hexsha
stringlengths
40
40
size
int64
2
1.02M
ext
stringclasses
10 values
lang
stringclasses
1 value
max_stars_repo_path
stringlengths
4
245
max_stars_repo_name
stringlengths
6
130
max_stars_repo_head_hexsha
stringlengths
40
40
max_stars_repo_licenses
listlengths
1
10
max_stars_count
int64
1
191k
max_stars_repo_stars_event_min_datetime
stringlengths
24
24
max_stars_repo_stars_event_max_datetime
stringlengths
24
24
max_issues_repo_path
stringlengths
4
245
max_issues_repo_name
stringlengths
6
130
max_issues_repo_head_hexsha
stringlengths
40
40
max_issues_repo_licenses
listlengths
1
10
max_issues_count
int64
1
67k
max_issues_repo_issues_event_min_datetime
stringlengths
24
24
max_issues_repo_issues_event_max_datetime
stringlengths
24
24
max_forks_repo_path
stringlengths
4
245
max_forks_repo_name
stringlengths
6
130
max_forks_repo_head_hexsha
stringlengths
40
40
max_forks_repo_licenses
listlengths
1
10
max_forks_count
int64
1
105k
max_forks_repo_forks_event_min_datetime
stringlengths
24
24
max_forks_repo_forks_event_max_datetime
stringlengths
24
24
content
stringlengths
2
1.02M
avg_line_length
float64
1
417k
max_line_length
int64
1
987k
alphanum_fraction
float64
0
1
content_no_comment
stringlengths
0
1.01M
is_comment_constant_removed
bool
1 class
is_sharp_comment_removed
bool
1 class
f70a5536b187b95499372854a9278b60efced3b0
788
py
Python
merge-sort/merge_sort/merge_sort.py
doaa-1996/Data-structures-and-algorithms1
5b2b4e1ece2f6671770dac80a95b662345106f49
[ "MIT" ]
1
2021-06-22T12:26:13.000Z
2021-06-22T12:26:13.000Z
merge-sort/merge_sort/merge_sort.py
doaa-1996/data-structures-and-algorithms
5b2b4e1ece2f6671770dac80a95b662345106f49
[ "MIT" ]
null
null
null
merge-sort/merge_sort/merge_sort.py
doaa-1996/data-structures-and-algorithms
5b2b4e1ece2f6671770dac80a95b662345106f49
[ "MIT" ]
null
null
null
def mergeSort(arr): n= len(arr) if n > 1: mid = int(n/2) left = arr[0:mid] right = arr[mid:n] mergeSort(left) mergeSort(right) Merge(left, right, arr) def Merge(left, right, arr): i = 0 j = 0 k = 0 while i < len(left) and j < len(right): if left[i] <= right[j]: arr[k] = left[i] i += 1 else: arr[k] = right[j] j += 1 k =k + 1 while i < len(left): arr[k] = left[i] i += 1 k += 1 while j < len(right): arr[k] = right[j] j += 1 k += 1 if __name__ == "__main__": arr = [8,4,23,42,16,15] print('Array => '+f'{arr}') mergeSort(arr) print('Sorted array => '+f'{arr}')
20.736842
43
0.413706
def mergeSort(arr): n= len(arr) if n > 1: mid = int(n/2) left = arr[0:mid] right = arr[mid:n] mergeSort(left) mergeSort(right) Merge(left, right, arr) def Merge(left, right, arr): i = 0 j = 0 k = 0 while i < len(left) and j < len(right): if left[i] <= right[j]: arr[k] = left[i] i += 1 else: arr[k] = right[j] j += 1 k =k + 1 while i < len(left): arr[k] = left[i] i += 1 k += 1 while j < len(right): arr[k] = right[j] j += 1 k += 1 if __name__ == "__main__": arr = [8,4,23,42,16,15] print('Array => '+f'{arr}') mergeSort(arr) print('Sorted array => '+f'{arr}')
true
true
f70a5558a78b0bae5dd9be819598d90e827a8312
624
py
Python
sphinxpapyrus/docxbuilder/nodes/important.py
amarin/sphinxpapyrus-docxbuilder
0fd00a0c5467554d0a2b5ad9cd93ab780511f1a3
[ "MIT" ]
null
null
null
sphinxpapyrus/docxbuilder/nodes/important.py
amarin/sphinxpapyrus-docxbuilder
0fd00a0c5467554d0a2b5ad9cd93ab780511f1a3
[ "MIT" ]
null
null
null
sphinxpapyrus/docxbuilder/nodes/important.py
amarin/sphinxpapyrus-docxbuilder
0fd00a0c5467554d0a2b5ad9cd93ab780511f1a3
[ "MIT" ]
null
null
null
# -*- coding: utf-8 -*- """ Translate docutils node important formatting. each important start will processed with visit() and finished with depart() """ from docutils.nodes import Node from sphinxpapyrus.docxbuilder.translator import DocxTranslator node_name = "important" def visit(visitor: DocxTranslator, node: Node): """Start processing important node""" assert isinstance(visitor, DocxTranslator) assert isinstance(node, Node) def depart(visitor: DocxTranslator, node: Node): """Finish processing important node""" assert isinstance(visitor, DocxTranslator) assert isinstance(node, Node)
27.130435
75
0.75
from docutils.nodes import Node from sphinxpapyrus.docxbuilder.translator import DocxTranslator node_name = "important" def visit(visitor: DocxTranslator, node: Node): assert isinstance(visitor, DocxTranslator) assert isinstance(node, Node) def depart(visitor: DocxTranslator, node: Node): assert isinstance(visitor, DocxTranslator) assert isinstance(node, Node)
true
true
f70a55c9bd6446009caf8957e8cedb97d86a3592
3,679
py
Python
setup.py
speezepearson/pow
7c86a36134cb90bfcf6e2740c4293d629b6021a1
[ "MIT" ]
5
2017-10-31T00:17:30.000Z
2017-11-11T00:53:08.000Z
setup.py
speezepearson/prpg
7c86a36134cb90bfcf6e2740c4293d629b6021a1
[ "MIT" ]
null
null
null
setup.py
speezepearson/prpg
7c86a36134cb90bfcf6e2740c4293d629b6021a1
[ "MIT" ]
null
null
null
# Always prefer setuptools over distutils from setuptools import setup, find_packages # To use a consistent encoding from codecs import open from os import path here = path.abspath(path.dirname(__file__)) # Get the long description from the relevant file with open(path.join(here, 'README.markdown'), encoding='utf-8') as f: long_description = f.read() setup( name='prpg', # Versions should comply with PEP440. For a discussion on single-sourcing # the version across setup.py and the project code, see # https://packaging.python.org/en/latest/single_source_version.html version='0.4.1', description='A pseudorandom password generator / password manager.', long_description=long_description, # The project's main homepage. url='https://github.com/speezepearson/prpg', # Author details author='speezepearson', author_email='speeze.pearson+prpg@gmail.com', # Choose your license # license='MIT', # See https://pypi.python.org/pypi?%3Aaction=list_classifiers classifiers=[ # How mature is this project? Common values are # 3 - Alpha # 4 - Beta # 5 - Production/Stable 'Development Status :: 4 - Beta', # Indicate who your project is intended for 'Intended Audience :: Developers', 'Topic :: Security', # Pick your license as you wish (should match "license" above) # 'License :: OSI Approved :: MIT License', # Specify the Python versions you support here. In particular, ensure # that you indicate whether you support Python 2, Python 3 or both. 'Programming Language :: Python :: 2.7', 'Programming Language :: Python :: 3.5', 'Programming Language :: Python :: 3.6', 'Programming Language :: Python :: 3.7', ], # What does your project relate to? keywords='password password-management password-generation', # You can just specify the packages manually here if your project is # simple. Or you can use find_packages(). packages=find_packages(exclude=['test', 'doc', 'wiki']), # List run-time dependencies here. These will be installed by pip when # your project is installed. For an analysis of "install_requires" vs pip's # requirements files see: # https://packaging.python.org/en/latest/requirements.html install_requires=[], # List additional groups of dependencies here (e.g. development # dependencies). You can install these using the following syntax, # for example: # $ pip install -e .[dev,test] extras_require={ 'dev': [], 'test': ['pytest', 'pexpect'], }, # If there are data files included in your packages that need to be # installed, specify them here. If using Python 2.6 or less, then these # have to be included in MANIFEST.in as well. # package_data={ # 'browsergui': ['_server/*.html', '_server/*.js', 'examples/*.png'], # }, # Although 'package_data' is the preferred approach, in some case you may # need to place data files outside of your packages. See: # http://docs.python.org/3.4/distutils/setupscript.html#installing-additional-files # noqa # In this case, 'data_file' will be installed into '<sys.prefix>/my_data' # data_files=[('my_data', ['data/data_file'])], # To provide executable scripts, use entry points in preference to the # "scripts" keyword. Entry points provide cross-platform support and allow # pip to create the appropriate form of executable for the target platform. entry_points={ 'console_scripts': [ 'prpg=prpg:main', ], }, )
36.425743
94
0.665398
from setuptools import setup, find_packages from codecs import open from os import path here = path.abspath(path.dirname(__file__)) with open(path.join(here, 'README.markdown'), encoding='utf-8') as f: long_description = f.read() setup( name='prpg', version='0.4.1', description='A pseudorandom password generator / password manager.', long_description=long_description, url='https://github.com/speezepearson/prpg', # Author details author='speezepearson', author_email='speeze.pearson+prpg@gmail.com', # Choose your license # license='MIT', # See https://pypi.python.org/pypi?%3Aaction=list_classifiers classifiers=[ # How mature is this project? Common values are # 3 - Alpha # 4 - Beta # 5 - Production/Stable 'Development Status :: 4 - Beta', # Indicate who your project is intended for 'Intended Audience :: Developers', 'Topic :: Security', # Pick your license as you wish (should match "license" above) # 'License :: OSI Approved :: MIT License', # Specify the Python versions you support here. In particular, ensure # that you indicate whether you support Python 2, Python 3 or both. 'Programming Language :: Python :: 2.7', 'Programming Language :: Python :: 3.5', 'Programming Language :: Python :: 3.6', 'Programming Language :: Python :: 3.7', ], # What does your project relate to? keywords='password password-management password-generation', # You can just specify the packages manually here if your project is # simple. Or you can use find_packages(). packages=find_packages(exclude=['test', 'doc', 'wiki']), # List run-time dependencies here. These will be installed by pip when # your project is installed. For an analysis of "install_requires" vs pip's install_requires=[], extras_require={ 'dev': [], 'test': ['pytest', 'pexpect'], }, ts={ 'console_scripts': [ 'prpg=prpg:main', ], }, )
true
true
f70a56767a954b3cb026e141fd9f582d9f92fc11
847
py
Python
djangoPharma/app/templatetags/app_tags.py
thodoris/djangoPharma
76089e67bc9940651a876d078879469127f5ac66
[ "Apache-2.0" ]
null
null
null
djangoPharma/app/templatetags/app_tags.py
thodoris/djangoPharma
76089e67bc9940651a876d078879469127f5ac66
[ "Apache-2.0" ]
null
null
null
djangoPharma/app/templatetags/app_tags.py
thodoris/djangoPharma
76089e67bc9940651a876d078879469127f5ac66
[ "Apache-2.0" ]
null
null
null
from django import template from django.contrib.auth.models import Group register = template.Library() @register.filter(name='has_group') def has_group(user, group_name): try: group = Group.objects.get(name=group_name) except: return False # group doesn't exist, so for sure the user isn't part of the group # for superuser , always return True if user.is_superuser: return True return user.groups.filter(name=group_name).exists() # The first argument *must* be called "context" here. def breadcrumb_tag(context): request = context['request'] address = request.path return { 'link':address, 'title': address, } # Register the custom tag as an inclusion tag with takes_context=True. register.inclusion_tag('tags/breadcrumb.html', takes_context=True)(breadcrumb_tag)
29.206897
89
0.706021
from django import template from django.contrib.auth.models import Group register = template.Library() @register.filter(name='has_group') def has_group(user, group_name): try: group = Group.objects.get(name=group_name) except: return False if user.is_superuser: return True return user.groups.filter(name=group_name).exists() def breadcrumb_tag(context): request = context['request'] address = request.path return { 'link':address, 'title': address, } register.inclusion_tag('tags/breadcrumb.html', takes_context=True)(breadcrumb_tag)
true
true
f70a58845e40a18b54f35acaaa0caa0a007ce791
265
py
Python
demo_app/config/desktop.py
ravik0007/erpapp_tasks
bafd1de9bbf6889e639320b15c6e7c52124ba05b
[ "MIT" ]
null
null
null
demo_app/config/desktop.py
ravik0007/erpapp_tasks
bafd1de9bbf6889e639320b15c6e7c52124ba05b
[ "MIT" ]
null
null
null
demo_app/config/desktop.py
ravik0007/erpapp_tasks
bafd1de9bbf6889e639320b15c6e7c52124ba05b
[ "MIT" ]
null
null
null
# -*- coding: utf-8 -*- from __future__ import unicode_literals from frappe import _ def get_data(): return [ { "module_name": "Demo App", "color": "grey", "icon": "octicon octicon-file-directory", "type": "module", "label": _("Demo App") } ]
17.666667
44
0.607547
from __future__ import unicode_literals from frappe import _ def get_data(): return [ { "module_name": "Demo App", "color": "grey", "icon": "octicon octicon-file-directory", "type": "module", "label": _("Demo App") } ]
true
true
f70a5b9b2e7e749c433cad42920bd0cd17d8c944
4,446
py
Python
src/pretix/plugins/sendmail/forms.py
sker152/pretix
92754136a653453d00f0b95cdefac533fec5e1ba
[ "ECL-2.0", "Apache-2.0" ]
null
null
null
src/pretix/plugins/sendmail/forms.py
sker152/pretix
92754136a653453d00f0b95cdefac533fec5e1ba
[ "ECL-2.0", "Apache-2.0" ]
null
null
null
src/pretix/plugins/sendmail/forms.py
sker152/pretix
92754136a653453d00f0b95cdefac533fec5e1ba
[ "ECL-2.0", "Apache-2.0" ]
null
null
null
from django import forms from django.urls import reverse from django.utils.translation import pgettext_lazy, ugettext_lazy as _ from i18nfield.forms import I18nFormField, I18nTextarea, I18nTextInput from pretix.base.email import get_available_placeholders from pretix.base.forms import PlaceholderValidator from pretix.base.models import Item, Order, SubEvent from pretix.control.forms.widgets import Select2 class MailForm(forms.Form): recipients = forms.ChoiceField( label=_('Send email to'), widget=forms.RadioSelect, initial='orders', choices=[] ) sendto = forms.MultipleChoiceField() # overridden later subject = forms.CharField(label=_("Subject")) message = forms.CharField(label=_("Message")) items = forms.ModelMultipleChoiceField( widget=forms.CheckboxSelectMultiple( attrs={'class': 'scrolling-multiple-choice'} ), label=_('Only send to people who bought'), required=True, queryset=Item.objects.none() ) subevent = forms.ModelChoiceField( SubEvent.objects.none(), label=_('Only send to customers of'), required=False, empty_label=pgettext_lazy('subevent', 'All dates') ) def _set_field_placeholders(self, fn, base_parameters): phs = [ '{%s}' % p for p in sorted(get_available_placeholders(self.event, base_parameters).keys()) ] ht = _('Available placeholders: {list}').format( list=', '.join(phs) ) if self.fields[fn].help_text: self.fields[fn].help_text += ' ' + str(ht) else: self.fields[fn].help_text = ht self.fields[fn].validators.append( PlaceholderValidator(phs) ) def __init__(self, *args, **kwargs): event = self.event = kwargs.pop('event') super().__init__(*args, **kwargs) recp_choices = [ ('orders', _('Everyone who created a ticket order')) ] if event.settings.attendee_emails_asked: recp_choices += [ ('attendees', _('Every attendee (falling back to the order contact when no attendee email address is ' 'given)')), ('both', _('Both (all order contact addresses and all attendee email addresses)')) ] self.fields['recipients'].choices = recp_choices self.fields['subject'] = I18nFormField( label=_('Subject'), widget=I18nTextInput, required=True, locales=event.settings.get('locales'), ) self.fields['message'] = I18nFormField( label=_('Message'), widget=I18nTextarea, required=True, locales=event.settings.get('locales'), ) self._set_field_placeholders('subject', ['event', 'order', 'position_or_address']) self._set_field_placeholders('message', ['event', 'order', 'position_or_address']) choices = list(Order.STATUS_CHOICE) if not event.settings.get('payment_term_expire_automatically', as_type=bool): choices.append( ('overdue', _('pending with payment overdue')) ) self.fields['sendto'] = forms.MultipleChoiceField( label=_("Send to customers with order status"), widget=forms.CheckboxSelectMultiple( attrs={'class': 'scrolling-multiple-choice'} ), choices=choices ) if not self.initial.get('sendto'): self.initial['sendto'] = ['p', 'n'] self.fields['items'].queryset = event.items.all() if not self.initial.get('items'): self.initial['items'] = event.items.all() if event.has_subevents: self.fields['subevent'].queryset = event.subevents.all() self.fields['subevent'].widget = Select2( attrs={ 'data-model-select2': 'event', 'data-select2-url': reverse('control:event.subevents.select2', kwargs={ 'event': event.slug, 'organizer': event.organizer.slug, }), 'data-placeholder': pgettext_lazy('subevent', 'Date') } ) self.fields['subevent'].widget.choices = self.fields['subevent'].choices else: del self.fields['subevent']
39
118
0.587494
from django import forms from django.urls import reverse from django.utils.translation import pgettext_lazy, ugettext_lazy as _ from i18nfield.forms import I18nFormField, I18nTextarea, I18nTextInput from pretix.base.email import get_available_placeholders from pretix.base.forms import PlaceholderValidator from pretix.base.models import Item, Order, SubEvent from pretix.control.forms.widgets import Select2 class MailForm(forms.Form): recipients = forms.ChoiceField( label=_('Send email to'), widget=forms.RadioSelect, initial='orders', choices=[] ) sendto = forms.MultipleChoiceField() subject = forms.CharField(label=_("Subject")) message = forms.CharField(label=_("Message")) items = forms.ModelMultipleChoiceField( widget=forms.CheckboxSelectMultiple( attrs={'class': 'scrolling-multiple-choice'} ), label=_('Only send to people who bought'), required=True, queryset=Item.objects.none() ) subevent = forms.ModelChoiceField( SubEvent.objects.none(), label=_('Only send to customers of'), required=False, empty_label=pgettext_lazy('subevent', 'All dates') ) def _set_field_placeholders(self, fn, base_parameters): phs = [ '{%s}' % p for p in sorted(get_available_placeholders(self.event, base_parameters).keys()) ] ht = _('Available placeholders: {list}').format( list=', '.join(phs) ) if self.fields[fn].help_text: self.fields[fn].help_text += ' ' + str(ht) else: self.fields[fn].help_text = ht self.fields[fn].validators.append( PlaceholderValidator(phs) ) def __init__(self, *args, **kwargs): event = self.event = kwargs.pop('event') super().__init__(*args, **kwargs) recp_choices = [ ('orders', _('Everyone who created a ticket order')) ] if event.settings.attendee_emails_asked: recp_choices += [ ('attendees', _('Every attendee (falling back to the order contact when no attendee email address is ' 'given)')), ('both', _('Both (all order contact addresses and all attendee email addresses)')) ] self.fields['recipients'].choices = recp_choices self.fields['subject'] = I18nFormField( label=_('Subject'), widget=I18nTextInput, required=True, locales=event.settings.get('locales'), ) self.fields['message'] = I18nFormField( label=_('Message'), widget=I18nTextarea, required=True, locales=event.settings.get('locales'), ) self._set_field_placeholders('subject', ['event', 'order', 'position_or_address']) self._set_field_placeholders('message', ['event', 'order', 'position_or_address']) choices = list(Order.STATUS_CHOICE) if not event.settings.get('payment_term_expire_automatically', as_type=bool): choices.append( ('overdue', _('pending with payment overdue')) ) self.fields['sendto'] = forms.MultipleChoiceField( label=_("Send to customers with order status"), widget=forms.CheckboxSelectMultiple( attrs={'class': 'scrolling-multiple-choice'} ), choices=choices ) if not self.initial.get('sendto'): self.initial['sendto'] = ['p', 'n'] self.fields['items'].queryset = event.items.all() if not self.initial.get('items'): self.initial['items'] = event.items.all() if event.has_subevents: self.fields['subevent'].queryset = event.subevents.all() self.fields['subevent'].widget = Select2( attrs={ 'data-model-select2': 'event', 'data-select2-url': reverse('control:event.subevents.select2', kwargs={ 'event': event.slug, 'organizer': event.organizer.slug, }), 'data-placeholder': pgettext_lazy('subevent', 'Date') } ) self.fields['subevent'].widget.choices = self.fields['subevent'].choices else: del self.fields['subevent']
true
true
f70a5c3041d88ac442f82714d37a6a78ffa82afd
14,503
py
Python
bases_2021_1S/Grupo 03/parserT28/models/instructions/Expression/trigonometric_functions.py
dadu0699/tytus
e1920f6932c840859e3e79eb8756a1d3da88bd77
[ "MIT" ]
35
2020-12-07T03:11:43.000Z
2021-04-15T17:38:16.000Z
bases_2021_1S/Grupo 03/parserT28/models/instructions/Expression/trigonometric_functions.py
dadu0699/tytus
e1920f6932c840859e3e79eb8756a1d3da88bd77
[ "MIT" ]
47
2020-12-09T01:29:09.000Z
2021-01-13T05:37:50.000Z
bases_2021_1S/Grupo 03/parserT28/models/instructions/Expression/trigonometric_functions.py
dadu0699/tytus
e1920f6932c840859e3e79eb8756a1d3da88bd77
[ "MIT" ]
556
2020-12-07T03:13:31.000Z
2021-06-17T17:41:10.000Z
from parserT28.models.instructions.Expression.type_enum import DATA_TYPE from parserT28.controllers.three_address_code import ThreeAddressCode from parserT28.controllers.error_controller import ErrorController from parserT28.models.instructions.Expression.expression import Expression, Identifiers, PrimitiveData from parserT28.models.instructions.shared import ObjectReference from math import * class ExpressionsTrigonometric(Expression): ''' ExpressionsTrigonometric ''' def __init__(self, type_trigonometric, expression1, optional_expression2, line, column): self.type_trigonometric = type_trigonometric self.expression1 = expression1 self.optional_expression2 = optional_expression2 self.line = line self.column = column self.alias = f'{self.type_trigonometric}({self.expression1.alias})' self._tac = "" def __repr__(self): return str(vars(self)) def process(self, expression): type_trigo = self.type_trigonometric exp1 = None exp2 = None result = 0 lista1 = [] try: if isinstance(self.expression1, Identifiers): if isinstance(self.optional_expression2, PrimitiveData): exp2 = self.optional_expression2.process(expression) exp1 = self.expression1.process(expression) if type_trigo.lower() == "acos": result = [acos(columns) for columns in exp1[0]] lista1.append(result) lista1.append(self.alias) return lista1 elif type_trigo.lower() == 'acosd': result = [degrees(acos(columns)) for columns in exp1[0]] lista1.append(result) lista1.append(self.alias) return lista1 elif type_trigo.lower() == 'asin': result = [asin(columns) for columns in exp1[0]] lista1.append(result) lista1.append(self.alias) return lista1 elif type_trigo.lower() == 'asind': result = [degrees(asin(columns)) for columns in exp1[0]] lista1.append(result) lista1.append(self.alias) return lista1 elif type_trigo.lower() == 'atan': result = [atan(columns) for columns in exp1[0]] lista1.append(result) lista1.append(self.alias) return lista1 elif type_trigo.lower() == 'atand': result = [degrees(atan(columns)) for columns in exp1[0]] lista1.append(result) lista1.append(self.alias) return lista1 elif type_trigo.lower() == 'atan2': result = [atan2(columns, exp2.value) for columns in exp1[0]] lista1.append(result) lista1.append(self.alias) return lista1 elif type_trigo.lower() == 'atan2d': result = [degrees(atan2(columns, exp2.value)) for columns in exp1[0]] lista1.append(result) lista1.append(self.alias) return lista1 elif type_trigo.lower() == 'cos': result = [cos(columns) for columns in exp1[0]] lista1.append(result) lista1.append(self.alias) return lista1 elif type_trigo.lower() == 'cosd': result = [degrees(cos(columns)) for columns in exp1[0]] lista1.append(result) lista1.append(self.alias) return lista1 elif type_trigo.lower() == 'cot': result = [(1)/(tan(columns)) for columns in exp1[0]] lista1.append(result) lista1.append(self.alias) return lista1 elif type_trigo.lower() == 'cotd': result = [degrees((1)/(tan(columns))) for columns in exp1[0]] lista1.append(result) lista1.append(self.alias) return lista1 elif type_trigo.lower() == 'sin': result = [sin(columns) for columns in exp1[0]] lista1.append(result) lista1.append(self.alias) return lista1 elif type_trigo.lower() == 'sind': result = [degrees(sin(columns)) for columns in exp1[0]] lista1.append(result) lista1.append(self.alias) return lista1 elif type_trigo.lower() == 'tan': result = [tan(columns) for columns in exp1[0]] lista1.append(result) lista1.append(self.alias) return lista1 elif type_trigo.lower() == 'tand': result = [degrees(tan(columns)) for columns in exp1[0]] lista1.append(result) lista1.append(self.alias) return lista1 elif type_trigo.lower() == 'cosh': result = [cosh(columns) for columns in exp1[0]] lista1.append(result) lista1.append(self.alias) return lista1 elif type_trigo.lower() == 'sinh': result = [sinh(columns) for columns in exp1[0]] lista1.append(result) lista1.append(self.alias) return lista1 elif type_trigo.lower() == 'tanh': result = [tanh(columns) for columns in exp1[0]] lista1.append(result) lista1.append(self.alias) return lista1 elif type_trigo.lower() == 'acosh': result = [acosh(columns) for columns in exp1[0]] lista1.append(result) lista1.append(self.alias) return lista1 elif type_trigo.lower() == 'asinh': result = [asinh(columns) for columns in exp1[0]] lista1.append(result) lista1.append(self.alias) return lista1 elif type_trigo.lower() == 'atanh': result = [atanh(columns) for columns in exp1[0]] lista1.append(result) lista1.append(self.alias) return lista1 else: if isinstance(self.expression1, PrimitiveData): exp1 = self.expression1.process(expression) if isinstance(self.optional_expression2, PrimitiveData): exp2 = self.optional_expression2.process(expression) if type_trigo.lower() == "acos": result = round(acos(float(exp1.value)), 4) elif type_trigo.lower() == 'acosd': result = round(degrees(acos(float(exp1.value))), 4) elif type_trigo.lower() == 'asin': result = round(asin(float(exp1.value)), 4) elif type_trigo.lower() == 'asind': result = round(degrees(asin(float(exp1.value))), 4) elif type_trigo.lower() == 'atan': result = round(atan(float(exp1.value)), 4) elif type_trigo.lower() == 'atand': result = round(degrees(atan(float(exp1.value))), 4) elif type_trigo.lower() == 'atan2': result = round( atan2(float(exp1.value), float(exp2.value)), 4) elif type_trigo.lower() == 'atan2d': result = round( degrees(atan2(float(exp1.value), float(exp2.value))), 4) elif type_trigo.lower() == 'cos': result = round(cos(float(exp1.value)), 4) elif type_trigo.lower() == 'cosd': result = round(degrees(cos(float(exp1.value))), 4) elif type_trigo.lower() == 'cot': result = round(1/(tan(float(exp1.value))), 4) elif type_trigo.lower() == 'cotd': result = round(degrees(1/(tan(float(exp1.value)))), 4) elif type_trigo.lower() == 'sin': result = round(sin(float(exp1.value)), 4) elif type_trigo.lower() == 'sind': result = round(degrees(sin(float(exp1.value))), 4) elif type_trigo.lower() == 'tan': result = round(tan(float(exp1.value)), 4) elif type_trigo.lower() == 'tand': result = round(degrees(tan(float(exp1.value))), 4) elif type_trigo.lower() == 'cosh': result = round(cosh(float(exp1.value)), 4) elif type_trigo.lower() == 'sinh': result = round(sinh(float(exp1.value)), 4) elif type_trigo.lower() == 'tanh': result = round(tanh(float(exp1.value)), 4) elif type_trigo.lower() == 'acosh': result = round(acosh(float(exp1.value)), 4) elif type_trigo.lower() == 'asinh': result = round(asinh(float(exp1.value)), 4) elif type_trigo.lower() == 'atanh': result = round(atanh(float(exp1.value)), 4) return PrimitiveData(DATA_TYPE.NUMBER, result, self.line, self.column) except: desc = "FATAL ERROR --- ExpressionsTrigonometric" ErrorController().add(34, 'Execution', desc, self.line, self.column) def compile(self, expression): type_trigo = self.type_trigonometric temporal = ThreeAddressCode().newTemp() temp1 = self.expression1.compile(expression) temp2 = None if self.optional_expression2: temp2 = self.optional_expression2.compile(expression) if type_trigo.lower() == "acos": ThreeAddressCode().addCode(f"{temporal} = acos({temp1.value})") elif type_trigo.lower() == 'acosd': temporal1 = ThreeAddressCode().newTemp() ThreeAddressCode().addCode(f"{temporal1} = acos({temp1.value})") ThreeAddressCode().addCode(f"{temporal} = degrees({temporal1})") elif type_trigo.lower() == 'asin': ThreeAddressCode().addCode(f"{temporal} = asin({temp1.value})") elif type_trigo.lower() == 'asind': temporal1 = ThreeAddressCode().newTemp() ThreeAddressCode().addCode(f"{temporal1} = asin({temp1.value})") ThreeAddressCode().addCode(f"{temporal} = degrees({temporal1})") elif type_trigo.lower() == 'atan': ThreeAddressCode().addCode(f"{temporal} = atan({temp1.value})") elif type_trigo.lower() == 'atand': temporal1 = ThreeAddressCode().newTemp() ThreeAddressCode().addCode(f"{temporal1} = atan({temp1.value})") ThreeAddressCode().addCode(f"{temporal} = degrees({temporal1})") elif type_trigo.lower() == 'atan2': ThreeAddressCode().addCode( f"{temporal} = atan2({temp1.value}, {temp2.value})") elif type_trigo.lower() == 'atan2d': temporal1 = ThreeAddressCode().newTemp() ThreeAddressCode().addCode( f"{temporal1} = atan2({temp1.value}, {temp2.value})") ThreeAddressCode().addCode(f"{temporal} = degrees({temporal1})") elif type_trigo.lower() == 'cos': ThreeAddressCode().addCode(f"{temporal} = cos({temp1.value})") elif type_trigo.lower() == 'cosd': temporal1 = ThreeAddressCode().newTemp() ThreeAddressCode().addCode(f"{temporal1} = cos({temp1.value})") ThreeAddressCode().addCode(f"{temporal} = degrees({temporal1})") elif type_trigo.lower() == 'cot': temporal1 = ThreeAddressCode().newTemp() ThreeAddressCode().addCode(f"{temporal1} = tan({temp1.value})") ThreeAddressCode().addCode(f"{temporal} = 1 / {temporal1}") elif type_trigo.lower() == 'cotd': temporal1 = ThreeAddressCode().newTemp() ThreeAddressCode().addCode(f"{temporal1} = tan({temp1.value})") temporal2 = ThreeAddressCode().newTemp() ThreeAddressCode().addCode(f"{temporal2} = 1 / {temporal1}") ThreeAddressCode().addCode(f"{temporal} = degrees({temporal2})") elif type_trigo.lower() == 'sin': ThreeAddressCode().addCode(f"{temporal} = sin({temp1.value})") elif type_trigo.lower() == 'sind': temporal1 = ThreeAddressCode().newTemp() ThreeAddressCode().addCode(f"{temporal1} = sin({temp1.value})") ThreeAddressCode().addCode(f"{temporal} = degrees({temporal1})") elif type_trigo.lower() == 'tan': ThreeAddressCode().addCode(f"{temporal} = tan({temp1.value})") elif type_trigo.lower() == 'tand': temporal1 = ThreeAddressCode().newTemp() ThreeAddressCode().addCode(f"{temporal1} = tan({temp1.value})") ThreeAddressCode().addCode(f"{temporal} = degrees({temporal1})") elif type_trigo.lower() == 'cosh': ThreeAddressCode().addCode(f"{temporal} = cosh({temp1.value})") elif type_trigo.lower() == 'sinh': ThreeAddressCode().addCode(f"{temporal} = sinh({temp1.value})") elif type_trigo.lower() == 'tanh': ThreeAddressCode().addCode(f"{temporal} = tanh({temp1.value})") elif type_trigo.lower() == 'acosh': ThreeAddressCode().addCode(f"{temporal} = acosh({temp1.value})") elif type_trigo.lower() == 'asinh': ThreeAddressCode().addCode(f"{temporal} = asinh({temp1.value})") elif type_trigo.lower() == 'atanh': ThreeAddressCode().addCode(f"{temporal} = atanh({temp1.value})") return PrimitiveData(DATA_TYPE.NUMBER, temporal, self.line, self.column)
46.187898
102
0.524581
from parserT28.models.instructions.Expression.type_enum import DATA_TYPE from parserT28.controllers.three_address_code import ThreeAddressCode from parserT28.controllers.error_controller import ErrorController from parserT28.models.instructions.Expression.expression import Expression, Identifiers, PrimitiveData from parserT28.models.instructions.shared import ObjectReference from math import * class ExpressionsTrigonometric(Expression): def __init__(self, type_trigonometric, expression1, optional_expression2, line, column): self.type_trigonometric = type_trigonometric self.expression1 = expression1 self.optional_expression2 = optional_expression2 self.line = line self.column = column self.alias = f'{self.type_trigonometric}({self.expression1.alias})' self._tac = "" def __repr__(self): return str(vars(self)) def process(self, expression): type_trigo = self.type_trigonometric exp1 = None exp2 = None result = 0 lista1 = [] try: if isinstance(self.expression1, Identifiers): if isinstance(self.optional_expression2, PrimitiveData): exp2 = self.optional_expression2.process(expression) exp1 = self.expression1.process(expression) if type_trigo.lower() == "acos": result = [acos(columns) for columns in exp1[0]] lista1.append(result) lista1.append(self.alias) return lista1 elif type_trigo.lower() == 'acosd': result = [degrees(acos(columns)) for columns in exp1[0]] lista1.append(result) lista1.append(self.alias) return lista1 elif type_trigo.lower() == 'asin': result = [asin(columns) for columns in exp1[0]] lista1.append(result) lista1.append(self.alias) return lista1 elif type_trigo.lower() == 'asind': result = [degrees(asin(columns)) for columns in exp1[0]] lista1.append(result) lista1.append(self.alias) return lista1 elif type_trigo.lower() == 'atan': result = [atan(columns) for columns in exp1[0]] lista1.append(result) lista1.append(self.alias) return lista1 elif type_trigo.lower() == 'atand': result = [degrees(atan(columns)) for columns in exp1[0]] lista1.append(result) lista1.append(self.alias) return lista1 elif type_trigo.lower() == 'atan2': result = [atan2(columns, exp2.value) for columns in exp1[0]] lista1.append(result) lista1.append(self.alias) return lista1 elif type_trigo.lower() == 'atan2d': result = [degrees(atan2(columns, exp2.value)) for columns in exp1[0]] lista1.append(result) lista1.append(self.alias) return lista1 elif type_trigo.lower() == 'cos': result = [cos(columns) for columns in exp1[0]] lista1.append(result) lista1.append(self.alias) return lista1 elif type_trigo.lower() == 'cosd': result = [degrees(cos(columns)) for columns in exp1[0]] lista1.append(result) lista1.append(self.alias) return lista1 elif type_trigo.lower() == 'cot': result = [(1)/(tan(columns)) for columns in exp1[0]] lista1.append(result) lista1.append(self.alias) return lista1 elif type_trigo.lower() == 'cotd': result = [degrees((1)/(tan(columns))) for columns in exp1[0]] lista1.append(result) lista1.append(self.alias) return lista1 elif type_trigo.lower() == 'sin': result = [sin(columns) for columns in exp1[0]] lista1.append(result) lista1.append(self.alias) return lista1 elif type_trigo.lower() == 'sind': result = [degrees(sin(columns)) for columns in exp1[0]] lista1.append(result) lista1.append(self.alias) return lista1 elif type_trigo.lower() == 'tan': result = [tan(columns) for columns in exp1[0]] lista1.append(result) lista1.append(self.alias) return lista1 elif type_trigo.lower() == 'tand': result = [degrees(tan(columns)) for columns in exp1[0]] lista1.append(result) lista1.append(self.alias) return lista1 elif type_trigo.lower() == 'cosh': result = [cosh(columns) for columns in exp1[0]] lista1.append(result) lista1.append(self.alias) return lista1 elif type_trigo.lower() == 'sinh': result = [sinh(columns) for columns in exp1[0]] lista1.append(result) lista1.append(self.alias) return lista1 elif type_trigo.lower() == 'tanh': result = [tanh(columns) for columns in exp1[0]] lista1.append(result) lista1.append(self.alias) return lista1 elif type_trigo.lower() == 'acosh': result = [acosh(columns) for columns in exp1[0]] lista1.append(result) lista1.append(self.alias) return lista1 elif type_trigo.lower() == 'asinh': result = [asinh(columns) for columns in exp1[0]] lista1.append(result) lista1.append(self.alias) return lista1 elif type_trigo.lower() == 'atanh': result = [atanh(columns) for columns in exp1[0]] lista1.append(result) lista1.append(self.alias) return lista1 else: if isinstance(self.expression1, PrimitiveData): exp1 = self.expression1.process(expression) if isinstance(self.optional_expression2, PrimitiveData): exp2 = self.optional_expression2.process(expression) if type_trigo.lower() == "acos": result = round(acos(float(exp1.value)), 4) elif type_trigo.lower() == 'acosd': result = round(degrees(acos(float(exp1.value))), 4) elif type_trigo.lower() == 'asin': result = round(asin(float(exp1.value)), 4) elif type_trigo.lower() == 'asind': result = round(degrees(asin(float(exp1.value))), 4) elif type_trigo.lower() == 'atan': result = round(atan(float(exp1.value)), 4) elif type_trigo.lower() == 'atand': result = round(degrees(atan(float(exp1.value))), 4) elif type_trigo.lower() == 'atan2': result = round( atan2(float(exp1.value), float(exp2.value)), 4) elif type_trigo.lower() == 'atan2d': result = round( degrees(atan2(float(exp1.value), float(exp2.value))), 4) elif type_trigo.lower() == 'cos': result = round(cos(float(exp1.value)), 4) elif type_trigo.lower() == 'cosd': result = round(degrees(cos(float(exp1.value))), 4) elif type_trigo.lower() == 'cot': result = round(1/(tan(float(exp1.value))), 4) elif type_trigo.lower() == 'cotd': result = round(degrees(1/(tan(float(exp1.value)))), 4) elif type_trigo.lower() == 'sin': result = round(sin(float(exp1.value)), 4) elif type_trigo.lower() == 'sind': result = round(degrees(sin(float(exp1.value))), 4) elif type_trigo.lower() == 'tan': result = round(tan(float(exp1.value)), 4) elif type_trigo.lower() == 'tand': result = round(degrees(tan(float(exp1.value))), 4) elif type_trigo.lower() == 'cosh': result = round(cosh(float(exp1.value)), 4) elif type_trigo.lower() == 'sinh': result = round(sinh(float(exp1.value)), 4) elif type_trigo.lower() == 'tanh': result = round(tanh(float(exp1.value)), 4) elif type_trigo.lower() == 'acosh': result = round(acosh(float(exp1.value)), 4) elif type_trigo.lower() == 'asinh': result = round(asinh(float(exp1.value)), 4) elif type_trigo.lower() == 'atanh': result = round(atanh(float(exp1.value)), 4) return PrimitiveData(DATA_TYPE.NUMBER, result, self.line, self.column) except: desc = "FATAL ERROR --- ExpressionsTrigonometric" ErrorController().add(34, 'Execution', desc, self.line, self.column) def compile(self, expression): type_trigo = self.type_trigonometric temporal = ThreeAddressCode().newTemp() temp1 = self.expression1.compile(expression) temp2 = None if self.optional_expression2: temp2 = self.optional_expression2.compile(expression) if type_trigo.lower() == "acos": ThreeAddressCode().addCode(f"{temporal} = acos({temp1.value})") elif type_trigo.lower() == 'acosd': temporal1 = ThreeAddressCode().newTemp() ThreeAddressCode().addCode(f"{temporal1} = acos({temp1.value})") ThreeAddressCode().addCode(f"{temporal} = degrees({temporal1})") elif type_trigo.lower() == 'asin': ThreeAddressCode().addCode(f"{temporal} = asin({temp1.value})") elif type_trigo.lower() == 'asind': temporal1 = ThreeAddressCode().newTemp() ThreeAddressCode().addCode(f"{temporal1} = asin({temp1.value})") ThreeAddressCode().addCode(f"{temporal} = degrees({temporal1})") elif type_trigo.lower() == 'atan': ThreeAddressCode().addCode(f"{temporal} = atan({temp1.value})") elif type_trigo.lower() == 'atand': temporal1 = ThreeAddressCode().newTemp() ThreeAddressCode().addCode(f"{temporal1} = atan({temp1.value})") ThreeAddressCode().addCode(f"{temporal} = degrees({temporal1})") elif type_trigo.lower() == 'atan2': ThreeAddressCode().addCode( f"{temporal} = atan2({temp1.value}, {temp2.value})") elif type_trigo.lower() == 'atan2d': temporal1 = ThreeAddressCode().newTemp() ThreeAddressCode().addCode( f"{temporal1} = atan2({temp1.value}, {temp2.value})") ThreeAddressCode().addCode(f"{temporal} = degrees({temporal1})") elif type_trigo.lower() == 'cos': ThreeAddressCode().addCode(f"{temporal} = cos({temp1.value})") elif type_trigo.lower() == 'cosd': temporal1 = ThreeAddressCode().newTemp() ThreeAddressCode().addCode(f"{temporal1} = cos({temp1.value})") ThreeAddressCode().addCode(f"{temporal} = degrees({temporal1})") elif type_trigo.lower() == 'cot': temporal1 = ThreeAddressCode().newTemp() ThreeAddressCode().addCode(f"{temporal1} = tan({temp1.value})") ThreeAddressCode().addCode(f"{temporal} = 1 / {temporal1}") elif type_trigo.lower() == 'cotd': temporal1 = ThreeAddressCode().newTemp() ThreeAddressCode().addCode(f"{temporal1} = tan({temp1.value})") temporal2 = ThreeAddressCode().newTemp() ThreeAddressCode().addCode(f"{temporal2} = 1 / {temporal1}") ThreeAddressCode().addCode(f"{temporal} = degrees({temporal2})") elif type_trigo.lower() == 'sin': ThreeAddressCode().addCode(f"{temporal} = sin({temp1.value})") elif type_trigo.lower() == 'sind': temporal1 = ThreeAddressCode().newTemp() ThreeAddressCode().addCode(f"{temporal1} = sin({temp1.value})") ThreeAddressCode().addCode(f"{temporal} = degrees({temporal1})") elif type_trigo.lower() == 'tan': ThreeAddressCode().addCode(f"{temporal} = tan({temp1.value})") elif type_trigo.lower() == 'tand': temporal1 = ThreeAddressCode().newTemp() ThreeAddressCode().addCode(f"{temporal1} = tan({temp1.value})") ThreeAddressCode().addCode(f"{temporal} = degrees({temporal1})") elif type_trigo.lower() == 'cosh': ThreeAddressCode().addCode(f"{temporal} = cosh({temp1.value})") elif type_trigo.lower() == 'sinh': ThreeAddressCode().addCode(f"{temporal} = sinh({temp1.value})") elif type_trigo.lower() == 'tanh': ThreeAddressCode().addCode(f"{temporal} = tanh({temp1.value})") elif type_trigo.lower() == 'acosh': ThreeAddressCode().addCode(f"{temporal} = acosh({temp1.value})") elif type_trigo.lower() == 'asinh': ThreeAddressCode().addCode(f"{temporal} = asinh({temp1.value})") elif type_trigo.lower() == 'atanh': ThreeAddressCode().addCode(f"{temporal} = atanh({temp1.value})") return PrimitiveData(DATA_TYPE.NUMBER, temporal, self.line, self.column)
true
true
f70a5c8395fa19831b0e3bd7d8affacab5114e5c
5,465
py
Python
docs/conf.py
kattni/Adafruit_CircuitPython_MatrixKeypad
cbe0474ca08ce0b9beaf7322ecda487d8db9a5fe
[ "MIT" ]
null
null
null
docs/conf.py
kattni/Adafruit_CircuitPython_MatrixKeypad
cbe0474ca08ce0b9beaf7322ecda487d8db9a5fe
[ "MIT" ]
null
null
null
docs/conf.py
kattni/Adafruit_CircuitPython_MatrixKeypad
cbe0474ca08ce0b9beaf7322ecda487d8db9a5fe
[ "MIT" ]
null
null
null
# -*- coding: utf-8 -*- import os import sys sys.path.insert(0, os.path.abspath('..')) # -- General configuration ------------------------------------------------ # Add any Sphinx extension module names here, as strings. They can be # extensions coming with Sphinx (named 'sphinx.ext.*') or your custom # ones. extensions = [ 'sphinx.ext.autodoc', 'sphinx.ext.intersphinx', 'sphinx.ext.napoleon', 'sphinx.ext.todo', ] # TODO: Please Read! # Uncomment the below if you use native CircuitPython modules such as # digitalio, micropython and busio. List the modules you use. Without it, the # autodoc module docs will fail to generate with a warning. # autodoc_mock_imports = ["digitalio", "busio"] # autodoc_mock_imports = ["digitalio"] intersphinx_mapping = {'python': ('https://docs.python.org/3.4', None),'BusDevice': ('https://circuitpython.readthedocs.io/projects/busdevice/en/latest/', None),'Register': ('https://circuitpython.readthedocs.io/projects/register/en/latest/', None),'CircuitPython': ('https://circuitpython.readthedocs.io/en/latest/', None)} # Add any paths that contain templates here, relative to this directory. templates_path = ['_templates'] source_suffix = '.rst' # The master toctree document. master_doc = 'index' # General information about the project. project = u'Adafruit MatrixKeypad Library' copyright = u'2018 ladyada' author = u'ladyada' # The version info for the project you're documenting, acts as replacement for # |version| and |release|, also used in various other places throughout the # built documents. # # The short X.Y version. version = u'1.0' # The full version, including alpha/beta/rc tags. release = u'1.0' # The language for content autogenerated by Sphinx. Refer to documentation # for a list of supported languages. # # This is also used if you do content translation via gettext catalogs. # Usually you set "language" from the command line for these cases. language = None # List of patterns, relative to source directory, that match files and # directories to ignore when looking for source files. # This patterns also effect to html_static_path and html_extra_path exclude_patterns = ['_build', 'Thumbs.db', '.DS_Store', '.env', 'CODE_OF_CONDUCT.md'] # The reST default role (used for this markup: `text`) to use for all # documents. # default_role = "any" # If true, '()' will be appended to :func: etc. cross-reference text. # add_function_parentheses = True # The name of the Pygments (syntax highlighting) style to use. pygments_style = 'sphinx' # If true, `todo` and `todoList` produce output, else they produce nothing. todo_include_todos = False # If this is True, todo emits a warning for each TODO entries. The default is False. todo_emit_warnings = True napoleon_numpy_docstring = False # -- Options for HTML output ---------------------------------------------- # The theme to use for HTML and HTML Help pages. See the documentation for # a list of builtin themes. # on_rtd = os.environ.get('READTHEDOCS', None) == 'True' if not on_rtd: # only import and set the theme if we're building docs locally try: import sphinx_rtd_theme html_theme = 'sphinx_rtd_theme' html_theme_path = [sphinx_rtd_theme.get_html_theme_path(), '.'] except: html_theme = 'default' html_theme_path = ['.'] else: html_theme_path = ['.'] # Add any paths that contain custom static files (such as style sheets) here, # relative to this directory. They are copied after the builtin static files, # so a file named "default.css" will overwrite the builtin "default.css". html_static_path = ['_static'] # The name of an image file (relative to this directory) to use as a favicon of # the docs. This file should be a Windows icon file (.ico) being 16x16 or 32x32 # pixels large. # html_favicon = '_static/favicon.ico' # Output file base name for HTML help builder. htmlhelp_basename = 'AdafruitMatrixkeypadLibrarydoc' # -- Options for LaTeX output --------------------------------------------- latex_elements = { # The paper size ('letterpaper' or 'a4paper'). # # 'papersize': 'letterpaper', # The font size ('10pt', '11pt' or '12pt'). # # 'pointsize': '10pt', # Additional stuff for the LaTeX preamble. # # 'preamble': '', # Latex figure (float) alignment # # 'figure_align': 'htbp', } # Grouping the document tree into LaTeX files. List of tuples # (source start file, target name, title, # author, documentclass [howto, manual, or own class]). latex_documents = [ (master_doc, 'AdafruitMatrixKeypadLibrary.tex', u'AdafruitMatrixKeypad Library Documentation', author, 'manual'), ] # -- Options for manual page output --------------------------------------- # One entry per manual page. List of tuples # (source start file, name, description, authors, manual section). man_pages = [ (master_doc, 'AdafruitMatrixKeypadlibrary', u'Adafruit MatrixKeypad Library Documentation', [author], 1) ] # -- Options for Texinfo output ------------------------------------------- # Grouping the document tree into Texinfo files. List of tuples # (source start file, target name, title, author, # dir menu entry, description, category) texinfo_documents = [ (master_doc, 'AdafruitMatrixKeypadLibrary', u'Adafruit MatrixKeypad Library Documentation', author, 'AdafruitMatrixKeypadLibrary', 'One line description of project.', 'Miscellaneous'), ]
33.734568
324
0.69021
import os import sys sys.path.insert(0, os.path.abspath('..')) extensions = [ 'sphinx.ext.autodoc', 'sphinx.ext.intersphinx', 'sphinx.ext.napoleon', 'sphinx.ext.todo', ] intersphinx_mapping = {'python': ('https://docs.python.org/3.4', None),'BusDevice': ('https://circuitpython.readthedocs.io/projects/busdevice/en/latest/', None),'Register': ('https://circuitpython.readthedocs.io/projects/register/en/latest/', None),'CircuitPython': ('https://circuitpython.readthedocs.io/en/latest/', None)} templates_path = ['_templates'] source_suffix = '.rst' master_doc = 'index' project = u'Adafruit MatrixKeypad Library' copyright = u'2018 ladyada' author = u'ladyada' # |version| and |release|, also used in various other places throughout the # built documents. # # The short X.Y version. version = u'1.0' # The full version, including alpha/beta/rc tags. release = u'1.0' # The language for content autogenerated by Sphinx. Refer to documentation # for a list of supported languages. # # This is also used if you do content translation via gettext catalogs. # Usually you set "language" from the command line for these cases. language = None # List of patterns, relative to source directory, that match files and # directories to ignore when looking for source files. # This patterns also effect to html_static_path and html_extra_path exclude_patterns = ['_build', 'Thumbs.db', '.DS_Store', '.env', 'CODE_OF_CONDUCT.md'] # The reST default role (used for this markup: `text`) to use for all # documents. # default_role = "any" # If true, '()' will be appended to :func: etc. cross-reference text. # add_function_parentheses = True # The name of the Pygments (syntax highlighting) style to use. pygments_style = 'sphinx' # If true, `todo` and `todoList` produce output, else they produce nothing. todo_include_todos = False # If this is True, todo emits a warning for each TODO entries. The default is False. todo_emit_warnings = True napoleon_numpy_docstring = False # -- Options for HTML output ---------------------------------------------- # The theme to use for HTML and HTML Help pages. See the documentation for # a list of builtin themes. # on_rtd = os.environ.get('READTHEDOCS', None) == 'True' if not on_rtd: # only import and set the theme if we're building docs locally try: import sphinx_rtd_theme html_theme = 'sphinx_rtd_theme' html_theme_path = [sphinx_rtd_theme.get_html_theme_path(), '.'] except: html_theme = 'default' html_theme_path = ['.'] else: html_theme_path = ['.'] html_static_path = ['_static'] html_favicon = '_static/favicon.ico' htmlhelp_basename = 'AdafruitMatrixkeypadLibrarydoc' latex_elements = { } latex_documents = [ (master_doc, 'AdafruitMatrixKeypadLibrary.tex', u'AdafruitMatrixKeypad Library Documentation', author, 'manual'), ] man_pages = [ (master_doc, 'AdafruitMatrixKeypadlibrary', u'Adafruit MatrixKeypad Library Documentation', [author], 1) ] texinfo_documents = [ (master_doc, 'AdafruitMatrixKeypadLibrary', u'Adafruit MatrixKeypad Library Documentation', author, 'AdafruitMatrixKeypadLibrary', 'One line description of project.', 'Miscellaneous'), ]
true
true
f70a5d79a04061ba9e020a7854cb72fde0f00f28
8,923
py
Python
DeutschlandStadtLandFluss/generateAnkiDeck.py
SoerenSofke/Anki
533b3d340f441582d094b04cfa1eb4d99bd7a8d0
[ "CC0-1.0" ]
null
null
null
DeutschlandStadtLandFluss/generateAnkiDeck.py
SoerenSofke/Anki
533b3d340f441582d094b04cfa1eb4d99bd7a8d0
[ "CC0-1.0" ]
null
null
null
DeutschlandStadtLandFluss/generateAnkiDeck.py
SoerenSofke/Anki
533b3d340f441582d094b04cfa1eb4d99bd7a8d0
[ "CC0-1.0" ]
null
null
null
import genanki import glob from pathlib import Path import random def generateAnki(): random.seed(42) title = 'Deutschland - Stadt, Land, Fluss' aDeck = genanki.Deck( 2059400110, title) # location to name aModel = genanki.Model( 1607392319, title, fields=[ {'name': 'Question'}, {'name': 'MapStyleQ'}, {'name': 'Answer'}, {'name': 'MapStyleA'}, ], templates=[ { 'name': 'Card Number', 'qfmt': '{{Question}}<br><br>{{MapStyleQ}}<div id="inline-svg"></div><script src="https://rawcdn.githack.com/SoerenSofke/Anki/release/v1.0.0/DeutschlandStadtLandFluss/inline-svg.js"></script>', 'afmt': '{{Question}}<br><br>{{MapStyleA}}<div id="inline-svg"></div><script src="https://rawcdn.githack.com/SoerenSofke/Anki/release/v1.0.0/DeutschlandStadtLandFluss/inline-svg.js"></script><hr id=answer><u>{{Answer}}</u>', }, ], css=''' .card { font-family: arial; font-size: 20px; text-align: center; color: black; background-color: white; } hr#answer { visibility: hidden; } ''' ) states = [ "Niedersachsen", "Hamburg", "Brandenburg", "Berlin", "Saarland", "Hessen", "Bremen", "Nordrhein-Westfalen", "Rheinland-Pfalz", "Sachsen", "Schleswig-Holstein", "Thüringen", "Mecklenburg-Vorpommern", "Bayern", "Baden-Württemberg", "Sachsen-Anhalt", ] random.shuffle(states) for state in states: question = 'Wie heißt das rot markierte <u>Bundesland</u>?' mapStyle = '<style>#State_' + state + ' {fill: crimson;}</style>' answer = state aDeck.add_note( genanki.Note( model=aModel, fields=[ question, mapStyle, answer, mapStyle, ] )) for state in states: question = 'Wo liegt das Bundesland <u>' + state +'</u>?' mapStyleQ = '<style></style>' answer = '' mapStyleA = '<style>#State_' + state + ' {fill: crimson;}</style>' aDeck.add_note( genanki.Note( model=aModel, fields=[ question, mapStyleQ, answer, mapStyleA, ] )) cities = [ 'Bremen', 'Berlin', 'Hamburg', 'Dresden', 'Düsseldorf', 'Erfurt', 'Hannover', 'Kiel', 'Magdeburg', 'Mainz', 'München', 'Saarbrücken', 'Schwerin', 'Stuttgart', 'Wiesbaden', 'Potsdam', ] random.shuffle(cities) for city in cities: question = 'Wie heißt die rot markierte <u>Stadt</u>?' mapStyle = '<style>#City_' + city + ' {fill: crimson;} #Cities {visibility: visible;}</style>' answer = city aDeck.add_note( genanki.Note( model=aModel, fields=[ question, mapStyle, answer, mapStyle ] )) for city in cities: question = 'Wo liegt die Stadt <u>' + city +'</u>?' mapStyleQ = '<style>#Cities {visibility: visible;}</style>' answer = '' mapStyleA = '<style>#City_' + city + ' {fill: crimson;} #Cities {visibility: visible;}</style>' aDeck.add_note( genanki.Note( model=aModel, fields=[ question, mapStyleQ, answer, mapStyleA ] )) mountains = [ 'Teutoburger_Wald', 'Rothaargebirge', 'Westerwald', 'Eifel', 'Taunus', 'Odenwald', 'Hunsrück', 'Vogelsberg', 'Rhön', 'Thüringer_Wald', 'Erzgebirge', 'Fichtelgebirge', 'Oberpfälzer_Wald', 'Fränkische_Alb', 'Bayerischer_Wald', 'Schwäbische_Alb', 'Schwarzwald', 'Alpenvorland', 'Spessart', 'Harz', ] random.shuffle(mountains) for mountain in mountains: question = 'Wie heißt das rot markierte <u>Gebirge</u>?' mapStyle = '<style>#Mountain_' + mountain + ' {fill: crimson;} #Mountains {visibility: visible;}</style>' answer = mountain.replace('_', ' ') aDeck.add_note( genanki.Note( model=aModel, fields=[ question, mapStyle, answer, mapStyle ] )) for mountain in mountains: question = 'Wo liegt das Gebirge <u>' + mountain.replace('_', ' ') +'</u>?' mapStyleQ = '<style>#Mountains {visibility: visible;}</style>' answer = '' mapStyleA = '<style>#Mountain_' + mountain + ' {fill: crimson;} #Mountains {visibility: visible;}</style>' aDeck.add_note( genanki.Note( model=aModel, fields=[ question, mapStyleQ, answer, mapStyleA ] )) rivers = [ 'Donau', 'Lech', 'Isar', 'Inn', 'Rhein', 'Neckar', 'Main', 'Ems', 'Weser', 'Werra', 'Ruhr', 'Oder', 'Saale', 'Mosel', 'Spree', 'Neisse', 'Lippe', 'Havel', 'Elbe', 'Fulda', 'Aller', 'Mulde', 'Unstrut', 'Peene', 'Naab', 'Lahn', 'Leine', 'Regnitz', 'Salzach', ] random.shuffle(rivers) for river in rivers: question = 'Wie heißt der rot markierte <u>Fluss</u>?' mapStyle = '<style>#River_' + river + ' {stroke: crimson; stroke-width: 5} #Rivers {visibility: visible;}</style>' answer = river aDeck.add_note( genanki.Note( model=aModel, fields=[ question, mapStyle, answer, mapStyle ] )) for river in rivers: question = 'Wo liegt der Fluss <u>' + river +'</u>?' mapStyleQ = '<style>#Rivers {visibility: visible;}</style>' answer = '' mapStyleA = '<style>#River_' + river + ' {stroke: crimson; stroke-width: 5} #Rivers {visibility: visible;}</style>' aDeck.add_note( genanki.Note( model=aModel, fields=[ question, mapStyleQ, answer, mapStyleA ] )) nations = [ 'Tschechien', 'Österreich', 'Frankreich', 'Schweiz', 'Polen', 'Belgien', 'Luxemburg', 'Niederlande', 'Dänemark', ] random.shuffle(nations) for nation in nations: question = 'Wie heißt das rot markierte <u>Land</u>?' mapStyle = '<style>#Nation_' + nation + ' {fill: crimson;} </style>' answer = nation aDeck.add_note( genanki.Note( model=aModel, fields=[ question, mapStyle, answer, mapStyle ] )) for nation in nations: question = 'Wo liegt der Land <u>' + nation +'</u>?' mapStyleQ = '<style></style>' answer = '' mapStyleA = '<style>#Nation_' + nation + ' {fill: crimson;} </style>' aDeck.add_note( genanki.Note( model=aModel, fields=[ question, mapStyleQ, answer, mapStyleA ] )) aPackage = genanki.Package(aDeck) aPackage.write_to_file(title + '.apkg') def main(): generateAnki() if __name__ == "__main__": main()
26.876506
240
0.419029
import genanki import glob from pathlib import Path import random def generateAnki(): random.seed(42) title = 'Deutschland - Stadt, Land, Fluss' aDeck = genanki.Deck( 2059400110, title) aModel = genanki.Model( 1607392319, title, fields=[ {'name': 'Question'}, {'name': 'MapStyleQ'}, {'name': 'Answer'}, {'name': 'MapStyleA'}, ], templates=[ { 'name': 'Card Number', 'qfmt': '{{Question}}<br><br>{{MapStyleQ}}<div id="inline-svg"></div><script src="https://rawcdn.githack.com/SoerenSofke/Anki/release/v1.0.0/DeutschlandStadtLandFluss/inline-svg.js"></script>', 'afmt': '{{Question}}<br><br>{{MapStyleA}}<div id="inline-svg"></div><script src="https://rawcdn.githack.com/SoerenSofke/Anki/release/v1.0.0/DeutschlandStadtLandFluss/inline-svg.js"></script><hr id=answer><u>{{Answer}}</u>', }, ], css=''' .card { font-family: arial; font-size: 20px; text-align: center; color: black; background-color: white; } hr#answer { visibility: hidden; } ''' ) states = [ "Niedersachsen", "Hamburg", "Brandenburg", "Berlin", "Saarland", "Hessen", "Bremen", "Nordrhein-Westfalen", "Rheinland-Pfalz", "Sachsen", "Schleswig-Holstein", "Thüringen", "Mecklenburg-Vorpommern", "Bayern", "Baden-Württemberg", "Sachsen-Anhalt", ] random.shuffle(states) for state in states: question = 'Wie heißt das rot markierte <u>Bundesland</u>?' mapStyle = '<style>#State_' + state + ' {fill: crimson;}</style>' answer = state aDeck.add_note( genanki.Note( model=aModel, fields=[ question, mapStyle, answer, mapStyle, ] )) for state in states: question = 'Wo liegt das Bundesland <u>' + state +'</u>?' mapStyleQ = '<style></style>' answer = '' mapStyleA = '<style>#State_' + state + ' {fill: crimson;}</style>' aDeck.add_note( genanki.Note( model=aModel, fields=[ question, mapStyleQ, answer, mapStyleA, ] )) cities = [ 'Bremen', 'Berlin', 'Hamburg', 'Dresden', 'Düsseldorf', 'Erfurt', 'Hannover', 'Kiel', 'Magdeburg', 'Mainz', 'München', 'Saarbrücken', 'Schwerin', 'Stuttgart', 'Wiesbaden', 'Potsdam', ] random.shuffle(cities) for city in cities: question = 'Wie heißt die rot markierte <u>Stadt</u>?' mapStyle = '<style>#City_' + city + ' {fill: crimson;} #Cities {visibility: visible;}</style>' answer = city aDeck.add_note( genanki.Note( model=aModel, fields=[ question, mapStyle, answer, mapStyle ] )) for city in cities: question = 'Wo liegt die Stadt <u>' + city +'</u>?' mapStyleQ = '<style>#Cities {visibility: visible;}</style>' answer = '' mapStyleA = '<style>#City_' + city + ' {fill: crimson;} #Cities {visibility: visible;}</style>' aDeck.add_note( genanki.Note( model=aModel, fields=[ question, mapStyleQ, answer, mapStyleA ] )) mountains = [ 'Teutoburger_Wald', 'Rothaargebirge', 'Westerwald', 'Eifel', 'Taunus', 'Odenwald', 'Hunsrück', 'Vogelsberg', 'Rhön', 'Thüringer_Wald', 'Erzgebirge', 'Fichtelgebirge', 'Oberpfälzer_Wald', 'Fränkische_Alb', 'Bayerischer_Wald', 'Schwäbische_Alb', 'Schwarzwald', 'Alpenvorland', 'Spessart', 'Harz', ] random.shuffle(mountains) for mountain in mountains: question = 'Wie heißt das rot markierte <u>Gebirge</u>?' mapStyle = '<style>#Mountain_' + mountain + ' {fill: crimson;} #Mountains {visibility: visible;}</style>' answer = mountain.replace('_', ' ') aDeck.add_note( genanki.Note( model=aModel, fields=[ question, mapStyle, answer, mapStyle ] )) for mountain in mountains: question = 'Wo liegt das Gebirge <u>' + mountain.replace('_', ' ') +'</u>?' mapStyleQ = '<style>#Mountains {visibility: visible;}</style>' answer = '' mapStyleA = '<style>#Mountain_' + mountain + ' {fill: crimson;} #Mountains {visibility: visible;}</style>' aDeck.add_note( genanki.Note( model=aModel, fields=[ question, mapStyleQ, answer, mapStyleA ] )) rivers = [ 'Donau', 'Lech', 'Isar', 'Inn', 'Rhein', 'Neckar', 'Main', 'Ems', 'Weser', 'Werra', 'Ruhr', 'Oder', 'Saale', 'Mosel', 'Spree', 'Neisse', 'Lippe', 'Havel', 'Elbe', 'Fulda', 'Aller', 'Mulde', 'Unstrut', 'Peene', 'Naab', 'Lahn', 'Leine', 'Regnitz', 'Salzach', ] random.shuffle(rivers) for river in rivers: question = 'Wie heißt der rot markierte <u>Fluss</u>?' mapStyle = '<style>#River_' + river + ' {stroke: crimson; stroke-width: 5} #Rivers {visibility: visible;}</style>' answer = river aDeck.add_note( genanki.Note( model=aModel, fields=[ question, mapStyle, answer, mapStyle ] )) for river in rivers: question = 'Wo liegt der Fluss <u>' + river +'</u>?' mapStyleQ = '<style>#Rivers {visibility: visible;}</style>' answer = '' mapStyleA = '<style>#River_' + river + ' {stroke: crimson; stroke-width: 5} #Rivers {visibility: visible;}</style>' aDeck.add_note( genanki.Note( model=aModel, fields=[ question, mapStyleQ, answer, mapStyleA ] )) nations = [ 'Tschechien', 'Österreich', 'Frankreich', 'Schweiz', 'Polen', 'Belgien', 'Luxemburg', 'Niederlande', 'Dänemark', ] random.shuffle(nations) for nation in nations: question = 'Wie heißt das rot markierte <u>Land</u>?' mapStyle = '<style>#Nation_' + nation + ' {fill: crimson;} </style>' answer = nation aDeck.add_note( genanki.Note( model=aModel, fields=[ question, mapStyle, answer, mapStyle ] )) for nation in nations: question = 'Wo liegt der Land <u>' + nation +'</u>?' mapStyleQ = '<style></style>' answer = '' mapStyleA = '<style>#Nation_' + nation + ' {fill: crimson;} </style>' aDeck.add_note( genanki.Note( model=aModel, fields=[ question, mapStyleQ, answer, mapStyleA ] )) aPackage = genanki.Package(aDeck) aPackage.write_to_file(title + '.apkg') def main(): generateAnki() if __name__ == "__main__": main()
true
true
f70a5d9047d00493189d08971cef9c2e994138ee
11,060
py
Python
src/oci/logging/models/create_unified_agent_configuration_details.py
Manny27nyc/oci-python-sdk
de60b04e07a99826254f7255e992f41772902df7
[ "Apache-2.0", "BSD-3-Clause" ]
249
2017-09-11T22:06:05.000Z
2022-03-04T17:09:29.000Z
src/oci/logging/models/create_unified_agent_configuration_details.py
Manny27nyc/oci-python-sdk
de60b04e07a99826254f7255e992f41772902df7
[ "Apache-2.0", "BSD-3-Clause" ]
228
2017-09-11T23:07:26.000Z
2022-03-23T10:58:50.000Z
src/oci/logging/models/create_unified_agent_configuration_details.py
Manny27nyc/oci-python-sdk
de60b04e07a99826254f7255e992f41772902df7
[ "Apache-2.0", "BSD-3-Clause" ]
224
2017-09-27T07:32:43.000Z
2022-03-25T16:55:42.000Z
# coding: utf-8 # Copyright (c) 2016, 2021, Oracle and/or its affiliates. All rights reserved. # This software is dual-licensed to you under the Universal Permissive License (UPL) 1.0 as shown at https://oss.oracle.com/licenses/upl or Apache License 2.0 as shown at http://www.apache.org/licenses/LICENSE-2.0. You may choose either license. from oci.util import formatted_flat_dict, NONE_SENTINEL, value_allowed_none_or_none_sentinel # noqa: F401 from oci.decorators import init_model_state_from_kwargs @init_model_state_from_kwargs class CreateUnifiedAgentConfigurationDetails(object): """ Unified Agent configuration creation object. """ def __init__(self, **kwargs): """ Initializes a new CreateUnifiedAgentConfigurationDetails object with values from keyword arguments. The following keyword arguments are supported (corresponding to the getters/setters of this class): :param display_name: The value to assign to the display_name property of this CreateUnifiedAgentConfigurationDetails. :type display_name: str :param is_enabled: The value to assign to the is_enabled property of this CreateUnifiedAgentConfigurationDetails. :type is_enabled: bool :param service_configuration: The value to assign to the service_configuration property of this CreateUnifiedAgentConfigurationDetails. :type service_configuration: oci.logging.models.UnifiedAgentServiceConfigurationDetails :param defined_tags: The value to assign to the defined_tags property of this CreateUnifiedAgentConfigurationDetails. :type defined_tags: dict(str, dict(str, object)) :param freeform_tags: The value to assign to the freeform_tags property of this CreateUnifiedAgentConfigurationDetails. :type freeform_tags: dict(str, str) :param compartment_id: The value to assign to the compartment_id property of this CreateUnifiedAgentConfigurationDetails. :type compartment_id: str :param description: The value to assign to the description property of this CreateUnifiedAgentConfigurationDetails. :type description: str :param group_association: The value to assign to the group_association property of this CreateUnifiedAgentConfigurationDetails. :type group_association: oci.logging.models.GroupAssociationDetails """ self.swagger_types = { 'display_name': 'str', 'is_enabled': 'bool', 'service_configuration': 'UnifiedAgentServiceConfigurationDetails', 'defined_tags': 'dict(str, dict(str, object))', 'freeform_tags': 'dict(str, str)', 'compartment_id': 'str', 'description': 'str', 'group_association': 'GroupAssociationDetails' } self.attribute_map = { 'display_name': 'displayName', 'is_enabled': 'isEnabled', 'service_configuration': 'serviceConfiguration', 'defined_tags': 'definedTags', 'freeform_tags': 'freeformTags', 'compartment_id': 'compartmentId', 'description': 'description', 'group_association': 'groupAssociation' } self._display_name = None self._is_enabled = None self._service_configuration = None self._defined_tags = None self._freeform_tags = None self._compartment_id = None self._description = None self._group_association = None @property def display_name(self): """ Gets the display_name of this CreateUnifiedAgentConfigurationDetails. The user-friendly display name. This must be unique within the enclosing resource, and it's changeable. Avoid entering confidential information. :return: The display_name of this CreateUnifiedAgentConfigurationDetails. :rtype: str """ return self._display_name @display_name.setter def display_name(self, display_name): """ Sets the display_name of this CreateUnifiedAgentConfigurationDetails. The user-friendly display name. This must be unique within the enclosing resource, and it's changeable. Avoid entering confidential information. :param display_name: The display_name of this CreateUnifiedAgentConfigurationDetails. :type: str """ self._display_name = display_name @property def is_enabled(self): """ **[Required]** Gets the is_enabled of this CreateUnifiedAgentConfigurationDetails. Whether or not this resource is currently enabled. :return: The is_enabled of this CreateUnifiedAgentConfigurationDetails. :rtype: bool """ return self._is_enabled @is_enabled.setter def is_enabled(self, is_enabled): """ Sets the is_enabled of this CreateUnifiedAgentConfigurationDetails. Whether or not this resource is currently enabled. :param is_enabled: The is_enabled of this CreateUnifiedAgentConfigurationDetails. :type: bool """ self._is_enabled = is_enabled @property def service_configuration(self): """ **[Required]** Gets the service_configuration of this CreateUnifiedAgentConfigurationDetails. :return: The service_configuration of this CreateUnifiedAgentConfigurationDetails. :rtype: oci.logging.models.UnifiedAgentServiceConfigurationDetails """ return self._service_configuration @service_configuration.setter def service_configuration(self, service_configuration): """ Sets the service_configuration of this CreateUnifiedAgentConfigurationDetails. :param service_configuration: The service_configuration of this CreateUnifiedAgentConfigurationDetails. :type: oci.logging.models.UnifiedAgentServiceConfigurationDetails """ self._service_configuration = service_configuration @property def defined_tags(self): """ Gets the defined_tags of this CreateUnifiedAgentConfigurationDetails. Defined tags for this resource. Each key is predefined and scoped to a namespace. For more information, see `Resource Tags`__. Example: `{\"Operations\": {\"CostCenter\": \"42\"}}` __ https://docs.cloud.oracle.com/Content/General/Concepts/resourcetags.htm :return: The defined_tags of this CreateUnifiedAgentConfigurationDetails. :rtype: dict(str, dict(str, object)) """ return self._defined_tags @defined_tags.setter def defined_tags(self, defined_tags): """ Sets the defined_tags of this CreateUnifiedAgentConfigurationDetails. Defined tags for this resource. Each key is predefined and scoped to a namespace. For more information, see `Resource Tags`__. Example: `{\"Operations\": {\"CostCenter\": \"42\"}}` __ https://docs.cloud.oracle.com/Content/General/Concepts/resourcetags.htm :param defined_tags: The defined_tags of this CreateUnifiedAgentConfigurationDetails. :type: dict(str, dict(str, object)) """ self._defined_tags = defined_tags @property def freeform_tags(self): """ Gets the freeform_tags of this CreateUnifiedAgentConfigurationDetails. Free-form tags for this resource. Each tag is a simple key-value pair with no predefined name, type, or namespace. For more information, see `Resource Tags`__. Example: `{\"Department\": \"Finance\"}` __ https://docs.cloud.oracle.com/Content/General/Concepts/resourcetags.htm :return: The freeform_tags of this CreateUnifiedAgentConfigurationDetails. :rtype: dict(str, str) """ return self._freeform_tags @freeform_tags.setter def freeform_tags(self, freeform_tags): """ Sets the freeform_tags of this CreateUnifiedAgentConfigurationDetails. Free-form tags for this resource. Each tag is a simple key-value pair with no predefined name, type, or namespace. For more information, see `Resource Tags`__. Example: `{\"Department\": \"Finance\"}` __ https://docs.cloud.oracle.com/Content/General/Concepts/resourcetags.htm :param freeform_tags: The freeform_tags of this CreateUnifiedAgentConfigurationDetails. :type: dict(str, str) """ self._freeform_tags = freeform_tags @property def compartment_id(self): """ **[Required]** Gets the compartment_id of this CreateUnifiedAgentConfigurationDetails. The OCID of the compartment that the resource belongs to. :return: The compartment_id of this CreateUnifiedAgentConfigurationDetails. :rtype: str """ return self._compartment_id @compartment_id.setter def compartment_id(self, compartment_id): """ Sets the compartment_id of this CreateUnifiedAgentConfigurationDetails. The OCID of the compartment that the resource belongs to. :param compartment_id: The compartment_id of this CreateUnifiedAgentConfigurationDetails. :type: str """ self._compartment_id = compartment_id @property def description(self): """ Gets the description of this CreateUnifiedAgentConfigurationDetails. Description for this resource. :return: The description of this CreateUnifiedAgentConfigurationDetails. :rtype: str """ return self._description @description.setter def description(self, description): """ Sets the description of this CreateUnifiedAgentConfigurationDetails. Description for this resource. :param description: The description of this CreateUnifiedAgentConfigurationDetails. :type: str """ self._description = description @property def group_association(self): """ Gets the group_association of this CreateUnifiedAgentConfigurationDetails. :return: The group_association of this CreateUnifiedAgentConfigurationDetails. :rtype: oci.logging.models.GroupAssociationDetails """ return self._group_association @group_association.setter def group_association(self, group_association): """ Sets the group_association of this CreateUnifiedAgentConfigurationDetails. :param group_association: The group_association of this CreateUnifiedAgentConfigurationDetails. :type: oci.logging.models.GroupAssociationDetails """ self._group_association = group_association def __repr__(self): return formatted_flat_dict(self) def __eq__(self, other): if other is None: return False return self.__dict__ == other.__dict__ def __ne__(self, other): return not self == other
36.866667
245
0.687703
from oci.util import formatted_flat_dict, NONE_SENTINEL, value_allowed_none_or_none_sentinel from oci.decorators import init_model_state_from_kwargs @init_model_state_from_kwargs class CreateUnifiedAgentConfigurationDetails(object): def __init__(self, **kwargs): self.swagger_types = { 'display_name': 'str', 'is_enabled': 'bool', 'service_configuration': 'UnifiedAgentServiceConfigurationDetails', 'defined_tags': 'dict(str, dict(str, object))', 'freeform_tags': 'dict(str, str)', 'compartment_id': 'str', 'description': 'str', 'group_association': 'GroupAssociationDetails' } self.attribute_map = { 'display_name': 'displayName', 'is_enabled': 'isEnabled', 'service_configuration': 'serviceConfiguration', 'defined_tags': 'definedTags', 'freeform_tags': 'freeformTags', 'compartment_id': 'compartmentId', 'description': 'description', 'group_association': 'groupAssociation' } self._display_name = None self._is_enabled = None self._service_configuration = None self._defined_tags = None self._freeform_tags = None self._compartment_id = None self._description = None self._group_association = None @property def display_name(self): return self._display_name @display_name.setter def display_name(self, display_name): self._display_name = display_name @property def is_enabled(self): return self._is_enabled @is_enabled.setter def is_enabled(self, is_enabled): self._is_enabled = is_enabled @property def service_configuration(self): return self._service_configuration @service_configuration.setter def service_configuration(self, service_configuration): self._service_configuration = service_configuration @property def defined_tags(self): return self._defined_tags @defined_tags.setter def defined_tags(self, defined_tags): self._defined_tags = defined_tags @property def freeform_tags(self): return self._freeform_tags @freeform_tags.setter def freeform_tags(self, freeform_tags): self._freeform_tags = freeform_tags @property def compartment_id(self): return self._compartment_id @compartment_id.setter def compartment_id(self, compartment_id): self._compartment_id = compartment_id @property def description(self): return self._description @description.setter def description(self, description): self._description = description @property def group_association(self): return self._group_association @group_association.setter def group_association(self, group_association): self._group_association = group_association def __repr__(self): return formatted_flat_dict(self) def __eq__(self, other): if other is None: return False return self.__dict__ == other.__dict__ def __ne__(self, other): return not self == other
true
true
f70a5f5db5f4952721a9c7dd0511c372f9948851
2,041
py
Python
whatsapp-bot-venv/Lib/site-packages/twilio/base/serialize.py
RedaMastouri/ConversationalPythonicChatBot
f204276d4b80348d42091b17d1a7d9eea33fb4e0
[ "MIT" ]
1,362
2015-01-04T10:25:18.000Z
2022-03-24T10:07:08.000Z
whatsapp-bot-venv/Lib/site-packages/twilio/base/serialize.py
RedaMastouri/ConversationalPythonicChatBot
f204276d4b80348d42091b17d1a7d9eea33fb4e0
[ "MIT" ]
299
2015-01-30T09:52:39.000Z
2022-03-31T23:03:02.000Z
bot/lib/python3.7/site-packages/twilio/base/serialize.py
carlosrh18/DavinciBot
d73a6b7f68d7bab25d134d3f85c6b63a86c206c5
[ "MIT" ]
622
2015-01-03T04:43:09.000Z
2022-03-29T14:11:00.000Z
import datetime import json from twilio.base import values def iso8601_date(d): """ Return a string representation of a date that the Twilio API understands Format is YYYY-MM-DD. Returns None if d is not a string, datetime, or date """ if d == values.unset: return d elif isinstance(d, datetime.datetime): return str(d.date()) elif isinstance(d, datetime.date): return str(d) elif isinstance(d, str): return d def iso8601_datetime(d): """ Return a string representation of a date that the Twilio API understands Format is YYYY-MM-DD. Returns None if d is not a string, datetime, or date """ if d == values.unset: return d elif isinstance(d, datetime.datetime) or isinstance(d, datetime.date): return d.strftime('%Y-%m-%dT%H:%M:%SZ') elif isinstance(d, str): return d def prefixed_collapsible_map(m, prefix): """ Return a dict of params corresponding to those in m with the added prefix """ if m == values.unset: return {} def flatten_dict(d, result=None, prv_keys=None): if result is None: result = {} if prv_keys is None: prv_keys = [] for k, v in d.items(): if isinstance(v, dict): flatten_dict(v, result, prv_keys + [k]) else: result['.'.join(prv_keys + [k])] = v return result if isinstance(m, dict): flattened = flatten_dict(m) return {'{}.{}'.format(prefix, k): v for k, v in flattened.items()} return {} def object(obj): """ Return a jsonified string represenation of obj if obj is jsonifiable else return obj untouched """ if isinstance(obj, dict) or isinstance(obj, list): return json.dumps(obj) return obj def map(lst, serialize_func): """ Applies serialize_func to every element in lst """ if not isinstance(lst, list): return lst return [serialize_func(e) for e in lst]
24.590361
78
0.602646
import datetime import json from twilio.base import values def iso8601_date(d): if d == values.unset: return d elif isinstance(d, datetime.datetime): return str(d.date()) elif isinstance(d, datetime.date): return str(d) elif isinstance(d, str): return d def iso8601_datetime(d): if d == values.unset: return d elif isinstance(d, datetime.datetime) or isinstance(d, datetime.date): return d.strftime('%Y-%m-%dT%H:%M:%SZ') elif isinstance(d, str): return d def prefixed_collapsible_map(m, prefix): if m == values.unset: return {} def flatten_dict(d, result=None, prv_keys=None): if result is None: result = {} if prv_keys is None: prv_keys = [] for k, v in d.items(): if isinstance(v, dict): flatten_dict(v, result, prv_keys + [k]) else: result['.'.join(prv_keys + [k])] = v return result if isinstance(m, dict): flattened = flatten_dict(m) return {'{}.{}'.format(prefix, k): v for k, v in flattened.items()} return {} def object(obj): if isinstance(obj, dict) or isinstance(obj, list): return json.dumps(obj) return obj def map(lst, serialize_func): if not isinstance(lst, list): return lst return [serialize_func(e) for e in lst]
true
true
f70a6146604ae77580af15ad77d5692ec2f498f1
4,713
py
Python
tests/test_dialects.py
blthree/sqlglot
c3130584db6d767575854ba0d57da37e026863c9
[ "MIT" ]
null
null
null
tests/test_dialects.py
blthree/sqlglot
c3130584db6d767575854ba0d57da37e026863c9
[ "MIT" ]
null
null
null
tests/test_dialects.py
blthree/sqlglot
c3130584db6d767575854ba0d57da37e026863c9
[ "MIT" ]
null
null
null
import unittest from sqlglot import transpile from sqlglot.errors import ErrorLevel, UnsupportedError class TestDialects(unittest.TestCase): def test_mysql(self): sql = transpile('SELECT CAST(`a`.`b` AS INT) FROM foo', read='mysql', write='mysql')[0] self.assertEqual(sql, 'SELECT CAST(`a`.`b` AS INT) FROM foo') def test_postgres(self): sql = transpile('SELECT CAST(`a`.`b` AS DOUBLE) FROM foo', read='postgres', write='postgres')[0] self.assertEqual(sql, 'SELECT CAST(`a`.`b` AS DOUBLE PRECISION) FROM foo') def test_presto(self): sql = transpile('SELECT "a"."b" FROM foo', read='presto', write='presto', identify=True)[0] self.assertEqual(sql, 'SELECT "a"."b" FROM "foo"') sql = transpile('SELECT a.b FROM foo', read='presto', write='spark')[0] self.assertEqual(sql, 'SELECT a.b FROM foo') sql = transpile('SELECT "a"."b" FROM foo', read='presto', write='spark', identify=True)[0] self.assertEqual(sql, 'SELECT `a`.`b` FROM `foo`') sql = transpile('SELECT a.b FROM foo', read='presto', write='spark', identify=True)[0] self.assertEqual(sql, 'SELECT `a`.`b` FROM `foo`') sql = transpile('SELECT APPROX_DISTINCT(a) FROM foo', read='presto', write='spark')[0] self.assertEqual(sql, 'SELECT APPROX_COUNT_DISTINCT(a) FROM foo') sql = transpile( 'SELECT APPROX_DISTINCT(a, 0.1) FROM foo', read='presto', write='spark', unsupported_level=ErrorLevel.IGNORE )[0] self.assertEqual(sql, 'SELECT APPROX_COUNT_DISTINCT(a) FROM foo') ctas = "CREATE TABLE test WITH (FORMAT = 'PARQUET') AS SELECT 1" self.assertEqual(transpile(ctas, read='presto', write='presto')[0], ctas) sql = transpile(ctas, read='presto', write='spark')[0] self.assertEqual(sql, "CREATE TABLE test STORED AS PARQUET AS SELECT 1") sql = transpile("SELECT JSON_EXTRACT(x, '$.name')", read='presto', write='spark')[0] self.assertEqual(sql, "SELECT GET_JSON_OBJECT(x, '$.name')") with self.assertRaises(UnsupportedError): transpile( 'SELECT APPROX_DISTINCT(a, 0.1) FROM foo', read='presto', write='spark', unsupported_level=ErrorLevel.RAISE, ) def test_hive(self): sql = transpile('SELECT "a"."b" FROM "foo"', write='hive')[0] self.assertEqual(sql, "SELECT `a`.`b` FROM `foo`") sql = transpile('SELECT CAST(`a`.`b` AS SMALLINT) FROM foo', read='hive', write='hive')[0] self.assertEqual(sql, 'SELECT CAST(`a`.`b` AS SMALLINT) FROM foo') sql = transpile('SELECT "a"."b" FROM foo', write='hive', identify=True)[0] self.assertEqual(sql, 'SELECT `a`.`b` FROM `foo`') sql = transpile('SELECT APPROX_COUNT_DISTINCT(a) FROM foo', read='hive', write='presto')[0] self.assertEqual(sql, 'SELECT APPROX_DISTINCT(a) FROM foo') sql = transpile('CREATE TABLE test STORED AS PARQUET AS SELECT 1', read='hive', write='presto')[0] self.assertEqual(sql, "CREATE TABLE test WITH (FORMAT = 'PARQUET') AS SELECT 1") sql = transpile("SELECT GET_JSON_OBJECT(x, '$.name')", read='hive', write='presto')[0] self.assertEqual(sql, "SELECT JSON_EXTRACT(x, '$.name')") def test_spark(self): sql = transpile('SELECT "a"."b" FROM "foo"', write='spark')[0] self.assertEqual(sql, "SELECT `a`.`b` FROM `foo`") sql = transpile('SELECT CAST(`a`.`b` AS SMALLINT) FROM foo', read='spark')[0] self.assertEqual(sql, 'SELECT CAST(`a`.`b` AS SHORT) FROM foo') sql = transpile('SELECT "a"."b" FROM foo', write='spark', identify=True)[0] self.assertEqual(sql, 'SELECT `a`.`b` FROM `foo`') sql = transpile('SELECT APPROX_COUNT_DISTINCT(a) FROM foo', read='spark', write='presto')[0] self.assertEqual(sql, 'SELECT APPROX_DISTINCT(a) FROM foo') sql = transpile('CREATE TABLE test STORED AS PARQUET AS SELECT 1', read='spark', write='presto')[0] self.assertEqual(sql, "CREATE TABLE test WITH (FORMAT = 'PARQUET') AS SELECT 1") sql = transpile('SELECT /*+ COALESCE(3) */ * FROM x', read='spark')[0] self.assertEqual(sql, 'SELECT /*+ COALESCE(3) */ * FROM x') def test_sqlite(self): sql = transpile('SELECT CAST(`a`.`b` AS SMALLINT) FROM foo', read='sqlite', write='sqlite')[0] self.assertEqual(sql, 'SELECT CAST(`a`.`b` AS INTEGER) FROM foo') def test_msaccess(self): sql = transpile('SELECT [a].[b] FROM [foo]', read='msacess', write='msacess')[0] self.assertEqual(sql, 'SELECT [a].[b] FROM [foo]')
46.663366
107
0.611288
import unittest from sqlglot import transpile from sqlglot.errors import ErrorLevel, UnsupportedError class TestDialects(unittest.TestCase): def test_mysql(self): sql = transpile('SELECT CAST(`a`.`b` AS INT) FROM foo', read='mysql', write='mysql')[0] self.assertEqual(sql, 'SELECT CAST(`a`.`b` AS INT) FROM foo') def test_postgres(self): sql = transpile('SELECT CAST(`a`.`b` AS DOUBLE) FROM foo', read='postgres', write='postgres')[0] self.assertEqual(sql, 'SELECT CAST(`a`.`b` AS DOUBLE PRECISION) FROM foo') def test_presto(self): sql = transpile('SELECT "a"."b" FROM foo', read='presto', write='presto', identify=True)[0] self.assertEqual(sql, 'SELECT "a"."b" FROM "foo"') sql = transpile('SELECT a.b FROM foo', read='presto', write='spark')[0] self.assertEqual(sql, 'SELECT a.b FROM foo') sql = transpile('SELECT "a"."b" FROM foo', read='presto', write='spark', identify=True)[0] self.assertEqual(sql, 'SELECT `a`.`b` FROM `foo`') sql = transpile('SELECT a.b FROM foo', read='presto', write='spark', identify=True)[0] self.assertEqual(sql, 'SELECT `a`.`b` FROM `foo`') sql = transpile('SELECT APPROX_DISTINCT(a) FROM foo', read='presto', write='spark')[0] self.assertEqual(sql, 'SELECT APPROX_COUNT_DISTINCT(a) FROM foo') sql = transpile( 'SELECT APPROX_DISTINCT(a, 0.1) FROM foo', read='presto', write='spark', unsupported_level=ErrorLevel.IGNORE )[0] self.assertEqual(sql, 'SELECT APPROX_COUNT_DISTINCT(a) FROM foo') ctas = "CREATE TABLE test WITH (FORMAT = 'PARQUET') AS SELECT 1" self.assertEqual(transpile(ctas, read='presto', write='presto')[0], ctas) sql = transpile(ctas, read='presto', write='spark')[0] self.assertEqual(sql, "CREATE TABLE test STORED AS PARQUET AS SELECT 1") sql = transpile("SELECT JSON_EXTRACT(x, '$.name')", read='presto', write='spark')[0] self.assertEqual(sql, "SELECT GET_JSON_OBJECT(x, '$.name')") with self.assertRaises(UnsupportedError): transpile( 'SELECT APPROX_DISTINCT(a, 0.1) FROM foo', read='presto', write='spark', unsupported_level=ErrorLevel.RAISE, ) def test_hive(self): sql = transpile('SELECT "a"."b" FROM "foo"', write='hive')[0] self.assertEqual(sql, "SELECT `a`.`b` FROM `foo`") sql = transpile('SELECT CAST(`a`.`b` AS SMALLINT) FROM foo', read='hive', write='hive')[0] self.assertEqual(sql, 'SELECT CAST(`a`.`b` AS SMALLINT) FROM foo') sql = transpile('SELECT "a"."b" FROM foo', write='hive', identify=True)[0] self.assertEqual(sql, 'SELECT `a`.`b` FROM `foo`') sql = transpile('SELECT APPROX_COUNT_DISTINCT(a) FROM foo', read='hive', write='presto')[0] self.assertEqual(sql, 'SELECT APPROX_DISTINCT(a) FROM foo') sql = transpile('CREATE TABLE test STORED AS PARQUET AS SELECT 1', read='hive', write='presto')[0] self.assertEqual(sql, "CREATE TABLE test WITH (FORMAT = 'PARQUET') AS SELECT 1") sql = transpile("SELECT GET_JSON_OBJECT(x, '$.name')", read='hive', write='presto')[0] self.assertEqual(sql, "SELECT JSON_EXTRACT(x, '$.name')") def test_spark(self): sql = transpile('SELECT "a"."b" FROM "foo"', write='spark')[0] self.assertEqual(sql, "SELECT `a`.`b` FROM `foo`") sql = transpile('SELECT CAST(`a`.`b` AS SMALLINT) FROM foo', read='spark')[0] self.assertEqual(sql, 'SELECT CAST(`a`.`b` AS SHORT) FROM foo') sql = transpile('SELECT "a"."b" FROM foo', write='spark', identify=True)[0] self.assertEqual(sql, 'SELECT `a`.`b` FROM `foo`') sql = transpile('SELECT APPROX_COUNT_DISTINCT(a) FROM foo', read='spark', write='presto')[0] self.assertEqual(sql, 'SELECT APPROX_DISTINCT(a) FROM foo') sql = transpile('CREATE TABLE test STORED AS PARQUET AS SELECT 1', read='spark', write='presto')[0] self.assertEqual(sql, "CREATE TABLE test WITH (FORMAT = 'PARQUET') AS SELECT 1") sql = transpile('SELECT /*+ COALESCE(3) */ * FROM x', read='spark')[0] self.assertEqual(sql, 'SELECT /*+ COALESCE(3) */ * FROM x') def test_sqlite(self): sql = transpile('SELECT CAST(`a`.`b` AS SMALLINT) FROM foo', read='sqlite', write='sqlite')[0] self.assertEqual(sql, 'SELECT CAST(`a`.`b` AS INTEGER) FROM foo') def test_msaccess(self): sql = transpile('SELECT [a].[b] FROM [foo]', read='msacess', write='msacess')[0] self.assertEqual(sql, 'SELECT [a].[b] FROM [foo]')
true
true
f70a6173c8c03d653e854b67508634dd8a582875
189
py
Python
tools/pathutils.py
Laogeodritt/KazTron
42f35e520875b458ffde7c2729865c95de606aca
[ "MIT" ]
6
2018-07-04T20:41:01.000Z
2021-09-08T08:10:34.000Z
tools/pathutils.py
Laogeodritt/KazTron
42f35e520875b458ffde7c2729865c95de606aca
[ "MIT" ]
259
2018-05-01T22:41:32.000Z
2022-02-08T23:25:00.000Z
tools/pathutils.py
Laogeodritt/KazTron
42f35e520875b458ffde7c2729865c95de606aca
[ "MIT" ]
6
2019-04-16T22:13:15.000Z
2021-12-15T08:06:38.000Z
from pathlib import Path import sys import os def add_application_path(): app_path = Path(__file__).resolve().parents[1] sys.path.append(str(app_path)) os.chdir(str(app_path))
21
50
0.730159
from pathlib import Path import sys import os def add_application_path(): app_path = Path(__file__).resolve().parents[1] sys.path.append(str(app_path)) os.chdir(str(app_path))
true
true
f70a6277163e65611b36ebc3dd064be9f81de3f7
1,159
py
Python
web/addons/hr_holidays/tests/__init__.py
diogocs1/comps
63df07f6cf21c41e4527c06e2d0499f23f4322e7
[ "Apache-2.0" ]
null
null
null
web/addons/hr_holidays/tests/__init__.py
diogocs1/comps
63df07f6cf21c41e4527c06e2d0499f23f4322e7
[ "Apache-2.0" ]
null
null
null
web/addons/hr_holidays/tests/__init__.py
diogocs1/comps
63df07f6cf21c41e4527c06e2d0499f23f4322e7
[ "Apache-2.0" ]
null
null
null
# -*- coding: utf-8 -*- ############################################################################## # # OpenERP, Open Source Business Applications # Copyright (c) 2013-TODAY OpenERP S.A. <http://www.openerp.com> # # This program is free software: you can redistribute it and/or modify # it under the terms of the GNU Affero General Public License as # published by the Free Software Foundation, either version 3 of the # License, or (at your option) any later version. # # This program is distributed in the hope that it will be useful, # but WITHOUT ANY WARRANTY; without even the implied warranty of # MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the # GNU Affero General Public License for more details. # # You should have received a copy of the GNU Affero General Public License # along with this program. If not, see <http://www.gnu.org/licenses/>. # ############################################################################## from openerp.addons.hr_holidays.tests import test_holidays_flow checks = [ test_holidays_flow, ] # vim:expandtab:smartindent:tabstop=4:softtabstop=4:shiftwidth=4:
39.965517
78
0.630716
true
true
f70a627d9cb818695d9704ab57ce2d2dce8ac924
248
py
Python
plex_notifier/__init__.py
sudoursa/plex_notifier
d0c7123d23b7e5a37ef5ad4ca0ab2c324d9c2332
[ "MIT" ]
1
2018-01-22T21:25:40.000Z
2018-01-22T21:25:40.000Z
plex_notifier/__init__.py
sudoursa/plex_notifier
d0c7123d23b7e5a37ef5ad4ca0ab2c324d9c2332
[ "MIT" ]
16
2018-01-22T15:22:26.000Z
2018-01-27T22:18:12.000Z
plex_notifier/__init__.py
sudoursa/plex_notifier
d0c7123d23b7e5a37ef5ad4ca0ab2c324d9c2332
[ "MIT" ]
1
2018-01-28T23:49:10.000Z
2018-01-28T23:49:10.000Z
""" importing public methods """ from .plex_auth import connect_to_plex from .plex_movies import return_movies from .plex_tv import return_tv from .plex_users import get_emails from .plex_users import unsub_emails from .plex_email import send_mail
24.8
38
0.834677
from .plex_auth import connect_to_plex from .plex_movies import return_movies from .plex_tv import return_tv from .plex_users import get_emails from .plex_users import unsub_emails from .plex_email import send_mail
true
true
f70a628c1ce95ca174fbb067a483d898b989003d
1,265
py
Python
_unittests/ut_packaged/test_LONG_script_install.py
sdpython/pymyinstall
72b3a56a29def0694e34ccae910bf288a95cf4a5
[ "MIT" ]
8
2015-08-24T21:01:49.000Z
2018-01-04T06:34:51.000Z
_unittests/ut_packaged/test_LONG_script_install.py
sdpython/pymyinstall
72b3a56a29def0694e34ccae910bf288a95cf4a5
[ "MIT" ]
66
2015-06-14T22:04:58.000Z
2021-11-11T13:46:03.000Z
_unittests/ut_packaged/test_LONG_script_install.py
sdpython/pymyinstall
72b3a56a29def0694e34ccae910bf288a95cf4a5
[ "MIT" ]
5
2016-09-13T18:14:46.000Z
2021-08-23T12:03:28.000Z
""" @brief test log(time=2s) """ import unittest import warnings from pyquickhelper.loghelper import fLOG class TestLONGScriptInstall(unittest.TestCase): def test_pypi(self): fLOG( __file__, self._testMethodName, OutputPrint=__name__ == "__main__") import xmlrpc.client as xmlrpc_client module_name = "version_information" url = 'https://pypi.org/pypi/pip/json' functions = [] with xmlrpc_client.ServerProxy(url) as pypi: try: for f in pypi.system.listMethods(): fLOG(f) sig = pypi.system.methodSignature(f) fLOG(" ", sig) h = pypi.system.methodHelp(f) fLOG(" ", h) functions.append(f) if len(functions) > 1: break available = pypi.package_releases(module_name, True) fLOG(available) except xmlrpc_client.ProtocolError as e: warnings.warn("PyPI protocal has changed {0}".format(e)) functions = [None, None] assert len(functions) > 1 if __name__ == "__main__": unittest.main()
30.119048
72
0.527273
import unittest import warnings from pyquickhelper.loghelper import fLOG class TestLONGScriptInstall(unittest.TestCase): def test_pypi(self): fLOG( __file__, self._testMethodName, OutputPrint=__name__ == "__main__") import xmlrpc.client as xmlrpc_client module_name = "version_information" url = 'https://pypi.org/pypi/pip/json' functions = [] with xmlrpc_client.ServerProxy(url) as pypi: try: for f in pypi.system.listMethods(): fLOG(f) sig = pypi.system.methodSignature(f) fLOG(" ", sig) h = pypi.system.methodHelp(f) fLOG(" ", h) functions.append(f) if len(functions) > 1: break available = pypi.package_releases(module_name, True) fLOG(available) except xmlrpc_client.ProtocolError as e: warnings.warn("PyPI protocal has changed {0}".format(e)) functions = [None, None] assert len(functions) > 1 if __name__ == "__main__": unittest.main()
true
true
f70a6377aa4fa71b8438d2f648431ccecf2a659a
1,216
py
Python
ambassador/views.py
cforcross/django-vue-admin
269ba3047b6762c565d9a4c306efc86c3ffd4867
[ "MIT" ]
null
null
null
ambassador/views.py
cforcross/django-vue-admin
269ba3047b6762c565d9a4c306efc86c3ffd4867
[ "MIT" ]
null
null
null
ambassador/views.py
cforcross/django-vue-admin
269ba3047b6762c565d9a4c306efc86c3ffd4867
[ "MIT" ]
null
null
null
from django.shortcuts import render from rest_framework.views import APIView from rest_framework.response import Response from rest_framework import exceptions from common.serializers import UserSerializer from core.models import User,Product,Link,OrderItem,Order from common.authentication import JWTAuthentication from rest_framework.permissions import IsAuthenticated from .serializers import ProductSerializer from django.core.cache import cache import time # Create your views here. class ProductFrontendAPIView(APIView): # authentication_classes =[JWTAuthentication] # permission_classes=[IsAuthenticated] def get(self, request): products = Product.objects.all() serializer = ProductSerializer(products, many=True) return Response(serializer.data) class ProductBackendAPIView(APIView): def get(self, request): products = cache.get('products_backend') if not products: time.sleep(2) products = list(Product.objects.all()) cache.set(products, 'products_backend',timeout=60*30) products = Product.objects.all() serializer = ProductSerializer(products, many=True) return Response(serializer.data)
39.225806
65
0.754112
from django.shortcuts import render from rest_framework.views import APIView from rest_framework.response import Response from rest_framework import exceptions from common.serializers import UserSerializer from core.models import User,Product,Link,OrderItem,Order from common.authentication import JWTAuthentication from rest_framework.permissions import IsAuthenticated from .serializers import ProductSerializer from django.core.cache import cache import time class ProductFrontendAPIView(APIView): def get(self, request): products = Product.objects.all() serializer = ProductSerializer(products, many=True) return Response(serializer.data) class ProductBackendAPIView(APIView): def get(self, request): products = cache.get('products_backend') if not products: time.sleep(2) products = list(Product.objects.all()) cache.set(products, 'products_backend',timeout=60*30) products = Product.objects.all() serializer = ProductSerializer(products, many=True) return Response(serializer.data)
true
true
f70a649a6c145f8eae91526b87cd9cfca92cdb65
679
py
Python
pyglet/window/cocoa/systemcursor.py
seeminglee/pyglet64
3dd167b5b0d3ad132a157e404586e53c2bb21736
[ "BSD-3-Clause" ]
1
2016-01-09T03:47:39.000Z
2016-01-09T03:47:39.000Z
pyglet/window/cocoa/systemcursor.py
seeminglee/pyglet64
3dd167b5b0d3ad132a157e404586e53c2bb21736
[ "BSD-3-Clause" ]
null
null
null
pyglet/window/cocoa/systemcursor.py
seeminglee/pyglet64
3dd167b5b0d3ad132a157e404586e53c2bb21736
[ "BSD-3-Clause" ]
null
null
null
from pyglet.libs.darwin.objc_runtime import * # This class is a wrapper around NSCursor which prevents us from # sending too many hide or unhide messages in a row. Apparently # NSCursor treats them like retain/release messages, which can be # problematic when we are e.g. switching between window & fullscreen. class SystemCursor: cursor_is_hidden = False @classmethod def hide(cls): if not cls.cursor_is_hidden: send_message('NSCursor', 'hide') cls.cursor_is_hidden = True @classmethod def unhide(cls): if cls.cursor_is_hidden: send_message('NSCursor', 'unhide') cls.cursor_is_hidden = False
35.736842
69
0.693667
from pyglet.libs.darwin.objc_runtime import * class SystemCursor: cursor_is_hidden = False @classmethod def hide(cls): if not cls.cursor_is_hidden: send_message('NSCursor', 'hide') cls.cursor_is_hidden = True @classmethod def unhide(cls): if cls.cursor_is_hidden: send_message('NSCursor', 'unhide') cls.cursor_is_hidden = False
true
true
f70a67ae0050e3dd5dbc7ea33789132d8704dd2b
269
py
Python
src/pycounts_polluxtroy3758/__init__.py
polluxtroy3758/pycounts
92bcbdb2609eb543c631293c7cf3babb0472565c
[ "MIT" ]
null
null
null
src/pycounts_polluxtroy3758/__init__.py
polluxtroy3758/pycounts
92bcbdb2609eb543c631293c7cf3babb0472565c
[ "MIT" ]
null
null
null
src/pycounts_polluxtroy3758/__init__.py
polluxtroy3758/pycounts
92bcbdb2609eb543c631293c7cf3babb0472565c
[ "MIT" ]
null
null
null
# read version from installed package from importlib.metadata import version __version__ = version("pycounts_polluxtroy3758") from pycounts_polluxtroy3758.plotting import plot_words # noqa: F401 from pycounts_polluxtroy3758.pycounts import count_words # noqa: F401
33.625
70
0.836431
from importlib.metadata import version __version__ = version("pycounts_polluxtroy3758") from pycounts_polluxtroy3758.plotting import plot_words from pycounts_polluxtroy3758.pycounts import count_words
true
true
f70a68ac62bf6c61cd21de3ffd41d24a77bdf900
11,410
py
Python
examples/adminapi.py
fkaufer/confluent-kafka-python
c4ff376cdbfba41b08806df8e4a68d68f953b593
[ "Apache-2.0" ]
1
2018-07-23T15:01:15.000Z
2018-07-23T15:01:15.000Z
examples/adminapi.py
AkuDTA/confluent-kafka-python
e4f7bb6d2feeae33ec1aa69f49bc3277265dba48
[ "Apache-2.0" ]
1
2018-06-14T19:53:56.000Z
2018-06-14T19:53:56.000Z
examples/adminapi.py
AkuDTA/confluent-kafka-python
e4f7bb6d2feeae33ec1aa69f49bc3277265dba48
[ "Apache-2.0" ]
null
null
null
#!/usr/bin/env python # # Copyright 2018 Confluent Inc. # # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. # # # Example Admin clients. # from confluent_kafka.admin import AdminClient, NewTopic, NewPartitions, ConfigResource, ConfigEntry from confluent_kafka import KafkaException import sys import threading import logging logging.basicConfig() def example_create_topics(a, topics): """ Create topics """ new_topics = [NewTopic(topic, num_partitions=3, replication_factor=1) for topic in topics] # Call create_topics to asynchronously create topics, a dict # of <topic,future> is returned. fs = a.create_topics(new_topics) # Wait for operation to finish. # Timeouts are preferably controlled by passing request_timeout=15.0 # to the create_topics() call. # All futures will finish at the same time. for topic, f in fs.items(): try: f.result() # The result itself is None print("Topic {} created".format(topic)) except Exception as e: print("Failed to create topic {}: {}".format(topic, e)) def example_delete_topics(a, topics): """ delete topics """ # Call delete_topics to asynchronously delete topics, a future is returned. # By default this operation on the broker returns immediately while # topics are deleted in the background. But here we give it some time (30s) # to propagate in the cluster before returning. # # Returns a dict of <topic,future>. fs = a.delete_topics(topics, operation_timeout=30) # Wait for operation to finish. for topic, f in fs.items(): try: f.result() # The result itself is None print("Topic {} deleted".format(topic)) except Exception as e: print("Failed to delete topic {}: {}".format(topic, e)) def example_create_partitions(a, topics): """ create partitions """ new_parts = [NewPartitions(topic, int(new_total_count)) for topic, new_total_count in zip(topics[0::2], topics[1::2])] # Try switching validate_only to True to only validate the operation # on the broker but not actually perform it. fs = a.create_partitions(new_parts, validate_only=False) # Wait for operation to finish. for topic, f in fs.items(): try: f.result() # The result itself is None print("Additional partitions created for topic {}".format(topic)) except Exception as e: print("Failed to add partitions to topic {}: {}".format(topic, e)) def print_config(config, depth): print('%40s = %-50s [%s,is:read-only=%r,default=%r,sensitive=%r,synonym=%r,synonyms=%s]' % ((' ' * depth) + config.name, config.value, ConfigEntry.config_source_to_str(config.source), config.is_read_only, config.is_default, config.is_sensitive, config.is_synonym, ["%s:%s" % (x.name, ConfigEntry.config_source_to_str(x.source)) for x in iter(config.synonyms.values())])) def example_describe_configs(a, args): """ describe configs """ resources = [ConfigResource(restype, resname) for restype, resname in zip(args[0::2], args[1::2])] fs = a.describe_configs(resources) # Wait for operation to finish. for res, f in fs.items(): try: configs = f.result() for config in iter(configs.values()): print_config(config, 1) except KafkaException as e: print("Failed to describe {}: {}".format(res, e)) except Exception as e: raise def example_alter_configs(a, args): """ Alter configs atomically, replacing non-specified configuration properties with their default values. """ resources = [] for restype, resname, configs in zip(args[0::3], args[1::3], args[2::3]): resource = ConfigResource(restype, resname) resources.append(resource) for k, v in [conf.split('=') for conf in configs.split(',')]: resource.set_config(k, v) fs = a.alter_configs(resources) # Wait for operation to finish. for res, f in fs.items(): try: f.result() # empty, but raises exception on failure print("{} configuration successfully altered".format(res)) except Exception: raise def example_delta_alter_configs(a, args): """ The AlterConfigs Kafka API requires all configuration to be passed, any left out configuration properties will revert to their default settings. This example shows how to just modify the supplied configuration entries by first reading the configuration from the broker, updating the supplied configuration with the broker configuration (without overwriting), and then writing it all back. The async nature of futures is also show-cased, which makes this example a bit more complex than it needs to be in the synchronous case. """ # Convert supplied config to resources. # We can reuse the same resources both for describe_configs and # alter_configs. resources = [] for restype, resname, configs in zip(args[0::3], args[1::3], args[2::3]): resource = ConfigResource(restype, resname) resources.append(resource) for k, v in [conf.split('=') for conf in configs.split(',')]: resource.set_config(k, v) # Set up a locked counter and an Event (for signaling) to track when the # second level of futures are done. This is a bit of contrived example # due to no other asynchronous mechanism being used, so we'll need # to wait on something to signal completion. class WaitZero(object): def __init__(self, waitcnt): self.cnt = waitcnt self.lock = threading.Lock() self.event = threading.Event() def decr(self): """ Decrement cnt by 1""" with self.lock: assert self.cnt > 0 self.cnt -= 1 self.event.set() def wait(self): """ Wait until cnt reaches 0 """ self.lock.acquire() while self.cnt > 0: self.lock.release() self.event.wait() self.event.clear() self.lock.acquire() self.lock.release() def __len__(self): with self.lock: return self.cnt wait_zero = WaitZero(len(resources)) # Read existing configuration from cluster fs = a.describe_configs(resources) def delta_alter_configs_done(fut, resource): e = fut.exception() if e is not None: print("Config update for {} failed: {}".format(resource, e)) else: print("Config for {} updated".format(resource)) wait_zero.decr() def delta_alter_configs(resource, remote_config): print("Updating {} supplied config entries {} with {} config entries read from cluster".format( len(resource), resource, len(remote_config))) # Only set configuration that is not default for k, entry in [(k, v) for k, v in remote_config.items() if not v.is_default]: resource.set_config(k, entry.value, overwrite=False) fs = a.alter_configs([resource]) fs[resource].add_done_callback(lambda fut: delta_alter_configs_done(fut, resource)) # For each resource's future set up a completion callback # that in turn calls alter_configs() on that single resource. # This is ineffective since the resources can usually go in # one single alter_configs() call, but we're also show-casing # the futures here. for res, f in fs.items(): f.add_done_callback(lambda fut, resource=res: delta_alter_configs(resource, fut.result())) # Wait for done callbacks to be triggered and operations to complete. print("Waiting for {} resource updates to finish".format(len(wait_zero))) wait_zero.wait() def example_list(a, args): """ list topics and cluster metadata """ if len(args) == 0: what = "all" else: what = args[0] md = a.list_topics(timeout=10) print("Cluster {} metadata (response from broker {}):".format(md.cluster_id, md.orig_broker_name)) if what in ("all", "brokers"): print(" {} brokers:".format(len(md.brokers))) for b in iter(md.brokers.values()): if b.id == md.controller_id: print(" {} (controller)".format(b)) else: print(" {}".format(b)) if what not in ("all", "topics"): return print(" {} topics:".format(len(md.topics))) for t in iter(md.topics.values()): if t.error is not None: errstr = ": {}".format(t.error) else: errstr = "" print(" \"{}\" with {} partition(s){}".format(t, len(t.partitions), errstr)) for p in iter(t.partitions.values()): if p.error is not None: errstr = ": {}".format(p.error) else: errstr = "" print(" partition {} leader: {}, replicas: {}, isrs: {}".format( p.id, p.leader, p.replicas, p.isrs, errstr)) if __name__ == '__main__': if len(sys.argv) < 3: sys.stderr.write('Usage: %s <bootstrap-brokers> <operation> <args..>\n\n' % sys.argv[0]) sys.stderr.write('operations:\n') sys.stderr.write(' create_topics <topic1> <topic2> ..\n') sys.stderr.write(' delete_topics <topic1> <topic2> ..\n') sys.stderr.write(' create_partitions <topic1> <new_total_count1> <topic2> <new_total_count2> ..\n') sys.stderr.write(' describe_configs <resource_type1> <resource_name1> <resource2> <resource_name2> ..\n') sys.stderr.write(' alter_configs <resource_type1> <resource_name1> ' + '<config=val,config2=val2> <resource_type2> <resource_name2> <config..> ..\n') sys.stderr.write(' delta_alter_configs <resource_type1> <resource_name1> ' + '<config=val,config2=val2> <resource_type2> <resource_name2> <config..> ..\n') sys.stderr.write(' list [<all|topics|brokers>]\n') sys.exit(1) broker = sys.argv[1] operation = sys.argv[2] args = sys.argv[3:] # Create Admin client a = AdminClient({'bootstrap.servers': broker}) opsmap = {'create_topics': example_create_topics, 'delete_topics': example_delete_topics, 'create_partitions': example_create_partitions, 'describe_configs': example_describe_configs, 'alter_configs': example_alter_configs, 'delta_alter_configs': example_delta_alter_configs, 'list': example_list} if operation not in opsmap: sys.stderr.write('Unknown operation: %s\n' % operation) sys.exit(1) opsmap[operation](a, args)
36.453674
113
0.627695
from confluent_kafka.admin import AdminClient, NewTopic, NewPartitions, ConfigResource, ConfigEntry from confluent_kafka import KafkaException import sys import threading import logging logging.basicConfig() def example_create_topics(a, topics): new_topics = [NewTopic(topic, num_partitions=3, replication_factor=1) for topic in topics] fs = a.create_topics(new_topics) for topic, f in fs.items(): try: f.result() print("Topic {} created".format(topic)) except Exception as e: print("Failed to create topic {}: {}".format(topic, e)) def example_delete_topics(a, topics): fs = a.delete_topics(topics, operation_timeout=30) for topic, f in fs.items(): try: f.result() print("Topic {} deleted".format(topic)) except Exception as e: print("Failed to delete topic {}: {}".format(topic, e)) def example_create_partitions(a, topics): new_parts = [NewPartitions(topic, int(new_total_count)) for topic, new_total_count in zip(topics[0::2], topics[1::2])] fs = a.create_partitions(new_parts, validate_only=False) for topic, f in fs.items(): try: f.result() print("Additional partitions created for topic {}".format(topic)) except Exception as e: print("Failed to add partitions to topic {}: {}".format(topic, e)) def print_config(config, depth): print('%40s = %-50s [%s,is:read-only=%r,default=%r,sensitive=%r,synonym=%r,synonyms=%s]' % ((' ' * depth) + config.name, config.value, ConfigEntry.config_source_to_str(config.source), config.is_read_only, config.is_default, config.is_sensitive, config.is_synonym, ["%s:%s" % (x.name, ConfigEntry.config_source_to_str(x.source)) for x in iter(config.synonyms.values())])) def example_describe_configs(a, args): resources = [ConfigResource(restype, resname) for restype, resname in zip(args[0::2], args[1::2])] fs = a.describe_configs(resources) for res, f in fs.items(): try: configs = f.result() for config in iter(configs.values()): print_config(config, 1) except KafkaException as e: print("Failed to describe {}: {}".format(res, e)) except Exception as e: raise def example_alter_configs(a, args): resources = [] for restype, resname, configs in zip(args[0::3], args[1::3], args[2::3]): resource = ConfigResource(restype, resname) resources.append(resource) for k, v in [conf.split('=') for conf in configs.split(',')]: resource.set_config(k, v) fs = a.alter_configs(resources) for res, f in fs.items(): try: f.result() print("{} configuration successfully altered".format(res)) except Exception: raise def example_delta_alter_configs(a, args): resources = [] for restype, resname, configs in zip(args[0::3], args[1::3], args[2::3]): resource = ConfigResource(restype, resname) resources.append(resource) for k, v in [conf.split('=') for conf in configs.split(',')]: resource.set_config(k, v) # to wait on something to signal completion. class WaitZero(object): def __init__(self, waitcnt): self.cnt = waitcnt self.lock = threading.Lock() self.event = threading.Event() def decr(self): with self.lock: assert self.cnt > 0 self.cnt -= 1 self.event.set() def wait(self): self.lock.acquire() while self.cnt > 0: self.lock.release() self.event.wait() self.event.clear() self.lock.acquire() self.lock.release() def __len__(self): with self.lock: return self.cnt wait_zero = WaitZero(len(resources)) # Read existing configuration from cluster fs = a.describe_configs(resources) def delta_alter_configs_done(fut, resource): e = fut.exception() if e is not None: print("Config update for {} failed: {}".format(resource, e)) else: print("Config for {} updated".format(resource)) wait_zero.decr() def delta_alter_configs(resource, remote_config): print("Updating {} supplied config entries {} with {} config entries read from cluster".format( len(resource), resource, len(remote_config))) # Only set configuration that is not default for k, entry in [(k, v) for k, v in remote_config.items() if not v.is_default]: resource.set_config(k, entry.value, overwrite=False) fs = a.alter_configs([resource]) fs[resource].add_done_callback(lambda fut: delta_alter_configs_done(fut, resource)) # For each resource's future set up a completion callback # the futures here. for res, f in fs.items(): f.add_done_callback(lambda fut, resource=res: delta_alter_configs(resource, fut.result())) # Wait for done callbacks to be triggered and operations to complete. print("Waiting for {} resource updates to finish".format(len(wait_zero))) wait_zero.wait() def example_list(a, args): if len(args) == 0: what = "all" else: what = args[0] md = a.list_topics(timeout=10) print("Cluster {} metadata (response from broker {}):".format(md.cluster_id, md.orig_broker_name)) if what in ("all", "brokers"): print(" {} brokers:".format(len(md.brokers))) for b in iter(md.brokers.values()): if b.id == md.controller_id: print(" {} (controller)".format(b)) else: print(" {}".format(b)) if what not in ("all", "topics"): return print(" {} topics:".format(len(md.topics))) for t in iter(md.topics.values()): if t.error is not None: errstr = ": {}".format(t.error) else: errstr = "" print(" \"{}\" with {} partition(s){}".format(t, len(t.partitions), errstr)) for p in iter(t.partitions.values()): if p.error is not None: errstr = ": {}".format(p.error) else: errstr = "" print(" partition {} leader: {}, replicas: {}, isrs: {}".format( p.id, p.leader, p.replicas, p.isrs, errstr)) if __name__ == '__main__': if len(sys.argv) < 3: sys.stderr.write('Usage: %s <bootstrap-brokers> <operation> <args..>\n\n' % sys.argv[0]) sys.stderr.write('operations:\n') sys.stderr.write(' create_topics <topic1> <topic2> ..\n') sys.stderr.write(' delete_topics <topic1> <topic2> ..\n') sys.stderr.write(' create_partitions <topic1> <new_total_count1> <topic2> <new_total_count2> ..\n') sys.stderr.write(' describe_configs <resource_type1> <resource_name1> <resource2> <resource_name2> ..\n') sys.stderr.write(' alter_configs <resource_type1> <resource_name1> ' + '<config=val,config2=val2> <resource_type2> <resource_name2> <config..> ..\n') sys.stderr.write(' delta_alter_configs <resource_type1> <resource_name1> ' + '<config=val,config2=val2> <resource_type2> <resource_name2> <config..> ..\n') sys.stderr.write(' list [<all|topics|brokers>]\n') sys.exit(1) broker = sys.argv[1] operation = sys.argv[2] args = sys.argv[3:] # Create Admin client a = AdminClient({'bootstrap.servers': broker}) opsmap = {'create_topics': example_create_topics, 'delete_topics': example_delete_topics, 'create_partitions': example_create_partitions, 'describe_configs': example_describe_configs, 'alter_configs': example_alter_configs, 'delta_alter_configs': example_delta_alter_configs, 'list': example_list} if operation not in opsmap: sys.stderr.write('Unknown operation: %s\n' % operation) sys.exit(1) opsmap[operation](a, args)
