fumiyau/python_comments_free_500000 · Datasets at Hugging Face

1c2fee415938db09e076fa4c0900a5cb1d183bbb

34

py

Python

5.py

eliascmaciiel/Exercicios_LP_1B

f56d49cde772bbc3fe9e205693fbe2c5612eae49

[ "MIT" ]

null

5.py

eliascmaciiel/Exercicios_LP_1B

f56d49cde772bbc3fe9e205693fbe2c5612eae49

[ "MIT" ]

null

5.py

eliascmaciiel/Exercicios_LP_1B

f56d49cde772bbc3fe9e205693fbe2c5612eae49

[ "MIT" ]

null

digitado = input("Digite algo.")

11.333333

32

0.676471

digitado = input("Digite algo.")

true

1c2feeb3159d965187d6337fb06614b6aae8cdef

1,355

py

Python

runtime/image_classification/models/vgg16/gpus=16_straight/stage8.py

NestLakerJasonLIN/pipedream

f50827f2e28cbdbd82a4ea686c0498272b1460d6

[ "MIT" ]

273

2019-08-31T14:12:11.000Z

2022-03-05T13:34:25.000Z

runtime/image_classification/models/vgg16/gpus=16_straight/stage8.py

albertsh10/pipedream

cad624f79a71f44ba79099f0c38321347b13e5c2

[ "MIT" ]

67

2019-09-19T15:36:59.000Z

2022-01-13T09:11:54.000Z

runtime/image_classification/models/vgg16/gpus=16_straight/stage8.py

albertsh10/pipedream

cad624f79a71f44ba79099f0c38321347b13e5c2

[ "MIT" ]

100

2019-09-16T20:59:14.000Z

2022-03-23T12:56:56.000Z

# Copyright (c) Microsoft Corporation. # Licensed under the MIT license. import torch class Stage8(torch.nn.Module): def __init__(self): super(Stage8, self).__init__() self.layer1 = torch.nn.ReLU(inplace=True) self.layer2 = torch.nn.MaxPool2d(kernel_size=2, stride=2, padding=0, dilation=1, ceil_mode=False) self.layer3 = torch.nn.Conv2d(128, 256, kernel_size=(3, 3), stride=(1, 1), padding=(1, 1)) self.layer4 = torch.nn.ReLU(inplace=True) self._initialize_weights() def forward(self, input0): out0 = input0.clone() out1 = self.layer1(out0) out2 = self.layer2(out1) out3 = self.layer3(out2) out4 = self.layer4(out3) return out4 def _initialize_weights(self): for m in self.modules(): if isinstance(m, torch.nn.Conv2d): torch.nn.init.kaiming_normal_(m.weight, mode='fan_out', nonlinearity='relu') if m.bias is not None: torch.nn.init.constant_(m.bias, 0) elif isinstance(m, torch.nn.BatchNorm2d): torch.nn.init.constant_(m.weight, 1) torch.nn.init.constant_(m.bias, 0) elif isinstance(m, torch.nn.Linear): torch.nn.init.normal_(m.weight, 0, 0.01) torch.nn.init.constant_(m.bias, 0)

37.638889

105

0.597048

import torch class Stage8(torch.nn.Module): def __init__(self): super(Stage8, self).__init__() self.layer1 = torch.nn.ReLU(inplace=True) self.layer2 = torch.nn.MaxPool2d(kernel_size=2, stride=2, padding=0, dilation=1, ceil_mode=False) self.layer3 = torch.nn.Conv2d(128, 256, kernel_size=(3, 3), stride=(1, 1), padding=(1, 1)) self.layer4 = torch.nn.ReLU(inplace=True) self._initialize_weights() def forward(self, input0): out0 = input0.clone() out1 = self.layer1(out0) out2 = self.layer2(out1) out3 = self.layer3(out2) out4 = self.layer4(out3) return out4 def _initialize_weights(self): for m in self.modules(): if isinstance(m, torch.nn.Conv2d): torch.nn.init.kaiming_normal_(m.weight, mode='fan_out', nonlinearity='relu') if m.bias is not None: torch.nn.init.constant_(m.bias, 0) elif isinstance(m, torch.nn.BatchNorm2d): torch.nn.init.constant_(m.weight, 1) torch.nn.init.constant_(m.bias, 0) elif isinstance(m, torch.nn.Linear): torch.nn.init.normal_(m.weight, 0, 0.01) torch.nn.init.constant_(m.bias, 0)

true

1c2ff0b065e5812246df47b329a55dd1d2ed290d

1,912

py

Python

data_api.py

samarthbhargav/pytorch-vision-language

625e35c2e1945afa89108e20596664d66198ce5b

[ "MIT" ]

1

2020-11-19T08:32:06.000Z

data_api.py

samarthbhargav/pytorch-vision-language

625e35c2e1945afa89108e20596664d66198ce5b

[ "MIT" ]

1

2018-06-21T13:15:37.000Z

data_api.py

samarthbhargav/pytorch-vision-language

625e35c2e1945afa89108e20596664d66198ce5b

[ "MIT" ]

null

import sys, os import codecs import json import pickle as pkl from collections import defaultdict import random class DataApi: # TODO figure out how to do this for test images def __init__(self, location="data/cub/"): self.description_test = self.get_descriptions( os.path.join(location, "descriptions_bird.test.fg.json") ) self.data = [] self.classes = defaultdict(list) self.images = {} annotations = {} for annotation in self.description_test["annotations"]: annotations[annotation["image_id"]] = annotation["caption"] for index, image in enumerate(self.description_test["images"]): class_label = image["id"].split(".")[1].split("/")[0] self.classes[class_label].append(index) image_index = "_".join(image["file_name"].split("/")[1].split("_")[:-1]) self.data.append( { "class_label": class_label, "id": image["id"], "path": os.path.join(location, "images", image["file_name"]), "caption": annotations[image["id"]], } ) assert os.path.exists(self.data[-1]["path"]) def sample_images(self, n): images = [] for _ in range(n): images.append(random.choice(self.data).copy()) return images def get_image(self, image_id): img = next((img for img in self.data if img["id"] == image_id), None) # Return a copy return img.copy() def get_descriptions(self, path): with codecs.open(path, "r", "utf-8") as reader: return json.load(reader) def get_classes(self): return [k for k in self.classes.keys()] def sample_class(self, klass): idx = random.choice(self.classes[klass]) return self.data[idx].copy()

30.349206

84

0.566946

import sys, os import codecs import json import pickle as pkl from collections import defaultdict import random class DataApi: def __init__(self, location="data/cub/"): self.description_test = self.get_descriptions( os.path.join(location, "descriptions_bird.test.fg.json") ) self.data = [] self.classes = defaultdict(list) self.images = {} annotations = {} for annotation in self.description_test["annotations"]: annotations[annotation["image_id"]] = annotation["caption"] for index, image in enumerate(self.description_test["images"]): class_label = image["id"].split(".")[1].split("/")[0] self.classes[class_label].append(index) image_index = "_".join(image["file_name"].split("/")[1].split("_")[:-1]) self.data.append( { "class_label": class_label, "id": image["id"], "path": os.path.join(location, "images", image["file_name"]), "caption": annotations[image["id"]], } ) assert os.path.exists(self.data[-1]["path"]) def sample_images(self, n): images = [] for _ in range(n): images.append(random.choice(self.data).copy()) return images def get_image(self, image_id): img = next((img for img in self.data if img["id"] == image_id), None) return img.copy() def get_descriptions(self, path): with codecs.open(path, "r", "utf-8") as reader: return json.load(reader) def get_classes(self): return [k for k in self.classes.keys()] def sample_class(self, klass): idx = random.choice(self.classes[klass]) return self.data[idx].copy()

true

1c2ff0d6e6322701a08acaff4002e86c28914868

186

py

Python

frappe/patches/v5_0/modify_session.py

Nxweb-in/frappe

56b3eb52bf56dd71bee29fde3ed28ed9c6d15947

[ "MIT" ]

1

2021-06-03T07:04:48.000Z

frappe/patches/v5_0/modify_session.py

Nxweb-in/frappe

56b3eb52bf56dd71bee29fde3ed28ed9c6d15947

[ "MIT" ]

null

frappe/patches/v5_0/modify_session.py

Nxweb-in/frappe

56b3eb52bf56dd71bee29fde3ed28ed9c6d15947

[ "MIT" ]

null

import frappe def execute(): if "device" not in frappe.db.get_table_columns("Sessions"): frappe.db.sql("alter table tabSessions add column `device` varchar(255) default 'desktop'")

26.571429

93

0.747312

import frappe def execute(): if "device" not in frappe.db.get_table_columns("Sessions"): frappe.db.sql("alter table tabSessions add column `device` varchar(255) default 'desktop'")

true

1c2ff1812d83c0c212d78f3ce04388489258502c

34,819

py

Python

unittests/test_pipeline.py

FrancisCrickInstitute/reframe

aec9ab794342de3f813c6e540d978e9a8d0e9e0a

[ "BSD-3-Clause" ]

null

unittests/test_pipeline.py

FrancisCrickInstitute/reframe

aec9ab794342de3f813c6e540d978e9a8d0e9e0a

[ "BSD-3-Clause" ]

null

unittests/test_pipeline.py

FrancisCrickInstitute/reframe

aec9ab794342de3f813c6e540d978e9a8d0e9e0a

[ "BSD-3-Clause" ]

null

# Copyright 2016-2020 Swiss National Supercomputing Centre (CSCS/ETH Zurich) # ReFrame Project Developers. See the top-level LICENSE file for details. # # SPDX-License-Identifier: BSD-3-Clause import os import pathlib import pytest import re import reframe as rfm import reframe.core.runtime as rt import reframe.utility.os_ext as os_ext import reframe.utility.sanity as sn import unittests.fixtures as fixtures from reframe.core.exceptions import (BuildError, PipelineError, ReframeError, ReframeSyntaxError, PerformanceError, SanityError) from reframe.frontend.loader import RegressionCheckLoader from unittests.resources.checks.hellocheck import HelloTest def _run(test, partition, prgenv): test.setup(partition, prgenv) test.compile() test.compile_wait() test.run() test.wait() test.check_sanity() test.check_performance() test.cleanup(remove_files=True) def load_test(testfile): loader = RegressionCheckLoader(['unittests/resources/checks']) return loader.load_from_file(testfile) @pytest.fixture def temp_runtime(tmp_path): def _temp_runtime(config_file, system=None, options={}): options.update({'systems/prefix': str(tmp_path)}) with rt.temp_runtime(config_file, system, options): yield rt.runtime() yield _temp_runtime @pytest.fixture def generic_system(temp_runtime): yield from temp_runtime(fixtures.TEST_CONFIG_FILE, 'generic') @pytest.fixture def testsys_system(temp_runtime): yield from temp_runtime(fixtures.TEST_CONFIG_FILE, 'testsys') @pytest.fixture def user_system(temp_runtime): if fixtures.USER_CONFIG_FILE: yield from temp_runtime(fixtures.USER_CONFIG_FILE, fixtures.USER_SYSTEM) else: yield generic_system @pytest.fixture def hellotest(): yield load_test('unittests/resources/checks/hellocheck.py')[0] @pytest.fixture def local_exec_ctx(generic_system): partition = fixtures.partition_by_name('default') environ = fixtures.environment_by_name('builtin-gcc', partition) yield partition, environ @pytest.fixture def local_user_exec_ctx(user_system): partition = fixtures.partition_by_scheduler('local') if partition is None: pytest.skip('no local jobs are supported') try: environ = partition.environs[0] except IndexError: pytest.skip('no environments configured for partition: %s' % partition.fullname) yield partition, environ @pytest.fixture def remote_exec_ctx(user_system): partition = fixtures.partition_by_scheduler() if partition is None: pytest.skip('job submission not supported') try: environ = partition.environs[0] except IndexError: pytest.skip('no environments configured for partition: %s' % partition.fullname) yield partition, environ @pytest.fixture def remote_exec_ctx(user_system): partition = fixtures.partition_by_scheduler() if partition is None: pytest.skip('job submission not supported') try: environ = partition.environs[0] except IndexError: pytest.skip('no environments configured for partition: %s' % partition.fullname) yield partition, environ @pytest.fixture def container_remote_exec_ctx(remote_exec_ctx): def _container_exec_ctx(platform): partition = remote_exec_ctx[0] if platform not in partition.container_environs.keys(): pytest.skip('%s is not configured on the system' % platform) yield from remote_exec_ctx return _container_exec_ctx @pytest.fixture def container_local_exec_ctx(local_user_exec_ctx): def _container_exec_ctx(platform): partition = local_user_exec_ctx[0] if platform not in partition.container_environs.keys(): pytest.skip('%s is not configured on the system' % platform) yield from local_user_exec_ctx return _container_exec_ctx def test_environ_setup(hellotest, local_exec_ctx): # Use test environment for the regression check hellotest.variables = {'_FOO_': '1', '_BAR_': '2'} hellotest.setup(*local_exec_ctx) for k in hellotest.variables.keys(): assert k not in os.environ def test_hellocheck(hellotest, remote_exec_ctx): _run(hellotest, *remote_exec_ctx) def test_hellocheck_make(remote_exec_ctx): test = load_test('unittests/resources/checks/hellocheck_make.py')[0] _run(test, *remote_exec_ctx) def test_hellocheck_local(hellotest, local_exec_ctx): # Test also the prebuild/postbuild functionality hellotest.prebuild_cmd = ['touch prebuild', 'mkdir prebuild_dir'] hellotest.postbuild_cmd = ['touch postbuild', 'mkdir postbuild_dir'] hellotest.keep_files = ['prebuild', 'postbuild', 'prebuild_dir', 'postbuild_dir'] # Force local execution of the test; just for testing .local hellotest.local = True _run(hellotest, *local_exec_ctx) must_keep = [ hellotest.stdout.evaluate(), hellotest.stderr.evaluate(), hellotest.build_stdout.evaluate(), hellotest.build_stderr.evaluate(), hellotest.job.script_filename, *hellotest.keep_files ] for f in must_keep: assert os.path.exists(os.path.join(hellotest.outputdir, f)) def test_hellocheck_local_prepost_run(hellotest, local_exec_ctx): @sn.sanity_function def stagedir(test): return test.stagedir # Test also the prebuild/postbuild functionality hellotest.pre_run = ['echo prerun: `pwd`'] hellotest.post_run = ['echo postrun: `pwd`'] pre_run_path = sn.extractsingle(r'^prerun: (\S+)', hellotest.stdout, 1) post_run_path = sn.extractsingle(r'^postrun: (\S+)', hellotest.stdout, 1) hellotest.sanity_patterns = sn.all([ sn.assert_eq(stagedir(hellotest), pre_run_path), sn.assert_eq(stagedir(hellotest), post_run_path), ]) _run(hellotest, *local_exec_ctx) def test_run_only_sanity(local_exec_ctx): @fixtures.custom_prefix('unittests/resources/checks') class MyTest(rfm.RunOnlyRegressionTest): def __init__(self): self.executable = './hello.sh' self.executable_opts = ['Hello, World!'] self.local = True self.valid_prog_environs = ['*'] self.valid_systems = ['*'] self.sanity_patterns = sn.assert_found( r'Hello, World\!', self.stdout) _run(MyTest(), *local_exec_ctx) def test_run_only_no_srcdir(local_exec_ctx): @fixtures.custom_prefix('foo/bar/') class MyTest(rfm.RunOnlyRegressionTest): def __init__(self): self.executable = 'echo' self.executable_opts = ['hello'] self.valid_prog_environs = ['*'] self.valid_systems = ['*'] self.sanity_patterns = sn.assert_found(r'hello', self.stdout) test = MyTest() assert test.sourcesdir is None _run(test, *local_exec_ctx) def test_compile_only_failure(local_exec_ctx): @fixtures.custom_prefix('unittests/resources/checks') class MyTest(rfm.CompileOnlyRegressionTest): def __init__(self): self.sourcepath = 'compiler_failure.c' self.valid_prog_environs = ['*'] self.valid_systems = ['*'] test = MyTest() test.setup(*local_exec_ctx) test.compile() with pytest.raises(BuildError): test.compile_wait() def test_compile_only_warning(local_exec_ctx): @fixtures.custom_prefix('unittests/resources/checks') class MyTest(rfm.RunOnlyRegressionTest): def __init__(self): self.build_system = 'SingleSource' self.build_system.srcfile = 'compiler_warning.c' self.build_system.cflags = ['-Wall'] self.valid_prog_environs = ['*'] self.valid_systems = ['*'] self.sanity_patterns = sn.assert_found(r'warning', self.stderr) _run(MyTest(), *local_exec_ctx) def test_supports_system(hellotest, testsys_system): hellotest.valid_systems = ['*'] assert hellotest.supports_system('gpu') assert hellotest.supports_system('login') assert hellotest.supports_system('testsys:gpu') assert hellotest.supports_system('testsys:login') hellotest.valid_systems = ['*:*'] assert hellotest.supports_system('gpu') assert hellotest.supports_system('login') assert hellotest.supports_system('testsys:gpu') assert hellotest.supports_system('testsys:login') hellotest.valid_systems = ['testsys'] assert hellotest.supports_system('gpu') assert hellotest.supports_system('login') assert hellotest.supports_system('testsys:gpu') assert hellotest.supports_system('testsys:login') hellotest.valid_systems = ['testsys:gpu'] assert hellotest.supports_system('gpu') assert not hellotest.supports_system('login') assert hellotest.supports_system('testsys:gpu') assert not hellotest.supports_system('testsys:login') hellotest.valid_systems = ['testsys:login'] assert not hellotest.supports_system('gpu') assert hellotest.supports_system('login') assert not hellotest.supports_system('testsys:gpu') assert hellotest.supports_system('testsys:login') hellotest.valid_systems = ['foo'] assert not hellotest.supports_system('gpu') assert not hellotest.supports_system('login') assert not hellotest.supports_system('testsys:gpu') assert not hellotest.supports_system('testsys:login') hellotest.valid_systems = ['*:gpu'] assert hellotest.supports_system('testsys:gpu') assert hellotest.supports_system('foo:gpu') assert not hellotest.supports_system('testsys:cpu') assert not hellotest.supports_system('testsys:login') hellotest.valid_systems = ['testsys:*'] assert hellotest.supports_system('testsys:login') assert hellotest.supports_system('gpu') assert not hellotest.supports_system('foo:gpu') def test_supports_environ(hellotest, generic_system): hellotest.valid_prog_environs = ['*'] assert hellotest.supports_environ('foo1') assert hellotest.supports_environ('foo-env') assert hellotest.supports_environ('*') def test_sourcesdir_none(local_exec_ctx): @fixtures.custom_prefix('unittests/resources/checks') class MyTest(rfm.RegressionTest): def __init__(self): self.sourcesdir = None self.valid_prog_environs = ['*'] self.valid_systems = ['*'] with pytest.raises(ReframeError): _run(MyTest(), *local_exec_ctx) def test_sourcesdir_build_system(local_exec_ctx): @fixtures.custom_prefix('unittests/resources/checks') class MyTest(rfm.RegressionTest): def __init__(self): self.build_system = 'Make' self.sourcepath = 'code' self.executable = './code/hello' self.valid_systems = ['*'] self.valid_prog_environs = ['*'] self.sanity_patterns = sn.assert_found(r'Hello, World\!', self.stdout) _run(MyTest(), *local_exec_ctx) def test_sourcesdir_none_generated_sources(local_exec_ctx): @fixtures.custom_prefix('unittests/resources/checks') class MyTest(rfm.RegressionTest): def __init__(self): self.sourcesdir = None self.prebuild_cmd = [ "printf '#include <stdio.h>\\n int main(){ " "printf(\"Hello, World!\\\\n\"); return 0; }' > hello.c" ] self.executable = './hello' self.sourcepath = 'hello.c' self.valid_systems = ['*'] self.valid_prog_environs = ['*'] self.sanity_patterns = sn.assert_found(r'Hello, World\!', self.stdout) _run(MyTest(), *local_exec_ctx) def test_sourcesdir_none_compile_only(local_exec_ctx): @fixtures.custom_prefix('unittests/resources/checks') class MyTest(rfm.CompileOnlyRegressionTest): def __init__(self): self.sourcesdir = None self.valid_prog_environs = ['*'] self.valid_systems = ['*'] with pytest.raises(BuildError): _run(MyTest(), *local_exec_ctx) def test_sourcesdir_none_run_only(local_exec_ctx): @fixtures.custom_prefix('unittests/resources/checks') class MyTest(rfm.RunOnlyRegressionTest): def __init__(self): self.sourcesdir = None self.executable = 'echo' self.executable_opts = ["Hello, World!"] self.valid_prog_environs = ['*'] self.valid_systems = ['*'] self.sanity_patterns = sn.assert_found(r'Hello, World\!', self.stdout) _run(MyTest(), *local_exec_ctx) def test_sourcepath_abs(local_exec_ctx): @fixtures.custom_prefix('unittests/resources/checks') class MyTest(rfm.CompileOnlyRegressionTest): def __init__(self): self.valid_prog_environs = ['*'] self.valid_systems = ['*'] test = MyTest() test.setup(*local_exec_ctx) test.sourcepath = '/usr/src' with pytest.raises(PipelineError): test.compile() def test_sourcepath_upref(local_exec_ctx): @fixtures.custom_prefix('unittests/resources/checks') class MyTest(rfm.CompileOnlyRegressionTest): def __init__(self): self.valid_prog_environs = ['*'] self.valid_systems = ['*'] test = MyTest() test.setup(*local_exec_ctx) test.sourcepath = '../hellosrc' with pytest.raises(PipelineError): test.compile() def test_extra_resources(testsys_system): @fixtures.custom_prefix('unittests/resources/checks') class MyTest(HelloTest): def __init__(self): super().__init__() self.name = type(self).__name__ self.executable = os.path.join('.', self.name) self.local = True @rfm.run_after('setup') def set_resources(self): test.extra_resources = { 'gpu': {'num_gpus_per_node': 2}, 'datawarp': {'capacity': '100GB', 'stagein_src': test.stagedir} } test.job.options += ['--foo'] test = MyTest() partition = fixtures.partition_by_name('gpu') environ = partition.environment('builtin-gcc') _run(test, partition, environ) expected_job_options = {'--gres=gpu:2', '#DW jobdw capacity=100GB', '#DW stage_in source=%s' % test.stagedir, '--foo'} assert expected_job_options == set(test.job.options) def test_setup_hooks(local_exec_ctx): @fixtures.custom_prefix('unittests/resources/checks') class MyTest(HelloTest): def __init__(self): super().__init__() self.name = type(self).__name__ self.executable = os.path.join('.', self.name) self.count = 0 @rfm.run_before('setup') def prefoo(self): assert self.current_environ is None self.count += 1 @rfm.run_after('setup') def postfoo(self): assert self.current_environ is not None self.count += 1 test = MyTest() _run(test, *local_exec_ctx) assert test.count == 2 def test_compile_hooks(local_exec_ctx): @fixtures.custom_prefix('unittests/resources/checks') class MyTest(HelloTest): def __init__(self): super().__init__() self.name = type(self).__name__ self.executable = os.path.join('.', self.name) self.count = 0 @rfm.run_before('compile') def setflags(self): self.count += 1 @rfm.run_after('compile') def check_executable(self): exec_file = os.path.join(self.stagedir, self.executable) # Make sure that this hook is executed after compile_wait() assert os.path.exists(exec_file) test = MyTest() _run(test, *local_exec_ctx) assert test.count == 1 def test_run_hooks(local_exec_ctx): @fixtures.custom_prefix('unittests/resources/checks') class MyTest(HelloTest): def __init__(self): super().__init__() self.name = type(self).__name__ self.executable = os.path.join('.', self.name) @rfm.run_before('run') def setflags(self): self.post_run = ['echo hello > greetings.txt'] @rfm.run_after('run') def check_executable(self): outfile = os.path.join(self.stagedir, 'greetings.txt') # Make sure that this hook is executed after wait() assert os.path.exists(outfile) _run(MyTest(), *local_exec_ctx) def test_multiple_hooks(local_exec_ctx): @fixtures.custom_prefix('unittests/resources/checks') class MyTest(HelloTest): def __init__(self): super().__init__() self.name = type(self).__name__ self.executable = os.path.join('.', self.name) self.var = 0 @rfm.run_after('setup') def x(self): self.var += 1 @rfm.run_after('setup') def y(self): self.var += 1 @rfm.run_after('setup') def z(self): self.var += 1 test = MyTest() _run(test, *local_exec_ctx) assert test.var == 3 def test_stacked_hooks(local_exec_ctx): @fixtures.custom_prefix('unittests/resources/checks') class MyTest(HelloTest): def __init__(self): super().__init__() self.name = type(self).__name__ self.executable = os.path.join('.', self.name) self.var = 0 @rfm.run_before('setup') @rfm.run_after('setup') @rfm.run_after('compile') def x(self): self.var += 1 test = MyTest() _run(test, *local_exec_ctx) assert test.var == 3 def test_inherited_hooks(local_exec_ctx): @fixtures.custom_prefix('unittests/resources/checks') class BaseTest(HelloTest): def __init__(self): super().__init__() self.name = type(self).__name__ self.executable = os.path.join('.', self.name) self.var = 0 @rfm.run_after('setup') def x(self): self.var += 1 class C(rfm.RegressionTest): @rfm.run_before('run') def y(self): self.foo = 1 class DerivedTest(BaseTest, C): @rfm.run_after('setup') def z(self): self.var += 1 class MyTest(DerivedTest): pass test = MyTest() _run(test, *local_exec_ctx) assert test.var == 2 assert test.foo == 1 def test_overriden_hooks(local_exec_ctx): @fixtures.custom_prefix('unittests/resources/checks') class BaseTest(HelloTest): def __init__(self): super().__init__() self.name = type(self).__name__ self.executable = os.path.join('.', self.name) self.var = 0 self.foo = 0 @rfm.run_after('setup') def x(self): self.var += 1 @rfm.run_before('setup') def y(self): self.foo += 1 class DerivedTest(BaseTest): @rfm.run_after('setup') def x(self): self.var += 5 class MyTest(DerivedTest): @rfm.run_before('setup') def y(self): self.foo += 10 test = MyTest() _run(test, *local_exec_ctx) assert test.var == 5 assert test.foo == 10 def test_require_deps(local_exec_ctx): import reframe.frontend.dependency as dependency import reframe.frontend.executors as executors @fixtures.custom_prefix('unittests/resources/checks') class T0(HelloTest): def __init__(self): super().__init__() self.name = type(self).__name__ self.executable = os.path.join('.', self.name) self.x = 1 @fixtures.custom_prefix('unittests/resources/checks') class T1(HelloTest): def __init__(self): super().__init__() self.name = type(self).__name__ self.executable = os.path.join('.', self.name) self.depends_on('T0') @rfm.require_deps def sety(self, T0): self.y = T0().x + 1 @rfm.run_before('run') @rfm.require_deps def setz(self, T0): self.z = T0().x + 2 cases = executors.generate_testcases([T0(), T1()]) deps = dependency.build_deps(cases) for c in dependency.toposort(deps): _run(*c) for c in cases: t = c.check if t.name == 'T0': assert t.x == 1 elif t.name == 'T1': assert t.y == 2 assert t.z == 3 def test_regression_test_name(): class MyTest(rfm.RegressionTest): def __init__(self, a, b): self.a = a self.b = b test = MyTest(1, 2) assert os.path.abspath(os.path.dirname(__file__)) == test.prefix assert 'test_regression_test_name.<locals>.MyTest_1_2' == test.name def test_strange_test_names(): class C: def __init__(self, a): self.a = a def __repr__(self): return 'C(%s)' % self.a class MyTest(rfm.RegressionTest): def __init__(self, a, b): self.a = a self.b = b test = MyTest('(a*b+c)/12', C(33)) assert ('test_strange_test_names.<locals>.MyTest__a_b_c__12_C_33_' == test.name) def test_name_user_inheritance(): class MyBaseTest(rfm.RegressionTest): def __init__(self, a, b): self.a = a self.b = b class MyTest(MyBaseTest): def __init__(self): super().__init__(1, 2) test = MyTest() assert 'test_name_user_inheritance.<locals>.MyTest' == test.name def test_name_runonly_test(): class MyTest(rfm.RunOnlyRegressionTest): def __init__(self, a, b): self.a = a self.b = b test = MyTest(1, 2) assert os.path.abspath(os.path.dirname(__file__)) == test.prefix assert 'test_name_runonly_test.<locals>.MyTest_1_2' == test.name def test_name_compileonly_test(): class MyTest(rfm.CompileOnlyRegressionTest): def __init__(self, a, b): self.a = a self.b = b test = MyTest(1, 2) assert os.path.abspath(os.path.dirname(__file__)) == test.prefix assert 'test_name_compileonly_test.<locals>.MyTest_1_2' == test.name def test_registration_of_tests(): import sys import unittests.resources.checks_unlisted.good as mod checks = mod._rfm_gettests() assert 13 == len(checks) assert [mod.MyBaseTest(0, 0), mod.MyBaseTest(0, 1), mod.MyBaseTest(1, 0), mod.MyBaseTest(1, 1), mod.MyBaseTest(2, 0), mod.MyBaseTest(2, 1), mod.AnotherBaseTest(0, 0), mod.AnotherBaseTest(0, 1), mod.AnotherBaseTest(1, 0), mod.AnotherBaseTest(1, 1), mod.AnotherBaseTest(2, 0), mod.AnotherBaseTest(2, 1), mod.MyBaseTest(10, 20)] == checks def _run_sanity(test, *exec_ctx, skip_perf=False): test.setup(*exec_ctx) test.check_sanity() if not skip_perf: test.check_performance() @pytest.fixture def dummy_gpu_exec_ctx(testsys_system): partition = fixtures.partition_by_name('gpu') environ = fixtures.environment_by_name('builtin-gcc', partition) yield partition, environ @pytest.fixture def perf_file(tmp_path): yield tmp_path / 'perf.out' @pytest.fixture def sanity_file(tmp_path): yield tmp_path / 'sanity.out' @pytest.fixture def dummytest(testsys_system, perf_file, sanity_file): class MyTest(rfm.RunOnlyRegressionTest): def __init__(self): self.perf_file = perf_file self.sourcesdir = None self.reference = { 'testsys': { 'value1': (1.4, -0.1, 0.1, None), 'value2': (1.7, -0.1, 0.1, None), }, 'testsys:gpu': { 'value3': (3.1, -0.1, 0.1, None), } } self.perf_patterns = { 'value1': sn.extractsingle( r'perf1 = (\S+)', perf_file, 1, float ), 'value2': sn.extractsingle( r'perf2 = (\S+)', perf_file, 1, float ), 'value3': sn.extractsingle( r'perf3 = (\S+)', perf_file, 1, float ) } self.sanity_patterns = sn.assert_found( r'result = success', sanity_file ) yield MyTest() def test_sanity_success(dummytest, sanity_file, perf_file, dummy_gpu_exec_ctx): sanity_file.write_text('result = success\n') perf_file.write_text('perf1 = 1.3\n' 'perf2 = 1.8\n' 'perf3 = 3.3\n') _run_sanity(dummytest, *dummy_gpu_exec_ctx) def test_sanity_failure(dummytest, sanity_file, dummy_gpu_exec_ctx): sanity_file.write_text('result = failure\n') with pytest.raises(SanityError): _run_sanity(dummytest, *dummy_gpu_exec_ctx, skip_perf=True) def test_sanity_failure_noassert(dummytest, sanity_file, dummy_gpu_exec_ctx): dummytest.sanity_patterns = sn.findall(r'result = success', sanity_file) sanity_file.write_text('result = failure\n') with pytest.raises(SanityError): _run_sanity(dummytest, *dummy_gpu_exec_ctx, skip_perf=True) def test_sanity_multiple_patterns(dummytest, sanity_file, dummy_gpu_exec_ctx): sanity_file.write_text('result1 = success\n' 'result2 = success\n') # Simulate a pure sanity test; reset the perf_patterns dummytest.perf_patterns = None dummytest.sanity_patterns = sn.assert_eq( sn.count(sn.findall(r'result\d = success', sanity_file)), 2 ) _run_sanity(dummytest, *dummy_gpu_exec_ctx, skip_perf=True) # Require more patterns to be present dummytest.sanity_patterns = sn.assert_eq( sn.count(sn.findall(r'result\d = success', sanity_file)), 3 ) with pytest.raises(SanityError): _run_sanity(dummytest, *dummy_gpu_exec_ctx, skip_perf=True) def test_sanity_multiple_files(dummytest, tmp_path, dummy_gpu_exec_ctx): file0 = tmp_path / 'out1.txt' file1 = tmp_path / 'out2.txt' file0.write_text('result = success\n') file1.write_text('result = success\n') dummytest.sanity_patterns = sn.all([ sn.assert_found(r'result = success', file0), sn.assert_found(r'result = success', file1) ]) _run_sanity(dummytest, *dummy_gpu_exec_ctx, skip_perf=True) def test_performance_failure(dummytest, sanity_file, perf_file, dummy_gpu_exec_ctx): sanity_file.write_text('result = success\n') perf_file.write_text('perf1 = 1.0\n' 'perf2 = 1.8\n' 'perf3 = 3.3\n') with pytest.raises(PerformanceError): _run_sanity(dummytest, *dummy_gpu_exec_ctx) def test_reference_unknown_tag(dummytest, sanity_file, perf_file, dummy_gpu_exec_ctx): sanity_file.write_text('result = success\n') perf_file.write_text('perf1 = 1.3\n' 'perf2 = 1.8\n' 'perf3 = 3.3\n') dummytest.reference = { 'testsys': { 'value1': (1.4, -0.1, 0.1, None), 'value2': (1.7, -0.1, 0.1, None), 'foo': (3.1, -0.1, 0.1, None), } } with pytest.raises(SanityError): _run_sanity(dummytest, *dummy_gpu_exec_ctx) def test_reference_unknown_system(dummytest, sanity_file, perf_file, dummy_gpu_exec_ctx): sanity_file.write_text('result = success\n') perf_file.write_text('perf1 = 1.3\n' 'perf2 = 1.8\n' 'perf3 = 3.3\n') dummytest.reference = { 'testsys:login': { 'value1': (1.4, -0.1, 0.1, None), 'value3': (3.1, -0.1, 0.1, None), }, 'testsys:login2': { 'value2': (1.7, -0.1, 0.1, None) } } _run_sanity(dummytest, *dummy_gpu_exec_ctx) def test_reference_empty(dummytest, sanity_file, perf_file, dummy_gpu_exec_ctx): sanity_file.write_text('result = success\n') perf_file.write_text('perf1 = 1.3\n' 'perf2 = 1.8\n' 'perf3 = 3.3\n') dummytest.reference = {} _run_sanity(dummytest, *dummy_gpu_exec_ctx) def test_reference_default(dummytest, sanity_file, perf_file, dummy_gpu_exec_ctx): sanity_file.write_text('result = success\n') perf_file.write_text('perf1 = 1.3\n' 'perf2 = 1.8\n' 'perf3 = 3.3\n') dummytest.reference = { '*': { 'value1': (1.4, -0.1, 0.1, None), 'value2': (1.7, -0.1, 0.1, None), 'value3': (3.1, -0.1, 0.1, None), } } _run_sanity(dummytest, *dummy_gpu_exec_ctx) def test_reference_tag_resolution(dummytest, sanity_file, perf_file, dummy_gpu_exec_ctx): sanity_file.write_text('result = success\n') perf_file.write_text('perf1 = 1.3\n' 'perf2 = 1.8\n' 'perf3 = 3.3\n') dummytest.reference = { 'testsys': { 'value1': (1.4, -0.1, 0.1, None), 'value2': (1.7, -0.1, 0.1, None), }, '*': { 'value3': (3.1, -0.1, 0.1, None), } } _run_sanity(dummytest, *dummy_gpu_exec_ctx) def test_performance_invalid_value(dummytest, sanity_file, perf_file, dummy_gpu_exec_ctx): sanity_file.write_text('result = success\n') perf_file.write_text('perf1 = 1.3\n' 'perf2 = foo\n' 'perf3 = 3.3\n') dummytest.perf_patterns = { 'value1': sn.extractsingle(r'perf1 = (\S+)', perf_file, 1, float), 'value2': sn.extractsingle(r'perf2 = (\S+)', perf_file, 1, str), 'value3': sn.extractsingle(r'perf3 = (\S+)', perf_file, 1, float) } with pytest.raises(SanityError, match='not a number'): _run_sanity(dummytest, *dummy_gpu_exec_ctx) def test_performance_var_evaluation(dummytest, sanity_file, perf_file, dummy_gpu_exec_ctx): # All performance values must be evaluated, despite the first one # failing To test this, we need an extract function that will have a # side effect when evaluated, whose result we will check after calling # `check_performance()`. logfile = 'perf.log' @sn.sanity_function def extract_perf(patt, tag): val = sn.evaluate( sn.extractsingle(patt, perf_file, tag, float) ) with open('perf.log', 'a') as fp: fp.write('%s=%s' % (tag, val)) return val sanity_file.write_text('result = success\n') perf_file.write_text('perf1 = 1.0\n' 'perf2 = 1.8\n' 'perf3 = 3.3\n') dummytest.perf_patterns = { 'value1': extract_perf(r'perf1 = (?P<v1>\S+)', 'v1'), 'value2': extract_perf(r'perf2 = (?P<v2>\S+)', 'v2'), 'value3': extract_perf(r'perf3 = (?P<v3>\S+)', 'v3') } with pytest.raises(PerformanceError) as cm: _run_sanity(dummytest, *dummy_gpu_exec_ctx) logfile = os.path.join(dummytest.stagedir, logfile) with open(logfile) as fp: log_output = fp.read() assert 'v1' in log_output assert 'v2' in log_output assert 'v3' in log_output @pytest.fixture def container_test(tmp_path): def _container_test(platform, image): @fixtures.custom_prefix(tmp_path) class ContainerTest(rfm.RunOnlyRegressionTest): def __init__(self): self.name = 'container_test' self.valid_prog_environs = ['*'] self.valid_systems = ['*'] self.container_platform = platform self.container_platform.image = image self.container_platform.commands = [ 'pwd', 'ls', 'cat /etc/os-release' ] self.container_platform.workdir = '/workdir' self.pre_run = ['touch foo'] self.sanity_patterns = sn.all([ sn.assert_found( r'^' + self.container_platform.workdir, self.stdout), sn.assert_found(r'^foo', self.stdout), sn.assert_found( r'18\.04\.\d+ LTS $Bionic Beaver$', self.stdout), ]) return ContainerTest() yield _container_test def _cray_cle_version(): completed = os_ext.run_command('cat /etc/opt/cray/release/cle-release') matched = re.match(r'^RELEASE=(\S+)', completed.stdout) if matched is None: return None return matched.group(1) def test_with_singularity(container_test, container_remote_exec_ctx): cle_version = _cray_cle_version() if cle_version is not None and cle_version.startswith('6.0'): pytest.skip('test not supported on Cray CLE6') _run(container_test('Singularity', 'docker://ubuntu:18.04'), *container_remote_exec_ctx('Singularity')) def test_with_shifter(container_test, container_remote_exec_ctx): _run(container_test('Shifter', 'ubuntu:18.04'), *container_remote_exec_ctx('Shifter')) def test_with_sarus(container_test, container_remote_exec_ctx): _run(container_test('Sarus', 'ubuntu:18.04'), *container_remote_exec_ctx('Sarus')) def test_with_docker(container_test, container_local_exec_ctx): _run(container_test('Docker', 'ubuntu:18.04'), *container_local_exec_ctx('Docker')) def test_unknown_container_platform(container_test, local_exec_ctx): with pytest.raises(ValueError): _run(container_test('foo', 'ubuntu:18.04'), *local_exec_ctx) def test_not_configured_container_platform(container_test, local_exec_ctx): partition, environ = local_exec_ctx platform = None for cp in ['Docker', 'Singularity', 'Sarus', 'ShifterNG']: if cp not in partition.container_environs.keys(): platform = cp break if platform is None: pytest.skip('cannot find a supported platform that is not configured') with pytest.raises(PipelineError): _run(container_test(platform, 'ubuntu:18.04'), *local_exec_ctx)

31.827239

79

0.616502

import os import pathlib import pytest import re import reframe as rfm import reframe.core.runtime as rt import reframe.utility.os_ext as os_ext import reframe.utility.sanity as sn import unittests.fixtures as fixtures from reframe.core.exceptions import (BuildError, PipelineError, ReframeError, ReframeSyntaxError, PerformanceError, SanityError) from reframe.frontend.loader import RegressionCheckLoader from unittests.resources.checks.hellocheck import HelloTest def _run(test, partition, prgenv): test.setup(partition, prgenv) test.compile() test.compile_wait() test.run() test.wait() test.check_sanity() test.check_performance() test.cleanup(remove_files=True) def load_test(testfile): loader = RegressionCheckLoader(['unittests/resources/checks']) return loader.load_from_file(testfile) @pytest.fixture def temp_runtime(tmp_path): def _temp_runtime(config_file, system=None, options={}): options.update({'systems/prefix': str(tmp_path)}) with rt.temp_runtime(config_file, system, options): yield rt.runtime() yield _temp_runtime @pytest.fixture def generic_system(temp_runtime): yield from temp_runtime(fixtures.TEST_CONFIG_FILE, 'generic') @pytest.fixture def testsys_system(temp_runtime): yield from temp_runtime(fixtures.TEST_CONFIG_FILE, 'testsys') @pytest.fixture def user_system(temp_runtime): if fixtures.USER_CONFIG_FILE: yield from temp_runtime(fixtures.USER_CONFIG_FILE, fixtures.USER_SYSTEM) else: yield generic_system @pytest.fixture def hellotest(): yield load_test('unittests/resources/checks/hellocheck.py')[0] @pytest.fixture def local_exec_ctx(generic_system): partition = fixtures.partition_by_name('default') environ = fixtures.environment_by_name('builtin-gcc', partition) yield partition, environ @pytest.fixture def local_user_exec_ctx(user_system): partition = fixtures.partition_by_scheduler('local') if partition is None: pytest.skip('no local jobs are supported') try: environ = partition.environs[0] except IndexError: pytest.skip('no environments configured for partition: %s' % partition.fullname) yield partition, environ @pytest.fixture def remote_exec_ctx(user_system): partition = fixtures.partition_by_scheduler() if partition is None: pytest.skip('job submission not supported') try: environ = partition.environs[0] except IndexError: pytest.skip('no environments configured for partition: %s' % partition.fullname) yield partition, environ @pytest.fixture def remote_exec_ctx(user_system): partition = fixtures.partition_by_scheduler() if partition is None: pytest.skip('job submission not supported') try: environ = partition.environs[0] except IndexError: pytest.skip('no environments configured for partition: %s' % partition.fullname) yield partition, environ @pytest.fixture def container_remote_exec_ctx(remote_exec_ctx): def _container_exec_ctx(platform): partition = remote_exec_ctx[0] if platform not in partition.container_environs.keys(): pytest.skip('%s is not configured on the system' % platform) yield from remote_exec_ctx return _container_exec_ctx @pytest.fixture def container_local_exec_ctx(local_user_exec_ctx): def _container_exec_ctx(platform): partition = local_user_exec_ctx[0] if platform not in partition.container_environs.keys(): pytest.skip('%s is not configured on the system' % platform) yield from local_user_exec_ctx return _container_exec_ctx def test_environ_setup(hellotest, local_exec_ctx): hellotest.variables = {'_FOO_': '1', '_BAR_': '2'} hellotest.setup(*local_exec_ctx) for k in hellotest.variables.keys(): assert k not in os.environ def test_hellocheck(hellotest, remote_exec_ctx): _run(hellotest, *remote_exec_ctx) def test_hellocheck_make(remote_exec_ctx): test = load_test('unittests/resources/checks/hellocheck_make.py')[0] _run(test, *remote_exec_ctx) def test_hellocheck_local(hellotest, local_exec_ctx): hellotest.prebuild_cmd = ['touch prebuild', 'mkdir prebuild_dir'] hellotest.postbuild_cmd = ['touch postbuild', 'mkdir postbuild_dir'] hellotest.keep_files = ['prebuild', 'postbuild', 'prebuild_dir', 'postbuild_dir'] hellotest.local = True _run(hellotest, *local_exec_ctx) must_keep = [ hellotest.stdout.evaluate(), hellotest.stderr.evaluate(), hellotest.build_stdout.evaluate(), hellotest.build_stderr.evaluate(), hellotest.job.script_filename, *hellotest.keep_files ] for f in must_keep: assert os.path.exists(os.path.join(hellotest.outputdir, f)) def test_hellocheck_local_prepost_run(hellotest, local_exec_ctx): @sn.sanity_function def stagedir(test): return test.stagedir hellotest.pre_run = ['echo prerun: `pwd`'] hellotest.post_run = ['echo postrun: `pwd`'] pre_run_path = sn.extractsingle(r'^prerun: (\S+)', hellotest.stdout, 1) post_run_path = sn.extractsingle(r'^postrun: (\S+)', hellotest.stdout, 1) hellotest.sanity_patterns = sn.all([ sn.assert_eq(stagedir(hellotest), pre_run_path), sn.assert_eq(stagedir(hellotest), post_run_path), ]) _run(hellotest, *local_exec_ctx) def test_run_only_sanity(local_exec_ctx): @fixtures.custom_prefix('unittests/resources/checks') class MyTest(rfm.RunOnlyRegressionTest): def __init__(self): self.executable = './hello.sh' self.executable_opts = ['Hello, World!'] self.local = True self.valid_prog_environs = ['*'] self.valid_systems = ['*'] self.sanity_patterns = sn.assert_found( r'Hello, World\!', self.stdout) _run(MyTest(), *local_exec_ctx) def test_run_only_no_srcdir(local_exec_ctx): @fixtures.custom_prefix('foo/bar/') class MyTest(rfm.RunOnlyRegressionTest): def __init__(self): self.executable = 'echo' self.executable_opts = ['hello'] self.valid_prog_environs = ['*'] self.valid_systems = ['*'] self.sanity_patterns = sn.assert_found(r'hello', self.stdout) test = MyTest() assert test.sourcesdir is None _run(test, *local_exec_ctx) def test_compile_only_failure(local_exec_ctx): @fixtures.custom_prefix('unittests/resources/checks') class MyTest(rfm.CompileOnlyRegressionTest): def __init__(self): self.sourcepath = 'compiler_failure.c' self.valid_prog_environs = ['*'] self.valid_systems = ['*'] test = MyTest() test.setup(*local_exec_ctx) test.compile() with pytest.raises(BuildError): test.compile_wait() def test_compile_only_warning(local_exec_ctx): @fixtures.custom_prefix('unittests/resources/checks') class MyTest(rfm.RunOnlyRegressionTest): def __init__(self): self.build_system = 'SingleSource' self.build_system.srcfile = 'compiler_warning.c' self.build_system.cflags = ['-Wall'] self.valid_prog_environs = ['*'] self.valid_systems = ['*'] self.sanity_patterns = sn.assert_found(r'warning', self.stderr) _run(MyTest(), *local_exec_ctx) def test_supports_system(hellotest, testsys_system): hellotest.valid_systems = ['*'] assert hellotest.supports_system('gpu') assert hellotest.supports_system('login') assert hellotest.supports_system('testsys:gpu') assert hellotest.supports_system('testsys:login') hellotest.valid_systems = ['*:*'] assert hellotest.supports_system('gpu') assert hellotest.supports_system('login') assert hellotest.supports_system('testsys:gpu') assert hellotest.supports_system('testsys:login') hellotest.valid_systems = ['testsys'] assert hellotest.supports_system('gpu') assert hellotest.supports_system('login') assert hellotest.supports_system('testsys:gpu') assert hellotest.supports_system('testsys:login') hellotest.valid_systems = ['testsys:gpu'] assert hellotest.supports_system('gpu') assert not hellotest.supports_system('login') assert hellotest.supports_system('testsys:gpu') assert not hellotest.supports_system('testsys:login') hellotest.valid_systems = ['testsys:login'] assert not hellotest.supports_system('gpu') assert hellotest.supports_system('login') assert not hellotest.supports_system('testsys:gpu') assert hellotest.supports_system('testsys:login') hellotest.valid_systems = ['foo'] assert not hellotest.supports_system('gpu') assert not hellotest.supports_system('login') assert not hellotest.supports_system('testsys:gpu') assert not hellotest.supports_system('testsys:login') hellotest.valid_systems = ['*:gpu'] assert hellotest.supports_system('testsys:gpu') assert hellotest.supports_system('foo:gpu') assert not hellotest.supports_system('testsys:cpu') assert not hellotest.supports_system('testsys:login') hellotest.valid_systems = ['testsys:*'] assert hellotest.supports_system('testsys:login') assert hellotest.supports_system('gpu') assert not hellotest.supports_system('foo:gpu') def test_supports_environ(hellotest, generic_system): hellotest.valid_prog_environs = ['*'] assert hellotest.supports_environ('foo1') assert hellotest.supports_environ('foo-env') assert hellotest.supports_environ('*') def test_sourcesdir_none(local_exec_ctx): @fixtures.custom_prefix('unittests/resources/checks') class MyTest(rfm.RegressionTest): def __init__(self): self.sourcesdir = None self.valid_prog_environs = ['*'] self.valid_systems = ['*'] with pytest.raises(ReframeError): _run(MyTest(), *local_exec_ctx) def test_sourcesdir_build_system(local_exec_ctx): @fixtures.custom_prefix('unittests/resources/checks') class MyTest(rfm.RegressionTest): def __init__(self): self.build_system = 'Make' self.sourcepath = 'code' self.executable = './code/hello' self.valid_systems = ['*'] self.valid_prog_environs = ['*'] self.sanity_patterns = sn.assert_found(r'Hello, World\!', self.stdout) _run(MyTest(), *local_exec_ctx) def test_sourcesdir_none_generated_sources(local_exec_ctx): @fixtures.custom_prefix('unittests/resources/checks') class MyTest(rfm.RegressionTest): def __init__(self): self.sourcesdir = None self.prebuild_cmd = [ "printf '#include <stdio.h>\\n int main(){ " "printf(\"Hello, World!\\\\n\"); return 0; }' > hello.c" ] self.executable = './hello' self.sourcepath = 'hello.c' self.valid_systems = ['*'] self.valid_prog_environs = ['*'] self.sanity_patterns = sn.assert_found(r'Hello, World\!', self.stdout) _run(MyTest(), *local_exec_ctx) def test_sourcesdir_none_compile_only(local_exec_ctx): @fixtures.custom_prefix('unittests/resources/checks') class MyTest(rfm.CompileOnlyRegressionTest): def __init__(self): self.sourcesdir = None self.valid_prog_environs = ['*'] self.valid_systems = ['*'] with pytest.raises(BuildError): _run(MyTest(), *local_exec_ctx) def test_sourcesdir_none_run_only(local_exec_ctx): @fixtures.custom_prefix('unittests/resources/checks') class MyTest(rfm.RunOnlyRegressionTest): def __init__(self): self.sourcesdir = None self.executable = 'echo' self.executable_opts = ["Hello, World!"] self.valid_prog_environs = ['*'] self.valid_systems = ['*'] self.sanity_patterns = sn.assert_found(r'Hello, World\!', self.stdout) _run(MyTest(), *local_exec_ctx) def test_sourcepath_abs(local_exec_ctx): @fixtures.custom_prefix('unittests/resources/checks') class MyTest(rfm.CompileOnlyRegressionTest): def __init__(self): self.valid_prog_environs = ['*'] self.valid_systems = ['*'] test = MyTest() test.setup(*local_exec_ctx) test.sourcepath = '/usr/src' with pytest.raises(PipelineError): test.compile() def test_sourcepath_upref(local_exec_ctx): @fixtures.custom_prefix('unittests/resources/checks') class MyTest(rfm.CompileOnlyRegressionTest): def __init__(self): self.valid_prog_environs = ['*'] self.valid_systems = ['*'] test = MyTest() test.setup(*local_exec_ctx) test.sourcepath = '../hellosrc' with pytest.raises(PipelineError): test.compile() def test_extra_resources(testsys_system): @fixtures.custom_prefix('unittests/resources/checks') class MyTest(HelloTest): def __init__(self): super().__init__() self.name = type(self).__name__ self.executable = os.path.join('.', self.name) self.local = True @rfm.run_after('setup') def set_resources(self): test.extra_resources = { 'gpu': {'num_gpus_per_node': 2}, 'datawarp': {'capacity': '100GB', 'stagein_src': test.stagedir} } test.job.options += ['--foo'] test = MyTest() partition = fixtures.partition_by_name('gpu') environ = partition.environment('builtin-gcc') _run(test, partition, environ) expected_job_options = {'--gres=gpu:2', '#DW jobdw capacity=100GB', '#DW stage_in source=%s' % test.stagedir, '--foo'} assert expected_job_options == set(test.job.options) def test_setup_hooks(local_exec_ctx): @fixtures.custom_prefix('unittests/resources/checks') class MyTest(HelloTest): def __init__(self): super().__init__() self.name = type(self).__name__ self.executable = os.path.join('.', self.name) self.count = 0 @rfm.run_before('setup') def prefoo(self): assert self.current_environ is None self.count += 1 @rfm.run_after('setup') def postfoo(self): assert self.current_environ is not None self.count += 1 test = MyTest() _run(test, *local_exec_ctx) assert test.count == 2 def test_compile_hooks(local_exec_ctx): @fixtures.custom_prefix('unittests/resources/checks') class MyTest(HelloTest): def __init__(self): super().__init__() self.name = type(self).__name__ self.executable = os.path.join('.', self.name) self.count = 0 @rfm.run_before('compile') def setflags(self): self.count += 1 @rfm.run_after('compile') def check_executable(self): exec_file = os.path.join(self.stagedir, self.executable) assert os.path.exists(exec_file) test = MyTest() _run(test, *local_exec_ctx) assert test.count == 1 def test_run_hooks(local_exec_ctx): @fixtures.custom_prefix('unittests/resources/checks') class MyTest(HelloTest): def __init__(self): super().__init__() self.name = type(self).__name__ self.executable = os.path.join('.', self.name) @rfm.run_before('run') def setflags(self): self.post_run = ['echo hello > greetings.txt'] @rfm.run_after('run') def check_executable(self): outfile = os.path.join(self.stagedir, 'greetings.txt') assert os.path.exists(outfile) _run(MyTest(), *local_exec_ctx) def test_multiple_hooks(local_exec_ctx): @fixtures.custom_prefix('unittests/resources/checks') class MyTest(HelloTest): def __init__(self): super().__init__() self.name = type(self).__name__ self.executable = os.path.join('.', self.name) self.var = 0 @rfm.run_after('setup') def x(self): self.var += 1 @rfm.run_after('setup') def y(self): self.var += 1 @rfm.run_after('setup') def z(self): self.var += 1 test = MyTest() _run(test, *local_exec_ctx) assert test.var == 3 def test_stacked_hooks(local_exec_ctx): @fixtures.custom_prefix('unittests/resources/checks') class MyTest(HelloTest): def __init__(self): super().__init__() self.name = type(self).__name__ self.executable = os.path.join('.', self.name) self.var = 0 @rfm.run_before('setup') @rfm.run_after('setup') @rfm.run_after('compile') def x(self): self.var += 1 test = MyTest() _run(test, *local_exec_ctx) assert test.var == 3 def test_inherited_hooks(local_exec_ctx): @fixtures.custom_prefix('unittests/resources/checks') class BaseTest(HelloTest): def __init__(self): super().__init__() self.name = type(self).__name__ self.executable = os.path.join('.', self.name) self.var = 0 @rfm.run_after('setup') def x(self): self.var += 1 class C(rfm.RegressionTest): @rfm.run_before('run') def y(self): self.foo = 1 class DerivedTest(BaseTest, C): @rfm.run_after('setup') def z(self): self.var += 1 class MyTest(DerivedTest): pass test = MyTest() _run(test, *local_exec_ctx) assert test.var == 2 assert test.foo == 1 def test_overriden_hooks(local_exec_ctx): @fixtures.custom_prefix('unittests/resources/checks') class BaseTest(HelloTest): def __init__(self): super().__init__() self.name = type(self).__name__ self.executable = os.path.join('.', self.name) self.var = 0 self.foo = 0 @rfm.run_after('setup') def x(self): self.var += 1 @rfm.run_before('setup') def y(self): self.foo += 1 class DerivedTest(BaseTest): @rfm.run_after('setup') def x(self): self.var += 5 class MyTest(DerivedTest): @rfm.run_before('setup') def y(self): self.foo += 10 test = MyTest() _run(test, *local_exec_ctx) assert test.var == 5 assert test.foo == 10 def test_require_deps(local_exec_ctx): import reframe.frontend.dependency as dependency import reframe.frontend.executors as executors @fixtures.custom_prefix('unittests/resources/checks') class T0(HelloTest): def __init__(self): super().__init__() self.name = type(self).__name__ self.executable = os.path.join('.', self.name) self.x = 1 @fixtures.custom_prefix('unittests/resources/checks') class T1(HelloTest): def __init__(self): super().__init__() self.name = type(self).__name__ self.executable = os.path.join('.', self.name) self.depends_on('T0') @rfm.require_deps def sety(self, T0): self.y = T0().x + 1 @rfm.run_before('run') @rfm.require_deps def setz(self, T0): self.z = T0().x + 2 cases = executors.generate_testcases([T0(), T1()]) deps = dependency.build_deps(cases) for c in dependency.toposort(deps): _run(*c) for c in cases: t = c.check if t.name == 'T0': assert t.x == 1 elif t.name == 'T1': assert t.y == 2 assert t.z == 3 def test_regression_test_name(): class MyTest(rfm.RegressionTest): def __init__(self, a, b): self.a = a self.b = b test = MyTest(1, 2) assert os.path.abspath(os.path.dirname(__file__)) == test.prefix assert 'test_regression_test_name.<locals>.MyTest_1_2' == test.name def test_strange_test_names(): class C: def __init__(self, a): self.a = a def __repr__(self): return 'C(%s)' % self.a class MyTest(rfm.RegressionTest): def __init__(self, a, b): self.a = a self.b = b test = MyTest('(a*b+c)/12', C(33)) assert ('test_strange_test_names.<locals>.MyTest__a_b_c__12_C_33_' == test.name) def test_name_user_inheritance(): class MyBaseTest(rfm.RegressionTest): def __init__(self, a, b): self.a = a self.b = b class MyTest(MyBaseTest): def __init__(self): super().__init__(1, 2) test = MyTest() assert 'test_name_user_inheritance.<locals>.MyTest' == test.name def test_name_runonly_test(): class MyTest(rfm.RunOnlyRegressionTest): def __init__(self, a, b): self.a = a self.b = b test = MyTest(1, 2) assert os.path.abspath(os.path.dirname(__file__)) == test.prefix assert 'test_name_runonly_test.<locals>.MyTest_1_2' == test.name def test_name_compileonly_test(): class MyTest(rfm.CompileOnlyRegressionTest): def __init__(self, a, b): self.a = a self.b = b test = MyTest(1, 2) assert os.path.abspath(os.path.dirname(__file__)) == test.prefix assert 'test_name_compileonly_test.<locals>.MyTest_1_2' == test.name def test_registration_of_tests(): import sys import unittests.resources.checks_unlisted.good as mod checks = mod._rfm_gettests() assert 13 == len(checks) assert [mod.MyBaseTest(0, 0), mod.MyBaseTest(0, 1), mod.MyBaseTest(1, 0), mod.MyBaseTest(1, 1), mod.MyBaseTest(2, 0), mod.MyBaseTest(2, 1), mod.AnotherBaseTest(0, 0), mod.AnotherBaseTest(0, 1), mod.AnotherBaseTest(1, 0), mod.AnotherBaseTest(1, 1), mod.AnotherBaseTest(2, 0), mod.AnotherBaseTest(2, 1), mod.MyBaseTest(10, 20)] == checks def _run_sanity(test, *exec_ctx, skip_perf=False): test.setup(*exec_ctx) test.check_sanity() if not skip_perf: test.check_performance() @pytest.fixture def dummy_gpu_exec_ctx(testsys_system): partition = fixtures.partition_by_name('gpu') environ = fixtures.environment_by_name('builtin-gcc', partition) yield partition, environ @pytest.fixture def perf_file(tmp_path): yield tmp_path / 'perf.out' @pytest.fixture def sanity_file(tmp_path): yield tmp_path / 'sanity.out' @pytest.fixture def dummytest(testsys_system, perf_file, sanity_file): class MyTest(rfm.RunOnlyRegressionTest): def __init__(self): self.perf_file = perf_file self.sourcesdir = None self.reference = { 'testsys': { 'value1': (1.4, -0.1, 0.1, None), 'value2': (1.7, -0.1, 0.1, None), }, 'testsys:gpu': { 'value3': (3.1, -0.1, 0.1, None), } } self.perf_patterns = { 'value1': sn.extractsingle( r'perf1 = (\S+)', perf_file, 1, float ), 'value2': sn.extractsingle( r'perf2 = (\S+)', perf_file, 1, float ), 'value3': sn.extractsingle( r'perf3 = (\S+)', perf_file, 1, float ) } self.sanity_patterns = sn.assert_found( r'result = success', sanity_file ) yield MyTest() def test_sanity_success(dummytest, sanity_file, perf_file, dummy_gpu_exec_ctx): sanity_file.write_text('result = success\n') perf_file.write_text('perf1 = 1.3\n' 'perf2 = 1.8\n' 'perf3 = 3.3\n') _run_sanity(dummytest, *dummy_gpu_exec_ctx) def test_sanity_failure(dummytest, sanity_file, dummy_gpu_exec_ctx): sanity_file.write_text('result = failure\n') with pytest.raises(SanityError): _run_sanity(dummytest, *dummy_gpu_exec_ctx, skip_perf=True) def test_sanity_failure_noassert(dummytest, sanity_file, dummy_gpu_exec_ctx): dummytest.sanity_patterns = sn.findall(r'result = success', sanity_file) sanity_file.write_text('result = failure\n') with pytest.raises(SanityError): _run_sanity(dummytest, *dummy_gpu_exec_ctx, skip_perf=True) def test_sanity_multiple_patterns(dummytest, sanity_file, dummy_gpu_exec_ctx): sanity_file.write_text('result1 = success\n' 'result2 = success\n') dummytest.perf_patterns = None dummytest.sanity_patterns = sn.assert_eq( sn.count(sn.findall(r'result\d = success', sanity_file)), 2 ) _run_sanity(dummytest, *dummy_gpu_exec_ctx, skip_perf=True) dummytest.sanity_patterns = sn.assert_eq( sn.count(sn.findall(r'result\d = success', sanity_file)), 3 ) with pytest.raises(SanityError): _run_sanity(dummytest, *dummy_gpu_exec_ctx, skip_perf=True) def test_sanity_multiple_files(dummytest, tmp_path, dummy_gpu_exec_ctx): file0 = tmp_path / 'out1.txt' file1 = tmp_path / 'out2.txt' file0.write_text('result = success\n') file1.write_text('result = success\n') dummytest.sanity_patterns = sn.all([ sn.assert_found(r'result = success', file0), sn.assert_found(r'result = success', file1) ]) _run_sanity(dummytest, *dummy_gpu_exec_ctx, skip_perf=True) def test_performance_failure(dummytest, sanity_file, perf_file, dummy_gpu_exec_ctx): sanity_file.write_text('result = success\n') perf_file.write_text('perf1 = 1.0\n' 'perf2 = 1.8\n' 'perf3 = 3.3\n') with pytest.raises(PerformanceError): _run_sanity(dummytest, *dummy_gpu_exec_ctx) def test_reference_unknown_tag(dummytest, sanity_file, perf_file, dummy_gpu_exec_ctx): sanity_file.write_text('result = success\n') perf_file.write_text('perf1 = 1.3\n' 'perf2 = 1.8\n' 'perf3 = 3.3\n') dummytest.reference = { 'testsys': { 'value1': (1.4, -0.1, 0.1, None), 'value2': (1.7, -0.1, 0.1, None), 'foo': (3.1, -0.1, 0.1, None), } } with pytest.raises(SanityError): _run_sanity(dummytest, *dummy_gpu_exec_ctx) def test_reference_unknown_system(dummytest, sanity_file, perf_file, dummy_gpu_exec_ctx): sanity_file.write_text('result = success\n') perf_file.write_text('perf1 = 1.3\n' 'perf2 = 1.8\n' 'perf3 = 3.3\n') dummytest.reference = { 'testsys:login': { 'value1': (1.4, -0.1, 0.1, None), 'value3': (3.1, -0.1, 0.1, None), }, 'testsys:login2': { 'value2': (1.7, -0.1, 0.1, None) } } _run_sanity(dummytest, *dummy_gpu_exec_ctx) def test_reference_empty(dummytest, sanity_file, perf_file, dummy_gpu_exec_ctx): sanity_file.write_text('result = success\n') perf_file.write_text('perf1 = 1.3\n' 'perf2 = 1.8\n' 'perf3 = 3.3\n') dummytest.reference = {} _run_sanity(dummytest, *dummy_gpu_exec_ctx) def test_reference_default(dummytest, sanity_file, perf_file, dummy_gpu_exec_ctx): sanity_file.write_text('result = success\n') perf_file.write_text('perf1 = 1.3\n' 'perf2 = 1.8\n' 'perf3 = 3.3\n') dummytest.reference = { '*': { 'value1': (1.4, -0.1, 0.1, None), 'value2': (1.7, -0.1, 0.1, None), 'value3': (3.1, -0.1, 0.1, None), } } _run_sanity(dummytest, *dummy_gpu_exec_ctx) def test_reference_tag_resolution(dummytest, sanity_file, perf_file, dummy_gpu_exec_ctx): sanity_file.write_text('result = success\n') perf_file.write_text('perf1 = 1.3\n' 'perf2 = 1.8\n' 'perf3 = 3.3\n') dummytest.reference = { 'testsys': { 'value1': (1.4, -0.1, 0.1, None), 'value2': (1.7, -0.1, 0.1, None), }, '*': { 'value3': (3.1, -0.1, 0.1, None), } } _run_sanity(dummytest, *dummy_gpu_exec_ctx) def test_performance_invalid_value(dummytest, sanity_file, perf_file, dummy_gpu_exec_ctx): sanity_file.write_text('result = success\n') perf_file.write_text('perf1 = 1.3\n' 'perf2 = foo\n' 'perf3 = 3.3\n') dummytest.perf_patterns = { 'value1': sn.extractsingle(r'perf1 = (\S+)', perf_file, 1, float), 'value2': sn.extractsingle(r'perf2 = (\S+)', perf_file, 1, str), 'value3': sn.extractsingle(r'perf3 = (\S+)', perf_file, 1, float) } with pytest.raises(SanityError, match='not a number'): _run_sanity(dummytest, *dummy_gpu_exec_ctx) def test_performance_var_evaluation(dummytest, sanity_file, perf_file, dummy_gpu_exec_ctx): logfile = 'perf.log' @sn.sanity_function def extract_perf(patt, tag): val = sn.evaluate( sn.extractsingle(patt, perf_file, tag, float) ) with open('perf.log', 'a') as fp: fp.write('%s=%s' % (tag, val)) return val sanity_file.write_text('result = success\n') perf_file.write_text('perf1 = 1.0\n' 'perf2 = 1.8\n' 'perf3 = 3.3\n') dummytest.perf_patterns = { 'value1': extract_perf(r'perf1 = (?P<v1>\S+)', 'v1'), 'value2': extract_perf(r'perf2 = (?P<v2>\S+)', 'v2'), 'value3': extract_perf(r'perf3 = (?P<v3>\S+)', 'v3') } with pytest.raises(PerformanceError) as cm: _run_sanity(dummytest, *dummy_gpu_exec_ctx) logfile = os.path.join(dummytest.stagedir, logfile) with open(logfile) as fp: log_output = fp.read() assert 'v1' in log_output assert 'v2' in log_output assert 'v3' in log_output @pytest.fixture def container_test(tmp_path): def _container_test(platform, image): @fixtures.custom_prefix(tmp_path) class ContainerTest(rfm.RunOnlyRegressionTest): def __init__(self): self.name = 'container_test' self.valid_prog_environs = ['*'] self.valid_systems = ['*'] self.container_platform = platform self.container_platform.image = image self.container_platform.commands = [ 'pwd', 'ls', 'cat /etc/os-release' ] self.container_platform.workdir = '/workdir' self.pre_run = ['touch foo'] self.sanity_patterns = sn.all([ sn.assert_found( r'^' + self.container_platform.workdir, self.stdout), sn.assert_found(r'^foo', self.stdout), sn.assert_found( r'18\.04\.\d+ LTS $Bionic Beaver$', self.stdout), ]) return ContainerTest() yield _container_test def _cray_cle_version(): completed = os_ext.run_command('cat /etc/opt/cray/release/cle-release') matched = re.match(r'^RELEASE=(\S+)', completed.stdout) if matched is None: return None return matched.group(1) def test_with_singularity(container_test, container_remote_exec_ctx): cle_version = _cray_cle_version() if cle_version is not None and cle_version.startswith('6.0'): pytest.skip('test not supported on Cray CLE6') _run(container_test('Singularity', 'docker://ubuntu:18.04'), *container_remote_exec_ctx('Singularity')) def test_with_shifter(container_test, container_remote_exec_ctx): _run(container_test('Shifter', 'ubuntu:18.04'), *container_remote_exec_ctx('Shifter')) def test_with_sarus(container_test, container_remote_exec_ctx): _run(container_test('Sarus', 'ubuntu:18.04'), *container_remote_exec_ctx('Sarus')) def test_with_docker(container_test, container_local_exec_ctx): _run(container_test('Docker', 'ubuntu:18.04'), *container_local_exec_ctx('Docker')) def test_unknown_container_platform(container_test, local_exec_ctx): with pytest.raises(ValueError): _run(container_test('foo', 'ubuntu:18.04'), *local_exec_ctx) def test_not_configured_container_platform(container_test, local_exec_ctx): partition, environ = local_exec_ctx platform = None for cp in ['Docker', 'Singularity', 'Sarus', 'ShifterNG']: if cp not in partition.container_environs.keys(): platform = cp break if platform is None: pytest.skip('cannot find a supported platform that is not configured') with pytest.raises(PipelineError): _run(container_test(platform, 'ubuntu:18.04'), *local_exec_ctx)

