeated_capabilities(r, prefix) return rep_cap_list @_convert_repeated_capabilities.register(slice) def _(repeated_capability, prefix): def ifnone(a, b): return b if a is None else a rng = range(ifnone(repeated_capability.start, 0), repeated_capability.stop, ifnone(repeated_capability.step, 1)) return _convert_repeated_capabilities(rng, prefix) def convert_repeated_capabilities(repeated_capability, prefix=''): if repeated_capability is None: return [] return [prefix + r for r in _convert_repeated_capabilities(repeated_capability, prefix)] def convert_repeated_capabilities_from_init(repeated_capability): return ','.join(convert_repeated_capabilities(repeated_capability, '')) def _convert_timedelta(value, library_type, scaling): try: scaled_value = value.total_seconds() * scaling except AttributeError: # cast to float so scaled_value is always a float. This allows `timeout=10` to work as expected scaled_value = float(value) * scaling # ctype integer types don't convert to int from float so we need to if library_type in [_visatype.ViInt64, _visatype.ViInt32, _visatype.ViUInt32, _visatype.ViInt16, _visatype.ViUInt16, _visatype.ViInt8]: scaled_value = int(scaled_value) return library_type(scaled_value) def convert_timedelta_to_seconds_real64(value): return _convert_timedelta(value, _visatype.ViReal64, 1) def convert_timedelta_to_milliseconds_int32(value): return _convert_timedelta(value, _visatype.ViInt32, 1000) def convert_timedeltas_to_seconds_real64(values): return [convert_timedelta_to_seconds_real64(i) for i in values] def convert_seconds_real64_to_timedeltas(seconds): return [datetime.timedelta(seconds=i) for i in seconds] def convert_month_to_timedelta(months): return datetime.timedelta(days=(30.4167 * months)) def convert_init_with_options_dictionary(values): if type(values) is str: init_with_options_string = values else: good_keys = { 'rangecheck': 'RangeCheck', 'queryinstrstatus': 'QueryInstrStatus', 'cache': 'Cache', 'simulate': 'Simulate', 'recordcoercions': 'RecordCoercions', 'interchangecheck': 'InterchangeCheck', 'driversetup': 'DriverSetup', 'range_check': 'RangeCheck', 'query_instr_status': 'QueryInstrStatus', 'record_coercions': 'RecordCoercions', 'interchange_check': 'InterchangeCheck', 'driver_setup': 'DriverSetup', } init_with_options = [] for k in sorted(values.keys()): value = None if k.lower() in good_keys and not good_keys[k.lower()] == 'DriverSetup': value = good_keys[k.lower()] + ('=1' if values[k] is True else '=0') elif k.lower() in good_keys and good_keys[k.lower()] == 'DriverSetup': if not isinstance(values[k], dict): raise TypeError('DriverSetup must be a dictionary') value = 'DriverSetup=' + (';'.join([key + ':' + values[k][key] for key in sorted(values[k])])) else: value = k + ('=1' if values[k] is True else '=0') init_with_options.append(value) init_with_options_string = ','.join(init_with_options) return init_with_options_string @singledispatch def _convert_to_bytes(value): pass @_convert_to_bytes.register(list) @_convert_to_bytes.register(bytes) @_convert_to_bytes.register(bytearray) @_convert_to_bytes.register(array.array) def _(value): return value @_convert_to_bytes.register(str) def _(value): return value.encode() def convert_to_bytes(value): return bytes(_convert_to_bytes(value)) def test_convert_init_with_options_dictionary(): assert convert_init_with_options_dictionary('') == '' assert convert_init_with_options_dictionary('Simulate=1') == 'Simulate=1' assert convert_init_with_options_dictionary({'Simulate': True, }) == 'Simulate=1' assert convert_init_with_options_dictionary({'Simulate': False, }) == 'Simulate=0' assert convert_init_with_options_dictionary({'Simulate': True, 'Cache': False}) == 'Cache=0,Simulate=1' assert convert_init_with_options_dictionary({'DriverSetup': {'Model': '5162 (4CH)', 'Bitfile': 'CustomProcessing'}}) == 'DriverSetup=Bitfile:CustomProcessing;Model:5162 (4CH)' assert convert_init_with_options_dictionary({'Simulate': True, 'DriverSetup': {'Model': '5162 (4CH)', 'Bitfile': 'CustomProcessing'}}) == 'DriverSetup=Bitfile:CustomProcessing;Model:5162 (4CH),Simulate=1' assert convert_init_with_options_dictionary({'simulate': True, 'cache': False}) == 'Cache=0,Simulate=1' assert convert_init_with_options_dictionary({'driver_setup': {'Model': '5162 (4CH)', 'Bitfile': 'CustomProcessing'}}) == 'DriverSetup=Bitfile:CustomProcessing;Model:5162 (4CH)' assert convert_init_with_options_dictionary({'simulate': True, 'driver_setup': {'Model': '5162 (4CH)', 'Bitfile': 'CustomProcessing'}}) == 'DriverSetup=Bitfile:CustomProcessing;Model:5162 (4CH),Simulate=1' # Tests - time def test_convert_timedelta_to_seconds_double(): test_result = convert_timedelta_to_seconds_real64(datetime.timedelta(seconds=10)) assert test_result.value == 10.0 assert isinstance(test_result, _visatype.ViReal64) test_result = convert_timedelta_to_seconds_real64(datetime.timedelta(seconds=-1)) assert test_result.value == -1 assert isinstance(test_result, _visatype.ViReal64) test_result = convert_timedelta_to_seconds_real64(10.5) assert test_result.value == 10.5 assert isinstance(test_result, _visatype.ViReal64) test_result = convert_timedelta_to_seconds_real64(-1) assert test_result.value == -1 assert isinstance(test_result, _visatype.ViReal64) def test_convert_timedelta_to_milliseconds_int32(): test_result = convert_timedelta_to_milliseconds_int32(datetime.timedelta(seconds=10)) assert test_result.value == 10000 assert isinstance(test_result, _visatype.ViInt32) test_result = convert_timedelta_to_milliseconds_int32(datetime.timedelta(seconds=-1)) assert test_result.value == -1000 assert isinstance(test_result, _visatype.ViInt32) test_result = convert_timedelta_to_milliseconds_int32(10.5) assert test_result.value == 10500 assert isinstance(test_result, _visatype.ViInt32) test_result = convert_timedelta_to_milliseconds_int32(-1) assert test_result.value == -1000 assert isinstance(test_result, _visatype.ViInt32) def test_convert_timedeltas_to_seconds_real64(): time_values = [10.5, -1] test_result = convert_timedeltas_to_seconds_real64(time_values) assert all([actual.value == expected for actual, expected in zip(test_result, time_values)]) assert all([isinstance(i, _visatype.ViReal64) for i in test_result]) timedeltas = [datetime.timedelta(seconds=s, milliseconds=ms) for s, ms in zip([10, -1], [500, 0])] test_result = convert_timedeltas_to_seconds_real64(timedeltas) assert all([actual.value == expected for actual, expected in zip(test_result, time_values)]) assert all([isinstance(i, _visatype.ViReal64) for i in test_result]) def test_convert_seconds_real64_to_timedeltas(): time_values = [10.5, -1] timedeltas = convert_seconds_real64_to_timedeltas(time_values) assert all([actual.total_seconds() == expected for actual, expected in zip(timedeltas, time_values)]) # Tests - repeated capabilities def test_repeated_capabilies_string_channel(): test_result_list = convert_repeated_capabilities('0') assert test_result_list == ['0'] test_result_list = convert_repeated_capabilities('r0') assert test_result_list == ['r0'] test_result_list = convert_repeated_capabilities('0,1') assert test_result_list == ['0', '1'] def test_repeated_capabilies_string_prefix(): test_result_list = convert_repeated_capabilities('0', prefix='ScriptTrigger') assert test_result_list == ['ScriptTrigger0'] def test_repeated_capabilies_list_channel(): test_result_list = convert_repeated_capabilities(['0']) assert test_result_list == ['0'] test_result_list = convert_repeated_capabilities(['r0']) assert test_result_list == ['r0'] test_result_list = convert_repeated_capabilities(['0', '1']) assert test_result_list == ['0', '1'] test_result_list = convert_repeated_capabilities([0, 1]) assert test_result_list == ['0', '1'] test_result_list = convert_repeated_capabilities([0, 1, '3']) assert test_result_list == ['0', '1', '3'] def test_repeated_capabilies_list_prefix(): test_result_list = convert_repeated_capabilities(['ScriptTrigger0', 'ScriptTrigger1'], prefix='ScriptTrigger') assert test_result_list == ['ScriptTrigger0', 'ScriptTrigger1'] test_result_list = convert_repeated_capabilities(['0'], prefix='ScriptTrigger') assert test_result_list == ['ScriptTrigger0'] test_result_list = convert_repeated_capabilities(['0', '1'], prefix='ScriptTrigger') assert test_result_list == ['ScriptTrigger0', 'ScriptTrigger1'] test_result_list = convert_repeated_capabilities([0, 1], prefix='ScriptTrigger') assert test_result_list == ['ScriptTrigger0', 'ScriptTrigger1'] def test_repeated_capabilies_tuple_channel(): test_result_list = convert_repeated_capabilities(('0')) assert test_result_list == ['0'] test_result_list = convert_repeated_capabilities(('0,1')) assert test_result_list == ['0', '1'] test_result_list = convert_repeated_capabilities(('0', '1')) assert test_result_list == ['0', '1'] test_result_list = convert_repeated_capabilities((0, 1)) assert test_result_list == ['0', '1'] test_result_list = convert_repeated_capabilities((0, 1, '3')) assert test_result_list == ['0', '1', '3'] def test_repeated_capabilies_tuple_prefix(): test_result_list = convert_repeated_capabilities(('ScriptTrigger0,ScriptTrigger1'), prefix='ScriptTrigger') assert test_result_list == ['ScriptTrigger0', 'ScriptTrigger1'] test_result_list = convert_repeated_capabilities(('0'), prefix='ScriptTrigger') assert test_result_list == ['ScriptTrigger0'] test_result_list = convert_repeated_capabilities(('0', '1'), prefix='ScriptTrigger') assert test_result_list == ['ScriptTrigger0', 'ScriptTrigger1'] test_result_list = convert_repeated_capabilities((0, 1), prefix='ScriptTrigger') assert test_result_list == ['ScriptTrigger0', 'ScriptTrigger1'] def test_repeated_capabilies_unicode(): test_result_list = convert_repeated_capabilities(u'ScriptTrigger0,ScriptTrigger1', prefix='ScriptTrigger') assert test_result_list == ['ScriptTrigger0', 'ScriptTrigger1'] test_result_list = convert_repeated_capabilities(u'ScriptTrigger0,ScriptTrigger1', prefix=u'ScriptTrigger') assert test_result_list == ['ScriptTrigger0', 'ScriptTrigger1'] test_result_list = convert_repeated_capabilities('ScriptTrigger0,ScriptTrigger1', prefix=u'ScriptTrigger') assert test_result_list == ['ScriptTrigger0', 'ScriptTrigger1'] def test_repeated_capabilies_raw(): test_result_list = convert_repeated_capabilities(r'ScriptTrigger0,ScriptTrigger1', prefix='ScriptTrigger') assert test_result_list == ['ScriptTrigger0', 'ScriptTrigger1'] test_result_list = convert_repeated_capabilities(r'ScriptTrigger0,ScriptTrigger1', prefix=r'ScriptTrigger') assert test_result_list == ['ScriptTrigger0', 'ScriptTrigger1'] test_result_list = convert_repeated_capabilities('ScriptTrigger0,ScriptTrigger1', prefix=r'ScriptTrigger') assert test_result_list == ['ScriptTrigger0', 'ScriptTrigger1'] test_result_list = convert_repeated_capabilities(r'ScriptTrigger0,ScriptTrigger1', prefix=u'ScriptTrigger') assert test_result_list == ['ScriptTrigger0', 'ScriptTrigger1'] test_result_list = convert_repeated_capabilities(r'ScriptTrigger0,ScriptTrigger1', prefix=r'ScriptTrigger') assert test_result_list == ['ScriptTrigger0', 'ScriptTrigger1'] test_result_list = convert_repeated_capabilities(u'ScriptTrigger0,ScriptTrigger1', prefix=r'ScriptTrigger') assert test_result_list == ['ScriptTrigger0', 'ScriptTrigger1'] def test_repeated_capabilies_slice_channel(): test_result_list = convert_repeated_capabilities(slice(0, 1)) assert test_result_list == ['0'] test_result_list = convert_repeated_capabilities(slice(0, 2)) assert test_result_list == ['0', '1'] test_result_list = convert_repeated_capabilities(slice(None, 2)) assert test_result_list == ['0', '1'] def test_repeated_capabilies_mixed_channel(): test_result_list = convert_repeated_capabilities((slice(0, 1), '2', [4, '5-6'], '7-9', '11:14', '16, 17')) assert test_result_list == ['0', '2', '4', '5', '6', '7', '8', '9', '11', '12', '13', '14', '16', '17'] test_result_list = convert_repeated_capabilities([slice(0, 1), '2', [4, '5-6'], '7-9', '11:14', '16, 17']) assert test_result_list == ['0', '2', '4', '5', '6', '7', '8', '9', '11', '12', '13', '14', '16', '17'] def test_repeated_capabilies_mixed_prefix(): test_result_list = convert_repeated_capabilities((slice(0, 1), '2', [4, '5-6'], '7-9', '11:14', '16, 17'), prefix='ScriptTrigger') assert test_result_list == ['ScriptTrigger0', 'ScriptTrigger2', 'ScriptTrigger4', 'ScriptTrigger5', 'ScriptTrigger6', 'ScriptTrigger7', 'ScriptTrigger8', 'ScriptTrigger9', 'ScriptTrigger11', 'ScriptTrigger12', 'ScriptTrigger13', 'ScriptTrigger14', 'ScriptTrigger16', 'ScriptTrigger17'] test_result_list = convert_repeated_capabilities([slice(0, 1), '2', [4, '5-6'], '7-9', '11:14', '16, 17'], prefix='ScriptTrigger') assert test_result_list == ['ScriptTrigger0', 'ScriptTrigger2', 'ScriptTrigger4', 'ScriptTrigger5', 'ScriptTrigger6', 'ScriptTrigger7', 'ScriptTrigger8', 'ScriptTrigger9', 'ScriptTrigger11', 'ScriptTrigger12', 'ScriptTrigger13', 'ScriptTrigger14', 'ScriptTrigger16', 'ScriptTrigger17'] def test_invalid_repeated_capabilies(): try: convert_repeated_capabilities('6-8-10') assert False except errors.InvalidRepeatedCapabilityError: pass try: convert_repeated_capabilities(['5', '6-8-10']) assert False except errors.InvalidRepeatedCapabilityError: pass try: convert_repeated_capabilities(('5', '6-8-10')) assert False except errors.InvalidRepeatedCapabilityError: pass try: convert_repeated_capabilities('5,6-8-10') assert False except errors.InvalidRepeatedCapabilityError: pass try: convert_repeated_capabilities(5.0) assert False except errors.InvalidRepeatedCapabilityError: pass try: convert_repeated_capabilities([5.0, '0']) assert False except errors.InvalidRepeatedCapabilityError: pass try: convert_repeated_capabilities((5.0, '0')) assert False except errors.InvalidRepeatedCapabilityError: pass def test_repeated_capabilies_slice_prefix(): test_result_list = convert_repeated_capabilities(slice(0, 1), prefix='ScriptTrigger') assert test_result_list == ['ScriptTrigger0'] test_result_list = convert_repeated_capabilities(slice(0, 2), prefix='ScriptTrigger') assert test_result_list == ['ScriptTrigger0', 'ScriptTrigger1'] test_result_list = convert_repeated_capabilities(slice(None, 2), prefix='ScriptTrigger') assert test_result_list == ['ScriptTrigger0', 'ScriptTrigger1'] def test_repeated_capabilies_from_init(): test_result = convert_repeated_capabilities_from_init((slice(0, 1), '2', [4, '5-6'], '7-9', '11:14', '16, 17')) assert test_result == '0,2,4,5,6,7,8,9,11,12,13,14,16,17' def test_string_to_list_channel(): test_result = _convert_repeated_capabilities('r0', '') assert test_result == ['r0'] test_result = _convert_repeated_capabilities(['0-2'], '') assert test_result == ['0', '1', '2'] test_result = _convert_repeated_capabilities(['3:7'], '') assert test_result == ['3', '4', '5', '6', '7'] test_result = _convert_repeated_capabilities(['2-0'], '') assert test_result == ['2', '1', '0'] test_result = _convert_repeated_capabilities(['2:0'], '') assert test_result == ['2', '1', '0'] def test_string_to_list_prefix(): test_result = _convert_repeated_capabilities(['ScriptTrigger3-ScriptTrigger7'], 'ScriptTrigger') assert test_result == ['3', '4', '5', '6', '7'] test_result = _convert_repeated_capabilities(['ScriptTrigger3:ScriptTrigger7'], 'ScriptTrigger') assert test_result == ['3', '4', '5', '6', '7'] test_result = _convert_repeated_capabilities(['ScriptTrigger2-ScriptTrigger0'], 'ScriptTrigger') assert test_result == ['2', '1', '0'] test_result = _convert_repeated_capabilities(['ScriptTrigger2:ScriptTrigger0'], 'ScriptTrigger') assert test_result == ['2', '1', '0']
true
true
f72bc1b96d03b897b764119148a72447728fb58c
3,110
py
Python
DQMServices/Components/python/test/create_filePB_ref_cfg.py
nistefan/cmssw
ea13af97f7f2117a4f590a5e654e06ecd9825a5b
[ "Apache-2.0" ]
null
null
null
DQMServices/Components/python/test/create_filePB_ref_cfg.py
nistefan/cmssw
ea13af97f7f2117a4f590a5e654e06ecd9825a5b
[ "Apache-2.0" ]
null
null
null
DQMServices/Components/python/test/create_filePB_ref_cfg.py
nistefan/cmssw
ea13af97f7f2117a4f590a5e654e06ecd9825a5b
[ "Apache-2.0" ]
null
null
null
import FWCore.ParameterSet.Config as cms import DQMServices.Components.test.checkBooking as booking import DQMServices.Components.test.createElements as c import sys process = cms.Process("TEST") # load DQM process.load("DQMServices.Core.DQM_cfg") process.load("DQMServices.Components.DQMEnvironment_cfi") b = booking.BookingParams(sys.argv) b.doCheck(testOnly=False) process.maxEvents = cms.untracked.PSet(input = cms.untracked.int32(10)) process.source = cms.Source("EmptySource", firstLuminosityBlock = cms.untracked.uint32(1), firstEvent = cms.untracked.uint32(1), numberEventsInLuminosityBlock = cms.untracked.uint32(1)) elements = c.createElements() readRunElements = c.createReadRunElements() readLumiElements = c.createReadLumiElements() process.filler = cms.EDAnalyzer("DummyBookFillDQMStore" + b.mt_postfix(), folder = cms.untracked.string("TestFolder/"), elements = cms.untracked.VPSet(*elements), fillRuns = cms.untracked.bool(True), fillLumis = cms.untracked.bool(True), book_at_constructor = cms.untracked.bool(b.getBookLogic('CTOR')), book_at_beginJob = cms.untracked.bool(b.getBookLogic('BJ')), book_at_beginRun = cms.untracked.bool(b.getBookLogic('BR'))) process.out = cms.OutputModule("DQMRootOutputModule", fileName = cms.untracked.string("dqm_filePB_ref.root")) process.p = cms.Path(process.filler) process.o = cms.EndPath(process.out) process.schedule = cms.Schedule( process.p, process.o ) process.add_(cms.Service("DQMStore")) if b.multithread(): process.out.enableMultiThread = cms.untracked.bool(True) process.DQMStore.enableMultiThread = cms.untracked.bool(True) process.options = cms.untracked.PSet( numberOfThreads = cms.untracked.uint32(4), numberOfStreams = cms.untracked.uint32(4) ) if len(sys.argv) > 3: if sys.argv[3] == "ForceReset": print "Forcing Reset of histograms at every Run Transition." process.DQMStore.forceResetOnBeginRun = cms.untracked.bool(True) #----------------------------------------------------------# ### global options Online ### process.DQMStore.LSbasedMode = cms.untracked.bool(False) process.DQMStore.verbose = cms.untracked.int32(5) process.dqmSaver.workflow = '' process.dqmSaver.convention = 'FilterUnit' process.dqmSaver.saveByLumiSection = -1 process.dqmSaver.fileFormat = cms.untracked.string('ROOT') process.dqmSaver.fakeFilterUnitMode = cms.untracked.bool(True) #process.add_(cms.Service("Tracer"))