true
true
f70a6906b34d328a586c5a69de02ca915b6ad0ee
5,457
py
Python
fixit/cli/run_rules.py
isidentical/Fixit
e9bd1bcce14922d44086ee31798959b302377338
[ "Apache-2.0" ]
null
null
null
fixit/cli/run_rules.py
isidentical/Fixit
e9bd1bcce14922d44086ee31798959b302377338
[ "Apache-2.0" ]
null
null
null
fixit/cli/run_rules.py
isidentical/Fixit
e9bd1bcce14922d44086ee31798959b302377338
[ "Apache-2.0" ]
1
2020-09-09T09:57:35.000Z
2020-09-09T09:57:35.000Z
# Copyright (c) Facebook, Inc. and its affiliates. # # This source code is licensed under the MIT license found in the # LICENSE file in the root directory of this source tree. # Usage: # # $ python -m fixit.cli.run_rules --help # $ python -m fixit.cli.run_rules # $ python -m fixit.cli.run_rules --rules AvoidOrInExceptRule # $ python -m fixit.cli.run_rules . --rules AvoidOrInExceptRule NoUnnecessaryListComprehensionRule # $ python -m fixit.cli.run_rules . --rules AvoidOrInExceptRule my.custom.rules.package # $ python -m fixit.cli.run_rules . --rules fixit.rules import argparse import itertools import shutil import sys import time from dataclasses import dataclass from pathlib import Path from typing import TYPE_CHECKING, Iterable, Mapping, Optional, Sequence from libcst import ParserSyntaxError, parse_module from libcst.metadata import MetadataWrapper from fixit.cli import find_files, map_paths from fixit.cli.args import ( get_compact_parser, get_multiprocessing_parser, get_paths_parser, get_rules_parser, get_skip_ignore_byte_marker_parser, get_use_ignore_comments_parser, ) from fixit.cli.formatter import LintRuleReportFormatter from fixit.cli.full_repo_metadata import ( get_metadata_caches, rules_require_metadata_cache, ) from fixit.cli.utils import print_red from fixit.common.utils import LintRuleCollectionT from fixit.rule_lint_engine import lint_file if TYPE_CHECKING: from libcst.metadata.base_provider import ProviderT @dataclass(frozen=True) class LintOpts: rules: LintRuleCollectionT use_ignore_byte_markers: bool use_ignore_comments: bool formatter: LintRuleReportFormatter def get_formatted_reports_for_path( path: Path, opts: LintOpts, metadata_cache: Optional[Mapping["ProviderT", object]] = None, ) -> Iterable[str]: with open(path, "rb") as f: source = f.read() try: cst_wrapper = None if metadata_cache is not None: cst_wrapper = MetadataWrapper(parse_module(source), True, metadata_cache) raw_reports = lint_file( path, source, rules=opts.rules, use_ignore_byte_markers=opts.use_ignore_byte_markers, use_ignore_comments=opts.use_ignore_comments, cst_wrapper=cst_wrapper, ) except (SyntaxError, ParserSyntaxError) as e: print_red( f"Encountered the following error while parsing source code in file {path}:" ) print(e) return [] # linter completed successfully return [opts.formatter.format(rr) for rr in raw_reports] def main(raw_args: Sequence[str]) -> int: parser = argparse.ArgumentParser( description=( "Validates your lint rules by running them against the specified, " + "directory or file(s). This is not a substitute for unit tests, " + "but it can provide additional confidence in your lint rules.\n" + "If no lint rules or packages are specified, runs all lint rules " + "found in the packages specified in `fixit.config.yaml`." ), parents=[ get_paths_parser(), get_rules_parser(), get_use_ignore_comments_parser(), get_skip_ignore_byte_marker_parser(), get_compact_parser(), get_multiprocessing_parser(), ], ) parser.add_argument( "--cache-timeout", type=int, help="Timeout (seconds) for metadata cache fetching. Default is 2 seconds.", default=2, ) args = parser.parse_args(raw_args) width = shutil.get_terminal_size(fallback=(80, 24)).columns # expand path if it's a directory file_paths = tuple(find_files(args.paths)) all_rules = args.rules if not args.compact: print(f"Scanning {len(file_paths)} files") print(f"Testing {len(all_rules)} rules") print() start_time = time.time() metadata_caches: Optional[Mapping[str, Mapping["ProviderT", object]]] = None if rules_require_metadata_cache(all_rules): metadata_caches = get_metadata_caches(args.cache_timeout, file_paths) # opts is a more type-safe version of args that we pass around opts = LintOpts( rules=all_rules, use_ignore_byte_markers=args.use_ignore_byte_markers, use_ignore_comments=args.use_ignore_comments, formatter=LintRuleReportFormatter(width, args.compact), ) formatted_reports_iter = itertools.chain.from_iterable( map_paths( get_formatted_reports_for_path, file_paths, opts, workers=args.workers, metadata_caches=metadata_caches, ) ) formatted_reports = [] for formatted_report in formatted_reports_iter: # Reports are yielded as soon as they're available. Stream the output to the # terminal. print(formatted_report) # save the report from the iterator for later use formatted_reports.append(formatted_report) if not args.compact: print() print( f"Found {len(formatted_reports)} reports in {len(file_paths)} files in " + f"{time.time() - start_time :.2f} seconds." ) # Return with an exit code of 1 if there are any violations found. return int(bool(formatted_reports)) if __name__ == "__main__": sys.exit(main(sys.argv[1:]))
31.912281
100
0.68206
import argparse import itertools import shutil import sys import time from dataclasses import dataclass from pathlib import Path from typing import TYPE_CHECKING, Iterable, Mapping, Optional, Sequence from libcst import ParserSyntaxError, parse_module from libcst.metadata import MetadataWrapper from fixit.cli import find_files, map_paths from fixit.cli.args import ( get_compact_parser, get_multiprocessing_parser, get_paths_parser, get_rules_parser, get_skip_ignore_byte_marker_parser, get_use_ignore_comments_parser, ) from fixit.cli.formatter import LintRuleReportFormatter from fixit.cli.full_repo_metadata import ( get_metadata_caches, rules_require_metadata_cache, ) from fixit.cli.utils import print_red from fixit.common.utils import LintRuleCollectionT from fixit.rule_lint_engine import lint_file if TYPE_CHECKING: from libcst.metadata.base_provider import ProviderT @dataclass(frozen=True) class LintOpts: rules: LintRuleCollectionT use_ignore_byte_markers: bool use_ignore_comments: bool formatter: LintRuleReportFormatter def get_formatted_reports_for_path( path: Path, opts: LintOpts, metadata_cache: Optional[Mapping["ProviderT", object]] = None, ) -> Iterable[str]: with open(path, "rb") as f: source = f.read() try: cst_wrapper = None if metadata_cache is not None: cst_wrapper = MetadataWrapper(parse_module(source), True, metadata_cache) raw_reports = lint_file( path, source, rules=opts.rules, use_ignore_byte_markers=opts.use_ignore_byte_markers, use_ignore_comments=opts.use_ignore_comments, cst_wrapper=cst_wrapper, ) except (SyntaxError, ParserSyntaxError) as e: print_red( f"Encountered the following error while parsing source code in file {path}:" ) print(e) return [] return [opts.formatter.format(rr) for rr in raw_reports] def main(raw_args: Sequence[str]) -> int: parser = argparse.ArgumentParser( description=( "Validates your lint rules by running them against the specified, " + "directory or file(s). This is not a substitute for unit tests, " + "but it can provide additional confidence in your lint rules.\n" + "If no lint rules or packages are specified, runs all lint rules " + "found in the packages specified in `fixit.config.yaml`." ), parents=[ get_paths_parser(), get_rules_parser(), get_use_ignore_comments_parser(), get_skip_ignore_byte_marker_parser(), get_compact_parser(), get_multiprocessing_parser(), ], ) parser.add_argument( "--cache-timeout", type=int, help="Timeout (seconds) for metadata cache fetching. Default is 2 seconds.", default=2, ) args = parser.parse_args(raw_args) width = shutil.get_terminal_size(fallback=(80, 24)).columns file_paths = tuple(find_files(args.paths)) all_rules = args.rules if not args.compact: print(f"Scanning {len(file_paths)} files") print(f"Testing {len(all_rules)} rules") print() start_time = time.time() metadata_caches: Optional[Mapping[str, Mapping["ProviderT", object]]] = None if rules_require_metadata_cache(all_rules): metadata_caches = get_metadata_caches(args.cache_timeout, file_paths) # opts is a more type-safe version of args that we pass around opts = LintOpts( rules=all_rules, use_ignore_byte_markers=args.use_ignore_byte_markers, use_ignore_comments=args.use_ignore_comments, formatter=LintRuleReportFormatter(width, args.compact), ) formatted_reports_iter = itertools.chain.from_iterable( map_paths( get_formatted_reports_for_path, file_paths, opts, workers=args.workers, metadata_caches=metadata_caches, ) ) formatted_reports = [] for formatted_report in formatted_reports_iter: # Reports are yielded as soon as they're available. Stream the output to the print(formatted_report) formatted_reports.append(formatted_report) if not args.compact: print() print( f"Found {len(formatted_reports)} reports in {len(file_paths)} files in " + f"{time.time() - start_time :.2f} seconds." ) return int(bool(formatted_reports)) if __name__ == "__main__": sys.exit(main(sys.argv[1:]))
true
true
f70a695a360de2a4638bc8fac6801bae01f235ff
19,184
py
Python
gym/envs/__init__.py
Jekyll1021/gym
1701741df2e6ae9a762fe647122ee8344f586bc9
[ "Python-2.0", "OLDAP-2.7" ]
null
null
null
gym/envs/__init__.py
Jekyll1021/gym
1701741df2e6ae9a762fe647122ee8344f586bc9
[ "Python-2.0", "OLDAP-2.7" ]
null
null
null
gym/envs/__init__.py
Jekyll1021/gym
1701741df2e6ae9a762fe647122ee8344f586bc9
[ "Python-2.0", "OLDAP-2.7" ]
null
null
null
from gym.envs.registration import registry, register, make, spec # Algorithmic # ---------------------------------------- register( id='Copy-v0', entry_point='gym.envs.algorithmic:CopyEnv', max_episode_steps=200, reward_threshold=25.0, ) register( id='RepeatCopy-v0', entry_point='gym.envs.algorithmic:RepeatCopyEnv', max_episode_steps=200, reward_threshold=75.0, ) register( id='ReversedAddition-v0', entry_point='gym.envs.algorithmic:ReversedAdditionEnv', kwargs={'rows' : 2}, max_episode_steps=200, reward_threshold=25.0, ) register( id='ReversedAddition3-v0', entry_point='gym.envs.algorithmic:ReversedAdditionEnv', kwargs={'rows' : 3}, max_episode_steps=200, reward_threshold=25.0, ) register( id='DuplicatedInput-v0', entry_point='gym.envs.algorithmic:DuplicatedInputEnv', max_episode_steps=200, reward_threshold=9.0, ) register( id='Reverse-v0', entry_point='gym.envs.algorithmic:ReverseEnv', max_episode_steps=200, reward_threshold=25.0, ) # Classic # ---------------------------------------- register( id='CartPole-v0', entry_point='gym.envs.classic_control:CartPoleEnv', max_episode_steps=200, reward_threshold=195.0, ) register( id='CartPole-v1', entry_point='gym.envs.classic_control:CartPoleEnv', max_episode_steps=500, reward_threshold=475.0, ) register( id='MountainCar-v0', entry_point='gym.envs.classic_control:MountainCarEnv', max_episode_steps=200, reward_threshold=-110.0, ) register( id='MountainCarContinuous-v0', entry_point='gym.envs.classic_control:Continuous_MountainCarEnv', max_episode_steps=999, reward_threshold=90.0, ) register( id='Pendulum-v0', entry_point='gym.envs.classic_control:PendulumEnv', max_episode_steps=200, ) register( id='Acrobot-v1', entry_point='gym.envs.classic_control:AcrobotEnv', max_episode_steps=500, ) # Box2d # ---------------------------------------- register( id='LunarLander-v2', entry_point='gym.envs.box2d:LunarLander', max_episode_steps=1000, reward_threshold=200, ) register( id='LunarLanderContinuous-v2', entry_point='gym.envs.box2d:LunarLanderContinuous', max_episode_steps=1000, reward_threshold=200, ) register( id='BipedalWalker-v2', entry_point='gym.envs.box2d:BipedalWalker', max_episode_steps=1600, reward_threshold=300, ) register( id='BipedalWalkerHardcore-v2', entry_point='gym.envs.box2d:BipedalWalkerHardcore', max_episode_steps=2000, reward_threshold=300, ) register( id='CarRacing-v0', entry_point='gym.envs.box2d:CarRacing', max_episode_steps=1000, reward_threshold=900, ) # Toy Text # ---------------------------------------- register( id='Blackjack-v0', entry_point='gym.envs.toy_text:BlackjackEnv', ) register( id='KellyCoinflip-v0', entry_point='gym.envs.toy_text:KellyCoinflipEnv', reward_threshold=246.61, ) register( id='KellyCoinflipGeneralized-v0', entry_point='gym.envs.toy_text:KellyCoinflipGeneralizedEnv', ) register( id='FrozenLake-v0', entry_point='gym.envs.toy_text:FrozenLakeEnv', kwargs={'map_name' : '4x4'}, max_episode_steps=100, reward_threshold=0.78, # optimum = .8196 ) register( id='FrozenLake8x8-v0', entry_point='gym.envs.toy_text:FrozenLakeEnv', kwargs={'map_name' : '8x8'}, max_episode_steps=200, reward_threshold=0.99, # optimum = 1 ) register( id='CliffWalking-v0', entry_point='gym.envs.toy_text:CliffWalkingEnv', ) register( id='NChain-v0', entry_point='gym.envs.toy_text:NChainEnv', max_episode_steps=1000, ) register( id='Roulette-v0', entry_point='gym.envs.toy_text:RouletteEnv', max_episode_steps=100, ) register( id='Taxi-v2', entry_point='gym.envs.toy_text:TaxiEnv', reward_threshold=8, # optimum = 8.46 max_episode_steps=200, ) register( id='GuessingGame-v0', entry_point='gym.envs.toy_text:GuessingGame', max_episode_steps=200, ) register( id='HotterColder-v0', entry_point='gym.envs.toy_text:HotterColder', max_episode_steps=200, ) # Mujoco # ---------------------------------------- # 2D register( id='Reacher-v2', entry_point='gym.envs.mujoco:ReacherEnv', max_episode_steps=50, reward_threshold=-3.75, ) register( id='Pusher-v2', entry_point='gym.envs.mujoco:PusherEnv', max_episode_steps=100, reward_threshold=0.0, ) register( id='Thrower-v2', entry_point='gym.envs.mujoco:ThrowerEnv', max_episode_steps=100, reward_threshold=0.0, ) register( id='Striker-v2', entry_point='gym.envs.mujoco:StrikerEnv', max_episode_steps=100, reward_threshold=0.0, ) register( id='InvertedPendulum-v2', entry_point='gym.envs.mujoco:InvertedPendulumEnv', max_episode_steps=1000, reward_threshold=950.0, ) register( id='InvertedDoublePendulum-v2', entry_point='gym.envs.mujoco:InvertedDoublePendulumEnv', max_episode_steps=1000, reward_threshold=9100.0, ) register( id='HalfCheetah-v2', entry_point='gym.envs.mujoco:HalfCheetahEnv', max_episode_steps=1000, reward_threshold=4800.0, ) register( id='Hopper-v2', entry_point='gym.envs.mujoco:HopperEnv', max_episode_steps=1000, reward_threshold=3800.0, ) register( id='Swimmer-v2', entry_point='gym.envs.mujoco:SwimmerEnv', max_episode_steps=1000, reward_threshold=360.0, ) register( id='Walker2d-v2', max_episode_steps=1000, entry_point='gym.envs.mujoco:Walker2dEnv', ) register( id='Ant-v2', entry_point='gym.envs.mujoco:AntEnv', max_episode_steps=1000, reward_threshold=6000.0, ) register( id='Humanoid-v2', entry_point='gym.envs.mujoco:HumanoidEnv', max_episode_steps=1000, ) register( id='HumanoidStandup-v2', entry_point='gym.envs.mujoco:HumanoidStandupEnv', max_episode_steps=1000, ) # Robotics # ---------------------------------------- def _merge(a, b): a.update(b) return a for reward_type in ['sparse', 'dense']: suffix = 'Dense' if reward_type == 'dense' else '' kwargs = { 'reward_type': reward_type, } # Fetch register( id='FetchSlide{}-v1'.format(suffix), entry_point='gym.envs.robotics:FetchSlideEnv', kwargs=kwargs, max_episode_steps=50, ) register( id='CamSlide{}-v0'.format(suffix), entry_point='gym.envs.robotics:CamSlideEnv', kwargs=kwargs, max_episode_steps=50, ) register( id='CamSlideJoint{}-v0'.format(suffix), entry_point='gym.envs.robotics:CamSlideJointEnv', kwargs=kwargs, max_episode_steps=500, ) register( id='FetchPickAndPlace{}-v1'.format(suffix), entry_point='gym.envs.robotics:FetchPickAndPlaceEnv', kwargs=kwargs, max_episode_steps=50, ) register( id='CamPickAndPlace{}-v0'.format(suffix), entry_point='gym.envs.robotics:CamPickAndPlaceEnv', kwargs=kwargs, max_episode_steps=50, ) register( id='CamPickAndPlaceJoint{}-v0'.format(suffix), entry_point='gym.envs.robotics:CamPickAndPlaceJointEnv', kwargs=kwargs, max_episode_steps=500, ) register( id='FetchReach{}-v1'.format(suffix), entry_point='gym.envs.robotics:FetchReachEnv', kwargs=kwargs, max_episode_steps=50, ) register( id='CamReach{}-v0'.format(suffix), entry_point='gym.envs.robotics:CamReachEnv', kwargs=kwargs, max_episode_steps=50, ) register( id='CamReachJoint{}-v0'.format(suffix), entry_point='gym.envs.robotics:CamReachJointEnv', kwargs=kwargs, max_episode_steps=500, ) register( id='FetchPush{}-v1'.format(suffix), entry_point='gym.envs.robotics:FetchPushEnv', kwargs=kwargs, max_episode_steps=50, ) register( id='CamPush{}-v0'.format(suffix), entry_point='gym.envs.robotics:CamPushEnv', kwargs=kwargs, max_episode_steps=50, ) register( id='CamPushJoint{}-v0'.format(suffix), entry_point='gym.envs.robotics:CamPushJointEnv', kwargs=kwargs, max_episode_steps=500, ) # grasp register( id='Grasp{}-v0'.format(suffix), entry_point='gym.envs.robotics:CamGraspEnv', kwargs=kwargs, max_episode_steps=2, ) # grasp open to close register( id='GraspOpenToClose{}-v0'.format(suffix), entry_point='gym.envs.robotics:CamGraspOpenToCloseEnv', kwargs=kwargs, max_episode_steps=3, ) # grasp rotation register( id='GraspRot{}-v0'.format(suffix), entry_point='gym.envs.robotics:CamGraspRotationEnv', kwargs=kwargs, max_episode_steps=2, ) # push register( id='Push{}-v0'.format(suffix), entry_point='gym.envs.robotics:CamPushEnv', kwargs=kwargs, max_episode_steps=3, ) # Peg Insertion register( id='PegInsert{}-v0'.format(suffix), entry_point='gym.envs.robotics:CamPegInsertEnv', kwargs=kwargs, max_episode_steps=2, ) # peg rotation register( id='PegInsertRot{}-v0'.format(suffix), entry_point='gym.envs.robotics:CamPegInsertRotationEnv', kwargs=kwargs, max_episode_steps=2, ) # peg open to close register( id='PegInsertOpenToClose{}-v0'.format(suffix), entry_point='gym.envs.robotics:CamPegInsertOpenToCloseEnv', kwargs=kwargs, max_episode_steps=3, ) # slide register( id='Slide{}-v0'.format(suffix), entry_point='gym.envs.robotics:CamSlideEnv', kwargs=kwargs, max_episode_steps=2, ) # slide rotation register( id='SlideRot{}-v0'.format(suffix), entry_point='gym.envs.robotics:CamSlideRotationEnv', kwargs=kwargs, max_episode_steps=2, ) # slide open to close register( id='SlideOpenToClose{}-v0'.format(suffix), entry_point='gym.envs.robotics:CamSlideOpenToCloseEnv', kwargs=kwargs, max_episode_steps=3, ) # Drawer open register( id='Drawer{}-v0'.format(suffix), entry_point='gym.envs.robotics:CamDrawerOpenEnv', kwargs=kwargs, max_episode_steps=2, ) # Drawer open to close register( id='DrawerOpenToClose{}-v0'.format(suffix), entry_point='gym.envs.robotics:CamDrawerOpenToCloseEnv', kwargs=kwargs, max_episode_steps=3, ) # inverse peg insertion register( id='InversePegInsert{}-v0'.format(suffix), entry_point='gym.envs.robotics:CamInversePegInsertEnv', kwargs=kwargs, max_episode_steps=2, ) # Hand register( id='HandReach{}-v0'.format(suffix), entry_point='gym.envs.robotics:HandReachEnv', kwargs=kwargs, max_episode_steps=50, ) register( id='HandManipulateBlockRotateZ{}-v0'.format(suffix), entry_point='gym.envs.robotics:HandBlockEnv', kwargs=_merge({'target_position': 'ignore', 'target_rotation': 'z'}, kwargs), max_episode_steps=100, ) register( id='HandManipulateBlockRotateParallel{}-v0'.format(suffix), entry_point='gym.envs.robotics:HandBlockEnv', kwargs=_merge({'target_position': 'ignore', 'target_rotation': 'parallel'}, kwargs), max_episode_steps=100, ) register( id='HandManipulateBlockRotateXYZ{}-v0'.format(suffix), entry_point='gym.envs.robotics:HandBlockEnv', kwargs=_merge({'target_position': 'ignore', 'target_rotation': 'xyz'}, kwargs), max_episode_steps=100, ) register( id='HandManipulateBlockFull{}-v0'.format(suffix), entry_point='gym.envs.robotics:HandBlockEnv', kwargs=_merge({'target_position': 'random', 'target_rotation': 'xyz'}, kwargs), max_episode_steps=100, ) # Alias for "Full" register( id='HandManipulateBlock{}-v0'.format(suffix), entry_point='gym.envs.robotics:HandBlockEnv', kwargs=_merge({'target_position': 'random', 'target_rotation': 'xyz'}, kwargs), max_episode_steps=100, ) register( id='HandManipulateBlockTouchSensors{}-v0'.format(suffix), entry_point='gym.envs.robotics:HandBlockTouchSensorsEnv', kwargs=_merge({'target_position': 'random', 'target_rotation': 'xyz'}, kwargs), max_episode_steps=100, ) register( id='HandManipulateEggRotate{}-v0'.format(suffix), entry_point='gym.envs.robotics:HandEggEnv', kwargs=_merge({'target_position': 'ignore', 'target_rotation': 'xyz'}, kwargs), max_episode_steps=100, ) register( id='HandManipulateEggFull{}-v0'.format(suffix), entry_point='gym.envs.robotics:HandEggEnv', kwargs=_merge({'target_position': 'random', 'target_rotation': 'xyz'}, kwargs), max_episode_steps=100, ) # Alias for "Full" register( id='HandManipulateEgg{}-v0'.format(suffix), entry_point='gym.envs.robotics:HandEggEnv', kwargs=_merge({'target_position': 'random', 'target_rotation': 'xyz'}, kwargs), max_episode_steps=100, ) register( id='HandManipulateEggTouchSensors{}-v0'.format(suffix), entry_point='gym.envs.robotics:HandEggTouchSensorsEnv', kwargs=_merge({'target_position': 'random', 'target_rotation': 'xyz'}, kwargs), max_episode_steps=100, ) register( id='HandManipulatePenRotate{}-v0'.format(suffix), entry_point='gym.envs.robotics:HandPenEnv', kwargs=_merge({'target_position': 'ignore', 'target_rotation': 'xyz'}, kwargs), max_episode_steps=100, ) register( id='HandManipulatePenFull{}-v0'.format(suffix), entry_point='gym.envs.robotics:HandPenEnv', kwargs=_merge({'target_position': 'random', 'target_rotation': 'xyz'}, kwargs), max_episode_steps=100, ) # Alias for "Full" register( id='HandManipulatePen{}-v0'.format(suffix), entry_point='gym.envs.robotics:HandPenEnv', kwargs=_merge({'target_position': 'random', 'target_rotation': 'xyz'}, kwargs), max_episode_steps=100, ) register( id='HandManipulatePenTouchSensors{}-v0'.format(suffix), entry_point='gym.envs.robotics:HandPenTouchSensorsEnv', kwargs=_merge({'target_position': 'random', 'target_rotation': 'xyz'}, kwargs), max_episode_steps=100, ) # Atari # ---------------------------------------- # # print ', '.join(["'{}'".format(name.split('.')[0]) for name in atari_py.list_games()]) for game in ['air_raid', 'alien', 'amidar', 'assault', 'asterix', 'asteroids', 'atlantis', 'bank_heist', 'battle_zone', 'beam_rider', 'berzerk', 'bowling', 'boxing', 'breakout', 'carnival', 'centipede', 'chopper_command', 'crazy_climber', 'defender', 'demon_attack', 'double_dunk', 'elevator_action', 'enduro', 'fishing_derby', 'freeway', 'frostbite', 'gopher', 'gravitar', 'hero', 'ice_hockey', 'jamesbond', 'journey_escape', 'kangaroo', 'krull', 'kung_fu_master', 'montezuma_revenge', 'ms_pacman', 'name_this_game', 'phoenix', 'pitfall', 'pong', 'pooyan', 'private_eye', 'qbert', 'riverraid', 'road_runner', 'robotank', 'seaquest', 'skiing', 'solaris', 'space_invaders', 'star_gunner', 'tennis', 'time_pilot', 'tutankham', 'up_n_down', 'venture', 'video_pinball', 'wizard_of_wor', 'yars_revenge', 'zaxxon']: for obs_type in ['image', 'ram']: # space_invaders should yield SpaceInvaders-v0 and SpaceInvaders-ram-v0 name = ''.join([g.capitalize() for g in game.split('_')]) if obs_type == 'ram': name = '{}-ram'.format(name) nondeterministic = False if game == 'elevator_action' and obs_type == 'ram': # ElevatorAction-ram-v0 seems to yield slightly # non-deterministic observations about 10% of the time. We # should track this down eventually, but for now we just # mark it as nondeterministic. nondeterministic = True register( id='{}-v0'.format(name), entry_point='gym.envs.atari:AtariEnv', kwargs={'game': game, 'obs_type': obs_type, 'repeat_action_probability': 0.25}, max_episode_steps=10000, nondeterministic=nondeterministic, ) register( id='{}-v4'.format(name), entry_point='gym.envs.atari:AtariEnv', kwargs={'game': game, 'obs_type': obs_type}, max_episode_steps=100000, nondeterministic=nondeterministic, ) # Standard Deterministic (as in the original DeepMind paper) if game == 'space_invaders': frameskip = 3 else: frameskip = 4 # Use a deterministic frame skip. register( id='{}Deterministic-v0'.format(name), entry_point='gym.envs.atari:AtariEnv', kwargs={'game': game, 'obs_type': obs_type, 'frameskip': frameskip, 'repeat_action_probability': 0.25}, max_episode_steps=100000, nondeterministic=nondeterministic, ) register( id='{}Deterministic-v4'.format(name), entry_point='gym.envs.atari:AtariEnv', kwargs={'game': game, 'obs_type': obs_type, 'frameskip': frameskip}, max_episode_steps=100000, nondeterministic=nondeterministic, ) register( id='{}NoFrameskip-v0'.format(name), entry_point='gym.envs.atari:AtariEnv', kwargs={'game': game, 'obs_type': obs_type, 'frameskip': 1, 'repeat_action_probability': 0.25}, # A frameskip of 1 means we get every frame max_episode_steps=frameskip * 100000, nondeterministic=nondeterministic, ) # No frameskip. (Atari has no entropy source, so these are # deterministic environments.) register( id='{}NoFrameskip-v4'.format(name), entry_point='gym.envs.atari:AtariEnv', kwargs={'game': game, 'obs_type': obs_type, 'frameskip': 1}, # A frameskip of 1 means we get every frame max_episode_steps=frameskip * 100000, nondeterministic=nondeterministic, ) # Unit test # --------- register( id='CubeCrash-v0', entry_point='gym.envs.unittest:CubeCrash', reward_threshold=0.9, ) register( id='CubeCrashSparse-v0', entry_point='gym.envs.unittest:CubeCrashSparse', reward_threshold=0.9, ) register( id='CubeCrashScreenBecomesBlack-v0', entry_point='gym.envs.unittest:CubeCrashScreenBecomesBlack', reward_threshold=0.9, ) register( id='MemorizeDigits-v0', entry_point='gym.envs.unittest:MemorizeDigits', reward_threshold=20, )
26.868347
151
0.634122
from gym.envs.registration import registry, register, make, spec register( id='Copy-v0', entry_point='gym.envs.algorithmic:CopyEnv', max_episode_steps=200, reward_threshold=25.0, ) register( id='RepeatCopy-v0', entry_point='gym.envs.algorithmic:RepeatCopyEnv', max_episode_steps=200, reward_threshold=75.0, ) register( id='ReversedAddition-v0', entry_point='gym.envs.algorithmic:ReversedAdditionEnv', kwargs={'rows' : 2}, max_episode_steps=200, reward_threshold=25.0, ) register( id='ReversedAddition3-v0', entry_point='gym.envs.algorithmic:ReversedAdditionEnv', kwargs={'rows' : 3}, max_episode_steps=200, reward_threshold=25.0, ) register( id='DuplicatedInput-v0', entry_point='gym.envs.algorithmic:DuplicatedInputEnv', max_episode_steps=200, reward_threshold=9.0, ) register( id='Reverse-v0', entry_point='gym.envs.algorithmic:ReverseEnv', max_episode_steps=200, reward_threshold=25.0, ) register( id='CartPole-v0', entry_point='gym.envs.classic_control:CartPoleEnv', max_episode_steps=200, reward_threshold=195.0, ) register( id='CartPole-v1', entry_point='gym.envs.classic_control:CartPoleEnv', max_episode_steps=500, reward_threshold=475.0, ) register( id='MountainCar-v0', entry_point='gym.envs.classic_control:MountainCarEnv', max_episode_steps=200, reward_threshold=-110.0, ) register( id='MountainCarContinuous-v0', entry_point='gym.envs.classic_control:Continuous_MountainCarEnv', max_episode_steps=999, reward_threshold=90.0, ) register( id='Pendulum-v0', entry_point='gym.envs.classic_control:PendulumEnv', max_episode_steps=200, ) register( id='Acrobot-v1', entry_point='gym.envs.classic_control:AcrobotEnv', max_episode_steps=500, ) register( id='LunarLander-v2', entry_point='gym.envs.box2d:LunarLander', max_episode_steps=1000, reward_threshold=200, ) register( id='LunarLanderContinuous-v2', entry_point='gym.envs.box2d:LunarLanderContinuous', max_episode_steps=1000, reward_threshold=200, ) register( id='BipedalWalker-v2', entry_point='gym.envs.box2d:BipedalWalker', max_episode_steps=1600, reward_threshold=300, ) register( id='BipedalWalkerHardcore-v2', entry_point='gym.envs.box2d:BipedalWalkerHardcore', max_episode_steps=2000, reward_threshold=300, ) register( id='CarRacing-v0', entry_point='gym.envs.box2d:CarRacing', max_episode_steps=1000, reward_threshold=900, ) register( id='Blackjack-v0', entry_point='gym.envs.toy_text:BlackjackEnv', ) register( id='KellyCoinflip-v0', entry_point='gym.envs.toy_text:KellyCoinflipEnv', reward_threshold=246.61, ) register( id='KellyCoinflipGeneralized-v0', entry_point='gym.envs.toy_text:KellyCoinflipGeneralizedEnv', ) register( id='FrozenLake-v0', entry_point='gym.envs.toy_text:FrozenLakeEnv', kwargs={'map_name' : '4x4'}, max_episode_steps=100, reward_threshold=0.78, ) register( id='FrozenLake8x8-v0', entry_point='gym.envs.toy_text:FrozenLakeEnv', kwargs={'map_name' : '8x8'}, max_episode_steps=200, reward_threshold=0.99, ) register( id='CliffWalking-v0', entry_point='gym.envs.toy_text:CliffWalkingEnv', ) register( id='NChain-v0', entry_point='gym.envs.toy_text:NChainEnv', max_episode_steps=1000, ) register( id='Roulette-v0', entry_point='gym.envs.toy_text:RouletteEnv', max_episode_steps=100, ) register( id='Taxi-v2', entry_point='gym.envs.toy_text:TaxiEnv', reward_threshold=8, max_episode_steps=200, ) register( id='GuessingGame-v0', entry_point='gym.envs.toy_text:GuessingGame', max_episode_steps=200, ) register( id='HotterColder-v0', entry_point='gym.envs.toy_text:HotterColder', max_episode_steps=200, ) register( id='Reacher-v2', entry_point='gym.envs.mujoco:ReacherEnv', max_episode_steps=50, reward_threshold=-3.75, ) register( id='Pusher-v2', entry_point='gym.envs.mujoco:PusherEnv', max_episode_steps=100, reward_threshold=0.0, ) register( id='Thrower-v2', entry_point='gym.envs.mujoco:ThrowerEnv', max_episode_steps=100, reward_threshold=0.0, ) register( id='Striker-v2', entry_point='gym.envs.mujoco:StrikerEnv', max_episode_steps=100, reward_threshold=0.0, ) register( id='InvertedPendulum-v2', entry_point='gym.envs.mujoco:InvertedPendulumEnv', max_episode_steps=1000, reward_threshold=950.0, ) register( id='InvertedDoublePendulum-v2', entry_point='gym.envs.mujoco:InvertedDoublePendulumEnv', max_episode_steps=1000, reward_threshold=9100.0, ) register( id='HalfCheetah-v2', entry_point='gym.envs.mujoco:HalfCheetahEnv', max_episode_steps=1000, reward_threshold=4800.0, ) register( id='Hopper-v2', entry_point='gym.envs.mujoco:HopperEnv', max_episode_steps=1000, reward_threshold=3800.0, ) register( id='Swimmer-v2', entry_point='gym.envs.mujoco:SwimmerEnv', max_episode_steps=1000, reward_threshold=360.0, ) register( id='Walker2d-v2', max_episode_steps=1000, entry_point='gym.envs.mujoco:Walker2dEnv', ) register( id='Ant-v2', entry_point='gym.envs.mujoco:AntEnv', max_episode_steps=1000, reward_threshold=6000.0, ) register( id='Humanoid-v2', entry_point='gym.envs.mujoco:HumanoidEnv', max_episode_steps=1000, ) register( id='HumanoidStandup-v2', entry_point='gym.envs.mujoco:HumanoidStandupEnv', max_episode_steps=1000, ) def _merge(a, b): a.update(b) return a for reward_type in ['sparse', 'dense']: suffix = 'Dense' if reward_type == 'dense' else '' kwargs = { 'reward_type': reward_type, } register( id='FetchSlide{}-v1'.format(suffix), entry_point='gym.envs.robotics:FetchSlideEnv', kwargs=kwargs, max_episode_steps=50, ) register( id='CamSlide{}-v0'.format(suffix), entry_point='gym.envs.robotics:CamSlideEnv', kwargs=kwargs, max_episode_steps=50, ) register( id='CamSlideJoint{}-v0'.format(suffix), entry_point='gym.envs.robotics:CamSlideJointEnv', kwargs=kwargs, max_episode_steps=500, ) register( id='FetchPickAndPlace{}-v1'.format(suffix), entry_point='gym.envs.robotics:FetchPickAndPlaceEnv', kwargs=kwargs, max_episode_steps=50, ) register( id='CamPickAndPlace{}-v0'.format(suffix), entry_point='gym.envs.robotics:CamPickAndPlaceEnv', kwargs=kwargs, max_episode_steps=50, ) register( id='CamPickAndPlaceJoint{}-v0'.format(suffix), entry_point='gym.envs.robotics:CamPickAndPlaceJointEnv', kwargs=kwargs, max_episode_steps=500, ) register( id='FetchReach{}-v1'.format(suffix), entry_point='gym.envs.robotics:FetchReachEnv', kwargs=kwargs, max_episode_steps=50, ) register( id='CamReach{}-v0'.format(suffix), entry_point='gym.envs.robotics:CamReachEnv', kwargs=kwargs, max_episode_steps=50, ) register( id='CamReachJoint{}-v0'.format(suffix), entry_point='gym.envs.robotics:CamReachJointEnv', kwargs=kwargs, max_episode_steps=500, ) register( id='FetchPush{}-v1'.format(suffix), entry_point='gym.envs.robotics:FetchPushEnv', kwargs=kwargs, max_episode_steps=50, ) register( id='CamPush{}-v0'.format(suffix), entry_point='gym.envs.robotics:CamPushEnv', kwargs=kwargs, max_episode_steps=50, ) register( id='CamPushJoint{}-v0'.format(suffix), entry_point='gym.envs.robotics:CamPushJointEnv', kwargs=kwargs, max_episode_steps=500, ) register( id='Grasp{}-v0'.format(suffix), entry_point='gym.envs.robotics:CamGraspEnv', kwargs=kwargs, max_episode_steps=2, ) register( id='GraspOpenToClose{}-v0'.format(suffix), entry_point='gym.envs.robotics:CamGraspOpenToCloseEnv', kwargs=kwargs, max_episode_steps=3, ) register( id='GraspRot{}-v0'.format(suffix), entry_point='gym.envs.robotics:CamGraspRotationEnv', kwargs=kwargs, max_episode_steps=2, ) register( id='Push{}-v0'.format(suffix), entry_point='gym.envs.robotics:CamPushEnv', kwargs=kwargs, max_episode_steps=3, ) register( id='PegInsert{}-v0'.format(suffix), entry_point='gym.envs.robotics:CamPegInsertEnv', kwargs=kwargs, max_episode_steps=2, ) register( id='PegInsertRot{}-v0'.format(suffix), entry_point='gym.envs.robotics:CamPegInsertRotationEnv', kwargs=kwargs, max_episode_steps=2, ) register( id='PegInsertOpenToClose{}-v0'.format(suffix), entry_point='gym.envs.robotics:CamPegInsertOpenToCloseEnv', kwargs=kwargs, max_episode_steps=3, ) register( id='Slide{}-v0'.format(suffix), entry_point='gym.envs.robotics:CamSlideEnv', kwargs=kwargs, max_episode_steps=2, ) register( id='SlideRot{}-v0'.format(suffix), entry_point='gym.envs.robotics:CamSlideRotationEnv', kwargs=kwargs, max_episode_steps=2, ) register( id='SlideOpenToClose{}-v0'.format(suffix), entry_point='gym.envs.robotics:CamSlideOpenToCloseEnv', kwargs=kwargs, max_episode_steps=3, ) register( id='Drawer{}-v0'.format(suffix), entry_point='gym.envs.robotics:CamDrawerOpenEnv', kwargs=kwargs, max_episode_steps=2, ) register( id='DrawerOpenToClose{}-v0'.format(suffix), entry_point='gym.envs.robotics:CamDrawerOpenToCloseEnv', kwargs=kwargs, max_episode_steps=3, ) register( id='InversePegInsert{}-v0'.format(suffix), entry_point='gym.envs.robotics:CamInversePegInsertEnv', kwargs=kwargs, max_episode_steps=2, ) register( id='HandReach{}-v0'.format(suffix), entry_point='gym.envs.robotics:HandReachEnv', kwargs=kwargs, max_episode_steps=50, ) register( id='HandManipulateBlockRotateZ{}-v0'.format(suffix), entry_point='gym.envs.robotics:HandBlockEnv', kwargs=_merge({'target_position': 'ignore', 'target_rotation': 'z'}, kwargs), max_episode_steps=100, ) register( id='HandManipulateBlockRotateParallel{}-v0'.format(suffix), entry_point='gym.envs.robotics:HandBlockEnv', kwargs=_merge({'target_position': 'ignore', 'target_rotation': 'parallel'}, kwargs), max_episode_steps=100, ) register( id='HandManipulateBlockRotateXYZ{}-v0'.format(suffix), entry_point='gym.envs.robotics:HandBlockEnv', kwargs=_merge({'target_position': 'ignore', 'target_rotation': 'xyz'}, kwargs), max_episode_steps=100, ) register( id='HandManipulateBlockFull{}-v0'.format(suffix), entry_point='gym.envs.robotics:HandBlockEnv', kwargs=_merge({'target_position': 'random', 'target_rotation': 'xyz'}, kwargs), max_episode_steps=100, ) register( id='HandManipulateBlock{}-v0'.format(suffix), entry_point='gym.envs.robotics:HandBlockEnv', kwargs=_merge({'target_position': 'random', 'target_rotation': 'xyz'}, kwargs), max_episode_steps=100, ) register( id='HandManipulateBlockTouchSensors{}-v0'.format(suffix), entry_point='gym.envs.robotics:HandBlockTouchSensorsEnv', kwargs=_merge({'target_position': 'random', 'target_rotation': 'xyz'}, kwargs), max_episode_steps=100, ) register( id='HandManipulateEggRotate{}-v0'.format(suffix), entry_point='gym.envs.robotics:HandEggEnv', kwargs=_merge({'target_position': 'ignore', 'target_rotation': 'xyz'}, kwargs), max_episode_steps=100, ) register( id='HandManipulateEggFull{}-v0'.format(suffix), entry_point='gym.envs.robotics:HandEggEnv', kwargs=_merge({'target_position': 'random', 'target_rotation': 'xyz'}, kwargs), max_episode_steps=100, ) register( id='HandManipulateEgg{}-v0'.format(suffix), entry_point='gym.envs.robotics:HandEggEnv', kwargs=_merge({'target_position': 'random', 'target_rotation': 'xyz'}, kwargs), max_episode_steps=100, ) register( id='HandManipulateEggTouchSensors{}-v0'.format(suffix), entry_point='gym.envs.robotics:HandEggTouchSensorsEnv', kwargs=_merge({'target_position': 'random', 'target_rotation': 'xyz'}, kwargs), max_episode_steps=100, ) register( id='HandManipulatePenRotate{}-v0'.format(suffix), entry_point='gym.envs.robotics:HandPenEnv', kwargs=_merge({'target_position': 'ignore', 'target_rotation': 'xyz'}, kwargs), max_episode_steps=100, ) register( id='HandManipulatePenFull{}-v0'.format(suffix), entry_point='gym.envs.robotics:HandPenEnv', kwargs=_merge({'target_position': 'random', 'target_rotation': 'xyz'}, kwargs), max_episode_steps=100, ) register( id='HandManipulatePen{}-v0'.format(suffix), entry_point='gym.envs.robotics:HandPenEnv', kwargs=_merge({'target_position': 'random', 'target_rotation': 'xyz'}, kwargs), max_episode_steps=100, ) register( id='HandManipulatePenTouchSensors{}-v0'.format(suffix), entry_point='gym.envs.robotics:HandPenTouchSensorsEnv', kwargs=_merge({'target_position': 'random', 'target_rotation': 'xyz'}, kwargs), max_episode_steps=100, ) s', 'bank_heist', 'battle_zone', 'beam_rider', 'berzerk', 'bowling', 'boxing', 'breakout', 'carnival', 'centipede', 'chopper_command', 'crazy_climber', 'defender', 'demon_attack', 'double_dunk', 'elevator_action', 'enduro', 'fishing_derby', 'freeway', 'frostbite', 'gopher', 'gravitar', 'hero', 'ice_hockey', 'jamesbond', 'journey_escape', 'kangaroo', 'krull', 'kung_fu_master', 'montezuma_revenge', 'ms_pacman', 'name_this_game', 'phoenix', 'pitfall', 'pong', 'pooyan', 'private_eye', 'qbert', 'riverraid', 'road_runner', 'robotank', 'seaquest', 'skiing', 'solaris', 'space_invaders', 'star_gunner', 'tennis', 'time_pilot', 'tutankham', 'up_n_down', 'venture', 'video_pinball', 'wizard_of_wor', 'yars_revenge', 'zaxxon']: for obs_type in ['image', 'ram']: name = ''.join([g.capitalize() for g in game.split('_')]) if obs_type == 'ram': name = '{}-ram'.format(name) nondeterministic = False if game == 'elevator_action' and obs_type == 'ram': nondeterministic = True register( id='{}-v0'.format(name), entry_point='gym.envs.atari:AtariEnv', kwargs={'game': game, 'obs_type': obs_type, 'repeat_action_probability': 0.25}, max_episode_steps=10000, nondeterministic=nondeterministic, ) register( id='{}-v4'.format(name), entry_point='gym.envs.atari:AtariEnv', kwargs={'game': game, 'obs_type': obs_type}, max_episode_steps=100000, nondeterministic=nondeterministic, ) if game == 'space_invaders': frameskip = 3 else: frameskip = 4 register( id='{}Deterministic-v0'.format(name), entry_point='gym.envs.atari:AtariEnv', kwargs={'game': game, 'obs_type': obs_type, 'frameskip': frameskip, 'repeat_action_probability': 0.25}, max_episode_steps=100000, nondeterministic=nondeterministic, ) register( id='{}Deterministic-v4'.format(name), entry_point='gym.envs.atari:AtariEnv', kwargs={'game': game, 'obs_type': obs_type, 'frameskip': frameskip}, max_episode_steps=100000, nondeterministic=nondeterministic, ) register( id='{}NoFrameskip-v0'.format(name), entry_point='gym.envs.atari:AtariEnv', kwargs={'game': game, 'obs_type': obs_type, 'frameskip': 1, 'repeat_action_probability': 0.25}, max_episode_steps=frameskip * 100000, nondeterministic=nondeterministic, ) register( id='{}NoFrameskip-v4'.format(name), entry_point='gym.envs.atari:AtariEnv', kwargs={'game': game, 'obs_type': obs_type, 'frameskip': 1}, max_episode_steps=frameskip * 100000, nondeterministic=nondeterministic, ) register( id='CubeCrash-v0', entry_point='gym.envs.unittest:CubeCrash', reward_threshold=0.9, ) register( id='CubeCrashSparse-v0', entry_point='gym.envs.unittest:CubeCrashSparse', reward_threshold=0.9, ) register( id='CubeCrashScreenBecomesBlack-v0', entry_point='gym.envs.unittest:CubeCrashScreenBecomesBlack', reward_threshold=0.9, ) register( id='MemorizeDigits-v0', entry_point='gym.envs.unittest:MemorizeDigits', reward_threshold=20, )
true
true
f70a6966c8f433d99412dfc5c6bb2b7a62863608
347
py
Python
topicnet/cooking_machine/recipes/__init__.py
DmitriyValetov/TopicNet
b450606ce6cdf2b1f75280112627666f325b1b2c
[ "MIT" ]
null
null
null
topicnet/cooking_machine/recipes/__init__.py
DmitriyValetov/TopicNet
b450606ce6cdf2b1f75280112627666f325b1b2c
[ "MIT" ]
null
null
null
topicnet/cooking_machine/recipes/__init__.py
DmitriyValetov/TopicNet
b450606ce6cdf2b1f75280112627666f325b1b2c
[ "MIT" ]
null
null
null
from .multimodal_exploratory_search_pipeline import MultimodalSearchRecipe from .artm_baseline_pipeline import BaselineRecipe from .exploratory_search_pipeline import SearchRecipe from .artm_baseline_pipeline import ARTM_baseline_template as ARTM_baseline from .exploratory_search_pipeline import exploratory_search_template as exploratory_search
57.833333
90
0.916427
from .multimodal_exploratory_search_pipeline import MultimodalSearchRecipe from .artm_baseline_pipeline import BaselineRecipe from .exploratory_search_pipeline import SearchRecipe from .artm_baseline_pipeline import ARTM_baseline_template as ARTM_baseline from .exploratory_search_pipeline import exploratory_search_template as exploratory_search
true
true
f70a69b8a7b993da0e40d67273f8006f8f15f747
2,299
py
Python
grr/parsers/windows_persistence_test.py
StanislavParovoy/GRR
7cdf490f9be2ccc0a8160c9b8ae23b73922049d5
[ "Apache-2.0" ]
5
2017-03-17T08:25:09.000Z
2022-02-22T05:28:14.000Z
grr/parsers/windows_persistence_test.py
StanislavParovoy/GRR
7cdf490f9be2ccc0a8160c9b8ae23b73922049d5
[ "Apache-2.0" ]
null
null
null
grr/parsers/windows_persistence_test.py
StanislavParovoy/GRR
7cdf490f9be2ccc0a8160c9b8ae23b73922049d5
[ "Apache-2.0" ]
3
2018-12-07T07:04:37.000Z
2022-02-22T05:28:16.000Z
#!/usr/bin/env python """Tests for grr.parsers.windows_persistence.""" from grr.lib import flags from grr.lib import rdfvalue from grr.lib import test_lib from grr.lib.rdfvalues import client as rdf_client from grr.lib.rdfvalues import paths as rdf_paths from grr.lib.rdfvalues import protodict as rdf_protodict from grr.parsers import windows_persistence class WindowsPersistenceMechanismsParserTest(test_lib.FlowTestsBaseclass): def testParse(self): parser = windows_persistence.WindowsPersistenceMechanismsParser() path = (r"HKEY_LOCAL_MACHINE\Software\Microsoft\Windows\CurrentVersion" r"\Run\test") pathspec = rdf_paths.PathSpec( path=path, pathtype=rdf_paths.PathSpec.PathType.REGISTRY) reg_data = "C:\\blah\\some.exe /v" reg_type = rdf_client.StatEntry.RegistryType.REG_SZ stat = rdf_client.StatEntry( aff4path="aff4:/asdfasdf/", pathspec=pathspec, registry_type=reg_type, registry_data=rdf_protodict.DataBlob(string=reg_data)) persistence = [stat] image_paths = [ "system32\\drivers\\ACPI.sys", "%systemroot%\\system32\\svchost.exe -k netsvcs", "\\SystemRoot\\system32\\drivers\\acpipmi.sys" ] reg_key = rdfvalue.RDFURN("aff4:/C.1000000000000000/registry" "/HKEY_LOCAL_MACHINE/SYSTEM/ControlSet001" "/services/AcpiPmi") for path in image_paths: serv_info = rdf_client.WindowsServiceInformation( name="blah", display_name="GRRservice", image_path=path, registry_key=reg_key) persistence.append(serv_info) knowledge_base = rdf_client.KnowledgeBase() knowledge_base.environ_systemroot = "C:\\Windows" expected = [ "C:\\blah\\some.exe", "C:\\Windows\\system32\\drivers\\ACPI.sys", "C:\\Windows\\system32\\svchost.exe", "C:\\Windows\\system32\\drivers\\acpipmi.sys" ] for index, item in enumerate(persistence): results = list( parser.Parse(item, knowledge_base, rdf_paths.PathSpec.PathType.OS)) self.assertEqual(results[0].pathspec.path, expected[index]) self.assertEqual(len(results), 1) def main(argv): test_lib.main(argv) if __name__ == "__main__": flags.StartMain(main)
33.808824
77
0.683776
from grr.lib import flags from grr.lib import rdfvalue from grr.lib import test_lib from grr.lib.rdfvalues import client as rdf_client from grr.lib.rdfvalues import paths as rdf_paths from grr.lib.rdfvalues import protodict as rdf_protodict from grr.parsers import windows_persistence class WindowsPersistenceMechanismsParserTest(test_lib.FlowTestsBaseclass): def testParse(self): parser = windows_persistence.WindowsPersistenceMechanismsParser() path = (r"HKEY_LOCAL_MACHINE\Software\Microsoft\Windows\CurrentVersion" r"\Run\test") pathspec = rdf_paths.PathSpec( path=path, pathtype=rdf_paths.PathSpec.PathType.REGISTRY) reg_data = "C:\\blah\\some.exe /v" reg_type = rdf_client.StatEntry.RegistryType.REG_SZ stat = rdf_client.StatEntry( aff4path="aff4:/asdfasdf/", pathspec=pathspec, registry_type=reg_type, registry_data=rdf_protodict.DataBlob(string=reg_data)) persistence = [stat] image_paths = [ "system32\\drivers\\ACPI.sys", "%systemroot%\\system32\\svchost.exe -k netsvcs", "\\SystemRoot\\system32\\drivers\\acpipmi.sys" ] reg_key = rdfvalue.RDFURN("aff4:/C.1000000000000000/registry" "/HKEY_LOCAL_MACHINE/SYSTEM/ControlSet001" "/services/AcpiPmi") for path in image_paths: serv_info = rdf_client.WindowsServiceInformation( name="blah", display_name="GRRservice", image_path=path, registry_key=reg_key) persistence.append(serv_info) knowledge_base = rdf_client.KnowledgeBase() knowledge_base.environ_systemroot = "C:\\Windows" expected = [ "C:\\blah\\some.exe", "C:\\Windows\\system32\\drivers\\ACPI.sys", "C:\\Windows\\system32\\svchost.exe", "C:\\Windows\\system32\\drivers\\acpipmi.sys" ] for index, item in enumerate(persistence): results = list( parser.Parse(item, knowledge_base, rdf_paths.PathSpec.PathType.OS)) self.assertEqual(results[0].pathspec.path, expected[index]) self.assertEqual(len(results), 1) def main(argv): test_lib.main(argv) if __name__ == "__main__": flags.StartMain(main)
true
true
f70a6a6b45048c2b9550d17284e2cbac8687e10a
1,656
py
Python
kafka-python-console-sample/consumertask.py
IBM-CSM/event-streams-samples
ce90b1f7f57f3d2afff0596b3f4610392c025ece
[ "Apache-2.0" ]
39
2015-10-13T21:41:25.000Z
2018-08-14T12:29:48.000Z
kafka-python-console-sample/consumertask.py
IBM-CSM/event-streams-samples
ce90b1f7f57f3d2afff0596b3f4610392c025ece
[ "Apache-2.0" ]
22
2016-05-06T15:30:43.000Z
2018-09-12T06:59:49.000Z
kafka-python-console-sample/consumertask.py
IBM-CSM/event-streams-samples
ce90b1f7f57f3d2afff0596b3f4610392c025ece
[ "Apache-2.0" ]
92
2015-10-13T21:41:25.000Z
2018-09-19T09:08:10.000Z
""" Copyright 2015-2018 IBM Licensed under the Apache License, Version 2.0 (the "License"); you may not use this file except in compliance with the License. You may obtain a copy of the License at http://www.apache.org/licenses/LICENSE-2.0 Unless required by applicable law or agreed to in writing, software distributed under the License is distributed on an "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the License for the specific language governing permissions and limitations under the License. Licensed Materials - Property of IBM © Copyright IBM Corp. 2015-2018 """ import asyncio from confluent_kafka import Consumer class ConsumerTask(object): def __init__(self, conf, topic_name): self.consumer = Consumer(conf) self.topic_name = topic_name self.running = True def stop(self): self.running = False @asyncio.coroutine def run(self): print('The consumer has started') self.consumer.subscribe([self.topic_name]) while self.running: msg = self.consumer.poll(1) if msg is not None and msg.error() is None: print('Message consumed: topic={0}, partition={1}, offset={2}, key={3}, value={4}'.format( msg.topic(), msg.partition(), msg.offset(), msg.key().decode('utf-8'), msg.value().decode('utf-8'))) else: print('No messages consumed') yield from asyncio.sleep(2) self.consumer.unsubscribe() self.consumer.close()
32.470588
106
0.629831
import asyncio from confluent_kafka import Consumer class ConsumerTask(object): def __init__(self, conf, topic_name): self.consumer = Consumer(conf) self.topic_name = topic_name self.running = True def stop(self): self.running = False @asyncio.coroutine def run(self): print('The consumer has started') self.consumer.subscribe([self.topic_name]) while self.running: msg = self.consumer.poll(1) if msg is not None and msg.error() is None: print('Message consumed: topic={0}, partition={1}, offset={2}, key={3}, value={4}'.format( msg.topic(), msg.partition(), msg.offset(), msg.key().decode('utf-8'), msg.value().decode('utf-8'))) else: print('No messages consumed') yield from asyncio.sleep(2) self.consumer.unsubscribe() self.consumer.close()
true
true
f70a6a7d524410e5221820b26a7da36dcf0ac821
1,296
py
Python
var/spack/repos/builtin/packages/seqan/package.py
xiki-tempula/spack
9d66c05e93ab8a933fc59915040c0e0c86a4aac4
[ "ECL-2.0", "Apache-2.0", "MIT" ]
9
2018-04-18T07:51:40.000Z
2021-09-10T03:56:57.000Z
var/spack/repos/builtin/packages/seqan/package.py
xiki-tempula/spack
9d66c05e93ab8a933fc59915040c0e0c86a4aac4
[ "ECL-2.0", "Apache-2.0", "MIT" ]
907
2018-04-18T11:17:57.000Z
2022-03-31T13:20:25.000Z
var/spack/repos/builtin/packages/seqan/package.py
xiki-tempula/spack
9d66c05e93ab8a933fc59915040c0e0c86a4aac4
[ "ECL-2.0", "Apache-2.0", "MIT" ]
29
2018-11-05T16:14:23.000Z
2022-02-03T16:07:09.000Z
# Copyright 2013-2020 Lawrence Livermore National Security, LLC and other # Spack Project Developers. See the top-level COPYRIGHT file for details. # # SPDX-License-Identifier: (Apache-2.0 OR MIT) from spack import * class Seqan(CMakePackage): """SeqAn is an open source C++ library of efficient algorithms and data structures for the analysis of sequences with the focus on biological data. Our library applies a unique generic design that guarantees high performance, generality, extensibility, and integration with other libraries. SeqAn is easy to use and simplifies the development of new software tools with a minimal loss of performance""" homepage = "https://www.seqan.de" url = "https://github.com/seqan/seqan/archive/seqan-v2.4.0.tar.gz" version('2.4.0', sha256='d7084d17729214003e84818e0280a16f223c8f1c6a30eeef040c27e0c0047bd7') depends_on('cmake@3.4.0:', type='build') depends_on('python@2.7.0:', type='build') depends_on('py-nose', type='build') depends_on('py-sphinx', type='build') depends_on('boost', type=('build', 'link')) depends_on('zlib', type=('build', 'link')) depends_on('bzip2', type=('build', 'link')) conflicts('%intel@:16.0.4') conflicts('%gcc@:4.9.4') conflicts('%llvm@:3.5.1')
38.117647
95
0.70216
from spack import * class Seqan(CMakePackage): homepage = "https://www.seqan.de" url = "https://github.com/seqan/seqan/archive/seqan-v2.4.0.tar.gz" version('2.4.0', sha256='d7084d17729214003e84818e0280a16f223c8f1c6a30eeef040c27e0c0047bd7') depends_on('cmake@3.4.0:', type='build') depends_on('python@2.7.0:', type='build') depends_on('py-nose', type='build') depends_on('py-sphinx', type='build') depends_on('boost', type=('build', 'link')) depends_on('zlib', type=('build', 'link')) depends_on('bzip2', type=('build', 'link')) conflicts('%intel@:16.0.4') conflicts('%gcc@:4.9.4') conflicts('%llvm@:3.5.1')
true
true
f70a6a9e38230c1855566a8a044921b83b845f35
6,386
py
Python
tests/lite/test_wrappers.py
FeryET/pytorch-lightning
b1f8b111b5085373599758a4e155a482259cdbf0
[ "Apache-2.0" ]
null
null
null
tests/lite/test_wrappers.py
FeryET/pytorch-lightning
b1f8b111b5085373599758a4e155a482259cdbf0
[ "Apache-2.0" ]
1
2022-03-18T21:56:53.000Z
2022-03-18T21:56:53.000Z
tests/lite/test_wrappers.py
FeryET/pytorch-lightning
b1f8b111b5085373599758a4e155a482259cdbf0
[ "Apache-2.0" ]
null
null
null
# Copyright The PyTorch Lightning team. # # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. from unittest.mock import ANY, Mock import pytest import torch from torch.utils.data.dataloader import DataLoader from pytorch_lightning.core.mixins import DeviceDtypeModuleMixin from pytorch_lightning.lite import LightningLite from pytorch_lightning.lite.wrappers import _LiteDataLoader, _LiteModule, _LiteOptimizer from tests.helpers.runif import RunIf class EmptyLite(LightningLite): def run(self): pass def test_lite_module_wraps(): """Test that the wrapped module is accessible via the property.""" module = Mock() assert _LiteModule(module, Mock()).module is module @RunIf(min_gpus=1) @pytest.mark.parametrize( "precision, input_type, expected_type", [ (32, torch.float16, torch.float32), (32, torch.float32, torch.float32), (32, torch.float64, torch.float32), (32, torch.int, torch.int), (16, torch.float32, torch.float16), (16, torch.float64, torch.float16), (16, torch.long, torch.long), pytest.param("bf16", torch.float32, torch.bfloat16, marks=RunIf(min_torch="1.10")), pytest.param("bf16", torch.float64, torch.bfloat16, marks=RunIf(min_torch="1.10")), pytest.param("bf16", torch.bool, torch.bool, marks=RunIf(min_torch="1.10")), ], ) def test_lite_module_forward_conversion(precision, input_type, expected_type): """Test that the LiteModule performs autocasting on the input tensors and during forward().""" lite = EmptyLite(precision=precision, accelerator="gpu", devices=1) device = torch.device("cuda", 0) def check_autocast(forward_input): assert precision != 16 or torch.is_autocast_enabled() return forward_input module = Mock(wraps=torch.nn.Identity(), side_effect=check_autocast) lite_module = _LiteModule(module, lite._precision_plugin).to(device) out = lite_module(torch.tensor([1, 2, 3], dtype=input_type, device=device)) assert module.call_args[0][0].dtype == expected_type assert out.dtype == input_type or out.dtype == torch.get_default_dtype() @pytest.mark.parametrize( "device", [torch.device("cpu"), pytest.param(torch.device("cuda", 0), marks=RunIf(min_gpus=1))] ) @pytest.mark.parametrize("dtype", [torch.float32, torch.float16]) def test_lite_module_device_dtype_propagation(device, dtype): """Test that the LiteModule propagates device and dtype properties to its submodules (e.g. torchmetrics).""" class DeviceModule(DeviceDtypeModuleMixin): pass device_module = DeviceModule() lite_module = _LiteModule(device_module, Mock()) lite_module.to(device) assert device_module.device == device assert lite_module.device == device lite_module.to(dtype) assert device_module.dtype == dtype assert lite_module.dtype == dtype def test_lite_dataloader_iterator(): """Test that the iteration over a LiteDataLoader wraps the iterator of the underlying dataloader (no automatic device placement).""" dataloader = DataLoader(range(5), batch_size=2) lite_dataloader = _LiteDataLoader(dataloader) assert len(lite_dataloader) == len(dataloader) == 3 iterator = iter(dataloader) lite_iterator = iter(lite_dataloader) assert torch.equal(next(iterator), next(lite_iterator)) assert torch.equal(next(iterator), next(lite_iterator)) assert torch.equal(next(iterator), next(lite_iterator)) with pytest.raises(StopIteration): next(iterator) with pytest.raises(StopIteration): next(lite_iterator) @pytest.mark.parametrize( "src_device, dest_device", [ (torch.device("cpu"), torch.device("cpu")), pytest.param(torch.device("cpu"), torch.device("cuda", 0), marks=RunIf(min_gpus=1)), pytest.param(torch.device("cuda", 0), torch.device("cpu"), marks=RunIf(min_gpus=1)), ], ) def test_lite_dataloader_device_placement(src_device, dest_device): """Test that the LiteDataLoader moves data to the device in its iterator.""" sample0 = torch.tensor(0, device=src_device) sample1 = torch.tensor(1, device=src_device) sample2 = {"data": torch.tensor(2, device=src_device)} sample3 = {"data": torch.tensor(3, device=src_device)} dataloader = DataLoader([sample0, sample1, sample2, sample3], batch_size=2) lite_dataloader = _LiteDataLoader(dataloader=dataloader, device=dest_device) iterator = iter(lite_dataloader) batch0 = next(iterator) assert torch.equal(batch0, torch.tensor([0, 1], device=dest_device)) batch1 = next(iterator) assert torch.equal(batch1["data"], torch.tensor([2, 3], device=dest_device)) def test_lite_optimizer_wraps(): """Test that the LiteOptimizer fully wraps the optimizer.""" optimizer_cls = torch.optim.SGD optimizer = Mock(spec=optimizer_cls) lite_optimizer = _LiteOptimizer(optimizer, Mock()) assert lite_optimizer.optimizer is optimizer assert isinstance(lite_optimizer, optimizer_cls) def test_lite_optimizer_state_dict(): """Test that the LiteOptimizer calls into the strategy to collect the state.""" optimizer = Mock() strategy = Mock() lite_optimizer = _LiteOptimizer(optimizer=optimizer, strategy=strategy) lite_optimizer.state_dict() strategy.optimizer_state.assert_called_with(optimizer) def test_lite_optimizer_steps(): """Test that the LiteOptimizer forwards the step() and zero_grad() calls to the wrapped optimizer.""" optimizer = Mock() strategy = Mock() strategy.optimizer_step.return_value = 123 lite_optimizer = _LiteOptimizer(optimizer=optimizer, strategy=strategy) step_output = lite_optimizer.step() assert step_output == 123 strategy.optimizer_step.assert_called_once() strategy.optimizer_step.assert_called_with(optimizer, opt_idx=0, closure=ANY, model=strategy.model)
38.939024
114
0.727216
from unittest.mock import ANY, Mock import pytest import torch from torch.utils.data.dataloader import DataLoader from pytorch_lightning.core.mixins import DeviceDtypeModuleMixin from pytorch_lightning.lite import LightningLite from pytorch_lightning.lite.wrappers import _LiteDataLoader, _LiteModule, _LiteOptimizer from tests.helpers.runif import RunIf class EmptyLite(LightningLite): def run(self): pass def test_lite_module_wraps(): module = Mock() assert _LiteModule(module, Mock()).module is module @RunIf(min_gpus=1) @pytest.mark.parametrize( "precision, input_type, expected_type", [ (32, torch.float16, torch.float32), (32, torch.float32, torch.float32), (32, torch.float64, torch.float32), (32, torch.int, torch.int), (16, torch.float32, torch.float16), (16, torch.float64, torch.float16), (16, torch.long, torch.long), pytest.param("bf16", torch.float32, torch.bfloat16, marks=RunIf(min_torch="1.10")), pytest.param("bf16", torch.float64, torch.bfloat16, marks=RunIf(min_torch="1.10")), pytest.param("bf16", torch.bool, torch.bool, marks=RunIf(min_torch="1.10")), ], ) def test_lite_module_forward_conversion(precision, input_type, expected_type): lite = EmptyLite(precision=precision, accelerator="gpu", devices=1) device = torch.device("cuda", 0) def check_autocast(forward_input): assert precision != 16 or torch.is_autocast_enabled() return forward_input module = Mock(wraps=torch.nn.Identity(), side_effect=check_autocast) lite_module = _LiteModule(module, lite._precision_plugin).to(device) out = lite_module(torch.tensor([1, 2, 3], dtype=input_type, device=device)) assert module.call_args[0][0].dtype == expected_type assert out.dtype == input_type or out.dtype == torch.get_default_dtype() @pytest.mark.parametrize( "device", [torch.device("cpu"), pytest.param(torch.device("cuda", 0), marks=RunIf(min_gpus=1))] ) @pytest.mark.parametrize("dtype", [torch.float32, torch.float16]) def test_lite_module_device_dtype_propagation(device, dtype): class DeviceModule(DeviceDtypeModuleMixin): pass device_module = DeviceModule() lite_module = _LiteModule(device_module, Mock()) lite_module.to(device) assert device_module.device == device assert lite_module.device == device lite_module.to(dtype) assert device_module.dtype == dtype assert lite_module.dtype == dtype def test_lite_dataloader_iterator(): dataloader = DataLoader(range(5), batch_size=2) lite_dataloader = _LiteDataLoader(dataloader) assert len(lite_dataloader) == len(dataloader) == 3 iterator = iter(dataloader) lite_iterator = iter(lite_dataloader) assert torch.equal(next(iterator), next(lite_iterator)) assert torch.equal(next(iterator), next(lite_iterator)) assert torch.equal(next(iterator), next(lite_iterator)) with pytest.raises(StopIteration): next(iterator) with pytest.raises(StopIteration): next(lite_iterator) @pytest.mark.parametrize( "src_device, dest_device", [ (torch.device("cpu"), torch.device("cpu")), pytest.param(torch.device("cpu"), torch.device("cuda", 0), marks=RunIf(min_gpus=1)), pytest.param(torch.device("cuda", 0), torch.device("cpu"), marks=RunIf(min_gpus=1)), ], ) def test_lite_dataloader_device_placement(src_device, dest_device): sample0 = torch.tensor(0, device=src_device) sample1 = torch.tensor(1, device=src_device) sample2 = {"data": torch.tensor(2, device=src_device)} sample3 = {"data": torch.tensor(3, device=src_device)} dataloader = DataLoader([sample0, sample1, sample2, sample3], batch_size=2) lite_dataloader = _LiteDataLoader(dataloader=dataloader, device=dest_device) iterator = iter(lite_dataloader) batch0 = next(iterator) assert torch.equal(batch0, torch.tensor([0, 1], device=dest_device)) batch1 = next(iterator) assert torch.equal(batch1["data"], torch.tensor([2, 3], device=dest_device)) def test_lite_optimizer_wraps(): optimizer_cls = torch.optim.SGD optimizer = Mock(spec=optimizer_cls) lite_optimizer = _LiteOptimizer(optimizer, Mock()) assert lite_optimizer.optimizer is optimizer assert isinstance(lite_optimizer, optimizer_cls) def test_lite_optimizer_state_dict(): optimizer = Mock() strategy = Mock() lite_optimizer = _LiteOptimizer(optimizer=optimizer, strategy=strategy) lite_optimizer.state_dict() strategy.optimizer_state.assert_called_with(optimizer) def test_lite_optimizer_steps(): optimizer = Mock() strategy = Mock() strategy.optimizer_step.return_value = 123 lite_optimizer = _LiteOptimizer(optimizer=optimizer, strategy=strategy) step_output = lite_optimizer.step() assert step_output == 123 strategy.optimizer_step.assert_called_once() strategy.optimizer_step.assert_called_with(optimizer, opt_idx=0, closure=ANY, model=strategy.model)
true
true
f70a6b28b67cb2ac17dd95251e5df602c3b4223d
56,239
py
Python
.install/.backup/platform/gsutil/third_party/boto/boto/beanstalk/layer1.py
bopopescu/google-cloud-sdk
b34e6a18f1e89673508166acce816111c3421e4b
[ "Apache-2.0" ]
1
2017-11-18T18:23:22.000Z
2017-11-18T18:23:22.000Z
taskqueue/venv_tq/lib/python2.7/site-packages/boto/beanstalk/layer1.py
matthappens/taskqueue
548979587326b95bf41851eb135052de782e74fc
[ "MIT" ]
null
null
null
taskqueue/venv_tq/lib/python2.7/site-packages/boto/beanstalk/layer1.py
matthappens/taskqueue
548979587326b95bf41851eb135052de782e74fc
[ "MIT" ]
1
2020-07-24T20:04:47.000Z
2020-07-24T20:04:47.000Z
# Copyright (c) 2012 Mitch Garnaat http://garnaat.org/ # Copyright (c) 2012 Amazon.com, Inc. or its affiliates. # All Rights Reserved # # Permission is hereby granted, free of charge, to any person obtaining a # copy of this software and associated documentation files (the # "Software"), to deal in the Software without restriction, including # without limitation the rights to use, copy, modify, merge, publish, dis- # tribute, sublicense, and/or sell copies of the Software, and to permit # persons to whom the Software is furnished to do so, subject to the fol- # lowing conditions: # # The above copyright notice and this permission notice shall be included # in all copies or substantial portions of the Software. # # THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS # OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABIL- # ITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT # SHALL THE AUTHOR BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, # WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, # OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS # IN THE SOFTWARE. # import boto import boto.jsonresponse from boto.compat import json from boto.regioninfo import RegionInfo from boto.connection import AWSQueryConnection class Layer1(AWSQueryConnection): APIVersion = '2010-12-01' DefaultRegionName = 'us-east-1' DefaultRegionEndpoint = 'elasticbeanstalk.us-east-1.amazonaws.com' def __init__(self, aws_access_key_id=None, aws_secret_access_key=None, is_secure=True, port=None, proxy=None, proxy_port=None, proxy_user=None, proxy_pass=None, debug=0, https_connection_factory=None, region=None, path='/', api_version=None, security_token=None): if not region: region = RegionInfo(self, self.DefaultRegionName, self.DefaultRegionEndpoint) self.region = region super(Layer1, self).__init__(aws_access_key_id, aws_secret_access_key, is_secure, port, proxy, proxy_port, proxy_user, proxy_pass, self.region.endpoint, debug, https_connection_factory, path, security_token) def _required_auth_capability(self): return ['hmac-v4'] def _encode_bool(self, v): v = bool(v) return {True: "true", False: "false"}[v] def _get_response(self, action, params, path='/', verb='GET'): params['ContentType'] = 'JSON' response = self.make_request(action, params, path, verb) body = response.read() boto.log.debug(body) if response.status == 200: return json.loads(body) else: raise self.ResponseError(response.status, response.reason, body) def check_dns_availability(self, cname_prefix): """Checks if the specified CNAME is available. :type cname_prefix: string :param cname_prefix: The prefix used when this CNAME is reserved. """ params = {'CNAMEPrefix': cname_prefix} return self._get_response('CheckDNSAvailability', params) def create_application(self, application_name, description=None): """ Creates an application that has one configuration template named default and no application versions. :type application_name: string :param application_name: The name of the application. Constraint: This name must be unique within your account. If the specified name already exists, the action returns an InvalidParameterValue error. :type description: string :param description: Describes the application. :raises: TooManyApplicationsException """ params = {'ApplicationName': application_name} if description: params['Description'] = description return self._get_response('CreateApplication', params) def create_application_version(self, application_name, version_label, description=None, s3_bucket=None, s3_key=None, auto_create_application=None): """Creates an application version for the specified application. :type application_name: string :param application_name: The name of the application. If no application is found with this name, and AutoCreateApplication is false, returns an InvalidParameterValue error. :type version_label: string :param version_label: A label identifying this version. Constraint: Must be unique per application. If an application version already exists with this label for the specified application, AWS Elastic Beanstalk returns an InvalidParameterValue error. :type description: string :param description: Describes this version. :type s3_bucket: string :param s3_bucket: The Amazon S3 bucket where the data is located. :type s3_key: string :param s3_key: The Amazon S3 key where the data is located. Both s3_bucket and s3_key must be specified in order to use a specific source bundle. If both of these values are not specified the sample application will be used. :type auto_create_application: boolean :param auto_create_application: Determines how the system behaves if the specified application for this version does not already exist: true: Automatically creates the specified application for this version if it does not already exist. false: Returns an InvalidParameterValue if the specified application for this version does not already exist. Default: false Valid Values: true | false :raises: TooManyApplicationsException, TooManyApplicationVersionsException, InsufficientPrivilegesException, S3LocationNotInServiceRegionException """ params = {'ApplicationName': application_name, 'VersionLabel': version_label} if description: params['Description'] = description if s3_bucket and s3_key: params['SourceBundle.S3Bucket'] = s3_bucket params['SourceBundle.S3Key'] = s3_key if auto_create_application: params['AutoCreateApplication'] = self._encode_bool( auto_create_application) return self._get_response('CreateApplicationVersion', params) def create_configuration_template(self, application_name, template_name, solution_stack_name=None, source_configuration_application_name=None, source_configuration_template_name=None, environment_id=None, description=None, option_settings=None): """Creates a configuration template. Templates are associated with a specific application and are used to deploy different versions of the application with the same configuration settings. :type application_name: string :param application_name: The name of the application to associate with this configuration template. If no application is found with this name, AWS Elastic Beanstalk returns an InvalidParameterValue error. :type template_name: string :param template_name: The name of the configuration template. Constraint: This name must be unique per application. Default: If a configuration template already exists with this name, AWS Elastic Beanstalk returns an InvalidParameterValue error. :type solution_stack_name: string :param solution_stack_name: The name of the solution stack used by this configuration. The solution stack specifies the operating system, architecture, and application server for a configuration template. It determines the set of configuration options as well as the possible and default values. Use ListAvailableSolutionStacks to obtain a list of available solution stacks. Default: If the SolutionStackName is not specified and the source configuration parameter is blank, AWS Elastic Beanstalk uses the default solution stack. If not specified and the source configuration parameter is specified, AWS Elastic Beanstalk uses the same solution stack as the source configuration template. :type source_configuration_application_name: string :param source_configuration_application_name: The name of the application associated with the configuration. :type source_configuration_template_name: string :param source_configuration_template_name: The name of the configuration template. :type environment_id: string :param environment_id: The ID of the environment used with this configuration template. :type description: string :param description: Describes this configuration. :type option_settings: list :param option_settings: If specified, AWS Elastic Beanstalk sets the specified configuration option to the requested value. The new value overrides the value obtained from the solution stack or the source configuration template. :raises: InsufficientPrivilegesException, TooManyConfigurationTemplatesException """ params = {'ApplicationName': application_name, 'TemplateName': template_name} if solution_stack_name: params['SolutionStackName'] = solution_stack_name if source_configuration_application_name: params['SourceConfiguration.ApplicationName'] = source_configuration_application_name if source_configuration_template_name: params['SourceConfiguration.TemplateName'] = source_configuration_template_name if environment_id: params['EnvironmentId'] = environment_id if description: params['Description'] = description if option_settings: self._build_list_params(params, option_settings, 'OptionSettings.member', ('Namespace', 'OptionName', 'Value')) return self._get_response('CreateConfigurationTemplate', params) def create_environment(self, application_name, environment_name, version_label=None, template_name=None, solution_stack_name=None, cname_prefix=None, description=None, option_settings=None, options_to_remove=None, tier_name=None, tier_type=None, tier_version='1.0'): """Launches an environment for the application using a configuration. :type application_name: string :param application_name: The name of the application that contains the version to be deployed. If no application is found with this name, CreateEnvironment returns an InvalidParameterValue error. :type environment_name: string :param environment_name: A unique name for the deployment environment. Used in the application URL. Constraint: Must be from 4 to 23 characters in length. The name can contain only letters, numbers, and hyphens. It cannot start or end with a hyphen. This name must be unique in your account. If the specified name already exists, AWS Elastic Beanstalk returns an InvalidParameterValue error. Default: If the CNAME parameter is not specified, the environment name becomes part of the CNAME, and therefore part of the visible URL for your application. :type version_label: string :param version_label: The name of the application version to deploy. If the specified application has no associated application versions, AWS Elastic Beanstalk UpdateEnvironment returns an InvalidParameterValue error. Default: If not specified, AWS Elastic Beanstalk attempts to launch the most recently created application version. :type template_name: string :param template_name: The name of the configuration template to use in deployment. If no configuration template is found with this name, AWS Elastic Beanstalk returns an InvalidParameterValue error. Condition: You must specify either this parameter or a SolutionStackName, but not both. If you specify both, AWS Elastic Beanstalk returns an InvalidParameterCombination error. If you do not specify either, AWS Elastic Beanstalk returns a MissingRequiredParameter error. :type solution_stack_name: string :param solution_stack_name: This is an alternative to specifying a configuration name. If specified, AWS Elastic Beanstalk sets the configuration values to the default values associated with the specified solution stack. Condition: You must specify either this or a TemplateName, but not both. If you specify both, AWS Elastic Beanstalk returns an InvalidParameterCombination error. If you do not specify either, AWS Elastic Beanstalk returns a MissingRequiredParameter error. :type cname_prefix: string :param cname_prefix: If specified, the environment attempts to use this value as the prefix for the CNAME. If not specified, the environment uses the environment name. :type description: string :param description: Describes this environment. :type option_settings: list :param option_settings: If specified, AWS Elastic Beanstalk sets the specified configuration options to the requested value in the configuration set for the new environment. These override the values obtained from the solution stack or the configuration template. Each element in the list is a tuple of (Namespace, OptionName, Value), for example:: [('aws:autoscaling:launchconfiguration', 'Ec2KeyName', 'mykeypair')] :type options_to_remove: list :param options_to_remove: A list of custom user-defined configuration options to remove from the configuration set for this new environment. :type tier_name: string :param tier_name: The name of the tier. Valid values are "WebServer" and "Worker". Defaults to "WebServer". The ``tier_name`` and a ``tier_type`` parameters are related and the values provided must be valid. The possible combinations are: * "WebServer" and "Standard" (the default) * "Worker" and "SQS/HTTP" :type tier_type: string :param tier_type: The type of the tier. Valid values are "Standard" if ``tier_name`` is "WebServer" and "SQS/HTTP" if ``tier_name`` is "Worker". Defaults to "Standard". :type tier_version: string :type tier_version: The version of the tier. Valid values currently are "1.0". Defaults to "1.0". :raises: TooManyEnvironmentsException, InsufficientPrivilegesException """ params = {'ApplicationName': application_name, 'EnvironmentName': environment_name} if version_label: params['VersionLabel'] = version_label if template_name: params['TemplateName'] = template_name if solution_stack_name: params['SolutionStackName'] = solution_stack_name if cname_prefix: params['CNAMEPrefix'] = cname_prefix if description: params['Description'] = description if option_settings: self._build_list_params(params, option_settings, 'OptionSettings.member', ('Namespace', 'OptionName', 'Value')) if options_to_remove: self.build_list_params(params, options_to_remove, 'OptionsToRemove.member') if tier_name and tier_type and tier_version: params['Tier.member.Name'] = tier_name params['Tier.member.Type'] = tier_type params['Tier.member.Version'] = tier_version return self._get_response('CreateEnvironment', params) def create_storage_location(self): """ Creates the Amazon S3 storage location for the account. This location is used to store user log files. :raises: TooManyBucketsException, S3SubscriptionRequiredException, InsufficientPrivilegesException """ return self._get_response('CreateStorageLocation', params={}) def delete_application(self, application_name, terminate_env_by_force=None): """ Deletes the specified application along with all associated versions and configurations. The application versions will not be deleted from your Amazon S3 bucket. :type application_name: string :param application_name: The name of the application to delete. :type terminate_env_by_force: boolean :param terminate_env_by_force: When set to true, running environments will be terminated before deleting the application. :raises: OperationInProgressException """ params = {'ApplicationName': application_name} if terminate_env_by_force: params['TerminateEnvByForce'] = self._encode_bool( terminate_env_by_force) return self._get_response('DeleteApplication', params) def delete_application_version(self, application_name, version_label, delete_source_bundle=None): """Deletes the specified version from the specified application. :type application_name: string :param application_name: The name of the application to delete releases from. :type version_label: string :param version_label: The label of the version to delete. :type delete_source_bundle: boolean :param delete_source_bundle: Indicates whether to delete the associated source bundle from Amazon S3. Valid Values: true | false :raises: SourceBundleDeletionException, InsufficientPrivilegesException, OperationInProgressException, S3LocationNotInServiceRegionException """ params = {'ApplicationName': application_name, 'VersionLabel': version_label} if delete_source_bundle: params['DeleteSourceBundle'] = self._encode_bool( delete_source_bundle) return self._get_response('DeleteApplicationVersion', params) def delete_configuration_template(self, application_name, template_name): """Deletes the specified configuration template. :type application_name: string :param application_name: The name of the application to delete the configuration template from. :type template_name: string :param template_name: The name of the configuration template to delete. :raises: OperationInProgressException """ params = {'ApplicationName': application_name, 'TemplateName': template_name} return self._get_response('DeleteConfigurationTemplate', params) def delete_environment_configuration(self, application_name, environment_name): """ Deletes the draft configuration associated with the running environment. Updating a running environment with any configuration changes creates a draft configuration set. You can get the draft configuration using DescribeConfigurationSettings while the update is in progress or if the update fails. The DeploymentStatus for the draft configuration indicates whether the deployment is in process or has failed. The draft configuration remains in existence until it is deleted with this action. :type application_name: string :param application_name: The name of the application the environment is associated with. :type environment_name: string :param environment_name: The name of the environment to delete the draft configuration from. """ params = {'ApplicationName': application_name, 'EnvironmentName': environment_name} return self._get_response('DeleteEnvironmentConfiguration', params) def describe_application_versions(self, application_name=None, version_labels=None): """Returns descriptions for existing application versions. :type application_name: string :param application_name: If specified, AWS Elastic Beanstalk restricts the returned descriptions to only include ones that are associated with the specified application. :type version_labels: list :param version_labels: If specified, restricts the returned descriptions to only include ones that have the specified version labels. """ params = {} if application_name: params['ApplicationName'] = application_name if version_labels: self.build_list_params(params, version_labels, 'VersionLabels.member') return self._get_response('DescribeApplicationVersions', params) def describe_applications(self, application_names=None): """Returns the descriptions of existing applications. :type application_names: list :param application_names: If specified, AWS Elastic Beanstalk restricts the returned descriptions to only include those with the specified names. """ params = {} if application_names: self.build_list_params(params, application_names, 'ApplicationNames.member') return self._get_response('DescribeApplications', params) def describe_configuration_options(self, application_name=None, template_name=None, environment_name=None, solution_stack_name=None, options=None): """Describes configuration options used in a template or environment. Describes the configuration options that are used in a particular configuration template or environment, or that a specified solution stack defines. The description includes the values the options, their default values, and an indication of the required action on a running environment if an option value is changed. :type application_name: string :param application_name: The name of the application associated with the configuration template or environment. Only needed if you want to describe the configuration options associated with either the configuration template or environment. :type template_name: string :param template_name: The name of the configuration template whose configuration options you want to describe. :type environment_name: string :param environment_name: The name of the environment whose configuration options you want to describe. :type solution_stack_name: string :param solution_stack_name: The name of the solution stack whose configuration options you want to describe. :type options: list :param options: If specified, restricts the descriptions to only the specified options. """ params = {} if application_name: params['ApplicationName'] = application_name if template_name: params['TemplateName'] = template_name if environment_name: params['EnvironmentName'] = environment_name if solution_stack_name: params['SolutionStackName'] = solution_stack_name if options: self.build_list_params(params, options, 'Options.member') return self._get_response('DescribeConfigurationOptions', params) def describe_configuration_settings(self, application_name, template_name=None, environment_name=None): """ Returns a description of the settings for the specified configuration set, that is, either a configuration template or the configuration set associated with a running environment. When describing the settings for the configuration set associated with a running environment, it is possible to receive two sets of setting descriptions. One is the deployed configuration set, and the other is a draft configuration of an environment that is either in the process of deployment or that failed to deploy. :type application_name: string :param application_name: The application for the environment or configuration template. :type template_name: string :param template_name: The name of the configuration template to describe. Conditional: You must specify either this parameter or an EnvironmentName, but not both. If you specify both, AWS Elastic Beanstalk returns an InvalidParameterCombination error. If you do not specify either, AWS Elastic Beanstalk returns a MissingRequiredParameter error. :type environment_name: string :param environment_name: The name of the environment to describe. Condition: You must specify either this or a TemplateName, but not both. If you specify both, AWS Elastic Beanstalk returns an InvalidParameterCombination error. If you do not specify either, AWS Elastic Beanstalk returns MissingRequiredParameter error. """ params = {'ApplicationName': application_name} if template_name: params['TemplateName'] = template_name if environment_name: params['EnvironmentName'] = environment_name return self._get_response('DescribeConfigurationSettings', params) def describe_environment_resources(self, environment_id=None, environment_name=None): """Returns AWS resources for this environment. :type environment_id: string :param environment_id: The ID of the environment to retrieve AWS resource usage data. Condition: You must specify either this or an EnvironmentName, or both. If you do not specify either, AWS Elastic Beanstalk returns MissingRequiredParameter error. :type environment_name: string :param environment_name: The name of the environment to retrieve AWS resource usage data. Condition: You must specify either this or an EnvironmentId, or both. If you do not specify either, AWS Elastic Beanstalk returns MissingRequiredParameter error. :raises: InsufficientPrivilegesException """ params = {} if environment_id: params['EnvironmentId'] = environment_id if environment_name: params['EnvironmentName'] = environment_name return self._get_response('DescribeEnvironmentResources', params) def describe_environments(self, application_name=None, version_label=None, environment_ids=None, environment_names=None, include_deleted=None, included_deleted_back_to=None): """Returns descriptions for existing environments. :type application_name: string :param application_name: If specified, AWS Elastic Beanstalk restricts the returned descriptions to include only those that are associated with this application. :type version_label: string :param version_label: If specified, AWS Elastic Beanstalk restricts the returned descriptions to include only those that are associated with this application version. :type environment_ids: list :param environment_ids: If specified, AWS Elastic Beanstalk restricts the returned descriptions to include only those that have the specified IDs. :type environment_names: list :param environment_names: If specified, AWS Elastic Beanstalk restricts the returned descriptions to include only those that have the specified names. :type include_deleted: boolean :param include_deleted: Indicates whether to include deleted environments: true: Environments that have been deleted after IncludedDeletedBackTo are displayed. false: Do not include deleted environments. :type included_deleted_back_to: timestamp :param included_deleted_back_to: If specified when IncludeDeleted is set to true, then environments deleted after this date are displayed. """ params = {} if application_name: params['ApplicationName'] = application_name if version_label: params['VersionLabel'] = version_label if environment_ids: self.build_list_params(params, environment_ids, 'EnvironmentIds.member') if environment_names: self.build_list_params(params, environment_names, 'EnvironmentNames.member') if include_deleted: params['IncludeDeleted'] = self._encode_bool(include_deleted) if included_deleted_back_to: params['IncludedDeletedBackTo'] = included_deleted_back_to return self._get_response('DescribeEnvironments', params) def describe_events(self, application_name=None, version_label=None, template_name=None, environment_id=None, environment_name=None, request_id=None, severity=None, start_time=None, end_time=None, max_records=None, next_token=None): """Returns event descriptions matching criteria up to the last 6 weeks. :type application_name: string :param application_name: If specified, AWS Elastic Beanstalk restricts the returned descriptions to include only those associated with this application. :type version_label: string :param version_label: If specified, AWS Elastic Beanstalk restricts the returned descriptions to those associated with this application version. :type template_name: string :param template_name: If specified, AWS Elastic Beanstalk restricts the returned descriptions to those that are associated with this environment configuration. :type environment_id: string :param environment_id: If specified, AWS Elastic Beanstalk restricts the returned descriptions to those associated with this environment. :type environment_name: string :param environment_name: If specified, AWS Elastic Beanstalk restricts the returned descriptions to those associated with this environment. :type request_id: string :param request_id: If specified, AWS Elastic Beanstalk restricts the described events to include only those associated with this request ID. :type severity: string :param severity: If specified, limits the events returned from this call to include only those with the specified severity or higher. :type start_time: timestamp :param start_time: If specified, AWS Elastic Beanstalk restricts the returned descriptions to those that occur on or after this time. :type end_time: timestamp :param end_time: If specified, AWS Elastic Beanstalk restricts the returned descriptions to those that occur up to, but not including, the EndTime. :type max_records: integer :param max_records: Specifies the maximum number of events that can be returned, beginning with the most recent event. :type next_token: string :param next_token: Pagination token. If specified, the events return the next batch of results. """ params = {} if application_name: params['ApplicationName'] = application_name if version_label: params['VersionLabel'] = version_label if template_name: params['TemplateName'] = template_name if environment_id: params['EnvironmentId'] = environment_id if environment_name: params['EnvironmentName'] = environment_name if request_id: params['RequestId'] = request_id if severity: params['Severity'] = severity if start_time: params['StartTime'] = start_time if end_time: params['EndTime'] = end_time if max_records: params['MaxRecords'] = max_records if next_token: params['NextToken'] = next_token return self._get_response('DescribeEvents', params) def list_available_solution_stacks(self): """Returns a list of the available solution stack names.""" return self._get_response('ListAvailableSolutionStacks', params={}) def rebuild_environment(self, environment_id=None, environment_name=None): """ Deletes and recreates all of the AWS resources (for example: the Auto Scaling group, load balancer, etc.) for a specified environment and forces a restart. :type environment_id: string :param environment_id: The ID of the environment to rebuild. Condition: You must specify either this or an EnvironmentName, or both. If you do not specify either, AWS Elastic Beanstalk returns MissingRequiredParameter error. :type environment_name: string :param environment_name: The name of the environment to rebuild. Condition: You must specify either this or an EnvironmentId, or both. If you do not specify either, AWS Elastic Beanstalk returns MissingRequiredParameter error. :raises: InsufficientPrivilegesException """ params = {} if environment_id: params['EnvironmentId'] = environment_id if environment_name: params['EnvironmentName'] = environment_name return self._get_response('RebuildEnvironment', params) def request_environment_info(self, info_type='tail', environment_id=None, environment_name=None): """ Initiates a request to compile the specified type of information of the deployed environment. Setting the InfoType to tail compiles the last lines from the application server log files of every Amazon EC2 instance in your environment. Use RetrieveEnvironmentInfo to access the compiled information. :type info_type: string :param info_type: The type of information to request. :type environment_id: string :param environment_id: The ID of the environment of the requested data. If no such environment is found, RequestEnvironmentInfo returns an InvalidParameterValue error. Condition: You must specify either this or an EnvironmentName, or both. If you do not specify either, AWS Elastic Beanstalk returns MissingRequiredParameter error. :type environment_name: string :param environment_name: The name of the environment of the requested data. If no such environment is found, RequestEnvironmentInfo returns an InvalidParameterValue error. Condition: You must specify either this or an EnvironmentId, or both. If you do not specify either, AWS Elastic Beanstalk returns MissingRequiredParameter error. """ params = {'InfoType': info_type} if environment_id: params['EnvironmentId'] = environment_id if environment_name: params['EnvironmentName'] = environment_name return self._get_response('RequestEnvironmentInfo', params) def restart_app_server(self, environment_id=None, environment_name=None): """ Causes the environment to restart the application container server running on each Amazon EC2 instance. :type environment_id: string :param environment_id: The ID of the environment to restart the server for. Condition: You must specify either this or an EnvironmentName, or both. If you do not specify either, AWS Elastic Beanstalk returns MissingRequiredParameter error. :type environment_name: string :param environment_name: The name of the environment to restart the server for. Condition: You must specify either this or an EnvironmentId, or both. If you do not specify either, AWS Elastic Beanstalk returns MissingRequiredParameter error. """ params = {} if environment_id: params['EnvironmentId'] = environment_id if environment_name: params['EnvironmentName'] = environment_name return self._get_response('RestartAppServer', params) def retrieve_environment_info(self, info_type='tail', environment_id=None, environment_name=None): """ Retrieves the compiled information from a RequestEnvironmentInfo request. :type info_type: string :param info_type: The type of information to retrieve. :type environment_id: string :param environment_id: The ID of the data's environment. If no such environment is found, returns an InvalidParameterValue error. Condition: You must specify either this or an EnvironmentName, or both. If you do not specify either, AWS Elastic Beanstalk returns MissingRequiredParameter error. :type environment_name: string :param environment_name: The name of the data's environment. If no such environment is found, returns an InvalidParameterValue error. Condition: You must specify either this or an EnvironmentId, or both. If you do not specify either, AWS Elastic Beanstalk returns MissingRequiredParameter error. """ params = {'InfoType': info_type} if environment_id: params['EnvironmentId'] = environment_id if environment_name: params['EnvironmentName'] = environment_name return self._get_response('RetrieveEnvironmentInfo', params) def swap_environment_cnames(self, source_environment_id=None, source_environment_name=None, destination_environment_id=None, destination_environment_name=None): """Swaps the CNAMEs of two environments. :type source_environment_id: string :param source_environment_id: The ID of the source environment. Condition: You must specify at least the SourceEnvironmentID or the SourceEnvironmentName. You may also specify both. If you specify the SourceEnvironmentId, you must specify the DestinationEnvironmentId. :type source_environment_name: string :param source_environment_name: The name of the source environment. Condition: You must specify at least the SourceEnvironmentID or the SourceEnvironmentName. You may also specify both. If you specify the SourceEnvironmentName, you must specify the DestinationEnvironmentName. :type destination_environment_id: string :param destination_environment_id: The ID of the destination environment. Condition: You must specify at least the DestinationEnvironmentID or the DestinationEnvironmentName. You may also specify both. You must specify the SourceEnvironmentId with the DestinationEnvironmentId. :type destination_environment_name: string :param destination_environment_name: The name of the destination environment. Condition: You must specify at least the DestinationEnvironmentID or the DestinationEnvironmentName. You may also specify both. You must specify the SourceEnvironmentName with the DestinationEnvironmentName. """ params = {} if source_environment_id: params['SourceEnvironmentId'] = source_environment_id if source_environment_name: params['SourceEnvironmentName'] = source_environment_name if destination_environment_id: params['DestinationEnvironmentId'] = destination_environment_id if destination_environment_name: params['DestinationEnvironmentName'] = destination_environment_name return self._get_response('SwapEnvironmentCNAMEs', params) def terminate_environment(self, environment_id=None, environment_name=None, terminate_resources=None): """Terminates the specified environment. :type environment_id: string :param environment_id: The ID of the environment to terminate. Condition: You must specify either this or an EnvironmentName, or both. If you do not specify either, AWS Elastic Beanstalk returns MissingRequiredParameter error. :type environment_name: string :param environment_name: The name of the environment to terminate. Condition: You must specify either this or an EnvironmentId, or both. If you do not specify either, AWS Elastic Beanstalk returns MissingRequiredParameter error. :type terminate_resources: boolean :param terminate_resources: Indicates whether the associated AWS resources should shut down when the environment is terminated: true: (default) The user AWS resources (for example, the Auto Scaling group, LoadBalancer, etc.) are terminated along with the environment. false: The environment is removed from the AWS Elastic Beanstalk but the AWS resources continue to operate. For more information, see the AWS Elastic Beanstalk User Guide. Default: true Valid Values: true | false :raises: InsufficientPrivilegesException """ params = {} if environment_id: params['EnvironmentId'] = environment_id if environment_name: params['EnvironmentName'] = environment_name if terminate_resources: params['TerminateResources'] = self._encode_bool( terminate_resources) return self._get_response('TerminateEnvironment', params) def update_application(self, application_name, description=None): """ Updates the specified application to have the specified properties. :type application_name: string :param application_name: The name of the application to update. If no such application is found, UpdateApplication returns an InvalidParameterValue error. :type description: string :param description: A new description for the application. Default: If not specified, AWS Elastic Beanstalk does not update the description. """ params = {'ApplicationName': application_name} if description: params['Description'] = description return self._get_response('UpdateApplication', params) def update_application_version(self, application_name, version_label, description=None): """Updates the application version to have the properties. :type application_name: string :param application_name: The name of the application associated with this version. If no application is found with this name, UpdateApplication returns an InvalidParameterValue error. :type version_label: string :param version_label: The name of the version to update. If no application version is found with this label, UpdateApplication returns an InvalidParameterValue error. :type description: string :param description: A new description for this release. """ params = {'ApplicationName': application_name, 'VersionLabel': version_label} if description: params['Description'] = description return self._get_response('UpdateApplicationVersion', params) def update_configuration_template(self, application_name, template_name, description=None, option_settings=None, options_to_remove=None): """ Updates the specified configuration template to have the specified properties or configuration option values. :type application_name: string :param application_name: The name of the application associated with the configuration template to update. If no application is found with this name, UpdateConfigurationTemplate returns an InvalidParameterValue error. :type template_name: string :param template_name: The name of the configuration template to update. If no configuration template is found with this name, UpdateConfigurationTemplate returns an InvalidParameterValue error. :type description: string :param description: A new description for the configuration. :type option_settings: list :param option_settings: A list of configuration option settings to update with the new specified option value. :type options_to_remove: list :param options_to_remove: A list of configuration options to remove from the configuration set. Constraint: You can remove only UserDefined configuration options. :raises: InsufficientPrivilegesException """ params = {'ApplicationName': application_name, 'TemplateName': template_name} if description: params['Description'] = description if option_settings: self._build_list_params(params, option_settings, 'OptionSettings.member', ('Namespace', 'OptionName', 'Value')) if options_to_remove: self.build_list_params(params, options_to_remove, 'OptionsToRemove.member') return self._get_response('UpdateConfigurationTemplate', params) def update_environment(self, environment_id=None, environment_name=None, version_label=None, template_name=None, description=None, option_settings=None, options_to_remove=None, tier_name=None, tier_type=None, tier_version='1.0'): """ Updates the environment description, deploys a new application version, updates the configuration settings to an entirely new configuration template, or updates select configuration option values in the running environment. Attempting to update both the release and configuration is not allowed and AWS Elastic Beanstalk returns an InvalidParameterCombination error. When updating the configuration settings to a new template or individual settings, a draft configuration is created and DescribeConfigurationSettings for this environment returns two setting descriptions with different DeploymentStatus values. :type environment_id: string :param environment_id: The ID of the environment to update. If no environment with this ID exists, AWS Elastic Beanstalk returns an InvalidParameterValue error. Condition: You must specify either this or an EnvironmentName, or both. If you do not specify either, AWS Elastic Beanstalk returns MissingRequiredParameter error. :type environment_name: string :param environment_name: The name of the environment to update. If no environment with this name exists, AWS Elastic Beanstalk returns an InvalidParameterValue error. Condition: You must specify either this or an EnvironmentId, or both. If you do not specify either, AWS Elastic Beanstalk returns MissingRequiredParameter error. :type version_label: string :param version_label: If this parameter is specified, AWS Elastic Beanstalk deploys the named application version to the environment. If no such application version is found, returns an InvalidParameterValue error. :type template_name: string :param template_name: If this parameter is specified, AWS Elastic Beanstalk deploys this configuration template to the environment. If no such configuration template is found, AWS Elastic Beanstalk returns an InvalidParameterValue error. :type description: string :param description: If this parameter is specified, AWS Elastic Beanstalk updates the description of this environment. :type option_settings: list :param option_settings: If specified, AWS Elastic Beanstalk updates the configuration set associated with the running environment and sets the specified configuration options to the requested value. :type options_to_remove: list :param options_to_remove: A list of custom user-defined configuration options to remove from the configuration set for this environment. :type tier_name: string :param tier_name: The name of the tier. Valid values are "WebServer" and "Worker". Defaults to "WebServer". The ``tier_name`` and a ``tier_type`` parameters are related and the values provided must be valid. The possible combinations are: * "WebServer" and "Standard" (the default) * "Worker" and "SQS/HTTP" :type tier_type: string :param tier_type: The type of the tier. Valid values are "Standard" if ``tier_name`` is "WebServer" and "SQS/HTTP" if ``tier_name`` is "Worker". Defaults to "Standard". :type tier_version: string :type tier_version: The version of the tier. Valid values currently are "1.0". Defaults to "1.0". :raises: InsufficientPrivilegesException """ params = {} if environment_id: params['EnvironmentId'] = environment_id if environment_name: params['EnvironmentName'] = environment_name if version_label: params['VersionLabel'] = version_label if template_name: params['TemplateName'] = template_name if description: params['Description'] = description if option_settings: self._build_list_params(params, option_settings, 'OptionSettings.member', ('Namespace', 'OptionName', 'Value')) if options_to_remove: self.build_list_params(params, options_to_remove, 'OptionsToRemove.member') if tier_name and tier_type and tier_version: params['Tier.member.Name'] = tier_name params['Tier.member.Type'] = tier_type params['Tier.member.Version'] = tier_version return self._get_response('UpdateEnvironment', params) def validate_configuration_settings(self, application_name, option_settings, template_name=None, environment_name=None): """ Takes a set of configuration settings and either a configuration template or environment, and determines whether those values are valid. This action returns a list of messages indicating any errors or warnings associated with the selection of option values. :type application_name: string :param application_name: The name of the application that the configuration template or environment belongs to. :type template_name: string :param template_name: The name of the configuration template to validate the settings against. Condition: You cannot specify both this and an environment name. :type environment_name: string :param environment_name: The name of the environment to validate the settings against. Condition: You cannot specify both this and a configuration template name. :type option_settings: list :param option_settings: A list of the options and desired values to evaluate. :raises: InsufficientPrivilegesException """ params = {'ApplicationName': application_name} self._build_list_params(params, option_settings, 'OptionSettings.member', ('Namespace', 'OptionName', 'Value')) if template_name: params['TemplateName'] = template_name if environment_name: params['EnvironmentName'] = environment_name return self._get_response('ValidateConfigurationSettings', params) def _build_list_params(self, params, user_values, prefix, tuple_names): # For params such as the ConfigurationOptionSettings, # they can specify a list of tuples where each tuple maps to a specific # arg. For example: # user_values = [('foo', 'bar', 'baz'] # prefix=MyOption.member # tuple_names=('One', 'Two', 'Three') # would result in: # MyOption.member.1.One = foo # MyOption.member.1.Two = bar # MyOption.member.1.Three = baz for i, user_value in enumerate(user_values, 1): current_prefix = '%s.%s' % (prefix, i) for key, value in zip(tuple_names, user_value): full_key = '%s.%s' % (current_prefix, key) params[full_key] = value
46.787854
97
0.655577