true

1c2ff2f8bc879c16f78556a674ed8c6aeb2eef07

27,688

py

Python

analysis.py

ElectronicNose/Electronic-Nose

3e79711a7701d352ef5c1c2151c535c5b576b71e

[ "MIT" ]

1

2019-10-08T05:12:52.000Z

analysis.py

ElectronicNose/Electronic-Nose

3e79711a7701d352ef5c1c2151c535c5b576b71e

[ "MIT" ]

null

analysis.py

ElectronicNose/Electronic-Nose

3e79711a7701d352ef5c1c2151c535c5b576b71e

[ "MIT" ]

null

#analysis files from PyQt5 import QtCore, QtGui, QtWidgets from PyQt5.QtWidgets import QFileDialog from analysis_gui import Ui_Analysis import numpy as np import matplotlib,math,csv matplotlib.use('Qt5Agg') from matplotlib.backends.backend_qt5agg import FigureCanvasQTAgg as FigureCanvas from matplotlib.backends.backend_qt5agg import NavigationToolbar2QT as NavigationToolbar from matplotlib.figure import Figure class MyMplCanvas(FigureCanvas): """Ultimately, this is a QWidget (as well as a FigureCanvasAgg, etc.).""" def __init__(self, parent=None): fig = Figure() self.axes = fig.add_subplot(111) self.compute_initial_figure() FigureCanvas.__init__(self, fig) self.setParent(parent) FigureCanvas.setSizePolicy(self, QtWidgets.QSizePolicy.Expanding, QtWidgets.QSizePolicy.Expanding) FigureCanvas.updateGeometry(self) def compute_initial_figure(self): pass class Radar(FigureCanvas): def __init__(self, titles, rect=None, parent=None): fig = Figure() if rect is None: rect = [0.05, 0.05, 0.8, 0.8] self.n = len(titles) self.angles = np.arange(90, 90 + 360, 360.0 / self.n) self.angles = [a % 360 for a in self.angles] self.axes = [fig.add_axes(rect, projection="polar", label="axes%d" % i) for i in range(self.n)] #FigureCanvas.setSizePolicy(self, #QtWidgets.QSizePolicy.Expanding, #QtWidgets.QSizePolicy.Expanding) #FigureCanvas.updateGeometry(self) self.ax = self.axes[0] self.ax.set_thetagrids(self.angles,labels=titles, fontsize=14) for ax in self.axes[1:]: ax.patch.set_visible(False) ax.grid("off") ax.xaxis.set_visible(False) for ax, angle in zip(self.axes, self.angles): ax.set_rgrids([0.2,0.4,0.6,0.8,1.0], angle=angle) ax.spines["polar"].set_visible(False) ax.set_ylim(auto=True) ax.set_xlim(auto=True) FigureCanvas.__init__(self, fig) self.setParent(parent) def plot(self, values, *args, **kw): angle = np.deg2rad(np.r_[self.angles, self.angles[0]]) values = np.r_[values, values[0]] self.ax.plot(angle, values, *args, **kw) class Analysis(QtWidgets.QMainWindow, Ui_Analysis): def __init__(self,parent = None): super(Analysis,self).__init__(parent) self.setupUi(self) self.XY_widget = QtWidgets.QWidget(self.tab_XY) self.Radar_widget = QtWidgets.QWidget(self.tab_Radar) self.Box_widget = QtWidgets.QWidget(self.tab_Box) self.Table_widget = QtWidgets.QWidget(self.tab_Table) self.XY_Layout = QtWidgets.QVBoxLayout(self.XY_widget) self.XY = MyMplCanvas(self.XY_widget) self.XY_Layout.addWidget(self.XY) self.mpl_toolbar = NavigationToolbar(self.XY, self.XY_widget) self.XY_Layout.addWidget(self.mpl_toolbar) self.Box_Layout = QtWidgets.QVBoxLayout(self.Box_widget) self.box = MyMplCanvas(self.Box_widget) self.Box_Layout.addWidget(self.box) self.box_toolbar = NavigationToolbar(self.box, self.Box_widget) self.Box_Layout.addWidget(self.box_toolbar) #self.tabWidget.setFocus() #self.setCentralWidget(self.tabWidget) #self.XY_widget.setFocus() #self.Radar_widget.setFocus() #self.Box_widget.setFocus() #self.tabWidget.setFocus() #self.setCentralWidget(self.tabWidget) self.actionOpen.triggered.connect(self.open) self.actionMax_min.triggered.connect(self.max_min) self.actionStandardization_M_0_S_1.triggered.connect(self.standardization) self.actionBaseline_Correction.triggered.connect(self.baseline) self.actionPeak_Detection.triggered.connect(self.peak_detection) self.actionFWHM.triggered.connect(self.FWHM) self.actionRise_Time.triggered.connect(self.rise_time) self.actionFall_Time.triggered.connect(self.fall_time) self.sensor_name = [] self.sensor_sn = [] self.time = [] self.s1, self.s2, self.s3, self.s4, self.s5 = [], [], [], [], [] self.s6, self.s7, self.s8, self.s9, self.s10 = [], [], [], [], [] self.s11, self.s12, self.s13, self.s14, self.s15 = [], [], [], [], [] self.s16, self.s17, self.s18 = [], [], [] def open(self): self.data = [] self.sensor_name = [] self.sensor_sn = [] self.time = [] self.s1, self.s2, self.s3, self.s4, self.s5 = [], [], [], [], [] self.s6, self.s7, self.s8, self.s9, self.s10 = [], [], [], [], [] self.s11, self.s12, self.s13, self.s14, self.s15 = [], [], [], [], [] self.s16, self.s17, self.s18 = [], [], [] self.s1_normalized = [] self.s2_normalized = [] self.s3_normalized = [] self.s4_normalized = [] self.s5_normalized = [] self.s6_normalized = [] self.s7_normalized = [] self.s8_normalized = [] self.s9_normalized = [] self.s10_normalized = [] self.s11_normalized = [] self.s12_normalized = [] self.s13_normalized = [] self.s14_normalized = [] self.s15_normalized = [] self.s16_normalized = [] self.s17_normalized = [] self.s18_normalized = [] filename = QFileDialog.getOpenFileName(self, 'Open',filter="CSV Files (*.csv);;FOX Files (*.txt)", initialFilter= "CSV Files (*.csv)") if filename[0]=='': print("Cancel") elif filename[1]=='FOX Files (*.txt)': file = open(filename[0]) lines = file.readlines() for i in range(len(lines)): if lines[i].startswith("[SENSOR NAME]"): i += 1 self.sensor_name = lines[i].split() if lines[i].startswith("[SENSOR SN]"): i += 1 self.sensor_sn = lines[i].split() if lines[i].startswith("[SENSOR DATA]"): j = i + 1 self.data = [] for i in range(121): self.data.append(lines[j].split()) j += 1 print(self.sensor_name) print(self.sensor_sn) print(self.data) for i in range(len(self.data)): for j in range(19): if j==0: self.time.append(self.data[i][j]) if j==1: self.s1.append(float(self.data[i][j])) if j==2: self.s2.append(float(self.data[i][j])) if j==3: self.s3.append(float(self.data[i][j])) if j==4: self.s4.append(float(self.data[i][j])) if j==5: self.s5.append(float(self.data[i][j])) if j==6: self.s6.append(float(self.data[i][j])) if j==7: self.s7.append(float(self.data[i][j])) if j==8: self.s8.append(float(self.data[i][j])) if j==9: self.s9.append(float(self.data[i][j])) if j==10: self.s10.append(float(self.data[i][j])) if j==11: self.s11.append(float(self.data[i][j])) if j==12: self.s12.append(float(self.data[i][j])) if j==13: self.s13.append(float(self.data[i][j])) if j==14: self.s14.append(float(self.data[i][j])) if j==15: self.s15.append(float(self.data[i][j])) if j==16: self.s16.append(float(self.data[i][j])) if j==17: self.s17.append(float(self.data[i][j])) if j==18: self.s18.append(float(self.data[i][j])) self.XY.axes.cla() self.XY.axes.plot(self.time, self.s1,label=self.sensor_name[0]) self.XY.axes.plot(self.time, self.s2,label=self.sensor_name[1]) self.XY.axes.plot(self.time, self.s3,label=self.sensor_name[2]) self.XY.axes.plot(self.time, self.s4,label=self.sensor_name[3]) self.XY.axes.plot(self.time, self.s5,label=self.sensor_name[4]) self.XY.axes.plot(self.time, self.s6,label=self.sensor_name[5]) self.XY.axes.plot(self.time, self.s7,label=self.sensor_name[6]) self.XY.axes.plot(self.time, self.s8,label=self.sensor_name[7]) self.XY.axes.plot(self.time, self.s9,label=self.sensor_name[8]) self.XY.axes.plot(self.time, self.s10,label=self.sensor_name[9]) self.XY.axes.plot(self.time, self.s11,label=self.sensor_name[10]) self.XY.axes.plot(self.time, self.s12,label=self.sensor_name[11]) self.XY.axes.plot(self.time, self.s13,label=self.sensor_name[12]) self.XY.axes.plot(self.time, self.s14,label=self.sensor_name[13]) self.XY.axes.plot(self.time, self.s15,label=self.sensor_name[14]) self.XY.axes.plot(self.time, self.s16,label=self.sensor_name[15]) self.XY.axes.plot(self.time, self.s17,label=self.sensor_name[16]) self.XY.axes.plot(self.time, self.s18,label=self.sensor_name[17]) self.XY.axes.set_xlabel("Time") self.XY.axes.set_ylabel("Impedance") self.XY.axes.legend(loc='best') self.XY.draw() self.menuNormalization.setEnabled(True) for item in self.s1: self.s1_normalized.append((item - min(self.s1)) / (max(self.s1) - min(self.s1))) for item in self.s2: self.s2_normalized.append((item - min(self.s2)) / (max(self.s2) - min(self.s2))) for item in self.s3: self.s3_normalized.append((item - min(self.s3)) / (max(self.s3) - min(self.s3))) for item in self.s4: self.s4_normalized.append((item - min(self.s4)) / (max(self.s4) - min(self.s4))) for item in self.s5: self.s5_normalized.append((item - min(self.s5)) / (max(self.s5) - min(self.s5))) for item in self.s6: self.s6_normalized.append((item - min(self.s6)) / (max(self.s6) - min(self.s6))) for item in self.s7: self.s7_normalized.append((item - min(self.s7)) / (max(self.s7) - min(self.s7))) for item in self.s8: self.s8_normalized.append((item - min(self.s8)) / (max(self.s8) - min(self.s8))) for item in self.s9: self.s9_normalized.append((item - min(self.s9)) / (max(self.s9) - min(self.s9))) for item in self.s10: self.s10_normalized.append((item - min(self.s10)) / (max(self.s10) - min(self.s10))) for item in self.s11: self.s11_normalized.append((item - min(self.s11)) / (max(self.s11) - min(self.s11))) for item in self.s12: self.s12_normalized.append((item - min(self.s12)) / (max(self.s12) - min(self.s12))) for item in self.s13: self.s13_normalized.append((item - min(self.s13)) / (max(self.s13) - min(self.s13))) for item in self.s14: self.s14_normalized.append((item - min(self.s14)) / (max(self.s14) - min(self.s14))) for item in self.s15: self.s15_normalized.append((item - min(self.s15)) / (max(self.s15) - min(self.s15))) for item in self.s16: self.s16_normalized.append((item - min(self.s16)) / (max(self.s16) - min(self.s16))) for item in self.s17: self.s17_normalized.append((item - min(self.s17)) / (max(self.s17) - min(self.s17))) for item in self.s18: self.s18_normalized.append((item - min(self.s18)) / (max(self.s18) - min(self.s18))) self.radar_plot() self.box_plot() elif filename[1] == "CSV Files (*.csv)": with open(filename[0], 'r') as csvfile: lines = csv.reader(csvfile) data = list(lines) self.tableWidget.setRowCount(len(data)) self.tableWidget.setColumnCount(64) for i in range(3): for j in range(2): self.tableWidget.setItem(i,j,QtWidgets.QTableWidgetItem(data[i][j])) for i in range(3,len(data)): for j in range(64): self.tableWidget.setItem(i, j, QtWidgets.QTableWidgetItem(data[i][j])) def max_min(self): self.XY.axes.cla() self.XY.axes.plot(self.time, self.s1_normalized, label=self.sensor_name[0]) ''' self.sc.axes.plot(self.time, self.s2_normalized, label=self.sensor_name[1]) self.sc.axes.plot(self.time, self.s3_normalized, label=self.sensor_name[2]) self.sc.axes.plot(self.time, self.s4_normalized, label=self.sensor_name[3]) self.sc.axes.plot(self.time, self.s5_normalized, label=self.sensor_name[4]) self.sc.axes.plot(self.time, self.s6_normalized, label=self.sensor_name[5]) self.sc.axes.plot(self.time, self.s7_normalized, label=self.sensor_name[6]) self.sc.axes.plot(self.time, self.s8_normalized, label=self.sensor_name[7]) self.sc.axes.plot(self.time, self.s9_normalized, label=self.sensor_name[8]) self.sc.axes.plot(self.time, self.s10_normalized, label=self.sensor_name[9]) self.sc.axes.plot(self.time, self.s11_normalized, label=self.sensor_name[10]) self.sc.axes.plot(self.time, self.s12_normalized, label=self.sensor_name[11]) self.sc.axes.plot(self.time, self.s13_normalized, label=self.sensor_name[12]) self.sc.axes.plot(self.time, self.s14_normalized, label=self.sensor_name[13]) self.sc.axes.plot(self.time, self.s15_normalized, label=self.sensor_name[14]) self.sc.axes.plot(self.time, self.s16_normalized, label=self.sensor_name[15]) self.sc.axes.plot(self.time, self.s17_normalized, label=self.sensor_name[16]) self.sc.axes.plot(self.time, self.s18_normalized, label=self.sensor_name[17]) ''' self.XY.axes.set_xlabel("Time") self.XY.axes.set_ylabel("Impedance") self.XY.axes.legend(loc='best') self.XY.draw() self.actionPeak_Detection.setEnabled(True) self.actionRise_Time.setEnabled(True) self.actionFall_Time.setEnabled(True) self.actionFWHM.setEnabled(True) def standardization(self): z1,z2,z3,z4,z5,z6,z7,z8,z9,z10,z11,z12,z13,z14,z15,z16,z17,z18 = [],[],[],[],[],[],[],[],[],[],[],[],[],[],[],[],[],[] m1 = sum(self.s1) / len(self.s1) m2 = sum(self.s2) / len(self.s2) m3 = sum(self.s3) / len(self.s3) m4 = sum(self.s4) / len(self.s4) m5 = sum(self.s5) / len(self.s5) m6 = sum(self.s6) / len(self.s6) m7 = sum(self.s7) / len(self.s7) m8 = sum(self.s8) / len(self.s8) m9 = sum(self.s9) / len(self.s9) m10 = sum(self.s10) / len(self.s10) m11 = sum(self.s11) / len(self.s11) m12 = sum(self.s12) / len(self.s12) m13 = sum(self.s13) / len(self.s13) m14 = sum(self.s14) / len(self.s14) m15 = sum(self.s15) / len(self.s15) m16 = sum(self.s16) / len(self.s16) m17 = sum(self.s17) / len(self.s17) m18 = sum(self.s18) / len(self.s18) sd1 = self.calculate_sd(self.s1, m1) sd2 = self.calculate_sd(self.s2, m2) sd3 = self.calculate_sd(self.s3, m3) sd4 = self.calculate_sd(self.s4, m4) sd5 = self.calculate_sd(self.s5, m5) sd6 = self.calculate_sd(self.s6, m6) sd7 = self.calculate_sd(self.s7, m7) sd8 = self.calculate_sd(self.s8, m8) sd9 = self.calculate_sd(self.s9, m9) sd10 = self.calculate_sd(self.s10, m10) sd11 = self.calculate_sd(self.s11, m11) sd12 = self.calculate_sd(self.s12, m12) sd13 = self.calculate_sd(self.s13, m13) sd14 = self.calculate_sd(self.s14, m14) sd15 = self.calculate_sd(self.s15, m15) sd16 = self.calculate_sd(self.s16, m16) sd17 = self.calculate_sd(self.s17, m17) sd18 = self.calculate_sd(self.s18, m18) for item in self.s1: z1.append((item-m1)/sd1) for item in self.s2: z2.append((item-m2)/sd2) for item in self.s3: z3.append((item-m3)/sd3) for item in self.s4: z4.append((item-m4)/sd4) for item in self.s5: z5.append((item-m5)/sd5) for item in self.s6: z6.append((item-m6)/sd6) for item in self.s7: z7.append((item-m7)/sd7) for item in self.s8: z8.append((item-m8)/sd8) for item in self.s9: z9.append((item-m9)/sd9) for item in self.s10: z10.append((item-m10)/sd10) for item in self.s11: z11.append((item-m11)/sd11) for item in self.s12: z12.append((item-m12)/sd12) for item in self.s13: z13.append((item-m13)/sd13) for item in self.s14: z14.append((item-m14)/sd14) for item in self.s15: z15.append((item-m15)/sd15) for item in self.s16: z16.append((item-m16)/sd16) for item in self.s17: z17.append((item-m17)/sd17) for item in self.s18: z18.append((item-m18)/sd18) ''' mz1 = sum(z1) / len(z1) mz2 = sum(z2) / len(z2) mz3 = sum(z3) / len(z3) mz4 = sum(z4) / len(z4) mz5 = sum(z5) / len(z5) mz6 = sum(z6) / len(z6) mz7 = sum(z7) / len(z7) mz8 = sum(z8) / len(z8) mz9 = sum(z9) / len(z9) mz10 = sum(z10) / len(z10) mz11 = sum(z11) / len(z11) mz12 = sum(z12) / len(z12) mz13 = sum(z13) / len(z13) mz14 = sum(z14) / len(z14) mz15 = sum(z15) / len(z15) mz16 = sum(z16) / len(z16) mz17 = sum(z17) / len(z17) mz18 = sum(z18) / len(z18) sdz1 = self.calculate_sd(z1, mz1) sdz2 = self.calculate_sd(z2, mz2) sdz3 = self.calculate_sd(z3, mz3) sdz4 = self.calculate_sd(z4, mz4) sdz5 = self.calculate_sd(z5, mz5) sdz6 = self.calculate_sd(z6, mz6) sdz7 = self.calculate_sd(z7, mz7) sdz8 = self.calculate_sd(z8, mz8) sdz9 = self.calculate_sd(z9, mz9) sdz10 = self.calculate_sd(z10, mz10) sdz11 = self.calculate_sd(z11, mz11) sdz12 = self.calculate_sd(z12, mz12) sdz13 = self.calculate_sd(z13, mz13) sdz14 = self.calculate_sd(z14, mz14) sdz15 = self.calculate_sd(z15, mz15) sdz16 = self.calculate_sd(z16, mz16) sdz17 = self.calculate_sd(z17, mz17) sdz18 = self.calculate_sd(z18, mz18) print(mz1,sdz1) print(mz2, sdz2) print(mz3, sdz3) print(mz4, sdz4) print(mz5, sdz5) print(mz6, sdz6) print(mz7, sdz7) print(mz8, sdz8) print(mz9, sdz9) print(mz10, sdz10) print(mz11, sdz11) print(mz12, sdz12) print(mz13, sdz13) print(mz14, sdz14) print(mz15, sdz15) print(mz16, sdz16) print(mz17, sdz17) print(mz18, sdz18) ''' self.XY.axes.cla() self.XY.axes.plot(self.time, z1, label=self.sensor_name[0]) ''' self.sc.axes.plot(self.time, z2, label=self.sensor_name[1]) self.sc.axes.plot(self.time, z3, label=self.sensor_name[2]) self.sc.axes.plot(self.time, z4, label=self.sensor_name[3]) self.sc.axes.plot(self.time, z5, label=self.sensor_name[4]) self.sc.axes.plot(self.time, z6, label=self.sensor_name[5]) self.sc.axes.plot(self.time, z7, label=self.sensor_name[6]) self.sc.axes.plot(self.time, z8, label=self.sensor_name[7]) self.sc.axes.plot(self.time, z9, label=self.sensor_name[8]) self.sc.axes.plot(self.time, z10, label=self.sensor_name[9]) self.sc.axes.plot(self.time, z11, label=self.sensor_name[10]) self.sc.axes.plot(self.time, z12, label=self.sensor_name[11]) self.sc.axes.plot(self.time, z13, label=self.sensor_name[12]) self.sc.axes.plot(self.time, z14, label=self.sensor_name[13]) self.sc.axes.plot(self.time, z15, label=self.sensor_name[14]) self.sc.axes.plot(self.time, z16, label=self.sensor_name[15]) self.sc.axes.plot(self.time, z17, label=self.sensor_name[16]) self.sc.axes.plot(self.time, z18, label=self.sensor_name[17]) ''' self.XY.axes.set_xlabel("Time") self.XY.axes.set_ylabel("Impedance") self.XY.axes.legend(loc='best') self.XY.draw() def calculate_sd(self,list,mean): sd = 0.0 for item in list: sd += (item-mean) ** 2 sd = sd/(len(list)-1) sd = sd ** (1/2) return sd def baseline(self): ''' s1 = np.array(self.s1) base = peakutils.baseline(s1, deg=3, max_it=100, tol=0.001) #self.sc.axes.cla() self.sc.axes.plot(self.time, base, label="baseline",c='red') self.sc.axes.legend(loc='best') self.sc.draw() ''' def peak_detection(self): s1_diff = [] self.s1_indexes = [] for i in range(len(self.s1_normalized)-1): s1_diff.append(self.s1_normalized[i+1]-self.s1_normalized[i]) print("diff=" + str(s1_diff)) print(len(s1_diff)) for i in range(len(s1_diff)-1): if s1_diff[i]>0 and s1_diff[i+1]<0: self.s1_indexes.append(i+1) print(self.s1_indexes) for i in range(len(self.s1_indexes)-1): if self.s1_normalized[self.s1_indexes[i]]>0.5 and (self.s1_indexes[i+1]-self.s1_indexes[i])>=5: self.XY.axes.scatter(self.time[self.s1_indexes[i]], self.s1_normalized[self.s1_indexes[i]],c='red') self.XY.draw() self.actionRise_Time.setEnabled(True) def rise_time(self): upper_limit = 0 lower_limit = 0 max_index = 0 rel_tol = 0.05 abs_tol = 0.1 peak_values = [] #for i in range(len(self.s1_indexes)): #peak_values.append(self.s1_normalized[self.s1_indexes[i]]) for i in range(len(self.s1_normalized)): if self.s1_normalized[i]==max(self.s1_normalized): max_index = i print("max index=" + str(max_index)) for i in range(max_index): #if math.isclose(self.s1_normalized[i],0.9*self.s1_normalized[peak_index],rel_tol=0.05): if abs(self.s1_normalized[i]-0.9*max(self.s1_normalized)) <= abs_tol: upper_limit = i #if math.isclose(self.s1_normalized[i], 0.1*self.s1_normalized[peak_index], rel_tol=0.05): if abs(self.s1_normalized[i]-0.1*max(self.s1_normalized)) <= abs_tol: lower_limit = i print(upper_limit) print(lower_limit) self.XY.axes.text(100,0.9,"Rise Time = " + str(upper_limit-lower_limit)+'s') self.XY.draw() def fall_time(self): upper_limit = 0 lower_limit = 0 max_index = 0 rel_tol = 0.05 abs_tol = 0.1 for i in range(len(self.s1_normalized)): if self.s1_normalized[i]==max(self.s1_normalized): max_index = i print("max index="+ str(max_index)) for i in range(max_index,len(self.s1_normalized)): if abs(self.s1_normalized[i] - 0.9 * max(self.s1_normalized)) <= abs_tol: lower_limit = i if abs(self.s1_normalized[i] - 0.1 * max(self.s1_normalized)) <= abs_tol: upper_limit = i break print(upper_limit) print(lower_limit) self.XY.axes.text(100,0.8,"Fall Time = " + str(upper_limit - lower_limit) + 's') self.XY.draw() def FWHM(self): upper_limit = 0 lower_limit = 0 max_index = 0 rel_tol = 0.15 abs_tol = 0.1 for i in range(len(self.s1_normalized)): if self.s1_normalized[i] == max(self.s1_normalized): max_index = i print("max index=" + str(max_index)) for i in range(max_index): if abs(self.s1_normalized[i] - 0.5 * max(self.s1_normalized)) <= abs_tol: lower_limit = i for i in range(max_index, len(self.s1_normalized)): if abs(self.s1_normalized[i] - 0.5 * max(self.s1_normalized)) <= abs_tol: upper_limit = i break print(upper_limit) print(lower_limit) x = [lower_limit,upper_limit] y = [self.s1_normalized[lower_limit],self.s1_normalized[upper_limit]] self.XY.axes.plot(x,y,c='red') self.XY.axes.text(100,0.7, "FWHM = " + str(upper_limit - lower_limit) + 's') self.XY.draw() def radar_plot(self): titles = self.sensor_name self.Radar_Layout = QtWidgets.QVBoxLayout(self.Radar_widget) self.radar = Radar(titles, rect=None, parent=self.Radar_widget) self.Radar_Layout.addWidget(self.radar) self.radar_toolbar = NavigationToolbar(self.radar, self.Radar_widget) self.Radar_Layout.addWidget(self.radar_toolbar) for i in range(121): self.radar.plot([self.s1_normalized[i],self.s2_normalized[i],self.s3_normalized[i],self.s4_normalized[i],self.s5_normalized[i],self.s6_normalized[i],self.s7_normalized[i],self.s8_normalized[i],self.s9_normalized[i],self.s10_normalized[i],self.s11_normalized[i],self.s12_normalized[i],self.s13_normalized[i],self.s14_normalized[i],self.s15_normalized[i],self.s16_normalized[i],self.s17_normalized[i],self.s18_normalized[i]]) self.radar.draw() self.actionRadar_Plot.setEnabled(False) def box_plot(self): labels = self.sensor_name data = [self.s1_normalized,self.s2_normalized,self.s3_normalized,self.s4_normalized,self.s5_normalized,self.s6_normalized,self.s7_normalized,self.s8_normalized,self.s9_normalized,self.s10_normalized,self.s11_normalized,self.s12_normalized,self.s13_normalized,self.s14_normalized,self.s15_normalized,self.s16_normalized,self.s17_normalized,self.s18_normalized] self.box.axes.cla() self.box.axes.boxplot(data,labels=labels) self.box.axes.set_ylabel("Impedance") self.box.draw()

44.3008

436

0.556992

from PyQt5 import QtCore, QtGui, QtWidgets from PyQt5.QtWidgets import QFileDialog from analysis_gui import Ui_Analysis import numpy as np import matplotlib,math,csv matplotlib.use('Qt5Agg') from matplotlib.backends.backend_qt5agg import FigureCanvasQTAgg as FigureCanvas from matplotlib.backends.backend_qt5agg import NavigationToolbar2QT as NavigationToolbar from matplotlib.figure import Figure class MyMplCanvas(FigureCanvas): def __init__(self, parent=None): fig = Figure() self.axes = fig.add_subplot(111) self.compute_initial_figure() FigureCanvas.__init__(self, fig) self.setParent(parent) FigureCanvas.setSizePolicy(self, QtWidgets.QSizePolicy.Expanding, QtWidgets.QSizePolicy.Expanding) FigureCanvas.updateGeometry(self) def compute_initial_figure(self): pass class Radar(FigureCanvas): def __init__(self, titles, rect=None, parent=None): fig = Figure() if rect is None: rect = [0.05, 0.05, 0.8, 0.8] self.n = len(titles) self.angles = np.arange(90, 90 + 360, 360.0 / self.n) self.angles = [a % 360 for a in self.angles] self.axes = [fig.add_axes(rect, projection="polar", label="axes%d" % i) for i in range(self.n)] self.ax = self.axes[0] self.ax.set_thetagrids(self.angles,labels=titles, fontsize=14) for ax in self.axes[1:]: ax.patch.set_visible(False) ax.grid("off") ax.xaxis.set_visible(False) for ax, angle in zip(self.axes, self.angles): ax.set_rgrids([0.2,0.4,0.6,0.8,1.0], angle=angle) ax.spines["polar"].set_visible(False) ax.set_ylim(auto=True) ax.set_xlim(auto=True) FigureCanvas.__init__(self, fig) self.setParent(parent) def plot(self, values, *args, **kw): angle = np.deg2rad(np.r_[self.angles, self.angles[0]]) values = np.r_[values, values[0]] self.ax.plot(angle, values, *args, **kw) class Analysis(QtWidgets.QMainWindow, Ui_Analysis): def __init__(self,parent = None): super(Analysis,self).__init__(parent) self.setupUi(self) self.XY_widget = QtWidgets.QWidget(self.tab_XY) self.Radar_widget = QtWidgets.QWidget(self.tab_Radar) self.Box_widget = QtWidgets.QWidget(self.tab_Box) self.Table_widget = QtWidgets.QWidget(self.tab_Table) self.XY_Layout = QtWidgets.QVBoxLayout(self.XY_widget) self.XY = MyMplCanvas(self.XY_widget) self.XY_Layout.addWidget(self.XY) self.mpl_toolbar = NavigationToolbar(self.XY, self.XY_widget) self.XY_Layout.addWidget(self.mpl_toolbar) self.Box_Layout = QtWidgets.QVBoxLayout(self.Box_widget) self.box = MyMplCanvas(self.Box_widget) self.Box_Layout.addWidget(self.box) self.box_toolbar = NavigationToolbar(self.box, self.Box_widget) self.Box_Layout.addWidget(self.box_toolbar) self.actionOpen.triggered.connect(self.open) self.actionMax_min.triggered.connect(self.max_min) self.actionStandardization_M_0_S_1.triggered.connect(self.standardization) self.actionBaseline_Correction.triggered.connect(self.baseline) self.actionPeak_Detection.triggered.connect(self.peak_detection) self.actionFWHM.triggered.connect(self.FWHM) self.actionRise_Time.triggered.connect(self.rise_time) self.actionFall_Time.triggered.connect(self.fall_time) self.sensor_name = [] self.sensor_sn = [] self.time = [] self.s1, self.s2, self.s3, self.s4, self.s5 = [], [], [], [], [] self.s6, self.s7, self.s8, self.s9, self.s10 = [], [], [], [], [] self.s11, self.s12, self.s13, self.s14, self.s15 = [], [], [], [], [] self.s16, self.s17, self.s18 = [], [], [] def open(self): self.data = [] self.sensor_name = [] self.sensor_sn = [] self.time = [] self.s1, self.s2, self.s3, self.s4, self.s5 = [], [], [], [], [] self.s6, self.s7, self.s8, self.s9, self.s10 = [], [], [], [], [] self.s11, self.s12, self.s13, self.s14, self.s15 = [], [], [], [], [] self.s16, self.s17, self.s18 = [], [], [] self.s1_normalized = [] self.s2_normalized = [] self.s3_normalized = [] self.s4_normalized = [] self.s5_normalized = [] self.s6_normalized = [] self.s7_normalized = [] self.s8_normalized = [] self.s9_normalized = [] self.s10_normalized = [] self.s11_normalized = [] self.s12_normalized = [] self.s13_normalized = [] self.s14_normalized = [] self.s15_normalized = [] self.s16_normalized = [] self.s17_normalized = [] self.s18_normalized = [] filename = QFileDialog.getOpenFileName(self, 'Open',filter="CSV Files (*.csv);;FOX Files (*.txt)", initialFilter= "CSV Files (*.csv)") if filename[0]=='': print("Cancel") elif filename[1]=='FOX Files (*.txt)': file = open(filename[0]) lines = file.readlines() for i in range(len(lines)): if lines[i].startswith("[SENSOR NAME]"): i += 1 self.sensor_name = lines[i].split() if lines[i].startswith("[SENSOR SN]"): i += 1 self.sensor_sn = lines[i].split() if lines[i].startswith("[SENSOR DATA]"): j = i + 1 self.data = [] for i in range(121): self.data.append(lines[j].split()) j += 1 print(self.sensor_name) print(self.sensor_sn) print(self.data) for i in range(len(self.data)): for j in range(19): if j==0: self.time.append(self.data[i][j]) if j==1: self.s1.append(float(self.data[i][j])) if j==2: self.s2.append(float(self.data[i][j])) if j==3: self.s3.append(float(self.data[i][j])) if j==4: self.s4.append(float(self.data[i][j])) if j==5: self.s5.append(float(self.data[i][j])) if j==6: self.s6.append(float(self.data[i][j])) if j==7: self.s7.append(float(self.data[i][j])) if j==8: self.s8.append(float(self.data[i][j])) if j==9: self.s9.append(float(self.data[i][j])) if j==10: self.s10.append(float(self.data[i][j])) if j==11: self.s11.append(float(self.data[i][j])) if j==12: self.s12.append(float(self.data[i][j])) if j==13: self.s13.append(float(self.data[i][j])) if j==14: self.s14.append(float(self.data[i][j])) if j==15: self.s15.append(float(self.data[i][j])) if j==16: self.s16.append(float(self.data[i][j])) if j==17: self.s17.append(float(self.data[i][j])) if j==18: self.s18.append(float(self.data[i][j])) self.XY.axes.cla() self.XY.axes.plot(self.time, self.s1,label=self.sensor_name[0]) self.XY.axes.plot(self.time, self.s2,label=self.sensor_name[1]) self.XY.axes.plot(self.time, self.s3,label=self.sensor_name[2]) self.XY.axes.plot(self.time, self.s4,label=self.sensor_name[3]) self.XY.axes.plot(self.time, self.s5,label=self.sensor_name[4]) self.XY.axes.plot(self.time, self.s6,label=self.sensor_name[5]) self.XY.axes.plot(self.time, self.s7,label=self.sensor_name[6]) self.XY.axes.plot(self.time, self.s8,label=self.sensor_name[7]) self.XY.axes.plot(self.time, self.s9,label=self.sensor_name[8]) self.XY.axes.plot(self.time, self.s10,label=self.sensor_name[9]) self.XY.axes.plot(self.time, self.s11,label=self.sensor_name[10]) self.XY.axes.plot(self.time, self.s12,label=self.sensor_name[11]) self.XY.axes.plot(self.time, self.s13,label=self.sensor_name[12]) self.XY.axes.plot(self.time, self.s14,label=self.sensor_name[13]) self.XY.axes.plot(self.time, self.s15,label=self.sensor_name[14]) self.XY.axes.plot(self.time, self.s16,label=self.sensor_name[15]) self.XY.axes.plot(self.time, self.s17,label=self.sensor_name[16]) self.XY.axes.plot(self.time, self.s18,label=self.sensor_name[17]) self.XY.axes.set_xlabel("Time") self.XY.axes.set_ylabel("Impedance") self.XY.axes.legend(loc='best') self.XY.draw() self.menuNormalization.setEnabled(True) for item in self.s1: self.s1_normalized.append((item - min(self.s1)) / (max(self.s1) - min(self.s1))) for item in self.s2: self.s2_normalized.append((item - min(self.s2)) / (max(self.s2) - min(self.s2))) for item in self.s3: self.s3_normalized.append((item - min(self.s3)) / (max(self.s3) - min(self.s3))) for item in self.s4: self.s4_normalized.append((item - min(self.s4)) / (max(self.s4) - min(self.s4))) for item in self.s5: self.s5_normalized.append((item - min(self.s5)) / (max(self.s5) - min(self.s5))) for item in self.s6: self.s6_normalized.append((item - min(self.s6)) / (max(self.s6) - min(self.s6))) for item in self.s7: self.s7_normalized.append((item - min(self.s7)) / (max(self.s7) - min(self.s7))) for item in self.s8: self.s8_normalized.append((item - min(self.s8)) / (max(self.s8) - min(self.s8))) for item in self.s9: self.s9_normalized.append((item - min(self.s9)) / (max(self.s9) - min(self.s9))) for item in self.s10: self.s10_normalized.append((item - min(self.s10)) / (max(self.s10) - min(self.s10))) for item in self.s11: self.s11_normalized.append((item - min(self.s11)) / (max(self.s11) - min(self.s11))) for item in self.s12: self.s12_normalized.append((item - min(self.s12)) / (max(self.s12) - min(self.s12))) for item in self.s13: self.s13_normalized.append((item - min(self.s13)) / (max(self.s13) - min(self.s13))) for item in self.s14: self.s14_normalized.append((item - min(self.s14)) / (max(self.s14) - min(self.s14))) for item in self.s15: self.s15_normalized.append((item - min(self.s15)) / (max(self.s15) - min(self.s15))) for item in self.s16: self.s16_normalized.append((item - min(self.s16)) / (max(self.s16) - min(self.s16))) for item in self.s17: self.s17_normalized.append((item - min(self.s17)) / (max(self.s17) - min(self.s17))) for item in self.s18: self.s18_normalized.append((item - min(self.s18)) / (max(self.s18) - min(self.s18))) self.radar_plot() self.box_plot() elif filename[1] == "CSV Files (*.csv)": with open(filename[0], 'r') as csvfile: lines = csv.reader(csvfile) data = list(lines) self.tableWidget.setRowCount(len(data)) self.tableWidget.setColumnCount(64) for i in range(3): for j in range(2): self.tableWidget.setItem(i,j,QtWidgets.QTableWidgetItem(data[i][j])) for i in range(3,len(data)): for j in range(64): self.tableWidget.setItem(i, j, QtWidgets.QTableWidgetItem(data[i][j])) def max_min(self): self.XY.axes.cla() self.XY.axes.plot(self.time, self.s1_normalized, label=self.sensor_name[0]) self.XY.axes.set_xlabel("Time") self.XY.axes.set_ylabel("Impedance") self.XY.axes.legend(loc='best') self.XY.draw() self.actionPeak_Detection.setEnabled(True) self.actionRise_Time.setEnabled(True) self.actionFall_Time.setEnabled(True) self.actionFWHM.setEnabled(True) def standardization(self): z1,z2,z3,z4,z5,z6,z7,z8,z9,z10,z11,z12,z13,z14,z15,z16,z17,z18 = [],[],[],[],[],[],[],[],[],[],[],[],[],[],[],[],[],[] m1 = sum(self.s1) / len(self.s1) m2 = sum(self.s2) / len(self.s2) m3 = sum(self.s3) / len(self.s3) m4 = sum(self.s4) / len(self.s4) m5 = sum(self.s5) / len(self.s5) m6 = sum(self.s6) / len(self.s6) m7 = sum(self.s7) / len(self.s7) m8 = sum(self.s8) / len(self.s8) m9 = sum(self.s9) / len(self.s9) m10 = sum(self.s10) / len(self.s10) m11 = sum(self.s11) / len(self.s11) m12 = sum(self.s12) / len(self.s12) m13 = sum(self.s13) / len(self.s13) m14 = sum(self.s14) / len(self.s14) m15 = sum(self.s15) / len(self.s15) m16 = sum(self.s16) / len(self.s16) m17 = sum(self.s17) / len(self.s17) m18 = sum(self.s18) / len(self.s18) sd1 = self.calculate_sd(self.s1, m1) sd2 = self.calculate_sd(self.s2, m2) sd3 = self.calculate_sd(self.s3, m3) sd4 = self.calculate_sd(self.s4, m4) sd5 = self.calculate_sd(self.s5, m5) sd6 = self.calculate_sd(self.s6, m6) sd7 = self.calculate_sd(self.s7, m7) sd8 = self.calculate_sd(self.s8, m8) sd9 = self.calculate_sd(self.s9, m9) sd10 = self.calculate_sd(self.s10, m10) sd11 = self.calculate_sd(self.s11, m11) sd12 = self.calculate_sd(self.s12, m12) sd13 = self.calculate_sd(self.s13, m13) sd14 = self.calculate_sd(self.s14, m14) sd15 = self.calculate_sd(self.s15, m15) sd16 = self.calculate_sd(self.s16, m16) sd17 = self.calculate_sd(self.s17, m17) sd18 = self.calculate_sd(self.s18, m18) for item in self.s1: z1.append((item-m1)/sd1) for item in self.s2: z2.append((item-m2)/sd2) for item in self.s3: z3.append((item-m3)/sd3) for item in self.s4: z4.append((item-m4)/sd4) for item in self.s5: z5.append((item-m5)/sd5) for item in self.s6: z6.append((item-m6)/sd6) for item in self.s7: z7.append((item-m7)/sd7) for item in self.s8: z8.append((item-m8)/sd8) for item in self.s9: z9.append((item-m9)/sd9) for item in self.s10: z10.append((item-m10)/sd10) for item in self.s11: z11.append((item-m11)/sd11) for item in self.s12: z12.append((item-m12)/sd12) for item in self.s13: z13.append((item-m13)/sd13) for item in self.s14: z14.append((item-m14)/sd14) for item in self.s15: z15.append((item-m15)/sd15) for item in self.s16: z16.append((item-m16)/sd16) for item in self.s17: z17.append((item-m17)/sd17) for item in self.s18: z18.append((item-m18)/sd18) self.XY.axes.cla() self.XY.axes.plot(self.time, z1, label=self.sensor_name[0]) self.XY.axes.set_xlabel("Time") self.XY.axes.set_ylabel("Impedance") self.XY.axes.legend(loc='best') self.XY.draw() def calculate_sd(self,list,mean): sd = 0.0 for item in list: sd += (item-mean) ** 2 sd = sd/(len(list)-1) sd = sd ** (1/2) return sd def baseline(self): def peak_detection(self): s1_diff = [] self.s1_indexes = [] for i in range(len(self.s1_normalized)-1): s1_diff.append(self.s1_normalized[i+1]-self.s1_normalized[i]) print("diff=" + str(s1_diff)) print(len(s1_diff)) for i in range(len(s1_diff)-1): if s1_diff[i]>0 and s1_diff[i+1]<0: self.s1_indexes.append(i+1) print(self.s1_indexes) for i in range(len(self.s1_indexes)-1): if self.s1_normalized[self.s1_indexes[i]]>0.5 and (self.s1_indexes[i+1]-self.s1_indexes[i])>=5: self.XY.axes.scatter(self.time[self.s1_indexes[i]], self.s1_normalized[self.s1_indexes[i]],c='red') self.XY.draw() self.actionRise_Time.setEnabled(True) def rise_time(self): upper_limit = 0 lower_limit = 0 max_index = 0 rel_tol = 0.05 abs_tol = 0.1 peak_values = [] for i in range(len(self.s1_normalized)): if self.s1_normalized[i]==max(self.s1_normalized): max_index = i print("max index=" + str(max_index)) for i in range(max_index): if abs(self.s1_normalized[i]-0.9*max(self.s1_normalized)) <= abs_tol: upper_limit = i if abs(self.s1_normalized[i]-0.1*max(self.s1_normalized)) <= abs_tol: lower_limit = i print(upper_limit) print(lower_limit) self.XY.axes.text(100,0.9,"Rise Time = " + str(upper_limit-lower_limit)+'s') self.XY.draw() def fall_time(self): upper_limit = 0 lower_limit = 0 max_index = 0 rel_tol = 0.05 abs_tol = 0.1 for i in range(len(self.s1_normalized)): if self.s1_normalized[i]==max(self.s1_normalized): max_index = i print("max index="+ str(max_index)) for i in range(max_index,len(self.s1_normalized)): if abs(self.s1_normalized[i] - 0.9 * max(self.s1_normalized)) <= abs_tol: lower_limit = i if abs(self.s1_normalized[i] - 0.1 * max(self.s1_normalized)) <= abs_tol: upper_limit = i break print(upper_limit) print(lower_limit) self.XY.axes.text(100,0.8,"Fall Time = " + str(upper_limit - lower_limit) + 's') self.XY.draw() def FWHM(self): upper_limit = 0 lower_limit = 0 max_index = 0 rel_tol = 0.15 abs_tol = 0.1 for i in range(len(self.s1_normalized)): if self.s1_normalized[i] == max(self.s1_normalized): max_index = i print("max index=" + str(max_index)) for i in range(max_index): if abs(self.s1_normalized[i] - 0.5 * max(self.s1_normalized)) <= abs_tol: lower_limit = i for i in range(max_index, len(self.s1_normalized)): if abs(self.s1_normalized[i] - 0.5 * max(self.s1_normalized)) <= abs_tol: upper_limit = i break print(upper_limit) print(lower_limit) x = [lower_limit,upper_limit] y = [self.s1_normalized[lower_limit],self.s1_normalized[upper_limit]] self.XY.axes.plot(x,y,c='red') self.XY.axes.text(100,0.7, "FWHM = " + str(upper_limit - lower_limit) + 's') self.XY.draw() def radar_plot(self): titles = self.sensor_name self.Radar_Layout = QtWidgets.QVBoxLayout(self.Radar_widget) self.radar = Radar(titles, rect=None, parent=self.Radar_widget) self.Radar_Layout.addWidget(self.radar) self.radar_toolbar = NavigationToolbar(self.radar, self.Radar_widget) self.Radar_Layout.addWidget(self.radar_toolbar) for i in range(121): self.radar.plot([self.s1_normalized[i],self.s2_normalized[i],self.s3_normalized[i],self.s4_normalized[i],self.s5_normalized[i],self.s6_normalized[i],self.s7_normalized[i],self.s8_normalized[i],self.s9_normalized[i],self.s10_normalized[i],self.s11_normalized[i],self.s12_normalized[i],self.s13_normalized[i],self.s14_normalized[i],self.s15_normalized[i],self.s16_normalized[i],self.s17_normalized[i],self.s18_normalized[i]]) self.radar.draw() self.actionRadar_Plot.setEnabled(False) def box_plot(self): labels = self.sensor_name data = [self.s1_normalized,self.s2_normalized,self.s3_normalized,self.s4_normalized,self.s5_normalized,self.s6_normalized,self.s7_normalized,self.s8_normalized,self.s9_normalized,self.s10_normalized,self.s11_normalized,self.s12_normalized,self.s13_normalized,self.s14_normalized,self.s15_normalized,self.s16_normalized,self.s17_normalized,self.s18_normalized] self.box.axes.cla() self.box.axes.boxplot(data,labels=labels) self.box.axes.set_ylabel("Impedance") self.box.draw()

true

1c2ff38c1946798381749e366e028267adeefd55

2,459

py

Python

batch_script/Bootstrap_Energy.py

DavidAce/2Component_GL

b0821956ebe1d65355b2afd954b099ed18b9ad54

[ "MIT" ]

null

batch_script/Bootstrap_Energy.py

DavidAce/2Component_GL

b0821956ebe1d65355b2afd954b099ed18b9ad54

[ "MIT" ]

null

batch_script/Bootstrap_Energy.py

DavidAce/2Component_GL

b0821956ebe1d65355b2afd954b099ed18b9ad54

[ "MIT" ]

null

import numpy as np import matplotlib.pyplot as plt import matplotlib.colors as mcolors import sys import os import math from statsmodels.graphics.tsaplots import plot_acf import statsmodels.api as sm from statsmodels.tsa.stattools import acf import scipy.integrate as integrate import random import h5py beta_low=float(sys.argv[1]) beta_high=float(sys.argv[2]) nbeta=int(sys.argv[3]) h=float(sys.argv[4]) e=float(sys.argv[5]) transient_time=float(sys.argv[6]) tau_max=float(sys.argv[7]) transient_time=int(transient_time) tau_max=int(tau_max) beta=np.zeros((nbeta)) if( (h).is_integer()): h=int(h) L=[] for ind in range(8, len(sys.argv)): L.append(int(sys.argv[ind])) block_size=20*tau_max plt.rc('text', usetex=True) plt.rc('font', family='serif', size=18) plt.rc('text.latex', preamble=r'\usepackage{bm}') fig, ax1 = plt.subplots(2, 1, figsize=(9,12)) ax1[0].set_title("h=%s; e=%s" %(h, e)) ax1[0].set_xlabel(r"$\beta$") ax1[0].set_ylabel(r"$E/V$") ax1[1].set_xlabel(r"$\beta$") ax1[1].set_ylabel(r"$C_{v}$") for l in range(len(L)): BASEDIR=("/home/ilaria/Desktop/MultiComponents_SC/Output_2C/L%d_e%s_h%s_bmin%s_bmax%s" %(L[l], e, h, beta_low, beta_high)) Cv_mean=np.zeros((nbeta)) Cv_err=np.zeros((nbeta)) E_mean=np.zeros((nbeta)) E_err=np.zeros((nbeta)) for b in range(nbeta): beta[b]=beta_low +b*(beta_high -beta_low)/(nbeta-1) #fileE=("%s/beta_%d/Energy.npy" %(BASEDIR, b)) #E=np.load(fileE) file=h5py.File('%s/beta_%d/Output.h5' %(BASEDIR, b), 'r') E=np.asarray(file['Measurements']['E']) #cut of the transient regime: E=E[transient_time:] # print(len(E)) E_mean[b]=np.mean(E)/(L[l]**3) E_err[b]=np.sqrt(np.var(E/(L[l]**3))/(len(E)-1)) nblocks=int(len(E)/block_size) # print(nblocks) varE_resampling=np.zeros((nblocks)) for block in range(nblocks): # <E²> - <E>² varE_resampling[block]=np.var(np.random.choice(E, size=block_size)) Cv_mean[b]=beta[b]*np.var(E)/(L[l]**3) Cv_err[b]= (beta[b]/(L[l]**3))*np.sqrt(np.var(varE_resampling)/(nblocks-1)) ax1[0].plot(beta, E_mean, '-') ax1[0].errorbar(beta, E_mean, yerr=E_err, capsize=2,label="L=%s" %L[l]) ax1[1].plot(beta, Cv_mean, '-') ax1[1].errorbar(beta, Cv_mean, yerr=Cv_err, capsize=2) ax1[0].legend(loc="best") plt.tight_layout() plt.show()

26.44086

127

0.629118

import numpy as np import matplotlib.pyplot as plt import matplotlib.colors as mcolors import sys import os import math from statsmodels.graphics.tsaplots import plot_acf import statsmodels.api as sm from statsmodels.tsa.stattools import acf import scipy.integrate as integrate import random import h5py beta_low=float(sys.argv[1]) beta_high=float(sys.argv[2]) nbeta=int(sys.argv[3]) h=float(sys.argv[4]) e=float(sys.argv[5]) transient_time=float(sys.argv[6]) tau_max=float(sys.argv[7]) transient_time=int(transient_time) tau_max=int(tau_max) beta=np.zeros((nbeta)) if( (h).is_integer()): h=int(h) L=[] for ind in range(8, len(sys.argv)): L.append(int(sys.argv[ind])) block_size=20*tau_max plt.rc('text', usetex=True) plt.rc('font', family='serif', size=18) plt.rc('text.latex', preamble=r'\usepackage{bm}') fig, ax1 = plt.subplots(2, 1, figsize=(9,12)) ax1[0].set_title("h=%s; e=%s" %(h, e)) ax1[0].set_xlabel(r"$\beta$") ax1[0].set_ylabel(r"$E/V$") ax1[1].set_xlabel(r"$\beta$") ax1[1].set_ylabel(r"$C_{v}$") for l in range(len(L)): BASEDIR=("/home/ilaria/Desktop/MultiComponents_SC/Output_2C/L%d_e%s_h%s_bmin%s_bmax%s" %(L[l], e, h, beta_low, beta_high)) Cv_mean=np.zeros((nbeta)) Cv_err=np.zeros((nbeta)) E_mean=np.zeros((nbeta)) E_err=np.zeros((nbeta)) for b in range(nbeta): beta[b]=beta_low +b*(beta_high -beta_low)/(nbeta-1) file=h5py.File('%s/beta_%d/Output.h5' %(BASEDIR, b), 'r') E=np.asarray(file['Measurements']['E']) E=E[transient_time:] E_mean[b]=np.mean(E)/(L[l]**3) E_err[b]=np.sqrt(np.var(E/(L[l]**3))/(len(E)-1)) nblocks=int(len(E)/block_size) varE_resampling=np.zeros((nblocks)) for block in range(nblocks): varE_resampling[block]=np.var(np.random.choice(E, size=block_size)) Cv_mean[b]=beta[b]*np.var(E)/(L[l]**3) Cv_err[b]= (beta[b]/(L[l]**3))*np.sqrt(np.var(varE_resampling)/(nblocks-1)) ax1[0].plot(beta, E_mean, '-') ax1[0].errorbar(beta, E_mean, yerr=E_err, capsize=2,label="L=%s" %L[l]) ax1[1].plot(beta, Cv_mean, '-') ax1[1].errorbar(beta, Cv_mean, yerr=Cv_err, capsize=2) ax1[0].legend(loc="best") plt.tight_layout() plt.show()

true

1c2ff3c29461205a7f9fc39f271e6cb0d572c236

1,774

py

Python

fedrec/utilities/registry.py

ruchirgarg05/RecoEdge

5986af75bcd97087662ff4b1927925f7afb05ee1

[ "Apache-2.0" ]