39.367089
196
0.586174
import FWCore.ParameterSet.Config as cms import DQMServices.Components.test.checkBooking as booking import DQMServices.Components.test.createElements as c import sys process = cms.Process("TEST") process.load("DQMServices.Core.DQM_cfg") process.load("DQMServices.Components.DQMEnvironment_cfi") b = booking.BookingParams(sys.argv) b.doCheck(testOnly=False) process.maxEvents = cms.untracked.PSet(input = cms.untracked.int32(10)) process.source = cms.Source("EmptySource", firstLuminosityBlock = cms.untracked.uint32(1), firstEvent = cms.untracked.uint32(1), numberEventsInLuminosityBlock = cms.untracked.uint32(1)) elements = c.createElements() readRunElements = c.createReadRunElements() readLumiElements = c.createReadLumiElements() process.filler = cms.EDAnalyzer("DummyBookFillDQMStore" + b.mt_postfix(), folder = cms.untracked.string("TestFolder/"), elements = cms.untracked.VPSet(*elements), fillRuns = cms.untracked.bool(True), fillLumis = cms.untracked.bool(True), book_at_constructor = cms.untracked.bool(b.getBookLogic('CTOR')), book_at_beginJob = cms.untracked.bool(b.getBookLogic('BJ')), book_at_beginRun = cms.untracked.bool(b.getBookLogic('BR'))) process.out = cms.OutputModule("DQMRootOutputModule", fileName = cms.untracked.string("dqm_filePB_ref.root")) process.p = cms.Path(process.filler) process.o = cms.EndPath(process.out) process.schedule = cms.Schedule( process.p, process.o ) process.add_(cms.Service("DQMStore")) if b.multithread(): process.out.enableMultiThread = cms.untracked.bool(True) process.DQMStore.enableMultiThread = cms.untracked.bool(True) process.options = cms.untracked.PSet( numberOfThreads = cms.untracked.uint32(4), numberOfStreams = cms.untracked.uint32(4) ) if len(sys.argv) > 3: if sys.argv[3] == "ForceReset": print "Forcing Reset of histograms at every Run Transition." process.DQMStore.forceResetOnBeginRun = cms.untracked.bool(True)
false
true
f72bc1d5aefbd73272c909b63fc43b86465f5c78
29,314
py
Python
tensor2tensor/layers/discretization.py
spacegoing/t2t_caps
ded708b738fa8966eb7544708c4a785479da4c3c
[ "Apache-2.0" ]
null
null
null
tensor2tensor/layers/discretization.py
spacegoing/t2t_caps
ded708b738fa8966eb7544708c4a785479da4c3c
[ "Apache-2.0" ]
null
null
null
tensor2tensor/layers/discretization.py
spacegoing/t2t_caps
ded708b738fa8966eb7544708c4a785479da4c3c
[ "Apache-2.0" ]
null
null
null
# coding=utf-8 # Copyright 2018 The Tensor2Tensor Authors. # # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. """Discretization bottlenecks used to train discrete latent variables.""" from __future__ import absolute_import from __future__ import division from __future__ import print_function from functools import partial # Dependency imports from tensor2tensor.layers import common_layers import tensorflow as tf from tensorflow.python.training import moving_averages def project_hidden(x, projection_tensors, hidden_size, num_blocks): """Project encoder hidden state into block_dim using projection tensors. Args: x: Encoder hidden state of shape [-1, hidden_size]. projection_tensors: Projection tensors used to project the hidden state. hidden_size: Dimension of the latent space. num_blocks: Number of blocks in DVQ. Returns: Projected states of shape [-1, num_blocks, block_dim]. """ x = tf.reshape(x, shape=[1, -1, hidden_size]) x_tiled = tf.reshape( tf.tile(x, multiples=[num_blocks, 1, 1]), shape=[num_blocks, -1, hidden_size]) x_projected = tf.matmul(x_tiled, projection_tensors) x_projected = tf.transpose(x_projected, perm=[1, 0, 2]) return x_projected def slice_hidden(x, hidden_size, num_blocks): """Slice encoder hidden state into block_dim. Args: x: Encoder hidden state of shape [-1, hidden_size]. hidden_size: Dimension of the latent space. num_blocks: Number of blocks in DVQ. Returns: Sliced states of shape [-1, num_blocks, block_dim]. """ block_dim = int(hidden_size // num_blocks) x_sliced = tf.reshape(x, shape=[-1, num_blocks, block_dim]) return x_sliced def nearest_neighbor(x, means, block_v_size, random_top_k=1, soft_em=False, num_samples=1): """Find the nearest element in means to elements in x. Args: x: Batch of encoder continuous latent states sliced/projected into shape [-1, num_blocks, block_dim]. means: Embedding table of shpae [num_blocks, block_v_size, block_dim]. block_v_size: Number of table entries per block. random_top_k: Noisy top-k if this is bigger than 1 (Default: 1). soft_em: If True then use soft EM rather than hard EM (Default: False). num_samples: Number of samples to take in soft EM (Default: 1). Returns: Tensor with nearest element in mean encoded in one-hot notation and distances. """ x_norm_sq = tf.reduce_sum(tf.square(x), axis=-1, keep_dims=True) means_norm_sq = tf.reduce_sum(tf.square(means), axis=-1, keep_dims=True) scalar_prod = tf.matmul( tf.transpose(x, perm=[1, 0, 2]), tf.transpose(means, perm=[0, 2, 1])) scalar_prod = tf.transpose(scalar_prod, perm=[1, 0, 2]) dist = x_norm_sq + tf.transpose( means_norm_sq, perm=[2, 0, 1]) - 2 * scalar_prod # computing cluster probabilities if soft_em: num_blocks = common_layers.shape_list(dist)[1] nearest_idx = tf.stack( [ tf.multinomial(-dist[:, i, :], num_samples=num_samples) for i in range(num_blocks) ], axis=1) nearest_hot = tf.one_hot(nearest_idx, depth=block_v_size) nearest_hot = tf.reduce_mean(nearest_hot, axis=-2) else: if random_top_k > 1: _, top_k_idx = tf.nn.top_k(-dist, k=random_top_k) nearest_idx = tf.gather( top_k_idx, tf.random_uniform( [1], minval=0, maxval=random_top_k - 1, dtype=tf.int32), axis=-1) else: nearest_idx = tf.argmax(-dist, axis=-1) nearest_hot = tf.one_hot(nearest_idx, block_v_size) return nearest_hot def embedding_lookup(x, means, num_blocks, block_v_size, random_top_k=1, soft_em=False, num_samples=1): """Compute nearest neighbors and loss for training the embeddings via DVQ. Args: x: Batch of encoder continuous latent states sliced/projected into shape [-1, num_blocks, block_dim]. means: Embedding table of shape [num_blocks, block_v_size, block_dim]. num_blocks: Number of blocks in DVQ. block_v_size: Number of table entries per block. random_top_k: Noisy top-k if this is bigger than 1 (Default: 1). soft_em: If True then use soft EM rather than hard EM (Default: False). num_samples: Number of samples to use for soft EM (Default: 1). Returns: The nearest neighbor in one hot form, the nearest neighbor itself, the commitment loss, embedding training loss and distances. """ x_means_hot = nearest_neighbor( x, means, block_v_size, random_top_k, soft_em=soft_em, num_samples=num_samples) x_means_hot_flat = tf.reshape(x_means_hot, [-1, num_blocks, block_v_size]) x_means = tf.matmul(tf.transpose(x_means_hot_flat, perm=[1, 0, 2]), means) x_means = tf.transpose(x_means, [1, 0, 2]) q_loss = tf.reduce_mean(tf.square((tf.stop_gradient(x) - x_means))) e_loss = tf.reduce_mean(tf.square(x - tf.stop_gradient(x_means))) return x_means_hot, x_means, q_loss, e_loss def bit_to_int(x_bit, num_bits, base=2): """Turn x_bit representing numbers bitwise (lower-endian) to int tensor. Args: x_bit: Tensor containing numbers in a particular base to be converted to int. num_bits: Number of bits in the representation. base: Base of the representation. Returns: Integer representation of this number. """ x_l = tf.stop_gradient(tf.to_int32(tf.reshape(x_bit, [-1, num_bits]))) x_labels = [] for i in range(num_bits): x_labels.append(x_l[:, i] * tf.to_int32(base)**tf.to_int32(i)) res = sum(x_labels) return tf.to_int32(tf.reshape(res, common_layers.shape_list(x_bit)[:-1])) def int_to_bit(x_int, num_bits, base=2): """Turn x_int representing numbers into a bitwise (lower-endian) tensor. Args: x_int: Tensor containing integer to be converted into base notation. num_bits: Number of bits in the representation. base: Base of the representation. Returns: Corresponding number expressed in base. """ x_l = tf.to_int32(tf.expand_dims(x_int, axis=-1)) x_labels = [] for i in range(num_bits): x_labels.append( tf.floormod( tf.floordiv(tf.to_int32(x_l), tf.to_int32(base)**i), tf.to_int32(base))) res = tf.concat(x_labels, axis=-1) return tf.to_float(res) def int_to_bit_embed(x_int, num_bits, embedding_size, base=2): """Turn x_int into a bitwise (lower-endian) tensor and embed densly.""" shape = common_layers.shape_list(x_int) inputs = int_to_bit(x_int, num_bits, base=base) inputs = tf.reshape(inputs, shape[:-1] + [shape[-1] * 8]) inputs = 2.0 * tf.to_float(inputs) - 1.0 # Move from 0/1 to -1/1. return tf.layers.dense(inputs, embedding_size, name="int_to_bit_embed") def embed(x, hidden_size, z_size, filter_size, name, bottleneck_kind="dvq", soft_em=False, num_blocks=2, num_residuals=1, block_v_size=None, means=None): """Embedding function that takes discrete latent and returns embedding. Args: x: Input to the discretization bottleneck. hidden_size: Dimension of the latent state. z_size: Number of bits used to produce discrete code; discrete codes range from 1 to 2**z_size. filter_size: Filter size to be used for the embedding function. name: Name for the bottleneck scope. bottleneck_kind: Kind of discretization bottleneck to use; one of dvq, semhash, gumbel-softmax (Default: dvq). soft_em: If True then it uses a multi-sample version of EM (Default: False). num_blocks: Number of blocks in DVQ (Default: 2). num_residuals: Number of residuals (Default: 1). block_v_size: Number of embedding entries per block (Default: None). means: The embedding table for dvq (Default: None). Returns: Continuous embedding to be passed on to the decoder. Raises: ValueError: For unknown or missing arguments. """ with tf.variable_scope(name, reuse=tf.AUTO_REUSE): if bottleneck_kind == "semhash": c = int_to_bit(x, z_size) h1a = tf.layers.dense(c, filter_size, name="vch1a") h1b = tf.layers.dense(1.0 - c, filter_size, name="vch1b") h1 = h1a + h1b elif bottleneck_kind == "gumbel-softmax": hot = tf.one_hot(x, 2**z_size) h1 = tf.layers.dense(hot, hidden_size, name="dae_dense") elif bottleneck_kind == "dvq": if block_v_size is None: raise ValueError("Bottleneck kind is dvq but block_v_size is None.") if soft_em: assert num_residuals == 1 x_hot_flat = tf.reshape(x, shape=[-1, num_blocks, block_v_size]) h1 = tf.matmul(tf.transpose(x_hot_flat, perm=[1, 0, 2]), means[0]) h1 = tf.transpose(h1, perm=[1, 0, 2]) new_shape = common_layers.shape_list(x) new_shape[-1] = hidden_size h1 = tf.reshape(h1, shape=new_shape) else: shape_x = common_layers.shape_list(x) x_flat = tf.reshape(x, [-1, 1]) c = int_to_bit(x_flat, num_bits=z_size, base=2) shape = common_layers.shape_list(c) new_shape = shape new_shape[-1] = num_residuals new_shape.append(num_blocks) new_shape.append(int(z_size / (num_residuals * num_blocks))) c = tf.to_int32(tf.reshape(c, shape=new_shape)) h1_shape = shape_x h1_shape.append(hidden_size) h1 = tf.zeros(dtype=tf.float32, shape=h1_shape) for i in range(num_residuals): c_residual = bit_to_int( c[:, :, i, :, :], num_bits=int(z_size / (num_residuals * num_blocks)), base=2) c_hot = tf.one_hot(c_residual, depth=block_v_size, axis=-1) c_hot_flat = tf.reshape(c_hot, shape=[-1, num_blocks, block_v_size]) h1_residual = tf.matmul( tf.transpose(c_hot_flat, perm=[1, 0, 2]), means[i]) h1_residual = tf.transpose(h1_residual, perm=[1, 0, 2]) h1_residual = tf.reshape(h1_residual, shape=h1_shape) h1 += h1_residual elif bottleneck_kind == "rounding": h1 = x else: raise ValueError("Unknown bottleneck kind.") h2 = tf.layers.dense(tf.nn.relu(h1), filter_size, name="vch2") return tf.layers.dense(tf.nn.relu(h2), hidden_size, name="vcfin") def vae(x, name, z_size): """Simple variational autoencoder without discretization. Args: x: Input to the discretization bottleneck. name: Name for the bottleneck scope. z_size: Number of bits used to produce discrete code; discrete codes range from 1 to 2**z_size. Returns: Embedding function, latent, loss, mu and log_simga. """ with tf.variable_scope(name): mu = tf.layers.dense(x, z_size, name="mu") log_sigma = tf.layers.dense(x, z_size, name="log_sigma") shape = common_layers.shape_list(x) epsilon = tf.random_normal([shape[0], shape[1], 1, z_size]) z = mu + tf.exp(log_sigma / 2) * epsilon kl = 0.5 * tf.reduce_mean( tf.exp(log_sigma) + tf.square(mu) - 1. - log_sigma, axis=-1) free_bits = z_size // 4 kl_loss = tf.reduce_mean(tf.maximum(kl - free_bits, 0.0)) return z, kl_loss, mu, log_sigma def top_k_softmax(x, k): """Calculate softmax(x), select top-k and rescale to sum to 1. Args: x: Input to softmax over. k: Number of top-k to select. Returns: softmax(x) and maximum item. """ x = tf.nn.softmax(x) top_x, _ = tf.nn.top_k(x, k=k + 1) min_top = tf.reduce_min(top_x, axis=-1, keep_dims=True) x = tf.nn.relu((x - min_top) + 1e-12) x /= tf.reduce_sum(x, axis=-1, keep_dims=True) return x, tf.reduce_max(top_x, axis=-1) def gumbel_sample(shape): """Sample from the Gumbel distribution, protect from overflows. Args: shape: Shape of Gumbel samples. Returns: Noise drawn from Gumbel distribution. """ uniform_samples = tf.random_uniform(shape, minval=0.00001, maxval=0.99998) return -tf.log(-tf.log(uniform_samples)) def gumbel_softmax(x, name, z_size, mode, softmax_k=0, kl_warmup_steps=150000, summary=True): """Gumbel softmax discretization bottleneck. Args: x: Input to the discretization bottleneck. name: Name for the bottleneck scope. z_size: Number of bits used to produce discrete code; discrete codes range from 1 to 2**z_size. mode: Mode represents whether we are training or testing for bottlenecks that differ in behavior (Default: None). softmax_k: If > 1 then do top-k softmax (Default: 0). kl_warmup_steps: Number of steps for kl warmup (Default: 150000). summary: If True, then write summaries (Default: True). Returns: Embedding function, discrete code and loss. """ with tf.variable_scope(name): m = tf.layers.dense(x, 2**z_size, name="mask") if softmax_k > 0: m, kl = top_k_softmax(m, softmax_k) return m, m, 1.0 - tf.reduce_mean(kl) logsm = tf.nn.log_softmax(m) # Gumbel-softmax sample. gumbel_samples = gumbel_sample(common_layers.shape_list(m)) steps = kl_warmup_steps gumbel_samples *= common_layers.inverse_exp_decay(steps // 5) * 0.5 temperature = 1.2 - common_layers.inverse_lin_decay(steps) # 10% of the time keep reasonably high temperature to keep learning. temperature = tf.cond( tf.less(tf.random_uniform([]), 0.9), lambda: temperature, lambda: tf.random_uniform([], minval=0.5, maxval=1.0)) s = tf.nn.softmax((logsm + gumbel_samples) / temperature) m = tf.nn.softmax(m) kl = -tf.reduce_max(logsm, axis=-1) if summary: tf.summary.histogram("max-log", tf.reshape(kl, [-1])) # Calculate the argmax and construct hot vectors. maxvec = tf.reshape(tf.argmax(m, axis=-1), [-1]) maxvhot = tf.stop_gradient(tf.one_hot(maxvec, 2**z_size)) # Add losses that prevent too few being used. distrib = tf.reshape(logsm, [-1, 2**z_size]) * maxvhot d_mean = tf.reduce_mean(distrib, axis=[0], keep_dims=True) d_variance = tf.reduce_mean(tf.square(distrib - d_mean), axis=[0]) d_dev = -tf.reduce_mean(d_variance) ret = s if mode != tf.contrib.learn.ModeKeys.TRAIN: ret = tf.reshape(maxvhot, common_layers.shape_list(s)) # Just hot @eval. return m, ret, d_dev * 5.0 + tf.reduce_mean(kl) * 0.002 def discrete_bottleneck(x, hidden_size, z_size, filter_size, name, mode=None, startup_steps=50000, bottleneck_kind="dvq", num_blocks=2, num_residuals=1, reshape_method="slice", projection_tensors=None, means=None, beta=0.25, noise_dev=1., decay=0.999, discrete_mix=0.5, random_top_k=1, soft_em=False, num_samples=1, epsilon=1e-5, softmax_k=0, kl_warmup_steps=150000, ema=True, ema_count=None, ema_means=None, summary=True): """Discretization bottleneck for latent variables. Args: x: Input to the discretization bottleneck. hidden_size: Dimension of the latent state. z_size: Number of bits used to produce discrete code; discrete codes range from 1 to 2**z_size. filter_size: Filter size to be used for the embedding function. name: Name for the bottleneck scope. mode: Mode represents whether we are training or testing for bottlenecks that differ in behavior (Default: None). startup_steps: Number of steps after which latent predictor is trained (Default: 50000). bottleneck_kind: Kind of discretization bottleneck to use; one of dvq, semhash, gumbel-softmax (Default: dvq). num_blocks: Number of blocks to use for decomposed vector quantization (Default: 2). num_residuals: Number of residual units used to compute nearest neighbors (Default: 1). reshape_method: Method to reshape for DVQ (Default: slice). projection_tensors: If the reshape method is project, then these are the tensors used to project (Default: None). means: The embedding table for dvq (Default: None). beta: Beta factor for the DVQ loss (Default: 0.25). noise_dev: Stddev for noise added for semhash (Default: 0). decay: Decay factor for the exponential moving average (Default: 0.999). discrete_mix: Factor for mixing discrete and non-discrete input for semhash (Default: 0.5). random_top_k: Noisy top-k for DVQ (Default: 1). soft_em: If True then use soft EM rather than hard EM (Default: False). num_samples: Number of samples for soft EM (Default: 1). epsilon: Epsilon parameter for DVQ (Default: 1e-5). softmax_k: If > 1 then do top-k softmax (Default: 0). kl_warmup_steps: Number of steps for kl warmup (Default: 150000). ema: If True update embeddings using exponential moving averages (Default: True). ema_count: Table of counts for each embedding corresponding to how many examples in a batch