import boto import boto.jsonresponse from boto.compat import json from boto.regioninfo import RegionInfo from boto.connection import AWSQueryConnection class Layer1(AWSQueryConnection): APIVersion = '2010-12-01' DefaultRegionName = 'us-east-1' DefaultRegionEndpoint = 'elasticbeanstalk.us-east-1.amazonaws.com' def __init__(self, aws_access_key_id=None, aws_secret_access_key=None, is_secure=True, port=None, proxy=None, proxy_port=None, proxy_user=None, proxy_pass=None, debug=0, https_connection_factory=None, region=None, path='/', api_version=None, security_token=None): if not region: region = RegionInfo(self, self.DefaultRegionName, self.DefaultRegionEndpoint) self.region = region super(Layer1, self).__init__(aws_access_key_id, aws_secret_access_key, is_secure, port, proxy, proxy_port, proxy_user, proxy_pass, self.region.endpoint, debug, https_connection_factory, path, security_token) def _required_auth_capability(self): return ['hmac-v4'] def _encode_bool(self, v): v = bool(v) return {True: "true", False: "false"}[v] def _get_response(self, action, params, path='/', verb='GET'): params['ContentType'] = 'JSON' response = self.make_request(action, params, path, verb) body = response.read() boto.log.debug(body) if response.status == 200: return json.loads(body) else: raise self.ResponseError(response.status, response.reason, body) def check_dns_availability(self, cname_prefix): params = {'CNAMEPrefix': cname_prefix} return self._get_response('CheckDNSAvailability', params) def create_application(self, application_name, description=None): params = {'ApplicationName': application_name} if description: params['Description'] = description return self._get_response('CreateApplication', params) def create_application_version(self, application_name, version_label, description=None, s3_bucket=None, s3_key=None, auto_create_application=None): params = {'ApplicationName': application_name, 'VersionLabel': version_label} if description: params['Description'] = description if s3_bucket and s3_key: params['SourceBundle.S3Bucket'] = s3_bucket params['SourceBundle.S3Key'] = s3_key if auto_create_application: params['AutoCreateApplication'] = self._encode_bool( auto_create_application) return self._get_response('CreateApplicationVersion', params) def create_configuration_template(self, application_name, template_name, solution_stack_name=None, source_configuration_application_name=None, source_configuration_template_name=None, environment_id=None, description=None, option_settings=None): params = {'ApplicationName': application_name, 'TemplateName': template_name} if solution_stack_name: params['SolutionStackName'] = solution_stack_name if source_configuration_application_name: params['SourceConfiguration.ApplicationName'] = source_configuration_application_name if source_configuration_template_name: params['SourceConfiguration.TemplateName'] = source_configuration_template_name if environment_id: params['EnvironmentId'] = environment_id if description: params['Description'] = description if option_settings: self._build_list_params(params, option_settings, 'OptionSettings.member', ('Namespace', 'OptionName', 'Value')) return self._get_response('CreateConfigurationTemplate', params) def create_environment(self, application_name, environment_name, version_label=None, template_name=None, solution_stack_name=None, cname_prefix=None, description=None, option_settings=None, options_to_remove=None, tier_name=None, tier_type=None, tier_version='1.0'): params = {'ApplicationName': application_name, 'EnvironmentName': environment_name} if version_label: params['VersionLabel'] = version_label if template_name: params['TemplateName'] = template_name if solution_stack_name: params['SolutionStackName'] = solution_stack_name if cname_prefix: params['CNAMEPrefix'] = cname_prefix if description: params['Description'] = description if option_settings: self._build_list_params(params, option_settings, 'OptionSettings.member', ('Namespace', 'OptionName', 'Value')) if options_to_remove: self.build_list_params(params, options_to_remove, 'OptionsToRemove.member') if tier_name and tier_type and tier_version: params['Tier.member.Name'] = tier_name params['Tier.member.Type'] = tier_type params['Tier.member.Version'] = tier_version return self._get_response('CreateEnvironment', params) def create_storage_location(self): return self._get_response('CreateStorageLocation', params={}) def delete_application(self, application_name, terminate_env_by_force=None): params = {'ApplicationName': application_name} if terminate_env_by_force: params['TerminateEnvByForce'] = self._encode_bool( terminate_env_by_force) return self._get_response('DeleteApplication', params) def delete_application_version(self, application_name, version_label, delete_source_bundle=None): params = {'ApplicationName': application_name, 'VersionLabel': version_label} if delete_source_bundle: params['DeleteSourceBundle'] = self._encode_bool( delete_source_bundle) return self._get_response('DeleteApplicationVersion', params) def delete_configuration_template(self, application_name, template_name): params = {'ApplicationName': application_name, 'TemplateName': template_name} return self._get_response('DeleteConfigurationTemplate', params) def delete_environment_configuration(self, application_name, environment_name): params = {'ApplicationName': application_name, 'EnvironmentName': environment_name} return self._get_response('DeleteEnvironmentConfiguration', params) def describe_application_versions(self, application_name=None, version_labels=None): params = {} if application_name: params['ApplicationName'] = application_name if version_labels: self.build_list_params(params, version_labels, 'VersionLabels.member') return self._get_response('DescribeApplicationVersions', params) def describe_applications(self, application_names=None): params = {} if application_names: self.build_list_params(params, application_names, 'ApplicationNames.member') return self._get_response('DescribeApplications', params) def describe_configuration_options(self, application_name=None, template_name=None, environment_name=None, solution_stack_name=None, options=None): params = {} if application_name: params['ApplicationName'] = application_name if template_name: params['TemplateName'] = template_name if environment_name: params['EnvironmentName'] = environment_name if solution_stack_name: params['SolutionStackName'] = solution_stack_name if options: self.build_list_params(params, options, 'Options.member') return self._get_response('DescribeConfigurationOptions', params) def describe_configuration_settings(self, application_name, template_name=None, environment_name=None): params = {'ApplicationName': application_name} if template_name: params['TemplateName'] = template_name if environment_name: params['EnvironmentName'] = environment_name return self._get_response('DescribeConfigurationSettings', params) def describe_environment_resources(self, environment_id=None, environment_name=None): params = {} if environment_id: params['EnvironmentId'] = environment_id if environment_name: params['EnvironmentName'] = environment_name return self._get_response('DescribeEnvironmentResources', params) def describe_environments(self, application_name=None, version_label=None, environment_ids=None, environment_names=None, include_deleted=None, included_deleted_back_to=None): params = {} if application_name: params['ApplicationName'] = application_name if version_label: params['VersionLabel'] = version_label if environment_ids: self.build_list_params(params, environment_ids, 'EnvironmentIds.member') if environment_names: self.build_list_params(params, environment_names, 'EnvironmentNames.member') if include_deleted: params['IncludeDeleted'] = self._encode_bool(include_deleted) if included_deleted_back_to: params['IncludedDeletedBackTo'] = included_deleted_back_to return self._get_response('DescribeEnvironments', params) def describe_events(self, application_name=None, version_label=None, template_name=None, environment_id=None, environment_name=None, request_id=None, severity=None, start_time=None, end_time=None, max_records=None, next_token=None): params = {} if application_name: params['ApplicationName'] = application_name if version_label: params['VersionLabel'] = version_label if template_name: params['TemplateName'] = template_name if environment_id: params['EnvironmentId'] = environment_id if environment_name: params['EnvironmentName'] = environment_name if request_id: params['RequestId'] = request_id if severity: params['Severity'] = severity if start_time: params['StartTime'] = start_time if end_time: params['EndTime'] = end_time if max_records: params['MaxRecords'] = max_records if next_token: params['NextToken'] = next_token return self._get_response('DescribeEvents', params) def list_available_solution_stacks(self): return self._get_response('ListAvailableSolutionStacks', params={}) def rebuild_environment(self, environment_id=None, environment_name=None): params = {} if environment_id: params['EnvironmentId'] = environment_id if environment_name: params['EnvironmentName'] = environment_name return self._get_response('RebuildEnvironment', params) def request_environment_info(self, info_type='tail', environment_id=None, environment_name=None): params = {'InfoType': info_type} if environment_id: params['EnvironmentId'] = environment_id if environment_name: params['EnvironmentName'] = environment_name return self._get_response('RequestEnvironmentInfo', params) def restart_app_server(self, environment_id=None, environment_name=None): params = {} if environment_id: params['EnvironmentId'] = environment_id if environment_name: params['EnvironmentName'] = environment_name return self._get_response('RestartAppServer', params) def retrieve_environment_info(self, info_type='tail', environment_id=None, environment_name=None): params = {'InfoType': info_type} if environment_id: params['EnvironmentId'] = environment_id if environment_name: params['EnvironmentName'] = environment_name return self._get_response('RetrieveEnvironmentInfo', params) def swap_environment_cnames(self, source_environment_id=None, source_environment_name=None, destination_environment_id=None, destination_environment_name=None): params = {} if source_environment_id: params['SourceEnvironmentId'] = source_environment_id if source_environment_name: params['SourceEnvironmentName'] = source_environment_name if destination_environment_id: params['DestinationEnvironmentId'] = destination_environment_id if destination_environment_name: params['DestinationEnvironmentName'] = destination_environment_name return self._get_response('SwapEnvironmentCNAMEs', params) def terminate_environment(self, environment_id=None, environment_name=None, terminate_resources=None): params = {} if environment_id: params['EnvironmentId'] = environment_id if environment_name: params['EnvironmentName'] = environment_name if terminate_resources: params['TerminateResources'] = self._encode_bool( terminate_resources) return self._get_response('TerminateEnvironment', params) def update_application(self, application_name, description=None): params = {'ApplicationName': application_name} if description: params['Description'] = description return self._get_response('UpdateApplication', params) def update_application_version(self, application_name, version_label, description=None): params = {'ApplicationName': application_name, 'VersionLabel': version_label} if description: params['Description'] = description return self._get_response('UpdateApplicationVersion', params) def update_configuration_template(self, application_name, template_name, description=None, option_settings=None, options_to_remove=None): params = {'ApplicationName': application_name, 'TemplateName': template_name} if description: params['Description'] = description if option_settings: self._build_list_params(params, option_settings, 'OptionSettings.member', ('Namespace', 'OptionName', 'Value')) if options_to_remove: self.build_list_params(params, options_to_remove, 'OptionsToRemove.member') return self._get_response('UpdateConfigurationTemplate', params) def update_environment(self, environment_id=None, environment_name=None, version_label=None, template_name=None, description=None, option_settings=None, options_to_remove=None, tier_name=None, tier_type=None, tier_version='1.0'): params = {} if environment_id: params['EnvironmentId'] = environment_id if environment_name: params['EnvironmentName'] = environment_name if version_label: params['VersionLabel'] = version_label if template_name: params['TemplateName'] = template_name if description: params['Description'] = description if option_settings: self._build_list_params(params, option_settings, 'OptionSettings.member', ('Namespace', 'OptionName', 'Value')) if options_to_remove: self.build_list_params(params, options_to_remove, 'OptionsToRemove.member') if tier_name and tier_type and tier_version: params['Tier.member.Name'] = tier_name params['Tier.member.Type'] = tier_type params['Tier.member.Version'] = tier_version return self._get_response('UpdateEnvironment', params) def validate_configuration_settings(self, application_name, option_settings, template_name=None, environment_name=None): params = {'ApplicationName': application_name} self._build_list_params(params, option_settings, 'OptionSettings.member', ('Namespace', 'OptionName', 'Value')) if template_name: params['TemplateName'] = template_name if environment_name: params['EnvironmentName'] = environment_name return self._get_response('ValidateConfigurationSettings', params) def _build_list_params(self, params, user_values, prefix, tuple_names): for i, user_value in enumerate(user_values, 1): current_prefix = '%s.%s' % (prefix, i) for key, value in zip(tuple_names, user_value): full_key = '%s.%s' % (current_prefix, key) params[full_key] = value
true
true
f70a6be4011c55e74593391945721361e11f0255
814
py
Python
concurrency-overview/io_mp.py
syberflea/materials
54f44725b40edf00c1b523d7a85b34a85014d7eb
[ "MIT" ]
3,682
2018-05-07T19:45:24.000Z
2022-03-31T15:19:10.000Z
concurrency-overview/io_mp.py
sribarrow/materials
c17c4a4d6f8487e59eac1df8c88ca92b73d6d2a5
[ "MIT" ]
148
2018-05-15T21:18:49.000Z
2022-03-21T11:25:39.000Z
concurrency-overview/io_mp.py
sribarrow/materials
c17c4a4d6f8487e59eac1df8c88ca92b73d6d2a5
[ "MIT" ]
5,535
2018-05-25T23:36:08.000Z
2022-03-31T16:55:52.000Z
#!/usr/bin/env python3 import requests import multiprocessing import time session = None def set_global_session(): global session if not session: session = requests.Session() def download_site(url): with session.get(url) as response: name = multiprocessing.current_process().name print(f"{name}:Read {len(response.content)} from {url}") def download_all_sites(sites): with multiprocessing.Pool(initializer=set_global_session) as pool: pool.map(download_site, sites) if __name__ == "__main__": sites = [ "https://www.jython.org", "http://olympus.realpython.org/dice", ] * 80 start_time = time.time() download_all_sites(sites) duration = time.time() - start_time print(f"Downloaded {len(sites)} in {duration} seconds")
23.257143
70
0.675676
import requests import multiprocessing import time session = None def set_global_session(): global session if not session: session = requests.Session() def download_site(url): with session.get(url) as response: name = multiprocessing.current_process().name print(f"{name}:Read {len(response.content)} from {url}") def download_all_sites(sites): with multiprocessing.Pool(initializer=set_global_session) as pool: pool.map(download_site, sites) if __name__ == "__main__": sites = [ "https://www.jython.org", "http://olympus.realpython.org/dice", ] * 80 start_time = time.time() download_all_sites(sites) duration = time.time() - start_time print(f"Downloaded {len(sites)} in {duration} seconds")
true
true
f70a6c957ea73f9a7a4e7f4df245a126a32c588e
22,064
py
Python
tests/test_filters.py
ticketmaster/cloud-custodian
0da3866f70f858895af228cc08706d0909a2a324
[ "Apache-2.0" ]
null
null
null
tests/test_filters.py
ticketmaster/cloud-custodian
0da3866f70f858895af228cc08706d0909a2a324
[ "Apache-2.0" ]
4
2017-02-02T17:08:23.000Z
2017-05-25T19:33:19.000Z
tests/test_filters.py
ticketmaster/cloud-custodian
0da3866f70f858895af228cc08706d0909a2a324
[ "Apache-2.0" ]
null
null
null
# Copyright 2016 Capital One Services, LLC # # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. from __future__ import absolute_import, division, print_function, unicode_literals from dateutil import tz from datetime import datetime, timedelta import unittest from c7n import filters as base_filters from c7n.resources.ec2 import filters from c7n.utils import annotation from .common import instance, event_data, Bag class BaseFilterTest(unittest.TestCase): def assertFilter(self, f, i, v): """ f: filter data/spec i: instance v: expected value (true/false) """ try: self.assertEqual(filters.factory(f)(i), v) except AssertionError: print(f, i['LaunchTime'], i['Tags'], v) raise class TestFilter(unittest.TestCase): def test_filter_construction(self): self.assertTrue( isinstance( filters.factory({'tag:ASV': 'absent'}), base_filters.ValueFilter)) def test_filter_validation(self): self.assertRaises( base_filters.FilterValidationError, filters.factory, {'type': 'ax', 'xyz': 1}) def test_filter_call(self): filter_instance = base_filters.Filter({}) self.assertIsInstance(filter_instance, base_filters.Filter) class TestOrFilter(unittest.TestCase): def test_or(self): f = filters.factory({ 'or': [ {'Architecture': 'x86_64'}, {'Architecture': 'armv8'}]}) results = [instance(Architecture='x86_64')] self.assertEqual( f.process(results), results) self.assertEqual( f.process([instance(Architecture='amd64')]), []) class TestAndFilter(unittest.TestCase): def test_and(self): f = filters.factory({ 'and': [ {'Architecture': 'x86_64'}, {'Color': 'green'}]}) results = [instance(Architecture='x86_64', Color='green')] self.assertEqual( f.process(results), results) self.assertEqual( f.process([ instance( Architecture='x86_64', Color='blue')]), []) self.assertEqual( f.process([ instance( Architecture='x86_64')]), []) class TestNotFilter(unittest.TestCase): def test_not(self): results = [ instance(Architecture='x86_64', Color='green'), instance(Architecture='x86_64', Color='blue'), instance(Architecture='x86_64', Color='yellow'), ] f = filters.factory({ 'not': [ {'Architecture': 'x86_64'}, {'Color': 'green'}]}) self.assertEqual(len(f.process(results)), 2) """ f = filters.factory({ 'not': [ {'Architecture': 'x86'}]}) self.assertEqual(len(f.process(results)), 3) f = filters.factory({ 'not': [ {'Architecture': 'x86_64'}, {'or': [ {'Color': 'green'}, {'Color': 'blue'}, {'Color': 'yellow'}, ]}]}) self.assertEqual(len(f.process(results)), 0) """ class TestValueFilter(unittest.TestCase): # TODO test_manager needs a valid session_factory object # def test_value_match(self): # test_manager = ??? # f_data = { # 'type': 'value', # 'key': 'day', # 'value': 5, # 'value_from': { # 'url': 's3://custodian-byebye/resource.json', # }, # } # vf = filters.factory(f_data, test_manager) # vf.match({'tag:ASV': 'present'}) def test_value_type(self): sentinel = datetime.now() value = 5 resource = {'a': 1, 'Tags': [{'Key': 'xtra', 'Value': 'hello'}]} vf = filters.factory({'tag:ASV': 'absent'}) vf.vtype = 'size' res = vf.process_value_type(sentinel, value, resource) self.assertEqual(res, (sentinel, 0)) vf.vtype = 'age' res = vf.process_value_type(sentinel, value, resource) self.assertEqual(res, (0, sentinel)) vf.vtype = 'cidr' sentinel = '10.0.0.0/16' value = '10.10.10.10' res = vf.process_value_type(sentinel, value, resource) self.assertEqual( (str(res[0]), str(res[1])), (sentinel, value), ) vf.vtype = 'cidr_size' value = '10.10.10.300' res = vf.process_value_type(sentinel, value, resource) self.assertEqual(res, (sentinel, 0)) vf.vtype = 'expr' value = 'tag:xtra' sentinel = None res = vf.process_value_type(sentinel, value, resource) self.assertEqual(res, (None, 'hello')) vf.vtype = 'expr' value = 'a' sentinel = None res = vf.process_value_type(sentinel, value, resource) self.assertEqual(res, (None, 1)) class TestAgeFilter(unittest.TestCase): def test_age_filter(self): af = base_filters.AgeFilter({}) self.assertRaises(NotImplementedError, af.validate) class TestGlobValue(unittest.TestCase): def test_regex_match(self): f = filters.factory( {'type': 'value', 'key': 'Color', 'value': '*green*', 'op': 'glob'}) self.assertEqual( f(instance( Architecture='x86_64', Color='mighty green papaya')), True) self.assertEqual( f(instance( Architecture='x86_64', Color='blue')), False) def test_glob_match(self): glob_match = base_filters.core.glob_match self.assertFalse(glob_match(0, '')) class TestRegexValue(unittest.TestCase): def test_regex_validate(self): self.assertRaises( base_filters.FilterValidationError, filters.factory({ 'type': 'value', 'key': 'Color', 'value': '*green', 'op': 'regex'}).validate) def test_regex_match(self): f = filters.factory( {'type': 'value', 'key': 'Color', 'value': '.*green.*', 'op': 'regex'}) self.assertEqual( f(instance( Architecture='x86_64', Color='green papaya')), True) self.assertEqual( f(instance( Architecture='x86_64', Color='blue')), False) self.assertEqual( f(instance( Architecture='x86_64')), False) class TestValueTypes(BaseFilterTest): def test_normalize(self): fdata = { 'type': 'value', 'key': 'tag:Name', 'value_type': 'normalize', 'value': 'compilelambda' } self.assertFilter(fdata, instance(), True) def test_size(self): fdata = { 'type': 'value', 'key': 'SecurityGroups[].GroupId', 'value_type': 'size', 'value': 2 } self.assertFilter(fdata, instance(), True) def test_integer(self): fdata = { 'type': 'value', 'key': 'tag:Count', 'op': 'greater-than', 'value_type': 'integer', 'value': 0} def i(d): return instance(Tags=[{"Key": "Count", "Value": d}]) self.assertFilter(fdata, i('42'), True) self.assertFilter(fdata, i('abc'), False) fdata['op'] = 'equal' self.assertFilter(fdata, i('abc'), True) def test_swap(self): fdata = { 'type': 'value', 'key': 'SecurityGroups[].GroupId', 'value_type': 'swap', 'op': 'in', 'value': 'sg-47b76f22' } self.assertFilter(fdata, instance(), True) def test_age(self): now = datetime.now(tz=tz.tzutc()) three_months = now - timedelta(90) two_months = now - timedelta(60) one_month = now - timedelta(30) def i(d): return instance(LaunchTime=d) fdata = { 'type': 'value', 'key': 'LaunchTime', 'op': 'less-than', 'value_type': 'age', 'value': 32} self.assertFilter(fdata, i(three_months), False) self.assertFilter(fdata, i(two_months), False) self.assertFilter(fdata, i(one_month), True) self.assertFilter(fdata, i(now), True) self.assertFilter(fdata, i(now.isoformat()), True) def test_expiration(self): now = datetime.now(tz=tz.tzutc()) three_months = now + timedelta(90) two_months = now + timedelta(60) def i(d): return instance(LaunchTime=d) fdata = { 'type': 'value', 'key': 'LaunchTime', 'op': 'less-than', 'value_type': 'expiration', 'value': 61} self.assertFilter(fdata, i(three_months), False) self.assertFilter(fdata, i(two_months), True) self.assertFilter(fdata, i(now), True) self.assertFilter(fdata, i(now.isoformat()), True) def test_resource_count_filter(self): fdata = { 'type': 'value', 'value_type': 'resource_count', 'op': 'lt', 'value': 2 } self.assertFilter(fdata, instance(file='ec2-instances.json'), []) f = filters.factory({ 'type': 'value', 'value_type': 'resource_count', 'op': 'eq', 'value': 2 }) i = instance(file='ec2-instances.json') self.assertEqual(i, f(i)) def test_resource_count_filter_validation(self): # Bad `op` f = { 'type': 'value', 'value_type': 'resource_count', 'op': 'regex', 'value': 1, } self.assertRaises( base_filters.FilterValidationError, filters.factory(f, {}).validate) # Bad `value` f = { 'type': 'value', 'value_type': 'resource_count', 'op': 'eq', 'value': 'foo', } self.assertRaises( base_filters.FilterValidationError, filters.factory(f, {}).validate) # Missing `op` f = { 'type': 'value', 'value_type': 'resource_count', 'value': 1, } self.assertRaises( base_filters.FilterValidationError, filters.factory(f, {}).validate) class TestInstanceAge(BaseFilterTest): def test_filter_instance_age(self): now = datetime.now(tz=tz.tzutc()) three_months = now - timedelta(90) two_months = now - timedelta(60) one_month = now - timedelta(30) def i(d): return instance(LaunchTime=d) for ii, v in [ (i(now), False), (i(three_months), True), (i(two_months), True), (i(one_month), False) ]: self.assertFilter({'type': 'instance-uptime', 'op': 'gte', 'days': 60}, ii, v) class TestInstanceAgeMinute(BaseFilterTest): def test_filter_instance_age(self): now = datetime.now(tz=tz.tzutc()) five_minute = now - timedelta(minutes=5) def i(d): return instance(LaunchTime=d) for ii, v in [ (i(now), False), (i(five_minute), True) ]: self.assertFilter({'type': 'instance-uptime', 'op': 'gte', 'minutes': 5}, ii, v) class TestMarkedForAction(BaseFilterTest): def test_marked_for_op_with_skew(self): now = datetime.now() yesterday = datetime.now() - timedelta(7) next_week = now + timedelta(7) def i(d, action='stop'): return instance(Tags=[ {"Key": "maid_status", "Value": "not compliant: %s@%s" % ( action, d.strftime("%Y/%m/%d"))}]) for inst, skew, expected in [ (i(next_week), 7, True), (i(next_week), 3, False), (i(now), 0, True), (i(now), 5, True), (i(yesterday), 5, True), (i(now+timedelta(1)), 1, True), (i(now+timedelta(2)), 1, False), (i(now+timedelta(3)), 1, False) ]: self.assertFilter( {'type': 'marked-for-op', 'skew': skew}, inst, expected) def test_filter_action_date(self): now = datetime.now() yesterday = now - timedelta(1) tomorrow = now + timedelta(1) def i(d, action='stop'): return instance(Tags=[ {"Key": "maid_status", "Value": "not compliant: %s@%s" % ( action, d.strftime("%Y/%m/%d"))}]) for ii, v in [ (i(yesterday), True), (i(now), True), (i(tomorrow), False), (i(yesterday, 'terminate'), False) ]: self.assertFilter({'type': 'marked-for-op'}, ii, v) class EventFilterTest(BaseFilterTest): def test_event_filter(self): b = Bag(data={'mode': []}) event = event_data('event-instance-state.json') f = {'type': 'event', 'key': 'detail.state', 'value': 'pending'} ef = filters.factory(f, b) self.assertTrue(ef.process( [instance()], event)) # event is None self.assertEqual(ef.process('resources'), 'resources') # event is not None, but is not "true" either self.assertEqual(ef.process('resources', []), []) def test_event_no_mode(self): b = Bag(data={'resource': 'something'}) f = {'type': 'event', 'key': 'detail.state', 'value': 'pending'} f = filters.factory(f, b) self.assertRaises( base_filters.FilterValidationError, f.validate) class TestInstanceValue(BaseFilterTest): def test_filter_tag_count(self): tags = [] for i in range(10): tags.append({'Key': str(i), 'Value': str(i)}) i = instance(Tags=tags) self.assertFilter( {'type': 'tag-count', 'op': 'lt'}, i, False) tags.pop(0) i = instance(Tags=tags) self.assertFilter( {'type': 'tag-count', 'op': 'gte', 'count': 9}, i, True) def test_filter_tag(self): i = instance(Tags=[ {'Key': 'ASV', 'Value': 'abcd'}]) self.assertFilter( {'tag:ASV': 'def'}, i, False) self.assertEqual( annotation(i, base_filters.ANNOTATION_KEY), ()) i = instance(Tags=[ {'Key': 'CMDB', 'Value': 'abcd'}]) self.assertFilter( {'tag:ASV': 'absent'}, i, True) self.assertEqual( annotation(i, base_filters.ANNOTATION_KEY), ['tag:ASV']) def test_present(self): i = instance(Tags=[ {'Key': 'ASV', 'Value': ''}]) self.assertFilter( {'type': 'value', 'key': 'tag:ASV', 'value': 'present'}, i, True) def test_jmespath(self): self.assertFilter( {'Placement.AvailabilityZone': 'us-west-2c'}, instance(), True) self.assertFilter( {'Placement.AvailabilityZone': 'us-east-1c'}, instance(), False) def test_complex_validator(self): self.assertRaises( base_filters.FilterValidationError, filters.factory({ "key": "xyz", "type": "value"}).validate) self.assertRaises( base_filters.FilterValidationError, filters.factory({ "value": "xyz", "type": "value"}).validate) self.assertRaises( base_filters.FilterValidationError, filters.factory({ "key": "xyz", "value": "xyz", "op": "oo", "type": "value"}).validate) def test_complex_value_filter(self): self.assertFilter( {"key": ( "length(BlockDeviceMappings" "[?Ebs.DeleteOnTermination == `true`]" ".Ebs.DeleteOnTermination)"), "value": 0, "type": "value", "op": "gt"}, instance(), True) def test_not_null_filter(self): self.assertFilter( {"key": "Hypervisor", "value": "not-null", "type": "value"}, instance(), True) class TestEqualValue(unittest.TestCase): def test_eq(self): f = filters.factory( {'type': 'value', 'key': 'Color', 'value': 'green', 'op': 'eq'}) self.assertEqual( f(instance(Color='green')), True) self.assertEqual( f(instance(Color='blue')), False) def test_equal(self): f = filters.factory( {'type': 'value', 'key': 'Color', 'value': 'green', 'op': 'equal'}) self.assertEqual( f(instance(Color='green')), True) self.assertEqual( f(instance(Color='blue')), False) class TestNotEqualValue(unittest.TestCase): def test_ne(self): f = filters.factory( {'type': 'value', 'key': 'Color', 'value': 'green', 'op': 'ne'}) self.assertEqual( f(instance(Color='green')), False) self.assertEqual( f(instance(Color='blue')), True) def test_not_equal(self): f = filters.factory( {'type': 'value', 'key': 'Color', 'value': 'green', 'op': 'not-equal'}) self.assertEqual( f(instance(Color='green')), False) self.assertEqual( f(instance(Color='blue')), True) class TestGreaterThanValue(unittest.TestCase): def test_gt(self): f = filters.factory( {'type': 'value', 'key': 'Number', 'value': 10, 'op': 'gt'}) self.assertEqual( f(instance(Number=11)), True) self.assertEqual( f(instance(Number=9)), False) self.assertEqual( f(instance(Number=10)), False) def test_greater_than(self): f = filters.factory( {'type': 'value', 'key': 'Number', 'value': 10, 'op': 'greater-than'}) self.assertEqual( f(instance(Number=11)), True) self.assertEqual( f(instance(Number=9)), False) self.assertEqual( f(instance(Number=10)), False) class TestLessThanValue(unittest.TestCase): def test_lt(self): f = filters.factory( {'type': 'value', 'key': 'Number', 'value': 10, 'op': 'lt'}) self.assertEqual( f(instance(Number=9)), True) self.assertEqual( f(instance(Number=11)), False) self.assertEqual( f(instance(Number=10)), False) def test_less_than(self): f = filters.factory( {'type': 'value', 'key': 'Number', 'value': 10, 'op': 'less-than'}) self.assertEqual( f(instance(Number=9)), True) self.assertEqual( f(instance(Number=11)), False) self.assertEqual( f(instance(Number=10)), False) class TestInList(unittest.TestCase): def test_in(self): f = filters.factory( {'type': 'value', 'key': 'Thing', 'value': ['Foo', 'Bar', 'Quux'], 'op': 'in'}) self.assertEqual( f(instance(Thing='Foo')), True) self.assertEqual( f(instance(Thing='Baz')), False) class TestNotInList(unittest.TestCase): def test_ni(self): f = filters.factory( {'type': 'value', 'key': 'Thing', 'value': ['Foo', 'Bar', 'Quux'], 'op': 'ni'}) self.assertEqual( f(instance(Thing='Baz')), True) self.assertEqual( f(instance(Thing='Foo')), False) def test_not_in(self): f = filters.factory( {'type': 'value', 'key': 'Thing', 'value': ['Foo', 'Bar', 'Quux'], 'op': 'not-in'}) self.assertEqual( f(instance(Thing='Baz')), True) self.assertEqual( f(instance(Thing='Foo')), False) class TestFilterRegistry(unittest.TestCase): def test_filter_registry(self): reg = base_filters.FilterRegistry('test.filters') self.assertRaises( base_filters.FilterValidationError, reg.factory, {'type': ''}, ) if __name__ == '__main__': unittest.main()
28.654545
92
0.497145
from __future__ import absolute_import, division, print_function, unicode_literals from dateutil import tz from datetime import datetime, timedelta import unittest from c7n import filters as base_filters from c7n.resources.ec2 import filters from c7n.utils import annotation from .common import instance, event_data, Bag class BaseFilterTest(unittest.TestCase): def assertFilter(self, f, i, v): try: self.assertEqual(filters.factory(f)(i), v) except AssertionError: print(f, i['LaunchTime'], i['Tags'], v) raise class TestFilter(unittest.TestCase): def test_filter_construction(self): self.assertTrue( isinstance( filters.factory({'tag:ASV': 'absent'}), base_filters.ValueFilter)) def test_filter_validation(self): self.assertRaises( base_filters.FilterValidationError, filters.factory, {'type': 'ax', 'xyz': 1}) def test_filter_call(self): filter_instance = base_filters.Filter({}) self.assertIsInstance(filter_instance, base_filters.Filter) class TestOrFilter(unittest.TestCase): def test_or(self): f = filters.factory({ 'or': [ {'Architecture': 'x86_64'}, {'Architecture': 'armv8'}]}) results = [instance(Architecture='x86_64')] self.assertEqual( f.process(results), results) self.assertEqual( f.process([instance(Architecture='amd64')]), []) class TestAndFilter(unittest.TestCase): def test_and(self): f = filters.factory({ 'and': [ {'Architecture': 'x86_64'}, {'Color': 'green'}]}) results = [instance(Architecture='x86_64', Color='green')] self.assertEqual( f.process(results), results) self.assertEqual( f.process([ instance( Architecture='x86_64', Color='blue')]), []) self.assertEqual( f.process([ instance( Architecture='x86_64')]), []) class TestNotFilter(unittest.TestCase): def test_not(self): results = [ instance(Architecture='x86_64', Color='green'), instance(Architecture='x86_64', Color='blue'), instance(Architecture='x86_64', Color='yellow'), ] f = filters.factory({ 'not': [ {'Architecture': 'x86_64'}, {'Color': 'green'}]}) self.assertEqual(len(f.process(results)), 2) class TestValueFilter(unittest.TestCase): def test_value_type(self): sentinel = datetime.now() value = 5 resource = {'a': 1, 'Tags': [{'Key': 'xtra', 'Value': 'hello'}]} vf = filters.factory({'tag:ASV': 'absent'}) vf.vtype = 'size' res = vf.process_value_type(sentinel, value, resource) self.assertEqual(res, (sentinel, 0)) vf.vtype = 'age' res = vf.process_value_type(sentinel, value, resource) self.assertEqual(res, (0, sentinel)) vf.vtype = 'cidr' sentinel = '10.0.0.0/16' value = '10.10.10.10' res = vf.process_value_type(sentinel, value, resource) self.assertEqual( (str(res[0]), str(res[1])), (sentinel, value), ) vf.vtype = 'cidr_size' value = '10.10.10.300' res = vf.process_value_type(sentinel, value, resource) self.assertEqual(res, (sentinel, 0)) vf.vtype = 'expr' value = 'tag:xtra' sentinel = None res = vf.process_value_type(sentinel, value, resource) self.assertEqual(res, (None, 'hello')) vf.vtype = 'expr' value = 'a' sentinel = None res = vf.process_value_type(sentinel, value, resource) self.assertEqual(res, (None, 1)) class TestAgeFilter(unittest.TestCase): def test_age_filter(self): af = base_filters.AgeFilter({}) self.assertRaises(NotImplementedError, af.validate) class TestGlobValue(unittest.TestCase): def test_regex_match(self): f = filters.factory( {'type': 'value', 'key': 'Color', 'value': '*green*', 'op': 'glob'}) self.assertEqual( f(instance( Architecture='x86_64', Color='mighty green papaya')), True) self.assertEqual( f(instance( Architecture='x86_64', Color='blue')), False) def test_glob_match(self): glob_match = base_filters.core.glob_match self.assertFalse(glob_match(0, '')) class TestRegexValue(unittest.TestCase): def test_regex_validate(self): self.assertRaises( base_filters.FilterValidationError, filters.factory({ 'type': 'value', 'key': 'Color', 'value': '*green', 'op': 'regex'}).validate) def test_regex_match(self): f = filters.factory( {'type': 'value', 'key': 'Color', 'value': '.*green.*', 'op': 'regex'}) self.assertEqual( f(instance( Architecture='x86_64', Color='green papaya')), True) self.assertEqual( f(instance( Architecture='x86_64', Color='blue')), False) self.assertEqual( f(instance( Architecture='x86_64')), False) class TestValueTypes(BaseFilterTest): def test_normalize(self): fdata = { 'type': 'value', 'key': 'tag:Name', 'value_type': 'normalize', 'value': 'compilelambda' } self.assertFilter(fdata, instance(), True) def test_size(self): fdata = { 'type': 'value', 'key': 'SecurityGroups[].GroupId', 'value_type': 'size', 'value': 2 } self.assertFilter(fdata, instance(), True) def test_integer(self): fdata = { 'type': 'value', 'key': 'tag:Count', 'op': 'greater-than', 'value_type': 'integer', 'value': 0} def i(d): return instance(Tags=[{"Key": "Count", "Value": d}]) self.assertFilter(fdata, i('42'), True) self.assertFilter(fdata, i('abc'), False) fdata['op'] = 'equal' self.assertFilter(fdata, i('abc'), True) def test_swap(self): fdata = { 'type': 'value', 'key': 'SecurityGroups[].GroupId', 'value_type': 'swap', 'op': 'in', 'value': 'sg-47b76f22' } self.assertFilter(fdata, instance(), True) def test_age(self): now = datetime.now(tz=tz.tzutc()) three_months = now - timedelta(90) two_months = now - timedelta(60) one_month = now - timedelta(30) def i(d): return instance(LaunchTime=d) fdata = { 'type': 'value', 'key': 'LaunchTime', 'op': 'less-than', 'value_type': 'age', 'value': 32} self.assertFilter(fdata, i(three_months), False) self.assertFilter(fdata, i(two_months), False) self.assertFilter(fdata, i(one_month), True) self.assertFilter(fdata, i(now), True) self.assertFilter(fdata, i(now.isoformat()), True) def test_expiration(self): now = datetime.now(tz=tz.tzutc()) three_months = now + timedelta(90) two_months = now + timedelta(60) def i(d): return instance(LaunchTime=d) fdata = { 'type': 'value', 'key': 'LaunchTime', 'op': 'less-than', 'value_type': 'expiration', 'value': 61} self.assertFilter(fdata, i(three_months), False) self.assertFilter(fdata, i(two_months), True) self.assertFilter(fdata, i(now), True) self.assertFilter(fdata, i(now.isoformat()), True) def test_resource_count_filter(self): fdata = { 'type': 'value', 'value_type': 'resource_count', 'op': 'lt', 'value': 2 } self.assertFilter(fdata, instance(file='ec2-instances.json'), []) f = filters.factory({ 'type': 'value', 'value_type': 'resource_count', 'op': 'eq', 'value': 2 }) i = instance(file='ec2-instances.json') self.assertEqual(i, f(i)) def test_resource_count_filter_validation(self): f = { 'type': 'value', 'value_type': 'resource_count', 'op': 'regex', 'value': 1, } self.assertRaises( base_filters.FilterValidationError, filters.factory(f, {}).validate) f = { 'type': 'value', 'value_type': 'resource_count', 'op': 'eq', 'value': 'foo', } self.assertRaises( base_filters.FilterValidationError, filters.factory(f, {}).validate) f = { 'type': 'value', 'value_type': 'resource_count', 'value': 1, } self.assertRaises( base_filters.FilterValidationError, filters.factory(f, {}).validate) class TestInstanceAge(BaseFilterTest): def test_filter_instance_age(self): now = datetime.now(tz=tz.tzutc()) three_months = now - timedelta(90) two_months = now - timedelta(60) one_month = now - timedelta(30) def i(d): return instance(LaunchTime=d) for ii, v in [ (i(now), False), (i(three_months), True), (i(two_months), True), (i(one_month), False) ]: self.assertFilter({'type': 'instance-uptime', 'op': 'gte', 'days': 60}, ii, v) class TestInstanceAgeMinute(BaseFilterTest): def test_filter_instance_age(self): now = datetime.now(tz=tz.tzutc()) five_minute = now - timedelta(minutes=5) def i(d): return instance(LaunchTime=d) for ii, v in [ (i(now), False), (i(five_minute), True) ]: self.assertFilter({'type': 'instance-uptime', 'op': 'gte', 'minutes': 5}, ii, v) class TestMarkedForAction(BaseFilterTest): def test_marked_for_op_with_skew(self): now = datetime.now() yesterday = datetime.now() - timedelta(7) next_week = now + timedelta(7) def i(d, action='stop'): return instance(Tags=[ {"Key": "maid_status", "Value": "not compliant: %s@%s" % ( action, d.strftime("%Y/%m/%d"))}]) for inst, skew, expected in [ (i(next_week), 7, True), (i(next_week), 3, False), (i(now), 0, True), (i(now), 5, True), (i(yesterday), 5, True), (i(now+timedelta(1)), 1, True), (i(now+timedelta(2)), 1, False), (i(now+timedelta(3)), 1, False) ]: self.assertFilter( {'type': 'marked-for-op', 'skew': skew}, inst, expected) def test_filter_action_date(self): now = datetime.now() yesterday = now - timedelta(1) tomorrow = now + timedelta(1) def i(d, action='stop'): return instance(Tags=[ {"Key": "maid_status", "Value": "not compliant: %s@%s" % ( action, d.strftime("%Y/%m/%d"))}]) for ii, v in [ (i(yesterday), True), (i(now), True), (i(tomorrow), False), (i(yesterday, 'terminate'), False) ]: self.assertFilter({'type': 'marked-for-op'}, ii, v) class EventFilterTest(BaseFilterTest): def test_event_filter(self): b = Bag(data={'mode': []}) event = event_data('event-instance-state.json') f = {'type': 'event', 'key': 'detail.state', 'value': 'pending'} ef = filters.factory(f, b) self.assertTrue(ef.process( [instance()], event)) self.assertEqual(ef.process('resources'), 'resources') self.assertEqual(ef.process('resources', []), []) def test_event_no_mode(self): b = Bag(data={'resource': 'something'}) f = {'type': 'event', 'key': 'detail.state', 'value': 'pending'} f = filters.factory(f, b) self.assertRaises( base_filters.FilterValidationError, f.validate) class TestInstanceValue(BaseFilterTest): def test_filter_tag_count(self): tags = [] for i in range(10): tags.append({'Key': str(i), 'Value': str(i)}) i = instance(Tags=tags) self.assertFilter( {'type': 'tag-count', 'op': 'lt'}, i, False) tags.pop(0) i = instance(Tags=tags) self.assertFilter( {'type': 'tag-count', 'op': 'gte', 'count': 9}, i, True) def test_filter_tag(self): i = instance(Tags=[ {'Key': 'ASV', 'Value': 'abcd'}]) self.assertFilter( {'tag:ASV': 'def'}, i, False) self.assertEqual( annotation(i, base_filters.ANNOTATION_KEY), ()) i = instance(Tags=[ {'Key': 'CMDB', 'Value': 'abcd'}]) self.assertFilter( {'tag:ASV': 'absent'}, i, True) self.assertEqual( annotation(i, base_filters.ANNOTATION_KEY), ['tag:ASV']) def test_present(self): i = instance(Tags=[ {'Key': 'ASV', 'Value': ''}]) self.assertFilter( {'type': 'value', 'key': 'tag:ASV', 'value': 'present'}, i, True) def test_jmespath(self): self.assertFilter( {'Placement.AvailabilityZone': 'us-west-2c'}, instance(), True) self.assertFilter( {'Placement.AvailabilityZone': 'us-east-1c'}, instance(), False) def test_complex_validator(self): self.assertRaises( base_filters.FilterValidationError, filters.factory({ "key": "xyz", "type": "value"}).validate) self.assertRaises( base_filters.FilterValidationError, filters.factory({ "value": "xyz", "type": "value"}).validate) self.assertRaises( base_filters.FilterValidationError, filters.factory({ "key": "xyz", "value": "xyz", "op": "oo", "type": "value"}).validate) def test_complex_value_filter(self): self.assertFilter( {"key": ( "length(BlockDeviceMappings" "[?Ebs.DeleteOnTermination == `true`]" ".Ebs.DeleteOnTermination)"), "value": 0, "type": "value", "op": "gt"}, instance(), True) def test_not_null_filter(self): self.assertFilter( {"key": "Hypervisor", "value": "not-null", "type": "value"}, instance(), True) class TestEqualValue(unittest.TestCase): def test_eq(self): f = filters.factory( {'type': 'value', 'key': 'Color', 'value': 'green', 'op': 'eq'}) self.assertEqual( f(instance(Color='green')), True) self.assertEqual( f(instance(Color='blue')), False) def test_equal(self): f = filters.factory( {'type': 'value', 'key': 'Color', 'value': 'green', 'op': 'equal'}) self.assertEqual( f(instance(Color='green')), True) self.assertEqual( f(instance(Color='blue')), False) class TestNotEqualValue(unittest.TestCase): def test_ne(self): f = filters.factory( {'type': 'value', 'key': 'Color', 'value': 'green', 'op': 'ne'}) self.assertEqual( f(instance(Color='green')), False) self.assertEqual( f(instance(Color='blue')), True) def test_not_equal(self): f = filters.factory( {'type': 'value', 'key': 'Color', 'value': 'green', 'op': 'not-equal'}) self.assertEqual( f(instance(Color='green')), False) self.assertEqual( f(instance(Color='blue')), True) class TestGreaterThanValue(unittest.TestCase): def test_gt(self): f = filters.factory( {'type': 'value', 'key': 'Number', 'value': 10, 'op': 'gt'}) self.assertEqual( f(instance(Number=11)), True) self.assertEqual( f(instance(Number=9)), False) self.assertEqual( f(instance(Number=10)), False) def test_greater_than(self): f = filters.factory( {'type': 'value', 'key': 'Number', 'value': 10, 'op': 'greater-than'}) self.assertEqual( f(instance(Number=11)), True) self.assertEqual( f(instance(Number=9)), False) self.assertEqual( f(instance(Number=10)), False) class TestLessThanValue(unittest.TestCase): def test_lt(self): f = filters.factory( {'type': 'value', 'key': 'Number', 'value': 10, 'op': 'lt'}) self.assertEqual( f(instance(Number=9)), True) self.assertEqual( f(instance(Number=11)), False) self.assertEqual( f(instance(Number=10)), False) def test_less_than(self): f = filters.factory( {'type': 'value', 'key': 'Number', 'value': 10, 'op': 'less-than'}) self.assertEqual( f(instance(Number=9)), True) self.assertEqual( f(instance(Number=11)), False) self.assertEqual( f(instance(Number=10)), False) class TestInList(unittest.TestCase): def test_in(self): f = filters.factory( {'type': 'value', 'key': 'Thing', 'value': ['Foo', 'Bar', 'Quux'], 'op': 'in'}) self.assertEqual( f(instance(Thing='Foo')), True) self.assertEqual( f(instance(Thing='Baz')), False) class TestNotInList(unittest.TestCase): def test_ni(self): f = filters.factory( {'type': 'value', 'key': 'Thing', 'value': ['Foo', 'Bar', 'Quux'], 'op': 'ni'}) self.assertEqual( f(instance(Thing='Baz')), True) self.assertEqual( f(instance(Thing='Foo')), False) def test_not_in(self): f = filters.factory( {'type': 'value', 'key': 'Thing', 'value': ['Foo', 'Bar', 'Quux'], 'op': 'not-in'}) self.assertEqual( f(instance(Thing='Baz')), True) self.assertEqual( f(instance(Thing='Foo')), False) class TestFilterRegistry(unittest.TestCase): def test_filter_registry(self): reg = base_filters.FilterRegistry('test.filters') self.assertRaises( base_filters.FilterValidationError, reg.factory, {'type': ''}, ) if __name__ == '__main__': unittest.main()
true
true
f70a6d4fa3cb899a39d76c539603b4d81d6a554c
448
py
Python
14.py
CallMeTwitch/LeetCode
7d59b299fe76eb93ecc3d6936ab4bfedeb323ef7
[ "MIT" ]
null
null
null
14.py
CallMeTwitch/LeetCode
7d59b299fe76eb93ecc3d6936ab4bfedeb323ef7
[ "MIT" ]
null
null
null
14.py
CallMeTwitch/LeetCode
7d59b299fe76eb93ecc3d6936ab4bfedeb323ef7
[ "MIT" ]
null
null
null
class Solution: def longestCommonPrefix(self, strs): min_len = len(min(strs, key = len)) for q in range(len(strs)): strs[q] = list(strs[q]) lst = [] final = '' for _ in range(min_len): lst = [q.pop(0) for q in strs] if all(q == lst[0] for q in lst): final += lst[0] else: return final return final
26.352941
46
0.4375
class Solution: def longestCommonPrefix(self, strs): min_len = len(min(strs, key = len)) for q in range(len(strs)): strs[q] = list(strs[q]) lst = [] final = '' for _ in range(min_len): lst = [q.pop(0) for q in strs] if all(q == lst[0] for q in lst): final += lst[0] else: return final return final
true
true
f70a6de635ea8ebcd428588097104e0bda6abb8a
664
py
Python
tests/test_slider.py
Yardanico/pylibui-cffi
10d90f08b6b1e43bf567ffcd22dbe976cb10e80e
[ "MIT" ]
6
2017-10-16T03:23:05.000Z
2020-11-10T06:24:04.000Z
tests/test_slider.py
TiberiumN/pylibui-cffi
10d90f08b6b1e43bf567ffcd22dbe976cb10e80e
[ "MIT" ]
null
null
null
tests/test_slider.py
TiberiumN/pylibui-cffi
10d90f08b6b1e43bf567ffcd22dbe976cb10e80e
[ "MIT" ]
1
2018-09-07T06:14:27.000Z
2018-09-07T06:14:27.000Z
""" Pylibui test suite. """ from pylibui.controls import Slider from tests.utils import WindowTestCase class SliderTest(WindowTestCase): def setUp(self): super().setUp() self.slider = Slider(0, 100) def test_value_initial_value(self): """Tests the sliders's `value` initial value is the first parameter passed to constructor.""" slider = Slider(10, 110) self.assertEqual(slider.value, 10) def test_value_can_be_changed(self): """Tests the slider's `value` attribute can be changed.""" value = 30 self.slider.value = value self.assertEqual(self.slider.value, value)
25.538462
75
0.653614
from pylibui.controls import Slider from tests.utils import WindowTestCase class SliderTest(WindowTestCase): def setUp(self): super().setUp() self.slider = Slider(0, 100) def test_value_initial_value(self): slider = Slider(10, 110) self.assertEqual(slider.value, 10) def test_value_can_be_changed(self): value = 30 self.slider.value = value self.assertEqual(self.slider.value, value)
true
true
f70a6e363fb6bb482c5e3c38f34d9a3cc6bb57b1
2,239
py
Python
frappe/core/page/background_jobs/background_jobs.py
juhiwue/frappe
77f88af74e037dcca0bae3f3ef1e8cae7fb0f699
[ "MIT" ]
null
null
null
frappe/core/page/background_jobs/background_jobs.py
juhiwue/frappe
77f88af74e037dcca0bae3f3ef1e8cae7fb0f699
[ "MIT" ]
17
2021-03-22T18:47:14.000Z
2022-03-15T12:21:00.000Z
frappe/core/page/background_jobs/background_jobs.py
juhiwue/frappe
77f88af74e037dcca0bae3f3ef1e8cae7fb0f699
[ "MIT" ]
null
null
null
# Copyright (c) 2015, Frappe Technologies Pvt. Ltd. and Contributors # MIT License. See license.txt import json from typing import TYPE_CHECKING, Dict, List from rq import Queue, Worker import frappe from frappe import _ from frappe.utils import convert_utc_to_user_timezone, format_datetime from frappe.utils.background_jobs import get_redis_conn from frappe.utils.scheduler import is_scheduler_inactive if TYPE_CHECKING: from rq.job import Job JOB_COLORS = { 'queued': 'orange', 'failed': 'red', 'started': 'blue', 'finished': 'green' } @frappe.whitelist() def get_info(show_failed=False) -> List[Dict]: if isinstance(show_failed, str): show_failed = json.loads(show_failed) conn = get_redis_conn() queues = Queue.all(conn) workers = Worker.all(conn) jobs = [] def add_job(job: 'Job', name: str) -> None: if job.kwargs.get('site') == frappe.local.site: job_info = { 'job_name': job.kwargs.get('kwargs', {}).get('playbook_method') or job.kwargs.get('kwargs', {}).get('job_type') or str(job.kwargs.get('job_name')), 'status': job.get_status(), 'queue': name, 'creation': format_datetime(convert_utc_to_user_timezone(job.created_at)), 'color': JOB_COLORS[job.get_status()] } if job.exc_info: job_info['exc_info'] = job.exc_info jobs.append(job_info) # show worker jobs for worker in workers: job = worker.get_current_job() if job: add_job(job, worker.name) for queue in queues: # show active queued jobs if queue.name != 'failed': for job in queue.jobs: add_job(job, queue.name) # show failed jobs, if requested if show_failed: fail_registry = queue.failed_job_registry for job_id in fail_registry.get_job_ids(): job = queue.fetch_job(job_id) if job: add_job(job, queue.name) return jobs @frappe.whitelist() def remove_failed_jobs(): conn = get_redis_conn() queues = Queue.all(conn) for queue in queues: fail_registry = queue.failed_job_registry for job_id in fail_registry.get_job_ids(): job = queue.fetch_job(job_id) fail_registry.remove(job, delete_job=True) @frappe.whitelist() def get_scheduler_status(): if is_scheduler_inactive(): return [_("Inactive"), "red"] return [_("Active"), "green"]
24.336957
78
0.711925
import json from typing import TYPE_CHECKING, Dict, List from rq import Queue, Worker import frappe from frappe import _ from frappe.utils import convert_utc_to_user_timezone, format_datetime from frappe.utils.background_jobs import get_redis_conn from frappe.utils.scheduler import is_scheduler_inactive if TYPE_CHECKING: from rq.job import Job JOB_COLORS = { 'queued': 'orange', 'failed': 'red', 'started': 'blue', 'finished': 'green' } @frappe.whitelist() def get_info(show_failed=False) -> List[Dict]: if isinstance(show_failed, str): show_failed = json.loads(show_failed) conn = get_redis_conn() queues = Queue.all(conn) workers = Worker.all(conn) jobs = [] def add_job(job: 'Job', name: str) -> None: if job.kwargs.get('site') == frappe.local.site: job_info = { 'job_name': job.kwargs.get('kwargs', {}).get('playbook_method') or job.kwargs.get('kwargs', {}).get('job_type') or str(job.kwargs.get('job_name')), 'status': job.get_status(), 'queue': name, 'creation': format_datetime(convert_utc_to_user_timezone(job.created_at)), 'color': JOB_COLORS[job.get_status()] } if job.exc_info: job_info['exc_info'] = job.exc_info jobs.append(job_info) for worker in workers: job = worker.get_current_job() if job: add_job(job, worker.name) for queue in queues: if queue.name != 'failed': for job in queue.jobs: add_job(job, queue.name) if show_failed: fail_registry = queue.failed_job_registry for job_id in fail_registry.get_job_ids(): job = queue.fetch_job(job_id) if job: add_job(job, queue.name) return jobs @frappe.whitelist() def remove_failed_jobs(): conn = get_redis_conn() queues = Queue.all(conn) for queue in queues: fail_registry = queue.failed_job_registry for job_id in fail_registry.get_job_ids(): job = queue.fetch_job(job_id) fail_registry.remove(job, delete_job=True) @frappe.whitelist() def get_scheduler_status(): if is_scheduler_inactive(): return [_("Inactive"), "red"] return [_("Active"), "green"]
true
true
f70a6ea2f3bc1234f058f1d39e3b1937ed425d61
10,360
py
Python
jax/_src/device_array.py
zjzh/jax
8372b98c4856b6b2363b7bb28abdb4579440a656
[ "Apache-2.0" ]
null
null
null
jax/_src/device_array.py
zjzh/jax
8372b98c4856b6b2363b7bb28abdb4579440a656
[ "Apache-2.0" ]
8
2022-01-03T10:15:55.000Z
2022-02-14T10:19:45.000Z
jax/_src/device_array.py
zjzh/jax
8372b98c4856b6b2363b7bb28abdb4579440a656
[ "Apache-2.0" ]
null
null
null
# Copyright 2018 Google LLC # # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # https://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. # On-device arrays. from functools import partial, partialmethod import operator from typing import (Any, List, Optional, Union) import weakref import numpy as np from jax import core from jax._src.config import config from jax._src import abstract_arrays from jax._src import dtypes from jax._src import profiler from jax._src.lib import xla_client as xc import jax._src.util as util ### device-persistent data xe = xc._xla Device = xc.Device Buffer = xe.Buffer def _forward_method(attrname, self, fun, *args): return fun(getattr(self, attrname), *args) _forward_to_value = partial(_forward_method, "_value") # The following is used for the type xc.Buffer or _DeviceArray. DeviceArrayProtocol = Any DeviceArray = xc.DeviceArrayBase def make_device_array( aval: core.ShapedArray, device: Optional[Device], device_buffer: Buffer, ) -> Union[Buffer, "_DeviceArray"]: """Returns a DeviceArray implementation based on arguments. This is to be used only within JAX. It will return either a PythonDeviceArray or a C++ equivalent implementation. """ if isinstance(device_buffer, xc.Buffer): if device_buffer.aval == aval and device_buffer._device == device: return device_buffer device_buffer = device_buffer.clone() device_buffer._device = device device_buffer.aval = aval device_buffer.weak_type = aval.weak_type return device_buffer return _DeviceArray(aval, device, device_buffer) def type_is_device_array(x): """Returns `True` if `x` is a non-sharded DeviceArray. Use this function instead of `type(x) is Devicearray`. """ type_x = type(x) return type_x is _DeviceArray or type_x is xc.Buffer def device_array_supports_weakrefs(): try: weakref.ref(DeviceArray()) return True except TypeError: return False class _DeviceArray(DeviceArray): # type: ignore """A DeviceArray is an ndarray backed by a single device memory buffer.""" # We don't subclass ndarray because that would open up a host of issues, # but lax_numpy.py overrides isinstance behavior and attaches ndarray methods. __slots__ = [ "aval", "device_buffer", "_npy_value", "_device", "__weakref__" ] __array_priority__ = 100 # DeviceArray has methods that are dynamically populated in lax_numpy.py, # and this annotation is needed to make pytype happy. _HAS_DYNAMIC_ATTRIBUTES = True def __init__(self, aval: core.ShapedArray, device: Optional[Device], device_buffer: Buffer): """Initializer. Args: aval: The abstract value associated to this array (shape+dtype+weak_type). device: The optional sticky device. See https://jax.readthedocs.io/en/latest/faq.html#controlling-data-and-computation-placement-on-devices device_buffer: The underlying buffer owning the on-device data. """ DeviceArray.__init__(self) self.aval = aval self.device_buffer = device_buffer self._device = device self._npy_value = None if config.jax_enable_checks: assert type(aval) is core.ShapedArray npy_value = self._value assert npy_value.dtype == aval.dtype and npy_value.shape == aval.shape, ( aval, npy_value.shape, npy_value.dtype) assert (device is None) or device is device_buffer.device() def _check_if_deleted(self): if self.device_buffer is deleted_buffer: raise RuntimeError("DeviceArray has been deleted.") @profiler.annotate_function def block_until_ready(self): """Blocks the caller until the buffer's value has been computed on device. This method is mostly useful for timing microbenchmarks that wish to time how long a computation takes, without transferring the result back to the host. Returns the buffer object (`self`). """ self._check_if_deleted() self.device_buffer.block_host_until_ready() # pytype: disable=attribute-error return self @property def _value(self): self._check_if_deleted() if self._npy_value is None: self._npy_value = self.device_buffer.to_py() # pytype: disable=attribute-error # bind-properties self._npy_value.flags.writeable = False return self._npy_value @property def shape(self): return self.aval.shape @property def dtype(self): return self.aval.dtype @property def size(self): return util.prod(self.aval.shape) @property def ndim(self): return len(self.aval.shape) def device(self): self._check_if_deleted() return self.device_buffer.device() # pytype: disable=attribute-error def copy_to_host_async(self): """Requests a copy of the buffer to the host.""" self._check_if_deleted() if self._npy_value is None: self.device_buffer.copy_to_host_async() # pytype: disable=attribute-error def delete(self): """Deletes the device array and any cached copy on the host. It is an error to access the contents of a `DeviceArray` after it has been deleted. Use of this method is optional; device buffers will be reclaimed automatically by Python when a DeviceArray object is garbage collected. However, it is sometimes useful to have more explicit control over the time of deletion. """ self.device_buffer.delete() # pytype: disable=attribute-error self.device_buffer = deleted_buffer self._npy_value = None @property def __cuda_array_interface__(self): return self.device_buffer.__cuda_array_interface__ # pytype: disable=attribute-error # bind-properties # Adding methods dynamically to both _DeviceArray and xc.Buffer # pylint: disable=protected-access for device_array in [DeviceArray]: def copy(self): """Returns an ndarray (backed by host memory, not device memory).""" return np.asarray(self) setattr(device_array, "copy", copy) def __repr__(self): line_width = np.get_printoptions()["linewidth"] prefix = '{}('.format(self.__class__.__name__.lstrip('_')) s = np.array2string(self._value, prefix=prefix, suffix=',', separator=', ', max_line_width=line_width) if self.aval is not None and self.aval.weak_type: dtype_str = f'dtype={self.dtype.name}, weak_type=True)' else: dtype_str = f'dtype={self.dtype.name})' last_line_len = len(s) - s.rfind('\n') + 1 sep = ' ' if last_line_len + len(dtype_str) + 1 > line_width: sep = ' ' * len(prefix) return "{}{},{}{}".format(prefix, s, sep, dtype_str) setattr(device_array, "__repr__", __repr__) def item(self): if dtypes.issubdtype(self.dtype, np.complexfloating): return complex(self) elif dtypes.issubdtype(self.dtype, np.floating): return float(self) elif dtypes.issubdtype(self.dtype, np.integer): return int(self) elif dtypes.issubdtype(self.dtype, np.bool_): return bool(self) else: raise TypeError(self.dtype) setattr(device_array, "item", item) def __len__(self): try: return self.aval.shape[0] except IndexError as err: raise TypeError("len() of unsized object") from err # same as numpy error setattr(device_array, "__len__", __len__) def __iter__(self): if self.ndim == 0: raise TypeError("iteration over a 0-d array") # same as numpy error else: return (sl for chunk in self._chunk_iter(100) for sl in chunk._unstack()) setattr(device_array, "__iter__", __iter__) def __reversed__(self): return iter(self[::-1]) setattr(device_array, "__reversed__", __reversed__) def __format__(self, format_spec): # Simulates behavior of https://github.com/numpy/numpy/pull/9883 if self.ndim == 0: return format(self._value[()], format_spec) else: return format(self._value, format_spec) setattr(device_array, "__format__", __format__) def __array__(self, dtype=None, context=None): return np.asarray(self._value, dtype=dtype) setattr(device_array, "__array__", __array__) setattr(device_array, "__str__", partialmethod(_forward_to_value, str)) setattr(device_array, "__bool__", partialmethod(_forward_to_value, bool)) setattr(device_array, "__nonzero__", partialmethod(_forward_to_value, bool)) setattr(device_array, "__float__", lambda self: self._value.__float__()) setattr(device_array, "__int__", lambda self: self._value.__int__()) setattr(device_array, "__complex__", lambda self: self._value.__complex__()) setattr(device_array, "__hex__", partialmethod(_forward_to_value, hex)) setattr(device_array, "__oct__", partialmethod(_forward_to_value, oct)) setattr(device_array, "__index__", partialmethod(_forward_to_value, operator.index)) to_bytes = lambda self, order="C": self._value.tobytes(order) setattr(device_array, "tobytes", to_bytes) del to_bytes setattr(device_array, "tolist", lambda self: self._value.tolist()) # pickle saves and loads just like an ndarray setattr(device_array, "__reduce__", partialmethod(_forward_to_value, operator.methodcaller("__reduce__"))) # explicitly set to be unhashable. setattr(device_array, "__hash__", None) # clobbered when jax.numpy is imported, but useful in tests setattr(device_array, "__eq__", lambda self, other: self._value == other) # The following methods are dynamically overridden in lax_numpy.py. def raise_not_implemented(): raise NotImplementedError setattr(device_array, "__getitem__", lambda self, i: raise_not_implemented()) # pylint: enable=protected-access class DeletedBuffer(object): pass deleted_buffer = DeletedBuffer() device_array_types: List[type] = [xc.Buffer, _DeviceArray] for _device_array in device_array_types: core.literalable_types.add(_device_array) core.pytype_aval_mappings[device_array] = abstract_arrays.canonical_concrete_aval
32.888889
108
0.721911
from functools import partial, partialmethod import operator from typing import (Any, List, Optional, Union) import weakref import numpy as np from jax import core from jax._src.config import config from jax._src import abstract_arrays from jax._src import dtypes from jax._src import profiler from jax._src.lib import xla_client as xc import jax._src.util as util ffer def _forward_method(attrname, self, fun, *args): return fun(getattr(self, attrname), *args) _forward_to_value = partial(_forward_method, "_value") DeviceArrayProtocol = Any DeviceArray = xc.DeviceArrayBase def make_device_array( aval: core.ShapedArray, device: Optional[Device], device_buffer: Buffer, ) -> Union[Buffer, "_DeviceArray"]: if isinstance(device_buffer, xc.Buffer): if device_buffer.aval == aval and device_buffer._device == device: return device_buffer device_buffer = device_buffer.clone() device_buffer._device = device device_buffer.aval = aval device_buffer.weak_type = aval.weak_type return device_buffer return _DeviceArray(aval, device, device_buffer) def type_is_device_array(x): type_x = type(x) return type_x is _DeviceArray or type_x is xc.Buffer def device_array_supports_weakrefs(): try: weakref.ref(DeviceArray()) return True except TypeError: return False class _DeviceArray(DeviceArray): # but lax_numpy.py overrides isinstance behavior and attaches ndarray methods. __slots__ = [ "aval", "device_buffer", "_npy_value", "_device", "__weakref__" ] __array_priority__ = 100 # DeviceArray has methods that are dynamically populated in lax_numpy.py, # and this annotation is needed to make pytype happy. _HAS_DYNAMIC_ATTRIBUTES = True def __init__(self, aval: core.ShapedArray, device: Optional[Device], device_buffer: Buffer): DeviceArray.__init__(self) self.aval = aval self.device_buffer = device_buffer self._device = device self._npy_value = None if config.jax_enable_checks: assert type(aval) is core.ShapedArray npy_value = self._value assert npy_value.dtype == aval.dtype and npy_value.shape == aval.shape, ( aval, npy_value.shape, npy_value.dtype) assert (device is None) or device is device_buffer.device() def _check_if_deleted(self): if self.device_buffer is deleted_buffer: raise RuntimeError("DeviceArray has been deleted.") @profiler.annotate_function def block_until_ready(self): self._check_if_deleted() self.device_buffer.block_host_until_ready() # pytype: disable=attribute-error return self @property def _value(self): self._check_if_deleted() if self._npy_value is None: self._npy_value = self.device_buffer.to_py() # pytype: disable=attribute-error # bind-properties self._npy_value.flags.writeable = False return self._npy_value @property def shape(self): return self.aval.shape @property def dtype(self): return self.aval.dtype @property def size(self): return util.prod(self.aval.shape) @property def ndim(self): return len(self.aval.shape) def device(self): self._check_if_deleted() return self.device_buffer.device() # pytype: disable=attribute-error def copy_to_host_async(self): self._check_if_deleted() if self._npy_value is None: self.device_buffer.copy_to_host_async() # pytype: disable=attribute-error def delete(self): self.device_buffer.delete() # pytype: disable=attribute-error self.device_buffer = deleted_buffer self._npy_value = None @property def __cuda_array_interface__(self): return self.device_buffer.__cuda_array_interface__ # pytype: disable=attribute-error # bind-properties # Adding methods dynamically to both _DeviceArray and xc.Buffer # pylint: disable=protected-access for device_array in [DeviceArray]: def copy(self): return np.asarray(self) setattr(device_array, "copy", copy) def __repr__(self): line_width = np.get_printoptions()["linewidth"] prefix = '{}('.format(self.__class__.__name__.lstrip('_')) s = np.array2string(self._value, prefix=prefix, suffix=',', separator=', ', max_line_width=line_width) if self.aval is not None and self.aval.weak_type: dtype_str = f'dtype={self.dtype.name}, weak_type=True)' else: dtype_str = f'dtype={self.dtype.name})' last_line_len = len(s) - s.rfind('\n') + 1 sep = ' ' if last_line_len + len(dtype_str) + 1 > line_width: sep = ' ' * len(prefix) return "{}{},{}{}".format(prefix, s, sep, dtype_str) setattr(device_array, "__repr__", __repr__) def item(self): if dtypes.issubdtype(self.dtype, np.complexfloating): return complex(self) elif dtypes.issubdtype(self.dtype, np.floating): return float(self) elif dtypes.issubdtype(self.dtype, np.integer): return int(self) elif dtypes.issubdtype(self.dtype, np.bool_): return bool(self) else: raise TypeError(self.dtype) setattr(device_array, "item", item) def __len__(self): try: return self.aval.shape[0] except IndexError as err: raise TypeError("len() of unsized object") from err # same as numpy error setattr(device_array, "__len__", __len__) def __iter__(self): if self.ndim == 0: raise TypeError("iteration over a 0-d array") # same as numpy error else: return (sl for chunk in self._chunk_iter(100) for sl in chunk._unstack()) setattr(device_array, "__iter__", __iter__) def __reversed__(self): return iter(self[::-1]) setattr(device_array, "__reversed__", __reversed__) def __format__(self, format_spec): # Simulates behavior of https://github.com/numpy/numpy/pull/9883 if self.ndim == 0: return format(self._value[()], format_spec) else: return format(self._value, format_spec) setattr(device_array, "__format__", __format__) def __array__(self, dtype=None, context=None): return np.asarray(self._value, dtype=dtype) setattr(device_array, "__array__", __array__) setattr(device_array, "__str__", partialmethod(_forward_to_value, str)) setattr(device_array, "__bool__", partialmethod(_forward_to_value, bool)) setattr(device_array, "__nonzero__", partialmethod(_forward_to_value, bool)) setattr(device_array, "__float__", lambda self: self._value.__float__()) setattr(device_array, "__int__", lambda self: self._value.__int__()) setattr(device_array, "__complex__", lambda self: self._value.__complex__()) setattr(device_array, "__hex__", partialmethod(_forward_to_value, hex)) setattr(device_array, "__oct__", partialmethod(_forward_to_value, oct)) setattr(device_array, "__index__", partialmethod(_forward_to_value, operator.index)) to_bytes = lambda self, order="C": self._value.tobytes(order) setattr(device_array, "tobytes", to_bytes) del to_bytes setattr(device_array, "tolist", lambda self: self._value.tolist()) # pickle saves and loads just like an ndarray setattr(device_array, "__reduce__", partialmethod(_forward_to_value, operator.methodcaller("__reduce__"))) # explicitly set to be unhashable. setattr(device_array, "__hash__", None) # clobbered when jax.numpy is imported, but useful in tests setattr(device_array, "__eq__", lambda self, other: self._value == other) # The following methods are dynamically overridden in lax_numpy.py. def raise_not_implemented(): raise NotImplementedError setattr(device_array, "__getitem__", lambda self, i: raise_not_implemented()) # pylint: enable=protected-access class DeletedBuffer(object): pass deleted_buffer = DeletedBuffer() device_array_types: List[type] = [xc.Buffer, _DeviceArray] for _device_array in device_array_types: core.literalable_types.add(_device_array) core.pytype_aval_mappings[device_array] = abstract_arrays.canonical_concrete_aval
true
true
f70a6f4e41b9deabaa98231dc49f102c2da5262c
3,144
py
Python
pkgs/ipykernel-4.3.1-py27_0/lib/python2.7/site-packages/ipykernel/gui/gtk3embed.py
wangyum/anaconda
6e5a0dbead3327661d73a61e85414cf92aa52be6
[ "Apache-2.0", "BSD-3-Clause" ]
652
2015-07-26T00:00:17.000Z
2022-02-24T18:30:04.000Z
pkgs/ipykernel-4.3.1-py27_0/lib/python2.7/site-packages/ipykernel/gui/gtk3embed.py
wangyum/anaconda
6e5a0dbead3327661d73a61e85414cf92aa52be6
[ "Apache-2.0", "BSD-3-Clause" ]
8
2015-09-07T03:38:19.000Z
2021-05-23T03:18:51.000Z
pkgs/ipykernel-4.3.1-py27_0/lib/python2.7/site-packages/ipykernel/gui/gtk3embed.py
wangyum/anaconda
6e5a0dbead3327661d73a61e85414cf92aa52be6
[ "Apache-2.0", "BSD-3-Clause" ]
40
2015-07-24T19:45:08.000Z
2021-11-01T14:54:56.000Z
"""GUI support for the IPython ZeroMQ kernel - GTK toolkit support. """ #----------------------------------------------------------------------------- # Copyright (C) 2010-2011 The IPython Development Team # # Distributed under the terms of the BSD License. The full license is in # the file COPYING.txt, distributed as part of this software. #----------------------------------------------------------------------------- #----------------------------------------------------------------------------- # Imports #----------------------------------------------------------------------------- # stdlib import sys # Third-party from gi.repository import GObject, Gtk #----------------------------------------------------------------------------- # Classes and functions #----------------------------------------------------------------------------- class GTKEmbed(object): """A class to embed a kernel into the GTK main event loop. """ def __init__(self, kernel): self.kernel = kernel # These two will later store the real gtk functions when we hijack them self.gtk_main = None self.gtk_main_quit = None def start(self): """Starts the GTK main event loop and sets our kernel startup routine. """ # Register our function to initiate the kernel and start gtk GObject.idle_add(self._wire_kernel) Gtk.main() def _wire_kernel(self): """Initializes the kernel inside GTK. This is meant to run only once at startup, so it does its job and returns False to ensure it doesn't get run again by GTK. """ self.gtk_main, self.gtk_main_quit = self._hijack_gtk() GObject.timeout_add(int(1000*self.kernel._poll_interval), self.iterate_kernel) return False def iterate_kernel(self): """Run one iteration of the kernel and return True. GTK timer functions must return True to be called again, so we make the call to :meth:`do_one_iteration` and then return True for GTK. """ self.kernel.do_one_iteration() return True def stop(self): # FIXME: this one isn't getting called because we have no reliable # kernel shutdown. We need to fix that: once the kernel has a # shutdown mechanism, it can call this. self.gtk_main_quit() sys.exit() def _hijack_gtk(self): """Hijack a few key functions in GTK for IPython integration. Modifies pyGTK's main and main_quit with a dummy so user code does not block IPython. This allows us to use %run to run arbitrary pygtk scripts from a long-lived IPython session, and when they attempt to start or stop Returns ------- The original functions that have been hijacked: - Gtk.main - Gtk.main_quit """ def dummy(*args, **kw): pass # save and trap main and main_quit from gtk orig_main, Gtk.main = Gtk.main, dummy orig_main_quit, Gtk.main_quit = Gtk.main_quit, dummy return orig_main, orig_main_quit
36.55814
79
0.54612
import sys from gi.repository import GObject, Gtk class GTKEmbed(object): def __init__(self, kernel): self.kernel = kernel self.gtk_main = None self.gtk_main_quit = None def start(self): GObject.idle_add(self._wire_kernel) Gtk.main() def _wire_kernel(self): self.gtk_main, self.gtk_main_quit = self._hijack_gtk() GObject.timeout_add(int(1000*self.kernel._poll_interval), self.iterate_kernel) return False def iterate_kernel(self): self.kernel.do_one_iteration() return True def stop(self): # kernel shutdown. We need to fix that: once the kernel has a # shutdown mechanism, it can call this. self.gtk_main_quit() sys.exit() def _hijack_gtk(self): def dummy(*args, **kw): pass # save and trap main and main_quit from gtk orig_main, Gtk.main = Gtk.main, dummy orig_main_quit, Gtk.main_quit = Gtk.main_quit, dummy return orig_main, orig_main_quit
true
true
f70a703ecf8b20f0a4ea6cf7f1cfc565cffc8462
19,936
py
Python
caesd-master/main.py
korecodes/FYP
b4f67d968081f9199d1555a1729856d4af4a895e
[ "MIT" ]
1
2022-01-18T15:33:46.000Z
2022-01-18T15:33:46.000Z
caesd-master/main.py
korecodes/FYP
b4f67d968081f9199d1555a1729856d4af4a895e
[ "MIT" ]
null
null
null
caesd-master/main.py
korecodes/FYP
b4f67d968081f9199d1555a1729856d4af4a895e
[ "MIT" ]
null
null
null
#GUI classes for the application from kivy.app import App from kivy.lang import Builder from kivy.core.window import Window from kivy.uix.screenmanager import ScreenManager, Screen, FadeTransition from kivy.uix.popup import Popup from kivy.uix.button import Button from kivy.uix.label import Label from kivy.uix.spinner import Spinner from kivy.uix.textinput import TextInput from kivy.properties import ObjectProperty, BooleanProperty from kivy.uix.recycleview import RecycleView from kivy.uix.recycleboxlayout import RecycleBoxLayout from kivy.uix.recycleview.views import RecycleDataViewBehavior from kivy.uix.behaviors import FocusBehavior from kivy.uix.recycleview.layout import LayoutSelectionBehavior #Window.size = (1200, 800) #FUNCTION classes for the application from app_functions import AmpFunctions, RoomDesign from app_constants import AppConstants class SelectableLabel(RecycleDataViewBehavior, Label): index = None selected = BooleanProperty(False) selectable = BooleanProperty(True) def refresh_view_attrs(self, rv, index, data): self.index = index self.selected = True ''' Catch and handle the view changes ''' return super(SelectableLabel, self).refresh_view_attrs( rv, index, data) def on_touch_down(self, touch): ''' Add selection on touch down ''' if super(SelectableLabel, self).on_touch_down(touch): return True if self.collide_point(*touch.pos) and self.selectable: return self.parent.select_with_touch(self.index, touch) def apply_selection(self, rv, index, is_selected): action = CAESD() ''' Respond to the selection of items in the view. ''' self.selected = is_selected if is_selected: machine_data = """ Machine Section: %s Machine Name: %s Machine Load: %s Machine Current: %sA Machine Current(fx): %sA Machine Cable Size: %smm2 Machine Breaker Size: %sA Machine Cable Type: Armoured PVC Insulated Single Core Cable Machine Breaker Type: %s """ % (str(rv.data[index]['machine_section']), str(rv.data[index]['machine_name']), str(rv.data[index]['machine_load']), str(rv.data[index]['machine_amp']), str(rv.data[index]['machine_amp_gd']), str(rv.data[index]['cable_size']), str(rv.data[index]['breaker_size']), str(rv.data[index]['breaker_type'])) action.popDisplays('Machine Details', machine_data) class SelectableRecycleBoxLayout(FocusBehavior, LayoutSelectionBehavior, RecycleBoxLayout): ''' Adds selection and focus behaviour to the view. ''' #Screens class LaunchPage(Screen): pass class CctvPage(Screen): dropManufacturer = ObjectProperty() dropModel = ObjectProperty() dropSensor = ObjectProperty() distFromCamera = ObjectProperty() sceneWidth = ObjectProperty() sceneHeight = ObjectProperty() sceneArea = ObjectProperty() focalLength = ObjectProperty() datastore = { 'Manu_Model_pairs': [], 'Manufacturer': '', 'Model': '', 'Sensor': '', 'Distance': '', 'Width': '', 'Height': '', 'Focal': '', 'Area': '' } def selectedManufacturer(self): self.datastore['Manufacturer'] = self.dropManufacturer.text self.datastore['Manu_Model_pairs'] = AppConstants().manufacturerModels(self.dropManufacturer.text) self.dropModel.values = [i for i in self.datastore['Manu_Model_pairs'].keys()] pass def selectedModel(self): if self.dropModel.text != 'Model': self.datastore['Model'] = self.dropModel.text self.datastore['Sensor'] = self.datastore['Manu_Model_pairs'][self.dropModel.text] self.dropSensor.text = 'Sensor format: '+ self.datastore['Sensor']+'"' self.sensor_values = AppConstants().sensorsValues(self.datastore['Sensor']) def checkManufacturerModelSelected(self): if self.dropManufacturer.text != "" and self.dropModel.text != 'Model': return True def clearValues(self): if self.sceneWidth.text == '': self.sceneHeight.text = '' self.focalLength.text = '' self.sceneArea.text = '' elif self.sceneHeight.text == '': self.sceneWidth.text = '' self.focalLength.text = '' self.sceneArea.text = '' def calculateSceneDimensions(self, dimension, value): app = CAESD() if value != '': if self.checkManufacturerModelSelected(): if self.distFromCamera.focus: self.datastore['Distance'] = self.distFromCamera.text if self.sceneWidth.text == '' or self.sceneHeight.text == '': pass else: self.focalLength.text = str(round((float(self.sensor_values[0])*float(self.distFromCamera.text))/float(self.sceneWidth.text), 1)) self.sceneArea.text = str(round(float(self.sceneWidth.text)*float(self.sceneHeight.text), 2)) elif self.sceneWidth.focus: self.datastore['Height'] = '' self.datastore['Width'] = self.sceneWidth.text self.sceneHeight.text = str(round((float(self.sceneWidth.text)*float(self.sensor_values[1]))/float(self.sensor_values[0]), 1)) if self.distFromCamera.text != '': self.focalLength.text = str(round((float(self.sensor_values[0])*float(self.distFromCamera.text))/float(self.sceneWidth.text), 1)) self.sceneArea.text = str(round(float(self.sceneWidth.text)*float(self.sceneHeight.text), 2)) elif self.sceneHeight.focus: self.datastore['Width'] = '' self.datastore['Height'] = self.sceneHeight.text self.sceneWidth.text = str(round((float(self.sceneHeight.text)*float(self.sensor_values[0]))/float(self.sensor_values[1]), 1)) if self.distFromCamera.text != '': self.focalLength.text = str(round((float(self.sensor_values[1])*float(self.distFromCamera.text))/float(self.sceneHeight.text), 1)) self.sceneArea.text = str(round(float(self.sceneHeight.text)*float(self.sceneWidth.text), 2)) else: pass else: errorMessage = 'Please select the Model' app.popDisplays('Application Error', errorMessage) else: if self.distFromCamera.text == '': self.focalLength.text = '' self.clearValues() else: self.clearValues() class EarthingPage(Screen): pass class PowerPage_one(Screen): numMachines = ObjectProperty() numSections = ObjectProperty() normalVoltage: ObjectProperty() utilityVoltage: ObjectProperty growthFactor: ObjectProperty() deratingFactor: ObjectProperty() loadingFactor: ObjectProperty() dispPowerOneError: ObjectProperty() buttAddMachines: ObjectProperty() def calculatePowerInputs(self, machines, sections): if machines: if sections: self.buttAddMachines.disabled = False PowerPage_two().powerdataApp(machines, sections, self.normalVoltage.text, self.utilityVoltage.text, self.growthFactor.text, self.deratingFactor.text) else: CAESD().displayInLabelMessage(self.dispPowerOneError, t='Please Indicate Number of Sections', i=True) else: CAESD().displayInLabelMessage(self.dispPowerOneError, t='Please Indicate Number of Machines', i=True) class PowerPage_two(Screen): machineOutOfNum = ObjectProperty() machineNameName = ObjectProperty() machineNameInput = ObjectProperty() machineLoad = ObjectProperty machineFactor = ObjectProperty() dropSelectMachineSection = ObjectProperty() dispPowerTwoScreen = ObjectProperty() buttAddMachines = ObjectProperty() buttAllMachines = ObjectProperty() dropViewMachineSection = ObjectProperty() dispMachineListHeader = ObjectProperty() dispMachineScreen = ObjectProperty() num_of_machines_and_sections = [] storageMachineData = [] def addMachineParameters(self, machine_name, load, section_selected): if machine_name: if load: if section_selected != 'Select Machine Section': CAESD().displayInLabelMessage(self.dispPowerTwoScreen, t='', i=True) self.buttAllMachines.disabled = False self.dropViewMachineSection.disabled = False self.dispMachineListHeader.disabled = False if int(self.getCurMachineNumber()) == int(self.num_of_machines_and_sections[0]): self.machineListLabels() self. displayPowerViewboard() self.buttAddMachines.disabled = True self.dropSelectMachineSection.disabled = True out_message = "Complete!!! "+str(int(self.getCurMachineNumber()))+" out of "+str(self.num_of_machines_and_sections[0])+" machines added!" CAESD().displayInLabelMessage(self.machineOutOfNum, t=out_message) else: self.machineListLabels() self. displayPowerViewboard() self.machineNameName.text = "Name for Machine "+str(int(self.getCurMachineNumber())+1) self.machineNameInput.text = "Machine "+str(int(self.getCurMachineNumber())) out_message =str(int(self.getCurMachineNumber())-1)+" out of "+str(self.num_of_machines_and_sections[0])+" machines added!" CAESD().displayInLabelMessage(self.machineOutOfNum, t=out_message, c=[0,0,0,1]) self.machineLoad.text = '' self.dropSelectMachineSection.text = 'Select Machine Section' else: CAESD().displayInLabelMessage(self.dispPowerTwoScreen, t='Please Select A Machine Section', i=True) else: CAESD().displayInLabelMessage(self.dispPowerTwoScreen, t='Please Indicate Machine Load', i=True) else: CAESD().displayInLabelMessage(self.dispPowerTwoScreen, t='Please Indicate Machine Name', i=True) def powerdataApp(self, machines, sections, a, b, c, d): self.num_of_machines_and_sections.append(machines) self.num_of_machines_and_sections.append(sections) self.num_of_machines_and_sections.append([a,b,c,d]) def getCurMachineNumber(self): return self.machineNameName.text.split(' ')[3] def selectMachineSection(self): values = [] section_alt = [chr(i) for i in range(65,91)] for i in range(1, int(self.num_of_machines_and_sections[1])+1): values.append('Section '+str(section_alt[i-1])) self.dropSelectMachineSection.values = values self.dropViewMachineSection.values = values #self.buttMachineSection.values = values def machineListLabels(self): ampCal = AmpFunctions(float(self.machineLoad.text), float(self.num_of_machines_and_sections[2][0]), float(self.num_of_machines_and_sections[2][2]), float(self.num_of_machines_and_sections[2][3])) appCons = AppConstants() self.storageMachineData.insert(0, { 'machine_section': str(self.dropSelectMachineSection.text), 'machine_name': str(self.machineNameInput.text), 'machine_load': str(self.machineLoad.text), 'machine_amp': str(ampCal.ampWithoutFutureExpansion()), 'machine_amp_gd': str(ampCal.ampWithFutureExpansion()), 'breaker_size': str(appCons.breakerSize(ampCal.ampWithFutureExpansion())), 'cable_size': str(appCons.cableSize(ampCal.ampWithoutFutureExpansion())), 'breaker_type': str(appCons.breakerType(appCons.breakerSize(ampCal.ampWithFutureExpansion())))}) self.dispMachineScreen.data = self.storageMachineData def machineSectionLabels(self, sections, data): self.dispMachineSection.data = [] values = [] section_alt = [chr(i) for i in range(65,91)] for i in range(1, int(sections)+1): values.append('Section '+str(section_alt[i-1])) values.reverse() for sect in values: section_data = [] for row in data: if row['machine_section'] == sect: section_data.append(row) formatted_data = ['Machine | Load | Amp |\n']+[i['machine_name']+' | '+i['machine_load']+'kVa | '+i['machine_amp']+'A | \n' for i in section_data] #section_header = 'Machine Name | Machine Load |\n' #formatted_data(section_header) self.dispMachineSection.data.insert(0, {'machine_section_name': str(sect), 'machine_section_data': str(''.join(formatted_data))}) def displayPowerViewboard(self): ampCal = AmpFunctions(float(self.machineLoad.text), float(self.num_of_machines_and_sections[2][0]), float(self.num_of_machines_and_sections[2][2]), float(self.num_of_machines_and_sections[2][3])) #Determine the total current all_currents = [] for i in self.dispMachineScreen.data: all_currents.append(float(i['machine_amp'])) t_current = round(sum(all_currents), 2) #Determine the transformer capacity p_current = (float(self.num_of_machines_and_sections[2][0]) * t_current)/float(self.num_of_machines_and_sections[2][1]) t_capacity = round((ampCal.phaseRoot() * float(self.num_of_machines_and_sections[2][1]) * p_current * 1)/1000, 2) power_viewboard_message = """ POWER VIEWBOARD Total Current from Machines: %sA Change Over Switch Capacity: 2500A Transformer Capacity: %skVA Generator Capacity: %skVA """ % (t_current, t_capacity, t_capacity) self.dispPowerTwoScreen.text = power_viewboard_message def displayPanelBoard(self, data_key): if data_key == 'All Machines': self.dispMachineScreen.data = self.storageMachineData #self.sectionViewboard.text = '' else: section_data = [] self.dispMachineScreen.data = [] for row in self.storageMachineData: if row['machine_section'] == data_key: section_data.append(row) else: self.dispMachineScreen.data = [] self.dispMachineScreen.data = section_data if self.dispMachineScreen.data == []: out_message = 'NO MACHINE ADDED YET FOR '+data_key.upper() CAESD().displayInLabelMessage(self.dispPowerTwoScreen, t=out_message, c=[0,0,0,1]) else: tot_load = 0 tot_amp = 0 tot_amp_gd = 0 tot_breaker_size = 0 #tot_cable_size = 0 for i in self.dispMachineScreen.data: tot_load += float(i['machine_load']) tot_amp += float(i['machine_amp']) tot_amp_gd += float(i['machine_amp_gd']) tot_breaker_size += float(i['breaker_size']) #tot_cable_size += float(i['cable_size']) data_summary = """ SUMMARY FOR %s Number of Machines: %s Total Load: %skVA Total Current: %sA Total Current(fx): %sA Total Breaker Size: %sA """ % (data_key.upper(), len(self.dispMachineScreen.data), tot_load, round(tot_amp, 2), round(tot_amp_gd, 2), round(tot_breaker_size, 2)) self.dispPowerTwoScreen.text = data_summary class IlluminationPage(Screen): lengthOfRoom = ObjectProperty() breadthOfRoom = ObjectProperty() workingHeight = ObjectProperty() wattMSq = ObjectProperty() lampL = ObjectProperty() numL = ObjectProperty() mainFac = ObjectProperty() dispIllumination = ObjectProperty() dispLampDistributions = ObjectProperty() def calculateLampsNeeded(self, length, breadth, w_height, watt_m_sq, lamp_l, no_lumin, main_fac): app = CAESD() if length and breadth and watt_m_sq and lamp_l: if lamp_l != 'Lamp lumen': if main_fac != 'Maintenance factor': Ll = AppConstants().lampLumen(str(self.lampL.text)) room = RoomDesign(float(self.lengthOfRoom.text), float(self.breadthOfRoom.text), float(self.workingHeight.text), float(self.wattMSq.text), float(Ll), float(self.numL.text), float(self.mainFac.text)) message_illumination = """ Room Index Calculated at: %s \r Total Number of lamps needed: %s """ % (str(room.roomIndex()), str(room.roomLamps())) lamp_dis = """ POSSIBLE COMBINATIONS OF LAMPS\r %s """ % str(room.possibleLampConfigurations()) app.displayInLabelMessage(self.dispIllumination, t=message_illumination, c=[0,0,0,1]) app.displayInLabelMessage(self.dispLampDistributions, t=lamp_dis, c=[0,0,0,1]) else: app.displayInLabelMessage(self.dispIllumination, t='Please select the maintenance factor', i=True) else: app.displayInLabelMessage(self.dispIllumination, t='Please choose the lamp lumen', i=True) else: app.displayInLabelMessage(self.dispIllumination, t='Missing Parameter/Input', i=True) #Main Screen Manager class CAESDApp(ScreenManager): pass main_kv = Builder.load_file("main.kv") class CAESD(App): def build(self): self.title = 'Computer Aided Electrical Services Design' self.background_color = 0,0,0,1 return main_kv def displayInLabelMessage(self, obj, **kwargs): obj.color = 1, 0, 0, 1 obj.italic = False if kwargs == {}: #Default error message obj.text = 'Attention: Application Message' else: for i in kwargs.keys(): if i == 'text' or i == 't': obj.text = kwargs[i] elif i == 'color' or i == 'c': obj.color = kwargs[i] elif i == 'italic' or i == 'i': obj.italic = kwargs[i] def popDisplays(self, title, message, hint=(.7, .45)): Popup(title=title, title_color=[1,1,1,1], content=Label(text=message), size_hint=hint, separator_color=[1,1,0,.6]).open() if __name__ == '__main__': CAESD().run()
48.154589
169
0.589938
from kivy.app import App from kivy.lang import Builder from kivy.core.window import Window from kivy.uix.screenmanager import ScreenManager, Screen, FadeTransition from kivy.uix.popup import Popup from kivy.uix.button import Button from kivy.uix.label import Label from kivy.uix.spinner import Spinner from kivy.uix.textinput import TextInput from kivy.properties import ObjectProperty, BooleanProperty from kivy.uix.recycleview import RecycleView from kivy.uix.recycleboxlayout import RecycleBoxLayout from kivy.uix.recycleview.views import RecycleDataViewBehavior from kivy.uix.behaviors import FocusBehavior from kivy.uix.recycleview.layout import LayoutSelectionBehavior from app_functions import AmpFunctions, RoomDesign from app_constants import AppConstants class SelectableLabel(RecycleDataViewBehavior, Label): index = None selected = BooleanProperty(False) selectable = BooleanProperty(True) def refresh_view_attrs(self, rv, index, data): self.index = index self.selected = True return super(SelectableLabel, self).refresh_view_attrs( rv, index, data) def on_touch_down(self, touch): if super(SelectableLabel, self).on_touch_down(touch): return True if self.collide_point(*touch.pos) and self.selectable: return self.parent.select_with_touch(self.index, touch) def apply_selection(self, rv, index, is_selected): action = CAESD() self.selected = is_selected if is_selected: machine_data = """ Machine Section: %s Machine Name: %s Machine Load: %s Machine Current: %sA Machine Current(fx): %sA Machine Cable Size: %smm2 Machine Breaker Size: %sA Machine Cable Type: Armoured PVC Insulated Single Core Cable Machine Breaker Type: %s """ % (str(rv.data[index]['machine_section']), str(rv.data[index]['machine_name']), str(rv.data[index]['machine_load']), str(rv.data[index]['machine_amp']), str(rv.data[index]['machine_amp_gd']), str(rv.data[index]['cable_size']), str(rv.data[index]['breaker_size']), str(rv.data[index]['breaker_type'])) action.popDisplays('Machine Details', machine_data) class SelectableRecycleBoxLayout(FocusBehavior, LayoutSelectionBehavior, RecycleBoxLayout): class LaunchPage(Screen): pass class CctvPage(Screen): dropManufacturer = ObjectProperty() dropModel = ObjectProperty() dropSensor = ObjectProperty() distFromCamera = ObjectProperty() sceneWidth = ObjectProperty() sceneHeight = ObjectProperty() sceneArea = ObjectProperty() focalLength = ObjectProperty() datastore = { 'Manu_Model_pairs': [], 'Manufacturer': '', 'Model': '', 'Sensor': '', 'Distance': '', 'Width': '', 'Height': '', 'Focal': '', 'Area': '' } def selectedManufacturer(self): self.datastore['Manufacturer'] = self.dropManufacturer.text self.datastore['Manu_Model_pairs'] = AppConstants().manufacturerModels(self.dropManufacturer.text) self.dropModel.values = [i for i in self.datastore['Manu_Model_pairs'].keys()] pass def selectedModel(self): if self.dropModel.text != 'Model': self.datastore['Model'] = self.dropModel.text self.datastore['Sensor'] = self.datastore['Manu_Model_pairs'][self.dropModel.text] self.dropSensor.text = 'Sensor format: '+ self.datastore['Sensor']+'"' self.sensor_values = AppConstants().sensorsValues(self.datastore['Sensor']) def checkManufacturerModelSelected(self): if self.dropManufacturer.text != "" and self.dropModel.text != 'Model': return True def clearValues(self): if self.sceneWidth.text == '': self.sceneHeight.text = '' self.focalLength.text = '' self.sceneArea.text = '' elif self.sceneHeight.text == '': self.sceneWidth.text = '' self.focalLength.text = '' self.sceneArea.text = '' def calculateSceneDimensions(self, dimension, value): app = CAESD() if value != '': if self.checkManufacturerModelSelected(): if self.distFromCamera.focus: self.datastore['Distance'] = self.distFromCamera.text if self.sceneWidth.text == '' or self.sceneHeight.text == '': pass else: self.focalLength.text = str(round((float(self.sensor_values[0])*float(self.distFromCamera.text))/float(self.sceneWidth.text), 1)) self.sceneArea.text = str(round(float(self.sceneWidth.text)*float(self.sceneHeight.text), 2)) elif self.sceneWidth.focus: self.datastore['Height'] = '' self.datastore['Width'] = self.sceneWidth.text self.sceneHeight.text = str(round((float(self.sceneWidth.text)*float(self.sensor_values[1]))/float(self.sensor_values[0]), 1)) if self.distFromCamera.text != '': self.focalLength.text = str(round((float(self.sensor_values[0])*float(self.distFromCamera.text))/float(self.sceneWidth.text), 1)) self.sceneArea.text = str(round(float(self.sceneWidth.text)*float(self.sceneHeight.text), 2)) elif self.sceneHeight.focus: self.datastore['Width'] = '' self.datastore['Height'] = self.sceneHeight.text self.sceneWidth.text = str(round((float(self.sceneHeight.text)*float(self.sensor_values[0]))/float(self.sensor_values[1]), 1)) if self.distFromCamera.text != '': self.focalLength.text = str(round((float(self.sensor_values[1])*float(self.distFromCamera.text))/float(self.sceneHeight.text), 1)) self.sceneArea.text = str(round(float(self.sceneHeight.text)*float(self.sceneWidth.text), 2)) else: pass else: errorMessage = 'Please select the Model' app.popDisplays('Application Error', errorMessage) else: if self.distFromCamera.text == '': self.focalLength.text = '' self.clearValues() else: self.clearValues() class EarthingPage(Screen): pass class PowerPage_one(Screen): numMachines = ObjectProperty() numSections = ObjectProperty() normalVoltage: ObjectProperty() utilityVoltage: ObjectProperty growthFactor: ObjectProperty() deratingFactor: ObjectProperty() loadingFactor: ObjectProperty() dispPowerOneError: ObjectProperty() buttAddMachines: ObjectProperty() def calculatePowerInputs(self, machines, sections): if machines: if sections: self.buttAddMachines.disabled = False PowerPage_two().powerdataApp(machines, sections, self.normalVoltage.text, self.utilityVoltage.text, self.growthFactor.text, self.deratingFactor.text) else: CAESD().displayInLabelMessage(self.dispPowerOneError, t='Please Indicate Number of Sections', i=True) else: CAESD().displayInLabelMessage(self.dispPowerOneError, t='Please Indicate Number of Machines', i=True) class PowerPage_two(Screen): machineOutOfNum = ObjectProperty() machineNameName = ObjectProperty() machineNameInput = ObjectProperty() machineLoad = ObjectProperty machineFactor = ObjectProperty() dropSelectMachineSection = ObjectProperty() dispPowerTwoScreen = ObjectProperty() buttAddMachines = ObjectProperty() buttAllMachines = ObjectProperty() dropViewMachineSection = ObjectProperty() dispMachineListHeader = ObjectProperty() dispMachineScreen = ObjectProperty() num_of_machines_and_sections = [] storageMachineData = [] def addMachineParameters(self, machine_name, load, section_selected): if machine_name: if load: if section_selected != 'Select Machine Section': CAESD().displayInLabelMessage(self.dispPowerTwoScreen, t='', i=True) self.buttAllMachines.disabled = False self.dropViewMachineSection.disabled = False self.dispMachineListHeader.disabled = False if int(self.getCurMachineNumber()) == int(self.num_of_machines_and_sections[0]): self.machineListLabels() self. displayPowerViewboard() self.buttAddMachines.disabled = True self.dropSelectMachineSection.disabled = True out_message = "Complete!!! "+str(int(self.getCurMachineNumber()))+" out of "+str(self.num_of_machines_and_sections[0])+" machines added!" CAESD().displayInLabelMessage(self.machineOutOfNum, t=out_message) else: self.machineListLabels() self. displayPowerViewboard() self.machineNameName.text = "Name for Machine "+str(int(self.getCurMachineNumber())+1) self.machineNameInput.text = "Machine "+str(int(self.getCurMachineNumber())) out_message =str(int(self.getCurMachineNumber())-1)+" out of "+str(self.num_of_machines_and_sections[0])+" machines added!" CAESD().displayInLabelMessage(self.machineOutOfNum, t=out_message, c=[0,0,0,1]) self.machineLoad.text = '' self.dropSelectMachineSection.text = 'Select Machine Section' else: CAESD().displayInLabelMessage(self.dispPowerTwoScreen, t='Please Select A Machine Section', i=True) else: CAESD().displayInLabelMessage(self.dispPowerTwoScreen, t='Please Indicate Machine Load', i=True) else: CAESD().displayInLabelMessage(self.dispPowerTwoScreen, t='Please Indicate Machine Name', i=True) def powerdataApp(self, machines, sections, a, b, c, d): self.num_of_machines_and_sections.append(machines) self.num_of_machines_and_sections.append(sections) self.num_of_machines_and_sections.append([a,b,c,d]) def getCurMachineNumber(self): return self.machineNameName.text.split(' ')[3] def selectMachineSection(self): values = [] section_alt = [chr(i) for i in range(65,91)] for i in range(1, int(self.num_of_machines_and_sections[1])+1): values.append('Section '+str(section_alt[i-1])) self.dropSelectMachineSection.values = values self.dropViewMachineSection.values = values #self.buttMachineSection.values = values def machineListLabels(self): ampCal = AmpFunctions(float(self.machineLoad.text), float(self.num_of_machines_and_sections[2][0]), float(self.num_of_machines_and_sections[2][2]), float(self.num_of_machines_and_sections[2][3])) appCons = AppConstants() self.storageMachineData.insert(0, { 'machine_section': str(self.dropSelectMachineSection.text), 'machine_name': str(self.machineNameInput.text), 'machine_load': str(self.machineLoad.text), 'machine_amp': str(ampCal.ampWithoutFutureExpansion()), 'machine_amp_gd': str(ampCal.ampWithFutureExpansion()), 'breaker_size': str(appCons.breakerSize(ampCal.ampWithFutureExpansion())), 'cable_size': str(appCons.cableSize(ampCal.ampWithoutFutureExpansion())), 'breaker_type': str(appCons.breakerType(appCons.breakerSize(ampCal.ampWithFutureExpansion())))}) self.dispMachineScreen.data = self.storageMachineData def machineSectionLabels(self, sections, data): self.dispMachineSection.data = [] values = [] section_alt = [chr(i) for i in range(65,91)] for i in range(1, int(sections)+1): values.append('Section '+str(section_alt[i-1])) values.reverse() for sect in values: section_data = [] for row in data: if row['machine_section'] == sect: section_data.append(row) formatted_data = ['Machine | Load | Amp |\n']+[i['machine_name']+' | '+i['machine_load']+'kVa | '+i['machine_amp']+'A | \n' for i in section_data] #section_header = 'Machine Name | Machine Load |\n' #formatted_data(section_header) self.dispMachineSection.data.insert(0, {'machine_section_name': str(sect), 'machine_section_data': str(''.join(formatted_data))}) def displayPowerViewboard(self): ampCal = AmpFunctions(float(self.machineLoad.text), float(self.num_of_machines_and_sections[2][0]), float(self.num_of_machines_and_sections[2][2]), float(self.num_of_machines_and_sections[2][3])) #Determine the total current all_currents = [] for i in self.dispMachineScreen.data: all_currents.append(float(i['machine_amp'])) t_current = round(sum(all_currents), 2) #Determine the transformer capacity p_current = (float(self.num_of_machines_and_sections[2][0]) * t_current)/float(self.num_of_machines_and_sections[2][1]) t_capacity = round((ampCal.phaseRoot() * float(self.num_of_machines_and_sections[2][1]) * p_current * 1)/1000, 2) power_viewboard_message = """ POWER VIEWBOARD Total Current from Machines: %sA Change Over Switch Capacity: 2500A Transformer Capacity: %skVA Generator Capacity: %skVA """ % (t_current, t_capacity, t_capacity) self.dispPowerTwoScreen.text = power_viewboard_message def displayPanelBoard(self, data_key): if data_key == 'All Machines': self.dispMachineScreen.data = self.storageMachineData #self.sectionViewboard.text = '' else: section_data = [] self.dispMachineScreen.data = [] for row in self.storageMachineData: if row['machine_section'] == data_key: section_data.append(row) else: self.dispMachineScreen.data = [] self.dispMachineScreen.data = section_data if self.dispMachineScreen.data == []: out_message = 'NO MACHINE ADDED YET FOR '+data_key.upper() CAESD().displayInLabelMessage(self.dispPowerTwoScreen, t=out_message, c=[0,0,0,1]) else: tot_load = 0 tot_amp = 0 tot_amp_gd = 0 tot_breaker_size = 0 #tot_cable_size = 0 for i in self.dispMachineScreen.data: tot_load += float(i['machine_load']) tot_amp += float(i['machine_amp']) tot_amp_gd += float(i['machine_amp_gd']) tot_breaker_size += float(i['breaker_size']) #tot_cable_size += float(i['cable_size']) data_summary = """ SUMMARY FOR %s Number of Machines: %s Total Load: %skVA Total Current: %sA Total Current(fx): %sA Total Breaker Size: %sA """ % (data_key.upper(), len(self.dispMachineScreen.data), tot_load, round(tot_amp, 2), round(tot_amp_gd, 2), round(tot_breaker_size, 2)) self.dispPowerTwoScreen.text = data_summary class IlluminationPage(Screen): lengthOfRoom = ObjectProperty() breadthOfRoom = ObjectProperty() workingHeight = ObjectProperty() wattMSq = ObjectProperty() lampL = ObjectProperty() numL = ObjectProperty() mainFac = ObjectProperty() dispIllumination = ObjectProperty() dispLampDistributions = ObjectProperty() def calculateLampsNeeded(self, length, breadth, w_height, watt_m_sq, lamp_l, no_lumin, main_fac): app = CAESD() if length and breadth and watt_m_sq and lamp_l: if lamp_l != 'Lamp lumen': if main_fac != 'Maintenance factor': Ll = AppConstants().lampLumen(str(self.lampL.text)) room = RoomDesign(float(self.lengthOfRoom.text), float(self.breadthOfRoom.text), float(self.workingHeight.text), float(self.wattMSq.text), float(Ll), float(self.numL.text), float(self.mainFac.text)) message_illumination = """ Room Index Calculated at: %s \r Total Number of lamps needed: %s """ % (str(room.roomIndex()), str(room.roomLamps())) lamp_dis = """ POSSIBLE COMBINATIONS OF LAMPS\r %s """ % str(room.possibleLampConfigurations()) app.displayInLabelMessage(self.dispIllumination, t=message_illumination, c=[0,0,0,1]) app.displayInLabelMessage(self.dispLampDistributions, t=lamp_dis, c=[0,0,0,1]) else: app.displayInLabelMessage(self.dispIllumination, t='Please select the maintenance factor', i=True) else: app.displayInLabelMessage(self.dispIllumination, t='Please choose the lamp lumen', i=True) else: app.displayInLabelMessage(self.dispIllumination, t='Missing Parameter/Input', i=True) #Main Screen Manager class CAESDApp(ScreenManager): pass main_kv = Builder.load_file("main.kv") class CAESD(App): def build(self): self.title = 'Computer Aided Electrical Services Design' self.background_color = 0,0,0,1 return main_kv def displayInLabelMessage(self, obj, **kwargs): obj.color = 1, 0, 0, 1 obj.italic = False if kwargs == {}: #Default error message obj.text = 'Attention: Application Message' else: for i in kwargs.keys(): if i == 'text' or i == 't': obj.text = kwargs[i] elif i == 'color' or i == 'c': obj.color = kwargs[i] elif i == 'italic' or i == 'i': obj.italic = kwargs[i] def popDisplays(self, title, message, hint=(.7, .45)): Popup(title=title, title_color=[1,1,1,1], content=Label(text=message), size_hint=hint, separator_color=[1,1,0,.6]).open() if __name__ == '__main__': CAESD().run()
true
true
f70a71c00a69752a6818debf925e56044120def3
619
py
Python
apps/addpaths.py
lorenzcsunikl/Dataset-of-Artefact-Aware-Human-Motion-Capture-using-Inertial-Sensors-Integrated-into-Loose-Clothing
e5864e20d60bd7fa38bf6935ba1bacfadcdb3035
[ "Apache-2.0" ]
null
null
null
apps/addpaths.py
lorenzcsunikl/Dataset-of-Artefact-Aware-Human-Motion-Capture-using-Inertial-Sensors-Integrated-into-Loose-Clothing
e5864e20d60bd7fa38bf6935ba1bacfadcdb3035
[ "Apache-2.0" ]
null
null
null
apps/addpaths.py
lorenzcsunikl/Dataset-of-Artefact-Aware-Human-Motion-Capture-using-Inertial-Sensors-Integrated-into-Loose-Clothing
e5864e20d60bd7fa38bf6935ba1bacfadcdb3035
[ "Apache-2.0" ]
null
null
null
import os, sys, inspect # realpath() will make your script run, even if you symlink it :) cmd_folder = os.path.realpath(os.path.abspath(os.path.split(inspect.getfile(inspect.currentframe()))[0])) if cmd_folder not in sys.path: sys.path.insert(0, cmd_folder) # # Use this if you want to include modules from a subfolder cmd_subfolder = os.path.realpath( os.path.abspath(os.path.join(os.path.split(inspect.getfile(inspect.currentframe()))[0], ".."))) if cmd_subfolder not in sys.path: sys.path.insert(0, cmd_subfolder) sys.path.append('../') sys.path.append('../utils/') sys.path.append('../vizualization/')
41.266667
105
0.722132
import os, sys, inspect cmd_folder = os.path.realpath(os.path.abspath(os.path.split(inspect.getfile(inspect.currentframe()))[0])) if cmd_folder not in sys.path: sys.path.insert(0, cmd_folder) path.join(os.path.split(inspect.getfile(inspect.currentframe()))[0], ".."))) if cmd_subfolder not in sys.path: sys.path.insert(0, cmd_subfolder) sys.path.append('../') sys.path.append('../utils/') sys.path.append('../vizualization/')
true
true
f70a71c87434c0461dadcc68734d1ada03bc32f7
35,695
py
Python
snaps/openstack/tests/create_image_tests.py
hashnfv/hashnfv-snaps
0dfca494ef7c2778babfac48d9b701953860b54f
[ "Apache-2.0" ]
null
null
null
snaps/openstack/tests/create_image_tests.py
hashnfv/hashnfv-snaps
0dfca494ef7c2778babfac48d9b701953860b54f
[ "Apache-2.0" ]
null
null
null
snaps/openstack/tests/create_image_tests.py
hashnfv/hashnfv-snaps
0dfca494ef7c2778babfac48d9b701953860b54f
[ "Apache-2.0" ]
null
null
null