68

2021-06-20T07:54:48.000Z

2022-02-19T16:11:01.000Z

fedrec/utilities/registry.py

ruchirgarg05/RecoEdge

5986af75bcd97087662ff4b1927925f7afb05ee1

[ "Apache-2.0" ]

100

2021-06-24T13:33:24.000Z

2022-02-23T10:30:27.000Z

fedrec/utilities/registry.py

ruchirgarg05/RecoEdge

5986af75bcd97087662ff4b1927925f7afb05ee1

[ "Apache-2.0" ]

38

2021-07-13T12:16:24.000Z

2022-02-26T05:08:28.000Z

import collections import collections.abc import inspect import sys LOOKUP_DICT = collections.defaultdict(dict) def load(kind, name): registry = LOOKUP_DICT[kind] def decorator(obj): if name in registry: raise LookupError('{} already present'.format(name, kind)) registry[name] = obj return obj return decorator def lookup(kind, name): if isinstance(name, collections.abc.Mapping): name = name['name'] if kind not in LOOKUP_DICT: raise KeyError('Nothing registered under "{}"'.format(kind)) return LOOKUP_DICT[kind][name] def construct(kind, config, unused_keys=(), **kwargs): if isinstance(config, str): config = {'name': config} return instantiate( lookup(kind, config), config, unused_keys + ('name',), **kwargs) def instantiate(callable, config, unused_keys=(), **kwargs): merged = {**config, **kwargs} signature = inspect.signature(callable) for name, param in signature.parameters.items(): if param.kind in (inspect.Parameter.POSITIONAL_ONLY, inspect.Parameter.VAR_POSITIONAL): raise ValueError('Unsupported kind for param {}: {}'.format( name, param.kind)) if any(param.kind == inspect.Parameter.VAR_KEYWORD for param in signature.parameters.values()): return callable(**merged) missing = {} for key in list(merged.keys()): if key not in signature.parameters: if key not in unused_keys: missing[key] = merged[key] merged.pop(key) if missing: print('WARNING {}: superfluous {}'.format( callable, missing), file=sys.stderr) return callable(**merged)

28.15873

72

0.619504

import collections import collections.abc import inspect import sys LOOKUP_DICT = collections.defaultdict(dict) def load(kind, name): registry = LOOKUP_DICT[kind] def decorator(obj): if name in registry: raise LookupError('{} already present'.format(name, kind)) registry[name] = obj return obj return decorator def lookup(kind, name): if isinstance(name, collections.abc.Mapping): name = name['name'] if kind not in LOOKUP_DICT: raise KeyError('Nothing registered under "{}"'.format(kind)) return LOOKUP_DICT[kind][name] def construct(kind, config, unused_keys=(), **kwargs): if isinstance(config, str): config = {'name': config} return instantiate( lookup(kind, config), config, unused_keys + ('name',), **kwargs) def instantiate(callable, config, unused_keys=(), **kwargs): merged = {**config, **kwargs} signature = inspect.signature(callable) for name, param in signature.parameters.items(): if param.kind in (inspect.Parameter.POSITIONAL_ONLY, inspect.Parameter.VAR_POSITIONAL): raise ValueError('Unsupported kind for param {}: {}'.format( name, param.kind)) if any(param.kind == inspect.Parameter.VAR_KEYWORD for param in signature.parameters.values()): return callable(**merged) missing = {} for key in list(merged.keys()): if key not in signature.parameters: if key not in unused_keys: missing[key] = merged[key] merged.pop(key) if missing: print('WARNING {}: superfluous {}'.format( callable, missing), file=sys.stderr) return callable(**merged)

true

1c2ff4247fcd37d7a23fe72dfd5f9801afa595fa

19,358

py

Python

src/model.py

GuillaumeAI/gia-style-transfer-tf2

543e4e3434b87612bff6bb901c6ce4026069fa15

[ "MIT" ]

16

2019-05-21T22:28:30.000Z

2022-03-07T19:29:08.000Z

src/model.py

GuillaumeAI/gia-style-transfer-tf2

543e4e3434b87612bff6bb901c6ce4026069fa15

[ "MIT" ]

4

2021-09-01T07:23:48.000Z

2022-02-26T12:15:40.000Z

src/model.py

GuillaumeAI/gia-style-transfer-tf2

543e4e3434b87612bff6bb901c6ce4026069fa15

[ "MIT" ]

5

2020-02-08T10:08:58.000Z

2021-06-03T17:47:32.000Z

from absl import logging, flags import tensorflow as tf from tensorflow import keras from tensorflow.python.keras.utils import tf_utils # Define model flags FLAGS = flags.FLAGS flags.DEFINE_enum("increase_size_layer_type", "default", ["default", "unpool", "deconv"], "Type of layer to use in the decoder part. Default use the type specified in research paper (unpool for adaptive st, deconv for cartoon GAN)") flags.DEFINE_enum("norm_layer", "default", ["default", "instance_norm", "batch_norm"], "Type of layer to use for normalization. Default use the type specified in research paper (instance_norm for adaptive st, batch_norm for cartoon GAN)") flags.DEFINE_bool("mobilenet", False, "Build model with mobilenet optimization (depthwise convolution...)") flags.DEFINE_enum("model", "default", ["default", "adaptive_st", "cartoon_gan"], "Model topology to use. If default then use the topology corresponding to training_method") flags.DEFINE_integer("n_filter_generator", 32, "Number of filters in first conv layer of generator (encoder-decoder)") flags.DEFINE_integer("n_filter_discriminator", 64, "Number of filters in first conv layer of discriminator") flags.DEFINE_float("l2_reg", 0.001, "l2 regularization weigh to apply") flags.DEFINE_integer("transformer_kernel_size", 10, "Size of kernel we apply to the input_tensor in the transformer model if using adaptive_st training method") ################# # Custom layers # ################# class UnpoolLayer(keras.layers.Layer): def __init__(self, **kwargs): super().__init__(**kwargs) @tf_utils.shape_type_conversion def compute_output_shape(self, input_shape): return input_shape[0], input_shape[1] * 2, input_shape[2] * 2, input_shape[3] def get_config(self): base_config = super(UnpoolLayer, self).get_config() return base_config @classmethod def from_config(cls, config): return cls(**config) def build(self, input_shape): super().build(input_shape) def call(self, inputs): return tf.image.resize(inputs, tf.shape(inputs)[1:3] * 2, method=tf.image.ResizeMethod.NEAREST_NEIGHBOR) class InstanceNormLayer(keras.layers.Layer): """ See: https://github.com/keras-team/keras-contrib/blob/master/keras_contrib/layers/normalization.py """ def __init__(self, **kwargs): self.epsilon = 1e-5 super().__init__(**kwargs) def compute_output_shape(self, input_shape): shape = tf.TensorShape(input_shape).as_list() return tf.TensorShape([shape[0], shape[1], shape[2], shape[3]]) def build(self, input_shape): depth = (input_shape[3],) self.scale = self.add_weight(shape=depth, name='gamma', initializer=keras.initializers.get('ones')) self.offset = self.add_weight(shape=depth, name='gamma', initializer=keras.initializers.get('zeros')) super().build(input_shape) def call(self, inputs): mean, variance = tf.nn.moments(inputs, axes=[1, 2], keepdims=True) inv = tf.math.rsqrt(variance + self.epsilon) normalized = (inputs - mean) * inv return self.scale * normalized + self.offset class ReflectPadLayer(keras.layers.Layer): def __init__(self, pad_size, **kwargs): self.pad_size = pad_size super().__init__(**kwargs) def compute_output_shape(self, input_shape): shape = tf.TensorShape(input_shape).as_list() return tf.TensorShape([shape[0], shape[1] + self.pad_size * 2, shape[2] + self.pad_size * 2, shape[3]]) def build(self, input_shape): super().build(input_shape) def call(self, inputs): return tf.pad(inputs, [[0, 0], [self.pad_size, self.pad_size], [self.pad_size, self.pad_size], [0, 0]], "SYMMETRIC") class CenterLayer(keras.layers.Layer): def __init__(self, **kwargs): super().__init__(**kwargs) def build(self, input_shape): super().build(input_shape) def call(self, inputs): return inputs * 2. - 1. ############## # Custom ops # ############## def relu6(x): return tf.keras.activations.relu(x, max_value=6) def inverted_res_block(inputs, stride, in_channels, out_channels, norm_layer, expansion=1): x = inputs x = tf.keras.layers.Conv2D(expansion * in_channels, kernel_size=1, padding='same', use_bias=False, activation=None)(x) x = norm_layer()(x) x = tf.keras.layers.ReLU(6.)(x) # Depthwise if stride == 2: x = norm_layer()(x) x = ReflectPadLayer(1)(x) x = tf.keras.layers.DepthwiseConv2D(kernel_size=3, strides=stride, activation=None, use_bias=False, padding='valid' if stride == 1 else 'valid')(x) x = norm_layer()(x) x = tf.keras.layers.ReLU(6.)(x) # Project x = tf.keras.layers.Conv2D(out_channels, kernel_size=1, padding='same', use_bias=False, activation=None)(x) x = norm_layer()(x) if in_channels == out_channels and stride == 1: return keras.layers.Add()([inputs, x]) return x def make_models(): """build all the models based on the arguments provided via absl Returns: encoder_model, decoder_model, discriminator_model """ if FLAGS.model == "default" and FLAGS.training_method == "adaptive_st" or FLAGS.model == "adaptive_st": logging.info("define adaptive_st model") if FLAGS.norm_layer == "instance_norm" or FLAGS.norm_layer == "default": norm_layer = InstanceNormLayer else: norm_layer = tf.keras.layers.BatchNormalization logging.warning("Use unusual norm layer for this model") if FLAGS.increase_size_layer_type == "default" or FLAGS.increase_size_layer_type == "unpool": increase_size_layer = UnpoolLayer else: increase_size_layer = tf.keras.layers.Conv2DTranspose raise Exception("Not yet implemented") discriminator_model = make_discriminator_model_adaptive_style_transfer(norm_layer) if not FLAGS.mobilenet: encoder_model = make_encoder_model_adaptive_style_transfer(norm_layer) decoder_model = make_decoder_model_adaptive_style_transfer(encoder_model.output_shape[1:], norm_layer) else: logging.info("Use mobilenet version") encoder_model = make_encoder_model_mobilenet(norm_layer) decoder_model = make_decoder_model_mobilenet(encoder_model.output_shape[1:], norm_layer) else: logging.info("define cartoon_gan model") if FLAGS.norm_layer == "batch_norm" or FLAGS.norm_layer == "default": norm_layer = tf.keras.layers.BatchNormalization else: norm_layer = InstanceNormLayer logging.warning("Use unusual norm layer for this model") if FLAGS.increase_size_layer_type == "default" or FLAGS.increase_size_layer_type == "deconv": increase_size_layer = tf.keras.layers.Conv2DTranspose else: increase_size_layer = UnpoolLayer raise Exception("Not yet implemented") encoder_model = make_encoder_model_cartoon(norm_layer) decoder_model = make_decoder_model_cartoon(encoder_model.output_shape[1:], norm_layer) discriminator_model = make_discriminator_model_cartoon(norm_layer) return encoder_model, decoder_model, discriminator_model def make_encoder_model_adaptive_style_transfer(norm_layer): """encoder model following https://arxiv.org/pdf/1807.10201.pdf Returns: encoder model """ model = keras.Sequential(name="Encoder") model.add(norm_layer(input_shape=(FLAGS.image_size, FLAGS.image_size, 3), dtype=tf.float32)) model.add(ReflectPadLayer(15)) def add_conv(n_filter, strides): model.add(keras.layers.Conv2D(n_filter, 3, strides, 'VALID', kernel_regularizer=keras.regularizers.l2(FLAGS.l2_reg))) model.add(norm_layer()) model.add(keras.layers.Activation("relu")) add_conv(FLAGS.n_filter_generator, 1) add_conv(FLAGS.n_filter_generator, 2) add_conv(FLAGS.n_filter_generator * 2, 2) add_conv(FLAGS.n_filter_generator * 4, 2) add_conv(FLAGS.n_filter_generator * 8, 2) return model def make_decoder_model_adaptive_style_transfer(input_shape, norm_layer): """decoder model following https://arxiv.org/pdf/1807.10201.pdf Returns: decoder model """ x = keras.layers.Input(shape=input_shape, dtype=tf.float32) inputs = x def residual_block(x, dim, kernel_size=3, s=1): pad = int((kernel_size - 1) / 2) y = ReflectPadLayer(pad)(x) y = keras.layers.Activation("relu")(norm_layer()(keras.layers.Conv2D(dim, kernel_size, s, 'VALID', kernel_regularizer=keras.regularizers.l2(FLAGS.l2_reg))(y))) y = ReflectPadLayer(pad)(y) y = norm_layer()(keras.layers.Conv2D(dim, kernel_size, s, 'VALID', kernel_regularizer=keras.regularizers.l2(FLAGS.l2_reg))(y)) return keras.layers.Add()([x, y]) # Now stack 9 residual blocks num_kernels = FLAGS.n_filter_generator * 8 for i in range(9): x = residual_block(x, num_kernels) # Decode image. for i in range(4): x = UnpoolLayer()(x) x = keras.layers.Conv2D(FLAGS.n_filter_generator * 2 ** (3 - i), 3, 1, "SAME", kernel_regularizer=keras.regularizers.l2(FLAGS.l2_reg))(x) x = keras.layers.Activation("relu")(norm_layer()(x)) x = ReflectPadLayer(3)(x) x = keras.layers.Activation("sigmoid")(keras.layers.Conv2D(3, 7, 1, "VALID", kernel_regularizer=keras.regularizers.l2(FLAGS.l2_reg))(x)) x = CenterLayer()(x) model = keras.Model(inputs=inputs, outputs=x, name="Decoder") return model def make_encoder_model_mobilenet(norm_layer): x = keras.layers.Input(shape=(FLAGS.image_size, FLAGS.image_size, 3), dtype=tf.float32) inputs = x x = norm_layer()(x) x = ReflectPadLayer(15)(x) def add_conv(n_filter_new, strides, x): x = keras.layers.DepthwiseConv2D(3, strides=strides, use_bias=False)(x) x = InstanceNormLayer()(x) x = tf.keras.layers.Activation(relu6)(x) x = keras.layers.Conv2D(n_filter_new, 1, 1, activation=relu6, use_bias=False, kernel_regularizer=keras.regularizers.l2(FLAGS.l2_reg))(x) x = InstanceNormLayer()(x) x = tf.keras.layers.Activation(relu6)(x) return x # First conv is a normal conv x = keras.layers.Conv2D(FLAGS.n_filter_generator, 3, 1, 'VALID', kernel_regularizer=keras.regularizers.l2(FLAGS.l2_reg))(x) x = norm_layer()(x) x = keras.layers.Activation(relu6)(x) # x = add_conv(n_filter, 1, x) # Then use DWConv x = add_conv(FLAGS.n_filter_generator, 2, x) x = add_conv(FLAGS.n_filter_generator * 2, 2, x) x = add_conv(FLAGS.n_filter_generator * 4, 2, x) x = add_conv(FLAGS.n_filter_generator * 8, 2, x) model = keras.Model(inputs=inputs, outputs=x, name="Encoder") return model def make_decoder_model_mobilenet(input_shape, norm_layer): x = keras.layers.Input(shape=input_shape, dtype=tf.float32) inputs = x # Residual part num_kernels = FLAGS.n_filter_generator * 8 kernel_size = 3 pad = int((kernel_size - 1) / 2) for i in range(9): x = inverted_res_block(x, 1, num_kernels, num_kernels, norm_layer) x = inverted_res_block(x, 1, num_kernels, num_kernels, norm_layer) # Decode image for i in range(4): x = UnpoolLayer()(x) x = inverted_res_block(x, 1, FLAGS.n_filter_generator * 2 ** (3 - i + 1), FLAGS.n_filter_generator * 2 ** (3 - i), norm_layer) x = ReflectPadLayer(3)(x) x = keras.layers.Activation("sigmoid")(keras.layers.Conv2D(3, 7, 1, "VALID", kernel_regularizer=keras.regularizers.l2(FLAGS.l2_reg))(x)) x = CenterLayer()(x) model = keras.Model(inputs=inputs, outputs=x, name="Decoder") return model def make_discriminator_model_adaptive_style_transfer(norm_layer): """ Discriminator agent, that provides us with information about image plausibility at different scales. Returns: Image estimates at different scales. """ image = keras.layers.Input(shape=(FLAGS.image_size, FLAGS.image_size, 3), dtype=tf.float32) h0 = keras.layers.LeakyReLU()(norm_layer()(keras.layers.Conv2D(FLAGS.n_filter_discriminator * 2, 5, 2, kernel_regularizer=keras.regularizers.l2(FLAGS.l2_reg))(image))) h0_pred = keras.layers.Conv2D(1, 5)(h0) h1 = keras.layers.LeakyReLU()(norm_layer()(keras.layers.Conv2D(FLAGS.n_filter_discriminator * 2, 5, 2, kernel_regularizer=keras.regularizers.l2(FLAGS.l2_reg))(h0))) h1_pred = keras.layers.Conv2D(1, 10)(h1) h2 = keras.layers.LeakyReLU()(norm_layer()(keras.layers.Conv2D(FLAGS.n_filter_discriminator * 4, 5, 2, kernel_regularizer=keras.regularizers.l2(FLAGS.l2_reg))(h1))) h3 = keras.layers.LeakyReLU()(norm_layer()(keras.layers.Conv2D(FLAGS.n_filter_discriminator * 8, 5, 2, kernel_regularizer=keras.regularizers.l2(FLAGS.l2_reg))(h2))) h3_pred = keras.layers.Conv2D(1, 10)(h3) h4 = keras.layers.LeakyReLU()(norm_layer()(keras.layers.Conv2D(FLAGS.n_filter_discriminator * 8, 5, 2, kernel_regularizer=keras.regularizers.l2(FLAGS.l2_reg))(h3))) h5 = keras.layers.LeakyReLU()(norm_layer()(keras.layers.Conv2D(FLAGS.n_filter_discriminator * 16, 5, 2, kernel_regularizer=keras.regularizers.l2(FLAGS.l2_reg))(h4))) h5_pred = keras.layers.Conv2D(1, 6)(h5) h6 = keras.layers.LeakyReLU()(norm_layer()(keras.layers.Conv2D(FLAGS.n_filter_discriminator * 16, 5, 2, kernel_regularizer=keras.regularizers.l2(FLAGS.l2_reg))(h5))) h6_pred = keras.layers.Conv2D(1, 3)(h6) model = keras.Model(inputs=image, outputs=[h0_pred, h1_pred, h3_pred, h5_pred, h6_pred], name="Discriminator") return model def make_transformer_model(): """ This is a simplified version of transformer block described in the paper https://arxiv.org/abs/1807.10201. Returns: Transformed tensor """ model = keras.Sequential(name="Transformer") model.add(keras.layers.AvgPool2D(FLAGS.transformer_kernel_size, strides=1, padding="same")) return model def make_encoder_model_cartoon(norm_layer): """ Follow the description in the paper http://openaccess.thecvf.com/content_cvpr_2018/papers/Chen_CartoonGAN_Generative_Adversarial_CVPR_2018_paper.pdf """ x = tf.keras.Input(shape=(FLAGS.image_size, FLAGS.image_size, 3)) x_input = x # flat convolution stage x = tf.keras.layers.Conv2D(64, 7, padding="same")(x) x = norm_layer()(x) x = tf.keras.layers.ReLU()(x) # Down convolution stage for n_filters in [128, 256]: x = tf.keras.layers.Conv2D(n_filters, 3, 2, padding="same")(x) x = tf.keras.layers.Conv2D(n_filters, 3, 1, padding="same")(x) x = norm_layer()(x) x = tf.keras.layers.ReLU()(x) model = tf.keras.Model(inputs=[x_input], outputs=[x], name="Encoder") return model def make_decoder_model_cartoon(input_shape, norm_layer): x = tf.keras.Input(shape=input_shape) x_input = x # Residual part for _ in range(8): x_residual = x x = tf.keras.layers.Conv2D(256, 3, 1, padding="same")(x) x = norm_layer()(x) x = tf.keras.layers.ReLU()(x) x = tf.keras.layers.Conv2D(256, 3, 1, padding="same")(x) x = norm_layer()(x) x = tf.keras.layers.Add()([x, x_residual]) # Up-convolution for n_filters in [128, 64]: x = tf.keras.layers.Conv2DTranspose(n_filters, 3, 2, padding="same")(x) x = tf.keras.layers.Conv2D(n_filters, 3, 1, padding="same")(x) x = norm_layer()(x) x = tf.keras.layers.ReLU()(x) x = tf.keras.layers.Conv2D(3, 7, padding="same")(x) model = tf.keras.Model(inputs=[x_input], outputs=[x], name="Decoder") return model def make_discriminator_model_cartoon(norm_layer): x = tf.keras.Input(shape=(FLAGS.image_size, FLAGS.image_size, 3)) x_input = x # Flat convolution x = tf.keras.layers.Conv2D(32, 3, 1, "same")(x) x = tf.keras.layers.LeakyReLU(0.2)(x) # Down convolution stage for n_filters in [64, 128]: x = tf.keras.layers.Conv2D(n_filters, 3, 2, "same")(x) x = tf.keras.layers.LeakyReLU(0.2)(x) x = tf.keras.layers.Conv2D(n_filters * 2, 3, 1, "same")(x) x = norm_layer()(x) x = tf.keras.layers.LeakyReLU(0.2)(x) x = tf.keras.layers.Conv2D(256, 3, 1, "same")(x) x = norm_layer()(x) x = tf.keras.layers.LeakyReLU(0.2)(x) x = tf.keras.layers.Conv2D(1, 3, 1, "same")(x) model = tf.keras.Model(inputs=[x_input], outputs=[x], name="generator") return model def VGG19(): layers = tf.keras.layers img_input = layers.Input(shape=(FLAGS.image_size, FLAGS.image_size, 3)) # Block 1 x = layers.Conv2D(64, (3, 3), activation='relu', padding='same', name='block1_conv1')(img_input) x = layers.Conv2D(64, (3, 3), activation='relu', padding='same', name='block1_conv2')(x) x = layers.MaxPooling2D((2, 2), strides=(2, 2), name='block1_pool')(x) # Block 2 x = layers.Conv2D(128, (3, 3), activation='relu', padding='same', name='block2_conv1')(x) x = layers.Conv2D(128, (3, 3), activation='relu', padding='same', name='block2_conv2')(x) x = layers.MaxPooling2D((2, 2), strides=(2, 2), name='block2_pool')(x) # Block 3 x = layers.Conv2D(256, (3, 3), activation='relu', padding='same', name='block3_conv1')(x) x = layers.Conv2D(256, (3, 3), activation='relu', padding='same', name='block3_conv2')(x) x = layers.Conv2D(256, (3, 3), activation='relu', padding='same', name='block3_conv3')(x) x = layers.Conv2D(256, (3, 3), activation='relu', padding='same', name='block3_conv4')(x) x = layers.MaxPooling2D((2, 2), strides=(2, 2), name='block3_pool')(x) # Block 4 x = layers.Conv2D(512, (3, 3), activation='relu', padding='same', name='block4_conv1')(x) x = layers.Conv2D(512, (3, 3), activation='relu', padding='same', name='block4_conv2')(x) x = layers.Conv2D(512, (3, 3), activation='relu', padding='same', name='block4_conv3')(x) x = layers.Conv2D(512, (3, 3), activation='relu', padding='same', name='block4_conv4')(x) save_x = x # Block 5 x = layers.Conv2D(512, (3, 3), activation='relu', padding='same', name='block5_conv1')(x) x = layers.Conv2D(512, (3, 3), activation='relu', padding='same', name='block5_conv2')(x) x = layers.Conv2D(512, (3, 3), activation='relu', padding='same', name='block5_conv3')(x) x = layers.Conv2D(512, (3, 3), activation='relu', padding='same', name='block5_conv4')(x) model = tf.keras.models.Model(img_input, x, name='vgg16') # Load weights. weights_path_no_top = ('https://github.com/fchollet/deep-learning-models/' 'releases/download/v0.1/' 'vgg19_weights_tf_dim_ordering_tf_kernels_notop.h5') weights_path = tf.keras.utils.get_file( 'vgg19_weights_tf_dim_ordering_tf_kernels_notop.h5', weights_path_no_top, cache_subdir='models', file_hash='253f8cb515780f3b799900260a226db6') model.load_weights(weights_path) sub_model = tf.keras.models.Model(img_input, save_x, name='VGG') return sub_model

40.839662

171

0.667218

from absl import logging, flags import tensorflow as tf from tensorflow import keras from tensorflow.python.keras.utils import tf_utils FLAGS = flags.FLAGS flags.DEFINE_enum("increase_size_layer_type", "default", ["default", "unpool", "deconv"], "Type of layer to use in the decoder part. Default use the type specified in research paper (unpool for adaptive st, deconv for cartoon GAN)") flags.DEFINE_enum("norm_layer", "default", ["default", "instance_norm", "batch_norm"], "Type of layer to use for normalization. Default use the type specified in research paper (instance_norm for adaptive st, batch_norm for cartoon GAN)") flags.DEFINE_bool("mobilenet", False, "Build model with mobilenet optimization (depthwise convolution...)") flags.DEFINE_enum("model", "default", ["default", "adaptive_st", "cartoon_gan"], "Model topology to use. If default then use the topology corresponding to training_method") flags.DEFINE_integer("n_filter_generator", 32, "Number of filters in first conv layer of generator (encoder-decoder)") flags.DEFINE_integer("n_filter_discriminator", 64, "Number of filters in first conv layer of discriminator") flags.DEFINE_float("l2_reg", 0.001, "l2 regularization weigh to apply") flags.DEFINE_integer("transformer_kernel_size", 10, "Size of kernel we apply to the input_tensor in the transformer model if using adaptive_st training method") _shape[3] def get_config(self): base_config = super(UnpoolLayer, self).get_config() return base_config @classmethod def from_config(cls, config): return cls(**config) def build(self, input_shape): super().build(input_shape) def call(self, inputs): return tf.image.resize(inputs, tf.shape(inputs)[1:3] * 2, method=tf.image.ResizeMethod.NEAREST_NEIGHBOR) class InstanceNormLayer(keras.layers.Layer): def __init__(self, **kwargs): self.epsilon = 1e-5 super().__init__(**kwargs) def compute_output_shape(self, input_shape): shape = tf.TensorShape(input_shape).as_list() return tf.TensorShape([shape[0], shape[1], shape[2], shape[3]]) def build(self, input_shape): depth = (input_shape[3],) self.scale = self.add_weight(shape=depth, name='gamma', initializer=keras.initializers.get('ones')) self.offset = self.add_weight(shape=depth, name='gamma', initializer=keras.initializers.get('zeros')) super().build(input_shape) def call(self, inputs): mean, variance = tf.nn.moments(inputs, axes=[1, 2], keepdims=True) inv = tf.math.rsqrt(variance + self.epsilon) normalized = (inputs - mean) * inv return self.scale * normalized + self.offset class ReflectPadLayer(keras.layers.Layer): def __init__(self, pad_size, **kwargs): self.pad_size = pad_size super().__init__(**kwargs) def compute_output_shape(self, input_shape): shape = tf.TensorShape(input_shape).as_list() return tf.TensorShape([shape[0], shape[1] + self.pad_size * 2, shape[2] + self.pad_size * 2, shape[3]]) def build(self, input_shape): super().build(input_shape) def call(self, inputs): return tf.pad(inputs, [[0, 0], [self.pad_size, self.pad_size], [self.pad_size, self.pad_size], [0, 0]], "SYMMETRIC") class CenterLayer(keras.layers.Layer): def __init__(self, **kwargs): super().__init__(**kwargs) def build(self, input_shape): super().build(input_shape) def call(self, inputs): return inputs * 2. - 1. x = tf.keras.layers.Conv2D(expansion * in_channels, kernel_size=1, padding='same', use_bias=False, activation=None)(x) x = norm_layer()(x) x = tf.keras.layers.ReLU(6.)(x) if stride == 2: x = norm_layer()(x) x = ReflectPadLayer(1)(x) x = tf.keras.layers.DepthwiseConv2D(kernel_size=3, strides=stride, activation=None, use_bias=False, padding='valid' if stride == 1 else 'valid')(x) x = norm_layer()(x) x = tf.keras.layers.ReLU(6.)(x) x = tf.keras.layers.Conv2D(out_channels, kernel_size=1, padding='same', use_bias=False, activation=None)(x) x = norm_layer()(x) if in_channels == out_channels and stride == 1: return keras.layers.Add()([inputs, x]) return x def make_models(): if FLAGS.model == "default" and FLAGS.training_method == "adaptive_st" or FLAGS.model == "adaptive_st": logging.info("define adaptive_st model") if FLAGS.norm_layer == "instance_norm" or FLAGS.norm_layer == "default": norm_layer = InstanceNormLayer else: norm_layer = tf.keras.layers.BatchNormalization logging.warning("Use unusual norm layer for this model") if FLAGS.increase_size_layer_type == "default" or FLAGS.increase_size_layer_type == "unpool": increase_size_layer = UnpoolLayer else: increase_size_layer = tf.keras.layers.Conv2DTranspose raise Exception("Not yet implemented") discriminator_model = make_discriminator_model_adaptive_style_transfer(norm_layer) if not FLAGS.mobilenet: encoder_model = make_encoder_model_adaptive_style_transfer(norm_layer) decoder_model = make_decoder_model_adaptive_style_transfer(encoder_model.output_shape[1:], norm_layer) else: logging.info("Use mobilenet version") encoder_model = make_encoder_model_mobilenet(norm_layer) decoder_model = make_decoder_model_mobilenet(encoder_model.output_shape[1:], norm_layer) else: logging.info("define cartoon_gan model") if FLAGS.norm_layer == "batch_norm" or FLAGS.norm_layer == "default": norm_layer = tf.keras.layers.BatchNormalization else: norm_layer = InstanceNormLayer logging.warning("Use unusual norm layer for this model") if FLAGS.increase_size_layer_type == "default" or FLAGS.increase_size_layer_type == "deconv": increase_size_layer = tf.keras.layers.Conv2DTranspose else: increase_size_layer = UnpoolLayer raise Exception("Not yet implemented") encoder_model = make_encoder_model_cartoon(norm_layer) decoder_model = make_decoder_model_cartoon(encoder_model.output_shape[1:], norm_layer) discriminator_model = make_discriminator_model_cartoon(norm_layer) return encoder_model, decoder_model, discriminator_model def make_encoder_model_adaptive_style_transfer(norm_layer): model = keras.Sequential(name="Encoder") model.add(norm_layer(input_shape=(FLAGS.image_size, FLAGS.image_size, 3), dtype=tf.float32)) model.add(ReflectPadLayer(15)) def add_conv(n_filter, strides): model.add(keras.layers.Conv2D(n_filter, 3, strides, 'VALID', kernel_regularizer=keras.regularizers.l2(FLAGS.l2_reg))) model.add(norm_layer()) model.add(keras.layers.Activation("relu")) add_conv(FLAGS.n_filter_generator, 1) add_conv(FLAGS.n_filter_generator, 2) add_conv(FLAGS.n_filter_generator * 2, 2) add_conv(FLAGS.n_filter_generator * 4, 2) add_conv(FLAGS.n_filter_generator * 8, 2) return model def make_decoder_model_adaptive_style_transfer(input_shape, norm_layer): x = keras.layers.Input(shape=input_shape, dtype=tf.float32) inputs = x def residual_block(x, dim, kernel_size=3, s=1): pad = int((kernel_size - 1) / 2) y = ReflectPadLayer(pad)(x) y = keras.layers.Activation("relu")(norm_layer()(keras.layers.Conv2D(dim, kernel_size, s, 'VALID', kernel_regularizer=keras.regularizers.l2(FLAGS.l2_reg))(y))) y = ReflectPadLayer(pad)(y) y = norm_layer()(keras.layers.Conv2D(dim, kernel_size, s, 'VALID', kernel_regularizer=keras.regularizers.l2(FLAGS.l2_reg))(y)) return keras.layers.Add()([x, y]) num_kernels = FLAGS.n_filter_generator * 8 for i in range(9): x = residual_block(x, num_kernels) for i in range(4): x = UnpoolLayer()(x) x = keras.layers.Conv2D(FLAGS.n_filter_generator * 2 ** (3 - i), 3, 1, "SAME", kernel_regularizer=keras.regularizers.l2(FLAGS.l2_reg))(x) x = keras.layers.Activation("relu")(norm_layer()(x)) x = ReflectPadLayer(3)(x) x = keras.layers.Activation("sigmoid")(keras.layers.Conv2D(3, 7, 1, "VALID", kernel_regularizer=keras.regularizers.l2(FLAGS.l2_reg))(x)) x = CenterLayer()(x) model = keras.Model(inputs=inputs, outputs=x, name="Decoder") return model def make_encoder_model_mobilenet(norm_layer): x = keras.layers.Input(shape=(FLAGS.image_size, FLAGS.image_size, 3), dtype=tf.float32) inputs = x x = norm_layer()(x) x = ReflectPadLayer(15)(x) def add_conv(n_filter_new, strides, x): x = keras.layers.DepthwiseConv2D(3, strides=strides, use_bias=False)(x) x = InstanceNormLayer()(x) x = tf.keras.layers.Activation(relu6)(x) x = keras.layers.Conv2D(n_filter_new, 1, 1, activation=relu6, use_bias=False, kernel_regularizer=keras.regularizers.l2(FLAGS.l2_reg))(x) x = InstanceNormLayer()(x) x = tf.keras.layers.Activation(relu6)(x) return x x = keras.layers.Conv2D(FLAGS.n_filter_generator, 3, 1, 'VALID', kernel_regularizer=keras.regularizers.l2(FLAGS.l2_reg))(x) x = norm_layer()(x) x = keras.layers.Activation(relu6)(x) x = add_conv(FLAGS.n_filter_generator, 2, x) x = add_conv(FLAGS.n_filter_generator * 2, 2, x) x = add_conv(FLAGS.n_filter_generator * 4, 2, x) x = add_conv(FLAGS.n_filter_generator * 8, 2, x) model = keras.Model(inputs=inputs, outputs=x, name="Encoder") return model def make_decoder_model_mobilenet(input_shape, norm_layer): x = keras.layers.Input(shape=input_shape, dtype=tf.float32) inputs = x num_kernels = FLAGS.n_filter_generator * 8 kernel_size = 3 pad = int((kernel_size - 1) / 2) for i in range(9): x = inverted_res_block(x, 1, num_kernels, num_kernels, norm_layer) x = inverted_res_block(x, 1, num_kernels, num_kernels, norm_layer) for i in range(4): x = UnpoolLayer()(x) x = inverted_res_block(x, 1, FLAGS.n_filter_generator * 2 ** (3 - i + 1), FLAGS.n_filter_generator * 2 ** (3 - i), norm_layer) x = ReflectPadLayer(3)(x) x = keras.layers.Activation("sigmoid")(keras.layers.Conv2D(3, 7, 1, "VALID", kernel_regularizer=keras.regularizers.l2(FLAGS.l2_reg))(x)) x = CenterLayer()(x) model = keras.Model(inputs=inputs, outputs=x, name="Decoder") return model def make_discriminator_model_adaptive_style_transfer(norm_layer): image = keras.layers.Input(shape=(FLAGS.image_size, FLAGS.image_size, 3), dtype=tf.float32) h0 = keras.layers.LeakyReLU()(norm_layer()(keras.layers.Conv2D(FLAGS.n_filter_discriminator * 2, 5, 2, kernel_regularizer=keras.regularizers.l2(FLAGS.l2_reg))(image))) h0_pred = keras.layers.Conv2D(1, 5)(h0) h1 = keras.layers.LeakyReLU()(norm_layer()(keras.layers.Conv2D(FLAGS.n_filter_discriminator * 2, 5, 2, kernel_regularizer=keras.regularizers.l2(FLAGS.l2_reg))(h0))) h1_pred = keras.layers.Conv2D(1, 10)(h1) h2 = keras.layers.LeakyReLU()(norm_layer()(keras.layers.Conv2D(FLAGS.n_filter_discriminator * 4, 5, 2, kernel_regularizer=keras.regularizers.l2(FLAGS.l2_reg))(h1))) h3 = keras.layers.LeakyReLU()(norm_layer()(keras.layers.Conv2D(FLAGS.n_filter_discriminator * 8, 5, 2, kernel_regularizer=keras.regularizers.l2(FLAGS.l2_reg))(h2))) h3_pred = keras.layers.Conv2D(1, 10)(h3) h4 = keras.layers.LeakyReLU()(norm_layer()(keras.layers.Conv2D(FLAGS.n_filter_discriminator * 8, 5, 2, kernel_regularizer=keras.regularizers.l2(FLAGS.l2_reg))(h3))) h5 = keras.layers.LeakyReLU()(norm_layer()(keras.layers.Conv2D(FLAGS.n_filter_discriminator * 16, 5, 2, kernel_regularizer=keras.regularizers.l2(FLAGS.l2_reg))(h4))) h5_pred = keras.layers.Conv2D(1, 6)(h5) h6 = keras.layers.LeakyReLU()(norm_layer()(keras.layers.Conv2D(FLAGS.n_filter_discriminator * 16, 5, 2, kernel_regularizer=keras.regularizers.l2(FLAGS.l2_reg))(h5))) h6_pred = keras.layers.Conv2D(1, 3)(h6) model = keras.Model(inputs=image, outputs=[h0_pred, h1_pred, h3_pred, h5_pred, h6_pred], name="Discriminator") return model def make_transformer_model(): model = keras.Sequential(name="Transformer") model.add(keras.layers.AvgPool2D(FLAGS.transformer_kernel_size, strides=1, padding="same")) return model def make_encoder_model_cartoon(norm_layer): x = tf.keras.Input(shape=(FLAGS.image_size, FLAGS.image_size, 3)) x_input = x x = tf.keras.layers.Conv2D(64, 7, padding="same")(x) x = norm_layer()(x) x = tf.keras.layers.ReLU()(x) for n_filters in [128, 256]: x = tf.keras.layers.Conv2D(n_filters, 3, 2, padding="same")(x) x = tf.keras.layers.Conv2D(n_filters, 3, 1, padding="same")(x) x = norm_layer()(x) x = tf.keras.layers.ReLU()(x) model = tf.keras.Model(inputs=[x_input], outputs=[x], name="Encoder") return model def make_decoder_model_cartoon(input_shape, norm_layer): x = tf.keras.Input(shape=input_shape) x_input = x for _ in range(8): x_residual = x x = tf.keras.layers.Conv2D(256, 3, 1, padding="same")(x) x = norm_layer()(x) x = tf.keras.layers.ReLU()(x) x = tf.keras.layers.Conv2D(256, 3, 1, padding="same")(x) x = norm_layer()(x) x = tf.keras.layers.Add()([x, x_residual]) for n_filters in [128, 64]: x = tf.keras.layers.Conv2DTranspose(n_filters, 3, 2, padding="same")(x) x = tf.keras.layers.Conv2D(n_filters, 3, 1, padding="same")(x) x = norm_layer()(x) x = tf.keras.layers.ReLU()(x) x = tf.keras.layers.Conv2D(3, 7, padding="same")(x) model = tf.keras.Model(inputs=[x_input], outputs=[x], name="Decoder") return model def make_discriminator_model_cartoon(norm_layer): x = tf.keras.Input(shape=(FLAGS.image_size, FLAGS.image_size, 3)) x_input = x x = tf.keras.layers.Conv2D(32, 3, 1, "same")(x) x = tf.keras.layers.LeakyReLU(0.2)(x) for n_filters in [64, 128]: x = tf.keras.layers.Conv2D(n_filters, 3, 2, "same")(x) x = tf.keras.layers.LeakyReLU(0.2)(x) x = tf.keras.layers.Conv2D(n_filters * 2, 3, 1, "same")(x) x = norm_layer()(x) x = tf.keras.layers.LeakyReLU(0.2)(x) x = tf.keras.layers.Conv2D(256, 3, 1, "same")(x) x = norm_layer()(x) x = tf.keras.layers.LeakyReLU(0.2)(x) x = tf.keras.layers.Conv2D(1, 3, 1, "same")(x) model = tf.keras.Model(inputs=[x_input], outputs=[x], name="generator") return model def VGG19(): layers = tf.keras.layers img_input = layers.Input(shape=(FLAGS.image_size, FLAGS.image_size, 3)) x = layers.Conv2D(64, (3, 3), activation='relu', padding='same', name='block1_conv1')(img_input) x = layers.Conv2D(64, (3, 3), activation='relu', padding='same', name='block1_conv2')(x) x = layers.MaxPooling2D((2, 2), strides=(2, 2), name='block1_pool')(x) x = layers.Conv2D(128, (3, 3), activation='relu', padding='same', name='block2_conv1')(x) x = layers.Conv2D(128, (3, 3), activation='relu', padding='same', name='block2_conv2')(x) x = layers.MaxPooling2D((2, 2), strides=(2, 2), name='block2_pool')(x) x = layers.Conv2D(256, (3, 3), activation='relu', padding='same', name='block3_conv1')(x) x = layers.Conv2D(256, (3, 3), activation='relu', padding='same', name='block3_conv2')(x) x = layers.Conv2D(256, (3, 3), activation='relu', padding='same', name='block3_conv3')(x) x = layers.Conv2D(256, (3, 3), activation='relu', padding='same', name='block3_conv4')(x) x = layers.MaxPooling2D((2, 2), strides=(2, 2), name='block3_pool')(x) x = layers.Conv2D(512, (3, 3), activation='relu', padding='same', name='block4_conv1')(x) x = layers.Conv2D(512, (3, 3), activation='relu', padding='same', name='block4_conv2')(x) x = layers.Conv2D(512, (3, 3), activation='relu', padding='same', name='block4_conv3')(x) x = layers.Conv2D(512, (3, 3), activation='relu', padding='same', name='block4_conv4')(x) save_x = x x = layers.Conv2D(512, (3, 3), activation='relu', padding='same', name='block5_conv1')(x) x = layers.Conv2D(512, (3, 3), activation='relu', padding='same', name='block5_conv2')(x) x = layers.Conv2D(512, (3, 3), activation='relu', padding='same', name='block5_conv3')(x) x = layers.Conv2D(512, (3, 3), activation='relu', padding='same', name='block5_conv4')(x) model = tf.keras.models.Model(img_input, x, name='vgg16') weights_path_no_top = ('https://github.com/fchollet/deep-learning-models/' 'releases/download/v0.1/' 'vgg19_weights_tf_dim_ordering_tf_kernels_notop.h5') weights_path = tf.keras.utils.get_file( 'vgg19_weights_tf_dim_ordering_tf_kernels_notop.h5', weights_path_no_top, cache_subdir='models', file_hash='253f8cb515780f3b799900260a226db6') model.load_weights(weights_path) sub_model = tf.keras.models.Model(img_input, save_x, name='VGG') return sub_model

true

1c2ff4a9a8a5c5b42363d7b52e47f2bf3c5fb502

2,127

py

Python

chatter/core.py

ii-Python/Chatter-Server-Beta

24ea0e5946259d659a13d1e53a0220340fcbd7e3

[ "MIT" ]

null

chatter/core.py

ii-Python/Chatter-Server-Beta

24ea0e5946259d659a13d1e53a0220340fcbd7e3

[ "MIT" ]

null

chatter/core.py

ii-Python/Chatter-Server-Beta

24ea0e5946259d659a13d1e53a0220340fcbd7e3

[ "MIT" ]

null

# Modules import socket from .colors import colored from .logging import verbose from .config import load_config from .client import ClientManager # Initialization __version__ = "1.0.32" __author__ = "Benjamin O'Brien (iiPython)" # Master class class ChatterServer(object): def __init__(self, args): self.args = args self.config = {} def _generate_sock(self, host, port, config, max_connections = 5): verbose("Generating new socket...") # Create a new socket server = socket.socket(socket.AF_INET, socket.SOCK_STREAM) server.bind((host, port)) server.listen(max_connections) # Then create a client manager verbose("Creating client manager...") clients = ClientManager(config) verbose("Socket and client manager created.") return (server, clients) def load_config(self): """Loads configuration info from config.json""" # Load configuration verbose("Began loading configuration file.") try: self.config = load_config() except Exception as err: verbose("Failed while loading:", err) return {} print("Loaded configuration from config.json") print() server_name = input("Server name: ") self.config["server_name"] = server_name # Return our data return self.config def start(self): """Launches the Chatter server and begins an infinite response loop""" print(f"Chatter Server v{__version__}") config = self.load_config() print() print(f"Listening on {config['host']}:{config['port']}", f"with authentication code {config['code']}" if config["code"] else "") print() # Begin master loop server, internal = self._generate_sock(config["host"], config["port"], config) verbose("Server started, listening for requests!") while True: conn, addr = server.accept() verbose("Received connection from", addr) internal.add_client(addr, conn)

24.170455

136

0.615421

import socket from .colors import colored from .logging import verbose from .config import load_config from .client import ClientManager __version__ = "1.0.32" __author__ = "Benjamin O'Brien (iiPython)" # Master class class ChatterServer(object): def __init__(self, args): self.args = args self.config = {} def _generate_sock(self, host, port, config, max_connections = 5): verbose("Generating new socket...") # Create a new socket server = socket.socket(socket.AF_INET, socket.SOCK_STREAM) server.bind((host, port)) server.listen(max_connections) # Then create a client manager verbose("Creating client manager...") clients = ClientManager(config) verbose("Socket and client manager created.") return (server, clients) def load_config(self): # Load configuration verbose("Began loading configuration file.") try: self.config = load_config() except Exception as err: verbose("Failed while loading:", err) return {} print("Loaded configuration from config.json") print() server_name = input("Server name: ") self.config["server_name"] = server_name # Return our data return self.config def start(self): print(f"Chatter Server v{__version__}") config = self.load_config() print() print(f"Listening on {config['host']}:{config['port']}", f"with authentication code {config['code']}" if config["code"] else "") print() # Begin master loop server, internal = self._generate_sock(config["host"], config["port"], config) verbose("Server started, listening for requests!") while True: conn, addr = server.accept() verbose("Received connection from", addr) internal.add_client(addr, conn)

true

1c2ff4dbfd802e4d4eba5c4159798b8dbab43d7d

1,175

py

Python

maximum_effort/urls.py

PaulBowden673/Projects-MP-MP4

a4a176457560e6d5087c823f86da0a88f2ad6537

[ "W3C", "PostgreSQL" ]

null

maximum_effort/urls.py

PaulBowden673/Projects-MP-MP4

a4a176457560e6d5087c823f86da0a88f2ad6537

[ "W3C", "PostgreSQL" ]

null

maximum_effort/urls.py

PaulBowden673/Projects-MP-MP4

a4a176457560e6d5087c823f86da0a88f2ad6537

[ "W3C", "PostgreSQL" ]

null

"""maximum_effort URL Configuration The `urlpatterns` list routes URLs to views. For more information please see: https://docs.djangoproject.com/en/3.2/topics/http/urls/ Examples: Function views 1. Add an import: from my_app import views 2. Add a URL to urlpatterns: path('', views.home, name='home') Class-based views 1. Add an import: from other_app.views import Home 2. Add a URL to urlpatterns: path('', Home.as_view(), name='home') Including another URLconf 1. Import the include() function: from django.urls import include, path 2. Add a URL to urlpatterns: path('blog/', include('blog.urls')) """ from django.contrib import admin from django.urls import path, include from django.conf import settings from django.conf.urls.static import static urlpatterns = [ path('admin/', admin.site.urls), path('accounts/', include('allauth.urls')), path('', include('home.urls')), path('products/', include('products.urls')), path('bag/', include('bag.urls')), path('checkout/', include('checkout.urls')), path('profile/', include('profiles.urls')), ] + static(settings.MEDIA_URL, document_root=settings.MEDIA_ROOT)

37.903226

77

0.702128

from django.contrib import admin from django.urls import path, include from django.conf import settings from django.conf.urls.static import static urlpatterns = [ path('admin/', admin.site.urls), path('accounts/', include('allauth.urls')), path('', include('home.urls')), path('products/', include('products.urls')), path('bag/', include('bag.urls')), path('checkout/', include('checkout.urls')), path('profile/', include('profiles.urls')), ] + static(settings.MEDIA_URL, document_root=settings.MEDIA_ROOT)

true

1c2ff5ae08e63595101cfc142c33334519f8fd9f

907

py

Python

tsx/examples/rocket_native_guide.py

MatthiasJakobs/tsx

8a686ffd0af2f9f826d9ce11349e0fa0e883e897

[ "MIT" ]

null

tsx/examples/rocket_native_guide.py

MatthiasJakobs/tsx

8a686ffd0af2f9f826d9ce11349e0fa0e883e897

[ "MIT" ]

null

tsx/examples/rocket_native_guide.py

MatthiasJakobs/tsx

8a686ffd0af2f9f826d9ce11349e0fa0e883e897

[ "MIT" ]

null

import numpy as np import torch import matplotlib.pyplot as plt from tsx.models.classifier import ROCKET from tsx.datasets import load_itapowdem from tsx.counterfactuals import NativeGuide ds = load_itapowdem() x_train, y_train = ds.torch(train=True) x_test, y_test = ds.torch(train=False) model = ROCKET(input_length=x_train.shape[-1], batch_size=100, n_classes=len(np.unique(y_train))) model.fit(x_train, y_train, x_test, y_test) cf = NativeGuide(model, x_train, y_train, distance='euclidian', batch_size=1000) print("Original classes of input: {}".format(y_test[0:2])) # Get two counterfactuals for each datapoint generated_cfs = cf.generate(x_test[0:2], y_test[0:2], n=2) plt.figure() for i in range(len(generated_cfs)): plt.subplot(1,2,i+1) plt.plot(x_test[i].squeeze(), color='green') print(generated_cfs[i][0][1].shape) plt.plot(generated_cfs[i][0][1], color='red') plt.show()

30.233333

97

0.743109

import numpy as np import torch import matplotlib.pyplot as plt from tsx.models.classifier import ROCKET from tsx.datasets import load_itapowdem from tsx.counterfactuals import NativeGuide ds = load_itapowdem() x_train, y_train = ds.torch(train=True) x_test, y_test = ds.torch(train=False) model = ROCKET(input_length=x_train.shape[-1], batch_size=100, n_classes=len(np.unique(y_train))) model.fit(x_train, y_train, x_test, y_test) cf = NativeGuide(model, x_train, y_train, distance='euclidian', batch_size=1000) print("Original classes of input: {}".format(y_test[0:2])) generated_cfs = cf.generate(x_test[0:2], y_test[0:2], n=2) plt.figure() for i in range(len(generated_cfs)): plt.subplot(1,2,i+1) plt.plot(x_test[i].squeeze(), color='green') print(generated_cfs[i][0][1].shape) plt.plot(generated_cfs[i][0][1], color='red') plt.show()

true

1c2ff5b0c279d00d3c1a682c519050f56c123082

2,232

py

Python

demo/tutorial_TMD.py

aravindhk/Vides

65d9ea9764ddf5f6ef40e869bd31387d0e3e378f

[ "BSD-4-Clause" ]

2

2021-11-03T17:24:24.000Z

2021-12-02T06:06:50.000Z

demo/tutorial_TMD.py

aravindhk/Vides

65d9ea9764ddf5f6ef40e869bd31387d0e3e378f

[ "BSD-4-Clause" ]

null

demo/tutorial_TMD.py

aravindhk/Vides

65d9ea9764ddf5f6ef40e869bd31387d0e3e378f

[ "BSD-4-Clause" ]

null

from NanoTCAD_ViDES import * import sys from module_TMD import * rank = 0 # I create the grid xg = nonuniformgrid(array([-2.0, 1, 0, 0.05, 2.0, 1])) FLAKE = TMD(30.0, "n"); acc = FLAKE.acc; kF = 2 * pi / (3 * sqrt(3) * acc); kymax = pi / FLAKE.delta; Nky = 32.0; dk = kymax / Nky; FLAKE.kmax = pi / FLAKE.delta; FLAKE.kmin = 0; FLAKE.dk = dk; FLAKE.dE = 0.001 grid = grid2D(xg, FLAKE.y, FLAKE.x, FLAKE.y); savetxt("gridx.out", grid.gridx) savetxt("gridy.out", grid.gridy) # I take care of the solid Oxide1 = region("hex", grid.xmin, 0, grid.ymin, grid.ymax) Oxide1.eps = 3.9; Oxide2 = region("hex", 0, grid.xmax, grid.ymin, grid.ymax) Oxide2.eps = 3.9; top_gate = gate("hex", grid.xmax, grid.xmax, 10.0, 20.0); bottom_gate = gate("hex", grid.xmin, grid.xmin, 10.0, 20.0); p = interface2D(grid, Oxide1, Oxide2, top_gate, bottom_gate); fraction_source = 0.01 fraction_drain = 0.01 dope_reservoir(grid, p, FLAKE, fraction_source, array([-1, 1, grid.ymin, 10.0])); dope_reservoir(grid, p, FLAKE, fraction_drain, array([-1, 1, 20.0, grid.ymax])); # solve_init(grid,p,FLAKE); Vgmin = 0.0; Vgmax = 1.0; Vgstep = 0.05; Np = int(abs(Vgmin - Vgmax) / Vgstep) + 1; vg = zeros(Np); current = zeros(Np); p.underel = 0.1; counter = 0; Vgs = Vgmin; FLAKE.mu1 = -0.0 FLAKE.mu2 = -0.1 while (Vgs <= Vgmax): bottom_gate.Ef = -Vgs; set_gate(p, bottom_gate) top_gate.Ef = -Vgs; set_gate(p, top_gate) p.normpoisson = 1e-1; p.normd = 5e-3; solve_self_consistent(grid, p, FLAKE); vg[counter] = Vgs; current[counter] = FLAKE.current(); # I save the output files if (rank == 0): string = "./datiout/Phi%s.out" % Vgs; savetxt(string, p.Phi); string = "./datiout/ncar%s.out" % Vgs; savetxt(string, p.free_charge); a = [FLAKE.E, FLAKE.T]; string = "./datiout/T%s.out" % Vgs; savetxt(string, transpose(a)); string = "./datiout/jayn%s.out" % Vgs; fp = open(string, "w"); string2 = "%s" % current[counter]; fp.write(string2); fp.close(); counter = counter + 1; Vgs = Vgs + Vgstep; tempo = [vg, current] savetxt("./datiout/idvgs.out", transpose(tempo)); plot(vg[:counter], current[:counter]) show()

24.527473

81

0.611111

from NanoTCAD_ViDES import * import sys from module_TMD import * rank = 0 xg = nonuniformgrid(array([-2.0, 1, 0, 0.05, 2.0, 1])) FLAKE = TMD(30.0, "n"); acc = FLAKE.acc; kF = 2 * pi / (3 * sqrt(3) * acc); kymax = pi / FLAKE.delta; Nky = 32.0; dk = kymax / Nky; FLAKE.kmax = pi / FLAKE.delta; FLAKE.kmin = 0; FLAKE.dk = dk; FLAKE.dE = 0.001 grid = grid2D(xg, FLAKE.y, FLAKE.x, FLAKE.y); savetxt("gridx.out", grid.gridx) savetxt("gridy.out", grid.gridy) Oxide1 = region("hex", grid.xmin, 0, grid.ymin, grid.ymax) Oxide1.eps = 3.9; Oxide2 = region("hex", 0, grid.xmax, grid.ymin, grid.ymax) Oxide2.eps = 3.9; top_gate = gate("hex", grid.xmax, grid.xmax, 10.0, 20.0); bottom_gate = gate("hex", grid.xmin, grid.xmin, 10.0, 20.0); p = interface2D(grid, Oxide1, Oxide2, top_gate, bottom_gate); fraction_source = 0.01 fraction_drain = 0.01 dope_reservoir(grid, p, FLAKE, fraction_source, array([-1, 1, grid.ymin, 10.0])); dope_reservoir(grid, p, FLAKE, fraction_drain, array([-1, 1, 20.0, grid.ymax])); Vgmin = 0.0; Vgmax = 1.0; Vgstep = 0.05; Np = int(abs(Vgmin - Vgmax) / Vgstep) + 1; vg = zeros(Np); current = zeros(Np); p.underel = 0.1; counter = 0; Vgs = Vgmin; FLAKE.mu1 = -0.0 FLAKE.mu2 = -0.1 while (Vgs <= Vgmax): bottom_gate.Ef = -Vgs; set_gate(p, bottom_gate) top_gate.Ef = -Vgs; set_gate(p, top_gate) p.normpoisson = 1e-1; p.normd = 5e-3; solve_self_consistent(grid, p, FLAKE); vg[counter] = Vgs; current[counter] = FLAKE.current(); if (rank == 0): string = "./datiout/Phi%s.out" % Vgs; savetxt(string, p.Phi); string = "./datiout/ncar%s.out" % Vgs; savetxt(string, p.free_charge); a = [FLAKE.E, FLAKE.T]; string = "./datiout/T%s.out" % Vgs; savetxt(string, transpose(a)); string = "./datiout/jayn%s.out" % Vgs; fp = open(string, "w"); string2 = "%s" % current[counter]; fp.write(string2); fp.close(); counter = counter + 1; Vgs = Vgs + Vgstep; tempo = [vg, current] savetxt("./datiout/idvgs.out", transpose(tempo)); plot(vg[:counter], current[:counter]) show()

true

1c2ff604819a2df5c8840a388bb0d80ce8a53246

2,074

py

Python

Applications/ParaView/Testing/Python/CTHAMRContour.py

mathstuf/ParaView

e867e280545ada10c4ed137f6a966d9d2f3db4cb

[ "Apache-2.0" ]

2

2019-09-27T08:04:34.000Z

2019-10-16T22:30:54.000Z

Applications/ParaView/Testing/Python/CTHAMRContour.py

mathstuf/ParaView

e867e280545ada10c4ed137f6a966d9d2f3db4cb

[ "Apache-2.0" ]

null

Applications/ParaView/Testing/Python/CTHAMRContour.py

mathstuf/ParaView

e867e280545ada10c4ed137f6a966d9d2f3db4cb

[ "Apache-2.0" ]

5

2016-04-14T13:42:37.000Z

2021-05-22T04:59:42.000Z

#/usr/bin/env python import QtTesting import QtTestingImage object1 = 'pqClientMainWindow/MainControlsToolbar/actionOpenData' QtTesting.playCommand(object1, 'activate', '') object2 = 'pqClientMainWindow/FileOpenDialog' QtTesting.playCommand(object2, 'filesSelected', '$PARAVIEW_DATA_ROOT/SPCTH/Dave_Karelitz_Small/spcth_a') object3 = 'pqClientMainWindow/proxyTabDock/proxyTabWidget/qt_tabwidget_stackedwidget/objectInspector/ScrollArea/qt_scrollarea_viewport/PanelArea/Editor/CellArrayStatus/1QHeaderView0' QtTesting.playCommand(object3, 'mousePress', '1,1,0,0,0,0') QtTesting.playCommand(object3, 'mouseRelease', '1,0,0,0,0,0') object4 = 'pqClientMainWindow/proxyTabDock/proxyTabWidget/qt_tabwidget_stackedwidget/objectInspector/Accept' QtTesting.playCommand(object4, 'activate', '') object5 = 'pqClientMainWindow/representationToolbar/displayRepresentation/comboBox' QtTesting.playCommand(object5, 'set_string', 'Surface') object6 = 'pqClientMainWindow/cameraToolbar/actionNegativeY' QtTesting.playCommand(object6, 'activate', '') object7 = 'pqClientMainWindow/variableToolbar/displayColor/Variables' QtTesting.playCommand(object7, 'set_string', 'Pressure (dynes/cm^2^)') object8 = 'pqClientMainWindow/menubar' QtTesting.playCommand(object8, 'activate', 'menuFilters') object9 = 'pqClientMainWindow/menubar/menuFilters/Alphabetical' QtTesting.playCommand(object9, 'activate', 'AMRDualContour') object10 = 'pqClientMainWindow/proxyTabDock/proxyTabWidget/qt_tabwidget_stackedwidget/objectInspector/ScrollArea/qt_scrollarea_viewport/PanelArea/Editor/SelectMaterialArrays/1QHeaderView0' QtTesting.playCommand(object10, 'mousePress', '1,1,0,0,0,0') QtTesting.playCommand(object10, 'mouseRelease', '1,0,0,0,0,0') QtTesting.playCommand(object4, 'activate', '') QtTesting.playCommand(object7, 'set_string', 'Pressure (dynes/cm^2^) (partial)') # DO_IMAGE_COMPARE snapshotWidget = 'pqClientMainWindow/centralwidget/MultiViewWidget/CoreWidget/qt_tabwidget_stackedwidget/MultiViewWidget1/Frame.0/Viewport' QtTestingImage.compareImage(snapshotWidget, 'CTHAMRContour.png', 300, 300)