it was the closest to (Default: None). ema_means: Exponentially averaged version of the embeddings (Default: None). summary: If True, then write summaries (Default: True). Returns: Embedding to pass to the decoder, discrete latent, loss, and the embedding function. Raises: ValueError: If projection_tensors is None for reshape_method project, or ema_count or ema_means is None if we are using ema, or unknown args. """ block_v_size = None if bottleneck_kind == "dvq": # Define the dvq parameters assert means is not None # Check block dimensions add up if hidden_size % num_blocks != 0: raise ValueError("num_blocks does not divide hidden size") if z_size % num_residuals != 0: raise ValueError("num_residuals does not divide embedding table size") z_size_per_residual = int(z_size / num_residuals) if z_size_per_residual % num_blocks != 0: raise ValueError("num_blocks does not divide embedding table size") block_v_size = 2**(z_size_per_residual / num_blocks) block_v_size = int(block_v_size) # Set the reshape method corresponding to projections or slices if reshape_method == "slice": reshape_fn = partial( slice_hidden, hidden_size=hidden_size, num_blocks=num_blocks) elif reshape_method == "project": if projection_tensors is None: raise ValueError( "Projection tensors is None for reshape_method project") reshape_fn = partial( project_hidden, projection_tensors=projection_tensors, hidden_size=hidden_size, num_blocks=num_blocks) else: raise ValueError("Unknown reshape_method") # Check if the ema settings make sense if ema: if ema_count is None: raise ValueError("ema_count is None but ema is True") if ema_means is None: raise ValueError("ema_means is None but ema is True") with tf.variable_scope(name, reuse=tf.AUTO_REUSE): l = tf.constant(0.0) if bottleneck_kind == "dense": c = tf.layers.dense(x, z_size, name="vcc") h1 = tf.layers.dense(c, filter_size, name="vch1") elif bottleneck_kind == "vae": c, l, _, _ = vae(x, z_size, "vae") h1 = tf.layers.dense(c, filter_size, name="vch1") elif bottleneck_kind == "semhash": c = tf.layers.dense(x, z_size, name="vcc") y_clean = common_layers.saturating_sigmoid(c) if summary: tf.summary.histogram("y_clean", tf.reshape(y_clean, [-1])) if noise_dev > 0 and mode == tf.estimator.ModeKeys.TRAIN: noise = tf.truncated_normal( common_layers.shape_list(c), mean=0.0, stddev=noise_dev) y = common_layers.saturating_sigmoid(c + noise) else: y = y_clean d = tf.to_float(tf.less(0.5, y)) y_discrete = tf.stop_gradient(d) + y - tf.stop_gradient(y) pd = common_layers.inverse_exp_decay(startup_steps * 2) pd *= discrete_mix pd = pd if mode == tf.estimator.ModeKeys.TRAIN else 1.0 c = tf.where( tf.less(tf.random_uniform([common_layers.shape_list(y)[0]]), pd), y_discrete, y) h1a = tf.layers.dense(c, filter_size, name="vch1a") h1b = tf.layers.dense(1.0 - c, filter_size, name="vch1b") h1 = h1a + h1b dx = tf.to_int32(tf.stop_gradient(d)) c = bit_to_int(dx, z_size) elif bottleneck_kind == "gumbel-softmax": _, hot, l = gumbel_softmax(x, name, z_size, mode, softmax_k, kl_warmup_steps, summary) c = tf.argmax(hot, axis=-1) h1 = tf.layers.dense(hot, hidden_size, name="dae_dense") elif bottleneck_kind == "dvq": x_reshaped = reshape_fn(x) x_res = x_reshaped x_means_hot = [] x_means = 0 l = 0 for i in range(num_residuals): x_means_hot_res, x_means_res, q_loss_res, e_loss_res = embedding_lookup( x_res, means[i], num_blocks, block_v_size, random_top_k, soft_em, num_samples) # Update the ema variables if ema: tf.logging.info("Using EMA with beta = {}".format(beta)) updated_ema_count_res = moving_averages.assign_moving_average( ema_count[i], tf.reduce_sum( tf.reshape( x_means_hot_res, shape=[-1, num_blocks, block_v_size]), axis=0), decay, zero_debias=False) dw = tf.matmul( tf.transpose(x_means_hot_res, perm=[1, 2, 0]), tf.transpose(x_res, perm=[1, 0, 2])) updated_ema_means_res = moving_averages.assign_moving_average( ema_means[i], dw, decay, zero_debias=False) n = tf.reduce_sum(updated_ema_count_res, axis=-1, keep_dims=True) updated_ema_count_res = ((updated_ema_count_res + epsilon) / (n + 2**z_size * epsilon) * n) # pylint: disable=g-no-augmented-assignment updated_ema_means_res = updated_ema_means_res / tf.expand_dims( updated_ema_count_res, axis=-1) # pylint: enable=g-no-augmented-assignment with tf.control_dependencies([e_loss_res]): update_means_res = tf.assign(means[i], updated_ema_means_res) with tf.control_dependencies([update_means_res]): l += beta * e_loss_res else: l += q_loss_res + beta * e_loss_res # Update the residuals x_res -= x_means_res x_means += x_means_res x_means_hot.append(x_means_hot_res) # Get the discrete latent representation x_means_hot = tf.stack(x_means_hot, axis=1) x_means_idx = tf.argmax(x_means_hot, axis=-1) # Get the binary representation x_means_bits = int_to_bit( x_means_idx, num_bits=int(z_size / (num_residuals * num_blocks)), base=2) shape = common_layers.shape_list(x_means_bits) new_shape = shape[:-2] new_shape[-1] = z_size x_means_bits = tf.reshape(x_means_bits, shape=new_shape) c = bit_to_int(tf.to_int32(x_means_bits), num_bits=z_size, base=2) # Adjust shape of c shape_x = common_layers.shape_list(x) new_shape = shape_x[:-1] c = tf.reshape(c, new_shape) # If we are doing soft EM then c is x_means_hot if soft_em: c = x_means_hot new_shape.append(block_v_size) c = tf.reshape(c, new_shape) x_means = tf.reshape(x_means, shape_x) x_reshaped = tf.reshape(x_reshaped, shape_x) h1 = x_reshaped + tf.stop_gradient(x_means - x_reshaped) else: raise ValueError("Unknown discretization method.") h2 = tf.layers.dense(tf.nn.relu(h1), filter_size, name="vch2") res = tf.layers.dense(tf.nn.relu(h2), hidden_size, name="vcfin") embed_fn = partial( embed, hidden_size=hidden_size, z_size=z_size, filter_size=filter_size, name=name, bottleneck_kind=bottleneck_kind, soft_em=soft_em, num_blocks=num_blocks, num_residuals=num_residuals, block_v_size=block_v_size, means=means) return res, c, l, embed_fn # New API for discretization bottlenecks: # * Each method is separate and provides 2 functions: # * The [method]_bottleneck function returns discretized state. # * The [method]_unbottleneck function moves from discretized state to dense. def tanh_discrete_bottleneck(x, bottleneck_size, bottleneck_noise, discretize_warmup_steps, mode): """Simple discretization through tanh, flip bottleneck_noise many bits.""" x = tf.tanh(tf.layers.dense(x, bottleneck_size, name="tanh_discrete_bottleneck")) d = x + tf.stop_gradient(2.0 * tf.to_float(tf.less(0.0, x)) - 1.0 - x) if mode == tf.estimator.ModeKeys.TRAIN: noise = tf.random_uniform(common_layers.shape_list(x)) noise = 2.0 * tf.to_float(tf.less(bottleneck_noise, noise)) - 1.0 d *= noise d = common_layers.mix(d, x, discretize_warmup_steps, mode == tf.estimator.ModeKeys.TRAIN) return d def tanh_discrete_unbottleneck(x, hidden_size): """Simple un-discretization from tanh.""" x = tf.layers.dense(x, hidden_size, name="tanh_discrete_unbottleneck") return x def isemhash_bottleneck(x, bottleneck_size, bottleneck_noise, discretize_warmup_steps, mode, isemhash_noise_dev=0.5, isemhash_mix_prob=0.5): """Improved semantic hashing bottleneck.""" with tf.variable_scope("isemhash_bottleneck"): x = tf.layers.dense(x, bottleneck_size, name="dense") y = common_layers.saturating_sigmoid(x) if isemhash_noise_dev > 0 and mode == tf.estimator.ModeKeys.TRAIN: noise = tf.truncated_normal( common_layers.shape_list(x), mean=0.0, stddev=isemhash_noise_dev) y = common_layers.saturating_sigmoid(x + noise) d = tf.to_float(tf.less(0.5, y)) + y - tf.stop_gradient(y) d = 2.0 * d - 1.0 # Move from [0, 1] to [-1, 1]. if mode == tf.estimator.ModeKeys.TRAIN: # Flip some bits. noise = tf.random_uniform(common_layers.shape_list(x)) noise = 2.0 * tf.to_float(tf.less(bottleneck_noise, noise)) - 1.0 d *= noise d = common_layers.mix(d, 2.0 * y - 1.0, discretize_warmup_steps, mode == tf.estimator.ModeKeys.TRAIN, max_prob=isemhash_mix_prob) return d def isemhash_unbottleneck(x, hidden_size, isemhash_filter_size_multiplier=1.0): """Improved semantic hashing un-bottleneck.""" filter_size = int(hidden_size * isemhash_filter_size_multiplier) x = 0.5 * (x - 1.0) # Move from [-1, 1] to [0, 1]. with tf.variable_scope("isemhash_unbottleneck"): h1a = tf.layers.dense(x, filter_size, name="hidden1a") h1b = tf.layers.dense(1.0 - x, filter_size, name="hidden1b") h2 = tf.layers.dense(tf.nn.relu(h1a + h1b), filter_size, name="hidden2") return tf.layers.dense(tf.nn.relu(h2), hidden_size, name="final") def parametrized_bottleneck(x, hparams): """Meta-function calling all the above bottlenecks with hparams.""" if hparams.bottleneck_kind == "tanh_discrete": return tanh_discrete_bottleneck( x, hparams.bottleneck_size, hparams.bottleneck_noise * 0.5, hparams.discretize_warmup_steps, hparams.mode) if hparams.bottleneck_kind == "isemhash": return isemhash_bottleneck( x, hparams.bottleneck_size, hparams.bottleneck_noise * 0.5, hparams.discretize_warmup_steps, hparams.mode, hparams.isemhash_noise_dev, hparams.isemhash_mix_prob) raise ValueError("Unsupported hparams.bottleneck_kind %s" % hparams.bottleneck_kind) def parametrized_unbottleneck(x, hidden_size, hparams): """Meta-function calling all the above un-bottlenecks with hparams.""" if hparams.bottleneck_kind == "tanh_discrete": return tanh_discrete_unbottleneck(x, hidden_size) if hparams.bottleneck_kind == "isemhash": return isemhash_unbottleneck( x, hidden_size, hparams.isemhash_filter_size_multiplier) raise ValueError("Unsupported hparams.bottleneck_kind %s" % hparams.bottleneck_kind)
38.877984
80
0.651395
from __future__ import absolute_import from __future__ import division from __future__ import print_function from functools import partial from tensor2tensor.layers import common_layers import tensorflow as tf from tensorflow.python.training import moving_averages def project_hidden(x, projection_tensors, hidden_size, num_blocks): x = tf.reshape(x, shape=[1, -1, hidden_size]) x_tiled = tf.reshape( tf.tile(x, multiples=[num_blocks, 1, 1]), shape=[num_blocks, -1, hidden_size]) x_projected = tf.matmul(x_tiled, projection_tensors) x_projected = tf.transpose(x_projected, perm=[1, 0, 2]) return x_projected def slice_hidden(x, hidden_size, num_blocks): block_dim = int(hidden_size // num_blocks) x_sliced = tf.reshape(x, shape=[-1, num_blocks, block_dim]) return x_sliced def nearest_neighbor(x, means, block_v_size, random_top_k=1, soft_em=False, num_samples=1): x_norm_sq = tf.reduce_sum(tf.square(x), axis=-1, keep_dims=True) means_norm_sq = tf.reduce_sum(tf.square(means), axis=-1, keep_dims=True) scalar_prod = tf.matmul( tf.transpose(x, perm=[1, 0, 2]), tf.transpose(means, perm=[0, 2, 1])) scalar_prod = tf.transpose(scalar_prod, perm=[1, 0, 2]) dist = x_norm_sq + tf.transpose( means_norm_sq, perm=[2, 0, 1]) - 2 * scalar_prod if soft_em: num_blocks = common_layers.shape_list(dist)[1] nearest_idx = tf.stack( [ tf.multinomial(-dist[:, i, :], num_samples=num_samples) for i in range(num_blocks) ], axis=1) nearest_hot = tf.one_hot(nearest_idx, depth=block_v_size) nearest_hot = tf.reduce_mean(nearest_hot, axis=-2) else: if random_top_k > 1: _, top_k_idx = tf.nn.top_k(-dist, k=random_top_k) nearest_idx = tf.gather( top_k_idx, tf.random_uniform( [1], minval=0, maxval=random_top_k - 1, dtype=tf.int32), axis=-1) else: nearest_idx = tf.argmax(-dist, axis=-1) nearest_hot = tf.one_hot(nearest_idx, block_v_size) return nearest_hot def embedding_lookup(x, means, num_blocks, block_v_size, random_top_k=1, soft_em=False, num_samples=1): x_means_hot = nearest_neighbor( x, means, block_v_size, random_top_k, soft_em=soft_em, num_samples=num_samples) x_means_hot_flat = tf.reshape(x_means_hot, [-1, num_blocks, block_v_size]) x_means = tf.matmul(tf.transpose(x_means_hot_flat, perm=[1, 0, 2]), means) x_means = tf.transpose(x_means, [1, 0, 2]) q_loss = tf.reduce_mean(tf.square((tf.stop_gradient(x) - x_means))) e_loss = tf.reduce_mean(tf.square(x - tf.stop_gradient(x_means))) return x_means_hot, x_means, q_loss, e_loss def bit_to_int(x_bit, num_bits, base=2): x_l = tf.stop_gradient(tf.to_int32(tf.reshape(x_bit, [-1, num_bits]))) x_labels = [] for i in range(num_bits): x_labels.append(x_l[:, i] * tf.to_int32(base)**tf.to_int32(i)) res = sum(x_labels) return tf.to_int32(tf.reshape(res, common_layers.shape_list(x_bit)[:-1])) def int_to_bit(x_int, num_bits, base=2): x_l = tf.to_int32(tf.expand_dims(x_int, axis=-1)) x_labels = [] for i in range(num_bits): x_labels.append( tf.floormod( tf.floordiv(tf.to_int32(x_l), tf.to_int32(base)**i), tf.to_int32(base))) res = tf.concat(x_labels, axis=-1) return tf.to_float(res) def int_to_bit_embed(x_int, num_bits, embedding_size, base=2): shape = common_layers.shape_list(x_int) inputs = int_to_bit(x_int, num_bits, base=base) inputs = tf.reshape(inputs, shape[:-1] + [shape[-1] * 8]) inputs = 2.0 * tf.to_float(inputs) - 1.0 return tf.layers.dense(inputs, embedding_size, name="int_to_bit_embed") def embed(x, hidden_size, z_size, filter_size, name, bottleneck_kind="dvq", soft_em=False, num_blocks=2, num_residuals=1, block_v_size=None, means=None): with tf.variable_scope(name, reuse=tf.AUTO_REUSE): if bottleneck_kind == "semhash": c = int_to_bit(x, z_size) h1a = tf.layers.dense(c, filter_size, name="vch1a") h1b = tf.layers.dense(1.0 - c, filter_size, name="vch1b") h1 = h1a + h1b elif bottleneck_kind == "gumbel-softmax": hot = tf.one_hot(x, 2**z_size) h1 = tf.layers.dense(hot, hidden_size, name="dae_dense") elif bottleneck_kind == "dvq": if block_v_size is None: raise ValueError("Bottleneck kind is dvq but block_v_size is None.") if soft_em: assert num_residuals == 1 x_hot_flat = tf.reshape(x, shape=[-1, num_blocks, block_v_size]) h1 = tf.matmul(tf.transpose(x_hot_flat, perm=[1, 0, 2]), means[0]) h1 = tf.transpose(h1, perm=[1, 0, 2]) new_shape = common_layers.shape_list(x) new_shape[-1] = hidden_size h1 = tf.reshape(h1, shape=new_shape) else: shape_x = common_layers.shape_list(x) x_flat = tf.reshape(x, [-1, 1]) c = int_to_bit(x_flat, num_bits=z_size, base=2) shape = common_layers.shape_list(c) new_shape = shape new_shape[-1] = num_residuals new_shape.append(num_blocks) new_shape.append(int(z_size / (num_residuals * num_blocks))) c = tf.to_int32(tf.reshape(c, shape=new_shape)) h1_shape = shape_x h1_shape.append(hidden_size) h1 = tf.zeros(dtype=tf.float32, shape=h1_shape) for i in range(num_residuals): c_residual = bit_to_int( c[:, :, i, :, :], num_bits=int(z_size / (num_residuals * num_blocks)), base=2) c_hot = tf.one_hot(c_residual, depth=block_v_size, axis=-1) c_hot_flat = tf.reshape(c_hot, shape=[-1, num_blocks, block_v_size]) h1_residual = tf.matmul( tf.transpose(c_hot_flat, perm=[1, 0, 2]), means[i]) h1_residual = tf.transpose(h1_residual, perm=[1, 0, 2]) h1_residual = tf.reshape(h1_residual, shape=h1_shape) h1 += h1_residual elif bottleneck_kind == "rounding": h1 = x else: raise ValueError("Unknown bottleneck kind.") h2 = tf.layers.dense(tf.nn.relu(h1), filter_size, name="vch2") return tf.layers.dense(tf.nn.relu(h2), hidden_size, name="vcfin") def vae(x, name, z_size): with tf.variable_scope(name): mu = tf.layers.dense(x, z_size, name="mu") log_sigma = tf.layers.dense(x, z_size, name="log_sigma") shape = common_layers.shape_list(x) epsilon = tf.random_normal([shape[0], shape[1], 1, z_size]) z = mu + tf.exp(log_sigma / 2) * epsilon kl = 0.5 * tf.reduce_mean( tf.exp(log_sigma) + tf.square(mu) - 1. - log_sigma, axis=-1) free_bits = z_size // 4 kl_loss = tf.reduce_mean(tf.maximum(kl - free_bits, 0.0)) return z, kl_loss, mu, log_sigma def top_k_softmax(x, k): x = tf.nn.softmax(x) top_x, _ = tf.nn.top_k(x, k=k + 1) min_top = tf.reduce_min(top_x, axis=-1, keep_dims=True) x = tf.nn.relu((x - min_top) + 1e-12) x /= tf.reduce_sum(x, axis=-1, keep_dims=True) return x, tf.reduce_max(top_x, axis=-1) def gumbel_sample(shape): uniform_samples = tf.random_uniform(shape, minval=0.00001, maxval=0.99998) return -tf.log(-tf.log(uniform_samples)) def gumbel_softmax(x, name, z_size, mode, softmax_k=0, kl_warmup_steps=150000, summary=True): with tf.variable_scope(name): m = tf.layers.dense(x, 2**z_size, name="mask") if softmax_k > 0: m, kl = top_k_softmax(m, softmax_k) return m, m, 1.0 - tf.reduce_mean(kl) logsm = tf.nn.log_softmax(m) gumbel_samples = gumbel_sample(common_layers.shape_list(m)) steps = kl_warmup_steps gumbel_samples *= common_layers.inverse_exp_decay(steps // 5) * 0.5 temperature = 1.2 - common_layers.inverse_lin_decay(steps) temperature = tf.cond( tf.less(tf.random_uniform([]), 0.9), lambda: temperature, lambda: tf.random_uniform([], minval=0.5, maxval=1.0)) s = tf.nn.softmax((logsm + gumbel_samples) / temperature) m = tf.nn.softmax(m) kl = -tf.reduce_max(logsm, axis=-1) if summary: tf.summary.histogram("max-log", tf.reshape(kl, [-1])) maxvec = tf.reshape(tf.argmax(m, axis=-1), [-1]) maxvhot = tf.stop_gradient(tf.one_hot(maxvec, 2**z_size)) distrib = tf.reshape(logsm, [-1, 2**z_size]) * maxvhot d_mean = tf.reduce_mean(distrib, axis=[0], keep_dims=True) d_variance = tf.reduce_mean(tf.square(distrib - d_mean), axis=[0]) d_dev = -tf.reduce_mean(d_variance) ret = s if mode != tf.contrib.learn.ModeKeys.TRAIN: ret = tf.reshape(maxvhot, common_layers.shape_list(s)) return m, ret, d_dev * 5.0 + tf.reduce_mean(kl) * 0.002 def discrete_bottleneck(x, hidden_size, z_size, filter_size, name, mode=None, startup_steps=50000, bottleneck_kind="dvq", num_blocks=2, num_residuals=1, reshape_method="slice", projection_tensors=None, means=None, beta=0.25, noise_dev=1., decay=0.999, discrete_mix=0.5, random_top_k=1, soft_em=False, num_samples=1, epsilon=1e-5, softmax_k=0, kl_warmup_steps=150000, ema=True, ema_count=None, ema_means=None, summary=True): block_v_size = None if bottleneck_kind == "dvq": assert means is not None if hidden_size % num_blocks != 0: raise ValueError("num_blocks does not divide hidden size") if z_size % num_residuals != 0: raise ValueError("num_residuals does not divide embedding table size") z_size_per_residual = int(z_size / num_residuals) if z_size_per_residual % num_blocks != 0: raise ValueError("num_blocks does not divide embedding table size") block_v_size = 2**(z_size_per_residual / num_blocks) block_v_size = int(block_v_size) if reshape_method == "slice": reshape_fn = partial( slice_hidden, hidden_size=hidden_size, num_blocks=num_blocks) elif reshape_method == "project": if projection_tensors is None: raise ValueError( "Projection tensors is None for reshape_method project") reshape_fn = partial( project_hidden, projection_tensors=projection_tensors, hidden_size=hidden_size, num_blocks=num_blocks) else: raise ValueError("Unknown reshape_method") if ema: if ema_count is None: raise ValueError("ema_count is None but ema is True") if ema_means is None: raise ValueError("ema_means is None but ema is True") with tf.variable_scope(name, reuse=tf.AUTO_REUSE): l = tf.constant(0.0) if bottleneck_kind == "dense": c = tf.layers.dense(x, z_size, name="vcc") h1 = tf.layers.dense(c, filter_size, name="vch1") elif bottleneck_kind == "vae": c, l, _, _ = vae(x, z_size, "vae") h1 = tf.layers.dense(c, filter_size, name="vch1") elif bottleneck_kind == "semhash": c = tf.layers.dense(x, z_size, name="vcc") y_clean = common_layers.saturating_sigmoid(c) if summary: tf.summary.histogram("y_clean", tf.reshape(y_clean, [-1])) if noise_dev > 0 and mode == tf.estimator.ModeKeys.TRAIN: noise = tf.truncated_normal( common_layers.shape_list(c), mean=0.0, stddev=noise_dev) y = common_layers.saturating_sigmoid(c + noise) else: y = y_clean d = tf.to_float(tf.less(0.5, y)) y_discrete = tf.stop_gradient(d) + y - tf.stop_gradient(y) pd = common_layers.inverse_exp_decay(startup_steps * 2) pd *= discrete_mix pd = pd if mode == tf.estimator.ModeKeys.TRAIN else 1.0 c = tf.where( tf.less(tf.random_uniform([common_layers.shape_list(y)[0]]), pd), y_discrete, y) h1a = tf.layers.dense(c, filter_size, name="vch1a") h1b = tf.layers.dense(1.0 - c, filter_size, name="vch1b") h1 = h1a + h1b dx = tf.to_int32(tf.stop_gradient(d)) c = bit_to_int(dx, z_size) elif bottleneck_kind == "gumbel-softmax": _, hot, l = gumbel_softmax(x, name, z_size, mode, softmax_k, kl_warmup_steps, summary) c = tf.argmax(hot, axis=-1) h1 = tf.layers.dense(hot, hidden_size, name="dae_dense") elif bottleneck_kind == "dvq": x_reshaped = reshape_fn(x) x_res = x_reshaped x_means_hot = [] x_means = 0 l = 0 for i in range(num_residuals): x_means_hot_res, x_means_res, q_loss_res, e_loss_res = embedding_lookup( x_res, means[i], num_blocks, block_v_size, random_top_k, soft_em, num_samples) if ema: tf.logging.info("Using EMA with beta = {}".format(beta)) updated_ema_count_res = moving_averages.assign_moving_average( ema_count[i], tf.reduce_sum( tf.reshape( x_means_hot_res, shape=[-1, num_blocks, block_v_size]), axis=0), decay, zero_debias=False) dw = tf.matmul( tf.transpose(x_means_hot_res, perm=[1, 2, 0]), tf.transpose(x_res, perm=[1, 0, 2])) updated_ema_means_res = moving_averages.assign_moving_average( ema_means[i], dw, decay, zero_debias=False) n = tf.reduce_sum(updated_ema_count_res, axis=-1, keep_dims=True) updated_ema_count_res = ((updated_ema_count_res + epsilon) / (n + 2**z_size * epsilon) * n) updated_ema_means_res = updated_ema_means_res / tf.expand_dims( updated_ema_count_res, axis=-1) with tf.control_dependencies([e_loss_res]): update_means_res = tf.assign(means[i], updated_ema_means_res) with tf.control_dependencies([update_means_res]): l += beta * e_loss_res else: l += q_loss_res + beta * e_loss_res x_res -= x_means_res x_means += x_means_res x_means_hot.append(x_means_hot_res) x_means_hot = tf.stack(x_means_hot, axis=1) x_means_idx = tf.argmax(x_means_hot, axis=-1) x_means_bits = int_to_bit( x_means_idx, num_bits=int(z_size / (num_residuals * num_blocks)), base=2) shape = common_layers.shape_list(x_means_bits) new_shape = shape[:-2] new_shape[-1] = z_size x_means_bits = tf.reshape(x_means_bits, shape=new_shape) c = bit_to_int(tf.to_int32(x_means_bits), num_bits=z_size, base=2) shape_x = common_layers.shape_list(x) new_shape = shape_x[:-1] c = tf.reshape(c, new_shape) if soft_em: c = x_means_hot new_shape.append(block_v_size) c = tf.reshape(c, new_shape) x_means = tf.reshape(x_means, shape_x) x_reshaped = tf.reshape(x_reshaped, shape_x) h1 = x_reshaped + tf.stop_gradient(x_means - x_reshaped) else: raise ValueError("Unknown discretization method.") h2 = tf.layers.dense(tf.nn.relu(h1), filter_size, name="vch2") res = tf.layers.dense(tf.nn.relu(h2), hidden_size, name="vcfin") embed_fn = partial( embed, hidden_size=hidden_size, z_size=z_size, filter_size=filter_size, name=name, bottleneck_kind=bottleneck_kind, soft_em=soft_em, num_blocks=num_blocks, num_residuals=num_residuals, block_v_size=block_v_size, means=means) return res, c, l, embed_fn def tanh_discrete_bottleneck(x, bottleneck_size, bottleneck_noise, discretize_warmup_steps, mode): x = tf.tanh(tf.layers.dense(x, bottleneck_size, name="tanh_discrete_bottleneck")) d = x + tf.stop_gradient(2.0 * tf.to_float(tf.less(0.0, x)) - 1.0 - x) if mode == tf.estimator.ModeKeys.TRAIN: noise = tf.random_uniform(common_layers.shape_list(x)) noise = 2.0 * tf.to_float(tf.less(bottleneck_noise, noise)) - 1.0 d *= noise d = common_layers.mix(d, x, discretize_warmup_steps, mode == tf.estimator.ModeKeys.TRAIN) return d def tanh_discrete_unbottleneck(x, hidden_size): x = tf.layers.dense(x, hidden_size, name="tanh_discrete_unbottleneck") return x def isemhash_bottleneck(x, bottleneck_size, bottleneck_noise, discretize_warmup_steps, mode, isemhash_noise_dev=0.5, isemhash_mix_prob=0.5): with tf.variable_scope("isemhash_bottleneck"): x = tf.layers.dense(x, bottleneck_size, name="dense") y = common_layers.saturating_sigmoid(x) if isemhash_noise_dev > 0 and mode == tf.estimator.ModeKeys.TRAIN: noise = tf.truncated_normal( common_layers.shape_list(x), mean=0.0, stddev=isemhash_noise_dev) y = common_layers.saturating_sigmoid(x + noise) d = tf.to_float(tf.less(0.5, y)) + y - tf.stop_gradient(y) d = 2.0 * d - 1.0 if mode == tf.estimator.ModeKeys.TRAIN: noise = tf.random_uniform(common_layers.shape_list(x)) noise = 2.0 * tf.to_float(tf.less(bottleneck_noise, noise)) - 1.0 d *= noise d = common_layers.mix(d, 2.0 * y - 1.0, discretize_warmup_steps, mode == tf.estimator.ModeKeys.TRAIN, max_prob=isemhash_mix_prob) return d def isemhash_unbottleneck(x, hidden_size, isemhash_filter_size_multiplier=1.0): filter_size = int(hidden_size * isemhash_filter_size_multiplier) x = 0.5 * (x - 1.0) with tf.variable_scope("isemhash_unbottleneck"): h1a = tf.layers.dense(x, filter_size, name="hidden1a") h1b = tf.layers.dense(1.0 - x, filter_size, name="hidden1b") h2 = tf.layers.dense(tf.nn.relu(h1a + h1b), filter_size, name="hidden2") return tf.layers.dense(tf.nn.relu(h2), hidden_size, name="final") def parametrized_bottleneck(x, hparams): if hparams.bottleneck_kind == "tanh_discrete": return tanh_discrete_bottleneck( x, hparams.bottleneck_size, hparams.bottleneck_noise * 0.5, hparams.discretize_warmup_steps, hparams.mode) if hparams.bottleneck_kind == "isemhash": return isemhash_bottleneck( x, hparams.bottleneck_size, hparams.bottleneck_noise * 0.5, hparams.discretize_warmup_steps, hparams.mode, hparams.isemhash_noise_dev, hparams.isemhash_mix_prob) raise ValueError("Unsupported hparams.bottleneck_kind %s" % hparams.bottleneck_kind) def parametrized_unbottleneck(x, hidden_size, hparams): if hparams.bottleneck_kind == "tanh_discrete": return tanh_discrete_unbottleneck(x, hidden_size) if hparams.bottleneck_kind == "isemhash": return isemhash_unbottleneck( x, hidden_size, hparams.isemhash_filter_size_multiplier) raise ValueError("Unsupported hparams.bottleneck_kind %s" % hparams.bottleneck_kind)
true
true
f72bc2026dd2bf64e09da4b3d2a51aebf0adea83
5,122
py
Python
perfect_information_game/tablebases/symmetry_transform.py
amaarquadri/perfect-information-game
6755f9633935be762d039ece9c0b646c64de6ab8
[ "MIT" ]
null
null
null
perfect_information_game/tablebases/symmetry_transform.py
amaarquadri/perfect-information-game
6755f9633935be762d039ece9c0b646c64de6ab8
[ "MIT" ]
null
null
null
perfect_information_game/tablebases/symmetry_transform.py
amaarquadri/perfect-information-game
6755f9633935be762d039ece9c0b646c64de6ab8
[ "MIT" ]
null
null
null
import numpy as np from perfect_information_game.games import Chess from perfect_information_game.utils import iter_product from perfect_information_game.tablebases import get_verified_chess_subclass class SymmetryTransform: # noinspection PyChainedComparisons PAWNLESS_UNIQUE_SQUARE_INDICES = [(i, j) for i, j in iter_product(Chess.BOARD_SHAPE) if i < 4 and j < 4 and i <= j] UNIQUE_SQUARE_INDICES = [(i, j) for i, j in iter_product(Chess.BOARD_SHAPE) if j < 4] def __init__(self, GameClass, state): self.GameClass = get_verified_chess_subclass(GameClass) self.flip_colors = self.flip_i = self.flip_j = self.flip_diagonal = False if self.should_swap_colours(state): # black is attacking, so switch white and black self.flip_colors = True i, j = self.GameClass.get_king_pos(state, self.GameClass.BLACK_SLICE) i = self.GameClass.ROWS - 1 - i else: i, j = self.GameClass.get_king_pos(state, self.GameClass.WHITE_SLICE) pawnless = np.all(state[:, :, self.GameClass.WHITE_PAWN] == 0) and \ np.all(state[:, :, self.GameClass.BLACK_PAWN] == 0) if pawnless and not (i < 4): self.flip_i = True i = self.GameClass.ROWS - 1 - i if not (j < 4): # horizontal flipping can be done, even with pawns self.flip_j = True j = self.GameClass.COLUMNS - 1 - j if pawnless and not (i <= j): self.flip_diagonal = True def should_swap_colours(self, state): heuristic = self.GameClass.heuristic(state) if heuristic > 0: # white is up in material, so don't swap colours return False if heuristic < 0: # black is up in material, so swap colours return True # compare the number of pawns on each rank, from most advanced to least advanced pawns # no need to check second rank pawns, because if everything else is equal they must be equal too for rank in range(7, 2, -1): if np.sum(state[rank - 1, :, self.GameClass.BLACK_PAWN]) > \ np.sum(state[8 - rank, :, self.GameClass.WHITE_PAWN]): # black has more pawns than white on this rank, so swap colours return True return False @staticmethod def identity(GameClass): identity = SymmetryTransform(GameClass, GameClass.STARTING_STATE) identity.flip_colors = identity.flip_i = identity.flip_j = identity.flip_diagonal = False return identity @staticmethod def random(GameClass, descriptor): """ Returns a random symmetry transform for the given descriptor. """ random = SymmetryTransform.identity(GameClass) pawnless = 'p' not in descriptor and 'P' not in descriptor random.flip_colors = np.random.random() < 0.5 random.flip_j = np.random.random() < 0.5 if pawnless: random.flip_i = np.random.random() < 0.5 random.flip_diagonal = np.random.random() < 0.5 return random def is_identity(self): return not self.flip_colors and not self.flip_i and not self.flip_j and not self.flip_diagonal def transform_state(self, state): if self.flip_colors: state = self.flip_state_colors(self.GameClass, state) if self.flip_i: state = self.flip_state_i(state) if self.flip_j: state = self.flip_state_j(state) if self.flip_diagonal: state = self.flip_state_diagonal(state) return state def untransform_state(self, state): # since all transform_funcs are their own inverses, we can just run through them in reverse if self.flip_diagonal: state = self.flip_state_diagonal(state) if self.flip_j: state = self.flip_state_j(state) if self.flip_i: state = self.flip_state_i(state) if self.flip_colors: state = self.flip_state_colors(self.GameClass, state) return state def transform_outcome(self, outcome): return -outcome if self.flip_colors else outcome @staticmethod def flip_state_colors(GameClass, state): special_layers = np.copy(state[..., -2:]) special_layers[..., -1] = 1 - special_layers[..., -1] # flip whose turn it is new_state = np.concatenate((state[..., GameClass.BLACK_SLICE], state[..., GameClass.WHITE_SLICE], special_layers), axis=-1) # need to flip board vertically after flipping colours # this ensures that the pawns move in the correct directions return SymmetryTransform.flip_state_i(new_state) @staticmethod def flip_state_i(state): return np.flip(state, axis=0) @staticmethod def flip_state_j(state): return np.flip(state, axis=1) @staticmethod def flip_state_diagonal(state): return np.rot90(np.flip(state, axis=1), axes=(0, 1))
40.650794
105
0.625927
import numpy as np from perfect_information_game.games import Chess from perfect_information_game.utils import iter_product from perfect_information_game.tablebases import get_verified_chess_subclass class SymmetryTransform: PAWNLESS_UNIQUE_SQUARE_INDICES = [(i, j) for i, j in iter_product(Chess.BOARD_SHAPE) if i < 4 and j < 4 and i <= j] UNIQUE_SQUARE_INDICES = [(i, j) for i, j in iter_product(Chess.BOARD_SHAPE) if j < 4] def __init__(self, GameClass, state): self.GameClass = get_verified_chess_subclass(GameClass) self.flip_colors = self.flip_i = self.flip_j = self.flip_diagonal = False if self.should_swap_colours(state): self.flip_colors = True i, j = self.GameClass.get_king_pos(state, self.GameClass.BLACK_SLICE) i = self.GameClass.ROWS - 1 - i else: i, j = self.GameClass.get_king_pos(state, self.GameClass.WHITE_SLICE) pawnless = np.all(state[:, :, self.GameClass.WHITE_PAWN] == 0) and \ np.all(state[:, :, self.GameClass.BLACK_PAWN] == 0) if pawnless and not (i < 4): self.flip_i = True i = self.GameClass.ROWS - 1 - i if not (j < 4): self.flip_j = True j = self.GameClass.COLUMNS - 1 - j if pawnless and not (i <= j): self.flip_diagonal = True def should_swap_colours(self, state): heuristic = self.GameClass.heuristic(state) if heuristic > 0: return False if heuristic < 0: # black is up in material, so swap colours return True # compare the number of pawns on each rank, from most advanced to least advanced pawns # no need to check second rank pawns, because if everything else is equal they must be equal too for rank in range(7, 2, -1): if np.sum(state[rank - 1, :, self.GameClass.BLACK_PAWN]) > \ np.sum(state[8 - rank, :, self.GameClass.WHITE_PAWN]): # black has more pawns than white on this rank, so swap colours return True return False @staticmethod def identity(GameClass): identity = SymmetryTransform(GameClass, GameClass.STARTING_STATE) identity.flip_colors = identity.flip_i = identity.flip_j = identity.flip_diagonal = False return identity @staticmethod def random(GameClass, descriptor): random = SymmetryTransform.identity(GameClass) pawnless = 'p' not in descriptor and 'P' not in descriptor random.flip_colors = np.random.random() < 0.5 random.flip_j = np.random.random() < 0.5 if pawnless: random.flip_i = np.random.random() < 0.5 random.flip_diagonal = np.random.random() < 0.5 return random def is_identity(self): return not self.flip_colors and not self.flip_i and not self.flip_j and not self.flip_diagonal def transform_state(self, state): if self.flip_colors: state = self.flip_state_colors(self.GameClass, state) if self.flip_i: state = self.flip_state_i(state) if self.flip_j: state = self.flip_state_j(state) if self.flip_diagonal: state = self.flip_state_diagonal(state) return state def untransform_state(self, state): # since all transform_funcs are their own inverses, we can just run through them in reverse if self.flip_diagonal: state = self.flip_state_diagonal(state) if self.flip_j: state = self.flip_state_j(state) if self.flip_i: state = self.flip_state_i(state) if self.flip_colors: state = self.flip_state_colors(self.GameClass, state) return state def transform_outcome(self, outcome): return -outcome if self.flip_colors else outcome @staticmethod def flip_state_colors(GameClass, state): special_layers = np.copy(state[..., -2:]) special_layers[..., -1] = 1 - special_layers[..., -1] # flip whose turn it is new_state = np.concatenate((state[..., GameClass.BLACK_SLICE], state[..., GameClass.WHITE_SLICE], special_layers), axis=-1) # need to flip board vertically after flipping colours # this ensures that the pawns move in the correct directions return SymmetryTransform.flip_state_i(new_state) @staticmethod def flip_state_i(state): return np.flip(state, axis=0) @staticmethod def flip_state_j(state): return np.flip(state, axis=1) @staticmethod def flip_state_diagonal(state): return np.rot90(np.flip(state, axis=1), axes=(0, 1))
true
true
f72bc25c098c14f516c7757477bbf04b559e5b10
8,291
py
Python
custom_components/dahua/config_flow.py
ikke-zelf/dahua
9fca03b3d0caf5661efee7d71668a838b0478587
[ "MIT" ]
null
null
null
custom_components/dahua/config_flow.py
ikke-zelf/dahua
9fca03b3d0caf5661efee7d71668a838b0478587
[ "MIT" ]
null
null
null
custom_components/dahua/config_flow.py
ikke-zelf/dahua
9fca03b3d0caf5661efee7d71668a838b0478587
[ "MIT" ]
null
null
null