# Copyright (c) 2017 Cable Television Laboratories, Inc. ("CableLabs") # and others. All rights reserved. # # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at: # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. from glanceclient.exc import HTTPBadRequest try: from urllib.request import URLError except ImportError: from urllib2 import URLError import logging import shutil import unittest import uuid import os from snaps import file_utils from snaps.openstack import create_image from snaps.openstack.create_image import (ImageSettings, ImageCreationError, ImageSettingsError) from snaps.openstack.tests import openstack_tests from snaps.openstack.tests.os_source_file_test import OSIntegrationTestCase from snaps.openstack.utils import glance_utils __author__ = 'spisarski' logger = logging.getLogger('create_image_tests') class ImageSettingsUnitTests(unittest.TestCase): """ Tests the construction of the ImageSettings class """ def test_no_params(self): with self.assertRaises(ImageSettingsError): ImageSettings() def test_empty_config(self): with self.assertRaises(ImageSettingsError): ImageSettings(**dict()) def test_name_only(self): with self.assertRaises(ImageSettingsError): ImageSettings(name='foo') def test_config_with_name_only(self): with self.assertRaises(ImageSettingsError): ImageSettings(**{'name': 'foo'}) def test_name_user_only(self): with self.assertRaises(ImageSettingsError): ImageSettings(name='foo', image_user='bar') def test_config_with_name_user_only(self): with self.assertRaises(ImageSettingsError): ImageSettings(**{'name': 'foo', 'image_user': 'bar'}) def test_name_user_format_only(self): with self.assertRaises(ImageSettingsError): ImageSettings(name='foo', image_user='bar', img_format='qcow2') def test_config_with_name_user_format_only(self): with self.assertRaises(ImageSettingsError): ImageSettings( **{'name': 'foo', 'image_user': 'bar', 'format': 'qcow2'}) def test_name_user_format_url_only(self): settings = ImageSettings(name='foo', image_user='bar', img_format='qcow2', url='http://foo.com') self.assertEqual('foo', settings.name) self.assertEqual('bar', settings.image_user) self.assertEqual('qcow2', settings.format) self.assertEqual('http://foo.com', settings.url) self.assertIsNone(settings.image_file) self.assertFalse(settings.exists) self.assertFalse(settings.public) self.assertIsNone(settings.nic_config_pb_loc) def test_name_user_format_url_only_properties(self): properties = {'hw_video_model': 'vga'} settings = ImageSettings(name='foo', image_user='bar', img_format='qcow2', url='http://foo.com', extra_properties=properties) self.assertEqual('foo', settings.name) self.assertEqual('bar', settings.image_user) self.assertEqual('qcow2', settings.format) self.assertEqual('http://foo.com', settings.url) self.assertEqual(properties, settings.extra_properties) self.assertIsNone(settings.image_file) self.assertFalse(settings.exists) self.assertFalse(settings.public) self.assertIsNone(settings.nic_config_pb_loc) def test_config_with_name_user_format_url_only(self): settings = ImageSettings( **{'name': 'foo', 'image_user': 'bar', 'format': 'qcow2', 'download_url': 'http://foo.com'}) self.assertEqual('foo', settings.name) self.assertEqual('bar', settings.image_user) self.assertEqual('qcow2', settings.format) self.assertEqual('http://foo.com', settings.url) self.assertIsNone(settings.image_file) self.assertFalse(settings.exists) self.assertFalse(settings.public) self.assertIsNone(settings.nic_config_pb_loc) def test_name_user_format_file_only(self): settings = ImageSettings(name='foo', image_user='bar', img_format='qcow2', image_file='/foo/bar.qcow') self.assertEqual('foo', settings.name) self.assertEqual('bar', settings.image_user) self.assertEqual('qcow2', settings.format) self.assertIsNone(settings.url) self.assertEqual('/foo/bar.qcow', settings.image_file) self.assertFalse(settings.exists) self.assertFalse(settings.public) self.assertIsNone(settings.nic_config_pb_loc) def test_config_with_name_user_format_file_only(self): settings = ImageSettings( **{'name': 'foo', 'image_user': 'bar', 'format': 'qcow2', 'image_file': '/foo/bar.qcow'}) self.assertEqual('foo', settings.name) self.assertEqual('bar', settings.image_user) self.assertEqual('qcow2', settings.format) self.assertIsNone(settings.url) self.assertEqual('/foo/bar.qcow', settings.image_file) self.assertFalse(settings.exists) self.assertFalse(settings.public) self.assertIsNone(settings.nic_config_pb_loc) def test_all_url(self): properties = {'hw_video_model': 'vga'} kernel_settings = ImageSettings(name='kernel', url='http://kernel.com', image_user='bar', img_format='qcow2') ramdisk_settings = ImageSettings(name='ramdisk', url='http://ramdisk.com', image_user='bar', img_format='qcow2') settings = ImageSettings(name='foo', image_user='bar', img_format='qcow2', url='http://foo.com', extra_properties=properties, nic_config_pb_loc='/foo/bar', kernel_image_settings=kernel_settings, ramdisk_image_settings=ramdisk_settings, exists=True, public=True) self.assertEqual('foo', settings.name) self.assertEqual('bar', settings.image_user) self.assertEqual('qcow2', settings.format) self.assertEqual('http://foo.com', settings.url) self.assertEqual(properties, settings.extra_properties) self.assertIsNone(settings.image_file) self.assertEqual('/foo/bar', settings.nic_config_pb_loc) self.assertEqual('kernel', settings.kernel_image_settings.name) self.assertEqual('http://kernel.com', settings.kernel_image_settings.url) self.assertEqual('bar', settings.kernel_image_settings.image_user) self.assertEqual('qcow2', settings.kernel_image_settings.format) self.assertEqual('ramdisk', settings.ramdisk_image_settings.name) self.assertEqual('http://ramdisk.com', settings.ramdisk_image_settings.url) self.assertEqual('bar', settings.ramdisk_image_settings.image_user) self.assertEqual('qcow2', settings.ramdisk_image_settings.format) self.assertTrue(settings.exists) self.assertTrue(settings.public) def test_config_all_url(self): settings = ImageSettings( **{'name': 'foo', 'image_user': 'bar', 'format': 'qcow2', 'download_url': 'http://foo.com', 'extra_properties': '{\'hw_video_model\': \'vga\'}', 'nic_config_pb_loc': '/foo/bar', 'kernel_image_settings': { 'name': 'kernel', 'download_url': 'http://kernel.com', 'image_user': 'bar', 'format': 'qcow2'}, 'ramdisk_image_settings': { 'name': 'ramdisk', 'download_url': 'http://ramdisk.com', 'image_user': 'bar', 'format': 'qcow2'}, 'exists': True, 'public': True}) self.assertEqual('foo', settings.name) self.assertEqual('bar', settings.image_user) self.assertEqual('qcow2', settings.format) self.assertEqual('http://foo.com', settings.url) self.assertEqual('{\'hw_video_model\': \'vga\'}', settings.extra_properties) self.assertIsNone(settings.image_file) self.assertEqual('/foo/bar', settings.nic_config_pb_loc) self.assertEqual('kernel', settings.kernel_image_settings.name) self.assertEqual('http://kernel.com', settings.kernel_image_settings.url) self.assertEqual('ramdisk', settings.ramdisk_image_settings.name) self.assertEqual('http://ramdisk.com', settings.ramdisk_image_settings.url) self.assertTrue(settings.exists) self.assertTrue(settings.public) def test_all_file(self): properties = {'hw_video_model': 'vga'} settings = ImageSettings(name='foo', image_user='bar', img_format='qcow2', image_file='/foo/bar.qcow', extra_properties=properties, nic_config_pb_loc='/foo/bar', exists=True, public=True) self.assertEqual('foo', settings.name) self.assertEqual('bar', settings.image_user) self.assertEqual('qcow2', settings.format) self.assertIsNone(settings.url) self.assertEqual('/foo/bar.qcow', settings.image_file) self.assertEqual(properties, settings.extra_properties) self.assertEqual('/foo/bar', settings.nic_config_pb_loc) self.assertTrue(settings.exists) self.assertTrue(settings.public) def test_config_all_file(self): settings = ImageSettings( **{'name': 'foo', 'image_user': 'bar', 'format': 'qcow2', 'image_file': '/foo/bar.qcow', 'extra_properties': '{\'hw_video_model\' : \'vga\'}', 'nic_config_pb_loc': '/foo/bar', 'exists': True, 'public': True}) self.assertEqual('foo', settings.name) self.assertEqual('bar', settings.image_user) self.assertEqual('qcow2', settings.format) self.assertIsNone(settings.url) self.assertEqual('/foo/bar.qcow', settings.image_file) self.assertEqual('{\'hw_video_model\' : \'vga\'}', settings.extra_properties) self.assertEqual('/foo/bar', settings.nic_config_pb_loc) self.assertTrue(settings.exists) self.assertTrue(settings.public) class CreateImageSuccessTests(OSIntegrationTestCase): """ Test for the CreateImage class defined in create_image.py """ def setUp(self): """ Instantiates the CreateImage object that is responsible for downloading and creating an OS image file within OpenStack """ super(self.__class__, self).__start__() guid = uuid.uuid4() self.image_name = self.__class__.__name__ + '-' + str(guid) self.glance = glance_utils.glance_client(self.os_creds) self.image_creator = None if self.image_metadata and 'glance_tests' in self.image_metadata: glance_test_meta = self.image_metadata['glance_tests'] else: glance_test_meta = None self.tmp_dir = 'tmp/' + str(guid) if not os.path.exists(self.tmp_dir): os.makedirs(self.tmp_dir) self.image_settings = openstack_tests.cirros_image_settings( name=self.image_name, image_metadata=glance_test_meta) def tearDown(self): """ Cleans the image and downloaded image file """ if self.image_creator: self.image_creator.clean() if os.path.exists(self.tmp_dir) and os.path.isdir(self.tmp_dir): shutil.rmtree(self.tmp_dir) super(self.__class__, self).__clean__() def test_create_image_clean_url(self): """ Tests the creation of an OpenStack image from a URL. """ # Create Image # Set the default image settings, then set any custom parameters sent # from the app self.image_creator = create_image.OpenStackImage(self.os_creds, self.image_settings) created_image = self.image_creator.create() self.assertIsNotNone(created_image) retrieved_image = glance_utils.get_image( self.glance, image_settings=self.image_settings) self.assertIsNotNone(retrieved_image) self.assertEqual(created_image.size, retrieved_image.size) self.assertEqual(get_image_size(self.image_settings), retrieved_image.size) self.assertEqual(created_image.name, retrieved_image.name) self.assertEqual(created_image.id, retrieved_image.id) def test_create_image_clean_url_properties(self): """ Tests the creation of an OpenStack image from a URL and set properties. """ # Create Image # Set the default image settings, then set any custom parameters sent # from the app self.image_creator = create_image.OpenStackImage(self.os_creds, self.image_settings) created_image = self.image_creator.create() self.assertIsNotNone(created_image) retrieved_image = glance_utils.get_image( self.glance, image_settings=self.image_settings) self.assertIsNotNone(retrieved_image) self.assertEqual(self.image_creator.get_image().size, retrieved_image.size) self.assertEqual(get_image_size(self.image_settings), retrieved_image.size) self.assertEqual(created_image.name, retrieved_image.name) self.assertEqual(created_image.id, retrieved_image.id) self.assertEqual(created_image.properties, retrieved_image.properties) def test_create_image_clean_file(self): """ Tests the creation of an OpenStack image from a file. """ if not self.image_settings.image_file and self.image_settings.url: # Download the file of the image image_file_name = file_utils.download(self.image_settings.url, self.tmp_dir).name else: image_file_name = self.image_settings.image_file if image_file_name: file_image_settings = openstack_tests.file_image_test_settings( name=self.image_name, file_path=image_file_name) self.image_creator = create_image.OpenStackImage( self.os_creds, file_image_settings) created_image = self.image_creator.create() self.assertIsNotNone(created_image) self.assertEqual(self.image_name, created_image.name) retrieved_image = glance_utils.get_image( self.glance, image_settings=file_image_settings) self.assertIsNotNone(retrieved_image) self.assertEqual(self.image_creator.get_image().size, retrieved_image.size) self.assertEqual(get_image_size(file_image_settings), retrieved_image.size) self.assertEqual(created_image.name, retrieved_image.name) self.assertEqual(created_image.id, retrieved_image.id) else: logger.warn( 'Test not executed as the image metadata requires image files') def test_create_delete_image(self): """ Tests the creation then deletion of an OpenStack image to ensure clean() does not raise an Exception. """ # Create Image self.image_creator = create_image.OpenStackImage(self.os_creds, self.image_settings) created_image = self.image_creator.create() self.assertIsNotNone(created_image) retrieved_image = glance_utils.get_image( self.glance, image_settings=self.image_settings) self.assertIsNotNone(retrieved_image) self.assertEqual(self.image_creator.get_image().size, retrieved_image.size) self.assertEqual(get_image_size(self.image_settings), retrieved_image.size) # Delete Image manually glance_utils.delete_image(self.glance, created_image) self.assertIsNone(glance_utils.get_image( self.glance, image_settings=self.image_creator.image_settings)) # Must not throw an exception when attempting to cleanup non-existent # image self.image_creator.clean() self.assertIsNone(self.image_creator.get_image()) def test_create_same_image(self): """ Tests the creation of an OpenStack image when the image already exists. """ # Create Image self.image_creator = create_image.OpenStackImage(self.os_creds, self.image_settings) image1 = self.image_creator.create() retrieved_image = glance_utils.get_image( self.glance, image_settings=self.image_settings) self.assertIsNotNone(retrieved_image) self.assertEqual(self.image_creator.get_image().size, retrieved_image.size) self.assertEqual(get_image_size(self.image_settings), retrieved_image.size) self.assertEqual(image1.name, retrieved_image.name) self.assertEqual(image1.id, retrieved_image.id) self.assertEqual(image1.properties, retrieved_image.properties) # Should be retrieving the instance data os_image_2 = create_image.OpenStackImage(self.os_creds, self.image_settings) image2 = os_image_2.create() self.assertEqual(image1.id, image2.id) def test_create_same_image_new_settings(self): """ Tests the creation of an OpenStack image when the image already exists and the configuration only contains the name. """ # Create Image self.image_creator = create_image.OpenStackImage(self.os_creds, self.image_settings) image1 = self.image_creator.create() retrieved_image = glance_utils.get_image( self.glance, image_settings=self.image_settings) self.assertIsNotNone(retrieved_image) self.assertEqual(self.image_creator.get_image().size, retrieved_image.size) self.assertEqual(get_image_size(self.image_settings), retrieved_image.size) self.assertEqual(image1.name, retrieved_image.name) self.assertEqual(image1.id, retrieved_image.id) self.assertEqual(image1.properties, retrieved_image.properties) # Should be retrieving the instance data image_2_settings = ImageSettings(name=self.image_settings.name, image_user='foo', exists=True) os_image_2 = create_image.OpenStackImage(self.os_creds, image_2_settings) image2 = os_image_2.create() self.assertEqual(image1.id, image2.id) class CreateImageNegativeTests(OSIntegrationTestCase): """ Negative test cases for the CreateImage class """ def setUp(self): super(self.__class__, self).__start__() self.image_name = self.__class__.__name__ + '-' + str(uuid.uuid4()) self.image_creator = None def tearDown(self): if self.image_creator: self.image_creator.clean() super(self.__class__, self).__clean__() def test_bad_image_name(self): """ Expect an ImageCreationError when the image name does not exist when a file or URL has not been configured """ os_image_settings = ImageSettings(name='foo', image_user='bar', exists=True) self.image_creator = create_image.OpenStackImage(self.os_creds, os_image_settings) with self.assertRaises(ImageCreationError): self.image_creator.create() self.fail('ImageCreationError should have been raised prior to' 'this line') def test_bad_image_url(self): """ Expect an ImageCreationError when the image download url is bad """ os_image_settings = openstack_tests.cirros_image_settings( name=self.image_name) self.image_creator = create_image.OpenStackImage( self.os_creds, create_image.ImageSettings(name=os_image_settings.name, image_user=os_image_settings.image_user, img_format=os_image_settings.format, url="http://foo.bar")) try: self.image_creator.create() except HTTPBadRequest: pass except URLError: pass except Exception as e: self.fail('Invalid Exception ' + str(e)) def test_bad_image_image_type(self): """ Expect an ImageCreationError when the image type bad """ os_image_settings = openstack_tests.cirros_image_settings( name=self.image_name) self.image_creator = create_image.OpenStackImage( self.os_creds, create_image.ImageSettings(name=os_image_settings.name, image_user=os_image_settings.image_user, img_format='foo', url=os_image_settings.url)) with self.assertRaises(Exception): self.image_creator.create() def test_bad_image_file(self): """ Expect an ImageCreationError when the image file does not exist """ os_image_settings = openstack_tests.cirros_image_settings( name=self.image_name) self.image_creator = create_image.OpenStackImage( self.os_creds, create_image.ImageSettings(name=os_image_settings.name, image_user=os_image_settings.image_user, img_format=os_image_settings.format, image_file="/foo/bar.qcow")) with self.assertRaises(IOError): self.image_creator.create() class CreateMultiPartImageTests(OSIntegrationTestCase): """ Test different means for creating a 3-part images """ def setUp(self): """ Instantiates the CreateImage object that is responsible for downloading and creating an OS image file within OpenStack """ super(self.__class__, self).__start__() guid = uuid.uuid4() self.image_creators = list() self.image_name = self.__class__.__name__ + '-' + str(guid) self.glance = glance_utils.glance_client(self.os_creds) self.tmp_dir = 'tmp/' + str(guid) if not os.path.exists(self.tmp_dir): os.makedirs(self.tmp_dir) if self.image_metadata and 'glance_tests' in self.image_metadata: self.glance_test_meta = self.image_metadata['glance_tests'] else: self.glance_test_meta = dict() def tearDown(self): """ Cleans the images and downloaded image file """ for image_creator in self.image_creators: image_creator.clean() if os.path.exists(self.tmp_dir) and os.path.isdir(self.tmp_dir): shutil.rmtree(self.tmp_dir) super(self.__class__, self).__clean__() def test_create_three_part_image_from_url(self): """ Tests the creation of a 3-part OpenStack image from a URL. """ # Create the kernel image if 'disk_file' not in self.glance_test_meta: image_settings = openstack_tests.cirros_image_settings( name=self.image_name, image_metadata={ 'disk_url': openstack_tests.CIRROS_DEFAULT_IMAGE_URL, 'kernel_url': openstack_tests.CIRROS_DEFAULT_KERNEL_IMAGE_URL, 'ramdisk_url': openstack_tests.CIRROS_DEFAULT_RAMDISK_IMAGE_URL}) image_creator = create_image.OpenStackImage(self.os_creds, image_settings) self.image_creators.append(image_creator) image_creator.create() main_image = glance_utils.get_image(self.glance, image_settings=image_settings) self.assertIsNotNone(main_image) self.assertIsNotNone(image_creator.get_image()) self.assertEqual(image_creator.get_image().id, main_image.id) kernel_image = glance_utils.get_image( self.glance, image_settings=image_settings.kernel_image_settings) self.assertIsNotNone(kernel_image) self.assertIsNotNone(image_creator.get_kernel_image()) self.assertEqual(kernel_image.id, image_creator.get_kernel_image().id) ramdisk_image = glance_utils.get_image( self.glance, image_settings=image_settings.ramdisk_image_settings) self.assertIsNotNone(ramdisk_image) self.assertIsNotNone(image_creator.get_ramdisk_image()) self.assertEqual(ramdisk_image.id, image_creator.get_ramdisk_image().id) else: logger.warn( 'Test not executed as the image metadata requires image files') def test_create_three_part_image_from_file_3_creators(self): """ Tests the creation of a 3-part OpenStack image from files. """ file_only = False # Set properties properties = {} if self.glance_test_meta: if 'extra_properties' in self.glance_test_meta: properties = self.glance_test_meta['extra_properties'] if 'disk_file' in self.glance_test_meta: file_only = True # Create the kernel image kernel_file_name = None kernel_url = openstack_tests.CIRROS_DEFAULT_KERNEL_IMAGE_URL if 'kernel_file' in self.glance_test_meta: kernel_file_name = self.glance_test_meta['kernel_file'] elif 'kernel_url' in self.glance_test_meta: kernel_url = self.glance_test_meta['kernel_url'] else: kernel_url = openstack_tests.CIRROS_DEFAULT_KERNEL_IMAGE_URL if not kernel_file_name and not file_only: kernel_file_name = file_utils.download(kernel_url, self.tmp_dir).name else: logger.warn('Will not download the kernel image.' ' Cannot execute test') return kernel_file_image_settings = openstack_tests.file_image_test_settings( name=self.image_name + '_kernel', file_path=kernel_file_name) self.image_creators.append(create_image.OpenStackImage( self.os_creds, kernel_file_image_settings)) kernel_image = self.image_creators[-1].create() self.assertIsNotNone(kernel_image) self.assertEqual(get_image_size(kernel_file_image_settings), kernel_image.size) # Create the ramdisk image ramdisk_file_name = None ramdisk_url = openstack_tests.CIRROS_DEFAULT_RAMDISK_IMAGE_URL if 'ramdisk_file' in self.glance_test_meta: ramdisk_file_name = self.glance_test_meta['ramdisk_file'] elif 'ramdisk_url' in self.glance_test_meta: ramdisk_url = self.glance_test_meta['ramdisk_url'] if not ramdisk_file_name and not file_only: ramdisk_file_name = file_utils.download(ramdisk_url, self.tmp_dir).name else: logger.warn('Will not download the ramdisk image.' ' Cannot execute test') return ramdisk_file_image_settings = openstack_tests.file_image_test_settings( name=self.image_name + '_ramdisk', file_path=ramdisk_file_name) self.image_creators.append(create_image.OpenStackImage( self.os_creds, ramdisk_file_image_settings)) ramdisk_image = self.image_creators[-1].create() self.assertIsNotNone(ramdisk_image) self.assertEqual(get_image_size(ramdisk_file_image_settings), ramdisk_image.size) # Create the main disk image disk_file_name = None disk_url = openstack_tests.CIRROS_DEFAULT_IMAGE_URL if 'disk_file' in self.glance_test_meta: disk_file_name = self.glance_test_meta['disk_file'] elif 'disk_url' in self.glance_test_meta: disk_url = self.glance_test_meta['disk_url'] if not disk_file_name and not file_only: disk_file_name = file_utils.download(disk_url, self.tmp_dir).name else: logger.warn('Will not download the disk file image.' ' Cannot execute test') return file_image_settings = openstack_tests.file_image_test_settings( name=self.image_name, file_path=disk_file_name) properties['kernel_id'] = kernel_image.id properties['ramdisk_id'] = ramdisk_image.id file_image_settings.extra_properties = properties self.image_creators.append( create_image.OpenStackImage(self.os_creds, file_image_settings)) created_image = self.image_creators[-1].create() self.assertIsNotNone(created_image) self.assertEqual(self.image_name, created_image.name) retrieved_image = glance_utils.get_image( self.glance, image_settings=file_image_settings) self.assertIsNotNone(retrieved_image) self.assertEqual(self.image_creators[-1].get_image().size, retrieved_image.size) self.assertEqual(get_image_size(file_image_settings), retrieved_image.size) self.assertEqual(created_image.name, retrieved_image.name) self.assertEqual(created_image.id, retrieved_image.id) self.assertEqual(created_image.properties, retrieved_image.properties) def test_create_three_part_image_from_url_3_creators(self): """ Tests the creation of a 3-part OpenStack image from a URL. """ if 'disk_file' not in self.glance_test_meta: # Set properties properties = {} if self.glance_test_meta and \ 'extra_properties' in self.glance_test_meta: properties = self.glance_test_meta['extra_properties'] # Create the kernel image kernel_image_settings = openstack_tests.cirros_image_settings( name=self.image_name + '_kernel', url=openstack_tests.CIRROS_DEFAULT_KERNEL_IMAGE_URL) if self.glance_test_meta: if 'kernel_url' in self.glance_test_meta: kernel_image_settings.url = self.glance_test_meta[ 'kernel_url'] self.image_creators.append( create_image.OpenStackImage(self.os_creds, kernel_image_settings)) kernel_image = self.image_creators[-1].create() self.assertIsNotNone(kernel_image) self.assertEqual(get_image_size(kernel_image_settings), kernel_image.size) # Create the ramdisk image ramdisk_image_settings = openstack_tests.cirros_image_settings( name=self.image_name + '_ramdisk', url=openstack_tests.CIRROS_DEFAULT_RAMDISK_IMAGE_URL) if self.glance_test_meta: if 'ramdisk_url' in self.glance_test_meta: ramdisk_image_settings.url = self.glance_test_meta[ 'ramdisk_url'] self.image_creators.append( create_image.OpenStackImage(self.os_creds, ramdisk_image_settings)) ramdisk_image = self.image_creators[-1].create() self.assertIsNotNone(ramdisk_image) self.assertEqual(get_image_size(ramdisk_image_settings), ramdisk_image.size) # Create the main image os_image_settings = openstack_tests.cirros_image_settings( name=self.image_name, url=openstack_tests.CIRROS_DEFAULT_IMAGE_URL) if self.glance_test_meta: if 'disk_url' in self.glance_test_meta: os_image_settings.url = self.glance_test_meta['disk_url'] properties['kernel_id'] = kernel_image.id properties['ramdisk_id'] = ramdisk_image.id os_image_settings.extra_properties = properties self.image_creators.append( create_image.OpenStackImage(self.os_creds, os_image_settings)) created_image = self.image_creators[-1].create() self.assertIsNotNone(created_image) self.assertEqual(self.image_name, created_image.name) retrieved_image = glance_utils.get_image( self.glance, image_settings=os_image_settings) self.assertIsNotNone(retrieved_image) self.assertEqual(self.image_creators[-1].get_image().size, retrieved_image.size) self.assertEqual(get_image_size(os_image_settings), retrieved_image.size) self.assertEqual(created_image.name, retrieved_image.name) self.assertEqual(created_image.id, retrieved_image.id) self.assertEqual(created_image.properties, retrieved_image.properties) else: logger.warn( 'Test not executed as the image metadata requires image files') def get_image_size(image_settings): """ Returns the expected image size :return: """ if image_settings.image_file: return os.path.getsize(image_settings.image_file) elif image_settings.url: return int(file_utils.get_content_length(image_settings.url)) else: raise Exception( 'Cannot retrieve expected image size. Image filename or URL has ' 'not been configured')
43.109903
79
0.620143
from glanceclient.exc import HTTPBadRequest try: from urllib.request import URLError except ImportError: from urllib2 import URLError import logging import shutil import unittest import uuid import os from snaps import file_utils from snaps.openstack import create_image from snaps.openstack.create_image import (ImageSettings, ImageCreationError, ImageSettingsError) from snaps.openstack.tests import openstack_tests from snaps.openstack.tests.os_source_file_test import OSIntegrationTestCase from snaps.openstack.utils import glance_utils __author__ = 'spisarski' logger = logging.getLogger('create_image_tests') class ImageSettingsUnitTests(unittest.TestCase): def test_no_params(self): with self.assertRaises(ImageSettingsError): ImageSettings() def test_empty_config(self): with self.assertRaises(ImageSettingsError): ImageSettings(**dict()) def test_name_only(self): with self.assertRaises(ImageSettingsError): ImageSettings(name='foo') def test_config_with_name_only(self): with self.assertRaises(ImageSettingsError): ImageSettings(**{'name': 'foo'}) def test_name_user_only(self): with self.assertRaises(ImageSettingsError): ImageSettings(name='foo', image_user='bar') def test_config_with_name_user_only(self): with self.assertRaises(ImageSettingsError): ImageSettings(**{'name': 'foo', 'image_user': 'bar'}) def test_name_user_format_only(self): with self.assertRaises(ImageSettingsError): ImageSettings(name='foo', image_user='bar', img_format='qcow2') def test_config_with_name_user_format_only(self): with self.assertRaises(ImageSettingsError): ImageSettings( **{'name': 'foo', 'image_user': 'bar', 'format': 'qcow2'}) def test_name_user_format_url_only(self): settings = ImageSettings(name='foo', image_user='bar', img_format='qcow2', url='http://foo.com') self.assertEqual('foo', settings.name) self.assertEqual('bar', settings.image_user) self.assertEqual('qcow2', settings.format) self.assertEqual('http://foo.com', settings.url) self.assertIsNone(settings.image_file) self.assertFalse(settings.exists) self.assertFalse(settings.public) self.assertIsNone(settings.nic_config_pb_loc) def test_name_user_format_url_only_properties(self): properties = {'hw_video_model': 'vga'} settings = ImageSettings(name='foo', image_user='bar', img_format='qcow2', url='http://foo.com', extra_properties=properties) self.assertEqual('foo', settings.name) self.assertEqual('bar', settings.image_user) self.assertEqual('qcow2', settings.format) self.assertEqual('http://foo.com', settings.url) self.assertEqual(properties, settings.extra_properties) self.assertIsNone(settings.image_file) self.assertFalse(settings.exists) self.assertFalse(settings.public) self.assertIsNone(settings.nic_config_pb_loc) def test_config_with_name_user_format_url_only(self): settings = ImageSettings( **{'name': 'foo', 'image_user': 'bar', 'format': 'qcow2', 'download_url': 'http://foo.com'}) self.assertEqual('foo', settings.name) self.assertEqual('bar', settings.image_user) self.assertEqual('qcow2', settings.format) self.assertEqual('http://foo.com', settings.url) self.assertIsNone(settings.image_file) self.assertFalse(settings.exists) self.assertFalse(settings.public) self.assertIsNone(settings.nic_config_pb_loc) def test_name_user_format_file_only(self): settings = ImageSettings(name='foo', image_user='bar', img_format='qcow2', image_file='/foo/bar.qcow') self.assertEqual('foo', settings.name) self.assertEqual('bar', settings.image_user) self.assertEqual('qcow2', settings.format) self.assertIsNone(settings.url) self.assertEqual('/foo/bar.qcow', settings.image_file) self.assertFalse(settings.exists) self.assertFalse(settings.public) self.assertIsNone(settings.nic_config_pb_loc) def test_config_with_name_user_format_file_only(self): settings = ImageSettings( **{'name': 'foo', 'image_user': 'bar', 'format': 'qcow2', 'image_file': '/foo/bar.qcow'}) self.assertEqual('foo', settings.name) self.assertEqual('bar', settings.image_user) self.assertEqual('qcow2', settings.format) self.assertIsNone(settings.url) self.assertEqual('/foo/bar.qcow', settings.image_file) self.assertFalse(settings.exists) self.assertFalse(settings.public) self.assertIsNone(settings.nic_config_pb_loc) def test_all_url(self): properties = {'hw_video_model': 'vga'} kernel_settings = ImageSettings(name='kernel', url='http://kernel.com', image_user='bar', img_format='qcow2') ramdisk_settings = ImageSettings(name='ramdisk', url='http://ramdisk.com', image_user='bar', img_format='qcow2') settings = ImageSettings(name='foo', image_user='bar', img_format='qcow2', url='http://foo.com', extra_properties=properties, nic_config_pb_loc='/foo/bar', kernel_image_settings=kernel_settings, ramdisk_image_settings=ramdisk_settings, exists=True, public=True) self.assertEqual('foo', settings.name) self.assertEqual('bar', settings.image_user) self.assertEqual('qcow2', settings.format) self.assertEqual('http://foo.com', settings.url) self.assertEqual(properties, settings.extra_properties) self.assertIsNone(settings.image_file) self.assertEqual('/foo/bar', settings.nic_config_pb_loc) self.assertEqual('kernel', settings.kernel_image_settings.name) self.assertEqual('http://kernel.com', settings.kernel_image_settings.url) self.assertEqual('bar', settings.kernel_image_settings.image_user) self.assertEqual('qcow2', settings.kernel_image_settings.format) self.assertEqual('ramdisk', settings.ramdisk_image_settings.name) self.assertEqual('http://ramdisk.com', settings.ramdisk_image_settings.url) self.assertEqual('bar', settings.ramdisk_image_settings.image_user) self.assertEqual('qcow2', settings.ramdisk_image_settings.format) self.assertTrue(settings.exists) self.assertTrue(settings.public) def test_config_all_url(self): settings = ImageSettings( **{'name': 'foo', 'image_user': 'bar', 'format': 'qcow2', 'download_url': 'http://foo.com', 'extra_properties': '{\'hw_video_model\': \'vga\'}', 'nic_config_pb_loc': '/foo/bar', 'kernel_image_settings': { 'name': 'kernel', 'download_url': 'http://kernel.com', 'image_user': 'bar', 'format': 'qcow2'}, 'ramdisk_image_settings': { 'name': 'ramdisk', 'download_url': 'http://ramdisk.com', 'image_user': 'bar', 'format': 'qcow2'}, 'exists': True, 'public': True}) self.assertEqual('foo', settings.name) self.assertEqual('bar', settings.image_user) self.assertEqual('qcow2', settings.format) self.assertEqual('http://foo.com', settings.url) self.assertEqual('{\'hw_video_model\': \'vga\'}', settings.extra_properties) self.assertIsNone(settings.image_file) self.assertEqual('/foo/bar', settings.nic_config_pb_loc) self.assertEqual('kernel', settings.kernel_image_settings.name) self.assertEqual('http://kernel.com', settings.kernel_image_settings.url) self.assertEqual('ramdisk', settings.ramdisk_image_settings.name) self.assertEqual('http://ramdisk.com', settings.ramdisk_image_settings.url) self.assertTrue(settings.exists) self.assertTrue(settings.public) def test_all_file(self): properties = {'hw_video_model': 'vga'} settings = ImageSettings(name='foo', image_user='bar', img_format='qcow2', image_file='/foo/bar.qcow', extra_properties=properties, nic_config_pb_loc='/foo/bar', exists=True, public=True) self.assertEqual('foo', settings.name) self.assertEqual('bar', settings.image_user) self.assertEqual('qcow2', settings.format) self.assertIsNone(settings.url) self.assertEqual('/foo/bar.qcow', settings.image_file) self.assertEqual(properties, settings.extra_properties) self.assertEqual('/foo/bar', settings.nic_config_pb_loc) self.assertTrue(settings.exists) self.assertTrue(settings.public) def test_config_all_file(self): settings = ImageSettings( **{'name': 'foo', 'image_user': 'bar', 'format': 'qcow2', 'image_file': '/foo/bar.qcow', 'extra_properties': '{\'hw_video_model\' : \'vga\'}', 'nic_config_pb_loc': '/foo/bar', 'exists': True, 'public': True}) self.assertEqual('foo', settings.name) self.assertEqual('bar', settings.image_user) self.assertEqual('qcow2', settings.format) self.assertIsNone(settings.url) self.assertEqual('/foo/bar.qcow', settings.image_file) self.assertEqual('{\'hw_video_model\' : \'vga\'}', settings.extra_properties) self.assertEqual('/foo/bar', settings.nic_config_pb_loc) self.assertTrue(settings.exists) self.assertTrue(settings.public) class CreateImageSuccessTests(OSIntegrationTestCase): def setUp(self): super(self.__class__, self).__start__() guid = uuid.uuid4() self.image_name = self.__class__.__name__ + '-' + str(guid) self.glance = glance_utils.glance_client(self.os_creds) self.image_creator = None if self.image_metadata and 'glance_tests' in self.image_metadata: glance_test_meta = self.image_metadata['glance_tests'] else: glance_test_meta = None self.tmp_dir = 'tmp/' + str(guid) if not os.path.exists(self.tmp_dir): os.makedirs(self.tmp_dir) self.image_settings = openstack_tests.cirros_image_settings( name=self.image_name, image_metadata=glance_test_meta) def tearDown(self): if self.image_creator: self.image_creator.clean() if os.path.exists(self.tmp_dir) and os.path.isdir(self.tmp_dir): shutil.rmtree(self.tmp_dir) super(self.__class__, self).__clean__() def test_create_image_clean_url(self): self.image_creator = create_image.OpenStackImage(self.os_creds, self.image_settings) created_image = self.image_creator.create() self.assertIsNotNone(created_image) retrieved_image = glance_utils.get_image( self.glance, image_settings=self.image_settings) self.assertIsNotNone(retrieved_image) self.assertEqual(created_image.size, retrieved_image.size) self.assertEqual(get_image_size(self.image_settings), retrieved_image.size) self.assertEqual(created_image.name, retrieved_image.name) self.assertEqual(created_image.id, retrieved_image.id) def test_create_image_clean_url_properties(self): self.image_creator = create_image.OpenStackImage(self.os_creds, self.image_settings) created_image = self.image_creator.create() self.assertIsNotNone(created_image) retrieved_image = glance_utils.get_image( self.glance, image_settings=self.image_settings) self.assertIsNotNone(retrieved_image) self.assertEqual(self.image_creator.get_image().size, retrieved_image.size) self.assertEqual(get_image_size(self.image_settings), retrieved_image.size) self.assertEqual(created_image.name, retrieved_image.name) self.assertEqual(created_image.id, retrieved_image.id) self.assertEqual(created_image.properties, retrieved_image.properties) def test_create_image_clean_file(self): if not self.image_settings.image_file and self.image_settings.url: image_file_name = file_utils.download(self.image_settings.url, self.tmp_dir).name else: image_file_name = self.image_settings.image_file if image_file_name: file_image_settings = openstack_tests.file_image_test_settings( name=self.image_name, file_path=image_file_name) self.image_creator = create_image.OpenStackImage( self.os_creds, file_image_settings) created_image = self.image_creator.create() self.assertIsNotNone(created_image) self.assertEqual(self.image_name, created_image.name) retrieved_image = glance_utils.get_image( self.glance, image_settings=file_image_settings) self.assertIsNotNone(retrieved_image) self.assertEqual(self.image_creator.get_image().size, retrieved_image.size) self.assertEqual(get_image_size(file_image_settings), retrieved_image.size) self.assertEqual(created_image.name, retrieved_image.name) self.assertEqual(created_image.id, retrieved_image.id) else: logger.warn( 'Test not executed as the image metadata requires image files') def test_create_delete_image(self): self.image_creator = create_image.OpenStackImage(self.os_creds, self.image_settings) created_image = self.image_creator.create() self.assertIsNotNone(created_image) retrieved_image = glance_utils.get_image( self.glance, image_settings=self.image_settings) self.assertIsNotNone(retrieved_image) self.assertEqual(self.image_creator.get_image().size, retrieved_image.size) self.assertEqual(get_image_size(self.image_settings), retrieved_image.size) glance_utils.delete_image(self.glance, created_image) self.assertIsNone(glance_utils.get_image( self.glance, image_settings=self.image_creator.image_settings)) self.image_creator.clean() self.assertIsNone(self.image_creator.get_image()) def test_create_same_image(self): self.image_creator = create_image.OpenStackImage(self.os_creds, self.image_settings) image1 = self.image_creator.create() retrieved_image = glance_utils.get_image( self.glance, image_settings=self.image_settings) self.assertIsNotNone(retrieved_image) self.assertEqual(self.image_creator.get_image().size, retrieved_image.size) self.assertEqual(get_image_size(self.image_settings), retrieved_image.size) self.assertEqual(image1.name, retrieved_image.name) self.assertEqual(image1.id, retrieved_image.id) self.assertEqual(image1.properties, retrieved_image.properties) os_image_2 = create_image.OpenStackImage(self.os_creds, self.image_settings) image2 = os_image_2.create() self.assertEqual(image1.id, image2.id) def test_create_same_image_new_settings(self): self.image_creator = create_image.OpenStackImage(self.os_creds, self.image_settings) image1 = self.image_creator.create() retrieved_image = glance_utils.get_image( self.glance, image_settings=self.image_settings) self.assertIsNotNone(retrieved_image) self.assertEqual(self.image_creator.get_image().size, retrieved_image.size) self.assertEqual(get_image_size(self.image_settings), retrieved_image.size) self.assertEqual(image1.name, retrieved_image.name) self.assertEqual(image1.id, retrieved_image.id) self.assertEqual(image1.properties, retrieved_image.properties) image_2_settings = ImageSettings(name=self.image_settings.name, image_user='foo', exists=True) os_image_2 = create_image.OpenStackImage(self.os_creds, image_2_settings) image2 = os_image_2.create() self.assertEqual(image1.id, image2.id) class CreateImageNegativeTests(OSIntegrationTestCase): def setUp(self): super(self.__class__, self).__start__() self.image_name = self.__class__.__name__ + '-' + str(uuid.uuid4()) self.image_creator = None def tearDown(self): if self.image_creator: self.image_creator.clean() super(self.__class__, self).__clean__() def test_bad_image_name(self): os_image_settings = ImageSettings(name='foo', image_user='bar', exists=True) self.image_creator = create_image.OpenStackImage(self.os_creds, os_image_settings) with self.assertRaises(ImageCreationError): self.image_creator.create() self.fail('ImageCreationError should have been raised prior to' 'this line') def test_bad_image_url(self): os_image_settings = openstack_tests.cirros_image_settings( name=self.image_name) self.image_creator = create_image.OpenStackImage( self.os_creds, create_image.ImageSettings(name=os_image_settings.name, image_user=os_image_settings.image_user, img_format=os_image_settings.format, url="http://foo.bar")) try: self.image_creator.create() except HTTPBadRequest: pass except URLError: pass except Exception as e: self.fail('Invalid Exception ' + str(e)) def test_bad_image_image_type(self): os_image_settings = openstack_tests.cirros_image_settings( name=self.image_name) self.image_creator = create_image.OpenStackImage( self.os_creds, create_image.ImageSettings(name=os_image_settings.name, image_user=os_image_settings.image_user, img_format='foo', url=os_image_settings.url)) with self.assertRaises(Exception): self.image_creator.create() def test_bad_image_file(self): os_image_settings = openstack_tests.cirros_image_settings( name=self.image_name) self.image_creator = create_image.OpenStackImage( self.os_creds, create_image.ImageSettings(name=os_image_settings.name, image_user=os_image_settings.image_user, img_format=os_image_settings.format, image_file="/foo/bar.qcow")) with self.assertRaises(IOError): self.image_creator.create() class CreateMultiPartImageTests(OSIntegrationTestCase): def setUp(self): super(self.__class__, self).__start__() guid = uuid.uuid4() self.image_creators = list() self.image_name = self.__class__.__name__ + '-' + str(guid) self.glance = glance_utils.glance_client(self.os_creds) self.tmp_dir = 'tmp/' + str(guid) if not os.path.exists(self.tmp_dir): os.makedirs(self.tmp_dir) if self.image_metadata and 'glance_tests' in self.image_metadata: self.glance_test_meta = self.image_metadata['glance_tests'] else: self.glance_test_meta = dict() def tearDown(self): for image_creator in self.image_creators: image_creator.clean() if os.path.exists(self.tmp_dir) and os.path.isdir(self.tmp_dir): shutil.rmtree(self.tmp_dir) super(self.__class__, self).__clean__() def test_create_three_part_image_from_url(self): if 'disk_file' not in self.glance_test_meta: image_settings = openstack_tests.cirros_image_settings( name=self.image_name, image_metadata={ 'disk_url': openstack_tests.CIRROS_DEFAULT_IMAGE_URL, 'kernel_url': openstack_tests.CIRROS_DEFAULT_KERNEL_IMAGE_URL, 'ramdisk_url': openstack_tests.CIRROS_DEFAULT_RAMDISK_IMAGE_URL}) image_creator = create_image.OpenStackImage(self.os_creds, image_settings) self.image_creators.append(image_creator) image_creator.create() main_image = glance_utils.get_image(self.glance, image_settings=image_settings) self.assertIsNotNone(main_image) self.assertIsNotNone(image_creator.get_image()) self.assertEqual(image_creator.get_image().id, main_image.id) kernel_image = glance_utils.get_image( self.glance, image_settings=image_settings.kernel_image_settings) self.assertIsNotNone(kernel_image) self.assertIsNotNone(image_creator.get_kernel_image()) self.assertEqual(kernel_image.id, image_creator.get_kernel_image().id) ramdisk_image = glance_utils.get_image( self.glance, image_settings=image_settings.ramdisk_image_settings) self.assertIsNotNone(ramdisk_image) self.assertIsNotNone(image_creator.get_ramdisk_image()) self.assertEqual(ramdisk_image.id, image_creator.get_ramdisk_image().id) else: logger.warn( 'Test not executed as the image metadata requires image files') def test_create_three_part_image_from_file_3_creators(self): file_only = False properties = {} if self.glance_test_meta: if 'extra_properties' in self.glance_test_meta: properties = self.glance_test_meta['extra_properties'] if 'disk_file' in self.glance_test_meta: file_only = True kernel_file_name = None kernel_url = openstack_tests.CIRROS_DEFAULT_KERNEL_IMAGE_URL if 'kernel_file' in self.glance_test_meta: kernel_file_name = self.glance_test_meta['kernel_file'] elif 'kernel_url' in self.glance_test_meta: kernel_url = self.glance_test_meta['kernel_url'] else: kernel_url = openstack_tests.CIRROS_DEFAULT_KERNEL_IMAGE_URL if not kernel_file_name and not file_only: kernel_file_name = file_utils.download(kernel_url, self.tmp_dir).name else: logger.warn('Will not download the kernel image.' ' Cannot execute test') return kernel_file_image_settings = openstack_tests.file_image_test_settings( name=self.image_name + '_kernel', file_path=kernel_file_name) self.image_creators.append(create_image.OpenStackImage( self.os_creds, kernel_file_image_settings)) kernel_image = self.image_creators[-1].create() self.assertIsNotNone(kernel_image) self.assertEqual(get_image_size(kernel_file_image_settings), kernel_image.size) ramdisk_file_name = None ramdisk_url = openstack_tests.CIRROS_DEFAULT_RAMDISK_IMAGE_URL if 'ramdisk_file' in self.glance_test_meta: ramdisk_file_name = self.glance_test_meta['ramdisk_file'] elif 'ramdisk_url' in self.glance_test_meta: ramdisk_url = self.glance_test_meta['ramdisk_url'] if not ramdisk_file_name and not file_only: ramdisk_file_name = file_utils.download(ramdisk_url, self.tmp_dir).name else: logger.warn('Will not download the ramdisk image.' ' Cannot execute test') return ramdisk_file_image_settings = openstack_tests.file_image_test_settings( name=self.image_name + '_ramdisk', file_path=ramdisk_file_name) self.image_creators.append(create_image.OpenStackImage( self.os_creds, ramdisk_file_image_settings)) ramdisk_image = self.image_creators[-1].create() self.assertIsNotNone(ramdisk_image) self.assertEqual(get_image_size(ramdisk_file_image_settings), ramdisk_image.size) disk_file_name = None disk_url = openstack_tests.CIRROS_DEFAULT_IMAGE_URL if 'disk_file' in self.glance_test_meta: disk_file_name = self.glance_test_meta['disk_file'] elif 'disk_url' in self.glance_test_meta: disk_url = self.glance_test_meta['disk_url'] if not disk_file_name and not file_only: disk_file_name = file_utils.download(disk_url, self.tmp_dir).name else: logger.warn('Will not download the disk file image.' ' Cannot execute test') return file_image_settings = openstack_tests.file_image_test_settings( name=self.image_name, file_path=disk_file_name) properties['kernel_id'] = kernel_image.id properties['ramdisk_id'] = ramdisk_image.id file_image_settings.extra_properties = properties self.image_creators.append( create_image.OpenStackImage(self.os_creds, file_image_settings)) created_image = self.image_creators[-1].create() self.assertIsNotNone(created_image) self.assertEqual(self.image_name, created_image.name) retrieved_image = glance_utils.get_image( self.glance, image_settings=file_image_settings) self.assertIsNotNone(retrieved_image) self.assertEqual(self.image_creators[-1].get_image().size, retrieved_image.size) self.assertEqual(get_image_size(file_image_settings), retrieved_image.size) self.assertEqual(created_image.name, retrieved_image.name) self.assertEqual(created_image.id, retrieved_image.id) self.assertEqual(created_image.properties, retrieved_image.properties) def test_create_three_part_image_from_url_3_creators(self): if 'disk_file' not in self.glance_test_meta: properties = {} if self.glance_test_meta and \ 'extra_properties' in self.glance_test_meta: properties = self.glance_test_meta['extra_properties'] kernel_image_settings = openstack_tests.cirros_image_settings( name=self.image_name + '_kernel', url=openstack_tests.CIRROS_DEFAULT_KERNEL_IMAGE_URL) if self.glance_test_meta: if 'kernel_url' in self.glance_test_meta: kernel_image_settings.url = self.glance_test_meta[ 'kernel_url'] self.image_creators.append( create_image.OpenStackImage(self.os_creds, kernel_image_settings)) kernel_image = self.image_creators[-1].create() self.assertIsNotNone(kernel_image) self.assertEqual(get_image_size(kernel_image_settings), kernel_image.size) ramdisk_image_settings = openstack_tests.cirros_image_settings( name=self.image_name + '_ramdisk', url=openstack_tests.CIRROS_DEFAULT_RAMDISK_IMAGE_URL) if self.glance_test_meta: if 'ramdisk_url' in self.glance_test_meta: ramdisk_image_settings.url = self.glance_test_meta[ 'ramdisk_url'] self.image_creators.append( create_image.OpenStackImage(self.os_creds, ramdisk_image_settings)) ramdisk_image = self.image_creators[-1].create() self.assertIsNotNone(ramdisk_image) self.assertEqual(get_image_size(ramdisk_image_settings), ramdisk_image.size) os_image_settings = openstack_tests.cirros_image_settings( name=self.image_name, url=openstack_tests.CIRROS_DEFAULT_IMAGE_URL) if self.glance_test_meta: if 'disk_url' in self.glance_test_meta: os_image_settings.url = self.glance_test_meta['disk_url'] properties['kernel_id'] = kernel_image.id properties['ramdisk_id'] = ramdisk_image.id os_image_settings.extra_properties = properties self.image_creators.append( create_image.OpenStackImage(self.os_creds, os_image_settings)) created_image = self.image_creators[-1].create() self.assertIsNotNone(created_image) self.assertEqual(self.image_name, created_image.name) retrieved_image = glance_utils.get_image( self.glance, image_settings=os_image_settings) self.assertIsNotNone(retrieved_image) self.assertEqual(self.image_creators[-1].get_image().size, retrieved_image.size) self.assertEqual(get_image_size(os_image_settings), retrieved_image.size) self.assertEqual(created_image.name, retrieved_image.name) self.assertEqual(created_image.id, retrieved_image.id) self.assertEqual(created_image.properties, retrieved_image.properties) else: logger.warn( 'Test not executed as the image metadata requires image files') def get_image_size(image_settings): if image_settings.image_file: return os.path.getsize(image_settings.image_file) elif image_settings.url: return int(file_utils.get_content_length(image_settings.url)) else: raise Exception( 'Cannot retrieve expected image size. Image filename or URL has ' 'not been configured')
true
true
f70a721597372b0efa52b1d23b20e2d0f1387886
7,859
py
Python
benchmarks/f3_wrong_hints_permutations/scaling_nonlinear_software/10-19_7.py
EnricoMagnago/F3
c863215c318d7d5f258eb9be38c6962cf6863b52
[ "MIT" ]
3
2021-04-23T23:29:26.000Z
2022-03-23T10:00:30.000Z
benchmarks/f3_wrong_hints_permutations/scaling_nonlinear_software/10-19_7.py
EnricoMagnago/F3
c863215c318d7d5f258eb9be38c6962cf6863b52
[ "MIT" ]
null
null
null
benchmarks/f3_wrong_hints_permutations/scaling_nonlinear_software/10-19_7.py
EnricoMagnago/F3
c863215c318d7d5f258eb9be38c6962cf6863b52
[ "MIT" ]
1
2021-11-17T22:02:56.000Z
2021-11-17T22:02:56.000Z
from typing import FrozenSet, Tuple import pysmt.typing as types from pysmt.environment import Environment as PysmtEnv from pysmt.fnode import FNode from utils import symb_to_next from hint import Hint, Location def transition_system(env: PysmtEnv) -> Tuple[FrozenSet[FNode], FNode, FNode, FNode]: assert isinstance(env, PysmtEnv) mgr = env.formula_manager pc = mgr.Symbol("pc", types.INT) x = mgr.Symbol("x", types.INT) y = mgr.Symbol("y", types.INT) z = mgr.Symbol("z", types.INT) x_pc = symb_to_next(mgr, pc) x_x = symb_to_next(mgr, x) x_y = symb_to_next(mgr, y) x_z = symb_to_next(mgr, z) symbols = frozenset([pc, x, y, z]) n_locs = 5 int_bound = n_locs pcs = [] x_pcs = [] ints = [mgr.Int(i) for i in range(int_bound)] for l in range(n_locs): n = ints[l] pcs.append(mgr.Equals(pc, n)) x_pcs.append(mgr.Equals(x_pc, n)) m_1 = mgr.Int(-1) pcend = mgr.Equals(pc, m_1) x_pcend = mgr.Equals(x_pc, m_1) # initial location. init = pcs[0] # control flow graph. cfg = mgr.And( # pc = -1 : -1, mgr.Implies(pcend, x_pcend), # pc = 0 & !(y >= 1) : -1, mgr.Implies(mgr.And(pcs[0], mgr.Not(mgr.GE(y, ints[1]))), x_pcend), # pc = 0 & y >= 1 : 1, mgr.Implies(mgr.And(pcs[0], mgr.GE(y, ints[1])), x_pcs[1]), # pc = 1 & !(z >= 1) : -1, mgr.Implies(mgr.And(pcs[1], mgr.Not(mgr.GE(z, ints[1]))), x_pcend), # pc = 1 & z >= 1 : 2, mgr.Implies(mgr.And(pcs[1], mgr.GE(z, ints[1])), x_pcs[2]), # pc = 2 & !(x >= 0) : -1, mgr.Implies(mgr.And(pcs[2], mgr.Not(mgr.GE(x, ints[0]))), x_pcend), # pc = 2 & x >= 0 : 3, mgr.Implies(mgr.And(pcs[2], mgr.GE(x, ints[0])), x_pcs[3]), # pc = 3 : 4, mgr.Implies(pcs[3], x_pcs[4]), # pc = 4 : 2, mgr.Implies(pcs[4], x_pcs[2])) # transition labels. labels = mgr.And( # (pc = -1 & pc' = -1) -> (x' = x & y' = y & z' = z), mgr.Implies( mgr.And(pcend, x_pcend), mgr.And(mgr.Equals(x_x, x), mgr.Equals(x_y, y), mgr.Equals(x_z, z))), # (pc = 0 & pc' = -1) -> (x' = x & y' = y & z' = z), mgr.Implies( mgr.And(pcs[0], x_pcend), mgr.And(mgr.Equals(x_x, x), mgr.Equals(x_y, y), mgr.Equals(x_z, z))), # (pc = 0 & pc' = 1) -> (x' = x & y' = y & z' = z), mgr.Implies( mgr.And(pcs[0], x_pcs[1]), mgr.And(mgr.Equals(x_x, x), mgr.Equals(x_y, y), mgr.Equals(x_z, z))), # (pc = 1 & pc' = -1) -> (x' = x & y' = y & z' = z), mgr.Implies( mgr.And(pcs[1], x_pcend), mgr.And(mgr.Equals(x_x, x), mgr.Equals(x_y, y), mgr.Equals(x_z, z))), # (pc = 1 & pc' = 2) -> (x' = x & y' = y & z' = z), mgr.Implies( mgr.And(pcs[1], x_pcs[2]), mgr.And(mgr.Equals(x_x, x), mgr.Equals(x_y, y), mgr.Equals(x_z, z))), # (pc = 2 & pc' = -1) -> (x' = x & y' = y & z' = z), mgr.Implies( mgr.And(pcs[2], x_pcend), mgr.And(mgr.Equals(x_x, x), mgr.Equals(x_y, y), mgr.Equals(x_z, z))), # (pc = 2 & pc' = 3) -> (x' = x & y' = y & z' = z), mgr.Implies( mgr.And(pcs[2], x_pcs[3]), mgr.And(mgr.Equals(x_x, x), mgr.Equals(x_y, y), mgr.Equals(x_z, z))), # (pc = 3 & pc' = 4) -> (x' = y*z - 1 & y' = y & z' = z), mgr.Implies( mgr.And(pcs[3], x_pcs[4]), mgr.And(mgr.Equals(x_x, mgr.Minus(mgr.Times(y, z), ints[1])), mgr.Equals(x_y, y), mgr.Equals(x_z, z))), # (pc = 4 & pc' = 2) -> (x' = x & y' = y+1 & z' = z), mgr.Implies( mgr.And(pcs[4], x_pcs[2]), mgr.And(mgr.Equals(x_x, x), mgr.Equals(x_y, mgr.Plus(y, ints[1])), mgr.Equals(x_z, z)))) # transition relation. trans = mgr.And(cfg, labels) # fairness. fairness = mgr.Not(pcend) return symbols, init, trans, fairness def hints(env: PysmtEnv) -> FrozenSet[Hint]: assert isinstance(env, PysmtEnv) mgr = env.formula_manager pc = mgr.Symbol("pc", types.INT) x = mgr.Symbol("x", types.INT) y = mgr.Symbol("y", types.INT) z = mgr.Symbol("z", types.INT) symbs = frozenset([pc, x, y, z]) x_pc = symb_to_next(mgr, pc) x_x = symb_to_next(mgr, x) x_y = symb_to_next(mgr, y) x_z = symb_to_next(mgr, z) res = [] i_0 = mgr.Int(0) i_1 = mgr.Int(1) i_2 = mgr.Int(2) i_3 = mgr.Int(3) loc0 = Location(env, mgr.Equals(pc, i_2)) loc0.set_progress(1, mgr.GT(x_pc, i_2)) loc1 = Location(env, mgr.GE(pc, i_3)) loc1.set_progress(0, mgr.Equals(x_pc, i_2)) h_pc = Hint("h_pc3", env, frozenset([pc]), symbs) h_pc.set_locs([loc0, loc1]) res.append(h_pc) stutter = mgr.Equals(x_x, x) loc0 = Location(env, mgr.GT(x, i_0), mgr.And(mgr.GT(y, i_1), mgr.GT(z, i_1))) loc0.set_progress(1, mgr.GE(x_x, mgr.Minus(mgr.Times(y, z), i_1))) loc1 = Location(env, mgr.GT(x, i_0)) loc1.set_progress(0, mgr.Equals(x_x, mgr.Plus(x, i_1))) h_x = Hint("h_x2", env, frozenset([x]), symbs) h_x.set_locs([loc0, loc1]) res.append(h_x) loc0 = Location(env, mgr.GE(z, i_3), mgr.GE(y, i_0)) loc0.set_progress(1, mgr.Equals(x_z, y)) loc1 = Location(env, mgr.GE(z, i_0), mgr.GE(x, i_3)) loc1.set_progress(0, mgr.GE(x_z, mgr.Plus(z, x))) h_z = Hint("h_z3", env, frozenset([z]), symbs) h_z.set_locs([loc0, loc1]) res.append(h_z) loc0 = Location(env, mgr.GE(y, i_3)) loc0.set_progress(1, mgr.Equals(x_y, mgr.Plus(y, i_1))) loc1 = Location(env, mgr.GE(y, i_3), mgr.GE(x, i_2)) loc1.set_progress(0, mgr.Equals(x_y, mgr.Plus(y, x))) h_y = Hint("h_y3", env, frozenset([y]), symbs) h_y.set_locs([loc0, loc1]) res.append(h_y) loc0 = Location(env, mgr.GT(x, i_3), mgr.And(mgr.GT(y, i_1), mgr.GT(z, i_1))) loc0.set_progress(1, mgr.GE(x_x, mgr.Minus(mgr.Times(y, z), i_1))) loc1 = Location(env, mgr.GT(x, i_0), mgr.GE(y, i_1)) loc1.set_progress(0, mgr.Equals(x_x, mgr.Plus(x, y))) h_x = Hint("h_x3", env, frozenset([x]), symbs) h_x.set_locs([loc0, loc1]) res.append(h_x) loc0 = Location(env, mgr.GE(z, i_3)) loc0.set_progress(0, mgr.GT(x_z, z)) h_z = Hint("h_z1", env, frozenset([z]), symbs) h_z.set_locs([loc0]) res.append(h_z) loc0 = Location(env, mgr.GE(y, i_3)) loc0.set_progress(1, mgr.Equals(x_y, mgr.Plus(y, i_1))) loc1 = Location(env, mgr.GE(y, i_3)) loc1.set_progress(2, mgr.Equals(x_y, y)) loc2 = Location(env, mgr.GE(y, i_3)) loc2.set_progress(2, mgr.Equals(x_y, mgr.Plus(y, i_1))) h_y = Hint("h_y4", env, frozenset([y]), symbs) h_y.set_locs([loc0, loc1, loc2]) res.append(h_y) loc = Location(env, mgr.LE(z, i_0)) loc.set_progress(0, mgr.Equals(x_z, z)) h_z = Hint("h_z0", env, frozenset([z]), symbs) h_z.set_locs([loc]) res.append(h_z) loc0 = Location(env, mgr.GE(z, i_0)) loc0.set_progress(1, mgr.Equals(x_z, z)) loc1 = Location(env, mgr.GE(z, i_0)) loc1.set_progress(0, mgr.Equals(x_z, mgr.Plus(z, i_3))) h_z = Hint("h_z4", env, frozenset([z]), symbs) h_z.set_locs([loc0, loc1]) res.append(h_z) stutter = mgr.Equals(x_y, y) loc0 = Location(env, mgr.GE(y, i_3)) loc0.set_progress(1, mgr.Equals(x_y, mgr.Plus(y, i_1))) loc1 = Location(env, mgr.GE(y, i_3), mgr.GE(z, i_2)) loc1.set_progress(0, mgr.Equals(x_y, mgr.Plus(y, z))) h_y = Hint("h_y2", env, frozenset([y]), symbs) h_y.set_locs([loc0, loc1]) res.append(h_y) return frozenset(res)
34.169565
81
0.529457
from typing import FrozenSet, Tuple import pysmt.typing as types from pysmt.environment import Environment as PysmtEnv from pysmt.fnode import FNode from utils import symb_to_next from hint import Hint, Location def transition_system(env: PysmtEnv) -> Tuple[FrozenSet[FNode], FNode, FNode, FNode]: assert isinstance(env, PysmtEnv) mgr = env.formula_manager pc = mgr.Symbol("pc", types.INT) x = mgr.Symbol("x", types.INT) y = mgr.Symbol("y", types.INT) z = mgr.Symbol("z", types.INT) x_pc = symb_to_next(mgr, pc) x_x = symb_to_next(mgr, x) x_y = symb_to_next(mgr, y) x_z = symb_to_next(mgr, z) symbols = frozenset([pc, x, y, z]) n_locs = 5 int_bound = n_locs pcs = [] x_pcs = [] ints = [mgr.Int(i) for i in range(int_bound)] for l in range(n_locs): n = ints[l] pcs.append(mgr.Equals(pc, n)) x_pcs.append(mgr.Equals(x_pc, n)) m_1 = mgr.Int(-1) pcend = mgr.Equals(pc, m_1) x_pcend = mgr.Equals(x_pc, m_1) init = pcs[0] cfg = mgr.And( mgr.Implies(pcend, x_pcend), mgr.Implies(mgr.And(pcs[0], mgr.Not(mgr.GE(y, ints[1]))), x_pcend), mgr.Implies(mgr.And(pcs[0], mgr.GE(y, ints[1])), x_pcs[1]), mgr.Implies(mgr.And(pcs[1], mgr.Not(mgr.GE(z, ints[1]))), x_pcend), mgr.Implies(mgr.And(pcs[1], mgr.GE(z, ints[1])), x_pcs[2]), mgr.Implies(mgr.And(pcs[2], mgr.Not(mgr.GE(x, ints[0]))), x_pcend), mgr.Implies(mgr.And(pcs[2], mgr.GE(x, ints[0])), x_pcs[3]), mgr.Implies(pcs[3], x_pcs[4]), mgr.Implies(pcs[4], x_pcs[2])) labels = mgr.And( mgr.Implies( mgr.And(pcend, x_pcend), mgr.And(mgr.Equals(x_x, x), mgr.Equals(x_y, y), mgr.Equals(x_z, z))), mgr.Implies( mgr.And(pcs[0], x_pcend), mgr.And(mgr.Equals(x_x, x), mgr.Equals(x_y, y), mgr.Equals(x_z, z))), mgr.Implies( mgr.And(pcs[0], x_pcs[1]), mgr.And(mgr.Equals(x_x, x), mgr.Equals(x_y, y), mgr.Equals(x_z, z))), mgr.Implies( mgr.And(pcs[1], x_pcend), mgr.And(mgr.Equals(x_x, x), mgr.Equals(x_y, y), mgr.Equals(x_z, z))), mgr.Implies( mgr.And(pcs[1], x_pcs[2]), mgr.And(mgr.Equals(x_x, x), mgr.Equals(x_y, y), mgr.Equals(x_z, z))), mgr.Implies( mgr.And(pcs[2], x_pcend), mgr.And(mgr.Equals(x_x, x), mgr.Equals(x_y, y), mgr.Equals(x_z, z))), mgr.Implies( mgr.And(pcs[2], x_pcs[3]), mgr.And(mgr.Equals(x_x, x), mgr.Equals(x_y, y), mgr.Equals(x_z, z))), mgr.Implies( mgr.And(pcs[3], x_pcs[4]), mgr.And(mgr.Equals(x_x, mgr.Minus(mgr.Times(y, z), ints[1])), mgr.Equals(x_y, y), mgr.Equals(x_z, z))), mgr.Implies( mgr.And(pcs[4], x_pcs[2]), mgr.And(mgr.Equals(x_x, x), mgr.Equals(x_y, mgr.Plus(y, ints[1])), mgr.Equals(x_z, z)))) trans = mgr.And(cfg, labels) fairness = mgr.Not(pcend) return symbols, init, trans, fairness def hints(env: PysmtEnv) -> FrozenSet[Hint]: assert isinstance(env, PysmtEnv) mgr = env.formula_manager pc = mgr.Symbol("pc", types.INT) x = mgr.Symbol("x", types.INT) y = mgr.Symbol("y", types.INT) z = mgr.Symbol("z", types.INT) symbs = frozenset([pc, x, y, z]) x_pc = symb_to_next(mgr, pc) x_x = symb_to_next(mgr, x) x_y = symb_to_next(mgr, y) x_z = symb_to_next(mgr, z) res = [] i_0 = mgr.Int(0) i_1 = mgr.Int(1) i_2 = mgr.Int(2) i_3 = mgr.Int(3) loc0 = Location(env, mgr.Equals(pc, i_2)) loc0.set_progress(1, mgr.GT(x_pc, i_2)) loc1 = Location(env, mgr.GE(pc, i_3)) loc1.set_progress(0, mgr.Equals(x_pc, i_2)) h_pc = Hint("h_pc3", env, frozenset([pc]), symbs) h_pc.set_locs([loc0, loc1]) res.append(h_pc) stutter = mgr.Equals(x_x, x) loc0 = Location(env, mgr.GT(x, i_0), mgr.And(mgr.GT(y, i_1), mgr.GT(z, i_1))) loc0.set_progress(1, mgr.GE(x_x, mgr.Minus(mgr.Times(y, z), i_1))) loc1 = Location(env, mgr.GT(x, i_0)) loc1.set_progress(0, mgr.Equals(x_x, mgr.Plus(x, i_1))) h_x = Hint("h_x2", env, frozenset([x]), symbs) h_x.set_locs([loc0, loc1]) res.append(h_x) loc0 = Location(env, mgr.GE(z, i_3), mgr.GE(y, i_0)) loc0.set_progress(1, mgr.Equals(x_z, y)) loc1 = Location(env, mgr.GE(z, i_0), mgr.GE(x, i_3)) loc1.set_progress(0, mgr.GE(x_z, mgr.Plus(z, x))) h_z = Hint("h_z3", env, frozenset([z]), symbs) h_z.set_locs([loc0, loc1]) res.append(h_z) loc0 = Location(env, mgr.GE(y, i_3)) loc0.set_progress(1, mgr.Equals(x_y, mgr.Plus(y, i_1))) loc1 = Location(env, mgr.GE(y, i_3), mgr.GE(x, i_2)) loc1.set_progress(0, mgr.Equals(x_y, mgr.Plus(y, x))) h_y = Hint("h_y3", env, frozenset([y]), symbs) h_y.set_locs([loc0, loc1]) res.append(h_y) loc0 = Location(env, mgr.GT(x, i_3), mgr.And(mgr.GT(y, i_1), mgr.GT(z, i_1))) loc0.set_progress(1, mgr.GE(x_x, mgr.Minus(mgr.Times(y, z), i_1))) loc1 = Location(env, mgr.GT(x, i_0), mgr.GE(y, i_1)) loc1.set_progress(0, mgr.Equals(x_x, mgr.Plus(x, y))) h_x = Hint("h_x3", env, frozenset([x]), symbs) h_x.set_locs([loc0, loc1]) res.append(h_x) loc0 = Location(env, mgr.GE(z, i_3)) loc0.set_progress(0, mgr.GT(x_z, z)) h_z = Hint("h_z1", env, frozenset([z]), symbs) h_z.set_locs([loc0]) res.append(h_z) loc0 = Location(env, mgr.GE(y, i_3)) loc0.set_progress(1, mgr.Equals(x_y, mgr.Plus(y, i_1))) loc1 = Location(env, mgr.GE(y, i_3)) loc1.set_progress(2, mgr.Equals(x_y, y)) loc2 = Location(env, mgr.GE(y, i_3)) loc2.set_progress(2, mgr.Equals(x_y, mgr.Plus(y, i_1))) h_y = Hint("h_y4", env, frozenset([y]), symbs) h_y.set_locs([loc0, loc1, loc2]) res.append(h_y) loc = Location(env, mgr.LE(z, i_0)) loc.set_progress(0, mgr.Equals(x_z, z)) h_z = Hint("h_z0", env, frozenset([z]), symbs) h_z.set_locs([loc]) res.append(h_z) loc0 = Location(env, mgr.GE(z, i_0)) loc0.set_progress(1, mgr.Equals(x_z, z)) loc1 = Location(env, mgr.GE(z, i_0)) loc1.set_progress(0, mgr.Equals(x_z, mgr.Plus(z, i_3))) h_z = Hint("h_z4", env, frozenset([z]), symbs) h_z.set_locs([loc0, loc1]) res.append(h_z) stutter = mgr.Equals(x_y, y) loc0 = Location(env, mgr.GE(y, i_3)) loc0.set_progress(1, mgr.Equals(x_y, mgr.Plus(y, i_1))) loc1 = Location(env, mgr.GE(y, i_3), mgr.GE(z, i_2)) loc1.set_progress(0, mgr.Equals(x_y, mgr.Plus(y, z))) h_y = Hint("h_y2", env, frozenset([y]), symbs) h_y.set_locs([loc0, loc1]) res.append(h_y) return frozenset(res)
true
true
f70a73527a65c5e526a4eb9382c4dd98ceed86bc
294
py
Python
manage.py
dstl/lighthouse
b810742d9f4cbfac02bf99096542499d25c88b58
[ "MIT" ]
5
2016-05-12T13:47:38.000Z
2020-06-22T07:33:35.000Z
manage.py
dstl/lighthouse
b810742d9f4cbfac02bf99096542499d25c88b58
[ "MIT" ]
7
2016-10-24T12:41:09.000Z
2016-12-08T21:58:18.000Z
manage.py
dstl/lighthouse
b810742d9f4cbfac02bf99096542499d25c88b58
[ "MIT" ]
4
2016-05-12T21:53:21.000Z
2021-04-10T22:02:26.000Z
#!/usr/bin/env python # (c) Crown Owned Copyright, 2016. Dstl. import os import sys if __name__ == "__main__": os.environ.setdefault("DJANGO_SETTINGS_MODULE", "lighthouse.settings") from django.core.management import execute_from_command_line execute_from_command_line(sys.argv)
24.5
74
0.761905
import os import sys if __name__ == "__main__": os.environ.setdefault("DJANGO_SETTINGS_MODULE", "lighthouse.settings") from django.core.management import execute_from_command_line execute_from_command_line(sys.argv)
true
true
f70a73e7ec769ceacef155b98ab3be8009c63172
5,229
py
Python
models/project.py
jlgoh/labeldat
057248a22c7f022110d712dbcb61befd40e62760
[ "MIT" ]
1
2021-09-07T06:34:54.000Z
2021-09-07T06:34:54.000Z
models/project.py
wilsonteng97/labeldat
bdca5df0af55bdd460807808861de25d762b28da
[ "MIT" ]
5
2021-09-08T02:44:59.000Z
2022-02-27T10:55:29.000Z
models/project.py
wilsonteng97/labeldat
bdca5df0af55bdd460807808861de25d762b28da
[ "MIT" ]
1
2020-12-31T11:03:39.000Z
2020-12-31T11:03:39.000Z
from extensions import db from models.item_data_type import ItemDataType from models.label import Label from models.task import Task class Project(db.Model): id = db.Column(db.String(80), primary_key=True, nullable=False) # 1(Project)-to-1(organisation) org_id = db.Column(db.String(80), db.ForeignKey('organisation.id'), nullable=False) project_name = db.Column(db.String(80), nullable=False) item_data_type = db.Column(db.Enum(ItemDataType), nullable=False) layout = db.Column(db.JSON, nullable=False) outsource_labelling = db.Column(db.Boolean, nullable=False) created_at = db.Column(db.DateTime(), nullable=False) # parent 1-to-many w Task tasks = db.relationship('Task', backref='task', lazy=True) # parent 1-to-many w ProjectManager project_managers = db.relationship('ProjectManager', backref='project', lazy=True) def __repr__(self): return f"<Project {self.id} | {self.project_name} | Organisation : {self.org_id}>" def to_response(self): return { "id": self.id, "orgId": self.org_id, "projectName": self.project_name, "itemDataType": self.item_data_type.name, "layout": self.layout, "outsourceLabelling": self.outsource_labelling, "tasks": [t.to_response_without_item_data() for t in self.tasks], "projectManagers": [pm.to_response() for pm in self.project_managers], "created_at": self.created_at } def to_project_for_user_response(self, user_id): return { "id": self.id, "orgId": self.org_id, "projectName": self.project_name, "itemDataType": self.item_data_type.name, "layout": self.layout, "outsourceLabelling": self.outsource_labelling, "tasksLabelled": [t.to_response_with_labels_from_user(user_id) for t in self.tasks_and_labels_from_user(user_id)], "projectManagers": [pm.to_response() for pm in self.project_managers], "created_at": self.created_at } def to_created_project_response(self): return { "id": self.id, "orgId": self.org_id, "projectName": self.project_name, "itemDataType": self.item_data_type.name, "layout": self.layout, "outsourceLabelling": self.outsource_labelling, "tasks": [t.to_response_without_item_data() for t in self.tasks], "projectManagers": [pm.to_response() for pm in self.project_managers], "tasksCount": self.calculate_number_of_tasks(), "overallPercentage": self.calculate_tasks_labelled_percentage(), "created_at": self.created_at } def to_contributed_project_response(self, user_id): return { "id": self.id, "orgId": self.org_id, "projectName": self.project_name, "itemDataType": self.item_data_type.name, "layout": self.layout, "outsourceLabelling": self.outsource_labelling, "tasks": [t.to_response_without_item_data() for t in self.tasks], "projectManagers": [pm.to_response() for pm in self.project_managers], "tasksCount": self.calculate_number_of_tasks(), "overallPercentage": self.calculate_tasks_labelled_percentage(), "contributionCount": self.calculate_tasks_labelled_by_user(user_id), "contributionPercentage": self.calculate_tasks_labelled_percentage_by_user(user_id), "created_at": self.created_at } def tasks_and_labels_from_user(self, user_id): resulting_tasks = [] for task in self.tasks: for label in task.labels: if label.user_id == user_id: resulting_tasks.append(task) break return resulting_tasks def calculate_number_of_tasks(self): return len(self.tasks) def calculate_tasks_labelled_percentage(self): """ Count % of tasks that have >= 1 label """ number_of_tasks = self.calculate_number_of_tasks() if not number_of_tasks: # When there are no tasks return 0 num_labelled = len([task for task in self.tasks if len(task.labels) > 0]) return round(float((num_labelled / number_of_tasks * 100)), 1) def calculate_tasks_labelled_percentage_by_user(self, user_id): """ Count % of tasks that a user has labelled """ number_of_tasks = self.calculate_number_of_tasks() if not number_of_tasks: # When there are no tasks return 0 num_labelled_by_user = self.calculate_tasks_labelled_by_user(user_id) return round(float((num_labelled_by_user / number_of_tasks) * 100), 1) def calculate_tasks_labelled_by_user(self, user_id): """ Count number of tasks that a user has labelled """ tasks_by_user = db.session.query(Task).filter_by(project_id=self.id).join(Label).filter_by( user_id=user_id).all() num_labelled = len(tasks_by_user) return num_labelled
42.169355
99
0.634921
from extensions import db from models.item_data_type import ItemDataType from models.label import Label from models.task import Task class Project(db.Model): id = db.Column(db.String(80), primary_key=True, nullable=False) org_id = db.Column(db.String(80), db.ForeignKey('organisation.id'), nullable=False) project_name = db.Column(db.String(80), nullable=False) item_data_type = db.Column(db.Enum(ItemDataType), nullable=False) layout = db.Column(db.JSON, nullable=False) outsource_labelling = db.Column(db.Boolean, nullable=False) created_at = db.Column(db.DateTime(), nullable=False) tasks = db.relationship('Task', backref='task', lazy=True) project_managers = db.relationship('ProjectManager', backref='project', lazy=True) def __repr__(self): return f"<Project {self.id} | {self.project_name} | Organisation : {self.org_id}>" def to_response(self): return { "id": self.id, "orgId": self.org_id, "projectName": self.project_name, "itemDataType": self.item_data_type.name, "layout": self.layout, "outsourceLabelling": self.outsource_labelling, "tasks": [t.to_response_without_item_data() for t in self.tasks], "projectManagers": [pm.to_response() for pm in self.project_managers], "created_at": self.created_at } def to_project_for_user_response(self, user_id): return { "id": self.id, "orgId": self.org_id, "projectName": self.project_name, "itemDataType": self.item_data_type.name, "layout": self.layout, "outsourceLabelling": self.outsource_labelling, "tasksLabelled": [t.to_response_with_labels_from_user(user_id) for t in self.tasks_and_labels_from_user(user_id)], "projectManagers": [pm.to_response() for pm in self.project_managers], "created_at": self.created_at } def to_created_project_response(self): return { "id": self.id, "orgId": self.org_id, "projectName": self.project_name, "itemDataType": self.item_data_type.name, "layout": self.layout, "outsourceLabelling": self.outsource_labelling, "tasks": [t.to_response_without_item_data() for t in self.tasks], "projectManagers": [pm.to_response() for pm in self.project_managers], "tasksCount": self.calculate_number_of_tasks(), "overallPercentage": self.calculate_tasks_labelled_percentage(), "created_at": self.created_at } def to_contributed_project_response(self, user_id): return { "id": self.id, "orgId": self.org_id, "projectName": self.project_name, "itemDataType": self.item_data_type.name, "layout": self.layout, "outsourceLabelling": self.outsource_labelling, "tasks": [t.to_response_without_item_data() for t in self.tasks], "projectManagers": [pm.to_response() for pm in self.project_managers], "tasksCount": self.calculate_number_of_tasks(), "overallPercentage": self.calculate_tasks_labelled_percentage(), "contributionCount": self.calculate_tasks_labelled_by_user(user_id), "contributionPercentage": self.calculate_tasks_labelled_percentage_by_user(user_id), "created_at": self.created_at } def tasks_and_labels_from_user(self, user_id): resulting_tasks = [] for task in self.tasks: for label in task.labels: if label.user_id == user_id: resulting_tasks.append(task) break return resulting_tasks def calculate_number_of_tasks(self): return len(self.tasks) def calculate_tasks_labelled_percentage(self): number_of_tasks = self.calculate_number_of_tasks() if not number_of_tasks: return 0 num_labelled = len([task for task in self.tasks if len(task.labels) > 0]) return round(float((num_labelled / number_of_tasks * 100)), 1) def calculate_tasks_labelled_percentage_by_user(self, user_id): number_of_tasks = self.calculate_number_of_tasks() if not number_of_tasks: return 0 num_labelled_by_user = self.calculate_tasks_labelled_by_user(user_id) return round(float((num_labelled_by_user / number_of_tasks) * 100), 1) def calculate_tasks_labelled_by_user(self, user_id): tasks_by_user = db.session.query(Task).filter_by(project_id=self.id).join(Label).filter_by( user_id=user_id).all() num_labelled = len(tasks_by_user) return num_labelled
true
true
f70a74917258038a2fbc62fab3d8f0fe001b74ce
8,773
py
Python
videoanalyst/model/task_model/taskmodel_impl/siamese_track.py
983632847/video_analyst
01b7ad278b828a3f7ff7a0488c5ca8f055240192
[ "MIT" ]
2
2020-07-30T08:26:08.000Z
2020-11-24T07:40:46.000Z
videoanalyst/model/task_model/taskmodel_impl/siamese_track.py
983632847/video_analyst
01b7ad278b828a3f7ff7a0488c5ca8f055240192
[ "MIT" ]
null
null
null
videoanalyst/model/task_model/taskmodel_impl/siamese_track.py
983632847/video_analyst
01b7ad278b828a3f7ff7a0488c5ca8f055240192
[ "MIT" ]
null
null
null
# -*- coding: utf-8 -* import numpy as np from loguru import logger import torch import torch.nn as nn import torch.nn.functional as F from videoanalyst.model.common_opr.common_block import (conv_bn_relu, xcorr_depthwise) from videoanalyst.model.module_base import ModuleBase from videoanalyst.model.task_model.taskmodel_base import (TRACK_TASKMODELS, VOS_TASKMODELS) torch.set_printoptions(precision=8) @TRACK_TASKMODELS.register @VOS_TASKMODELS.register class SiamTrack(ModuleBase): r""" SiamTrack model for tracking Hyper-Parameters ---------------- pretrain_model_path: string path to parameter to be loaded into module head_width: int feature width in head structure """ default_hyper_params = dict(pretrain_model_path="", head_width=256, conv_weight_std=0.01, neck_conv_bias=[True, True, True, True], corr_fea_output=False, trt_mode=False, trt_fea_model_path="", trt_track_model_path="") support_phases = ["train", "feature", "track", "freeze_track_fea"] def __init__(self, backbone, head, loss=None): super(SiamTrack, self).__init__() self.basemodel = backbone self.head = head self.loss = loss self.trt_fea_model = None self.trt_track_model = None self._phase = "train" @property def phase(self): return self._phase @phase.setter def phase(self, p): assert p in self.support_phases self._phase = p def forward(self, *args, phase=None): r""" Perform tracking process for different phases (e.g. train / init / track) Arguments --------- target_img: torch.Tensor target template image patch search_img: torch.Tensor search region image patch Returns ------- fcos_score_final: torch.Tensor predicted score for bboxes, shape=(B, HW, 1) fcos_bbox_final: torch.Tensor predicted bbox in the crop, shape=(B, HW, 4) fcos_cls_prob_final: torch.Tensor classification score, shape=(B, HW, 1) fcos_ctr_prob_final: torch.Tensor center-ness score, shape=(B, HW, 1) """ if phase is None: phase = self._phase # used during training if phase == 'train': # resolve training data training_data = args[0] target_img = training_data["im_z"] search_img = training_data["im_x"] # backbone feature f_z = self.basemodel(target_img) f_x = self.basemodel(search_img) # feature adjustment c_z_k = self.c_z_k(f_z) r_z_k = self.r_z_k(f_z) c_x = self.c_x(f_x) r_x = self.r_x(f_x) # feature matching r_out = xcorr_depthwise(r_x, r_z_k) c_out = xcorr_depthwise(c_x, c_z_k) # head fcos_cls_score_final, fcos_ctr_score_final, fcos_bbox_final, corr_fea = self.head( c_out, r_out) predict_data = dict( cls_pred=fcos_cls_score_final, ctr_pred=fcos_ctr_score_final, box_pred=fcos_bbox_final, ) if self._hyper_params["corr_fea_output"]: predict_data["corr_fea"] = corr_fea return predict_data # used for template feature extraction (normal mode) elif phase == 'feature': target_img, = args if self._hyper_params["trt_mode"]: # extract feature with trt model out_list = self.trt_fea_model(target_img) else: # backbone feature f_z = self.basemodel(target_img) # template as kernel c_z_k = self.c_z_k(f_z) r_z_k = self.r_z_k(f_z) # output out_list = [c_z_k, r_z_k] # used for template feature extraction (trt mode) elif phase == "freeze_track_fea": search_img, = args # backbone feature f_x = self.basemodel(search_img) # feature adjustment c_x = self.c_x(f_x) r_x = self.r_x(f_x) # head return [c_x, r_x] # [Broken] used for template feature extraction (trt mode) # currently broken due to following issue of "torch2trt" package # c.f. https://github.com/NVIDIA-AI-IOT/torch2trt/issues/251 elif phase == "freeze_track_head": c_out, r_out = args # head outputs = self.head(c_out, r_out, 0, True) return outputs # used for tracking one frame during test elif phase == 'track': if len(args) == 3: search_img, c_z_k, r_z_k = args if self._hyper_params["trt_mode"]: c_x, r_x = self.trt_track_model(search_img) else: # backbone feature f_x = self.basemodel(search_img) # feature adjustment c_x = self.c_x(f_x) r_x = self.r_x(f_x) elif len(args) == 4: # c_x, r_x already computed c_z_k, r_z_k, c_x, r_x = args else: raise ValueError("Illegal args length: %d" % len(args)) # feature matching r_out = xcorr_depthwise(r_x, r_z_k) c_out = xcorr_depthwise(c_x, c_z_k) # head fcos_cls_score_final, fcos_ctr_score_final, fcos_bbox_final, corr_fea = self.head( c_out, r_out, search_img.size(-1)) # apply sigmoid fcos_cls_prob_final = torch.sigmoid(fcos_cls_score_final) fcos_ctr_prob_final = torch.sigmoid(fcos_ctr_score_final) # apply centerness correction fcos_score_final = fcos_cls_prob_final * fcos_ctr_prob_final # register extra output extra = dict(c_x=c_x, r_x=r_x, corr_fea=corr_fea) # output out_list = fcos_score_final, fcos_bbox_final, fcos_cls_prob_final, fcos_ctr_prob_final, extra else: raise ValueError("Phase non-implemented.") return out_list def update_params(self): r""" Load model parameters """ self._make_convs() self._initialize_conv() super().update_params() if self._hyper_params["trt_mode"]: logger.info("trt mode enable") from torch2trt import TRTModule self.trt_fea_model = TRTModule() self.trt_fea_model.load_state_dict( torch.load(self._hyper_params["trt_fea_model_path"])) self.trt_track_model = TRTModule() self.trt_track_model.load_state_dict( torch.load(self._hyper_params["trt_track_model_path"])) logger.info("loading trt model succefully") def _make_convs(self): head_width = self._hyper_params['head_width'] # feature adjustment self.r_z_k = conv_bn_relu(head_width, head_width, 1, 3, 0, has_relu=False) self.c_z_k = conv_bn_relu(head_width, head_width, 1, 3, 0, has_relu=False) self.r_x = conv_bn_relu(head_width, head_width, 1, 3, 0, has_relu=False) self.c_x = conv_bn_relu(head_width, head_width, 1, 3, 0, has_relu=False) def _initialize_conv(self, ): conv_weight_std = self._hyper_params['conv_weight_std'] conv_list = [ self.r_z_k.conv, self.c_z_k.conv, self.r_x.conv, self.c_x.conv ] for ith in range(len(conv_list)): conv = conv_list[ith] torch.nn.init.normal_(conv.weight, std=conv_weight_std) # conv_weight_std=0.01 def set_device(self, dev): if not isinstance(dev, torch.device): dev = torch.device(dev) self.to(dev) if self.loss is not None: for loss_name in self.loss: self.loss[loss_name].to(dev)
36.861345
105
0.53904
import numpy as np from loguru import logger import torch import torch.nn as nn import torch.nn.functional as F from videoanalyst.model.common_opr.common_block import (conv_bn_relu, xcorr_depthwise) from videoanalyst.model.module_base import ModuleBase from videoanalyst.model.task_model.taskmodel_base import (TRACK_TASKMODELS, VOS_TASKMODELS) torch.set_printoptions(precision=8) @TRACK_TASKMODELS.register @VOS_TASKMODELS.register class SiamTrack(ModuleBase): default_hyper_params = dict(pretrain_model_path="", head_width=256, conv_weight_std=0.01, neck_conv_bias=[True, True, True, True], corr_fea_output=False, trt_mode=False, trt_fea_model_path="", trt_track_model_path="") support_phases = ["train", "feature", "track", "freeze_track_fea"] def __init__(self, backbone, head, loss=None): super(SiamTrack, self).__init__() self.basemodel = backbone self.head = head self.loss = loss self.trt_fea_model = None self.trt_track_model = None self._phase = "train" @property def phase(self): return self._phase @phase.setter def phase(self, p): assert p in self.support_phases self._phase = p def forward(self, *args, phase=None): if phase is None: phase = self._phase if phase == 'train': training_data = args[0] target_img = training_data["im_z"] search_img = training_data["im_x"] f_z = self.basemodel(target_img) f_x = self.basemodel(search_img) c_z_k = self.c_z_k(f_z) r_z_k = self.r_z_k(f_z) c_x = self.c_x(f_x) r_x = self.r_x(f_x) r_out = xcorr_depthwise(r_x, r_z_k) c_out = xcorr_depthwise(c_x, c_z_k) fcos_cls_score_final, fcos_ctr_score_final, fcos_bbox_final, corr_fea = self.head( c_out, r_out) predict_data = dict( cls_pred=fcos_cls_score_final, ctr_pred=fcos_ctr_score_final, box_pred=fcos_bbox_final, ) if self._hyper_params["corr_fea_output"]: predict_data["corr_fea"] = corr_fea return predict_data elif phase == 'feature': target_img, = args if self._hyper_params["trt_mode"]: out_list = self.trt_fea_model(target_img) else: f_z = self.basemodel(target_img) c_z_k = self.c_z_k(f_z) r_z_k = self.r_z_k(f_z) out_list = [c_z_k, r_z_k] elif phase == "freeze_track_fea": search_img, = args f_x = self.basemodel(search_img) c_x = self.c_x(f_x) r_x = self.r_x(f_x) return [c_x, r_x] elif phase == "freeze_track_head": c_out, r_out = args outputs = self.head(c_out, r_out, 0, True) return outputs elif phase == 'track': if len(args) == 3: search_img, c_z_k, r_z_k = args if self._hyper_params["trt_mode"]: c_x, r_x = self.trt_track_model(search_img) else: f_x = self.basemodel(search_img) c_x = self.c_x(f_x) r_x = self.r_x(f_x) elif len(args) == 4: c_z_k, r_z_k, c_x, r_x = args else: raise ValueError("Illegal args length: %d" % len(args)) r_out = xcorr_depthwise(r_x, r_z_k) c_out = xcorr_depthwise(c_x, c_z_k) fcos_cls_score_final, fcos_ctr_score_final, fcos_bbox_final, corr_fea = self.head( c_out, r_out, search_img.size(-1)) fcos_cls_prob_final = torch.sigmoid(fcos_cls_score_final) fcos_ctr_prob_final = torch.sigmoid(fcos_ctr_score_final) fcos_score_final = fcos_cls_prob_final * fcos_ctr_prob_final extra = dict(c_x=c_x, r_x=r_x, corr_fea=corr_fea) out_list = fcos_score_final, fcos_bbox_final, fcos_cls_prob_final, fcos_ctr_prob_final, extra else: raise ValueError("Phase non-implemented.") return out_list def update_params(self): self._make_convs() self._initialize_conv() super().update_params() if self._hyper_params["trt_mode"]: logger.info("trt mode enable") from torch2trt import TRTModule self.trt_fea_model = TRTModule() self.trt_fea_model.load_state_dict( torch.load(self._hyper_params["trt_fea_model_path"])) self.trt_track_model = TRTModule() self.trt_track_model.load_state_dict( torch.load(self._hyper_params["trt_track_model_path"])) logger.info("loading trt model succefully") def _make_convs(self): head_width = self._hyper_params['head_width'] self.r_z_k = conv_bn_relu(head_width, head_width, 1, 3, 0, has_relu=False) self.c_z_k = conv_bn_relu(head_width, head_width, 1, 3, 0, has_relu=False) self.r_x = conv_bn_relu(head_width, head_width, 1, 3, 0, has_relu=False) self.c_x = conv_bn_relu(head_width, head_width, 1, 3, 0, has_relu=False) def _initialize_conv(self, ): conv_weight_std = self._hyper_params['conv_weight_std'] conv_list = [ self.r_z_k.conv, self.c_z_k.conv, self.r_x.conv, self.c_x.conv ] for ith in range(len(conv_list)): conv = conv_list[ith] torch.nn.init.normal_(conv.weight, std=conv_weight_std) def set_device(self, dev): if not isinstance(dev, torch.device): dev = torch.device(dev) self.to(dev) if self.loss is not None: for loss_name in self.loss: self.loss[loss_name].to(dev)
true
true
f70a75256c638f4a3ce9cda3b9577176e49f3cca
4,042
py
Python
youtube_dl/extractor/redtube.py
aalvarito68/https-github.com-rg3-youtube-dl
dfc80bdd2e4ef3d30f161a93f99f3050537944ab
[ "Unlicense" ]
3
2017-09-28T22:31:51.000Z
2021-09-15T07:43:07.000Z
youtube_dl/extractor/redtube.py
aalvarito68/https-github.com-rg3-youtube-dl
dfc80bdd2e4ef3d30f161a93f99f3050537944ab
[ "Unlicense" ]
null
null
null
youtube_dl/extractor/redtube.py
aalvarito68/https-github.com-rg3-youtube-dl
dfc80bdd2e4ef3d30f161a93f99f3050537944ab
[ "Unlicense" ]
3
2020-12-01T10:58:29.000Z
2021-07-22T15:57:22.000Z
from __future__ import unicode_literals import re from .common import InfoExtractor from ..compat import compat_str from ..utils import ( ExtractorError, int_or_none, str_to_int, unified_strdate, ) class RedTubeIE(InfoExtractor): _VALID_URL = r'https?://(?:(?:www\.)?redtube\.com/|embed\.redtube\.com/\?.*?\bid=)(?P<id>[0-9]+)' _TESTS = [{ 'url': 'http://www.redtube.com/66418', 'md5': '7b8c22b5e7098a3e1c09709df1126d2d', 'info_dict': { 'id': '66418', 'ext': 'mp4', 'title': 'Sucked on a toilet', 'upload_date': '20120831', 'duration': 596, 'view_count': int, 'age_limit': 18, } }, { 'url': 'http://embed.redtube.com/?bgcolor=000000&id=1443286', 'only_matching': True, }] @staticmethod def _extract_urls(webpage): return re.findall( r'<iframe[^>]+?src=["\'](?P<url>(?:https?:)?//embed\.redtube\.com/\?.*?\bid=\d+)', webpage) def _real_extract(self, url): video_id = self._match_id(url) webpage = self._download_webpage( 'http://www.redtube.com/%s' % video_id, video_id) if any(s in webpage for s in ['video-deleted-info', '>This video has been removed']): raise ExtractorError('Video %s has been removed' % video_id, expected=True) title = self._html_search_regex( (r'<h1 class="videoTitle[^"]*">(?P<title>.+?)</h1>', r'videoTitle\s*:\s*(["\'])(?P<title>)\1'), webpage, 'title', group='title') formats = [] sources = self._parse_json( self._search_regex( r'sources\s*:\s*({.+?})', webpage, 'source', default='{}'), video_id, fatal=False) if sources and isinstance(sources, dict): for format_id, format_url in sources.items(): if format_url: formats.append({ 'url': format_url, 'format_id': format_id, 'height': int_or_none(format_id), }) medias = self._parse_json( self._search_regex( r'mediaDefinition\s*:\s*(\[.+?\])', webpage, 'media definitions', default='{}'), video_id, fatal=False) if medias and isinstance(medias, list): for media in medias: format_url = media.get('videoUrl') if not format_url or not isinstance(format_url, compat_str): continue format_id = media.get('quality') formats.append({ 'url': format_url, 'format_id': format_id, 'height': int_or_none(format_id), }) if not formats: video_url = self._html_search_regex( r'<source src="(.+?)" type="video/mp4">', webpage, 'video URL') formats.append({'url': video_url}) self._sort_formats(formats) thumbnail = self._og_search_thumbnail(webpage) upload_date = unified_strdate(self._search_regex( r'<span[^>]+class="added-time"[^>]*>ADDED ([^<]+)<', webpage, 'upload date', fatal=False)) duration = int_or_none(self._search_regex( r'videoDuration\s*:\s*(\d+)', webpage, 'duration', default=None)) view_count = str_to_int(self._search_regex( r'<span[^>]*>VIEWS</span></td>\s*<td>([\d,.]+)', webpage, 'view count', fatal=False)) # No self-labeling, but they describe themselves as # "Home of Videos Porno" age_limit = 18 return { 'id': video_id, 'ext': 'mp4', 'title': title, 'thumbnail': thumbnail, 'upload_date': upload_date, 'duration': duration, 'view_count': view_count, 'age_limit': age_limit, 'formats': formats, }
35.769912
101
0.517566
from __future__ import unicode_literals import re from .common import InfoExtractor from ..compat import compat_str from ..utils import ( ExtractorError, int_or_none, str_to_int, unified_strdate, ) class RedTubeIE(InfoExtractor): _VALID_URL = r'https?://(?:(?:www\.)?redtube\.com/|embed\.redtube\.com/\?.*?\bid=)(?P<id>[0-9]+)' _TESTS = [{ 'url': 'http://www.redtube.com/66418', 'md5': '7b8c22b5e7098a3e1c09709df1126d2d', 'info_dict': { 'id': '66418', 'ext': 'mp4', 'title': 'Sucked on a toilet', 'upload_date': '20120831', 'duration': 596, 'view_count': int, 'age_limit': 18, } }, { 'url': 'http://embed.redtube.com/?bgcolor=000000&id=1443286', 'only_matching': True, }] @staticmethod def _extract_urls(webpage): return re.findall( r'<iframe[^>]+?src=["\'](?P<url>(?:https?:)?//embed\.redtube\.com/\?.*?\bid=\d+)', webpage) def _real_extract(self, url): video_id = self._match_id(url) webpage = self._download_webpage( 'http://www.redtube.com/%s' % video_id, video_id) if any(s in webpage for s in ['video-deleted-info', '>This video has been removed']): raise ExtractorError('Video %s has been removed' % video_id, expected=True) title = self._html_search_regex( (r'<h1 class="videoTitle[^"]*">(?P<title>.+?)</h1>', r'videoTitle\s*:\s*(["\'])(?P<title>)\1'), webpage, 'title', group='title') formats = [] sources = self._parse_json( self._search_regex( r'sources\s*:\s*({.+?})', webpage, 'source', default='{}'), video_id, fatal=False) if sources and isinstance(sources, dict): for format_id, format_url in sources.items(): if format_url: formats.append({ 'url': format_url, 'format_id': format_id, 'height': int_or_none(format_id), }) medias = self._parse_json( self._search_regex( r'mediaDefinition\s*:\s*(\[.+?\])', webpage, 'media definitions', default='{}'), video_id, fatal=False) if medias and isinstance(medias, list): for media in medias: format_url = media.get('videoUrl') if not format_url or not isinstance(format_url, compat_str): continue format_id = media.get('quality') formats.append({ 'url': format_url, 'format_id': format_id, 'height': int_or_none(format_id), }) if not formats: video_url = self._html_search_regex( r'<source src="(.+?)" type="video/mp4">', webpage, 'video URL') formats.append({'url': video_url}) self._sort_formats(formats) thumbnail = self._og_search_thumbnail(webpage) upload_date = unified_strdate(self._search_regex( r'<span[^>]+class="added-time"[^>]*>ADDED ([^<]+)<', webpage, 'upload date', fatal=False)) duration = int_or_none(self._search_regex( r'videoDuration\s*:\s*(\d+)', webpage, 'duration', default=None)) view_count = str_to_int(self._search_regex( r'<span[^>]*>VIEWS</span></td>\s*<td>([\d,.]+)', webpage, 'view count', fatal=False)) # No self-labeling, but they describe themselves as # "Home of Videos Porno" age_limit = 18 return { 'id': video_id, 'ext': 'mp4', 'title': title, 'thumbnail': thumbnail, 'upload_date': upload_date, 'duration': duration, 'view_count': view_count, 'age_limit': age_limit, 'formats': formats, }
true
true
f70a75b50f6ab4c03d21568a0b919684fa9dd706
187
py
Python
repos/tf_ctpn_cpu/lib/utils/setup.py
ysglh/DeepVideoAnalytics
ce807cc1595c813250bb4bc7dfc6fb76cd644335
[ "MIT", "Apache-2.0", "BSD-3-Clause" ]
3
2019-03-05T00:46:56.000Z
2021-11-26T10:20:40.000Z
repos/tf_ctpn_cpu/lib/utils/setup.py
jiangxu87/DeepVideoAnalytics
e401b3273782409b2604657514bec293d6aa75b0
[ "MIT", "Apache-2.0", "BSD-3-Clause" ]
null
null
null
repos/tf_ctpn_cpu/lib/utils/setup.py
jiangxu87/DeepVideoAnalytics
e401b3273782409b2604657514bec293d6aa75b0
[ "MIT", "Apache-2.0", "BSD-3-Clause" ]
4
2021-09-22T07:47:27.000Z
2022-01-23T14:16:08.000Z
from Cython.Build import cythonize import numpy as np from distutils.core import setup setup(ext_modules=cythonize(["bbox.pyx","cython_nms.pyx"],include_path=[np.get_include()] ))
20.777778
89
0.764706
from Cython.Build import cythonize import numpy as np from distutils.core import setup setup(ext_modules=cythonize(["bbox.pyx","cython_nms.pyx"],include_path=[np.get_include()] ))
true
true
f70a75c0e2859d8527b98b051b3342213f23e151
6,992
py
Python
nicos/clients/gui/panels/base.py
ess-dmsc/nicos
755d61d403ff7123f804c45fc80c7ff4d762993b
[ "CC-BY-3.0", "Apache-2.0", "CC-BY-4.0" ]
1
2021-03-26T10:30:45.000Z
2021-03-26T10:30:45.000Z
nicos/clients/gui/panels/base.py
ess-dmsc/nicos
755d61d403ff7123f804c45fc80c7ff4d762993b
[ "CC-BY-3.0", "Apache-2.0", "CC-BY-4.0" ]
91
2020-08-18T09:20:26.000Z
2022-02-01T11:07:14.000Z
nicos/clients/gui/panels/base.py
ess-dmsc/nicos
755d61d403ff7123f804c45fc80c7ff4d762993b
[ "CC-BY-3.0", "Apache-2.0", "CC-BY-4.0" ]
3
2020-08-04T18:35:05.000Z
2021-04-16T11:22:08.000Z
# -*- coding: utf-8 -*- # ***************************************************************************** # NICOS, the Networked Instrument Control System of the MLZ # Copyright (c) 2009-2021 by the NICOS contributors (see AUTHORS) # # This program is free software; you can redistribute it and/or modify it under # the terms of the GNU General Public License as published by the Free Software # Foundation; either version 2 of the License, or (at your option) any later # version. # # This program is distributed in the hope that it will be useful, but WITHOUT # ANY WARRANTY; without even the implied warranty of MERCHANTABILITY or FITNESS # FOR A PARTICULAR PURPOSE. See the GNU General Public License for more # details. # # You should have received a copy of the GNU General Public License along with # this program; if not, write to the Free Software Foundation, Inc., # 59 Temple Place, Suite 330, Boston, MA 02111-1307 USA # # Module authors: # Georg Brandl <g.brandl@fz-juelich.de> # Christian Felder <c.felder@fz-juelich.de> # # ***************************************************************************** """Support for "auxiliary" windows containing panels.""" from time import time as currenttime from nicos.clients.gui.config import panel from nicos.clients.gui.utils import DlgUtils, SettingGroup from nicos.guisupport.qt import QDialog, QHBoxLayout, QObject, QPainter, \ QPalette, QStyle, QStyleOption, QWidget, pyqtSignal from nicos.utils import checkSetupSpec from nicos.utils.loggers import NicosLogger class SetupDepWindowMixin: def __init__(self, client): if 'session/mastersetup' not in client._reg_keys: return values = client.ask('getcachekeys', 'session/mastersetup', quiet=True, default=[]) for key, value in values: if key == 'session/mastersetup': currtime = currenttime() for widget in client._reg_keys[key]: if widget(): widget().on_keyChange(key, value, currtime, False) class PanelDialog(SetupDepWindowMixin, QDialog): def __init__(self, parent, client, panelcfg, title, **options): from nicos.clients.gui.panels.utils import createWindowItem QDialog.__init__(self, parent) self.panels = [] self.mainwindow = parent.mainwindow self.log = NicosLogger('PanelDialog') self.log.parent = self.mainwindow.log self.client = client self.user_color = self.palette().color(QPalette.Base) self.user_font = self.font() if isinstance(panelcfg, type) and issubclass(panelcfg, Panel): panelcfg = panel('%s.%s' % (panelcfg.__module__, panelcfg.__name__), **options) elif isinstance(panelcfg, str): panelcfg = panel(panelcfg, **options) hbox = QHBoxLayout() hbox.setContentsMargins(0, 0, 0, 0) pnl = createWindowItem(panelcfg, self, self, self.mainwindow, self.log) if pnl: hbox.addWidget(pnl) self.setLayout(hbox) self.setWindowTitle(title) SetupDepWindowMixin.__init__(self, self.client) self.setProperty('type', 'PanelDialog') def addPanel(self, panel, always=True): if always or panel not in self.panels: self.panels.append(panel) class SetupDepPanelMixin(QObject): """Mixin to handle setup-dependent visibility. Note: You must explicity add the following class attribute in all classes using this mixin (A PyQt resctriction, see https://riverbankcomputing.com/pipermail/pyqt/2013-September/033199.html): `setWidgetVisible = SetupDepPanelMixin.setWidgetVisible` """ setupSpec = () setWidgetVisible = pyqtSignal(QWidget, bool, name='setWidgetVisible') def __init__(self, client, options): # pylint: disable=super-init-not-called setups = options.get('setups', '') self.setSetups(setups) client.register(self, 'session/mastersetup') def setSetups(self, setupSpec): self.setupSpec = setupSpec self.log.debug('setups are: %r', self.setupSpec) checkSetupSpec(self.setupSpec, '', log=self.log) def on_keyChange(self, key, value, time, expired): if key == 'session/mastersetup' and self.setupSpec: if hasattr(self, 'setWidgetVisible'): enabled = checkSetupSpec(self.setupSpec, value, log=self.log) self.setWidgetVisible.emit(self, enabled) class Panel(DlgUtils, QWidget, SetupDepPanelMixin): panelName = '' setWidgetVisible = SetupDepPanelMixin.setWidgetVisible def __init__(self, parent, client, options): QWidget.__init__(self, parent) self.log = NicosLogger(self.panelName) self.log.parent = parent.mainwindow.log SetupDepPanelMixin.__init__(self, client, options) DlgUtils.__init__(self, self.panelName) self.parentwindow = parent self.client = client self.mainwindow = parent.mainwindow self.actions = set() self.sgroup = SettingGroup(self.panelName) with self.sgroup as settings: self.loadSettings(settings) self.setProperty('type', 'Panel') self.setProperty('panel', self.__class__.__name__) def closeWindow(self): """Try to close the window containing this panel. If the window is the main window, nothing will be done. """ from nicos.clients.gui.panels.tabwidget import DetachedWindow from nicos.clients.gui.panels.auxwindows import AuxiliaryWindow obj = self while hasattr(obj, 'parent'): obj = obj.parent() if isinstance(obj, (DetachedWindow, AuxiliaryWindow, PanelDialog)): obj.close() return def postInit(self): """This method can be implemented to perform actions after **all** panels have been created. This can be useful e.g. for accessing other panels using their unique ``panelName``. """ def setExpertMode(self, expert): pass def setViewOnly(self, viewonly): pass def loadSettings(self, settings): pass def saveSettings(self, settings): pass def setCustomStyle(self, font, back): pass def getToolbars(self): return [] def getMenus(self): return [] def hideTitle(self): """Called when the panel is shown in a dock or tab widget, which provides its own place for the panel title. If the panel has a title widget, it should hide it in this method. """ def requestClose(self): return True def updateStatus(self, status, exception=False): pass def paintEvent(self, event): opt = QStyleOption() opt.initFrom(self) painter = QPainter(self) self.style().drawPrimitive(QStyle.PE_Widget, opt, painter, self)
36.227979
81
0.641447
from time import time as currenttime from nicos.clients.gui.config import panel from nicos.clients.gui.utils import DlgUtils, SettingGroup from nicos.guisupport.qt import QDialog, QHBoxLayout, QObject, QPainter, \ QPalette, QStyle, QStyleOption, QWidget, pyqtSignal from nicos.utils import checkSetupSpec from nicos.utils.loggers import NicosLogger class SetupDepWindowMixin: def __init__(self, client): if 'session/mastersetup' not in client._reg_keys: return values = client.ask('getcachekeys', 'session/mastersetup', quiet=True, default=[]) for key, value in values: if key == 'session/mastersetup': currtime = currenttime() for widget in client._reg_keys[key]: if widget(): widget().on_keyChange(key, value, currtime, False) class PanelDialog(SetupDepWindowMixin, QDialog): def __init__(self, parent, client, panelcfg, title, **options): from nicos.clients.gui.panels.utils import createWindowItem QDialog.__init__(self, parent) self.panels = [] self.mainwindow = parent.mainwindow self.log = NicosLogger('PanelDialog') self.log.parent = self.mainwindow.log self.client = client self.user_color = self.palette().color(QPalette.Base) self.user_font = self.font() if isinstance(panelcfg, type) and issubclass(panelcfg, Panel): panelcfg = panel('%s.%s' % (panelcfg.__module__, panelcfg.__name__), **options) elif isinstance(panelcfg, str): panelcfg = panel(panelcfg, **options) hbox = QHBoxLayout() hbox.setContentsMargins(0, 0, 0, 0) pnl = createWindowItem(panelcfg, self, self, self.mainwindow, self.log) if pnl: hbox.addWidget(pnl) self.setLayout(hbox) self.setWindowTitle(title) SetupDepWindowMixin.__init__(self, self.client) self.setProperty('type', 'PanelDialog') def addPanel(self, panel, always=True): if always or panel not in self.panels: self.panels.append(panel) class SetupDepPanelMixin(QObject): setupSpec = () setWidgetVisible = pyqtSignal(QWidget, bool, name='setWidgetVisible') def __init__(self, client, options): setups = options.get('setups', '') self.setSetups(setups) client.register(self, 'session/mastersetup') def setSetups(self, setupSpec): self.setupSpec = setupSpec self.log.debug('setups are: %r', self.setupSpec) checkSetupSpec(self.setupSpec, '', log=self.log) def on_keyChange(self, key, value, time, expired): if key == 'session/mastersetup' and self.setupSpec: if hasattr(self, 'setWidgetVisible'): enabled = checkSetupSpec(self.setupSpec, value, log=self.log) self.setWidgetVisible.emit(self, enabled) class Panel(DlgUtils, QWidget, SetupDepPanelMixin): panelName = '' setWidgetVisible = SetupDepPanelMixin.setWidgetVisible def __init__(self, parent, client, options): QWidget.__init__(self, parent) self.log = NicosLogger(self.panelName) self.log.parent = parent.mainwindow.log SetupDepPanelMixin.__init__(self, client, options) DlgUtils.__init__(self, self.panelName) self.parentwindow = parent self.client = client self.mainwindow = parent.mainwindow self.actions = set() self.sgroup = SettingGroup(self.panelName) with self.sgroup as settings: self.loadSettings(settings) self.setProperty('type', 'Panel') self.setProperty('panel', self.__class__.__name__) def closeWindow(self): from nicos.clients.gui.panels.tabwidget import DetachedWindow from nicos.clients.gui.panels.auxwindows import AuxiliaryWindow obj = self while hasattr(obj, 'parent'): obj = obj.parent() if isinstance(obj, (DetachedWindow, AuxiliaryWindow, PanelDialog)): obj.close() return def postInit(self): def setExpertMode(self, expert): pass def setViewOnly(self, viewonly): pass def loadSettings(self, settings): pass def saveSettings(self, settings): pass def setCustomStyle(self, font, back): pass def getToolbars(self): return [] def getMenus(self): return [] def hideTitle(self): def requestClose(self): return True def updateStatus(self, status, exception=False): pass def paintEvent(self, event): opt = QStyleOption() opt.initFrom(self) painter = QPainter(self) self.style().drawPrimitive(QStyle.PE_Widget, opt, painter, self)
true
true
f70a75c3e0f6aec1f478f8422ff34adbef44b487
3,812
py
Python
tests/unit/test_diffusion2d_functions.py
constracktor/testing-python-exercise
70b15a9d8e193fc518e46996cbc3e9f52cb1336d
[ "CC-BY-4.0" ]
null
null
null
tests/unit/test_diffusion2d_functions.py
constracktor/testing-python-exercise
70b15a9d8e193fc518e46996cbc3e9f52cb1336d
[ "CC-BY-4.0" ]
null
null
null
tests/unit/test_diffusion2d_functions.py
constracktor/testing-python-exercise
70b15a9d8e193fc518e46996cbc3e9f52cb1336d
[ "CC-BY-4.0" ]
null
null
null
""" Tests for functions in class SolveDiffusion2D """ import numpy as np #import pytest from diffusion2d import SolveDiffusion2D from unittest import TestCase class TestOperations(TestCase): """ Test suite for mathematical operations functions. """ def setUp(self): # Fixture self.w = 12. self.h = 20. self.dx = 0.4 self.dy = 0.2 self.D = 0.5 self.T_cold = 300. self.T_hot = 700. def test_initialize_domain(self): """ Check function SolveDiffusion2D.initialize_domain """ solver = SolveDiffusion2D() expected_nx = 30 #int(self.w / self.dx) expected_ny = 100 #int(self.h / self.dy) solver.initialize_domain(self.w,self.h,self.dx,self.dy) self.assertEqual(solver.nx, expected_nx) self.assertEqual(solver.ny, expected_ny) def test_initialize_physical_parameters(self): """ Checks function SolveDiffusion2D.initialize_domain """ solver = SolveDiffusion2D() solver.dx = self.dx solver.dy = self.dy #dx**2 * dy**2 / (2 * d * (dx**2 + dy**2)) expected_dt = 0.032 solver.initialize_physical_parameters(self.D) self.assertAlmostEqual(solver.dt, expected_dt, 6) def test_get_initial_condition(self): """ Checks function SolveDiffusion2D.get_initial_function """ solver = SolveDiffusion2D() solver.T_cold = self.T_cold solver.T_hot = self.T_hot solver.initialize_domain(self.w,self.h,self.dx,self.dy) expected_u = self.T_cold * np.ones((solver.nx, solver.ny)) # Initial conditions - circle of radius r centred at (cx,cy) (mm) r, cx, cy = 2, 5, 5 r2 = r ** 2 for i in range(solver.nx): for j in range(solver.ny): p2 = (i * solver.dx - cx) ** 2 + (j * solver.dy - cy) ** 2 if p2 < r2: expected_u[i, j] = self.T_hot actual_u = solver.get_initial_condition() for i in range(solver.nx): for j in range(solver.ny): self.assertEqual(actual_u[i,j], expected_u[i,j]) # def test_initialize_domain(): # """ # Check function SolveDiffusion2D.initialize_domain # """ # solver = SolveDiffusion2D() # # w = 12. # h = 20. # dx = 0.4 # dy = 0.2 # expected_nx = 30 #int(w / dx) # expected_ny = 100 #int(h / dy) # # solver.initialize_domain(w,h,dx,dy) # # assert solver.nx == expected_nx # assert solver.ny == expected_ny # # def test_initialize_physical_parameters(): # """ # Checks function SolveDiffusion2D.initialize_domain # """ # solver = SolveDiffusion2D() # solver.dx = 0.2 # solver.dy = 0.4 # d=5. # # #dx**2 * dy**2 / (2 * d * (dx**2 + dy**2)) # expected_dt = pytest.approx(0.0032, abs=0.000001) # # solver.initialize_physical_parameters(d) # # assert solver.dt == expected_dt # # def test_get_initial_condition(): # """ # Checks function SolveDiffusion2D.get_initial_function # """ # solver = SolveDiffusion2D() # solver.T_cold = 300. # solver.T_hot = 700. # solver.dx = 0.1 # solver.dy = 0.2 # solver.nx = 100 # solver.ny = 50 # # expected_u = solver.T_cold * np.ones((solver.nx, solver.ny)) # # # Initial conditions - circle of radius r centred at (cx,cy) (mm) # r, cx, cy = 2, 5, 5 # r2 = r ** 2 # for i in range(solver.nx): # for j in range(solver.ny): # p2 = (i * solver.dx - cx) ** 2 + (j * solver.dy - cy) ** 2 # if p2 < r2: # expected_u[i, j] = solver.T_hot # # actual_u = solver.get_initial_condition() # # assert np.all(actual_u == expected_u)
27.228571
74
0.574239
import numpy as np from diffusion2d import SolveDiffusion2D from unittest import TestCase class TestOperations(TestCase): def setUp(self): self.w = 12. self.h = 20. self.dx = 0.4 self.dy = 0.2 self.D = 0.5 self.T_cold = 300. self.T_hot = 700. def test_initialize_domain(self): solver = SolveDiffusion2D() expected_nx = 30 expected_ny = 100 solver.initialize_domain(self.w,self.h,self.dx,self.dy) self.assertEqual(solver.nx, expected_nx) self.assertEqual(solver.ny, expected_ny) def test_initialize_physical_parameters(self): solver = SolveDiffusion2D() solver.dx = self.dx solver.dy = self.dy expected_dt = 0.032 solver.initialize_physical_parameters(self.D) self.assertAlmostEqual(solver.dt, expected_dt, 6) def test_get_initial_condition(self): solver = SolveDiffusion2D() solver.T_cold = self.T_cold solver.T_hot = self.T_hot solver.initialize_domain(self.w,self.h,self.dx,self.dy) expected_u = self.T_cold * np.ones((solver.nx, solver.ny)) r, cx, cy = 2, 5, 5 r2 = r ** 2 for i in range(solver.nx): for j in range(solver.ny): p2 = (i * solver.dx - cx) ** 2 + (j * solver.dy - cy) ** 2 if p2 < r2: expected_u[i, j] = self.T_hot actual_u = solver.get_initial_condition() for i in range(solver.nx): for j in range(solver.ny): self.assertEqual(actual_u[i,j], expected_u[i,j]) # Check function SolveDiffusion2D.initialize_domain # """ unction SolveDiffusion2D.initialize_domain # """ ion2D.get_initial_function # """
true
true
f70a75e1d9bb17e8ca4b66e379fd93f2e4479d40
5,117
py
Python
examples/gto/20-ao_integrals.py
nmardirossian/pyscf
57c8912dcfcc1157a822feede63df54ed1067115
[ "BSD-2-Clause" ]
1
2018-05-02T19:55:30.000Z
2018-05-02T19:55:30.000Z
examples/gto/20-ao_integrals.py
nmardirossian/pyscf
57c8912dcfcc1157a822feede63df54ed1067115
[ "BSD-2-Clause" ]
null
null
null
examples/gto/20-ao_integrals.py
nmardirossian/pyscf
57c8912dcfcc1157a822feede63df54ed1067115
[ "BSD-2-Clause" ]
null
null
null
#!/usr/bin/env python # # Author: Qiming Sun <osirpt.sun@gmail.com> # ''' Access AO integrals Mole.intor and Mole.intor_by_shell functions can generate AO integrals. Calling Mole.intor with the integral function name returns a integral matrix for all basis functions defined in Mole. If the integral operator has many compenents eg gradients, keyword argument comp=* needs to be specified to tell the function how many components the integrals have. Mole.intor_by_shell function generates the integrals for the given shell indices. Keyword argument comp=* is also required when the integral operator has multiple components. See pyscf/gto/moleintor.py file for the complete list of supported integrals. ''' import numpy from pyscf import gto, scf mol = gto.M( verbose = 0, atom = 'C 0 0 0; O 0 0 1.5', basis = 'ccpvdz' ) mf = scf.RHF(mol) mf.kernel() dm = mf.make_rdm1() # Overlap, kinetic, nuclear attraction s = mol.intor('cint1e_ovlp_sph') t = mol.intor('cint1e_kin_sph') v = mol.intor('cint1e_nuc_sph') # Overlap, kinetic, nuclear attraction gradients (against electron coordinates) s1 = mol.intor('cint1e_ipovlp_sph', comp=3) t1 = mol.intor('cint1e_ipkin_sph' , comp=3) v1 = mol.intor('cint1e_ipnuc_sph' , comp=3) print('Dipole %s' % numpy.einsum('xij,ij->x', mol.intor('cint1e_r_sph', comp=3), dm)) # # AO overlap between two molecules # mol1 = gto.M( verbose = 0, atom = 'H 0 1 0; H 1 0 0', basis = 'ccpvdz' ) s = gto.intor_cross('cint1e_ovlp_sph', mol, mol1) print('overlap shape (%d, %d)' % s.shape) # # 2e integrals. Keyword aosym is to specify the permutation symmetry in the # AO integral matrix. s8 means 8-fold symmetry, s2kl means 2-fold symmetry # for the symmetry between kl in (ij|kl) # eri = mol.intor('cint2e_sph', aosym='s8') # # 2e gradient integrals on first atom only # eri = mol.intor('cint2e_ip1_sph', aosym='s2kl') # # 2e integral gradients on certain atom # atm_id = 1 # second atom bas_start, bas_end, ao_start, ao_end = mol.aoslice_by_atom()[atm_id] tot_bra = ao_end - ao_start nao = mol.nao_nr() eri1 = numpy.empty((3,tot_bra,nao,nao,nao)) pi = 0 for i in range(mol.nbas): if mol.bas_atom(i) == atm_id: pj = 0 for j in range(mol.nbas): pk = 0 for k in range(mol.nbas): pl = 0 for l in range(mol.nbas): shls = (i, j, k, l) buf = mol.intor_by_shell('cint2e_ip1_sph', shls, comp=3) di, dj, dk, dl = buf.shape[1:] eri1[:,pi:pi+di,pj:pj+dj,pk:pk+dk,pl:pl+dl] = buf pl += dl pk += dk pj += dj pi += di print('integral shape %s' % str(eri1.shape)) # # Generate a sub-block of AO integrals. The sub-block (ij|kl) contains the # shells 2:5 for basis i, 0:2 for j, 0:4 for k and 1:3 for l # sub_eri = mol.intor('int2e_sph', shls_slice=(2,5,0,2,0,4,1,3)) # This statement is equivalent to dims = [] for i in range(mol.nbas): l = mol.bas_angular(i) nc = mol.bas_nctr(i) dims.append((l * 2 + 1) * nc) nao_i = sum(dims[2:5]) nao_j = sum(dims[0:2]) nao_k = sum(dims[0:4]) nao_l = sum(dims[1:3]) sub_eri = numpy.empty((nao_i,nao_j,nao_k,nao_l)) pi = 0 for i in range(2,5): pj = 0 for j in range(0,2): pk = 0 for k in range(0,4): pl = 0 for l in range(1,3): shls = (i, j, k, l) buf = mol.intor_by_shell('int2e_sph', shls) di, dj, dk, dl = buf.shape sub_eri[pi:pi+di,pj:pj+dj,pk:pk+dk,pl:pl+dl] = buf pl += dl pk += dk pj += dj pi += di sub_eri = sub_eri.reshape(nao_i*nao_j,nao_k*nao_l) # # Generate all AO integrals for a sub-system. # mol = gto.M(atom=[['H', 0,0,i] for i in range(10)]) atom_idx = [0,2,4] # The disjoint atoms sub_mol = mol.copy() sub_mol._bas = mol._bas[atom_idx] sub_eri = sub_mol.intor('int2e_sph', aosym='s1') # This statement is equivalent to sub_nao = 0 for i in range(mol.nbas): if mol.bas_atom(i) in atom_idx: l = mol.bas_angular(i) nc = mol.bas_nctr(i) sub_nao += (l * 2 + 1) * nc sub_eri = numpy.empty((sub_nao,sub_nao,sub_nao,sub_nao)) pi = 0 for i in range(mol.nbas): if mol.bas_atom(i) in atom_idx: pj = 0 for j in range(mol.nbas): if mol.bas_atom(j) in atom_idx: pk = 0 for k in range(mol.nbas): if mol.bas_atom(k) in atom_idx: pl = 0 for l in range(mol.nbas): if mol.bas_atom(l) in atom_idx: shls = (i, j, k, l) buf = mol.intor_by_shell('int2e_sph', shls) di, dj, dk, dl = buf.shape sub_eri[pi:pi+di,pj:pj+dj,pk:pk+dk,pl:pl+dl] = buf pl += dl pk += dk pj += dj pi += di sub_eri = sub_eri.reshape(sub_nao**2,sub_nao**2)
30.825301
82
0.580027
import numpy from pyscf import gto, scf mol = gto.M( verbose = 0, atom = 'C 0 0 0; O 0 0 1.5', basis = 'ccpvdz' ) mf = scf.RHF(mol) mf.kernel() dm = mf.make_rdm1() s = mol.intor('cint1e_ovlp_sph') t = mol.intor('cint1e_kin_sph') v = mol.intor('cint1e_nuc_sph') s1 = mol.intor('cint1e_ipovlp_sph', comp=3) t1 = mol.intor('cint1e_ipkin_sph' , comp=3) v1 = mol.intor('cint1e_ipnuc_sph' , comp=3) print('Dipole %s' % numpy.einsum('xij,ij->x', mol.intor('cint1e_r_sph', comp=3), dm)) mol1 = gto.M( verbose = 0, atom = 'H 0 1 0; H 1 0 0', basis = 'ccpvdz' ) s = gto.intor_cross('cint1e_ovlp_sph', mol, mol1) print('overlap shape (%d, %d)' % s.shape) eri = mol.intor('cint2e_sph', aosym='s8') eri = mol.intor('cint2e_ip1_sph', aosym='s2kl') atm_id = 1 bas_start, bas_end, ao_start, ao_end = mol.aoslice_by_atom()[atm_id] tot_bra = ao_end - ao_start nao = mol.nao_nr() eri1 = numpy.empty((3,tot_bra,nao,nao,nao)) pi = 0 for i in range(mol.nbas): if mol.bas_atom(i) == atm_id: pj = 0 for j in range(mol.nbas): pk = 0 for k in range(mol.nbas): pl = 0 for l in range(mol.nbas): shls = (i, j, k, l) buf = mol.intor_by_shell('cint2e_ip1_sph', shls, comp=3) di, dj, dk, dl = buf.shape[1:] eri1[:,pi:pi+di,pj:pj+dj,pk:pk+dk,pl:pl+dl] = buf pl += dl pk += dk pj += dj pi += di print('integral shape %s' % str(eri1.shape)) sub_eri = mol.intor('int2e_sph', shls_slice=(2,5,0,2,0,4,1,3)) dims = [] for i in range(mol.nbas): l = mol.bas_angular(i) nc = mol.bas_nctr(i) dims.append((l * 2 + 1) * nc) nao_i = sum(dims[2:5]) nao_j = sum(dims[0:2]) nao_k = sum(dims[0:4]) nao_l = sum(dims[1:3]) sub_eri = numpy.empty((nao_i,nao_j,nao_k,nao_l)) pi = 0 for i in range(2,5): pj = 0 for j in range(0,2): pk = 0 for k in range(0,4): pl = 0 for l in range(1,3): shls = (i, j, k, l) buf = mol.intor_by_shell('int2e_sph', shls) di, dj, dk, dl = buf.shape sub_eri[pi:pi+di,pj:pj+dj,pk:pk+dk,pl:pl+dl] = buf pl += dl pk += dk pj += dj pi += di sub_eri = sub_eri.reshape(nao_i*nao_j,nao_k*nao_l) mol = gto.M(atom=[['H', 0,0,i] for i in range(10)]) atom_idx = [0,2,4] sub_mol = mol.copy() sub_mol._bas = mol._bas[atom_idx] sub_eri = sub_mol.intor('int2e_sph', aosym='s1') sub_nao = 0 for i in range(mol.nbas): if mol.bas_atom(i) in atom_idx: l = mol.bas_angular(i) nc = mol.bas_nctr(i) sub_nao += (l * 2 + 1) * nc sub_eri = numpy.empty((sub_nao,sub_nao,sub_nao,sub_nao)) pi = 0 for i in range(mol.nbas): if mol.bas_atom(i) in atom_idx: pj = 0 for j in range(mol.nbas): if mol.bas_atom(j) in atom_idx: pk = 0 for k in range(mol.nbas): if mol.bas_atom(k) in atom_idx: pl = 0 for l in range(mol.nbas): if mol.bas_atom(l) in atom_idx: shls = (i, j, k, l) buf = mol.intor_by_shell('int2e_sph', shls) di, dj, dk, dl = buf.shape sub_eri[pi:pi+di,pj:pj+dj,pk:pk+dk,pl:pl+dl] = buf pl += dl pk += dk pj += dj pi += di sub_eri = sub_eri.reshape(sub_nao**2,sub_nao**2)
true
true
f70a767814ed94c06907f469c28d401cf661137d
1,461
py
Python
setup.py
mcflugen/plume
7fc65ba9461fece372eef4b2bee9ba6e72f42d19
[ "MIT" ]
null
null
null
setup.py
mcflugen/plume
7fc65ba9461fece372eef4b2bee9ba6e72f42d19
[ "MIT" ]
null
null
null
setup.py
mcflugen/plume
7fc65ba9461fece372eef4b2bee9ba6e72f42d19
[ "MIT" ]
1
2018-08-30T17:32:26.000Z
2018-08-30T17:32:26.000Z
from setuptools import setup, find_packages from distutils.extension import Extension import numpy as np import cython_gsl import versioneer def read_requirements(): import os path = os.path.dirname(os.path.abspath(__file__)) requirements_file = os.path.join(path, 'requirements.txt') try: with open(requirements_file, 'r') as req_fp: requires = req_fp.read().split() except IOError: return [] else: return [require.split() for require in requires] setup(name='plume', version=versioneer.get_version(), description='A hypopycnal sediment-carrying plume entering the ocean', author='Eric Hutton', author_email='huttone@colorado.edu', url='http://csdms.colorado.edu', install_requires=read_requirements(), setup_requires=['setuptools', ], packages=find_packages(), include_dirs = [np.get_include(), cython_gsl.get_include()], entry_points={ 'console_scripts': [ 'plume=plume.cli:main', ], }, ext_modules = [ Extension('plume.ext.centerline', ['plume/ext/centerline.pyx'], extra_compile_args=['-O3'], libraries=cython_gsl.get_libraries(), library_dirs=[cython_gsl.get_library_dir()], include_dirs=[cython_gsl.get_cython_include_dir()])], cmdclass=versioneer.get_cmdclass(), )
31.085106
76
0.626283
from setuptools import setup, find_packages from distutils.extension import Extension import numpy as np import cython_gsl import versioneer def read_requirements(): import os path = os.path.dirname(os.path.abspath(__file__)) requirements_file = os.path.join(path, 'requirements.txt') try: with open(requirements_file, 'r') as req_fp: requires = req_fp.read().split() except IOError: return [] else: return [require.split() for require in requires] setup(name='plume', version=versioneer.get_version(), description='A hypopycnal sediment-carrying plume entering the ocean', author='Eric Hutton', author_email='huttone@colorado.edu', url='http://csdms.colorado.edu', install_requires=read_requirements(), setup_requires=['setuptools', ], packages=find_packages(), include_dirs = [np.get_include(), cython_gsl.get_include()], entry_points={ 'console_scripts': [ 'plume=plume.cli:main', ], }, ext_modules = [ Extension('plume.ext.centerline', ['plume/ext/centerline.pyx'], extra_compile_args=['-O3'], libraries=cython_gsl.get_libraries(), library_dirs=[cython_gsl.get_library_dir()], include_dirs=[cython_gsl.get_cython_include_dir()])], cmdclass=versioneer.get_cmdclass(), )
true
true
f70a7759e95a54a93bcca22412d4b186cb575890
791
py
Python
src/home/migrations/0001_initial.py
gatortechuf/gatortechuf.com
8d0ad5f0772a42113c41bf454e96c2fa2c22d1f3
[ "MIT" ]
2
2016-07-18T02:11:37.000Z
2017-08-27T17:28:25.000Z
src/home/migrations/0001_initial.py
gatortechuf/gatortechuf.com
8d0ad5f0772a42113c41bf454e96c2fa2c22d1f3
[ "MIT" ]
66
2016-06-18T04:00:01.000Z
2018-02-03T17:42:17.000Z
src/home/migrations/0001_initial.py
gatortechuf/gatortechuf.com
8d0ad5f0772a42113c41bf454e96c2fa2c22d1f3
[ "MIT" ]
null
null
null
# -*- coding: utf-8 -*- # Generated by Django 1.10 on 2017-03-17 03:31 from __future__ import unicode_literals from django.db import migrations, models class Migration(migrations.Migration): initial = True dependencies = [ ] operations = [ migrations.CreateModel( name='SemesterModules', fields=[ ('id', models.AutoField(auto_created=True, primary_key=True, serialize=False, verbose_name='ID')), ('module_tile', models.CharField(max_length=256, verbose_name='Title')), ('module_icon', models.CharField(max_length=128, verbose_name='Font Awesome Icon')), ('module_description', models.TextField(max_length=1024, verbose_name='Description')), ], ), ]
30.423077
114
0.624526
from __future__ import unicode_literals from django.db import migrations, models class Migration(migrations.Migration): initial = True dependencies = [ ] operations = [ migrations.CreateModel( name='SemesterModules', fields=[ ('id', models.AutoField(auto_created=True, primary_key=True, serialize=False, verbose_name='ID')), ('module_tile', models.CharField(max_length=256, verbose_name='Title')), ('module_icon', models.CharField(max_length=128, verbose_name='Font Awesome Icon')), ('module_description', models.TextField(max_length=1024, verbose_name='Description')), ], ), ]
true
true
f70a79fccd50251c7ab4ed1433fa98f79020be5a
3,038
py
Python
guardabinario.py
paatshala1/firststeps
5b91e1ad9a0a1197438d827d23879701cf81afbb
[ "MIT" ]
null
null
null
guardabinario.py
paatshala1/firststeps
5b91e1ad9a0a1197438d827d23879701cf81afbb
[ "MIT" ]
null
null
null
guardabinario.py
paatshala1/firststeps
5b91e1ad9a0a1197438d827d23879701cf81afbb
[ "MIT" ]
null
null
null
import pickle # ============================================================================= # EL MÉTODO __str__ NO PERMITE IMPRIMIR LA INFO DEL OBJETO COMO STRING, YA QUE # DE LO CONTRARIO EL MÉTODO showp() MOSTRARÍA LOS OBJETOS CREADOS EN MEMORIA # PERO NO SU INFO: (<__main__.People object at 0x00000218F088B9C8>) # ============================================================================= class Person: def __init__(self , name , nac , age): self.name = name self.nac = nac self.age = age print("\nIt's been created:" , self.name) def __str__(self): return "{} {} {}".format(self.name , self.nac , self.age) # ============================================================================= # LA CLASE NO TENÍA EL __init__ PERO SI SU CONTENIDO, LO AGREGUÉ PARA TENER # CLARO QUE LO QUE SE ESTABA HACIENDO ERA CREAR UNA "PROPIEDAD" DEL OBJETO # PEOPLELIST QUE CONSISTE EN UNA LISTA Y QUE POR LO TANTO COMO CUALQUIER OTRA # PROPIEDAD DEBE SER LLAMADA EXPRESAMENTE PARA PODERLA UTILIZAR/MODIFICAR # ============================================================================= class Peoplelist: def __init__(self): self.persons = [] def addp(self , p): self.persons.append(p) def showp(self): for i in self.persons: print(i) # ============================================================================= x = input("Would you like to add (a) or read (r)?: \n>> ") while True: if x == "q": print("\t--Process finished by user--") del x break if x== "r": try: with open("People_info" , "rb") as pickledfile: unpickled = pickle.load(pickledfile) for i in unpickled: print(i) del unpickled x = input("Would you like to add (a), read (r) or quit (q)?: \n>> ") except: print("\t--File doesn't exist, you should create one first--") x = input("Would you like to add (a), read (r) or quit (q)?: \n>> ") elif x== "a": lst = Peoplelist() p = Person(input("Name: "), input("Country: "), int(input("Age: "))) try: with open("People_info" , "rb") as reading2update: lst.persons = pickle.load(reading2update) lst.addp(p) except: lst.addp(p) finally: lst.showp() with open("People_info" , "wb") as file: pickle.dump(lst.persons, file) # del lst print("Pickling process succesfully finished") x = input("Would you like to add (a), read (r) or quit (q)?: \n>> ") else: print("\t--You must select a valid option (a, r or q--") x = input("Would you like to add (a), read (r) or quit (q)?: \n>> ") print("\n** THIS IS THE END **")
34.134831
81
0.455892
import pickle class Person: def __init__(self , name , nac , age): self.name = name self.nac = nac self.age = age print("\nIt's been created:" , self.name) def __str__(self): return "{} {} {}".format(self.name , self.nac , self.age) # ============================================================================= # LA CLASE NO TENÍA EL __init__ PERO SI SU CONTENIDO, LO AGREGUÉ PARA TENER # CLARO QUE LO QUE SE ESTABA HACIENDO ERA CREAR UNA "PROPIEDAD" DEL OBJETO # PEOPLELIST QUE CONSISTE EN UNA LISTA Y QUE POR LO TANTO COMO CUALQUIER OTRA # PROPIEDAD DEBE SER LLAMADA EXPRESAMENTE PARA PODERLA UTILIZAR/MODIFICAR # ============================================================================= class Peoplelist: def __init__(self): self.persons = [] def addp(self , p): self.persons.append(p) def showp(self): for i in self.persons: print(i) # ============================================================================= x = input("Would you like to add (a) or read (r)?: \n>> ") while True: if x == "q": print("\t--Process finished by user--") del x break if x== "r": try: with open("People_info" , "rb") as pickledfile: unpickled = pickle.load(pickledfile) for i in unpickled: print(i) del unpickled x = input("Would you like to add (a), read (r) or quit (q)?: \n>> ") except: print("\t--File doesn't exist, you should create one first--") x = input("Would you like to add (a), read (r) or quit (q)?: \n>> ") elif x== "a": lst = Peoplelist() p = Person(input("Name: "), input("Country: "), int(input("Age: "))) try: with open("People_info" , "rb") as reading2update: lst.persons = pickle.load(reading2update) lst.addp(p) except: lst.addp(p) finally: lst.showp() with open("People_info" , "wb") as file: pickle.dump(lst.persons, file) print("Pickling process succesfully finished") x = input("Would you like to add (a), read (r) or quit (q)?: \n>> ") else: print("\t--You must select a valid option (a, r or q--") x = input("Would you like to add (a), read (r) or quit (q)?: \n>> ") print("\n** THIS IS THE END **")