61

188

0.831244

import QtTesting import QtTestingImage object1 = 'pqClientMainWindow/MainControlsToolbar/actionOpenData' QtTesting.playCommand(object1, 'activate', '') object2 = 'pqClientMainWindow/FileOpenDialog' QtTesting.playCommand(object2, 'filesSelected', '$PARAVIEW_DATA_ROOT/SPCTH/Dave_Karelitz_Small/spcth_a') object3 = 'pqClientMainWindow/proxyTabDock/proxyTabWidget/qt_tabwidget_stackedwidget/objectInspector/ScrollArea/qt_scrollarea_viewport/PanelArea/Editor/CellArrayStatus/1QHeaderView0' QtTesting.playCommand(object3, 'mousePress', '1,1,0,0,0,0') QtTesting.playCommand(object3, 'mouseRelease', '1,0,0,0,0,0') object4 = 'pqClientMainWindow/proxyTabDock/proxyTabWidget/qt_tabwidget_stackedwidget/objectInspector/Accept' QtTesting.playCommand(object4, 'activate', '') object5 = 'pqClientMainWindow/representationToolbar/displayRepresentation/comboBox' QtTesting.playCommand(object5, 'set_string', 'Surface') object6 = 'pqClientMainWindow/cameraToolbar/actionNegativeY' QtTesting.playCommand(object6, 'activate', '') object7 = 'pqClientMainWindow/variableToolbar/displayColor/Variables' QtTesting.playCommand(object7, 'set_string', 'Pressure (dynes/cm^2^)') object8 = 'pqClientMainWindow/menubar' QtTesting.playCommand(object8, 'activate', 'menuFilters') object9 = 'pqClientMainWindow/menubar/menuFilters/Alphabetical' QtTesting.playCommand(object9, 'activate', 'AMRDualContour') object10 = 'pqClientMainWindow/proxyTabDock/proxyTabWidget/qt_tabwidget_stackedwidget/objectInspector/ScrollArea/qt_scrollarea_viewport/PanelArea/Editor/SelectMaterialArrays/1QHeaderView0' QtTesting.playCommand(object10, 'mousePress', '1,1,0,0,0,0') QtTesting.playCommand(object10, 'mouseRelease', '1,0,0,0,0,0') QtTesting.playCommand(object4, 'activate', '') QtTesting.playCommand(object7, 'set_string', 'Pressure (dynes/cm^2^) (partial)') snapshotWidget = 'pqClientMainWindow/centralwidget/MultiViewWidget/CoreWidget/qt_tabwidget_stackedwidget/MultiViewWidget1/Frame.0/Viewport' QtTestingImage.compareImage(snapshotWidget, 'CTHAMRContour.png', 300, 300)

true

1c2ff621565308394041ea1c9e09a28937a17c49

12,515

py

Python

jacket/tests/compute/unit/api/openstack/compute/test_tenant_networks.py

bopopescu/jacket

d7ad3147fcb43131098c2a5210847634ff5fb325

[ "Apache-2.0" ]

null

jacket/tests/compute/unit/api/openstack/compute/test_tenant_networks.py

bopopescu/jacket

d7ad3147fcb43131098c2a5210847634ff5fb325

[ "Apache-2.0" ]

null

jacket/tests/compute/unit/api/openstack/compute/test_tenant_networks.py

bopopescu/jacket

d7ad3147fcb43131098c2a5210847634ff5fb325

[ "Apache-2.0" ]

2

2016-08-10T02:21:49.000Z

2020-07-24T01:57:21.000Z

# Copyright 2014 IBM Corp. # # Licensed under the Apache License, Version 2.0 (the "License"); you may # not use this file except in compliance with the License. You may obtain # a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, WITHOUT # WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the # License for the specific language governing permissions and limitations # under the License. import copy import mock from oslo_config import cfg import webob from jacket.api.compute.openstack.compute.legacy_v2.contrib import os_tenant_networks \ as networks from jacket.api.compute.openstack.compute import tenant_networks \ as networks_v21 from jacket.compute import exception from jacket.compute import test from jacket.tests.compute.unit.api.openstack import fakes CONF = cfg.CONF NETWORKS = [ { "id": 1, "cidr": "10.20.105.0/24", "label": "new net 1" }, { "id": 2, "cidr": "10.20.105.0/24", "label": "new net 2" } ] DEFAULT_NETWORK = { "id": 3, "cidr": "10.20.105.0/24", "label": "default" } NETWORKS_WITH_DEFAULT_NET = copy.deepcopy(NETWORKS) NETWORKS_WITH_DEFAULT_NET.append(DEFAULT_NETWORK) DEFAULT_TENANT_ID = 1 def fake_network_api_get_all(context): if (context.project_id == DEFAULT_TENANT_ID): return NETWORKS_WITH_DEFAULT_NET else: return NETWORKS class TenantNetworksTestV21(test.NoDBTestCase): ctrlr = networks_v21.TenantNetworkController validation_error = exception.ValidationError def setUp(self): super(TenantNetworksTestV21, self).setUp() self.controller = self.ctrlr() self.flags(enable_network_quota=True) self.req = fakes.HTTPRequest.blank('') self.original_value = CONF.use_neutron_default_nets def tearDown(self): super(TenantNetworksTestV21, self).tearDown() CONF.set_override("use_neutron_default_nets", self.original_value) def _fake_network_api_create(self, context, **kwargs): self.assertEqual(context.project_id, kwargs['project_id']) return NETWORKS @mock.patch('compute.quota.QUOTAS.reserve') @mock.patch('compute.quota.QUOTAS.rollback') @mock.patch('compute.network.api.API.disassociate') @mock.patch('compute.network.api.API.delete') def _test_network_delete_exception(self, delete_ex, disassociate_ex, expex, delete_mock, disassociate_mock, rollback_mock, reserve_mock): ctxt = self.req.environ['compute.context'] reserve_mock.return_value = 'rv' if delete_mock: delete_mock.side_effect = delete_ex if disassociate_ex: disassociate_mock.side_effect = disassociate_ex self.assertRaises(expex, self.controller.delete, self.req, 1) disassociate_mock.assert_called_once_with(ctxt, 1) if not disassociate_ex: delete_mock.assert_called_once_with(ctxt, 1) rollback_mock.assert_called_once_with(ctxt, 'rv') reserve_mock.assert_called_once_with(ctxt, networks=-1) def test_network_delete_exception_network_not_found(self): ex = exception.NetworkNotFound(network_id=1) expex = webob.exc.HTTPNotFound self._test_network_delete_exception(None, ex, expex) def test_network_delete_exception_policy_failed(self): ex = exception.PolicyNotAuthorized(action='dummy') expex = webob.exc.HTTPForbidden self._test_network_delete_exception(ex, None, expex) def test_network_delete_exception_network_in_use(self): ex = exception.NetworkInUse(network_id=1) expex = webob.exc.HTTPConflict self._test_network_delete_exception(ex, None, expex) @mock.patch('compute.quota.QUOTAS.reserve') @mock.patch('compute.quota.QUOTAS.commit') @mock.patch('compute.network.api.API.delete') @mock.patch('compute.network.api.API.disassociate') def test_network_delete(self, disassociate_mock, delete_mock, commit_mock, reserve_mock): ctxt = self.req.environ['compute.context'] reserve_mock.return_value = 'rv' res = self.controller.delete(self.req, 1) # NOTE: on v2.1, http status code is set as wsgi_code of API # method instead of status_int in a response object. if isinstance(self.controller, networks_v21.TenantNetworkController): status_int = self.controller.delete.wsgi_code else: status_int = res.status_int self.assertEqual(202, status_int) disassociate_mock.assert_called_once_with(ctxt, 1) delete_mock.assert_called_once_with(ctxt, 1) commit_mock.assert_called_once_with(ctxt, 'rv') reserve_mock.assert_called_once_with(ctxt, networks=-1) @mock.patch('compute.network.api.API.get') def test_network_show(self, get_mock): get_mock.return_value = NETWORKS[0] res = self.controller.show(self.req, 1) self.assertEqual(NETWORKS[0], res['network']) @mock.patch('compute.network.api.API.get') def test_network_show_not_found(self, get_mock): ctxt = self.req.environ['compute.context'] get_mock.side_effect = exception.NetworkNotFound(network_id=1) self.assertRaises(webob.exc.HTTPNotFound, self.controller.show, self.req, 1) get_mock.assert_called_once_with(ctxt, 1) @mock.patch('compute.network.api.API.get_all') def _test_network_index(self, get_all_mock, default_net=True): CONF.set_override("use_neutron_default_nets", default_net) get_all_mock.side_effect = fake_network_api_get_all expected = NETWORKS if default_net is True: self.req.environ['compute.context'].project_id = DEFAULT_TENANT_ID expected = NETWORKS_WITH_DEFAULT_NET res = self.controller.index(self.req) self.assertEqual(expected, res['networks']) def test_network_index_with_default_net(self): self._test_network_index() def test_network_index_without_default_net(self): self._test_network_index(default_net=False) @mock.patch('compute.quota.QUOTAS.reserve') @mock.patch('compute.quota.QUOTAS.commit') @mock.patch('compute.network.api.API.create') def test_network_create(self, create_mock, commit_mock, reserve_mock): ctxt = self.req.environ['compute.context'] reserve_mock.return_value = 'rv' create_mock.side_effect = self._fake_network_api_create body = copy.deepcopy(NETWORKS[0]) del body['id'] body = {'network': body} res = self.controller.create(self.req, body=body) self.assertEqual(NETWORKS[0], res['network']) commit_mock.assert_called_once_with(ctxt, 'rv') reserve_mock.assert_called_once_with(ctxt, networks=1) @mock.patch('compute.quota.QUOTAS.reserve') def test_network_create_quota_error(self, reserve_mock): ctxt = self.req.environ['compute.context'] reserve_mock.side_effect = exception.OverQuota(overs='fake') body = {'network': {"cidr": "10.20.105.0/24", "label": "new net 1"}} self.assertRaises(webob.exc.HTTPBadRequest, self.controller.create, self.req, body=body) reserve_mock.assert_called_once_with(ctxt, networks=1) @mock.patch('compute.quota.QUOTAS.reserve') @mock.patch('compute.quota.QUOTAS.rollback') @mock.patch('compute.network.api.API.create') def _test_network_create_exception(self, ex, expex, create_mock, rollback_mock, reserve_mock): ctxt = self.req.environ['compute.context'] reserve_mock.return_value = 'rv' create_mock.side_effect = ex body = {'network': {"cidr": "10.20.105.0/24", "label": "new net 1"}} self.assertRaises(expex, self.controller.create, self.req, body=body) reserve_mock.assert_called_once_with(ctxt, networks=1) def test_network_create_exception_policy_failed(self): ex = exception.PolicyNotAuthorized(action='dummy') expex = webob.exc.HTTPForbidden self._test_network_create_exception(ex, expex) def test_network_create_exception_conflictcidr(self): ex = exception.CidrConflict(cidr='dummy', other='dummy') expex = webob.exc.HTTPConflict self._test_network_create_exception(ex, expex) def test_network_create_exception_service_unavailable(self): ex = Exception expex = webob.exc.HTTPServiceUnavailable self._test_network_create_exception(ex, expex) def test_network_create_empty_body(self): self.assertRaises(exception.ValidationError, self.controller.create, self.req, body={}) def test_network_create_without_cidr(self): body = {'network': {"label": "new net 1"}} self.assertRaises(self.validation_error, self.controller.create, self.req, body=body) def test_network_create_bad_format_cidr(self): body = {'network': {"cidr": "123", "label": "new net 1"}} self.assertRaises(self.validation_error, self.controller.create, self.req, body=body) def test_network_create_empty_network(self): body = {'network': {}} self.assertRaises(self.validation_error, self.controller.create, self.req, body=body) def test_network_create_without_label(self): body = {'network': {"cidr": "10.20.105.0/24"}} self.assertRaises(self.validation_error, self.controller.create, self.req, body=body) class TenantNetworksTestV2(TenantNetworksTestV21): ctrlr = networks.NetworkController validation_error = webob.exc.HTTPBadRequest def setUp(self): super(TenantNetworksTestV2, self).setUp() self.req = fakes.HTTPRequest.blank('', use_admin_context=True) def test_network_create_empty_body(self): self.assertRaises(webob.exc.HTTPUnprocessableEntity, self.controller.create, self.req, {}) class TenantNetworksEnforcementV21(test.NoDBTestCase): def setUp(self): super(TenantNetworksEnforcementV21, self).setUp() self.controller = networks_v21.TenantNetworkController() self.req = fakes.HTTPRequest.blank('') def test_create_policy_failed(self): rule_name = 'os_compute_api:os-tenant-networks' self.policy.set_rules({rule_name: "project:non_fake"}) exc = self.assertRaises( exception.PolicyNotAuthorized, self.controller.create, self.req, body={'network': {'label': 'test', 'cidr': '10.0.0.0/32'}}) self.assertEqual( "Policy doesn't allow %s to be performed." % rule_name, exc.format_message()) def test_index_policy_failed(self): rule_name = 'os_compute_api:os-tenant-networks' self.policy.set_rules({rule_name: "project:non_fake"}) exc = self.assertRaises( exception.PolicyNotAuthorized, self.controller.index, self.req) self.assertEqual( "Policy doesn't allow %s to be performed." % rule_name, exc.format_message()) def test_delete_policy_failed(self): rule_name = 'os_compute_api:os-tenant-networks' self.policy.set_rules({rule_name: "project:non_fake"}) exc = self.assertRaises( exception.PolicyNotAuthorized, self.controller.delete, self.req, fakes.FAKE_UUID) self.assertEqual( "Policy doesn't allow %s to be performed." % rule_name, exc.format_message()) def test_show_policy_failed(self): rule_name = 'os_compute_api:os-tenant-networks' self.policy.set_rules({rule_name: "project:non_fake"}) exc = self.assertRaises( exception.PolicyNotAuthorized, self.controller.show, self.req, fakes.FAKE_UUID) self.assertEqual( "Policy doesn't allow %s to be performed." % rule_name, exc.format_message())

38.389571

87

0.665521

import copy import mock from oslo_config import cfg import webob from jacket.api.compute.openstack.compute.legacy_v2.contrib import os_tenant_networks \ as networks from jacket.api.compute.openstack.compute import tenant_networks \ as networks_v21 from jacket.compute import exception from jacket.compute import test from jacket.tests.compute.unit.api.openstack import fakes CONF = cfg.CONF NETWORKS = [ { "id": 1, "cidr": "10.20.105.0/24", "label": "new net 1" }, { "id": 2, "cidr": "10.20.105.0/24", "label": "new net 2" } ] DEFAULT_NETWORK = { "id": 3, "cidr": "10.20.105.0/24", "label": "default" } NETWORKS_WITH_DEFAULT_NET = copy.deepcopy(NETWORKS) NETWORKS_WITH_DEFAULT_NET.append(DEFAULT_NETWORK) DEFAULT_TENANT_ID = 1 def fake_network_api_get_all(context): if (context.project_id == DEFAULT_TENANT_ID): return NETWORKS_WITH_DEFAULT_NET else: return NETWORKS class TenantNetworksTestV21(test.NoDBTestCase): ctrlr = networks_v21.TenantNetworkController validation_error = exception.ValidationError def setUp(self): super(TenantNetworksTestV21, self).setUp() self.controller = self.ctrlr() self.flags(enable_network_quota=True) self.req = fakes.HTTPRequest.blank('') self.original_value = CONF.use_neutron_default_nets def tearDown(self): super(TenantNetworksTestV21, self).tearDown() CONF.set_override("use_neutron_default_nets", self.original_value) def _fake_network_api_create(self, context, **kwargs): self.assertEqual(context.project_id, kwargs['project_id']) return NETWORKS @mock.patch('compute.quota.QUOTAS.reserve') @mock.patch('compute.quota.QUOTAS.rollback') @mock.patch('compute.network.api.API.disassociate') @mock.patch('compute.network.api.API.delete') def _test_network_delete_exception(self, delete_ex, disassociate_ex, expex, delete_mock, disassociate_mock, rollback_mock, reserve_mock): ctxt = self.req.environ['compute.context'] reserve_mock.return_value = 'rv' if delete_mock: delete_mock.side_effect = delete_ex if disassociate_ex: disassociate_mock.side_effect = disassociate_ex self.assertRaises(expex, self.controller.delete, self.req, 1) disassociate_mock.assert_called_once_with(ctxt, 1) if not disassociate_ex: delete_mock.assert_called_once_with(ctxt, 1) rollback_mock.assert_called_once_with(ctxt, 'rv') reserve_mock.assert_called_once_with(ctxt, networks=-1) def test_network_delete_exception_network_not_found(self): ex = exception.NetworkNotFound(network_id=1) expex = webob.exc.HTTPNotFound self._test_network_delete_exception(None, ex, expex) def test_network_delete_exception_policy_failed(self): ex = exception.PolicyNotAuthorized(action='dummy') expex = webob.exc.HTTPForbidden self._test_network_delete_exception(ex, None, expex) def test_network_delete_exception_network_in_use(self): ex = exception.NetworkInUse(network_id=1) expex = webob.exc.HTTPConflict self._test_network_delete_exception(ex, None, expex) @mock.patch('compute.quota.QUOTAS.reserve') @mock.patch('compute.quota.QUOTAS.commit') @mock.patch('compute.network.api.API.delete') @mock.patch('compute.network.api.API.disassociate') def test_network_delete(self, disassociate_mock, delete_mock, commit_mock, reserve_mock): ctxt = self.req.environ['compute.context'] reserve_mock.return_value = 'rv' res = self.controller.delete(self.req, 1) if isinstance(self.controller, networks_v21.TenantNetworkController): status_int = self.controller.delete.wsgi_code else: status_int = res.status_int self.assertEqual(202, status_int) disassociate_mock.assert_called_once_with(ctxt, 1) delete_mock.assert_called_once_with(ctxt, 1) commit_mock.assert_called_once_with(ctxt, 'rv') reserve_mock.assert_called_once_with(ctxt, networks=-1) @mock.patch('compute.network.api.API.get') def test_network_show(self, get_mock): get_mock.return_value = NETWORKS[0] res = self.controller.show(self.req, 1) self.assertEqual(NETWORKS[0], res['network']) @mock.patch('compute.network.api.API.get') def test_network_show_not_found(self, get_mock): ctxt = self.req.environ['compute.context'] get_mock.side_effect = exception.NetworkNotFound(network_id=1) self.assertRaises(webob.exc.HTTPNotFound, self.controller.show, self.req, 1) get_mock.assert_called_once_with(ctxt, 1) @mock.patch('compute.network.api.API.get_all') def _test_network_index(self, get_all_mock, default_net=True): CONF.set_override("use_neutron_default_nets", default_net) get_all_mock.side_effect = fake_network_api_get_all expected = NETWORKS if default_net is True: self.req.environ['compute.context'].project_id = DEFAULT_TENANT_ID expected = NETWORKS_WITH_DEFAULT_NET res = self.controller.index(self.req) self.assertEqual(expected, res['networks']) def test_network_index_with_default_net(self): self._test_network_index() def test_network_index_without_default_net(self): self._test_network_index(default_net=False) @mock.patch('compute.quota.QUOTAS.reserve') @mock.patch('compute.quota.QUOTAS.commit') @mock.patch('compute.network.api.API.create') def test_network_create(self, create_mock, commit_mock, reserve_mock): ctxt = self.req.environ['compute.context'] reserve_mock.return_value = 'rv' create_mock.side_effect = self._fake_network_api_create body = copy.deepcopy(NETWORKS[0]) del body['id'] body = {'network': body} res = self.controller.create(self.req, body=body) self.assertEqual(NETWORKS[0], res['network']) commit_mock.assert_called_once_with(ctxt, 'rv') reserve_mock.assert_called_once_with(ctxt, networks=1) @mock.patch('compute.quota.QUOTAS.reserve') def test_network_create_quota_error(self, reserve_mock): ctxt = self.req.environ['compute.context'] reserve_mock.side_effect = exception.OverQuota(overs='fake') body = {'network': {"cidr": "10.20.105.0/24", "label": "new net 1"}} self.assertRaises(webob.exc.HTTPBadRequest, self.controller.create, self.req, body=body) reserve_mock.assert_called_once_with(ctxt, networks=1) @mock.patch('compute.quota.QUOTAS.reserve') @mock.patch('compute.quota.QUOTAS.rollback') @mock.patch('compute.network.api.API.create') def _test_network_create_exception(self, ex, expex, create_mock, rollback_mock, reserve_mock): ctxt = self.req.environ['compute.context'] reserve_mock.return_value = 'rv' create_mock.side_effect = ex body = {'network': {"cidr": "10.20.105.0/24", "label": "new net 1"}} self.assertRaises(expex, self.controller.create, self.req, body=body) reserve_mock.assert_called_once_with(ctxt, networks=1) def test_network_create_exception_policy_failed(self): ex = exception.PolicyNotAuthorized(action='dummy') expex = webob.exc.HTTPForbidden self._test_network_create_exception(ex, expex) def test_network_create_exception_conflictcidr(self): ex = exception.CidrConflict(cidr='dummy', other='dummy') expex = webob.exc.HTTPConflict self._test_network_create_exception(ex, expex) def test_network_create_exception_service_unavailable(self): ex = Exception expex = webob.exc.HTTPServiceUnavailable self._test_network_create_exception(ex, expex) def test_network_create_empty_body(self): self.assertRaises(exception.ValidationError, self.controller.create, self.req, body={}) def test_network_create_without_cidr(self): body = {'network': {"label": "new net 1"}} self.assertRaises(self.validation_error, self.controller.create, self.req, body=body) def test_network_create_bad_format_cidr(self): body = {'network': {"cidr": "123", "label": "new net 1"}} self.assertRaises(self.validation_error, self.controller.create, self.req, body=body) def test_network_create_empty_network(self): body = {'network': {}} self.assertRaises(self.validation_error, self.controller.create, self.req, body=body) def test_network_create_without_label(self): body = {'network': {"cidr": "10.20.105.0/24"}} self.assertRaises(self.validation_error, self.controller.create, self.req, body=body) class TenantNetworksTestV2(TenantNetworksTestV21): ctrlr = networks.NetworkController validation_error = webob.exc.HTTPBadRequest def setUp(self): super(TenantNetworksTestV2, self).setUp() self.req = fakes.HTTPRequest.blank('', use_admin_context=True) def test_network_create_empty_body(self): self.assertRaises(webob.exc.HTTPUnprocessableEntity, self.controller.create, self.req, {}) class TenantNetworksEnforcementV21(test.NoDBTestCase): def setUp(self): super(TenantNetworksEnforcementV21, self).setUp() self.controller = networks_v21.TenantNetworkController() self.req = fakes.HTTPRequest.blank('') def test_create_policy_failed(self): rule_name = 'os_compute_api:os-tenant-networks' self.policy.set_rules({rule_name: "project:non_fake"}) exc = self.assertRaises( exception.PolicyNotAuthorized, self.controller.create, self.req, body={'network': {'label': 'test', 'cidr': '10.0.0.0/32'}}) self.assertEqual( "Policy doesn't allow %s to be performed." % rule_name, exc.format_message()) def test_index_policy_failed(self): rule_name = 'os_compute_api:os-tenant-networks' self.policy.set_rules({rule_name: "project:non_fake"}) exc = self.assertRaises( exception.PolicyNotAuthorized, self.controller.index, self.req) self.assertEqual( "Policy doesn't allow %s to be performed." % rule_name, exc.format_message()) def test_delete_policy_failed(self): rule_name = 'os_compute_api:os-tenant-networks' self.policy.set_rules({rule_name: "project:non_fake"}) exc = self.assertRaises( exception.PolicyNotAuthorized, self.controller.delete, self.req, fakes.FAKE_UUID) self.assertEqual( "Policy doesn't allow %s to be performed." % rule_name, exc.format_message()) def test_show_policy_failed(self): rule_name = 'os_compute_api:os-tenant-networks' self.policy.set_rules({rule_name: "project:non_fake"}) exc = self.assertRaises( exception.PolicyNotAuthorized, self.controller.show, self.req, fakes.FAKE_UUID) self.assertEqual( "Policy doesn't allow %s to be performed." % rule_name, exc.format_message())

true

1c2ff63af1be2d0cda330784b4e1026fce04aee2

3,381

py

Python

domain_trainer.py

wiatrak2/BScThesis

e5dd012fd9052e7088d8464b409dc055dbfcf840

[ "MIT" ]

null

domain_trainer.py

wiatrak2/BScThesis

e5dd012fd9052e7088d8464b409dc055dbfcf840

[ "MIT" ]

null

domain_trainer.py

wiatrak2/BScThesis

e5dd012fd9052e7088d8464b409dc055dbfcf840

[ "MIT" ]

null

import numpy as np import torch import torch.nn as nn import torch.nn.functional as F import torch.optim as optim from collections import defaultdict, namedtuple class DomainTrainer: def __init__(self, models, optims, criterions, device, **kwargs): self.models = models self.optims = optims self.criterions = criterions self.device = device self.history = kwargs.get('history', True) self.log_interval = kwargs.get('log_interval', 100) self.print_logs = kwargs.get('print_logs', True) def _train_domain(self, loaders, gr_models, epoch, train_history): model_d = self.models.model_d.train() model_f = self.models.model_f.eval() train_loader = loaders.merged_test_loader optimizer = self.optims.optim_d criterion_domain = self.criterions.criterion_domain if gr_models is not None: model_c = gr_models.model_c model_gr = gr_models.model_d for batch_idx, (data, domains) in enumerate(train_loader): if train_loader.dataset.get_labels: _, domains = domains data, domains = data.to(self.device), domains.to(self.device) optimizer.zero_grad() output = model_d(model_f(data)) loss = criterion_domain(output, domains) loss.backward() optimizer.step() if self.history and gr_models: model_c_mtx = model_c.get_mtx().weight.cpu().detach().numpy() model_d_mtx = model_d.get_mtx().weight.cpu().detach().numpy() model_gr_mtx = model_gr.get_mtx().weight.cpu().detach().numpy() train_history['avg_len'].append(np.mean(np.diag(model_d_mtx.dot(model_d_mtx.T)))) train_history['avg_dot'].append(np.mean(model_d_mtx.dot(model_c_mtx.T))) train_history['avg_dot_gr'].append(np.mean(model_d_mtx.dot(model_gr_mtx.T))) if batch_idx % self.log_interval == 0 and self.print_logs: print('Train Epoch: {} [{}/{} ({:.0f}%)]\tLoss: {:.6f}'.format( epoch, batch_idx * len(data), len(train_loader.dataset), 100. * batch_idx / len(train_loader), loss.item())) @staticmethod def test_domain_pred(model, device, merged_test_loader, print_logs=True, test_history=None): model.eval() domain_test_loss = 0 domain_correct = 0 with torch.no_grad(): for data, target in merged_test_loader: data = data.to(device) if merged_test_loader.dataset.get_labels: _, domains = target else: domains = target domains = domains.to(device) domain_out = model(data) domain_pred = domain_out.max(1, keepdim=True)[1] domain_correct += domain_pred.eq(domains.view_as(domain_pred)).sum().item() domain_test_loss /= len(merged_test_loader.dataset) if print_logs: print('\nDomains predictor: Accuracy: {}/{} ({:.0f}%)\n'.format( domain_correct, len(merged_test_loader.dataset), 100. * domain_correct / len(merged_test_loader.dataset))) if test_history is not None: test_history['acc'].append(100. * domain_correct / len(merged_test_loader.dataset)) def train(self, epochs, loaders, gr_models=None, train_history=None): self.epochs = epochs if train_history is None: train_history = defaultdict(lambda:[]) for epoch in range(1, self.epochs+1): self._train_domain(loaders, gr_models, epoch, train_history) domain_model = nn.Sequential(self.models.model_f, self.models.model_d) self.test_domain_pred(domain_model, self.device, loaders.merged_test_loader, print_logs=self.print_logs, test_history=train_history)

39.313953

138

0.724933

import numpy as np import torch import torch.nn as nn import torch.nn.functional as F import torch.optim as optim from collections import defaultdict, namedtuple class DomainTrainer: def __init__(self, models, optims, criterions, device, **kwargs): self.models = models self.optims = optims self.criterions = criterions self.device = device self.history = kwargs.get('history', True) self.log_interval = kwargs.get('log_interval', 100) self.print_logs = kwargs.get('print_logs', True) def _train_domain(self, loaders, gr_models, epoch, train_history): model_d = self.models.model_d.train() model_f = self.models.model_f.eval() train_loader = loaders.merged_test_loader optimizer = self.optims.optim_d criterion_domain = self.criterions.criterion_domain if gr_models is not None: model_c = gr_models.model_c model_gr = gr_models.model_d for batch_idx, (data, domains) in enumerate(train_loader): if train_loader.dataset.get_labels: _, domains = domains data, domains = data.to(self.device), domains.to(self.device) optimizer.zero_grad() output = model_d(model_f(data)) loss = criterion_domain(output, domains) loss.backward() optimizer.step() if self.history and gr_models: model_c_mtx = model_c.get_mtx().weight.cpu().detach().numpy() model_d_mtx = model_d.get_mtx().weight.cpu().detach().numpy() model_gr_mtx = model_gr.get_mtx().weight.cpu().detach().numpy() train_history['avg_len'].append(np.mean(np.diag(model_d_mtx.dot(model_d_mtx.T)))) train_history['avg_dot'].append(np.mean(model_d_mtx.dot(model_c_mtx.T))) train_history['avg_dot_gr'].append(np.mean(model_d_mtx.dot(model_gr_mtx.T))) if batch_idx % self.log_interval == 0 and self.print_logs: print('Train Epoch: {} [{}/{} ({:.0f}%)]\tLoss: {:.6f}'.format( epoch, batch_idx * len(data), len(train_loader.dataset), 100. * batch_idx / len(train_loader), loss.item())) @staticmethod def test_domain_pred(model, device, merged_test_loader, print_logs=True, test_history=None): model.eval() domain_test_loss = 0 domain_correct = 0 with torch.no_grad(): for data, target in merged_test_loader: data = data.to(device) if merged_test_loader.dataset.get_labels: _, domains = target else: domains = target domains = domains.to(device) domain_out = model(data) domain_pred = domain_out.max(1, keepdim=True)[1] domain_correct += domain_pred.eq(domains.view_as(domain_pred)).sum().item() domain_test_loss /= len(merged_test_loader.dataset) if print_logs: print('\nDomains predictor: Accuracy: {}/{} ({:.0f}%)\n'.format( domain_correct, len(merged_test_loader.dataset), 100. * domain_correct / len(merged_test_loader.dataset))) if test_history is not None: test_history['acc'].append(100. * domain_correct / len(merged_test_loader.dataset)) def train(self, epochs, loaders, gr_models=None, train_history=None): self.epochs = epochs if train_history is None: train_history = defaultdict(lambda:[]) for epoch in range(1, self.epochs+1): self._train_domain(loaders, gr_models, epoch, train_history) domain_model = nn.Sequential(self.models.model_f, self.models.model_d) self.test_domain_pred(domain_model, self.device, loaders.merged_test_loader, print_logs=self.print_logs, test_history=train_history)

true

1c2ff6667032bf51186ac6754942e176dc8d0b6c

4,355

py

Python

a10_neutron_lbaas/v1/handler_hm.py

hthompson6/a10-neutron-lbaas

f1639758cd3abcc6c86c8e6b64dcb0397c359621

[ "Apache-2.0" ]

10

2015-09-15T05:16:15.000Z

2020-03-18T02:34:39.000Z

a10_neutron_lbaas/v1/handler_hm.py

hthompson6/a10-neutron-lbaas

f1639758cd3abcc6c86c8e6b64dcb0397c359621

[ "Apache-2.0" ]

334

2015-02-11T23:45:00.000Z

2020-02-28T08:58:51.000Z

a10_neutron_lbaas/v1/handler_hm.py

hthompson6/a10-neutron-lbaas

f1639758cd3abcc6c86c8e6b64dcb0397c359621

[ "Apache-2.0" ]

24

2015-01-13T21:14:45.000Z

2021-06-02T17:22:14.000Z

# Copyright 2014, Doug Wiegley (dougwig), A10 Networks # # Licensed under the Apache License, Version 2.0 (the "License"); you may # not use this file except in compliance with the License. You may obtain # a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, WITHOUT # WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the # License for the specific language governing permissions and limitations # under the License. import acos_client.errors as acos_errors import logging from a10_neutron_lbaas.acos import openstack_mappings from a10_neutron_lbaas.v1 import handler_base_v1 from a10_neutron_lbaas.v1 import v1_context as a10 LOG = logging.getLogger(__name__) class HealthMonitorHandler(handler_base_v1.HandlerBaseV1): def _name(self, hm): return hm['id'][0:28] def _set(self, c, set_method, context, hm): hm_name = self._meta_name(hm) method = None url = None expect_code = None if hm['type'] in ['HTTP', 'HTTPS']: method = hm['http_method'] url = hm['url_path'] expect_code = hm['expected_codes'] args = self.meta(hm, 'hm', {}) set_method(hm_name, openstack_mappings.hm_type(c, hm['type']), hm['delay'], hm['timeout'], hm['max_retries'], method=method, url=url, expect_code=expect_code, axapi_args=args) def create(self, context, hm, pool_id): h = hm.copy() h['pool_id'] = pool_id with a10.A10WriteHMStatusContext(self, context, h, action='create') as c: try: self._set(c, c.client.slb.hm.create, context, hm) except acos_errors.Exists: pass if pool_id is not None: c.client.slb.service_group.update( self._pool_name(context, pool_id), health_monitor=self._meta_name(hm)) for pool in hm['pools']: if pool['pool_id'] == pool_id: continue c.client.slb.service_group.update( self._pool_name(context, pool['pool_id']), health_monitor=self._meta_name(hm)) def update(self, context, old_hm, hm, pool_id): h = hm.copy() h['pool_id'] = pool_id with a10.A10WriteHMStatusContext(self, context, h) as c: self._set(c, c.client.slb.hm.update, context, hm) def _dissociate(self, c, context, hm, pool_id): """Remove a pool association""" pool_name = self._pool_name(context, pool_id) c.client.slb.service_group.update(pool_name, health_monitor="", health_check_disable=True) def dissociate(self, c, context, hm, pool_id): """Remove a pool association, and the healthmonitor if its the last one""" self._dissociate(c, context, hm, pool_id) pools = hm.get("pools", []) if not any(p for p in pools if p.get("pool_id") != pool_id): self._delete_unused(c, context, hm) def _delete(self, c, context, hm): """Delete a healthmonitor and ALL its pool associations""" pools = hm.get("pools", []) for pool in pools: pool_id = pool.get("pool_id") self._dissociate(c, context, hm, pool_id) self._delete_unused(c, context, hm) def _delete_unused(self, c, context, hm): try: c.client.slb.hm.delete(self._meta_name(hm)) except acos_errors.InUse: LOG.error("Cannot delete a health monitor with existing associations") raise except acos_errors.NotFound: pass def delete(self, context, hm, pool_id): h = hm.copy() # Get the binding count to see if we need to perform disassociation h['pool_id'] = pool_id with a10.A10DeleteHMContext(self, context, h) as c: if pool_id is None: # Delete the whole healthmonitor self._delete(c, context, hm) else: # Disassociate this pool self.dissociate(c, context, hm, pool_id)

35.991736

82

0.60023

import acos_client.errors as acos_errors import logging from a10_neutron_lbaas.acos import openstack_mappings from a10_neutron_lbaas.v1 import handler_base_v1 from a10_neutron_lbaas.v1 import v1_context as a10 LOG = logging.getLogger(__name__) class HealthMonitorHandler(handler_base_v1.HandlerBaseV1): def _name(self, hm): return hm['id'][0:28] def _set(self, c, set_method, context, hm): hm_name = self._meta_name(hm) method = None url = None expect_code = None if hm['type'] in ['HTTP', 'HTTPS']: method = hm['http_method'] url = hm['url_path'] expect_code = hm['expected_codes'] args = self.meta(hm, 'hm', {}) set_method(hm_name, openstack_mappings.hm_type(c, hm['type']), hm['delay'], hm['timeout'], hm['max_retries'], method=method, url=url, expect_code=expect_code, axapi_args=args) def create(self, context, hm, pool_id): h = hm.copy() h['pool_id'] = pool_id with a10.A10WriteHMStatusContext(self, context, h, action='create') as c: try: self._set(c, c.client.slb.hm.create, context, hm) except acos_errors.Exists: pass if pool_id is not None: c.client.slb.service_group.update( self._pool_name(context, pool_id), health_monitor=self._meta_name(hm)) for pool in hm['pools']: if pool['pool_id'] == pool_id: continue c.client.slb.service_group.update( self._pool_name(context, pool['pool_id']), health_monitor=self._meta_name(hm)) def update(self, context, old_hm, hm, pool_id): h = hm.copy() h['pool_id'] = pool_id with a10.A10WriteHMStatusContext(self, context, h) as c: self._set(c, c.client.slb.hm.update, context, hm) def _dissociate(self, c, context, hm, pool_id): pool_name = self._pool_name(context, pool_id) c.client.slb.service_group.update(pool_name, health_monitor="", health_check_disable=True) def dissociate(self, c, context, hm, pool_id): self._dissociate(c, context, hm, pool_id) pools = hm.get("pools", []) if not any(p for p in pools if p.get("pool_id") != pool_id): self._delete_unused(c, context, hm) def _delete(self, c, context, hm): pools = hm.get("pools", []) for pool in pools: pool_id = pool.get("pool_id") self._dissociate(c, context, hm, pool_id) self._delete_unused(c, context, hm) def _delete_unused(self, c, context, hm): try: c.client.slb.hm.delete(self._meta_name(hm)) except acos_errors.InUse: LOG.error("Cannot delete a health monitor with existing associations") raise except acos_errors.NotFound: pass def delete(self, context, hm, pool_id): h = hm.copy() h['pool_id'] = pool_id with a10.A10DeleteHMContext(self, context, h) as c: if pool_id is None: self._delete(c, context, hm) else: self.dissociate(c, context, hm, pool_id)

true

1c2ff740a6516ce48791949ac6dad97d7a9e429f

5,737

py

Python

mixcoatl/platform/relational_database_product.py

zomGreg/mixcoatl

dd8d7e206682955b251d7f858fffee56b11df8c6

[ "Apache-2.0" ]

null

mixcoatl/platform/relational_database_product.py

zomGreg/mixcoatl

dd8d7e206682955b251d7f858fffee56b11df8c6

[ "Apache-2.0" ]

null

mixcoatl/platform/relational_database_product.py

zomGreg/mixcoatl

dd8d7e206682955b251d7f858fffee56b11df8c6

[ "Apache-2.0" ]

null

from mixcoatl.resource import Resource from mixcoatl.admin.job import Job from mixcoatl.decorators.lazy import lazy_property from mixcoatl.utils import uncamel, camelize, camel_keys, uncamel_keys class RelationalDatabaseProduct(Resource): """Represents a product with costs from a cloud relational database vendor.""" PATH = 'platform/RelationalDatabaseProduct' COLLECTION_NAME = 'rdbmsProducts' PRIMARY_KEY = 'product_id' def __init__(self, product_id=None, endpoint=None, *args, **kwargs): Resource.__init__(self, endpoint=endpoint) self.__product_id = product_id @property def product_id(self): """`int` - The unique ID in DCM for this relational database product.""" return self.__product_id @lazy_property def status(self): """`str` - The current status of the product.""" return self.__status @lazy_property def architecture(self): """`str` - The underlying CPU architecture of this database server.""" return self.__architecture @lazy_property def cloud(self): """`dict` - The cloud for which this product operates.""" return self.__cloud @lazy_property def core_count(self): """`int` - The number of CPU cores allocated to your database environment.""" return self.__core_count @lazy_property def cpu_in_g_hz(self): """`int` - The speed of the CPUs allocated to your database environment.""" return self.__cpu_in_g_hz @lazy_property def custom_pricing(self): """`bool` - Indicates whether or not this pricing reflects the standard retail rates from the cloud provider.""" return self.__custom_pricing @lazy_property def description(self): """`str` - A long description for this product.""" return self.__description @lazy_property def engine(self): """ `enum` - The database engine represented by this product.""" return self.__engine @lazy_property def hourly_pricing(self): """`dict` - The hourly rate the cloud provider charges for having a relational database provisioned.""" return self.__hourly_pricing @lazy_property def io_pricing(self): """`dict` - The rate charged by the cloud provider for data going in and out of the cloud to the database.""" return self.__io_pricing @lazy_property def io_units(self): """`int` - The number of I/O units reflecting in the I/O pricing.""" return self.__io_units @lazy_property def maximum_storage_in_gb(self): """`int` - The amount of storage up to which you may have allocated to be reflected by this product.""" return self.__maximum_storage_in_gb @lazy_property def memory_in_gb(self): """`int` - The amount of RAM allocated to this virtual database server.""" return self.__memory_in_gb @lazy_property def minimum_storage_in_gb(self): """`int` - The amount of storage you must have allocated to receive the pricing reflected in this product.""" return self.__minimum_storage_in_gb @lazy_property def name(self): """`str` - A user-friendly name to describe this product.""" return self.__name @lazy_property def region(self): """`dict` - A region for which this product is good.""" return self.__region @lazy_property def provider_id(self): """`str` - How this product is identified to the cloud provider.""" return self.__provider_id @lazy_property def storage_pricing(self): """`dict` - The rate per storageUnits charged for the storage allocated for this relational database product.""" return self.__storage_pricing @lazy_property def storage_units(self): """`int` - The number of storage units reflected in the storage pricing.""" return self.__storage_units def reload(self): """Reload resource data from API calls""" if self.product_id is not None: self.load() elif self.current_job is None: self.load() else: if Job.wait_for(self.current_job): job = Job(self.current_job, endpoint=self.endpoint) self.__relational_database_id = job.message self.load() else: return self.last_error @classmethod def all(cls, region_id, engine, endpoint=None, **kwargs): """Get a list of all known relational_databases >>> RelationalDatabaseProduct.all(region_id=100, engine='MYSQL51') [{'product_id':1,...},{'product_id':2,...}] :returns: list -- a list of :class:`RelationalDatabaseProduct` :raises: RelationalDatabaseProductException """ r = Resource(cls.PATH, endpoint=endpoint) r.request_details = 'basic' params = {'regionId': region_id, 'engine': engine} if 'detail' in kwargs: r.request_details = kwargs['detail'] else: r.request_details = 'basic' if 'keys_only' in kwargs: keys_only = kwargs['keys_only'] else: keys_only = False x = r.get(params=params) if r.last_error is None: if keys_only is True: results = [i[camelize(cls.PRIMARY_KEY)] for i in x[cls.COLLECTION_NAME]] else: results = [type(cls.__name__, (object,), i) for i in uncamel_keys(x)[uncamel(cls.COLLECTION_NAME)]] return results else: raise RelationalDatabaseProductException(r.last_error) class RelationalDatabaseProductException(BaseException): pass

34.14881

120

0.644413

from mixcoatl.resource import Resource from mixcoatl.admin.job import Job from mixcoatl.decorators.lazy import lazy_property from mixcoatl.utils import uncamel, camelize, camel_keys, uncamel_keys class RelationalDatabaseProduct(Resource): PATH = 'platform/RelationalDatabaseProduct' COLLECTION_NAME = 'rdbmsProducts' PRIMARY_KEY = 'product_id' def __init__(self, product_id=None, endpoint=None, *args, **kwargs): Resource.__init__(self, endpoint=endpoint) self.__product_id = product_id @property def product_id(self): return self.__product_id @lazy_property def status(self): return self.__status @lazy_property def architecture(self): return self.__architecture @lazy_property def cloud(self): return self.__cloud @lazy_property def core_count(self): return self.__core_count @lazy_property def cpu_in_g_hz(self): return self.__cpu_in_g_hz @lazy_property def custom_pricing(self): return self.__custom_pricing @lazy_property def description(self): return self.__description @lazy_property def engine(self): return self.__engine @lazy_property def hourly_pricing(self): return self.__hourly_pricing @lazy_property def io_pricing(self): return self.__io_pricing @lazy_property def io_units(self): return self.__io_units @lazy_property def maximum_storage_in_gb(self): return self.__maximum_storage_in_gb @lazy_property def memory_in_gb(self): return self.__memory_in_gb @lazy_property def minimum_storage_in_gb(self): return self.__minimum_storage_in_gb @lazy_property def name(self): return self.__name @lazy_property def region(self): return self.__region @lazy_property def provider_id(self): return self.__provider_id @lazy_property def storage_pricing(self): return self.__storage_pricing @lazy_property def storage_units(self): return self.__storage_units def reload(self): if self.product_id is not None: self.load() elif self.current_job is None: self.load() else: if Job.wait_for(self.current_job): job = Job(self.current_job, endpoint=self.endpoint) self.__relational_database_id = job.message self.load() else: return self.last_error @classmethod def all(cls, region_id, engine, endpoint=None, **kwargs): r = Resource(cls.PATH, endpoint=endpoint) r.request_details = 'basic' params = {'regionId': region_id, 'engine': engine} if 'detail' in kwargs: r.request_details = kwargs['detail'] else: r.request_details = 'basic' if 'keys_only' in kwargs: keys_only = kwargs['keys_only'] else: keys_only = False x = r.get(params=params) if r.last_error is None: if keys_only is True: results = [i[camelize(cls.PRIMARY_KEY)] for i in x[cls.COLLECTION_NAME]] else: results = [type(cls.__name__, (object,), i) for i in uncamel_keys(x)[uncamel(cls.COLLECTION_NAME)]] return results else: raise RelationalDatabaseProductException(r.last_error) class RelationalDatabaseProductException(BaseException): pass

true

1c2ff87a59fc0949bd18ae26bc290ba7f4c77632

62

py

Python

neoepiscope/version.py

jxshi/neoepiscope

4e9b7de2f355bf1de270e17eda22d176f0bff627

[ "MIT" ]

18

2018-09-14T23:38:10.000Z

2022-01-25T22:32:26.000Z

neoepiscope/version.py

jxshi/neoepiscope

4e9b7de2f355bf1de270e17eda22d176f0bff627

[ "MIT" ]

14

2018-10-09T17:03:52.000Z

2021-05-07T07:26:27.000Z

neoepiscope/version.py

jxshi/neoepiscope

4e9b7de2f355bf1de270e17eda22d176f0bff627

[ "MIT" ]

18

2018-09-13T21:00:21.000Z

2022-02-11T07:39:36.000Z

#!/usr/bin/env python # coding=utf-8 version_number = "0.5.0"

15.5

24

0.677419

version_number = "0.5.0"

true

1c2ff9917e9a0fcc17fee39c454701dcfa689355

53,055

py

Python

netbox/netbox/views/generic.py

mtinberg/netbox

e8d6281007a70553b044f59a3ff6ed6f9d22ea10

[ "Apache-2.0" ]

1

2022-01-20T11:33:29.000Z

netbox/netbox/views/generic.py

mtinberg/netbox

e8d6281007a70553b044f59a3ff6ed6f9d22ea10

[ "Apache-2.0" ]

null

netbox/netbox/views/generic.py

mtinberg/netbox

e8d6281007a70553b044f59a3ff6ed6f9d22ea10

[ "Apache-2.0" ]