"""Adds config flow (UI flow) for Dahua IP cameras.""" import logging import voluptuous as vol from homeassistant import config_entries from homeassistant.core import callback from homeassistant.helpers.aiohttp_client import async_create_clientsession from homeassistant.helpers import config_validation as cv from .client import DahuaClient from .const import ( CONF_PASSWORD, CONF_USERNAME, CONF_ADDRESS, CONF_RTSP_PORT, CONF_PORT, CONF_STREAMS, CONF_EVENTS, CONF_NAME, STREAM_MAIN, STREAM_SUB, STREAM_BOTH, DOMAIN, PLATFORMS, ) from .rpc2 import DahuaRpc2Client """ https://developers.home-assistant.io/docs/config_entries_config_flow_handler https://developers.home-assistant.io/docs/data_entry_flow_index/ """ _LOGGER: logging.Logger = logging.getLogger(__package__) STREAMS = [STREAM_MAIN, STREAM_SUB, STREAM_BOTH] DEFAULT_EVENTS = ["VideoMotion", "CrossLineDetection", "AlarmLocal", "VideoLoss", "VideoBlind"] ALL_EVENTS = ["VideoMotion", "VideoLoss", "AlarmLocal", "CrossLineDetection", "AudioAnomaly", "AudioMutation", "VideoMotionInfo", "SmartMotionHuman", "SmartMotionVehicle", "NewFile", "VideoBlind", "IntelliFrame", "CrossRegionDetection", "LeftDetection", "TakenAwayDetection", "VideoAbnormalDetection", "FaceDetection", "VideoUnFocus", "WanderDetection", "RioterDetection", "ParkingDetection", "MoveDetection", "StorageNotExist", "StorageFailure", "StorageLowSpace", "AlarmOutput", "InterVideoAccess", "NTPAdjustTime", "TimeChange", "MDResult", "HeatImagingTemper", "CrowdDetection", "FireWarning", "FireWarningInfo", ] """ https://developers.home-assistant.io/docs/data_entry_flow_index """ class DahuaFlowHandler(config_entries.ConfigFlow, domain=DOMAIN): """Config flow for Dahua Camera API.""" VERSION = 1 CONNECTION_CLASS = config_entries.CONN_CLASS_LOCAL_POLL def __init__(self): """Initialize.""" self.dahua_config = {} self._errors = {} self.init_info = None async def async_step_user(self, user_input=None): """Handle a flow initialized by the user to add a camera.""" self._errors = {} # Uncomment the next 2 lines if only a single instance of the integration is allowed: # if self._async_current_entries(): # return self.async_abort(reason="single_instance_allowed") if user_input is not None: data = await self._test_credentials( user_input[CONF_USERNAME], user_input[CONF_PASSWORD], user_input[CONF_ADDRESS], user_input[CONF_PORT], user_input[CONF_RTSP_PORT], ) if data is not None: # Only allow a camera to be setup once if "serialNumber" in data and data["serialNumber"] is not None: await self.async_set_unique_id(data["serialNumber"]) self._abort_if_unique_id_configured() user_input[CONF_NAME] = data["name"] self.init_info = user_input return await self._show_config_form_name(user_input) else: self._errors["base"] = "auth" return await self._show_config_form_user(user_input) async def async_step_name(self, user_input=None): """Handle a flow to configure the camera name.""" self._errors = {} if user_input is not None: if self.init_info is not None: self.init_info.update(user_input) return self.async_create_entry( title=self.init_info["name"], data=self.init_info, ) return await self._show_config_form_name(user_input) @staticmethod @callback def async_get_options_flow(config_entry): return DahuaOptionsFlowHandler(config_entry) async def _show_config_form_user(self, user_input): # pylint: disable=unused-argument """Show the configuration form to edit camera name.""" return self.async_show_form( step_id="user", data_schema=vol.Schema( { vol.Required(CONF_USERNAME): str, vol.Required(CONF_PASSWORD): str, vol.Required(CONF_ADDRESS): str, vol.Required(CONF_PORT, default="80"): str, vol.Required(CONF_RTSP_PORT, default="554"): str, vol.Required(CONF_STREAMS, default=STREAMS[0]): vol.In(STREAMS), vol.Optional(CONF_EVENTS, default=DEFAULT_EVENTS): cv.multi_select(ALL_EVENTS), } ), errors=self._errors, ) async def _show_config_form_name(self, user_input): # pylint: disable=unused-argument """Show the configuration form to edit location data.""" return self.async_show_form( step_id="name", data_schema=vol.Schema( { vol.Required(CONF_NAME, default=user_input[CONF_NAME]): str, } ), errors=self._errors, ) async def _test_credentials(self, username, password, address, port, rtsp_port): """Return name and serialNumber if credentials is valid.""" session = async_create_clientsession(self.hass) try: # The long term goal is to migrate to the DahuaRpc2Client client and remove the DahuaClient # Testing this out via login to see how it goes client = DahuaRpc2Client(username, password, address, port, rtsp_port, session) await client.login() _LOGGER.info("Authenticated with the RPC2 API") name = await client.get_device_name() serial = await client.get_serial_number() await client.logout() return { "name": name, "serialNumber": serial, } except Exception: # pylint: disable=broad-except _LOGGER.warning("Could not connect to Dahua device via the RPC2 API, falling back to cgi") try: client2 = DahuaClient(username, password, address, port, rtsp_port, session) data = await client2.get_machine_name() serial = await client2.async_get_system_info() data.update(serial) if "name" in data: return data except Exception as exception: # pylint: disable=broad-except _LOGGER.warning("Could not connect to Dahua device", exc_info=exception) return None class DahuaOptionsFlowHandler(config_entries.OptionsFlow): """Dahua config flow options handler.""" def __init__(self, config_entry): """Initialize HACS options flow.""" self.config_entry = config_entry self.options = dict(config_entry.options) async def async_step_init(self, user_input=None): # pylint: disable=unused-argument """Manage the options.""" return await self.async_step_user() async def async_step_user(self, user_input=None): """Handle a flow initialized by the user.""" if user_input is not None: self.options.update(user_input) return await self._update_options() return self.async_show_form( step_id="user", data_schema=vol.Schema( { vol.Required(x, default=self.options.get(x, True)): bool for x in sorted(PLATFORMS) } ), ) async def _update_options(self): """Update config entry options.""" return self.async_create_entry( title=self.config_entry.data.get(CONF_USERNAME), data=self.options )
34.983122
103
0.592329
import logging import voluptuous as vol from homeassistant import config_entries from homeassistant.core import callback from homeassistant.helpers.aiohttp_client import async_create_clientsession from homeassistant.helpers import config_validation as cv from .client import DahuaClient from .const import ( CONF_PASSWORD, CONF_USERNAME, CONF_ADDRESS, CONF_RTSP_PORT, CONF_PORT, CONF_STREAMS, CONF_EVENTS, CONF_NAME, STREAM_MAIN, STREAM_SUB, STREAM_BOTH, DOMAIN, PLATFORMS, ) from .rpc2 import DahuaRpc2Client _LOGGER: logging.Logger = logging.getLogger(__package__) STREAMS = [STREAM_MAIN, STREAM_SUB, STREAM_BOTH] DEFAULT_EVENTS = ["VideoMotion", "CrossLineDetection", "AlarmLocal", "VideoLoss", "VideoBlind"] ALL_EVENTS = ["VideoMotion", "VideoLoss", "AlarmLocal", "CrossLineDetection", "AudioAnomaly", "AudioMutation", "VideoMotionInfo", "SmartMotionHuman", "SmartMotionVehicle", "NewFile", "VideoBlind", "IntelliFrame", "CrossRegionDetection", "LeftDetection", "TakenAwayDetection", "VideoAbnormalDetection", "FaceDetection", "VideoUnFocus", "WanderDetection", "RioterDetection", "ParkingDetection", "MoveDetection", "StorageNotExist", "StorageFailure", "StorageLowSpace", "AlarmOutput", "InterVideoAccess", "NTPAdjustTime", "TimeChange", "MDResult", "HeatImagingTemper", "CrowdDetection", "FireWarning", "FireWarningInfo", ] class DahuaFlowHandler(config_entries.ConfigFlow, domain=DOMAIN): VERSION = 1 CONNECTION_CLASS = config_entries.CONN_CLASS_LOCAL_POLL def __init__(self): self.dahua_config = {} self._errors = {} self.init_info = None async def async_step_user(self, user_input=None): self._errors = {} if user_input is not None: data = await self._test_credentials( user_input[CONF_USERNAME], user_input[CONF_PASSWORD], user_input[CONF_ADDRESS], user_input[CONF_PORT], user_input[CONF_RTSP_PORT], ) if data is not None: if "serialNumber" in data and data["serialNumber"] is not None: await self.async_set_unique_id(data["serialNumber"]) self._abort_if_unique_id_configured() user_input[CONF_NAME] = data["name"] self.init_info = user_input return await self._show_config_form_name(user_input) else: self._errors["base"] = "auth" return await self._show_config_form_user(user_input) async def async_step_name(self, user_input=None): self._errors = {} if user_input is not None: if self.init_info is not None: self.init_info.update(user_input) return self.async_create_entry( title=self.init_info["name"], data=self.init_info, ) return await self._show_config_form_name(user_input) @staticmethod @callback def async_get_options_flow(config_entry): return DahuaOptionsFlowHandler(config_entry) async def _show_config_form_user(self, user_input): return self.async_show_form( step_id="user", data_schema=vol.Schema( { vol.Required(CONF_USERNAME): str, vol.Required(CONF_PASSWORD): str, vol.Required(CONF_ADDRESS): str, vol.Required(CONF_PORT, default="80"): str, vol.Required(CONF_RTSP_PORT, default="554"): str, vol.Required(CONF_STREAMS, default=STREAMS[0]): vol.In(STREAMS), vol.Optional(CONF_EVENTS, default=DEFAULT_EVENTS): cv.multi_select(ALL_EVENTS), } ), errors=self._errors, ) async def _show_config_form_name(self, user_input): return self.async_show_form( step_id="name", data_schema=vol.Schema( { vol.Required(CONF_NAME, default=user_input[CONF_NAME]): str, } ), errors=self._errors, ) async def _test_credentials(self, username, password, address, port, rtsp_port): session = async_create_clientsession(self.hass) try: client = DahuaRpc2Client(username, password, address, port, rtsp_port, session) await client.login() _LOGGER.info("Authenticated with the RPC2 API") name = await client.get_device_name() serial = await client.get_serial_number() await client.logout() return { "name": name, "serialNumber": serial, } except Exception: _LOGGER.warning("Could not connect to Dahua device via the RPC2 API, falling back to cgi") try: client2 = DahuaClient(username, password, address, port, rtsp_port, session) data = await client2.get_machine_name() serial = await client2.async_get_system_info() data.update(serial) if "name" in data: return data except Exception as exception: _LOGGER.warning("Could not connect to Dahua device", exc_info=exception) return None class DahuaOptionsFlowHandler(config_entries.OptionsFlow): def __init__(self, config_entry): self.config_entry = config_entry self.options = dict(config_entry.options) async def async_step_init(self, user_input=None): return await self.async_step_user() async def async_step_user(self, user_input=None): if user_input is not None: self.options.update(user_input) return await self._update_options() return self.async_show_form( step_id="user", data_schema=vol.Schema( { vol.Required(x, default=self.options.get(x, True)): bool for x in sorted(PLATFORMS) } ), ) async def _update_options(self): return self.async_create_entry( title=self.config_entry.data.get(CONF_USERNAME), data=self.options )
true
true
f72bc3b606d3adbd104ee19fb8f0f98ea61cc6ed
36,568
py
Python
python/avi/migrationtools/ace_converter/ace_parser.py
Crypto89/sdk
56c48329b7ced2c56b7c92aa40bb52efb5f2e6c0
[ "Apache-2.0" ]
4
2017-06-16T18:51:52.000Z
2020-02-11T15:22:42.000Z
vendor/github.com/avinetworks/sdk/python/avi/migrationtools/ace_converter/ace_parser.py
sudswasavi/servicemesh
4f07c228e9b62c9b621cb0bfc464c75e85351f7f
[ "Apache-2.0" ]
17
2019-01-11T05:57:35.000Z
2019-08-29T05:33:38.000Z
vendor/github.com/avinetworks/sdk/python/avi/migrationtools/ace_converter/ace_parser.py
sudswasavi/servicemesh
4f07c228e9b62c9b621cb0bfc464c75e85351f7f
[ "Apache-2.0" ]
8
2017-06-26T18:15:58.000Z
2021-04-12T08:09:03.000Z
import os import sys import logging from pyparsing import Keyword, Word, OneOrMore, printables, Group, nums,\ alphas, ZeroOrMore, Optional, Combine, QuotedString, restOfLine from itertools import cycle from avi.migrationtools.ace_converter.ace_utils import printProgressBar,\ set_excel_dict LOG = logging.getLogger(__name__) def create_ace_grammer(): """ This function creates grammer for ace configuration parsing. :return grammer for parsing """ # Pyparsing grammer starts here :excitement :-O command = Group(Keyword('logging') | Keyword( 'access-list') | Keyword('probe')) # Grammer Global name = Word(printables) ipaddress = Combine(Word(nums) + ('.' + Word(nums)) * 3) num = Word(nums) # Grammer 1: # logging enable # logging timestamp # logging trap 9 # logging buffered 9 # logging host 127.0.0.1 udp/619 log = Keyword('logging') single_key = Keyword('enable') | Keyword('timestamp') double_key = (Keyword('trap') | Keyword('buffered')) + num triple_key = Keyword('host') + ipaddress + name grammer_1 = Group(log + (single_key | double_key | triple_key)) # Grammer 2: # eg : access-list FROM_INSIDE line 11 extended permit ip <ip> 255.255.255.0 any access = Keyword('access-list') in_out = Keyword('FROM_INSIDE') | Keyword('FROM_OUTSIDE') line = Keyword('line') extend = Keyword('extended') permit = Keyword('permit') ip_key = Keyword('ip') any_key = Keyword('any') ip_any = ipaddress | any_key grammer_2 = Group(access + in_out + line + num + extend + permit + ip_key + ip_any + ip_any + ip_any) # Grammer 3: # eg: probe http prb_HTTP-1234 # port 1234 # receive 5 # interval 10 # expect status 200 200 # expect regex "(200|302)" # ssl version all # request method get url /test/test:ping # passdetect interval 10 # open 3 probe = Keyword('probe') type_key = Keyword('http') | Keyword( 'icmp') | Keyword('https') | Keyword('tcp') grammer_3_1 = Group(probe + type_key + name) grammer_3_2 = Group(Keyword('port') + Word(nums)) grammer_3_3 = Group(Keyword('receive') + Word(nums)) grammer_3_4 = Group(Keyword('interval') + Word(nums)) grammer_3_5 = Group((Keyword('expect') + Keyword('status') + Word(nums) + Word(nums)) | (Keyword('expect') + Keyword('regex') + Word(printables))) # grammer_3_6 = Group(Keyword('passdetect') + Keyword('interval') + num) #grammer_3_7 = Group(Keyword('open') + num) grammer_3_6 = Group(Keyword('ssl') + Keyword('version') + Keyword('all')) grammer_3_7 = Group(Keyword('request') + Keyword('method') + Keyword('get') + Keyword('url') + Word(printables)) grammer_3_8 = Group(Keyword('request') + Keyword('method') + Word(printables)) grammer_3_9 = Group(Keyword('header') + Keyword('Host') + Keyword('header-value') + Word(printables)) grammer_3 = Group(grammer_3_1 + ZeroOrMore(grammer_3_2 | grammer_3_3 | grammer_3_4 | grammer_3_5 | grammer_3_6 | grammer_3_7 | grammer_3_8 | grammer_3_9 )) # grammer 4: # rserver host rs_Test123 # description TEST_DESC # ip address 127.0.0.1 # webhost-redirection https://www.google.com/test/1234/ 301 # probe prb_HTTP-1234 # inservice rserver_key = Keyword('rserver') host = Keyword('host') rserver_name = Word(printables) grammer_4_1 = Group(rserver_key + host + rserver_name) grammer_4_2 = Group(Keyword('description') + restOfLine) grammer_4_3 = Group(Keyword('ip address') + ipaddress) grammer_4_4 = Group(Keyword('probe') + Word(printables)) grammer_4_5 = Group(Keyword('inservice')) grammer_4_6 = Group(Keyword('webhost-redirection') + Word(printables) + num) grammer_4 = Group(grammer_4_1 + ZeroOrMore(grammer_4_2 | grammer_4_3 | grammer_4_4 | grammer_4_5 | grammer_4_6)) # grammer 5 # parameter-map type <connection|http|ssl> ALLOW_TEST # tcp-options selective-ack allow # tcp-options timestamp allow # tcp-options window-scale allow # persistence-rebalance strict # set timeout inactivity 9999 # session-cache timeout 300 # queue-delay timeout 1 # set header-maxparse-length 65535 # set content-maxparse-length 65535 # cipher RSA_EXPORT1024_WITH_RC4_56_SHA param_key = Keyword('parameter-map') type_key = Word('type') connection = Word('connection') | Word('http') | Word('ssl') param_name = Word(printables) tcp_key = Word('tcp-options') tcp_type = Keyword('timestamp') | Keyword( 'window-scale') | Keyword('selective-ack') allow = Word('allow') sess_queue = Keyword('session-cache') | Keyword('queue-delay') timeout = Keyword('timeout') set = Keyword('set') length = Keyword( 'header-maxparse-length') | Keyword('content-maxparse-length') grammer_5_1 = Group(param_key + type_key + connection + param_name) grammer_5_2 = Group(tcp_key + tcp_type + allow) grammer_5_3 = Group( Keyword('persistence-rebalance') + Keyword('strict')) grammer_5_4 = Group(Keyword('set') + Keyword('timeout') + Keyword('inactivity') + Word(nums)) grammer_5_5 = Group(set + length + num) grammer_5_6 = Group(sess_queue + timeout + num) grammer_5_7 = Group(Keyword('cipher') + name) grammer_5_8 = Keyword('case-insensitive') grammer_5_9 = Group(Keyword('parsing') + name) grammer_5_10 = Group(Keyword('exceed-mss') + name) grammer_5 = Group(grammer_5_1 + ZeroOrMore( grammer_5_2 | grammer_5_3 | grammer_5_4 | grammer_5_6 | grammer_5_7 | grammer_5_8 | grammer_5_9 | grammer_5_10)) # Grammer 6: # sticky ip-netmask 255.255.255.255 address source test-adfdas-$5D # sticky http-cookie TEST TEST_COOKIE # serverfarm sf_TEST # timeout 1000 # replicate sticky # cookie insert browser-expire # 8 static cookie-value "ONETXEIS" rserver ESC20_TXEIS_APP_1 443 sticky = Keyword('sticky') ipnetmask = Keyword('ip-netmask') http_cookie = Keyword('http-cookie') address = Keyword('address') source = Keyword('source') sticky_name = Word(printables) cookie = Keyword('cookie') insert = Keyword('insert') browser_expire = Keyword('browser-expire') static = Keyword('static') cookie_val = Keyword('cookie-value') grammer_6_1 = Group(sticky + ipnetmask + ipaddress + address + source + sticky_name) | Group(sticky + http_cookie + name + name) grammer_6_2 = Group(Keyword('serverfarm') + Word(printables)) grammer_6_3 = Group(Keyword('timeout') + Word(nums)) grammer_6_4 = Group(Keyword('replicate') + sticky) grammer_6_5 = Group(cookie + insert + browser_expire) grammer_6_6 = Group(num + static + cookie_val + name + rserver_key + name + num) grammer_6 = Group(grammer_6_1 + ZeroOrMore(grammer_6_2 | grammer_6_3 | grammer_6_4 | grammer_6_5 | grammer_6_6)) # grammer7: # class-map type management match-any TEST-PROTOCOLS # class-map match-any TEST_TEST_123 # class-map match-any TEST_TEST_123 # class-map match-all TEST_TEST_123 # 2 match protocol icmp source-address 127.0.0.1 255.0.0.0 # 3 match protocol snmp source-address 127.0.0.1 255.255.255.0 # 2 match destination-address 127.0.0.1 255.255.255.0 # 3 match source-address 127.0.0.1 255.255.255.0 # 2 match virtual-address 127.0.0.1 tcp eq 1234 # 2 match virtual-address 127.0.0.1 tcp any # 2 match http url .