true
true
f70a7a3f1fea92b6119cb3af8052d25d1baf7caf
737
py
Python
python-algorithm/common/trie_node.py
isudox/nerd-algorithm
c1fbe153953cf3fc24395f75d102016fdf9ea0fa
[ "MIT" ]
5
2017-06-11T09:19:34.000Z
2019-01-16T16:58:31.000Z
python-algorithm/common/trie_node.py
isudox/leetcode-solution
60085e64deaf396a171367affc94b18114565c43
[ "MIT" ]
5
2020-03-22T13:53:54.000Z
2020-03-23T08:49:35.000Z
python-algorithm/common/trie_node.py
isudox/nerd-algorithm
c1fbe153953cf3fc24395f75d102016fdf9ea0fa
[ "MIT" ]
1
2019-03-02T15:50:43.000Z
2019-03-02T15:50:43.000Z
# Trie Tree Node from typing import Optional class TrieNode: def __init__(self, char: Optional[str] = None): self.char = char self.children = [] self.counter = 0 self.end = False def add(self, word: str): node = self for char in word: found_in_children = False for child in node.children: if child.char == char: found_in_children = True child.counter += 1 node = child break if not found_in_children: new_node = TrieNode(char) node.children.append(new_node) node = new_node node.end = True
27.296296
51
0.497965
from typing import Optional class TrieNode: def __init__(self, char: Optional[str] = None): self.char = char self.children = [] self.counter = 0 self.end = False def add(self, word: str): node = self for char in word: found_in_children = False for child in node.children: if child.char == char: found_in_children = True child.counter += 1 node = child break if not found_in_children: new_node = TrieNode(char) node.children.append(new_node) node = new_node node.end = True
true
true
f70a7a5a3c556402a7e07cce5f17dc361e7a5d74
7,221
py
Python
moto/ec2/responses/elastic_ip_addresses.py
symroe/moto
4e106995af6f2820273528fca8a4e9ee288690a5
[ "Apache-2.0" ]
null
null
null
moto/ec2/responses/elastic_ip_addresses.py
symroe/moto
4e106995af6f2820273528fca8a4e9ee288690a5
[ "Apache-2.0" ]
1
2022-03-07T07:39:03.000Z
2022-03-07T07:39:03.000Z
moto/ec2/responses/elastic_ip_addresses.py
symroe/moto
4e106995af6f2820273528fca8a4e9ee288690a5
[ "Apache-2.0" ]
null
null
null
from moto.ec2.utils import add_tag_specification from ._base_response import EC2BaseResponse class ElasticIPAddresses(EC2BaseResponse): def allocate_address(self): domain = self._get_param("Domain", if_none="standard") reallocate_address = self._get_param("Address", if_none=None) tags = self._get_multi_param("TagSpecification") tags = add_tag_specification(tags) if self.is_not_dryrun("AllocateAddress"): if reallocate_address: address = self.ec2_backend.allocate_address( domain, address=reallocate_address, tags=tags ) else: address = self.ec2_backend.allocate_address(domain, tags=tags) template = self.response_template(ALLOCATE_ADDRESS_RESPONSE) return template.render(address=address) def associate_address(self): instance = eni = None if "InstanceId" in self.querystring: instance = self.ec2_backend.get_instance(self._get_param("InstanceId")) elif "NetworkInterfaceId" in self.querystring: eni = self.ec2_backend.get_network_interface( self._get_param("NetworkInterfaceId") ) else: self.ec2_backend.raise_error( "MissingParameter", "Invalid request, expect InstanceId/NetworkId parameter.", ) reassociate = False if "AllowReassociation" in self.querystring: reassociate = self._get_param("AllowReassociation") == "true" if self.is_not_dryrun("AssociateAddress"): if instance or eni: if "PublicIp" in self.querystring: eip = self.ec2_backend.associate_address( instance=instance, eni=eni, address=self._get_param("PublicIp"), reassociate=reassociate, ) elif "AllocationId" in self.querystring: eip = self.ec2_backend.associate_address( instance=instance, eni=eni, allocation_id=self._get_param("AllocationId"), reassociate=reassociate, ) else: self.ec2_backend.raise_error( "MissingParameter", "Invalid request, expect PublicIp/AllocationId parameter.", ) else: self.ec2_backend.raise_error( "MissingParameter", "Invalid request, expect either instance or ENI.", ) template = self.response_template(ASSOCIATE_ADDRESS_RESPONSE) return template.render(address=eip) def describe_addresses(self): self.error_on_dryrun() allocation_ids = self._get_multi_param("AllocationId") public_ips = self._get_multi_param("PublicIp") filters = self._filters_from_querystring() addresses = self.ec2_backend.describe_addresses( allocation_ids, public_ips, filters ) template = self.response_template(DESCRIBE_ADDRESS_RESPONSE) return template.render(addresses=addresses) def disassociate_address(self): if self.is_not_dryrun("DisAssociateAddress"): if "PublicIp" in self.querystring: self.ec2_backend.disassociate_address( address=self._get_param("PublicIp") ) elif "AssociationId" in self.querystring: self.ec2_backend.disassociate_address( association_id=self._get_param("AssociationId") ) else: self.ec2_backend.raise_error( "MissingParameter", "Invalid request, expect PublicIp/AssociationId parameter.", ) return self.response_template(DISASSOCIATE_ADDRESS_RESPONSE).render() def release_address(self): if self.is_not_dryrun("ReleaseAddress"): if "PublicIp" in self.querystring: self.ec2_backend.release_address(address=self._get_param("PublicIp")) elif "AllocationId" in self.querystring: self.ec2_backend.release_address( allocation_id=self._get_param("AllocationId") ) else: self.ec2_backend.raise_error( "MissingParameter", "Invalid request, expect PublicIp/AllocationId parameter.", ) return self.response_template(RELEASE_ADDRESS_RESPONSE).render() ALLOCATE_ADDRESS_RESPONSE = """<AllocateAddressResponse xmlns="http://ec2.amazonaws.com/doc/2013-10-15/"> <requestId>59dbff89-35bd-4eac-99ed-be587EXAMPLE</requestId> <publicIp>{{ address.public_ip }}</publicIp> <domain>{{ address.domain }}</domain> {% if address.allocation_id %} <allocationId>{{ address.allocation_id }}</allocationId> {% endif %} </AllocateAddressResponse>""" ASSOCIATE_ADDRESS_RESPONSE = """<AssociateAddressResponse xmlns="http://ec2.amazonaws.com/doc/2013-10-15/"> <requestId>59dbff89-35bd-4eac-99ed-be587EXAMPLE</requestId> <return>true</return> {% if address.association_id %} <associationId>{{ address.association_id }}</associationId> {% endif %} </AssociateAddressResponse>""" DESCRIBE_ADDRESS_RESPONSE = """<DescribeAddressesResponse xmlns="http://ec2.amazonaws.com/doc/2013-10-15/"> <requestId>59dbff89-35bd-4eac-99ed-be587EXAMPLE</requestId> <addressesSet> {% for address in addresses %} <item> <publicIp>{{ address.public_ip }}</publicIp> <domain>{{ address.domain }}</domain> {% if address.instance %} <instanceId>{{ address.instance.id }}</instanceId> {% else %} <instanceId/> {% endif %} {% if address.eni %} <networkInterfaceId>{{ address.eni.id }}</networkInterfaceId> {% else %} <networkInterfaceId/> {% endif %} {% if address.allocation_id %} <allocationId>{{ address.allocation_id }}</allocationId> {% endif %} {% if address.association_id %} <associationId>{{ address.association_id }}</associationId> {% endif %} <tagSet> {% for tag in address.get_tags() %} <item> <key>{{ tag.key }}</key> <value>{{ tag.value }}</value> </item> {% endfor %} </tagSet> </item> {% endfor %} </addressesSet> </DescribeAddressesResponse>""" DISASSOCIATE_ADDRESS_RESPONSE = """<DisassociateAddressResponse xmlns="http://ec2.amazonaws.com/doc/2013-10-15/"> <requestId>59dbff89-35bd-4eac-99ed-be587EXAMPLE</requestId> <return>true</return> </DisassociateAddressResponse>""" RELEASE_ADDRESS_RESPONSE = """<ReleaseAddressResponse xmlns="http://ec2.amazonaws.com/doc/2013-10-15/"> <requestId>59dbff89-35bd-4eac-99ed-be587EXAMPLE</requestId> <return>true</return> </ReleaseAddressResponse>"""
40.340782
113
0.596316
from moto.ec2.utils import add_tag_specification from ._base_response import EC2BaseResponse class ElasticIPAddresses(EC2BaseResponse): def allocate_address(self): domain = self._get_param("Domain", if_none="standard") reallocate_address = self._get_param("Address", if_none=None) tags = self._get_multi_param("TagSpecification") tags = add_tag_specification(tags) if self.is_not_dryrun("AllocateAddress"): if reallocate_address: address = self.ec2_backend.allocate_address( domain, address=reallocate_address, tags=tags ) else: address = self.ec2_backend.allocate_address(domain, tags=tags) template = self.response_template(ALLOCATE_ADDRESS_RESPONSE) return template.render(address=address) def associate_address(self): instance = eni = None if "InstanceId" in self.querystring: instance = self.ec2_backend.get_instance(self._get_param("InstanceId")) elif "NetworkInterfaceId" in self.querystring: eni = self.ec2_backend.get_network_interface( self._get_param("NetworkInterfaceId") ) else: self.ec2_backend.raise_error( "MissingParameter", "Invalid request, expect InstanceId/NetworkId parameter.", ) reassociate = False if "AllowReassociation" in self.querystring: reassociate = self._get_param("AllowReassociation") == "true" if self.is_not_dryrun("AssociateAddress"): if instance or eni: if "PublicIp" in self.querystring: eip = self.ec2_backend.associate_address( instance=instance, eni=eni, address=self._get_param("PublicIp"), reassociate=reassociate, ) elif "AllocationId" in self.querystring: eip = self.ec2_backend.associate_address( instance=instance, eni=eni, allocation_id=self._get_param("AllocationId"), reassociate=reassociate, ) else: self.ec2_backend.raise_error( "MissingParameter", "Invalid request, expect PublicIp/AllocationId parameter.", ) else: self.ec2_backend.raise_error( "MissingParameter", "Invalid request, expect either instance or ENI.", ) template = self.response_template(ASSOCIATE_ADDRESS_RESPONSE) return template.render(address=eip) def describe_addresses(self): self.error_on_dryrun() allocation_ids = self._get_multi_param("AllocationId") public_ips = self._get_multi_param("PublicIp") filters = self._filters_from_querystring() addresses = self.ec2_backend.describe_addresses( allocation_ids, public_ips, filters ) template = self.response_template(DESCRIBE_ADDRESS_RESPONSE) return template.render(addresses=addresses) def disassociate_address(self): if self.is_not_dryrun("DisAssociateAddress"): if "PublicIp" in self.querystring: self.ec2_backend.disassociate_address( address=self._get_param("PublicIp") ) elif "AssociationId" in self.querystring: self.ec2_backend.disassociate_address( association_id=self._get_param("AssociationId") ) else: self.ec2_backend.raise_error( "MissingParameter", "Invalid request, expect PublicIp/AssociationId parameter.", ) return self.response_template(DISASSOCIATE_ADDRESS_RESPONSE).render() def release_address(self): if self.is_not_dryrun("ReleaseAddress"): if "PublicIp" in self.querystring: self.ec2_backend.release_address(address=self._get_param("PublicIp")) elif "AllocationId" in self.querystring: self.ec2_backend.release_address( allocation_id=self._get_param("AllocationId") ) else: self.ec2_backend.raise_error( "MissingParameter", "Invalid request, expect PublicIp/AllocationId parameter.", ) return self.response_template(RELEASE_ADDRESS_RESPONSE).render() ALLOCATE_ADDRESS_RESPONSE = """<AllocateAddressResponse xmlns="http://ec2.amazonaws.com/doc/2013-10-15/"> <requestId>59dbff89-35bd-4eac-99ed-be587EXAMPLE</requestId> <publicIp>{{ address.public_ip }}</publicIp> <domain>{{ address.domain }}</domain> {% if address.allocation_id %} <allocationId>{{ address.allocation_id }}</allocationId> {% endif %} </AllocateAddressResponse>""" ASSOCIATE_ADDRESS_RESPONSE = """<AssociateAddressResponse xmlns="http://ec2.amazonaws.com/doc/2013-10-15/"> <requestId>59dbff89-35bd-4eac-99ed-be587EXAMPLE</requestId> <return>true</return> {% if address.association_id %} <associationId>{{ address.association_id }}</associationId> {% endif %} </AssociateAddressResponse>""" DESCRIBE_ADDRESS_RESPONSE = """<DescribeAddressesResponse xmlns="http://ec2.amazonaws.com/doc/2013-10-15/"> <requestId>59dbff89-35bd-4eac-99ed-be587EXAMPLE</requestId> <addressesSet> {% for address in addresses %} <item> <publicIp>{{ address.public_ip }}</publicIp> <domain>{{ address.domain }}</domain> {% if address.instance %} <instanceId>{{ address.instance.id }}</instanceId> {% else %} <instanceId/> {% endif %} {% if address.eni %} <networkInterfaceId>{{ address.eni.id }}</networkInterfaceId> {% else %} <networkInterfaceId/> {% endif %} {% if address.allocation_id %} <allocationId>{{ address.allocation_id }}</allocationId> {% endif %} {% if address.association_id %} <associationId>{{ address.association_id }}</associationId> {% endif %} <tagSet> {% for tag in address.get_tags() %} <item> <key>{{ tag.key }}</key> <value>{{ tag.value }}</value> </item> {% endfor %} </tagSet> </item> {% endfor %} </addressesSet> </DescribeAddressesResponse>""" DISASSOCIATE_ADDRESS_RESPONSE = """<DisassociateAddressResponse xmlns="http://ec2.amazonaws.com/doc/2013-10-15/"> <requestId>59dbff89-35bd-4eac-99ed-be587EXAMPLE</requestId> <return>true</return> </DisassociateAddressResponse>""" RELEASE_ADDRESS_RESPONSE = """<ReleaseAddressResponse xmlns="http://ec2.amazonaws.com/doc/2013-10-15/"> <requestId>59dbff89-35bd-4eac-99ed-be587EXAMPLE</requestId> <return>true</return> </ReleaseAddressResponse>"""
true
true
f70a7a9d650cd69fbf70293d70feac3812614d3c
6,344
py
Python
markdown/extensions/headerid.py
koocieyu/interactive-tutorials
873851b37f0a13b6218ba1e656d51169010981fe
[ "Apache-2.0" ]
5,079
2015-01-01T03:39:46.000Z
2022-03-31T07:38:22.000Z
markdown/extensions/headerid.py
koocieyu/interactive-tutorials
873851b37f0a13b6218ba1e656d51169010981fe
[ "Apache-2.0" ]
1,623
2015-01-01T08:06:24.000Z
2022-03-30T19:48:52.000Z
markdown/extensions/headerid.py
koocieyu/interactive-tutorials
873851b37f0a13b6218ba1e656d51169010981fe
[ "Apache-2.0" ]
2,033
2015-01-04T07:18:02.000Z
2022-03-28T19:55:47.000Z
#!/usr/bin/python """ HeaderID Extension for Python-Markdown ====================================== Adds ability to set HTML IDs for headers. Basic usage: >>> import markdown >>> text = "# Some Header # {#some_id}" >>> md = markdown.markdown(text, ['headerid']) >>> md u'<h1 id="some_id">Some Header</h1>' All header IDs are unique: >>> text = ''' ... #Header ... #Another Header {#header} ... #Third Header {#header}''' >>> md = markdown.markdown(text, ['headerid']) >>> md u'<h1 id="header">Header</h1>\\n<h1 id="header_1">Another Header</h1>\\n<h1 id="header_2">Third Header</h1>' To fit within a html template's hierarchy, set the header base level: >>> text = ''' ... #Some Header ... ## Next Level''' >>> md = markdown.markdown(text, ['headerid(level=3)']) >>> md u'<h3 id="some_header">Some Header</h3>\\n<h4 id="next_level">Next Level</h4>' Turn off auto generated IDs: >>> text = ''' ... # Some Header ... # Header with ID # { #foo }''' >>> md = markdown.markdown(text, ['headerid(forceid=False)']) >>> md u'<h1>Some Header</h1>\\n<h1 id="foo">Header with ID</h1>' Use with MetaData extension: >>> text = '''header_level: 2 ... header_forceid: Off ... ... # A Header''' >>> md = markdown.markdown(text, ['headerid', 'meta']) >>> md u'<h2>A Header</h2>' Copyright 2007-2008 [Waylan Limberg](http://achinghead.com/). Project website: <http://www.freewisdom.org/project/python-markdown/HeaderId> Contact: markdown@freewisdom.org License: BSD (see ../docs/LICENSE for details) Dependencies: * [Python 2.3+](http://python.org) * [Markdown 2.0+](http://www.freewisdom.org/projects/python-markdown/) """ import markdown from markdown import etree import re from string import ascii_lowercase, digits, punctuation ID_CHARS = ascii_lowercase + digits + '-_' IDCOUNT_RE = re.compile(r'^(.*)_([0-9]+)$') class HeaderIdProcessor(markdown.blockprocessors.BlockProcessor): """ Replacement BlockProcessor for Header IDs. """ # Detect a header at start of any line in block RE = re.compile(r"""(^|\n) (?P<level>\#{1,6}) # group('level') = string of hashes (?P<header>.*?) # group('header') = Header text \#* # optional closing hashes (?:[ \t]*\{[ \t]*\#(?P<id>[-_:a-zA-Z0-9]+)[ \t]*\})? (\n|$) # ^^ group('id') = id attribute """, re.VERBOSE) IDs = [] def test(self, parent, block): return bool(self.RE.search(block)) def run(self, parent, blocks): block = blocks.pop(0) m = self.RE.search(block) if m: before = block[:m.start()] # All lines before header after = block[m.end():] # All lines after header if before: # As the header was not the first line of the block and the # lines before the header must be parsed first, # recursively parse this lines as a block. self.parser.parseBlocks(parent, [before]) # Create header using named groups from RE start_level, force_id = self._get_meta() level = len(m.group('level')) + start_level if level > 6: level = 6 h = markdown.etree.SubElement(parent, 'h%d' % level) h.text = m.group('header').strip() if m.group('id'): h.set('id', self._unique_id(m.group('id'))) elif force_id: h.set('id', self._create_id(m.group('header').strip())) if after: # Insert remaining lines as first block for future parsing. blocks.insert(0, after) else: # This should never happen, but just in case... message(CRITICAL, "We've got a problem header!") def _get_meta(self): """ Return meta data suported by this ext as a tuple """ level = int(self.config['level'][0]) - 1 force = self._str2bool(self.config['forceid'][0]) if hasattr(self.md, 'Meta'): if self.md.Meta.has_key('header_level'): level = int(self.md.Meta['header_level'][0]) - 1 if self.md.Meta.has_key('header_forceid'): force = self._str2bool(self.md.Meta['header_forceid'][0]) return level, force def _str2bool(self, s, default=False): """ Convert a string to a booleen value. """ s = str(s) if s.lower() in ['0', 'f', 'false', 'off', 'no', 'n']: return False elif s.lower() in ['1', 't', 'true', 'on', 'yes', 'y']: return True return default def _unique_id(self, id): """ Ensure ID is unique. Append '_1', '_2'... if not """ while id in self.IDs: m = IDCOUNT_RE.match(id) if m: id = '%s_%d'% (m.group(1), int(m.group(2))+1) else: id = '%s_%d'% (id, 1) self.IDs.append(id) return id def _create_id(self, header): """ Return ID from Header text. """ h = '' for c in header.lower().replace(' ', '_'): if c in ID_CHARS: h += c elif c not in punctuation: h += '+' return self._unique_id(h) class HeaderIdExtension (markdown.Extension): def __init__(self, configs): # set defaults self.config = { 'level' : ['1', 'Base level for headers.'], 'forceid' : ['True', 'Force all headers to have an id.'] } for key, value in configs: self.setConfig(key, value) def extendMarkdown(self, md, md_globals): md.registerExtension(self) self.processor = HeaderIdProcessor(md.parser) self.processor.md = md self.processor.config = self.config # Replace existing hasheader in place. md.parser.blockprocessors['hashheader'] = self.processor def reset(self): self.processor.IDs = [] def makeExtension(configs=None): return HeaderIdExtension(configs=configs) if __name__ == "__main__": import doctest doctest.testmod()
32.367347
112
0.539565
import markdown from markdown import etree import re from string import ascii_lowercase, digits, punctuation ID_CHARS = ascii_lowercase + digits + '-_' IDCOUNT_RE = re.compile(r'^(.*)_([0-9]+)$') class HeaderIdProcessor(markdown.blockprocessors.BlockProcessor): RE = re.compile(r"""(^|\n) (?P<level>\#{1,6}) # group('level') = string of hashes (?P<header>.*?) # group('header') = Header text \#* # optional closing hashes (?:[ \t]*\{[ \t]*\#(?P<id>[-_:a-zA-Z0-9]+)[ \t]*\})? (\n|$) # ^^ group('id') = id attribute """, re.VERBOSE) IDs = [] def test(self, parent, block): return bool(self.RE.search(block)) def run(self, parent, blocks): block = blocks.pop(0) m = self.RE.search(block) if m: before = block[:m.start()] after = block[m.end():] if before: self.parser.parseBlocks(parent, [before]) start_level, force_id = self._get_meta() level = len(m.group('level')) + start_level if level > 6: level = 6 h = markdown.etree.SubElement(parent, 'h%d' % level) h.text = m.group('header').strip() if m.group('id'): h.set('id', self._unique_id(m.group('id'))) elif force_id: h.set('id', self._create_id(m.group('header').strip())) if after: blocks.insert(0, after) else: message(CRITICAL, "We've got a problem header!") def _get_meta(self): level = int(self.config['level'][0]) - 1 force = self._str2bool(self.config['forceid'][0]) if hasattr(self.md, 'Meta'): if self.md.Meta.has_key('header_level'): level = int(self.md.Meta['header_level'][0]) - 1 if self.md.Meta.has_key('header_forceid'): force = self._str2bool(self.md.Meta['header_forceid'][0]) return level, force def _str2bool(self, s, default=False): s = str(s) if s.lower() in ['0', 'f', 'false', 'off', 'no', 'n']: return False elif s.lower() in ['1', 't', 'true', 'on', 'yes', 'y']: return True return default def _unique_id(self, id): while id in self.IDs: m = IDCOUNT_RE.match(id) if m: id = '%s_%d'% (m.group(1), int(m.group(2))+1) else: id = '%s_%d'% (id, 1) self.IDs.append(id) return id def _create_id(self, header): h = '' for c in header.lower().replace(' ', '_'): if c in ID_CHARS: h += c elif c not in punctuation: h += '+' return self._unique_id(h) class HeaderIdExtension (markdown.Extension): def __init__(self, configs): # set defaults self.config = { 'level' : ['1', 'Base level for headers.'], 'forceid' : ['True', 'Force all headers to have an id.'] } for key, value in configs: self.setConfig(key, value) def extendMarkdown(self, md, md_globals): md.registerExtension(self) self.processor = HeaderIdProcessor(md.parser) self.processor.md = md self.processor.config = self.config # Replace existing hasheader in place. md.parser.blockprocessors['hashheader'] = self.processor def reset(self): self.processor.IDs = [] def makeExtension(configs=None): return HeaderIdExtension(configs=configs) if __name__ == "__main__": import doctest doctest.testmod()
true
true
f70a7c482c9860f258e06df2c22abbd6f1f50e9f
60,529
py
Python
xdl-algorithm-solution/Rocket/script/rnn.py
Ru-Xiang/x-deeplearning
04cc0497150920c64b06bb8c314ef89977a3427a
[ "Apache-2.0" ]
4,071
2018-12-13T04:17:38.000Z
2022-03-30T03:29:35.000Z
xdl-algorithm-solution/Rocket/script/rnn.py
laozhuang727/x-deeplearning
781545783a4e2bbbda48fc64318fb2c6d8bbb3cc
[ "Apache-2.0" ]
359
2018-12-21T01:14:57.000Z
2022-02-15T07:18:02.000Z
xdl-algorithm-solution/Rocket/script/rnn.py
laozhuang727/x-deeplearning
781545783a4e2bbbda48fc64318fb2c6d8bbb3cc
[ "Apache-2.0" ]
1,054
2018-12-20T09:57:42.000Z
2022-03-29T07:16:53.000Z
# Copyright (C) 2016-2018 Alibaba Group Holding Limited # # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. # ============================================================================== # Copyright 2015 The TensorFlow Authors. All Rights Reserved. # # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. # ============================================================================== """RNN helpers for TensorFlow models. @@bidirectional_dynamic_rnn @@dynamic_rnn @@raw_rnn @@static_rnn @@static_state_saving_rnn @@static_bidirectional_rnn """ from __future__ import absolute_import from __future__ import division from __future__ import print_function from tensorflow.python.framework import constant_op from tensorflow.python.framework import dtypes from tensorflow.python.framework import ops from tensorflow.python.framework import tensor_shape from tensorflow.python.ops import array_ops from tensorflow.python.ops import control_flow_ops from tensorflow.python.ops import math_ops from tensorflow.python.ops import rnn_cell_impl from tensorflow.python.ops import tensor_array_ops from tensorflow.python.ops import variable_scope as vs from tensorflow.python.util import nest # pylint: disable=protected-access _concat = rnn_cell_impl._concat assert_like_rnncell = rnn_cell_impl.assert_like_rnncell # pylint: enable=protected-access def _transpose_batch_time(x): """Transpose the batch and time dimensions of a Tensor. Retains as much of the static shape information as possible. Args: x: A tensor of rank 2 or higher. Returns: x transposed along the first two dimensions. Raises: ValueError: if `x` is rank 1 or lower. """ x_static_shape = x.get_shape() if x_static_shape.ndims is not None and x_static_shape.ndims < 2: raise ValueError( "Expected input tensor %s to have rank at least 2, but saw shape: %s" % (x, x_static_shape)) x_rank = array_ops.rank(x) x_t = array_ops.transpose( x, array_ops.concat( ([1, 0], math_ops.range(2, x_rank)), axis=0)) x_t.set_shape( tensor_shape.TensorShape([ x_static_shape[1].value, x_static_shape[0].value ]).concatenate(x_static_shape[2:])) return x_t def _best_effort_input_batch_size(flat_input): """Get static input batch size if available, with fallback to the dynamic one. Args: flat_input: An iterable of time major input Tensors of shape [max_time, batch_size, ...]. All inputs should have compatible batch sizes. Returns: The batch size in Python integer if available, or a scalar Tensor otherwise. Raises: ValueError: if there is any input with an invalid shape. """ for input_ in flat_input: shape = input_.shape if shape.ndims is None: continue if shape.ndims < 2: raise ValueError( "Expected input tensor %s to have rank at least 2" % input_) batch_size = shape[1].value if batch_size is not None: return batch_size # Fallback to the dynamic batch size of the first input. return array_ops.shape(flat_input[0])[1] def _infer_state_dtype(explicit_dtype, state): """Infer the dtype of an RNN state. Args: explicit_dtype: explicitly declared dtype or None. state: RNN's hidden state. Must be a Tensor or a nested iterable containing Tensors. Returns: dtype: inferred dtype of hidden state. Raises: ValueError: if `state` has heterogeneous dtypes or is empty. """ if explicit_dtype is not None: return explicit_dtype elif nest.is_sequence(state): inferred_dtypes = [element.dtype for element in nest.flatten(state)] if not inferred_dtypes: raise ValueError("Unable to infer dtype from empty state.") all_same = all([x == inferred_dtypes[0] for x in inferred_dtypes]) if not all_same: raise ValueError( "State has tensors of different inferred_dtypes. Unable to infer a " "single representative dtype.") return inferred_dtypes[0] else: return state.dtype # pylint: disable=unused-argument def _rnn_step( time, sequence_length, min_sequence_length, max_sequence_length, zero_output, state, call_cell, state_size, skip_conditionals=False): """Calculate one step of a dynamic RNN minibatch. Returns an (output, state) pair conditioned on the sequence_lengths. When skip_conditionals=False, the pseudocode is something like: if t >= max_sequence_length: return (zero_output, state) if t < min_sequence_length: return call_cell() # Selectively output zeros or output, old state or new state depending # on if we've finished calculating each row. new_output, new_state = call_cell() final_output = np.vstack([ zero_output if time >= sequence_lengths[r] else new_output_r for r, new_output_r in enumerate(new_output) ]) final_state = np.vstack([ state[r] if time >= sequence_lengths[r] else new_state_r for r, new_state_r in enumerate(new_state) ]) return (final_output, final_state) Args: time: Python int, the current time step sequence_length: int32 `Tensor` vector of size [batch_size] min_sequence_length: int32 `Tensor` scalar, min of sequence_length max_sequence_length: int32 `Tensor` scalar, max of sequence_length zero_output: `Tensor` vector of shape [output_size] state: Either a single `Tensor` matrix of shape `[batch_size, state_size]`, or a list/tuple of such tensors. call_cell: lambda returning tuple of (new_output, new_state) where new_output is a `Tensor` matrix of shape `[batch_size, output_size]`. new_state is a `Tensor` matrix of shape `[batch_size, state_size]`. state_size: The `cell.state_size` associated with the state. skip_conditionals: Python bool, whether to skip using the conditional calculations. This is useful for `dynamic_rnn`, where the input tensor matches `max_sequence_length`, and using conditionals just slows everything down. Returns: A tuple of (`final_output`, `final_state`) as given by the pseudocode above: final_output is a `Tensor` matrix of shape [batch_size, output_size] final_state is either a single `Tensor` matrix, or a tuple of such matrices (matching length and shapes of input `state`). Raises: ValueError: If the cell returns a state tuple whose length does not match that returned by `state_size`. """ # Convert state to a list for ease of use flat_state = nest.flatten(state) flat_zero_output = nest.flatten(zero_output) def _copy_one_through(output, new_output): # If the state contains a scalar value we simply pass it through. if output.shape.ndims == 0: return new_output copy_cond = (time >= sequence_length) with ops.colocate_with(new_output): return array_ops.where(copy_cond, output, new_output) def _copy_some_through(flat_new_output, flat_new_state): # Use broadcasting select to determine which values should get # the previous state & zero output, and which values should get # a calculated state & output. flat_new_output = [ _copy_one_through(zero_output, new_output) for zero_output, new_output in zip(flat_zero_output, flat_new_output)] flat_new_state = [ _copy_one_through(state, new_state) for state, new_state in zip(flat_state, flat_new_state)] return flat_new_output + flat_new_state def _maybe_copy_some_through(): """Run RNN step. Pass through either no or some past state.""" new_output, new_state = call_cell() nest.assert_same_structure(state, new_state) flat_new_state = nest.flatten(new_state) flat_new_output = nest.flatten(new_output) return control_flow_ops.cond( # if t < min_seq_len: calculate and return everything time < min_sequence_length, lambda: flat_new_output + flat_new_state, # else copy some of it through lambda: _copy_some_through(flat_new_output, flat_new_state)) # TODO(ebrevdo): skipping these conditionals may cause a slowdown, # but benefits from removing cond() and its gradient. We should # profile with and without this switch here. if skip_conditionals: # Instead of using conditionals, perform the selective copy at all time # steps. This is faster when max_seq_len is equal to the number of unrolls # (which is typical for dynamic_rnn). new_output, new_state = call_cell() nest.assert_same_structure(state, new_state) new_state = nest.flatten(new_state) new_output = nest.flatten(new_output) final_output_and_state = _copy_some_through(new_output, new_state) else: empty_update = lambda: flat_zero_output + flat_state final_output_and_state = control_flow_ops.cond( # if t >= max_seq_len: copy all state through, output zeros time >= max_sequence_length, empty_update, # otherwise calculation is required: copy some or all of it through _maybe_copy_some_through) if len(final_output_and_state) != len(flat_zero_output) + len(flat_state): raise ValueError("Internal error: state and output were not concatenated " "correctly.") final_output = final_output_and_state[:len(flat_zero_output)] final_state = final_output_and_state[len(flat_zero_output):] for output, flat_output in zip(final_output, flat_zero_output): output.set_shape(flat_output.get_shape()) for substate, flat_substate in zip(final_state, flat_state): substate.set_shape(flat_substate.get_shape()) final_output = nest.pack_sequence_as( structure=zero_output, flat_sequence=final_output) final_state = nest.pack_sequence_as( structure=state, flat_sequence=final_state) return final_output, final_state def _reverse_seq(input_seq, lengths): """Reverse a list of Tensors up to specified lengths. Args: input_seq: Sequence of seq_len tensors of dimension (batch_size, n_features) or nested tuples of tensors. lengths: A `Tensor` of dimension batch_size, containing lengths for each sequence in the batch. If "None" is specified, simply reverses the list. Returns: time-reversed sequence """ if lengths is None: return list(reversed(input_seq)) flat_input_seq = tuple(nest.flatten(input_) for input_ in input_seq) flat_results = [[] for _ in range(len(input_seq))] for sequence in zip(*flat_input_seq): input_shape = tensor_shape.unknown_shape( ndims=sequence[0].get_shape().ndims) for input_ in sequence: input_shape.merge_with(input_.get_shape()) input_.set_shape(input_shape) # Join into (time, batch_size, depth) s_joined = array_ops.stack(sequence) # Reverse along dimension 0 s_reversed = array_ops.reverse_sequence(s_joined, lengths, 0, 1) # Split again into list result = array_ops.unstack(s_reversed) for r, flat_result in zip(result, flat_results): r.set_shape(input_shape) flat_result.append(r) results = [nest.pack_sequence_as(structure=input_, flat_sequence=flat_result) for input_, flat_result in zip(input_seq, flat_results)] return results def bidirectional_dynamic_rnn(cell_fw, cell_bw, inputs, sequence_length=None, initial_state_fw=None, initial_state_bw=None, dtype=None, parallel_iterations=None, swap_memory=False, time_major=False, scope=None): """Creates a dynamic version of bidirectional recurrent neural network. Takes input and builds independent forward and backward RNNs. The input_size of forward and backward cell must match. The initial state for both directions is zero by default (but can be set optionally) and no intermediate states are ever returned -- the network is fully unrolled for the given (passed in) length(s) of the sequence(s) or completely unrolled if length(s) is not given. Args: cell_fw: An instance of RNNCell, to be used for forward direction. cell_bw: An instance of RNNCell, to be used for backward direction. inputs: The RNN inputs. If time_major == False (default), this must be a tensor of shape: `[batch_size, max_time, ...]`, or a nested tuple of such elements. If time_major == True, this must be a tensor of shape: `[max_time, batch_size, ...]`, or a nested tuple of such elements. sequence_length: (optional) An int32/int64 vector, size `[batch_size]`, containing the actual lengths for each of the sequences in the batch. If not provided, all batch entries are assumed to be full sequences; and time reversal is applied from time `0` to `max_time` for each sequence. initial_state_fw: (optional) An initial state for the forward RNN. This must be a tensor of appropriate type and shape `[batch_size, cell_fw.state_size]`. If `cell_fw.state_size` is a tuple, this should be a tuple of tensors having shapes `[batch_size, s] for s in cell_fw.state_size`. initial_state_bw: (optional) Same as for `initial_state_fw`, but using the corresponding properties of `cell_bw`. dtype: (optional) The data type for the initial states and expected output. Required if initial_states are not provided or RNN states have a heterogeneous dtype. parallel_iterations: (Default: 32). The number of iterations to run in parallel. Those operations which do not have any temporal dependency and can be run in parallel, will be. This parameter trades off time for space. Values >> 1 use more memory but take less time, while smaller values use less memory but computations take longer. swap_memory: Transparently swap the tensors produced in forward inference but needed for back prop from GPU to CPU. This allows training RNNs which would typically not fit on a single GPU, with very minimal (or no) performance penalty. time_major: The shape format of the `inputs` and `outputs` Tensors. If true, these `Tensors` must be shaped `[max_time, batch_size, depth]`. If false, these `Tensors` must be shaped `[batch_size, max_time, depth]`. Using `time_major = True` is a bit more efficient because it avoids transposes at the beginning and end of the RNN calculation. However, most TensorFlow data is batch-major, so by default this function accepts input and emits output in batch-major form. scope: VariableScope for the created subgraph; defaults to "bidirectional_rnn" Returns: A tuple (outputs, output_states) where: outputs: A tuple (output_fw, output_bw) containing the forward and the backward rnn output `Tensor`. If time_major == False (default), output_fw will be a `Tensor` shaped: `[batch_size, max_time, cell_fw.output_size]` and output_bw will be a `Tensor` shaped: `[batch_size, max_time, cell_bw.output_size]`. If time_major == True, output_fw will be a `Tensor` shaped: `[max_time, batch_size, cell_fw.output_size]` and output_bw will be a `Tensor` shaped: `[max_time, batch_size, cell_bw.output_size]`. It returns a tuple instead of a single concatenated `Tensor`, unlike in the `bidirectional_rnn`. If the concatenated one is preferred, the forward and backward outputs can be concatenated as `tf.concat(outputs, 2)`. output_states: A tuple (output_state_fw, output_state_bw) containing the forward and the backward final states of bidirectional rnn. Raises: TypeError: If `cell_fw` or `cell_bw` is not an instance of `RNNCell`. """ assert_like_rnncell("cell_fw", cell_fw) assert_like_rnncell("cell_bw", cell_bw) with vs.variable_scope(scope or "bidirectional_rnn"): # Forward direction with vs.variable_scope("fw") as fw_scope: output_fw, output_state_fw = dynamic_rnn( cell=cell_fw, inputs=inputs, sequence_length=sequence_length, initial_state=initial_state_fw, dtype=dtype, parallel_iterations=parallel_iterations, swap_memory=swap_memory, time_major=time_major, scope=fw_scope) # Backward direction if not time_major: time_dim = 1 batch_dim = 0 else: time_dim = 0 batch_dim = 1 def _reverse(input_, seq_lengths, seq_dim, batch_dim): if seq_lengths is not None: return array_ops.reverse_sequence( input=input_, seq_lengths=seq_lengths, seq_dim=seq_dim, batch_dim=batch_dim) else: return array_ops.reverse(input_, axis=[seq_dim]) with vs.variable_scope("bw") as bw_scope: inputs_reverse = _reverse( inputs, seq_lengths=sequence_length, seq_dim=time_dim, batch_dim=batch_dim) tmp, output_state_bw = dynamic_rnn( cell=cell_bw, inputs=inputs_reverse, sequence_length=sequence_length, initial_state=initial_state_bw, dtype=dtype, parallel_iterations=parallel_iterations, swap_memory=swap_memory, time_major=time_major, scope=bw_scope) output_bw = _reverse( tmp, seq_lengths=sequence_length, seq_dim=time_dim, batch_dim=batch_dim) outputs = (output_fw, output_bw) output_states = (output_state_fw, output_state_bw) return (outputs, output_states) def dynamic_rnn(cell, inputs, att_scores=None, sequence_length=None, initial_state=None, dtype=None, parallel_iterations=None, swap_memory=False, time_major=False, scope=None): """Creates a recurrent neural network specified by RNNCell `cell`. Performs fully dynamic unrolling of `inputs`. Example: ```python # create a BasicRNNCell rnn_cell = tf.nn.rnn_cell.BasicRNNCell(hidden_size) # 'outputs' is a tensor of shape [batch_size, max_time, cell_state_size] # defining initial state initial_state = rnn_cell.zero_state(batch_size, dtype=tf.float32) # 'state' is a tensor of shape [batch_size, cell_state_size] outputs, state = tf.nn.dynamic_rnn(rnn_cell, input_data, initial_state=initial_state, dtype=tf.float32) ``` ```python # create 2 LSTMCells rnn_layers = [tf.nn.rnn_cell.LSTMCell(size) for size in [128, 256]] # create a RNN cell composed sequentially of a number of RNNCells multi_rnn_cell = tf.nn.rnn_cell.MultiRNNCell(rnn_layers) # 'outputs' is a tensor of shape [batch_size, max_time, 256] # 'state' is a N-tuple where N is the number of LSTMCells containing a # tf.contrib.rnn.LSTMStateTuple for each cell outputs, state = tf.nn.dynamic_rnn(cell=multi_rnn_cell, inputs=data, dtype=tf.float32) ``` Args: cell: An instance of RNNCell. inputs: The RNN inputs. If `time_major == False` (default), this must be a `Tensor` of shape: `[batch_size, max_time, ...]`, or a nested tuple of such elements. If `time_major == True`, this must be a `Tensor` of shape: `[max_time, batch_size, ...]`, or a nested tuple of such elements. This may also be a (possibly nested) tuple of Tensors satisfying this property. The first two dimensions must match across all the inputs, but otherwise the ranks and other shape components may differ. In this case, input to `cell` at each time-step will replicate the structure of these tuples, except for the time dimension (from which the time is taken). The input to `cell` at each time step will be a `Tensor` or (possibly nested) tuple of Tensors each with dimensions `[batch_size, ...]`. sequence_length: (optional) An int32/int64 vector sized `[batch_size]`. Used to copy-through state and zero-out outputs when past a batch element's sequence length. So it's more for correctness than performance. initial_state: (optional) An initial state for the RNN. If `cell.state_size` is an integer, this must be a `Tensor` of appropriate type and shape `[batch_size, cell.state_size]`. If `cell.state_size` is a tuple, this should be a tuple of tensors having shapes `[batch_size, s] for s in cell.state_size`. dtype: (optional) The data type for the initial state and expected output. Required if initial_state is not provided or RNN state has a heterogeneous dtype. parallel_iterations: (Default: 32). The number of iterations to run in parallel. Those operations which do not have any temporal dependency and can be run in parallel, will be. This parameter trades off time for space. Values >> 1 use more memory but take less time, while smaller values use less memory but computations take longer. swap_memory: Transparently swap the tensors produced in forward inference but needed for back prop from GPU to CPU. This allows training RNNs which would typically not fit on a single GPU, with very minimal (or no) performance penalty. time_major: The shape format of the `inputs` and `outputs` Tensors. If true, these `Tensors` must be shaped `[max_time, batch_size, depth]`. If false, these `Tensors` must be shaped `[batch_size, max_time, depth]`. Using `time_major = True` is a bit more efficient because it avoids transposes at the beginning and end of the RNN calculation. However, most TensorFlow data is batch-major, so by default this function accepts input and emits output in batch-major form. scope: VariableScope for the created subgraph; defaults to "rnn". Returns: A pair (outputs, state) where: outputs: The RNN output `Tensor`. If time_major == False (default), this will be a `Tensor` shaped: `[batch_size, max_time, cell.output_size]`. If time_major == True, this will be a `Tensor` shaped: `[max_time, batch_size, cell.output_size]`. Note, if `cell.output_size` is a (possibly nested) tuple of integers or `TensorShape` objects, then `outputs` will be a tuple having the same structure as `cell.output_size`, containing Tensors having shapes corresponding to the shape data in `cell.output_size`. state: The final state. If `cell.state_size` is an int, this will be shaped `[batch_size, cell.state_size]`. If it is a `TensorShape`, this will be shaped `[batch_size] + cell.state_size`. If it is a (possibly nested) tuple of ints or `TensorShape`, this will be a tuple having the corresponding shapes. If cells are `LSTMCells` `state` will be a tuple containing a `LSTMStateTuple` for each cell. Raises: TypeError: If `cell` is not an instance of RNNCell. ValueError: If inputs is None or an empty list. """ assert_like_rnncell("cell", cell) # By default, time_major==False and inputs are batch-major: shaped # [batch, time, depth] # For internal calculations, we transpose to [time, batch, depth] flat_input = nest.flatten(inputs) if not time_major: # (B,T,D) => (T,B,D) flat_input = [ops.convert_to_tensor(input_) for input_ in flat_input] flat_input = tuple(_transpose_batch_time(input_) for input_ in flat_input) parallel_iterations = parallel_iterations or 32 if sequence_length is not None: sequence_length = math_ops.to_int32(sequence_length) if sequence_length.get_shape().ndims not in (None, 1): raise ValueError( "sequence_length must be a vector of length batch_size, " "but saw shape: %s" % sequence_length.get_shape()) sequence_length = array_ops.identity( # Just to find it in the graph. sequence_length, name="sequence_length") # Create a new scope in which the caching device is either # determined by the parent scope, or is set to place the cached # Variable using the same placement as for the rest of the RNN. with vs.variable_scope(scope or "rnn") as varscope: if varscope.caching_device is None: varscope.set_caching_device(lambda op: op.device) batch_size = _best_effort_input_batch_size(flat_input) if initial_state is not None: state = initial_state else: if not dtype: raise ValueError("If there is no initial_state, you must give a dtype.") state = cell.zero_state(batch_size, dtype) def _assert_has_shape(x, shape): x_shape = array_ops.shape(x) packed_shape = array_ops.stack(shape) return control_flow_ops.Assert( math_ops.reduce_all(math_ops.equal(x_shape, packed_shape)), ["Expected shape for Tensor %s is " % x.name, packed_shape, " but saw shape: ", x_shape]) if sequence_length is not None: # Perform some shape validation with ops.control_dependencies( [_assert_has_shape(sequence_length, [batch_size])]): sequence_length = array_ops.identity( sequence_length, name="CheckSeqLen") inputs = nest.pack_sequence_as(structure=inputs, flat_sequence=flat_input) (outputs, final_state) = _dynamic_rnn_loop( cell, inputs, state, parallel_iterations=parallel_iterations, swap_memory=swap_memory, att_scores = att_scores, sequence_length=sequence_length, dtype=dtype) # Outputs of _dynamic_rnn_loop are always shaped [time, batch, depth]. # If we are performing batch-major calculations, transpose output back # to shape [batch, time, depth] if not time_major: # (T,B,D) => (B,T,D) outputs = nest.map_structure(_transpose_batch_time, outputs) return (outputs, final_state) def _dynamic_rnn_loop(cell, inputs, initial_state, parallel_iterations, swap_memory, att_scores = None, sequence_length=None, dtype=None): """Internal implementation of Dynamic RNN. Args: cell: An instance of RNNCell. inputs: A `Tensor` of shape [time, batch_size, input_size], or a nested tuple of such elements. initial_state: A `Tensor` of shape `[batch_size, state_size]`, or if `cell.state_size` is a tuple, then this should be a tuple of tensors having shapes `[batch_size, s] for s in cell.state_size`. parallel_iterations: Positive Python int. swap_memory: A Python boolean sequence_length: (optional) An `int32` `Tensor` of shape [batch_size]. dtype: (optional) Expected dtype of output. If not specified, inferred from initial_state. Returns: Tuple `(final_outputs, final_state)`. final_outputs: A `Tensor` of shape `[time, batch_size, cell.output_size]`. If `cell.output_size` is a (possibly nested) tuple of ints or `TensorShape` objects, then this returns a (possibly nsted) tuple of Tensors matching the corresponding shapes. final_state: A `Tensor`, or possibly nested tuple of Tensors, matching in length and shapes to `initial_state`. Raises: ValueError: If the input depth cannot be inferred via shape inference from the inputs. """ state = initial_state assert isinstance(parallel_iterations, int), "parallel_iterations must be int" state_size = cell.state_size flat_input = nest.flatten(inputs) flat_output_size = nest.flatten(cell.output_size) # Construct an initial output input_shape = array_ops.shape(flat_input[0]) time_steps = input_shape[0] batch_size = _best_effort_input_batch_size(flat_input) inputs_got_shape = tuple(input_.get_shape().with_rank_at_least(3) for input_ in flat_input) const_time_steps, const_batch_size = inputs_got_shape[0].as_list()[:2] for shape in inputs_got_shape: if not shape[2:].is_fully_defined(): raise ValueError( "Input size (depth of inputs) must be accessible via shape inference," " but saw value None.") got_time_steps = shape[0].value got_batch_size = shape[1].value if const_time_steps != got_time_steps: raise ValueError( "Time steps is not the same for all the elements in the input in a " "batch.") if const_batch_size != got_batch_size: raise ValueError( "Batch_size is not the same for all the elements in the input.") # Prepare dynamic conditional copying of state & output def _create_zero_arrays(size): size = _concat(batch_size, size) return array_ops.zeros( array_ops.stack(size), _infer_state_dtype(dtype, state)) flat_zero_output = tuple(_create_zero_arrays(output) for output in flat_output_size) zero_output = nest.pack_sequence_as(structure=cell.output_size, flat_sequence=flat_zero_output) if sequence_length is not None: min_sequence_length = math_ops.reduce_min(sequence_length) max_sequence_length = math_ops.reduce_max(sequence_length) time = array_ops.constant(0, dtype=dtypes.int32, name="time") with ops.name_scope("dynamic_rnn") as scope: base_name = scope def _create_ta(name, dtype): return tensor_array_ops.TensorArray(dtype=dtype, size=time_steps, tensor_array_name=base_name + name) output_ta = tuple(_create_ta("output_%d" % i, _infer_state_dtype(dtype, state)) for i in range(len(flat_output_size))) input_ta = tuple(_create_ta("input_%d" % i, flat_input[i].dtype) for i in range(len(flat_input))) input_ta = tuple(ta.unstack(input_) for ta, input_ in zip(input_ta, flat_input)) def _time_step(time, output_ta_t, state, att_scores=None): """Take a time step of the dynamic RNN. Args: time: int32 scalar Tensor. output_ta_t: List of `TensorArray`s that represent the output. state: nested tuple of vector tensors that represent the state. Returns: The tuple (time + 1, output_ta_t with updated flow, new_state). """ input_t = tuple(ta.read(time) for ta in input_ta) # Restore some shape information for input_, shape in zip(input_t, inputs_got_shape): input_.set_shape(shape[1:]) input_t = nest.pack_sequence_as(structure=inputs, flat_sequence=input_t) if att_scores is not None: att_score = att_scores[:, time, :] call_cell = lambda: cell(input_t, state, att_score) else: call_cell = lambda: cell(input_t, state) if sequence_length is not None: (output, new_state) = _rnn_step( time=time, sequence_length=sequence_length, min_sequence_length=min_sequence_length, max_sequence_length=max_sequence_length, zero_output=zero_output, state=state, call_cell=call_cell, state_size=state_size, skip_conditionals=True) else: (output, new_state) = call_cell() # Pack state if using state tuples output = nest.flatten(output) output_ta_t = tuple( ta.write(time, out) for ta, out in zip(output_ta_t, output)) if att_scores is not None: return (time + 1, output_ta_t, new_state, att_scores) else: return (time + 1, output_ta_t, new_state) if att_scores is not None: _, output_final_ta, final_state, _ = control_flow_ops.while_loop( cond=lambda time, *_: time < time_steps, body=_time_step, loop_vars=(time, output_ta, state, att_scores), parallel_iterations=parallel_iterations, swap_memory=swap_memory) else: _, output_final_ta, final_state = control_flow_ops.while_loop( cond=lambda time, *_: time < time_steps, body=_time_step, loop_vars=(time, output_ta, state), parallel_iterations=parallel_iterations, swap_memory=swap_memory) # Unpack final output if not using output tuples. final_outputs = tuple(ta.stack() for ta in output_final_ta) # Restore some shape information for output, output_size in zip(final_outputs, flat_output_size): shape = _concat( [const_time_steps, const_batch_size], output_size, static=True) output.set_shape(shape) final_outputs = nest.pack_sequence_as( structure=cell.output_size, flat_sequence=final_outputs) return (final_outputs, final_state) def raw_rnn(cell, loop_fn, parallel_iterations=None, swap_memory=False, scope=None): """Creates an `RNN` specified by RNNCell `cell` and loop function `loop_fn`. **NOTE: This method is still in testing, and the API may change.** This function is a more primitive version of `dynamic_rnn` that provides more direct access to the inputs each iteration. It also provides more control over when to start and finish reading the sequence, and what to emit for the output. For example, it can be used to implement the dynamic decoder of a seq2seq model. Instead of working with `Tensor` objects, most operations work with `TensorArray` objects directly. The operation of `raw_rnn`, in pseudo-code, is basically the following: ```python time = tf.constant(0, dtype=tf.int32) (finished, next_input, initial_state, _, loop_state) = loop_fn( time=time, cell_output=None, cell_state=None, loop_state=None) emit_ta = TensorArray(dynamic_size=True, dtype=initial_state.dtype) state = initial_state while not all(finished): (output, cell_state) = cell(next_input, state) (next_finished, next_input, next_state, emit, loop_state) = loop_fn( time=time + 1, cell_output=output, cell_state=cell_state, loop_state=loop_state) # Emit zeros and copy forward state for minibatch entries that are finished. state = tf.where(finished, state, next_state) emit = tf.where(finished, tf.zeros_like(emit), emit) emit_ta = emit_ta.write(time, emit) # If any new minibatch entries are marked as finished, mark these. finished = tf.logical_or(finished, next_finished) time += 1 return (emit_ta, state, loop_state) ``` with the additional properties that output and state may be (possibly nested) tuples, as determined by `cell.output_size` and `cell.state_size`, and as a result the final `state` and `emit_ta` may themselves be tuples. A simple implementation of `dynamic_rnn` via `raw_rnn` looks like this: ```python inputs = tf.placeholder(shape=(max_time, batch_size, input_depth), dtype=tf.float32) sequence_length = tf.placeholder(shape=(batch_size,), dtype=tf.int32) inputs_ta = tf.TensorArray(dtype=tf.float32, size=max_time) inputs_ta = inputs_ta.unstack(inputs) cell = tf.contrib.rnn.LSTMCell(num_units) def loop_fn(time, cell_output, cell_state, loop_state): emit_output = cell_output # == None for time == 0 if cell_output is None: # time == 0 next_cell_state = cell.zero_state(batch_size, tf.float32) else: next_cell_state = cell_state elements_finished = (time >= sequence_length) finished = tf.reduce_all(elements_finished) next_input = tf.cond( finished, lambda: tf.zeros([batch_size, input_depth], dtype=tf.float32), lambda: inputs_ta.read(time)) next_loop_state = None return (elements_finished, next_input, next_cell_state, emit_output, next_loop_state) outputs_ta, final_state, _ = raw_rnn(cell, loop_fn) outputs = outputs_ta.stack() ``` Args: cell: An instance of RNNCell. loop_fn: A callable that takes inputs `(time, cell_output, cell_state, loop_state)` and returns the tuple `(finished, next_input, next_cell_state, emit_output, next_loop_state)`. Here `time` is an int32 scalar `Tensor`, `cell_output` is a `Tensor` or (possibly nested) tuple of tensors as determined by `cell.output_size`, and `cell_state` is a `Tensor` or (possibly nested) tuple of tensors, as determined by the `loop_fn` on its first call (and should match `cell.state_size`). The outputs are: `finished`, a boolean `Tensor` of shape `[batch_size]`, `next_input`: the next input to feed to `cell`, `next_cell_state`: the next state to feed to `cell`, and `emit_output`: the output to store for this iteration. Note that `emit_output` should be a `Tensor` or (possibly nested) tuple of tensors with shapes and structure matching `cell.output_size` and `cell_output` above. The parameter `cell_state` and output `next_cell_state` may be either a single or (possibly nested) tuple of tensors. The parameter `loop_state` and output `next_loop_state` may be either a single or (possibly nested) tuple of `Tensor` and `TensorArray` objects. This last parameter may be ignored by `loop_fn` and the return value may be `None`. If it is not `None`, then the `loop_state` will be propagated through the RNN loop, for use purely by `loop_fn` to keep track of its own state. The `next_loop_state` parameter returned may be `None`. The first call to `loop_fn` will be `time = 0`, `cell_output = None`, `cell_state = None`, and `loop_state = None`. For this call: The `next_cell_state` value should be the value with which to initialize the cell's state. It may be a final state from a previous RNN or it may be the output of `cell.zero_state()`. It should be a (possibly nested) tuple structure of tensors. If `cell.state_size` is an integer, this must be a `Tensor` of appropriate type and shape `[batch_size, cell.state_size]`. If `cell.state_size` is a `TensorShape`, this must be a `Tensor` of appropriate type and shape `[batch_size] + cell.state_size`. If `cell.state_size` is a (possibly nested) tuple of ints or `TensorShape`, this will be a tuple having the corresponding shapes. The `emit_output` value may be either `None` or a (possibly nested) tuple structure of tensors, e.g., `(tf.zeros(shape_0, dtype=dtype_0), tf.zeros(shape_1, dtype=dtype_1))`. If this first `emit_output` return value is `None`, then the `emit_ta` result of `raw_rnn` will have the same structure and dtypes as `cell.output_size`. Otherwise `emit_ta` will have the same structure, shapes (prepended with a `batch_size` dimension), and dtypes as `emit_output`. The actual values returned for `emit_output` at this initializing call are ignored. Note, this emit structure must be consistent across all time steps. parallel_iterations: (Default: 32). The number of iterations to run in parallel. Those operations which do not have any temporal dependency and can be run in parallel, will be. This parameter trades off time for space. Values >> 1 use more memory but take less time, while smaller values use less memory but computations take longer. swap_memory: Transparently swap the tensors produced in forward inference but needed for back prop from GPU to CPU. This allows training RNNs which would typically not fit on a single GPU, with very minimal (or no) performance penalty. scope: VariableScope for the created subgraph; defaults to "rnn". Returns: A tuple `(emit_ta, final_state, final_loop_state)` where: `emit_ta`: The RNN output `TensorArray`. If `loop_fn` returns a (possibly nested) set of Tensors for `emit_output` during initialization, (inputs `time = 0`, `cell_output = None`, and `loop_state = None`), then `emit_ta` will have the same structure, dtypes, and shapes as `emit_output` instead. If `loop_fn` returns `emit_output = None` during this call, the structure of `cell.output_size` is used: If `cell.output_size` is a (possibly nested) tuple of integers or `TensorShape` objects, then `emit_ta` will be a tuple having the same structure as `cell.output_size`, containing TensorArrays whose elements' shapes correspond to the shape data in `cell.output_size`. `final_state`: The final cell state. If `cell.state_size` is an int, this will be shaped `[batch_size, cell.state_size]`. If it is a `TensorShape`, this will be shaped `[batch_size] + cell.state_size`. If it is a (possibly nested) tuple of ints or `TensorShape`, this will be a tuple having the corresponding shapes. `final_loop_state`: The final loop state as returned by `loop_fn`. Raises: TypeError: If `cell` is not an instance of RNNCell, or `loop_fn` is not a `callable`. """ assert_like_rnncell("cell", cell) if not callable(loop_fn): raise TypeError("loop_fn must be a callable") parallel_iterations = parallel_iterations or 32 # Create a new scope in which the caching device is either # determined by the parent scope, or is set to place the cached # Variable using the same placement as for the rest of the RNN. with vs.variable_scope(scope or "rnn") as varscope: if varscope.caching_device is None: varscope.set_caching_device(lambda op: op.device) time = constant_op.constant(0, dtype=dtypes.int32) (elements_finished, next_input, initial_state, emit_structure, init_loop_state) = loop_fn( time, None, None, None) # time, cell_output, cell_state, loop_state flat_input = nest.flatten(next_input) # Need a surrogate loop state for the while_loop if none is available. loop_state = (init_loop_state if init_loop_state is not None else constant_op.constant(0, dtype=dtypes.int32)) input_shape = [input_.get_shape() for input_ in flat_input] static_batch_size = input_shape[0][0] for input_shape_i in input_shape: # Static verification that batch sizes all match static_batch_size.merge_with(input_shape_i[0]) batch_size = static_batch_size.value if batch_size is None: batch_size = array_ops.shape(flat_input[0])[0] nest.assert_same_structure(initial_state, cell.state_size) state = initial_state flat_state = nest.flatten(state) flat_state = [ops.convert_to_tensor(s) for s in flat_state] state = nest.pack_sequence_as(structure=state, flat_sequence=flat_state) if emit_structure is not None: flat_emit_structure = nest.flatten(emit_structure) flat_emit_size = [emit.shape if emit.shape.is_fully_defined() else array_ops.shape(emit) for emit in flat_emit_structure] flat_emit_dtypes = [emit.dtype for emit in flat_emit_structure] else: emit_structure = cell.output_size flat_emit_size = nest.flatten(emit_structure) flat_emit_dtypes = [flat_state[0].dtype] * len(flat_emit_size) flat_emit_ta = [ tensor_array_ops.TensorArray( dtype=dtype_i, dynamic_size=True, size=0, name="rnn_output_%d" % i) for i, dtype_i in enumerate(flat_emit_dtypes)] emit_ta = nest.pack_sequence_as(structure=emit_structure, flat_sequence=flat_emit_ta) flat_zero_emit = [ array_ops.zeros(_concat(batch_size, size_i), dtype_i) for size_i, dtype_i in zip(flat_emit_size, flat_emit_dtypes)] zero_emit = nest.pack_sequence_as(structure=emit_structure, flat_sequence=flat_zero_emit) def condition(unused_time, elements_finished, *_): return math_ops.logical_not(math_ops.reduce_all(elements_finished)) def body(time, elements_finished, current_input, emit_ta, state, loop_state): """Internal while loop body for raw_rnn. Args: time: time scalar. elements_finished: batch-size vector. current_input: possibly nested tuple of input tensors. emit_ta: possibly nested tuple of output TensorArrays. state: possibly nested tuple of state tensors. loop_state: possibly nested tuple of loop state tensors. Returns: Tuple having the same size as Args but with updated values. """ (next_output, cell_state) = cell(current_input, state) nest.assert_same_structure(state, cell_state) nest.assert_same_structure(cell.output_size, next_output) next_time = time + 1 (next_finished, next_input, next_state, emit_output, next_loop_state) = loop_fn( next_time, next_output, cell_state, loop_state) nest.assert_same_structure(state, next_state) nest.assert_same_structure(current_input, next_input) nest.assert_same_structure(emit_ta, emit_output) # If loop_fn returns None for next_loop_state, just reuse the # previous one. loop_state = loop_state if next_loop_state is None else next_loop_state def _copy_some_through(current, candidate): """Copy some tensors through via array_ops.where.""" def copy_fn(cur_i, cand_i): with ops.colocate_with(cand_i): return array_ops.where(elements_finished, cur_i, cand_i) return nest.map_structure(copy_fn, current, candidate) emit_output = _copy_some_through(zero_emit, emit_output) next_state = _copy_some_through(state, next_state) emit_ta = nest.map_structure( lambda ta, emit: ta.write(time, emit), emit_ta, emit_output) elements_finished = math_ops.logical_or(elements_finished, next_finished) return (next_time, elements_finished, next_input, emit_ta, next_state, loop_state) returned = control_flow_ops.while_loop( condition, body, loop_vars=[ time, elements_finished, next_input, emit_ta, state, loop_state], parallel_iterations=parallel_iterations, swap_memory=swap_memory) (emit_ta, final_state, final_loop_state) = returned[-3:] if init_loop_state is None: final_loop_state = None return (emit_ta, final_state, final_loop_state) def static_rnn(cell, inputs, initial_state=None, dtype=None, sequence_length=None, scope=None): """Creates a recurrent neural network specified by RNNCell `cell`. The simplest form of RNN network generated is: ```python state = cell.zero_state(...) outputs = [] for input_ in inputs: output, state = cell(input_, state) outputs.append(output) return (outputs, state) ``` However, a few other options are available: An initial state can be provided. If the sequence_length vector is provided, dynamic calculation is performed. This method of calculation does not compute the RNN steps past the maximum sequence length of the minibatch (thus saving computational time), and properly propagates the state at an example's sequence length to the final state output. The dynamic calculation performed is, at time `t` for batch row `b`, ```python (output, state)(b, t) = (t >= sequence_length(b)) ? (zeros(cell.output_size), states(b, sequence_length(b) - 1)) : cell(input(b, t), state(b, t - 1)) ``` Args: cell: An instance of RNNCell. inputs: A length T list of inputs, each a `Tensor` of shape `[batch_size, input_size]`, or a nested tuple of such elements. initial_state: (optional) An initial state for the RNN. If `cell.state_size` is an integer, this must be a `Tensor` of appropriate type and shape `[batch_size, cell.state_size]`. If `cell.state_size` is a tuple, this should be a tuple of tensors having shapes `[batch_size, s] for s in cell.state_size`. dtype: (optional) The data type for the initial state and expected output. Required if initial_state is not provided or RNN state has a heterogeneous dtype. sequence_length: Specifies the length of each sequence in inputs. An int32 or int64 vector (tensor) size `[batch_size]`, values in `[0, T)`. scope: VariableScope for the created subgraph; defaults to "rnn". Returns: A pair (outputs, state) where: - outputs is a length T list of outputs (one for each input), or a nested tuple of such elements. - state is the final state Raises: TypeError: If `cell` is not an instance of RNNCell. ValueError: If `inputs` is `None` or an empty list, or if the input depth (column size) cannot be inferred from inputs via shape inference. """ assert_like_rnncell("cell", cell) if not nest.is_sequence(inputs): raise TypeError("inputs must be a sequence") if not inputs: raise ValueError("inputs must not be empty") outputs = [] # Create a new scope in which the caching device is either # determined by the parent scope, or is set to place the cached # Variable using the same placement as for the rest of the RNN. with vs.variable_scope(scope or "rnn") as varscope: if varscope.caching_device is None: varscope.set_caching_device(lambda op: op.device) # Obtain the first sequence of the input first_input = inputs while nest.is_sequence(first_input): first_input = first_input[0] # Temporarily avoid EmbeddingWrapper and seq2seq badness # TODO(lukaszkaiser): remove EmbeddingWrapper if first_input.get_shape().ndims != 1: input_shape = first_input.get_shape().with_rank_at_least(2) fixed_batch_size = input_shape[0] flat_inputs = nest.flatten(inputs) for flat_input in flat_inputs: input_shape = flat_input.get_shape().with_rank_at_least(2) batch_size, input_size = input_shape[0], input_shape[1:] fixed_batch_size.merge_with(batch_size) for i, size in enumerate(input_size): if size.value is None: raise ValueError( "Input size (dimension %d of inputs) must be accessible via " "shape inference, but saw value None." % i) else: fixed_batch_size = first_input.get_shape().with_rank_at_least(1)[0] if fixed_batch_size.value: batch_size = fixed_batch_size.value else: batch_size = array_ops.shape(first_input)[0] if initial_state is not None: state = initial_state else: if not dtype: raise ValueError("If no initial_state is provided, " "dtype must be specified") state = cell.zero_state(batch_size, dtype) if sequence_length is not None: # Prepare variables sequence_length = ops.convert_to_tensor( sequence_length, name="sequence_length") if sequence_length.get_shape().ndims not in (None, 1): raise ValueError( "sequence_length must be a vector of length batch_size") def _create_zero_output(output_size): # convert int to TensorShape if necessary size = _concat(batch_size, output_size) output = array_ops.zeros( array_ops.stack(size), _infer_state_dtype(dtype, state)) shape = _concat(fixed_batch_size.value, output_size, static=True) output.set_shape(tensor_shape.TensorShape(shape)) return output output_size = cell.output_size flat_output_size = nest.flatten(output_size) flat_zero_output = tuple( _create_zero_output(size) for size in flat_output_size) zero_output = nest.pack_sequence_as( structure=output_size, flat_sequence=flat_zero_output) sequence_length = math_ops.to_int32(sequence_length) min_sequence_length = math_ops.reduce_min(sequence_length) max_sequence_length = math_ops.reduce_max(sequence_length) for time, input_ in enumerate(inputs): if time > 0: varscope.reuse_variables() # pylint: disable=cell-var-from-loop call_cell = lambda: cell(input_, state) # pylint: enable=cell-var-from-loop if sequence_length is not None: (output, state) = _rnn_step( time=time, sequence_length=sequence_length, min_sequence_length=min_sequence_length, max_sequence_length=max_sequence_length, zero_output=zero_output, state=state, call_cell=call_cell, state_size=cell.state_size) else: (output, state) = call_cell() outputs.append(output) return (outputs, state) def static_state_saving_rnn(cell, inputs, state_saver, state_name, sequence_length=None, scope=None): """RNN that accepts a state saver for time-truncated RNN calculation. Args: cell: An instance of `RNNCell`. inputs: A length T list of inputs, each a `Tensor` of shape `[batch_size, input_size]`. state_saver: A state saver object with methods `state` and `save_state`. state_name: Python string or tuple of strings. The name to use with the state_saver. If the cell returns tuples of states (i.e., `cell.state_size` is a tuple) then `state_name` should be a tuple of strings having the same length as `cell.state_size`. Otherwise it should be a single string. sequence_length: (optional) An int32/int64 vector size [batch_size]. See the documentation for rnn() for more details about sequence_length. scope: VariableScope for the created subgraph; defaults to "rnn". Returns: A pair (outputs, state) where: outputs is a length T list of outputs (one for each input) states is the final state Raises: TypeError: If `cell` is not an instance of RNNCell. ValueError: If `inputs` is `None` or an empty list, or if the arity and type of `state_name` does not match that of `cell.state_size`. """ state_size = cell.state_size state_is_tuple = nest.is_sequence(state_size) state_name_tuple = nest.is_sequence(state_name) if state_is_tuple != state_name_tuple: raise ValueError("state_name should be the same type as cell.state_size. " "state_name: %s, cell.state_size: %s" % (str(state_name), str(state_size))) if state_is_tuple: state_name_flat = nest.flatten(state_name) state_size_flat = nest.flatten(state_size) if len(state_name_flat) != len(state_size_flat): raise ValueError("#elems(state_name) != #elems(state_size): %d vs. %d" % (len(state_name_flat), len(state_size_flat))) initial_state = nest.pack_sequence_as( structure=state_size, flat_sequence=[state_saver.state(s) for s in state_name_flat]) else: initial_state = state_saver.state(state_name) (outputs, state) = static_rnn( cell, inputs, initial_state=initial_state, sequence_length=sequence_length, scope=scope) if state_is_tuple: flat_state = nest.flatten(state) state_name = nest.flatten(state_name) save_state = [ state_saver.save_state(name, substate) for name, substate in zip(state_name, flat_state) ] else: save_state = [state_saver.save_state(state_name, state)] with ops.control_dependencies(save_state): last_output = outputs[-1] flat_last_output = nest.flatten(last_output) flat_last_output = [ array_ops.identity(output) for output in flat_last_output ] outputs[-1] = nest.pack_sequence_as( structure=last_output, flat_sequence=flat_last_output) return (outputs, state) def static_bidirectional_rnn(cell_fw, cell_bw, inputs, initial_state_fw=None, initial_state_bw=None, dtype=None, sequence_length=None, scope=None): """Creates a bidirectional recurrent neural network. Similar to the unidirectional case above (rnn) but takes input and builds independent forward and backward RNNs with the final forward and backward outputs depth-concatenated, such that the output will have the format [time][batch][cell_fw.output_size + cell_bw.output_size]. The input_size of forward and backward cell must match. The initial state for both directions is zero by default (but can be set optionally) and no intermediate states are ever returned -- the network is fully unrolled for the given (passed in) length(s) of the sequence(s) or completely unrolled if length(s) is not given. Args: cell_fw: An instance of RNNCell, to be used for forward direction. cell_bw: An instance of RNNCell, to be used for backward direction. inputs: A length T list of inputs, each a tensor of shape [batch_size, input_size], or a nested tuple of such elements. initial_state_fw: (optional) An initial state for the forward RNN. This must be a tensor of appropriate type and shape `[batch_size, cell_fw.state_size]`. If `cell_fw.state_size` is a tuple, this should be a tuple of tensors having shapes `[batch_size, s] for s in cell_fw.state_size`. initial_state_bw: (optional) Same as for `initial_state_fw`, but using the corresponding properties of `cell_bw`. dtype: (optional) The data type for the initial state. Required if either of the initial states are not provided. sequence_length: (optional) An int32/int64 vector, size `[batch_size]`, containing the actual lengths for each of the sequences. scope: VariableScope for the created subgraph; defaults to "bidirectional_rnn" Returns: A tuple (outputs, output_state_fw, output_state_bw) where: outputs is a length `T` list of outputs (one for each input), which are depth-concatenated forward and backward outputs. output_state_fw is the final state of the forward rnn. output_state_bw is the final state of the backward rnn. Raises: TypeError: If `cell_fw` or `cell_bw` is not an instance of `RNNCell`. ValueError: If inputs is None or an empty list. """ if not _like_rnncell(cell_fw): raise TypeError("cell_fw must be an instance of RNNCell") if not _like_rnncell(cell_bw): raise TypeError("cell_bw must be an instance of RNNCell") if not nest.is_sequence(inputs): raise TypeError("inputs must be a sequence") if not inputs: raise ValueError("inputs must not be empty") with vs.variable_scope(scope or "bidirectional_rnn"): # Forward direction with vs.variable_scope("fw") as fw_scope: output_fw, output_state_fw = static_rnn( cell_fw, inputs, initial_state_fw, dtype, sequence_length, scope=fw_scope) # Backward direction with vs.variable_scope("bw") as bw_scope: reversed_inputs = _reverse_seq(inputs, sequence_length) tmp, output_state_bw = static_rnn( cell_bw, reversed_inputs, initial_state_bw, dtype, sequence_length, scope=bw_scope) output_bw = _reverse_seq(tmp, sequence_length) # Concat each of the forward/backward outputs flat_output_fw = nest.flatten(output_fw) flat_output_bw = nest.flatten(output_bw) flat_outputs = tuple( array_ops.concat([fw, bw], 1) for fw, bw in zip(flat_output_fw, flat_output_bw)) outputs = nest.pack_sequence_as( structure=output_fw, flat_sequence=flat_outputs) return (outputs, output_state_fw, output_state_bw)
41.316724
88
0.693321
from __future__ import absolute_import from __future__ import division from __future__ import print_function from tensorflow.python.framework import constant_op from tensorflow.python.framework import dtypes from tensorflow.python.framework import ops from tensorflow.python.framework import tensor_shape from tensorflow.python.ops import array_ops from tensorflow.python.ops import control_flow_ops from tensorflow.python.ops import math_ops from tensorflow.python.ops import rnn_cell_impl from tensorflow.python.ops import tensor_array_ops from tensorflow.python.ops import variable_scope as vs from tensorflow.python.util import nest _concat = rnn_cell_impl._concat assert_like_rnncell = rnn_cell_impl.assert_like_rnncell def _transpose_batch_time(x): x_static_shape = x.get_shape() if x_static_shape.ndims is not None and x_static_shape.ndims < 2: raise ValueError( "Expected input tensor %s to have rank at least 2, but saw shape: %s" % (x, x_static_shape)) x_rank = array_ops.rank(x) x_t = array_ops.transpose( x, array_ops.concat( ([1, 0], math_ops.range(2, x_rank)), axis=0)) x_t.set_shape( tensor_shape.TensorShape([ x_static_shape[1].value, x_static_shape[0].value ]).concatenate(x_static_shape[2:])) return x_t def _best_effort_input_batch_size(flat_input): for input_ in flat_input: shape = input_.shape if shape.ndims is None: continue if shape.ndims < 2: raise ValueError( "Expected input tensor %s to have rank at least 2" % input_) batch_size = shape[1].value if batch_size is not None: return batch_size return array_ops.shape(flat_input[0])[1] def _infer_state_dtype(explicit_dtype, state): if explicit_dtype is not None: return explicit_dtype elif nest.is_sequence(state): inferred_dtypes = [element.dtype for element in nest.flatten(state)] if not inferred_dtypes: raise ValueError("Unable to infer dtype from empty state.") all_same = all([x == inferred_dtypes[0] for x in inferred_dtypes]) if not all_same: raise ValueError( "State has tensors of different inferred_dtypes. Unable to infer a " "single representative dtype.") return inferred_dtypes[0] else: return state.dtype def _rnn_step( time, sequence_length, min_sequence_length, max_sequence_length, zero_output, state, call_cell, state_size, skip_conditionals=False): flat_state = nest.flatten(state) flat_zero_output = nest.flatten(zero_output) def _copy_one_through(output, new_output): if output.shape.ndims == 0: return new_output copy_cond = (time >= sequence_length) with ops.colocate_with(new_output): return array_ops.where(copy_cond, output, new_output) def _copy_some_through(flat_new_output, flat_new_state): flat_new_output = [ _copy_one_through(zero_output, new_output) for zero_output, new_output in zip(flat_zero_output, flat_new_output)] flat_new_state = [ _copy_one_through(state, new_state) for state, new_state in zip(flat_state, flat_new_state)] return flat_new_output + flat_new_state def _maybe_copy_some_through(): new_output, new_state = call_cell() nest.assert_same_structure(state, new_state) flat_new_state = nest.flatten(new_state) flat_new_output = nest.flatten(new_output) return control_flow_ops.cond( time < min_sequence_length, lambda: flat_new_output + flat_new_state, lambda: _copy_some_through(flat_new_output, flat_new_state)) if skip_conditionals: new_output, new_state = call_cell() nest.assert_same_structure(state, new_state) new_state = nest.flatten(new_state) new_output = nest.flatten(new_output) final_output_and_state = _copy_some_through(new_output, new_state) else: empty_update = lambda: flat_zero_output + flat_state final_output_and_state = control_flow_ops.cond( time >= max_sequence_length, empty_update, _maybe_copy_some_through) if len(final_output_and_state) != len(flat_zero_output) + len(flat_state): raise ValueError("Internal error: state and output were not concatenated " "correctly.") final_output = final_output_and_state[:len(flat_zero_output)] final_state = final_output_and_state[len(flat_zero_output):] for output, flat_output in zip(final_output, flat_zero_output): output.set_shape(flat_output.get_shape()) for substate, flat_substate in zip(final_state, flat_state): substate.set_shape(flat_substate.get_shape()) final_output = nest.pack_sequence_as( structure=zero_output, flat_sequence=final_output) final_state = nest.pack_sequence_as( structure=state, flat_sequence=final_state) return final_output, final_state def _reverse_seq(input_seq, lengths): if lengths is None: return list(reversed(input_seq)) flat_input_seq = tuple(nest.flatten(input_) for input_ in input_seq) flat_results = [[] for _ in range(len(input_seq))] for sequence in zip(*flat_input_seq): input_shape = tensor_shape.unknown_shape( ndims=sequence[0].get_shape().ndims) for input_ in sequence: input_shape.merge_with(input_.get_shape()) input_.set_shape(input_shape) s_joined = array_ops.stack(sequence) s_reversed = array_ops.reverse_sequence(s_joined, lengths, 0, 1) result = array_ops.unstack(s_reversed) for r, flat_result in zip(result, flat_results): r.set_shape(input_shape) flat_result.append(r) results = [nest.pack_sequence_as(structure=input_, flat_sequence=flat_result) for input_, flat_result in zip(input_seq, flat_results)] return results def bidirectional_dynamic_rnn(cell_fw, cell_bw, inputs, sequence_length=None, initial_state_fw=None, initial_state_bw=None, dtype=None, parallel_iterations=None, swap_memory=False, time_major=False, scope=None): assert_like_rnncell("cell_fw", cell_fw) assert_like_rnncell("cell_bw", cell_bw) with vs.variable_scope(scope or "bidirectional_rnn"): with vs.variable_scope("fw") as fw_scope: output_fw, output_state_fw = dynamic_rnn( cell=cell_fw, inputs=inputs, sequence_length=sequence_length, initial_state=initial_state_fw, dtype=dtype, parallel_iterations=parallel_iterations, swap_memory=swap_memory, time_major=time_major, scope=fw_scope) if not time_major: time_dim = 1 batch_dim = 0 else: time_dim = 0 batch_dim = 1 def _reverse(input_, seq_lengths, seq_dim, batch_dim): if seq_lengths is not None: return array_ops.reverse_sequence( input=input_, seq_lengths=seq_lengths, seq_dim=seq_dim, batch_dim=batch_dim) else: return array_ops.reverse(input_, axis=[seq_dim]) with vs.variable_scope("bw") as bw_scope: inputs_reverse = _reverse( inputs, seq_lengths=sequence_length, seq_dim=time_dim, batch_dim=batch_dim) tmp, output_state_bw = dynamic_rnn( cell=cell_bw, inputs=inputs_reverse, sequence_length=sequence_length, initial_state=initial_state_bw, dtype=dtype, parallel_iterations=parallel_iterations, swap_memory=swap_memory, time_major=time_major, scope=bw_scope) output_bw = _reverse( tmp, seq_lengths=sequence_length, seq_dim=time_dim, batch_dim=batch_dim) outputs = (output_fw, output_bw) output_states = (output_state_fw, output_state_bw) return (outputs, output_states) def dynamic_rnn(cell, inputs, att_scores=None, sequence_length=None, initial_state=None, dtype=None, parallel_iterations=None, swap_memory=False, time_major=False, scope=None): assert_like_rnncell("cell", cell) flat_input = nest.flatten(inputs) if not time_major: flat_input = [ops.convert_to_tensor(input_) for input_ in flat_input] flat_input = tuple(_transpose_batch_time(input_) for input_ in flat_input) parallel_iterations = parallel_iterations or 32 if sequence_length is not None: sequence_length = math_ops.to_int32(sequence_length) if sequence_length.get_shape().ndims not in (None, 1): raise ValueError( "sequence_length must be a vector of length batch_size, " "but saw shape: %s" % sequence_length.get_shape()) sequence_length = array_ops.identity( sequence_length, name="sequence_length") with vs.variable_scope(scope or "rnn") as varscope: if varscope.caching_device is None: varscope.set_caching_device(lambda op: op.device) batch_size = _best_effort_input_batch_size(flat_input) if initial_state is not None: state = initial_state else: if not dtype: raise ValueError("If there is no initial_state, you must give a dtype.") state = cell.zero_state(batch_size, dtype) def _assert_has_shape(x, shape): x_shape = array_ops.shape(x) packed_shape = array_ops.stack(shape) return control_flow_ops.Assert( math_ops.reduce_all(math_ops.equal(x_shape, packed_shape)), ["Expected shape for Tensor %s is " % x.name, packed_shape, " but saw shape: ", x_shape]) if sequence_length is not None: with ops.control_dependencies( [_assert_has_shape(sequence_length, [batch_size])]): sequence_length = array_ops.identity( sequence_length, name="CheckSeqLen") inputs = nest.pack_sequence_as(structure=inputs, flat_sequence=flat_input) (outputs, final_state) = _dynamic_rnn_loop( cell, inputs, state, parallel_iterations=parallel_iterations, swap_memory=swap_memory, att_scores = att_scores, sequence_length=sequence_length, dtype=dtype) if not time_major: outputs = nest.map_structure(_transpose_batch_time, outputs) return (outputs, final_state) def _dynamic_rnn_loop(cell, inputs, initial_state, parallel_iterations, swap_memory, att_scores = None, sequence_length=None, dtype=None): state = initial_state assert isinstance(parallel_iterations, int), "parallel_iterations must be int" state_size = cell.state_size flat_input = nest.flatten(inputs) flat_output_size = nest.flatten(cell.output_size) input_shape = array_ops.shape(flat_input[0]) time_steps = input_shape[0] batch_size = _best_effort_input_batch_size(flat_input) inputs_got_shape = tuple(input_.get_shape().with_rank_at_least(3) for input_ in flat_input) const_time_steps, const_batch_size = inputs_got_shape[0].as_list()[:2] for shape in inputs_got_shape: if not shape[2:].is_fully_defined(): raise ValueError( "Input size (depth of inputs) must be accessible via shape inference," " but saw value None.") got_time_steps = shape[0].value got_batch_size = shape[1].value if const_time_steps != got_time_steps: raise ValueError( "Time steps is not the same for all the elements in the input in a " "batch.") if const_batch_size != got_batch_size: raise ValueError( "Batch_size is not the same for all the elements in the input.") def _create_zero_arrays(size): size = _concat(batch_size, size) return array_ops.zeros( array_ops.stack(size), _infer_state_dtype(dtype, state)) flat_zero_output = tuple(_create_zero_arrays(output) for output in flat_output_size) zero_output = nest.pack_sequence_as(structure=cell.output_size, flat_sequence=flat_zero_output) if sequence_length is not None: min_sequence_length = math_ops.reduce_min(sequence_length) max_sequence_length = math_ops.reduce_max(sequence_length) time = array_ops.constant(0, dtype=dtypes.int32, name="time") with ops.name_scope("dynamic_rnn") as scope: base_name = scope def _create_ta(name, dtype): return tensor_array_ops.TensorArray(dtype=dtype, size=time_steps, tensor_array_name=base_name + name) output_ta = tuple(_create_ta("output_%d" % i, _infer_state_dtype(dtype, state)) for i in range(len(flat_output_size))) input_ta = tuple(_create_ta("input_%d" % i, flat_input[i].dtype) for i in range(len(flat_input))) input_ta = tuple(ta.unstack(input_) for ta, input_ in zip(input_ta, flat_input)) def _time_step(time, output_ta_t, state, att_scores=None): input_t = tuple(ta.read(time) for ta in input_ta) for input_, shape in zip(input_t, inputs_got_shape): input_.set_shape(shape[1:]) input_t = nest.pack_sequence_as(structure=inputs, flat_sequence=input_t) if att_scores is not None: att_score = att_scores[:, time, :] call_cell = lambda: cell(input_t, state, att_score) else: call_cell = lambda: cell(input_t, state) if sequence_length is not None: (output, new_state) = _rnn_step( time=time, sequence_length=sequence_length, min_sequence_length=min_sequence_length, max_sequence_length=max_sequence_length, zero_output=zero_output, state=state, call_cell=call_cell, state_size=state_size, skip_conditionals=True) else: (output, new_state) = call_cell() output = nest.flatten(output) output_ta_t = tuple( ta.write(time, out) for ta, out in zip(output_ta_t, output)) if att_scores is not None: return (time + 1, output_ta_t, new_state, att_scores) else: return (time + 1, output_ta_t, new_state) if att_scores is not None: _, output_final_ta, final_state, _ = control_flow_ops.while_loop( cond=lambda time, *_: time < time_steps, body=_time_step, loop_vars=(time, output_ta, state, att_scores), parallel_iterations=parallel_iterations, swap_memory=swap_memory) else: _, output_final_ta, final_state = control_flow_ops.while_loop( cond=lambda time, *_: time < time_steps, body=_time_step, loop_vars=(time, output_ta, state), parallel_iterations=parallel_iterations, swap_memory=swap_memory) final_outputs = tuple(ta.stack() for ta in output_final_ta) for output, output_size in zip(final_outputs, flat_output_size): shape = _concat( [const_time_steps, const_batch_size], output_size, static=True) output.set_shape(shape) final_outputs = nest.pack_sequence_as( structure=cell.output_size, flat_sequence=final_outputs) return (final_outputs, final_state) def raw_rnn(cell, loop_fn, parallel_iterations=None, swap_memory=False, scope=None): assert_like_rnncell("cell", cell) if not callable(loop_fn): raise TypeError("loop_fn must be a callable") parallel_iterations = parallel_iterations or 32 with vs.variable_scope(scope or "rnn") as varscope: if varscope.caching_device is None: varscope.set_caching_device(lambda op: op.device) time = constant_op.constant(0, dtype=dtypes.int32) (elements_finished, next_input, initial_state, emit_structure, init_loop_state) = loop_fn( time, None, None, None) flat_input = nest.flatten(next_input) loop_state = (init_loop_state if init_loop_state is not None else constant_op.constant(0, dtype=dtypes.int32)) input_shape = [input_.get_shape() for input_ in flat_input] static_batch_size = input_shape[0][0] for input_shape_i in input_shape: static_batch_size.merge_with(input_shape_i[0]) batch_size = static_batch_size.value if batch_size is None: batch_size = array_ops.shape(flat_input[0])[0] nest.assert_same_structure(initial_state, cell.state_size) state = initial_state flat_state = nest.flatten(state) flat_state = [ops.convert_to_tensor(s) for s in flat_state] state = nest.pack_sequence_as(structure=state, flat_sequence=flat_state) if emit_structure is not None: flat_emit_structure = nest.flatten(emit_structure) flat_emit_size = [emit.shape if emit.shape.is_fully_defined() else array_ops.shape(emit) for emit in flat_emit_structure] flat_emit_dtypes = [emit.dtype for emit in flat_emit_structure] else: emit_structure = cell.output_size flat_emit_size = nest.flatten(emit_structure) flat_emit_dtypes = [flat_state[0].dtype] * len(flat_emit_size) flat_emit_ta = [ tensor_array_ops.TensorArray( dtype=dtype_i, dynamic_size=True, size=0, name="rnn_output_%d" % i) for i, dtype_i in enumerate(flat_emit_dtypes)] emit_ta = nest.pack_sequence_as(structure=emit_structure, flat_sequence=flat_emit_ta) flat_zero_emit = [ array_ops.zeros(_concat(batch_size, size_i), dtype_i) for size_i, dtype_i in zip(flat_emit_size, flat_emit_dtypes)] zero_emit = nest.pack_sequence_as(structure=emit_structure, flat_sequence=flat_zero_emit) def condition(unused_time, elements_finished, *_): return math_ops.logical_not(math_ops.reduce_all(elements_finished)) def body(time, elements_finished, current_input, emit_ta, state, loop_state): (next_output, cell_state) = cell(current_input, state) nest.assert_same_structure(state, cell_state) nest.assert_same_structure(cell.output_size, next_output) next_time = time + 1 (next_finished, next_input, next_state, emit_output, next_loop_state) = loop_fn( next_time, next_output, cell_state, loop_state) nest.assert_same_structure(state, next_state) nest.assert_same_structure(current_input, next_input) nest.assert_same_structure(emit_ta, emit_output) loop_state = loop_state if next_loop_state is None else next_loop_state def _copy_some_through(current, candidate): def copy_fn(cur_i, cand_i): with ops.colocate_with(cand_i): return array_ops.where(elements_finished, cur_i, cand_i) return nest.map_structure(copy_fn, current, candidate) emit_output = _copy_some_through(zero_emit, emit_output) next_state = _copy_some_through(state, next_state) emit_ta = nest.map_structure( lambda ta, emit: ta.write(time, emit), emit_ta, emit_output) elements_finished = math_ops.logical_or(elements_finished, next_finished) return (next_time, elements_finished, next_input, emit_ta, next_state, loop_state) returned = control_flow_ops.while_loop( condition, body, loop_vars=[ time, elements_finished, next_input, emit_ta, state, loop_state], parallel_iterations=parallel_iterations, swap_memory=swap_memory) (emit_ta, final_state, final_loop_state) = returned[-3:] if init_loop_state is None: final_loop_state = None return (emit_ta, final_state, final_loop_state) def static_rnn(cell, inputs, initial_state=None, dtype=None, sequence_length=None, scope=None): assert_like_rnncell("cell", cell) if not nest.is_sequence(inputs): raise TypeError("inputs must be a sequence") if not inputs: raise ValueError("inputs must not be empty") outputs = [] with vs.variable_scope(scope or "rnn") as varscope: if varscope.caching_device is None: varscope.set_caching_device(lambda op: op.device) first_input = inputs while nest.is_sequence(first_input): first_input = first_input[0] if first_input.get_shape().ndims != 1: input_shape = first_input.get_shape().with_rank_at_least(2) fixed_batch_size = input_shape[0] flat_inputs = nest.flatten(inputs) for flat_input in flat_inputs: input_shape = flat_input.get_shape().with_rank_at_least(2) batch_size, input_size = input_shape[0], input_shape[1:] fixed_batch_size.merge_with(batch_size) for i, size in enumerate(input_size): if size.value is None: raise ValueError( "Input size (dimension %d of inputs) must be accessible via " "shape inference, but saw value None." % i) else: fixed_batch_size = first_input.get_shape().with_rank_at_least(1)[0] if fixed_batch_size.value: batch_size = fixed_batch_size.value else: batch_size = array_ops.shape(first_input)[0] if initial_state is not None: state = initial_state else: if not dtype: raise ValueError("If no initial_state is provided, " "dtype must be specified") state = cell.zero_state(batch_size, dtype) if sequence_length is not None: sequence_length = ops.convert_to_tensor( sequence_length, name="sequence_length") if sequence_length.get_shape().ndims not in (None, 1): raise ValueError( "sequence_length must be a vector of length batch_size") def _create_zero_output(output_size): size = _concat(batch_size, output_size) output = array_ops.zeros( array_ops.stack(size), _infer_state_dtype(dtype, state)) shape = _concat(fixed_batch_size.value, output_size, static=True) output.set_shape(tensor_shape.TensorShape(shape)) return output output_size = cell.output_size flat_output_size = nest.flatten(output_size) flat_zero_output = tuple( _create_zero_output(size) for size in flat_output_size) zero_output = nest.pack_sequence_as( structure=output_size, flat_sequence=flat_zero_output) sequence_length = math_ops.to_int32(sequence_length) min_sequence_length = math_ops.reduce_min(sequence_length) max_sequence_length = math_ops.reduce_max(sequence_length) for time, input_ in enumerate(inputs): if time > 0: varscope.reuse_variables() call_cell = lambda: cell(input_, state) if sequence_length is not None: (output, state) = _rnn_step( time=time, sequence_length=sequence_length, min_sequence_length=min_sequence_length, max_sequence_length=max_sequence_length, zero_output=zero_output, state=state, call_cell=call_cell, state_size=cell.state_size) else: (output, state) = call_cell() outputs.append(output) return (outputs, state) def static_state_saving_rnn(cell, inputs, state_saver, state_name, sequence_length=None, scope=None): state_size = cell.state_size state_is_tuple = nest.is_sequence(state_size) state_name_tuple = nest.is_sequence(state_name) if state_is_tuple != state_name_tuple: raise ValueError("state_name should be the same type as cell.state_size. " "state_name: %s, cell.state_size: %s" % (str(state_name), str(state_size))) if state_is_tuple: state_name_flat = nest.flatten(state_name) state_size_flat = nest.flatten(state_size) if len(state_name_flat) != len(state_size_flat): raise ValueError("#elems(state_name) != #elems(state_size): %d vs. %d" % (len(state_name_flat), len(state_size_flat))) initial_state = nest.pack_sequence_as( structure=state_size, flat_sequence=[state_saver.state(s) for s in state_name_flat]) else: initial_state = state_saver.state(state_name) (outputs, state) = static_rnn( cell, inputs, initial_state=initial_state, sequence_length=sequence_length, scope=scope) if state_is_tuple: flat_state = nest.flatten(state) state_name = nest.flatten(state_name) save_state = [ state_saver.save_state(name, substate) for name, substate in zip(state_name, flat_state) ] else: save_state = [state_saver.save_state(state_name, state)] with ops.control_dependencies(save_state): last_output = outputs[-1] flat_last_output = nest.flatten(last_output) flat_last_output = [ array_ops.identity(output) for output in flat_last_output ] outputs[-1] = nest.pack_sequence_as( structure=last_output, flat_sequence=flat_last_output) return (outputs, state) def static_bidirectional_rnn(cell_fw, cell_bw, inputs, initial_state_fw=None, initial_state_bw=None, dtype=None, sequence_length=None, scope=None): if not _like_rnncell(cell_fw): raise TypeError("cell_fw must be an instance of RNNCell") if not _like_rnncell(cell_bw): raise TypeError("cell_bw must be an instance of RNNCell") if not nest.is_sequence(inputs): raise TypeError("inputs must be a sequence") if not inputs: raise ValueError("inputs must not be empty") with vs.variable_scope(scope or "bidirectional_rnn"): with vs.variable_scope("fw") as fw_scope: output_fw, output_state_fw = static_rnn( cell_fw, inputs, initial_state_fw, dtype, sequence_length, scope=fw_scope) with vs.variable_scope("bw") as bw_scope: reversed_inputs = _reverse_seq(inputs, sequence_length) tmp, output_state_bw = static_rnn( cell_bw, reversed_inputs, initial_state_bw, dtype, sequence_length, scope=bw_scope) output_bw = _reverse_seq(tmp, sequence_length) flat_output_fw = nest.flatten(output_fw) flat_output_bw = nest.flatten(output_bw) flat_outputs = tuple( array_ops.concat([fw, bw], 1) for fw, bw in zip(flat_output_fw, flat_output_bw)) outputs = nest.pack_sequence_as( structure=output_fw, flat_sequence=flat_outputs) return (outputs, output_state_fw, output_state_bw)
true
true
f70a7c8757ec8f2334ab61df77799b4f77e92dfc
1,711
py
Python
libs/cnn/customlayers.py
franckfotso/kr_cnn_models
242f4a6650004af5849404c8e0e7b3621ba020b6
[ "MIT" ]
1
2017-07-06T03:30:33.000Z
2017-07-06T03:30:33.000Z
libs/cnn/customlayers.py
romyny/kr_cnn_models
242f4a6650004af5849404c8e0e7b3621ba020b6
[ "MIT" ]
null
null
null
libs/cnn/customlayers.py
romyny/kr_cnn_models
242f4a6650004af5849404c8e0e7b3621ba020b6
[ "MIT" ]
null
null
null
# -------------------------------------------------------- # Written by: Romuald FOTSO # Licensed: MIT License # Copyright (c) 2017 # Based on 'dandxy89' github repository: # https://github.com/dandxy89/ImageModels/blob/master/KerasLayers/Custom_layers.py # -------------------------------------------------------- from keras.engine import Layer from keras import backend as K class LRN2D(Layer): def __init__(self, alpha=1e-4, k=2, beta=0.75, n=5, **kwargs): if n % 2 == 0: raise NotImplementedError( "LRN2D only works with odd n. n provided: " + str(n)) super(LRN2D, self).__init__(**kwargs) self.alpha = alpha self.k = k self.beta = beta self.n = n def get_output(self, train): X = self.get_input(train) b, ch, r, c = K.shape(X) half_n = self.n // 2 input_sqr = K.square(X) extra_channels = K.zeros((b, ch + 2 * half_n, r, c)) input_sqr = K.concatenate([extra_channels[:, :half_n, :, :], input_sqr, extra_channels[:, half_n + ch:, :, :]], axis=1) scale = self.k for i in range(self.n): scale += self.alpha * input_sqr[:, i:i + ch, :, :] scale = scale ** self.beta return X / scale def get_config(self): config = {"name": self.__class__.__name__, "alpha": self.alpha, "k": self.k, "beta": self.beta, "n": self.n} base_config = super(LRN2D, self).get_config() return dict(list(base_config.items()) + list(config.items()))
33.54902
82
0.484512
from keras.engine import Layer from keras import backend as K class LRN2D(Layer): def __init__(self, alpha=1e-4, k=2, beta=0.75, n=5, **kwargs): if n % 2 == 0: raise NotImplementedError( "LRN2D only works with odd n. n provided: " + str(n)) super(LRN2D, self).__init__(**kwargs) self.alpha = alpha self.k = k self.beta = beta self.n = n def get_output(self, train): X = self.get_input(train) b, ch, r, c = K.shape(X) half_n = self.n // 2 input_sqr = K.square(X) extra_channels = K.zeros((b, ch + 2 * half_n, r, c)) input_sqr = K.concatenate([extra_channels[:, :half_n, :, :], input_sqr, extra_channels[:, half_n + ch:, :, :]], axis=1) scale = self.k for i in range(self.n): scale += self.alpha * input_sqr[:, i:i + ch, :, :] scale = scale ** self.beta return X / scale def get_config(self): config = {"name": self.__class__.__name__, "alpha": self.alpha, "k": self.k, "beta": self.beta, "n": self.n} base_config = super(LRN2D, self).get_config() return dict(list(base_config.items()) + list(config.items()))
true
true
f70a7c97aa3c694dfc2fdc8eb7fb9de62211e209
119
py
Python
carbon/client/metrics/__init__.py
mosquito/carbonate
5eca69602b9fc03dc0b982f9104c7ebb04159059
[ "MIT" ]
2
2017-12-21T15:40:12.000Z
2018-02-07T10:00:14.000Z
carbon/client/metrics/__init__.py
mosquito/carbonate
5eca69602b9fc03dc0b982f9104c7ebb04159059
[ "MIT" ]
2
2016-12-02T08:53:48.000Z
2016-12-05T21:46:04.000Z
carbon/client/metrics/__init__.py
mosquito/carbonate
5eca69602b9fc03dc0b982f9104c7ebb04159059
[ "MIT" ]
5
2015-07-22T14:31:28.000Z
2020-09-30T08:20:29.000Z
from .timer import Timer from .simple import Counter from .heartbeat import HeartBeat from .collector import Collector
23.8
32
0.831933
from .timer import Timer from .simple import Counter from .heartbeat import HeartBeat from .collector import Collector
true
true
f70a7d0c89eb7ecab3a17df6d81f44d7bf8719a8
928
py
Python
examples/addons/pycsg_sphere_vs_menger_sponge.py
hh-wu/ezdxf
62509ba39b826ee9b36f19c0a5abad7f3518186a
[ "MIT" ]
1
2021-06-05T09:15:15.000Z
2021-06-05T09:15:15.000Z
examples/addons/pycsg_sphere_vs_menger_sponge.py
luoyu-123/ezdxf
40963a2010028f87846241e08434f43ab421f3fb
[ "MIT" ]
null
null
null
examples/addons/pycsg_sphere_vs_menger_sponge.py
luoyu-123/ezdxf
40963a2010028f87846241e08434f43ab421f3fb
[ "MIT" ]
null
null
null
# Copyright (c) 2020, Manfred Moitzi # License: MIT License from pathlib import Path from time import perf_counter import ezdxf from ezdxf.render.forms import sphere from ezdxf.addons import MengerSponge from ezdxf.addons.pycsg import CSG DIR = Path('~/Desktop/Outbox').expanduser() doc = ezdxf.new() doc.layers.new('sponge', dxfattribs={'color': 5}) doc.layers.new('sphere', dxfattribs={'color': 6}) doc.set_modelspace_vport(6, center=(5, 0)) msp = doc.modelspace() sponge1 = MengerSponge(level=3).mesh() sphere1 = sphere(count=32, stacks=16, radius=.5, quads=True).translate(.25, .25, 1) t0 = perf_counter() subtract = (CSG(sponge1, meshid=1) - CSG(sphere1, meshid=2)) t1 = perf_counter() # get mesh result by id subtract.mesh(1).render(msp, dxfattribs={'layer': 'sponge'}) subtract.mesh(2).render(msp, dxfattribs={'layer': 'sphere'}) print(f'runtime: {t1-t0:.3f}s') doc.saveas(DIR / 'csg_sphere_vs_menger_sponge.dxf')
29
83
0.727371
from pathlib import Path from time import perf_counter import ezdxf from ezdxf.render.forms import sphere from ezdxf.addons import MengerSponge from ezdxf.addons.pycsg import CSG DIR = Path('~/Desktop/Outbox').expanduser() doc = ezdxf.new() doc.layers.new('sponge', dxfattribs={'color': 5}) doc.layers.new('sphere', dxfattribs={'color': 6}) doc.set_modelspace_vport(6, center=(5, 0)) msp = doc.modelspace() sponge1 = MengerSponge(level=3).mesh() sphere1 = sphere(count=32, stacks=16, radius=.5, quads=True).translate(.25, .25, 1) t0 = perf_counter() subtract = (CSG(sponge1, meshid=1) - CSG(sphere1, meshid=2)) t1 = perf_counter() subtract.mesh(1).render(msp, dxfattribs={'layer': 'sponge'}) subtract.mesh(2).render(msp, dxfattribs={'layer': 'sphere'}) print(f'runtime: {t1-t0:.3f}s') doc.saveas(DIR / 'csg_sphere_vs_menger_sponge.dxf')
true
true
f70a7dc2646487373bb5e2077dd5a51a79e9d7fb
10,424
py
Python
Code/Model/resnet.py
Jinwon-DK/GaitAnalysis
6b7be4aae9963b8986519af5bcbff39f32ebf2cd
[ "MIT" ]
5
2020-07-23T05:55:54.000Z
2021-07-09T22:15:33.000Z
Code/Model/resnet.py
Jinwon-DK/GaitAnalysis
6b7be4aae9963b8986519af5bcbff39f32ebf2cd
[ "MIT" ]
null
null
null
Code/Model/resnet.py
Jinwon-DK/GaitAnalysis
6b7be4aae9963b8986519af5bcbff39f32ebf2cd
[ "MIT" ]
2
2020-07-23T06:05:54.000Z
2021-04-13T05:55:24.000Z
from __future__ import division import six import keras from keras.models import Model from keras.layers import ( Input, Activation, Dense, Flatten ) from keras.layers import Conv2D, MaxPooling2D, AveragePooling2D from keras.layers import add from keras.layers import BatchNormalization from keras.regularizers import l2 from keras import backend as K import tensorflow as tf def _bn_relu(input): """Helper to build a BN -> relu block """ norm = BatchNormalization(axis=CHANNEL_AXIS)(input) return Activation("relu")(norm) def _conv_bn_relu(**conv_params): """Helper to build a conv -> BN -> relu block """ filters = conv_params["filters"] kernel_size = conv_params["kernel_size"] strides = conv_params.setdefault("strides", (1, 1)) kernel_initializer = conv_params.setdefault("kernel_initializer", "he_normal") padding = conv_params.setdefault("padding", "same") kernel_regularizer = conv_params.setdefault("kernel_regularizer", l2(1.e-4)) def f(input): conv = Conv2D(filters=filters, kernel_size=kernel_size, strides=strides, padding=padding, kernel_initializer=kernel_initializer, kernel_regularizer=kernel_regularizer)(input) return _bn_relu(conv) return f def _bn_relu_conv(**conv_params): """Helper to build a BN -> relu -> conv block. This is an improved scheme proposed in http://arxiv.org/pdf/1603.05027v2.pdf """ filters = conv_params["filters"] kernel_size = conv_params["kernel_size"] strides = conv_params.setdefault("strides", (1, 1)) kernel_initializer = conv_params.setdefault("kernel_initializer", "he_normal") padding = conv_params.setdefault("padding", "same") kernel_regularizer = conv_params.setdefault("kernel_regularizer", l2(1.e-4)) def f(input): activation = _bn_relu(input) return Conv2D(filters=filters, kernel_size=kernel_size, strides=strides, padding=padding, kernel_initializer=kernel_initializer, kernel_regularizer=kernel_regularizer)(activation) return f def _shortcut(input, residual): """Adds a shortcut between input and residual block and merges them with "sum" """ # Expand channels of shortcut to match residual. # Stride appropriately to match residual (width, height) # Should be int if network architecture is correctly configured. input_shape = K.int_shape(input) residual_shape = K.int_shape(residual) stride_width = int(round(input_shape[ROW_AXIS] / residual_shape[ROW_AXIS])) stride_height = int(round(input_shape[COL_AXIS] / residual_shape[COL_AXIS])) equal_channels = input_shape[CHANNEL_AXIS] == residual_shape[CHANNEL_AXIS] shortcut = input # 1 X 1 conv if shape is different. Else identity. if stride_width > 1 or stride_height > 1 or not equal_channels: shortcut = Conv2D(filters=residual_shape[CHANNEL_AXIS], kernel_size=(1, 1), strides=(stride_width, stride_height), padding="valid", kernel_initializer="he_normal", kernel_regularizer=l2(0.0001))(input) return add([shortcut, residual]) def _residual_block(block_function, filters, repetitions, is_first_layer=False): """Builds a residual block with repeating bottleneck blocks. """ def f(input): for i in range(repetitions): init_strides = (1, 1) if i == 0 and not is_first_layer: init_strides = (2, 2) input = block_function(filters=filters, init_strides=init_strides, is_first_block_of_first_layer=(is_first_layer and i == 0))(input) return input return f def basic_block(filters, init_strides=(1, 1), is_first_block_of_first_layer=False): """Basic 3 X 3 convolution blocks for use on resnets with layers <= 34. Follows improved proposed scheme in http://arxiv.org/pdf/1603.05027v2.pdf """ def f(input): if is_first_block_of_first_layer: # don't repeat bn->relu since we just did bn->relu->maxpool conv1 = Conv2D(filters=filters, kernel_size=(3, 3), strides=init_strides, padding="same", kernel_initializer="he_normal", kernel_regularizer=l2(1e-4))(input) else: conv1 = _bn_relu_conv(filters=filters, kernel_size=(3, 3), strides=init_strides)(input) residual = _bn_relu_conv(filters=filters, kernel_size=(3, 3))(conv1) return _shortcut(input, residual) return f def bottleneck(filters, init_strides=(1, 1), is_first_block_of_first_layer=False): """Bottleneck architecture for > 34 layer resnet. Follows improved proposed scheme in http://arxiv.org/pdf/1603.05027v2.pdf Returns: A final conv layer of filters * 4 """ def f(input): if is_first_block_of_first_layer: # don't repeat bn->relu since we just did bn->relu->maxpool conv_1_1 = Conv2D(filters=filters, kernel_size=(1, 1), strides=init_strides, padding="same", kernel_initializer="he_normal", kernel_regularizer=l2(1e-4))(input) else: conv_1_1 = _bn_relu_conv(filters=filters, kernel_size=(1, 1), strides=init_strides)(input) conv_3_3 = _bn_relu_conv(filters=filters, kernel_size=(3, 3))(conv_1_1) residual = _bn_relu_conv(filters=filters * 4, kernel_size=(1, 1))(conv_3_3) return _shortcut(input, residual) return f def _handle_dim_ordering(): global ROW_AXIS global COL_AXIS global CHANNEL_AXIS if K.image_dim_ordering() == 'tf': ROW_AXIS = 1 COL_AXIS = 2 CHANNEL_AXIS = 3 else: CHANNEL_AXIS = 1 ROW_AXIS = 2 COL_AXIS = 3 def _get_block(identifier): if isinstance(identifier, six.string_types): res = globals().get(identifier) if not res: raise ValueError('Invalid {}'.format(identifier)) return res return identifier class ResnetBuilder(object): @staticmethod def build(input_shape, num_outputs, block_fn, repetitions, input): """Builds a custom ResNet like architecture. Args: input_shape: The input shape in the form (nb_channels, nb_rows, nb_cols) num_outputs: The number of outputs at final softmax layer block_fn: The block function to use. This is either `basic_block` or `bottleneck`. The original paper used basic_block for layers < 50 repetitions: Number of repetitions of various block units. At each block unit, the number of filters are doubled and the input size is halved Returns: The keras `Model`. """ _handle_dim_ordering() if len(input_shape) != 3: raise Exception("Input shape should be a tuple (nb_channels, nb_rows, nb_cols)") # Permute dimension order if necessary #if K.image_dim_ordering() == 'tf': # input_shape = (input_shape[1], input_shape[2], input_shape[0])#??? # Load function from str if needed. block_fn = _get_block(block_fn) # input = Input(shape=input_shape) conv1 = _conv_bn_relu(filters=64, kernel_size=(7, 7), strides=(2, 2))(input) pool1 = MaxPooling2D(pool_size=(3, 3), strides=(2, 2), padding="same")(conv1) block = pool1 filters = 64 for i, r in enumerate(repetitions): block = _residual_block(block_fn, filters=filters, repetitions=r, is_first_layer=(i == 0))(block) filters *= 2 # Last activation block = _bn_relu(block) # Classifier block block_shape = K.int_shape(block) pool2 = AveragePooling2D(pool_size=(block_shape[ROW_AXIS], block_shape[COL_AXIS]), strides=(1, 1))(block) flatten1 = Flatten()(pool2) # dense = Dense(units=num_outputs, kernel_initializer="he_normal", # activation="softmax")(flatten1) # model = Model(inputs=input, outputs=flatten1) return flatten1 @staticmethod def build_resnet_18(input_shape, num_outputs, input): return ResnetBuilder.build(input_shape, num_outputs, basic_block, [2, 2, 2, 2], input) @staticmethod def build_resnet_34(input_shape, num_outputs): return ResnetBuilder.build(input_shape, num_outputs, basic_block, [3, 4, 6, 3]) @staticmethod def build_resnet_50(input_shape, num_outputs): return ResnetBuilder.build(input_shape, num_outputs, bottleneck, [3, 4, 6, 3]) @staticmethod def build_resnet_101(input_shape, num_outputs): return ResnetBuilder.build(input_shape, num_outputs, bottleneck, [3, 4, 23, 3]) @staticmethod def build_resnet_152(input_shape, num_outputs): return ResnetBuilder.build(input_shape, num_outputs, bottleneck, [3, 8, 36, 3]) def resnet_builder(shape_list, nb_class): input_layers = list() resnet_layers = list() for input_shape in shape_list: input_layer = keras.layers.Input(shape=input_shape) input_layers.append(input_layer) resnet_layers.append(ResnetBuilder.build_resnet_18(input_shape, nb_class, input_layer)) merged_layer = keras.layers.concatenate(resnet_layers) merged_dense = keras.layers.Dense(units=1000, activation='relu')(merged_layer) merged_batchnorm = keras.layers.BatchNormalization()(merged_dense) merged_dropout = keras.layers.Dropout(0.7)(merged_batchnorm) merged_class_layer = keras.layers.Dense(units=nb_class, activation='softmax')(merged_dropout) model = keras.models.Model(inputs=input_layers, output=merged_class_layer) # model.compile(optimizer=keras.optimizers.Adam(lr=0.0001), # loss=keras.losses.categorical_crossentropy, metrics=['accuracy']) model.compile(optimizer=keras.optimizers.Adam(lr=0.0001), loss='categorical_crossentropy', metrics=['accuracy']) return model
37.905455
109
0.647448