null

import logging import re from copy import deepcopy from django.contrib import messages from django.contrib.contenttypes.models import ContentType from django.core.exceptions import FieldDoesNotExist, ObjectDoesNotExist, ValidationError from django.db import transaction, IntegrityError from django.db.models import ManyToManyField, ProtectedError from django.forms import Form, ModelMultipleChoiceField, MultipleHiddenInput, Textarea from django.http import HttpResponse from django.shortcuts import get_object_or_404, redirect, render from django.utils.html import escape from django.utils.http import is_safe_url from django.utils.safestring import mark_safe from django.views.generic import View from django_tables2.export import TableExport from extras.models import ExportTemplate from extras.signals import clear_webhooks from utilities.error_handlers import handle_protectederror from utilities.exceptions import AbortTransaction, PermissionsViolation from utilities.forms import ( BootstrapMixin, BulkRenameForm, ConfirmationForm, CSVDataField, CSVFileField, ImportForm, restrict_form_fields, ) from utilities.permissions import get_permission_for_model from utilities.tables import paginate_table from utilities.utils import normalize_querydict, prepare_cloned_fields from utilities.views import GetReturnURLMixin, ObjectPermissionRequiredMixin class ObjectView(ObjectPermissionRequiredMixin, View): """ Retrieve a single object for display. queryset: The base queryset for retrieving the object template_name: Name of the template to use """ queryset = None template_name = None def get_required_permission(self): return get_permission_for_model(self.queryset.model, 'view') def get_template_name(self): """ Return self.template_name if set. Otherwise, resolve the template path by model app_label and name. """ if self.template_name is not None: return self.template_name model_opts = self.queryset.model._meta return f'{model_opts.app_label}/{model_opts.model_name}.html' def get_extra_context(self, request, instance): """ Return any additional context data for the template. request: The current request instance: The object being viewed """ return {} def get(self, request, *args, **kwargs): """ Generic GET handler for accessing an object by PK or slug """ instance = get_object_or_404(self.queryset, **kwargs) return render(request, self.get_template_name(), { 'object': instance, **self.get_extra_context(request, instance), }) class ObjectListView(ObjectPermissionRequiredMixin, View): """ List a series of objects. queryset: The queryset of objects to display. Note: Prefetching related objects is not necessary, as the table will prefetch objects as needed depending on the columns being displayed. filter: A django-filter FilterSet that is applied to the queryset filter_form: The form used to render filter options table: The django-tables2 Table used to render the objects list template_name: The name of the template """ queryset = None filterset = None filterset_form = None table = None template_name = 'generic/object_list.html' action_buttons = ('add', 'import', 'export') def get_required_permission(self): return get_permission_for_model(self.queryset.model, 'view') def get_table(self, request, permissions): table = self.table(self.queryset, user=request.user) if 'pk' in table.base_columns and (permissions['change'] or permissions['delete']): table.columns.show('pk') return table def export_yaml(self): """ Export the queryset of objects as concatenated YAML documents. """ yaml_data = [obj.to_yaml() for obj in self.queryset] return '---\n'.join(yaml_data) def export_table(self, table, columns=None): """ Export all table data in CSV format. :param table: The Table instance to export :param columns: A list of specific columns to include. If not specified, all columns will be exported. """ exclude_columns = {'pk'} if columns: all_columns = [col_name for col_name, _ in table.selected_columns + table.available_columns] exclude_columns.update({ col for col in all_columns if col not in columns }) exporter = TableExport( export_format=TableExport.CSV, table=table, exclude_columns=exclude_columns ) return exporter.response( filename=f'netbox_{self.queryset.model._meta.verbose_name_plural}.csv' ) def export_template(self, template, request): """ Render an ExportTemplate using the current queryset. :param template: ExportTemplate instance :param request: The current request """ try: return template.render_to_response(self.queryset) except Exception as e: messages.error(request, f"There was an error rendering the selected export template ({template.name}): {e}") return redirect(request.path) def get(self, request): model = self.queryset.model content_type = ContentType.objects.get_for_model(model) if self.filterset: self.queryset = self.filterset(request.GET, self.queryset).qs # Compile a dictionary indicating which permissions are available to the current user for this model permissions = {} for action in ('add', 'change', 'delete', 'view'): perm_name = get_permission_for_model(model, action) permissions[action] = request.user.has_perm(perm_name) if 'export' in request.GET: # Export the current table view if request.GET['export'] == 'table': table = self.get_table(request, permissions) columns = [name for name, _ in table.selected_columns] return self.export_table(table, columns) # Render an ExportTemplate elif request.GET['export']: template = get_object_or_404(ExportTemplate, content_type=content_type, name=request.GET['export']) return self.export_template(template, request) # Check for YAML export support on the model elif hasattr(model, 'to_yaml'): response = HttpResponse(self.export_yaml(), content_type='text/yaml') filename = 'netbox_{}.yaml'.format(self.queryset.model._meta.verbose_name_plural) response['Content-Disposition'] = 'attachment; filename="{}"'.format(filename) return response # Fall back to default table/YAML export else: table = self.get_table(request, permissions) return self.export_table(table) # Render the objects table table = self.get_table(request, permissions) paginate_table(table, request) context = { 'content_type': content_type, 'table': table, 'permissions': permissions, 'action_buttons': self.action_buttons, 'filter_form': self.filterset_form(request.GET, label_suffix='') if self.filterset_form else None, } context.update(self.extra_context()) return render(request, self.template_name, context) def extra_context(self): return {} class ObjectEditView(GetReturnURLMixin, ObjectPermissionRequiredMixin, View): """ Create or edit a single object. queryset: The base queryset for the object being modified model_form: The form used to create or edit the object template_name: The name of the template """ queryset = None model_form = None template_name = 'generic/object_edit.html' def get_required_permission(self): # self._permission_action is set by dispatch() to either "add" or "change" depending on whether # we are modifying an existing object or creating a new one. return get_permission_for_model(self.queryset.model, self._permission_action) def get_object(self, kwargs): # Look up an existing object by slug or PK, if provided. if 'slug' in kwargs: obj = get_object_or_404(self.queryset, slug=kwargs['slug']) elif 'pk' in kwargs: obj = get_object_or_404(self.queryset, pk=kwargs['pk']) # Otherwise, return a new instance. else: return self.queryset.model() # Take a snapshot of change-logged models if hasattr(obj, 'snapshot'): obj.snapshot() return obj def alter_obj(self, obj, request, url_args, url_kwargs): # Allow views to add extra info to an object before it is processed. For example, a parent object can be defined # given some parameter from the request URL. return obj def dispatch(self, request, *args, **kwargs): # Determine required permission based on whether we are editing an existing object self._permission_action = 'change' if kwargs else 'add' return super().dispatch(request, *args, **kwargs) def get(self, request, *args, **kwargs): obj = self.alter_obj(self.get_object(kwargs), request, args, kwargs) initial_data = normalize_querydict(request.GET) form = self.model_form(instance=obj, initial=initial_data) restrict_form_fields(form, request.user) return render(request, self.template_name, { 'obj': obj, 'obj_type': self.queryset.model._meta.verbose_name, 'form': form, 'return_url': self.get_return_url(request, obj), }) def post(self, request, *args, **kwargs): logger = logging.getLogger('netbox.views.ObjectEditView') obj = self.alter_obj(self.get_object(kwargs), request, args, kwargs) form = self.model_form( data=request.POST, files=request.FILES, instance=obj ) restrict_form_fields(form, request.user) if form.is_valid(): logger.debug("Form validation was successful") try: with transaction.atomic(): object_created = form.instance.pk is None obj = form.save() # Check that the new object conforms with any assigned object-level permissions if not self.queryset.filter(pk=obj.pk).first(): raise PermissionsViolation() msg = '{} {}'.format( 'Created' if object_created else 'Modified', self.queryset.model._meta.verbose_name ) logger.info(f"{msg} {obj} (PK: {obj.pk})") if hasattr(obj, 'get_absolute_url'): msg = '{} <a href="{}">{}</a>'.format(msg, obj.get_absolute_url(), escape(obj)) else: msg = '{} {}'.format(msg, escape(obj)) messages.success(request, mark_safe(msg)) if '_addanother' in request.POST: redirect_url = request.path # If the object has clone_fields, pre-populate a new instance of the form if hasattr(obj, 'clone_fields'): redirect_url += f"?{prepare_cloned_fields(obj)}" return redirect(redirect_url) return_url = self.get_return_url(request, obj) return redirect(return_url) except PermissionsViolation: msg = "Object save failed due to object-level permissions violation" logger.debug(msg) form.add_error(None, msg) clear_webhooks.send(sender=self) else: logger.debug("Form validation failed") return render(request, self.template_name, { 'obj': obj, 'obj_type': self.queryset.model._meta.verbose_name, 'form': form, 'return_url': self.get_return_url(request, obj), }) class ObjectDeleteView(GetReturnURLMixin, ObjectPermissionRequiredMixin, View): """ Delete a single object. queryset: The base queryset for the object being deleted template_name: The name of the template """ queryset = None template_name = 'generic/object_delete.html' def get_required_permission(self): return get_permission_for_model(self.queryset.model, 'delete') def get_object(self, kwargs): # Look up object by slug if one has been provided. Otherwise, use PK. if 'slug' in kwargs: obj = get_object_or_404(self.queryset, slug=kwargs['slug']) else: obj = get_object_or_404(self.queryset, pk=kwargs['pk']) # Take a snapshot of change-logged models if hasattr(obj, 'snapshot'): obj.snapshot() return obj def get(self, request, **kwargs): obj = self.get_object(kwargs) form = ConfirmationForm(initial=request.GET) return render(request, self.template_name, { 'obj': obj, 'form': form, 'obj_type': self.queryset.model._meta.verbose_name, 'return_url': self.get_return_url(request, obj), }) def post(self, request, **kwargs): logger = logging.getLogger('netbox.views.ObjectDeleteView') obj = self.get_object(kwargs) form = ConfirmationForm(request.POST) if form.is_valid(): logger.debug("Form validation was successful") try: obj.delete() except ProtectedError as e: logger.info("Caught ProtectedError while attempting to delete object") handle_protectederror([obj], request, e) return redirect(obj.get_absolute_url()) msg = 'Deleted {} {}'.format(self.queryset.model._meta.verbose_name, obj) logger.info(msg) messages.success(request, msg) return_url = form.cleaned_data.get('return_url') if return_url is not None and is_safe_url(url=return_url, allowed_hosts=request.get_host()): return redirect(return_url) else: return redirect(self.get_return_url(request, obj)) else: logger.debug("Form validation failed") return render(request, self.template_name, { 'obj': obj, 'form': form, 'obj_type': self.queryset.model._meta.verbose_name, 'return_url': self.get_return_url(request, obj), }) class BulkCreateView(GetReturnURLMixin, ObjectPermissionRequiredMixin, View): """ Create new objects in bulk. queryset: Base queryset for the objects being created form: Form class which provides the `pattern` field model_form: The ModelForm used to create individual objects pattern_target: Name of the field to be evaluated as a pattern (if any) template_name: The name of the template """ queryset = None form = None model_form = None pattern_target = '' template_name = None def get_required_permission(self): return get_permission_for_model(self.queryset.model, 'add') def get(self, request): # Set initial values for visible form fields from query args initial = {} for field in getattr(self.model_form._meta, 'fields', []): if request.GET.get(field): initial[field] = request.GET[field] form = self.form() model_form = self.model_form(initial=initial) return render(request, self.template_name, { 'obj_type': self.model_form._meta.model._meta.verbose_name, 'form': form, 'model_form': model_form, 'return_url': self.get_return_url(request), }) def post(self, request): logger = logging.getLogger('netbox.views.BulkCreateView') model = self.queryset.model form = self.form(request.POST) model_form = self.model_form(request.POST) if form.is_valid(): logger.debug("Form validation was successful") pattern = form.cleaned_data['pattern'] new_objs = [] try: with transaction.atomic(): # Create objects from the expanded. Abort the transaction on the first validation error. for value in pattern: # Reinstantiate the model form each time to avoid overwriting the same instance. Use a mutable # copy of the POST QueryDict so that we can update the target field value. model_form = self.model_form(request.POST.copy()) model_form.data[self.pattern_target] = value # Validate each new object independently. if model_form.is_valid(): obj = model_form.save() logger.debug(f"Created {obj} (PK: {obj.pk})") new_objs.append(obj) else: # Copy any errors on the pattern target field to the pattern form. errors = model_form.errors.as_data() if errors.get(self.pattern_target): form.add_error('pattern', errors[self.pattern_target]) # Raise an IntegrityError to break the for loop and abort the transaction. raise IntegrityError() # Enforce object-level permissions if self.queryset.filter(pk__in=[obj.pk for obj in new_objs]).count() != len(new_objs): raise PermissionsViolation # If we make it to this point, validation has succeeded on all new objects. msg = "Added {} {}".format(len(new_objs), model._meta.verbose_name_plural) logger.info(msg) messages.success(request, msg) if '_addanother' in request.POST: return redirect(request.path) return redirect(self.get_return_url(request)) except IntegrityError: pass except PermissionsViolation: msg = "Object creation failed due to object-level permissions violation" logger.debug(msg) form.add_error(None, msg) else: logger.debug("Form validation failed") return render(request, self.template_name, { 'form': form, 'model_form': model_form, 'obj_type': model._meta.verbose_name, 'return_url': self.get_return_url(request), }) class ObjectImportView(GetReturnURLMixin, ObjectPermissionRequiredMixin, View): """ Import a single object (YAML or JSON format). queryset: Base queryset for the objects being created model_form: The ModelForm used to create individual objects related_object_forms: A dictionary mapping of forms to be used for the creation of related (child) objects template_name: The name of the template """ queryset = None model_form = None related_object_forms = dict() template_name = 'generic/object_import.html' def get_required_permission(self): return get_permission_for_model(self.queryset.model, 'add') def get(self, request): form = ImportForm() return render(request, self.template_name, { 'form': form, 'obj_type': self.queryset.model._meta.verbose_name, 'return_url': self.get_return_url(request), }) def post(self, request): logger = logging.getLogger('netbox.views.ObjectImportView') form = ImportForm(request.POST) if form.is_valid(): logger.debug("Import form validation was successful") # Initialize model form data = form.cleaned_data['data'] model_form = self.model_form(data) restrict_form_fields(model_form, request.user) # Assign default values for any fields which were not specified. We have to do this manually because passing # 'initial=' to the form on initialization merely sets default values for the widgets. Since widgets are not # used for YAML/JSON import, we first bind the imported data normally, then update the form's data with the # applicable field defaults as needed prior to form validation. for field_name, field in model_form.fields.items(): if field_name not in data and hasattr(field, 'initial'): model_form.data[field_name] = field.initial if model_form.is_valid(): try: with transaction.atomic(): # Save the primary object obj = model_form.save() # Enforce object-level permissions if not self.queryset.filter(pk=obj.pk).first(): raise PermissionsViolation() logger.debug(f"Created {obj} (PK: {obj.pk})") # Iterate through the related object forms (if any), validating and saving each instance. for field_name, related_object_form in self.related_object_forms.items(): logger.debug("Processing form for related objects: {related_object_form}") related_obj_pks = [] for i, rel_obj_data in enumerate(data.get(field_name, list())): f = related_object_form(obj, rel_obj_data) for subfield_name, field in f.fields.items(): if subfield_name not in rel_obj_data and hasattr(field, 'initial'): f.data[subfield_name] = field.initial if f.is_valid(): related_obj = f.save() related_obj_pks.append(related_obj.pk) else: # Replicate errors on the related object form to the primary form for display for subfield_name, errors in f.errors.items(): for err in errors: err_msg = "{}[{}] {}: {}".format(field_name, i, subfield_name, err) model_form.add_error(None, err_msg) raise AbortTransaction() # Enforce object-level permissions on related objects model = related_object_form.Meta.model if model.objects.filter(pk__in=related_obj_pks).count() != len(related_obj_pks): raise ObjectDoesNotExist except AbortTransaction: clear_webhooks.send(sender=self) except PermissionsViolation: msg = "Object creation failed due to object-level permissions violation" logger.debug(msg) form.add_error(None, msg) clear_webhooks.send(sender=self) if not model_form.errors: logger.info(f"Import object {obj} (PK: {obj.pk})") messages.success(request, mark_safe('Imported object: <a href="{}">{}</a>'.format( obj.get_absolute_url(), obj ))) if '_addanother' in request.POST: return redirect(request.get_full_path()) return_url = form.cleaned_data.get('return_url') if return_url is not None and is_safe_url(url=return_url, allowed_hosts=request.get_host()): return redirect(return_url) else: return redirect(self.get_return_url(request, obj)) else: logger.debug("Model form validation failed") # Replicate model form errors for display for field, errors in model_form.errors.items(): for err in errors: if field == '__all__': form.add_error(None, err) else: form.add_error(None, "{}: {}".format(field, err)) else: logger.debug("Import form validation failed") return render(request, self.template_name, { 'form': form, 'obj_type': self.queryset.model._meta.verbose_name, 'return_url': self.get_return_url(request), }) class BulkImportView(GetReturnURLMixin, ObjectPermissionRequiredMixin, View): """ Import objects in bulk (CSV format). queryset: Base queryset for the model model_form: The form used to create each imported object table: The django-tables2 Table used to render the list of imported objects template_name: The name of the template widget_attrs: A dict of attributes to apply to the import widget (e.g. to require a session key) """ queryset = None model_form = None table = None template_name = 'generic/object_bulk_import.html' widget_attrs = {} def _import_form(self, *args, **kwargs): class ImportForm(BootstrapMixin, Form): csv = CSVDataField( from_form=self.model_form, widget=Textarea(attrs=self.widget_attrs) ) csv_file = CSVFileField( label="CSV file", from_form=self.model_form, required=False ) def clean(self): csv_rows = self.cleaned_data['csv'][1] if 'csv' in self.cleaned_data else None csv_file = self.files.get('csv_file') # Check that the user has not submitted both text data and a file if csv_rows and csv_file: raise ValidationError( "Cannot process CSV text and file attachment simultaneously. Please choose only one import " "method." ) return ImportForm(*args, **kwargs) def _save_obj(self, obj_form, request): """ Provide a hook to modify the object immediately before saving it (e.g. to encrypt secret data). """ return obj_form.save() def get_required_permission(self): return get_permission_for_model(self.queryset.model, 'add') def get(self, request): return render(request, self.template_name, { 'form': self._import_form(), 'fields': self.model_form().fields, 'obj_type': self.model_form._meta.model._meta.verbose_name, 'return_url': self.get_return_url(request), }) def post(self, request): logger = logging.getLogger('netbox.views.BulkImportView') new_objs = [] form = self._import_form(request.POST, request.FILES) if form.is_valid(): logger.debug("Form validation was successful") try: # Iterate through CSV data and bind each row to a new model form instance. with transaction.atomic(): if request.FILES: headers, records = form.cleaned_data['csv_file'] else: headers, records = form.cleaned_data['csv'] for row, data in enumerate(records, start=1): obj_form = self.model_form(data, headers=headers) restrict_form_fields(obj_form, request.user) if obj_form.is_valid(): obj = self._save_obj(obj_form, request) new_objs.append(obj) else: for field, err in obj_form.errors.items(): form.add_error('csv', "Row {} {}: {}".format(row, field, err[0])) raise ValidationError("") # Enforce object-level permissions if self.queryset.filter(pk__in=[obj.pk for obj in new_objs]).count() != len(new_objs): raise PermissionsViolation # Compile a table containing the imported objects obj_table = self.table(new_objs) if new_objs: msg = 'Imported {} {}'.format(len(new_objs), new_objs[0]._meta.verbose_name_plural) logger.info(msg) messages.success(request, msg) return render(request, "import_success.html", { 'table': obj_table, 'return_url': self.get_return_url(request), }) except ValidationError: clear_webhooks.send(sender=self) except PermissionsViolation: msg = "Object import failed due to object-level permissions violation" logger.debug(msg) form.add_error(None, msg) clear_webhooks.send(sender=self) else: logger.debug("Form validation failed") return render(request, self.template_name, { 'form': form, 'fields': self.model_form().fields, 'obj_type': self.model_form._meta.model._meta.verbose_name, 'return_url': self.get_return_url(request), }) class BulkEditView(GetReturnURLMixin, ObjectPermissionRequiredMixin, View): """ Edit objects in bulk. queryset: Custom queryset to use when retrieving objects (e.g. to select related objects) filter: FilterSet to apply when deleting by QuerySet table: The table used to display devices being edited form: The form class used to edit objects in bulk template_name: The name of the template """ queryset = None filterset = None table = None form = None template_name = 'generic/object_bulk_edit.html' def get_required_permission(self): return get_permission_for_model(self.queryset.model, 'change') def get(self, request): return redirect(self.get_return_url(request)) def post(self, request, **kwargs): logger = logging.getLogger('netbox.views.BulkEditView') model = self.queryset.model # If we are editing *all* objects in the queryset, replace the PK list with all matched objects. if request.POST.get('_all') and self.filterset is not None: pk_list = self.filterset(request.GET, self.queryset.values_list('pk', flat=True)).qs else: pk_list = request.POST.getlist('pk') # Include the PK list as initial data for the form initial_data = {'pk': pk_list} # Check for other contextual data needed for the form. We avoid passing all of request.GET because the # filter values will conflict with the bulk edit form fields. # TODO: Find a better way to accomplish this if 'device' in request.GET: initial_data['device'] = request.GET.get('device') elif 'device_type' in request.GET: initial_data['device_type'] = request.GET.get('device_type') elif 'virtual_machine' in request.GET: initial_data['virtual_machine'] = request.GET.get('virtual_machine') if '_apply' in request.POST: form = self.form(model, request.POST, initial=initial_data) restrict_form_fields(form, request.user) if form.is_valid(): logger.debug("Form validation was successful") custom_fields = form.custom_fields if hasattr(form, 'custom_fields') else [] standard_fields = [ field for field in form.fields if field not in custom_fields + ['pk'] ] nullified_fields = request.POST.getlist('_nullify') try: with transaction.atomic(): updated_objects = [] for obj in self.queryset.filter(pk__in=form.cleaned_data['pk']): # Take a snapshot of change-logged models if hasattr(obj, 'snapshot'): obj.snapshot() # Update standard fields. If a field is listed in _nullify, delete its value. for name in standard_fields: try: model_field = model._meta.get_field(name) except FieldDoesNotExist: # This form field is used to modify a field rather than set its value directly model_field = None # Handle nullification if name in form.nullable_fields and name in nullified_fields: if isinstance(model_field, ManyToManyField): getattr(obj, name).set([]) else: setattr(obj, name, None if model_field.null else '') # ManyToManyFields elif isinstance(model_field, ManyToManyField): if form.cleaned_data[name]: getattr(obj, name).set(form.cleaned_data[name]) # Normal fields elif name in form.changed_data: setattr(obj, name, form.cleaned_data[name]) # Update custom fields for name in custom_fields: if name in form.nullable_fields and name in nullified_fields: obj.custom_field_data[name] = None elif name in form.changed_data: obj.custom_field_data[name] = form.cleaned_data[name] obj.full_clean() obj.save() updated_objects.append(obj) logger.debug(f"Saved {obj} (PK: {obj.pk})") # Add/remove tags if form.cleaned_data.get('add_tags', None): obj.tags.add(*form.cleaned_data['add_tags']) if form.cleaned_data.get('remove_tags', None): obj.tags.remove(*form.cleaned_data['remove_tags']) # Enforce object-level permissions if self.queryset.filter(pk__in=[obj.pk for obj in updated_objects]).count() != len(updated_objects): raise PermissionsViolation if updated_objects: msg = 'Updated {} {}'.format(len(updated_objects), model._meta.verbose_name_plural) logger.info(msg) messages.success(self.request, msg) return redirect(self.get_return_url(request)) except ValidationError as e: messages.error(self.request, "{} failed validation: {}".format(obj, ", ".join(e.messages))) clear_webhooks.send(sender=self) except PermissionsViolation: msg = "Object update failed due to object-level permissions violation" logger.debug(msg) form.add_error(None, msg) clear_webhooks.send(sender=self) else: logger.debug("Form validation failed") else: form = self.form(model, initial=initial_data) restrict_form_fields(form, request.user) # Retrieve objects being edited table = self.table(self.queryset.filter(pk__in=pk_list), orderable=False) if not table.rows: messages.warning(request, "No {} were selected.".format(model._meta.verbose_name_plural)) return redirect(self.get_return_url(request)) return render(request, self.template_name, { 'form': form, 'table': table, 'obj_type_plural': model._meta.verbose_name_plural, 'return_url': self.get_return_url(request), }) class BulkRenameView(GetReturnURLMixin, ObjectPermissionRequiredMixin, View): """ An extendable view for renaming objects in bulk. """ queryset = None template_name = 'generic/object_bulk_rename.html' def __init__(self, *args, **kwargs): super().__init__(*args, **kwargs) # Create a new Form class from BulkRenameForm class _Form(BulkRenameForm): pk = ModelMultipleChoiceField( queryset=self.queryset, widget=MultipleHiddenInput() ) self.form = _Form def get_required_permission(self): return get_permission_for_model(self.queryset.model, 'change') def post(self, request): logger = logging.getLogger('netbox.views.BulkRenameView') if '_preview' in request.POST or '_apply' in request.POST: form = self.form(request.POST, initial={'pk': request.POST.getlist('pk')}) selected_objects = self.queryset.filter(pk__in=form.initial['pk']) if form.is_valid(): try: with transaction.atomic(): renamed_pks = [] for obj in selected_objects: # Take a snapshot of change-logged models if hasattr(obj, 'snapshot'): obj.snapshot() find = form.cleaned_data['find'] replace = form.cleaned_data['replace'] if form.cleaned_data['use_regex']: try: obj.new_name = re.sub(find, replace, obj.name) # Catch regex group reference errors except re.error: obj.new_name = obj.name else: obj.new_name = obj.name.replace(find, replace) renamed_pks.append(obj.pk) if '_apply' in request.POST: for obj in selected_objects: obj.name = obj.new_name obj.save() # Enforce constrained permissions if self.queryset.filter(pk__in=renamed_pks).count() != len(selected_objects): raise PermissionsViolation messages.success(request, "Renamed {} {}".format( len(selected_objects), self.queryset.model._meta.verbose_name_plural )) return redirect(self.get_return_url(request)) except PermissionsViolation: msg = "Object update failed due to object-level permissions violation" logger.debug(msg) form.add_error(None, msg) clear_webhooks.send(sender=self) else: form = self.form(initial={'pk': request.POST.getlist('pk')}) selected_objects = self.queryset.filter(pk__in=form.initial['pk']) return render(request, self.template_name, { 'form': form, 'obj_type_plural': self.queryset.model._meta.verbose_name_plural, 'selected_objects': selected_objects, 'return_url': self.get_return_url(request), }) class BulkDeleteView(GetReturnURLMixin, ObjectPermissionRequiredMixin, View): """ Delete objects in bulk. queryset: Custom queryset to use when retrieving objects (e.g. to select related objects) filter: FilterSet to apply when deleting by QuerySet table: The table used to display devices being deleted form: The form class used to delete objects in bulk template_name: The name of the template """ queryset = None filterset = None table = None form = None template_name = 'generic/object_bulk_delete.html' def get_required_permission(self): return get_permission_for_model(self.queryset.model, 'delete') def get(self, request): return redirect(self.get_return_url(request)) def post(self, request, **kwargs): logger = logging.getLogger('netbox.views.BulkDeleteView') model = self.queryset.model # Are we deleting *all* objects in the queryset or just a selected subset? if request.POST.get('_all'): qs = model.objects.all() if self.filterset is not None: qs = self.filterset(request.GET, qs).qs pk_list = qs.only('pk').values_list('pk', flat=True) else: pk_list = [int(pk) for pk in request.POST.getlist('pk')] form_cls = self.get_form() if '_confirm' in request.POST: form = form_cls(request.POST) if form.is_valid(): logger.debug("Form validation was successful") # Delete objects queryset = self.queryset.filter(pk__in=pk_list) deleted_count = queryset.count() try: for obj in queryset: # Take a snapshot of change-logged models if hasattr(obj, 'snapshot'): obj.snapshot() obj.delete() except ProtectedError as e: logger.info("Caught ProtectedError while attempting to delete objects") handle_protectederror(queryset, request, e) return redirect(self.get_return_url(request)) msg = f"Deleted {deleted_count} {model._meta.verbose_name_plural}" logger.info(msg) messages.success(request, msg) return redirect(self.get_return_url(request)) else: logger.debug("Form validation failed") else: form = form_cls(initial={ 'pk': pk_list, 'return_url': self.get_return_url(request), }) # Retrieve objects being deleted table = self.table(self.queryset.filter(pk__in=pk_list), orderable=False) if not table.rows: messages.warning(request, "No {} were selected for deletion.".format(model._meta.verbose_name_plural)) return redirect(self.get_return_url(request)) return render(request, self.template_name, { 'form': form, 'obj_type_plural': model._meta.verbose_name_plural, 'table': table, 'return_url': self.get_return_url(request), }) def get_form(self): """ Provide a standard bulk delete form if none has been specified for the view """ class BulkDeleteForm(ConfirmationForm): pk = ModelMultipleChoiceField(queryset=self.queryset, widget=MultipleHiddenInput) if self.form: return self.form return BulkDeleteForm # # Device/VirtualMachine components # # TODO: Replace with BulkCreateView class ComponentCreateView(GetReturnURLMixin, ObjectPermissionRequiredMixin, View): """ Add one or more components (e.g. interfaces, console ports, etc.) to a Device or VirtualMachine. """ queryset = None form = None model_form = None template_name = 'generic/object_edit.html' def get_required_permission(self): return get_permission_for_model(self.queryset.model, 'add') def get(self, request): form = self.form(initial=request.GET) return render(request, self.template_name, { 'obj': self.queryset.model(), 'obj_type': self.queryset.model._meta.verbose_name, 'form': form, 'return_url': self.get_return_url(request), }) def post(self, request): logger = logging.getLogger('netbox.views.ComponentCreateView') form = self.form(request.POST, initial=request.GET) self.validate_form(request, form) if form.is_valid() and not form.errors: if '_addanother' in request.POST: return redirect(request.get_full_path()) else: return redirect(self.get_return_url(request)) return render(request, self.template_name, { 'obj_type': self.queryset.model._meta.verbose_name, 'form': form, 'return_url': self.get_return_url(request), }) def validate_form(self, request, form): """ Validate form values and set errors on the form object as they are detected. If no errors are found, signal success messages. """ logger = logging.getLogger('netbox.views.ComponentCreateView') if form.is_valid(): new_components = [] data = deepcopy(request.POST) names = form.cleaned_data['name_pattern'] labels = form.cleaned_data.get('label_pattern') for i, name in enumerate(names): label = labels[i] if labels else None # Initialize the individual component form data['name'] = name data['label'] = label if hasattr(form, 'get_iterative_data'): data.update(form.get_iterative_data(i)) component_form = self.model_form(data) if component_form.is_valid(): new_components.append(component_form) else: for field, errors in component_form.errors.as_data().items(): # Assign errors on the child form's name/label field to name_pattern/label_pattern on the parent form if field == 'name': field = 'name_pattern' elif field == 'label': field = 'label_pattern' for e in errors: form.add_error(field, '{}: {}'.format(name, ', '.join(e))) if not form.errors: try: with transaction.atomic(): # Create the new components new_objs = [] for component_form in new_components: obj = component_form.save() new_objs.append(obj) # Enforce object-level permissions if self.queryset.filter(pk__in=[obj.pk for obj in new_objs]).count() != len(new_objs): raise PermissionsViolation messages.success(request, "Added {} {}".format( len(new_components), self.queryset.model._meta.verbose_name_plural )) # Return the newly created objects so overridden post methods can use the data as needed. return new_objs except PermissionsViolation: msg = "Component creation failed due to object-level permissions violation" logger.debug(msg) form.add_error(None, msg) clear_webhooks.send(sender=self) return None class BulkComponentCreateView(GetReturnURLMixin, ObjectPermissionRequiredMixin, View): """ Add one or more components (e.g. interfaces, console ports, etc.) to a set of Devices or VirtualMachines. """ parent_model = None parent_field = None form = None queryset = None model_form = None filterset = None table = None template_name = 'generic/object_bulk_add_component.html' def get_required_permission(self): return f'dcim.add_{self.queryset.model._meta.model_name}' def post(self, request): logger = logging.getLogger('netbox.views.BulkComponentCreateView') parent_model_name = self.parent_model._meta.verbose_name_plural model_name = self.queryset.model._meta.verbose_name_plural # Are we editing *all* objects in the queryset or just a selected subset? if request.POST.get('_all') and self.filterset is not None: pk_list = [obj.pk for obj in self.filterset(request.GET, self.parent_model.objects.only('pk')).qs] else: pk_list = [int(pk) for pk in request.POST.getlist('pk')] selected_objects = self.parent_model.objects.filter(pk__in=pk_list) if not selected_objects: messages.warning(request, "No {} were selected.".format(self.parent_model._meta.verbose_name_plural)) return redirect(self.get_return_url(request)) table = self.table(selected_objects) if '_create' in request.POST: form = self.form(request.POST) if form.is_valid(): logger.debug("Form validation was successful") new_components = [] data = deepcopy(form.cleaned_data) try: with transaction.atomic(): for obj in data['pk']: names = data['name_pattern'] labels = data['label_pattern'] if 'label_pattern' in data else None for i, name in enumerate(names): label = labels[i] if labels else None component_data = { self.parent_field: obj.pk, 'name': name, 'label': label } component_data.update(data) component_form = self.model_form(component_data) if component_form.is_valid(): instance = component_form.save() logger.debug(f"Created {instance} on {instance.parent_object}") new_components.append(instance) else: for field, errors in component_form.errors.as_data().items(): for e in errors: form.add_error(field, '{} {}: {}'.format(obj, name, ', '.join(e))) # Enforce object-level permissions if self.queryset.filter(pk__in=[obj.pk for obj in new_components]).count() != len(new_components): raise PermissionsViolation except IntegrityError: clear_webhooks.send(sender=self) except PermissionsViolation: msg = "Component creation failed due to object-level permissions violation" logger.debug(msg) form.add_error(None, msg) clear_webhooks.send(sender=self) if not form.errors: msg = "Added {} {} to {} {}.".format( len(new_components), model_name, len(form.cleaned_data['pk']), parent_model_name ) logger.info(msg) messages.success(request, msg) return redirect(self.get_return_url(request)) else: logger.debug("Form validation failed") else: form = self.form(initial={'pk': pk_list}) return render(request, self.template_name, { 'form': form, 'parent_model_name': parent_model_name, 'model_name': model_name, 'table': table, 'return_url': self.get_return_url(request), })

40.592961

125

0.570276

import logging import re from copy import deepcopy from django.contrib import messages from django.contrib.contenttypes.models import ContentType from django.core.exceptions import FieldDoesNotExist, ObjectDoesNotExist, ValidationError from django.db import transaction, IntegrityError from django.db.models import ManyToManyField, ProtectedError from django.forms import Form, ModelMultipleChoiceField, MultipleHiddenInput, Textarea from django.http import HttpResponse from django.shortcuts import get_object_or_404, redirect, render from django.utils.html import escape from django.utils.http import is_safe_url from django.utils.safestring import mark_safe from django.views.generic import View from django_tables2.export import TableExport from extras.models import ExportTemplate from extras.signals import clear_webhooks from utilities.error_handlers import handle_protectederror from utilities.exceptions import AbortTransaction, PermissionsViolation from utilities.forms import ( BootstrapMixin, BulkRenameForm, ConfirmationForm, CSVDataField, CSVFileField, ImportForm, restrict_form_fields, ) from utilities.permissions import get_permission_for_model from utilities.tables import paginate_table from utilities.utils import normalize_querydict, prepare_cloned_fields from utilities.views import GetReturnURLMixin, ObjectPermissionRequiredMixin class ObjectView(ObjectPermissionRequiredMixin, View): queryset = None template_name = None def get_required_permission(self): return get_permission_for_model(self.queryset.model, 'view') def get_template_name(self): if self.template_name is not None: return self.template_name model_opts = self.queryset.model._meta return f'{model_opts.app_label}/{model_opts.model_name}.html' def get_extra_context(self, request, instance): return {} def get(self, request, *args, **kwargs): instance = get_object_or_404(self.queryset, **kwargs) return render(request, self.get_template_name(), { 'object': instance, **self.get_extra_context(request, instance), }) class ObjectListView(ObjectPermissionRequiredMixin, View): queryset = None filterset = None filterset_form = None table = None template_name = 'generic/object_list.html' action_buttons = ('add', 'import', 'export') def get_required_permission(self): return get_permission_for_model(self.queryset.model, 'view') def get_table(self, request, permissions): table = self.table(self.queryset, user=request.user) if 'pk' in table.base_columns and (permissions['change'] or permissions['delete']): table.columns.show('pk') return table def export_yaml(self): yaml_data = [obj.to_yaml() for obj in self.queryset] return '---\n'.join(yaml_data) def export_table(self, table, columns=None): exclude_columns = {'pk'} if columns: all_columns = [col_name for col_name, _ in table.selected_columns + table.available_columns] exclude_columns.update({ col for col in all_columns if col not in columns }) exporter = TableExport( export_format=TableExport.CSV, table=table, exclude_columns=exclude_columns ) return exporter.response( filename=f'netbox_{self.queryset.model._meta.verbose_name_plural}.csv' ) def export_template(self, template, request): try: return template.render_to_response(self.queryset) except Exception as e: messages.error(request, f"There was an error rendering the selected export template ({template.name}): {e}") return redirect(request.path) def get(self, request): model = self.queryset.model content_type = ContentType.objects.get_for_model(model) if self.filterset: self.queryset = self.filterset(request.GET, self.queryset).qs permissions = {} for action in ('add', 'change', 'delete', 'view'): perm_name = get_permission_for_model(model, action) permissions[action] = request.user.has_perm(perm_name) if 'export' in request.GET: if request.GET['export'] == 'table': table = self.get_table(request, permissions) columns = [name for name, _ in table.selected_columns] return self.export_table(table, columns) elif request.GET['export']: template = get_object_or_404(ExportTemplate, content_type=content_type, name=request.GET['export']) return self.export_template(template, request) elif hasattr(model, 'to_yaml'): response = HttpResponse(self.export_yaml(), content_type='text/yaml') filename = 'netbox_{}.yaml'.format(self.queryset.model._meta.verbose_name_plural) response['Content-Disposition'] = 'attachment; filename="{}"'.format(filename) return response else: table = self.get_table(request, permissions) return self.export_table(table) table = self.get_table(request, permissions) paginate_table(table, request) context = { 'content_type': content_type, 'table': table, 'permissions': permissions, 'action_buttons': self.action_buttons, 'filter_form': self.filterset_form(request.GET, label_suffix='') if self.filterset_form else None, } context.update(self.extra_context()) return render(request, self.template_name, context) def extra_context(self): return {} class ObjectEditView(GetReturnURLMixin, ObjectPermissionRequiredMixin, View): queryset = None model_form = None template_name = 'generic/object_edit.html' def get_required_permission(self): return get_permission_for_model(self.queryset.model, self._permission_action) def get_object(self, kwargs): if 'slug' in kwargs: obj = get_object_or_404(self.queryset, slug=kwargs['slug']) elif 'pk' in kwargs: obj = get_object_or_404(self.queryset, pk=kwargs['pk']) else: return self.queryset.model() if hasattr(obj, 'snapshot'): obj.snapshot() return obj def alter_obj(self, obj, request, url_args, url_kwargs): return obj def dispatch(self, request, *args, **kwargs): self._permission_action = 'change' if kwargs else 'add' return super().dispatch(request, *args, **kwargs) def get(self, request, *args, **kwargs): obj = self.alter_obj(self.get_object(kwargs), request, args, kwargs) initial_data = normalize_querydict(request.GET) form = self.model_form(instance=obj, initial=initial_data) restrict_form_fields(form, request.user) return render(request, self.template_name, { 'obj': obj, 'obj_type': self.queryset.model._meta.verbose_name, 'form': form, 'return_url': self.get_return_url(request, obj), }) def post(self, request, *args, **kwargs): logger = logging.getLogger('netbox.views.ObjectEditView') obj = self.alter_obj(self.get_object(kwargs), request, args, kwargs) form = self.model_form( data=request.POST, files=request.FILES, instance=obj ) restrict_form_fields(form, request.user) if form.is_valid(): logger.debug("Form validation was successful") try: with transaction.atomic(): object_created = form.instance.pk is None obj = form.save() if not self.queryset.filter(pk=obj.pk).first(): raise PermissionsViolation() msg = '{} {}'.format( 'Created' if object_created else 'Modified', self.queryset.model._meta.verbose_name ) logger.info(f"{msg} {obj} (PK: {obj.pk})") if hasattr(obj, 'get_absolute_url'): msg = '{} <a href="{}">{}</a>'.format(msg, obj.get_absolute_url(), escape(obj)) else: msg = '{} {}'.format(msg, escape(obj)) messages.success(request, mark_safe(msg)) if '_addanother' in request.POST: redirect_url = request.path if hasattr(obj, 'clone_fields'): redirect_url += f"?{prepare_cloned_fields(obj)}" return redirect(redirect_url) return_url = self.get_return_url(request, obj) return redirect(return_url) except PermissionsViolation: msg = "Object save failed due to object-level permissions violation" logger.debug(msg) form.add_error(None, msg) clear_webhooks.send(sender=self) else: logger.debug("Form validation failed") return render(request, self.template_name, { 'obj': obj, 'obj_type': self.queryset.model._meta.verbose_name, 'form': form, 'return_url': self.get_return_url(request, obj), }) class ObjectDeleteView(GetReturnURLMixin, ObjectPermissionRequiredMixin, View): queryset = None template_name = 'generic/object_delete.html' def get_required_permission(self): return get_permission_for_model(self.queryset.model, 'delete') def get_object(self, kwargs): if 'slug' in kwargs: obj = get_object_or_404(self.queryset, slug=kwargs['slug']) else: obj = get_object_or_404(self.queryset, pk=kwargs['pk']) if hasattr(obj, 'snapshot'): obj.snapshot() return obj def get(self, request, **kwargs): obj = self.get_object(kwargs) form = ConfirmationForm(initial=request.GET) return render(request, self.template_name, { 'obj': obj, 'form': form, 'obj_type': self.queryset.model._meta.verbose_name, 'return_url': self.get_return_url(request, obj), }) def post(self, request, **kwargs): logger = logging.getLogger('netbox.views.ObjectDeleteView') obj = self.get_object(kwargs) form = ConfirmationForm(request.POST) if form.is_valid(): logger.debug("Form validation was successful") try: obj.delete() except ProtectedError as e: logger.info("Caught ProtectedError while attempting to delete object") handle_protectederror([obj], request, e) return redirect(obj.get_absolute_url()) msg = 'Deleted {} {}'.format(self.queryset.model._meta.verbose_name, obj) logger.info(msg) messages.success(request, msg) return_url = form.cleaned_data.get('return_url') if return_url is not None and is_safe_url(url=return_url, allowed_hosts=request.get_host()): return redirect(return_url) else: return redirect(self.get_return_url(request, obj)) else: logger.debug("Form validation failed") return render(request, self.template_name, { 'obj': obj, 'form': form, 'obj_type': self.queryset.model._meta.verbose_name, 'return_url': self.get_return_url(request, obj), }) class BulkCreateView(GetReturnURLMixin, ObjectPermissionRequiredMixin, View): queryset = None form = None model_form = None pattern_target = '' template_name = None def get_required_permission(self): return get_permission_for_model(self.queryset.model, 'add') def get(self, request): initial = {} for field in getattr(self.model_form._meta, 'fields', []): if request.GET.get(field): initial[field] = request.GET[field] form = self.form() model_form = self.model_form(initial=initial) return render(request, self.template_name, { 'obj_type': self.model_form._meta.model._meta.verbose_name, 'form': form, 'model_form': model_form, 'return_url': self.get_return_url(request), }) def post(self, request): logger = logging.getLogger('netbox.views.BulkCreateView') model = self.queryset.model form = self.form(request.POST) model_form = self.model_form(request.POST) if form.is_valid(): logger.debug("Form validation was successful") pattern = form.cleaned_data['pattern'] new_objs = [] try: with transaction.atomic(): for value in pattern: model_form = self.model_form(request.POST.copy()) model_form.data[self.pattern_target] = value if model_form.is_valid(): obj = model_form.save() logger.debug(f"Created {obj} (PK: {obj.pk})") new_objs.append(obj) else: errors = model_form.errors.as_data() if errors.get(self.pattern_target): form.add_error('pattern', errors[self.pattern_target]) raise IntegrityError() if self.queryset.filter(pk__in=[obj.pk for obj in new_objs]).count() != len(new_objs): raise PermissionsViolation msg = "Added {} {}".format(len(new_objs), model._meta.verbose_name_plural) logger.info(msg) messages.success(request, msg) if '_addanother' in request.POST: return redirect(request.path) return redirect(self.get_return_url(request)) except IntegrityError: pass except PermissionsViolation: msg = "Object creation failed due to object-level permissions violation" logger.debug(msg) form.add_error(None, msg) else: logger.debug("Form validation failed") return render(request, self.template_name, { 'form': form, 'model_form': model_form, 'obj_type': model._meta.verbose_name, 'return_url': self.get_return_url(request), }) class ObjectImportView(GetReturnURLMixin, ObjectPermissionRequiredMixin, View): queryset = None model_form = None related_object_forms = dict() template_name = 'generic/object_import.html' def get_required_permission(self): return get_permission_for_model(self.queryset.model, 'add') def get(self, request): form = ImportForm() return render(request, self.template_name, { 'form': form, 'obj_type': self.queryset.model._meta.verbose_name, 'return_url': self.get_return_url(request), }) def post(self, request): logger = logging.getLogger('netbox.views.ObjectImportView') form = ImportForm(request.POST) if form.is_valid(): logger.debug("Import form validation was successful") data = form.cleaned_data['data'] model_form = self.model_form(data) restrict_form_fields(model_form, request.user) # applicable field defaults as needed prior to form validation. for field_name, field in model_form.fields.items(): if field_name not in data and hasattr(field, 'initial'): model_form.data[field_name] = field.initial if model_form.is_valid(): try: with transaction.atomic(): # Save the primary object obj = model_form.save() # Enforce object-level permissions if not self.queryset.filter(pk=obj.pk).first(): raise PermissionsViolation() logger.debug(f"Created {obj} (PK: {obj.pk})") # Iterate through the related object forms (if any), validating and saving each instance. for field_name, related_object_form in self.related_object_forms.items(): logger.debug("Processing form for related objects: {related_object_form}") related_obj_pks = [] for i, rel_obj_data in enumerate(data.get(field_name, list())): f = related_object_form(obj, rel_obj_data) for subfield_name, field in f.fields.items(): if subfield_name not in rel_obj_data and hasattr(field, 'initial'): f.data[subfield_name] = field.initial if f.is_valid(): related_obj = f.save() related_obj_pks.append(related_obj.pk) else: # Replicate errors on the related object form to the primary form for display for subfield_name, errors in f.errors.items(): for err in errors: err_msg = "{}[{}] {}: {}".format(field_name, i, subfield_name, err) model_form.add_error(None, err_msg) raise AbortTransaction() # Enforce object-level permissions on related objects model = related_object_form.Meta.model if model.objects.filter(pk__in=related_obj_pks).count() != len(related_obj_pks): raise ObjectDoesNotExist except AbortTransaction: clear_webhooks.send(sender=self) except PermissionsViolation: msg = "Object creation failed due to object-level permissions violation" logger.debug(msg) form.add_error(None, msg) clear_webhooks.send(sender=self) if not model_form.errors: logger.info(f"Import object {obj} (PK: {obj.pk})") messages.success(request, mark_safe('Imported object: <a href="{}">{}</a>'.format( obj.get_absolute_url(), obj ))) if '_addanother' in request.POST: return redirect(request.get_full_path()) return_url = form.cleaned_data.get('return_url') if return_url is not None and is_safe_url(url=return_url, allowed_hosts=request.get_host()): return redirect(return_url) else: return redirect(self.get_return_url(request, obj)) else: logger.debug("Model form validation failed") # Replicate model form errors for display for field, errors in model_form.errors.items(): for err in errors: if field == '__all__': form.add_error(None, err) else: form.add_error(None, "{}: {}".format(field, err)) else: logger.debug("Import form validation failed") return render(request, self.template_name, { 'form': form, 'obj_type': self.queryset.model._meta.verbose_name, 'return_url': self.get_return_url(request), }) class BulkImportView(GetReturnURLMixin, ObjectPermissionRequiredMixin, View): queryset = None model_form = None table = None template_name = 'generic/object_bulk_import.html' widget_attrs = {} def _import_form(self, *args, **kwargs): class ImportForm(BootstrapMixin, Form): csv = CSVDataField( from_form=self.model_form, widget=Textarea(attrs=self.widget_attrs) ) csv_file = CSVFileField( label="CSV file", from_form=self.model_form, required=False ) def clean(self): csv_rows = self.cleaned_data['csv'][1] if 'csv' in self.cleaned_data else None csv_file = self.files.get('csv_file') # Check that the user has not submitted both text data and a file if csv_rows and csv_file: raise ValidationError( "Cannot process CSV text and file attachment simultaneously. Please choose only one import " "method." ) return ImportForm(*args, **kwargs) def _save_obj(self, obj_form, request): return obj_form.save() def get_required_permission(self): return get_permission_for_model(self.queryset.model, 'add') def get(self, request): return render(request, self.template_name, { 'form': self._import_form(), 'fields': self.model_form().fields, 'obj_type': self.model_form._meta.model._meta.verbose_name, 'return_url': self.get_return_url(request), }) def post(self, request): logger = logging.getLogger('netbox.views.BulkImportView') new_objs = [] form = self._import_form(request.POST, request.FILES) if form.is_valid(): logger.debug("Form validation was successful") try: # Iterate through CSV data and bind each row to a new model form instance. with transaction.atomic(): if request.FILES: headers, records = form.cleaned_data['csv_file'] else: headers, records = form.cleaned_data['csv'] for row, data in enumerate(records, start=1): obj_form = self.model_form(data, headers=headers) restrict_form_fields(obj_form, request.user) if obj_form.is_valid(): obj = self._save_obj(obj_form, request) new_objs.append(obj) else: for field, err in obj_form.errors.items(): form.add_error('csv', "Row {} {}: {}".format(row, field, err[0])) raise ValidationError("") # Enforce object-level permissions if self.queryset.filter(pk__in=[obj.pk for obj in new_objs]).count() != len(new_objs): raise PermissionsViolation # Compile a table containing the imported objects obj_table = self.table(new_objs) if new_objs: msg = 'Imported {} {}'.format(len(new_objs), new_objs[0]._meta.verbose_name_plural) logger.info(msg) messages.success(request, msg) return render(request, "import_success.html", { 'table': obj_table, 'return_url': self.get_return_url(request), }) except ValidationError: clear_webhooks.send(sender=self) except PermissionsViolation: msg = "Object import failed due to object-level permissions violation" logger.debug(msg) form.add_error(None, msg) clear_webhooks.send(sender=self) else: logger.debug("Form validation failed") return render(request, self.template_name, { 'form': form, 'fields': self.model_form().fields, 'obj_type': self.model_form._meta.model._meta.verbose_name, 'return_url': self.get_return_url(request), }) class BulkEditView(GetReturnURLMixin, ObjectPermissionRequiredMixin, View): queryset = None filterset = None table = None form = None template_name = 'generic/object_bulk_edit.html' def get_required_permission(self): return get_permission_for_model(self.queryset.model, 'change') def get(self, request): return redirect(self.get_return_url(request)) def post(self, request, **kwargs): logger = logging.getLogger('netbox.views.BulkEditView') model = self.queryset.model # If we are editing *all* objects in the queryset, replace the PK list with all matched objects. if request.POST.get('_all') and self.filterset is not None: pk_list = self.filterset(request.GET, self.queryset.values_list('pk', flat=True)).qs else: pk_list = request.POST.getlist('pk') # Include the PK list as initial data for the form initial_data = {'pk': pk_list} # Check for other contextual data needed for the form. We avoid passing all of request.GET because the # filter values will conflict with the bulk edit form fields. # TODO: Find a better way to accomplish this if 'device' in request.GET: initial_data['device'] = request.GET.get('device') elif 'device_type' in request.GET: initial_data['device_type'] = request.GET.get('device_type') elif 'virtual_machine' in request.GET: initial_data['virtual_machine'] = request.GET.get('virtual_machine') if '_apply' in request.POST: form = self.form(model, request.POST, initial=initial_data) restrict_form_fields(form, request.user) if form.is_valid(): logger.debug("Form validation was successful") custom_fields = form.custom_fields if hasattr(form, 'custom_fields') else [] standard_fields = [ field for field in form.fields if field not in custom_fields + ['pk'] ] nullified_fields = request.POST.getlist('_nullify') try: with transaction.atomic(): updated_objects = [] for obj in self.queryset.filter(pk__in=form.cleaned_data['pk']): # Take a snapshot of change-logged models if hasattr(obj, 'snapshot'): obj.snapshot() # Update standard fields. If a field is listed in _nullify, delete its value. for name in standard_fields: try: model_field = model._meta.get_field(name) except FieldDoesNotExist: # This form field is used to modify a field rather than set its value directly model_field = None # Handle nullification if name in form.nullable_fields and name in nullified_fields: if isinstance(model_field, ManyToManyField): getattr(obj, name).set([]) else: setattr(obj, name, None if model_field.null else '') # ManyToManyFields elif isinstance(model_field, ManyToManyField): if form.cleaned_data[name]: getattr(obj, name).set(form.cleaned_data[name]) # Normal fields elif name in form.changed_data: setattr(obj, name, form.cleaned_data[name]) # Update custom fields for name in custom_fields: if name in form.nullable_fields and name in nullified_fields: obj.custom_field_data[name] = None elif name in form.changed_data: obj.custom_field_data[name] = form.cleaned_data[name] obj.full_clean() obj.save() updated_objects.append(obj) logger.debug(f"Saved {obj} (PK: {obj.pk})") # Add/remove tags if form.cleaned_data.get('add_tags', None): obj.tags.add(*form.cleaned_data['add_tags']) if form.cleaned_data.get('remove_tags', None): obj.tags.remove(*form.cleaned_data['remove_tags']) # Enforce object-level permissions if self.queryset.filter(pk__in=[obj.pk for obj in updated_objects]).count() != len(updated_objects): raise PermissionsViolation if updated_objects: msg = 'Updated {} {}'.format(len(updated_objects), model._meta.verbose_name_plural) logger.info(msg) messages.success(self.request, msg) return redirect(self.get_return_url(request)) except ValidationError as e: messages.error(self.request, "{} failed validation: {}".format(obj, ", ".join(e.messages))) clear_webhooks.send(sender=self) except PermissionsViolation: msg = "Object update failed due to object-level permissions violation" logger.debug(msg) form.add_error(None, msg) clear_webhooks.send(sender=self) else: logger.debug("Form validation failed") else: form = self.form(model, initial=initial_data) restrict_form_fields(form, request.user) # Retrieve objects being edited table = self.table(self.queryset.filter(pk__in=pk_list), orderable=False) if not table.rows: messages.warning(request, "No {} were selected.".format(model._meta.verbose_name_plural)) return redirect(self.get_return_url(request)) return render(request, self.template_name, { 'form': form, 'table': table, 'obj_type_plural': model._meta.verbose_name_plural, 'return_url': self.get_return_url(request), }) class BulkRenameView(GetReturnURLMixin, ObjectPermissionRequiredMixin, View): queryset = None template_name = 'generic/object_bulk_rename.html' def __init__(self, *args, **kwargs): super().__init__(*args, **kwargs) # Create a new Form class from BulkRenameForm class _Form(BulkRenameForm): pk = ModelMultipleChoiceField( queryset=self.queryset, widget=MultipleHiddenInput() ) self.form = _Form def get_required_permission(self): return get_permission_for_model(self.queryset.model, 'change') def post(self, request): logger = logging.getLogger('netbox.views.BulkRenameView') if '_preview' in request.POST or '_apply' in request.POST: form = self.form(request.POST, initial={'pk': request.POST.getlist('pk')}) selected_objects = self.queryset.filter(pk__in=form.initial['pk']) if form.is_valid(): try: with transaction.atomic(): renamed_pks = [] for obj in selected_objects: # Take a snapshot of change-logged models if hasattr(obj, 'snapshot'): obj.snapshot() find = form.cleaned_data['find'] replace = form.cleaned_data['replace'] if form.cleaned_data['use_regex']: try: obj.new_name = re.sub(find, replace, obj.name) # Catch regex group reference errors except re.error: obj.new_name = obj.name else: obj.new_name = obj.name.replace(find, replace) renamed_pks.append(obj.pk) if '_apply' in request.POST: for obj in selected_objects: obj.name = obj.new_name obj.save() # Enforce constrained permissions if self.queryset.filter(pk__in=renamed_pks).count() != len(selected_objects): raise PermissionsViolation messages.success(request, "Renamed {} {}".format( len(selected_objects), self.queryset.model._meta.verbose_name_plural )) return redirect(self.get_return_url(request)) except PermissionsViolation: msg = "Object update failed due to object-level permissions violation" logger.debug(msg) form.add_error(None, msg) clear_webhooks.send(sender=self) else: form = self.form(initial={'pk': request.POST.getlist('pk')}) selected_objects = self.queryset.filter(pk__in=form.initial['pk']) return render(request, self.template_name, { 'form': form, 'obj_type_plural': self.queryset.model._meta.verbose_name_plural, 'selected_objects': selected_objects, 'return_url': self.get_return_url(request), }) class BulkDeleteView(GetReturnURLMixin, ObjectPermissionRequiredMixin, View): queryset = None filterset = None table = None form = None template_name = 'generic/object_bulk_delete.html' def get_required_permission(self): return get_permission_for_model(self.queryset.model, 'delete') def get(self, request): return redirect(self.get_return_url(request)) def post(self, request, **kwargs): logger = logging.getLogger('netbox.views.BulkDeleteView') model = self.queryset.model # Are we deleting *all* objects in the queryset or just a selected subset? if request.POST.get('_all'): qs = model.objects.all() if self.filterset is not None: qs = self.filterset(request.GET, qs).qs pk_list = qs.only('pk').values_list('pk', flat=True) else: pk_list = [int(pk) for pk in request.POST.getlist('pk')] form_cls = self.get_form() if '_confirm' in request.POST: form = form_cls(request.POST) if form.is_valid(): logger.debug("Form validation was successful") # Delete objects queryset = self.queryset.filter(pk__in=pk_list) deleted_count = queryset.count() try: for obj in queryset: # Take a snapshot of change-logged models if hasattr(obj, 'snapshot'): obj.snapshot() obj.delete() except ProtectedError as e: logger.info("Caught ProtectedError while attempting to delete objects") handle_protectederror(queryset, request, e) return redirect(self.get_return_url(request)) msg = f"Deleted {deleted_count} {model._meta.verbose_name_plural}" logger.info(msg) messages.success(request, msg) return redirect(self.get_return_url(request)) else: logger.debug("Form validation failed") else: form = form_cls(initial={ 'pk': pk_list, 'return_url': self.get_return_url(request), }) # Retrieve objects being deleted table = self.table(self.queryset.filter(pk__in=pk_list), orderable=False) if not table.rows: messages.warning(request, "No {} were selected for deletion.".format(model._meta.verbose_name_plural)) return redirect(self.get_return_url(request)) return render(request, self.template_name, { 'form': form, 'obj_type_plural': model._meta.verbose_name_plural, 'table': table, 'return_url': self.get_return_url(request), }) def get_form(self): class BulkDeleteForm(ConfirmationForm): pk = ModelMultipleChoiceField(queryset=self.queryset, widget=MultipleHiddenInput) if self.form: return self.form return BulkDeleteForm # # Device/VirtualMachine components # # TODO: Replace with BulkCreateView class ComponentCreateView(GetReturnURLMixin, ObjectPermissionRequiredMixin, View): queryset = None form = None model_form = None template_name = 'generic/object_edit.html' def get_required_permission(self): return get_permission_for_model(self.queryset.model, 'add') def get(self, request): form = self.form(initial=request.GET) return render(request, self.template_name, { 'obj': self.queryset.model(), 'obj_type': self.queryset.model._meta.verbose_name, 'form': form, 'return_url': self.get_return_url(request), }) def post(self, request): logger = logging.getLogger('netbox.views.ComponentCreateView') form = self.form(request.POST, initial=request.GET) self.validate_form(request, form) if form.is_valid() and not form.errors: if '_addanother' in request.POST: return redirect(request.get_full_path()) else: return redirect(self.get_return_url(request)) return render(request, self.template_name, { 'obj_type': self.queryset.model._meta.verbose_name, 'form': form, 'return_url': self.get_return_url(request), }) def validate_form(self, request, form): logger = logging.getLogger('netbox.views.ComponentCreateView') if form.is_valid(): new_components = [] data = deepcopy(request.POST) names = form.cleaned_data['name_pattern'] labels = form.cleaned_data.get('label_pattern') for i, name in enumerate(names): label = labels[i] if labels else None # Initialize the individual component form data['name'] = name data['label'] = label if hasattr(form, 'get_iterative_data'): data.update(form.get_iterative_data(i)) component_form = self.model_form(data) if component_form.is_valid(): new_components.append(component_form) else: for field, errors in component_form.errors.as_data().items(): # Assign errors on the child form's name/label field to name_pattern/label_pattern on the parent form if field == 'name': field = 'name_pattern' elif field == 'label': field = 'label_pattern' for e in errors: form.add_error(field, '{}: {}'.format(name, ', '.join(e))) if not form.errors: try: with transaction.atomic(): new_objs = [] for component_form in new_components: obj = component_form.save() new_objs.append(obj) if self.queryset.filter(pk__in=[obj.pk for obj in new_objs]).count() != len(new_objs): raise PermissionsViolation messages.success(request, "Added {} {}".format( len(new_components), self.queryset.model._meta.verbose_name_plural )) return new_objs except PermissionsViolation: msg = "Component creation failed due to object-level permissions violation" logger.debug(msg) form.add_error(None, msg) clear_webhooks.send(sender=self) return None class BulkComponentCreateView(GetReturnURLMixin, ObjectPermissionRequiredMixin, View): parent_model = None parent_field = None form = None queryset = None model_form = None filterset = None table = None template_name = 'generic/object_bulk_add_component.html' def get_required_permission(self): return f'dcim.add_{self.queryset.model._meta.model_name}' def post(self, request): logger = logging.getLogger('netbox.views.BulkComponentCreateView') parent_model_name = self.parent_model._meta.verbose_name_plural model_name = self.queryset.model._meta.verbose_name_plural if request.POST.get('_all') and self.filterset is not None: pk_list = [obj.pk for obj in self.filterset(request.GET, self.parent_model.objects.only('pk')).qs] else: pk_list = [int(pk) for pk in request.POST.getlist('pk')] selected_objects = self.parent_model.objects.filter(pk__in=pk_list) if not selected_objects: messages.warning(request, "No {} were selected.".format(self.parent_model._meta.verbose_name_plural)) return redirect(self.get_return_url(request)) table = self.table(selected_objects) if '_create' in request.POST: form = self.form(request.POST) if form.is_valid(): logger.debug("Form validation was successful") new_components = [] data = deepcopy(form.cleaned_data) try: with transaction.atomic(): for obj in data['pk']: names = data['name_pattern'] labels = data['label_pattern'] if 'label_pattern' in data else None for i, name in enumerate(names): label = labels[i] if labels else None component_data = { self.parent_field: obj.pk, 'name': name, 'label': label } component_data.update(data) component_form = self.model_form(component_data) if component_form.is_valid(): instance = component_form.save() logger.debug(f"Created {instance} on {instance.parent_object}") new_components.append(instance) else: for field, errors in component_form.errors.as_data().items(): for e in errors: form.add_error(field, '{} {}: {}'.format(obj, name, ', '.join(e))) if self.queryset.filter(pk__in=[obj.pk for obj in new_components]).count() != len(new_components): raise PermissionsViolation except IntegrityError: clear_webhooks.send(sender=self) except PermissionsViolation: msg = "Component creation failed due to object-level permissions violation" logger.debug(msg) form.add_error(None, msg) clear_webhooks.send(sender=self) if not form.errors: msg = "Added {} {} to {} {}.".format( len(new_components), model_name, len(form.cleaned_data['pk']), parent_model_name ) logger.info(msg) messages.success(request, msg) return redirect(self.get_return_url(request)) else: logger.debug("Form validation failed") else: form = self.form(initial={'pk': pk_list}) return render(request, self.template_name, { 'form': form, 'parent_model_name': parent_model_name, 'model_name': model_name, 'table': table, 'return_url': self.get_return_url(request), })

true

1c2ff9b1862ba7075c4b45778d02b951166dc9c9

7,084

py

Python

chaingreen/cmds/configure.py

todortron/chaingreen-test

9054bfd79812ebd7fb3a3d341c03dbadea990fd0

[ "Apache-2.0" ]

null

chaingreen/cmds/configure.py

todortron/chaingreen-test

9054bfd79812ebd7fb3a3d341c03dbadea990fd0

[ "Apache-2.0" ]

null

chaingreen/cmds/configure.py

todortron/chaingreen-test

9054bfd79812ebd7fb3a3d341c03dbadea990fd0

[ "Apache-2.0" ]

null

from pathlib import Path from typing import Dict import click from chaingreen.util.config import load_config, save_config, str2bool from chaingreen.util.default_root import DEFAULT_ROOT_PATH def configure( root_path: Path, set_farmer_peer: str, set_node_introducer: str, set_fullnode_port: str, set_harvester_port: str, set_log_level: str, enable_upnp: str, set_outbound_peer_count: str, set_peer_count: str, testnet: str, ): config: Dict = load_config(DEFAULT_ROOT_PATH, "config.yaml") change_made = False if set_node_introducer: try: if set_node_introducer.index(":"): host, port = ( ":".join(set_node_introducer.split(":")[:-1]), set_node_introducer.split(":")[-1], ) config["full_node"]["introducer_peer"]["host"] = host config["full_node"]["introducer_peer"]["port"] = int(port) config["introducer"]["port"] = int(port) print("Node introducer updated") change_made = True except ValueError: print("Node introducer address must be in format [IP:Port]") if set_farmer_peer: try: if set_farmer_peer.index(":"): host, port = ( ":".join(set_farmer_peer.split(":")[:-1]), set_farmer_peer.split(":")[-1], ) config["full_node"]["farmer_peer"]["host"] = host config["full_node"]["farmer_peer"]["port"] = int(port) config["harvester"]["farmer_peer"]["host"] = host config["harvester"]["farmer_peer"]["port"] = int(port) print("Farmer peer updated, make sure your harvester has the proper cert installed") change_made = True except ValueError: print("Farmer address must be in format [IP:Port]") if set_fullnode_port: config["full_node"]["port"] = int(set_fullnode_port) config["full_node"]["introducer_peer"]["port"] = int(set_fullnode_port) config["farmer"]["full_node_peer"]["port"] = int(set_fullnode_port) config["timelord"]["full_node_peer"]["port"] = int(set_fullnode_port) config["wallet"]["full_node_peer"]["port"] = int(set_fullnode_port) config["wallet"]["introducer_peer"]["port"] = int(set_fullnode_port) config["introducer"]["port"] = int(set_fullnode_port) print("Default full node port updated") change_made = True if set_harvester_port: config["harvester"]["port"] = int(set_harvester_port) config["farmer"]["harvester_peer"]["port"] = int(set_harvester_port) print("Default harvester port updated") change_made = True if set_log_level: levels = ["CRITICAL", "ERROR", "WARNING", "INFO", "DEBUG", "NOTSET"] if set_log_level in levels: config["logging"]["log_level"] = set_log_level print(f"Logging level updated. Check {DEFAULT_ROOT_PATH}/log/debug.log") change_made = True else: print(f"Logging level not updated. Use one of: {levels}") if enable_upnp is not None: config["full_node"]["enable_upnp"] = str2bool(enable_upnp) if str2bool(enable_upnp): print("uPnP enabled") else: print("uPnP disabled") change_made = True if set_outbound_peer_count is not None: config["full_node"]["target_outbound_peer_count"] = int(set_outbound_peer_count) print("Target outbound peer count updated") change_made = True if set_peer_count is not None: config["full_node"]["target_peer_count"] = int(set_peer_count) print("Target peer count updated") change_made = True if testnet is not None: print("Setting Testnet") testnet_port = "58744" testnet_introducer = "testnet0.introducer.chaingreen.org" testnet = "testnet0" config["full_node"]["port"] = int(testnet_port) config["full_node"]["introducer_peer"]["port"] = int(testnet_port) config["farmer"]["full_node_peer"]["port"] = int(testnet_port) config["timelord"]["full_node_peer"]["port"] = int(testnet_port) config["wallet"]["full_node_peer"]["port"] = int(testnet_port) config["wallet"]["introducer_peer"]["port"] = int(testnet_port) config["introducer"]["port"] = int(testnet_port) config["full_node"]["introducer_peer"]["host"] = testnet_introducer config["selected_network"] = testnet config["harvester"]["selected_network"] = testnet config["pool"]["selected_network"] = testnet config["farmer"]["selected_network"] = testnet config["timelord"]["selected_network"] = testnet config["full_node"]["selected_network"] = testnet config["ui"]["selected_network"] = testnet config["introducer"]["selected_network"] = testnet config["wallet"]["selected_network"] = testnet print("Default full node port, introducer and network setting updated") change_made = True if change_made: print("Restart any running chaingreen services for changes to take effect") save_config(root_path, "config.yaml", config) return 0 @click.command("configure", short_help="Modify configuration") @click.option( "--testnet", "-t", help="configures for connection to testnet", type=click.Choice(["true", "t", "false", "f"]), ) @click.option("--set-node-introducer", help="Set the introducer for node - IP:Port", type=str) @click.option("--set-farmer-peer", help="Set the farmer peer for harvester - IP:Port", type=str) @click.option( "--set-fullnode-port", help="Set the port to use for the fullnode, useful for testing", type=str, ) @click.option( "--set-harvester-port", help="Set the port to use for the harvester, useful for testing", type=str, ) @click.option( "--set-log-level", "--log-level", "-log-level", help="Set the instance log level", type=click.Choice(["CRITICAL", "ERROR", "WARNING", "INFO", "DEBUG", "NOTSET"]), ) @click.option( "--enable-upnp", "--upnp", "-upnp", help="Enable or disable uPnP", type=click.Choice(["true", "t", "false", "f"]), ) @click.option( "--set_outbound-peer-count", help="Update the target outbound peer count (default 8)", type=str, ) @click.option("--set-peer-count", help="Update the target peer count (default 80)", type=str) @click.pass_context def configure_cmd( ctx, set_farmer_peer, set_node_introducer, set_fullnode_port, set_harvester_port, set_log_level, enable_upnp, set_outbound_peer_count, set_peer_count, testnet, ): configure( ctx.obj["root_path"], set_farmer_peer, set_node_introducer, set_fullnode_port, set_harvester_port, set_log_level, enable_upnp, set_outbound_peer_count, set_peer_count, testnet, )