* classmap = Keyword('class-map') classmap_type = Keyword('type') mgmt = Keyword('management') | ( Keyword('http') + Keyword('loadbalance')) type_key_att = classmap_type + mgmt match_key = Keyword('match-any') | Keyword('match-all') grammer7_1 = Group(classmap + match_key + name) match_key = Keyword('match') proto_key = Keyword('protocol') grammer_url = Group( num + match_key + Keyword('http') + Keyword('url') + name) proto_type = Keyword('tcp') | Keyword('icmp') | Keyword( 'snmp') | Keyword('http') | Keyword('https') | Keyword('udp') proto = proto_key + proto_type source_dest = Keyword( 'source-address') | Keyword('destination-address') virtual_add = Keyword('virtual-address') eq_key = Keyword('eq') eq_val = Keyword('https') | Keyword('www') | Keyword('http') | num any_key = Keyword('any') add_att = Optional(proto) + source_dest + ipaddress + ipaddress virt_att = virtual_add + ipaddress + \ proto_type + ((eq_key + eq_val) | any_key) grammer7_2 = Group(num + match_key + (add_att | virt_att)) | grammer_url grammer_7 = Group(grammer7_1 + ZeroOrMore(grammer7_2)) # grammer8: # policy-map type loadbalance first-match LB_TEST_MAP_1235 # class class-default # serverfarm TEST_FARM_2 # sticky-serverfarm TEST_FARM_2 # connection advanced-options TEST_CONN123 # loadbalance vip inservice # loadbalance vip icmp-reply # loadbalance policy LB_TEST_123 # inspect ftp # ssl-proxy server ssl_name # nat dynamic 5 vlan 2100 # appl-parameter http advanced-options ADV-HTTP # connection advanced-options NETSETTINGS # action test_rewrite policy_key = Keyword('policy-map') lb_key = Keyword('loadbalance') match = Keyword('first-match') | Keyword('multi-match') grammer_8_1 = Group( policy_key + Optional(type_key + lb_key) + match + name) grammer_8_2_1 = Group(Keyword('class') + name) grammer_8_2_2 = Group(( (Keyword('serverfarm') | Keyword('action') | Keyword('sticky-serverfarm')) + name) | Keyword('drop') | Keyword('insert-http') + restOfLine) grammer_8_2_3 = Group(Keyword('connection') + Keyword('advanced-option') + name) lb_vip = Keyword('vip') + ( Keyword('inservice') | Keyword('icmp-reply') + ZeroOrMore(Keyword('active') + ZeroOrMore(Keyword('primary-inservice'))) | Keyword('inservice')) lb_policy = Keyword('policy') + name grammer_8_2_4 = Group(Keyword('loadbalance') + (lb_vip | lb_policy)) grammer_8_2_5 = Group(Keyword('inspect') + Keyword('ftp')) grammer_8_2_6 = Group(Keyword('ssl-proxy') + Keyword('server') + name) grammer_8_2_7 = Group(Keyword('nat') + Keyword('dynamic') + num + Keyword('vlan') + num) grammer_8_2_8 = Group(Keyword('appl-parameter') + Keyword('http') + Keyword('advanced-options') + name) grammer_8_2_9 = Group(Keyword('connection') + Keyword('advanced-options') + name) grammer_8_2_10 = Group(Keyword('action') + name) grammer_8_3 = Group(Keyword('description') + restOfLine) grammer_8_2 = Group(grammer_8_2_1 + ZeroOrMore( grammer_8_2_2 | grammer_8_2_3 | grammer_8_2_4 | grammer_8_2_5 | grammer_8_2_6 | grammer_8_2_7 | grammer_8_2_8 | grammer_8_2_9 | grammer_8_2_10)) grammer_8 = Group(grammer_8_1 + ZeroOrMore(grammer_8_3) + ZeroOrMore(grammer_8_2)) # grammer9: # interface vlan 1011 # ip address 127.0.0.1 255.255.255.0 # alias 127.0.0.1 255.255.255.0 # peer ip address 127.0.0.1 255.255.255.0 # access-group input FROM_TEST # service-policy input TEST_ACCESS # service-policy input vs_TEST # service-policy input TEST_POLICY_8080 # no shutdown # nat-pool 1 127.0.0.1 127.0.0.1 netmask 255.255.255.255 pat grammer_9_1 = Group(Keyword('interface') + Keyword('vlan') + num) grammer_9_2 = Group(ip_key + address + ipaddress + ipaddress) grammer_9_3 = Group(Keyword('alias') + ipaddress + ipaddress) grammer_9_4 = Group(Keyword('peer') + ip_key + address + ipaddress + ipaddress) grammer_9_5 = Group(Keyword('access-group') + Keyword('input') + name) grammer_9_6 = Group(Keyword('service-policy') + Keyword('input') + name) grammer_9_7 = Group(Keyword('no') + Keyword('shutdown')) grammer_9_8 = Group(Keyword('nat-pool') + num + ipaddress + ipaddress + Keyword('netmask') + ipaddress + Keyword('pat')) grammer_9 = Group(grammer_9_1 + ZeroOrMore(grammer_9_2 | grammer_9_3 | grammer_9_4 | grammer_9_5 | grammer_9_6 | grammer_9_7 | grammer_9_8)) # grammer 10: # ip route 0.0.0.0 0.0.0.0 127.0.0.1 grammer_10 = Group(ip_key + Keyword('route') + ipaddress + ipaddress) # grammer 11: # snmp-server host 127.0.0.1 traps version 2c ******** # snmp-server enable traps slb k7server snmp = Keyword('snmp-server') host = Keyword('host') traps = Keyword('traps') slb = Keyword('slb') version = Keyword('version') enable = Keyword('enable') host_att = host + ipaddress + traps + version + name + name ord_att = enable + traps + slb + name grammer_11 = Group(snmp + (host_att | ord_att)) # grammer 12 # serverfarm host TEST_TEST_79 # probe probe_TEST_123 # inband-health check count # predictor leastconns slowstart 30 # rserver RS_TEST123 # inservice serverfarm = Keyword('serverfarm') host = Keyword('host') grammer_12_1 = Group(serverfarm + host + name) grammer_12_2 = Group(Keyword('probe') + name) grammer_12_3 = Group(Keyword('inband-health') + Keyword('check') + name) grammer_12_4_1 = Keyword('rserver') + ~Word( 'host') + name + ZeroOrMore(num) grammer_12_4_2 = Keyword('inservice') + Optional(Keyword('standby')) grammer_12_4_3 = Group(Keyword('probe') + restOfLine) grammer_12_4_4 = Group(Keyword('backup-rserver') + restOfLine) grammer_12_4 = Group(grammer_12_4_1 + ZeroOrMore(grammer_12_4_3) + ZeroOrMore(grammer_12_4_4) + ZeroOrMore(grammer_12_4_2)) grammer_12_5 = Group(Keyword('predictor') + Keyword('leastconns') + Keyword('slowstart') + num) grammer_12_6 = Group(Keyword('description') + restOfLine) grammer_12_7 = Group(Keyword('predictor') + restOfLine) grammer_12_8 = Group(Keyword('retcode') + restOfLine) grammer_12_9 = Group(Keyword('failaction') + restOfLine) grammer_12_10 = Keyword('fail-on-all') grammer_12 = Group(grammer_12_1 + ZeroOrMore( grammer_12_2 | grammer_12_3 | grammer_12_4 | grammer_12_5 | grammer_12_6 | grammer_12_7 | grammer_12_8 | grammer_12_9 | grammer_12_10)) # grammer ssl # ssl-proxy service SSL_CLIENT # key KEY12.PEM # cert CERT12.PEM # ssl advanced-options PM1 grammer_ssl = Group(Keyword('ssl-proxy') + Keyword('service') + name) grammer_ssl_key = Group(Keyword('key') + name) grammer_ssl_cert = Group(Keyword('cert') + name) grammer_ssl_chaingroup = Group(Keyword('chaingroup') + name) grammer_ssl_opt = Group(Keyword('ssl') + Keyword('advanced-options') + name) grammer_ssl_comp = Group(grammer_ssl + ZeroOrMore(grammer_ssl_key | grammer_ssl_cert | grammer_ssl_chaingroup | grammer_ssl_opt)) # Grammer crypto: # eg: crypto chaingroup ACME-PROD-CA_CHAINGROUP # cert acme-prod-root-ca_24092044.crt # cert acme-prod-issuing-ca_22102028.crt # # crypto csr-params llprd-frontend-csr # country DK # state Sealand # organization-name ACME # organization-unit ACME Input Management # common-name tcpwebprod.prod.acmeintern.dk # crypto csr-params llprd-backend-csr # country DK # state Sealand # organization-name ACME # organization-unit ACME Input Management # common-name acmenpap.prod.acmeintern.dk #grammer for crypto chaingroup test_group # cert Test_cert.crt grammer_crypto_1 = Group( Keyword('crypto') + Keyword('chaingroup') + name) grammer_crypto_2 = Group(Keyword('cert') + name) grammer_crypto_3 = Group(grammer_crypto_1 + ZeroOrMore(grammer_crypto_2)) #grammer for crypto csr-params grammer_crypto_4 = Group( Keyword('crypto') + Keyword('csr-params') + name) grammer_crypto_5 = Group(Keyword('country') + name) grammer_crypto_6 = Group(Keyword('state') + name) grammer_crypto_7 = Group(Keyword('organization-name') + restOfLine) grammer_crypto_8 = Group(Keyword('organization-unit') + name) grammer_crypto_9 = Group(Keyword('common-name') + name) grammer_crypto_10 = Group(grammer_crypto_4 + ZeroOrMore(grammer_crypto_5 | grammer_crypto_6 | grammer_crypto_7 | grammer_crypto_8 | grammer_crypto_9)) # aaa authentication login default group TAC_PLUS local # aaa accounting default group TAC_PLUS grammer_aaa_1 = Keyword('aaa') grammer_aaa_2 = Keyword( 'authentication login') | Keyword('accounting') grammer_aaa_3 = Keyword('default') grammer_aaa_4 = Keyword('group') grammer_aaa_5 = Keyword('local') grammer_aaa = Group(grammer_aaa_1 + grammer_aaa_2 + grammer_aaa_3 + grammer_aaa_4 + (name | grammer_aaa_5)) # action-list type modify http test-ssl-rewrite # ssl url rewrite location ".*" # header rewrite request Host header-value "(.*)" replace "%1\/" grammer_al_1 = Keyword('action-list') grammer_al_2 = Keyword('type') grammer_al_3 = Keyword('modify') grammer_al_4 = Keyword('http') grammer_al_5 = Keyword('ssl') grammer_al_6 = Keyword('url') grammer_al_7 = Keyword('rewrite') grammer_al_8 = Keyword('location') grammer_al_9 = Keyword('header') grammer_al_10 = Keyword('request') grammer_al_11 = Keyword('Host') grammer_al_12 = Keyword('header-value') grammer_al_13 = Keyword('replace') grammer_al_1_1 = Group( grammer_al_5 + grammer_al_6 + grammer_al_7 + grammer_al_8 + name) grammer_al_1_2 = Group( grammer_al_9 + grammer_al_7 + grammer_al_10 + grammer_al_11 + grammer_al_12 + name + grammer_al_13 + name ) grammer_al = Group(Group(grammer_al_1 + grammer_al_2 + grammer_al_3 + grammer_al_4 + name) + ZeroOrMore(grammer_al_1_1 | grammer_al_1_2)) # Overall Grammer grammer = Group(grammer_1 | grammer_2 | grammer_3 | grammer_4 | grammer_5 | grammer_6 | grammer_7 | grammer_8 | grammer_9 | grammer_10 | grammer_11 | grammer_12 | grammer_ssl_comp | grammer_aaa | grammer_crypto_3 | grammer_crypto_10 | grammer_al) print "Grammer created for ace config parser." LOG.info("Grammer created for ace config parser.") return grammer def parse_ace_grammer(grammer, data, file_size, out_dict, final_excel, total_parse_count): """ This function parse grammer for ace converter convertes to intermediate parser output. :return parsed intermediate output. """ LOG.info("Started ace grammer parsing.") final_dict = dict() for match, start, end in grammer.scanString(data): key = '' extra_dict = {} # printing progress bar msg = '' printProgressBar(end, file_size, msg, prefix='Progress', suffix='') if match: matched = match.asList() out_dict.append(matched) if type(matched[0][0][0]) is list: key = matched[0][0][0][0] name_to_log = matched[0][0][0][1] else: key = matched[0][0][0] name_to_log = matched[0][0][1] LOG.info('Parsing happening for :{} -> {}'.format(key, name_to_log)) excel_dict = { 'name': '', 'type': '', 'command': '', 'converted': 'n', 'status': 'Not Supported', 'skipped': [], 'indirect': [], 'NA': [], 'Avi Object': '' } name_to_log = None type_to_log = ['logging', 'access-list', 'rserver', 'serverfarm', 'parameter-map', 'class-map', 'policy-map', 'sticky', 'probe', 'action-list', 'crypto'] if key == 'logging': matched = matched[0][0] name_to_log = matched[1] if len(matched) == 2: extra_dict = { 'log_type': matched[1] } elif len(matched) == 3: extra_dict = { 'log_type': matched[1], 'value': matched[2] } elif len(matched) == 4: extra_dict = { 'log_type': matched[1], 'value': matched[2], 'packet': matched[3] } LOG.info('parsing: Logging for value : {}'.format(name_to_log)) if key == 'access-list': matched = matched[0][0] name_to_log = "{} line {}".format(matched[0][1], matched[0][4]) extra_dict = { 'type': matched[1], matched[2]: matched[3], 'extend': matched[4], 'permit': matched[5], 'ip1': matched[7], 'ip2': matched[8], 'ip3': matched[9] } LOG.info('parsing: Access-list {}'.format(name_to_log)) if key == 'rserver': matched = matched[0][0] name_to_log = matched[0][2] extra_dict = { matched[0][1]: matched[0][2], 'desc': [] } for match in matched[1:]: if len(match) == 1: temp_dict = { 'type': match[0] } elif len(match) == 3: temp_dict = { 'type': 'redirect', 'code': match[2], 'location': match[1] } else: temp_dict = { match[0]: match[1] } extra_dict['desc'].append(temp_dict) LOG.info('parsing: rserver for value : {}'.format(name_to_log)) if key == 'serverfarm': matched = matched[0][0] name_to_log = matched[0][2] extra_dict = { matched[0][1]: matched[0][2], # getting serverfarm name 'desc': [] } for match in matched[1:]: temp_dict = dict() if len(match) < 3: temp_dict = { match[0]: match[1] } # Handled object such as ['rserver', 'ACMENPMOS01', '9217', 'inservice'] or #For Object such as # ['rserver', 'ACMENPMOS02', 'inservice']. Taken care of port is present or not in input # configuration file. elif 'rserver' in match: if len(match) >= 4: temp_dict = { match[0]: match[1], # if port no is present in configuration. 'port': match[2], # inservice status 'enabled': match[4] if len(match) > 4 else match[3] } else: temp_dict = { match[0]: match[1], 'enabled': match[2] if len(match)>2 else 'false' } # Atleast 2 keys must be presents. i.e. rserver keyword and rserver name. If both present then only add # that filed into serverfarm otherwise just ignore. if len(temp_dict.keys()) > 1: extra_dict['desc'].append(temp_dict) LOG.info('parsing: server farm for value : {}'.format(name_to_log)) if key == 'parameter-map': matched = matched[0][0] name_to_log = matched[0][3] extra_dict = { matched[0][1]: matched[0][2], 'conn_name': matched[0][3], 'desc': [] } for match in matched[1:]: if len(match) == 2: temp_dict = { match[0]: match[1] } else: temp_dict = { match[0]: match[1], 'allow': match[2] } extra_dict['desc'].append(temp_dict) LOG.info( 'parsing: parameter-map for value : {}'.format(name_to_log)) if key == 'class-map': matched = matched[0][0] name_to_log = matched[0][2] extra_dict = { matched[0][0]: matched[0][2], 'type': matched[0][1], 'desc': [] } for match in matched[1:]: temp_dict = dict() if len(match) == 7: temp_dict = { match[1]: match[0], match[2]: match[3], match[4]: match[6] } elif len(match) == 5: temp_dict = { match[1]: match[0], match[2]: match[3], "mask": match[4] } elif len(match) == 6: temp_dict = { match[1]: match[0], match[2]: match[3], match[4]: match[5] } extra_dict['desc'].append(temp_dict) LOG.info('parsing: class-map for value : {}'.format(name_to_log)) if key == 'policy-map': matched = matched[0][0] if len(matched[0]) == 5: extra_dict = { matched[0][1]: matched[0][2], 'match': matched[0][3], 'name': matched[0][4], 'desc': [] } name_to_log = matched[0][4] else: extra_dict = { matched[0][0]: matched[0][2], 'match': matched[0][1], 'desc': [] } name_to_log = matched[0][2] for match in matched[1:]: temp_dict = dict() temp_dict = { match[0][0]: match[0][1], 'class_desc': [] } for match1 in match[1:]: temp_dict_1 = dict() if len(match1) == 2: temp_dict_1 = { match1[0]: match1[1] } elif len(match1) == 3: temp_dict_1 = { match1[0]: match1[1], 'type': match1[2] } temp_dict['class_desc'].append(temp_dict_1) extra_dict['desc'].append(temp_dict) LOG.info('parsing: policy-map for value : {}'.format(name_to_log)) if key == 'sticky': matched = matched[0][0] if len(matched[0]) == 6: name_to_log = matched[0][5] extra_dict = { matched[0][1]: matched[0][2], 'name': matched[0][5], 'desc': [] } if len(matched[0]) == 4: name_to_log = matched[0][3] extra_dict = { matched[0][1]: matched[0][1], 'name': name_to_log, 'desc': [] } for match in matched[1:]: temp_dict = dict() if len(match) == 2: temp_dict = { match[0]: match[1] } extra_dict['desc'].append(temp_dict) LOG.info('parsing: sticky for value : {}'.format(name_to_log)) if key == 'ssl-proxy': matched = matched[0][0] name_to_log = matched[0][2] extra_dict = { 'type': matched[0][1], 'name': name_to_log, 'desc': [] } for match in matched[1:]: if len(match) == 2: temp_dict = { match[0]: match[1] } if len(match) == 3: temp_dict = { match[0]: match[1], 'name': match[2] } extra_dict['desc'].append(temp_dict) # action-list type modify http test-ssl-rewrite # ssl url rewrite location ".*" # header rewrite request Host header-value "(.*)" replace "%1\/" if key == 'action-list': matched = matched[0][0] name_to_log = matched[0][4] extra_dict = { matched[0][0]: name_to_log, matched[0][1]: matched[0][2], matched[0][3]: matched[0][4], 'desc': [] } for match in matched[1:]: if len(match) == 5: temp_dict = { match[0]: match[1], match[2]: match[3], "to": match[4] } if len(match) == 8: temp_dict = { match[0]: match[1], match[2]: match[3], match[4]: match[5], match[6]: match[7], } extra_dict['desc'].append(temp_dict) LOG.info('parsing: action-list for value : {}'.format(name_to_log)) if key == 'probe': matched = matched[0][0] name_to_log = matched[0][2] extra_dict = { 'type': matched[0][1], 'name': matched[0][2], } for match in matched[1:]: temp_dict = dict() if len(match) == 2: temp_dict = { match[0]: match[1] } if len(match) == 4: if 'status' in match: temp_dict = { 'status': match[2], 'status1': match[3] } elif 'header' in match: temp_dict = { 'host': match[1], 'header-value': match[3] } if len(match) == 3: if 'regex' in match: temp_dict = { 'regex': 'yes' } if len(match) == 5: temp_dict = { match[1]: match[2], match[3]: match[4] } extra_dict.update(temp_dict) LOG.info('parsing: probe for value : {}'.format(name_to_log)) if key == 'crypto': matched = matched[0][0] name_to_log = matched[0][2] if matched[0][1] == 'chaingroup': extra_dict = { 'cert': [], matched[0][1]: matched[0][2], } for match in matched[0:]: temp_dict = dict() if 'cert' in match: # getting chaingroup certs extra_dict['cert'].append(match[1]) elif 'csr-params' in match: temp_dict = { # getting CSR params such as country, state, organization name. match[1]: match[2] } else: temp_dict = { match[0]: match[1] } extra_dict.update(temp_dict) LOG.info('parsing: crypto for value : {}'.format(name_to_log)) # Updating excel sheet if key in type_to_log and name_to_log: excel_dict['name'] = name_to_log excel_dict['type'] = key final_excel.append(excel_dict) if key not in final_dict.keys(): final_dict.update({key: [extra_dict]}) else: final_dict[key].append(extra_dict) set_excel_dict(final_excel) printProgressBar(file_size, file_size, msg, prefix='Progress', suffix='') return final_dict class Parser(): """ This class is for Parsing - Parsing grammars are written in pyparsing """ def __init__(self, file_name): self.file_name = file_name def parse_ace(self): out_dict = [] total_parse_count = 0 final_excel = [] with open(self.file_name, 'r') as input_config: input_data = input_config.read() input_config.seek(0, 2) file_size = input_config.tell() overall_grammer = create_ace_grammer() parsed_ace_config = parse_ace_grammer(overall_grammer, input_data, file_size, out_dict, final_excel, total_parse_count) return parsed_ace_config if __name__ == '__main__': s = """ serverfarm host sfarm_IDST-EXTADRESSBUCH-HTTPS probe probe_L7_IDST-EXTADRESSBUCH-HTTPS fail-on-all rserver rserver_L0550022 443 inservice rserver rserver_L0551022 443 inservice """ name = Word(printables) num = Word(nums) serverfarm = Keyword('serverfarm') host = Keyword('host') grammer_12_1 = Group(serverfarm + host + name) grammer_12_2 = Group(Keyword('probe') + name) grammer_12_3 = Group(Keyword('inband-health') + Keyword('check') + name) grammer_12_4_1 = Keyword('rserver') + ~Word( 'host') + name + ZeroOrMore(num) grammer_12_4_2 = Keyword('inservice') + Optional(Keyword('standby')) grammer_12_4_3 = Group(Keyword('probe')+ restOfLine) grammer_12_4_4 = Group(Keyword('backup-rserver') + restOfLine) grammer_12_4 = Group(grammer_12_4_1 + ZeroOrMore(grammer_12_4_3) + ZeroOrMore(grammer_12_4_4) + ZeroOrMore(grammer_12_4_2)) grammer_12_5 = Group(Keyword('predictor') + Keyword('leastconns') + Keyword('slowstart') + num) # grammer_12_6 = Group(Keyword('description') + printables) # grammer_12_7 = Group(Keyword('predictor') + printables) grammer_12_6 = Group(Keyword('description') + restOfLine) grammer_12_7 = Group(Keyword('predictor') + restOfLine) grammer_12_8 = Group(Keyword('retcode') + restOfLine) grammer_12_9 = Keyword('fail-on-all') grammer_12 = Group(grammer_12_1 + ZeroOrMore( grammer_12_2 | grammer_12_2 | grammer_12_3 | grammer_12_4 | grammer_12_5 | grammer_12_6 | grammer_12_7 | grammer_12_8 | grammer_12_9)) for match, start, end in grammer_12.scanString(s): print match