from __future__ import division import six import keras from keras.models import Model from keras.layers import ( Input, Activation, Dense, Flatten ) from keras.layers import Conv2D, MaxPooling2D, AveragePooling2D from keras.layers import add from keras.layers import BatchNormalization from keras.regularizers import l2 from keras import backend as K import tensorflow as tf def _bn_relu(input): norm = BatchNormalization(axis=CHANNEL_AXIS)(input) return Activation("relu")(norm) def _conv_bn_relu(**conv_params): filters = conv_params["filters"] kernel_size = conv_params["kernel_size"] strides = conv_params.setdefault("strides", (1, 1)) kernel_initializer = conv_params.setdefault("kernel_initializer", "he_normal") padding = conv_params.setdefault("padding", "same") kernel_regularizer = conv_params.setdefault("kernel_regularizer", l2(1.e-4)) def f(input): conv = Conv2D(filters=filters, kernel_size=kernel_size, strides=strides, padding=padding, kernel_initializer=kernel_initializer, kernel_regularizer=kernel_regularizer)(input) return _bn_relu(conv) return f def _bn_relu_conv(**conv_params): filters = conv_params["filters"] kernel_size = conv_params["kernel_size"] strides = conv_params.setdefault("strides", (1, 1)) kernel_initializer = conv_params.setdefault("kernel_initializer", "he_normal") padding = conv_params.setdefault("padding", "same") kernel_regularizer = conv_params.setdefault("kernel_regularizer", l2(1.e-4)) def f(input): activation = _bn_relu(input) return Conv2D(filters=filters, kernel_size=kernel_size, strides=strides, padding=padding, kernel_initializer=kernel_initializer, kernel_regularizer=kernel_regularizer)(activation) return f def _shortcut(input, residual): input_shape = K.int_shape(input) residual_shape = K.int_shape(residual) stride_width = int(round(input_shape[ROW_AXIS] / residual_shape[ROW_AXIS])) stride_height = int(round(input_shape[COL_AXIS] / residual_shape[COL_AXIS])) equal_channels = input_shape[CHANNEL_AXIS] == residual_shape[CHANNEL_AXIS] shortcut = input if stride_width > 1 or stride_height > 1 or not equal_channels: shortcut = Conv2D(filters=residual_shape[CHANNEL_AXIS], kernel_size=(1, 1), strides=(stride_width, stride_height), padding="valid", kernel_initializer="he_normal", kernel_regularizer=l2(0.0001))(input) return add([shortcut, residual]) def _residual_block(block_function, filters, repetitions, is_first_layer=False): def f(input): for i in range(repetitions): init_strides = (1, 1) if i == 0 and not is_first_layer: init_strides = (2, 2) input = block_function(filters=filters, init_strides=init_strides, is_first_block_of_first_layer=(is_first_layer and i == 0))(input) return input return f def basic_block(filters, init_strides=(1, 1), is_first_block_of_first_layer=False): def f(input): if is_first_block_of_first_layer: conv1 = Conv2D(filters=filters, kernel_size=(3, 3), strides=init_strides, padding="same", kernel_initializer="he_normal", kernel_regularizer=l2(1e-4))(input) else: conv1 = _bn_relu_conv(filters=filters, kernel_size=(3, 3), strides=init_strides)(input) residual = _bn_relu_conv(filters=filters, kernel_size=(3, 3))(conv1) return _shortcut(input, residual) return f def bottleneck(filters, init_strides=(1, 1), is_first_block_of_first_layer=False): def f(input): if is_first_block_of_first_layer: # don't repeat bn->relu since we just did bn->relu->maxpool conv_1_1 = Conv2D(filters=filters, kernel_size=(1, 1), strides=init_strides, padding="same", kernel_initializer="he_normal", kernel_regularizer=l2(1e-4))(input) else: conv_1_1 = _bn_relu_conv(filters=filters, kernel_size=(1, 1), strides=init_strides)(input) conv_3_3 = _bn_relu_conv(filters=filters, kernel_size=(3, 3))(conv_1_1) residual = _bn_relu_conv(filters=filters * 4, kernel_size=(1, 1))(conv_3_3) return _shortcut(input, residual) return f def _handle_dim_ordering(): global ROW_AXIS global COL_AXIS global CHANNEL_AXIS if K.image_dim_ordering() == 'tf': ROW_AXIS = 1 COL_AXIS = 2 CHANNEL_AXIS = 3 else: CHANNEL_AXIS = 1 ROW_AXIS = 2 COL_AXIS = 3 def _get_block(identifier): if isinstance(identifier, six.string_types): res = globals().get(identifier) if not res: raise ValueError('Invalid {}'.format(identifier)) return res return identifier class ResnetBuilder(object): @staticmethod def build(input_shape, num_outputs, block_fn, repetitions, input): _handle_dim_ordering() if len(input_shape) != 3: raise Exception("Input shape should be a tuple (nb_channels, nb_rows, nb_cols)") block_fn = _get_block(block_fn) conv1 = _conv_bn_relu(filters=64, kernel_size=(7, 7), strides=(2, 2))(input) pool1 = MaxPooling2D(pool_size=(3, 3), strides=(2, 2), padding="same")(conv1) block = pool1 filters = 64 for i, r in enumerate(repetitions): block = _residual_block(block_fn, filters=filters, repetitions=r, is_first_layer=(i == 0))(block) filters *= 2 block = _bn_relu(block) block_shape = K.int_shape(block) pool2 = AveragePooling2D(pool_size=(block_shape[ROW_AXIS], block_shape[COL_AXIS]), strides=(1, 1))(block) flatten1 = Flatten()(pool2) return flatten1 @staticmethod def build_resnet_18(input_shape, num_outputs, input): return ResnetBuilder.build(input_shape, num_outputs, basic_block, [2, 2, 2, 2], input) @staticmethod def build_resnet_34(input_shape, num_outputs): return ResnetBuilder.build(input_shape, num_outputs, basic_block, [3, 4, 6, 3]) @staticmethod def build_resnet_50(input_shape, num_outputs): return ResnetBuilder.build(input_shape, num_outputs, bottleneck, [3, 4, 6, 3]) @staticmethod def build_resnet_101(input_shape, num_outputs): return ResnetBuilder.build(input_shape, num_outputs, bottleneck, [3, 4, 23, 3]) @staticmethod def build_resnet_152(input_shape, num_outputs): return ResnetBuilder.build(input_shape, num_outputs, bottleneck, [3, 8, 36, 3]) def resnet_builder(shape_list, nb_class): input_layers = list() resnet_layers = list() for input_shape in shape_list: input_layer = keras.layers.Input(shape=input_shape) input_layers.append(input_layer) resnet_layers.append(ResnetBuilder.build_resnet_18(input_shape, nb_class, input_layer)) merged_layer = keras.layers.concatenate(resnet_layers) merged_dense = keras.layers.Dense(units=1000, activation='relu')(merged_layer) merged_batchnorm = keras.layers.BatchNormalization()(merged_dense) merged_dropout = keras.layers.Dropout(0.7)(merged_batchnorm) merged_class_layer = keras.layers.Dense(units=nb_class, activation='softmax')(merged_dropout) model = keras.models.Model(inputs=input_layers, output=merged_class_layer) model.compile(optimizer=keras.optimizers.Adam(lr=0.0001), loss='categorical_crossentropy', metrics=['accuracy']) return model
true
true
f70a7e2116a93a54134b28967766017ed21b90c0
633
py
Python
Back-End/Python/Basics/Part -4- OOP/07 - Metaprogramming/04_metaclass.py
ASHISHKUMAR2411/Programming-CookBook
9c60655d64d21985ccb4196360858d98344701f9
[ "MIT" ]
25
2021-04-28T02:51:26.000Z
2022-03-24T13:58:04.000Z
Back-End/Python/Basics/Part -4- OOP/07 - Metaprogramming/04_metaclass.py
ASHISHKUMAR2411/Programming-CookBook
9c60655d64d21985ccb4196360858d98344701f9
[ "MIT" ]
1
2022-03-03T23:33:41.000Z
2022-03-03T23:35:41.000Z
Back-End/Python/Basics/Part -4- OOP/07 - Metaprogramming/04_metaclass.py
ASHISHKUMAR2411/Programming-CookBook
9c60655d64d21985ccb4196360858d98344701f9
[ "MIT" ]
15
2021-05-30T01:35:20.000Z
2022-03-25T12:38:25.000Z
import math class CustomType(type): def __new__(mcls, name, bases, class_dict): print(f'Using custom metaclass {mcls} to create class {name}...') cls_obj = super().__new__(mcls, name, bases, class_dict) cls_obj.circ = lambda self: 2 * math.pi * self.r return cls_obj class Circle(metaclass=CustomType): def __init__(self, x, y, r): self.x = x self.y = y self.r = r def area(self): return math.pi * self.r ** 2 # Using custom metaclass <class '__main__.CustomType'> to create class Circle... c = Circle(0, 0, 1) print(c.area()) print(c.circ())
26.375
81
0.606635
import math class CustomType(type): def __new__(mcls, name, bases, class_dict): print(f'Using custom metaclass {mcls} to create class {name}...') cls_obj = super().__new__(mcls, name, bases, class_dict) cls_obj.circ = lambda self: 2 * math.pi * self.r return cls_obj class Circle(metaclass=CustomType): def __init__(self, x, y, r): self.x = x self.y = y self.r = r def area(self): return math.pi * self.r ** 2 c = Circle(0, 0, 1) print(c.area()) print(c.circ())
true
true
f70a7f477db698ca69684e5e9325cf10a6ff9cb3
1,801
py
Python
main.py
ankurankan/game_of_life
81cf2f7f70a05019e78206d1ee7a8205aa590186
[ "MIT" ]
null
null
null
main.py
ankurankan/game_of_life
81cf2f7f70a05019e78206d1ee7a8205aa590186
[ "MIT" ]
null
null
null
main.py
ankurankan/game_of_life
81cf2f7f70a05019e78206d1ee7a8205aa590186
[ "MIT" ]
null
null
null
from time import sleep import numpy as np import matplotlib.pyplot as plt def get_initial_state(size): return np.random.choice([0, 1], size) def compute_next_state(state): new_state = np.zeros(state.shape, dtype=int) for i in range(state.shape[0]): for j in range(state.shape[1]): low_x, high_x = max(0, i-1), min(i+2, state.shape[0]) low_y, high_y = max(0, j-1), min(j+2, state.shape[1]) n_live = np.sum(state[low_x: high_x, low_y: high_y]) - state[i, j] if (state[i, j] == 1) and (n_live < 2): new_state[i, j] = 0 elif (state[i, j] == 1) and (2 <= n_live <= 3): new_state[i, j] = 1 elif (state[i, j] == 1) and (n_live > 3): new_state[i, j] = 0 elif (state[i, j] == 0) and (n_live == 3): new_state[i, j] = 1 else: new_state[i, j] = state[i, j] return new_state def start(initial_state=None, loop_delay=1, size=(200, 200)): if initial_state is None: state = get_initial_state(size) else: state = initial_state size = state.shape age = np.zeros(size, dtype=int) counter = 0 while True: new_state = compute_next_state(state) age += new_state age = age * new_state counter += 1 plt.imshow(age, cmap='Greys') plt.xlim(right=size[1], left=0) plt.ylim(top=0, bottom=size[0]) plt.pause(loop_delay) if (np.sum(new_state) == 0) or (new_state == state).all(): print(counter) state = get_initial_state(size) age = np.zeros(size, dtype=int) counter = 0 else: state = new_state if __name__ == "__main__": start()
28.587302
78
0.533592
from time import sleep import numpy as np import matplotlib.pyplot as plt def get_initial_state(size): return np.random.choice([0, 1], size) def compute_next_state(state): new_state = np.zeros(state.shape, dtype=int) for i in range(state.shape[0]): for j in range(state.shape[1]): low_x, high_x = max(0, i-1), min(i+2, state.shape[0]) low_y, high_y = max(0, j-1), min(j+2, state.shape[1]) n_live = np.sum(state[low_x: high_x, low_y: high_y]) - state[i, j] if (state[i, j] == 1) and (n_live < 2): new_state[i, j] = 0 elif (state[i, j] == 1) and (2 <= n_live <= 3): new_state[i, j] = 1 elif (state[i, j] == 1) and (n_live > 3): new_state[i, j] = 0 elif (state[i, j] == 0) and (n_live == 3): new_state[i, j] = 1 else: new_state[i, j] = state[i, j] return new_state def start(initial_state=None, loop_delay=1, size=(200, 200)): if initial_state is None: state = get_initial_state(size) else: state = initial_state size = state.shape age = np.zeros(size, dtype=int) counter = 0 while True: new_state = compute_next_state(state) age += new_state age = age * new_state counter += 1 plt.imshow(age, cmap='Greys') plt.xlim(right=size[1], left=0) plt.ylim(top=0, bottom=size[0]) plt.pause(loop_delay) if (np.sum(new_state) == 0) or (new_state == state).all(): print(counter) state = get_initial_state(size) age = np.zeros(size, dtype=int) counter = 0 else: state = new_state if __name__ == "__main__": start()
true
true
f70a7f830ddc667a9fa64921ab6b3d031ed80d41
42,759
py
Python
tests/auth_tests/test_forms.py
markvdb/django
b08a18f17ba53eb0bc7fd7993924f3d7f8ed5c52
[ "PSF-2.0", "BSD-3-Clause" ]
1
2019-03-04T12:45:49.000Z
2019-03-04T12:45:49.000Z
tests/auth_tests/test_forms.py
Kiku-git/django
b08a18f17ba53eb0bc7fd7993924f3d7f8ed5c52
[ "PSF-2.0", "BSD-3-Clause" ]
1
2019-06-24T07:34:43.000Z
2019-06-24T07:34:43.000Z
tests/auth_tests/test_forms.py
Kiku-git/django
b08a18f17ba53eb0bc7fd7993924f3d7f8ed5c52
[ "PSF-2.0", "BSD-3-Clause" ]
null
null
null
import datetime import re from unittest import mock from django import forms from django.contrib.auth.forms import ( AdminPasswordChangeForm, AuthenticationForm, PasswordChangeForm, PasswordResetForm, ReadOnlyPasswordHashField, ReadOnlyPasswordHashWidget, SetPasswordForm, UserChangeForm, UserCreationForm, ) from django.contrib.auth.models import User from django.contrib.auth.signals import user_login_failed from django.contrib.sites.models import Site from django.core import mail from django.core.mail import EmailMultiAlternatives from django.forms.fields import CharField, Field, IntegerField from django.test import SimpleTestCase, TestCase, override_settings from django.utils import translation from django.utils.text import capfirst from django.utils.translation import gettext as _ from .models.custom_user import ( CustomUser, CustomUserWithoutIsActiveField, ExtensionUser, ) from .models.with_custom_email_field import CustomEmailField from .models.with_integer_username import IntegerUsernameUser from .settings import AUTH_TEMPLATES class TestDataMixin: @classmethod def setUpTestData(cls): cls.u1 = User.objects.create_user(username='testclient', password='password', email='testclient@example.com') cls.u2 = User.objects.create_user(username='inactive', password='password', is_active=False) cls.u3 = User.objects.create_user(username='staff', password='password') cls.u4 = User.objects.create(username='empty_password', password='') cls.u5 = User.objects.create(username='unmanageable_password', password='$') cls.u6 = User.objects.create(username='unknown_password', password='foo$bar') class UserCreationFormTest(TestDataMixin, TestCase): def test_user_already_exists(self): data = { 'username': 'testclient', 'password1': 'test123', 'password2': 'test123', } form = UserCreationForm(data) self.assertFalse(form.is_valid()) self.assertEqual(form["username"].errors, [str(User._meta.get_field('username').error_messages['unique'])]) def test_invalid_data(self): data = { 'username': 'jsmith!', 'password1': 'test123', 'password2': 'test123', } form = UserCreationForm(data) self.assertFalse(form.is_valid()) validator = next(v for v in User._meta.get_field('username').validators if v.code == 'invalid') self.assertEqual(form["username"].errors, [str(validator.message)]) def test_password_verification(self): # The verification password is incorrect. data = { 'username': 'jsmith', 'password1': 'test123', 'password2': 'test', } form = UserCreationForm(data) self.assertFalse(form.is_valid()) self.assertEqual(form["password2"].errors, [str(form.error_messages['password_mismatch'])]) def test_both_passwords(self): # One (or both) passwords weren't given data = {'username': 'jsmith'} form = UserCreationForm(data) required_error = [str(Field.default_error_messages['required'])] self.assertFalse(form.is_valid()) self.assertEqual(form['password1'].errors, required_error) self.assertEqual(form['password2'].errors, required_error) data['password2'] = 'test123' form = UserCreationForm(data) self.assertFalse(form.is_valid()) self.assertEqual(form['password1'].errors, required_error) self.assertEqual(form['password2'].errors, []) @mock.patch('django.contrib.auth.password_validation.password_changed') def test_success(self, password_changed): # The success case. data = { 'username': 'jsmith@example.com', 'password1': 'test123', 'password2': 'test123', } form = UserCreationForm(data) self.assertTrue(form.is_valid()) form.save(commit=False) self.assertEqual(password_changed.call_count, 0) u = form.save() self.assertEqual(password_changed.call_count, 1) self.assertEqual(repr(u), '<User: jsmith@example.com>') def test_unicode_username(self): data = { 'username': '宝', 'password1': 'test123', 'password2': 'test123', } form = UserCreationForm(data) self.assertTrue(form.is_valid()) u = form.save() self.assertEqual(u.username, '宝') def test_normalize_username(self): # The normalization happens in AbstractBaseUser.clean() and ModelForm # validation calls Model.clean(). ohm_username = 'testΩ' # U+2126 OHM SIGN data = { 'username': ohm_username, 'password1': 'pwd2', 'password2': 'pwd2', } form = UserCreationForm(data) self.assertTrue(form.is_valid()) user = form.save() self.assertNotEqual(user.username, ohm_username) self.assertEqual(user.username, 'testΩ') # U+03A9 GREEK CAPITAL LETTER OMEGA def test_duplicate_normalized_unicode(self): """ To prevent almost identical usernames, visually identical but differing by their unicode code points only, Unicode NFKC normalization should make appear them equal to Django. """ omega_username = 'iamtheΩ' # U+03A9 GREEK CAPITAL LETTER OMEGA ohm_username = 'iamtheΩ' # U+2126 OHM SIGN self.assertNotEqual(omega_username, ohm_username) User.objects.create_user(username=omega_username, password='pwd') data = { 'username': ohm_username, 'password1': 'pwd2', 'password2': 'pwd2', } form = UserCreationForm(data) self.assertFalse(form.is_valid()) self.assertEqual( form.errors['username'], ["A user with that username already exists."] ) @override_settings(AUTH_PASSWORD_VALIDATORS=[ {'NAME': 'django.contrib.auth.password_validation.UserAttributeSimilarityValidator'}, {'NAME': 'django.contrib.auth.password_validation.MinimumLengthValidator', 'OPTIONS': { 'min_length': 12, }}, ]) def test_validates_password(self): data = { 'username': 'testclient', 'password1': 'testclient', 'password2': 'testclient', } form = UserCreationForm(data) self.assertFalse(form.is_valid()) self.assertEqual(len(form['password2'].errors), 2) self.assertIn('The password is too similar to the username.', form['password2'].errors) self.assertIn( 'This password is too short. It must contain at least 12 characters.', form['password2'].errors ) def test_custom_form(self): class CustomUserCreationForm(UserCreationForm): class Meta(UserCreationForm.Meta): model = ExtensionUser fields = UserCreationForm.Meta.fields + ('date_of_birth',) data = { 'username': 'testclient', 'password1': 'testclient', 'password2': 'testclient', 'date_of_birth': '1988-02-24', } form = CustomUserCreationForm(data) self.assertTrue(form.is_valid()) def test_custom_form_with_different_username_field(self): class CustomUserCreationForm(UserCreationForm): class Meta(UserCreationForm.Meta): model = CustomUser fields = ('email', 'date_of_birth') data = { 'email': 'test@client222.com', 'password1': 'testclient', 'password2': 'testclient', 'date_of_birth': '1988-02-24', } form = CustomUserCreationForm(data) self.assertTrue(form.is_valid()) def test_custom_form_hidden_username_field(self): class CustomUserCreationForm(UserCreationForm): class Meta(UserCreationForm.Meta): model = CustomUserWithoutIsActiveField fields = ('email',) # without USERNAME_FIELD data = { 'email': 'testclient@example.com', 'password1': 'testclient', 'password2': 'testclient', } form = CustomUserCreationForm(data) self.assertTrue(form.is_valid()) def test_password_whitespace_not_stripped(self): data = { 'username': 'testuser', 'password1': ' testpassword ', 'password2': ' testpassword ', } form = UserCreationForm(data) self.assertTrue(form.is_valid()) self.assertEqual(form.cleaned_data['password1'], data['password1']) self.assertEqual(form.cleaned_data['password2'], data['password2']) @override_settings(AUTH_PASSWORD_VALIDATORS=[ {'NAME': 'django.contrib.auth.password_validation.UserAttributeSimilarityValidator'}, ]) def test_password_help_text(self): form = UserCreationForm() self.assertEqual( form.fields['password1'].help_text, '<ul><li>Your password can&#x27;t be too similar to your other personal information.</li></ul>' ) @override_settings(AUTH_PASSWORD_VALIDATORS=[ {'NAME': 'django.contrib.auth.password_validation.UserAttributeSimilarityValidator'}, ]) def test_user_create_form_validates_password_with_all_data(self): """UserCreationForm password validation uses all of the form's data.""" class CustomUserCreationForm(UserCreationForm): class Meta(UserCreationForm.Meta): model = User fields = ('username', 'email', 'first_name', 'last_name') form = CustomUserCreationForm({ 'username': 'testuser', 'password1': 'testpassword', 'password2': 'testpassword', 'first_name': 'testpassword', 'last_name': 'lastname', }) self.assertFalse(form.is_valid()) self.assertEqual( form.errors['password2'], ['The password is too similar to the first name.'], ) def test_username_field_autocapitalize_none(self): form = UserCreationForm() self.assertEqual(form.fields['username'].widget.attrs.get('autocapitalize'), 'none') def test_html_autocomplete_attributes(self): form = UserCreationForm() tests = ( ('username', 'username'), ('password1', 'new-password'), ('password2', 'new-password'), ) for field_name, autocomplete in tests: with self.subTest(field_name=field_name, autocomplete=autocomplete): self.assertEqual(form.fields[field_name].widget.attrs['autocomplete'], autocomplete) # To verify that the login form rejects inactive users, use an authentication # backend that allows them. @override_settings(AUTHENTICATION_BACKENDS=['django.contrib.auth.backends.AllowAllUsersModelBackend']) class AuthenticationFormTest(TestDataMixin, TestCase): def test_invalid_username(self): # The user submits an invalid username. data = { 'username': 'jsmith_does_not_exist', 'password': 'test123', } form = AuthenticationForm(None, data) self.assertFalse(form.is_valid()) self.assertEqual( form.non_field_errors(), [ form.error_messages['invalid_login'] % { 'username': User._meta.get_field('username').verbose_name } ] ) def test_inactive_user(self): # The user is inactive. data = { 'username': 'inactive', 'password': 'password', } form = AuthenticationForm(None, data) self.assertFalse(form.is_valid()) self.assertEqual(form.non_field_errors(), [str(form.error_messages['inactive'])]) # Use an authentication backend that rejects inactive users. @override_settings(AUTHENTICATION_BACKENDS=['django.contrib.auth.backends.ModelBackend']) def test_inactive_user_incorrect_password(self): """An invalid login doesn't leak the inactive status of a user.""" data = { 'username': 'inactive', 'password': 'incorrect', } form = AuthenticationForm(None, data) self.assertFalse(form.is_valid()) self.assertEqual( form.non_field_errors(), [ form.error_messages['invalid_login'] % { 'username': User._meta.get_field('username').verbose_name } ] ) def test_login_failed(self): signal_calls = [] def signal_handler(**kwargs): signal_calls.append(kwargs) user_login_failed.connect(signal_handler) fake_request = object() try: form = AuthenticationForm(fake_request, { 'username': 'testclient', 'password': 'incorrect', }) self.assertFalse(form.is_valid()) self.assertIs(signal_calls[0]['request'], fake_request) finally: user_login_failed.disconnect(signal_handler) def test_inactive_user_i18n(self): with self.settings(USE_I18N=True), translation.override('pt-br', deactivate=True): # The user is inactive. data = { 'username': 'inactive', 'password': 'password', } form = AuthenticationForm(None, data) self.assertFalse(form.is_valid()) self.assertEqual(form.non_field_errors(), [str(form.error_messages['inactive'])]) # Use an authentication backend that allows inactive users. @override_settings(AUTHENTICATION_BACKENDS=['django.contrib.auth.backends.AllowAllUsersModelBackend']) def test_custom_login_allowed_policy(self): # The user is inactive, but our custom form policy allows them to log in. data = { 'username': 'inactive', 'password': 'password', } class AuthenticationFormWithInactiveUsersOkay(AuthenticationForm): def confirm_login_allowed(self, user): pass form = AuthenticationFormWithInactiveUsersOkay(None, data) self.assertTrue(form.is_valid()) # If we want to disallow some logins according to custom logic, # we should raise a django.forms.ValidationError in the form. class PickyAuthenticationForm(AuthenticationForm): def confirm_login_allowed(self, user): if user.username == "inactive": raise forms.ValidationError("This user is disallowed.") raise forms.ValidationError("Sorry, nobody's allowed in.") form = PickyAuthenticationForm(None, data) self.assertFalse(form.is_valid()) self.assertEqual(form.non_field_errors(), ['This user is disallowed.']) data = { 'username': 'testclient', 'password': 'password', } form = PickyAuthenticationForm(None, data) self.assertFalse(form.is_valid()) self.assertEqual(form.non_field_errors(), ["Sorry, nobody's allowed in."]) def test_success(self): # The success case data = { 'username': 'testclient', 'password': 'password', } form = AuthenticationForm(None, data) self.assertTrue(form.is_valid()) self.assertEqual(form.non_field_errors(), []) def test_unicode_username(self): User.objects.create_user(username='Σαρα', password='pwd') data = { 'username': 'Σαρα', 'password': 'pwd', } form = AuthenticationForm(None, data) self.assertTrue(form.is_valid()) self.assertEqual(form.non_field_errors(), []) @override_settings(AUTH_USER_MODEL='auth_tests.CustomEmailField') def test_username_field_max_length_matches_user_model(self): self.assertEqual(CustomEmailField._meta.get_field('username').max_length, 255) data = { 'username': 'u' * 255, 'password': 'pwd', 'email': 'test@example.com', } CustomEmailField.objects.create_user(**data) form = AuthenticationForm(None, data) self.assertEqual(form.fields['username'].max_length, 255) self.assertEqual(form.errors, {}) @override_settings(AUTH_USER_MODEL='auth_tests.IntegerUsernameUser') def test_username_field_max_length_defaults_to_254(self): self.assertIsNone(IntegerUsernameUser._meta.get_field('username').max_length) data = { 'username': '0123456', 'password': 'password', } IntegerUsernameUser.objects.create_user(**data) form = AuthenticationForm(None, data) self.assertEqual(form.fields['username'].max_length, 254) self.assertEqual(form.errors, {}) def test_username_field_label(self): class CustomAuthenticationForm(AuthenticationForm): username = CharField(label="Name", max_length=75) form = CustomAuthenticationForm() self.assertEqual(form['username'].label, "Name") def test_username_field_label_not_set(self): class CustomAuthenticationForm(AuthenticationForm): username = CharField() form = CustomAuthenticationForm() username_field = User._meta.get_field(User.USERNAME_FIELD) self.assertEqual(form.fields['username'].label, capfirst(username_field.verbose_name)) def test_username_field_autocapitalize_none(self): form = AuthenticationForm() self.assertEqual(form.fields['username'].widget.attrs.get('autocapitalize'), 'none') def test_username_field_label_empty_string(self): class CustomAuthenticationForm(AuthenticationForm): username = CharField(label='') form = CustomAuthenticationForm() self.assertEqual(form.fields['username'].label, "") def test_password_whitespace_not_stripped(self): data = { 'username': 'testuser', 'password': ' pass ', } form = AuthenticationForm(None, data) form.is_valid() # Not necessary to have valid credentails for the test. self.assertEqual(form.cleaned_data['password'], data['password']) @override_settings(AUTH_USER_MODEL='auth_tests.IntegerUsernameUser') def test_integer_username(self): class CustomAuthenticationForm(AuthenticationForm): username = IntegerField() user = IntegerUsernameUser.objects.create_user(username=0, password='pwd') data = { 'username': 0, 'password': 'pwd', } form = CustomAuthenticationForm(None, data) self.assertTrue(form.is_valid()) self.assertEqual(form.cleaned_data['username'], data['username']) self.assertEqual(form.cleaned_data['password'], data['password']) self.assertEqual(form.errors, {}) self.assertEqual(form.user_cache, user) def test_get_invalid_login_error(self): error = AuthenticationForm().get_invalid_login_error() self.assertIsInstance(error, forms.ValidationError) self.assertEqual( error.message, 'Please enter a correct %(username)s and password. Note that both ' 'fields may be case-sensitive.', ) self.assertEqual(error.code, 'invalid_login') self.assertEqual(error.params, {'username': 'username'}) def test_html_autocomplete_attributes(self): form = AuthenticationForm() tests = ( ('username', 'username'), ('password', 'current-password'), ) for field_name, autocomplete in tests: with self.subTest(field_name=field_name, autocomplete=autocomplete): self.assertEqual(form.fields[field_name].widget.attrs['autocomplete'], autocomplete) class SetPasswordFormTest(TestDataMixin, TestCase): def test_password_verification(self): # The two new passwords do not match. user = User.objects.get(username='testclient') data = { 'new_password1': 'abc123', 'new_password2': 'abc', } form = SetPasswordForm(user, data) self.assertFalse(form.is_valid()) self.assertEqual( form["new_password2"].errors, [str(form.error_messages['password_mismatch'])] ) @mock.patch('django.contrib.auth.password_validation.password_changed') def test_success(self, password_changed): user = User.objects.get(username='testclient') data = { 'new_password1': 'abc123', 'new_password2': 'abc123', } form = SetPasswordForm(user, data) self.assertTrue(form.is_valid()) form.save(commit=False) self.assertEqual(password_changed.call_count, 0) form.save() self.assertEqual(password_changed.call_count, 1) @override_settings(AUTH_PASSWORD_VALIDATORS=[ {'NAME': 'django.contrib.auth.password_validation.UserAttributeSimilarityValidator'}, {'NAME': 'django.contrib.auth.password_validation.MinimumLengthValidator', 'OPTIONS': { 'min_length': 12, }}, ]) def test_validates_password(self): user = User.objects.get(username='testclient') data = { 'new_password1': 'testclient', 'new_password2': 'testclient', } form = SetPasswordForm(user, data) self.assertFalse(form.is_valid()) self.assertEqual(len(form["new_password2"].errors), 2) self.assertIn('The password is too similar to the username.', form["new_password2"].errors) self.assertIn( 'This password is too short. It must contain at least 12 characters.', form["new_password2"].errors ) def test_password_whitespace_not_stripped(self): user = User.objects.get(username='testclient') data = { 'new_password1': ' password ', 'new_password2': ' password ', } form = SetPasswordForm(user, data) self.assertTrue(form.is_valid()) self.assertEqual(form.cleaned_data['new_password1'], data['new_password1']) self.assertEqual(form.cleaned_data['new_password2'], data['new_password2']) @override_settings(AUTH_PASSWORD_VALIDATORS=[ {'NAME': 'django.contrib.auth.password_validation.UserAttributeSimilarityValidator'}, {'NAME': 'django.contrib.auth.password_validation.MinimumLengthValidator', 'OPTIONS': { 'min_length': 12, }}, ]) def test_help_text_translation(self): french_help_texts = [ 'Votre mot de passe ne peut pas trop ressembler à vos autres informations personnelles.', 'Votre mot de passe doit contenir au minimum 12 caractères.', ] form = SetPasswordForm(self.u1) with translation.override('fr'): html = form.as_p() for french_text in french_help_texts: self.assertIn(french_text, html) def test_html_autocomplete_attributes(self): form = SetPasswordForm(self.u1) tests = ( ('new_password1', 'new-password'), ('new_password2', 'new-password'), ) for field_name, autocomplete in tests: with self.subTest(field_name=field_name, autocomplete=autocomplete): self.assertEqual(form.fields[field_name].widget.attrs['autocomplete'], autocomplete) class PasswordChangeFormTest(TestDataMixin, TestCase): def test_incorrect_password(self): user = User.objects.get(username='testclient') data = { 'old_password': 'test', 'new_password1': 'abc123', 'new_password2': 'abc123', } form = PasswordChangeForm(user, data) self.assertFalse(form.is_valid()) self.assertEqual(form["old_password"].errors, [str(form.error_messages['password_incorrect'])]) def test_password_verification(self): # The two new passwords do not match. user = User.objects.get(username='testclient') data = { 'old_password': 'password', 'new_password1': 'abc123', 'new_password2': 'abc', } form = PasswordChangeForm(user, data) self.assertFalse(form.is_valid()) self.assertEqual(form["new_password2"].errors, [str(form.error_messages['password_mismatch'])]) @mock.patch('django.contrib.auth.password_validation.password_changed') def test_success(self, password_changed): # The success case. user = User.objects.get(username='testclient') data = { 'old_password': 'password', 'new_password1': 'abc123', 'new_password2': 'abc123', } form = PasswordChangeForm(user, data) self.assertTrue(form.is_valid()) form.save(commit=False) self.assertEqual(password_changed.call_count, 0) form.save() self.assertEqual(password_changed.call_count, 1) def test_field_order(self): # Regression test - check the order of fields: user = User.objects.get(username='testclient') self.assertEqual(list(PasswordChangeForm(user, {}).fields), ['old_password', 'new_password1', 'new_password2']) def test_password_whitespace_not_stripped(self): user = User.objects.get(username='testclient') user.set_password(' oldpassword ') data = { 'old_password': ' oldpassword ', 'new_password1': ' pass ', 'new_password2': ' pass ', } form = PasswordChangeForm(user, data) self.assertTrue(form.is_valid()) self.assertEqual(form.cleaned_data['old_password'], data['old_password']) self.assertEqual(form.cleaned_data['new_password1'], data['new_password1']) self.assertEqual(form.cleaned_data['new_password2'], data['new_password2']) def test_html_autocomplete_attributes(self): user = User.objects.get(username='testclient') form = PasswordChangeForm(user) self.assertEqual(form.fields['old_password'].widget.attrs['autocomplete'], 'current-password') class UserChangeFormTest(TestDataMixin, TestCase): def test_username_validity(self): user = User.objects.get(username='testclient') data = {'username': 'not valid'} form = UserChangeForm(data, instance=user) self.assertFalse(form.is_valid()) validator = next(v for v in User._meta.get_field('username').validators if v.code == 'invalid') self.assertEqual(form["username"].errors, [str(validator.message)]) def test_bug_14242(self): # A regression test, introduce by adding an optimization for the # UserChangeForm. class MyUserForm(UserChangeForm): def __init__(self, *args, **kwargs): super().__init__(*args, **kwargs) self.fields['groups'].help_text = 'These groups give users different permissions' class Meta(UserChangeForm.Meta): fields = ('groups',) # Just check we can create it MyUserForm({}) def test_unusable_password(self): user = User.objects.get(username='empty_password') user.set_unusable_password() user.save() form = UserChangeForm(instance=user) self.assertIn(_("No password set."), form.as_table()) def test_bug_17944_empty_password(self): user = User.objects.get(username='empty_password') form = UserChangeForm(instance=user) self.assertIn(_("No password set."), form.as_table()) def test_bug_17944_unmanageable_password(self): user = User.objects.get(username='unmanageable_password') form = UserChangeForm(instance=user) self.assertIn(_("Invalid password format or unknown hashing algorithm."), form.as_table()) def test_bug_17944_unknown_password_algorithm(self): user = User.objects.get(username='unknown_password') form = UserChangeForm(instance=user) self.assertIn(_("Invalid password format or unknown hashing algorithm."), form.as_table()) def test_bug_19133(self): "The change form does not return the password value" # Use the form to construct the POST data user = User.objects.get(username='testclient') form_for_data = UserChangeForm(instance=user) post_data = form_for_data.initial # The password field should be readonly, so anything # posted here should be ignored; the form will be # valid, and give back the 'initial' value for the # password field. post_data['password'] = 'new password' form = UserChangeForm(instance=user, data=post_data) self.assertTrue(form.is_valid()) # original hashed password contains $ self.assertIn('$', form.cleaned_data['password']) def test_bug_19349_bound_password_field(self): user = User.objects.get(username='testclient') form = UserChangeForm(data={}, instance=user) # When rendering the bound password field, # ReadOnlyPasswordHashWidget needs the initial # value to render correctly self.assertEqual(form.initial['password'], form['password'].value()) def test_custom_form(self): class CustomUserChangeForm(UserChangeForm): class Meta(UserChangeForm.Meta): model = ExtensionUser fields = ('username', 'password', 'date_of_birth',) user = User.objects.get(username='testclient') data = { 'username': 'testclient', 'password': 'testclient', 'date_of_birth': '1998-02-24', } form = CustomUserChangeForm(data, instance=user) self.assertTrue(form.is_valid()) form.save() self.assertEqual(form.cleaned_data['username'], 'testclient') self.assertEqual(form.cleaned_data['date_of_birth'], datetime.date(1998, 2, 24)) def test_password_excluded(self): class UserChangeFormWithoutPassword(UserChangeForm): password = None class Meta: model = User exclude = ['password'] form = UserChangeFormWithoutPassword() self.assertNotIn('password', form.fields) def test_username_field_autocapitalize_none(self): form = UserChangeForm() self.assertEqual(form.fields['username'].widget.attrs.get('autocapitalize'), 'none') @override_settings(TEMPLATES=AUTH_TEMPLATES) class PasswordResetFormTest(TestDataMixin, TestCase): @classmethod def setUpClass(cls): super().setUpClass() # This cleanup is necessary because contrib.sites cache # makes tests interfere with each other, see #11505 Site.objects.clear_cache() def create_dummy_user(self): """ Create a user and return a tuple (user_object, username, email). """ username = 'jsmith' email = 'jsmith@example.com' user = User.objects.create_user(username, email, 'test123') return (user, username, email) def test_invalid_email(self): data = {'email': 'not valid'} form = PasswordResetForm(data) self.assertFalse(form.is_valid()) self.assertEqual(form['email'].errors, [_('Enter a valid email address.')]) def test_nonexistent_email(self): """ Test nonexistent email address. This should not fail because it would expose information about registered users. """ data = {'email': 'foo@bar.com'} form = PasswordResetForm(data) self.assertTrue(form.is_valid()) self.assertEqual(len(mail.outbox), 0) def test_cleaned_data(self): (user, username, email) = self.create_dummy_user() data = {'email': email} form = PasswordResetForm(data) self.assertTrue(form.is_valid()) form.save(domain_override='example.com') self.assertEqual(form.cleaned_data['email'], email) self.assertEqual(len(mail.outbox), 1) def test_custom_email_subject(self): data = {'email': 'testclient@example.com'} form = PasswordResetForm(data) self.assertTrue(form.is_valid()) # Since we're not providing a request object, we must provide a # domain_override to prevent the save operation from failing in the # potential case where contrib.sites is not installed. Refs #16412. form.save(domain_override='example.com') self.assertEqual(len(mail.outbox), 1) self.assertEqual(mail.outbox[0].subject, 'Custom password reset on example.com') def test_custom_email_constructor(self): data = {'email': 'testclient@example.com'} class CustomEmailPasswordResetForm(PasswordResetForm): def send_mail(self, subject_template_name, email_template_name, context, from_email, to_email, html_email_template_name=None): EmailMultiAlternatives( "Forgot your password?", "Sorry to hear you forgot your password.", None, [to_email], ['site_monitor@example.com'], headers={'Reply-To': 'webmaster@example.com'}, alternatives=[ ("Really sorry to hear you forgot your password.", "text/html") ], ).send() form = CustomEmailPasswordResetForm(data) self.assertTrue(form.is_valid()) # Since we're not providing a request object, we must provide a # domain_override to prevent the save operation from failing in the # potential case where contrib.sites is not installed. Refs #16412. form.save(domain_override='example.com') self.assertEqual(len(mail.outbox), 1) self.assertEqual(mail.outbox[0].subject, 'Forgot your password?') self.assertEqual(mail.outbox[0].bcc, ['site_monitor@example.com']) self.assertEqual(mail.outbox[0].content_subtype, "plain") def test_preserve_username_case(self): """ Preserve the case of the user name (before the @ in the email address) when creating a user (#5605). """ user = User.objects.create_user('forms_test2', 'tesT@EXAMple.com', 'test') self.assertEqual(user.email, 'tesT@example.com') user = User.objects.create_user('forms_test3', 'tesT', 'test') self.assertEqual(user.email, 'tesT') def test_inactive_user(self): """ Inactive user cannot receive password reset email. """ (user, username, email) = self.create_dummy_user() user.is_active = False user.save() form = PasswordResetForm({'email': email}) self.assertTrue(form.is_valid()) form.save() self.assertEqual(len(mail.outbox), 0) def test_unusable_password(self): user = User.objects.create_user('testuser', 'test@example.com', 'test') data = {"email": "test@example.com"} form = PasswordResetForm(data) self.assertTrue(form.is_valid()) user.set_unusable_password() user.save() form = PasswordResetForm(data) # The form itself is valid, but no email is sent self.assertTrue(form.is_valid()) form.save() self.assertEqual(len(mail.outbox), 0) def test_save_plaintext_email(self): """ Test the PasswordResetForm.save() method with no html_email_template_name parameter passed in. Test to ensure original behavior is unchanged after the parameter was added. """ (user, username, email) = self.create_dummy_user() form = PasswordResetForm({"email": email}) self.assertTrue(form.is_valid()) form.save() self.assertEqual(len(mail.outbox), 1) message = mail.outbox[0].message() self.assertFalse(message.is_multipart()) self.assertEqual(message.get_content_type(), 'text/plain') self.assertEqual(message.get('subject'), 'Custom password reset on example.com') self.assertEqual(len(mail.outbox[0].alternatives), 0) self.assertEqual(message.get_all('to'), [email]) self.assertTrue(re.match(r'^http://example.com/reset/[\w+/-]', message.get_payload())) def test_save_html_email_template_name(self): """ Test the PasswordResetForm.save() method with html_email_template_name parameter specified. Test to ensure that a multipart email is sent with both text/plain and text/html parts. """ (user, username, email) = self.create_dummy_user() form = PasswordResetForm({"email": email}) self.assertTrue(form.is_valid()) form.save(html_email_template_name='registration/html_password_reset_email.html') self.assertEqual(len(mail.outbox), 1) self.assertEqual(len(mail.outbox[0].alternatives), 1) message = mail.outbox[0].message() self.assertEqual(message.get('subject'), 'Custom password reset on example.com') self.assertEqual(len(message.get_payload()), 2) self.assertTrue(message.is_multipart()) self.assertEqual(message.get_payload(0).get_content_type(), 'text/plain') self.assertEqual(message.get_payload(1).get_content_type(), 'text/html') self.assertEqual(message.get_all('to'), [email]) self.assertTrue(re.match(r'^http://example.com/reset/[\w/-]+', message.get_payload(0).get_payload())) self.assertTrue(re.match( r'^<html><a href="http://example.com/reset/[\w/-]+/">Link</a></html>$', message.get_payload(1).get_payload() )) @override_settings(AUTH_USER_MODEL='auth_tests.CustomEmailField') def test_custom_email_field(self): email = 'test@mail.com' CustomEmailField.objects.create_user('test name', 'test password', email) form = PasswordResetForm({'email': email}) self.assertTrue(form.is_valid()) form.save() self.assertEqual(form.cleaned_data['email'], email) self.assertEqual(len(mail.outbox), 1) self.assertEqual(mail.outbox[0].to, [email]) def test_html_autocomplete_attributes(self): form = PasswordResetForm() self.assertEqual(form.fields['email'].widget.attrs['autocomplete'], 'email') class ReadOnlyPasswordHashTest(SimpleTestCase): def test_bug_19349_render_with_none_value(self): # Rendering the widget with value set to None # mustn't raise an exception. widget = ReadOnlyPasswordHashWidget() html = widget.render(name='password', value=None, attrs={}) self.assertIn(_("No password set."), html) @override_settings(PASSWORD_HASHERS=['django.contrib.auth.hashers.PBKDF2PasswordHasher']) def test_render(self): widget = ReadOnlyPasswordHashWidget() value = 'pbkdf2_sha256$100000$a6Pucb1qSFcD$WmCkn9Hqidj48NVe5x0FEM6A9YiOqQcl/83m2Z5udm0=' self.assertHTMLEqual( widget.render('name', value, {'id': 'id_password'}), """ <div id="id_password"> <strong>algorithm</strong>: pbkdf2_sha256 <strong>iterations</strong>: 100000 <strong>salt</strong>: a6Pucb****** <strong>hash</strong>: WmCkn9************************************** </div> """ ) def test_readonly_field_has_changed(self): field = ReadOnlyPasswordHashField() self.assertFalse(field.has_changed('aaa', 'bbb')) class AdminPasswordChangeFormTest(TestDataMixin, TestCase): @mock.patch('django.contrib.auth.password_validation.password_changed') def test_success(self, password_changed): user = User.objects.get(username='testclient') data = { 'password1': 'test123', 'password2': 'test123', } form = AdminPasswordChangeForm(user, data) self.assertTrue(form.is_valid()) form.save(commit=False) self.assertEqual(password_changed.call_count, 0) form.save() self.assertEqual(password_changed.call_count, 1) def test_password_whitespace_not_stripped(self): user = User.objects.get(username='testclient') data = { 'password1': ' pass ', 'password2': ' pass ', } form = AdminPasswordChangeForm(user, data) self.assertTrue(form.is_valid()) self.assertEqual(form.cleaned_data['password1'], data['password1']) self.assertEqual(form.cleaned_data['password2'], data['password2']) def test_non_matching_passwords(self): user = User.objects.get(username='testclient') data = {'password1': 'password1', 'password2': 'password2'} form = AdminPasswordChangeForm(user, data) self.assertEqual(form.errors['password2'], [form.error_messages['password_mismatch']]) def test_missing_passwords(self): user = User.objects.get(username='testclient') data = {'password1': '', 'password2': ''} form = AdminPasswordChangeForm(user, data) required_error = [Field.default_error_messages['required']] self.assertEqual(form.errors['password1'], required_error) self.assertEqual(form.errors['password2'], required_error) def test_one_password(self): user = User.objects.get(username='testclient') form1 = AdminPasswordChangeForm(user, {'password1': '', 'password2': 'test'}) required_error = [Field.default_error_messages['required']] self.assertEqual(form1.errors['password1'], required_error) self.assertNotIn('password2', form1.errors) form2 = AdminPasswordChangeForm(user, {'password1': 'test', 'password2': ''}) self.assertEqual(form2.errors['password2'], required_error) self.assertNotIn('password1', form2.errors) def test_html_autocomplete_attributes(self): user = User.objects.get(username='testclient') form = AdminPasswordChangeForm(user) tests = ( ('password1', 'new-password'), ('password2', 'new-password'), ) for field_name, autocomplete in tests: with self.subTest(field_name=field_name, autocomplete=autocomplete): self.assertEqual(form.fields[field_name].widget.attrs['autocomplete'], autocomplete)
40.68411
119
0.634556
import datetime import re from unittest import mock from django import forms from django.contrib.auth.forms import ( AdminPasswordChangeForm, AuthenticationForm, PasswordChangeForm, PasswordResetForm, ReadOnlyPasswordHashField, ReadOnlyPasswordHashWidget, SetPasswordForm, UserChangeForm, UserCreationForm, ) from django.contrib.auth.models import User from django.contrib.auth.signals import user_login_failed from django.contrib.sites.models import Site from django.core import mail from django.core.mail import EmailMultiAlternatives from django.forms.fields import CharField, Field, IntegerField from django.test import SimpleTestCase, TestCase, override_settings from django.utils import translation from django.utils.text import capfirst from django.utils.translation import gettext as _ from .models.custom_user import ( CustomUser, CustomUserWithoutIsActiveField, ExtensionUser, ) from .models.with_custom_email_field import CustomEmailField from .models.with_integer_username import IntegerUsernameUser from .settings import AUTH_TEMPLATES class TestDataMixin: @classmethod def setUpTestData(cls): cls.u1 = User.objects.create_user(username='testclient', password='password', email='testclient@example.com') cls.u2 = User.objects.create_user(username='inactive', password='password', is_active=False) cls.u3 = User.objects.create_user(username='staff', password='password') cls.u4 = User.objects.create(username='empty_password', password='') cls.u5 = User.objects.create(username='unmanageable_password', password='$') cls.u6 = User.objects.create(username='unknown_password', password='foo$bar') class UserCreationFormTest(TestDataMixin, TestCase): def test_user_already_exists(self): data = { 'username': 'testclient', 'password1': 'test123', 'password2': 'test123', } form = UserCreationForm(data) self.assertFalse(form.is_valid()) self.assertEqual(form["username"].errors, [str(User._meta.get_field('username').error_messages['unique'])]) def test_invalid_data(self): data = { 'username': 'jsmith!', 'password1': 'test123', 'password2': 'test123', } form = UserCreationForm(data) self.assertFalse(form.is_valid()) validator = next(v for v in User._meta.get_field('username').validators if v.code == 'invalid') self.assertEqual(form["username"].errors, [str(validator.message)]) def test_password_verification(self): data = { 'username': 'jsmith', 'password1': 'test123', 'password2': 'test', } form = UserCreationForm(data) self.assertFalse(form.is_valid()) self.assertEqual(form["password2"].errors, [str(form.error_messages['password_mismatch'])]) def test_both_passwords(self): data = {'username': 'jsmith'} form = UserCreationForm(data) required_error = [str(Field.default_error_messages['required'])] self.assertFalse(form.is_valid()) self.assertEqual(form['password1'].errors, required_error) self.assertEqual(form['password2'].errors, required_error) data['password2'] = 'test123' form = UserCreationForm(data) self.assertFalse(form.is_valid()) self.assertEqual(form['password1'].errors, required_error) self.assertEqual(form['password2'].errors, []) @mock.patch('django.contrib.auth.password_validation.password_changed') def test_success(self, password_changed): # The success case. data = { 'username': 'jsmith@example.com', 'password1': 'test123', 'password2': 'test123', } form = UserCreationForm(data) self.assertTrue(form.is_valid()) form.save(commit=False) self.assertEqual(password_changed.call_count, 0) u = form.save() self.assertEqual(password_changed.call_count, 1) self.assertEqual(repr(u), '<User: jsmith@example.com>') def test_unicode_username(self): data = { 'username': '宝', 'password1': 'test123', 'password2': 'test123', } form = UserCreationForm(data) self.assertTrue(form.is_valid()) u = form.save() self.assertEqual(u.username, '宝') def test_normalize_username(self): # The normalization happens in AbstractBaseUser.clean() and ModelForm # validation calls Model.clean(). ohm_username = 'testΩ' # U+2126 OHM SIGN data = { 'username': ohm_username, 'password1': 'pwd2', 'password2': 'pwd2', } form = UserCreationForm(data) self.assertTrue(form.is_valid()) user = form.save() self.assertNotEqual(user.username, ohm_username) self.assertEqual(user.username, 'testΩ') # U+03A9 GREEK CAPITAL LETTER OMEGA def test_duplicate_normalized_unicode(self): omega_username = 'iamtheΩ' # U+03A9 GREEK CAPITAL LETTER OMEGA ohm_username = 'iamtheΩ' # U+2126 OHM SIGN self.assertNotEqual(omega_username, ohm_username) User.objects.create_user(username=omega_username, password='pwd') data = { 'username': ohm_username, 'password1': 'pwd2', 'password2': 'pwd2', } form = UserCreationForm(data) self.assertFalse(form.is_valid()) self.assertEqual( form.errors['username'], ["A user with that username already exists."] ) @override_settings(AUTH_PASSWORD_VALIDATORS=[ {'NAME': 'django.contrib.auth.password_validation.UserAttributeSimilarityValidator'}, {'NAME': 'django.contrib.auth.password_validation.MinimumLengthValidator', 'OPTIONS': { 'min_length': 12, }}, ]) def test_validates_password(self): data = { 'username': 'testclient', 'password1': 'testclient', 'password2': 'testclient', } form = UserCreationForm(data) self.assertFalse(form.is_valid()) self.assertEqual(len(form['password2'].errors), 2) self.assertIn('The password is too similar to the username.', form['password2'].errors) self.assertIn( 'This password is too short. It must contain at least 12 characters.', form['password2'].errors ) def test_custom_form(self): class CustomUserCreationForm(UserCreationForm): class Meta(UserCreationForm.Meta): model = ExtensionUser fields = UserCreationForm.Meta.fields + ('date_of_birth',) data = { 'username': 'testclient', 'password1': 'testclient', 'password2': 'testclient', 'date_of_birth': '1988-02-24', } form = CustomUserCreationForm(data) self.assertTrue(form.is_valid()) def test_custom_form_with_different_username_field(self): class CustomUserCreationForm(UserCreationForm): class Meta(UserCreationForm.Meta): model = CustomUser fields = ('email', 'date_of_birth') data = { 'email': 'test@client222.com', 'password1': 'testclient', 'password2': 'testclient', 'date_of_birth': '1988-02-24', } form = CustomUserCreationForm(data) self.assertTrue(form.is_valid()) def test_custom_form_hidden_username_field(self): class CustomUserCreationForm(UserCreationForm): class Meta(UserCreationForm.Meta): model = CustomUserWithoutIsActiveField fields = ('email',) # without USERNAME_FIELD data = { 'email': 'testclient@example.com', 'password1': 'testclient', 'password2': 'testclient', } form = CustomUserCreationForm(data) self.assertTrue(form.is_valid()) def test_password_whitespace_not_stripped(self): data = { 'username': 'testuser', 'password1': ' testpassword ', 'password2': ' testpassword ', } form = UserCreationForm(data) self.assertTrue(form.is_valid()) self.assertEqual(form.cleaned_data['password1'], data['password1']) self.assertEqual(form.cleaned_data['password2'], data['password2']) @override_settings(AUTH_PASSWORD_VALIDATORS=[ {'NAME': 'django.contrib.auth.password_validation.UserAttributeSimilarityValidator'}, ]) def test_password_help_text(self): form = UserCreationForm() self.assertEqual( form.fields['password1'].help_text, '<ul><li>Your password can& ) @override_settings(AUTH_PASSWORD_VALIDATORS=[ {'NAME': 'django.contrib.auth.password_validation.UserAttributeSimilarityValidator'}, ]) def test_user_create_form_validates_password_with_all_data(self): class CustomUserCreationForm(UserCreationForm): class Meta(UserCreationForm.Meta): model = User fields = ('username', 'email', 'first_name', 'last_name') form = CustomUserCreationForm({ 'username': 'testuser', 'password1': 'testpassword', 'password2': 'testpassword', 'first_name': 'testpassword', 'last_name': 'lastname', }) self.assertFalse(form.is_valid()) self.assertEqual( form.errors['password2'], ['The password is too similar to the first name.'], ) def test_username_field_autocapitalize_none(self): form = UserCreationForm() self.assertEqual(form.fields['username'].widget.attrs.get('autocapitalize'), 'none') def test_html_autocomplete_attributes(self): form = UserCreationForm() tests = ( ('username', 'username'), ('password1', 'new-password'), ('password2', 'new-password'), ) for field_name, autocomplete in tests: with self.subTest(field_name=field_name, autocomplete=autocomplete): self.assertEqual(form.fields[field_name].widget.attrs['autocomplete'], autocomplete) # To verify that the login form rejects inactive users, use an authentication # backend that allows them. @override_settings(AUTHENTICATION_BACKENDS=['django.contrib.auth.backends.AllowAllUsersModelBackend']) class AuthenticationFormTest(TestDataMixin, TestCase): def test_invalid_username(self): # The user submits an invalid username. data = { 'username': 'jsmith_does_not_exist', 'password': 'test123', } form = AuthenticationForm(None, data) self.assertFalse(form.is_valid()) self.assertEqual( form.non_field_errors(), [ form.error_messages['invalid_login'] % { 'username': User._meta.get_field('username').verbose_name } ] ) def test_inactive_user(self): # The user is inactive. data = { 'username': 'inactive', 'password': 'password', } form = AuthenticationForm(None, data) self.assertFalse(form.is_valid()) self.assertEqual(form.non_field_errors(), [str(form.error_messages['inactive'])]) # Use an authentication backend that rejects inactive users. @override_settings(AUTHENTICATION_BACKENDS=['django.contrib.auth.backends.ModelBackend']) def test_inactive_user_incorrect_password(self): data = { 'username': 'inactive', 'password': 'incorrect', } form = AuthenticationForm(None, data) self.assertFalse(form.is_valid()) self.assertEqual( form.non_field_errors(), [ form.error_messages['invalid_login'] % { 'username': User._meta.get_field('username').verbose_name } ] ) def test_login_failed(self): signal_calls = [] def signal_handler(**kwargs): signal_calls.append(kwargs) user_login_failed.connect(signal_handler) fake_request = object() try: form = AuthenticationForm(fake_request, { 'username': 'testclient', 'password': 'incorrect', }) self.assertFalse(form.is_valid()) self.assertIs(signal_calls[0]['request'], fake_request) finally: user_login_failed.disconnect(signal_handler) def test_inactive_user_i18n(self): with self.settings(USE_I18N=True), translation.override('pt-br', deactivate=True): # The user is inactive. data = { 'username': 'inactive', 'password': 'password', } form = AuthenticationForm(None, data) self.assertFalse(form.is_valid()) self.assertEqual(form.non_field_errors(), [str(form.error_messages['inactive'])]) # Use an authentication backend that allows inactive users. @override_settings(AUTHENTICATION_BACKENDS=['django.contrib.auth.backends.AllowAllUsersModelBackend']) def test_custom_login_allowed_policy(self): # The user is inactive, but our custom form policy allows them to log in. data = { 'username': 'inactive', 'password': 'password', } class AuthenticationFormWithInactiveUsersOkay(AuthenticationForm): def confirm_login_allowed(self, user): pass form = AuthenticationFormWithInactiveUsersOkay(None, data) self.assertTrue(form.is_valid()) # If we want to disallow some logins according to custom logic, # we should raise a django.forms.ValidationError in the form. class PickyAuthenticationForm(AuthenticationForm): def confirm_login_allowed(self, user): if user.username == "inactive": raise forms.ValidationError("This user is disallowed.") raise forms.ValidationError("Sorry, nobody's allowed in.") form = PickyAuthenticationForm(None, data) self.assertFalse(form.is_valid()) self.assertEqual(form.non_field_errors(), ['This user is disallowed.']) data = { 'username': 'testclient', 'password': 'password', } form = PickyAuthenticationForm(None, data) self.assertFalse(form.is_valid()) self.assertEqual(form.non_field_errors(), ["Sorry, nobody's allowed in."]) def test_success(self): # The success case data = { 'username': 'testclient', 'password': 'password', } form = AuthenticationForm(None, data) self.assertTrue(form.is_valid()) self.assertEqual(form.non_field_errors(), []) def test_unicode_username(self): User.objects.create_user(username='Σαρα', password='pwd') data = { 'username': 'Σαρα', 'password': 'pwd', } form = AuthenticationForm(None, data) self.assertTrue(form.is_valid()) self.assertEqual(form.non_field_errors(), []) @override_settings(AUTH_USER_MODEL='auth_tests.CustomEmailField') def test_username_field_max_length_matches_user_model(self): self.assertEqual(CustomEmailField._meta.get_field('username').max_length, 255) data = { 'username': 'u' * 255, 'password': 'pwd', 'email': 'test@example.com', } CustomEmailField.objects.create_user(**data) form = AuthenticationForm(None, data) self.assertEqual(form.fields['username'].max_length, 255) self.assertEqual(form.errors, {}) @override_settings(AUTH_USER_MODEL='auth_tests.IntegerUsernameUser') def test_username_field_max_length_defaults_to_254(self): self.assertIsNone(IntegerUsernameUser._meta.get_field('username').max_length) data = { 'username': '0123456', 'password': 'password', } IntegerUsernameUser.objects.create_user(**data) form = AuthenticationForm(None, data) self.assertEqual(form.fields['username'].max_length, 254) self.assertEqual(form.errors, {}) def test_username_field_label(self): class CustomAuthenticationForm(AuthenticationForm): username = CharField(label="Name", max_length=75) form = CustomAuthenticationForm() self.assertEqual(form['username'].label, "Name") def test_username_field_label_not_set(self): class CustomAuthenticationForm(AuthenticationForm): username = CharField() form = CustomAuthenticationForm() username_field = User._meta.get_field(User.USERNAME_FIELD) self.assertEqual(form.fields['username'].label, capfirst(username_field.verbose_name)) def test_username_field_autocapitalize_none(self): form = AuthenticationForm() self.assertEqual(form.fields['username'].widget.attrs.get('autocapitalize'), 'none') def test_username_field_label_empty_string(self): class CustomAuthenticationForm(AuthenticationForm): username = CharField(label='') form = CustomAuthenticationForm() self.assertEqual(form.fields['username'].label, "") def test_password_whitespace_not_stripped(self): data = { 'username': 'testuser', 'password': ' pass ', } form = AuthenticationForm(None, data) form.is_valid() # Not necessary to have valid credentails for the test. self.assertEqual(form.cleaned_data['password'], data['password']) @override_settings(AUTH_USER_MODEL='auth_tests.IntegerUsernameUser') def test_integer_username(self): class CustomAuthenticationForm(AuthenticationForm): username = IntegerField() user = IntegerUsernameUser.objects.create_user(username=0, password='pwd') data = { 'username': 0, 'password': 'pwd', } form = CustomAuthenticationForm(None, data) self.assertTrue(form.is_valid()) self.assertEqual(form.cleaned_data['username'], data['username']) self.assertEqual(form.cleaned_data['password'], data['password']) self.assertEqual(form.errors, {}) self.assertEqual(form.user_cache, user) def test_get_invalid_login_error(self): error = AuthenticationForm().get_invalid_login_error() self.assertIsInstance(error, forms.ValidationError) self.assertEqual( error.message, 'Please enter a correct %(username)s and password. Note that both ' 'fields may be case-sensitive.', ) self.assertEqual(error.code, 'invalid_login') self.assertEqual(error.params, {'username': 'username'}) def test_html_autocomplete_attributes(self): form = AuthenticationForm() tests = ( ('username', 'username'), ('password', 'current-password'), ) for field_name, autocomplete in tests: with self.subTest(field_name=field_name, autocomplete=autocomplete): self.assertEqual(form.fields[field_name].widget.attrs['autocomplete'], autocomplete) class SetPasswordFormTest(TestDataMixin, TestCase): def test_password_verification(self): # The two new passwords do not match. user = User.objects.get(username='testclient') data = { 'new_password1': 'abc123', 'new_password2': 'abc', } form = SetPasswordForm(user, data) self.assertFalse(form.is_valid()) self.assertEqual( form["new_password2"].errors, [str(form.error_messages['password_mismatch'])] ) @mock.patch('django.contrib.auth.password_validation.password_changed') def test_success(self, password_changed): user = User.objects.get(username='testclient') data = { 'new_password1': 'abc123', 'new_password2': 'abc123', } form = SetPasswordForm(user, data) self.assertTrue(form.is_valid()) form.save(commit=False) self.assertEqual(password_changed.call_count, 0) form.save() self.assertEqual(password_changed.call_count, 1) @override_settings(AUTH_PASSWORD_VALIDATORS=[ {'NAME': 'django.contrib.auth.password_validation.UserAttributeSimilarityValidator'}, {'NAME': 'django.contrib.auth.password_validation.MinimumLengthValidator', 'OPTIONS': { 'min_length': 12, }}, ]) def test_validates_password(self): user = User.objects.get(username='testclient') data = { 'new_password1': 'testclient', 'new_password2': 'testclient', } form = SetPasswordForm(user, data) self.assertFalse(form.is_valid()) self.assertEqual(len(form["new_password2"].errors), 2) self.assertIn('The password is too similar to the username.', form["new_password2"].errors) self.assertIn( 'This password is too short. It must contain at least 12 characters.', form["new_password2"].errors ) def test_password_whitespace_not_stripped(self): user = User.objects.get(username='testclient') data = { 'new_password1': ' password ', 'new_password2': ' password ', } form = SetPasswordForm(user, data) self.assertTrue(form.is_valid()) self.assertEqual(form.cleaned_data['new_password1'], data['new_password1']) self.assertEqual(form.cleaned_data['new_password2'], data['new_password2']) @override_settings(AUTH_PASSWORD_VALIDATORS=[ {'NAME': 'django.contrib.auth.password_validation.UserAttributeSimilarityValidator'}, {'NAME': 'django.contrib.auth.password_validation.MinimumLengthValidator', 'OPTIONS': { 'min_length': 12, }}, ]) def test_help_text_translation(self): french_help_texts = [ 'Votre mot de passe ne peut pas trop ressembler à vos autres informations personnelles.', 'Votre mot de passe doit contenir au minimum 12 caractères.', ] form = SetPasswordForm(self.u1) with translation.override('fr'): html = form.as_p() for french_text in french_help_texts: self.assertIn(french_text, html) def test_html_autocomplete_attributes(self): form = SetPasswordForm(self.u1) tests = ( ('new_password1', 'new-password'), ('new_password2', 'new-password'), ) for field_name, autocomplete in tests: with self.subTest(field_name=field_name, autocomplete=autocomplete): self.assertEqual(form.fields[field_name].widget.attrs['autocomplete'], autocomplete) class PasswordChangeFormTest(TestDataMixin, TestCase): def test_incorrect_password(self): user = User.objects.get(username='testclient') data = { 'old_password': 'test', 'new_password1': 'abc123', 'new_password2': 'abc123', } form = PasswordChangeForm(user, data) self.assertFalse(form.is_valid()) self.assertEqual(form["old_password"].errors, [str(form.error_messages['password_incorrect'])]) def test_password_verification(self): # The two new passwords do not match. user = User.objects.get(username='testclient') data = { 'old_password': 'password', 'new_password1': 'abc123', 'new_password2': 'abc', } form = PasswordChangeForm(user, data) self.assertFalse(form.is_valid()) self.assertEqual(form["new_password2"].errors, [str(form.error_messages['password_mismatch'])]) @mock.patch('django.contrib.auth.password_validation.password_changed') def test_success(self, password_changed): # The success case. user = User.objects.get(username='testclient') data = { 'old_password': 'password', 'new_password1': 'abc123', 'new_password2': 'abc123', } form = PasswordChangeForm(user, data) self.assertTrue(form.is_valid()) form.save(commit=False) self.assertEqual(password_changed.call_count, 0) form.save() self.assertEqual(password_changed.call_count, 1) def test_field_order(self): # Regression test - check the order of fields: user = User.objects.get(username='testclient') self.assertEqual(list(PasswordChangeForm(user, {}).fields), ['old_password', 'new_password1', 'new_password2']) def test_password_whitespace_not_stripped(self): user = User.objects.get(username='testclient') user.set_password(' oldpassword ') data = { 'old_password': ' oldpassword ', 'new_password1': ' pass ', 'new_password2': ' pass ', } form = PasswordChangeForm(user, data) self.assertTrue(form.is_valid()) self.assertEqual(form.cleaned_data['old_password'], data['old_password']) self.assertEqual(form.cleaned_data['new_password1'], data['new_password1']) self.assertEqual(form.cleaned_data['new_password2'], data['new_password2']) def test_html_autocomplete_attributes(self): user = User.objects.get(username='testclient') form = PasswordChangeForm(user) self.assertEqual(form.fields['old_password'].widget.attrs['autocomplete'], 'current-password') class UserChangeFormTest(TestDataMixin, TestCase): def test_username_validity(self): user = User.objects.get(username='testclient') data = {'username': 'not valid'} form = UserChangeForm(data, instance=user) self.assertFalse(form.is_valid()) validator = next(v for v in User._meta.get_field('username').validators if v.code == 'invalid') self.assertEqual(form["username"].errors, [str(validator.message)]) def test_bug_14242(self): # A regression test, introduce by adding an optimization for the # UserChangeForm. class MyUserForm(UserChangeForm): def __init__(self, *args, **kwargs): super().__init__(*args, **kwargs) self.fields['groups'].help_text = 'These groups give users different permissions' class Meta(UserChangeForm.Meta): fields = ('groups',) # Just check we can create it MyUserForm({}) def test_unusable_password(self): user = User.objects.get(username='empty_password') user.set_unusable_password() user.save() form = UserChangeForm(instance=user) self.assertIn(_("No password set."), form.as_table()) def test_bug_17944_empty_password(self): user = User.objects.get(username='empty_password') form = UserChangeForm(instance=user) self.assertIn(_("No password set."), form.as_table()) def test_bug_17944_unmanageable_password(self): user = User.objects.get(username='unmanageable_password') form = UserChangeForm(instance=user) self.assertIn(_("Invalid password format or unknown hashing algorithm."), form.as_table()) def test_bug_17944_unknown_password_algorithm(self): user = User.objects.get(username='unknown_password') form = UserChangeForm(instance=user) self.assertIn(_("Invalid password format or unknown hashing algorithm."), form.as_table()) def test_bug_19133(self): # Use the form to construct the POST data user = User.objects.get(username='testclient') form_for_data = UserChangeForm(instance=user) post_data = form_for_data.initial # The password field should be readonly, so anything # posted here should be ignored; the form will be # valid, and give back the 'initial' value for the # password field. post_data['password'] = 'new password' form = UserChangeForm(instance=user, data=post_data) self.assertTrue(form.is_valid()) # original hashed password contains $ self.assertIn('$', form.cleaned_data['password']) def test_bug_19349_bound_password_field(self): user = User.objects.get(username='testclient') form = UserChangeForm(data={}, instance=user) # When rendering the bound password field, # ReadOnlyPasswordHashWidget needs the initial # value to render correctly self.assertEqual(form.initial['password'], form['password'].value()) def test_custom_form(self): class CustomUserChangeForm(UserChangeForm): class Meta(UserChangeForm.Meta): model = ExtensionUser fields = ('username', 'password', 'date_of_birth',) user = User.objects.get(username='testclient') data = { 'username': 'testclient', 'password': 'testclient', 'date_of_birth': '1998-02-24', } form = CustomUserChangeForm(data, instance=user) self.assertTrue(form.is_valid()) form.save() self.assertEqual(form.cleaned_data['username'], 'testclient') self.assertEqual(form.cleaned_data['date_of_birth'], datetime.date(1998, 2, 24)) def test_password_excluded(self): class UserChangeFormWithoutPassword(UserChangeForm): password = None class Meta: model = User exclude = ['password'] form = UserChangeFormWithoutPassword() self.assertNotIn('password', form.fields) def test_username_field_autocapitalize_none(self): form = UserChangeForm() self.assertEqual(form.fields['username'].widget.attrs.get('autocapitalize'), 'none') @override_settings(TEMPLATES=AUTH_TEMPLATES) class PasswordResetFormTest(TestDataMixin, TestCase): @classmethod def setUpClass(cls): super().setUpClass() # This cleanup is necessary because contrib.sites cache # makes tests interfere with each other, see #11505 Site.objects.clear_cache() def create_dummy_user(self): username = 'jsmith' email = 'jsmith@example.com' user = User.objects.create_user(username, email, 'test123') return (user, username, email) def test_invalid_email(self): data = {'email': 'not valid'} form = PasswordResetForm(data) self.assertFalse(form.is_valid()) self.assertEqual(form['email'].errors, [_('Enter a valid email address.')]) def test_nonexistent_email(self): data = {'email': 'foo@bar.com'} form = PasswordResetForm(data) self.assertTrue(form.is_valid()) self.assertEqual(len(mail.outbox), 0) def test_cleaned_data(self): (user, username, email) = self.create_dummy_user() data = {'email': email} form = PasswordResetForm(data) self.assertTrue(form.is_valid()) form.save(domain_override='example.com') self.assertEqual(form.cleaned_data['email'], email) self.assertEqual(len(mail.outbox), 1) def test_custom_email_subject(self): data = {'email': 'testclient@example.com'} form = PasswordResetForm(data) self.assertTrue(form.is_valid()) # Since we're not providing a request object, we must provide a form.save(domain_override='example.com') self.assertEqual(len(mail.outbox), 1) self.assertEqual(mail.outbox[0].subject, 'Custom password reset on example.com') def test_custom_email_constructor(self): data = {'email': 'testclient@example.com'} class CustomEmailPasswordResetForm(PasswordResetForm): def send_mail(self, subject_template_name, email_template_name, context, from_email, to_email, html_email_template_name=None): EmailMultiAlternatives( "Forgot your password?", "Sorry to hear you forgot your password.", None, [to_email], ['site_monitor@example.com'], headers={'Reply-To': 'webmaster@example.com'}, alternatives=[ ("Really sorry to hear you forgot your password.", "text/html") ], ).send() form = CustomEmailPasswordResetForm(data) self.assertTrue(form.is_valid()) # domain_override to prevent the save operation from failing in the # potential case where contrib.sites is not installed. Refs #16412. form.save(domain_override='example.com') self.assertEqual(len(mail.outbox), 1) self.assertEqual(mail.outbox[0].subject, 'Forgot your password?') self.assertEqual(mail.outbox[0].bcc, ['site_monitor@example.com']) self.assertEqual(mail.outbox[0].content_subtype, "plain") def test_preserve_username_case(self): user = User.objects.create_user('forms_test2', 'tesT@EXAMple.com', 'test') self.assertEqual(user.email, 'tesT@example.com') user = User.objects.create_user('forms_test3', 'tesT', 'test') self.assertEqual(user.email, 'tesT') def test_inactive_user(self): (user, username, email) = self.create_dummy_user() user.is_active = False user.save() form = PasswordResetForm({'email': email}) self.assertTrue(form.is_valid()) form.save() self.assertEqual(len(mail.outbox), 0) def test_unusable_password(self): user = User.objects.create_user('testuser', 'test@example.com', 'test') data = {"email": "test@example.com"} form = PasswordResetForm(data) self.assertTrue(form.is_valid()) user.set_unusable_password() user.save() form = PasswordResetForm(data) # The form itself is valid, but no email is sent self.assertTrue(form.is_valid()) form.save() self.assertEqual(len(mail.outbox), 0) def test_save_plaintext_email(self): (user, username, email) = self.create_dummy_user() form = PasswordResetForm({"email": email}) self.assertTrue(form.is_valid()) form.save() self.assertEqual(len(mail.outbox), 1) message = mail.outbox[0].message() self.assertFalse(message.is_multipart()) self.assertEqual(message.get_content_type(), 'text/plain') self.assertEqual(message.get('subject'), 'Custom password reset on example.com') self.assertEqual(len(mail.outbox[0].alternatives), 0) self.assertEqual(message.get_all('to'), [email]) self.assertTrue(re.match(r'^http://example.com/reset/[\w+/-]', message.get_payload())) def test_save_html_email_template_name(self): (user, username, email) = self.create_dummy_user() form = PasswordResetForm({"email": email}) self.assertTrue(form.is_valid()) form.save(html_email_template_name='registration/html_password_reset_email.html') self.assertEqual(len(mail.outbox), 1) self.assertEqual(len(mail.outbox[0].alternatives), 1) message = mail.outbox[0].message() self.assertEqual(message.get('subject'), 'Custom password reset on example.com') self.assertEqual(len(message.get_payload()), 2) self.assertTrue(message.is_multipart()) self.assertEqual(message.get_payload(0).get_content_type(), 'text/plain') self.assertEqual(message.get_payload(1).get_content_type(), 'text/html') self.assertEqual(message.get_all('to'), [email]) self.assertTrue(re.match(r'^http://example.com/reset/[\w/-]+', message.get_payload(0).get_payload())) self.assertTrue(re.match( r'^<html><a href="http://example.com/reset/[\w/-]+/">Link</a></html>$', message.get_payload(1).get_payload() )) @override_settings(AUTH_USER_MODEL='auth_tests.CustomEmailField') def test_custom_email_field(self): email = 'test@mail.com' CustomEmailField.objects.create_user('test name', 'test password', email) form = PasswordResetForm({'email': email}) self.assertTrue(form.is_valid()) form.save() self.assertEqual(form.cleaned_data['email'], email) self.assertEqual(len(mail.outbox), 1) self.assertEqual(mail.outbox[0].to, [email]) def test_html_autocomplete_attributes(self): form = PasswordResetForm() self.assertEqual(form.fields['email'].widget.attrs['autocomplete'], 'email') class ReadOnlyPasswordHashTest(SimpleTestCase): def test_bug_19349_render_with_none_value(self): # Rendering the widget with value set to None # mustn't raise an exception. widget = ReadOnlyPasswordHashWidget() html = widget.render(name='password', value=None, attrs={}) self.assertIn(_("No password set."), html) @override_settings(PASSWORD_HASHERS=['django.contrib.auth.hashers.PBKDF2PasswordHasher']) def test_render(self): widget = ReadOnlyPasswordHashWidget() value = 'pbkdf2_sha256$100000$a6Pucb1qSFcD$WmCkn9Hqidj48NVe5x0FEM6A9YiOqQcl/83m2Z5udm0=' self.assertHTMLEqual( widget.render('name', value, {'id': 'id_password'}), """ <div id="id_password"> <strong>algorithm</strong>: pbkdf2_sha256 <strong>iterations</strong>: 100000 <strong>salt</strong>: a6Pucb****** <strong>hash</strong>: WmCkn9************************************** </div> """ ) def test_readonly_field_has_changed(self): field = ReadOnlyPasswordHashField() self.assertFalse(field.has_changed('aaa', 'bbb')) class AdminPasswordChangeFormTest(TestDataMixin, TestCase): @mock.patch('django.contrib.auth.password_validation.password_changed') def test_success(self, password_changed): user = User.objects.get(username='testclient') data = { 'password1': 'test123', 'password2': 'test123', } form = AdminPasswordChangeForm(user, data) self.assertTrue(form.is_valid()) form.save(commit=False) self.assertEqual(password_changed.call_count, 0) form.save() self.assertEqual(password_changed.call_count, 1) def test_password_whitespace_not_stripped(self): user = User.objects.get(username='testclient') data = { 'password1': ' pass ', 'password2': ' pass ', } form = AdminPasswordChangeForm(user, data) self.assertTrue(form.is_valid()) self.assertEqual(form.cleaned_data['password1'], data['password1']) self.assertEqual(form.cleaned_data['password2'], data['password2']) def test_non_matching_passwords(self): user = User.objects.get(username='testclient') data = {'password1': 'password1', 'password2': 'password2'} form = AdminPasswordChangeForm(user, data) self.assertEqual(form.errors['password2'], [form.error_messages['password_mismatch']]) def test_missing_passwords(self): user = User.objects.get(username='testclient') data = {'password1': '', 'password2': ''} form = AdminPasswordChangeForm(user, data) required_error = [Field.default_error_messages['required']] self.assertEqual(form.errors['password1'], required_error) self.assertEqual(form.errors['password2'], required_error) def test_one_password(self): user = User.objects.get(username='testclient') form1 = AdminPasswordChangeForm(user, {'password1': '', 'password2': 'test'}) required_error = [Field.default_error_messages['required']] self.assertEqual(form1.errors['password1'], required_error) self.assertNotIn('password2', form1.errors) form2 = AdminPasswordChangeForm(user, {'password1': 'test', 'password2': ''}) self.assertEqual(form2.errors['password2'], required_error) self.assertNotIn('password1', form2.errors) def test_html_autocomplete_attributes(self): user = User.objects.get(username='testclient') form = AdminPasswordChangeForm(user) tests = ( ('password1', 'new-password'), ('password2', 'new-password'), ) for field_name, autocomplete in tests: with self.subTest(field_name=field_name, autocomplete=autocomplete): self.assertEqual(form.fields[field_name].widget.attrs['autocomplete'], autocomplete)
true
true
f70a801c5d683c1dba1026dff2fe4f7c00cc9e36
1,524
py
Python
NiaPy/benchmarks/chungReynolds.py
tuahk/NiaPy
c863d801fda8e1949a3ca716a4de7c7ca3d0ea16
[ "MIT" ]
null
null
null
NiaPy/benchmarks/chungReynolds.py
tuahk/NiaPy
c863d801fda8e1949a3ca716a4de7c7ca3d0ea16
[ "MIT" ]
null
null
null
NiaPy/benchmarks/chungReynolds.py
tuahk/NiaPy
c863d801fda8e1949a3ca716a4de7c7ca3d0ea16
[ "MIT" ]
null
null
null
# encoding=utf8 # pylint: disable=anomalous-backslash-in-string, old-style-class import math __all__ = ['ChungReynolds'] class ChungReynolds: r"""Implementation of Chung Reynolds functions. Date: 2018 Authors: Lucija Brezočnik License: MIT Function: **Chung Reynolds function** :math:`f(\mathbf{x}) = \left(\sum_{i=1}^D x_i^2\right)^2` **Input domain:** The function can be defined on any input domain but it is usually evaluated on the hypercube :math:`x_i ∈ [-100, 100]`, for all :math:`i = 1, 2,..., D` **Global minimum:** :math:`f(x^*) = 0`, at :math:`x^* = (0,...,0)` LaTeX formats: Inline: $f(\mathbf{x}) = \left(\sum_{i=1}^D x_i^2\right)^2$ Equation: \begin{equation} f(\mathbf{x}) = \left(\sum_{i=1}^D x_i^2\right)^2 \end{equation} Domain: $-100 \leq x_i \leq 100$ Reference paper: Jamil, M., and Yang, X. S. (2013). A literature survey of benchmark functions for global optimisation problems. International Journal of Mathematical Modelling and Numerical Optimisation, 4(2), 150-194. """ def __init__(self, Lower=-100.0, Upper=100.0): self.Lower = Lower self.Upper = Upper @classmethod def function(cls): def evaluate(D, sol): val = 0.0 for i in range(D): val += math.pow(sol[i], 2) return math.pow(val, 2) return evaluate
25.4
97
0.566273
import math __all__ = ['ChungReynolds'] class ChungReynolds: def __init__(self, Lower=-100.0, Upper=100.0): self.Lower = Lower self.Upper = Upper @classmethod def function(cls): def evaluate(D, sol): val = 0.0 for i in range(D): val += math.pow(sol[i], 2) return math.pow(val, 2) return evaluate
true
true
f70a811a53d750ec8a97ef9cb6bb7b23600aa0f9
3,184
bzl
Python
google/cloud/bigtable/bigtable_client.bzl
millerantonio810/google-cloud-cpp
71582d922bc22b0dcbc58234f36c726ea3b7c171
[ "Apache-2.0" ]
3
2020-05-27T23:21:23.000Z
2020-05-31T22:31:53.000Z
google/cloud/bigtable/bigtable_client.bzl
millerantonio810/google-cloud-cpp
71582d922bc22b0dcbc58234f36c726ea3b7c171
[ "Apache-2.0" ]
2
2020-05-31T22:26:57.000Z
2020-06-19T00:14:10.000Z
google/cloud/bigtable/bigtable_client.bzl
millerantonio810/google-cloud-cpp
71582d922bc22b0dcbc58234f36c726ea3b7c171
[ "Apache-2.0" ]
1
2021-12-09T16:26:23.000Z
2021-12-09T16:26:23.000Z
# Copyright 2018 Google LLC # # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. # # DO NOT EDIT -- GENERATED BY CMake -- Change the CMakeLists.txt file if needed """Automatically generated source lists for bigtable_client - DO NOT EDIT.""" bigtable_client_hdrs = [ "admin_client.h", "app_profile_config.h", "async_row_reader.h", "cell.h", "client_options.h", "cluster_config.h", "cluster_list_responses.h", "column_family.h", "completion_queue.h", "data_client.h", "expr.h", "filters.h", "iam_binding.h", "iam_policy.h", "idempotent_mutation_policy.h", "instance_admin.h", "instance_admin_client.h", "instance_config.h", "instance_list_responses.h", "instance_update_config.h", "internal/async_bulk_apply.h", "internal/async_longrunning_op.h", "internal/async_poll_op.h", "internal/async_retry_multi_page.h", "internal/async_retry_op.h", "internal/async_retry_unary_rpc_and_poll.h", "internal/bulk_mutator.h", "internal/client_options_defaults.h", "internal/common_client.h", "internal/conjunction.h", "internal/google_bytes_traits.h", "internal/prefix_range_end.h", "internal/readrowsparser.h", "internal/rowreaderiterator.h", "internal/rpc_policy_parameters.h", "internal/rpc_policy_parameters.inc", "internal/unary_client_utils.h", "metadata_update_policy.h", "mutation_batcher.h", "mutations.h", "polling_policy.h", "read_modify_write_rule.h", "row.h", "row_key.h", "row_key_sample.h", "row_range.h", "row_reader.h", "row_set.h", "rpc_backoff_policy.h", "rpc_retry_policy.h", "table.h", "table_admin.h", "table_config.h", "version.h", "version_info.h", ] bigtable_client_srcs = [ "admin_client.cc", "app_profile_config.cc", "client_options.cc", "cluster_config.cc", "data_client.cc", "expr.cc", "iam_binding.cc", "iam_policy.cc", "idempotent_mutation_policy.cc", "instance_admin.cc", "instance_admin_client.cc", "instance_config.cc", "instance_update_config.cc", "internal/async_bulk_apply.cc", "internal/bulk_mutator.cc", "internal/common_client.cc", "internal/google_bytes_traits.cc", "internal/prefix_range_end.cc", "internal/readrowsparser.cc", "internal/rowreaderiterator.cc", "metadata_update_policy.cc", "mutation_batcher.cc", "mutations.cc", "polling_policy.cc", "row_range.cc", "row_reader.cc", "row_set.cc", "rpc_backoff_policy.cc", "rpc_retry_policy.cc", "table.cc", "table_admin.cc", "table_config.cc", "version.cc", ]
28.428571
79
0.682789
bigtable_client_hdrs = [ "admin_client.h", "app_profile_config.h", "async_row_reader.h", "cell.h", "client_options.h", "cluster_config.h", "cluster_list_responses.h", "column_family.h", "completion_queue.h", "data_client.h", "expr.h", "filters.h", "iam_binding.h", "iam_policy.h", "idempotent_mutation_policy.h", "instance_admin.h", "instance_admin_client.h", "instance_config.h", "instance_list_responses.h", "instance_update_config.h", "internal/async_bulk_apply.h", "internal/async_longrunning_op.h", "internal/async_poll_op.h", "internal/async_retry_multi_page.h", "internal/async_retry_op.h", "internal/async_retry_unary_rpc_and_poll.h", "internal/bulk_mutator.h", "internal/client_options_defaults.h", "internal/common_client.h", "internal/conjunction.h", "internal/google_bytes_traits.h", "internal/prefix_range_end.h", "internal/readrowsparser.h", "internal/rowreaderiterator.h", "internal/rpc_policy_parameters.h", "internal/rpc_policy_parameters.inc", "internal/unary_client_utils.h", "metadata_update_policy.h", "mutation_batcher.h", "mutations.h", "polling_policy.h", "read_modify_write_rule.h", "row.h", "row_key.h", "row_key_sample.h", "row_range.h", "row_reader.h", "row_set.h", "rpc_backoff_policy.h", "rpc_retry_policy.h", "table.h", "table_admin.h", "table_config.h", "version.h", "version_info.h", ] bigtable_client_srcs = [ "admin_client.cc", "app_profile_config.cc", "client_options.cc", "cluster_config.cc", "data_client.cc", "expr.cc", "iam_binding.cc", "iam_policy.cc", "idempotent_mutation_policy.cc", "instance_admin.cc", "instance_admin_client.cc", "instance_config.cc", "instance_update_config.cc", "internal/async_bulk_apply.cc", "internal/bulk_mutator.cc", "internal/common_client.cc", "internal/google_bytes_traits.cc", "internal/prefix_range_end.cc", "internal/readrowsparser.cc", "internal/rowreaderiterator.cc", "metadata_update_policy.cc", "mutation_batcher.cc", "mutations.cc", "polling_policy.cc", "row_range.cc", "row_reader.cc", "row_set.cc", "rpc_backoff_policy.cc", "rpc_retry_policy.cc", "table.cc", "table_admin.cc", "table_config.cc", "version.cc", ]
true
true
f70a8219ec7071e721f28c56f09238a86a3a82ea
312
py
Python
models/devices.py
stephanGarland/PyNotion
74460e4792758c740b4e779772f734f97d7ad371
[ "MIT" ]
9
2017-11-29T04:01:22.000Z
2022-02-06T09:19:24.000Z
models/devices.py
stephanGarland/PyNotion
74460e4792758c740b4e779772f734f97d7ad371
[ "MIT" ]
3
2021-09-01T20:51:32.000Z
2021-09-03T16:30:48.000Z
models/devices.py
stephanGarland/PyNotion
74460e4792758c740b4e779772f734f97d7ad371
[ "MIT" ]
1
2021-09-02T19:28:44.000Z
2021-09-02T19:28:44.000Z
class Device: def __init__(self, id=None, token=None, platform=None, endpoint=None, created_at=None, updated_at=None): self.id = id self.token = token self.platform = platform self.endpoint = endpoint self.created_at = created_at self.updated_at = updated_at
31.2
108
0.650641
class Device: def __init__(self, id=None, token=None, platform=None, endpoint=None, created_at=None, updated_at=None): self.id = id self.token = token self.platform = platform self.endpoint = endpoint self.created_at = created_at self.updated_at = updated_at
true
true
f70a8336bc5479f73419747b75d720f65693f002
3,574
py
Python
django_rq/management/commands/rqworker.py
UKTV/django_rq
681d8797eacda78a46db2897235b84b6929b8d16
[ "MIT" ]
null
null
null
django_rq/management/commands/rqworker.py
UKTV/django_rq
681d8797eacda78a46db2897235b84b6929b8d16
[ "MIT" ]
null
null
null
django_rq/management/commands/rqworker.py
UKTV/django_rq
681d8797eacda78a46db2897235b84b6929b8d16
[ "MIT" ]
1
2017-06-07T16:03:35.000Z
2017-06-07T16:03:35.000Z
from distutils.version import LooseVersion import os import importlib import logging import sys from django.core.management.base import BaseCommand from django.utils.version import get_version from django_rq.queues import get_queues from django_rq.workers import get_exception_handlers from redis.exceptions import ConnectionError from rq import use_connection from rq.utils import ColorizingStreamHandler # Setup logging for RQWorker if not already configured logger = logging.getLogger('rq.worker') if not logger.handlers: logger.setLevel(logging.DEBUG) formatter = logging.Formatter(fmt='%(asctime)s %(message)s', datefmt='%H:%M:%S') handler = ColorizingStreamHandler() handler.setFormatter(formatter) logger.addHandler(handler) # Copied from rq.utils def import_attribute(name): """Return an attribute from a dotted path name (e.g. "path.to.func").""" module_name, attribute = name.rsplit('.', 1) module = importlib.import_module(module_name) return getattr(module, attribute) class Command(BaseCommand): """ Runs RQ workers on specified queues. Note that all queues passed into a single rqworker command must share the same connection. Example usage: python manage.py rqworker high medium low """ args = '<queue queue ...>' def add_arguments(self, parser): parser.add_argument('--worker-class', action='store', dest='worker_class', default='rq.Worker', help='RQ Worker class to use') parser.add_argument('--pid', action='store', dest='pid', default=None, help='PID file to write the worker`s pid into') parser.add_argument('--burst', action='store_true', dest='burst', default=False, help='Run worker in burst mode') parser.add_argument('--name', action='store', dest='name', default=None, help='Name of the worker') parser.add_argument('--queue-class', action='store', dest='queue_class', default='django_rq.queues.DjangoRQ', help='Queues class to use') parser.add_argument('--worker-ttl', action='store', type=int, dest='worker_ttl', default=420, help='Default worker timeout to be used') if LooseVersion(get_version()) >= LooseVersion('1.10'): parser.add_argument('args', nargs='*', type=str, help='The queues to work on, separated by space') def handle(self, *args, **options): pid = options.get('pid') if pid: with open(os.path.expanduser(pid), "w") as fp: fp.write(str(os.getpid())) try: # Instantiate a worker worker_class = import_attribute(options['worker_class']) queues = get_queues(*args, queue_class=import_attribute(options['queue_class'])) w = worker_class( queues, connection=queues[0].connection, name=options['name'], exception_handlers=get_exception_handlers() or None, default_worker_ttl=options['worker_ttl'] ) # Call use_connection to push the redis connection into LocalStack # without this, jobs using RQ's get_current_job() will fail use_connection(w.connection) w.work(burst=options.get('burst', False)) except ConnectionError as e: print(e) sys.exit(1)
39.274725
92
0.622832
from distutils.version import LooseVersion import os import importlib import logging import sys from django.core.management.base import BaseCommand from django.utils.version import get_version from django_rq.queues import get_queues from django_rq.workers import get_exception_handlers from redis.exceptions import ConnectionError from rq import use_connection from rq.utils import ColorizingStreamHandler logger = logging.getLogger('rq.worker') if not logger.handlers: logger.setLevel(logging.DEBUG) formatter = logging.Formatter(fmt='%(asctime)s %(message)s', datefmt='%H:%M:%S') handler = ColorizingStreamHandler() handler.setFormatter(formatter) logger.addHandler(handler) def import_attribute(name): module_name, attribute = name.rsplit('.', 1) module = importlib.import_module(module_name) return getattr(module, attribute) class Command(BaseCommand): args = '<queue queue ...>' def add_arguments(self, parser): parser.add_argument('--worker-class', action='store', dest='worker_class', default='rq.Worker', help='RQ Worker class to use') parser.add_argument('--pid', action='store', dest='pid', default=None, help='PID file to write the worker`s pid into') parser.add_argument('--burst', action='store_true', dest='burst', default=False, help='Run worker in burst mode') parser.add_argument('--name', action='store', dest='name', default=None, help='Name of the worker') parser.add_argument('--queue-class', action='store', dest='queue_class', default='django_rq.queues.DjangoRQ', help='Queues class to use') parser.add_argument('--worker-ttl', action='store', type=int, dest='worker_ttl', default=420, help='Default worker timeout to be used') if LooseVersion(get_version()) >= LooseVersion('1.10'): parser.add_argument('args', nargs='*', type=str, help='The queues to work on, separated by space') def handle(self, *args, **options): pid = options.get('pid') if pid: with open(os.path.expanduser(pid), "w") as fp: fp.write(str(os.getpid())) try: worker_class = import_attribute(options['worker_class']) queues = get_queues(*args, queue_class=import_attribute(options['queue_class'])) w = worker_class( queues, connection=queues[0].connection, name=options['name'], exception_handlers=get_exception_handlers() or None, default_worker_ttl=options['worker_ttl'] ) use_connection(w.connection) w.work(burst=options.get('burst', False)) except ConnectionError as e: print(e) sys.exit(1)
true
true
f70a8465913381e196aa41c4ceeea530e222a6a2
2,947
py
Python
src/utils/args.py
ioangatop/srVAE
dfee765c53f11f4653e7c6e7118a339832656867
[ "MIT" ]
60
2020-06-11T11:06:15.000Z
2022-03-31T14:35:19.000Z
src/utils/args.py
ioangatop/srVAE
dfee765c53f11f4653e7c6e7118a339832656867
[ "MIT" ]
9
2020-06-28T09:45:28.000Z
2020-12-30T15:20:19.000Z
src/utils/args.py
ioangatop/srVAE
dfee765c53f11f4653e7c6e7118a339832656867
[ "MIT" ]
9
2020-07-28T12:03:32.000Z
2022-03-31T14:34:08.000Z
import torch import argparse # ----- Parser ----- def parser(): PARSER = argparse.ArgumentParser(description='Training parameters.') # Dataset PARSER.add_argument('--dataset', default='CIFAR10', type=str, choices=['CIFAR10', 'CelebA', 'Imagenette', 'ImageNet32', 'ImageNet64'], help="Data to be used.") PARSER.add_argument('--img_resize', default=32, type=int, help='Change image resolution.') # Model PARSER.add_argument('--model', default='VAE', type=str, choices=['VAE', 'srVAE'], help="Model to be used.") PARSER.add_argument('--network', default='densenet32', type=str, choices=['densenet32', 'densenet16x32'], help="Neural Network architecture to be used.") # Prior PARSER.add_argument('--prior', default='MixtureOfGaussians', type=str, choices=['StandardNormal', 'MixtureOfGaussians', 'RealNVP'], help='Prior type.') PARSER.add_argument('--z_dim', default=1024, type=int, help='Dimensionality of z latent space.') PARSER.add_argument('--u_dim', default=1024, type=int, help='Dimensionality of z latent space.') # data likelihood PARSER.add_argument('--likelihood', default='dmol', type=str, choices=['dmol'], help="Type of likelihood.") PARSER.add_argument('--iw_test', default=512, type=int, help="Number of Importance Weighting samples used for approximating the test log-likelihood.") # Training Parameters PARSER.add_argument('--batch_size', default=32, type=int, help='Batch size.') PARSER.add_argument('--epochs', default=2000, type=int, help='Number of training epochs.') # General Configs PARSER.add_argument('--seed', default=None, type=int, help='Fix random seed.') PARSER.add_argument('--n_samples', default=8, type=int, help='Number of generated samples.') PARSER.add_argument('--log_interval', default=True, type=bool, help='Print progress on every batch.') PARSER.add_argument('--device', default=None, type=str, choices=['cpu', 'cuda'], help='Device to run the experiment.') PARSER.add_argument('--use_tb', default=True, type=bool, help='Use TensorBoard.') PARSER.add_argument('--tags', default='logs', type=str, help='Run tags.') ARGS = PARSER.parse_args() # Check device if ARGS.device is None: ARGS.device = torch.device("cuda" if torch.cuda.is_available() else "cpu") return ARGS args = parser() if __name__ == "__main__": pass
38.272727
118
0.562606
import torch import argparse def parser(): PARSER = argparse.ArgumentParser(description='Training parameters.') PARSER.add_argument('--dataset', default='CIFAR10', type=str, choices=['CIFAR10', 'CelebA', 'Imagenette', 'ImageNet32', 'ImageNet64'], help="Data to be used.") PARSER.add_argument('--img_resize', default=32, type=int, help='Change image resolution.') PARSER.add_argument('--model', default='VAE', type=str, choices=['VAE', 'srVAE'], help="Model to be used.") PARSER.add_argument('--network', default='densenet32', type=str, choices=['densenet32', 'densenet16x32'], help="Neural Network architecture to be used.") PARSER.add_argument('--prior', default='MixtureOfGaussians', type=str, choices=['StandardNormal', 'MixtureOfGaussians', 'RealNVP'], help='Prior type.') PARSER.add_argument('--z_dim', default=1024, type=int, help='Dimensionality of z latent space.') PARSER.add_argument('--u_dim', default=1024, type=int, help='Dimensionality of z latent space.') PARSER.add_argument('--likelihood', default='dmol', type=str, choices=['dmol'], help="Type of likelihood.") PARSER.add_argument('--iw_test', default=512, type=int, help="Number of Importance Weighting samples used for approximating the test log-likelihood.") PARSER.add_argument('--batch_size', default=32, type=int, help='Batch size.') PARSER.add_argument('--epochs', default=2000, type=int, help='Number of training epochs.') PARSER.add_argument('--seed', default=None, type=int, help='Fix random seed.') PARSER.add_argument('--n_samples', default=8, type=int, help='Number of generated samples.') PARSER.add_argument('--log_interval', default=True, type=bool, help='Print progress on every batch.') PARSER.add_argument('--device', default=None, type=str, choices=['cpu', 'cuda'], help='Device to run the experiment.') PARSER.add_argument('--use_tb', default=True, type=bool, help='Use TensorBoard.') PARSER.add_argument('--tags', default='logs', type=str, help='Run tags.') ARGS = PARSER.parse_args() if ARGS.device is None: ARGS.device = torch.device("cuda" if torch.cuda.is_available() else "cpu") return ARGS args = parser() if __name__ == "__main__": pass
true
true
f70a84c63ca36138b87e96ed011c0fe5cf9d31bc
9,961
py
Python
third_party/catapult/dashboard/dashboard/models/histogram_test.py
zipated/src
2b8388091c71e442910a21ada3d97ae8bc1845d3
[ "BSD-3-Clause" ]
2,151
2020-04-18T07:31:17.000Z
2022-03-31T08:39:18.000Z
third_party/catapult/dashboard/dashboard/models/histogram_test.py
cangulcan/src
2b8388091c71e442910a21ada3d97ae8bc1845d3
[ "BSD-3-Clause" ]
395
2020-04-18T08:22:18.000Z
2021-12-08T13:04:49.000Z
third_party/catapult/dashboard/dashboard/models/histogram_test.py
cangulcan/src
2b8388091c71e442910a21ada3d97ae8bc1845d3
[ "BSD-3-Clause" ]
338
2020-04-18T08:03:10.000Z
2022-03-29T12:33:22.000Z
# Copyright 2017 The Chromium Authors. All rights reserved. # Use of this source code is governed by a BSD-style license that can be # found in the LICENSE file. import json import sys from dashboard.common import testing_common from dashboard.common import utils from dashboard.models import histogram from tracing.value.diagnostics import reserved_infos class SparseDiagnosticTest(testing_common.TestCase): """Test case for functions in SparseDiagnostic.""" def setUp(self): super(SparseDiagnosticTest, self).setUp() self.SetCurrentUser('foo@bar.com', is_admin=True) def _AddMockData(self, test_key): data_samples = { 'owners': [ { 'type': 'GenericSet', 'guid': '1', 'values': ['1'] }, { 'type': 'GenericSet', 'guid': '1', 'values': ['2'] }, { 'type': 'GenericSet', 'guid': '1', 'values': ['3'] }, ], 'bugs': [ { 'type': 'GenericSet', 'guid': '1', 'values': ['a'] }, { 'type': 'GenericSet', 'guid': '1', 'values': ['b'] }, { 'type': 'GenericSet', 'guid': '1', 'values': ['c'] }, ] } for k, diagnostic_samples in data_samples.iteritems(): for i in xrange(len(diagnostic_samples)): start_revision = i * 10 end_revision = (i + 1) * 10 - 1 if i == len(diagnostic_samples) - 1: end_revision = sys.maxint e = histogram.SparseDiagnostic( data=diagnostic_samples[i], test=test_key, start_revision=start_revision, end_revision=end_revision, name=k, internal_only=False) e.put() def testFixupDiagnostics_Middle_FixesRange(self): test_key = utils.TestKey('Chromium/win7/foo') self._AddMockData(test_key) data = { 'type': 'GenericSet', 'guid': '1', 'values': ['10'] } e = histogram.SparseDiagnostic( data=data, test=test_key, start_revision=5, end_revision=sys.maxint, name='owners', internal_only=False) e.put() histogram.SparseDiagnostic.FixDiagnostics(test_key).get_result() expected = { 'owners': [(0, 4), (5, 9), (10, 19), (20, sys.maxint)], 'bugs': [(0, 9), (10, 19), (20, sys.maxint)], } diags = histogram.SparseDiagnostic.query().fetch() for d in diags: self.assertIn((d.start_revision, d.end_revision), expected[d.name]) expected[d.name].remove((d.start_revision, d.end_revision)) self.assertEqual(0, len(expected['owners'])) self.assertEqual(0, len(expected['bugs'])) def testFixupDiagnostics_End_FixesRange(self): test_key = utils.TestKey('Chromium/win7/foo') self._AddMockData(test_key) data = { 'type': 'GenericSet', 'guid': '1', 'values': ['10'] } e = histogram.SparseDiagnostic( data=data, test=test_key, start_revision=100, end_revision=sys.maxint, name='owners', internal_only=False) e.put() histogram.SparseDiagnostic.FixDiagnostics(test_key).get_result() expected = { 'owners': [(0, 9), (10, 19), (20, 99), (100, sys.maxint)], 'bugs': [(0, 9), (10, 19), (20, sys.maxint)], } diags = histogram.SparseDiagnostic.query().fetch() for d in diags: self.assertIn((d.start_revision, d.end_revision), expected[d.name]) expected[d.name].remove((d.start_revision, d.end_revision)) self.assertEqual(0, len(expected['owners'])) self.assertEqual(0, len(expected['bugs'])) def testFixupDiagnostics_DifferentTestPath_NoChange(self): test_key1 = utils.TestKey('Chromium/win7/1') test_key2 = utils.TestKey('Chromium/win7/2') self._AddMockData(test_key1) self._AddMockData(test_key2) data = { 'type': 'GenericSet', 'guid': '1', 'values': ['10'] } e = histogram.SparseDiagnostic( data=data, test=test_key1, start_revision=5, end_revision=sys.maxint, name='owners', internal_only=False) e.put() histogram.SparseDiagnostic.FixDiagnostics(test_key2).get_result() expected = { 'owners': [(0, 9), (10, 19), (20, sys.maxint)], 'bugs': [(0, 9), (10, 19), (20, sys.maxint)], } diags = histogram.SparseDiagnostic.query( histogram.SparseDiagnostic.test == test_key2).fetch() for d in diags: self.assertIn((d.start_revision, d.end_revision), expected[d.name]) expected[d.name].remove((d.start_revision, d.end_revision)) self.assertEqual(0, len(expected['owners'])) self.assertEqual(0, len(expected['bugs'])) def testFixupDiagnostics_NotUnique_NoChange(self): test_key = utils.TestKey('Chromium/win7/foo') self._AddMockData(test_key) data = { 'type': 'GenericSet', 'guid': '1', 'values': ['1'] } e = histogram.SparseDiagnostic( data=data, test=test_key, start_revision=5, end_revision=sys.maxint, name='owners', internal_only=False) e.put() histogram.SparseDiagnostic.FixDiagnostics(test_key).get_result() expected = { 'owners': [(0, 9), (10, 19), (20, sys.maxint)], 'bugs': [(0, 9), (10, 19), (20, sys.maxint)], } diags = histogram.SparseDiagnostic.query( histogram.SparseDiagnostic.test == test_key).fetch() for d in diags: self.assertIn((d.start_revision, d.end_revision), expected[d.name]) expected[d.name].remove((d.start_revision, d.end_revision)) self.assertEqual(0, len(expected['owners'])) self.assertEqual(0, len(expected['bugs'])) def testGetMostRecentValuesByNames_ReturnAllData(self): data_samples = [ { 'type': 'GenericSet', 'guid': 'eb212e80-db58-4cbd-b331-c2245ecbb826', 'values': ['alice@chromium.org'] }, { 'type': 'GenericSet', 'guid': 'eb212e80-db58-4cbd-b331-c2245ecbb827', 'values': ['abc'] }] test_key = utils.TestKey('Chromium/win7/foo') entity = histogram.SparseDiagnostic( data=json.dumps(data_samples[0]), test=test_key, start_revision=1, end_revision=sys.maxint, id=data_samples[0]['guid'], name=reserved_infos.OWNERS.name) entity.put() entity = histogram.SparseDiagnostic( data=json.dumps(data_samples[1]), test=test_key, start_revision=1, end_revision=sys.maxint, id=data_samples[1]['guid'], name=reserved_infos.BUG_COMPONENTS.name) entity.put() lookup_result = histogram.SparseDiagnostic.GetMostRecentValuesByNames( test_key, set([reserved_infos.OWNERS.name, reserved_infos.BUG_COMPONENTS.name])) self.assertEqual(lookup_result.get(reserved_infos.OWNERS.name), ['alice@chromium.org']) self.assertEqual(lookup_result.get(reserved_infos.BUG_COMPONENTS.name), ['abc']) def testGetMostRecentValuesByNames_ReturnsNoneIfNoneFound(self): data_sample = { 'type': 'GenericSet', 'guid': 'eb212e80-db58-4cbd-b331-c2245ecbb826', 'values': ['alice@chromium.org'] } test_key = utils.TestKey('Chromium/win7/foo') entity = histogram.SparseDiagnostic( data=json.dumps(data_sample), test=test_key, start_revision=1, end_revision=sys.maxint, id=data_sample['guid'], name=reserved_infos.OWNERS.name) entity.put() lookup_result = histogram.SparseDiagnostic.GetMostRecentValuesByNames( test_key, set([reserved_infos.OWNERS.name, reserved_infos.BUG_COMPONENTS.name])) self.assertEqual(lookup_result.get(reserved_infos.OWNERS.name), ['alice@chromium.org']) self.assertIsNone(lookup_result.get(reserved_infos.BUG_COMPONENTS.name)) def testGetMostRecentValuesByNames_ReturnsNoneIfNoName(self): data_sample = { 'guid': 'abc', 'osName': 'linux', 'type': 'DeviceInfo' } test_key = utils.TestKey('Chromium/win7/foo') entity = histogram.SparseDiagnostic( data=json.dumps(data_sample), test=test_key, start_revision=1, end_revision=sys.maxint, id=data_sample['guid']) entity.put() lookup_result = histogram.SparseDiagnostic.GetMostRecentValuesByNames( test_key, set([reserved_infos.OWNERS.name, reserved_infos.BUG_COMPONENTS.name])) self.assertIsNone(lookup_result.get(reserved_infos.OWNERS.name)) self.assertIsNone(lookup_result.get(reserved_infos.BUG_COMPONENTS.name)) def testGetMostRecentValuesByNames_RaisesErrorIfDuplicateName(self): data_samples = [ { 'type': 'GenericSet', 'guid': 'eb212e80-db58-4cbd-b331-c2245ecbb826', 'values': ['alice@chromium.org'] }, { 'type': 'GenericSet', 'guid': 'eb212e80-db58-4cbd-b331-c2245ecbb827', 'values': ['bob@chromium.org'] }] test_key = utils.TestKey('Chromium/win7/foo') entity = histogram.SparseDiagnostic( data=json.dumps(data_samples[0]), test=test_key, start_revision=1, end_revision=sys.maxint, id=data_samples[0]['guid'], name=reserved_infos.OWNERS.name) entity.put() entity = histogram.SparseDiagnostic( data=json.dumps(data_samples[1]), test=test_key, start_revision=1, end_revision=sys.maxint, id=data_samples[1]['guid'], name=reserved_infos.OWNERS.name) entity.put() self.assertRaises( AssertionError, histogram.SparseDiagnostic.GetMostRecentValuesByNames, test_key, set([reserved_infos.OWNERS.name, reserved_infos.BUG_COMPONENTS.name]))
32.766447
78
0.609979
import json import sys from dashboard.common import testing_common from dashboard.common import utils from dashboard.models import histogram from tracing.value.diagnostics import reserved_infos class SparseDiagnosticTest(testing_common.TestCase): def setUp(self): super(SparseDiagnosticTest, self).setUp() self.SetCurrentUser('foo@bar.com', is_admin=True) def _AddMockData(self, test_key): data_samples = { 'owners': [ { 'type': 'GenericSet', 'guid': '1', 'values': ['1'] }, { 'type': 'GenericSet', 'guid': '1', 'values': ['2'] }, { 'type': 'GenericSet', 'guid': '1', 'values': ['3'] }, ], 'bugs': [ { 'type': 'GenericSet', 'guid': '1', 'values': ['a'] }, { 'type': 'GenericSet', 'guid': '1', 'values': ['b'] }, { 'type': 'GenericSet', 'guid': '1', 'values': ['c'] }, ] } for k, diagnostic_samples in data_samples.iteritems(): for i in xrange(len(diagnostic_samples)): start_revision = i * 10 end_revision = (i + 1) * 10 - 1 if i == len(diagnostic_samples) - 1: end_revision = sys.maxint e = histogram.SparseDiagnostic( data=diagnostic_samples[i], test=test_key, start_revision=start_revision, end_revision=end_revision, name=k, internal_only=False) e.put() def testFixupDiagnostics_Middle_FixesRange(self): test_key = utils.TestKey('Chromium/win7/foo') self._AddMockData(test_key) data = { 'type': 'GenericSet', 'guid': '1', 'values': ['10'] } e = histogram.SparseDiagnostic( data=data, test=test_key, start_revision=5, end_revision=sys.maxint, name='owners', internal_only=False) e.put() histogram.SparseDiagnostic.FixDiagnostics(test_key).get_result() expected = { 'owners': [(0, 4), (5, 9), (10, 19), (20, sys.maxint)], 'bugs': [(0, 9), (10, 19), (20, sys.maxint)], } diags = histogram.SparseDiagnostic.query().fetch() for d in diags: self.assertIn((d.start_revision, d.end_revision), expected[d.name]) expected[d.name].remove((d.start_revision, d.end_revision)) self.assertEqual(0, len(expected['owners'])) self.assertEqual(0, len(expected['bugs'])) def testFixupDiagnostics_End_FixesRange(self): test_key = utils.TestKey('Chromium/win7/foo') self._AddMockData(test_key) data = { 'type': 'GenericSet', 'guid': '1', 'values': ['10'] } e = histogram.SparseDiagnostic( data=data, test=test_key, start_revision=100, end_revision=sys.maxint, name='owners', internal_only=False) e.put() histogram.SparseDiagnostic.FixDiagnostics(test_key).get_result() expected = { 'owners': [(0, 9), (10, 19), (20, 99), (100, sys.maxint)], 'bugs': [(0, 9), (10, 19), (20, sys.maxint)], } diags = histogram.SparseDiagnostic.query().fetch() for d in diags: self.assertIn((d.start_revision, d.end_revision), expected[d.name]) expected[d.name].remove((d.start_revision, d.end_revision)) self.assertEqual(0, len(expected['owners'])) self.assertEqual(0, len(expected['bugs'])) def testFixupDiagnostics_DifferentTestPath_NoChange(self): test_key1 = utils.TestKey('Chromium/win7/1') test_key2 = utils.TestKey('Chromium/win7/2') self._AddMockData(test_key1) self._AddMockData(test_key2) data = { 'type': 'GenericSet', 'guid': '1', 'values': ['10'] } e = histogram.SparseDiagnostic( data=data, test=test_key1, start_revision=5, end_revision=sys.maxint, name='owners', internal_only=False) e.put() histogram.SparseDiagnostic.FixDiagnostics(test_key2).get_result() expected = { 'owners': [(0, 9), (10, 19), (20, sys.maxint)], 'bugs': [(0, 9), (10, 19), (20, sys.maxint)], } diags = histogram.SparseDiagnostic.query( histogram.SparseDiagnostic.test == test_key2).fetch() for d in diags: self.assertIn((d.start_revision, d.end_revision), expected[d.name]) expected[d.name].remove((d.start_revision, d.end_revision)) self.assertEqual(0, len(expected['owners'])) self.assertEqual(0, len(expected['bugs'])) def testFixupDiagnostics_NotUnique_NoChange(self): test_key = utils.TestKey('Chromium/win7/foo') self._AddMockData(test_key) data = { 'type': 'GenericSet', 'guid': '1', 'values': ['1'] } e = histogram.SparseDiagnostic( data=data, test=test_key, start_revision=5, end_revision=sys.maxint, name='owners', internal_only=False) e.put() histogram.SparseDiagnostic.FixDiagnostics(test_key).get_result() expected = { 'owners': [(0, 9), (10, 19), (20, sys.maxint)], 'bugs': [(0, 9), (10, 19), (20, sys.maxint)], } diags = histogram.SparseDiagnostic.query( histogram.SparseDiagnostic.test == test_key).fetch() for d in diags: self.assertIn((d.start_revision, d.end_revision), expected[d.name]) expected[d.name].remove((d.start_revision, d.end_revision)) self.assertEqual(0, len(expected['owners'])) self.assertEqual(0, len(expected['bugs'])) def testGetMostRecentValuesByNames_ReturnAllData(self): data_samples = [ { 'type': 'GenericSet', 'guid': 'eb212e80-db58-4cbd-b331-c2245ecbb826', 'values': ['alice@chromium.org'] }, { 'type': 'GenericSet', 'guid': 'eb212e80-db58-4cbd-b331-c2245ecbb827', 'values': ['abc'] }] test_key = utils.TestKey('Chromium/win7/foo') entity = histogram.SparseDiagnostic( data=json.dumps(data_samples[0]), test=test_key, start_revision=1, end_revision=sys.maxint, id=data_samples[0]['guid'], name=reserved_infos.OWNERS.name) entity.put() entity = histogram.SparseDiagnostic( data=json.dumps(data_samples[1]), test=test_key, start_revision=1, end_revision=sys.maxint, id=data_samples[1]['guid'], name=reserved_infos.BUG_COMPONENTS.name) entity.put() lookup_result = histogram.SparseDiagnostic.GetMostRecentValuesByNames( test_key, set([reserved_infos.OWNERS.name, reserved_infos.BUG_COMPONENTS.name])) self.assertEqual(lookup_result.get(reserved_infos.OWNERS.name), ['alice@chromium.org']) self.assertEqual(lookup_result.get(reserved_infos.BUG_COMPONENTS.name), ['abc']) def testGetMostRecentValuesByNames_ReturnsNoneIfNoneFound(self): data_sample = { 'type': 'GenericSet', 'guid': 'eb212e80-db58-4cbd-b331-c2245ecbb826', 'values': ['alice@chromium.org'] } test_key = utils.TestKey('Chromium/win7/foo') entity = histogram.SparseDiagnostic( data=json.dumps(data_sample), test=test_key, start_revision=1, end_revision=sys.maxint, id=data_sample['guid'], name=reserved_infos.OWNERS.name) entity.put() lookup_result = histogram.SparseDiagnostic.GetMostRecentValuesByNames( test_key, set([reserved_infos.OWNERS.name, reserved_infos.BUG_COMPONENTS.name])) self.assertEqual(lookup_result.get(reserved_infos.OWNERS.name), ['alice@chromium.org']) self.assertIsNone(lookup_result.get(reserved_infos.BUG_COMPONENTS.name)) def testGetMostRecentValuesByNames_ReturnsNoneIfNoName(self): data_sample = { 'guid': 'abc', 'osName': 'linux', 'type': 'DeviceInfo' } test_key = utils.TestKey('Chromium/win7/foo') entity = histogram.SparseDiagnostic( data=json.dumps(data_sample), test=test_key, start_revision=1, end_revision=sys.maxint, id=data_sample['guid']) entity.put() lookup_result = histogram.SparseDiagnostic.GetMostRecentValuesByNames( test_key, set([reserved_infos.OWNERS.name, reserved_infos.BUG_COMPONENTS.name])) self.assertIsNone(lookup_result.get(reserved_infos.OWNERS.name)) self.assertIsNone(lookup_result.get(reserved_infos.BUG_COMPONENTS.name)) def testGetMostRecentValuesByNames_RaisesErrorIfDuplicateName(self): data_samples = [ { 'type': 'GenericSet', 'guid': 'eb212e80-db58-4cbd-b331-c2245ecbb826', 'values': ['alice@chromium.org'] }, { 'type': 'GenericSet', 'guid': 'eb212e80-db58-4cbd-b331-c2245ecbb827', 'values': ['bob@chromium.org'] }] test_key = utils.TestKey('Chromium/win7/foo') entity = histogram.SparseDiagnostic( data=json.dumps(data_samples[0]), test=test_key, start_revision=1, end_revision=sys.maxint, id=data_samples[0]['guid'], name=reserved_infos.OWNERS.name) entity.put() entity = histogram.SparseDiagnostic( data=json.dumps(data_samples[1]), test=test_key, start_revision=1, end_revision=sys.maxint, id=data_samples[1]['guid'], name=reserved_infos.OWNERS.name) entity.put() self.assertRaises( AssertionError, histogram.SparseDiagnostic.GetMostRecentValuesByNames, test_key, set([reserved_infos.OWNERS.name, reserved_infos.BUG_COMPONENTS.name]))