38.291892

100

0.621118

from pathlib import Path from typing import Dict import click from chaingreen.util.config import load_config, save_config, str2bool from chaingreen.util.default_root import DEFAULT_ROOT_PATH def configure( root_path: Path, set_farmer_peer: str, set_node_introducer: str, set_fullnode_port: str, set_harvester_port: str, set_log_level: str, enable_upnp: str, set_outbound_peer_count: str, set_peer_count: str, testnet: str, ): config: Dict = load_config(DEFAULT_ROOT_PATH, "config.yaml") change_made = False if set_node_introducer: try: if set_node_introducer.index(":"): host, port = ( ":".join(set_node_introducer.split(":")[:-1]), set_node_introducer.split(":")[-1], ) config["full_node"]["introducer_peer"]["host"] = host config["full_node"]["introducer_peer"]["port"] = int(port) config["introducer"]["port"] = int(port) print("Node introducer updated") change_made = True except ValueError: print("Node introducer address must be in format [IP:Port]") if set_farmer_peer: try: if set_farmer_peer.index(":"): host, port = ( ":".join(set_farmer_peer.split(":")[:-1]), set_farmer_peer.split(":")[-1], ) config["full_node"]["farmer_peer"]["host"] = host config["full_node"]["farmer_peer"]["port"] = int(port) config["harvester"]["farmer_peer"]["host"] = host config["harvester"]["farmer_peer"]["port"] = int(port) print("Farmer peer updated, make sure your harvester has the proper cert installed") change_made = True except ValueError: print("Farmer address must be in format [IP:Port]") if set_fullnode_port: config["full_node"]["port"] = int(set_fullnode_port) config["full_node"]["introducer_peer"]["port"] = int(set_fullnode_port) config["farmer"]["full_node_peer"]["port"] = int(set_fullnode_port) config["timelord"]["full_node_peer"]["port"] = int(set_fullnode_port) config["wallet"]["full_node_peer"]["port"] = int(set_fullnode_port) config["wallet"]["introducer_peer"]["port"] = int(set_fullnode_port) config["introducer"]["port"] = int(set_fullnode_port) print("Default full node port updated") change_made = True if set_harvester_port: config["harvester"]["port"] = int(set_harvester_port) config["farmer"]["harvester_peer"]["port"] = int(set_harvester_port) print("Default harvester port updated") change_made = True if set_log_level: levels = ["CRITICAL", "ERROR", "WARNING", "INFO", "DEBUG", "NOTSET"] if set_log_level in levels: config["logging"]["log_level"] = set_log_level print(f"Logging level updated. Check {DEFAULT_ROOT_PATH}/log/debug.log") change_made = True else: print(f"Logging level not updated. Use one of: {levels}") if enable_upnp is not None: config["full_node"]["enable_upnp"] = str2bool(enable_upnp) if str2bool(enable_upnp): print("uPnP enabled") else: print("uPnP disabled") change_made = True if set_outbound_peer_count is not None: config["full_node"]["target_outbound_peer_count"] = int(set_outbound_peer_count) print("Target outbound peer count updated") change_made = True if set_peer_count is not None: config["full_node"]["target_peer_count"] = int(set_peer_count) print("Target peer count updated") change_made = True if testnet is not None: print("Setting Testnet") testnet_port = "58744" testnet_introducer = "testnet0.introducer.chaingreen.org" testnet = "testnet0" config["full_node"]["port"] = int(testnet_port) config["full_node"]["introducer_peer"]["port"] = int(testnet_port) config["farmer"]["full_node_peer"]["port"] = int(testnet_port) config["timelord"]["full_node_peer"]["port"] = int(testnet_port) config["wallet"]["full_node_peer"]["port"] = int(testnet_port) config["wallet"]["introducer_peer"]["port"] = int(testnet_port) config["introducer"]["port"] = int(testnet_port) config["full_node"]["introducer_peer"]["host"] = testnet_introducer config["selected_network"] = testnet config["harvester"]["selected_network"] = testnet config["pool"]["selected_network"] = testnet config["farmer"]["selected_network"] = testnet config["timelord"]["selected_network"] = testnet config["full_node"]["selected_network"] = testnet config["ui"]["selected_network"] = testnet config["introducer"]["selected_network"] = testnet config["wallet"]["selected_network"] = testnet print("Default full node port, introducer and network setting updated") change_made = True if change_made: print("Restart any running chaingreen services for changes to take effect") save_config(root_path, "config.yaml", config) return 0 @click.command("configure", short_help="Modify configuration") @click.option( "--testnet", "-t", help="configures for connection to testnet", type=click.Choice(["true", "t", "false", "f"]), ) @click.option("--set-node-introducer", help="Set the introducer for node - IP:Port", type=str) @click.option("--set-farmer-peer", help="Set the farmer peer for harvester - IP:Port", type=str) @click.option( "--set-fullnode-port", help="Set the port to use for the fullnode, useful for testing", type=str, ) @click.option( "--set-harvester-port", help="Set the port to use for the harvester, useful for testing", type=str, ) @click.option( "--set-log-level", "--log-level", "-log-level", help="Set the instance log level", type=click.Choice(["CRITICAL", "ERROR", "WARNING", "INFO", "DEBUG", "NOTSET"]), ) @click.option( "--enable-upnp", "--upnp", "-upnp", help="Enable or disable uPnP", type=click.Choice(["true", "t", "false", "f"]), ) @click.option( "--set_outbound-peer-count", help="Update the target outbound peer count (default 8)", type=str, ) @click.option("--set-peer-count", help="Update the target peer count (default 80)", type=str) @click.pass_context def configure_cmd( ctx, set_farmer_peer, set_node_introducer, set_fullnode_port, set_harvester_port, set_log_level, enable_upnp, set_outbound_peer_count, set_peer_count, testnet, ): configure( ctx.obj["root_path"], set_farmer_peer, set_node_introducer, set_fullnode_port, set_harvester_port, set_log_level, enable_upnp, set_outbound_peer_count, set_peer_count, testnet, )

true

1c2ff9f8f2ebf0991614c3a3a089c07f0b618eb9

9,702

py

Python

benchmarks/f3_wrong_hints/scaling_ltl_infinite_state/16-extending_bound_1.py

EnricoMagnago/F3

c863215c318d7d5f258eb9be38c6962cf6863b52

[ "MIT" ]

3

2021-04-23T23:29:26.000Z

2022-03-23T10:00:30.000Z

benchmarks/f3_wrong_hints/scaling_ltl_infinite_state/16-extending_bound_1.py

EnricoMagnago/F3

c863215c318d7d5f258eb9be38c6962cf6863b52

[ "MIT" ]

null

benchmarks/f3_wrong_hints/scaling_ltl_infinite_state/16-extending_bound_1.py

EnricoMagnago/F3

c863215c318d7d5f258eb9be38c6962cf6863b52

[ "MIT" ]

1

2021-11-17T22:02:56.000Z

from typing import Tuple, FrozenSet from collections import Iterable from mathsat import msat_term, msat_env from mathsat import msat_make_constant, msat_declare_function from mathsat import msat_get_integer_type, msat_get_rational_type, msat_get_bool_type from mathsat import msat_make_and, msat_make_not, msat_make_or from mathsat import msat_make_leq, msat_make_equal from mathsat import msat_make_number, msat_make_plus from pysmt.environment import Environment as PysmtEnv import pysmt.typing as types from ltl.ltl import TermMap, LTLEncoder from utils import name_next, symb_to_next from hint import Hint, Location def msat_make_lt(menv: msat_env, arg0: msat_term, arg1: msat_term): geq = msat_make_geq(menv, arg0, arg1) return msat_make_not(menv, geq) def msat_make_geq(menv: msat_env, arg0: msat_term, arg1: msat_term): return msat_make_leq(menv, arg1, arg0) def msat_make_gt(menv: msat_env, arg0: msat_term, arg1: msat_term): leq = msat_make_leq(menv, arg0, arg1) return msat_make_not(menv, leq) def msat_make_impl(menv: msat_env, arg0: msat_term, arg1: msat_term): n_arg0 = msat_make_not(menv, arg0) return msat_make_or(menv, n_arg0, arg1) def check_ltl(menv: msat_env, enc: LTLEncoder) -> Tuple[Iterable, msat_term, msat_term, msat_term]: assert menv assert isinstance(menv, msat_env) assert enc assert isinstance(enc, LTLEncoder) bool_type = msat_get_bool_type(menv) real_type = msat_get_rational_type(menv) i = msat_declare_function(menv, "i", real_type) i = msat_make_constant(menv, i) r = msat_declare_function(menv, "r", real_type) r = msat_make_constant(menv, r) l = msat_declare_function(menv, "l", real_type) l = msat_make_constant(menv, l) inc_i = msat_declare_function(menv, "inc_i", bool_type) inc_i = msat_make_constant(menv, inc_i) x_i = msat_declare_function(menv, name_next("i"), real_type) x_i = msat_make_constant(menv, x_i) x_r = msat_declare_function(menv, name_next("r"), real_type) x_r = msat_make_constant(menv, x_r) x_l = msat_declare_function(menv, name_next("l"), real_type) x_l = msat_make_constant(menv, x_l) x_inc_i = msat_declare_function(menv, name_next("inc_i"), bool_type) x_inc_i = msat_make_constant(menv, x_inc_i) curr2next = {i: x_i, r: x_r, l: x_l, inc_i: x_inc_i} zero = msat_make_number(menv, "0") one = msat_make_number(menv, "1") r_gt_0 = msat_make_gt(menv, r, zero) r_lt_l = msat_make_lt(menv, r, l) i_geq_0 = msat_make_geq(menv, i, zero) init = msat_make_and(menv, r_gt_0, r_lt_l) init = msat_make_and(menv, init, msat_make_and(menv, i_geq_0, msat_make_not(menv, inc_i))) init = msat_make_and(menv, init, msat_make_gt(menv, l, zero)) # r' = r trans = msat_make_equal(menv, x_r, r) # i < l -> ((inc_i' & i' = i + 1) | (!inc_i' & i' = i)) & l' = l i_lt_l = msat_make_lt(menv, i, l) x_i_eq_i_p_1 = msat_make_and(menv, x_inc_i, msat_make_equal(menv, x_i, msat_make_plus(menv, i, one))) x_i_eq_i = msat_make_and(menv, msat_make_not(menv, x_inc_i), msat_make_equal(menv, x_i, i)) x_i_eq_i_p_1_or_i = msat_make_or(menv, x_i_eq_i_p_1, x_i_eq_i) x_l_eq_l = msat_make_equal(menv, x_l, l) x_i_eq_i_p_1_or_i_and_x_l_eq_l = msat_make_and(menv, x_i_eq_i_p_1_or_i, x_l_eq_l) trans = msat_make_and(menv, trans, msat_make_impl(menv, i_lt_l, x_i_eq_i_p_1_or_i_and_x_l_eq_l)) # i >= l -> i' = 0 & l' = l + 1 & !inc_i' i_geq_l = msat_make_geq(menv, i, l) x_i_eq_0 = msat_make_equal(menv, x_i, zero) x_l_eq_l_p_1 = msat_make_equal(menv, x_l, msat_make_plus(menv, l, one)) x_i_eq_0_and_x_l_eq_l_p_1 = msat_make_and(menv, msat_make_and(menv, x_i_eq_0, x_l_eq_l_p_1), msat_make_not(menv, x_inc_i)) trans = msat_make_and(menv, trans, msat_make_impl(menv, i_geq_l, x_i_eq_0_and_x_l_eq_l_p_1)) # (G F inc_i) -> ! G F r > i G_F_x_i_gt_i = enc.make_G(enc.make_F(inc_i)) r_gt_i = msat_make_gt(menv, r, i) n_G_F_r_gt_i = msat_make_not(menv, enc.make_G(enc.make_F(r_gt_i))) ltl = msat_make_impl(menv, G_F_x_i_gt_i, n_G_F_r_gt_i) return TermMap(curr2next), init, trans, ltl def hints(env: PysmtEnv) -> FrozenSet[Hint]: assert isinstance(env, PysmtEnv) mgr = env.formula_manager i = mgr.Symbol("i", types.REAL) r = mgr.Symbol("r", types.REAL) l = mgr.Symbol("l", types.REAL) inc_i = mgr.Symbol("inc_i", types.BOOL) symbs = frozenset([i, r, l, inc_i]) x_i = symb_to_next(mgr, i) x_r = symb_to_next(mgr, r) x_l = symb_to_next(mgr, l) x_inc_i = symb_to_next(mgr, inc_i) res = [] n0 = mgr.Real(0) n1 = mgr.Real(1) loc = Location(env, mgr.GE(r, n0)) loc.set_progress(0, mgr.Equals(x_r, mgr.Plus(r, n1))) h_r = Hint("h_r0", env, frozenset([r]), symbs) h_r.set_locs([loc]) res.append(h_r) loc = Location(env, mgr.GE(l, n0)) loc.set_progress(0, mgr.Equals(x_l, mgr.Plus(l, n1))) h_l = Hint("h_l0", env, frozenset([l]), symbs) h_l.set_locs([loc]) res.append(h_l) loc = Location(env, inc_i) loc.set_progress(0, x_inc_i) h_inc = Hint("h_inc0", env, frozenset([inc_i]), symbs) h_inc.set_locs([loc]) res.append(h_inc) stutter = mgr.Equals(x_i, i) loc = Location(env, mgr.LE(i, n0), stutterT=stutter) loc.set_progress(0, mgr.Equals(x_i, mgr.Minus(i, n1))) h_i = Hint("h_i1", env, frozenset([i]), symbs) h_i.set_locs([loc]) res.append(h_i) loc = Location(env, mgr.LE(r, n0)) loc.set_progress(0, mgr.Equals(x_r, mgr.Minus(r, n1))) h_r = Hint("h_r1", env, frozenset([r]), symbs) h_r.set_locs([loc]) res.append(h_r) loc = Location(env, mgr.LE(l, n0)) loc.set_progress(0, mgr.Equals(x_l, mgr.Minus(l, n1))) h_l = Hint("h_l1", env, frozenset([l]), symbs) h_l.set_locs([loc]) res.append(h_l) loc = Location(env, mgr.Not(inc_i)) loc.set_progress(0, mgr.Not(x_inc_i)) h_inc = Hint("h_inc1", env, frozenset([inc_i]), symbs) h_inc.set_locs([loc]) res.append(h_inc) loc0 = Location(env, mgr.GE(i, n0)) loc0.set_progress(1, mgr.Equals(x_i, mgr.Plus(i, n1))) loc1 = Location(env, mgr.GE(i, n0)) loc1.set_progress(0, mgr.Equals(x_i, i)) h_i = Hint("h_i2", env, frozenset([i]), symbs) h_i.set_locs([loc0, loc1]) res.append(h_i) loc0 = Location(env, mgr.Not(inc_i)) loc0.set_progress(1, x_inc_i) loc1 = Location(env, inc_i) loc1.set_progress(0, mgr.Not(x_inc_i)) h_inc = Hint("h_inc2", env, frozenset([inc_i]), symbs) h_inc.set_locs([loc0, loc1]) res.append(h_inc) loc0 = Location(env, mgr.GE(i, n0), mgr.GE(l, n0), stutterT=mgr.Equals(x_i, mgr.Plus(i, l))) loc0.set_progress(1, mgr.Equals(x_i, mgr.Plus(i, n1))) loc1 = Location(env, mgr.GE(i, n0)) loc1.set_progress(0, mgr.Equals(x_i, i)) h_i = Hint("h_i3", env, frozenset([i]), symbs) h_i.set_locs([loc0, loc1]) res.append(h_i) loc0 = Location(env, mgr.GE(r, n0), mgr.GE(i, n0), stutterT=mgr.Equals(x_r, mgr.Plus(r, i))) loc0.set_progress(1, mgr.Equals(x_r, r)) loc1 = Location(env, mgr.GE(r, n0)) loc1.set_progress(0, mgr.Equals(x_r, mgr.Plus(r, n1))) h_r = Hint("h_r3", env, frozenset([r]), symbs) h_r.set_locs([loc0, loc1]) res.append(h_r) loc0 = Location(env, mgr.GE(l, n0), mgr.GE(r, n0), stutterT=mgr.Equals(x_l, mgr.Plus(l, r))) loc0.set_progress(1, mgr.Equals(x_l, mgr.Plus(l, n1))) loc1 = Location(env, mgr.GE(l, n0)) loc1.set_progress(0, mgr.Equals(x_l, l)) h_l = Hint("h_l3", env, frozenset([l]), symbs) h_l.set_locs([loc0, loc1]) res.append(h_l) loc0 = Location(env, mgr.Not(inc_i)) loc0.set_progress(1, x_inc_i) loc1 = Location(env, inc_i, stutterT=x_inc_i) loc1.set_progress(0, mgr.Not(x_inc_i)) h_inc = Hint("h_inc3", env, frozenset([inc_i]), symbs) h_inc.set_locs([loc0, loc1]) res.append(h_inc) loc0 = Location(env, mgr.GE(r, n0)) loc0.set_progress(1, mgr.Equals(x_r, r)) loc1 = Location(env, mgr.GE(r, n0)) loc1.set_progress(2, mgr.Equals(x_r, mgr.Plus(r, n1))) loc2 = Location(env, mgr.GE(r, n0)) loc2.set_progress(0, mgr.Equals(x_r, r)) h_r = Hint("h_r4", env, frozenset([r]), symbs) h_r.set_locs([loc0, loc1, loc2]) res.append(h_r) loc0 = Location(env, mgr.GE(l, n0)) loc0.set_progress(1, mgr.Equals(x_l, mgr.Plus(l, n1))) loc1 = Location(env, mgr.GE(l, n0)) loc1.set_progress(2, mgr.Equals(x_l, l)) loc2 = Location(env, mgr.GE(l, n0)) loc2.set_progress(0, mgr.Equals(x_l, l)) h_l = Hint("h_l4", env, frozenset([l]), symbs) h_l.set_locs([loc0, loc1, loc2]) res.append(h_l) loc0 = Location(env, mgr.Not(inc_i)) loc0.set_progress(1, x_inc_i) loc1 = Location(env, inc_i, stutterT=x_inc_i) loc1.set_progress(2, mgr.Not(x_inc_i)) loc2 = Location(env, mgr.Not(inc_i)) loc2.set_progress(0, mgr.Not(x_inc_i)) h_inc = Hint("h_inc4", env, frozenset([inc_i]), symbs) h_inc.set_locs([loc0, loc1, loc2]) res.append(h_inc) return frozenset(res)

35.408759

89

0.625335

from typing import Tuple, FrozenSet from collections import Iterable from mathsat import msat_term, msat_env from mathsat import msat_make_constant, msat_declare_function from mathsat import msat_get_integer_type, msat_get_rational_type, msat_get_bool_type from mathsat import msat_make_and, msat_make_not, msat_make_or from mathsat import msat_make_leq, msat_make_equal from mathsat import msat_make_number, msat_make_plus from pysmt.environment import Environment as PysmtEnv import pysmt.typing as types from ltl.ltl import TermMap, LTLEncoder from utils import name_next, symb_to_next from hint import Hint, Location def msat_make_lt(menv: msat_env, arg0: msat_term, arg1: msat_term): geq = msat_make_geq(menv, arg0, arg1) return msat_make_not(menv, geq) def msat_make_geq(menv: msat_env, arg0: msat_term, arg1: msat_term): return msat_make_leq(menv, arg1, arg0) def msat_make_gt(menv: msat_env, arg0: msat_term, arg1: msat_term): leq = msat_make_leq(menv, arg0, arg1) return msat_make_not(menv, leq) def msat_make_impl(menv: msat_env, arg0: msat_term, arg1: msat_term): n_arg0 = msat_make_not(menv, arg0) return msat_make_or(menv, n_arg0, arg1) def check_ltl(menv: msat_env, enc: LTLEncoder) -> Tuple[Iterable, msat_term, msat_term, msat_term]: assert menv assert isinstance(menv, msat_env) assert enc assert isinstance(enc, LTLEncoder) bool_type = msat_get_bool_type(menv) real_type = msat_get_rational_type(menv) i = msat_declare_function(menv, "i", real_type) i = msat_make_constant(menv, i) r = msat_declare_function(menv, "r", real_type) r = msat_make_constant(menv, r) l = msat_declare_function(menv, "l", real_type) l = msat_make_constant(menv, l) inc_i = msat_declare_function(menv, "inc_i", bool_type) inc_i = msat_make_constant(menv, inc_i) x_i = msat_declare_function(menv, name_next("i"), real_type) x_i = msat_make_constant(menv, x_i) x_r = msat_declare_function(menv, name_next("r"), real_type) x_r = msat_make_constant(menv, x_r) x_l = msat_declare_function(menv, name_next("l"), real_type) x_l = msat_make_constant(menv, x_l) x_inc_i = msat_declare_function(menv, name_next("inc_i"), bool_type) x_inc_i = msat_make_constant(menv, x_inc_i) curr2next = {i: x_i, r: x_r, l: x_l, inc_i: x_inc_i} zero = msat_make_number(menv, "0") one = msat_make_number(menv, "1") r_gt_0 = msat_make_gt(menv, r, zero) r_lt_l = msat_make_lt(menv, r, l) i_geq_0 = msat_make_geq(menv, i, zero) init = msat_make_and(menv, r_gt_0, r_lt_l) init = msat_make_and(menv, init, msat_make_and(menv, i_geq_0, msat_make_not(menv, inc_i))) init = msat_make_and(menv, init, msat_make_gt(menv, l, zero)) trans = msat_make_equal(menv, x_r, r) # i < l -> ((inc_i' & i' = i + 1) | (!inc_i' & i' = i)) & l' = l i_lt_l = msat_make_lt(menv, i, l) x_i_eq_i_p_1 = msat_make_and(menv, x_inc_i, msat_make_equal(menv, x_i, msat_make_plus(menv, i, one))) x_i_eq_i = msat_make_and(menv, msat_make_not(menv, x_inc_i), msat_make_equal(menv, x_i, i)) x_i_eq_i_p_1_or_i = msat_make_or(menv, x_i_eq_i_p_1, x_i_eq_i) x_l_eq_l = msat_make_equal(menv, x_l, l) x_i_eq_i_p_1_or_i_and_x_l_eq_l = msat_make_and(menv, x_i_eq_i_p_1_or_i, x_l_eq_l) trans = msat_make_and(menv, trans, msat_make_impl(menv, i_lt_l, x_i_eq_i_p_1_or_i_and_x_l_eq_l)) i_geq_l = msat_make_geq(menv, i, l) x_i_eq_0 = msat_make_equal(menv, x_i, zero) x_l_eq_l_p_1 = msat_make_equal(menv, x_l, msat_make_plus(menv, l, one)) x_i_eq_0_and_x_l_eq_l_p_1 = msat_make_and(menv, msat_make_and(menv, x_i_eq_0, x_l_eq_l_p_1), msat_make_not(menv, x_inc_i)) trans = msat_make_and(menv, trans, msat_make_impl(menv, i_geq_l, x_i_eq_0_and_x_l_eq_l_p_1)) # (G F inc_i) -> ! G F r > i G_F_x_i_gt_i = enc.make_G(enc.make_F(inc_i)) r_gt_i = msat_make_gt(menv, r, i) n_G_F_r_gt_i = msat_make_not(menv, enc.make_G(enc.make_F(r_gt_i))) ltl = msat_make_impl(menv, G_F_x_i_gt_i, n_G_F_r_gt_i) return TermMap(curr2next), init, trans, ltl def hints(env: PysmtEnv) -> FrozenSet[Hint]: assert isinstance(env, PysmtEnv) mgr = env.formula_manager i = mgr.Symbol("i", types.REAL) r = mgr.Symbol("r", types.REAL) l = mgr.Symbol("l", types.REAL) inc_i = mgr.Symbol("inc_i", types.BOOL) symbs = frozenset([i, r, l, inc_i]) x_i = symb_to_next(mgr, i) x_r = symb_to_next(mgr, r) x_l = symb_to_next(mgr, l) x_inc_i = symb_to_next(mgr, inc_i) res = [] n0 = mgr.Real(0) n1 = mgr.Real(1) loc = Location(env, mgr.GE(r, n0)) loc.set_progress(0, mgr.Equals(x_r, mgr.Plus(r, n1))) h_r = Hint("h_r0", env, frozenset([r]), symbs) h_r.set_locs([loc]) res.append(h_r) loc = Location(env, mgr.GE(l, n0)) loc.set_progress(0, mgr.Equals(x_l, mgr.Plus(l, n1))) h_l = Hint("h_l0", env, frozenset([l]), symbs) h_l.set_locs([loc]) res.append(h_l) loc = Location(env, inc_i) loc.set_progress(0, x_inc_i) h_inc = Hint("h_inc0", env, frozenset([inc_i]), symbs) h_inc.set_locs([loc]) res.append(h_inc) stutter = mgr.Equals(x_i, i) loc = Location(env, mgr.LE(i, n0), stutterT=stutter) loc.set_progress(0, mgr.Equals(x_i, mgr.Minus(i, n1))) h_i = Hint("h_i1", env, frozenset([i]), symbs) h_i.set_locs([loc]) res.append(h_i) loc = Location(env, mgr.LE(r, n0)) loc.set_progress(0, mgr.Equals(x_r, mgr.Minus(r, n1))) h_r = Hint("h_r1", env, frozenset([r]), symbs) h_r.set_locs([loc]) res.append(h_r) loc = Location(env, mgr.LE(l, n0)) loc.set_progress(0, mgr.Equals(x_l, mgr.Minus(l, n1))) h_l = Hint("h_l1", env, frozenset([l]), symbs) h_l.set_locs([loc]) res.append(h_l) loc = Location(env, mgr.Not(inc_i)) loc.set_progress(0, mgr.Not(x_inc_i)) h_inc = Hint("h_inc1", env, frozenset([inc_i]), symbs) h_inc.set_locs([loc]) res.append(h_inc) loc0 = Location(env, mgr.GE(i, n0)) loc0.set_progress(1, mgr.Equals(x_i, mgr.Plus(i, n1))) loc1 = Location(env, mgr.GE(i, n0)) loc1.set_progress(0, mgr.Equals(x_i, i)) h_i = Hint("h_i2", env, frozenset([i]), symbs) h_i.set_locs([loc0, loc1]) res.append(h_i) loc0 = Location(env, mgr.Not(inc_i)) loc0.set_progress(1, x_inc_i) loc1 = Location(env, inc_i) loc1.set_progress(0, mgr.Not(x_inc_i)) h_inc = Hint("h_inc2", env, frozenset([inc_i]), symbs) h_inc.set_locs([loc0, loc1]) res.append(h_inc) loc0 = Location(env, mgr.GE(i, n0), mgr.GE(l, n0), stutterT=mgr.Equals(x_i, mgr.Plus(i, l))) loc0.set_progress(1, mgr.Equals(x_i, mgr.Plus(i, n1))) loc1 = Location(env, mgr.GE(i, n0)) loc1.set_progress(0, mgr.Equals(x_i, i)) h_i = Hint("h_i3", env, frozenset([i]), symbs) h_i.set_locs([loc0, loc1]) res.append(h_i) loc0 = Location(env, mgr.GE(r, n0), mgr.GE(i, n0), stutterT=mgr.Equals(x_r, mgr.Plus(r, i))) loc0.set_progress(1, mgr.Equals(x_r, r)) loc1 = Location(env, mgr.GE(r, n0)) loc1.set_progress(0, mgr.Equals(x_r, mgr.Plus(r, n1))) h_r = Hint("h_r3", env, frozenset([r]), symbs) h_r.set_locs([loc0, loc1]) res.append(h_r) loc0 = Location(env, mgr.GE(l, n0), mgr.GE(r, n0), stutterT=mgr.Equals(x_l, mgr.Plus(l, r))) loc0.set_progress(1, mgr.Equals(x_l, mgr.Plus(l, n1))) loc1 = Location(env, mgr.GE(l, n0)) loc1.set_progress(0, mgr.Equals(x_l, l)) h_l = Hint("h_l3", env, frozenset([l]), symbs) h_l.set_locs([loc0, loc1]) res.append(h_l) loc0 = Location(env, mgr.Not(inc_i)) loc0.set_progress(1, x_inc_i) loc1 = Location(env, inc_i, stutterT=x_inc_i) loc1.set_progress(0, mgr.Not(x_inc_i)) h_inc = Hint("h_inc3", env, frozenset([inc_i]), symbs) h_inc.set_locs([loc0, loc1]) res.append(h_inc) loc0 = Location(env, mgr.GE(r, n0)) loc0.set_progress(1, mgr.Equals(x_r, r)) loc1 = Location(env, mgr.GE(r, n0)) loc1.set_progress(2, mgr.Equals(x_r, mgr.Plus(r, n1))) loc2 = Location(env, mgr.GE(r, n0)) loc2.set_progress(0, mgr.Equals(x_r, r)) h_r = Hint("h_r4", env, frozenset([r]), symbs) h_r.set_locs([loc0, loc1, loc2]) res.append(h_r) loc0 = Location(env, mgr.GE(l, n0)) loc0.set_progress(1, mgr.Equals(x_l, mgr.Plus(l, n1))) loc1 = Location(env, mgr.GE(l, n0)) loc1.set_progress(2, mgr.Equals(x_l, l)) loc2 = Location(env, mgr.GE(l, n0)) loc2.set_progress(0, mgr.Equals(x_l, l)) h_l = Hint("h_l4", env, frozenset([l]), symbs) h_l.set_locs([loc0, loc1, loc2]) res.append(h_l) loc0 = Location(env, mgr.Not(inc_i)) loc0.set_progress(1, x_inc_i) loc1 = Location(env, inc_i, stutterT=x_inc_i) loc1.set_progress(2, mgr.Not(x_inc_i)) loc2 = Location(env, mgr.Not(inc_i)) loc2.set_progress(0, mgr.Not(x_inc_i)) h_inc = Hint("h_inc4", env, frozenset([inc_i]), symbs) h_inc.set_locs([loc0, loc1, loc2]) res.append(h_inc) return frozenset(res)

true

1c2ffaeb75554bbb8fc96f57950559d0ff84f295

28,917

py

Python

electrum_dash/gui/qt/util.py

thephez/electrum-dash

bbf0ba1cc22feebc26d78b5d3b338251a41ca323

[ "MIT" ]

null

electrum_dash/gui/qt/util.py

thephez/electrum-dash

bbf0ba1cc22feebc26d78b5d3b338251a41ca323

[ "MIT" ]

null

electrum_dash/gui/qt/util.py

thephez/electrum-dash

bbf0ba1cc22feebc26d78b5d3b338251a41ca323

[ "MIT" ]

null

import asyncio import os.path import time import sys import platform import queue import traceback from functools import partial, lru_cache from typing import NamedTuple, Callable, Optional, TYPE_CHECKING, Union, List, Dict from PyQt5.QtGui import (QFont, QColor, QCursor, QPixmap, QStandardItem, QPalette, QIcon) from PyQt5.QtCore import (Qt, QPersistentModelIndex, QModelIndex, pyqtSignal, QCoreApplication, QItemSelectionModel, QThread, QSortFilterProxyModel, QSize, QLocale) from PyQt5.QtWidgets import (QPushButton, QLabel, QMessageBox, QHBoxLayout, QAbstractItemView, QVBoxLayout, QLineEdit, QStyle, QDialog, QGroupBox, QButtonGroup, QRadioButton, QFileDialog, QWidget, QToolButton, QTreeView, QPlainTextEdit, QHeaderView, QApplication, QToolTip, QTreeWidget, QStyledItemDelegate) from electrum_dash.i18n import _, languages from electrum_dash.util import (FileImportFailed, FileExportFailed, resource_path) from electrum_dash.paymentrequest import PR_UNPAID, PR_PAID, PR_EXPIRED if TYPE_CHECKING: from .main_window import ElectrumWindow if platform.system() == 'Windows': if platform.release() in ['7', '8', '10']: MONOSPACE_FONT = 'Consolas' else: MONOSPACE_FONT = 'Lucida Console' elif platform.system() == 'Darwin': MONOSPACE_FONT = 'Menlo' else: MONOSPACE_FONT = 'monospace' dialogs = [] pr_icons = { PR_UNPAID:"unpaid.png", PR_PAID:"confirmed.png", PR_EXPIRED:"expired.png" } pr_tooltips = { PR_UNPAID:_('Pending'), PR_PAID:_('Paid'), PR_EXPIRED:_('Expired') } expiration_values = [ (_('1 hour'), 60*60), (_('1 day'), 24*60*60), (_('1 week'), 7*24*60*60), (_('Never'), None) ] class EnterButton(QPushButton): def __init__(self, text, func): QPushButton.__init__(self, text) self.func = func self.clicked.connect(func) def keyPressEvent(self, e): if e.key() == Qt.Key_Return: self.func() class ThreadedButton(QPushButton): def __init__(self, text, task, on_success=None, on_error=None): QPushButton.__init__(self, text) self.task = task self.on_success = on_success self.on_error = on_error self.clicked.connect(self.run_task) def run_task(self): self.setEnabled(False) self.thread = TaskThread(self) self.thread.add(self.task, self.on_success, self.done, self.on_error) def done(self): self.setEnabled(True) self.thread.stop() class WWLabel(QLabel): def __init__ (self, text="", parent=None): QLabel.__init__(self, text, parent) self.setWordWrap(True) class HelpLabel(QLabel): def __init__(self, text, help_text): QLabel.__init__(self, text) self.help_text = help_text self.app = QCoreApplication.instance() self.font = QFont() def mouseReleaseEvent(self, x): QMessageBox.information(self, 'Help', self.help_text) def enterEvent(self, event): self.font.setUnderline(True) self.setFont(self.font) self.app.setOverrideCursor(QCursor(Qt.PointingHandCursor)) return QLabel.enterEvent(self, event) def leaveEvent(self, event): self.font.setUnderline(False) self.setFont(self.font) self.app.setOverrideCursor(QCursor(Qt.ArrowCursor)) return QLabel.leaveEvent(self, event) class HelpButton(QPushButton): def __init__(self, text): QPushButton.__init__(self, '?') self.help_text = text self.setFocusPolicy(Qt.NoFocus) self.setFixedWidth(20) self.clicked.connect(self.onclick) def onclick(self): QMessageBox.information(self, 'Help', self.help_text) class InfoButton(QPushButton): def __init__(self, text): QPushButton.__init__(self, 'Info') self.help_text = text self.setFocusPolicy(Qt.NoFocus) self.setFixedWidth(60) self.clicked.connect(self.onclick) def onclick(self): QMessageBox.information(self, 'Info', self.help_text) class Buttons(QHBoxLayout): def __init__(self, *buttons): QHBoxLayout.__init__(self) self.addStretch(1) for b in buttons: self.addWidget(b) class CloseButton(QPushButton): def __init__(self, dialog): QPushButton.__init__(self, _("Close")) self.clicked.connect(dialog.close) self.setDefault(True) class CopyButton(QPushButton): def __init__(self, text_getter, app): QPushButton.__init__(self, _("Copy")) self.clicked.connect(lambda: app.clipboard().setText(text_getter())) class CopyCloseButton(QPushButton): def __init__(self, text_getter, app, dialog): QPushButton.__init__(self, _("Copy and Close")) self.clicked.connect(lambda: app.clipboard().setText(text_getter())) self.clicked.connect(dialog.close) self.setDefault(True) class OkButton(QPushButton): def __init__(self, dialog, label=None): QPushButton.__init__(self, label or _("OK")) self.clicked.connect(dialog.accept) self.setDefault(True) class CancelButton(QPushButton): def __init__(self, dialog, label=None): QPushButton.__init__(self, label or _("Cancel")) self.clicked.connect(dialog.reject) class MessageBoxMixin(object): def top_level_window_recurse(self, window=None, test_func=None): window = window or self classes = (WindowModalDialog, QMessageBox) if test_func is None: test_func = lambda x: True for n, child in enumerate(window.children()): # Test for visibility as old closed dialogs may not be GC-ed. # Only accept children that confirm to test_func. if isinstance(child, classes) and child.isVisible() \ and test_func(child): return self.top_level_window_recurse(child, test_func=test_func) return window def top_level_window(self, test_func=None): return self.top_level_window_recurse(test_func) def question(self, msg, parent=None, title=None, icon=None): Yes, No = QMessageBox.Yes, QMessageBox.No return self.msg_box(icon or QMessageBox.Question, parent, title or '', msg, buttons=Yes|No, defaultButton=No) == Yes def show_warning(self, msg, parent=None, title=None, **kwargs): return self.msg_box(QMessageBox.Warning, parent, title or _('Warning'), msg, **kwargs) def show_error(self, msg, parent=None, **kwargs): return self.msg_box(QMessageBox.Warning, parent, _('Error'), msg, **kwargs) def show_critical(self, msg, parent=None, title=None, **kwargs): return self.msg_box(QMessageBox.Critical, parent, title or _('Critical Error'), msg, **kwargs) def show_message(self, msg, parent=None, title=None, **kwargs): return self.msg_box(QMessageBox.Information, parent, title or _('Information'), msg, **kwargs) def msg_box(self, icon, parent, title, text, buttons=QMessageBox.Ok, defaultButton=QMessageBox.NoButton, rich_text=False): parent = parent or self.top_level_window() if type(icon) is QPixmap: d = QMessageBox(QMessageBox.Information, title, str(text), buttons, parent) d.setIconPixmap(icon) else: d = QMessageBox(icon, title, str(text), buttons, parent) d.setWindowModality(Qt.WindowModal) d.setDefaultButton(defaultButton) if rich_text: d.setTextInteractionFlags(Qt.TextSelectableByMouse| Qt.LinksAccessibleByMouse) d.setTextFormat(Qt.RichText) else: d.setTextInteractionFlags(Qt.TextSelectableByMouse) d.setTextFormat(Qt.PlainText) return d.exec_() class WindowModalDialog(QDialog, MessageBoxMixin): '''Handy wrapper; window modal dialogs are better for our multi-window daemon model as other wallet windows can still be accessed.''' def __init__(self, parent, title=None): QDialog.__init__(self, parent) self.setWindowModality(Qt.WindowModal) if title: self.setWindowTitle(title) class WaitingDialog(WindowModalDialog): '''Shows a please wait dialog whilst running a task. It is not necessary to maintain a reference to this dialog.''' def __init__(self, parent, message, task, on_success=None, on_error=None): assert parent if isinstance(parent, MessageBoxMixin): parent = parent.top_level_window() WindowModalDialog.__init__(self, parent, _("Please wait")) vbox = QVBoxLayout(self) vbox.addWidget(QLabel(message)) self.accepted.connect(self.on_accepted) self.show() self.thread = TaskThread(self) self.thread.finished.connect(self.deleteLater) # see #3956 self.thread.add(task, on_success, self.accept, on_error) def wait(self): self.thread.wait() def on_accepted(self): self.thread.stop() def line_dialog(parent, title, label, ok_label, default=None): dialog = WindowModalDialog(parent, title) dialog.setMinimumWidth(500) l = QVBoxLayout() dialog.setLayout(l) l.addWidget(QLabel(label)) txt = QLineEdit() if default: txt.setText(default) l.addWidget(txt) l.addLayout(Buttons(CancelButton(dialog), OkButton(dialog, ok_label))) if dialog.exec_(): return txt.text() def text_dialog(parent, title, header_layout, ok_label, default=None, allow_multi=False): from .qrtextedit import ScanQRTextEdit dialog = WindowModalDialog(parent, title) dialog.setMinimumWidth(600) l = QVBoxLayout() dialog.setLayout(l) if isinstance(header_layout, str): l.addWidget(QLabel(header_layout)) else: l.addLayout(header_layout) txt = ScanQRTextEdit(allow_multi=allow_multi) if default: txt.setText(default) l.addWidget(txt) l.addLayout(Buttons(CancelButton(dialog), OkButton(dialog, ok_label))) if dialog.exec_(): return txt.toPlainText() class ChoicesLayout(object): def __init__(self, msg, choices, on_clicked=None, checked_index=0): vbox = QVBoxLayout() if len(msg) > 50: vbox.addWidget(WWLabel(msg)) msg = "" gb2 = QGroupBox(msg) vbox.addWidget(gb2) vbox2 = QVBoxLayout() gb2.setLayout(vbox2) self.group = group = QButtonGroup() for i,c in enumerate(choices): button = QRadioButton(gb2) button.setText(c) vbox2.addWidget(button) group.addButton(button) group.setId(button, i) if i==checked_index: button.setChecked(True) if on_clicked: group.buttonClicked.connect(partial(on_clicked, self)) self.vbox = vbox def layout(self): return self.vbox def selected_index(self): return self.group.checkedId() def address_field(addresses): hbox = QHBoxLayout() address_e = QLineEdit() if addresses and len(addresses) > 0: address_e.setText(addresses[0]) else: addresses = [] def func(): try: i = addresses.index(str(address_e.text())) + 1 i = i % len(addresses) address_e.setText(addresses[i]) except ValueError: # the user might have changed address_e to an # address not in the wallet (or to something that isn't an address) if addresses and len(addresses) > 0: address_e.setText(addresses[0]) button = QPushButton(_('Address')) button.clicked.connect(func) hbox.addWidget(button) hbox.addWidget(address_e) return hbox, address_e def filename_field(parent, config, defaultname, select_msg): vbox = QVBoxLayout() vbox.addWidget(QLabel(_("Format"))) gb = QGroupBox("format", parent) b1 = QRadioButton(gb) b1.setText(_("CSV")) b1.setChecked(True) b2 = QRadioButton(gb) b2.setText(_("json")) vbox.addWidget(b1) vbox.addWidget(b2) hbox = QHBoxLayout() directory = config.get('io_dir', os.path.expanduser('~')) path = os.path.join( directory, defaultname ) filename_e = QLineEdit() filename_e.setText(path) def func(): text = filename_e.text() _filter = "*.csv" if text.endswith(".csv") else "*.json" if text.endswith(".json") else None p, __ = QFileDialog.getSaveFileName(None, select_msg, text, _filter) if p: filename_e.setText(p) button = QPushButton(_('File')) button.clicked.connect(func) hbox.addWidget(button) hbox.addWidget(filename_e) vbox.addLayout(hbox) def set_csv(v): text = filename_e.text() text = text.replace(".json",".csv") if v else text.replace(".csv",".json") filename_e.setText(text) b1.clicked.connect(lambda: set_csv(True)) b2.clicked.connect(lambda: set_csv(False)) return vbox, filename_e, b1 class ElectrumItemDelegate(QStyledItemDelegate): def __init__(self, tv): super().__init__(tv) self.tv = tv self.opened = None def on_closeEditor(editor: QLineEdit, hint): self.opened = None def on_commitData(editor: QLineEdit): new_text = editor.text() idx = QModelIndex(self.opened) row, col = idx.row(), idx.column() _prior_text, user_role = self.tv.text_txid_from_coordinate(row, col) # check that we didn't forget to set UserRole on an editable field assert user_role is not None, (row, col) self.tv.on_edited(idx, user_role, new_text) self.closeEditor.connect(on_closeEditor) self.commitData.connect(on_commitData) def createEditor(self, parent, option, idx): self.opened = QPersistentModelIndex(idx) return super().createEditor(parent, option, idx) class MyTreeView(QTreeView): def __init__(self, parent: 'ElectrumWindow', create_menu, stretch_column=None, editable_columns=None): super().__init__(parent) self.parent = parent self.config = self.parent.config self.stretch_column = stretch_column self.setContextMenuPolicy(Qt.CustomContextMenu) self.customContextMenuRequested.connect(create_menu) self.setUniformRowHeights(True) # Control which columns are editable if editable_columns is None: editable_columns = {stretch_column} else: editable_columns = set(editable_columns) self.editable_columns = editable_columns self.setItemDelegate(ElectrumItemDelegate(self)) self.current_filter = "" self.setRootIsDecorated(False) # remove left margin self.toolbar_shown = False # When figuring out the size of columns, Qt by default looks at # the first 1000 rows (at least if resize mode is QHeaderView.ResizeToContents). # This would be REALLY SLOW, and it's not perfect anyway. # So to speed the UI up considerably, set it to # only look at as many rows as currently visible. self.header().setResizeContentsPrecision(0) def set_editability(self, items): for idx, i in enumerate(items): i.setEditable(idx in self.editable_columns) def selected_in_column(self, column: int): items = self.selectionModel().selectedIndexes() return list(x for x in items if x.column() == column) def current_item_user_role(self, col) -> Optional[QStandardItem]: idx = self.selectionModel().currentIndex() idx = idx.sibling(idx.row(), col) item = self.model().itemFromIndex(idx) if item: return item.data(Qt.UserRole) def set_current_idx(self, set_current: QPersistentModelIndex): if set_current: assert isinstance(set_current, QPersistentModelIndex) assert set_current.isValid() self.selectionModel().select(QModelIndex(set_current), QItemSelectionModel.SelectCurrent) def update_headers(self, headers: Union[List[str], Dict[int, str]]): # headers is either a list of column names, or a dict: (col_idx->col_name) if not isinstance(headers, dict): # convert to dict headers = dict(enumerate(headers)) col_names = [headers[col_idx] for col_idx in sorted(headers.keys())] model = self.model() model.setHorizontalHeaderLabels(col_names) self.header().setStretchLastSection(False) self.header().setDefaultAlignment(Qt.AlignCenter) for col_idx in headers: sm = QHeaderView.Stretch if col_idx == self.stretch_column else QHeaderView.ResizeToContents self.header().setSectionResizeMode(col_idx, sm) def keyPressEvent(self, event): if self.itemDelegate().opened: return if event.key() in [ Qt.Key_F2, Qt.Key_Return ]: self.on_activated(self.selectionModel().currentIndex()) return super().keyPressEvent(event) def on_activated(self, idx): # on 'enter' we show the menu pt = self.visualRect(idx).bottomLeft() pt.setX(50) self.customContextMenuRequested.emit(pt) def edit(self, idx, trigger=QAbstractItemView.AllEditTriggers, event=None): """ this is to prevent: edit: editing failed from inside qt """ return super().edit(idx, trigger, event) def on_edited(self, idx: QModelIndex, user_role, text): self.parent.wallet.set_label(user_role, text) self.parent.history_model.refresh('on_edited in MyTreeView') self.parent.update_completions() def should_hide(self, row): """ row_num is for self.model(). So if there is a proxy, it is the row number in that! """ return False def text_txid_from_coordinate(self, row_num, column): assert not isinstance(self.model(), QSortFilterProxyModel) idx = self.model().index(row_num, column) item = self.model().itemFromIndex(idx) user_role = item.data(Qt.UserRole) return item.text(), user_role def hide_row(self, row_num): """ row_num is for self.model(). So if there is a proxy, it is the row number in that! """ should_hide = self.should_hide(row_num) if not self.current_filter and should_hide is None: # no filters at all, neither date nor search self.setRowHidden(row_num, QModelIndex(), False) return for column in self.filter_columns: txt, _ = self.text_txid_from_coordinate(row_num, column) txt = txt.lower() if self.current_filter in txt: # the filter matched, but the date filter might apply self.setRowHidden(row_num, QModelIndex(), bool(should_hide)) break else: # we did not find the filter in any columns, hide the item self.setRowHidden(row_num, QModelIndex(), True) def filter(self, p): p = p.lower() self.current_filter = p self.hide_rows() def hide_rows(self): for row in range(self.model().rowCount()): self.hide_row(row) def create_toolbar(self, config=None): hbox = QHBoxLayout() buttons = self.get_toolbar_buttons() for b in buttons: b.setVisible(False) hbox.addWidget(b) hide_button = QPushButton('x') hide_button.setVisible(False) hide_button.pressed.connect(lambda: self.show_toolbar(False, config)) self.toolbar_buttons = buttons + (hide_button,) hbox.addStretch() hbox.addWidget(hide_button) return hbox def save_toolbar_state(self, state, config): pass # implemented in subclasses def show_toolbar(self, state, config=None): if state == self.toolbar_shown: return self.toolbar_shown = state if config: self.save_toolbar_state(state, config) for b in self.toolbar_buttons: b.setVisible(state) if not state: self.on_hide_toolbar() def toggle_toolbar(self, config=None): self.show_toolbar(not self.toolbar_shown, config) class ButtonsWidget(QWidget): def __init__(self): super(QWidget, self).__init__() self.buttons = [] def resizeButtons(self): frameWidth = self.style().pixelMetric(QStyle.PM_DefaultFrameWidth) x = self.rect().right() - frameWidth y = self.rect().bottom() - frameWidth for button in self.buttons: sz = button.sizeHint() x -= sz.width() button.move(x, y - sz.height()) def addButton(self, icon_name, on_click, tooltip): button = QToolButton(self) button.setIcon(read_QIcon(icon_name)) iconSize = QLineEdit().sizeHint().height() - 7 # 3px (button sz - icon sz), 2px borders, 2px padding button.setIconSize(QSize(iconSize, iconSize)) button.setCursor(QCursor(Qt.PointingHandCursor)) button.setStyleSheet("QToolButton { border: none; hover {border: 1px} pressed {border: 1px} padding: 0px; }") button.setVisible(True) button.setToolTip(tooltip) button.clicked.connect(on_click) self.buttons.append(button) return button def addCopyButton(self, app): self.app = app self.addButton("copy.png", self.on_copy, _("Copy to clipboard")) def on_copy(self): self.app.clipboard().setText(self.text()) QToolTip.showText(QCursor.pos(), _("Text copied to clipboard"), self) class ButtonsLineEdit(QLineEdit, ButtonsWidget): def __init__(self, text=None): QLineEdit.__init__(self, text) self.buttons = [] def resizeEvent(self, e): o = QLineEdit.resizeEvent(self, e) self.resizeButtons() return o class ButtonsTextEdit(QPlainTextEdit, ButtonsWidget): def __init__(self, text=None): QPlainTextEdit.__init__(self, text) self.setText = self.setPlainText self.text = self.toPlainText self.buttons = [] def resizeEvent(self, e): o = QPlainTextEdit.resizeEvent(self, e) self.resizeButtons() return o class TaskThread(QThread): '''Thread that runs background tasks. Callbacks are guaranteed to happen in the context of its parent.''' class Task(NamedTuple): task: Callable cb_success: Optional[Callable] cb_done: Optional[Callable] cb_error: Optional[Callable] doneSig = pyqtSignal(object, object, object) def __init__(self, parent, on_error=None): super(TaskThread, self).__init__(parent) self.on_error = on_error self.tasks = queue.Queue() self.doneSig.connect(self.on_done) self.start() def add(self, task, on_success=None, on_done=None, on_error=None): on_error = on_error or self.on_error self.tasks.put(TaskThread.Task(task, on_success, on_done, on_error)) def run(self): while True: task = self.tasks.get() # type: TaskThread.Task if not task: break try: result = task.task() self.doneSig.emit(result, task.cb_done, task.cb_success) except BaseException: self.doneSig.emit(sys.exc_info(), task.cb_done, task.cb_error) def on_done(self, result, cb_done, cb_result): # This runs in the parent's thread. if cb_done: cb_done() if cb_result: cb_result(result) def stop(self): self.tasks.put(None) class ColorSchemeItem: def __init__(self, fg_color, bg_color): self.colors = (fg_color, bg_color) def _get_color(self, background): return self.colors[(int(background) + int(ColorScheme.dark_scheme)) % 2] def as_stylesheet(self, background=False): css_prefix = "background-" if background else "" color = self._get_color(background) return "QWidget {{ {}color:{}; }}".format(css_prefix, color) def as_color(self, background=False): color = self._get_color(background) return QColor(color) class ColorScheme: dark_scheme = False GREEN = ColorSchemeItem("#117c11", "#8af296") YELLOW = ColorSchemeItem("#897b2a", "#ffff00") RED = ColorSchemeItem("#7c1111", "#f18c8c") BLUE = ColorSchemeItem("#123b7c", "#8cb3f2") DEFAULT = ColorSchemeItem("#818181", "white") @staticmethod def has_dark_background(widget): brightness = sum(widget.palette().color(QPalette.Background).getRgb()[0:3]) return brightness < (255*3/2) @staticmethod def update_from_widget(widget, force_dark=False): if force_dark or ColorScheme.has_dark_background(widget): ColorScheme.dark_scheme = True class AcceptFileDragDrop: def __init__(self, file_type=""): assert isinstance(self, QWidget) self.setAcceptDrops(True) self.file_type = file_type def validateEvent(self, event): if not event.mimeData().hasUrls(): event.ignore() return False for url in event.mimeData().urls(): if not url.toLocalFile().endswith(self.file_type): event.ignore() return False event.accept() return True def dragEnterEvent(self, event): self.validateEvent(event) def dragMoveEvent(self, event): if self.validateEvent(event): event.setDropAction(Qt.CopyAction) def dropEvent(self, event): if self.validateEvent(event): for url in event.mimeData().urls(): self.onFileAdded(url.toLocalFile()) def onFileAdded(self, fn): raise NotImplementedError() def import_meta_gui(electrum_window, title, importer, on_success): filter_ = "JSON (*.json);;All files (*)" filename = electrum_window.getOpenFileName(_("Open {} file").format(title), filter_) if not filename: return try: importer(filename) except FileImportFailed as e: electrum_window.show_critical(str(e)) else: electrum_window.show_message(_("Your {} were successfully imported").format(title)) on_success() def export_meta_gui(electrum_window, title, exporter): filter_ = "JSON (*.json);;All files (*)" filename = electrum_window.getSaveFileName(_("Select file to save your {}").format(title), 'electrum_{}.json'.format(title), filter_) if not filename: return try: exporter(filename) except FileExportFailed as e: electrum_window.show_critical(str(e)) else: electrum_window.show_message(_("Your {0} were exported to '{1}'") .format(title, str(filename))) def get_parent_main_window(widget): """Returns a reference to the ElectrumWindow this widget belongs to.""" from .main_window import ElectrumWindow for _ in range(100): if widget is None: return None if not isinstance(widget, ElectrumWindow): widget = widget.parentWidget() else: return widget return None def icon_path(icon_basename): return resource_path('gui', 'icons', icon_basename) @lru_cache(maxsize=1000) def read_QIcon(icon_basename): return QIcon(icon_path(icon_basename)) def get_default_language(): name = QLocale.system().name() return name if name in languages else 'en_UK' class FromList(QTreeWidget): def __init__(self, parent, create_menu): super().__init__(parent) self.setHeaderHidden(True) self.setMaximumHeight(300) self.setContextMenuPolicy(Qt.CustomContextMenu) self.customContextMenuRequested.connect(create_menu) self.setUniformRowHeights(True) # remove left margin self.setRootIsDecorated(False) self.setColumnCount(2) self.header().setStretchLastSection(False) sm = QHeaderView.ResizeToContents self.header().setSectionResizeMode(0, sm) self.header().setSectionResizeMode(1, sm) if __name__ == "__main__": app = QApplication([]) t = WaitingDialog(None, 'testing ...', lambda: [time.sleep(1)], lambda x: QMessageBox.information(None, 'done', "done")) t.start() app.exec_()