39.834423
127
0.52751
import os import sys import logging from pyparsing import Keyword, Word, OneOrMore, printables, Group, nums,\ alphas, ZeroOrMore, Optional, Combine, QuotedString, restOfLine from itertools import cycle from avi.migrationtools.ace_converter.ace_utils import printProgressBar,\ set_excel_dict LOG = logging.getLogger(__name__) def create_ace_grammer(): """ This function creates grammer for ace configuration parsing. :return grammer for parsing """ command = Group(Keyword('logging') | Keyword( 'access-list') | Keyword('probe')) name = Word(printables) ipaddress = Combine(Word(nums) + ('.' + Word(nums)) * 3) num = Word(nums) log = Keyword('logging') single_key = Keyword('enable') | Keyword('timestamp') double_key = (Keyword('trap') | Keyword('buffered')) + num triple_key = Keyword('host') + ipaddress + name grammer_1 = Group(log + (single_key | double_key | triple_key)) access = Keyword('access-list') in_out = Keyword('FROM_INSIDE') | Keyword('FROM_OUTSIDE') line = Keyword('line') extend = Keyword('extended') permit = Keyword('permit') ip_key = Keyword('ip') any_key = Keyword('any') ip_any = ipaddress | any_key grammer_2 = Group(access + in_out + line + num + extend + permit + ip_key + ip_any + ip_any + ip_any) probe = Keyword('probe') type_key = Keyword('http') | Keyword( 'icmp') | Keyword('https') | Keyword('tcp') grammer_3_1 = Group(probe + type_key + name) grammer_3_2 = Group(Keyword('port') + Word(nums)) grammer_3_3 = Group(Keyword('receive') + Word(nums)) grammer_3_4 = Group(Keyword('interval') + Word(nums)) grammer_3_5 = Group((Keyword('expect') + Keyword('status') + Word(nums) + Word(nums)) | (Keyword('expect') + Keyword('regex') + Word(printables))) grammer_3_6 = Group(Keyword('ssl') + Keyword('version') + Keyword('all')) grammer_3_7 = Group(Keyword('request') + Keyword('method') + Keyword('get') + Keyword('url') + Word(printables)) grammer_3_8 = Group(Keyword('request') + Keyword('method') + Word(printables)) grammer_3_9 = Group(Keyword('header') + Keyword('Host') + Keyword('header-value') + Word(printables)) grammer_3 = Group(grammer_3_1 + ZeroOrMore(grammer_3_2 | grammer_3_3 | grammer_3_4 | grammer_3_5 | grammer_3_6 | grammer_3_7 | grammer_3_8 | grammer_3_9 )) rserver_key = Keyword('rserver') host = Keyword('host') rserver_name = Word(printables) grammer_4_1 = Group(rserver_key + host + rserver_name) grammer_4_2 = Group(Keyword('description') + restOfLine) grammer_4_3 = Group(Keyword('ip address') + ipaddress) grammer_4_4 = Group(Keyword('probe') + Word(printables)) grammer_4_5 = Group(Keyword('inservice')) grammer_4_6 = Group(Keyword('webhost-redirection') + Word(printables) + num) grammer_4 = Group(grammer_4_1 + ZeroOrMore(grammer_4_2 | grammer_4_3 | grammer_4_4 | grammer_4_5 | grammer_4_6)) param_key = Keyword('parameter-map') type_key = Word('type') connection = Word('connection') | Word('http') | Word('ssl') param_name = Word(printables) tcp_key = Word('tcp-options') tcp_type = Keyword('timestamp') | Keyword( 'window-scale') | Keyword('selective-ack') allow = Word('allow') sess_queue = Keyword('session-cache') | Keyword('queue-delay') timeout = Keyword('timeout') set = Keyword('set') length = Keyword( 'header-maxparse-length') | Keyword('content-maxparse-length') grammer_5_1 = Group(param_key + type_key + connection + param_name) grammer_5_2 = Group(tcp_key + tcp_type + allow) grammer_5_3 = Group( Keyword('persistence-rebalance') + Keyword('strict')) grammer_5_4 = Group(Keyword('set') + Keyword('timeout') + Keyword('inactivity') + Word(nums)) grammer_5_5 = Group(set + length + num) grammer_5_6 = Group(sess_queue + timeout + num) grammer_5_7 = Group(Keyword('cipher') + name) grammer_5_8 = Keyword('case-insensitive') grammer_5_9 = Group(Keyword('parsing') + name) grammer_5_10 = Group(Keyword('exceed-mss') + name) grammer_5 = Group(grammer_5_1 + ZeroOrMore( grammer_5_2 | grammer_5_3 | grammer_5_4 | grammer_5_6 | grammer_5_7 | grammer_5_8 | grammer_5_9 | grammer_5_10)) sticky = Keyword('sticky') ipnetmask = Keyword('ip-netmask') http_cookie = Keyword('http-cookie') address = Keyword('address') source = Keyword('source') sticky_name = Word(printables) cookie = Keyword('cookie') insert = Keyword('insert') browser_expire = Keyword('browser-expire') static = Keyword('static') cookie_val = Keyword('cookie-value') grammer_6_1 = Group(sticky + ipnetmask + ipaddress + address + source + sticky_name) | Group(sticky + http_cookie + name + name) grammer_6_2 = Group(Keyword('serverfarm') + Word(printables)) grammer_6_3 = Group(Keyword('timeout') + Word(nums)) grammer_6_4 = Group(Keyword('replicate') + sticky) grammer_6_5 = Group(cookie + insert + browser_expire) grammer_6_6 = Group(num + static + cookie_val + name + rserver_key + name + num) grammer_6 = Group(grammer_6_1 + ZeroOrMore(grammer_6_2 | grammer_6_3 | grammer_6_4 | grammer_6_5 | grammer_6_6)) classmap = Keyword('class-map') classmap_type = Keyword('type') mgmt = Keyword('management') | ( Keyword('http') + Keyword('loadbalance')) type_key_att = classmap_type + mgmt match_key = Keyword('match-any') | Keyword('match-all') grammer7_1 = Group(classmap + match_key + name) match_key = Keyword('match') proto_key = Keyword('protocol') grammer_url = Group( num + match_key + Keyword('http') + Keyword('url') + name) proto_type = Keyword('tcp') | Keyword('icmp') | Keyword( 'snmp') | Keyword('http') | Keyword('https') | Keyword('udp') proto = proto_key + proto_type source_dest = Keyword( 'source-address') | Keyword('destination-address') virtual_add = Keyword('virtual-address') eq_key = Keyword('eq') eq_val = Keyword('https') | Keyword('www') | Keyword('http') | num any_key = Keyword('any') add_att = Optional(proto) + source_dest + ipaddress + ipaddress virt_att = virtual_add + ipaddress + \ proto_type + ((eq_key + eq_val) | any_key) grammer7_2 = Group(num + match_key + (add_att | virt_att)) | grammer_url grammer_7 = Group(grammer7_1 + ZeroOrMore(grammer7_2)) policy_key = Keyword('policy-map') lb_key = Keyword('loadbalance') match = Keyword('first-match') | Keyword('multi-match') grammer_8_1 = Group( policy_key + Optional(type_key + lb_key) + match + name) grammer_8_2_1 = Group(Keyword('class') + name) grammer_8_2_2 = Group(( (Keyword('serverfarm') | Keyword('action') | Keyword('sticky-serverfarm')) + name) | Keyword('drop') | Keyword('insert-http') + restOfLine) grammer_8_2_3 = Group(Keyword('connection') + Keyword('advanced-option') + name) lb_vip = Keyword('vip') + ( Keyword('inservice') | Keyword('icmp-reply') + ZeroOrMore(Keyword('active') + ZeroOrMore(Keyword('primary-inservice'))) | Keyword('inservice')) lb_policy = Keyword('policy') + name grammer_8_2_4 = Group(Keyword('loadbalance') + (lb_vip | lb_policy)) grammer_8_2_5 = Group(Keyword('inspect') + Keyword('ftp')) grammer_8_2_6 = Group(Keyword('ssl-proxy') + Keyword('server') + name) grammer_8_2_7 = Group(Keyword('nat') + Keyword('dynamic') + num + Keyword('vlan') + num) grammer_8_2_8 = Group(Keyword('appl-parameter') + Keyword('http') + Keyword('advanced-options') + name) grammer_8_2_9 = Group(Keyword('connection') + Keyword('advanced-options') + name) grammer_8_2_10 = Group(Keyword('action') + name) grammer_8_3 = Group(Keyword('description') + restOfLine) grammer_8_2 = Group(grammer_8_2_1 + ZeroOrMore( grammer_8_2_2 | grammer_8_2_3 | grammer_8_2_4 | grammer_8_2_5 | grammer_8_2_6 | grammer_8_2_7 | grammer_8_2_8 | grammer_8_2_9 | grammer_8_2_10)) grammer_8 = Group(grammer_8_1 + ZeroOrMore(grammer_8_3) + ZeroOrMore(grammer_8_2)) grammer_9_1 = Group(Keyword('interface') + Keyword('vlan') + num) grammer_9_2 = Group(ip_key + address + ipaddress + ipaddress) grammer_9_3 = Group(Keyword('alias') + ipaddress + ipaddress) grammer_9_4 = Group(Keyword('peer') + ip_key + address + ipaddress + ipaddress) grammer_9_5 = Group(Keyword('access-group') + Keyword('input') + name) grammer_9_6 = Group(Keyword('service-policy') + Keyword('input') + name) grammer_9_7 = Group(Keyword('no') + Keyword('shutdown')) grammer_9_8 = Group(Keyword('nat-pool') + num + ipaddress + ipaddress + Keyword('netmask') + ipaddress + Keyword('pat')) grammer_9 = Group(grammer_9_1 + ZeroOrMore(grammer_9_2 | grammer_9_3 | grammer_9_4 | grammer_9_5 | grammer_9_6 | grammer_9_7 | grammer_9_8)) grammer_10 = Group(ip_key + Keyword('route') + ipaddress + ipaddress) snmp = Keyword('snmp-server') host = Keyword('host') traps = Keyword('traps') slb = Keyword('slb') version = Keyword('version') enable = Keyword('enable') host_att = host + ipaddress + traps + version + name + name ord_att = enable + traps + slb + name grammer_11 = Group(snmp + (host_att | ord_att)) serverfarm = Keyword('serverfarm') host = Keyword('host') grammer_12_1 = Group(serverfarm + host + name) grammer_12_2 = Group(Keyword('probe') + name) grammer_12_3 = Group(Keyword('inband-health') + Keyword('check') + name) grammer_12_4_1 = Keyword('rserver') + ~Word( 'host') + name + ZeroOrMore(num) grammer_12_4_2 = Keyword('inservice') + Optional(Keyword('standby')) grammer_12_4_3 = Group(Keyword('probe') + restOfLine) grammer_12_4_4 = Group(Keyword('backup-rserver') + restOfLine) grammer_12_4 = Group(grammer_12_4_1 + ZeroOrMore(grammer_12_4_3) + ZeroOrMore(grammer_12_4_4) + ZeroOrMore(grammer_12_4_2)) grammer_12_5 = Group(Keyword('predictor') + Keyword('leastconns') + Keyword('slowstart') + num) grammer_12_6 = Group(Keyword('description') + restOfLine) grammer_12_7 = Group(Keyword('predictor') + restOfLine) grammer_12_8 = Group(Keyword('retcode') + restOfLine) grammer_12_9 = Group(Keyword('failaction') + restOfLine) grammer_12_10 = Keyword('fail-on-all') grammer_12 = Group(grammer_12_1 + ZeroOrMore( grammer_12_2 | grammer_12_3 | grammer_12_4 | grammer_12_5 | grammer_12_6 | grammer_12_7 | grammer_12_8 | grammer_12_9 | grammer_12_10)) grammer_ssl = Group(Keyword('ssl-proxy') + Keyword('service') + name) grammer_ssl_key = Group(Keyword('key') + name) grammer_ssl_cert = Group(Keyword('cert') + name) grammer_ssl_chaingroup = Group(Keyword('chaingroup') + name) grammer_ssl_opt = Group(Keyword('ssl') + Keyword('advanced-options') + name) grammer_ssl_comp = Group(grammer_ssl + ZeroOrMore(grammer_ssl_key | grammer_ssl_cert | grammer_ssl_chaingroup | grammer_ssl_opt)) grammer_crypto_1 = Group( Keyword('crypto') + Keyword('chaingroup') + name) grammer_crypto_2 = Group(Keyword('cert') + name) grammer_crypto_3 = Group(grammer_crypto_1 + ZeroOrMore(grammer_crypto_2)) grammer_crypto_4 = Group( Keyword('crypto') + Keyword('csr-params') + name) grammer_crypto_5 = Group(Keyword('country') + name) grammer_crypto_6 = Group(Keyword('state') + name) grammer_crypto_7 = Group(Keyword('organization-name') + restOfLine) grammer_crypto_8 = Group(Keyword('organization-unit') + name) grammer_crypto_9 = Group(Keyword('common-name') + name) grammer_crypto_10 = Group(grammer_crypto_4 + ZeroOrMore(grammer_crypto_5 | grammer_crypto_6 | grammer_crypto_7 | grammer_crypto_8 | grammer_crypto_9)) grammer_aaa_1 = Keyword('aaa') grammer_aaa_2 = Keyword( 'authentication login') | Keyword('accounting') grammer_aaa_3 = Keyword('default') grammer_aaa_4 = Keyword('group') grammer_aaa_5 = Keyword('local') grammer_aaa = Group(grammer_aaa_1 + grammer_aaa_2 + grammer_aaa_3 + grammer_aaa_4 + (name | grammer_aaa_5)) grammer_al_1 = Keyword('action-list') grammer_al_2 = Keyword('type') grammer_al_3 = Keyword('modify') grammer_al_4 = Keyword('http') grammer_al_5 = Keyword('ssl') grammer_al_6 = Keyword('url') grammer_al_7 = Keyword('rewrite') grammer_al_8 = Keyword('location') grammer_al_9 = Keyword('header') grammer_al_10 = Keyword('request') grammer_al_11 = Keyword('Host') grammer_al_12 = Keyword('header-value') grammer_al_13 = Keyword('replace') grammer_al_1_1 = Group( grammer_al_5 + grammer_al_6 + grammer_al_7 + grammer_al_8 + name) grammer_al_1_2 = Group( grammer_al_9 + grammer_al_7 + grammer_al_10 + grammer_al_11 + grammer_al_12 + name + grammer_al_13 + name ) grammer_al = Group(Group(grammer_al_1 + grammer_al_2 + grammer_al_3 + grammer_al_4 + name) + ZeroOrMore(grammer_al_1_1 | grammer_al_1_2)) grammer = Group(grammer_1 | grammer_2 | grammer_3 | grammer_4 | grammer_5 | grammer_6 | grammer_7 | grammer_8 | grammer_9 | grammer_10 | grammer_11 | grammer_12 | grammer_ssl_comp | grammer_aaa | grammer_crypto_3 | grammer_crypto_10 | grammer_al) print "Grammer created for ace config parser." LOG.info("Grammer created for ace config parser.") return grammer def parse_ace_grammer(grammer, data, file_size, out_dict, final_excel, total_parse_count): """ This function parse grammer for ace converter convertes to intermediate parser output. :return parsed intermediate output. """ LOG.info("Started ace grammer parsing.") final_dict = dict() for match, start, end in grammer.scanString(data): key = '' extra_dict = {} msg = '' printProgressBar(end, file_size, msg, prefix='Progress', suffix='') if match: matched = match.asList() out_dict.append(matched) if type(matched[0][0][0]) is list: key = matched[0][0][0][0] name_to_log = matched[0][0][0][1] else: key = matched[0][0][0] name_to_log = matched[0][0][1] LOG.info('Parsing happening for :{} -> {}'.format(key, name_to_log)) excel_dict = { 'name': '', 'type': '', 'command': '', 'converted': 'n', 'status': 'Not Supported', 'skipped': [], 'indirect': [], 'NA': [], 'Avi Object': '' } name_to_log = None type_to_log = ['logging', 'access-list', 'rserver', 'serverfarm', 'parameter-map', 'class-map', 'policy-map', 'sticky', 'probe', 'action-list', 'crypto'] if key == 'logging': matched = matched[0][0] name_to_log = matched[1] if len(matched) == 2: extra_dict = { 'log_type': matched[1] } elif len(matched) == 3: extra_dict = { 'log_type': matched[1], 'value': matched[2] } elif len(matched) == 4: extra_dict = { 'log_type': matched[1], 'value': matched[2], 'packet': matched[3] } LOG.info('parsing: Logging for value : {}'.format(name_to_log)) if key == 'access-list': matched = matched[0][0] name_to_log = "{} line {}".format(matched[0][1], matched[0][4]) extra_dict = { 'type': matched[1], matched[2]: matched[3], 'extend': matched[4], 'permit': matched[5], 'ip1': matched[7], 'ip2': matched[8], 'ip3': matched[9] } LOG.info('parsing: Access-list {}'.format(name_to_log)) if key == 'rserver': matched = matched[0][0] name_to_log = matched[0][2] extra_dict = { matched[0][1]: matched[0][2], 'desc': [] } for match in matched[1:]: if len(match) == 1: temp_dict = { 'type': match[0] } elif len(match) == 3: temp_dict = { 'type': 'redirect', 'code': match[2], 'location': match[1] } else: temp_dict = { match[0]: match[1] } extra_dict['desc'].append(temp_dict) LOG.info('parsing: rserver for value : {}'.format(name_to_log)) if key == 'serverfarm': matched = matched[0][0] name_to_log = matched[0][2] extra_dict = { matched[0][1]: matched[0][2], 'desc': [] } for match in matched[1:]: temp_dict = dict() if len(match) < 3: temp_dict = { match[0]: match[1] } elif 'rserver' in match: if len(match) >= 4: temp_dict = { match[0]: match[1], 'port': match[2], 'enabled': match[4] if len(match) > 4 else match[3] } else: temp_dict = { match[0]: match[1], 'enabled': match[2] if len(match)>2 else 'false' } if len(temp_dict.keys()) > 1: extra_dict['desc'].append(temp_dict) LOG.info('parsing: server farm for value : {}'.format(name_to_log)) if key == 'parameter-map': matched = matched[0][0] name_to_log = matched[0][3] extra_dict = { matched[0][1]: matched[0][2], 'conn_name': matched[0][3], 'desc': [] } for match in matched[1:]: if len(match) == 2: temp_dict = { match[0]: match[1] } else: temp_dict = { match[0]: match[1], 'allow': match[2] } extra_dict['desc'].append(temp_dict) LOG.info( 'parsing: parameter-map for value : {}'.format(name_to_log)) if key == 'class-map': matched = matched[0][0] name_to_log = matched[0][2] extra_dict = { matched[0][0]: matched[0][2], 'type': matched[0][1], 'desc': [] } for match in matched[1:]: temp_dict = dict() if len(match) == 7: temp_dict = { match[1]: match[0], match[2]: match[3], match[4]: match[6] } elif len(match) == 5: temp_dict = { match[1]: match[0], match[2]: match[3], "mask": match[4] } elif len(match) == 6: temp_dict = { match[1]: match[0], match[2]: match[3], match[4]: match[5] } extra_dict['desc'].append(temp_dict) LOG.info('parsing: class-map for value : {}'.format(name_to_log)) if key == 'policy-map': matched = matched[0][0] if len(matched[0]) == 5: extra_dict = { matched[0][1]: matched[0][2], 'match': matched[0][3], 'name': matched[0][4], 'desc': [] } name_to_log = matched[0][4] else: extra_dict = { matched[0][0]: matched[0][2], 'match': matched[0][1], 