true
true
f70a85945485651bb9a81ecb734bd755346a98cc
3,208
py
Python
meetnowport/settings.py
bonaw/Meetnow
02b77af78db7fa403a5ecee49ee1c64eea893a7a
[ "MIT" ]
null
null
null
meetnowport/settings.py
bonaw/Meetnow
02b77af78db7fa403a5ecee49ee1c64eea893a7a
[ "MIT" ]
null
null
null
meetnowport/settings.py
bonaw/Meetnow
02b77af78db7fa403a5ecee49ee1c64eea893a7a
[ "MIT" ]
null
null
null
""" Django settings for mysite project. Generated by 'django-admin startproject' using Django 2.0.5. For more information on this file, see https://docs.djangoproject.com/en/2.0/topics/settings/ For the full list of settings and their values, see https://docs.djangoproject.com/en/2.0/ref/settings/ """ import os # Build paths inside the project like this: os.path.join(BASE_DIR, ...) BASE_DIR = os.path.dirname(os.path.dirname(os.path.abspath(__file__))) # Quick-start development settings - unsuitable for production # See https://docs.djangoproject.com/en/2.0/howto/deployment/checklist/ # SECURITY WARNING: keep the secret key used in production secret! SECRET_KEY = 'a6j(qtzl$#pd2g^fm+=g27^^r&%gz6sh!o45ekij=--bj)^qx$' # SECURITY WARNING: don't run with debug turned on in production! DEBUG = True ALLOWED_HOSTS = [] # Application definition INSTALLED_APPS = [ 'django.contrib.admin', 'django.contrib.auth', 'django.contrib.contenttypes', 'django.contrib.sessions', 'django.contrib.messages', 'django.contrib.staticfiles', ] MIDDLEWARE = [ 'django.middleware.security.SecurityMiddleware', 'django.contrib.sessions.middleware.SessionMiddleware', 'django.middleware.common.CommonMiddleware', 'django.middleware.csrf.CsrfViewMiddleware', 'django.contrib.auth.middleware.AuthenticationMiddleware', 'django.contrib.messages.middleware.MessageMiddleware', 'django.middleware.clickjacking.XFrameOptionsMiddleware', ] ROOT_URLCONF = 'mysite.urls' TEMPLATES = [ { 'BACKEND': 'django.template.backends.django.DjangoTemplates', 'DIRS': [], 'APP_DIRS': True, 'OPTIONS': { 'context_processors': [ 'django.template.context_processors.debug', 'django.template.context_processors.request', 'django.contrib.auth.context_processors.auth', 'django.contrib.messages.context_processors.messages', ], }, }, ] WSGI_APPLICATION = 'mysite.wsgi.application' # Database # https://docs.djangoproject.com/en/2.0/ref/settings/#databases DATABASES = { 'default': { 'ENGINE': 'django.db.backends.sqlite3', 'NAME': os.path.join(BASE_DIR, 'db.sqlite3'), } } # Password validation # https://docs.djangoproject.com/en/2.0/ref/settings/#auth-password-validators AUTH_PASSWORD_VALIDATORS = [ { 'NAME': 'django.contrib.auth.password_validation.UserAttributeSimilarityValidator', }, { 'NAME': 'django.contrib.auth.password_validation.MinimumLengthValidator', }, { 'NAME': 'django.contrib.auth.password_validation.CommonPasswordValidator', }, { 'NAME': 'django.contrib.auth.password_validation.NumericPasswordValidator', }, ] # Internationalization # https://docs.djangoproject.com/en/2.0/topics/i18n/ LANGUAGE_CODE = 'en-us' TIME_ZONE = 'UTC' USE_I18N = True USE_L10N = True USE_TZ = True # Static files (CSS, JavaScript, Images) # https://docs.djangoproject.com/en/2.0/howto/static-files/ STATIC_URL = '/static/'
26.512397
92
0.668329
import os BASE_DIR = os.path.dirname(os.path.dirname(os.path.abspath(__file__))) SECRET_KEY = 'a6j(qtzl$#pd2g^fm+=g27^^r&%gz6sh!o45ekij=--bj)^qx$' DEBUG = True ALLOWED_HOSTS = [] # Application definition INSTALLED_APPS = [ 'django.contrib.admin', 'django.contrib.auth', 'django.contrib.contenttypes', 'django.contrib.sessions', 'django.contrib.messages', 'django.contrib.staticfiles', ] MIDDLEWARE = [ 'django.middleware.security.SecurityMiddleware', 'django.contrib.sessions.middleware.SessionMiddleware', 'django.middleware.common.CommonMiddleware', 'django.middleware.csrf.CsrfViewMiddleware', 'django.contrib.auth.middleware.AuthenticationMiddleware', 'django.contrib.messages.middleware.MessageMiddleware', 'django.middleware.clickjacking.XFrameOptionsMiddleware', ] ROOT_URLCONF = 'mysite.urls' TEMPLATES = [ { 'BACKEND': 'django.template.backends.django.DjangoTemplates', 'DIRS': [], 'APP_DIRS': True, 'OPTIONS': { 'context_processors': [ 'django.template.context_processors.debug', 'django.template.context_processors.request', 'django.contrib.auth.context_processors.auth', 'django.contrib.messages.context_processors.messages', ], }, }, ] WSGI_APPLICATION = 'mysite.wsgi.application' # Database # https://docs.djangoproject.com/en/2.0/ref/settings/#databases DATABASES = { 'default': { 'ENGINE': 'django.db.backends.sqlite3', 'NAME': os.path.join(BASE_DIR, 'db.sqlite3'), } } # Password validation # https://docs.djangoproject.com/en/2.0/ref/settings/#auth-password-validators AUTH_PASSWORD_VALIDATORS = [ { 'NAME': 'django.contrib.auth.password_validation.UserAttributeSimilarityValidator', }, { 'NAME': 'django.contrib.auth.password_validation.MinimumLengthValidator', }, { 'NAME': 'django.contrib.auth.password_validation.CommonPasswordValidator', }, { 'NAME': 'django.contrib.auth.password_validation.NumericPasswordValidator', }, ] # Internationalization # https://docs.djangoproject.com/en/2.0/topics/i18n/ LANGUAGE_CODE = 'en-us' TIME_ZONE = 'UTC' USE_I18N = True USE_L10N = True USE_TZ = True # Static files (CSS, JavaScript, Images) # https://docs.djangoproject.com/en/2.0/howto/static-files/ STATIC_URL = '/static/'
true
true
f70a859d84435c0a6414934e105c3751a53b1cad
161
py
Python
uclasm/matching/filters/__init__.py
cfld/uclasm
dbdbe99fa8bd6e85a7e90ac2e666c1e667c62d57
[ "MIT" ]
null
null
null
uclasm/matching/filters/__init__.py
cfld/uclasm
dbdbe99fa8bd6e85a7e90ac2e666c1e667c62d57
[ "MIT" ]
null
null
null
uclasm/matching/filters/__init__.py
cfld/uclasm
dbdbe99fa8bd6e85a7e90ac2e666c1e667c62d57
[ "MIT" ]
null
null
null
"""Provide functions for filtering.""" from .stats_filter import stats_filter from .topology_filter import topology_filter from .run_filters import run_filters
26.833333
44
0.832298
from .stats_filter import stats_filter from .topology_filter import topology_filter from .run_filters import run_filters
true
true
f70a8613e1d5d47e63f3f531a3bb99f989be6e47
11,728
py
Python
libcxx/utils/libcxx/test/features.py
jinge90/llvm
1f3f9b9b1181feb559e85970155678c18a436711
[ "Apache-2.0" ]
null
null
null
libcxx/utils/libcxx/test/features.py
jinge90/llvm
1f3f9b9b1181feb559e85970155678c18a436711
[ "Apache-2.0" ]
null
null
null
libcxx/utils/libcxx/test/features.py
jinge90/llvm
1f3f9b9b1181feb559e85970155678c18a436711
[ "Apache-2.0" ]
null
null
null
#===----------------------------------------------------------------------===## # # Part of the LLVM Project, under the Apache License v2.0 with LLVM Exceptions. # See https://llvm.org/LICENSE.txt for license information. # SPDX-License-Identifier: Apache-2.0 WITH LLVM-exception # #===----------------------------------------------------------------------===## from libcxx.test.dsl import * import re import shutil import sys import subprocess _isClang = lambda cfg: '__clang__' in compilerMacros(cfg) and '__apple_build_version__' not in compilerMacros(cfg) _isAppleClang = lambda cfg: '__apple_build_version__' in compilerMacros(cfg) _isGCC = lambda cfg: '__GNUC__' in compilerMacros(cfg) and '__clang__' not in compilerMacros(cfg) _isMSVC = lambda cfg: '_MSC_VER' in compilerMacros(cfg) _msvcVersion = lambda cfg: (int(compilerMacros(cfg)['_MSC_VER']) // 100, int(compilerMacros(cfg)['_MSC_VER']) % 100) DEFAULT_FEATURES = [ Feature(name='fcoroutines-ts', when=lambda cfg: hasCompileFlag(cfg, '-fcoroutines-ts') and featureTestMacros(cfg, flags='-fcoroutines-ts').get('__cpp_coroutines', 0) >= 201703, actions=[AddCompileFlag('-fcoroutines-ts')]), Feature(name='thread-safety', when=lambda cfg: hasCompileFlag(cfg, '-Werror=thread-safety'), actions=[AddCompileFlag('-Werror=thread-safety')]), Feature(name='diagnose-if-support', when=lambda cfg: hasCompileFlag(cfg, '-Wuser-defined-warnings'), actions=[AddCompileFlag('-Wuser-defined-warnings')]), Feature(name='has-fblocks', when=lambda cfg: hasCompileFlag(cfg, '-fblocks')), Feature(name='-fsized-deallocation', when=lambda cfg: hasCompileFlag(cfg, '-fsized-deallocation')), Feature(name='-faligned-allocation', when=lambda cfg: hasCompileFlag(cfg, '-faligned-allocation')), Feature(name='fdelayed-template-parsing', when=lambda cfg: hasCompileFlag(cfg, '-fdelayed-template-parsing')), Feature(name='libcpp-no-concepts', when=lambda cfg: featureTestMacros(cfg).get('__cpp_concepts', 0) < 201907), Feature(name='libcpp-no-coroutines', when=lambda cfg: featureTestMacros(cfg).get('__cpp_impl_coroutine', 0) < 201902), Feature(name='has-fobjc-arc', when=lambda cfg: hasCompileFlag(cfg, '-xobjective-c++ -fobjc-arc') and sys.platform.lower().strip() == 'darwin'), # TODO: this doesn't handle cross-compiling to Apple platforms. Feature(name='objective-c++', when=lambda cfg: hasCompileFlag(cfg, '-xobjective-c++ -fobjc-arc')), Feature(name='non-lockfree-atomics', when=lambda cfg: sourceBuilds(cfg, """ #include <atomic> struct Large { int storage[100]; }; std::atomic<Large> x; int main(int, char**) { (void)x.load(); return 0; } """)), # TODO: Remove this feature once compiler-rt includes __atomic_is_lockfree() # on all supported platforms. Feature(name='is-lockfree-runtime-function', when=lambda cfg: sourceBuilds(cfg, """ #include <atomic> struct Large { int storage[100]; }; std::atomic<Large> x; int main(int, char**) { return x.is_lock_free(); } """)), # Some tests rely on creating shared libraries which link in the C++ Standard Library. In some # cases, this doesn't work (e.g. if the library was built as a static archive and wasn't compiled # as position independent). This feature informs the test suite of whether it's possible to create # a shared library in a shell test by using the '-shared' compiler flag. # # Note: To implement this check properly, we need to make sure that we use something inside the # compiled library, not only in the headers. It should be safe to assume that all implementations # define `operator new` in the compiled library. Feature(name='cant-build-shared-library', when=lambda cfg: not sourceBuilds(cfg, """ void f() { new int(3); } """, ['-shared'])), Feature(name='apple-clang', when=_isAppleClang), Feature(name=lambda cfg: 'apple-clang-{__clang_major__}'.format(**compilerMacros(cfg)), when=_isAppleClang), Feature(name=lambda cfg: 'apple-clang-{__clang_major__}.{__clang_minor__}'.format(**compilerMacros(cfg)), when=_isAppleClang), Feature(name=lambda cfg: 'apple-clang-{__clang_major__}.{__clang_minor__}.{__clang_patchlevel__}'.format(**compilerMacros(cfg)), when=_isAppleClang), Feature(name='clang', when=_isClang, actions=[AddCompileFlag('-D_LIBCPP_HAS_NO_PRAGMA_SYSTEM_HEADER')]), Feature(name=lambda cfg: 'clang-{__clang_major__}'.format(**compilerMacros(cfg)), when=_isClang), Feature(name=lambda cfg: 'clang-{__clang_major__}.{__clang_minor__}'.format(**compilerMacros(cfg)), when=_isClang), Feature(name=lambda cfg: 'clang-{__clang_major__}.{__clang_minor__}.{__clang_patchlevel__}'.format(**compilerMacros(cfg)), when=_isClang), Feature(name='gcc', when=_isGCC), Feature(name=lambda cfg: 'gcc-{__GNUC__}'.format(**compilerMacros(cfg)), when=_isGCC), Feature(name=lambda cfg: 'gcc-{__GNUC__}.{__GNUC_MINOR__}'.format(**compilerMacros(cfg)), when=_isGCC), Feature(name=lambda cfg: 'gcc-{__GNUC__}.{__GNUC_MINOR__}.{__GNUC_PATCHLEVEL__}'.format(**compilerMacros(cfg)), when=_isGCC), Feature(name='msvc', when=_isMSVC), Feature(name=lambda cfg: 'msvc-{}'.format(*_msvcVersion(cfg)), when=_isMSVC), Feature(name=lambda cfg: 'msvc-{}.{}'.format(*_msvcVersion(cfg)), when=_isMSVC), ] # Deduce and add the test features that that are implied by the #defines in # the <__config_site> header. # # For each macro of the form `_LIBCPP_XXX_YYY_ZZZ` defined below that # is defined after including <__config_site>, add a Lit feature called # `libcpp-xxx-yyy-zzz`. When a macro is defined to a specific value # (e.g. `_LIBCPP_ABI_VERSION=2`), the feature is `libcpp-xxx-yyy-zzz=<value>`. macros = { '_LIBCPP_HAS_NO_MONOTONIC_CLOCK': 'libcpp-has-no-monotonic-clock', '_LIBCPP_HAS_NO_THREADS': 'libcpp-has-no-threads', '_LIBCPP_HAS_THREAD_API_EXTERNAL': 'libcpp-has-thread-api-external', '_LIBCPP_HAS_THREAD_API_PTHREAD': 'libcpp-has-thread-api-pthread', '_LIBCPP_NO_VCRUNTIME': 'libcpp-no-vcruntime', '_LIBCPP_ABI_VERSION': 'libcpp-abi-version', '_LIBCPP_ABI_UNSTABLE': 'libcpp-abi-unstable', '_LIBCPP_HAS_NO_FILESYSTEM_LIBRARY': 'libcpp-has-no-filesystem-library', '_LIBCPP_HAS_NO_RANDOM_DEVICE': 'libcpp-has-no-random-device', '_LIBCPP_HAS_NO_LOCALIZATION': 'libcpp-has-no-localization', '_LIBCPP_HAS_NO_WIDE_CHARACTERS': 'libcpp-has-no-wide-characters', '_LIBCPP_HAS_NO_INCOMPLETE_FORMAT': 'libcpp-has-no-incomplete-format', '_LIBCPP_HAS_NO_INCOMPLETE_RANGES': 'libcpp-has-no-incomplete-ranges', '_LIBCPP_HAS_NO_UNICODE': 'libcpp-has-no-unicode', } for macro, feature in macros.items(): DEFAULT_FEATURES += [ Feature(name=lambda cfg, m=macro, f=feature: f + ( '={}'.format(compilerMacros(cfg)[m]) if compilerMacros(cfg)[m] else '' ), when=lambda cfg, m=macro: m in compilerMacros(cfg), # FIXME: This is a hack that should be fixed using module maps. # If modules are enabled then we have to lift all of the definitions # in <__config_site> onto the command line. actions=lambda cfg, m=macro: [ AddCompileFlag('-Wno-macro-redefined -D{}'.format(m) + ( '={}'.format(compilerMacros(cfg)[m]) if compilerMacros(cfg)[m] else '' )) ] ) ] # Mapping from canonical locale names (used in the tests) to possible locale # names on various systems. Each locale is considered supported if any of the # alternative names is supported. locales = { 'en_US.UTF-8': ['en_US.UTF-8', 'en_US.utf8', 'English_United States.1252'], 'fr_FR.UTF-8': ['fr_FR.UTF-8', 'fr_FR.utf8', 'French_France.1252'], 'ru_RU.UTF-8': ['ru_RU.UTF-8', 'ru_RU.utf8', 'Russian_Russia.1251'], 'zh_CN.UTF-8': ['zh_CN.UTF-8', 'zh_CN.utf8', 'Chinese_China.936'], 'fr_CA.ISO8859-1': ['fr_CA.ISO8859-1', 'French_Canada.1252'], 'cs_CZ.ISO8859-2': ['cs_CZ.ISO8859-2', 'Czech_Czech Republic.1250'] } for locale, alts in locales.items(): # Note: Using alts directly in the lambda body here will bind it to the value at the # end of the loop. Assigning it to a default argument works around this issue. DEFAULT_FEATURES.append(Feature(name='locale.{}'.format(locale), when=lambda cfg, alts=alts: hasAnyLocale(cfg, alts))) # Add features representing the platform name: darwin, linux, windows, etc... DEFAULT_FEATURES += [ Feature(name='darwin', when=lambda cfg: '__APPLE__' in compilerMacros(cfg)), Feature(name='windows', when=lambda cfg: '_WIN32' in compilerMacros(cfg)), Feature(name='windows-dll', when=lambda cfg: '_WIN32' in compilerMacros(cfg) and not '_LIBCPP_DISABLE_VISIBILITY_ANNOTATIONS' in compilerMacros(cfg)), Feature(name='linux', when=lambda cfg: '__linux__' in compilerMacros(cfg)), Feature(name='netbsd', when=lambda cfg: '__NetBSD__' in compilerMacros(cfg)), Feature(name='freebsd', when=lambda cfg: '__FreeBSD__' in compilerMacros(cfg)) ] # Add features representing the build host platform name. # The build host could differ from the target platform for cross-compilation. DEFAULT_FEATURES += [ Feature(name='buildhost={}'.format(sys.platform.lower().strip())), # sys.platform can be represented by "sub-system" on Windows host, such as 'win32', 'cygwin', 'mingw' & etc. # Here is a consolidated feature for the build host plaform name on Windows. Feature(name='buildhost=windows', when=lambda cfg: platform.system().lower().startswith('windows')) ] # Detect whether GDB is on the system, has Python scripting and supports # adding breakpoint commands. If so add a substitution to access it. def check_gdb(cfg): gdb_path = shutil.which('gdb') if gdb_path is None: return False # Check that we can set breakpoint commands, which was added in 8.3. # Using the quit command here means that gdb itself exits, not just # the "python <...>" command. test_src = """\ try: gdb.Breakpoint(\"main\").commands=\"foo\" except AttributeError: gdb.execute(\"quit 1\") gdb.execute(\"quit\")""" try: stdout = subprocess.check_output( [gdb_path, "-ex", "python " + test_src, "--batch"], stderr=subprocess.DEVNULL, universal_newlines=True) except subprocess.CalledProcessError: # We can't set breakpoint commands return False # Check we actually ran the Python return not "Python scripting is not supported" in stdout DEFAULT_FEATURES += [ Feature(name='host-has-gdb-with-python', when=check_gdb, actions=[AddSubstitution('%{gdb}', lambda cfg: shutil.which('gdb'))] ) ]
56.114833
171
0.632418
rom libcxx.test.dsl import * import re import shutil import sys import subprocess _isClang = lambda cfg: '__clang__' in compilerMacros(cfg) and '__apple_build_version__' not in compilerMacros(cfg) _isAppleClang = lambda cfg: '__apple_build_version__' in compilerMacros(cfg) _isGCC = lambda cfg: '__GNUC__' in compilerMacros(cfg) and '__clang__' not in compilerMacros(cfg) _isMSVC = lambda cfg: '_MSC_VER' in compilerMacros(cfg) _msvcVersion = lambda cfg: (int(compilerMacros(cfg)['_MSC_VER']) // 100, int(compilerMacros(cfg)['_MSC_VER']) % 100) DEFAULT_FEATURES = [ Feature(name='fcoroutines-ts', when=lambda cfg: hasCompileFlag(cfg, '-fcoroutines-ts') and featureTestMacros(cfg, flags='-fcoroutines-ts').get('__cpp_coroutines', 0) >= 201703, actions=[AddCompileFlag('-fcoroutines-ts')]), Feature(name='thread-safety', when=lambda cfg: hasCompileFlag(cfg, '-Werror=thread-safety'), actions=[AddCompileFlag('-Werror=thread-safety')]), Feature(name='diagnose-if-support', when=lambda cfg: hasCompileFlag(cfg, '-Wuser-defined-warnings'), actions=[AddCompileFlag('-Wuser-defined-warnings')]), Feature(name='has-fblocks', when=lambda cfg: hasCompileFlag(cfg, '-fblocks')), Feature(name='-fsized-deallocation', when=lambda cfg: hasCompileFlag(cfg, '-fsized-deallocation')), Feature(name='-faligned-allocation', when=lambda cfg: hasCompileFlag(cfg, '-faligned-allocation')), Feature(name='fdelayed-template-parsing', when=lambda cfg: hasCompileFlag(cfg, '-fdelayed-template-parsing')), Feature(name='libcpp-no-concepts', when=lambda cfg: featureTestMacros(cfg).get('__cpp_concepts', 0) < 201907), Feature(name='libcpp-no-coroutines', when=lambda cfg: featureTestMacros(cfg).get('__cpp_impl_coroutine', 0) < 201902), Feature(name='has-fobjc-arc', when=lambda cfg: hasCompileFlag(cfg, '-xobjective-c++ -fobjc-arc') and sys.platform.lower().strip() == 'darwin'), Feature(name='objective-c++', when=lambda cfg: hasCompileFlag(cfg, '-xobjective-c++ -fobjc-arc')), Feature(name='non-lockfree-atomics', when=lambda cfg: sourceBuilds(cfg, """ #include <atomic> struct Large { int storage[100]; }; std::atomic<Large> x; int main(int, char**) { (void)x.load(); return 0; } """)), # TODO: Remove this feature once compiler-rt includes __atomic_is_lockfree() # on all supported platforms. Feature(name='is-lockfree-runtime-function', when=lambda cfg: sourceBuilds(cfg, """ #include <atomic> struct Large { int storage[100]; }; std::atomic<Large> x; int main(int, char**) { return x.is_lock_free(); } """)), # Some tests rely on creating shared libraries which link in the C++ Standard Library. In some # cases, this doesn't work (e.g. if the library was built as a static archive and wasn't compiled # as position independent). This feature informs the test suite of whether it's possible to create Feature(name='cant-build-shared-library', when=lambda cfg: not sourceBuilds(cfg, """ void f() { new int(3); } """, ['-shared'])), Feature(name='apple-clang', when=_isAppleClang), Feature(name=lambda cfg: 'apple-clang-{__clang_major__}'.format(**compilerMacros(cfg)), when=_isAppleClang), Feature(name=lambda cfg: 'apple-clang-{__clang_major__}.{__clang_minor__}'.format(**compilerMacros(cfg)), when=_isAppleClang), Feature(name=lambda cfg: 'apple-clang-{__clang_major__}.{__clang_minor__}.{__clang_patchlevel__}'.format(**compilerMacros(cfg)), when=_isAppleClang), Feature(name='clang', when=_isClang, actions=[AddCompileFlag('-D_LIBCPP_HAS_NO_PRAGMA_SYSTEM_HEADER')]), Feature(name=lambda cfg: 'clang-{__clang_major__}'.format(**compilerMacros(cfg)), when=_isClang), Feature(name=lambda cfg: 'clang-{__clang_major__}.{__clang_minor__}'.format(**compilerMacros(cfg)), when=_isClang), Feature(name=lambda cfg: 'clang-{__clang_major__}.{__clang_minor__}.{__clang_patchlevel__}'.format(**compilerMacros(cfg)), when=_isClang), Feature(name='gcc', when=_isGCC), Feature(name=lambda cfg: 'gcc-{__GNUC__}'.format(**compilerMacros(cfg)), when=_isGCC), Feature(name=lambda cfg: 'gcc-{__GNUC__}.{__GNUC_MINOR__}'.format(**compilerMacros(cfg)), when=_isGCC), Feature(name=lambda cfg: 'gcc-{__GNUC__}.{__GNUC_MINOR__}.{__GNUC_PATCHLEVEL__}'.format(**compilerMacros(cfg)), when=_isGCC), Feature(name='msvc', when=_isMSVC), Feature(name=lambda cfg: 'msvc-{}'.format(*_msvcVersion(cfg)), when=_isMSVC), Feature(name=lambda cfg: 'msvc-{}.{}'.format(*_msvcVersion(cfg)), when=_isMSVC), ] os = { '_LIBCPP_HAS_NO_MONOTONIC_CLOCK': 'libcpp-has-no-monotonic-clock', '_LIBCPP_HAS_NO_THREADS': 'libcpp-has-no-threads', '_LIBCPP_HAS_THREAD_API_EXTERNAL': 'libcpp-has-thread-api-external', '_LIBCPP_HAS_THREAD_API_PTHREAD': 'libcpp-has-thread-api-pthread', '_LIBCPP_NO_VCRUNTIME': 'libcpp-no-vcruntime', '_LIBCPP_ABI_VERSION': 'libcpp-abi-version', '_LIBCPP_ABI_UNSTABLE': 'libcpp-abi-unstable', '_LIBCPP_HAS_NO_FILESYSTEM_LIBRARY': 'libcpp-has-no-filesystem-library', '_LIBCPP_HAS_NO_RANDOM_DEVICE': 'libcpp-has-no-random-device', '_LIBCPP_HAS_NO_LOCALIZATION': 'libcpp-has-no-localization', '_LIBCPP_HAS_NO_WIDE_CHARACTERS': 'libcpp-has-no-wide-characters', '_LIBCPP_HAS_NO_INCOMPLETE_FORMAT': 'libcpp-has-no-incomplete-format', '_LIBCPP_HAS_NO_INCOMPLETE_RANGES': 'libcpp-has-no-incomplete-ranges', '_LIBCPP_HAS_NO_UNICODE': 'libcpp-has-no-unicode', } for macro, feature in macros.items(): DEFAULT_FEATURES += [ Feature(name=lambda cfg, m=macro, f=feature: f + ( '={}'.format(compilerMacros(cfg)[m]) if compilerMacros(cfg)[m] else '' ), when=lambda cfg, m=macro: m in compilerMacros(cfg), actions=lambda cfg, m=macro: [ AddCompileFlag('-Wno-macro-redefined -D{}'.format(m) + ( '={}'.format(compilerMacros(cfg)[m]) if compilerMacros(cfg)[m] else '' )) ] ) ] locales = { 'en_US.UTF-8': ['en_US.UTF-8', 'en_US.utf8', 'English_United States.1252'], 'fr_FR.UTF-8': ['fr_FR.UTF-8', 'fr_FR.utf8', 'French_France.1252'], 'ru_RU.UTF-8': ['ru_RU.UTF-8', 'ru_RU.utf8', 'Russian_Russia.1251'], 'zh_CN.UTF-8': ['zh_CN.UTF-8', 'zh_CN.utf8', 'Chinese_China.936'], 'fr_CA.ISO8859-1': ['fr_CA.ISO8859-1', 'French_Canada.1252'], 'cs_CZ.ISO8859-2': ['cs_CZ.ISO8859-2', 'Czech_Czech Republic.1250'] } for locale, alts in locales.items(): DEFAULT_FEATURES.append(Feature(name='locale.{}'.format(locale), when=lambda cfg, alts=alts: hasAnyLocale(cfg, alts))) DEFAULT_FEATURES += [ Feature(name='darwin', when=lambda cfg: '__APPLE__' in compilerMacros(cfg)), Feature(name='windows', when=lambda cfg: '_WIN32' in compilerMacros(cfg)), Feature(name='windows-dll', when=lambda cfg: '_WIN32' in compilerMacros(cfg) and not '_LIBCPP_DISABLE_VISIBILITY_ANNOTATIONS' in compilerMacros(cfg)), Feature(name='linux', when=lambda cfg: '__linux__' in compilerMacros(cfg)), Feature(name='netbsd', when=lambda cfg: '__NetBSD__' in compilerMacros(cfg)), Feature(name='freebsd', when=lambda cfg: '__FreeBSD__' in compilerMacros(cfg)) ] DEFAULT_FEATURES += [ Feature(name='buildhost={}'.format(sys.platform.lower().strip())), Feature(name='buildhost=windows', when=lambda cfg: platform.system().lower().startswith('windows')) ] def check_gdb(cfg): gdb_path = shutil.which('gdb') if gdb_path is None: return False test_src = """\ try: gdb.Breakpoint(\"main\").commands=\"foo\" except AttributeError: gdb.execute(\"quit 1\") gdb.execute(\"quit\")""" try: stdout = subprocess.check_output( [gdb_path, "-ex", "python " + test_src, "--batch"], stderr=subprocess.DEVNULL, universal_newlines=True) except subprocess.CalledProcessError: return False # Check we actually ran the Python return not "Python scripting is not supported" in stdout DEFAULT_FEATURES += [ Feature(name='host-has-gdb-with-python', when=check_gdb, actions=[AddSubstitution('%{gdb}', lambda cfg: shutil.which('gdb'))] ) ]
true
true
f70a86e1f718625d42509fc16e98474c738aa896
4,104
py
Python
lib/composite/LiPolymerDataScaler.py
KanHatakeyama/annealing_project
eac2dfe65c480450a5d12b09db2c1c9f83d03389
[ "MIT" ]
null
null
null
lib/composite/LiPolymerDataScaler.py
KanHatakeyama/annealing_project
eac2dfe65c480450a5d12b09db2c1c9f83d03389
[ "MIT" ]
null
null
null
lib/composite/LiPolymerDataScaler.py
KanHatakeyama/annealing_project
eac2dfe65c480450a5d12b09db2c1c9f83d03389
[ "MIT" ]
null
null
null
import pandas as pd import numpy as np from sklearn.preprocessing import StandardScaler from DataUtility import get_column_names class LiPolymerDataScaler: """ a special class to scale the lithium polymer database """ def __init__(self): self.scaling_dict = {} self.main_val_params = ["SMILES_wt", "wt_ratio", "inorg_contain_ratio"] self.main_txt_params = ["structureList", "inorg_name"] self.main_params = self.main_val_params+self.main_txt_params self.target_param = "Conductivity" def mutual_process(self, df): """ convert values (to log, etc) """ df["Conductivity"] = np.log10(df["Conductivity"].astype('float')) df["Temperature"] = np.log10(df["Temperature"].astype('float')+273) # fill Nan by zero for c in self.main_params: target_columns = get_column_names(df, c) df[target_columns] = df[target_columns].fillna(0) # convert molecular weight self.mw_column_list = get_column_names(df, "MWList") for c in self.mw_column_list: df[c] = np.log10(df[c].astype('float')) return df def fit_transform(self, original_df): """ scaling data, etc Parameters ---------------- original_df: dataframe dataframe to be scaled Returns ---------------- df: dataframe scaled dataframe """ df = original_df.copy() df = self.mutual_process(df) # fill lacking Molecular weight with average value self.average_mw = sum(df[self.mw_column_list].sum()) / \ sum(df[self.mw_column_list].count()) for c in self.mw_column_list: df[c] = df[c].fillna(self.average_mw) # scaling for v in self.main_val_params + ["Conductivity", "Temperature"]+self.mw_column_list: for c in get_column_names(df, v): sc = StandardScaler() df[c] = sc.fit_transform( df[c].astype('float').values.reshape(-1, 1)) self.scaling_dict[c] = sc # onehot encoding for v in self.main_txt_params: df = pd.get_dummies(df, columns=get_column_names(df, v)) self.use_columns = [] for c in ["Conductivity", "Temperature"]+self.main_params + self.mw_column_list+["fp_list"]: self.use_columns.extend(get_column_names(df, c)) """ ********************************************************** delete some columns for easiness of machine learning following parameters can be useful for machine learning (10.1021/jacs.9b11442), but ignored in this project. """ for remove_targets in ["MWList", "wt_ratio", "inorg", "structure", "Temperature"]: del_columns = get_column_names(df, remove_targets) for i in del_columns: self.use_columns.remove(i) self.tr_df = df return df def transform(self, original_df): """ scaling data, etc Parameters ---------------- original_df: dataframe dataframe to be scaled Returns ---------------- df: dataframe scaled dataframe """ df = original_df.copy() df = self.mutual_process(df) for c in self.mw_column_list: df[c] = df[c].fillna(self.average_mw) # scaling for v in self.main_val_params + ["Conductivity", "Temperature"]+self.mw_column_list: for c in get_column_names(df, v): df[c] = self.scaling_dict[c].transform( df[c].astype('float').values.reshape(-1, 1)) # onehot encoding for v in self.main_txt_params: df = pd.get_dummies(df, columns=get_column_names(df, v)) # for lacking columns, add the most frequent vals lacking_columns = set(self.use_columns)-set(df.columns) for i in lacking_columns: df[i] = self.tr_df[i].mode() return df
31.813953
116
0.569444
import pandas as pd import numpy as np from sklearn.preprocessing import StandardScaler from DataUtility import get_column_names class LiPolymerDataScaler: def __init__(self): self.scaling_dict = {} self.main_val_params = ["SMILES_wt", "wt_ratio", "inorg_contain_ratio"] self.main_txt_params = ["structureList", "inorg_name"] self.main_params = self.main_val_params+self.main_txt_params self.target_param = "Conductivity" def mutual_process(self, df): df["Conductivity"] = np.log10(df["Conductivity"].astype('float')) df["Temperature"] = np.log10(df["Temperature"].astype('float')+273) for c in self.main_params: target_columns = get_column_names(df, c) df[target_columns] = df[target_columns].fillna(0) self.mw_column_list = get_column_names(df, "MWList") for c in self.mw_column_list: df[c] = np.log10(df[c].astype('float')) return df def fit_transform(self, original_df): df = original_df.copy() df = self.mutual_process(df) self.average_mw = sum(df[self.mw_column_list].sum()) / \ sum(df[self.mw_column_list].count()) for c in self.mw_column_list: df[c] = df[c].fillna(self.average_mw) for v in self.main_val_params + ["Conductivity", "Temperature"]+self.mw_column_list: for c in get_column_names(df, v): sc = StandardScaler() df[c] = sc.fit_transform( df[c].astype('float').values.reshape(-1, 1)) self.scaling_dict[c] = sc for v in self.main_txt_params: df = pd.get_dummies(df, columns=get_column_names(df, v)) self.use_columns = [] for c in ["Conductivity", "Temperature"]+self.main_params + self.mw_column_list+["fp_list"]: self.use_columns.extend(get_column_names(df, c)) for remove_targets in ["MWList", "wt_ratio", "inorg", "structure", "Temperature"]: del_columns = get_column_names(df, remove_targets) for i in del_columns: self.use_columns.remove(i) self.tr_df = df return df def transform(self, original_df): df = original_df.copy() df = self.mutual_process(df) for c in self.mw_column_list: df[c] = df[c].fillna(self.average_mw) for v in self.main_val_params + ["Conductivity", "Temperature"]+self.mw_column_list: for c in get_column_names(df, v): df[c] = self.scaling_dict[c].transform( df[c].astype('float').values.reshape(-1, 1)) for v in self.main_txt_params: df = pd.get_dummies(df, columns=get_column_names(df, v)) lacking_columns = set(self.use_columns)-set(df.columns) for i in lacking_columns: df[i] = self.tr_df[i].mode() return df
true
true
f70a87ce62cba398e7370660217593d337998146
140
py
Python
python/data_sutram/scraper/test.py
SayanGhoshBDA/code-backup
8b6135facc0e598e9686b2e8eb2d69dd68198b80
[ "MIT" ]
16
2018-11-26T08:39:42.000Z
2019-05-08T10:09:52.000Z
python/data_sutram/scraper/test.py
SayanGhoshBDA/code-backup
8b6135facc0e598e9686b2e8eb2d69dd68198b80
[ "MIT" ]
8
2020-05-04T06:29:26.000Z
2022-02-12T05:33:16.000Z
python/data_sutram/scraper/test.py
SayanGhoshBDA/code-backup
8b6135facc0e598e9686b2e8eb2d69dd68198b80
[ "MIT" ]
5
2020-02-11T16:02:21.000Z
2021-02-05T07:48:30.000Z
def test_func(i): print(i) if i>10: return else: test_func(i+1) if __name__ == "__main__": test_func(2)
15.555556
26
0.521429
def test_func(i): print(i) if i>10: return else: test_func(i+1) if __name__ == "__main__": test_func(2)
true
true
f70a87f89311f5320018937ff535733ef8e8f539
10,355
py
Python
curtsies/formatstringarray.py
toolforger/curtsies
7f86c07d95aa22b004db9acf8f787e1abf49b581
[ "MIT" ]
3
2015-07-13T12:53:40.000Z
2018-01-21T20:38:46.000Z
curtsies/formatstringarray.py
toolforger/curtsies
7f86c07d95aa22b004db9acf8f787e1abf49b581
[ "MIT" ]
null
null
null
curtsies/formatstringarray.py
toolforger/curtsies
7f86c07d95aa22b004db9acf8f787e1abf49b581
[ "MIT" ]
1
2018-01-21T20:38:03.000Z
2018-01-21T20:38:03.000Z
""" Format String 2D array 2d array for compositing term-formated strings -autoexpanding vertically -interesting get_item behavior (renders fmtstrs) -caching behavior eventually >>> a = FSArray(10, 14) >>> a.shape (10, 14) >>> a[1] = 'i' >>> a[3:4, :] = ['i' * 14] >>> a[16:17, :] = ['j' * 14] >>> a.shape, a[16, 0] ((17, 14), ['j']) >>> a[200, 1] = ['i'] >>> a[200, 1] ['i'] """ import sys import logging from .formatstring import fmtstr from .formatstring import normalize_slice from .formatstring import FmtStr from typing import ( Any, Union, Text, List, Sequence, overload, Tuple, cast, no_type_check, ) actualize = str logger = logging.getLogger(__name__) # TODO check that strings used in arrays don't have tabs or spaces in them! def slicesize(s): # type: (slice) -> int return int((s.stop - s.start) / (s.step if s.step else 1)) def fsarray(strings, *args, **kwargs): # type: (List[Union[FmtStr, Text]], *Any, **Any) -> FSArray """fsarray(list_of_FmtStrs_or_strings, width=None) -> FSArray Returns a new FSArray of width of the maximum size of the provided strings, or width provided, and height of the number of strings provided. If a width is provided, raises a ValueError if any of the strings are of length greater than this width""" strings = list(strings) if "width" in kwargs: width = kwargs["width"] del kwargs["width"] if strings and any(len(s) > width for s in strings): raise ValueError(f"Those strings won't fit for width {width}") else: width = max(len(s) for s in strings) if strings else 0 fstrings = [ s if isinstance(s, FmtStr) else fmtstr(s, *args, **kwargs) for s in strings ] arr = FSArray(len(fstrings), width, *args, **kwargs) rows = [ fs.setslice_with_length(0, len(s), s, width) for fs, s in zip(arr.rows, fstrings) ] arr.rows = rows return arr class FSArray(Sequence): """A 2D array of colored text. Internally represented by a list of FmtStrs of identical size.""" # TODO add constructor that takes fmtstrs instead of dims def __init__(self, num_rows, num_columns, *args, **kwargs): # type: (int, int, *Any, **Any) -> None self.saved_args, self.saved_kwargs = args, kwargs self.rows = [ fmtstr("", *args, **kwargs) for _ in range(num_rows) ] # type: List[FmtStr] self.num_columns = num_columns @overload def __getitem__(self, slicetuple): # type: (int) -> FmtStr pass @overload def __getitem__(self, slicetuple): # type: (slice) -> List[FmtStr] pass @overload def __getitem__(self, slicetuple): # type: (Tuple[Union[slice, int], Union[slice, int]]) -> List[FmtStr] pass def __getitem__(self, slicetuple): # type: (Union[int, slice, Tuple[Union[int, slice], Union[int, slice]]]) -> Union[FmtStr, List[FmtStr]] if isinstance(slicetuple, int): if slicetuple < 0: slicetuple = len(self.rows) - slicetuple if slicetuple < 0 or slicetuple >= len(self.rows): raise IndexError("out of bounds") return self.rows[slicetuple] if isinstance(slicetuple, slice): rowslice = normalize_slice(len(self.rows), slicetuple) return self.rows[rowslice] ( row_slice_or_int, col_slice_or_int, ) = slicetuple # type: Tuple[Union[int, slice], Union[int, slice]] rowslice = normalize_slice(len(self.rows), row_slice_or_int) colslice = normalize_slice(self.num_columns, col_slice_or_int) # TODO clean up slices return [fs[colslice] for fs in self.rows[rowslice]] def __len__(self): # type: () -> int return len(self.rows) @property def shape(self): # type: () -> Tuple[int, int] """Tuple of (len(rows, len(num_columns)) numpy-style shape""" return len(self.rows), self.num_columns @property def height(self): # type: () -> int """The number of rows""" return len(self.rows) @property def width(self): # type: () -> int """The number of columns""" return self.num_columns # TODO rework this next major version bump @no_type_check def __setitem__(self, slicetuple, value): """Place a FSArray in a FSArray""" logger.debug("slice: %r", slicetuple) if isinstance(slicetuple, slice): rowslice, colslice = slicetuple, slice(None) if isinstance(value, (bytes, str)): raise ValueError( "if slice is 2D, value must be 2D as in of list type []" ) elif isinstance(slicetuple, int): normalize_slice(self.height, slicetuple) self.rows[slicetuple] = value return else: rowslice, colslice = slicetuple # temp shim to allow numpy arrays as values if value.__class__.__name__ == "ndarray": value = [fmtstr("".join(line)) for line in value] rowslice = normalize_slice(sys.maxsize, rowslice) additional_rows = max(0, rowslice.stop - len(self.rows)) self.rows.extend( [ fmtstr("", *self.saved_args, **self.saved_kwargs) for _ in range(additional_rows) ] ) logger.debug("num columns: %r", self.num_columns) logger.debug("colslice: %r", colslice) colslice = normalize_slice(self.num_columns, colslice) if slicesize(colslice) == 0 or slicesize(rowslice) == 0: return if slicesize(colslice) > 1 and isinstance(value, str): raise ValueError( """You cannot replace a multi column slice with a string please use a list [] with strings for the contents of each row""" ) if slicesize(rowslice) != len(value): area = slicesize(rowslice) * slicesize(colslice) val_len = sum(len(i) for i in value) grid_value = [fmtstr(" ", bg="cyan") * slicesize(colslice)] * slicesize( rowslice ) grid_fsarray = ( self.rows[: rowslice.start] + [ fs.setslice_with_length( colslice.start, colslice.stop, v, self.num_columns ) for fs, v in zip(self.rows[rowslice], grid_value) ] + self.rows[rowslice.stop :] ) msg = "You are trying to fit this value {} into the region {}: {}".format( fmtstr("".join(value), bg="cyan"), fmtstr("").join(grid_value), "\n ".join(grid_fsarray[x] for x in range(len(self.rows))), ) raise ValueError( """Error you are trying to replace a region of {} rows by {} columns for and area of {} with a value of len {}. The value used to replace the region must equal the area of the region replace. {}""".format( rowslice.stop - rowslice.start, colslice.stop - colslice.start, area, val_len, msg, ) ) self.rows = ( self.rows[: rowslice.start] + [ fs.setslice_with_length( colslice.start, colslice.stop, v, self.num_columns ) for fs, v in zip(self.rows[rowslice], value) ] + self.rows[rowslice.stop :] ) def dumb_display(self): # type: () -> None """Prints each row followed by a newline without regard for the terminal window size""" for line in self.rows: print(line) @classmethod def diff(cls, a, b, ignore_formatting=False): # type: (FSArray, FSArray, bool) -> Text """Returns two FSArrays with differences underlined""" def underline(x): # type: (Text) -> Text return f"\x1b[4m{x}\x1b[0m" def blink(x): # type: (Text) -> Text return f"\x1b[5m{x}\x1b[0m" a_rows = [] b_rows = [] max_width = max([len(row) for row in a] + [len(row) for row in b]) a_lengths = [] b_lengths = [] for a_row, b_row in zip(a, b): a_lengths.append(len(a_row)) b_lengths.append(len(b_row)) extra_a = "`" * (max_width - len(a_row)) extra_b = "`" * (max_width - len(b_row)) a_line = "" b_line = "" for a_char, b_char in zip(a_row + extra_a, b_row + extra_b): if ignore_formatting: a_char_for_eval = a_char.s if isinstance(a_char, FmtStr) else a_char b_char_for_eval = b_char.s if isinstance(b_char, FmtStr) else b_char else: a_char_for_eval = a_char b_char_for_eval = b_char if a_char_for_eval == b_char_for_eval: a_line += actualize(a_char) b_line += actualize(b_char) else: a_line += underline(blink(actualize(a_char))) b_line += underline(blink(actualize(b_char))) a_rows.append(a_line) b_rows.append(b_line) hdiff = "\n".join( a_line + " %3d | %3d " % (a_len, b_len) + b_line for a_line, b_line, a_len, b_len in zip( a_rows, b_rows, a_lengths, b_lengths ) ) return hdiff def simple_format(x): # type: (Union[FSArray, List[FmtStr]]) -> Text return "\n".join(actualize(l) for l in x) if __name__ == "__main__": a = FSArray(3, 14, bg="blue") a[0:2, 5:11] = cast( Tuple[FmtStr, ...], (fmtstr("hey", "on_blue") + " " + fmtstr("yo", "on_red"), fmtstr("qwe qw")), ) a.dumb_display() a = fsarray(["hey", "there"], bg="cyan") a.dumb_display() print(FSArray.diff(a, fsarray(["hey", "there "]), ignore_formatting=True))
33.29582
111
0.547562
import sys import logging from .formatstring import fmtstr from .formatstring import normalize_slice from .formatstring import FmtStr from typing import ( Any, Union, Text, List, Sequence, overload, Tuple, cast, no_type_check, ) actualize = str logger = logging.getLogger(__name__) def slicesize(s): # type: (slice) -> int return int((s.stop - s.start) / (s.step if s.step else 1)) def fsarray(strings, *args, **kwargs): # type: (List[Union[FmtStr, Text]], *Any, **Any) -> FSArray strings = list(strings) if "width" in kwargs: width = kwargs["width"] del kwargs["width"] if strings and any(len(s) > width for s in strings): raise ValueError(f"Those strings won't fit for width {width}") else: width = max(len(s) for s in strings) if strings else 0 fstrings = [ s if isinstance(s, FmtStr) else fmtstr(s, *args, **kwargs) for s in strings ] arr = FSArray(len(fstrings), width, *args, **kwargs) rows = [ fs.setslice_with_length(0, len(s), s, width) for fs, s in zip(arr.rows, fstrings) ] arr.rows = rows return arr class FSArray(Sequence): def __init__(self, num_rows, num_columns, *args, **kwargs): self.saved_args, self.saved_kwargs = args, kwargs self.rows = [ fmtstr("", *args, **kwargs) for _ in range(num_rows) ] self.num_columns = num_columns @overload def __getitem__(self, slicetuple): pass @overload def __getitem__(self, slicetuple): pass @overload def __getitem__(self, slicetuple): pass def __getitem__(self, slicetuple): if isinstance(slicetuple, int): if slicetuple < 0: slicetuple = len(self.rows) - slicetuple if slicetuple < 0 or slicetuple >= len(self.rows): raise IndexError("out of bounds") return self.rows[slicetuple] if isinstance(slicetuple, slice): rowslice = normalize_slice(len(self.rows), slicetuple) return self.rows[rowslice] ( row_slice_or_int, col_slice_or_int, ) = slicetuple rowslice = normalize_slice(len(self.rows), row_slice_or_int) colslice = normalize_slice(self.num_columns, col_slice_or_int) return [fs[colslice] for fs in self.rows[rowslice]] def __len__(self): return len(self.rows) @property def shape(self): return len(self.rows), self.num_columns @property def height(self): return len(self.rows) @property def width(self): return self.num_columns @no_type_check def __setitem__(self, slicetuple, value): logger.debug("slice: %r", slicetuple) if isinstance(slicetuple, slice): rowslice, colslice = slicetuple, slice(None) if isinstance(value, (bytes, str)): raise ValueError( "if slice is 2D, value must be 2D as in of list type []" ) elif isinstance(slicetuple, int): normalize_slice(self.height, slicetuple) self.rows[slicetuple] = value return else: rowslice, colslice = slicetuple if value.__class__.__name__ == "ndarray": value = [fmtstr("".join(line)) for line in value] rowslice = normalize_slice(sys.maxsize, rowslice) additional_rows = max(0, rowslice.stop - len(self.rows)) self.rows.extend( [ fmtstr("", *self.saved_args, **self.saved_kwargs) for _ in range(additional_rows) ] ) logger.debug("num columns: %r", self.num_columns) logger.debug("colslice: %r", colslice) colslice = normalize_slice(self.num_columns, colslice) if slicesize(colslice) == 0 or slicesize(rowslice) == 0: return if slicesize(colslice) > 1 and isinstance(value, str): raise ValueError( """You cannot replace a multi column slice with a string please use a list [] with strings for the contents of each row""" ) if slicesize(rowslice) != len(value): area = slicesize(rowslice) * slicesize(colslice) val_len = sum(len(i) for i in value) grid_value = [fmtstr(" ", bg="cyan") * slicesize(colslice)] * slicesize( rowslice ) grid_fsarray = ( self.rows[: rowslice.start] + [ fs.setslice_with_length( colslice.start, colslice.stop, v, self.num_columns ) for fs, v in zip(self.rows[rowslice], grid_value) ] + self.rows[rowslice.stop :] ) msg = "You are trying to fit this value {} into the region {}: {}".format( fmtstr("".join(value), bg="cyan"), fmtstr("").join(grid_value), "\n ".join(grid_fsarray[x] for x in range(len(self.rows))), ) raise ValueError( """Error you are trying to replace a region of {} rows by {} columns for and area of {} with a value of len {}. The value used to replace the region must equal the area of the region replace. {}""".format( rowslice.stop - rowslice.start, colslice.stop - colslice.start, area, val_len, msg, ) ) self.rows = ( self.rows[: rowslice.start] + [ fs.setslice_with_length( colslice.start, colslice.stop, v, self.num_columns ) for fs, v in zip(self.rows[rowslice], value) ] + self.rows[rowslice.stop :] ) def dumb_display(self): for line in self.rows: print(line) @classmethod def diff(cls, a, b, ignore_formatting=False): def underline(x): return f"\x1b[4m{x}\x1b[0m" def blink(x): return f"\x1b[5m{x}\x1b[0m" a_rows = [] b_rows = [] max_width = max([len(row) for row in a] + [len(row) for row in b]) a_lengths = [] b_lengths = [] for a_row, b_row in zip(a, b): a_lengths.append(len(a_row)) b_lengths.append(len(b_row)) extra_a = "`" * (max_width - len(a_row)) extra_b = "`" * (max_width - len(b_row)) a_line = "" b_line = "" for a_char, b_char in zip(a_row + extra_a, b_row + extra_b): if ignore_formatting: a_char_for_eval = a_char.s if isinstance(a_char, FmtStr) else a_char b_char_for_eval = b_char.s if isinstance(b_char, FmtStr) else b_char else: a_char_for_eval = a_char b_char_for_eval = b_char if a_char_for_eval == b_char_for_eval: a_line += actualize(a_char) b_line += actualize(b_char) else: a_line += underline(blink(actualize(a_char))) b_line += underline(blink(actualize(b_char))) a_rows.append(a_line) b_rows.append(b_line) hdiff = "\n".join( a_line + " %3d | %3d " % (a_len, b_len) + b_line for a_line, b_line, a_len, b_len in zip( a_rows, b_rows, a_lengths, b_lengths ) ) return hdiff def simple_format(x): return "\n".join(actualize(l) for l in x) if __name__ == "__main__": a = FSArray(3, 14, bg="blue") a[0:2, 5:11] = cast( Tuple[FmtStr, ...], (fmtstr("hey", "on_blue") + " " + fmtstr("yo", "on_red"), fmtstr("qwe qw")), ) a.dumb_display() a = fsarray(["hey", "there"], bg="cyan") a.dumb_display() print(FSArray.diff(a, fsarray(["hey", "there "]), ignore_formatting=True))
true
true
f70a8a2cc7770d9c4ef39696ddde8e9dab7893c8
670
py
Python
leetcode/[cutz]mergekarr.py
cutz-j/AlgorithmStudy
de0f81220e29bd5e109d174800f507b12a3bee36
[ "MIT" ]
3
2019-11-26T14:31:01.000Z
2020-01-10T18:19:46.000Z
leetcode/[cutz]mergekarr.py
cutz-j/AlgorithmStudy
de0f81220e29bd5e109d174800f507b12a3bee36
[ "MIT" ]
null
null
null
leetcode/[cutz]mergekarr.py
cutz-j/AlgorithmStudy
de0f81220e29bd5e109d174800f507b12a3bee36
[ "MIT" ]
null
null
null
import heapq # Definition for singly-linked list. # class ListNode: # def __init__(self, val=0, next=None): # self.val = val # self.next = next class Solution: def mergeKLists(self, lists: List[ListNode]) -> ListNode: heap = [] root = res = ListNode(None) for i in range(len(lists)): heapq.heappush(heap, (lists[i].val, i, lists[i])) print(heap) while heap: m = heapq.heappop(heap) idx = m[1] res.next = m[2] res = res.next if res.next: heapq.heappush(heap, (res.next.val, idx, res.next)) return root.next
25.769231
67
0.525373
import heapq class Solution: def mergeKLists(self, lists: List[ListNode]) -> ListNode: heap = [] root = res = ListNode(None) for i in range(len(lists)): heapq.heappush(heap, (lists[i].val, i, lists[i])) print(heap) while heap: m = heapq.heappop(heap) idx = m[1] res.next = m[2] res = res.next if res.next: heapq.heappush(heap, (res.next.val, idx, res.next)) return root.next
true
true
f70a8a8f20d027af22a12a78590c0391f8a9a744
6,361
py
Python
monai/metrics/surface_distance.py
danielschulz/MONAI
54ef6e9e700f0de3d50184c0148f953be871a58e
[ "Apache-2.0" ]
null
null
null
monai/metrics/surface_distance.py
danielschulz/MONAI
54ef6e9e700f0de3d50184c0148f953be871a58e
[ "Apache-2.0" ]
null
null
null
monai/metrics/surface_distance.py
danielschulz/MONAI
54ef6e9e700f0de3d50184c0148f953be871a58e
[ "Apache-2.0" ]
null
null
null
# Copyright 2020 - 2021 MONAI Consortium # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # http://www.apache.org/licenses/LICENSE-2.0 # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. import warnings from typing import Union import numpy as np import torch from monai.metrics.utils import * from monai.utils import MetricReduction class SurfaceDistanceMetric: """ Compute Surface Distance between two tensors. It can support both multi-classes and multi-labels tasks. It supports both symmetric and asymmetric surface distance calculation. Input `y_pred` (BNHW[D] where N is number of classes) is compared with ground truth `y` (BNHW[D]). `y_preds` is expected to have binarized predictions and `y` should be in one-hot format. You can use suitable transforms in ``monai.transforms.post`` first to achieve binarized values. Args: include_background: whether to skip distance computation on the first channel of the predicted output. Defaults to ``False``. symmetric: whether to calculate the symmetric average surface distance between `seg_pred` and `seg_gt`. Defaults to ``False``. distance_metric: : [``"euclidean"``, ``"chessboard"``, ``"taxicab"``] the metric used to compute surface distance. Defaults to ``"euclidean"``. reduction: {``"none"``, ``"mean"``, ``"sum"``, ``"mean_batch"``, ``"sum_batch"``, ``"mean_channel"``, ``"sum_channel"``} Define the mode to reduce computation result of 1 batch data. Defaults to ``"mean"``. """ def __init__( self, include_background: bool = False, symmetric: bool = False, distance_metric: str = "euclidean", reduction: Union[MetricReduction, str] = MetricReduction.MEAN, ) -> None: super().__init__() self.include_background = include_background self.distance_metric = distance_metric self.symmetric = symmetric self.reduction = reduction def __call__(self, y_pred: torch.Tensor, y: torch.Tensor): """ Args: y_pred: input data to compute, typical segmentation model output. It must be one-hot format and first dim is batch, example shape: [16, 3, 32, 32]. The values should be binarized. y: ground truth to compute the distance. It must be one-hot format and first dim is batch. The values should be binarized. Raises: ValueError: when `y` is not a binarized tensor. ValueError: when `y_pred` has less than three dimensions. """ if not torch.all(y_pred.byte() == y_pred): warnings.warn("y_pred is not a binarized tensor here!") if not torch.all(y.byte() == y): raise ValueError("y should be a binarized tensor.") dims = y_pred.ndimension() if dims < 3: raise ValueError("y_pred should have at least three dimensions.") # compute (BxC) for each channel for each batch f = compute_average_surface_distance( y_pred=y_pred, y=y, include_background=self.include_background, symmetric=self.symmetric, distance_metric=self.distance_metric, ) # do metric reduction f, not_nans = do_metric_reduction(f, self.reduction) return f, not_nans def compute_average_surface_distance( y_pred: Union[np.ndarray, torch.Tensor], y: Union[np.ndarray, torch.Tensor], include_background: bool = False, symmetric: bool = False, distance_metric: str = "euclidean", ): """ This function is used to compute the Average Surface Distance from `y_pred` to `y` under the default setting. In addition, if sets ``symmetric = True``, the average symmetric surface distance between these two inputs will be returned. Args: y_pred: input data to compute, typical segmentation model output. It must be one-hot format and first dim is batch, example shape: [16, 3, 32, 32]. The values should be binarized. y: ground truth to compute mean the distance. It must be one-hot format and first dim is batch. The values should be binarized. include_background: whether to skip distance computation on the first channel of the predicted output. Defaults to ``False``. symmetric: whether to calculate the symmetric average surface distance between `seg_pred` and `seg_gt`. Defaults to ``False``. distance_metric: : [``"euclidean"``, ``"chessboard"``, ``"taxicab"``] the metric used to compute surface distance. Defaults to ``"euclidean"``. """ if not include_background: y_pred, y = ignore_background( y_pred=y_pred, y=y, ) y = y.float() y_pred = y_pred.float() if y.shape != y_pred.shape: raise ValueError("y_pred and y should have same shapes.") batch_size, n_class = y_pred.shape[:2] asd = np.empty((batch_size, n_class)) for b, c in np.ndindex(batch_size, n_class): (edges_pred, edges_gt) = get_mask_edges(y_pred[b, c], y[b, c]) surface_distance = get_surface_distance(edges_pred, edges_gt, distance_metric=distance_metric) if surface_distance.shape == (0,): avg_surface_distance = np.nan else: avg_surface_distance = surface_distance.mean() if not symmetric: asd[b, c] = avg_surface_distance else: surface_distance_2 = get_surface_distance(edges_gt, edges_pred, distance_metric=distance_metric) if surface_distance_2.shape == (0,): avg_surface_distance_2 = np.nan else: avg_surface_distance_2 = surface_distance_2.mean() asd[b, c] = np.mean((avg_surface_distance, avg_surface_distance_2)) return torch.from_numpy(asd)
42.406667
108
0.652413
import warnings from typing import Union import numpy as np import torch from monai.metrics.utils import * from monai.utils import MetricReduction class SurfaceDistanceMetric: def __init__( self, include_background: bool = False, symmetric: bool = False, distance_metric: str = "euclidean", reduction: Union[MetricReduction, str] = MetricReduction.MEAN, ) -> None: super().__init__() self.include_background = include_background self.distance_metric = distance_metric self.symmetric = symmetric self.reduction = reduction def __call__(self, y_pred: torch.Tensor, y: torch.Tensor): if not torch.all(y_pred.byte() == y_pred): warnings.warn("y_pred is not a binarized tensor here!") if not torch.all(y.byte() == y): raise ValueError("y should be a binarized tensor.") dims = y_pred.ndimension() if dims < 3: raise ValueError("y_pred should have at least three dimensions.") f = compute_average_surface_distance( y_pred=y_pred, y=y, include_background=self.include_background, symmetric=self.symmetric, distance_metric=self.distance_metric, ) f, not_nans = do_metric_reduction(f, self.reduction) return f, not_nans def compute_average_surface_distance( y_pred: Union[np.ndarray, torch.Tensor], y: Union[np.ndarray, torch.Tensor], include_background: bool = False, symmetric: bool = False, distance_metric: str = "euclidean", ): if not include_background: y_pred, y = ignore_background( y_pred=y_pred, y=y, ) y = y.float() y_pred = y_pred.float() if y.shape != y_pred.shape: raise ValueError("y_pred and y should have same shapes.") batch_size, n_class = y_pred.shape[:2] asd = np.empty((batch_size, n_class)) for b, c in np.ndindex(batch_size, n_class): (edges_pred, edges_gt) = get_mask_edges(y_pred[b, c], y[b, c]) surface_distance = get_surface_distance(edges_pred, edges_gt, distance_metric=distance_metric) if surface_distance.shape == (0,): avg_surface_distance = np.nan else: avg_surface_distance = surface_distance.mean() if not symmetric: asd[b, c] = avg_surface_distance else: surface_distance_2 = get_surface_distance(edges_gt, edges_pred, distance_metric=distance_metric) if surface_distance_2.shape == (0,): avg_surface_distance_2 = np.nan else: avg_surface_distance_2 = surface_distance_2.mean() asd[b, c] = np.mean((avg_surface_distance, avg_surface_distance_2)) return torch.from_numpy(asd)
true
true
f70a8ae488be6f9e83f14e6becdc73cfc39e30b3
611
py
Python
src/spyne_smev/server/wsgi.py
barsgroup/m3-spyne-smev
356d190a0f341f3b91d626eba81875cde8ff12f2
[ "MIT" ]
7
2015-10-22T02:57:33.000Z
2021-08-08T16:46:48.000Z
src/spyne_smev/server/wsgi.py
barsgroup/m3-spyne-smev
356d190a0f341f3b91d626eba81875cde8ff12f2
[ "MIT" ]
2
2017-05-01T05:31:41.000Z
2020-03-18T16:26:43.000Z
src/spyne_smev/server/wsgi.py
barsgroup/m3-spyne-smev
356d190a0f341f3b91d626eba81875cde8ff12f2
[ "MIT" ]
8
2015-10-22T02:57:47.000Z
2021-11-08T08:28:32.000Z
# -*- coding: utf- """ wsgi.py :Created: 12 Jun 2014 :Author: tim """ from spyne.server.wsgi import WsgiApplication as _SpyneWsgiApplication from spyne_smev.server import _AllYourInterfaceDocuments class WsgiApplication(_SpyneWsgiApplication): def __init__(self, app, chunked=True, max_content_length=2 * 1024 * 1024, block_length=8 * 1024): super(WsgiApplication, self).__init__(app, chunked, max_content_length, block_length) self.doc = _AllYourInterfaceDocuments(app.interface)
26.565217
79
0.631751
from spyne.server.wsgi import WsgiApplication as _SpyneWsgiApplication from spyne_smev.server import _AllYourInterfaceDocuments class WsgiApplication(_SpyneWsgiApplication): def __init__(self, app, chunked=True, max_content_length=2 * 1024 * 1024, block_length=8 * 1024): super(WsgiApplication, self).__init__(app, chunked, max_content_length, block_length) self.doc = _AllYourInterfaceDocuments(app.interface)
true
true
f70a8c102b413f15a56d9719e7836be3413d7bfe
2,477
py
Python
Advent2020/23.py
SSteve/AdventOfCode
aed16209381ccd292fc02008f1f2da5d16ff1a05
[ "MIT" ]
null
null
null
Advent2020/23.py
SSteve/AdventOfCode
aed16209381ccd292fc02008f1f2da5d16ff1a05
[ "MIT" ]
null
null
null
Advent2020/23.py
SSteve/AdventOfCode
aed16209381ccd292fc02008f1f2da5d16ff1a05
[ "MIT" ]
null
null
null
class Node: def __init__(self, next: int): self.next = next self.up = False def MakeNodes(data: str): values = [int(ch) - 1 for ch in data] nodes = [] for value in range(len(values)): index = values.index(value) next = values[(index + 1) % len(values)] nodes.append(Node(next)) return nodes, values[0] def MakeNodes2(data: str): nodes, current = MakeNodes(data) next = nodes[current].next for _ in range(len(nodes) - 2): next = nodes[next].next nodes[next].next = len(nodes) for value in range(len(nodes), 1_000_000): nodes.append(Node(value + 1)) nodes[999_999].next = current return nodes, current def Turn(current: int, nodes): up = nodes[current].next firstUp = up for _ in range(3): nodes[up].up = True lastUp = up up = nodes[up].next destination = (current - 1) % len(nodes) while nodes[destination].up: destination = (destination - 1) % len(nodes) nodes[current].next = nodes[lastUp].next nodes[lastUp].next = nodes[destination].next nodes[destination].next = firstUp up = firstUp for _ in range(3): nodes[up].up = False up = nodes[up].next return nodes[current].next def PrintNodes(current: int, nodes): print(f"({current + 1})", end='') index = nodes[current].next for _ in range(min(len(nodes) - 1, 20)): print(f" {index + 1}", end='') index = nodes[index].next print() def Answer(nodes): answer = '' node = nodes[0].next for _ in range(len(nodes) - 1): answer += str(node + 1) node = nodes[node].next return answer def Answer2(nodes): cup1 = nodes[0].next cup2 = nodes[cup1].next return (cup1 + 1) * (cup2 + 1) TEST = "389125467" DATA = "487912365" testNodes, current = MakeNodes(TEST) for _ in range(100): current = Turn(current, testNodes) assert Answer(testNodes) == '67384529' nodes, current = MakeNodes(DATA) for _ in range(100): current = Turn(current, nodes) print(Answer(nodes)) assert Answer(nodes) == '89573246' testNodes, current = MakeNodes2(TEST) for _ in range(10_000_000): current = Turn(current, testNodes) assert Answer2(testNodes) == 149245887792 nodes, current = MakeNodes2(DATA) for _ in range(10_000_000): current = Turn(current, nodes) print(Answer2(nodes)) assert Answer2(nodes == 2029056128)
26.634409
52
0.608801
class Node: def __init__(self, next: int): self.next = next self.up = False def MakeNodes(data: str): values = [int(ch) - 1 for ch in data] nodes = [] for value in range(len(values)): index = values.index(value) next = values[(index + 1) % len(values)] nodes.append(Node(next)) return nodes, values[0] def MakeNodes2(data: str): nodes, current = MakeNodes(data) next = nodes[current].next for _ in range(len(nodes) - 2): next = nodes[next].next nodes[next].next = len(nodes) for value in range(len(nodes), 1_000_000): nodes.append(Node(value + 1)) nodes[999_999].next = current return nodes, current def Turn(current: int, nodes): up = nodes[current].next firstUp = up for _ in range(3): nodes[up].up = True lastUp = up up = nodes[up].next destination = (current - 1) % len(nodes) while nodes[destination].up: destination = (destination - 1) % len(nodes) nodes[current].next = nodes[lastUp].next nodes[lastUp].next = nodes[destination].next nodes[destination].next = firstUp up = firstUp for _ in range(3): nodes[up].up = False up = nodes[up].next return nodes[current].next def PrintNodes(current: int, nodes): print(f"({current + 1})", end='') index = nodes[current].next for _ in range(min(len(nodes) - 1, 20)): print(f" {index + 1}", end='') index = nodes[index].next print() def Answer(nodes): answer = '' node = nodes[0].next for _ in range(len(nodes) - 1): answer += str(node + 1) node = nodes[node].next return answer def Answer2(nodes): cup1 = nodes[0].next cup2 = nodes[cup1].next return (cup1 + 1) * (cup2 + 1) TEST = "389125467" DATA = "487912365" testNodes, current = MakeNodes(TEST) for _ in range(100): current = Turn(current, testNodes) assert Answer(testNodes) == '67384529' nodes, current = MakeNodes(DATA) for _ in range(100): current = Turn(current, nodes) print(Answer(nodes)) assert Answer(nodes) == '89573246' testNodes, current = MakeNodes2(TEST) for _ in range(10_000_000): current = Turn(current, testNodes) assert Answer2(testNodes) == 149245887792 nodes, current = MakeNodes2(DATA) for _ in range(10_000_000): current = Turn(current, nodes) print(Answer2(nodes)) assert Answer2(nodes == 2029056128)
true
true
f70a8c1d9d385ae5c5b01cb27f773a0610725826
4,907
py
Python
nextdl/extractor/palcomp3.py
devenu85/nextdl
0b458f556e2e0be80cb94bd9a9b1405ad2e9182d
[ "MIT" ]
1
2021-12-19T13:55:20.000Z
2021-12-19T13:55:20.000Z
nextdl/extractor/palcomp3.py
devenu85/nextdl
0b458f556e2e0be80cb94bd9a9b1405ad2e9182d
[ "MIT" ]
null
null
null
nextdl/extractor/palcomp3.py
devenu85/nextdl
0b458f556e2e0be80cb94bd9a9b1405ad2e9182d
[ "MIT" ]
null
null
null
# coding: utf-8 from __future__ import unicode_literals import re from ..compat import compat_str from ..utils import int_or_none, str_or_none, try_get from .common import InfoExtractor class PalcoMP3BaseIE(InfoExtractor): _GQL_QUERY_TMPL = """{ artist(slug: "%s") { %s } }""" _ARTIST_FIELDS_TMPL = """music(slug: "%%s") { %s }""" _MUSIC_FIELDS = """duration hls mp3File musicID plays title""" def _call_api(self, artist_slug, artist_fields): return self._download_json( "https://www.palcomp3.com.br/graphql/", artist_slug, query={ "query": self._GQL_QUERY_TMPL % (artist_slug, artist_fields), }, )["data"] def _parse_music(self, music): music_id = compat_str(music["musicID"]) title = music["title"] formats = [] hls_url = music.get("hls") if hls_url: formats.append( { "url": hls_url, "protocol": "m3u8_native", "ext": "mp4", } ) mp3_file = music.get("mp3File") if mp3_file: formats.append( { "url": mp3_file, } ) return { "id": music_id, "title": title, "formats": formats, "duration": int_or_none(music.get("duration")), "view_count": int_or_none(music.get("plays")), } def _real_initialize(self): self._ARTIST_FIELDS_TMPL = self._ARTIST_FIELDS_TMPL % self._MUSIC_FIELDS def _real_extract(self, url): artist_slug, music_slug = re.match(self._VALID_URL, url).groups() artist_fields = self._ARTIST_FIELDS_TMPL % music_slug music = self._call_api(artist_slug, artist_fields)["artist"]["music"] return self._parse_music(music) class PalcoMP3IE(PalcoMP3BaseIE): IE_NAME = "PalcoMP3:song" _VALID_URL = ( r"https?://(?:www\.)?palcomp3\.com(?:\.br)?/(?P<artist>[^/]+)/(?P<id>[^/?&#]+)" ) _TESTS = [ { "url": "https://www.palcomp3.com/maiaraemaraisaoficial/nossas-composicoes-cuida-bem-dela/", "md5": "99fd6405b2d8fd589670f6db1ba3b358", "info_dict": { "id": "3162927", "ext": "mp3", "title": "Nossas Composições - CUIDA BEM DELA", "duration": 210, "view_count": int, }, } ] @classmethod def suitable(cls, url): return ( False if PalcoMP3VideoIE.suitable(url) else super(PalcoMP3IE, cls).suitable(url) ) class PalcoMP3ArtistIE(PalcoMP3BaseIE): IE_NAME = "PalcoMP3:artist" _VALID_URL = r"https?://(?:www\.)?palcomp3\.com(?:\.br)?/(?P<id>[^/?&#]+)" _TESTS = [ { "url": "https://www.palcomp3.com.br/condedoforro/", "info_dict": { "id": "358396", "title": "Conde do Forró", }, "playlist_mincount": 188, } ] _ARTIST_FIELDS_TMPL = """artistID musics { nodes { %s } } name""" @classmethod def suitable(cls, url): return ( False if re.match(PalcoMP3IE._VALID_URL, url) else super(PalcoMP3ArtistIE, cls).suitable(url) ) def _real_extract(self, url): artist_slug = self._match_id(url) artist = self._call_api(artist_slug, self._ARTIST_FIELDS_TMPL)["artist"] def entries(): for music in try_get(artist, lambda x: x["musics"]["nodes"], list) or []: yield self._parse_music(music) return self.playlist_result( entries(), str_or_none(artist.get("artistID")), artist.get("name") ) class PalcoMP3VideoIE(PalcoMP3BaseIE): IE_NAME = "PalcoMP3:video" _VALID_URL = r"https?://(?:www\.)?palcomp3\.com(?:\.br)?/(?P<artist>[^/]+)/(?P<id>[^/?&#]+)/?#clipe" _TESTS = [ { "url": "https://www.palcomp3.com/maiaraemaraisaoficial/maiara-e-maraisa-voce-faz-falta-aqui-ao-vivo-em-vicosa-mg/#clipe", "add_ie": ["Youtube"], "info_dict": { "id": "_pD1nR2qqPg", "ext": "mp4", "title": "Maiara e Maraisa - Você Faz Falta Aqui - DVD Ao Vivo Em Campo Grande", "description": "md5:7043342c09a224598e93546e98e49282", "upload_date": "20161107", "uploader_id": "maiaramaraisaoficial", "uploader": "Maiara e Maraisa", }, } ] _MUSIC_FIELDS = "youtubeID" def _parse_music(self, music): youtube_id = music["youtubeID"] return self.url_result(youtube_id, "Youtube", youtube_id)
29.035503
133
0.525372
from __future__ import unicode_literals import re from ..compat import compat_str from ..utils import int_or_none, str_or_none, try_get from .common import InfoExtractor class PalcoMP3BaseIE(InfoExtractor): _GQL_QUERY_TMPL = """{ artist(slug: "%s") { %s } }""" _ARTIST_FIELDS_TMPL = """music(slug: "%%s") { %s }""" _MUSIC_FIELDS = """duration hls mp3File musicID plays title""" def _call_api(self, artist_slug, artist_fields): return self._download_json( "https://www.palcomp3.com.br/graphql/", artist_slug, query={ "query": self._GQL_QUERY_TMPL % (artist_slug, artist_fields), }, )["data"] def _parse_music(self, music): music_id = compat_str(music["musicID"]) title = music["title"] formats = [] hls_url = music.get("hls") if hls_url: formats.append( { "url": hls_url, "protocol": "m3u8_native", "ext": "mp4", } ) mp3_file = music.get("mp3File") if mp3_file: formats.append( { "url": mp3_file, } ) return { "id": music_id, "title": title, "formats": formats, "duration": int_or_none(music.get("duration")), "view_count": int_or_none(music.get("plays")), } def _real_initialize(self): self._ARTIST_FIELDS_TMPL = self._ARTIST_FIELDS_TMPL % self._MUSIC_FIELDS def _real_extract(self, url): artist_slug, music_slug = re.match(self._VALID_URL, url).groups() artist_fields = self._ARTIST_FIELDS_TMPL % music_slug music = self._call_api(artist_slug, artist_fields)["artist"]["music"] return self._parse_music(music) class PalcoMP3IE(PalcoMP3BaseIE): IE_NAME = "PalcoMP3:song" _VALID_URL = ( r"https?://(?:www\.)?palcomp3\.com(?:\.br)?/(?P<artist>[^/]+)/(?P<id>[^/?&#]+)" ) _TESTS = [ { "url": "https://www.palcomp3.com/maiaraemaraisaoficial/nossas-composicoes-cuida-bem-dela/", "md5": "99fd6405b2d8fd589670f6db1ba3b358", "info_dict": { "id": "3162927", "ext": "mp3", "title": "Nossas Composições - CUIDA BEM DELA", "duration": 210, "view_count": int, }, } ] @classmethod def suitable(cls, url): return ( False if PalcoMP3VideoIE.suitable(url) else super(PalcoMP3IE, cls).suitable(url) ) class PalcoMP3ArtistIE(PalcoMP3BaseIE): IE_NAME = "PalcoMP3:artist" _VALID_URL = r"https?://(?:www\.)?palcomp3\.com(?:\.br)?/(?P<id>[^/?&#]+)" _TESTS = [ { "url": "https://www.palcomp3.com.br/condedoforro/", "info_dict": { "id": "358396", "title": "Conde do Forró", }, "playlist_mincount": 188, } ] _ARTIST_FIELDS_TMPL = """artistID musics { nodes { %s } } name""" @classmethod def suitable(cls, url): return ( False if re.match(PalcoMP3IE._VALID_URL, url) else super(PalcoMP3ArtistIE, cls).suitable(url) ) def _real_extract(self, url): artist_slug = self._match_id(url) artist = self._call_api(artist_slug, self._ARTIST_FIELDS_TMPL)["artist"] def entries(): for music in try_get(artist, lambda x: x["musics"]["nodes"], list) or []: yield self._parse_music(music) return self.playlist_result( entries(), str_or_none(artist.get("artistID")), artist.get("name") ) class PalcoMP3VideoIE(PalcoMP3BaseIE): IE_NAME = "PalcoMP3:video" _VALID_URL = r"https?://(?:www\.)?palcomp3\.com(?:\.br)?/(?P<artist>[^/]+)/(?P<id>[^/?&#]+)/?#clipe" _TESTS = [ { "url": "https://www.palcomp3.com/maiaraemaraisaoficial/maiara-e-maraisa-voce-faz-falta-aqui-ao-vivo-em-vicosa-mg/#clipe", "add_ie": ["Youtube"], "info_dict": { "id": "_pD1nR2qqPg", "ext": "mp4", "title": "Maiara e Maraisa - Você Faz Falta Aqui - DVD Ao Vivo Em Campo Grande", "description": "md5:7043342c09a224598e93546e98e49282", "upload_date": "20161107", "uploader_id": "maiaramaraisaoficial", "uploader": "Maiara e Maraisa", }, } ] _MUSIC_FIELDS = "youtubeID" def _parse_music(self, music): youtube_id = music["youtubeID"] return self.url_result(youtube_id, "Youtube", youtube_id)
true
true
f70a8cead3e6860b7b1976560adb6005e93da51d
11,829
py
Python
vissl/data/dataset_catalog.py
NKI-AI/vissl
ddf5a97572c6640438faabba1f91426028520c4b
[ "MIT" ]
null
null
null
vissl/data/dataset_catalog.py
NKI-AI/vissl
ddf5a97572c6640438faabba1f91426028520c4b
[ "MIT" ]
null
null
null
vissl/data/dataset_catalog.py
NKI-AI/vissl
ddf5a97572c6640438faabba1f91426028520c4b
[ "MIT" ]
null
null
null
# Copyright (c) Facebook, Inc. and its affiliates. # This source code is licensed under the MIT license found in the # LICENSE file in the root directory of this source tree. """ Data and labels file for various datasets. """ import json import logging import os from typing import List import numpy as np from fvcore.common.file_io import PathManager from vissl.data.datasets import get_coco_imgs_labels_info, get_voc_images_labels_info from vissl.utils.misc import get_json_data_catalog_file from vissl.utils.slurm import get_slurm_dir class VisslDatasetCatalog(object): """ A catalog that stores information about the datasets and how to obtain them. It contains a mapping from strings (which are names that identify a dataset, e.g. "imagenet1k") to a `dict` which contains: 1) mapping of various data splits (train, test, val) to the data source (path on the disk whether a folder path or a filelist) 2) source of the data (disk_filelist | disk_folder) The purpose of having this catalog is to make it easy to choose different datasets, by just using the strings in the config. """ __REGISTERED_DATASETS = {} @staticmethod def register_json(json_catalog_path): """ Args: filepath: a .json filepath that contains the data to be registered """ with PathManager.open(json_catalog_path) as fopen: data_catalog = json.load(fopen) for key, value in data_catalog.items(): VisslDatasetCatalog.register_data(key, value) @staticmethod def register_dict(dict_catalog): """ Args: dict: a dict with a bunch of datasets to be registered """ for key, value in dict_catalog.items(): VisslDatasetCatalog.register_data(key, value) @staticmethod def register_data(name, data_dict): """ Args: name (str): the name that identifies a dataset, e.g. "imagenet1k_folder". func (callable): a callable which takes no arguments and returns a list of dicts. It must return the same results if called multiple times. """ assert isinstance( data_dict, dict ), "You must register a dictionary with VisslDatasetCatalog.register_dict" assert ( name not in VisslDatasetCatalog.__REGISTERED_DATASETS ), "Dataset '{}' is already registered!".format(name) VisslDatasetCatalog.__REGISTERED_DATASETS[name] = data_dict @staticmethod def get(name): """ Get the registered dict and return it. Args: name (str): the name that identifies a dataset, e.g. "imagenet1k". Returns: dict: dataset information (paths, source) """ try: info = VisslDatasetCatalog.__REGISTERED_DATASETS[name] except KeyError: raise KeyError( "Dataset '{}' is not registered! Available datasets are: {}".format( name, ", ".join(VisslDatasetCatalog.__REGISTERED_DATASETS.keys()) ) ) return info @staticmethod def list() -> List[str]: """ List all registered datasets. Returns: list[str] """ return list(VisslDatasetCatalog.__REGISTERED_DATASETS.keys()) @staticmethod def clear(): """ Remove all registered dataset. """ VisslDatasetCatalog.__REGISTERED_DATASETS.clear() @staticmethod def remove(name): """ Remove the dataset registered by ``name``. """ VisslDatasetCatalog.__REGISTERED_DATASETS.pop(name) @staticmethod def has_data(name): """ Check whether the data with ``name`` exists. """ data_found = name in VisslDatasetCatalog.__REGISTERED_DATASETS return data_found def get_local_path(input_file, dest_dir): """ If user specified copying data to a local directory, get the local path where the data files were copied. - If input_file is just a file, we return the dest_dir/filename - If the intput_file is a directory, then we check if the environemt is SLURM and use slurm_dir or otherwise dest_dir to look up copy_complete file is available. If available, we return the directory. - If both above fail, we return the input_file as is. """ out = "" if PathManager.isfile(input_file): out = os.path.join(dest_dir, os.path.basename(input_file)) elif PathManager.isdir(input_file): data_name = input_file.strip("/").split("/")[-1] if "SLURM_JOBID" in os.environ: dest_dir = get_slurm_dir(dest_dir) dest_dir = os.path.join(dest_dir, data_name) complete_flag = os.path.join(dest_dir, "copy_complete") if PathManager.isfile(complete_flag): out = dest_dir if PathManager.exists(out): return out else: return input_file def get_local_output_filepaths(input_files, dest_dir): """ If we have copied the files to local disk as specified in the config, we return those local paths. Otherwise return the original paths. """ output_files = [] for item in input_files: if isinstance(item, list): out = get_local_output_filepaths(item, dest_dir) else: out = get_local_path(item, dest_dir) output_files.append(out) return output_files def check_data_exists(data_files): """ Check that the input data files exist. If the data_files is a list, we iteratively check for each file in the list. """ if isinstance(data_files, list): return np.all([PathManager.exists(item) for item in data_files]) else: return PathManager.exists(data_files) def register_pascal_voc(): """ Register PASCAL VOC 2007 and 2012 datasets to the data catalog. We first look up for these datasets paths in the dataset catalog, if the paths exist, we register, otherwise we remove the voc_data from the catalog registry. """ voc_datasets = ["voc2007_folder", "voc2012_folder"] for voc_data in voc_datasets: data_info = VisslDatasetCatalog.get(voc_data) data_folder = data_info["train"][0] if PathManager.exists(data_folder): train_data_info = get_voc_images_labels_info("train", data_folder) test_data_info = get_voc_images_labels_info("val", data_folder) data_info["train"] = train_data_info data_info["val"] = test_data_info VisslDatasetCatalog.remove(voc_data) VisslDatasetCatalog.register_data(voc_data, data_info) else: VisslDatasetCatalog.remove(voc_data) def register_coco(): """ Register COCO 2004 datasets to the data catalog. We first look up for these datasets paths in the dataset catalog, if the paths exist, we register, otherwise we remove the coco2014_folder from the catalog registry. """ data_info = VisslDatasetCatalog.get("coco2014_folder") data_folder = data_info["train"][0] if PathManager.exists(data_folder): train_data_info = get_coco_imgs_labels_info("train", data_folder) test_data_info = get_coco_imgs_labels_info("val", data_folder) data_info["train"] = train_data_info data_info["val"] = test_data_info VisslDatasetCatalog.remove("coco2014_folder") VisslDatasetCatalog.register_data("coco2014_folder", data_info) else: VisslDatasetCatalog.remove("coco2014_folder") def register_datasets(json_catalog_path): """ If the json dataset_catalog file is found, we register the datasets specified in the catalog with VISSL. If the catalog also specified VOC or coco datasets, we resister them Args: json_catalog_path (str): the path to the json dataset catalog """ if PathManager.exists(json_catalog_path): logging.info(f"Registering datasets: {json_catalog_path}") VisslDatasetCatalog.clear() VisslDatasetCatalog.register_json(json_catalog_path) if VisslDatasetCatalog.has_data("voc2007_folder") or VisslDatasetCatalog.has_data( "voc2012_folder" ): register_pascal_voc() if VisslDatasetCatalog.has_data("coco2014_folder"): register_coco() def get_data_files(split, dataset_config): """ Get the path to the dataset (images and labels). 1. If the user has explicitly specified the data_sources, we simply use those and don't do lookup in the datasets registered with VISSL from the dataset catalog. 2. If the user hasn't specified the path, look for the dataset in the datasets catalog registered with VISSL. For a given list of datasets and a given partition (train/test), we first verify that we have the dataset and the correct source as specified by the user. Then for each dataset in the list, we get the data path (make sure it exists, sources match). For the label file, the file is optional. Once we have the dataset original paths, we replace the path with the local paths if the data was copied to local disk. """ assert len(dataset_config[split].DATASET_NAMES) == len( dataset_config[split].DATA_SOURCES ), "len(data_sources) != len(dataset_names)" if len(dataset_config[split].DATA_PATHS) > 0: assert len(dataset_config[split].DATA_SOURCES) == len( dataset_config[split].DATA_PATHS ), "len(data_sources) != len(data_paths)" data_files, label_files = [], [] data_names = dataset_config[split].DATASET_NAMES data_sources = dataset_config[split].DATA_SOURCES data_split = "train" if split == "TRAIN" else "val" for idx in range(len(data_sources)): # if there are synthetic data sources, we set the filepaths as none if data_sources[idx] == "synthetic": data_files.append("") continue # if user has specified the data path explicitly, we use it elif len(dataset_config[split].DATA_PATHS) > 0: data_files.append(dataset_config[split].DATA_PATHS[idx]) # otherwise retrieve from the cataloag based on the dataset name else: data_info = VisslDatasetCatalog.get(data_names[idx]) assert ( len(data_info[data_split]) > 0 ), f"data paths list for split: { data_split } is empty" check_data_exists( data_info[data_split][0] ), f"Some data files dont exist: {data_info[data_split][0]}" data_files.append(data_info[data_split][0]) # labels are optional and hence we append if we find them if len(dataset_config[split].LABEL_PATHS) > 0: if check_data_exists(dataset_config[split].LABEL_PATHS[idx]): label_files.append(dataset_config[split].LABEL_PATHS[idx]) else: label_data_info = VisslDatasetCatalog.get(data_names[idx]) if check_data_exists(label_data_info[data_split][1]): label_files.append(label_data_info[data_split][1]) output = [data_files, label_files] if dataset_config[split].COPY_TO_LOCAL_DISK: dest_dir = dataset_config[split]["COPY_DESTINATION_DIR"] local_data_files = get_local_output_filepaths(data_files, dest_dir) local_label_files = get_local_output_filepaths(label_files, dest_dir) output = [local_data_files, local_label_files] return output # get the path to dataset_catalog.json file json_catalog_file = get_json_data_catalog_file() # register the datasets specified in the catalog with VISSL register_datasets(json_catalog_file)
38.03537
93
0.668442
import json import logging import os from typing import List import numpy as np from fvcore.common.file_io import PathManager from vissl.data.datasets import get_coco_imgs_labels_info, get_voc_images_labels_info from vissl.utils.misc import get_json_data_catalog_file from vissl.utils.slurm import get_slurm_dir class VisslDatasetCatalog(object): __REGISTERED_DATASETS = {} @staticmethod def register_json(json_catalog_path): with PathManager.open(json_catalog_path) as fopen: data_catalog = json.load(fopen) for key, value in data_catalog.items(): VisslDatasetCatalog.register_data(key, value) @staticmethod def register_dict(dict_catalog): for key, value in dict_catalog.items(): VisslDatasetCatalog.register_data(key, value) @staticmethod def register_data(name, data_dict): assert isinstance( data_dict, dict ), "You must register a dictionary with VisslDatasetCatalog.register_dict" assert ( name not in VisslDatasetCatalog.__REGISTERED_DATASETS ), "Dataset '{}' is already registered!".format(name) VisslDatasetCatalog.__REGISTERED_DATASETS[name] = data_dict @staticmethod def get(name): try: info = VisslDatasetCatalog.__REGISTERED_DATASETS[name] except KeyError: raise KeyError( "Dataset '{}' is not registered! Available datasets are: {}".format( name, ", ".join(VisslDatasetCatalog.__REGISTERED_DATASETS.keys()) ) ) return info @staticmethod def list() -> List[str]: return list(VisslDatasetCatalog.__REGISTERED_DATASETS.keys()) @staticmethod def clear(): VisslDatasetCatalog.__REGISTERED_DATASETS.clear() @staticmethod def remove(name): VisslDatasetCatalog.__REGISTERED_DATASETS.pop(name) @staticmethod def has_data(name): data_found = name in VisslDatasetCatalog.__REGISTERED_DATASETS return data_found def get_local_path(input_file, dest_dir): out = "" if PathManager.isfile(input_file): out = os.path.join(dest_dir, os.path.basename(input_file)) elif PathManager.isdir(input_file): data_name = input_file.strip("/").split("/")[-1] if "SLURM_JOBID" in os.environ: dest_dir = get_slurm_dir(dest_dir) dest_dir = os.path.join(dest_dir, data_name) complete_flag = os.path.join(dest_dir, "copy_complete") if PathManager.isfile(complete_flag): out = dest_dir if PathManager.exists(out): return out else: return input_file def get_local_output_filepaths(input_files, dest_dir): output_files = [] for item in input_files: if isinstance(item, list): out = get_local_output_filepaths(item, dest_dir) else: out = get_local_path(item, dest_dir) output_files.append(out) return output_files def check_data_exists(data_files): if isinstance(data_files, list): return np.all([PathManager.exists(item) for item in data_files]) else: return PathManager.exists(data_files) def register_pascal_voc(): voc_datasets = ["voc2007_folder", "voc2012_folder"] for voc_data in voc_datasets: data_info = VisslDatasetCatalog.get(voc_data) data_folder = data_info["train"][0] if PathManager.exists(data_folder): train_data_info = get_voc_images_labels_info("train", data_folder) test_data_info = get_voc_images_labels_info("val", data_folder) data_info["train"] = train_data_info data_info["val"] = test_data_info VisslDatasetCatalog.remove(voc_data) VisslDatasetCatalog.register_data(voc_data, data_info) else: VisslDatasetCatalog.remove(voc_data) def register_coco(): data_info = VisslDatasetCatalog.get("coco2014_folder") data_folder = data_info["train"][0] if PathManager.exists(data_folder): train_data_info = get_coco_imgs_labels_info("train", data_folder) test_data_info = get_coco_imgs_labels_info("val", data_folder) data_info["train"] = train_data_info data_info["val"] = test_data_info VisslDatasetCatalog.remove("coco2014_folder") VisslDatasetCatalog.register_data("coco2014_folder", data_info) else: VisslDatasetCatalog.remove("coco2014_folder") def register_datasets(json_catalog_path): if PathManager.exists(json_catalog_path): logging.info(f"Registering datasets: {json_catalog_path}") VisslDatasetCatalog.clear() VisslDatasetCatalog.register_json(json_catalog_path) if VisslDatasetCatalog.has_data("voc2007_folder") or VisslDatasetCatalog.has_data( "voc2012_folder" ): register_pascal_voc() if VisslDatasetCatalog.has_data("coco2014_folder"): register_coco() def get_data_files(split, dataset_config): assert len(dataset_config[split].DATASET_NAMES) == len( dataset_config[split].DATA_SOURCES ), "len(data_sources) != len(dataset_names)" if len(dataset_config[split].DATA_PATHS) > 0: assert len(dataset_config[split].DATA_SOURCES) == len( dataset_config[split].DATA_PATHS ), "len(data_sources) != len(data_paths)" data_files, label_files = [], [] data_names = dataset_config[split].DATASET_NAMES data_sources = dataset_config[split].DATA_SOURCES data_split = "train" if split == "TRAIN" else "val" for idx in range(len(data_sources)): if data_sources[idx] == "synthetic": data_files.append("") continue elif len(dataset_config[split].DATA_PATHS) > 0: data_files.append(dataset_config[split].DATA_PATHS[idx]) else: data_info = VisslDatasetCatalog.get(data_names[idx]) assert ( len(data_info[data_split]) > 0 ), f"data paths list for split: { data_split } is empty" check_data_exists( data_info[data_split][0] ), f"Some data files dont exist: {data_info[data_split][0]}" data_files.append(data_info[data_split][0]) if len(dataset_config[split].LABEL_PATHS) > 0: if check_data_exists(dataset_config[split].LABEL_PATHS[idx]): label_files.append(dataset_config[split].LABEL_PATHS[idx]) else: label_data_info = VisslDatasetCatalog.get(data_names[idx]) if check_data_exists(label_data_info[data_split][1]): label_files.append(label_data_info[data_split][1]) output = [data_files, label_files] if dataset_config[split].COPY_TO_LOCAL_DISK: dest_dir = dataset_config[split]["COPY_DESTINATION_DIR"] local_data_files = get_local_output_filepaths(data_files, dest_dir) local_label_files = get_local_output_filepaths(label_files, dest_dir) output = [local_data_files, local_label_files] return output json_catalog_file = get_json_data_catalog_file() register_datasets(json_catalog_file)
true
true
f70a8d36f31dcd5350e51b402a11c45acf9c1b33
100
py
Python
Alys/src/alys/alys.py
PikaBlue107/alys-pronouns
ff86648bdc9a5bc82beaf5c007ad88be94961324
[ "MIT" ]
null
null
null
Alys/src/alys/alys.py
PikaBlue107/alys-pronouns
ff86648bdc9a5bc82beaf5c007ad88be94961324
[ "MIT" ]
null
null
null
Alys/src/alys/alys.py
PikaBlue107/alys-pronouns
ff86648bdc9a5bc82beaf5c007ad88be94961324
[ "MIT" ]
null
null
null
''' Created on Nov 20, 2019 @author: Melody Griesen ''' if __name__ == '__main__': pass
12.5
27
0.59
if __name__ == '__main__': pass
true
true
f70a8d437ab6062a2810b247f87863917ccd942b
4,412
py
Python
dags/python_scripts/load_staging_genre.py
jrderek/Movie_Analytics-Data-Engineering-
9789b2d4a13964b93f7f99b010137e9c4e6cc807
[ "MIT" ]
null
null
null
dags/python_scripts/load_staging_genre.py
jrderek/Movie_Analytics-Data-Engineering-
9789b2d4a13964b93f7f99b010137e9c4e6cc807
[ "MIT" ]
null
null
null
dags/python_scripts/load_staging_genre.py
jrderek/Movie_Analytics-Data-Engineering-
9789b2d4a13964b93f7f99b010137e9c4e6cc807
[ "MIT" ]
null
null
null
import sys import os from datetime import datetime from pyspark import SparkConf, SparkContext from pyspark.sql import SparkSession from pyspark.sql.types import (StructType, StructField as Fld, DoubleType as Dbl, IntegerType as Int, DateType as Date, BooleanType as Boolean, FloatType as Float, LongType as Long, StringType as String, ArrayType as Array) from pyspark.sql.functions import (col, year, month, dayofmonth, weekofyear, quarter, explode, from_json) def create_spark_session(aws_key, aws_secret_key): """ Description: Creates spark session. Returns: spark session object """ spark = SparkSession \ .builder \ .config("spark.executor.heartbeatInterval", "40s") \ .getOrCreate() spark.sparkContext._jsc.hadoopConfiguration().set("fs.s3a.impl", "org.apache.hadoop.fs.s3a.S3AFileSystem") spark.sparkContext._jsc.hadoopConfiguration().set("fs.s3a.access.key", aws_key) spark.sparkContext._jsc.hadoopConfiguration().set("fs.s3a.secret.key", aws_secret_key) spark.sparkContext._jsc.hadoopConfiguration().set("fs.s3a.endpoint", "s3.amazonaws.com") spark.sparkContext._jsc.hadoopConfiguration().set("fs.s3a.connection.timeout", "100") spark.sparkContext._jsc.hadoopConfiguration().set("fs.s3a.connection.maximum", "5000") spark.conf.set("spark.sql.shuffle.partitions", 4) return spark def format_datetime(ts): return datetime.fromtimestamp(ts/1000.0) if __name__ == "__main__": s3_bucket = sys.argv[1] s3_key = sys.argv[2] aws_key = sys.argv[3] aws_secret_key = sys.argv[4] redshift_conn_string = sys.argv[5] db_user = sys.argv[6] db_pass = sys.argv[7] spark = create_spark_session(aws_key, aws_secret_key) movies_schema = StructType([ Fld("adult", String()), Fld("belongs_to_collection", Long()), Fld("budget", Long()), Fld("genres", String()), Fld("homepage", String()), Fld("id", Int()), Fld("imdb_id", String()), Fld("original_language", String()), Fld("original_title", String()), Fld("overview", String()), Fld("popularity", Dbl()), Fld("poster_path", String()), Fld("production_company", String()), Fld("production_country", String()), Fld("release_date", Date()), Fld("revenue", Long()), Fld("runtime", Float()), Fld("spoken_languages", String()), Fld("status", String()), Fld("tagline", String()), Fld("title", String()), Fld("video", Boolean()), Fld("vote_average", Float()), Fld("vote_count", Int()) ]) movies_df = spark.read.option("header", "true") \ .csv("s3a://{}/{}/movies_metadata.csv".format(s3_bucket, s3_key), schema=movies_schema) genre_schema = Array(StructType([Fld("id", Int()), Fld("name", String())])) movies_df = movies_df.withColumn("genres", explode(from_json("genres", genre_schema))) \ .withColumn("genre_id", col("genres.id")) \ .withColumn("genre_name", col("genres.name")) \ movie_genre = movies_df.select("id", "genre_id").distinct() movie_genre = movie_genre.select(col("id").alias("movie_id"), col("genre_id")) genre = movies_df.select("genre_id", "genre_name").distinct() genre = genre.na.drop() # Load data into staging: genre.write \ .format("jdbc") \ .option("url", redshift_conn_string) \ .option("dbtable", "movies.stage_genre") \ .option("user", sys.argv[6]) \ .option("password", sys.argv[7]) \ .option("driver", "com.amazon.redshift.jdbc42.Driver") \ .mode("append") \ .save() movie_genre.write \ .format("jdbc") \ .option("url", redshift_conn_string) \ .option("dbtable", "movies.stage_movie_genre") \ .option("user", sys.argv[6]) \ .option("password", sys.argv[7]) \ .option("driver", "com.amazon.redshift.jdbc42.Driver") \ .mode("append") \ .save()
38.365217
95
0.577289
import sys import os from datetime import datetime from pyspark import SparkConf, SparkContext from pyspark.sql import SparkSession from pyspark.sql.types import (StructType, StructField as Fld, DoubleType as Dbl, IntegerType as Int, DateType as Date, BooleanType as Boolean, FloatType as Float, LongType as Long, StringType as String, ArrayType as Array) from pyspark.sql.functions import (col, year, month, dayofmonth, weekofyear, quarter, explode, from_json) def create_spark_session(aws_key, aws_secret_key): spark = SparkSession \ .builder \ .config("spark.executor.heartbeatInterval", "40s") \ .getOrCreate() spark.sparkContext._jsc.hadoopConfiguration().set("fs.s3a.impl", "org.apache.hadoop.fs.s3a.S3AFileSystem") spark.sparkContext._jsc.hadoopConfiguration().set("fs.s3a.access.key", aws_key) spark.sparkContext._jsc.hadoopConfiguration().set("fs.s3a.secret.key", aws_secret_key) spark.sparkContext._jsc.hadoopConfiguration().set("fs.s3a.endpoint", "s3.amazonaws.com") spark.sparkContext._jsc.hadoopConfiguration().set("fs.s3a.connection.timeout", "100") spark.sparkContext._jsc.hadoopConfiguration().set("fs.s3a.connection.maximum", "5000") spark.conf.set("spark.sql.shuffle.partitions", 4) return spark def format_datetime(ts): return datetime.fromtimestamp(ts/1000.0) if __name__ == "__main__": s3_bucket = sys.argv[1] s3_key = sys.argv[2] aws_key = sys.argv[3] aws_secret_key = sys.argv[4] redshift_conn_string = sys.argv[5] db_user = sys.argv[6] db_pass = sys.argv[7] spark = create_spark_session(aws_key, aws_secret_key) movies_schema = StructType([ Fld("adult", String()), Fld("belongs_to_collection", Long()), Fld("budget", Long()), Fld("genres", String()), Fld("homepage", String()), Fld("id", Int()), Fld("imdb_id", String()), Fld("original_language", String()), Fld("original_title", String()), Fld("overview", String()), Fld("popularity", Dbl()), Fld("poster_path", String()), Fld("production_company", String()), Fld("production_country", String()), Fld("release_date", Date()), Fld("revenue", Long()), Fld("runtime", Float()), Fld("spoken_languages", String()), Fld("status", String()), Fld("tagline", String()), Fld("title", String()), Fld("video", Boolean()), Fld("vote_average", Float()), Fld("vote_count", Int()) ]) movies_df = spark.read.option("header", "true") \ .csv("s3a://{}/{}/movies_metadata.csv".format(s3_bucket, s3_key), schema=movies_schema) genre_schema = Array(StructType([Fld("id", Int()), Fld("name", String())])) movies_df = movies_df.withColumn("genres", explode(from_json("genres", genre_schema))) \ .withColumn("genre_id", col("genres.id")) \ .withColumn("genre_name", col("genres.name")) \ movie_genre = movies_df.select("id", "genre_id").distinct() movie_genre = movie_genre.select(col("id").alias("movie_id"), col("genre_id")) genre = movies_df.select("genre_id", "genre_name").distinct() genre = genre.na.drop() genre.write \ .format("jdbc") \ .option("url", redshift_conn_string) \ .option("dbtable", "movies.stage_genre") \ .option("user", sys.argv[6]) \ .option("password", sys.argv[7]) \ .option("driver", "com.amazon.redshift.jdbc42.Driver") \ .mode("append") \ .save() movie_genre.write \ .format("jdbc") \ .option("url", redshift_conn_string) \ .option("dbtable", "movies.stage_movie_genre") \ .option("user", sys.argv[6]) \ .option("password", sys.argv[7]) \ .option("driver", "com.amazon.redshift.jdbc42.Driver") \ .mode("append") \ .save()
true
true
f70a8ee941ed8c8f91318a8c247810c74106e4af
8,951
py
Python
scripts/enip-logix/gen_pull.py
Vadoola/pulr
d276b94b4ffcc7381b661654cc004c5b8ebc2776
[ "Apache-2.0" ]
13
2020-08-28T17:20:23.000Z
2022-02-03T06:23:51.000Z
scripts/enip-logix/gen_pull.py
Vadoola/pulr
d276b94b4ffcc7381b661654cc004c5b8ebc2776
[ "Apache-2.0" ]
1
2021-05-06T10:43:42.000Z
2021-05-12T13:21:19.000Z
scripts/enip-logix/gen_pull.py
Vadoola/pulr
d276b94b4ffcc7381b661654cc004c5b8ebc2776
[ "Apache-2.0" ]
3
2020-09-02T08:10:12.000Z
2021-05-06T03:37:57.000Z
#!/usr/bin/env python3 """ Generates Pulr "pull" config section from JSON, created with fetch-tags.py """ import sys import argparse from textwrap import dedent try: import rapidjson as json except: import json import yaml DEFAULT_FREQ = 1 DEFAULT_PATH = '1,0' DEFAULT_CPU = 'LGX' DEFAULT_TIMEOUT = 2 def generate(tag_list, tag_file=None, tag_data=None, exclude=None, config=None, id_prefix='', id_suffix='', print_stats=False, print_config=False): def find_tag_in_struct(tag, data): if '.' in tag: tag_to_find, rest = tag.split('.', 1) else: tag_to_find = tag rest = None t = data[tag_to_find] if rest is None: return t else: if t['tag_type'] != 'struct': raise ValueError(f'{tag_to_find} is not a struct!') return find_tag_in_struct( rest, t['data_type']['internal_tags'], ) def find_tag(tag, data): if '.' in tag: tag_to_find, rest = tag.split('.', 1) else: tag_to_find = tag rest = None for t in data: if t['tag_name'] == tag_to_find: if rest is None: return t else: if t['tag_type'] != 'struct': raise ValueError(f'{tag_to_find} is not a struct!') else: return find_tag_in_struct( rest, t['data_type']['internal_tags']) if tag_data is None: if tag_file: with open(tag_file) as fh: tags = json.loads(fh.read()) else: tags = json.loads(sys.stdin.read()) else: tags = tag_data DATA_TYPES = { 'BOOL': 'uint8', 'BYTE': 'byte', 'WORD': 'word', 'DWORD': 'dword', 'LWORD': 'qword', 'SINT': 'sint8', 'USINT': 'uint8', 'INT': 'sint16', 'UINT': 'uint16', 'DINT': 'sint32', 'UDINT': 'uint32', 'LINT': 'sint64', 'ULINT': 'uint64', 'REAL': 'real32', 'LREAL': 'real64' } DATA_TYPE_SIZE = { 'BOOL': 1, 'BYTE': 1, 'WORD': 2, 'DWORD': 4, 'LWORD': 8, 'SINT': 1, 'USINT': 1, 'INT': 2, 'UINT': 2, 'DINT': 4, 'UDINT': 4, 'LINT': 8, 'ULINT': 8, 'REAL': 4, 'LREAL': 8 } def gen_offset(o1, o2, int_if_possible=False): if o1: o = f'{o1}+{o2}' else: o = o2 if int_if_possible else f'{o2}' return o def add_tag_info(tag_name, tag_data, coll, offset=0, base_offset=0): nonlocal tags_count if exclude: for x in exclude: if x.startswith('*'): if tag_name.endswith(x[1:]): return elif x.endswith('*'): if tag_name.startswith(x[:-1]): return else: if tag_name == x: return arr = tag_data.get('array', 0) if arr: for aofs in range(0, arr): tags_count += 1 coll.append({ 'offset': gen_offset(base_offset, offset + aofs * DATA_TYPE_SIZE[tag_data['data_type']], int_if_possible=True), 'set-id': f'{id_prefix}{tag_name}{id_suffix}[{aofs}]', 'type': DATA_TYPES[tag_data['data_type']] }) else: tags_count += 1 coll.append({ 'offset': gen_offset(base_offset, offset, int_if_possible=True), 'set-id': f'{id_prefix}{tag_name}{id_suffix}', 'type': DATA_TYPES[tag_data['data_type']] }) tags_count = 0 pulls = [] def parse_offset(offset): if isinstance(offset, int): return offset elif '+' in offset: o = offset.split('+') result = 0 for i in o: o += int(i) return result else: return int(offset) def gen_process(data, offset, tag_name, result=[]): for tag, d in data.items(): if d['tag_type'] == 'struct': if d['array'] == 0: gen_process(d['data_type']['internal_tags'], gen_offset(offset, d['offset']), tag_name + '.' + tag, result) else: for aofs in range(0, d['array']): gen_process( d['data_type']['internal_tags'], gen_offset( parse_offset(offset) + aofs * d['data_type']['template']['structure_size'], d['offset']), f'{tag_name}.{tag}[{aofs}]', result) else: add_tag_info(f'{tag_name}.{tag}', d, result, offset=d['offset'], base_offset=offset) return result for TAG in tag_list: data = find_tag(TAG, tags) if data is None: raise ValueError(f'Tag not found: {TAG}') if data['tag_type'] == 'struct': pulls.append({ '1tag': TAG, 'process': gen_process(data['data_type']['internal_tags'], 0, TAG, []) }) else: result = [] add_tag_info(TAG, data, result) pulls.append({'1tag': TAG, 'process': result}) CFG = '' if config: CFG += dedent(f""" version: 2 timeout: {config.get("timeout", DEFAULT_TIMEOUT)} freq: {config.get("freq", DEFAULT_FREQ)} proto: name: enip/ab_eip source: {config["source"]} path: {config.get("path", DEFAULT_PATH)} cpu: {config.get("cpu", DEFAULT_CPU)} """).lstrip() CFG += yaml.dump(dict(pull=pulls), default_flow_style=False).replace('\n- 1tag', '\n- tag') if print_config: print(CFG) if print_stats: print(f'{tags_count} tag(s) generated', file=sys.stderr) return CFG if __name__ == '__main__': ap = argparse.ArgumentParser() ap.add_argument('tag', metavar='TAG', help='Tags to parse (comma separated)') ap.add_argument('-F', '--tag_file', metavar='FILE', help='JSON tags file (default: stdin)') ap.add_argument('-s', '--source', metavar='ADDR', help='PLC IP[:port] (full config is generated is defined') ap.add_argument( '-x', '--exclude', metavar='TAGS', help='Tags to exclude (comma separated, star masks possible)') ap.add_argument('-f', '--freq', metavar='HERZ', help='Pull frequency', default=DEFAULT_FREQ, type=int) ap.add_argument('--path', metavar='PATH', help='PLC path', default=DEFAULT_PATH) ap.add_argument('--cpu', metavar='CPU', help='CPU', default=DEFAULT_CPU) ap.add_argument('--timeout', metavar='SEC', help='PLC TIMEOUT', type=float, default=DEFAULT_TIMEOUT) ap.add_argument('--id-prefix', metavar='VALUE', help='ID prefix', default='') ap.add_argument('--id-suffix', metavar='VALUE', help='ID suffix', default='') a = ap.parse_args() if a.source: config = dict(source=a.source, freq=a.freq, path=a.path, cpu=a.cpu, timeout=a.timeout) else: config = None generate(tag_file=a.tag_file, tag_list=a.tag.split(','), config=config, exclude=a.exclude.split(',') if a.exclude else None, id_prefix=a.id_prefix, id_suffix=a.id_suffix, print_stats=True, print_config=True)
28.597444
80
0.431013
import sys import argparse from textwrap import dedent try: import rapidjson as json except: import json import yaml DEFAULT_FREQ = 1 DEFAULT_PATH = '1,0' DEFAULT_CPU = 'LGX' DEFAULT_TIMEOUT = 2 def generate(tag_list, tag_file=None, tag_data=None, exclude=None, config=None, id_prefix='', id_suffix='', print_stats=False, print_config=False): def find_tag_in_struct(tag, data): if '.' in tag: tag_to_find, rest = tag.split('.', 1) else: tag_to_find = tag rest = None t = data[tag_to_find] if rest is None: return t else: if t['tag_type'] != 'struct': raise ValueError(f'{tag_to_find} is not a struct!') return find_tag_in_struct( rest, t['data_type']['internal_tags'], ) def find_tag(tag, data): if '.' in tag: tag_to_find, rest = tag.split('.', 1) else: tag_to_find = tag rest = None for t in data: if t['tag_name'] == tag_to_find: if rest is None: return t else: if t['tag_type'] != 'struct': raise ValueError(f'{tag_to_find} is not a struct!') else: return find_tag_in_struct( rest, t['data_type']['internal_tags']) if tag_data is None: if tag_file: with open(tag_file) as fh: tags = json.loads(fh.read()) else: tags = json.loads(sys.stdin.read()) else: tags = tag_data DATA_TYPES = { 'BOOL': 'uint8', 'BYTE': 'byte', 'WORD': 'word', 'DWORD': 'dword', 'LWORD': 'qword', 'SINT': 'sint8', 'USINT': 'uint8', 'INT': 'sint16', 'UINT': 'uint16', 'DINT': 'sint32', 'UDINT': 'uint32', 'LINT': 'sint64', 'ULINT': 'uint64', 'REAL': 'real32', 'LREAL': 'real64' } DATA_TYPE_SIZE = { 'BOOL': 1, 'BYTE': 1, 'WORD': 2, 'DWORD': 4, 'LWORD': 8, 'SINT': 1, 'USINT': 1, 'INT': 2, 'UINT': 2, 'DINT': 4, 'UDINT': 4, 'LINT': 8, 'ULINT': 8, 'REAL': 4, 'LREAL': 8 } def gen_offset(o1, o2, int_if_possible=False): if o1: o = f'{o1}+{o2}' else: o = o2 if int_if_possible else f'{o2}' return o def add_tag_info(tag_name, tag_data, coll, offset=0, base_offset=0): nonlocal tags_count if exclude: for x in exclude: if x.startswith('*'): if tag_name.endswith(x[1:]): return elif x.endswith('*'): if tag_name.startswith(x[:-1]): return else: if tag_name == x: return arr = tag_data.get('array', 0) if arr: for aofs in range(0, arr): tags_count += 1 coll.append({ 'offset': gen_offset(base_offset, offset + aofs * DATA_TYPE_SIZE[tag_data['data_type']], int_if_possible=True), 'set-id': f'{id_prefix}{tag_name}{id_suffix}[{aofs}]', 'type': DATA_TYPES[tag_data['data_type']] }) else: tags_count += 1 coll.append({ 'offset': gen_offset(base_offset, offset, int_if_possible=True), 'set-id': f'{id_prefix}{tag_name}{id_suffix}', 'type': DATA_TYPES[tag_data['data_type']] }) tags_count = 0 pulls = [] def parse_offset(offset): if isinstance(offset, int): return offset elif '+' in offset: o = offset.split('+') result = 0 for i in o: o += int(i) return result else: return int(offset) def gen_process(data, offset, tag_name, result=[]): for tag, d in data.items(): if d['tag_type'] == 'struct': if d['array'] == 0: gen_process(d['data_type']['internal_tags'], gen_offset(offset, d['offset']), tag_name + '.' + tag, result) else: for aofs in range(0, d['array']): gen_process( d['data_type']['internal_tags'], gen_offset( parse_offset(offset) + aofs * d['data_type']['template']['structure_size'], d['offset']), f'{tag_name}.{tag}[{aofs}]', result) else: add_tag_info(f'{tag_name}.{tag}', d, result, offset=d['offset'], base_offset=offset) return result for TAG in tag_list: data = find_tag(TAG, tags) if data is None: raise ValueError(f'Tag not found: {TAG}') if data['tag_type'] == 'struct': pulls.append({ '1tag': TAG, 'process': gen_process(data['data_type']['internal_tags'], 0, TAG, []) }) else: result = [] add_tag_info(TAG, data, result) pulls.append({'1tag': TAG, 'process': result}) CFG = '' if config: CFG += dedent(f""" version: 2 timeout: {config.get("timeout", DEFAULT_TIMEOUT)} freq: {config.get("freq", DEFAULT_FREQ)} proto: name: enip/ab_eip source: {config["source"]} path: {config.get("path", DEFAULT_PATH)} cpu: {config.get("cpu", DEFAULT_CPU)} """).lstrip() CFG += yaml.dump(dict(pull=pulls), default_flow_style=False).replace('\n- 1tag', '\n- tag') if print_config: print(CFG) if print_stats: print(f'{tags_count} tag(s) generated', file=sys.stderr) return CFG if __name__ == '__main__': ap = argparse.ArgumentParser() ap.add_argument('tag', metavar='TAG', help='Tags to parse (comma separated)') ap.add_argument('-F', '--tag_file', metavar='FILE', help='JSON tags file (default: stdin)') ap.add_argument('-s', '--source', metavar='ADDR', help='PLC IP[:port] (full config is generated is defined') ap.add_argument( '-x', '--exclude', metavar='TAGS', help='Tags to exclude (comma separated, star masks possible)') ap.add_argument('-f', '--freq', metavar='HERZ', help='Pull frequency', default=DEFAULT_FREQ, type=int) ap.add_argument('--path', metavar='PATH', help='PLC path', default=DEFAULT_PATH) ap.add_argument('--cpu', metavar='CPU', help='CPU', default=DEFAULT_CPU) ap.add_argument('--timeout', metavar='SEC', help='PLC TIMEOUT', type=float, default=DEFAULT_TIMEOUT) ap.add_argument('--id-prefix', metavar='VALUE', help='ID prefix', default='') ap.add_argument('--id-suffix', metavar='VALUE', help='ID suffix', default='') a = ap.parse_args() if a.source: config = dict(source=a.source, freq=a.freq, path=a.path, cpu=a.cpu, timeout=a.timeout) else: config = None generate(tag_file=a.tag_file, tag_list=a.tag.split(','), config=config, exclude=a.exclude.split(',') if a.exclude else None, id_prefix=a.id_prefix, id_suffix=a.id_suffix, print_stats=True, print_config=True)
true
true
f70a9017583af2e35cffeb78d26cdec6a68df2ec
9,648
py
Python
makeReadmeMD.py
freehackquest/2016-tasks
3d4a1525213d9ef106bcfa8c5c6e33938489366d
[ "MIT" ]
null
null
null
makeReadmeMD.py
freehackquest/2016-tasks
3d4a1525213d9ef106bcfa8c5c6e33938489366d
[ "MIT" ]
null
null
null
makeReadmeMD.py
freehackquest/2016-tasks
3d4a1525213d9ef106bcfa8c5c6e33938489366d
[ "MIT" ]
1
2019-01-22T18:05:26.000Z
2019-01-22T18:05:26.000Z
#!/usr/bin/python # -*- coding: utf-8 -*- import json import os import sys import os.path import re from pprint import pprint from subprocess import Popen, PIPE readme = open('README.md', 'w') readme.write("# Free Hack Quest 2016\n") def getListOfDirsWithTasks(): result = [] dirs = os.listdir('./'); for d in dirs: print(d); if os.path.isdir(d): subdirs = os.listdir('./' + d) subdirs.sort() for sd in subdirs: path = './' + d + '/' + sd if os.path.isdir(path): if os.path.isfile(path + '/main.json'): result.append(path) print("Found: " + path); return result dirs = getListOfDirsWithTasks(); dirs.sort() game_name = 'Free Hack Quest 2016' stat_tasks = [] table_tasks = [] errors = {} def append_errors(path, text): if path not in errors: errors[path] = [] errors[path].append(text) possible_categories = ["admin", "web", "pwn", "crypto", "forensic", "misc", "ppc", "recon", "reverse", "stego"] def detectEncoding(path): p = Popen(['file', '-i', path], stdin=PIPE, stdout=PIPE, stderr=PIPE) output, err = p.communicate(b"input data that is passed to subprocess' stdin") pattern = re.compile('.*charset=(.*).*') m = pattern.match(output) if m: return m.group(1) return 'unknown' def parseAuthor(path): author = '' with open(path) as f: content = ''.join(f.readlines()) content = content.replace('\r', '') content = content.replace('\n', '') content = content.replace('\t', '') pattern = re.compile('.*"nick"[ ]*\:[ ]*"([A-Z-a-z@!._]*)".*') m = pattern.match(content) if m: author = m.group(1) contacts = [] pattern = re.compile('.*"contacts"[ ]*\:[ ]*\[[ ]*"([A-Z-a-z@/!._]*)"[ ]*,[ ]*"([A-Z-a-z@/!._]*)".*') m = pattern.match(content) if m: contacts.append(m.group(1)); contacts.append(m.group(2)); return author + '(' + ', '.join(contacts) + ')' def appendStatCat(category, value): for cat in stat_tasks: if cat['category'] == category: cat['count'] = cat['count'] + 1 cat['value'] = cat['value'] + value return stat_tasks.append({'category': category, 'count': 1, 'value': value}) def checkWriteUpFile(folder): path = folder + '/WRITEUP.md' if not os.path.isfile(path): append_errors(folder, 'Missing file WRITEUP.md') def getCategoryFromTask(data, folder): category = 'unknown' if 'category' not in data: append_errors(folder, 'main.json: Missing field "category"') else: category = data['category'] if category not in possible_categories: append_errors(folder, 'main.json: Field "category" has wrong value') return category; def getStatusFromTask(data, folder): status = 'need verify' if 'status' not in data: append_errors(folder, 'main.json: Missing field "status"') else: status = data['status'] return status; def getValueFromTask(data, folder): value = 0 if 'value' not in data: append_errors(folder, 'main.json: Missing field "value"') else: value = data['value'] if value == 0: append_errors(folder, 'main.json: Task has 0 value') return value def getDescriptionFromTask(data, folder): description = {"RU" : "", "EN": ""} if 'name' not in data: append_errors(folder, 'main.json: Missing field "name"') else: description = data['description'] if 'RU' not in description: append_errors(folder, 'main.json: Missing subfield description "RU"') else: if description["RU"] == "": append_errors(folder, 'main.json: Empty field in description "RU"') if 'EN' not in description: append_errors(folder, 'main.json: Missing subfield description "EN"') else: if description["EN"] == "": append_errors(folder, 'main.json: Empty field in description "EN"') return description def getAuthorsFromTask(data, path): authors = [] if 'authors' not in data: append_errors(path, 'main.json: Missing field "authors"') else: if not isinstance(data['authors'], list): append_errors(path, 'main.json: Field "authors" must be list') else: authors_ = data['authors'] for author in authors_: name = "" team = "" contacts = [] if "name" not in author: append_errors(path, 'main.json: Missing subfield author "name"') else: name = author["name"] if name == "": append_errors(path, 'main.json: Subfield author "name" is empty') if "team" not in author: append_errors(path, 'main.json: Missing subfield author "team"') else: team = author["team"] if team == "": append_errors(path, 'main.json: Subfield author "team" is empty') if "contacts" not in author: append_errors(path, 'main.json: Missing subfield author "contacts"') else: if not isinstance(author['contacts'], list): append_errors(path, 'main.json: Subfield author "contacts" must be list') else: for c in author['contacts']: if c == "": append_errors(path, 'main.json: Empty field in author "contacts"') else: contacts.append(c); contacts = ', '.join(contacts) if contacts == "": append_errors(path, 'main.json: Missing data in subfield authors "contacts"') authors.append('[' + team + '] ' + name + ' (' + contacts + ')') return authors def getNameFromTask(data, folder): name = path if 'name' not in data: append_errors(folder, 'main.json: Missing field "name"') else: name = data['name'] if name == "": append_errors(folder, 'main.json: Field "name" is empty') dirname = folder.split("/")[-1]; if name != dirname: append_errors(folder, 'main.json: Field "name" has wrong value must like dirname "' + dirname + '" be "' + folder + '"') return name def getFlagKeyFromTask(data, folder): flag_key = '' if 'flag_key' not in data: append_errors(path, 'main.json: Missing field "flag_key"') else: flag_key = data['flag_key'] pattern = re.compile('FHQ\(.*\)') pattern2 = re.compile('FHQ\{.*\}') m = pattern.match(flag_key) m2 = pattern2.match(flag_key) if flag_key == "": append_errors(folder, 'main.json: Field "flag_key" is empty') elif not m and not m2: append_errors(folder, 'main.json: Wrong value of field "flag_key" must be format "FHQ(`md5`) or FHQ(`sometext`)"') return flag_key def getGameFromTask(data, folder): game = '' if 'game' not in data: append_errors(folder, 'main.json: Missing field "game"') else: game = data['game'] if game != game_name: append_errors(folder, 'main.json: Wrong game name "' + game + '" Please change to "' + game_name + '"') return game def getHintsFromTask(data, folder): hints = [] if 'hints' not in data: append_errors(d, 'main.json: Missing field "hints"') else: if not isinstance(data['hints'], list): append_errors(d, 'main.json: Field "hints" must be list') else: hints = data['hints'] for hint in hints: if 'RU' not in hint: append_errors(folder, 'main.json: Missing subfield hint "RU"') else: if hint["RU"] == "": append_errors(folder, 'main.json: Empty field in hint "RU"') if 'EN' not in hint: append_errors(folder, 'main.json: Missing subfield hint "EN"') else: if hint["EN"] == "": append_errors(folder, 'main.json: Empty field in hint "EN"') return hints; for d in dirs: path = d + '/main.json' #encoding = detectEncoding(path); if os.path.isfile(path): try: checkWriteUpFile(d); with open(path) as main_json: data = json.load(main_json) category = getCategoryFromTask(data, d) value = getValueFromTask(data, d) status = getStatusFromTask(data, d); authors = getAuthorsFromTask(data, d) name = getNameFromTask(data, d) getDescriptionFromTask(data, d) getFlagKeyFromTask(data, d) appendStatCat(category, value); table_tasks.append({ 'category': category, 'value': value, 'name': name, 'path': d, 'status': status, 'authors': ', '.join(authors) } ) getGameFromTask(data, d) getHintsFromTask(data, d) except Exception: status = '' encoding = detectEncoding(path); if encoding != 'utf-8': status = encoding append_errors(path, 'Wrong encoding in "' + path + '", expected "utf-8", got "' + encoding + '"') author = parseAuthor(path); # print sys.exc_info() table_tasks.append({'category': 'unknown', 'value': 0, 'name': d, 'status': 'invalid json', 'authors': author } ) appendStatCat('unknown', 0); readme.write("\n## Short list of tasks\n\n") for row in table_tasks: readme.write(' * ' + row['category'] + ' ' + str(row['value']) + ' "' + row['name'] + '" by ' + row['authors'] + "\n") if len(errors) > 0: readme.write("\n\n## Errors\n\n") for path in errors: print(' * ' + path) readme.write(' * ' + path + "\n") for e in errors[path]: print("\t * " + e) readme.write('\t * ' + e + "\n") readme.write("\n## Statistics by categories\n\n") readme.write("|Category|Count|Summary value\n") readme.write("|---|---|---\n") stat_tasks.sort(key=lambda x: x['category']) tasks_count_all=0 tasks_value_all=0 for cat in stat_tasks: readme.write("|" + cat['category'] + "|" + str(cat['count']) + "|" + str(cat['value']) + "\n") tasks_count_all = tasks_count_all + cat['count']; tasks_value_all = tasks_value_all + cat['value']; readme.write("|All|" + str(tasks_count_all) + "|" + str(tasks_value_all) + "\n") # sort table table_tasks.sort(key=lambda x: x['category'] + ' ' + str(x['value']).zfill(4)) readme.write("\n\n## Status table\n\n") readme.write("|Category&Value|Name|Status|Author(s)\n") readme.write("|---|---|---|---\n") for row in table_tasks: readme.write('|' + row['category'] + ' ' + str(row['value']) + '|' + row['name'] + '|' + row['status'] + '|' + row['authors'] + "\n")