34.180851

124

0.63869

import asyncio import os.path import time import sys import platform import queue import traceback from functools import partial, lru_cache from typing import NamedTuple, Callable, Optional, TYPE_CHECKING, Union, List, Dict from PyQt5.QtGui import (QFont, QColor, QCursor, QPixmap, QStandardItem, QPalette, QIcon) from PyQt5.QtCore import (Qt, QPersistentModelIndex, QModelIndex, pyqtSignal, QCoreApplication, QItemSelectionModel, QThread, QSortFilterProxyModel, QSize, QLocale) from PyQt5.QtWidgets import (QPushButton, QLabel, QMessageBox, QHBoxLayout, QAbstractItemView, QVBoxLayout, QLineEdit, QStyle, QDialog, QGroupBox, QButtonGroup, QRadioButton, QFileDialog, QWidget, QToolButton, QTreeView, QPlainTextEdit, QHeaderView, QApplication, QToolTip, QTreeWidget, QStyledItemDelegate) from electrum_dash.i18n import _, languages from electrum_dash.util import (FileImportFailed, FileExportFailed, resource_path) from electrum_dash.paymentrequest import PR_UNPAID, PR_PAID, PR_EXPIRED if TYPE_CHECKING: from .main_window import ElectrumWindow if platform.system() == 'Windows': if platform.release() in ['7', '8', '10']: MONOSPACE_FONT = 'Consolas' else: MONOSPACE_FONT = 'Lucida Console' elif platform.system() == 'Darwin': MONOSPACE_FONT = 'Menlo' else: MONOSPACE_FONT = 'monospace' dialogs = [] pr_icons = { PR_UNPAID:"unpaid.png", PR_PAID:"confirmed.png", PR_EXPIRED:"expired.png" } pr_tooltips = { PR_UNPAID:_('Pending'), PR_PAID:_('Paid'), PR_EXPIRED:_('Expired') } expiration_values = [ (_('1 hour'), 60*60), (_('1 day'), 24*60*60), (_('1 week'), 7*24*60*60), (_('Never'), None) ] class EnterButton(QPushButton): def __init__(self, text, func): QPushButton.__init__(self, text) self.func = func self.clicked.connect(func) def keyPressEvent(self, e): if e.key() == Qt.Key_Return: self.func() class ThreadedButton(QPushButton): def __init__(self, text, task, on_success=None, on_error=None): QPushButton.__init__(self, text) self.task = task self.on_success = on_success self.on_error = on_error self.clicked.connect(self.run_task) def run_task(self): self.setEnabled(False) self.thread = TaskThread(self) self.thread.add(self.task, self.on_success, self.done, self.on_error) def done(self): self.setEnabled(True) self.thread.stop() class WWLabel(QLabel): def __init__ (self, text="", parent=None): QLabel.__init__(self, text, parent) self.setWordWrap(True) class HelpLabel(QLabel): def __init__(self, text, help_text): QLabel.__init__(self, text) self.help_text = help_text self.app = QCoreApplication.instance() self.font = QFont() def mouseReleaseEvent(self, x): QMessageBox.information(self, 'Help', self.help_text) def enterEvent(self, event): self.font.setUnderline(True) self.setFont(self.font) self.app.setOverrideCursor(QCursor(Qt.PointingHandCursor)) return QLabel.enterEvent(self, event) def leaveEvent(self, event): self.font.setUnderline(False) self.setFont(self.font) self.app.setOverrideCursor(QCursor(Qt.ArrowCursor)) return QLabel.leaveEvent(self, event) class HelpButton(QPushButton): def __init__(self, text): QPushButton.__init__(self, '?') self.help_text = text self.setFocusPolicy(Qt.NoFocus) self.setFixedWidth(20) self.clicked.connect(self.onclick) def onclick(self): QMessageBox.information(self, 'Help', self.help_text) class InfoButton(QPushButton): def __init__(self, text): QPushButton.__init__(self, 'Info') self.help_text = text self.setFocusPolicy(Qt.NoFocus) self.setFixedWidth(60) self.clicked.connect(self.onclick) def onclick(self): QMessageBox.information(self, 'Info', self.help_text) class Buttons(QHBoxLayout): def __init__(self, *buttons): QHBoxLayout.__init__(self) self.addStretch(1) for b in buttons: self.addWidget(b) class CloseButton(QPushButton): def __init__(self, dialog): QPushButton.__init__(self, _("Close")) self.clicked.connect(dialog.close) self.setDefault(True) class CopyButton(QPushButton): def __init__(self, text_getter, app): QPushButton.__init__(self, _("Copy")) self.clicked.connect(lambda: app.clipboard().setText(text_getter())) class CopyCloseButton(QPushButton): def __init__(self, text_getter, app, dialog): QPushButton.__init__(self, _("Copy and Close")) self.clicked.connect(lambda: app.clipboard().setText(text_getter())) self.clicked.connect(dialog.close) self.setDefault(True) class OkButton(QPushButton): def __init__(self, dialog, label=None): QPushButton.__init__(self, label or _("OK")) self.clicked.connect(dialog.accept) self.setDefault(True) class CancelButton(QPushButton): def __init__(self, dialog, label=None): QPushButton.__init__(self, label or _("Cancel")) self.clicked.connect(dialog.reject) class MessageBoxMixin(object): def top_level_window_recurse(self, window=None, test_func=None): window = window or self classes = (WindowModalDialog, QMessageBox) if test_func is None: test_func = lambda x: True for n, child in enumerate(window.children()): if isinstance(child, classes) and child.isVisible() \ and test_func(child): return self.top_level_window_recurse(child, test_func=test_func) return window def top_level_window(self, test_func=None): return self.top_level_window_recurse(test_func) def question(self, msg, parent=None, title=None, icon=None): Yes, No = QMessageBox.Yes, QMessageBox.No return self.msg_box(icon or QMessageBox.Question, parent, title or '', msg, buttons=Yes|No, defaultButton=No) == Yes def show_warning(self, msg, parent=None, title=None, **kwargs): return self.msg_box(QMessageBox.Warning, parent, title or _('Warning'), msg, **kwargs) def show_error(self, msg, parent=None, **kwargs): return self.msg_box(QMessageBox.Warning, parent, _('Error'), msg, **kwargs) def show_critical(self, msg, parent=None, title=None, **kwargs): return self.msg_box(QMessageBox.Critical, parent, title or _('Critical Error'), msg, **kwargs) def show_message(self, msg, parent=None, title=None, **kwargs): return self.msg_box(QMessageBox.Information, parent, title or _('Information'), msg, **kwargs) def msg_box(self, icon, parent, title, text, buttons=QMessageBox.Ok, defaultButton=QMessageBox.NoButton, rich_text=False): parent = parent or self.top_level_window() if type(icon) is QPixmap: d = QMessageBox(QMessageBox.Information, title, str(text), buttons, parent) d.setIconPixmap(icon) else: d = QMessageBox(icon, title, str(text), buttons, parent) d.setWindowModality(Qt.WindowModal) d.setDefaultButton(defaultButton) if rich_text: d.setTextInteractionFlags(Qt.TextSelectableByMouse| Qt.LinksAccessibleByMouse) d.setTextFormat(Qt.RichText) else: d.setTextInteractionFlags(Qt.TextSelectableByMouse) d.setTextFormat(Qt.PlainText) return d.exec_() class WindowModalDialog(QDialog, MessageBoxMixin): def __init__(self, parent, title=None): QDialog.__init__(self, parent) self.setWindowModality(Qt.WindowModal) if title: self.setWindowTitle(title) class WaitingDialog(WindowModalDialog): def __init__(self, parent, message, task, on_success=None, on_error=None): assert parent if isinstance(parent, MessageBoxMixin): parent = parent.top_level_window() WindowModalDialog.__init__(self, parent, _("Please wait")) vbox = QVBoxLayout(self) vbox.addWidget(QLabel(message)) self.accepted.connect(self.on_accepted) self.show() self.thread = TaskThread(self) self.thread.finished.connect(self.deleteLater) self.thread.add(task, on_success, self.accept, on_error) def wait(self): self.thread.wait() def on_accepted(self): self.thread.stop() def line_dialog(parent, title, label, ok_label, default=None): dialog = WindowModalDialog(parent, title) dialog.setMinimumWidth(500) l = QVBoxLayout() dialog.setLayout(l) l.addWidget(QLabel(label)) txt = QLineEdit() if default: txt.setText(default) l.addWidget(txt) l.addLayout(Buttons(CancelButton(dialog), OkButton(dialog, ok_label))) if dialog.exec_(): return txt.text() def text_dialog(parent, title, header_layout, ok_label, default=None, allow_multi=False): from .qrtextedit import ScanQRTextEdit dialog = WindowModalDialog(parent, title) dialog.setMinimumWidth(600) l = QVBoxLayout() dialog.setLayout(l) if isinstance(header_layout, str): l.addWidget(QLabel(header_layout)) else: l.addLayout(header_layout) txt = ScanQRTextEdit(allow_multi=allow_multi) if default: txt.setText(default) l.addWidget(txt) l.addLayout(Buttons(CancelButton(dialog), OkButton(dialog, ok_label))) if dialog.exec_(): return txt.toPlainText() class ChoicesLayout(object): def __init__(self, msg, choices, on_clicked=None, checked_index=0): vbox = QVBoxLayout() if len(msg) > 50: vbox.addWidget(WWLabel(msg)) msg = "" gb2 = QGroupBox(msg) vbox.addWidget(gb2) vbox2 = QVBoxLayout() gb2.setLayout(vbox2) self.group = group = QButtonGroup() for i,c in enumerate(choices): button = QRadioButton(gb2) button.setText(c) vbox2.addWidget(button) group.addButton(button) group.setId(button, i) if i==checked_index: button.setChecked(True) if on_clicked: group.buttonClicked.connect(partial(on_clicked, self)) self.vbox = vbox def layout(self): return self.vbox def selected_index(self): return self.group.checkedId() def address_field(addresses): hbox = QHBoxLayout() address_e = QLineEdit() if addresses and len(addresses) > 0: address_e.setText(addresses[0]) else: addresses = [] def func(): try: i = addresses.index(str(address_e.text())) + 1 i = i % len(addresses) address_e.setText(addresses[i]) except ValueError: if addresses and len(addresses) > 0: address_e.setText(addresses[0]) button = QPushButton(_('Address')) button.clicked.connect(func) hbox.addWidget(button) hbox.addWidget(address_e) return hbox, address_e def filename_field(parent, config, defaultname, select_msg): vbox = QVBoxLayout() vbox.addWidget(QLabel(_("Format"))) gb = QGroupBox("format", parent) b1 = QRadioButton(gb) b1.setText(_("CSV")) b1.setChecked(True) b2 = QRadioButton(gb) b2.setText(_("json")) vbox.addWidget(b1) vbox.addWidget(b2) hbox = QHBoxLayout() directory = config.get('io_dir', os.path.expanduser('~')) path = os.path.join( directory, defaultname ) filename_e = QLineEdit() filename_e.setText(path) def func(): text = filename_e.text() _filter = "*.csv" if text.endswith(".csv") else "*.json" if text.endswith(".json") else None p, __ = QFileDialog.getSaveFileName(None, select_msg, text, _filter) if p: filename_e.setText(p) button = QPushButton(_('File')) button.clicked.connect(func) hbox.addWidget(button) hbox.addWidget(filename_e) vbox.addLayout(hbox) def set_csv(v): text = filename_e.text() text = text.replace(".json",".csv") if v else text.replace(".csv",".json") filename_e.setText(text) b1.clicked.connect(lambda: set_csv(True)) b2.clicked.connect(lambda: set_csv(False)) return vbox, filename_e, b1 class ElectrumItemDelegate(QStyledItemDelegate): def __init__(self, tv): super().__init__(tv) self.tv = tv self.opened = None def on_closeEditor(editor: QLineEdit, hint): self.opened = None def on_commitData(editor: QLineEdit): new_text = editor.text() idx = QModelIndex(self.opened) row, col = idx.row(), idx.column() _prior_text, user_role = self.tv.text_txid_from_coordinate(row, col) # check that we didn't forget to set UserRole on an editable field assert user_role is not None, (row, col) self.tv.on_edited(idx, user_role, new_text) self.closeEditor.connect(on_closeEditor) self.commitData.connect(on_commitData) def createEditor(self, parent, option, idx): self.opened = QPersistentModelIndex(idx) return super().createEditor(parent, option, idx) class MyTreeView(QTreeView): def __init__(self, parent: 'ElectrumWindow', create_menu, stretch_column=None, editable_columns=None): super().__init__(parent) self.parent = parent self.config = self.parent.config self.stretch_column = stretch_column self.setContextMenuPolicy(Qt.CustomContextMenu) self.customContextMenuRequested.connect(create_menu) self.setUniformRowHeights(True) if editable_columns is None: editable_columns = {stretch_column} else: editable_columns = set(editable_columns) self.editable_columns = editable_columns self.setItemDelegate(ElectrumItemDelegate(self)) self.current_filter = "" self.setRootIsDecorated(False) self.toolbar_shown = False # So to speed the UI up considerably, set it to # only look at as many rows as currently visible. self.header().setResizeContentsPrecision(0) def set_editability(self, items): for idx, i in enumerate(items): i.setEditable(idx in self.editable_columns) def selected_in_column(self, column: int): items = self.selectionModel().selectedIndexes() return list(x for x in items if x.column() == column) def current_item_user_role(self, col) -> Optional[QStandardItem]: idx = self.selectionModel().currentIndex() idx = idx.sibling(idx.row(), col) item = self.model().itemFromIndex(idx) if item: return item.data(Qt.UserRole) def set_current_idx(self, set_current: QPersistentModelIndex): if set_current: assert isinstance(set_current, QPersistentModelIndex) assert set_current.isValid() self.selectionModel().select(QModelIndex(set_current), QItemSelectionModel.SelectCurrent) def update_headers(self, headers: Union[List[str], Dict[int, str]]): # headers is either a list of column names, or a dict: (col_idx->col_name) if not isinstance(headers, dict): # convert to dict headers = dict(enumerate(headers)) col_names = [headers[col_idx] for col_idx in sorted(headers.keys())] model = self.model() model.setHorizontalHeaderLabels(col_names) self.header().setStretchLastSection(False) self.header().setDefaultAlignment(Qt.AlignCenter) for col_idx in headers: sm = QHeaderView.Stretch if col_idx == self.stretch_column else QHeaderView.ResizeToContents self.header().setSectionResizeMode(col_idx, sm) def keyPressEvent(self, event): if self.itemDelegate().opened: return if event.key() in [ Qt.Key_F2, Qt.Key_Return ]: self.on_activated(self.selectionModel().currentIndex()) return super().keyPressEvent(event) def on_activated(self, idx): # on 'enter' we show the menu pt = self.visualRect(idx).bottomLeft() pt.setX(50) self.customContextMenuRequested.emit(pt) def edit(self, idx, trigger=QAbstractItemView.AllEditTriggers, event=None): return super().edit(idx, trigger, event) def on_edited(self, idx: QModelIndex, user_role, text): self.parent.wallet.set_label(user_role, text) self.parent.history_model.refresh('on_edited in MyTreeView') self.parent.update_completions() def should_hide(self, row): return False def text_txid_from_coordinate(self, row_num, column): assert not isinstance(self.model(), QSortFilterProxyModel) idx = self.model().index(row_num, column) item = self.model().itemFromIndex(idx) user_role = item.data(Qt.UserRole) return item.text(), user_role def hide_row(self, row_num): should_hide = self.should_hide(row_num) if not self.current_filter and should_hide is None: # no filters at all, neither date nor search self.setRowHidden(row_num, QModelIndex(), False) return for column in self.filter_columns: txt, _ = self.text_txid_from_coordinate(row_num, column) txt = txt.lower() if self.current_filter in txt: # the filter matched, but the date filter might apply self.setRowHidden(row_num, QModelIndex(), bool(should_hide)) break else: # we did not find the filter in any columns, hide the item self.setRowHidden(row_num, QModelIndex(), True) def filter(self, p): p = p.lower() self.current_filter = p self.hide_rows() def hide_rows(self): for row in range(self.model().rowCount()): self.hide_row(row) def create_toolbar(self, config=None): hbox = QHBoxLayout() buttons = self.get_toolbar_buttons() for b in buttons: b.setVisible(False) hbox.addWidget(b) hide_button = QPushButton('x') hide_button.setVisible(False) hide_button.pressed.connect(lambda: self.show_toolbar(False, config)) self.toolbar_buttons = buttons + (hide_button,) hbox.addStretch() hbox.addWidget(hide_button) return hbox def save_toolbar_state(self, state, config): pass # implemented in subclasses def show_toolbar(self, state, config=None): if state == self.toolbar_shown: return self.toolbar_shown = state if config: self.save_toolbar_state(state, config) for b in self.toolbar_buttons: b.setVisible(state) if not state: self.on_hide_toolbar() def toggle_toolbar(self, config=None): self.show_toolbar(not self.toolbar_shown, config) class ButtonsWidget(QWidget): def __init__(self): super(QWidget, self).__init__() self.buttons = [] def resizeButtons(self): frameWidth = self.style().pixelMetric(QStyle.PM_DefaultFrameWidth) x = self.rect().right() - frameWidth y = self.rect().bottom() - frameWidth for button in self.buttons: sz = button.sizeHint() x -= sz.width() button.move(x, y - sz.height()) def addButton(self, icon_name, on_click, tooltip): button = QToolButton(self) button.setIcon(read_QIcon(icon_name)) iconSize = QLineEdit().sizeHint().height() - 7 # 3px (button sz - icon sz), 2px borders, 2px padding button.setIconSize(QSize(iconSize, iconSize)) button.setCursor(QCursor(Qt.PointingHandCursor)) button.setStyleSheet("QToolButton { border: none; hover {border: 1px} pressed {border: 1px} padding: 0px; }") button.setVisible(True) button.setToolTip(tooltip) button.clicked.connect(on_click) self.buttons.append(button) return button def addCopyButton(self, app): self.app = app self.addButton("copy.png", self.on_copy, _("Copy to clipboard")) def on_copy(self): self.app.clipboard().setText(self.text()) QToolTip.showText(QCursor.pos(), _("Text copied to clipboard"), self) class ButtonsLineEdit(QLineEdit, ButtonsWidget): def __init__(self, text=None): QLineEdit.__init__(self, text) self.buttons = [] def resizeEvent(self, e): o = QLineEdit.resizeEvent(self, e) self.resizeButtons() return o class ButtonsTextEdit(QPlainTextEdit, ButtonsWidget): def __init__(self, text=None): QPlainTextEdit.__init__(self, text) self.setText = self.setPlainText self.text = self.toPlainText self.buttons = [] def resizeEvent(self, e): o = QPlainTextEdit.resizeEvent(self, e) self.resizeButtons() return o class TaskThread(QThread): class Task(NamedTuple): task: Callable cb_success: Optional[Callable] cb_done: Optional[Callable] cb_error: Optional[Callable] doneSig = pyqtSignal(object, object, object) def __init__(self, parent, on_error=None): super(TaskThread, self).__init__(parent) self.on_error = on_error self.tasks = queue.Queue() self.doneSig.connect(self.on_done) self.start() def add(self, task, on_success=None, on_done=None, on_error=None): on_error = on_error or self.on_error self.tasks.put(TaskThread.Task(task, on_success, on_done, on_error)) def run(self): while True: task = self.tasks.get() # type: TaskThread.Task if not task: break try: result = task.task() self.doneSig.emit(result, task.cb_done, task.cb_success) except BaseException: self.doneSig.emit(sys.exc_info(), task.cb_done, task.cb_error) def on_done(self, result, cb_done, cb_result): # This runs in the parent's thread. if cb_done: cb_done() if cb_result: cb_result(result) def stop(self): self.tasks.put(None) class ColorSchemeItem: def __init__(self, fg_color, bg_color): self.colors = (fg_color, bg_color) def _get_color(self, background): return self.colors[(int(background) + int(ColorScheme.dark_scheme)) % 2] def as_stylesheet(self, background=False): css_prefix = "background-" if background else "" color = self._get_color(background) return "QWidget {{ {}color:{}; }}".format(css_prefix, color) def as_color(self, background=False): color = self._get_color(background) return QColor(color) class ColorScheme: dark_scheme = False GREEN = ColorSchemeItem("#117c11", "#8af296") YELLOW = ColorSchemeItem("#897b2a", "#ffff00") RED = ColorSchemeItem("#7c1111", "#f18c8c") BLUE = ColorSchemeItem("#123b7c", "#8cb3f2") DEFAULT = ColorSchemeItem("#818181", "white") @staticmethod def has_dark_background(widget): brightness = sum(widget.palette().color(QPalette.Background).getRgb()[0:3]) return brightness < (255*3/2) @staticmethod def update_from_widget(widget, force_dark=False): if force_dark or ColorScheme.has_dark_background(widget): ColorScheme.dark_scheme = True class AcceptFileDragDrop: def __init__(self, file_type=""): assert isinstance(self, QWidget) self.setAcceptDrops(True) self.file_type = file_type def validateEvent(self, event): if not event.mimeData().hasUrls(): event.ignore() return False for url in event.mimeData().urls(): if not url.toLocalFile().endswith(self.file_type): event.ignore() return False event.accept() return True def dragEnterEvent(self, event): self.validateEvent(event) def dragMoveEvent(self, event): if self.validateEvent(event): event.setDropAction(Qt.CopyAction) def dropEvent(self, event): if self.validateEvent(event): for url in event.mimeData().urls(): self.onFileAdded(url.toLocalFile()) def onFileAdded(self, fn): raise NotImplementedError() def import_meta_gui(electrum_window, title, importer, on_success): filter_ = "JSON (*.json);;All files (*)" filename = electrum_window.getOpenFileName(_("Open {} file").format(title), filter_) if not filename: return try: importer(filename) except FileImportFailed as e: electrum_window.show_critical(str(e)) else: electrum_window.show_message(_("Your {} were successfully imported").format(title)) on_success() def export_meta_gui(electrum_window, title, exporter): filter_ = "JSON (*.json);;All files (*)" filename = electrum_window.getSaveFileName(_("Select file to save your {}").format(title), 'electrum_{}.json'.format(title), filter_) if not filename: return try: exporter(filename) except FileExportFailed as e: electrum_window.show_critical(str(e)) else: electrum_window.show_message(_("Your {0} were exported to '{1}'") .format(title, str(filename))) def get_parent_main_window(widget): from .main_window import ElectrumWindow for _ in range(100): if widget is None: return None if not isinstance(widget, ElectrumWindow): widget = widget.parentWidget() else: return widget return None def icon_path(icon_basename): return resource_path('gui', 'icons', icon_basename) @lru_cache(maxsize=1000) def read_QIcon(icon_basename): return QIcon(icon_path(icon_basename)) def get_default_language(): name = QLocale.system().name() return name if name in languages else 'en_UK' class FromList(QTreeWidget): def __init__(self, parent, create_menu): super().__init__(parent) self.setHeaderHidden(True) self.setMaximumHeight(300) self.setContextMenuPolicy(Qt.CustomContextMenu) self.customContextMenuRequested.connect(create_menu) self.setUniformRowHeights(True) self.setRootIsDecorated(False) self.setColumnCount(2) self.header().setStretchLastSection(False) sm = QHeaderView.ResizeToContents self.header().setSectionResizeMode(0, sm) self.header().setSectionResizeMode(1, sm) if __name__ == "__main__": app = QApplication([]) t = WaitingDialog(None, 'testing ...', lambda: [time.sleep(1)], lambda x: QMessageBox.information(None, 'done', "done")) t.start() app.exec_()

true

1c2ffc104a4e49aee23eb6a73b5f88a7f6995938

414

py

Python

ontask/migrations/0018_auto_20180428_1425.py

pinheiroo27/ontask_b

23fee8caf4e1c5694a710a77f3004ca5d9effeac

[ "MIT" ]

33

2017-12-02T04:09:24.000Z

2021-11-07T08:41:57.000Z

ontask/migrations/0018_auto_20180428_1425.py

pinheiroo27/ontask_b

23fee8caf4e1c5694a710a77f3004ca5d9effeac

[ "MIT" ]

189

2017-11-16T04:06:29.000Z

2022-03-11T23:35:59.000Z

ontask/migrations/0018_auto_20180428_1425.py

pinheiroo27/ontask_b

23fee8caf4e1c5694a710a77f3004ca5d9effeac

[ "MIT" ]

30

2017-11-30T03:35:44.000Z

2022-01-31T03:08:08.000Z

# -*- coding: utf-8 -*- # Generated by Django 1.11.12 on 2018-04-28 04:25 from __future__ import unicode_literals from django.db import migrations class Migration(migrations.Migration): dependencies = [ ('ontask', '0017_auto_20180417_1557'), ] operations = [ migrations.AlterModelOptions( name='column', options={'ordering': ('-is_key',)}, ), ]

20.7

49

0.608696

from __future__ import unicode_literals from django.db import migrations class Migration(migrations.Migration): dependencies = [ ('ontask', '0017_auto_20180417_1557'), ] operations = [ migrations.AlterModelOptions( name='column', options={'ordering': ('-is_key',)}, ), ]

true

1c2ffc8083c9d545f112d5983231edff751831f7

3,172

py

Python

tests/test_record.py

cyemeng/python-little_r

13aa985c9fd89106acc6260e6c4eeb4eb99111af

[ "BSD-3-Clause" ]

7

2018-03-19T01:39:37.000Z

2022-01-09T09:19:30.000Z

tests/test_record.py

cyemeng/python-little_r

13aa985c9fd89106acc6260e6c4eeb4eb99111af

[ "BSD-3-Clause" ]

null

tests/test_record.py

cyemeng/python-little_r

13aa985c9fd89106acc6260e6c4eeb4eb99111af

[ "BSD-3-Clause" ]

4

2020-03-20T09:19:59.000Z

2022-01-09T07:49:50.000Z

import unittest from datetime import datetime from little_r import Record class TestRecord(unittest.TestCase): def create_sample_record(self, **kwargs): ''' Creates a toy record.abs ''' return Record('TestName', 100, 50, None, datetime(2017, 1, 1, 18, 30, 0), **kwargs) def test_getitem(self): r = self.create_sample_record(temperature=100.0) self.assertEqual(r['temperature'], 100.0) def test_setitem(self): r = Record('TestName', 100, 50, None, '2017-01-01') r['temperature'] = 100.0 self.assertEqual(r['temperature'], 100.0) def test_setitem_ignores_unknown(self): r = self.create_sample_record() with self.assertRaises(KeyError): r['something'] = 100.0 def test_date_format(self): r = self.create_sample_record() self.assertEqual(r.get_formated_time(), '20170101183000') def test_end_of_record(self): r = self.create_sample_record() self.assertEqual(r.end_of_message_line(), ' 1 0 0') def test_data_field_all_empty(self): r = self.create_sample_record() expected_output = '-888888.00000 0-888888.00000 0-888888.00000 0-888888.00000 0-888888.00000 0-888888.00000 0-888888.00000 0-888888.00000 0-888888.00000 0-888888.00000 0' self.assertEqual(r.data_record(), expected_output) def test_data_field_one_set(self): r = self.create_sample_record() r['temperature'] = 453.14999 expected_output = '-888888.00000 0-888888.00000 0 453.14999 0-888888.00000 0-888888.00000 0-888888.00000 0-888888.00000 0-888888.00000 0-888888.00000 0-888888.00000 0' self.assertEqual(r.data_record(), expected_output) def test_closing_line(self): r = self.create_sample_record() expected_output = '-777777.00000 0-777777.00000 0 1.00000 0-888888.00000 0-888888.00000 0-888888.00000 0-888888.00000 0-888888.00000 0-888888.00000 0-888888.00000 0' self.assertEqual(r.data_closing_line(), expected_output) def test_generate_header(self): self.maxDiff = None r = Record('Chieti 14.181 42.377 ', 42.377, 14.181, None, datetime(2011, 10, 25, 6, 30, 0)) # expected_output = ' 42.37700 14.18100Chieti 14.181 42.377 xxxxxxxxxxxxxxxxxxxSURFACE DATA FROM MY DATABASExxxxxxxxxxxFM-12 SYNOPxxxxxxxxxxxxxxxxxxxxxxxxxxxxxI did itxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxx -888888.00000 6 0 0 0 0 F F F -888888 -888888 20111025063000-888888.00000 0-888888.00000 0-888888.00000 0-888888.00000 0-888888.00000 0-888888.00000 0-888888.00000 0-888888.00000 0-888888.00000 0-888888.00000 0-888888.00000 0-888888.00000 0-888888.00000 0' # Just check the lenght self.assertEqual(len(r.message_header()), 600) if __name__ == '__main__': unittest.main()

38.216867

630

0.613178

import unittest from datetime import datetime from little_r import Record class TestRecord(unittest.TestCase): def create_sample_record(self, **kwargs): return Record('TestName', 100, 50, None, datetime(2017, 1, 1, 18, 30, 0), **kwargs) def test_getitem(self): r = self.create_sample_record(temperature=100.0) self.assertEqual(r['temperature'], 100.0) def test_setitem(self): r = Record('TestName', 100, 50, None, '2017-01-01') r['temperature'] = 100.0 self.assertEqual(r['temperature'], 100.0) def test_setitem_ignores_unknown(self): r = self.create_sample_record() with self.assertRaises(KeyError): r['something'] = 100.0 def test_date_format(self): r = self.create_sample_record() self.assertEqual(r.get_formated_time(), '20170101183000') def test_end_of_record(self): r = self.create_sample_record() self.assertEqual(r.end_of_message_line(), ' 1 0 0') def test_data_field_all_empty(self): r = self.create_sample_record() expected_output = '-888888.00000 0-888888.00000 0-888888.00000 0-888888.00000 0-888888.00000 0-888888.00000 0-888888.00000 0-888888.00000 0-888888.00000 0-888888.00000 0' self.assertEqual(r.data_record(), expected_output) def test_data_field_one_set(self): r = self.create_sample_record() r['temperature'] = 453.14999 expected_output = '-888888.00000 0-888888.00000 0 453.14999 0-888888.00000 0-888888.00000 0-888888.00000 0-888888.00000 0-888888.00000 0-888888.00000 0-888888.00000 0' self.assertEqual(r.data_record(), expected_output) def test_closing_line(self): r = self.create_sample_record() expected_output = '-777777.00000 0-777777.00000 0 1.00000 0-888888.00000 0-888888.00000 0-888888.00000 0-888888.00000 0-888888.00000 0-888888.00000 0-888888.00000 0' self.assertEqual(r.data_closing_line(), expected_output) def test_generate_header(self): self.maxDiff = None r = Record('Chieti 14.181 42.377 ', 42.377, 14.181, None, datetime(2011, 10, 25, 6, 30, 0)) self.assertEqual(len(r.message_header()), 600) if __name__ == '__main__': unittest.main()

true

1c2ffd8667949f55ea8e8b7327d6c14a76c3d52e

3,425

py

Python

gtts/utils.py

scottgigante/gTTS

f17c6d5affc68464f2fc4498cc51b61e8cb704d1

[ "MIT" ]

null

gtts/utils.py

scottgigante/gTTS

f17c6d5affc68464f2fc4498cc51b61e8cb704d1

[ "MIT" ]

null

gtts/utils.py

scottgigante/gTTS

f17c6d5affc68464f2fc4498cc51b61e8cb704d1

[ "MIT" ]

null

# -*- coding: utf-8 -*- from .tokenizer.symbols import ALL_PUNC as punc from string import whitespace as ws import re _ALL_PUNC_OR_SPACE = re.compile(u"^[{}]*$".format(re.escape(punc + ws))) """Regex that matches if an entire line is only comprised of whitespace and punctuation """ def _minimize(the_string, delim, max_size): """Recursively split a string in the largest chunks possible from the highest position of a delimiter all the way to a maximum size Args: the_string (string): The string to split. delim (string): The delimiter to split on. max_size (int): The maximum size of a chunk. Returns: list: the minimized string in tokens Every chunk size will be at minimum ``the_string[0:idx]`` where ``idx`` is the highest index of ``delim`` found in ``the_string``; and at maximum ``the_string[0:max_size]`` if no ``delim`` was found in ``the_string``. In the latter case, the split will occur at ``the_string[max_size]`` which can be any character. The function runs itself again on the rest of ``the_string`` (``the_string[idx:]``) until no chunk is larger than ``max_size``. """ # Remove `delim` from start of `the_string` # i.e. prevent a recursive infinite loop on `the_string[0:0]` # if `the_string` starts with `delim` and is larger than `max_size` if the_string.startswith(delim): the_string = the_string[_len(delim):] if _len(the_string) > max_size: try: # Find the highest index of `delim` in `the_string[0:max_size]` # i.e. `the_string` will be cut in half on `delim` index idx = the_string.rindex(delim, 0, max_size) except ValueError: # `delim` not found in `the_string`, index becomes `max_size` # i.e. `the_string` will be cut in half arbitrarily on `max_size` idx = max_size # Call itself again for `the_string[idx:]` return [the_string[:idx]] + \ _minimize(the_string[idx:], delim, max_size) else: return [the_string] def _len(text): """Same as ``len(text)`` for a string but that decodes ``text`` first in Python 2.x Args: text (string): String to get the size of. Returns: int: The size of the string. """ try: # Python 2 return len(unicode(text)) except NameError: # pragma: no cover # Python 3 return len(text) def _clean_tokens(tokens): """Clean a list of strings Args: tokens (list): A list of strings (tokens) to clean. Returns: list: Stripped strings ``tokens`` without the original elements that only consisted of whitespace and/or punctuation characters. """ return [t.strip() for t in tokens if not _ALL_PUNC_OR_SPACE.match(t)] def _translate_url(tld="com", path=""): """Generates a Google Translate URL Args: tld (string): Top-level domain for the Google Translate host, i.e ``https://translate.google.<tld>``. Default is ``com``. path: (string): A path to append to the Google Translate host, i.e ``https://translate.google.com/<path>``. Default is ``""``. Returns: string: A Google Translate URL `https://translate.google.<tld>/path` """ _GOOGLE_TTS_URL = "https://translate.google.{}/{}" return _GOOGLE_TTS_URL.format(tld, path)

33.578431

77

0.633577

from .tokenizer.symbols import ALL_PUNC as punc from string import whitespace as ws import re _ALL_PUNC_OR_SPACE = re.compile(u"^[{}]*$".format(re.escape(punc + ws))) def _minimize(the_string, delim, max_size): if the_string.startswith(delim): the_string = the_string[_len(delim):] if _len(the_string) > max_size: try: idx = the_string.rindex(delim, 0, max_size) except ValueError: idx = max_size return [the_string[:idx]] + \ _minimize(the_string[idx:], delim, max_size) else: return [the_string] def _len(text): try: return len(unicode(text)) except NameError: return len(text) def _clean_tokens(tokens): return [t.strip() for t in tokens if not _ALL_PUNC_OR_SPACE.match(t)] def _translate_url(tld="com", path=""): _GOOGLE_TTS_URL = "https://translate.google.{}/{}" return _GOOGLE_TTS_URL.format(tld, path)

true

1c2ffe7d14d648ccda0d61bed0666a3e5eefeaf2

191

py

Python

streaming/urls.py

joelsegoviacrespo/control_aforo_migrado

be90d1d45a20f735e7ef20449c4ab91ca05b5d85

[ "MIT" ]

null

streaming/urls.py

joelsegoviacrespo/control_aforo_migrado

be90d1d45a20f735e7ef20449c4ab91ca05b5d85

[ "MIT" ]

null

streaming/urls.py

joelsegoviacrespo/control_aforo_migrado

be90d1d45a20f735e7ef20449c4ab91ca05b5d85

[ "MIT" ]

null

# -*- encoding: utf-8 -*- from django.urls import path from django.conf.urls import url from streaming import views urlpatterns = [ path('', views.streaming, name='streaming'), ]

23.875

56

0.675393

from django.urls import path from django.conf.urls import url from streaming import views urlpatterns = [ path('', views.streaming, name='streaming'), ]

true

1c2fff320c8eda3af4138c91c695d6aa49179dc9

5,681

py

Python

tests/djinn_regression_example.py

LLNL/DJINN

3dd40a7f3bd179e1e51f7f7a9991faa457b9546a

[ "BSD-Source-Code" ]

32

2018-07-20T00:00:31.000Z

2022-02-18T15:35:04.000Z

tests/djinn_regression_example.py

LLNL/DJINN

3dd40a7f3bd179e1e51f7f7a9991faa457b9546a

[ "BSD-Source-Code" ]

3

2019-09-15T04:34:19.000Z

2021-06-01T16:41:23.000Z

tests/djinn_regression_example.py

LLNL/DJINN

3dd40a7f3bd179e1e51f7f7a9991faa457b9546a

[ "BSD-Source-Code" ]

9

2018-07-22T21:02:25.000Z

2021-04-04T04:57:37.000Z

############################################################################### # Copyright (c) 2018, Lawrence Livermore National Security, LLC. # # Produced at the Lawrence Livermore National Laboratory # # Written by K. Humbird (humbird1@llnl.gov), L. Peterson (peterson76@llnl.gov). # # LLNL-CODE-754815 # # All rights reserved. # # This file is part of DJINN. # # For details, see github.com/LLNL/djinn. # # For details about use and distribution, please read DJINN/LICENSE . ############################################################################### ############################################################################### # Demo script for DJINN # Below, each function available in DJINN is demonstrated for the # Boston housing dataset. Please see comments and djinn docs for # details on each function. ############################################################################### import numpy as np import matplotlib.pyplot as plt import sklearn try: from sklearn.model_selection import train_test_split except: from sklearn.cross_validation import train_test_split from sklearn import datasets from djinn import djinn print(sklearn.__version__) ''' NOTE: for the boston housing data you can expect test MSE~10-20, Mean Abs Err~3-4, Exp.Var.~0.8+ when using get_hyperparameters() function ''' #Load the data, split into training/testing groups d=datasets.load_boston() X=d.data Y=d.target x_train,x_test,y_train,y_test=train_test_split(X, Y, test_size=0.2, random_state=1) print("djinn example") modelname="reg_djinn_test" # name the model ntrees=1 # number of trees = number of neural nets in ensemble maxdepth=4 # max depth of tree -- optimize this for each data set dropout_keep=1.0 # dropout typically set to 1 for non-Bayesian models #initialize the model model=djinn.DJINN_Regressor(ntrees,maxdepth,dropout_keep) # find optimal settings: this function returns dict with hyper-parameters # each djinn function accepts random seeds for reproducible behavior optimal=model.get_hyperparameters(x_train, y_train, random_state=1) batchsize=optimal['batch_size'] learnrate=optimal['learn_rate'] epochs=optimal['epochs'] # train the model with hyperparameters determined above model.train(x_train,y_train,epochs=epochs,learn_rate=learnrate, batch_size=batchsize, display_step=1, save_files=True, file_name=modelname, save_model=True,model_name=modelname, random_state=1) # *note there is a function model.fit(x_train,y_train, ... ) that wraps # get_hyperparameters() and train(), so that you do not have to manually # pass hyperparameters to train(). However, get_hyperparameters() can # be expensive, so I recommend running it once per dataset and using those # hyperparameter values in train() to save computational time # make predictions m=model.predict(x_test) #returns the median prediction if more than one tree #evaluate results mse=sklearn.metrics.mean_squared_error(y_test,m) mabs=sklearn.metrics.mean_absolute_error(y_test,m) exvar=sklearn.metrics.explained_variance_score(y_test,m) print('MSE',mse) print('M Abs Err',mabs) print('Expl. Var.',exvar) #close model model.close_model() print("Reload model and continue training for 20 epochs") # reload model; can also open it using cPickle.load() model2=djinn.load(model_name="reg_djinn_test") #continue training for 20 epochs using same learning rate, etc as before model2.continue_training(x_train, y_train, 20, learnrate, batchsize, random_state=1) #make updated predictions m2=model2.predict(x_test) #evaluate results mse2=sklearn.metrics.mean_squared_error(y_test,m2) mabs2=sklearn.metrics.mean_absolute_error(y_test,m2) exvar2=sklearn.metrics.explained_variance_score(y_test,m2) print('MSE',mse2) print('M Abs Err',mabs2) print('Expl. Var.',exvar2) # Bayesian formulation with dropout. Recommend dropout keep # probability ~0.95, 5-10 trees. print("Bayesian djinn example") ntrees=3 dropout_keep=0.95 modelname="reg_bdjinn_test" # initialize a model bmodel=djinn.DJINN_Regressor(ntrees,maxdepth,dropout_keep) # "fit()" does what get_hyperparameters + train does, in one step: bmodel.fit(x_train,y_train, display_step=1, save_files=True, file_name=modelname, save_model=True,model_name=modelname, random_state=1) # evaluate: niters is the number of times you evaluate the network for # a single sample. higher niters = better resolved distribution of predictions niters=100 bl,bm,bu,results=bmodel.bayesian_predict(x_test,n_iters=niters, random_state=1) # bayesian_predict returns 25, 50, 75 percentile and results dict with all predictions # evaluate performance on median predictions mse=sklearn.metrics.mean_squared_error(y_test,bm) mabs=sklearn.metrics.mean_absolute_error(y_test,bm) exvar=sklearn.metrics.explained_variance_score(y_test,bm) print('MSE',mse) print('M Abs Err',mabs) print('Expl. Var.',exvar) # make a pretty plot yerrors = np.column_stack((bm-bl, bu-bm)).reshape((2,bl.shape[0])) g=np.linspace(np.min(y_test),np.max(y_test),10) fig, axs = plt.subplots(1,1, figsize=(8,8), facecolor='w', edgecolor='k') fig.subplots_adjust(hspace = .15, wspace=.1) sc=axs.scatter(y_test, bm, linewidth=0,s=6, alpha=0.8, c='#68d1ca') a,b,c=axs.errorbar(y_test, bm, yerr=yerrors, marker='',ls='',zorder=0, alpha=0.5, ecolor='black') axs.set_xlabel("True") axs.set_ylabel("B-DJINN Prediction") axs.plot(g,g,color='red') plt.show() # collect_tree_predictions gathers predictions in results dict # in a more intuitive way for easy plotting, etc p=bmodel.collect_tree_predictions(results['predictions'])

36.416667

86

0.718007

true

1c2fffe06ce7975caa39d9f22dfdacf3c33a8984

596

py

Python

examples/chat/server/wsgi.py

maxmzd/django-eventstream

20c5bf68263505f3a4ae4abdc5df71e9790b992c

[ "MIT" ]

null

examples/chat/server/wsgi.py

maxmzd/django-eventstream

20c5bf68263505f3a4ae4abdc5df71e9790b992c

[ "MIT" ]

null

examples/chat/server/wsgi.py

maxmzd/django-eventstream

20c5bf68263505f3a4ae4abdc5df71e9790b992c

[ "MIT" ]

null

""" WSGI config for server project. It exposes the WSGI callable as a module-level variable named ``application``. For more information on this file, see https://docs.djangoproject.com/en/1.11/howto/deployment/wsgi/ """ import os import sys sys.path.append(os.path.dirname(os.path.dirname(os.path.dirname(os.path.dirname(__file__))))) import dotenv from django.core.wsgi import get_wsgi_application dotenv.read_dotenv(os.path.join(os.path.dirname(os.path.dirname(__file__)), '.env')) os.environ.setdefault("DJANGO_SETTINGS_MODULE", "server.settings") application = get_wsgi_application()

25.913043

93

0.778523

import os import sys sys.path.append(os.path.dirname(os.path.dirname(os.path.dirname(os.path.dirname(__file__))))) import dotenv from django.core.wsgi import get_wsgi_application dotenv.read_dotenv(os.path.join(os.path.dirname(os.path.dirname(__file__)), '.env')) os.environ.setdefault("DJANGO_SETTINGS_MODULE", "server.settings") application = get_wsgi_application()

true

1c300254f128afd98e51a0416faca1fd3b346d12

1,315

py

Python

tests/integration/fixtures/__init__.py

ghga-de/datameta-client

f7900027af9d7d1eff23594de79e90e75baa123a

[ "Apache-2.0" ]

1

2021-07-20T12:59:09.000Z

tests/integration/fixtures/__init__.py

ghga-de/datameta-client

f7900027af9d7d1eff23594de79e90e75baa123a

[ "Apache-2.0" ]

11

2021-03-17T20:27:27.000Z

2021-04-07T16:22:55.000Z

tests/integration/fixtures/__init__.py

ghga-de/datameta-client

f7900027af9d7d1eff23594de79e90e75baa123a

[ "Apache-2.0" ]

null

import os import json from random import choice from string import ascii_letters, digits from copy import deepcopy base_dir = os.path.dirname(os.path.abspath(__file__)) # metadataset fixtures: metadataset_record_json_path = os.path.join( base_dir, "test_metadataset_record.json" ) with open(metadataset_record_json_path, "r") as json_file: metadataset_record = json.load(json_file) # change #ID to not fail global uniqueness constraint: #! to be removed: def replace_ID(mset): mset_ = deepcopy(mset) mset_["#ID"] = ( "".join(choice(ascii_letters).upper() for _ in range(2)) + "".join(str(choice(digits)) for _ in range(2)) ) return mset_ from datameta_client import metadatasets def get_fresh_metadataset_id(): mset = replace_ID(metadataset_record) return [ metadatasets.stage( metadata_json=mset )["id"]["uuid"] ] #! to be removed end # file fixtures: storage_path = os.getenv("DATAMETA_STORAGE_PATH") def get_content(path:str): with open(path, "r") as test_file: return test_file.read() files = [ { "name": name, "path": os.path.join(base_dir, name), "content": get_content(os.path.join(base_dir, name)) } for name in os.listdir(base_dir) if "test_file_" in name ]

24.351852

66

0.674525

import os import json from random import choice from string import ascii_letters, digits from copy import deepcopy base_dir = os.path.dirname(os.path.abspath(__file__)) metadataset_record_json_path = os.path.join( base_dir, "test_metadataset_record.json" ) with open(metadataset_record_json_path, "r") as json_file: metadataset_record = json.load(json_file) py(mset) mset_["#ID"] = ( "".join(choice(ascii_letters).upper() for _ in range(2)) + "".join(str(choice(digits)) for _ in range(2)) ) return mset_ from datameta_client import metadatasets def get_fresh_metadataset_id(): mset = replace_ID(metadataset_record) return [ metadatasets.stage( metadata_json=mset )["id"]["uuid"] ] storage_path = os.getenv("DATAMETA_STORAGE_PATH") def get_content(path:str): with open(path, "r") as test_file: return test_file.read() files = [ { "name": name, "path": os.path.join(base_dir, name), "content": get_content(os.path.join(base_dir, name)) } for name in os.listdir(base_dir) if "test_file_" in name ]

true

1c30030b10dc952c82faa3f440dd0221a612d20e

90

py

Python

py-flask/handlers.py

boscoh/rpcseed

4b9040c57f3d273a96f62cb1db931f2105fe0945

[ "MIT" ]

1

2021-05-08T12:38:03.000Z

py-flask/handlers.py

boscoh/rpcseed

4b9040c57f3d273a96f62cb1db931f2105fe0945

[ "MIT" ]

null

py-flask/handlers.py

boscoh/rpcseed

4b9040c57f3d273a96f62cb1db931f2105fe0945

[ "MIT" ]

null

config = {} def setConfig(k, v): config[k] = v def getConfig(): return config

9

20

0.577778

config = {} def setConfig(k, v): config[k] = v def getConfig(): return config

true

1c30049f639b04b25fc3ecb5c6ec0973f6e2a51a

1,687

py

Python

donkeycar/tests/test_tub.py

walzimmer/donkey

b73596400040ce881c0a319b0a4cc3cbd05226da

[ "MIT" ]

null

donkeycar/tests/test_tub.py

walzimmer/donkey

b73596400040ce881c0a319b0a4cc3cbd05226da

[ "MIT" ]

null

donkeycar/tests/test_tub.py

walzimmer/donkey

b73596400040ce881c0a319b0a4cc3cbd05226da

[ "MIT" ]

null

# -*- coding: utf-8 -*- import tempfile import unittest from donkeycar.parts.datastore import TubWriter, Tub import os import pytest #fixtures from .setup import tub, tub_path def test_tub_load(tub, tub_path): """Tub loads from existing tub path.""" t = Tub(tub_path) assert t is not None def test_tub_update_df(tub): """ Tub updats its dataframe """ tub.update_df() assert len(tub.df) == 128 def test_tub_add_record(tub): """Tub can save a record and then retrieve it.""" import numpy as np #img_arr = np.zeros((120,160)) img_arr = np.zeros((240, 320)) x=123 y=90 rec_in = {'cam/image_array': img_arr, 'user/angle': x, 'user/throttle':y} rec_index = tub.put_record(rec_in) rec_out = tub.get_record(rec_index) assert rec_in.keys() == rec_out.keys() class TestTubWriter(unittest.TestCase): def setUp(self): tempfolder = tempfile.TemporaryDirectory() self.path = os.path.join(tempfolder.name, 'new') self.inputs = ['name', 'age', 'pic'] self.types = ['str', 'float', 'str'] def test_tub_create(self): tub = TubWriter(self.path, inputs=self.inputs, types=self.types) def test_tub_path(self): tub = TubWriter(self.path, inputs=self.inputs, types=self.types) tub.run('will', 323, 'asdfasdf') def test_make_paths_absolute(self): tub = Tub(self.path, inputs=['file_path'], types=['image']) rel_file_name = 'test.jpg' record_dict = {'file_path': rel_file_name} abs_record_dict = tub.make_record_paths_absolute(record_dict) assert abs_record_dict['file_path'] == os.path.join(self.path, rel_file_name)

27.209677

85

0.656194

import tempfile import unittest from donkeycar.parts.datastore import TubWriter, Tub import os import pytest from .setup import tub, tub_path def test_tub_load(tub, tub_path): t = Tub(tub_path) assert t is not None def test_tub_update_df(tub): tub.update_df() assert len(tub.df) == 128 def test_tub_add_record(tub): import numpy as np img_arr = np.zeros((240, 320)) x=123 y=90 rec_in = {'cam/image_array': img_arr, 'user/angle': x, 'user/throttle':y} rec_index = tub.put_record(rec_in) rec_out = tub.get_record(rec_index) assert rec_in.keys() == rec_out.keys() class TestTubWriter(unittest.TestCase): def setUp(self): tempfolder = tempfile.TemporaryDirectory() self.path = os.path.join(tempfolder.name, 'new') self.inputs = ['name', 'age', 'pic'] self.types = ['str', 'float', 'str'] def test_tub_create(self): tub = TubWriter(self.path, inputs=self.inputs, types=self.types) def test_tub_path(self): tub = TubWriter(self.path, inputs=self.inputs, types=self.types) tub.run('will', 323, 'asdfasdf') def test_make_paths_absolute(self): tub = Tub(self.path, inputs=['file_path'], types=['image']) rel_file_name = 'test.jpg' record_dict = {'file_path': rel_file_name} abs_record_dict = tub.make_record_paths_absolute(record_dict) assert abs_record_dict['file_path'] == os.path.join(self.path, rel_file_name)

true

1c3004d1094d9967cccd10a343c6ff1e02fc35ab

401

py

Python

main_project/wsgi.py

rohithb/oneeightyone

c626ae1a8d91ac5650a9af7b9050c3522f0cde71

[ "MIT" ]

null

main_project/wsgi.py

rohithb/oneeightyone

c626ae1a8d91ac5650a9af7b9050c3522f0cde71

[ "MIT" ]

null

main_project/wsgi.py

rohithb/oneeightyone

c626ae1a8d91ac5650a9af7b9050c3522f0cde71

[ "MIT" ]

null

""" WSGI config for main_project project. It exposes the WSGI callable as a module-level variable named ``application``. For more information on this file, see https://docs.djangoproject.com/en/1.8/howto/deployment/wsgi/ """ import os from django.core.wsgi import get_wsgi_application os.environ.setdefault("DJANGO_SETTINGS_MODULE", "main_project.settings") application = get_wsgi_application()

23.588235

78

0.790524

import os from django.core.wsgi import get_wsgi_application os.environ.setdefault("DJANGO_SETTINGS_MODULE", "main_project.settings") application = get_wsgi_application()

true

1c3006d83d52a83c9deb255edfa04d5bb5aa7d84

8,148

py

Python

src/saml2/authn.py

HaToHo/pysaml2

be15a1e9c5f28cddb28b095f8da720a9f029c5c7

[ "Apache-2.0" ]

null

src/saml2/authn.py

HaToHo/pysaml2

be15a1e9c5f28cddb28b095f8da720a9f029c5c7

[ "Apache-2.0" ]

null

src/saml2/authn.py

HaToHo/pysaml2

be15a1e9c5f28cddb28b095f8da720a9f029c5c7

[ "Apache-2.0" ]

null

import logging import six import time import ldap from saml2 import SAMLError from saml2.aes import AESCipher from saml2.httputil import Response from saml2.httputil import make_cookie from saml2.httputil import Redirect from saml2.httputil import Unauthorized from saml2.httputil import parse_cookie from six.moves.urllib.parse import urlencode, parse_qs, urlsplit __author__ = 'rolandh' logger = logging.getLogger(__name__) class AuthnFailure(SAMLError): pass class EncodeError(SAMLError): pass class UserAuthnMethod(object): def __init__(self, srv): self.srv = srv def __call__(self, *args, **kwargs): raise NotImplemented def authenticated_as(self, **kwargs): raise NotImplemented def verify(self, **kwargs): raise NotImplemented def is_equal(a, b): if len(a) != len(b): return False result = 0 for x, y in zip(a, b): result |= x ^ y return result == 0 def url_encode_params(params=None): if not isinstance(params, dict): raise EncodeError("You must pass in a dictionary!") params_list = [] for k, v in params.items(): if isinstance(v, list): params_list.extend([(k, x) for x in v]) else: params_list.append((k, v)) return urlencode(params_list) def create_return_url(base, query, **kwargs): """ Add a query string plus extra parameters to a base URL which may contain a query part already. :param base: redirect_uri may contain a query part, no fragment allowed. :param query: Old query part as a string :param kwargs: extra query parameters :return: """ part = urlsplit(base) if part.fragment: raise ValueError("Base URL contained parts it shouldn't") for key, values in parse_qs(query).items(): if key in kwargs: if isinstance(kwargs[key], six.string_types): kwargs[key] = [kwargs[key]] kwargs[key].extend(values) else: kwargs[key] = values if part.query: for key, values in parse_qs(part.query).items(): if key in kwargs: if isinstance(kwargs[key], six.string_types): kwargs[key] = [kwargs[key]] kwargs[key].extend(values) else: kwargs[key] = values _pre = base.split("?")[0] else: _pre = base logger.debug("kwargs: %s" % kwargs) return "%s?%s" % (_pre, url_encode_params(kwargs)) class UsernamePasswordMako(UserAuthnMethod): """Do user authentication using the normal username password form using Mako as template system""" cookie_name = "userpassmako" def __init__(self, srv, mako_template, template_lookup, pwd, return_to): """ :param srv: The server instance :param mako_template: Which Mako template to use :param pwd: Username/password dictionary like database :param return_to: Where to send the user after authentication :return: """ UserAuthnMethod.__init__(self, srv) self.mako_template = mako_template self.template_lookup = template_lookup self.passwd = pwd self.return_to = return_to self.active = {} self.query_param = "upm_answer" self.aes = AESCipher(self.srv.symkey, srv.iv) def __call__(self, cookie=None, policy_url=None, logo_url=None, query="", **kwargs): """ Put up the login form """ if cookie: headers = [cookie] else: headers = [] resp = Response(headers=headers) argv = {"login": "", "password": "", "action": "verify", "policy_url": policy_url, "logo_url": logo_url, "query": query} logger.info("do_authentication argv: %s" % argv) mte = self.template_lookup.get_template(self.mako_template) resp.message = mte.render(**argv) return resp def _verify(self, pwd, user): assert is_equal(pwd, self.passwd[user]) def verify(self, request, **kwargs): """ Verifies that the given username and password was correct :param request: Either the query part of a URL a urlencoded body of a HTTP message or a parse such. :param kwargs: Catch whatever else is sent. :return: redirect back to where ever the base applications wants the user after authentication. """ #logger.debug("verify(%s)" % request) if isinstance(request, six.string_types): _dict = parse_qs(request) elif isinstance(request, dict): _dict = request else: raise ValueError("Wrong type of input") # verify username and password try: self._verify(_dict["password"][0], _dict["login"][0]) timestamp = str(int(time.mktime(time.gmtime()))) info = self.aes.encrypt("::".join([_dict["login"][0], timestamp])) self.active[info] = timestamp cookie = make_cookie(self.cookie_name, info, self.srv.seed) return_to = create_return_url(self.return_to, _dict["query"][0], **{self.query_param: "true"}) resp = Redirect(return_to, headers=[cookie]) except (AssertionError, KeyError): resp = Unauthorized("Unknown user or wrong password") return resp def authenticated_as(self, cookie=None, **kwargs): if cookie is None: return None else: logger.debug("kwargs: %s" % kwargs) try: info, timestamp = parse_cookie(self.cookie_name, self.srv.seed, cookie) if self.active[info] == timestamp: uid, _ts = self.aes.decrypt(info).split("::") if timestamp == _ts: return {"uid": uid} except Exception: pass return None def done(self, areq): try: _ = areq[self.query_param] return False except KeyError: return True class SocialService(UserAuthnMethod): def __init__(self, social): UserAuthnMethod.__init__(self, None) self.social = social def __call__(self, server_env, cookie=None, sid="", query="", **kwargs): return self.social.begin(server_env, cookie, sid, query) def callback(self, server_env, cookie=None, sid="", query="", **kwargs): return self.social.callback(server_env, cookie, sid, query, **kwargs) class AuthnMethodChooser(object): def __init__(self, methods=None): self.methods = methods def __call__(self, **kwargs): if not self.methods: raise SAMLError("No authentication methods defined") elif len(self.methods) == 1: return self.methods[0] else: pass # TODO class LDAPAuthn(UsernamePasswordMako): def __init__(self, srv, ldapsrv, return_to, dn_pattern, mako_template, template_lookup): """ :param srv: The server instance :param ldapsrv: Which LDAP server to us :param return_to: Where to send the user after authentication :return: """ UsernamePasswordMako.__init__(self, srv, mako_template, template_lookup, None, return_to) self.ldap = ldap.initialize(ldapsrv) self.ldap.protocol_version = 3 self.ldap.set_option(ldap.OPT_REFERRALS, 0) self.dn_pattern = dn_pattern def _verify(self, pwd, user): """ Verifies the username and password agains a LDAP server :param pwd: The password :param user: The username :return: AssertionError if the LDAP verification failed. """ _dn = self.dn_pattern % user try: self.ldap.simple_bind_s(_dn, pwd) except Exception: raise AssertionError()

30.863636

80

0.592415

import logging import six import time import ldap from saml2 import SAMLError from saml2.aes import AESCipher from saml2.httputil import Response from saml2.httputil import make_cookie from saml2.httputil import Redirect from saml2.httputil import Unauthorized from saml2.httputil import parse_cookie from six.moves.urllib.parse import urlencode, parse_qs, urlsplit __author__ = 'rolandh' logger = logging.getLogger(__name__) class AuthnFailure(SAMLError): pass class EncodeError(SAMLError): pass class UserAuthnMethod(object): def __init__(self, srv): self.srv = srv def __call__(self, *args, **kwargs): raise NotImplemented def authenticated_as(self, **kwargs): raise NotImplemented def verify(self, **kwargs): raise NotImplemented def is_equal(a, b): if len(a) != len(b): return False result = 0 for x, y in zip(a, b): result |= x ^ y return result == 0 def url_encode_params(params=None): if not isinstance(params, dict): raise EncodeError("You must pass in a dictionary!") params_list = [] for k, v in params.items(): if isinstance(v, list): params_list.extend([(k, x) for x in v]) else: params_list.append((k, v)) return urlencode(params_list) def create_return_url(base, query, **kwargs): part = urlsplit(base) if part.fragment: raise ValueError("Base URL contained parts it shouldn't") for key, values in parse_qs(query).items(): if key in kwargs: if isinstance(kwargs[key], six.string_types): kwargs[key] = [kwargs[key]] kwargs[key].extend(values) else: kwargs[key] = values if part.query: for key, values in parse_qs(part.query).items(): if key in kwargs: if isinstance(kwargs[key], six.string_types): kwargs[key] = [kwargs[key]] kwargs[key].extend(values) else: kwargs[key] = values _pre = base.split("?")[0] else: _pre = base logger.debug("kwargs: %s" % kwargs) return "%s?%s" % (_pre, url_encode_params(kwargs)) class UsernamePasswordMako(UserAuthnMethod): cookie_name = "userpassmako" def __init__(self, srv, mako_template, template_lookup, pwd, return_to): UserAuthnMethod.__init__(self, srv) self.mako_template = mako_template self.template_lookup = template_lookup self.passwd = pwd self.return_to = return_to self.active = {} self.query_param = "upm_answer" self.aes = AESCipher(self.srv.symkey, srv.iv) def __call__(self, cookie=None, policy_url=None, logo_url=None, query="", **kwargs): if cookie: headers = [cookie] else: headers = [] resp = Response(headers=headers) argv = {"login": "", "password": "", "action": "verify", "policy_url": policy_url, "logo_url": logo_url, "query": query} logger.info("do_authentication argv: %s" % argv) mte = self.template_lookup.get_template(self.mako_template) resp.message = mte.render(**argv) return resp def _verify(self, pwd, user): assert is_equal(pwd, self.passwd[user]) def verify(self, request, **kwargs): #logger.debug("verify(%s)" % request) if isinstance(request, six.string_types): _dict = parse_qs(request) elif isinstance(request, dict): _dict = request else: raise ValueError("Wrong type of input") # verify username and password try: self._verify(_dict["password"][0], _dict["login"][0]) timestamp = str(int(time.mktime(time.gmtime()))) info = self.aes.encrypt("::".join([_dict["login"][0], timestamp])) self.active[info] = timestamp cookie = make_cookie(self.cookie_name, info, self.srv.seed) return_to = create_return_url(self.return_to, _dict["query"][0], **{self.query_param: "true"}) resp = Redirect(return_to, headers=[cookie]) except (AssertionError, KeyError): resp = Unauthorized("Unknown user or wrong password") return resp def authenticated_as(self, cookie=None, **kwargs): if cookie is None: return None else: logger.debug("kwargs: %s" % kwargs) try: info, timestamp = parse_cookie(self.cookie_name, self.srv.seed, cookie) if self.active[info] == timestamp: uid, _ts = self.aes.decrypt(info).split("::") if timestamp == _ts: return {"uid": uid} except Exception: pass return None def done(self, areq): try: _ = areq[self.query_param] return False except KeyError: return True class SocialService(UserAuthnMethod): def __init__(self, social): UserAuthnMethod.__init__(self, None) self.social = social def __call__(self, server_env, cookie=None, sid="", query="", **kwargs): return self.social.begin(server_env, cookie, sid, query) def callback(self, server_env, cookie=None, sid="", query="", **kwargs): return self.social.callback(server_env, cookie, sid, query, **kwargs) class AuthnMethodChooser(object): def __init__(self, methods=None): self.methods = methods def __call__(self, **kwargs): if not self.methods: raise SAMLError("No authentication methods defined") elif len(self.methods) == 1: return self.methods[0] else: pass # TODO class LDAPAuthn(UsernamePasswordMako): def __init__(self, srv, ldapsrv, return_to, dn_pattern, mako_template, template_lookup): UsernamePasswordMako.__init__(self, srv, mako_template, template_lookup, None, return_to) self.ldap = ldap.initialize(ldapsrv) self.ldap.protocol_version = 3 self.ldap.set_option(ldap.OPT_REFERRALS, 0) self.dn_pattern = dn_pattern def _verify(self, pwd, user): _dn = self.dn_pattern % user try: self.ldap.simple_bind_s(_dn, pwd) except Exception: raise AssertionError()

true

1c3006de92a94f2615760f2a4b6c4585a5947d34

54,344

py

Python

cinder/volume/storwize_svc.py

alexpilotti/cinder

df2f070604dad61738ccd3113016f76f2af20cae

[ "Apache-2.0" ]

null

cinder/volume/storwize_svc.py

alexpilotti/cinder

df2f070604dad61738ccd3113016f76f2af20cae

[ "Apache-2.0" ]

null

cinder/volume/storwize_svc.py

alexpilotti/cinder

df2f070604dad61738ccd3113016f76f2af20cae

[ "Apache-2.0" ]