'desc': [] } name_to_log = matched[0][2] for match in matched[1:]: temp_dict = dict() temp_dict = { match[0][0]: match[0][1], 'class_desc': [] } for match1 in match[1:]: temp_dict_1 = dict() if len(match1) == 2: temp_dict_1 = { match1[0]: match1[1] } elif len(match1) == 3: temp_dict_1 = { match1[0]: match1[1], 'type': match1[2] } temp_dict['class_desc'].append(temp_dict_1) extra_dict['desc'].append(temp_dict) LOG.info('parsing: policy-map for value : {}'.format(name_to_log)) if key == 'sticky': matched = matched[0][0] if len(matched[0]) == 6: name_to_log = matched[0][5] extra_dict = { matched[0][1]: matched[0][2], 'name': matched[0][5], 'desc': [] } if len(matched[0]) == 4: name_to_log = matched[0][3] extra_dict = { matched[0][1]: matched[0][1], 'name': name_to_log, 'desc': [] } for match in matched[1:]: temp_dict = dict() if len(match) == 2: temp_dict = { match[0]: match[1] } extra_dict['desc'].append(temp_dict) LOG.info('parsing: sticky for value : {}'.format(name_to_log)) if key == 'ssl-proxy': matched = matched[0][0] name_to_log = matched[0][2] extra_dict = { 'type': matched[0][1], 'name': name_to_log, 'desc': [] } for match in matched[1:]: if len(match) == 2: temp_dict = { match[0]: match[1] } if len(match) == 3: temp_dict = { match[0]: match[1], 'name': match[2] } extra_dict['desc'].append(temp_dict) if key == 'action-list': matched = matched[0][0] name_to_log = matched[0][4] extra_dict = { matched[0][0]: name_to_log, matched[0][1]: matched[0][2], matched[0][3]: matched[0][4], 'desc': [] } for match in matched[1:]: if len(match) == 5: temp_dict = { match[0]: match[1], match[2]: match[3], "to": match[4] } if len(match) == 8: temp_dict = { match[0]: match[1], match[2]: match[3], match[4]: match[5], match[6]: match[7], } extra_dict['desc'].append(temp_dict) LOG.info('parsing: action-list for value : {}'.format(name_to_log)) if key == 'probe': matched = matched[0][0] name_to_log = matched[0][2] extra_dict = { 'type': matched[0][1], 'name': matched[0][2], } for match in matched[1:]: temp_dict = dict() if len(match) == 2: temp_dict = { match[0]: match[1] } if len(match) == 4: if 'status' in match: temp_dict = { 'status': match[2], 'status1': match[3] } elif 'header' in match: temp_dict = { 'host': match[1], 'header-value': match[3] } if len(match) == 3: if 'regex' in match: temp_dict = { 'regex': 'yes' } if len(match) == 5: temp_dict = { match[1]: match[2], match[3]: match[4] } extra_dict.update(temp_dict) LOG.info('parsing: probe for value : {}'.format(name_to_log)) if key == 'crypto': matched = matched[0][0] name_to_log = matched[0][2] if matched[0][1] == 'chaingroup': extra_dict = { 'cert': [], matched[0][1]: matched[0][2], } for match in matched[0:]: temp_dict = dict() if 'cert' in match: extra_dict['cert'].append(match[1]) elif 'csr-params' in match: temp_dict = { match[1]: match[2] } else: temp_dict = { match[0]: match[1] } extra_dict.update(temp_dict) LOG.info('parsing: crypto for value : {}'.format(name_to_log)) if key in type_to_log and name_to_log: excel_dict['name'] = name_to_log excel_dict['type'] = key final_excel.append(excel_dict) if key not in final_dict.keys(): final_dict.update({key: [extra_dict]}) else: final_dict[key].append(extra_dict) set_excel_dict(final_excel) printProgressBar(file_size, file_size, msg, prefix='Progress', suffix='') return final_dict class Parser(): """ This class is for Parsing - Parsing grammars are written in pyparsing """ def __init__(self, file_name): self.file_name = file_name def parse_ace(self): out_dict = [] total_parse_count = 0 final_excel = [] with open(self.file_name, 'r') as input_config: input_data = input_config.read() input_config.seek(0, 2) file_size = input_config.tell() overall_grammer = create_ace_grammer() parsed_ace_config = parse_ace_grammer(overall_grammer, input_data, file_size, out_dict, final_excel, total_parse_count) return parsed_ace_config if __name__ == '__main__': s = """ serverfarm host sfarm_IDST-EXTADRESSBUCH-HTTPS probe probe_L7_IDST-EXTADRESSBUCH-HTTPS fail-on-all rserver rserver_L0550022 443 inservice rserver rserver_L0551022 443 inservice """ name = Word(printables) num = Word(nums) serverfarm = Keyword('serverfarm') host = Keyword('host') grammer_12_1 = Group(serverfarm + host + name) grammer_12_2 = Group(Keyword('probe') + name) grammer_12_3 = Group(Keyword('inband-health') + Keyword('check') + name) grammer_12_4_1 = Keyword('rserver') + ~Word( 'host') + name + ZeroOrMore(num) grammer_12_4_2 = Keyword('inservice') + Optional(Keyword('standby')) grammer_12_4_3 = Group(Keyword('probe')+ restOfLine) grammer_12_4_4 = Group(Keyword('backup-rserver') + restOfLine) grammer_12_4 = Group(grammer_12_4_1 + ZeroOrMore(grammer_12_4_3) + ZeroOrMore(grammer_12_4_4) + ZeroOrMore(grammer_12_4_2)) grammer_12_5 = Group(Keyword('predictor') + Keyword('leastconns') + Keyword('slowstart') + num) grammer_12_6 = Group(Keyword('description') + restOfLine) grammer_12_7 = Group(Keyword('predictor') + restOfLine) grammer_12_8 = Group(Keyword('retcode') + restOfLine) grammer_12_9 = Keyword('fail-on-all') grammer_12 = Group(grammer_12_1 + ZeroOrMore( grammer_12_2 | grammer_12_2 | grammer_12_3 | grammer_12_4 | grammer_12_5 | grammer_12_6 | grammer_12_7 | grammer_12_8 | grammer_12_9)) for match, start, end in grammer_12.scanString(s): print match
false
true
f72bc3e123cf5d71ec9dfa9b87624f01ea910d05
7,358
py
Python
src/ptb/ptb_enas_controller.py
tremblerz/enas
329ee3f8beb5e715bf2dad1182cfb5120b3485f9
[ "Apache-2.0" ]
null
null
null
src/ptb/ptb_enas_controller.py
tremblerz/enas
329ee3f8beb5e715bf2dad1182cfb5120b3485f9
[ "Apache-2.0" ]
null
null
null
src/ptb/ptb_enas_controller.py
tremblerz/enas
329ee3f8beb5e715bf2dad1182cfb5120b3485f9
[ "Apache-2.0" ]
null
null
null
import sys import os import time import numpy as np import tensorflow as tf from src.utils import get_train_ops from src.common_ops import stack_lstm from tensorflow.python.training import moving_averages class PTBEnasController(object): def __init__(self, rhn_depth=5, lstm_size=32, lstm_num_layers=2, lstm_keep_prob=1.0, tanh_constant=None, temperature=None, num_funcs=2, lr_init=1e-3, lr_dec_start=0, lr_dec_every=100, lr_dec_rate=0.9, l2_reg=0, entropy_weight=None, clip_mode=None, grad_bound=None, bl_dec=0.999, optim_algo="adam", sync_replicas=False, num_aggregate=None, num_replicas=None, name="controller"): print("-" * 80) print("Building PTBEnasController") self.rhn_depth = rhn_depth self.lstm_size = lstm_size self.lstm_num_layers = lstm_num_layers self.lstm_keep_prob = lstm_keep_prob self.tanh_constant = tanh_constant self.temperature = temperature self.num_funcs = num_funcs self.lr_init = lr_init self.lr_dec_start = lr_dec_start self.lr_dec_every = lr_dec_every self.lr_dec_rate = lr_dec_rate self.l2_reg = l2_reg self.entropy_weight = entropy_weight self.clip_mode = clip_mode self.grad_bound = grad_bound self.bl_dec = bl_dec self.optim_algo = optim_algo self.sync_replicas = sync_replicas self.num_aggregate = num_aggregate self.num_replicas = num_replicas self.name = name self._create_params() self._build_sampler() def _create_params(self): initializer = tf.random_uniform_initializer(minval=-0.1, maxval=0.1) with tf.variable_scope(self.name, initializer=initializer): with tf.variable_scope("lstm"): self.w_lstm = [] for layer_id in range(self.lstm_num_layers): with tf.variable_scope("layer_{}".format(layer_id)): w = tf.get_variable("w", [2 * self.lstm_size, 4 * self.lstm_size]) self.w_lstm.append(w) num_funcs = self.num_funcs with tf.variable_scope("embedding"): self.g_emb = tf.get_variable("g_emb", [1, self.lstm_size]) self.w_emb = tf.get_variable("w", [num_funcs, self.lstm_size]) with tf.variable_scope("softmax"): self.w_soft = tf.get_variable("w", [self.lstm_size, num_funcs]) with tf.variable_scope("attention"): self.attn_w_1 = tf.get_variable("w_1", [self.lstm_size, self.lstm_size]) self.attn_w_2 = tf.get_variable("w_2", [self.lstm_size, self.lstm_size]) self.attn_v = tf.get_variable("v", [self.lstm_size, 1]) def _build_sampler(self): """Build the sampler ops and the log_prob ops.""" arc_seq = [] sample_log_probs = [] sample_entropy = [] all_h = [] all_h_w = [] # sampler ops inputs = self.g_emb prev_c, prev_h = [], [] for _ in range(self.lstm_num_layers): prev_c.append(tf.zeros([1, self.lstm_size], dtype=tf.float32)) prev_h.append(tf.zeros([1, self.lstm_size], dtype=tf.float32)) # used = tf.zeros([self.rhn_depth, 2], dtype=tf.int32) for layer_id in range(self.rhn_depth): next_c, next_h = stack_lstm(inputs, prev_c, prev_h, self.w_lstm) prev_c, prev_h = next_c, next_h all_h.append(next_h[-1]) all_h_w.append(tf.matmul(next_h[-1], self.attn_w_1)) if layer_id > 0: query = tf.matmul(next_h[-1], self.attn_w_2) query = query + tf.concat(all_h_w[:-1], axis=0) query = tf.tanh(query) logits = tf.matmul(query, self.attn_v) logits = tf.reshape(logits, [1, layer_id]) if self.temperature is not None: logits /= self.temperature if self.tanh_constant is not None: logits = self.tanh_constant * tf.tanh(logits) diff = tf.to_float(layer_id - tf.range(0, layer_id)) ** 2 logits -= tf.reshape(diff, [1, layer_id]) / 6.0 skip_index = tf.multinomial(logits, 1) skip_index = tf.to_int32(skip_index) skip_index = tf.reshape(skip_index, [1]) arc_seq.append(skip_index) log_prob = tf.nn.sparse_softmax_cross_entropy_with_logits( logits=logits, labels=skip_index) sample_log_probs.append(log_prob) entropy = log_prob * tf.exp(-log_prob) sample_entropy.append(tf.stop_gradient(entropy)) inputs = tf.nn.embedding_lookup( tf.concat(all_h[:-1], axis=0), skip_index) inputs /= (0.1 + tf.to_float(layer_id - skip_index)) else: inputs = self.g_emb next_c, next_h = stack_lstm(inputs, prev_c, prev_h, self.w_lstm) prev_c, prev_h = next_c, next_h logits = tf.matmul(next_h[-1], self.w_soft) if self.temperature is not None: logits /= self.temperature if self.tanh_constant is not None: logits = self.tanh_constant * tf.tanh(logits) func = tf.multinomial(logits, 1) func = tf.to_int32(func) func = tf.reshape(func, [1]) arc_seq.append(func) log_prob = tf.nn.sparse_softmax_cross_entropy_with_logits( logits=logits, labels=func) sample_log_probs.append(log_prob) entropy = log_prob * tf.exp(-log_prob) sample_entropy.append(tf.stop_gradient(entropy)) inputs = tf.nn.embedding_lookup(self.w_emb, func) arc_seq = tf.concat(arc_seq, axis=0) self.sample_arc = arc_seq self.sample_log_probs = tf.concat(sample_log_probs, axis=0) self.ppl = tf.exp(tf.reduce_mean(self.sample_log_probs)) sample_entropy = tf.concat(sample_entropy, axis=0) self.sample_entropy = tf.reduce_sum(sample_entropy) self.all_h = all_h def build_trainer(self, child_model): # actor self.valid_loss = tf.to_float(child_model.rl_loss) self.valid_loss = tf.stop_gradient(self.valid_loss) self.valid_ppl = tf.exp(self.valid_loss) self.reward = 80.0 / self.valid_ppl if self.entropy_weight is not None: self.reward += self.entropy_weight * self.sample_entropy # or baseline self.sample_log_probs = tf.reduce_sum(self.sample_log_probs) self.baseline = tf.Variable(0.0, dtype=tf.float32, trainable=False) baseline_update = tf.assign_sub( self.baseline, (1 - self.bl_dec) * (self.baseline - self.reward)) with tf.control_dependencies([baseline_update]): self.reward = tf.identity(self.reward) self.loss = self.sample_log_probs * (self.reward - self.baseline) self.train_step = tf.Variable( 0, dtype=tf.int32, trainable=False, name="train_step") tf_variables = [var for var in tf.trainable_variables() if var.name.startswith(self.name)] self.train_op, self.lr, self.grad_norm, self.optimizer = get_train_ops( self.loss, tf_variables, self.train_step, clip_mode=self.clip_mode, grad_bound=self.grad_bound, l2_reg=self.l2_reg, lr_init=self.lr_init, lr_dec_start=self.lr_dec_start, lr_dec_every=self.lr_dec_every, lr_dec_rate=self.lr_dec_rate, optim_algo=self.optim_algo, sync_replicas=self.sync_replicas, num_aggregate=self.num_aggregate, num_replicas=self.num_replicas)
33.907834
80
0.651536
import sys import os import time import numpy as np import tensorflow as tf from src.utils import get_train_ops from src.common_ops import stack_lstm from tensorflow.python.training import moving_averages class PTBEnasController(object): def __init__(self, rhn_depth=5, lstm_size=32, lstm_num_layers=2, lstm_keep_prob=1.0, tanh_constant=None, temperature=None, num_funcs=2, lr_init=1e-3, lr_dec_start=0, lr_dec_every=100, lr_dec_rate=0.9, l2_reg=0, entropy_weight=None, clip_mode=None, grad_bound=None, bl_dec=0.999, optim_algo="adam", sync_replicas=False, num_aggregate=None, num_replicas=None, name="controller"): print("-" * 80) print("Building PTBEnasController") self.rhn_depth = rhn_depth self.lstm_size = lstm_size self.lstm_num_layers = lstm_num_layers self.lstm_keep_prob = lstm_keep_prob self.tanh_constant = tanh_constant self.temperature = temperature self.num_funcs = num_funcs self.lr_init = lr_init self.lr_dec_start = lr_dec_start self.lr_dec_every = lr_dec_every self.lr_dec_rate = lr_dec_rate self.l2_reg = l2_reg self.entropy_weight = entropy_weight self.clip_mode = clip_mode self.grad_bound = grad_bound self.bl_dec = bl_dec self.optim_algo = optim_algo self.sync_replicas = sync_replicas self.num_aggregate = num_aggregate self.num_replicas = num_replicas self.name = name self._create_params() self._build_sampler() def _create_params(self): initializer = tf.random_uniform_initializer(minval=-0.1, maxval=0.1) with tf.variable_scope(self.name, initializer=initializer): with tf.variable_scope("lstm"): self.w_lstm = [] for layer_id in range(self.lstm_num_layers): with tf.variable_scope("layer_{}".format(layer_id)): w = tf.get_variable("w", [2 * self.lstm_size, 4 * self.lstm_size]) self.w_lstm.append(w) num_funcs = self.num_funcs with tf.variable_scope("embedding"): self.g_emb = tf.get_variable("g_emb", [1, self.lstm_size]) self.w_emb = tf.get_variable("w", [num_funcs, self.lstm_size]) with tf.variable_scope("softmax"): self.w_soft = tf.get_variable("w", [self.lstm_size, num_funcs]) with tf.variable_scope("attention"): self.attn_w_1 = tf.get_variable("w_1", [self.lstm_size, self.lstm_size]) self.attn_w_2 = tf.get_variable("w_2", [self.lstm_size, self.lstm_size]) self.attn_v = tf.get_variable("v", [self.lstm_size, 1]) def _build_sampler(self): arc_seq = [] sample_log_probs = [] sample_entropy = [] all_h = [] all_h_w = [] inputs = self.g_emb prev_c, prev_h = [], [] for _ in range(self.lstm_num_layers): prev_c.append(tf.zeros([1, self.lstm_size], dtype=tf.float32)) prev_h.append(tf.zeros([1, self.lstm_size], dtype=tf.float32)) for layer_id in range(self.rhn_depth): next_c, next_h = stack_lstm(inputs, prev_c, prev_h, self.w_lstm) prev_c, prev_h = next_c, next_h all_h.append(next_h[-1]) all_h_w.append(tf.matmul(next_h[-1], self.attn_w_1)) if layer_id > 0: query = tf.matmul(next_h[-1], self.attn_w_2) query = query + tf.concat(all_h_w[:-1], axis=0) query = tf.tanh(query) logits = tf.matmul(query, self.attn_v) logits = tf.reshape(logits, [1, layer_id]) if self.temperature is not None: logits /= self.temperature if self.tanh_constant is not None: logits = self.tanh_constant * tf.tanh(logits) diff = tf.to_float(layer_id - tf.range(0, layer_id)) ** 2 logits -= tf.reshape(diff, [1, layer_id]) / 6.0 skip_index = tf.multinomial(logits, 1) skip_index = tf.to_int32(skip_index) skip_index = tf.reshape(skip_index, [1]) arc_seq.append(skip_index) log_prob = tf.nn.sparse_softmax_cross_entropy_with_logits( logits=logits, labels=skip_index) sample_log_probs.append(log_prob) entropy = log_prob * tf.exp(-log_prob) sample_entropy.append(tf.stop_gradient(entropy)) inputs = tf.nn.embedding_lookup( tf.concat(all_h[:-1], axis=0), skip_index) inputs /= (0.1 + tf.to_float(layer_id - skip_index)) else: inputs = self.g_emb next_c, next_h = stack_lstm(inputs, prev_c, prev_h, self.w_lstm) prev_c, prev_h = next_c, next_h logits = tf.matmul(next_h[-1], self.w_soft) if self.temperature is not None: logits /= self.temperature if self.tanh_constant is not None: logits = self.tanh_constant * tf.tanh(logits) func = tf.multinomial(logits, 1) func = tf.to_int32(func) func = tf.reshape(func, [1]) arc_seq.append(func) log_prob = tf.nn.sparse_softmax_cross_entropy_with_logits( logits=logits, labels=func) sample_log_probs.append(log_prob) entropy = log_prob * tf.exp(-log_prob) sample_entropy.append(tf.stop_gradient(entropy)) inputs = tf.nn.embedding_lookup(self.w_emb, func) arc_seq = tf.concat(arc_seq, axis=0) self.sample_arc = arc_seq self.sample_log_probs = tf.concat(sample_log_probs, axis=0) self.ppl = tf.exp(tf.reduce_mean(self.sample_log_probs)) sample_entropy = tf.concat(sample_entropy, axis=0) self.sample_entropy = tf.reduce_sum(sample_entropy) self.all_h = all_h def build_trainer(self, child_model): self.valid_loss = tf.to_float(child_model.rl_loss) self.valid_loss = tf.stop_gradient(self.valid_loss) self.valid_ppl = tf.exp(self.valid_loss) self.reward = 80.0 / self.valid_ppl if self.entropy_weight is not None: self.reward += self.entropy_weight * self.sample_entropy self.sample_log_probs = tf.reduce_sum(self.sample_log_probs) self.baseline = tf.Variable(0.0, dtype=tf.float32, trainable=False) baseline_update = tf.assign_sub( self.baseline, (1 - self.bl_dec) * (self.baseline - self.reward)) with tf.control_dependencies([baseline_update]): self.reward = tf.identity(self.reward) self.loss = self.sample_log_probs * (self.reward - self.baseline) self.train_step = tf.Variable( 0, dtype=tf.int32, trainable=False, name="train_step") tf_variables = [var for var in tf.trainable_variables() if var.name.startswith(self.name)] self.train_op, self.lr, self.grad_norm, self.optimizer = get_train_ops( self.loss, tf_variables, self.train_step, clip_mode=self.clip_mode, grad_bound=self.grad_bound, l2_reg=self.l2_reg, lr_init=self.lr_init, lr_dec_start=self.lr_dec_start, lr_dec_every=self.lr_dec_every, lr_dec_rate=self.lr_dec_rate, optim_algo=self.optim_algo, sync_replicas=self.sync_replicas, num_aggregate=self.num_aggregate, num_replicas=self.num_replicas)
true
true