29.595092
134
0.632566
import json import os import sys import os.path import re from pprint import pprint from subprocess import Popen, PIPE readme = open('README.md', 'w') readme.write("# Free Hack Quest 2016\n") def getListOfDirsWithTasks(): result = [] dirs = os.listdir('./'); for d in dirs: print(d); if os.path.isdir(d): subdirs = os.listdir('./' + d) subdirs.sort() for sd in subdirs: path = './' + d + '/' + sd if os.path.isdir(path): if os.path.isfile(path + '/main.json'): result.append(path) print("Found: " + path); return result dirs = getListOfDirsWithTasks(); dirs.sort() game_name = 'Free Hack Quest 2016' stat_tasks = [] table_tasks = [] errors = {} def append_errors(path, text): if path not in errors: errors[path] = [] errors[path].append(text) possible_categories = ["admin", "web", "pwn", "crypto", "forensic", "misc", "ppc", "recon", "reverse", "stego"] def detectEncoding(path): p = Popen(['file', '-i', path], stdin=PIPE, stdout=PIPE, stderr=PIPE) output, err = p.communicate(b"input data that is passed to subprocess' stdin") pattern = re.compile('.*charset=(.*).*') m = pattern.match(output) if m: return m.group(1) return 'unknown' def parseAuthor(path): author = '' with open(path) as f: content = ''.join(f.readlines()) content = content.replace('\r', '') content = content.replace('\n', '') content = content.replace('\t', '') pattern = re.compile('.*"nick"[ ]*\:[ ]*"([A-Z-a-z@!._]*)".*') m = pattern.match(content) if m: author = m.group(1) contacts = [] pattern = re.compile('.*"contacts"[ ]*\:[ ]*\[[ ]*"([A-Z-a-z@/!._]*)"[ ]*,[ ]*"([A-Z-a-z@/!._]*)".*') m = pattern.match(content) if m: contacts.append(m.group(1)); contacts.append(m.group(2)); return author + '(' + ', '.join(contacts) + ')' def appendStatCat(category, value): for cat in stat_tasks: if cat['category'] == category: cat['count'] = cat['count'] + 1 cat['value'] = cat['value'] + value return stat_tasks.append({'category': category, 'count': 1, 'value': value}) def checkWriteUpFile(folder): path = folder + '/WRITEUP.md' if not os.path.isfile(path): append_errors(folder, 'Missing file WRITEUP.md') def getCategoryFromTask(data, folder): category = 'unknown' if 'category' not in data: append_errors(folder, 'main.json: Missing field "category"') else: category = data['category'] if category not in possible_categories: append_errors(folder, 'main.json: Field "category" has wrong value') return category; def getStatusFromTask(data, folder): status = 'need verify' if 'status' not in data: append_errors(folder, 'main.json: Missing field "status"') else: status = data['status'] return status; def getValueFromTask(data, folder): value = 0 if 'value' not in data: append_errors(folder, 'main.json: Missing field "value"') else: value = data['value'] if value == 0: append_errors(folder, 'main.json: Task has 0 value') return value def getDescriptionFromTask(data, folder): description = {"RU" : "", "EN": ""} if 'name' not in data: append_errors(folder, 'main.json: Missing field "name"') else: description = data['description'] if 'RU' not in description: append_errors(folder, 'main.json: Missing subfield description "RU"') else: if description["RU"] == "": append_errors(folder, 'main.json: Empty field in description "RU"') if 'EN' not in description: append_errors(folder, 'main.json: Missing subfield description "EN"') else: if description["EN"] == "": append_errors(folder, 'main.json: Empty field in description "EN"') return description def getAuthorsFromTask(data, path): authors = [] if 'authors' not in data: append_errors(path, 'main.json: Missing field "authors"') else: if not isinstance(data['authors'], list): append_errors(path, 'main.json: Field "authors" must be list') else: authors_ = data['authors'] for author in authors_: name = "" team = "" contacts = [] if "name" not in author: append_errors(path, 'main.json: Missing subfield author "name"') else: name = author["name"] if name == "": append_errors(path, 'main.json: Subfield author "name" is empty') if "team" not in author: append_errors(path, 'main.json: Missing subfield author "team"') else: team = author["team"] if team == "": append_errors(path, 'main.json: Subfield author "team" is empty') if "contacts" not in author: append_errors(path, 'main.json: Missing subfield author "contacts"') else: if not isinstance(author['contacts'], list): append_errors(path, 'main.json: Subfield author "contacts" must be list') else: for c in author['contacts']: if c == "": append_errors(path, 'main.json: Empty field in author "contacts"') else: contacts.append(c); contacts = ', '.join(contacts) if contacts == "": append_errors(path, 'main.json: Missing data in subfield authors "contacts"') authors.append('[' + team + '] ' + name + ' (' + contacts + ')') return authors def getNameFromTask(data, folder): name = path if 'name' not in data: append_errors(folder, 'main.json: Missing field "name"') else: name = data['name'] if name == "": append_errors(folder, 'main.json: Field "name" is empty') dirname = folder.split("/")[-1]; if name != dirname: append_errors(folder, 'main.json: Field "name" has wrong value must like dirname "' + dirname + '" be "' + folder + '"') return name def getFlagKeyFromTask(data, folder): flag_key = '' if 'flag_key' not in data: append_errors(path, 'main.json: Missing field "flag_key"') else: flag_key = data['flag_key'] pattern = re.compile('FHQ\(.*\)') pattern2 = re.compile('FHQ\{.*\}') m = pattern.match(flag_key) m2 = pattern2.match(flag_key) if flag_key == "": append_errors(folder, 'main.json: Field "flag_key" is empty') elif not m and not m2: append_errors(folder, 'main.json: Wrong value of field "flag_key" must be format "FHQ(`md5`) or FHQ(`sometext`)"') return flag_key def getGameFromTask(data, folder): game = '' if 'game' not in data: append_errors(folder, 'main.json: Missing field "game"') else: game = data['game'] if game != game_name: append_errors(folder, 'main.json: Wrong game name "' + game + '" Please change to "' + game_name + '"') return game def getHintsFromTask(data, folder): hints = [] if 'hints' not in data: append_errors(d, 'main.json: Missing field "hints"') else: if not isinstance(data['hints'], list): append_errors(d, 'main.json: Field "hints" must be list') else: hints = data['hints'] for hint in hints: if 'RU' not in hint: append_errors(folder, 'main.json: Missing subfield hint "RU"') else: if hint["RU"] == "": append_errors(folder, 'main.json: Empty field in hint "RU"') if 'EN' not in hint: append_errors(folder, 'main.json: Missing subfield hint "EN"') else: if hint["EN"] == "": append_errors(folder, 'main.json: Empty field in hint "EN"') return hints; for d in dirs: path = d + '/main.json' #encoding = detectEncoding(path); if os.path.isfile(path): try: checkWriteUpFile(d); with open(path) as main_json: data = json.load(main_json) category = getCategoryFromTask(data, d) value = getValueFromTask(data, d) status = getStatusFromTask(data, d); authors = getAuthorsFromTask(data, d) name = getNameFromTask(data, d) getDescriptionFromTask(data, d) getFlagKeyFromTask(data, d) appendStatCat(category, value); table_tasks.append({ 'category': category, 'value': value, 'name': name, 'path': d, 'status': status, 'authors': ', '.join(authors) } ) getGameFromTask(data, d) getHintsFromTask(data, d) except Exception: status = '' encoding = detectEncoding(path); if encoding != 'utf-8': status = encoding append_errors(path, 'Wrong encoding in "' + path + '", expected "utf-8", got "' + encoding + '"') author = parseAuthor(path); # print sys.exc_info() table_tasks.append({'category': 'unknown', 'value': 0, 'name': d, 'status': 'invalid json', 'authors': author } ) appendStatCat('unknown', 0); readme.write("\n## Short list of tasks\n\n") for row in table_tasks: readme.write(' * ' + row['category'] + ' ' + str(row['value']) + ' "' + row['name'] + '" by ' + row['authors'] + "\n") if len(errors) > 0: readme.write("\n\n## Errors\n\n") for path in errors: print(' * ' + path) readme.write(' * ' + path + "\n") for e in errors[path]: print("\t * " + e) readme.write('\t * ' + e + "\n") readme.write("\n## Statistics by categories\n\n") readme.write("|Category|Count|Summary value\n") readme.write("|---|---|---\n") stat_tasks.sort(key=lambda x: x['category']) tasks_count_all=0 tasks_value_all=0 for cat in stat_tasks: readme.write("|" + cat['category'] + "|" + str(cat['count']) + "|" + str(cat['value']) + "\n") tasks_count_all = tasks_count_all + cat['count']; tasks_value_all = tasks_value_all + cat['value']; readme.write("|All|" + str(tasks_count_all) + "|" + str(tasks_value_all) + "\n") # sort table table_tasks.sort(key=lambda x: x['category'] + ' ' + str(x['value']).zfill(4)) readme.write("\n\n## Status table\n\n") readme.write("|Category&Value|Name|Status|Author(s)\n") readme.write("|---|---|---|---\n") for row in table_tasks: readme.write('|' + row['category'] + ' ' + str(row['value']) + '|' + row['name'] + '|' + row['status'] + '|' + row['authors'] + "\n")
true
true
f70a90c74a64770e6bdc44f68bb42a89c0778438
1,441
py
Python
sms.py
Lyokolux/smsNotificationFree
e82290c1d643bc249c9e70bf9df54c05005da789
[ "MIT" ]
null
null
null
sms.py
Lyokolux/smsNotificationFree
e82290c1d643bc249c9e70bf9df54c05005da789
[ "MIT" ]
null
null
null
sms.py
Lyokolux/smsNotificationFree
e82290c1d643bc249c9e70bf9df54c05005da789
[ "MIT" ]
null
null
null
import sys import click import json from urllib.request import urlopen from urllib.parse import quote RESPONSES_CODE = { 200 : "SMS sent", 400 : "One parameter is missing (identifier, password or message).", 402 : "Too many SMS sent.", 403 : "Service not activated or false login/key.", 500 : "Server Error. Please try again later." } #--------------------------------------- # CREATION & CONFIGURATION DU MESSAGE #--------------------------------------- @click.command() @click.option("-m", "--message", prompt="SMS content: ", help="the message to be sent") @click.option("-c", "--config", type=click.Path(exists=True), prompt="Path of the config file", help="parse JSON file to get id and password keys") @click.option("-v", "--verbose", is_flag=True, help="Print the HTTP response code of the request") def sms(message, config, verbose): (user, password) = getKeys(config) url = f"https://smsapi.free-mobile.fr/sendmsg?&user={user}&pass={password}&msg={quote(message)}" response = urlopen(url) if verbose: status = response.getcode() print(f"{status} : {RESPONSES_CODE[status]}") def getKeys(config): with open(config) as f: credential = json.loads(f.read()) return (credential["user"], credential["password"]) if __name__ == "__main__": sms()
32.022222
100
0.581541
import sys import click import json from urllib.request import urlopen from urllib.parse import quote RESPONSES_CODE = { 200 : "SMS sent", 400 : "One parameter is missing (identifier, password or message).", 402 : "Too many SMS sent.", 403 : "Service not activated or false login/key.", 500 : "Server Error. Please try again later." } @click.command() @click.option("-m", "--message", prompt="SMS content: ", help="the message to be sent") @click.option("-c", "--config", type=click.Path(exists=True), prompt="Path of the config file", help="parse JSON file to get id and password keys") @click.option("-v", "--verbose", is_flag=True, help="Print the HTTP response code of the request") def sms(message, config, verbose): (user, password) = getKeys(config) url = f"https://smsapi.free-mobile.fr/sendmsg?&user={user}&pass={password}&msg={quote(message)}" response = urlopen(url) if verbose: status = response.getcode() print(f"{status} : {RESPONSES_CODE[status]}") def getKeys(config): with open(config) as f: credential = json.loads(f.read()) return (credential["user"], credential["password"]) if __name__ == "__main__": sms()
true
true
f70a91aa7357a9d5cc499152a4eeee87757d1d2b
1,086
py
Python
Experiments/ARIMA/RunnerARIMA.py
nj-czy/UCTB
bddb8b47953bef1f44cb06f1a57a3d7efbd31c3a
[ "MIT" ]
null
null
null
Experiments/ARIMA/RunnerARIMA.py
nj-czy/UCTB
bddb8b47953bef1f44cb06f1a57a3d7efbd31c3a
[ "MIT" ]
null
null
null
Experiments/ARIMA/RunnerARIMA.py
nj-czy/UCTB
bddb8b47953bef1f44cb06f1a57a3d7efbd31c3a
[ "MIT" ]
null
null
null
import os from tqdm import tqdm # dataset = [['Bike','NYC','all','365','sum','0.1'],['DiDi','Xian','all','all','sum','0.1'], # ['Metro','Chongqing','all','all','sum','0.1'],['ChargeStation','Beijing','all','all','max','0.1'], # ['METR','LA','all','all','average','0.2'],['PEMS','BAY','all','all','average','0.2']] dataset = [['METR','LA','all','all','average','0.2'],['PEMS','BAY','all','all','average','0.2']] with open("ARIMAresult3.txt","w") as fp: for index in tqdm(range(len(dataset))): fp.write("*********************************************************\n") fp.write("Processing city----------------{}---using ARIMA-------MergeIndex 12 --".format(dataset[index])) f_tmp = os.popen("python -W ignore ARIMA.py --dataset {} --city {} --MergeIndex 12 --DataRange {} --TrainDays {} --MergeWay {} --test_ratio {}".format(dataset[index][0],dataset[index][1],dataset[index][2],dataset[index][3],dataset[index][4],dataset[index][5]), "r") # to record ouput fp.write(f_tmp.read()) fp.flush() f_tmp.close() fp.write("\n")
51.714286
273
0.529466
import os from tqdm import tqdm dataset = [['METR','LA','all','all','average','0.2'],['PEMS','BAY','all','all','average','0.2']] with open("ARIMAresult3.txt","w") as fp: for index in tqdm(range(len(dataset))): fp.write("*********************************************************\n") fp.write("Processing city----------------{}---using ARIMA-------MergeIndex 12 --".format(dataset[index])) f_tmp = os.popen("python -W ignore ARIMA.py --dataset {} --city {} --MergeIndex 12 --DataRange {} --TrainDays {} --MergeWay {} --test_ratio {}".format(dataset[index][0],dataset[index][1],dataset[index][2],dataset[index][3],dataset[index][4],dataset[index][5]), "r") fp.write(f_tmp.read()) fp.flush() f_tmp.close() fp.write("\n")
true
true
f70a94376224e4e62b4838d7f26f665e40767945
1,015
py
Python
openstack_dashboard/dashboards/project/overview/urls.py
hashsos/hashcloudos-horizon
0cc080ca6777e4a1dac5cbcc6143202baddab176
[ "Apache-2.0" ]
930
2015-01-04T08:06:03.000Z
2022-03-13T18:47:13.000Z
openstack_dashboard/dashboards/project/overview/urls.py
hashsos/hashcloudos-horizon
0cc080ca6777e4a1dac5cbcc6143202baddab176
[ "Apache-2.0" ]
106
2019-01-18T03:06:55.000Z
2019-11-29T05:06:18.000Z
openstack_dashboard/dashboards/project/overview/urls.py
hashsos/hashcloudos-horizon
0cc080ca6777e4a1dac5cbcc6143202baddab176
[ "Apache-2.0" ]
1,040
2015-01-01T18:48:28.000Z
2022-03-19T08:35:18.000Z
# Copyright 2012 United States Government as represented by the # Administrator of the National Aeronautics and Space Administration. # All Rights Reserved. # # Copyright 2012 Nebula, Inc. # # Licensed under the Apache License, Version 2.0 (the "License"); you may # not use this file except in compliance with the License. You may obtain # a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, WITHOUT # WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the # License for the specific language governing permissions and limitations # under the License. from django.conf.urls import url from openstack_dashboard.dashboards.project.overview import views urlpatterns = [ url(r'^$', views.ProjectOverview.as_view(), name='index'), url(r'^warning$', views.WarningView.as_view(), name='warning'), ]
36.25
78
0.737931
from django.conf.urls import url from openstack_dashboard.dashboards.project.overview import views urlpatterns = [ url(r'^$', views.ProjectOverview.as_view(), name='index'), url(r'^warning$', views.WarningView.as_view(), name='warning'), ]
true
true
f70a944f916b145fc345dc057278b25d671d9ad4
170
py
Python
app/projects/TestProject.py
cchernn/ProjectsWebsite
ad5a23539f5034956076259b55f628542241d9d8
[ "MIT" ]
null
null
null
app/projects/TestProject.py
cchernn/ProjectsWebsite
ad5a23539f5034956076259b55f628542241d9d8
[ "MIT" ]
null
null
null
app/projects/TestProject.py
cchernn/ProjectsWebsite
ad5a23539f5034956076259b55f628542241d9d8
[ "MIT" ]
null
null
null
class handler(): def __init__(self): self.greeting = "Hello World" def __repr__(self): return self.greeting if __name__ == "__main__": pass
17
37
0.611765
class handler(): def __init__(self): self.greeting = "Hello World" def __repr__(self): return self.greeting if __name__ == "__main__": pass
true
true
f70a94c0e06d3fd4dafc82aa2df645c9cb1dba9e
916
py
Python
script/gimp_histemul.py
matteli/histemul
61f1ea8e1263b92fd2bead0c808f67940faad802
[ "BSD-2-Clause" ]
1
2019-07-05T09:40:50.000Z
2019-07-05T09:40:50.000Z
script/gimp_histemul.py
matteli/histemul
61f1ea8e1263b92fd2bead0c808f67940faad802
[ "BSD-2-Clause" ]
null
null
null
script/gimp_histemul.py
matteli/histemul
61f1ea8e1263b92fd2bead0c808f67940faad802
[ "BSD-2-Clause" ]
null
null
null
#!/usr/bin/env python from gimpfu import * from gimpenums import * import sys import os def color2id(color): a = (color[0]<<16) | (color[1]<<8) | color[2] b = (a & 0xF00000) >> 12 | (a & 0xF000) >> 8 | (a & 0xF00) << 4 | \ (a & 0xF0) >> 4 c = (b & 0xF000) | (b & 0x800) >> 11 | (b & 0x400) >> 7 | \ (b & 0x200) >> 3 | (b & 0x100) << 1 | (b & 0x80) >> 6 | \ (b & 0x40) >> 2 | (b & 0x20) << 2 | (b & 0x10) << 6 | \ (b & 0x8) >> 1 | (b & 0x4) << 3 | (b & 0x2) << 7 | (b & 0x1) << 11 return (c) def gimp_histemul(img, layer): idd = color2id(gimp.get_foreground()) gimp.pdb.gimp_message_set_handler (MESSAGE_BOX) gimp.pdb.gimp_message (idd) register( "python_fu_histemul_id", "", "", "matteli", "matteli", "", "<Image>/Filters/Histemul/_id", "RGB*", [], [], gimp_histemul) main()
24.756757
71
0.469432
from gimpfu import * from gimpenums import * import sys import os def color2id(color): a = (color[0]<<16) | (color[1]<<8) | color[2] b = (a & 0xF00000) >> 12 | (a & 0xF000) >> 8 | (a & 0xF00) << 4 | \ (a & 0xF0) >> 4 c = (b & 0xF000) | (b & 0x800) >> 11 | (b & 0x400) >> 7 | \ (b & 0x200) >> 3 | (b & 0x100) << 1 | (b & 0x80) >> 6 | \ (b & 0x40) >> 2 | (b & 0x20) << 2 | (b & 0x10) << 6 | \ (b & 0x8) >> 1 | (b & 0x4) << 3 | (b & 0x2) << 7 | (b & 0x1) << 11 return (c) def gimp_histemul(img, layer): idd = color2id(gimp.get_foreground()) gimp.pdb.gimp_message_set_handler (MESSAGE_BOX) gimp.pdb.gimp_message (idd) register( "python_fu_histemul_id", "", "", "matteli", "matteli", "", "<Image>/Filters/Histemul/_id", "RGB*", [], [], gimp_histemul) main()
true
true
f70a95254e35822d1e937560e483bbab7dc9a08f
1,510
py
Python
docker_engine/komand_docker_engine/actions/container_remove/schema.py
xhennessy-r7/insightconnect-plugins
59268051313d67735b5dd3a30222eccb92aca8e9
[ "MIT" ]
null
null
null
docker_engine/komand_docker_engine/actions/container_remove/schema.py
xhennessy-r7/insightconnect-plugins
59268051313d67735b5dd3a30222eccb92aca8e9
[ "MIT" ]
null
null
null
docker_engine/komand_docker_engine/actions/container_remove/schema.py
xhennessy-r7/insightconnect-plugins
59268051313d67735b5dd3a30222eccb92aca8e9
[ "MIT" ]
null
null
null
# GENERATED BY KOMAND SDK - DO NOT EDIT import komand import json class Input: FORCE = "force" ID = "id" LINK = "link" V = "v" class Output: SUCCESS = "success" class ContainerRemoveInput(komand.Input): schema = json.loads(""" { "type": "object", "title": "Variables", "properties": { "force": { "type": "boolean", "title": "Force Removal", "description": "Force the removal of a running container (uses SIGKILL)", "default": true, "order": 4 }, "id": { "type": "string", "title": "ID", "description": "Container ID", "order": 1 }, "link": { "type": "boolean", "title": "Link Removal", "description": "Remove the specified link and not the underlying container", "default": false, "order": 3 }, "v": { "type": "boolean", "title": "Volume Removal", "description": "Remove the volumes associated with the container", "default": false, "order": 2 } } } """) def __init__(self): super(self.__class__, self).__init__(self.schema) class ContainerRemoveOutput(komand.Output): schema = json.loads(""" { "type": "object", "title": "Variables", "properties": { "success": { "type": "boolean", "title": "Success", "description": "True if successful", "order": 1 } } } """) def __init__(self): super(self.__class__, self).__init__(self.schema)
19.868421
82
0.542384
import komand import json class Input: FORCE = "force" ID = "id" LINK = "link" V = "v" class Output: SUCCESS = "success" class ContainerRemoveInput(komand.Input): schema = json.loads(""" { "type": "object", "title": "Variables", "properties": { "force": { "type": "boolean", "title": "Force Removal", "description": "Force the removal of a running container (uses SIGKILL)", "default": true, "order": 4 }, "id": { "type": "string", "title": "ID", "description": "Container ID", "order": 1 }, "link": { "type": "boolean", "title": "Link Removal", "description": "Remove the specified link and not the underlying container", "default": false, "order": 3 }, "v": { "type": "boolean", "title": "Volume Removal", "description": "Remove the volumes associated with the container", "default": false, "order": 2 } } } """) def __init__(self): super(self.__class__, self).__init__(self.schema) class ContainerRemoveOutput(komand.Output): schema = json.loads(""" { "type": "object", "title": "Variables", "properties": { "success": { "type": "boolean", "title": "Success", "description": "True if successful", "order": 1 } } } """) def __init__(self): super(self.__class__, self).__init__(self.schema)
true
true
f70a95cc159cace0f85857909a871669972e3f9e
31,375
py
Python
scipy/integrate/quadrature.py
maxi-marufo/my-scipy
be6c2597fcee86419592ac512319301c7ddfc118
[ "BSD-3-Clause" ]
1
2020-07-22T17:29:25.000Z
2020-07-22T17:29:25.000Z
scipy/integrate/quadrature.py
maxi-marufo/my-scipy
be6c2597fcee86419592ac512319301c7ddfc118
[ "BSD-3-Clause" ]
null
null
null
scipy/integrate/quadrature.py
maxi-marufo/my-scipy
be6c2597fcee86419592ac512319301c7ddfc118
[ "BSD-3-Clause" ]
null
null
null
import functools import numpy as np import math import types import warnings # trapz is a public function for scipy.integrate, # even though it's actually a NumPy function. from numpy import trapz from scipy.special import roots_legendre from scipy.special import gammaln __all__ = ['fixed_quad', 'quadrature', 'romberg', 'trapz', 'simps', 'romb', 'cumtrapz', 'newton_cotes'] # Make See Also linking for our local copy work properly def _copy_func(f): """Based on http://stackoverflow.com/a/6528148/190597 (Glenn Maynard)""" g = types.FunctionType(f.__code__, f.__globals__, name=f.__name__, argdefs=f.__defaults__, closure=f.__closure__) g = functools.update_wrapper(g, f) g.__kwdefaults__ = f.__kwdefaults__ return g trapz = _copy_func(trapz) if trapz.__doc__: trapz.__doc__ = trapz.__doc__.replace('sum, cumsum', 'numpy.cumsum') class AccuracyWarning(Warning): pass def _cached_roots_legendre(n): """ Cache roots_legendre results to speed up calls of the fixed_quad function. """ if n in _cached_roots_legendre.cache: return _cached_roots_legendre.cache[n] _cached_roots_legendre.cache[n] = roots_legendre(n) return _cached_roots_legendre.cache[n] _cached_roots_legendre.cache = dict() def fixed_quad(func, a, b, args=(), n=5): """ Compute a definite integral using fixed-order Gaussian quadrature. Integrate `func` from `a` to `b` using Gaussian quadrature of order `n`. Parameters ---------- func : callable A Python function or method to integrate (must accept vector inputs). If integrating a vector-valued function, the returned array must have shape ``(..., len(x))``. a : float Lower limit of integration. b : float Upper limit of integration. args : tuple, optional Extra arguments to pass to function, if any. n : int, optional Order of quadrature integration. Default is 5. Returns ------- val : float Gaussian quadrature approximation to the integral none : None Statically returned value of None See Also -------- quad : adaptive quadrature using QUADPACK dblquad : double integrals tplquad : triple integrals romberg : adaptive Romberg quadrature quadrature : adaptive Gaussian quadrature romb : integrators for sampled data simps : integrators for sampled data cumtrapz : cumulative integration for sampled data ode : ODE integrator odeint : ODE integrator Examples -------- >>> from scipy import integrate >>> f = lambda x: x**8 >>> integrate.fixed_quad(f, 0.0, 1.0, n=4) (0.1110884353741496, None) >>> integrate.fixed_quad(f, 0.0, 1.0, n=5) (0.11111111111111102, None) >>> print(1/9.0) # analytical result 0.1111111111111111 >>> integrate.fixed_quad(np.cos, 0.0, np.pi/2, n=4) (0.9999999771971152, None) >>> integrate.fixed_quad(np.cos, 0.0, np.pi/2, n=5) (1.000000000039565, None) >>> np.sin(np.pi/2)-np.sin(0) # analytical result 1.0 """ x, w = _cached_roots_legendre(n) x = np.real(x) if np.isinf(a) or np.isinf(b): raise ValueError("Gaussian quadrature is only available for " "finite limits.") y = (b-a)*(x+1)/2.0 + a return (b-a)/2.0 * np.sum(w*func(y, *args), axis=-1), None def vectorize1(func, args=(), vec_func=False): """Vectorize the call to a function. This is an internal utility function used by `romberg` and `quadrature` to create a vectorized version of a function. If `vec_func` is True, the function `func` is assumed to take vector arguments. Parameters ---------- func : callable User defined function. args : tuple, optional Extra arguments for the function. vec_func : bool, optional True if the function func takes vector arguments. Returns ------- vfunc : callable A function that will take a vector argument and return the result. """ if vec_func: def vfunc(x): return func(x, *args) else: def vfunc(x): if np.isscalar(x): return func(x, *args) x = np.asarray(x) # call with first point to get output type y0 = func(x[0], *args) n = len(x) dtype = getattr(y0, 'dtype', type(y0)) output = np.empty((n,), dtype=dtype) output[0] = y0 for i in range(1, n): output[i] = func(x[i], *args) return output return vfunc def quadrature(func, a, b, args=(), tol=1.49e-8, rtol=1.49e-8, maxiter=50, vec_func=True, miniter=1): """ Compute a definite integral using fixed-tolerance Gaussian quadrature. Integrate `func` from `a` to `b` using Gaussian quadrature with absolute tolerance `tol`. Parameters ---------- func : function A Python function or method to integrate. a : float Lower limit of integration. b : float Upper limit of integration. args : tuple, optional Extra arguments to pass to function. tol, rtol : float, optional Iteration stops when error between last two iterates is less than `tol` OR the relative change is less than `rtol`. maxiter : int, optional Maximum order of Gaussian quadrature. vec_func : bool, optional True or False if func handles arrays as arguments (is a "vector" function). Default is True. miniter : int, optional Minimum order of Gaussian quadrature. Returns ------- val : float Gaussian quadrature approximation (within tolerance) to integral. err : float Difference between last two estimates of the integral. See also -------- romberg: adaptive Romberg quadrature fixed_quad: fixed-order Gaussian quadrature quad: adaptive quadrature using QUADPACK dblquad: double integrals tplquad: triple integrals romb: integrator for sampled data simps: integrator for sampled data cumtrapz: cumulative integration for sampled data ode: ODE integrator odeint: ODE integrator Examples -------- >>> from scipy import integrate >>> f = lambda x: x**8 >>> integrate.quadrature(f, 0.0, 1.0) (0.11111111111111106, 4.163336342344337e-17) >>> print(1/9.0) # analytical result 0.1111111111111111 >>> integrate.quadrature(np.cos, 0.0, np.pi/2) (0.9999999999999536, 3.9611425250996035e-11) >>> np.sin(np.pi/2)-np.sin(0) # analytical result 1.0 """ if not isinstance(args, tuple): args = (args,) vfunc = vectorize1(func, args, vec_func=vec_func) val = np.inf err = np.inf maxiter = max(miniter+1, maxiter) for n in range(miniter, maxiter+1): newval = fixed_quad(vfunc, a, b, (), n)[0] err = abs(newval-val) val = newval if err < tol or err < rtol*abs(val): break else: warnings.warn( "maxiter (%d) exceeded. Latest difference = %e" % (maxiter, err), AccuracyWarning) return val, err def tupleset(t, i, value): l = list(t) l[i] = value return tuple(l) def cumtrapz(y, x=None, dx=1.0, axis=-1, initial=None): """ Cumulatively integrate y(x) using the composite trapezoidal rule. Parameters ---------- y : array_like Values to integrate. x : array_like, optional The coordinate to integrate along. If None (default), use spacing `dx` between consecutive elements in `y`. dx : float, optional Spacing between elements of `y`. Only used if `x` is None. axis : int, optional Specifies the axis to cumulate. Default is -1 (last axis). initial : scalar, optional If given, insert this value at the beginning of the returned result. Typically this value should be 0. Default is None, which means no value at ``x[0]`` is returned and `res` has one element less than `y` along the axis of integration. Returns ------- res : ndarray The result of cumulative integration of `y` along `axis`. If `initial` is None, the shape is such that the axis of integration has one less value than `y`. If `initial` is given, the shape is equal to that of `y`. See Also -------- numpy.cumsum, numpy.cumprod quad: adaptive quadrature using QUADPACK romberg: adaptive Romberg quadrature quadrature: adaptive Gaussian quadrature fixed_quad: fixed-order Gaussian quadrature dblquad: double integrals tplquad: triple integrals romb: integrators for sampled data ode: ODE integrators odeint: ODE integrators Examples -------- >>> from scipy import integrate >>> import matplotlib.pyplot as plt >>> x = np.linspace(-2, 2, num=20) >>> y = x >>> y_int = integrate.cumtrapz(y, x, initial=0) >>> plt.plot(x, y_int, 'ro', x, y[0] + 0.5 * x**2, 'b-') >>> plt.show() """ y = np.asarray(y) if x is None: d = dx else: x = np.asarray(x) if x.ndim == 1: d = np.diff(x) # reshape to correct shape shape = [1] * y.ndim shape[axis] = -1 d = d.reshape(shape) elif len(x.shape) != len(y.shape): raise ValueError("If given, shape of x must be 1-D or the " "same as y.") else: d = np.diff(x, axis=axis) if d.shape[axis] != y.shape[axis] - 1: raise ValueError("If given, length of x along axis must be the " "same as y.") nd = len(y.shape) slice1 = tupleset((slice(None),)*nd, axis, slice(1, None)) slice2 = tupleset((slice(None),)*nd, axis, slice(None, -1)) res = np.cumsum(d * (y[slice1] + y[slice2]) / 2.0, axis=axis) if initial is not None: if not np.isscalar(initial): raise ValueError("`initial` parameter should be a scalar.") shape = list(res.shape) shape[axis] = 1 res = np.concatenate([np.full(shape, initial, dtype=res.dtype), res], axis=axis) return res def _basic_simps(y, start, stop, x, dx, axis): nd = len(y.shape) if start is None: start = 0 step = 2 slice_all = (slice(None),)*nd slice0 = tupleset(slice_all, axis, slice(start, stop, step)) slice1 = tupleset(slice_all, axis, slice(start+1, stop+1, step)) slice2 = tupleset(slice_all, axis, slice(start+2, stop+2, step)) if x is None: # Even-spaced Simpson's rule. result = np.sum(dx/3.0 * (y[slice0]+4*y[slice1]+y[slice2]), axis=axis) else: # Account for possibly different spacings. # Simpson's rule changes a bit. h = np.diff(x, axis=axis) sl0 = tupleset(slice_all, axis, slice(start, stop, step)) sl1 = tupleset(slice_all, axis, slice(start+1, stop+1, step)) h0 = h[sl0] h1 = h[sl1] hsum = h0 + h1 hprod = h0 * h1 h0divh1 = h0 / h1 tmp = hsum/6.0 * (y[slice0]*(2-1.0/h0divh1) + y[slice1]*hsum*hsum/hprod + y[slice2]*(2-h0divh1)) result = np.sum(tmp, axis=axis) return result def simps(y, x=None, dx=1, axis=-1, even='avg'): """ Integrate y(x) using samples along the given axis and the composite Simpson's rule. If x is None, spacing of dx is assumed. If there are an even number of samples, N, then there are an odd number of intervals (N-1), but Simpson's rule requires an even number of intervals. The parameter 'even' controls how this is handled. Parameters ---------- y : array_like Array to be integrated. x : array_like, optional If given, the points at which `y` is sampled. dx : int, optional Spacing of integration points along axis of `x`. Only used when `x` is None. Default is 1. axis : int, optional Axis along which to integrate. Default is the last axis. even : str {'avg', 'first', 'last'}, optional 'avg' : Average two results:1) use the first N-2 intervals with a trapezoidal rule on the last interval and 2) use the last N-2 intervals with a trapezoidal rule on the first interval. 'first' : Use Simpson's rule for the first N-2 intervals with a trapezoidal rule on the last interval. 'last' : Use Simpson's rule for the last N-2 intervals with a trapezoidal rule on the first interval. See Also -------- quad: adaptive quadrature using QUADPACK romberg: adaptive Romberg quadrature quadrature: adaptive Gaussian quadrature fixed_quad: fixed-order Gaussian quadrature dblquad: double integrals tplquad: triple integrals romb: integrators for sampled data cumtrapz: cumulative integration for sampled data ode: ODE integrators odeint: ODE integrators Notes ----- For an odd number of samples that are equally spaced the result is exact if the function is a polynomial of order 3 or less. If the samples are not equally spaced, then the result is exact only if the function is a polynomial of order 2 or less. Examples -------- >>> from scipy import integrate >>> x = np.arange(0, 10) >>> y = np.arange(0, 10) >>> integrate.simps(y, x) 40.5 >>> y = np.power(x, 3) >>> integrate.simps(y, x) 1642.5 >>> integrate.quad(lambda x: x**3, 0, 9)[0] 1640.25 >>> integrate.simps(y, x, even='first') 1644.5 """ y = np.asarray(y) nd = len(y.shape) N = y.shape[axis] last_dx = dx first_dx = dx returnshape = 0 if x is not None: x = np.asarray(x) if len(x.shape) == 1: shapex = [1] * nd shapex[axis] = x.shape[0] saveshape = x.shape returnshape = 1 x = x.reshape(tuple(shapex)) elif len(x.shape) != len(y.shape): raise ValueError("If given, shape of x must be 1-D or the " "same as y.") if x.shape[axis] != N: raise ValueError("If given, length of x along axis must be the " "same as y.") if N % 2 == 0: val = 0.0 result = 0.0 slice1 = (slice(None),)*nd slice2 = (slice(None),)*nd if even not in ['avg', 'last', 'first']: raise ValueError("Parameter 'even' must be " "'avg', 'last', or 'first'.") # Compute using Simpson's rule on first intervals if even in ['avg', 'first']: slice1 = tupleset(slice1, axis, -1) slice2 = tupleset(slice2, axis, -2) if x is not None: last_dx = x[slice1] - x[slice2] val += 0.5*last_dx*(y[slice1]+y[slice2]) result = _basic_simps(y, 0, N-3, x, dx, axis) # Compute using Simpson's rule on last set of intervals if even in ['avg', 'last']: slice1 = tupleset(slice1, axis, 0) slice2 = tupleset(slice2, axis, 1) if x is not None: first_dx = x[tuple(slice2)] - x[tuple(slice1)] val += 0.5*first_dx*(y[slice2]+y[slice1]) result += _basic_simps(y, 1, N-2, x, dx, axis) if even == 'avg': val /= 2.0 result /= 2.0 result = result + val else: result = _basic_simps(y, 0, N-2, x, dx, axis) if returnshape: x = x.reshape(saveshape) return result def romb(y, dx=1.0, axis=-1, show=False): """ Romberg integration using samples of a function. Parameters ---------- y : array_like A vector of ``2**k + 1`` equally-spaced samples of a function. dx : float, optional The sample spacing. Default is 1. axis : int, optional The axis along which to integrate. Default is -1 (last axis). show : bool, optional When `y` is a single 1-D array, then if this argument is True print the table showing Richardson extrapolation from the samples. Default is False. Returns ------- romb : ndarray The integrated result for `axis`. See also -------- quad : adaptive quadrature using QUADPACK romberg : adaptive Romberg quadrature quadrature : adaptive Gaussian quadrature fixed_quad : fixed-order Gaussian quadrature dblquad : double integrals tplquad : triple integrals simps : integrators for sampled data cumtrapz : cumulative integration for sampled data ode : ODE integrators odeint : ODE integrators Examples -------- >>> from scipy import integrate >>> x = np.arange(10, 14.25, 0.25) >>> y = np.arange(3, 12) >>> integrate.romb(y) 56.0 >>> y = np.sin(np.power(x, 2.5)) >>> integrate.romb(y) -0.742561336672229 >>> integrate.romb(y, show=True) Richardson Extrapolation Table for Romberg Integration ==================================================================== -0.81576 4.63862 6.45674 -1.10581 -3.02062 -3.65245 -2.57379 -3.06311 -3.06595 -3.05664 -1.34093 -0.92997 -0.78776 -0.75160 -0.74256 ==================================================================== -0.742561336672229 """ y = np.asarray(y) nd = len(y.shape) Nsamps = y.shape[axis] Ninterv = Nsamps-1 n = 1 k = 0 while n < Ninterv: n <<= 1 k += 1 if n != Ninterv: raise ValueError("Number of samples must be one plus a " "non-negative power of 2.") R = {} slice_all = (slice(None),) * nd slice0 = tupleset(slice_all, axis, 0) slicem1 = tupleset(slice_all, axis, -1) h = Ninterv * np.asarray(dx, dtype=float) R[(0, 0)] = (y[slice0] + y[slicem1])/2.0*h slice_R = slice_all start = stop = step = Ninterv for i in range(1, k+1): start >>= 1 slice_R = tupleset(slice_R, axis, slice(start, stop, step)) step >>= 1 R[(i, 0)] = 0.5*(R[(i-1, 0)] + h*y[slice_R].sum(axis=axis)) for j in range(1, i+1): prev = R[(i, j-1)] R[(i, j)] = prev + (prev-R[(i-1, j-1)]) / ((1 << (2*j))-1) h /= 2.0 if show: if not np.isscalar(R[(0, 0)]): print("*** Printing table only supported for integrals" + " of a single data set.") else: try: precis = show[0] except (TypeError, IndexError): precis = 5 try: width = show[1] except (TypeError, IndexError): width = 8 formstr = "%%%d.%df" % (width, precis) title = "Richardson Extrapolation Table for Romberg Integration" print("", title.center(68), "=" * 68, sep="\n", end="\n") for i in range(k+1): for j in range(i+1): print(formstr % R[(i, j)], end=" ") print() print("=" * 68) print() return R[(k, k)] # Romberg quadratures for numeric integration. # # Written by Scott M. Ransom <ransom@cfa.harvard.edu> # last revision: 14 Nov 98 # # Cosmetic changes by Konrad Hinsen <hinsen@cnrs-orleans.fr> # last revision: 1999-7-21 # # Adapted to SciPy by Travis Oliphant <oliphant.travis@ieee.org> # last revision: Dec 2001 def _difftrap(function, interval, numtraps): """ Perform part of the trapezoidal rule to integrate a function. Assume that we had called difftrap with all lower powers-of-2 starting with 1. Calling difftrap only returns the summation of the new ordinates. It does _not_ multiply by the width of the trapezoids. This must be performed by the caller. 'function' is the function to evaluate (must accept vector arguments). 'interval' is a sequence with lower and upper limits of integration. 'numtraps' is the number of trapezoids to use (must be a power-of-2). """ if numtraps <= 0: raise ValueError("numtraps must be > 0 in difftrap().") elif numtraps == 1: return 0.5*(function(interval[0])+function(interval[1])) else: numtosum = numtraps/2 h = float(interval[1]-interval[0])/numtosum lox = interval[0] + 0.5 * h points = lox + h * np.arange(numtosum) s = np.sum(function(points), axis=0) return s def _romberg_diff(b, c, k): """ Compute the differences for the Romberg quadrature corrections. See Forman Acton's "Real Computing Made Real," p 143. """ tmp = 4.0**k return (tmp * c - b)/(tmp - 1.0) def _printresmat(function, interval, resmat): # Print the Romberg result matrix. i = j = 0 print('Romberg integration of', repr(function), end=' ') print('from', interval) print('') print('%6s %9s %9s' % ('Steps', 'StepSize', 'Results')) for i in range(len(resmat)): print('%6d %9f' % (2**i, (interval[1]-interval[0])/(2.**i)), end=' ') for j in range(i+1): print('%9f' % (resmat[i][j]), end=' ') print('') print('') print('The final result is', resmat[i][j], end=' ') print('after', 2**(len(resmat)-1)+1, 'function evaluations.') def romberg(function, a, b, args=(), tol=1.48e-8, rtol=1.48e-8, show=False, divmax=10, vec_func=False): """ Romberg integration of a callable function or method. Returns the integral of `function` (a function of one variable) over the interval (`a`, `b`). If `show` is 1, the triangular array of the intermediate results will be printed. If `vec_func` is True (default is False), then `function` is assumed to support vector arguments. Parameters ---------- function : callable Function to be integrated. a : float Lower limit of integration. b : float Upper limit of integration. Returns ------- results : float Result of the integration. Other Parameters ---------------- args : tuple, optional Extra arguments to pass to function. Each element of `args` will be passed as a single argument to `func`. Default is to pass no extra arguments. tol, rtol : float, optional The desired absolute and relative tolerances. Defaults are 1.48e-8. show : bool, optional Whether to print the results. Default is False. divmax : int, optional Maximum order of extrapolation. Default is 10. vec_func : bool, optional Whether `func` handles arrays as arguments (i.e., whether it is a "vector" function). Default is False. See Also -------- fixed_quad : Fixed-order Gaussian quadrature. quad : Adaptive quadrature using QUADPACK. dblquad : Double integrals. tplquad : Triple integrals. romb : Integrators for sampled data. simps : Integrators for sampled data. cumtrapz : Cumulative integration for sampled data. ode : ODE integrator. odeint : ODE integrator. References ---------- .. [1] 'Romberg's method' https://en.wikipedia.org/wiki/Romberg%27s_method Examples -------- Integrate a gaussian from 0 to 1 and compare to the error function. >>> from scipy import integrate >>> from scipy.special import erf >>> gaussian = lambda x: 1/np.sqrt(np.pi) * np.exp(-x**2) >>> result = integrate.romberg(gaussian, 0, 1, show=True) Romberg integration of <function vfunc at ...> from [0, 1] :: Steps StepSize Results 1 1.000000 0.385872 2 0.500000 0.412631 0.421551 4 0.250000 0.419184 0.421368 0.421356 8 0.125000 0.420810 0.421352 0.421350 0.421350 16 0.062500 0.421215 0.421350 0.421350 0.421350 0.421350 32 0.031250 0.421317 0.421350 0.421350 0.421350 0.421350 0.421350 The final result is 0.421350396475 after 33 function evaluations. >>> print("%g %g" % (2*result, erf(1))) 0.842701 0.842701 """ if np.isinf(a) or np.isinf(b): raise ValueError("Romberg integration only available " "for finite limits.") vfunc = vectorize1(function, args, vec_func=vec_func) n = 1 interval = [a, b] intrange = b - a ordsum = _difftrap(vfunc, interval, n) result = intrange * ordsum resmat = [[result]] err = np.inf last_row = resmat[0] for i in range(1, divmax+1): n *= 2 ordsum += _difftrap(vfunc, interval, n) row = [intrange * ordsum / n] for k in range(i): row.append(_romberg_diff(last_row[k], row[k], k+1)) result = row[i] lastresult = last_row[i-1] if show: resmat.append(row) err = abs(result - lastresult) if err < tol or err < rtol * abs(result): break last_row = row else: warnings.warn( "divmax (%d) exceeded. Latest difference = %e" % (divmax, err), AccuracyWarning) if show: _printresmat(vfunc, interval, resmat) return result # Coefficients for Newton-Cotes quadrature # # These are the points being used # to construct the local interpolating polynomial # a are the weights for Newton-Cotes integration # B is the error coefficient. # error in these coefficients grows as N gets larger. # or as samples are closer and closer together # You can use maxima to find these rational coefficients # for equally spaced data using the commands # a(i,N) := integrate(product(r-j,j,0,i-1) * product(r-j,j,i+1,N),r,0,N) / ((N-i)! * i!) * (-1)^(N-i); # Be(N) := N^(N+2)/(N+2)! * (N/(N+3) - sum((i/N)^(N+2)*a(i,N),i,0,N)); # Bo(N) := N^(N+1)/(N+1)! * (N/(N+2) - sum((i/N)^(N+1)*a(i,N),i,0,N)); # B(N) := (if (mod(N,2)=0) then Be(N) else Bo(N)); # # pre-computed for equally-spaced weights # # num_a, den_a, int_a, num_B, den_B = _builtincoeffs[N] # # a = num_a*array(int_a)/den_a # B = num_B*1.0 / den_B # # integrate(f(x),x,x_0,x_N) = dx*sum(a*f(x_i)) + B*(dx)^(2k+3) f^(2k+2)(x*) # where k = N // 2 # _builtincoeffs = { 1: (1,2,[1,1],-1,12), 2: (1,3,[1,4,1],-1,90), 3: (3,8,[1,3,3,1],-3,80), 4: (2,45,[7,32,12,32,7],-8,945), 5: (5,288,[19,75,50,50,75,19],-275,12096), 6: (1,140,[41,216,27,272,27,216,41],-9,1400), 7: (7,17280,[751,3577,1323,2989,2989,1323,3577,751],-8183,518400), 8: (4,14175,[989,5888,-928,10496,-4540,10496,-928,5888,989], -2368,467775), 9: (9,89600,[2857,15741,1080,19344,5778,5778,19344,1080, 15741,2857], -4671, 394240), 10: (5,299376,[16067,106300,-48525,272400,-260550,427368, -260550,272400,-48525,106300,16067], -673175, 163459296), 11: (11,87091200,[2171465,13486539,-3237113, 25226685,-9595542, 15493566,15493566,-9595542,25226685,-3237113, 13486539,2171465], -2224234463, 237758976000), 12: (1, 5255250, [1364651,9903168,-7587864,35725120,-51491295, 87516288,-87797136,87516288,-51491295,35725120, -7587864,9903168,1364651], -3012, 875875), 13: (13, 402361344000,[8181904909, 56280729661, -31268252574, 156074417954,-151659573325,206683437987, -43111992612,-43111992612,206683437987, -151659573325,156074417954,-31268252574, 56280729661,8181904909], -2639651053, 344881152000), 14: (7, 2501928000, [90241897,710986864,-770720657,3501442784, -6625093363,12630121616,-16802270373,19534438464, -16802270373,12630121616,-6625093363,3501442784, -770720657,710986864,90241897], -3740727473, 1275983280000) } def newton_cotes(rn, equal=0): r""" Return weights and error coefficient for Newton-Cotes integration. Suppose we have (N+1) samples of f at the positions x_0, x_1, ..., x_N. Then an N-point Newton-Cotes formula for the integral between x_0 and x_N is: :math:`\int_{x_0}^{x_N} f(x)dx = \Delta x \sum_{i=0}^{N} a_i f(x_i) + B_N (\Delta x)^{N+2} f^{N+1} (\xi)` where :math:`\xi \in [x_0,x_N]` and :math:`\Delta x = \frac{x_N-x_0}{N}` is the average samples spacing. If the samples are equally-spaced and N is even, then the error term is :math:`B_N (\Delta x)^{N+3} f^{N+2}(\xi)`. Parameters ---------- rn : int The integer order for equally-spaced data or the relative positions of the samples with the first sample at 0 and the last at N, where N+1 is the length of `rn`. N is the order of the Newton-Cotes integration. equal : int, optional Set to 1 to enforce equally spaced data. Returns ------- an : ndarray 1-D array of weights to apply to the function at the provided sample positions. B : float Error coefficient. Examples -------- Compute the integral of sin(x) in [0, :math:`\pi`]: >>> from scipy.integrate import newton_cotes >>> def f(x): ... return np.sin(x) >>> a = 0 >>> b = np.pi >>> exact = 2 >>> for N in [2, 4, 6, 8, 10]: ... x = np.linspace(a, b, N + 1) ... an, B = newton_cotes(N, 1) ... dx = (b - a) / N ... quad = dx * np.sum(an * f(x)) ... error = abs(quad - exact) ... print('{:2d} {:10.9f} {:.5e}'.format(N, quad, error)) ... 2 2.094395102 9.43951e-02 4 1.998570732 1.42927e-03 6 2.000017814 1.78136e-05 8 1.999999835 1.64725e-07 10 2.000000001 1.14677e-09 Notes ----- Normally, the Newton-Cotes rules are used on smaller integration regions and a composite rule is used to return the total integral. """ try: N = len(rn)-1 if equal: rn = np.arange(N+1) elif np.all(np.diff(rn) == 1): equal = 1 except Exception: N = rn rn = np.arange(N+1) equal = 1 if equal and N in _builtincoeffs: na, da, vi, nb, db = _builtincoeffs[N] an = na * np.array(vi, dtype=float) / da return an, float(nb)/db if (rn[0] != 0) or (rn[-1] != N): raise ValueError("The sample positions must start at 0" " and end at N") yi = rn / float(N) ti = 2 * yi - 1 nvec = np.arange(N+1) C = ti ** nvec[:, np.newaxis] Cinv = np.linalg.inv(C) # improve precision of result for i in range(2): Cinv = 2*Cinv - Cinv.dot(C).dot(Cinv) vec = 2.0 / (nvec[::2]+1) ai = Cinv[:, ::2].dot(vec) * (N / 2.) if (N % 2 == 0) and equal: BN = N/(N+3.) power = N+2 else: BN = N/(N+2.) power = N+1 BN = BN - np.dot(yi**power, ai) p1 = power+1 fac = power*math.log(N) - gammaln(p1) fac = math.exp(fac) return ai, BN*fac
32.278807
103
0.578135
import functools import numpy as np import math import types import warnings from numpy import trapz from scipy.special import roots_legendre from scipy.special import gammaln __all__ = ['fixed_quad', 'quadrature', 'romberg', 'trapz', 'simps', 'romb', 'cumtrapz', 'newton_cotes'] # Make See Also linking for our local copy work properly def _copy_func(f): g = types.FunctionType(f.__code__, f.__globals__, name=f.__name__, argdefs=f.__defaults__, closure=f.__closure__) g = functools.update_wrapper(g, f) g.__kwdefaults__ = f.__kwdefaults__ return g trapz = _copy_func(trapz) if trapz.__doc__: trapz.__doc__ = trapz.__doc__.replace('sum, cumsum', 'numpy.cumsum') class AccuracyWarning(Warning): pass def _cached_roots_legendre(n): if n in _cached_roots_legendre.cache: return _cached_roots_legendre.cache[n] _cached_roots_legendre.cache[n] = roots_legendre(n) return _cached_roots_legendre.cache[n] _cached_roots_legendre.cache = dict() def fixed_quad(func, a, b, args=(), n=5): x, w = _cached_roots_legendre(n) x = np.real(x) if np.isinf(a) or np.isinf(b): raise ValueError("Gaussian quadrature is only available for " "finite limits.") y = (b-a)*(x+1)/2.0 + a return (b-a)/2.0 * np.sum(w*func(y, *args), axis=-1), None def vectorize1(func, args=(), vec_func=False): if vec_func: def vfunc(x): return func(x, *args) else: def vfunc(x): if np.isscalar(x): return func(x, *args) x = np.asarray(x) # call with first point to get output type y0 = func(x[0], *args) n = len(x) dtype = getattr(y0, 'dtype', type(y0)) output = np.empty((n,), dtype=dtype) output[0] = y0 for i in range(1, n): output[i] = func(x[i], *args) return output return vfunc def quadrature(func, a, b, args=(), tol=1.49e-8, rtol=1.49e-8, maxiter=50, vec_func=True, miniter=1): if not isinstance(args, tuple): args = (args,) vfunc = vectorize1(func, args, vec_func=vec_func) val = np.inf err = np.inf maxiter = max(miniter+1, maxiter) for n in range(miniter, maxiter+1): newval = fixed_quad(vfunc, a, b, (), n)[0] err = abs(newval-val) val = newval if err < tol or err < rtol*abs(val): break else: warnings.warn( "maxiter (%d) exceeded. Latest difference = %e" % (maxiter, err), AccuracyWarning) return val, err def tupleset(t, i, value): l = list(t) l[i] = value return tuple(l) def cumtrapz(y, x=None, dx=1.0, axis=-1, initial=None): y = np.asarray(y) if x is None: d = dx else: x = np.asarray(x) if x.ndim == 1: d = np.diff(x) # reshape to correct shape shape = [1] * y.ndim shape[axis] = -1 d = d.reshape(shape) elif len(x.shape) != len(y.shape): raise ValueError("If given, shape of x must be 1-D or the " "same as y.") else: d = np.diff(x, axis=axis) if d.shape[axis] != y.shape[axis] - 1: raise ValueError("If given, length of x along axis must be the " "same as y.") nd = len(y.shape) slice1 = tupleset((slice(None),)*nd, axis, slice(1, None)) slice2 = tupleset((slice(None),)*nd, axis, slice(None, -1)) res = np.cumsum(d * (y[slice1] + y[slice2]) / 2.0, axis=axis) if initial is not None: if not np.isscalar(initial): raise ValueError("`initial` parameter should be a scalar.") shape = list(res.shape) shape[axis] = 1 res = np.concatenate([np.full(shape, initial, dtype=res.dtype), res], axis=axis) return res def _basic_simps(y, start, stop, x, dx, axis): nd = len(y.shape) if start is None: start = 0 step = 2 slice_all = (slice(None),)*nd slice0 = tupleset(slice_all, axis, slice(start, stop, step)) slice1 = tupleset(slice_all, axis, slice(start+1, stop+1, step)) slice2 = tupleset(slice_all, axis, slice(start+2, stop+2, step)) if x is None: # Even-spaced Simpson's rule. result = np.sum(dx/3.0 * (y[slice0]+4*y[slice1]+y[slice2]), axis=axis) else: h = np.diff(x, axis=axis) sl0 = tupleset(slice_all, axis, slice(start, stop, step)) sl1 = tupleset(slice_all, axis, slice(start+1, stop+1, step)) h0 = h[sl0] h1 = h[sl1] hsum = h0 + h1 hprod = h0 * h1 h0divh1 = h0 / h1 tmp = hsum/6.0 * (y[slice0]*(2-1.0/h0divh1) + y[slice1]*hsum*hsum/hprod + y[slice2]*(2-h0divh1)) result = np.sum(tmp, axis=axis) return result def simps(y, x=None, dx=1, axis=-1, even='avg'): y = np.asarray(y) nd = len(y.shape) N = y.shape[axis] last_dx = dx first_dx = dx returnshape = 0 if x is not None: x = np.asarray(x) if len(x.shape) == 1: shapex = [1] * nd shapex[axis] = x.shape[0] saveshape = x.shape returnshape = 1 x = x.reshape(tuple(shapex)) elif len(x.shape) != len(y.shape): raise ValueError("If given, shape of x must be 1-D or the " "same as y.") if x.shape[axis] != N: raise ValueError("If given, length of x along axis must be the " "same as y.") if N % 2 == 0: val = 0.0 result = 0.0 slice1 = (slice(None),)*nd slice2 = (slice(None),)*nd if even not in ['avg', 'last', 'first']: raise ValueError("Parameter 'even' must be " "'avg', 'last', or 'first'.") # Compute using Simpson's rule on first intervals if even in ['avg', 'first']: slice1 = tupleset(slice1, axis, -1) slice2 = tupleset(slice2, axis, -2) if x is not None: last_dx = x[slice1] - x[slice2] val += 0.5*last_dx*(y[slice1]+y[slice2]) result = _basic_simps(y, 0, N-3, x, dx, axis) if even in ['avg', 'last']: slice1 = tupleset(slice1, axis, 0) slice2 = tupleset(slice2, axis, 1) if x is not None: first_dx = x[tuple(slice2)] - x[tuple(slice1)] val += 0.5*first_dx*(y[slice2]+y[slice1]) result += _basic_simps(y, 1, N-2, x, dx, axis) if even == 'avg': val /= 2.0 result /= 2.0 result = result + val else: result = _basic_simps(y, 0, N-2, x, dx, axis) if returnshape: x = x.reshape(saveshape) return result def romb(y, dx=1.0, axis=-1, show=False): y = np.asarray(y) nd = len(y.shape) Nsamps = y.shape[axis] Ninterv = Nsamps-1 n = 1 k = 0 while n < Ninterv: n <<= 1 k += 1 if n != Ninterv: raise ValueError("Number of samples must be one plus a " "non-negative power of 2.") R = {} slice_all = (slice(None),) * nd slice0 = tupleset(slice_all, axis, 0) slicem1 = tupleset(slice_all, axis, -1) h = Ninterv * np.asarray(dx, dtype=float) R[(0, 0)] = (y[slice0] + y[slicem1])/2.0*h slice_R = slice_all start = stop = step = Ninterv for i in range(1, k+1): start >>= 1 slice_R = tupleset(slice_R, axis, slice(start, stop, step)) step >>= 1 R[(i, 0)] = 0.5*(R[(i-1, 0)] + h*y[slice_R].sum(axis=axis)) for j in range(1, i+1): prev = R[(i, j-1)] R[(i, j)] = prev + (prev-R[(i-1, j-1)]) / ((1 << (2*j))-1) h /= 2.0 if show: if not np.isscalar(R[(0, 0)]): print("*** Printing table only supported for integrals" + " of a single data set.") else: try: precis = show[0] except (TypeError, IndexError): precis = 5 try: width = show[1] except (TypeError, IndexError): width = 8 formstr = "%%%d.%df" % (width, precis) title = "Richardson Extrapolation Table for Romberg Integration" print("", title.center(68), "=" * 68, sep="\n", end="\n") for i in range(k+1): for j in range(i+1): print(formstr % R[(i, j)], end=" ") print() print("=" * 68) print() return R[(k, k)] # Romberg quadratures for numeric integration. # # Written by Scott M. Ransom <ransom@cfa.harvard.edu> # last revision: 14 Nov 98 # # Cosmetic changes by Konrad Hinsen <hinsen@cnrs-orleans.fr> # last revision: 1999-7-21 # # Adapted to SciPy by Travis Oliphant <oliphant.travis@ieee.org> # last revision: Dec 2001 def _difftrap(function, interval, numtraps): if numtraps <= 0: raise ValueError("numtraps must be > 0 in difftrap().") elif numtraps == 1: return 0.5*(function(interval[0])+function(interval[1])) else: numtosum = numtraps/2 h = float(interval[1]-interval[0])/numtosum lox = interval[0] + 0.5 * h points = lox + h * np.arange(numtosum) s = np.sum(function(points), axis=0) return s def _romberg_diff(b, c, k): tmp = 4.0**k return (tmp * c - b)/(tmp - 1.0) def _printresmat(function, interval, resmat): # Print the Romberg result matrix. i = j = 0 print('Romberg integration of', repr(function), end=' ') print('from', interval) print('') print('%6s %9s %9s' % ('Steps', 'StepSize', 'Results')) for i in range(len(resmat)): print('%6d %9f' % (2**i, (interval[1]-interval[0])/(2.**i)), end=' ') for j in range(i+1): print('%9f' % (resmat[i][j]), end=' ') print('') print('') print('The final result is', resmat[i][j], end=' ') print('after', 2**(len(resmat)-1)+1, 'function evaluations.') def romberg(function, a, b, args=(), tol=1.48e-8, rtol=1.48e-8, show=False, divmax=10, vec_func=False): if np.isinf(a) or np.isinf(b): raise ValueError("Romberg integration only available " "for finite limits.") vfunc = vectorize1(function, args, vec_func=vec_func) n = 1 interval = [a, b] intrange = b - a ordsum = _difftrap(vfunc, interval, n) result = intrange * ordsum resmat = [[result]] err = np.inf last_row = resmat[0] for i in range(1, divmax+1): n *= 2 ordsum += _difftrap(vfunc, interval, n) row = [intrange * ordsum / n] for k in range(i): row.append(_romberg_diff(last_row[k], row[k], k+1)) result = row[i] lastresult = last_row[i-1] if show: resmat.append(row) err = abs(result - lastresult) if err < tol or err < rtol * abs(result): break last_row = row else: warnings.warn( "divmax (%d) exceeded. Latest difference = %e" % (divmax, err), AccuracyWarning) if show: _printresmat(vfunc, interval, resmat) return result # Coefficients for Newton-Cotes quadrature # # These are the points being used # to construct the local interpolating polynomial # a are the weights for Newton-Cotes integration # B is the error coefficient. # error in these coefficients grows as N gets larger. # or as samples are closer and closer together # You can use maxima to find these rational coefficients # for equally spaced data using the commands # a(i,N) := integrate(product(r-j,j,0,i-1) * product(r-j,j,i+1,N),r,0,N) / ((N-i)! * i!) * (-1)^(N-i); # Be(N) := N^(N+2)/(N+2)! * (N/(N+3) - sum((i/N)^(N+2)*a(i,N),i,0,N)); # Bo(N) := N^(N+1)/(N+1)! * (N/(N+2) - sum((i/N)^(N+1)*a(i,N),i,0,N)); # B(N) := (if (mod(N,2)=0) then Be(N) else Bo(N)); # # pre-computed for equally-spaced weights # # num_a, den_a, int_a, num_B, den_B = _builtincoeffs[N] # # a = num_a*array(int_a)/den_a # B = num_B*1.0 / den_B # # integrate(f(x),x,x_0,x_N) = dx*sum(a*f(x_i)) + B*(dx)^(2k+3) f^(2k+2)(x*) # where k = N // 2 # _builtincoeffs = { 1: (1,2,[1,1],-1,12), 2: (1,3,[1,4,1],-1,90), 3: (3,8,[1,3,3,1],-3,80), 4: (2,45,[7,32,12,32,7],-8,945), 5: (5,288,[19,75,50,50,75,19],-275,12096), 6: (1,140,[41,216,27,272,27,216,41],-9,1400), 7: (7,17280,[751,3577,1323,2989,2989,1323,3577,751],-8183,518400), 8: (4,14175,[989,5888,-928,10496,-4540,10496,-928,5888,989], -2368,467775), 9: (9,89600,[2857,15741,1080,19344,5778,5778,19344,1080, 15741,2857], -4671, 394240), 10: (5,299376,[16067,106300,-48525,272400,-260550,427368, -260550,272400,-48525,106300,16067], -673175, 163459296), 11: (11,87091200,[2171465,13486539,-3237113, 25226685,-9595542, 15493566,15493566,-9595542,25226685,-3237113, 13486539,2171465], -2224234463, 237758976000), 12: (1, 5255250, [1364651,9903168,-7587864,35725120,-51491295, 87516288,-87797136,87516288,-51491295,35725120, -7587864,9903168,1364651], -3012, 875875), 13: (13, 402361344000,[8181904909, 56280729661, -31268252574, 156074417954,-151659573325,206683437987, -43111992612,-43111992612,206683437987, -151659573325,156074417954,-31268252574, 56280729661,8181904909], -2639651053, 344881152000), 14: (7, 2501928000, [90241897,710986864,-770720657,3501442784, -6625093363,12630121616,-16802270373,19534438464, -16802270373,12630121616,-6625093363,3501442784, -770720657,710986864,90241897], -3740727473, 1275983280000) } def newton_cotes(rn, equal=0): try: N = len(rn)-1 if equal: rn = np.arange(N+1) elif np.all(np.diff(rn) == 1): equal = 1 except Exception: N = rn rn = np.arange(N+1) equal = 1 if equal and N in _builtincoeffs: na, da, vi, nb, db = _builtincoeffs[N] an = na * np.array(vi, dtype=float) / da return an, float(nb)/db if (rn[0] != 0) or (rn[-1] != N): raise ValueError("The sample positions must start at 0" " and end at N") yi = rn / float(N) ti = 2 * yi - 1 nvec = np.arange(N+1) C = ti ** nvec[:, np.newaxis] Cinv = np.linalg.inv(C) # improve precision of result for i in range(2): Cinv = 2*Cinv - Cinv.dot(C).dot(Cinv) vec = 2.0 / (nvec[::2]+1) ai = Cinv[:, ::2].dot(vec) * (N / 2.) if (N % 2 == 0) and equal: BN = N/(N+3.) power = N+2 else: BN = N/(N+2.) power = N+1 BN = BN - np.dot(yi**power, ai) p1 = power+1 fac = power*math.log(N) - gammaln(p1) fac = math.exp(fac) return ai, BN*fac
true
true
f70a96e43b69336d19518c9d33a4c86634d2adbd
3,541
py
Python
indy_common/authorize/auth_cons_strategies.py
Rob-S/indy-node
0aefbda62c5a7412d7e03b2fb9795c500ea67e9f
[ "Apache-2.0" ]
627
2017-07-06T12:38:08.000Z
2022-03-30T13:18:43.000Z
indy_common/authorize/auth_cons_strategies.py
Rob-S/indy-node
0aefbda62c5a7412d7e03b2fb9795c500ea67e9f
[ "Apache-2.0" ]
580
2017-06-29T17:59:57.000Z
2022-03-29T21:37:52.000Z
indy_common/authorize/auth_cons_strategies.py
Rob-S/indy-node
0aefbda62c5a7412d7e03b2fb9795c500ea67e9f
[ "Apache-2.0" ]
704
2017-06-29T17:45:34.000Z
2022-03-30T07:08:58.000Z
from abc import abstractmethod, ABCMeta from indy_common.authorize.auth_actions import split_action_id from indy_common.authorize.auth_constraints import AbstractAuthConstraint, AbstractConstraintSerializer from indy_common.state import config from plenum.common.metrics_collector import MetricsName, MetricsCollector from state.pruning_state import PruningState from stp_core.common.log import getlogger logger = getlogger() class AbstractAuthStrategy(metaclass=ABCMeta): def __init__(self, auth_map): self.auth_map = auth_map @abstractmethod def get_auth_constraint(self, action_id) -> AbstractAuthConstraint: raise NotImplementedError() @abstractmethod def _find_auth_constraint_key(self, action_id, auth_map): raise NotImplementedError() @staticmethod def is_accepted_action_id(from_auth_map, from_req): am = split_action_id(from_auth_map) r = split_action_id(from_req) if r.prefix != am.prefix: return False if r.txn_type != am.txn_type: return False if r.field != am.field and \ am.field != '*': return False if r.old_value != am.old_value and \ am.old_value != '*': return False if r.new_value != am.new_value and \ am.new_value != '*': return False return True class LocalAuthStrategy(AbstractAuthStrategy): def get_auth_constraint(self, action_id) -> AbstractAuthConstraint: am_id = self._find_auth_constraint_key(action_id, self.auth_map) return self.auth_map.get(am_id) def _find_auth_constraint_key(self, action_id, auth_map): for am_id in auth_map.keys(): if self.is_accepted_action_id(am_id, action_id): return am_id class ConfigLedgerAuthStrategy(AbstractAuthStrategy): def __init__(self, auth_map, state: PruningState, serializer: AbstractConstraintSerializer, metrics: MetricsCollector = None): super().__init__(auth_map=auth_map) self.state = state self.serializer = serializer self.metrics = metrics self.from_state_count = 0 def get_auth_constraint(self, action_id: str) -> AbstractAuthConstraint: """ Find rule_id for incoming action_id and return AuthConstraint instance """ return self._find_auth_constraint(action_id, self.auth_map) def _find_auth_constraint(self, action_id, auth_map): am_id = self._find_auth_constraint_key(action_id, auth_map) if am_id: constraint = self.get_from_state(key=config.make_state_path_for_auth_rule(am_id)) if not constraint: return auth_map.get(am_id) logger.debug("Using auth constraint from state") if self.metrics: self.from_state_count += 1 self.metrics.add_event(MetricsName.AUTH_RULES_FROM_STATE_COUNT, self.from_state_count) return constraint def _find_auth_constraint_key(self, action_id, auth_map): for am_id in auth_map.keys(): if self.is_accepted_action_id(am_id, action_id): return am_id def get_from_state(self, key, isCommitted=False): from_state = self.state.get(key=key, isCommitted=isCommitted) if not from_state: return None return self.serializer.deserialize(from_state)
35.767677
103
0.663372
from abc import abstractmethod, ABCMeta from indy_common.authorize.auth_actions import split_action_id from indy_common.authorize.auth_constraints import AbstractAuthConstraint, AbstractConstraintSerializer from indy_common.state import config from plenum.common.metrics_collector import MetricsName, MetricsCollector from state.pruning_state import PruningState from stp_core.common.log import getlogger logger = getlogger() class AbstractAuthStrategy(metaclass=ABCMeta): def __init__(self, auth_map): self.auth_map = auth_map @abstractmethod def get_auth_constraint(self, action_id) -> AbstractAuthConstraint: raise NotImplementedError() @abstractmethod def _find_auth_constraint_key(self, action_id, auth_map): raise NotImplementedError() @staticmethod def is_accepted_action_id(from_auth_map, from_req): am = split_action_id(from_auth_map) r = split_action_id(from_req) if r.prefix != am.prefix: return False if r.txn_type != am.txn_type: return False if r.field != am.field and \ am.field != '*': return False if r.old_value != am.old_value and \ am.old_value != '*': return False if r.new_value != am.new_value and \ am.new_value != '*': return False return True class LocalAuthStrategy(AbstractAuthStrategy): def get_auth_constraint(self, action_id) -> AbstractAuthConstraint: am_id = self._find_auth_constraint_key(action_id, self.auth_map) return self.auth_map.get(am_id) def _find_auth_constraint_key(self, action_id, auth_map): for am_id in auth_map.keys(): if self.is_accepted_action_id(am_id, action_id): return am_id class ConfigLedgerAuthStrategy(AbstractAuthStrategy): def __init__(self, auth_map, state: PruningState, serializer: AbstractConstraintSerializer, metrics: MetricsCollector = None): super().__init__(auth_map=auth_map) self.state = state self.serializer = serializer self.metrics = metrics self.from_state_count = 0 def get_auth_constraint(self, action_id: str) -> AbstractAuthConstraint: return self._find_auth_constraint(action_id, self.auth_map) def _find_auth_constraint(self, action_id, auth_map): am_id = self._find_auth_constraint_key(action_id, auth_map) if am_id: constraint = self.get_from_state(key=config.make_state_path_for_auth_rule(am_id)) if not constraint: return auth_map.get(am_id) logger.debug("Using auth constraint from state") if self.metrics: self.from_state_count += 1 self.metrics.add_event(MetricsName.AUTH_RULES_FROM_STATE_COUNT, self.from_state_count) return constraint def _find_auth_constraint_key(self, action_id, auth_map): for am_id in auth_map.keys(): if self.is_accepted_action_id(am_id, action_id): return am_id def get_from_state(self, key, isCommitted=False): from_state = self.state.get(key=key, isCommitted=isCommitted) if not from_state: return None return self.serializer.deserialize(from_state)
true
true
f70a9784cb666d54aa8b8ed0284ab8fdc2ba59d2
3,518
py
Python
supervisor/backups/validate.py
mib1185/homeassistant-supervisor
d536ac8604e1b5a0f5008c92e3d98fcc8ab16bb5
[ "Apache-2.0" ]
597
2017-04-27T15:10:08.000Z
2019-12-18T16:02:57.000Z
supervisor/backups/validate.py
mib1185/homeassistant-supervisor
d536ac8604e1b5a0f5008c92e3d98fcc8ab16bb5
[ "Apache-2.0" ]
799
2017-05-02T00:26:07.000Z
2019-12-18T21:40:18.000Z
supervisor/backups/validate.py
mib1185/homeassistant-supervisor
d536ac8604e1b5a0f5008c92e3d98fcc8ab16bb5
[ "Apache-2.0" ]
173
2017-04-26T17:03:42.000Z
2019-12-15T10:41:57.000Z
"""Validate some things around restore.""" from __future__ import annotations from typing import Any import voluptuous as vol from ..backups.const import BackupType from ..const import ( ATTR_ADDONS, ATTR_COMPRESSED, ATTR_CRYPTO, ATTR_DATE, ATTR_DOCKER, ATTR_FOLDERS, ATTR_HOMEASSISTANT, ATTR_NAME, ATTR_PROTECTED, ATTR_REPOSITORIES, ATTR_SIZE, ATTR_SLUG, ATTR_TYPE, ATTR_VERSION, CRYPTO_AES128, FOLDER_ADDONS, FOLDER_HOMEASSISTANT, FOLDER_MEDIA, FOLDER_SHARE, FOLDER_SSL, ) from ..validate import SCHEMA_DOCKER_CONFIG, repositories, version_tag ALL_FOLDERS = [ FOLDER_SHARE, FOLDER_ADDONS, FOLDER_SSL, FOLDER_MEDIA, ] def unique_addons(addons_list): """Validate that an add-on is unique.""" single = {addon[ATTR_SLUG] for addon in addons_list} if len(single) != len(addons_list): raise vol.Invalid("Invalid addon list in backup!") from None return addons_list def v1_homeassistant( homeassistant_data: dict[str, Any] | None ) -> dict[str, Any] | None: """Cleanup homeassistant artefacts from v1.""" if not homeassistant_data: return None if homeassistant_data.get(ATTR_VERSION) is None: return None return homeassistant_data def v1_folderlist(folder_data: list[str]) -> list[str]: """Cleanup folder artefacts from v1.""" if FOLDER_HOMEASSISTANT in folder_data: folder_data.remove(FOLDER_HOMEASSISTANT) return folder_data def v1_protected(protected: bool | str) -> bool: """Cleanup old protected handling.""" if isinstance(protected, bool): return protected return True # pylint: disable=no-value-for-parameter SCHEMA_BACKUP = vol.Schema( { vol.Optional(ATTR_VERSION, default=1): vol.All(vol.Coerce(int), vol.In((1, 2))), vol.Required(ATTR_SLUG): str, vol.Required(ATTR_TYPE): vol.Coerce(BackupType), vol.Required(ATTR_NAME): str, vol.Required(ATTR_DATE): str, vol.Optional(ATTR_COMPRESSED, default=True): vol.Boolean(), vol.Optional(ATTR_PROTECTED, default=False): vol.All( v1_protected, vol.Boolean() ), vol.Optional(ATTR_CRYPTO, default=None): vol.Maybe(CRYPTO_AES128), vol.Optional(ATTR_HOMEASSISTANT, default=None): vol.All( v1_homeassistant, vol.Maybe( vol.Schema( { vol.Required(ATTR_VERSION): version_tag, vol.Optional(ATTR_SIZE, default=0): vol.Coerce(float), }, extra=vol.REMOVE_EXTRA, ) ), ), vol.Optional(ATTR_DOCKER, default=dict): SCHEMA_DOCKER_CONFIG, vol.Optional(ATTR_FOLDERS, default=list): vol.All( v1_folderlist, [vol.In(ALL_FOLDERS)], vol.Unique() ), vol.Optional(ATTR_ADDONS, default=list): vol.All( [ vol.Schema( { vol.Required(ATTR_SLUG): str, vol.Required(ATTR_NAME): str, vol.Required(ATTR_VERSION): version_tag, vol.Optional(ATTR_SIZE, default=0): vol.Coerce(float), }, extra=vol.REMOVE_EXTRA, ) ], unique_addons, ), vol.Optional(ATTR_REPOSITORIES, default=list): repositories, }, extra=vol.ALLOW_EXTRA, )
28.370968
88
0.608016
from __future__ import annotations from typing import Any import voluptuous as vol from ..backups.const import BackupType from ..const import ( ATTR_ADDONS, ATTR_COMPRESSED, ATTR_CRYPTO, ATTR_DATE, ATTR_DOCKER, ATTR_FOLDERS, ATTR_HOMEASSISTANT, ATTR_NAME, ATTR_PROTECTED, ATTR_REPOSITORIES, ATTR_SIZE, ATTR_SLUG, ATTR_TYPE, ATTR_VERSION, CRYPTO_AES128, FOLDER_ADDONS, FOLDER_HOMEASSISTANT, FOLDER_MEDIA, FOLDER_SHARE, FOLDER_SSL, ) from ..validate import SCHEMA_DOCKER_CONFIG, repositories, version_tag ALL_FOLDERS = [ FOLDER_SHARE, FOLDER_ADDONS, FOLDER_SSL, FOLDER_MEDIA, ] def unique_addons(addons_list): single = {addon[ATTR_SLUG] for addon in addons_list} if len(single) != len(addons_list): raise vol.Invalid("Invalid addon list in backup!") from None return addons_list def v1_homeassistant( homeassistant_data: dict[str, Any] | None ) -> dict[str, Any] | None: if not homeassistant_data: return None if homeassistant_data.get(ATTR_VERSION) is None: return None return homeassistant_data def v1_folderlist(folder_data: list[str]) -> list[str]: if FOLDER_HOMEASSISTANT in folder_data: folder_data.remove(FOLDER_HOMEASSISTANT) return folder_data def v1_protected(protected: bool | str) -> bool: if isinstance(protected, bool): return protected return True SCHEMA_BACKUP = vol.Schema( { vol.Optional(ATTR_VERSION, default=1): vol.All(vol.Coerce(int), vol.In((1, 2))), vol.Required(ATTR_SLUG): str, vol.Required(ATTR_TYPE): vol.Coerce(BackupType), vol.Required(ATTR_NAME): str, vol.Required(ATTR_DATE): str, vol.Optional(ATTR_COMPRESSED, default=True): vol.Boolean(), vol.Optional(ATTR_PROTECTED, default=False): vol.All( v1_protected, vol.Boolean() ), vol.Optional(ATTR_CRYPTO, default=None): vol.Maybe(CRYPTO_AES128), vol.Optional(ATTR_HOMEASSISTANT, default=None): vol.All( v1_homeassistant, vol.Maybe( vol.Schema( { vol.Required(ATTR_VERSION): version_tag, vol.Optional(ATTR_SIZE, default=0): vol.Coerce(float), }, extra=vol.REMOVE_EXTRA, ) ), ), vol.Optional(ATTR_DOCKER, default=dict): SCHEMA_DOCKER_CONFIG, vol.Optional(ATTR_FOLDERS, default=list): vol.All( v1_folderlist, [vol.In(ALL_FOLDERS)], vol.Unique() ), vol.Optional(ATTR_ADDONS, default=list): vol.All( [ vol.Schema( { vol.Required(ATTR_SLUG): str, vol.Required(ATTR_NAME): str, vol.Required(ATTR_VERSION): version_tag, vol.Optional(ATTR_SIZE, default=0): vol.Coerce(float), }, extra=vol.REMOVE_EXTRA, ) ], unique_addons, ), vol.Optional(ATTR_REPOSITORIES, default=list): repositories, }, extra=vol.ALLOW_EXTRA, )
true
true
f70a978dd0049c27244b57c32fae3ca446d6330a
574
py
Python
utils/heap_queue.py
yeshwanthv5/PruneFL
ad1f7f33b0605d1d79abfbe42ef287fcc613a943
[ "MIT" ]
6
2021-07-01T05:35:08.000Z
2022-03-04T18:53:31.000Z
utils/heap_queue.py
yeshwanthv5/PruneFL
ad1f7f33b0605d1d79abfbe42ef287fcc613a943
[ "MIT" ]
null
null
null
utils/heap_queue.py
yeshwanthv5/PruneFL
ad1f7f33b0605d1d79abfbe42ef287fcc613a943
[ "MIT" ]
1
2021-06-21T14:24:47.000Z
2021-06-21T14:24:47.000Z
import heapq from typing import Iterable class HeapQueue: def __init__(self, init_h: Iterable): self.h = [(-val, index) for index, val in init_h] heapq.heapify(self.h) def replace_largest(self, new_val): heapq.heapreplace(self.h, (-new_val, self.max_index)) def pop(self): heapq.heappop(self.h) @property def max_index(self): return self.h[0][1] @property def max_val(self): return -self.h[0][0] def __repr__(self): return "HeapQueue instance containing data {}.".format(self.h)
22.076923
70
0.625436
import heapq from typing import Iterable class HeapQueue: def __init__(self, init_h: Iterable): self.h = [(-val, index) for index, val in init_h] heapq.heapify(self.h) def replace_largest(self, new_val): heapq.heapreplace(self.h, (-new_val, self.max_index)) def pop(self): heapq.heappop(self.h) @property def max_index(self): return self.h[0][1] @property def max_val(self): return -self.h[0][0] def __repr__(self): return "HeapQueue instance containing data {}.".format(self.h)
true
true
f70a9949d4166222fbcd0e7d65ca4dd9d870cbb4
628
py
Python
dynamicserialize/dstypes/com/raytheon/uf/common/dataplugin/gfe/request/LockChangeRequest.py
mjames-upc/python-awips
e2b05f5587b02761df3b6dd5c6ee1f196bd5f11c
[ "BSD-3-Clause" ]
null
null
null
dynamicserialize/dstypes/com/raytheon/uf/common/dataplugin/gfe/request/LockChangeRequest.py
mjames-upc/python-awips
e2b05f5587b02761df3b6dd5c6ee1f196bd5f11c
[ "BSD-3-Clause" ]
null
null
null
dynamicserialize/dstypes/com/raytheon/uf/common/dataplugin/gfe/request/LockChangeRequest.py
mjames-upc/python-awips
e2b05f5587b02761df3b6dd5c6ee1f196bd5f11c
[ "BSD-3-Clause" ]
null
null
null
## ## # File auto-generated against equivalent DynamicSerialize Java class class LockChangeRequest(object): def __init__(self): self.requests = None self.workstationID = None self.siteID = None def getRequests(self): return self.requests def setRequests(self, requests): self.requests = requests def getWorkstationID(self): return self.workstationID def setWorkstationID(self, workstationID): self.workstationID = workstationID def getSiteID(self): return self.siteID def setSiteID(self, siteID): self.siteID = siteID
20.258065
68
0.664013
class LockChangeRequest(object): def __init__(self): self.requests = None self.workstationID = None self.siteID = None def getRequests(self): return self.requests def setRequests(self, requests): self.requests = requests def getWorkstationID(self): return self.workstationID def setWorkstationID(self, workstationID): self.workstationID = workstationID def getSiteID(self): return self.siteID def setSiteID(self, siteID): self.siteID = siteID
true
true
f70a998e45a9cd53af285a0aff5b0be6fe9d545d
1,642
py
Python
xua/build_tools.py
kmirzavaziri/xua-cli
e442f7522665cf6a4605acce3c023e8194f07176
[ "MIT" ]
null
null
null
xua/build_tools.py
kmirzavaziri/xua-cli
e442f7522665cf6a4605acce3c023e8194f07176
[ "MIT" ]
null
null
null
xua/build_tools.py
kmirzavaziri/xua-cli
e442f7522665cf6a4605acce3c023e8194f07176
[ "MIT" ]
null
null
null
import os from xua import helpers from xua.constants import CLI, BUILD from xua.exceptions import UserError from xua.builders.doc import htmlOld def getBuildEngine(project, config): if project == CLI.PROJECT_SERVER_PHP: # @TODO return None elif project == CLI.PROJECT_MARSHAL_DART: # @TODO return None elif project == CLI.PROJECT_DOC_HTML: return htmlOld.BuildEngine(config) # return html.engine(config) elif project == CLI.PROJECT_DOC_LATEX: # @TODO return None else: raise UserError(f"Unknown project {project}.") def buildRecursive(path, buildEngine): if os.path.isfile(path): if buildEngine.config.isToBuild(path, buildEngine.project): destination = buildEngine.config.getCorrespondingPath( buildEngine.project, path, BUILD.MAP_PROJECT_EXTENSION[buildEngine.project]) try: helpers.write(buildEngine.build(path), destination) except UserError as e: helpers.Logger.log(helpers.Logger.ERROR, buildEngine.project, path + ": " + str(e)) else: helpers.Logger.log(helpers.Logger.SUCCESS, buildEngine.project, destination + ' built.') elif buildEngine.config.isToCopy(path, buildEngine.project): helpers.copy(path, buildEngine.config.getCorrespondingPath( buildEngine.project, path)) elif os.path.isdir(path): for child in os.listdir(path): buildRecursive(os.path.join(path, child), buildEngine)
37.318182
92
0.629111
import os from xua import helpers from xua.constants import CLI, BUILD from xua.exceptions import UserError from xua.builders.doc import htmlOld def getBuildEngine(project, config): if project == CLI.PROJECT_SERVER_PHP: return None elif project == CLI.PROJECT_MARSHAL_DART: return None elif project == CLI.PROJECT_DOC_HTML: return htmlOld.BuildEngine(config) elif project == CLI.PROJECT_DOC_LATEX: return None else: raise UserError(f"Unknown project {project}.") def buildRecursive(path, buildEngine): if os.path.isfile(path): if buildEngine.config.isToBuild(path, buildEngine.project): destination = buildEngine.config.getCorrespondingPath( buildEngine.project, path, BUILD.MAP_PROJECT_EXTENSION[buildEngine.project]) try: helpers.write(buildEngine.build(path), destination) except UserError as e: helpers.Logger.log(helpers.Logger.ERROR, buildEngine.project, path + ": " + str(e)) else: helpers.Logger.log(helpers.Logger.SUCCESS, buildEngine.project, destination + ' built.') elif buildEngine.config.isToCopy(path, buildEngine.project): helpers.copy(path, buildEngine.config.getCorrespondingPath( buildEngine.project, path)) elif os.path.isdir(path): for child in os.listdir(path): buildRecursive(os.path.join(path, child), buildEngine)
true
true
f70a9cb73c105b012ba90f9d50a5890ed86a8e48
14,491
py
Python
homeassistant/components/notify/html5.py
glogiotatidis/home-assistant
3b83a64f7cdf8a3b90f7f445869155c549c631b0
[ "Apache-2.0" ]
3
2019-01-24T20:32:14.000Z
2022-03-22T14:25:48.000Z
homeassistant/components/notify/html5.py
abusalimov/home-assistant
5b53bd6aa02a45ddcd4bf4358e74ddbc0285d8d3
[ "Apache-2.0" ]
null
null
null
homeassistant/components/notify/html5.py
abusalimov/home-assistant
5b53bd6aa02a45ddcd4bf4358e74ddbc0285d8d3
[ "Apache-2.0" ]
1
2022-03-22T14:25:52.000Z
2022-03-22T14:25:52.000Z
""" HTML5 Push Messaging notification service. For more details about this platform, please refer to the documentation at https://home-assistant.io/components/notify.html5/ """ import datetime import json import logging import time import uuid from aiohttp.hdrs import AUTHORIZATION import voluptuous as vol from voluptuous.humanize import humanize_error from homeassistant.util.json import load_json, save_json from homeassistant.exceptions import HomeAssistantError from homeassistant.components.frontend import add_manifest_json_key from homeassistant.components.http import HomeAssistantView from homeassistant.components.notify import ( ATTR_DATA, ATTR_TITLE, ATTR_TARGET, PLATFORM_SCHEMA, ATTR_TITLE_DEFAULT, BaseNotificationService) from homeassistant.const import ( URL_ROOT, HTTP_BAD_REQUEST, HTTP_UNAUTHORIZED, HTTP_INTERNAL_SERVER_ERROR) from homeassistant.helpers import config_validation as cv from homeassistant.util import ensure_unique_string REQUIREMENTS = ['pywebpush==1.6.0'] DEPENDENCIES = ['frontend'] _LOGGER = logging.getLogger(__name__) REGISTRATIONS_FILE = 'html5_push_registrations.conf' ATTR_GCM_SENDER_ID = 'gcm_sender_id' ATTR_GCM_API_KEY = 'gcm_api_key' PLATFORM_SCHEMA = PLATFORM_SCHEMA.extend({ vol.Optional(ATTR_GCM_SENDER_ID): cv.string, vol.Optional(ATTR_GCM_API_KEY): cv.string, }) ATTR_SUBSCRIPTION = 'subscription' ATTR_BROWSER = 'browser' ATTR_NAME = 'name' ATTR_ENDPOINT = 'endpoint' ATTR_KEYS = 'keys' ATTR_AUTH = 'auth' ATTR_P256DH = 'p256dh' ATTR_EXPIRATIONTIME = 'expirationTime' ATTR_TAG = 'tag' ATTR_ACTION = 'action' ATTR_ACTIONS = 'actions' ATTR_TYPE = 'type' ATTR_URL = 'url' ATTR_JWT = 'jwt' # The number of days after the moment a notification is sent that a JWT # is valid. JWT_VALID_DAYS = 7 KEYS_SCHEMA = vol.All( dict, vol.Schema({ vol.Required(ATTR_AUTH): cv.string, vol.Required(ATTR_P256DH): cv.string, }) ) SUBSCRIPTION_SCHEMA = vol.All( dict, vol.Schema({ # pylint: disable=no-value-for-parameter vol.Required(ATTR_ENDPOINT): vol.Url(), vol.Required(ATTR_KEYS): KEYS_SCHEMA, vol.Optional(ATTR_EXPIRATIONTIME): vol.Any(None, cv.positive_int), }) ) REGISTER_SCHEMA = vol.Schema({ vol.Required(ATTR_SUBSCRIPTION): SUBSCRIPTION_SCHEMA, vol.Required(ATTR_BROWSER): vol.In(['chrome', 'firefox']), vol.Optional(ATTR_NAME): cv.string }) CALLBACK_EVENT_PAYLOAD_SCHEMA = vol.Schema({ vol.Required(ATTR_TAG): cv.string, vol.Required(ATTR_TYPE): vol.In(['received', 'clicked', 'closed']), vol.Required(ATTR_TARGET): cv.string, vol.Optional(ATTR_ACTION): cv.string, vol.Optional(ATTR_DATA): dict, }) NOTIFY_CALLBACK_EVENT = 'html5_notification' # Badge and timestamp are Chrome specific (not in official spec) HTML5_SHOWNOTIFICATION_PARAMETERS = ( 'actions', 'badge', 'body', 'dir', 'icon', 'image', 'lang', 'renotify', 'requireInteraction', 'tag', 'timestamp', 'vibrate') def get_service(hass, config, discovery_info=None): """Get the HTML5 push notification service.""" json_path = hass.config.path(REGISTRATIONS_FILE) registrations = _load_config(json_path) if registrations is None: return None hass.http.register_view( HTML5PushRegistrationView(registrations, json_path)) hass.http.register_view(HTML5PushCallbackView(registrations)) gcm_api_key = config.get(ATTR_GCM_API_KEY) gcm_sender_id = config.get(ATTR_GCM_SENDER_ID) if gcm_sender_id is not None: add_manifest_json_key( ATTR_GCM_SENDER_ID, config.get(ATTR_GCM_SENDER_ID)) return HTML5NotificationService(gcm_api_key, registrations, json_path) def _load_config(filename): """Load configuration.""" try: return load_json(filename) except HomeAssistantError: pass return {} class HTML5PushRegistrationView(HomeAssistantView): """Accepts push registrations from a browser.""" url = '/api/notify.html5' name = 'api:notify.html5' def __init__(self, registrations, json_path): """Init HTML5PushRegistrationView.""" self.registrations = registrations self.json_path = json_path async def post(self, request): """Accept the POST request for push registrations from a browser.""" try: data = await request.json() except ValueError: return self.json_message('Invalid JSON', HTTP_BAD_REQUEST) try: data = REGISTER_SCHEMA(data) except vol.Invalid as ex: return self.json_message( humanize_error(data, ex), HTTP_BAD_REQUEST) devname = data.get(ATTR_NAME) data.pop(ATTR_NAME, None) name = self.find_registration_name(data, devname) previous_registration = self.registrations.get(name) self.registrations[name] = data try: hass = request.app['hass'] await hass.async_add_job(save_json, self.json_path, self.registrations) return self.json_message( 'Push notification subscriber registered.') except HomeAssistantError: if previous_registration is not None: self.registrations[name] = previous_registration else: self.registrations.pop(name) return self.json_message( 'Error saving registration.', HTTP_INTERNAL_SERVER_ERROR) def find_registration_name(self, data, suggested=None): """Find a registration name matching data or generate a unique one.""" endpoint = data.get(ATTR_SUBSCRIPTION).get(ATTR_ENDPOINT) for key, registration in self.registrations.items(): subscription = registration.get(ATTR_SUBSCRIPTION) if subscription.get(ATTR_ENDPOINT) == endpoint: return key return ensure_unique_string(suggested or 'unnamed device', self.registrations) async def delete(self, request): """Delete a registration.""" try: data = await request.json() except ValueError: return self.json_message('Invalid JSON', HTTP_BAD_REQUEST) subscription = data.get(ATTR_SUBSCRIPTION) found = None for key, registration in self.registrations.items(): if registration.get(ATTR_SUBSCRIPTION) == subscription: found = key break if not found: # If not found, unregistering was already done. Return 200 return self.json_message('Registration not found.') reg = self.registrations.pop(found) try: hass = request.app['hass'] await hass.async_add_job(save_json, self.json_path, self.registrations) except HomeAssistantError: self.registrations[found] = reg return self.json_message( 'Error saving registration.', HTTP_INTERNAL_SERVER_ERROR) return self.json_message('Push notification subscriber unregistered.') class HTML5PushCallbackView(HomeAssistantView): """Accepts push registrations from a browser.""" requires_auth = False url = '/api/notify.html5/callback' name = 'api:notify.html5/callback' def __init__(self, registrations): """Init HTML5PushCallbackView.""" self.registrations = registrations def decode_jwt(self, token): """Find the registration that signed this JWT and return it.""" import jwt # 1. Check claims w/o verifying to see if a target is in there. # 2. If target in claims, attempt to verify against the given name. # 2a. If decode is successful, return the payload. # 2b. If decode is unsuccessful, return a 401. target_check = jwt.decode(token, verify=False) if target_check.get(ATTR_TARGET) in self.registrations: possible_target = self.registrations[target_check[ATTR_TARGET]] key = possible_target[ATTR_SUBSCRIPTION][ATTR_KEYS][ATTR_AUTH] try: return jwt.decode(token, key, algorithms=["ES256", "HS256"]) except jwt.exceptions.DecodeError: pass return self.json_message('No target found in JWT', status_code=HTTP_UNAUTHORIZED) # The following is based on code from Auth0 # https://auth0.com/docs/quickstart/backend/python def check_authorization_header(self, request): """Check the authorization header.""" import jwt auth = request.headers.get(AUTHORIZATION, None) if not auth: return self.json_message('Authorization header is expected', status_code=HTTP_UNAUTHORIZED) parts = auth.split() if parts[0].lower() != 'bearer': return self.json_message('Authorization header must ' 'start with Bearer', status_code=HTTP_UNAUTHORIZED) if len(parts) != 2: return self.json_message('Authorization header must ' 'be Bearer token', status_code=HTTP_UNAUTHORIZED) token = parts[1] try: payload = self.decode_jwt(token) except jwt.exceptions.InvalidTokenError: return self.json_message('token is invalid', status_code=HTTP_UNAUTHORIZED) return payload async def post(self, request): """Accept the POST request for push registrations event callback.""" auth_check = self.check_authorization_header(request) if not isinstance(auth_check, dict): return auth_check try: data = await request.json() except ValueError: return self.json_message('Invalid JSON', HTTP_BAD_REQUEST) event_payload = { ATTR_TAG: data.get(ATTR_TAG), ATTR_TYPE: data[ATTR_TYPE], ATTR_TARGET: auth_check[ATTR_TARGET], } if data.get(ATTR_ACTION) is not None: event_payload[ATTR_ACTION] = data.get(ATTR_ACTION) if data.get(ATTR_DATA) is not None: event_payload[ATTR_DATA] = data.get(ATTR_DATA) try: event_payload = CALLBACK_EVENT_PAYLOAD_SCHEMA(event_payload) except vol.Invalid as ex: _LOGGER.warning("Callback event payload is not valid: %s", humanize_error(event_payload, ex)) event_name = '{}.{}'.format(NOTIFY_CALLBACK_EVENT, event_payload[ATTR_TYPE]) request.app['hass'].bus.fire(event_name, event_payload) return self.json({'status': 'ok', 'event': event_payload[ATTR_TYPE]}) class HTML5NotificationService(BaseNotificationService): """Implement the notification service for HTML5.""" def __init__(self, gcm_key, registrations, json_path): """Initialize the service.""" self._gcm_key = gcm_key self.registrations = registrations self.registrations_json_path = json_path @property def targets(self): """Return a dictionary of registered targets.""" targets = {} for registration in self.registrations: targets[registration] = registration return targets def send_message(self, message="", **kwargs): """Send a message to a user.""" import jwt from pywebpush import WebPusher timestamp = int(time.time()) tag = str(uuid.uuid4()) payload = { 'badge': '/static/images/notification-badge.png', 'body': message, ATTR_DATA: {}, 'icon': '/static/icons/favicon-192x192.png', ATTR_TAG: tag, 'timestamp': (timestamp*1000), # Javascript ms since epoch ATTR_TITLE: kwargs.get(ATTR_TITLE, ATTR_TITLE_DEFAULT) } data = kwargs.get(ATTR_DATA) if data: # Pick out fields that should go into the notification directly vs # into the notification data dictionary. data_tmp = {} for key, val in data.items(): if key in HTML5_SHOWNOTIFICATION_PARAMETERS: payload[key] = val else: data_tmp[key] = val payload[ATTR_DATA] = data_tmp if (payload[ATTR_DATA].get(ATTR_URL) is None and payload.get(ATTR_ACTIONS) is None): payload[ATTR_DATA][ATTR_URL] = URL_ROOT targets = kwargs.get(ATTR_TARGET) if not targets: targets = self.registrations.keys() for target in list(targets): info = self.registrations.get(target) if info is None: _LOGGER.error("%s is not a valid HTML5 push notification" " target", target) continue jwt_exp = (datetime.datetime.fromtimestamp(timestamp) + datetime.timedelta(days=JWT_VALID_DAYS)) jwt_secret = info[ATTR_SUBSCRIPTION][ATTR_KEYS][ATTR_AUTH] jwt_claims = {'exp': jwt_exp, 'nbf': timestamp, 'iat': timestamp, ATTR_TARGET: target, ATTR_TAG: payload[ATTR_TAG]} jwt_token = jwt.encode(jwt_claims, jwt_secret).decode('utf-8') payload[ATTR_DATA][ATTR_JWT] = jwt_token # Only pass the gcm key if we're actually using GCM # If we don't, notifications break on FireFox gcm_key = self._gcm_key \ if 'googleapis.com' in info[ATTR_SUBSCRIPTION][ATTR_ENDPOINT] \ else None response = WebPusher(info[ATTR_SUBSCRIPTION]).send( json.dumps(payload), gcm_key=gcm_key, ttl='86400' ) if response.status_code == 410: _LOGGER.info("Notification channel has expired") reg = self.registrations.pop(target) if not save_json(self.registrations_json_path, self.registrations): self.registrations[target] = reg _LOGGER.error("Error saving registration") else: _LOGGER.info("Configuration saved")
34.502381
79
0.630736
import datetime import json import logging import time import uuid from aiohttp.hdrs import AUTHORIZATION import voluptuous as vol from voluptuous.humanize import humanize_error from homeassistant.util.json import load_json, save_json from homeassistant.exceptions import HomeAssistantError from homeassistant.components.frontend import add_manifest_json_key from homeassistant.components.http import HomeAssistantView from homeassistant.components.notify import ( ATTR_DATA, ATTR_TITLE, ATTR_TARGET, PLATFORM_SCHEMA, ATTR_TITLE_DEFAULT, BaseNotificationService) from homeassistant.const import ( URL_ROOT, HTTP_BAD_REQUEST, HTTP_UNAUTHORIZED, HTTP_INTERNAL_SERVER_ERROR) from homeassistant.helpers import config_validation as cv from homeassistant.util import ensure_unique_string REQUIREMENTS = ['pywebpush==1.6.0'] DEPENDENCIES = ['frontend'] _LOGGER = logging.getLogger(__name__) REGISTRATIONS_FILE = 'html5_push_registrations.conf' ATTR_GCM_SENDER_ID = 'gcm_sender_id' ATTR_GCM_API_KEY = 'gcm_api_key' PLATFORM_SCHEMA = PLATFORM_SCHEMA.extend({ vol.Optional(ATTR_GCM_SENDER_ID): cv.string, vol.Optional(ATTR_GCM_API_KEY): cv.string, }) ATTR_SUBSCRIPTION = 'subscription' ATTR_BROWSER = 'browser' ATTR_NAME = 'name' ATTR_ENDPOINT = 'endpoint' ATTR_KEYS = 'keys' ATTR_AUTH = 'auth' ATTR_P256DH = 'p256dh' ATTR_EXPIRATIONTIME = 'expirationTime' ATTR_TAG = 'tag' ATTR_ACTION = 'action' ATTR_ACTIONS = 'actions' ATTR_TYPE = 'type' ATTR_URL = 'url' ATTR_JWT = 'jwt' JWT_VALID_DAYS = 7 KEYS_SCHEMA = vol.All( dict, vol.Schema({ vol.Required(ATTR_AUTH): cv.string, vol.Required(ATTR_P256DH): cv.string, }) ) SUBSCRIPTION_SCHEMA = vol.All( dict, vol.Schema({ vol.Required(ATTR_ENDPOINT): vol.Url(), vol.Required(ATTR_KEYS): KEYS_SCHEMA, vol.Optional(ATTR_EXPIRATIONTIME): vol.Any(None, cv.positive_int), }) ) REGISTER_SCHEMA = vol.Schema({ vol.Required(ATTR_SUBSCRIPTION): SUBSCRIPTION_SCHEMA, vol.Required(ATTR_BROWSER): vol.In(['chrome', 'firefox']), vol.Optional(ATTR_NAME): cv.string }) CALLBACK_EVENT_PAYLOAD_SCHEMA = vol.Schema({ vol.Required(ATTR_TAG): cv.string, vol.Required(ATTR_TYPE): vol.In(['received', 'clicked', 'closed']), vol.Required(ATTR_TARGET): cv.string, vol.Optional(ATTR_ACTION): cv.string, vol.Optional(ATTR_DATA): dict, }) NOTIFY_CALLBACK_EVENT = 'html5_notification' HTML5_SHOWNOTIFICATION_PARAMETERS = ( 'actions', 'badge', 'body', 'dir', 'icon', 'image', 'lang', 'renotify', 'requireInteraction', 'tag', 'timestamp', 'vibrate') def get_service(hass, config, discovery_info=None): json_path = hass.config.path(REGISTRATIONS_FILE) registrations = _load_config(json_path) if registrations is None: return None hass.http.register_view( HTML5PushRegistrationView(registrations, json_path)) hass.http.register_view(HTML5PushCallbackView(registrations)) gcm_api_key = config.get(ATTR_GCM_API_KEY) gcm_sender_id = config.get(ATTR_GCM_SENDER_ID) if gcm_sender_id is not None: add_manifest_json_key( ATTR_GCM_SENDER_ID, config.get(ATTR_GCM_SENDER_ID)) return HTML5NotificationService(gcm_api_key, registrations, json_path) def _load_config(filename): try: return load_json(filename) except HomeAssistantError: pass return {} class HTML5PushRegistrationView(HomeAssistantView): url = '/api/notify.html5' name = 'api:notify.html5' def __init__(self, registrations, json_path): self.registrations = registrations self.json_path = json_path async def post(self, request): try: data = await request.json() except ValueError: return self.json_message('Invalid JSON', HTTP_BAD_REQUEST) try: data = REGISTER_SCHEMA(data) except vol.Invalid as ex: return self.json_message( humanize_error(data, ex), HTTP_BAD_REQUEST) devname = data.get(ATTR_NAME) data.pop(ATTR_NAME, None) name = self.find_registration_name(data, devname) previous_registration = self.registrations.get(name) self.registrations[name] = data try: hass = request.app['hass'] await hass.async_add_job(save_json, self.json_path, self.registrations) return self.json_message( 'Push notification subscriber registered.') except HomeAssistantError: if previous_registration is not None: self.registrations[name] = previous_registration else: self.registrations.pop(name) return self.json_message( 'Error saving registration.', HTTP_INTERNAL_SERVER_ERROR) def find_registration_name(self, data, suggested=None): endpoint = data.get(ATTR_SUBSCRIPTION).get(ATTR_ENDPOINT) for key, registration in self.registrations.items(): subscription = registration.get(ATTR_SUBSCRIPTION) if subscription.get(ATTR_ENDPOINT) == endpoint: return key return ensure_unique_string(suggested or 'unnamed device', self.registrations) async def delete(self, request): try: data = await request.json() except ValueError: return self.json_message('Invalid JSON', HTTP_BAD_REQUEST) subscription = data.get(ATTR_SUBSCRIPTION) found = None for key, registration in self.registrations.items(): if registration.get(ATTR_SUBSCRIPTION) == subscription: found = key break if not found: return self.json_message('Registration not found.') reg = self.registrations.pop(found) try: hass = request.app['hass'] await hass.async_add_job(save_json, self.json_path, self.registrations) except HomeAssistantError: self.registrations[found] = reg return self.json_message( 'Error saving registration.', HTTP_INTERNAL_SERVER_ERROR) return self.json_message('Push notification subscriber unregistered.') class HTML5PushCallbackView(HomeAssistantView): requires_auth = False url = '/api/notify.html5/callback' name = 'api:notify.html5/callback' def __init__(self, registrations): self.registrations = registrations def decode_jwt(self, token): import jwt target_check = jwt.decode(token, verify=False) if target_check.get(ATTR_TARGET) in self.registrations: possible_target = self.registrations[target_check[ATTR_TARGET]] key = possible_target[ATTR_SUBSCRIPTION][ATTR_KEYS][ATTR_AUTH] try: return jwt.decode(token, key, algorithms=["ES256", "HS256"]) except jwt.exceptions.DecodeError: pass return self.json_message('No target found in JWT', status_code=HTTP_UNAUTHORIZED) def check_authorization_header(self, request): import jwt auth = request.headers.get(AUTHORIZATION, None) if not auth: return self.json_message('Authorization header is expected', status_code=HTTP_UNAUTHORIZED) parts = auth.split() if parts[0].lower() != 'bearer': return self.json_message('Authorization header must ' 'start with Bearer', status_code=HTTP_UNAUTHORIZED) if len(parts) != 2: return self.json_message('Authorization header must ' 'be Bearer token', status_code=HTTP_UNAUTHORIZED) token = parts[1] try: payload = self.decode_jwt(token) except jwt.exceptions.InvalidTokenError: return self.json_message('token is invalid', status_code=HTTP_UNAUTHORIZED) return payload async def post(self, request): auth_check = self.check_authorization_header(request) if not isinstance(auth_check, dict): return auth_check try: data = await request.json() except ValueError: return self.json_message('Invalid JSON', HTTP_BAD_REQUEST) event_payload = { ATTR_TAG: data.get(ATTR_TAG), ATTR_TYPE: data[ATTR_TYPE], ATTR_TARGET: auth_check[ATTR_TARGET], } if data.get(ATTR_ACTION) is not None: event_payload[ATTR_ACTION] = data.get(ATTR_ACTION) if data.get(ATTR_DATA) is not None: event_payload[ATTR_DATA] = data.get(ATTR_DATA) try: event_payload = CALLBACK_EVENT_PAYLOAD_SCHEMA(event_payload) except vol.Invalid as ex: _LOGGER.warning("Callback event payload is not valid: %s", humanize_error(event_payload, ex)) event_name = '{}.{}'.format(NOTIFY_CALLBACK_EVENT, event_payload[ATTR_TYPE]) request.app['hass'].bus.fire(event_name, event_payload) return self.json({'status': 'ok', 'event': event_payload[ATTR_TYPE]}) class HTML5NotificationService(BaseNotificationService): def __init__(self, gcm_key, registrations, json_path): self._gcm_key = gcm_key self.registrations = registrations self.registrations_json_path = json_path @property def targets(self): targets = {} for registration in self.registrations: targets[registration] = registration return targets def send_message(self, message="", **kwargs): import jwt from pywebpush import WebPusher timestamp = int(time.time()) tag = str(uuid.uuid4()) payload = { 'badge': '/static/images/notification-badge.png', 'body': message, ATTR_DATA: {}, 'icon': '/static/icons/favicon-192x192.png', ATTR_TAG: tag, 'timestamp': (timestamp*1000), ATTR_TITLE: kwargs.get(ATTR_TITLE, ATTR_TITLE_DEFAULT) } data = kwargs.get(ATTR_DATA) if data: data_tmp = {} for key, val in data.items(): if key in HTML5_SHOWNOTIFICATION_PARAMETERS: payload[key] = val else: data_tmp[key] = val payload[ATTR_DATA] = data_tmp if (payload[ATTR_DATA].get(ATTR_URL) is None and payload.get(ATTR_ACTIONS) is None): payload[ATTR_DATA][ATTR_URL] = URL_ROOT targets = kwargs.get(ATTR_TARGET) if not targets: targets = self.registrations.keys() for target in list(targets): info = self.registrations.get(target) if info is None: _LOGGER.error("%s is not a valid HTML5 push notification" " target", target) continue jwt_exp = (datetime.datetime.fromtimestamp(timestamp) + datetime.timedelta(days=JWT_VALID_DAYS)) jwt_secret = info[ATTR_SUBSCRIPTION][ATTR_KEYS][ATTR_AUTH] jwt_claims = {'exp': jwt_exp, 'nbf': timestamp, 'iat': timestamp, ATTR_TARGET: target, ATTR_TAG: payload[ATTR_TAG]} jwt_token = jwt.encode(jwt_claims, jwt_secret).decode('utf-8') payload[ATTR_DATA][ATTR_JWT] = jwt_token # If we don't, notifications break on FireFox gcm_key = self._gcm_key \ if 'googleapis.com' in info[ATTR_SUBSCRIPTION][ATTR_ENDPOINT] \ else None response = WebPusher(info[ATTR_SUBSCRIPTION]).send( json.dumps(payload), gcm_key=gcm_key, ttl='86400' ) if response.status_code == 410: _LOGGER.info("Notification channel has expired") reg = self.registrations.pop(target) if not save_json(self.registrations_json_path, self.registrations): self.registrations[target] = reg _LOGGER.error("Error saving registration") else: _LOGGER.info("Configuration saved")
true
true
f70a9ce853cb9ce01b71a3e215447fff235084b1
386
py
Python
mysit/urls.py
GhasemMatoo/Mysite_Restaurants
f44e0b0374016850cc47f212db0d5693d6de2ee6
[ "MIT" ]
null
null
null
mysit/urls.py
GhasemMatoo/Mysite_Restaurants
f44e0b0374016850cc47f212db0d5693d6de2ee6
[ "MIT" ]
null
null
null
mysit/urls.py
GhasemMatoo/Mysite_Restaurants
f44e0b0374016850cc47f212db0d5693d6de2ee6
[ "MIT" ]
null
null
null
from django.urls import path from mysit.views import * app_name = 'mysit' urlpatterns = [ path('',index_views, name='index'), path('about',about_views, name='about'), path('contact',contact_views, name='contact'), path('gallery',gallery_views, name='gallery'), path('menu',menu_views, name='menu'), path('reservation',reservation_views, name='reservation'), ]
27.571429
62
0.683938
from django.urls import path from mysit.views import * app_name = 'mysit' urlpatterns = [ path('',index_views, name='index'), path('about',about_views, name='about'), path('contact',contact_views, name='contact'), path('gallery',gallery_views, name='gallery'), path('menu',menu_views, name='menu'), path('reservation',reservation_views, name='reservation'), ]
true
true
f70a9def8d0fc3fb9e3a591155df239d7c97521c
971
py
Python
fizzbuzz/fizzbuzz/number_publisher_node.py
ericboehlke/ros_fizzbuzz
c1bf95a154f78c050be255caa29e6454942ff6f6
[ "MIT" ]
null
null
null
fizzbuzz/fizzbuzz/number_publisher_node.py
ericboehlke/ros_fizzbuzz
c1bf95a154f78c050be255caa29e6454942ff6f6
[ "MIT" ]
null
null
null
fizzbuzz/fizzbuzz/number_publisher_node.py
ericboehlke/ros_fizzbuzz
c1bf95a154f78c050be255caa29e6454942ff6f6
[ "MIT" ]
null
null
null
#!/usr/bin/env python3 import rclpy from rclpy.node import Node from std_msgs.msg import Int64 class NumberPublisher(Node): def __init__(self): super().__init__('number_publisher') self.publisher_ = self.create_publisher(Int64, 'numbers', 10) timer_period = 0.5 # seconds self.timer = self.create_timer(timer_period, self.timer_callback) self.i = 0 def timer_callback(self): msg = Int64() msg.data = self.i self.publisher_.publish(msg) self.get_logger().info('Publishing: "%s"' % msg.data) self.i += 1 def main(args=None): rclpy.init(args=args) number_publisher = NumberPublisher() rclpy.spin(number_publisher) # Destroy the node explicitly # (optional - otherwise it will be done automatically # when the garbage collector destroys the node object) number_publisher.destroy_node() rclpy.shutdown() if __name__ == '__main__': main()
23.119048
73
0.661174
import rclpy from rclpy.node import Node from std_msgs.msg import Int64 class NumberPublisher(Node): def __init__(self): super().__init__('number_publisher') self.publisher_ = self.create_publisher(Int64, 'numbers', 10) timer_period = 0.5 self.timer = self.create_timer(timer_period, self.timer_callback) self.i = 0 def timer_callback(self): msg = Int64() msg.data = self.i self.publisher_.publish(msg) self.get_logger().info('Publishing: "%s"' % msg.data) self.i += 1 def main(args=None): rclpy.init(args=args) number_publisher = NumberPublisher() rclpy.spin(number_publisher) number_publisher.destroy_node() rclpy.shutdown() if __name__ == '__main__': main()
true
true
f70a9fa422465f06e33a73da4d25cfab7390d3b8
2,624
py
Python
libs/dscache/odc/dscache/apps/dstiler.py
MatthewJA/odc-tools
4bf902701b858c15f2a5f27974d05daf96df42c3
[ "Apache-2.0" ]
null
null
null
libs/dscache/odc/dscache/apps/dstiler.py
MatthewJA/odc-tools
4bf902701b858c15f2a5f27974d05daf96df42c3
[ "Apache-2.0" ]
null
null
null
libs/dscache/odc/dscache/apps/dstiler.py
MatthewJA/odc-tools
4bf902701b858c15f2a5f27974d05daf96df42c3
[ "Apache-2.0" ]
null
null
null
from functools import partial import click from odc import dscache from odc.dscache.tools.tiling import ( bin_by_native_tile, web_gs, extract_native_albers_tile, parse_gridspec) from odc.dscache._dscache import mk_group_name from odc.index import bin_dataset_stream @click.command('dstiler') @click.option('--native', is_flag=True, help='Use Landsat Path/Row as grouping') @click.option('--native-albers', is_flag=True, help='When datasets are in Albers (AU) grid already') @click.option('--web', type=int, help='Use web map tiling regime at supplied zoom level') @click.option('--grid', type=str, help="Grid spec or name 'crs;pixel_resolution;shape_in_pixels'|albers_au_25", default='albers_au_25') @click.argument('dbfile', type=str, nargs=1) def cli(native, native_albers, web, grid, dbfile): """Add spatial grouping to file db. Default grid is Australian Albers (EPSG:3577) with 100k by 100k tiles. But you can also group by Landsat path/row (--native), or Google's map tiling regime (--web zoom_level) \b Example for custom --grid: - rectangular: 'epsg:6933;-10x10;2000x3000' ^crs ^y ^x ^ny ^nx - square : 'epsg:3857;10;10000' - named : albers_au_25 albers_africa_10 (20,30,60 are also available) """ cache = dscache.open_rw(dbfile) label = 'Processing {} ({:,d} datasets)'.format(dbfile, cache.count) group_prefix = 'grid' gs = None cells = {} if native: group_prefix = 'native' binner = partial(bin_by_native_tile, cells=cells) elif native_albers: group_prefix = 'albers' binner = lambda dss: bin_by_native_tile(dss, cells, native_tile_id=extract_native_albers_tile) elif web is not None: gs = web_gs(web) group_prefix = 'web_' + str(web) binner = lambda dss: bin_dataset_stream(gs, dss, cells) else: gs = parse_gridspec(grid) group_prefix = f"epsg{gs.crs.epsg:d}" binner = lambda dss: bin_dataset_stream(gs, dss, cells) if gs is not None: click.echo(f'Using gridspec: {gs}') cache.add_grid(gs, group_prefix) with click.progressbar(cache.get_all(), length=cache.count, label=label) as dss: for ds in binner(dss): pass click.echo('Total bins: {:d}'.format(len(cells))) with click.progressbar(cells.values(), length=len(cells), label='Saving') as groups: for group in groups: cache.add_grid_tile(group_prefix, group.idx, group.dss) if __name__ == '__main__': cli()
34.986667
102
0.653201
from functools import partial import click from odc import dscache from odc.dscache.tools.tiling import ( bin_by_native_tile, web_gs, extract_native_albers_tile, parse_gridspec) from odc.dscache._dscache import mk_group_name from odc.index import bin_dataset_stream @click.command('dstiler') @click.option('--native', is_flag=True, help='Use Landsat Path/Row as grouping') @click.option('--native-albers', is_flag=True, help='When datasets are in Albers (AU) grid already') @click.option('--web', type=int, help='Use web map tiling regime at supplied zoom level') @click.option('--grid', type=str, help="Grid spec or name 'crs;pixel_resolution;shape_in_pixels'|albers_au_25", default='albers_au_25') @click.argument('dbfile', type=str, nargs=1) def cli(native, native_albers, web, grid, dbfile): cache = dscache.open_rw(dbfile) label = 'Processing {} ({:,d} datasets)'.format(dbfile, cache.count) group_prefix = 'grid' gs = None cells = {} if native: group_prefix = 'native' binner = partial(bin_by_native_tile, cells=cells) elif native_albers: group_prefix = 'albers' binner = lambda dss: bin_by_native_tile(dss, cells, native_tile_id=extract_native_albers_tile) elif web is not None: gs = web_gs(web) group_prefix = 'web_' + str(web) binner = lambda dss: bin_dataset_stream(gs, dss, cells) else: gs = parse_gridspec(grid) group_prefix = f"epsg{gs.crs.epsg:d}" binner = lambda dss: bin_dataset_stream(gs, dss, cells) if gs is not None: click.echo(f'Using gridspec: {gs}') cache.add_grid(gs, group_prefix) with click.progressbar(cache.get_all(), length=cache.count, label=label) as dss: for ds in binner(dss): pass click.echo('Total bins: {:d}'.format(len(cells))) with click.progressbar(cells.values(), length=len(cells), label='Saving') as groups: for group in groups: cache.add_grid_tile(group_prefix, group.idx, group.dss) if __name__ == '__main__': cli()
true
true
f70aa11c73981f29fb4af7f7835b063d5d965fa2
917
py
Python
flex.py
johndemlon/c-and-c-server
562e5fd21b9b93f68f4e65a4c032f20128eb9c2d
[ "MIT" ]
2
2021-09-01T16:39:46.000Z
2021-09-08T16:44:56.000Z
flex.py
johndemlon/c-and-c-server
562e5fd21b9b93f68f4e65a4c032f20128eb9c2d
[ "MIT" ]
null
null
null
flex.py
johndemlon/c-and-c-server
562e5fd21b9b93f68f4e65a4c032f20128eb9c2d
[ "MIT" ]
null
null
null
# Date: 09/28/2017 # Author: Ethical-H4CK3R # Description: A Simple C&C Server from core.prompt import Prompt from core.server import Server from template.design import Designer from core.console import MainController from core.communicate import Communicate __version__ = 0.1 class Flex(Prompt, Server, Designer, MainController, Communicate): ''' A Simple C&C Server ''' def __init__(self): self.ip = '127.0.0.1' self.port = 4444 self.botnet = [] Prompt.__init__(self) Server.__init__(self) Designer.__init__(self) Communicate.__init__(self) MainController.__init__(self) self.wait = False self.ping = False self.alive = True self.debug = True self.activeIP = None self.activePort = None self.default_to_shell = True self.prompt = self.getprompt() def start(self): try:self.cmdloop() finally:self.disconnect(True) if __name__ == '__main__': Flex().start()
21.833333
66
0.718648
from core.prompt import Prompt from core.server import Server from template.design import Designer from core.console import MainController from core.communicate import Communicate __version__ = 0.1 class Flex(Prompt, Server, Designer, MainController, Communicate): def __init__(self): self.ip = '127.0.0.1' self.port = 4444 self.botnet = [] Prompt.__init__(self) Server.__init__(self) Designer.__init__(self) Communicate.__init__(self) MainController.__init__(self) self.wait = False self.ping = False self.alive = True self.debug = True self.activeIP = None self.activePort = None self.default_to_shell = True self.prompt = self.getprompt() def start(self): try:self.cmdloop() finally:self.disconnect(True) if __name__ == '__main__': Flex().start()
true
true