null

# vim: tabstop=4 shiftwidth=4 softtabstop=4 # Copyright (c) 2012 IBM, Inc. # Copyright (c) 2012 OpenStack LLC. # All Rights Reserved. # # Licensed under the Apache License, Version 2.0 (the "License"); you may # not use this file except in compliance with the License. You may obtain # a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, WITHOUT # WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the # License for the specific language governing permissions and limitations # under the License. # # Authors: # Ronen Kat <ronenkat@il.ibm.com> # Avishay Traeger <avishay@il.ibm.com> """ Volume driver for IBM Storwize V7000 and SVC storage systems. Notes: 1. If you specify both a password and a key file, this driver will use the key file only. 2. When using a key file for authentication, it is up to the user or system administrator to store the private key in a safe manner. 3. The defaults for creating volumes are "-rsize 2% -autoexpand -grainsize 256 -warning 0". These can be changed in the configuration file or by using volume types(recommended only for advanced users). Limitations: 1. The driver was not tested with SVC or clustered configurations of Storwize V7000. 2. The driver expects CLI output in English, error messages may be in a localized format. """ import random import re import string import time from cinder import exception from cinder import flags from cinder.openstack.common import cfg from cinder.openstack.common import excutils from cinder.openstack.common import log as logging from cinder.volume import san LOG = logging.getLogger(__name__) storwize_svc_opts = [ cfg.StrOpt('storwize_svc_volpool_name', default='volpool', help='Storage system storage pool for volumes'), cfg.StrOpt('storwize_svc_vol_rsize', default='2%', help='Storage system space-efficiency parameter for volumes'), cfg.StrOpt('storwize_svc_vol_warning', default='0', help='Storage system threshold for volume capacity warnings'), cfg.BoolOpt('storwize_svc_vol_autoexpand', default=True, help='Storage system autoexpand parameter for volumes ' '(True/False)'), cfg.StrOpt('storwize_svc_vol_grainsize', default='256', help='Storage system grain size parameter for volumes ' '(32/64/128/256)'), cfg.BoolOpt('storwize_svc_vol_compression', default=False, help='Storage system compression option for volumes'), cfg.BoolOpt('storwize_svc_vol_easytier', default=True, help='Enable Easy Tier for volumes'), cfg.StrOpt('storwize_svc_flashcopy_timeout', default='120', help='Maximum number of seconds to wait for FlashCopy to be ' 'prepared. Maximum value is 600 seconds (10 minutes).'), ] FLAGS = flags.FLAGS FLAGS.register_opts(storwize_svc_opts) class StorwizeSVCDriver(san.SanISCSIDriver): """IBM Storwize V7000 and SVC iSCSI volume driver.""" def __init__(self, *args, **kwargs): super(StorwizeSVCDriver, self).__init__(*args, **kwargs) self.iscsi_ipv4_conf = None self.iscsi_ipv6_conf = None # Build cleanup transaltion tables for hosts names to follow valid # host names for Storwizew V7000 and SVC storage systems. invalid_ch_in_host = '' for num in range(0, 128): ch = chr(num) if ((not ch.isalnum()) and (ch != ' ') and (ch != '.') and (ch != '-') and (ch != '_')): invalid_ch_in_host = invalid_ch_in_host + ch self._string_host_name_filter = string.maketrans(invalid_ch_in_host, '-' * len(invalid_ch_in_host)) self._unicode_host_name_filter = dict((ord(unicode(char)), u'-') for char in invalid_ch_in_host) def _get_hdr_dic(self, header, row, delim): """Return CLI row data as a dictionary indexed by names from header. Create a dictionary object from the data row string using the header string. The strings are converted to columns using the delimiter in delim. """ attributes = header.split(delim) values = row.split(delim) self._driver_assert(len(values) == len(attributes), _('_get_hdr_dic: attribute headers and values do not match.\n ' 'Headers: %(header)s\n Values: %(row)s') % {'header': str(header), 'row': str(row)}) dic = {} for attribute, value in map(None, attributes, values): dic[attribute] = value return dic def _driver_assert(self, assert_condition, exception_message): """Internal assertion mechanism for CLI output.""" if not assert_condition: LOG.error(exception_message) raise exception.VolumeBackendAPIException(data=exception_message) def check_for_setup_error(self): """Check that we have all configuration details from the storage.""" LOG.debug(_('enter: check_for_setup_error')) # Validate that the pool exists ssh_cmd = 'lsmdiskgrp -delim ! -nohdr' out, err = self._run_ssh(ssh_cmd) self._driver_assert(len(out) > 0, _('check_for_setup_error: failed with unexpected CLI output.\n ' 'Command: %(cmd)s\n stdout: %(out)s\n stderr: %(err)s') % {'cmd': ssh_cmd, 'out': str(out), 'err': str(err)}) search_text = '!%s!' % FLAGS.storwize_svc_volpool_name if search_text not in out: raise exception.InvalidInput( reason=(_('pool %s doesn\'t exist') % FLAGS.storwize_svc_volpool_name)) storage_nodes = {} # Get the iSCSI names of the Storwize/SVC nodes ssh_cmd = 'svcinfo lsnode -delim !' out, err = self._run_ssh(ssh_cmd) self._driver_assert(len(out) > 0, _('check_for_setup_error: failed with unexpected CLI output.\n ' 'Command: %(cmd)s\n stdout: %(out)s\n stderr: %(err)s') % {'cmd': ssh_cmd, 'out': str(out), 'err': str(err)}) nodes = out.strip().split('\n') self._driver_assert(len(nodes) > 0, _('check_for_setup_error: failed with unexpected CLI output.\n ' 'Command: %(cmd)s\n stdout: %(out)s\n stderr: %(err)s') % {'cmd': ssh_cmd, 'out': str(out), 'err': str(err)}) header = nodes.pop(0) for node_line in nodes: try: node_data = self._get_hdr_dic(header, node_line, '!') except exception.VolumeBackendAPIException as e: with excutils.save_and_reraise_exception(): LOG.error(_('check_for_setup_error: ' 'failed with unexpected CLI output.\n ' 'Command: %(cmd)s\n ' 'stdout: %(out)s\n stderr: %(err)s\n') % {'cmd': ssh_cmd, 'out': str(out), 'err': str(err)}) node = {} try: node['id'] = node_data['id'] node['name'] = node_data['name'] node['iscsi_name'] = node_data['iscsi_name'] node['status'] = node_data['status'] node['ipv4'] = [] node['ipv6'] = [] if node['iscsi_name'] != '': storage_nodes[node['id']] = node except KeyError as e: LOG.error(_('Did not find expected column name in ' 'svcinfo lsnode: %s') % str(e)) exception_message = ( _('check_for_setup_error: Unexpected CLI output.\n ' 'Details: %(msg)s\n' 'Command: %(cmd)s\n ' 'stdout: %(out)s\n stderr: %(err)s') % {'msg': str(e), 'cmd': ssh_cmd, 'out': str(out), 'err': str(err)}) raise exception.VolumeBackendAPIException( data=exception_message) # Get the iSCSI IP addresses of the Storwize/SVC nodes ssh_cmd = 'lsportip -delim !' out, err = self._run_ssh(ssh_cmd) self._driver_assert(len(out) > 0, _('check_for_setup_error: failed with unexpected CLI output.\n ' 'Command: %(cmd)s\n ' 'stdout: %(out)s\n stderr: %(err)s') % {'cmd': ssh_cmd, 'out': str(out), 'err': str(err)}) portips = out.strip().split('\n') self._driver_assert(len(portips) > 0, _('check_for_setup_error: failed with unexpected CLI output.\n ' 'Command: %(cmd)s\n stdout: %(out)s\n stderr: %(err)s') % {'cmd': ssh_cmd, 'out': str(out), 'err': str(err)}) header = portips.pop(0) for portip_line in portips: try: port_data = self._get_hdr_dic(header, portip_line, '!') except exception.VolumeBackendAPIException as e: with excutils.save_and_reraise_exception(): LOG.error(_('check_for_setup_error: ' 'failed with unexpected CLI output.\n ' 'Command: %(cmd)s\n ' 'stdout: %(out)s\n stderr: %(err)s\n') % {'cmd': ssh_cmd, 'out': str(out), 'err': str(err)}) try: port_node_id = port_data['node_id'] port_ipv4 = port_data['IP_address'] port_ipv6 = port_data['IP_address_6'] except KeyError as e: LOG.error(_('Did not find expected column name in ' 'lsportip: %s') % str(e)) exception_message = ( _('check_for_setup_error: Unexpected CLI output.\n ' 'Details: %(msg)s\n' 'Command: %(cmd)s\n ' 'stdout: %(out)s\n stderr: %(err)s') % {'msg': str(e), 'cmd': ssh_cmd, 'out': str(out), 'err': str(err)}) raise exception.VolumeBackendAPIException( data=exception_message) if port_node_id in storage_nodes: node = storage_nodes[port_node_id] if len(port_ipv4) > 0: node['ipv4'].append(port_ipv4) if len(port_ipv6) > 0: node['ipv6'].append(port_ipv6) else: raise exception.VolumeBackendAPIException( data=_('check_for_setup_error: ' 'fail to storage configuration: unknown ' 'storage node %(node_id)s from CLI output.\n ' 'stdout: %(out)s\n stderr: %(err)s\n') % {'node_id': port_node_id, 'out': str(out), 'err': str(err)}) iscsi_ipv4_conf = [] iscsi_ipv6_conf = [] for node_key in storage_nodes: node = storage_nodes[node_key] if 'ipv4' in node and len(node['iscsi_name']) > 0: iscsi_ipv4_conf.append({'iscsi_name': node['iscsi_name'], 'ip': node['ipv4'], 'node_id': node['id']}) if 'ipv6' in node and len(node['iscsi_name']) > 0: iscsi_ipv6_conf.append({'iscsi_name': node['iscsi_name'], 'ip': node['ipv6'], 'node_id': node['id']}) if (len(node['ipv4']) == 0) and (len(node['ipv6']) == 0): raise exception.VolumeBackendAPIException( data=_('check_for_setup_error: ' 'fail to storage configuration: storage ' 'node %s has no IP addresses configured') % node['id']) # Make sure we have at least one IPv4 address with a iSCSI name # TODO(ronenkat) need to expand this to support IPv6 self._driver_assert(len(iscsi_ipv4_conf) > 0, _('could not obtain IP address and iSCSI name from the storage. ' 'Please verify that the storage is configured for iSCSI.\n ' 'Storage nodes: %(nodes)s\n portips: %(portips)s') % {'nodes': nodes, 'portips': portips}) self.iscsi_ipv4_conf = iscsi_ipv4_conf self.iscsi_ipv6_conf = iscsi_ipv6_conf LOG.debug(_('leave: check_for_setup_error')) def _check_num_perc(self, value): """Return True if value is either a number or a percentage.""" if value.endswith('%'): value = value[0:-1] return value.isdigit() def _check_flags(self): """Ensure that the flags are set properly.""" required_flags = ['san_ip', 'san_ssh_port', 'san_login', 'storwize_svc_volpool_name'] for flag in required_flags: if not getattr(FLAGS, flag, None): raise exception.InvalidInput( reason=_('%s is not set') % flag) # Ensure that either password or keyfile were set if not (FLAGS.san_password or FLAGS.san_private_key): raise exception.InvalidInput( reason=_('Password or SSH private key is required for ' 'authentication: set either san_password or ' 'san_private_key option')) # Check that rsize is a number or percentage rsize = FLAGS.storwize_svc_vol_rsize if not self._check_num_perc(rsize) and (rsize != '-1'): raise exception.InvalidInput( reason=_('Illegal value specified for storwize_svc_vol_rsize: ' 'set to either a number or a percentage')) # Check that warning is a number or percentage warning = FLAGS.storwize_svc_vol_warning if not self._check_num_perc(warning): raise exception.InvalidInput( reason=_('Illegal value specified for ' 'storwize_svc_vol_warning: ' 'set to either a number or a percentage')) # Check that grainsize is 32/64/128/256 grainsize = FLAGS.storwize_svc_vol_grainsize if grainsize not in ['32', '64', '128', '256']: raise exception.InvalidInput( reason=_('Illegal value specified for ' 'storwize_svc_vol_grainsize: set to either ' '\'32\', \'64\', \'128\', or \'256\'')) # Check that flashcopy_timeout is numeric and 32/64/128/256 flashcopy_timeout = FLAGS.storwize_svc_flashcopy_timeout if not (flashcopy_timeout.isdigit() and int(flashcopy_timeout) > 0 and int(flashcopy_timeout) <= 600): raise exception.InvalidInput( reason=_('Illegal value %s specified for ' 'storwize_svc_flashcopy_timeout: ' 'valid values are between 0 and 600') % flashcopy_timeout) # Check that rsize is set volume_compression = FLAGS.storwize_svc_vol_compression if ((volume_compression == True) and (FLAGS.storwize_svc_vol_rsize == '-1')): raise exception.InvalidInput( reason=_('If compression is set to True, rsize must ' 'also be set (not equal to -1)')) def do_setup(self, context): """Validate the flags.""" LOG.debug(_('enter: do_setup')) self._check_flags() LOG.debug(_('leave: do_setup')) def create_volume(self, volume): """Create a new volume - uses the internal method.""" return self._create_volume(volume, units='gb') def _create_volume(self, volume, units='gb'): """Create a new volume.""" name = volume['name'] model_update = None LOG.debug(_('enter: create_volume: volume %s ') % name) size = int(volume['size']) if FLAGS.storwize_svc_vol_autoexpand == True: autoex = '-autoexpand' else: autoex = '' if FLAGS.storwize_svc_vol_easytier == True: easytier = '-easytier on' else: easytier = '-easytier off' # Set space-efficient options if FLAGS.storwize_svc_vol_rsize.strip() == '-1': ssh_cmd_se_opt = '' else: ssh_cmd_se_opt = ('-rsize %(rsize)s %(autoex)s -warning %(warn)s' % {'rsize': FLAGS.storwize_svc_vol_rsize, 'autoex': autoex, 'warn': FLAGS.storwize_svc_vol_warning}) if FLAGS.storwize_svc_vol_compression: ssh_cmd_se_opt = ssh_cmd_se_opt + ' -compressed' else: ssh_cmd_se_opt = ssh_cmd_se_opt + (' -grainsize %(grain)s' % {'grain': FLAGS.storwize_svc_vol_grainsize}) ssh_cmd = ('mkvdisk -name %(name)s -mdiskgrp %(mdiskgrp)s ' '-iogrp 0 -size %(size)s -unit ' '%(unit)s %(easytier)s %(ssh_cmd_se_opt)s' % {'name': name, 'mdiskgrp': FLAGS.storwize_svc_volpool_name, 'size': size, 'unit': units, 'easytier': easytier, 'ssh_cmd_se_opt': ssh_cmd_se_opt}) out, err = self._run_ssh(ssh_cmd) self._driver_assert(len(out.strip()) > 0, _('create volume %(name)s - did not find ' 'success message in CLI output.\n ' 'stdout: %(out)s\n stderr: %(err)s') % {'name': name, 'out': str(out), 'err': str(err)}) # Ensure that the output is as expected match_obj = re.search('Virtual Disk, id \[([0-9]+)\], ' 'successfully created', out) # Make sure we got a "successfully created" message with vdisk id self._driver_assert(match_obj is not None, _('create volume %(name)s - did not find ' 'success message in CLI output.\n ' 'stdout: %(out)s\n stderr: %(err)s') % {'name': name, 'out': str(out), 'err': str(err)}) LOG.debug(_('leave: create_volume: volume %(name)s ') % {'name': name}) def delete_volume(self, volume): self._delete_volume(volume, False) def _delete_volume(self, volume, force_opt): """Driver entry point for destroying existing volumes.""" name = volume['name'] LOG.debug(_('enter: delete_volume: volume %(name)s ') % {'name': name}) if force_opt: force_flag = '-force' else: force_flag = '' volume_defined = self._is_volume_defined(name) # Try to delete volume only if found on the storage if volume_defined: out, err = self._run_ssh('rmvdisk %(force)s %(name)s' % {'force': force_flag, 'name': name}) # No output should be returned from rmvdisk self._driver_assert(len(out.strip()) == 0, _('delete volume %(name)s - non empty output from CLI.\n ' 'stdout: %(out)s\n stderr: %(err)s') % {'name': name, 'out': str(out), 'err': str(err)}) else: # Log that volume does not exist LOG.info(_('warning: tried to delete volume %(name)s but ' 'it does not exist.') % {'name': name}) LOG.debug(_('leave: delete_volume: volume %(name)s ') % {'name': name}) def ensure_export(self, context, volume): """Check that the volume exists on the storage. The system does not "export" volumes as a Linux iSCSI target does, and therefore we just check that the volume exists on the storage. """ volume_defined = self._is_volume_defined(volume['name']) if not volume_defined: LOG.error(_('ensure_export: volume %s not found on storage') % volume['name']) def create_export(self, context, volume): model_update = None return model_update def remove_export(self, context, volume): pass def initialize_connection(self, volume, connector): """Perform the necessary work so that an iSCSI connection can be made. To be able to create an iSCSI connection from a given iSCSI name to a volume, we must: 1. Translate the given iSCSI name to a host name 2. Create new host on the storage system if it does not yet exist 2. Map the volume to the host if it is not already done 3. Return iSCSI properties, including the IP address of the preferred node for this volume and the LUN number. """ LOG.debug(_('enter: initialize_connection: volume %(vol)s with ' 'connector %(conn)s') % {'vol': str(volume), 'conn': str(connector)}) initiator_name = connector['initiator'] volume_name = volume['name'] host_name = self._get_host_from_iscsiname(initiator_name) # Check if a host is defined for the iSCSI initiator name if host_name is None: # Host does not exist - add a new host to Storwize/SVC host_name = self._create_new_host('host%s' % initiator_name, initiator_name) # Verify that create_new_host succeeded self._driver_assert(host_name is not None, _('_create_new_host failed to return the host name.')) lun_id = self._map_vol_to_host(volume_name, host_name) # Get preferred path # Only IPv4 for now because lack of OpenStack support # TODO(ronenkat): Add support for IPv6 volume_attributes = self._get_volume_attributes(volume_name) if (volume_attributes is not None and 'preferred_node_id' in volume_attributes): preferred_node = volume_attributes['preferred_node_id'] preferred_node_entry = None for node in self.iscsi_ipv4_conf: if node['node_id'] == preferred_node: preferred_node_entry = node break if preferred_node_entry is None: preferred_node_entry = self.iscsi_ipv4_conf[0] LOG.error(_('initialize_connection: did not find preferred ' 'node %(node)s for volume %(vol)s in iSCSI ' 'configuration') % {'node': preferred_node, 'vol': volume_name}) else: # Get 1st node preferred_node_entry = self.iscsi_ipv4_conf[0] LOG.error( _('initialize_connection: did not find a preferred node ' 'for volume %s in iSCSI configuration') % volume_name) properties = {} # We didn't use iSCSI discover, as in server-based iSCSI properties['target_discovered'] = False # We take the first IP address for now. Ideally, OpenStack will # support multipath for improved performance. properties['target_portal'] = ('%s:%s' % (preferred_node_entry['ip'][0], '3260')) properties['target_iqn'] = preferred_node_entry['iscsi_name'] properties['target_lun'] = lun_id properties['volume_id'] = volume['id'] LOG.debug(_('leave: initialize_connection:\n volume: %(vol)s\n ' 'connector %(conn)s\n properties: %(prop)s') % {'vol': str(volume), 'conn': str(connector), 'prop': str(properties)}) return {'driver_volume_type': 'iscsi', 'data': properties, } def terminate_connection(self, volume, connector): """Cleanup after an iSCSI connection has been terminated. When we clean up a terminated connection between a given iSCSI name and volume, we: 1. Translate the given iSCSI name to a host name 2. Remove the volume-to-host mapping if it exists 3. Delete the host if it has no more mappings (hosts are created automatically by this driver when mappings are created) """ LOG.debug(_('enter: terminate_connection: volume %(vol)s with ' 'connector %(conn)s') % {'vol': str(volume), 'conn': str(connector)}) vol_name = volume['name'] initiator_name = connector['initiator'] host_name = self._get_host_from_iscsiname(initiator_name) # Verify that _get_host_from_iscsiname returned the host. # This should always succeed as we terminate an existing connection. self._driver_assert(host_name is not None, _('_get_host_from_iscsiname failed to return the host name ' 'for iscsi name %s') % initiator_name) # Check if vdisk-host mapping exists, remove if it does mapping_data = self._get_hostvdisk_mappings(host_name) if vol_name in mapping_data: out, err = self._run_ssh('rmvdiskhostmap -host %s %s' % (host_name, vol_name)) # Verify CLI behaviour - no output is returned from # rmvdiskhostmap self._driver_assert(len(out.strip()) == 0, _('delete mapping of volume %(vol)s to host %(host)s ' '- non empty output from CLI.\n ' 'stdout: %(out)s\n stderr: %(err)s') % {'vol': vol_name, 'host': host_name, 'out': str(out), 'err': str(err)}) del mapping_data[vol_name] else: LOG.error(_('terminate_connection: no mapping of volume ' '%(vol)s to host %(host)s found') % {'vol': vol_name, 'host': host_name}) # If this host has no more mappings, delete it if not mapping_data: self._delete_host(host_name) LOG.debug(_('leave: terminate_connection: volume %(vol)s with ' 'connector %(conn)s') % {'vol': str(volume), 'conn': str(connector)}) def _flashcopy_cleanup(self, fc_map_id, source, target): """Clean up a failed FlashCopy operation.""" try: out, err = self._run_ssh('stopfcmap -force %s' % fc_map_id) out, err = self._run_ssh('rmfcmap -force %s' % fc_map_id) except exception.ProcessExecutionError as e: LOG.error(_('_run_flashcopy: fail to cleanup failed FlashCopy ' 'mapping %(fc_map_id)% ' 'from %(source)s to %(target)s.\n' 'stdout: %(out)s\n stderr: %(err)s') % {'fc_map_id': fc_map_id, 'source': source, 'target': target, 'out': e.stdout, 'err': e.stderr}) def _run_flashcopy(self, source, target): """Create a FlashCopy mapping from the source to the target.""" LOG.debug( _('enter: _run_flashcopy: execute FlashCopy from source ' '%(source)s to target %(target)s') % {'source': source, 'target': target}) fc_map_cli_cmd = ('mkfcmap -source %s -target %s -autodelete ' '-cleanrate 0' % (source, target)) out, err = self._run_ssh(fc_map_cli_cmd) self._driver_assert(len(out.strip()) > 0, _('create FC mapping from %(source)s to %(target)s - ' 'did not find success message in CLI output.\n' ' stdout: %(out)s\n stderr: %(err)s\n') % {'source': source, 'target': target, 'out': str(out), 'err': str(err)}) # Ensure that the output is as expected match_obj = re.search('FlashCopy Mapping, id \[([0-9]+)\], ' 'successfully created', out) # Make sure we got a "successfully created" message with vdisk id self._driver_assert(match_obj is not None, _('create FC mapping from %(source)s to %(target)s - ' 'did not find success message in CLI output.\n' ' stdout: %(out)s\n stderr: %(err)s\n') % {'source': source, 'target': target, 'out': str(out), 'err': str(err)}) try: fc_map_id = match_obj.group(1) self._driver_assert(fc_map_id is not None, _('create FC mapping from %(source)s to %(target)s - ' 'did not find mapping id in CLI output.\n' ' stdout: %(out)s\n stderr: %(err)s\n') % {'source': source, 'target': target, 'out': str(out), 'err': str(err)}) except IndexError: self._driver_assert(False, _('create FC mapping from %(source)s to %(target)s - ' 'did not find mapping id in CLI output.\n' ' stdout: %(out)s\n stderr: %(err)s\n') % {'source': source, 'target': target, 'out': str(out), 'err': str(err)}) try: out, err = self._run_ssh('prestartfcmap %s' % fc_map_id) except exception.ProcessExecutionError as e: with excutils.save_and_reraise_exception(): LOG.error(_('_run_flashcopy: fail to prepare FlashCopy ' 'from %(source)s to %(target)s.\n' 'stdout: %(out)s\n stderr: %(err)s') % {'source': source, 'target': target, 'out': e.stdout, 'err': e.stderr}) self._flashcopy_cleanup(fc_map_id, source, target) mapping_ready = False wait_time = 5 # Allow waiting of up to timeout (set as parameter) max_retries = (int(FLAGS.storwize_svc_flashcopy_timeout) / wait_time) + 1 for try_number in range(1, max_retries): mapping_attributes = self._get_flashcopy_mapping_attributes( fc_map_id) if (mapping_attributes is None or 'status' not in mapping_attributes): break if mapping_attributes['status'] == 'prepared': mapping_ready = True break elif mapping_attributes['status'] != 'preparing': # Unexpected mapping status exception_msg = (_('unexecpted mapping status %(status)s ' 'for mapping %(id)s. Attributes: ' '%(attr)s') % {'status': mapping_attributes['status'], 'id': fc_map_id, 'attr': mapping_attributes}) raise exception.VolumeBackendAPIException( data=exception_msg) # Need to wait for mapping to be prepared, wait a few seconds time.sleep(wait_time) if not mapping_ready: exception_msg = (_('mapping %(id)s prepare failed to complete ' 'within the alloted %(to)s seconds timeout. ' 'Terminating') % {'id': fc_map_id, 'to': FLAGS.storwize_svc_flashcopy_timeout}) LOG.error(_('_run_flashcopy: fail to start FlashCopy ' 'from %(source)s to %(target)s with ' 'exception %(ex)s') % {'source': source, 'target': target, 'ex': exception_msg}) self._flashcopy_cleanup(fc_map_id, source, target) raise exception.InvalidSnapshot( reason=_('_run_flashcopy: %s') % exception_msg) try: out, err = self._run_ssh('startfcmap %s' % fc_map_id) except exception.ProcessExecutionError as e: with excutils.save_and_reraise_exception(): LOG.error(_('_run_flashcopy: fail to start FlashCopy ' 'from %(source)s to %(target)s.\n' 'stdout: %(out)s\n stderr: %(err)s') % {'source': source, 'target': target, 'out': e.stdout, 'err': e.stderr}) self._flashcopy_cleanup(fc_map_id, source, target) LOG.debug(_('leave: _run_flashcopy: FlashCopy started from ' '%(source)s to %(target)s') % {'source': source, 'target': target}) def create_volume_from_snapshot(self, volume, snapshot): """Create a new snapshot from volume.""" source_volume = snapshot['name'] tgt_volume = volume['name'] LOG.debug(_('enter: create_volume_from_snapshot: snapshot %(tgt)s ' 'from volume %(src)s') % {'tgt': tgt_volume, 'src': source_volume}) src_volume_attributes = self._get_volume_attributes(source_volume) if src_volume_attributes is None: exception_msg = (_('create_volume_from_snapshot: source volume %s ' 'does not exist') % source_volume) LOG.error(exception_msg) raise exception.SnapshotNotFound(exception_msg, volume_id=source_volume) self._driver_assert('capacity' in src_volume_attributes, _('create_volume_from_snapshot: cannot get source ' 'volume %(src)s capacity from volume attributes ' '%(attr)s') % {'src': source_volume, 'attr': src_volume_attributes}) src_volume_size = src_volume_attributes['capacity'] tgt_volume_attributes = self._get_volume_attributes(tgt_volume) # Does the snapshot target exist? if tgt_volume_attributes is not None: exception_msg = (_('create_volume_from_snapshot: target volume %s ' 'already exists, cannot create') % tgt_volume) LOG.error(exception_msg) raise exception.InvalidSnapshot(reason=exception_msg) snapshot_volume = {} snapshot_volume['name'] = tgt_volume snapshot_volume['size'] = src_volume_size self._create_volume(snapshot_volume, units='b') try: self._run_flashcopy(source_volume, tgt_volume) except Exception: with excutils.save_and_reraise_exception(): # Clean up newly-created snapshot if the FlashCopy failed self._delete_volume(snapshot_volume, True) LOG.debug( _('leave: create_volume_from_snapshot: %s created successfully') % tgt_volume) def create_snapshot(self, snapshot): """Create a new snapshot using FlashCopy.""" src_volume = snapshot['volume_name'] tgt_volume = snapshot['name'] # Flag to keep track of created volumes in case FlashCopy tgt_volume_created = False LOG.debug(_('enter: create_snapshot: snapshot %(tgt)s from ' 'volume %(src)s') % {'tgt': tgt_volume, 'src': src_volume}) src_volume_attributes = self._get_volume_attributes(src_volume) if src_volume_attributes is None: exception_msg = ( _('create_snapshot: source volume %s does not exist') % src_volume) LOG.error(exception_msg) raise exception.VolumeNotFound(exception_msg, volume_id=src_volume) self._driver_assert('capacity' in src_volume_attributes, _('create_volume_from_snapshot: cannot get source ' 'volume %(src)s capacity from volume attributes ' '%(attr)s') % {'src': src_volume, 'attr': src_volume_attributes}) source_volume_size = src_volume_attributes['capacity'] tgt_volume_attributes = self._get_volume_attributes(tgt_volume) # Does the snapshot target exist? snapshot_volume = {} if tgt_volume_attributes is None: # No, create a new snapshot volume snapshot_volume['name'] = tgt_volume snapshot_volume['size'] = source_volume_size self._create_volume(snapshot_volume, units='b') tgt_volume_created = True else: # Yes, target exists, verify exact same size as source self._driver_assert('capacity' in tgt_volume_attributes, _('create_volume_from_snapshot: cannot get source ' 'volume %(src)s capacity from volume attributes ' '%(attr)s') % {'src': tgt_volume, 'attr': tgt_volume_attributes}) target_volume_size = tgt_volume_attributes['capacity'] if target_volume_size != source_volume_size: exception_msg = ( _('create_snapshot: source %(src)s and target ' 'volume %(tgt)s have different capacities ' '(source:%(ssize)s target:%(tsize)s)') % {'src': src_volume, 'tgt': tgt_volume, 'ssize': source_volume_size, 'tsize': target_volume_size}) LOG.error(exception_msg) raise exception.InvalidSnapshot(reason=exception_msg) try: self._run_flashcopy(src_volume, tgt_volume) except exception.InvalidSnapshot: with excutils.save_and_reraise_exception(): # Clean up newly-created snapshot if the FlashCopy failed if tgt_volume_created: self._delete_volume(snapshot_volume, True) LOG.debug(_('leave: create_snapshot: %s created successfully') % tgt_volume) def delete_snapshot(self, snapshot): self._delete_snapshot(snapshot, False) def _delete_snapshot(self, snapshot, force_opt): """Delete a snapshot from the storage.""" LOG.debug(_('enter: delete_snapshot: snapshot %s') % snapshot) snapshot_defined = self._is_volume_defined(snapshot['name']) if snapshot_defined: if force_opt: self._delete_volume(snapshot, force_opt) else: self.delete_volume(snapshot) LOG.debug(_('leave: delete_snapshot: snapshot %s') % snapshot) def _get_host_from_iscsiname(self, iscsi_name): """List the hosts defined in the storage. Return the host name with the given iSCSI name, or None if there is no host name with that iSCSI name. """ LOG.debug(_('enter: _get_host_from_iscsiname: iSCSI initiator %s') % iscsi_name) # Get list of host in the storage ssh_cmd = 'lshost -delim !' out, err = self._run_ssh(ssh_cmd) if (len(out.strip()) == 0): return None err_msg = _('_get_host_from_iscsiname: ' 'failed with unexpected CLI output.\n' ' command: %(cmd)s\n stdout: %(out)s\n ' 'stderr: %(err)s') % {'cmd': ssh_cmd, 'out': str(out), 'err': str(err)} host_lines = out.strip().split('\n') self._driver_assert(len(host_lines) > 0, err_msg) header = host_lines.pop(0).split('!') self._driver_assert('name' in header, err_msg) name_index = header.index('name') hosts = map(lambda x: x.split('!')[name_index], host_lines) hostname = None # For each host, get its details and check for its iSCSI name for host in hosts: ssh_cmd = 'lshost -delim ! %s' % host out, err = self._run_ssh(ssh_cmd) self._driver_assert(len(out) > 0, _('_get_host_from_iscsiname: ' 'Unexpected response from CLI output. ' 'Command: %(cmd)s\n stdout: %(out)s\n stderr: %(err)s') % {'cmd': ssh_cmd, 'out': str(out), 'err': str(err)}) for attrib_line in out.split('\n'): # If '!' not found, return the string and two empty strings attrib_name, foo, attrib_value = attrib_line.partition('!') if attrib_name == 'iscsi_name': if iscsi_name == attrib_value: hostname = host break if hostname is not None: break LOG.debug(_('leave: _get_host_from_iscsiname: iSCSI initiator %s') % iscsi_name) return hostname def _create_new_host(self, host_name, initiator_name): """Create a new host on the storage system. We modify the given host name, replace any invalid characters and adding a random suffix to avoid conflicts due to the translation. The host is associated with the given iSCSI initiator name. """ LOG.debug(_('enter: _create_new_host: host %(name)s with iSCSI ' 'initiator %(init)s') % {'name': host_name, 'init': initiator_name}) if isinstance(host_name, unicode): host_name = host_name.translate(self._unicode_host_name_filter) elif isinstance(host_name, str): host_name = host_name.translate(self._string_host_name_filter) else: msg = _('_create_new_host: cannot clean host name. Host name ' 'is not unicode or string') LOG.error(msg) raise exception.NoValidHost(reason=msg) # Add 5 digit random suffix to the host name to avoid # conflicts in host names after removing invalid characters # for Storwize/SVC names host_name = '%s_%s' % (host_name, random.randint(10000, 99999)) out, err = self._run_ssh('mkhost -name "%s" -iscsiname "%s"' % (host_name, initiator_name)) self._driver_assert(len(out.strip()) > 0 and 'successfully created' in out, _('create host %(name)s with iSCSI initiator %(init)s - ' 'did not find success message in CLI output.\n ' 'stdout: %(out)s\n stderr: %(err)s\n') % {'name': host_name, 'init': initiator_name, 'out': str(out), 'err': str(err)}) LOG.debug(_('leave: _create_new_host: host %(host)s with iSCSI ' 'initiator %(init)s') % {'host': host_name, 'init': initiator_name}) return host_name def _delete_host(self, host_name): """Delete a host and associated iSCSI initiator name.""" LOG.debug(_('enter: _delete_host: host %s ') % host_name) # Check if host exists on system, expect to find the host is_defined = self._is_host_defined(host_name) if is_defined: # Delete host out, err = self._run_ssh('rmhost %s ' % host_name) else: LOG.info(_('warning: tried to delete host %(name)s but ' 'it does not exist.') % {'name': host_name}) LOG.debug(_('leave: _delete_host: host %s ') % host_name) def _is_volume_defined(self, volume_name): """Check if volume is defined.""" LOG.debug(_('enter: _is_volume_defined: volume %s ') % volume_name) volume_attributes = self._get_volume_attributes(volume_name) LOG.debug(_('leave: _is_volume_defined: volume %(vol)s with %(str)s ') % {'vol': volume_name, 'str': volume_attributes is not None}) if volume_attributes is None: return False else: return True def _is_host_defined(self, host_name): """Check if a host is defined on the storage.""" LOG.debug(_('enter: _is_host_defined: host %s ') % host_name) # Get list of hosts with the name %host_name% # We expect zero or one line if host does not exist, # two lines if it does exist, otherwise error out, err = self._run_ssh('lshost -filtervalue name=%s -delim !' % host_name) if len(out.strip()) == 0: return False lines = out.strip().split('\n') self._driver_assert(len(lines) <= 2, _('_is_host_defined: Unexpected response from CLI output.\n ' 'stdout: %(out)s\n stderr: %(err)s\n') % {'out': str(out), 'err': str(err)}) if len(lines) == 2: host_info = self._get_hdr_dic(lines[0], lines[1], '!') host_name_from_storage = host_info['name'] # Make sure we got the data for the right host self._driver_assert(host_name_from_storage == host_name, _('Data received for host %(host1)s instead of host ' '%(host2)s.\n ' 'stdout: %(out)s\n stderr: %(err)s\n') % {'host1': host_name_from_storage, 'host2': host_name, 'out': str(out), 'err': str(err)}) else: # 0 or 1 lines host_name_from_storage = None LOG.debug(_('leave: _is_host_defined: host %(host)s with %(str)s ') % { 'host': host_name, 'str': host_name_from_storage is not None}) if host_name_from_storage is None: return False else: return True def _get_hostvdisk_mappings(self, host_name): """Return the defined storage mappings for a host.""" return_data = {} ssh_cmd = 'lshostvdiskmap -delim ! %s' % host_name out, err = self._run_ssh(ssh_cmd) mappings = out.strip().split('\n') if len(mappings) > 0: header = mappings.pop(0) for mapping_line in mappings: mapping_data = self._get_hdr_dic(header, mapping_line, '!') return_data[mapping_data['vdisk_name']] = mapping_data return return_data def _map_vol_to_host(self, volume_name, host_name): """Create a mapping between a volume to a host.""" LOG.debug(_('enter: _map_vol_to_host: volume %(vol)s to ' 'host %(host)s') % {'vol': volume_name, 'host': host_name}) # Check if this volume is already mapped to this host mapping_data = self._get_hostvdisk_mappings(host_name) mapped_flag = False result_lun = '-1' if volume_name in mapping_data: mapped_flag = True result_lun = mapping_data[volume_name]['SCSI_id'] else: lun_used = [] for k, v in mapping_data.iteritems(): lun_used.append(int(v['SCSI_id'])) lun_used.sort() # Assume all luns are taken to this point, and then try to find # an unused one result_lun = str(len(lun_used)) for index, n in enumerate(lun_used): if n > index: result_lun = str(index) # Volume is not mapped to host, create a new LUN if not mapped_flag: out, err = self._run_ssh('mkvdiskhostmap -host %s -scsi %s %s' % (host_name, result_lun, volume_name)) self._driver_assert(len(out.strip()) > 0 and 'successfully created' in out, _('_map_vol_to_host: mapping host %(host)s to ' 'volume %(vol)s with LUN ' '%(lun)s - did not find success message in CLI output. ' 'stdout: %(out)s\n stderr: %(err)s\n') % {'host': host_name, 'vol': volume_name, 'lun': result_lun, 'out': str(out), 'err': str(err)}) LOG.debug(_('leave: _map_vol_to_host: LUN %(lun)s, volume %(vol)s, ' 'host %(host)s') % {'lun': result_lun, 'vol': volume_name, 'host': host_name}) return result_lun def _get_flashcopy_mapping_attributes(self, fc_map_id): """Return the attributes of a FlashCopy mapping. Returns the attributes for the specified FlashCopy mapping, or None if the mapping does not exist. An exception is raised if the information from system can not be parsed or matched to a single FlashCopy mapping (this case should not happen under normal conditions). """ LOG.debug(_('enter: _get_flashcopy_mapping_attributes: mapping %s') % fc_map_id) # Get the lunid to be used fc_ls_map_cmd = ('lsfcmap -filtervalue id=%s -delim !' % fc_map_id) out, err = self._run_ssh(fc_ls_map_cmd) self._driver_assert(len(out) > 0, _('_get_flashcopy_mapping_attributes: ' 'Unexpected response from CLI output. ' 'Command: %(cmd)s\n stdout: %(out)s\n stderr: %(err)s') % {'cmd': fc_ls_map_cmd, 'out': str(out), 'err': str(err)}) # Get list of FlashCopy mappings # We expect zero or one line if mapping does not exist, # two lines if it does exist, otherwise error lines = out.strip().split('\n') self._driver_assert(len(lines) <= 2, _('_get_flashcopy_mapping_attributes: ' 'Unexpected response from CLI output. ' 'Command: %(cmd)s\n stdout: %(out)s\n stderr: %(err)s') % {'cmd': fc_ls_map_cmd, 'out': str(out), 'err': str(err)}) if len(lines) == 2: attributes = self._get_hdr_dic(lines[0], lines[1], '!') else: # 0 or 1 lines attributes = None LOG.debug(_('leave: _get_flashcopy_mapping_attributes: mapping ' '%(id)s, attributes %(attr)s') % {'id': fc_map_id, 'attr': attributes}) return attributes def _get_volume_attributes(self, volume_name): """Return volume attributes, or None if volume does not exist Exception is raised if the information from system can not be parsed/matched to a single volume. """ LOG.debug(_('enter: _get_volume_attributes: volume %s') % volume_name) # Get the lunid to be used try: ssh_cmd = 'lsvdisk -bytes -delim ! %s ' % volume_name out, err = self._run_ssh(ssh_cmd) except exception.ProcessExecutionError as e: # Didn't get details from the storage, return None LOG.error(_('CLI Exception output:\n command: %(cmd)s\n ' 'stdout: %(out)s\n stderr: %(err)s') % {'cmd': ssh_cmd, 'out': e.stdout, 'err': e.stderr}) return None self._driver_assert(len(out) > 0, ('_get_volume_attributes: ' 'Unexpected response from CLI output. ' 'Command: %(cmd)s\n stdout: %(out)s\n stderr: %(err)s') % {'cmd': ssh_cmd, 'out': str(out), 'err': str(err)}) attributes = {} for attrib_line in out.split('\n'): # If '!' not found, return the string and two empty strings attrib_name, foo, attrib_value = attrib_line.partition('!') if attrib_name is not None and attrib_name.strip() > 0: attributes[attrib_name] = attrib_value LOG.debug(_('leave: _get_volume_attributes:\n volume %(vol)s\n ' 'attributes: %(attr)s') % {'vol': volume_name, 'attr': str(attributes)}) return attributes

44.146223

79

0.533159

import random import re import string import time from cinder import exception from cinder import flags from cinder.openstack.common import cfg from cinder.openstack.common import excutils from cinder.openstack.common import log as logging from cinder.volume import san LOG = logging.getLogger(__name__) storwize_svc_opts = [ cfg.StrOpt('storwize_svc_volpool_name', default='volpool', help='Storage system storage pool for volumes'), cfg.StrOpt('storwize_svc_vol_rsize', default='2%', help='Storage system space-efficiency parameter for volumes'), cfg.StrOpt('storwize_svc_vol_warning', default='0', help='Storage system threshold for volume capacity warnings'), cfg.BoolOpt('storwize_svc_vol_autoexpand', default=True, help='Storage system autoexpand parameter for volumes ' '(True/False)'), cfg.StrOpt('storwize_svc_vol_grainsize', default='256', help='Storage system grain size parameter for volumes ' '(32/64/128/256)'), cfg.BoolOpt('storwize_svc_vol_compression', default=False, help='Storage system compression option for volumes'), cfg.BoolOpt('storwize_svc_vol_easytier', default=True, help='Enable Easy Tier for volumes'), cfg.StrOpt('storwize_svc_flashcopy_timeout', default='120', help='Maximum number of seconds to wait for FlashCopy to be ' 'prepared. Maximum value is 600 seconds (10 minutes).'), ] FLAGS = flags.FLAGS FLAGS.register_opts(storwize_svc_opts) class StorwizeSVCDriver(san.SanISCSIDriver): def __init__(self, *args, **kwargs): super(StorwizeSVCDriver, self).__init__(*args, **kwargs) self.iscsi_ipv4_conf = None self.iscsi_ipv6_conf = None invalid_ch_in_host = '' for num in range(0, 128): ch = chr(num) if ((not ch.isalnum()) and (ch != ' ') and (ch != '.') and (ch != '-') and (ch != '_')): invalid_ch_in_host = invalid_ch_in_host + ch self._string_host_name_filter = string.maketrans(invalid_ch_in_host, '-' * len(invalid_ch_in_host)) self._unicode_host_name_filter = dict((ord(unicode(char)), u'-') for char in invalid_ch_in_host) def _get_hdr_dic(self, header, row, delim): attributes = header.split(delim) values = row.split(delim) self._driver_assert(len(values) == len(attributes), _('_get_hdr_dic: attribute headers and values do not match.\n ' 'Headers: %(header)s\n Values: %(row)s') % {'header': str(header), 'row': str(row)}) dic = {} for attribute, value in map(None, attributes, values): dic[attribute] = value return dic def _driver_assert(self, assert_condition, exception_message): if not assert_condition: LOG.error(exception_message) raise exception.VolumeBackendAPIException(data=exception_message) def check_for_setup_error(self): LOG.debug(_('enter: check_for_setup_error')) ssh_cmd = 'lsmdiskgrp -delim ! -nohdr' out, err = self._run_ssh(ssh_cmd) self._driver_assert(len(out) > 0, _('check_for_setup_error: failed with unexpected CLI output.\n ' 'Command: %(cmd)s\n stdout: %(out)s\n stderr: %(err)s') % {'cmd': ssh_cmd, 'out': str(out), 'err': str(err)}) search_text = '!%s!' % FLAGS.storwize_svc_volpool_name if search_text not in out: raise exception.InvalidInput( reason=(_('pool %s doesn\'t exist') % FLAGS.storwize_svc_volpool_name)) storage_nodes = {} # Get the iSCSI names of the Storwize/SVC nodes ssh_cmd = 'svcinfo lsnode -delim !' out, err = self._run_ssh(ssh_cmd) self._driver_assert(len(out) > 0, _('check_for_setup_error: failed with unexpected CLI output.\n ' 'Command: %(cmd)s\n stdout: %(out)s\n stderr: %(err)s') % {'cmd': ssh_cmd, 'out': str(out), 'err': str(err)}) nodes = out.strip().split('\n') self._driver_assert(len(nodes) > 0, _('check_for_setup_error: failed with unexpected CLI output.\n ' 'Command: %(cmd)s\n stdout: %(out)s\n stderr: %(err)s') % {'cmd': ssh_cmd, 'out': str(out), 'err': str(err)}) header = nodes.pop(0) for node_line in nodes: try: node_data = self._get_hdr_dic(header, node_line, '!') except exception.VolumeBackendAPIException as e: with excutils.save_and_reraise_exception(): LOG.error(_('check_for_setup_error: ' 'failed with unexpected CLI output.\n ' 'Command: %(cmd)s\n ' 'stdout: %(out)s\n stderr: %(err)s\n') % {'cmd': ssh_cmd, 'out': str(out), 'err': str(err)}) node = {} try: node['id'] = node_data['id'] node['name'] = node_data['name'] node['iscsi_name'] = node_data['iscsi_name'] node['status'] = node_data['status'] node['ipv4'] = [] node['ipv6'] = [] if node['iscsi_name'] != '': storage_nodes[node['id']] = node except KeyError as e: LOG.error(_('Did not find expected column name in ' 'svcinfo lsnode: %s') % str(e)) exception_message = ( _('check_for_setup_error: Unexpected CLI output.\n ' 'Details: %(msg)s\n' 'Command: %(cmd)s\n ' 'stdout: %(out)s\n stderr: %(err)s') % {'msg': str(e), 'cmd': ssh_cmd, 'out': str(out), 'err': str(err)}) raise exception.VolumeBackendAPIException( data=exception_message) # Get the iSCSI IP addresses of the Storwize/SVC nodes ssh_cmd = 'lsportip -delim !' out, err = self._run_ssh(ssh_cmd) self._driver_assert(len(out) > 0, _('check_for_setup_error: failed with unexpected CLI output.\n ' 'Command: %(cmd)s\n ' 'stdout: %(out)s\n stderr: %(err)s') % {'cmd': ssh_cmd, 'out': str(out), 'err': str(err)}) portips = out.strip().split('\n') self._driver_assert(len(portips) > 0, _('check_for_setup_error: failed with unexpected CLI output.\n ' 'Command: %(cmd)s\n stdout: %(out)s\n stderr: %(err)s') % {'cmd': ssh_cmd, 'out': str(out), 'err': str(err)}) header = portips.pop(0) for portip_line in portips: try: port_data = self._get_hdr_dic(header, portip_line, '!') except exception.VolumeBackendAPIException as e: with excutils.save_and_reraise_exception(): LOG.error(_('check_for_setup_error: ' 'failed with unexpected CLI output.\n ' 'Command: %(cmd)s\n ' 'stdout: %(out)s\n stderr: %(err)s\n') % {'cmd': ssh_cmd, 'out': str(out), 'err': str(err)}) try: port_node_id = port_data['node_id'] port_ipv4 = port_data['IP_address'] port_ipv6 = port_data['IP_address_6'] except KeyError as e: LOG.error(_('Did not find expected column name in ' 'lsportip: %s') % str(e)) exception_message = ( _('check_for_setup_error: Unexpected CLI output.\n ' 'Details: %(msg)s\n' 'Command: %(cmd)s\n ' 'stdout: %(out)s\n stderr: %(err)s') % {'msg': str(e), 'cmd': ssh_cmd, 'out': str(out), 'err': str(err)}) raise exception.VolumeBackendAPIException( data=exception_message) if port_node_id in storage_nodes: node = storage_nodes[port_node_id] if len(port_ipv4) > 0: node['ipv4'].append(port_ipv4) if len(port_ipv6) > 0: node['ipv6'].append(port_ipv6) else: raise exception.VolumeBackendAPIException( data=_('check_for_setup_error: ' 'fail to storage configuration: unknown ' 'storage node %(node_id)s from CLI output.\n ' 'stdout: %(out)s\n stderr: %(err)s\n') % {'node_id': port_node_id, 'out': str(out), 'err': str(err)}) iscsi_ipv4_conf = [] iscsi_ipv6_conf = [] for node_key in storage_nodes: node = storage_nodes[node_key] if 'ipv4' in node and len(node['iscsi_name']) > 0: iscsi_ipv4_conf.append({'iscsi_name': node['iscsi_name'], 'ip': node['ipv4'], 'node_id': node['id']}) if 'ipv6' in node and len(node['iscsi_name']) > 0: iscsi_ipv6_conf.append({'iscsi_name': node['iscsi_name'], 'ip': node['ipv6'], 'node_id': node['id']}) if (len(node['ipv4']) == 0) and (len(node['ipv6']) == 0): raise exception.VolumeBackendAPIException( data=_('check_for_setup_error: ' 'fail to storage configuration: storage ' 'node %s has no IP addresses configured') % node['id']) # Make sure we have at least one IPv4 address with a iSCSI name # TODO(ronenkat) need to expand this to support IPv6 self._driver_assert(len(iscsi_ipv4_conf) > 0, _('could not obtain IP address and iSCSI name from the storage. ' 'Please verify that the storage is configured for iSCSI.\n ' 'Storage nodes: %(nodes)s\n portips: %(portips)s') % {'nodes': nodes, 'portips': portips}) self.iscsi_ipv4_conf = iscsi_ipv4_conf self.iscsi_ipv6_conf = iscsi_ipv6_conf LOG.debug(_('leave: check_for_setup_error')) def _check_num_perc(self, value): if value.endswith('%'): value = value[0:-1] return value.isdigit() def _check_flags(self): required_flags = ['san_ip', 'san_ssh_port', 'san_login', 'storwize_svc_volpool_name'] for flag in required_flags: if not getattr(FLAGS, flag, None): raise exception.InvalidInput( reason=_('%s is not set') % flag) # Ensure that either password or keyfile were set if not (FLAGS.san_password or FLAGS.san_private_key): raise exception.InvalidInput( reason=_('Password or SSH private key is required for ' 'authentication: set either san_password or ' 'san_private_key option')) # Check that rsize is a number or percentage rsize = FLAGS.storwize_svc_vol_rsize if not self._check_num_perc(rsize) and (rsize != '-1'): raise exception.InvalidInput( reason=_('Illegal value specified for storwize_svc_vol_rsize: ' 'set to either a number or a percentage')) # Check that warning is a number or percentage warning = FLAGS.storwize_svc_vol_warning if not self._check_num_perc(warning): raise exception.InvalidInput( reason=_('Illegal value specified for ' 'storwize_svc_vol_warning: ' 'set to either a number or a percentage')) # Check that grainsize is 32/64/128/256 grainsize = FLAGS.storwize_svc_vol_grainsize if grainsize not in ['32', '64', '128', '256']: raise exception.InvalidInput( reason=_('Illegal value specified for ' 'storwize_svc_vol_grainsize: set to either ' '\'32\', \'64\', \'128\', or \'256\'')) # Check that flashcopy_timeout is numeric and 32/64/128/256 flashcopy_timeout = FLAGS.storwize_svc_flashcopy_timeout if not (flashcopy_timeout.isdigit() and int(flashcopy_timeout) > 0 and int(flashcopy_timeout) <= 600): raise exception.InvalidInput( reason=_('Illegal value %s specified for ' 'storwize_svc_flashcopy_timeout: ' 'valid values are between 0 and 600') % flashcopy_timeout) # Check that rsize is set volume_compression = FLAGS.storwize_svc_vol_compression if ((volume_compression == True) and (FLAGS.storwize_svc_vol_rsize == '-1')): raise exception.InvalidInput( reason=_('If compression is set to True, rsize must ' 'also be set (not equal to -1)')) def do_setup(self, context): LOG.debug(_('enter: do_setup')) self._check_flags() LOG.debug(_('leave: do_setup')) def create_volume(self, volume): return self._create_volume(volume, units='gb') def _create_volume(self, volume, units='gb'): name = volume['name'] model_update = None LOG.debug(_('enter: create_volume: volume %s ') % name) size = int(volume['size']) if FLAGS.storwize_svc_vol_autoexpand == True: autoex = '-autoexpand' else: autoex = '' if FLAGS.storwize_svc_vol_easytier == True: easytier = '-easytier on' else: easytier = '-easytier off' # Set space-efficient options if FLAGS.storwize_svc_vol_rsize.strip() == '-1': ssh_cmd_se_opt = '' else: ssh_cmd_se_opt = ('-rsize %(rsize)s %(autoex)s -warning %(warn)s' % {'rsize': FLAGS.storwize_svc_vol_rsize, 'autoex': autoex, 'warn': FLAGS.storwize_svc_vol_warning}) if FLAGS.storwize_svc_vol_compression: ssh_cmd_se_opt = ssh_cmd_se_opt + ' -compressed' else: ssh_cmd_se_opt = ssh_cmd_se_opt + (' -grainsize %(grain)s' % {'grain': FLAGS.storwize_svc_vol_grainsize}) ssh_cmd = ('mkvdisk -name %(name)s -mdiskgrp %(mdiskgrp)s ' '-iogrp 0 -size %(size)s -unit ' '%(unit)s %(easytier)s %(ssh_cmd_se_opt)s' % {'name': name, 'mdiskgrp': FLAGS.storwize_svc_volpool_name, 'size': size, 'unit': units, 'easytier': easytier, 'ssh_cmd_se_opt': ssh_cmd_se_opt}) out, err = self._run_ssh(ssh_cmd) self._driver_assert(len(out.strip()) > 0, _('create volume %(name)s - did not find ' 'success message in CLI output.\n ' 'stdout: %(out)s\n stderr: %(err)s') % {'name': name, 'out': str(out), 'err': str(err)}) # Ensure that the output is as expected match_obj = re.search('Virtual Disk, id \[([0-9]+)\], ' 'successfully created', out) # Make sure we got a "successfully created" message with vdisk id self._driver_assert(match_obj is not None, _('create volume %(name)s - did not find ' 'success message in CLI output.\n ' 'stdout: %(out)s\n stderr: %(err)s') % {'name': name, 'out': str(out), 'err': str(err)}) LOG.debug(_('leave: create_volume: volume %(name)s ') % {'name': name}) def delete_volume(self, volume): self._delete_volume(volume, False) def _delete_volume(self, volume, force_opt): name = volume['name'] LOG.debug(_('enter: delete_volume: volume %(name)s ') % {'name': name}) if force_opt: force_flag = '-force' else: force_flag = '' volume_defined = self._is_volume_defined(name) # Try to delete volume only if found on the storage if volume_defined: out, err = self._run_ssh('rmvdisk %(force)s %(name)s' % {'force': force_flag, 'name': name}) # No output should be returned from rmvdisk self._driver_assert(len(out.strip()) == 0, _('delete volume %(name)s - non empty output from CLI.\n ' 'stdout: %(out)s\n stderr: %(err)s') % {'name': name, 'out': str(out), 'err': str(err)}) else: # Log that volume does not exist LOG.info(_('warning: tried to delete volume %(name)s but ' 'it does not exist.') % {'name': name}) LOG.debug(_('leave: delete_volume: volume %(name)s ') % {'name': name}) def ensure_export(self, context, volume): volume_defined = self._is_volume_defined(volume['name']) if not volume_defined: LOG.error(_('ensure_export: volume %s not found on storage') % volume['name']) def create_export(self, context, volume): model_update = None return model_update def remove_export(self, context, volume): pass def initialize_connection(self, volume, connector): LOG.debug(_('enter: initialize_connection: volume %(vol)s with ' 'connector %(conn)s') % {'vol': str(volume), 'conn': str(connector)}) initiator_name = connector['initiator'] volume_name = volume['name'] host_name = self._get_host_from_iscsiname(initiator_name) # Check if a host is defined for the iSCSI initiator name if host_name is None: # Host does not exist - add a new host to Storwize/SVC host_name = self._create_new_host('host%s' % initiator_name, initiator_name) # Verify that create_new_host succeeded self._driver_assert(host_name is not None, _('_create_new_host failed to return the host name.')) lun_id = self._map_vol_to_host(volume_name, host_name) # Get preferred path # Only IPv4 for now because lack of OpenStack support # TODO(ronenkat): Add support for IPv6 volume_attributes = self._get_volume_attributes(volume_name) if (volume_attributes is not None and 'preferred_node_id' in volume_attributes): preferred_node = volume_attributes['preferred_node_id'] preferred_node_entry = None for node in self.iscsi_ipv4_conf: if node['node_id'] == preferred_node: preferred_node_entry = node break if preferred_node_entry is None: preferred_node_entry = self.iscsi_ipv4_conf[0] LOG.error(_('initialize_connection: did not find preferred ' 'node %(node)s for volume %(vol)s in iSCSI ' 'configuration') % {'node': preferred_node, 'vol': volume_name}) else: # Get 1st node preferred_node_entry = self.iscsi_ipv4_conf[0] LOG.error( _('initialize_connection: did not find a preferred node ' 'for volume %s in iSCSI configuration') % volume_name) properties = {} # We didn't use iSCSI discover, as in server-based iSCSI properties['target_discovered'] = False properties['target_portal'] = ('%s:%s' % (preferred_node_entry['ip'][0], '3260')) properties['target_iqn'] = preferred_node_entry['iscsi_name'] properties['target_lun'] = lun_id properties['volume_id'] = volume['id'] LOG.debug(_('leave: initialize_connection:\n volume: %(vol)s\n ' 'connector %(conn)s\n properties: %(prop)s') % {'vol': str(volume), 'conn': str(connector), 'prop': str(properties)}) return {'driver_volume_type': 'iscsi', 'data': properties, } def terminate_connection(self, volume, connector): LOG.debug(_('enter: terminate_connection: volume %(vol)s with ' 'connector %(conn)s') % {'vol': str(volume), 'conn': str(connector)}) vol_name = volume['name'] initiator_name = connector['initiator'] host_name = self._get_host_from_iscsiname(initiator_name) self._driver_assert(host_name is not None, _('_get_host_from_iscsiname failed to return the host name ' 'for iscsi name %s') % initiator_name) mapping_data = self._get_hostvdisk_mappings(host_name) if vol_name in mapping_data: out, err = self._run_ssh('rmvdiskhostmap -host %s %s' % (host_name, vol_name)) self._driver_assert(len(out.strip()) == 0, _('delete mapping of volume %(vol)s to host %(host)s ' '- non empty output from CLI.\n ' 'stdout: %(out)s\n stderr: %(err)s') % {'vol': vol_name, 'host': host_name, 'out': str(out), 'err': str(err)}) del mapping_data[vol_name] else: LOG.error(_('terminate_connection: no mapping of volume ' '%(vol)s to host %(host)s found') % {'vol': vol_name, 'host': host_name}) if not mapping_data: self._delete_host(host_name) LOG.debug(_('leave: terminate_connection: volume %(vol)s with ' 'connector %(conn)s') % {'vol': str(volume), 'conn': str(connector)}) def _flashcopy_cleanup(self, fc_map_id, source, target): try: out, err = self._run_ssh('stopfcmap -force %s' % fc_map_id) out, err = self._run_ssh('rmfcmap -force %s' % fc_map_id) except exception.ProcessExecutionError as e: LOG.error(_('_run_flashcopy: fail to cleanup failed FlashCopy ' 'mapping %(fc_map_id)% ' 'from %(source)s to %(target)s.\n' 'stdout: %(out)s\n stderr: %(err)s') % {'fc_map_id': fc_map_id, 'source': source, 'target': target, 'out': e.stdout, 'err': e.stderr}) def _run_flashcopy(self, source, target): LOG.debug( _('enter: _run_flashcopy: execute FlashCopy from source ' '%(source)s to target %(target)s') % {'source': source, 'target': target}) fc_map_cli_cmd = ('mkfcmap -source %s -target %s -autodelete ' '-cleanrate 0' % (source, target)) out, err = self._run_ssh(fc_map_cli_cmd) self._driver_assert(len(out.strip()) > 0, _('create FC mapping from %(source)s to %(target)s - ' 'did not find success message in CLI output.\n' ' stdout: %(out)s\n stderr: %(err)s\n') % {'source': source, 'target': target, 'out': str(out), 'err': str(err)}) match_obj = re.search('FlashCopy Mapping, id \[([0-9]+)\], ' 'successfully created', out) self._driver_assert(match_obj is not None, _('create FC mapping from %(source)s to %(target)s - ' 'did not find success message in CLI output.\n' ' stdout: %(out)s\n stderr: %(err)s\n') % {'source': source, 'target': target, 'out': str(out), 'err': str(err)}) try: fc_map_id = match_obj.group(1) self._driver_assert(fc_map_id is not None, _('create FC mapping from %(source)s to %(target)s - ' 'did not find mapping id in CLI output.\n' ' stdout: %(out)s\n stderr: %(err)s\n') % {'source': source, 'target': target, 'out': str(out), 'err': str(err)}) except IndexError: self._driver_assert(False, _('create FC mapping from %(source)s to %(target)s - ' 'did not find mapping id in CLI output.\n' ' stdout: %(out)s\n stderr: %(err)s\n') % {'source': source, 'target': target, 'out': str(out), 'err': str(err)}) try: out, err = self._run_ssh('prestartfcmap %s' % fc_map_id) except exception.ProcessExecutionError as e: with excutils.save_and_reraise_exception(): LOG.error(_('_run_flashcopy: fail to prepare FlashCopy ' 'from %(source)s to %(target)s.\n' 'stdout: %(out)s\n stderr: %(err)s') % {'source': source, 'target': target, 'out': e.stdout, 'err': e.stderr}) self._flashcopy_cleanup(fc_map_id, source, target) mapping_ready = False wait_time = 5 max_retries = (int(FLAGS.storwize_svc_flashcopy_timeout) / wait_time) + 1 for try_number in range(1, max_retries): mapping_attributes = self._get_flashcopy_mapping_attributes( fc_map_id) if (mapping_attributes is None or 'status' not in mapping_attributes): break if mapping_attributes['status'] == 'prepared': mapping_ready = True break elif mapping_attributes['status'] != 'preparing': exception_msg = (_('unexecpted mapping status %(status)s ' 'for mapping %(id)s. Attributes: ' '%(attr)s') % {'status': mapping_attributes['status'], 'id': fc_map_id, 'attr': mapping_attributes}) raise exception.VolumeBackendAPIException( data=exception_msg) time.sleep(wait_time) if not mapping_ready: exception_msg = (_('mapping %(id)s prepare failed to complete ' 'within the alloted %(to)s seconds timeout. ' 'Terminating') % {'id': fc_map_id, 'to': FLAGS.storwize_svc_flashcopy_timeout}) LOG.error(_('_run_flashcopy: fail to start FlashCopy ' 'from %(source)s to %(target)s with ' 'exception %(ex)s') % {'source': source, 'target': target, 'ex': exception_msg}) self._flashcopy_cleanup(fc_map_id, source, target) raise exception.InvalidSnapshot( reason=_('_run_flashcopy: %s') % exception_msg) try: out, err = self._run_ssh('startfcmap %s' % fc_map_id) except exception.ProcessExecutionError as e: with excutils.save_and_reraise_exception(): LOG.error(_('_run_flashcopy: fail to start FlashCopy ' 'from %(source)s to %(target)s.\n' 'stdout: %(out)s\n stderr: %(err)s') % {'source': source, 'target': target, 'out': e.stdout, 'err': e.stderr}) self._flashcopy_cleanup(fc_map_id, source, target) LOG.debug(_('leave: _run_flashcopy: FlashCopy started from ' '%(source)s to %(target)s') % {'source': source, 'target': target}) def create_volume_from_snapshot(self, volume, snapshot): source_volume = snapshot['name'] tgt_volume = volume['name'] LOG.debug(_('enter: create_volume_from_snapshot: snapshot %(tgt)s ' 'from volume %(src)s') % {'tgt': tgt_volume, 'src': source_volume}) src_volume_attributes = self._get_volume_attributes(source_volume) if src_volume_attributes is None: exception_msg = (_('create_volume_from_snapshot: source volume %s ' 'does not exist') % source_volume) LOG.error(exception_msg) raise exception.SnapshotNotFound(exception_msg, volume_id=source_volume) self._driver_assert('capacity' in src_volume_attributes, _('create_volume_from_snapshot: cannot get source ' 'volume %(src)s capacity from volume attributes ' '%(attr)s') % {'src': source_volume, 'attr': src_volume_attributes}) src_volume_size = src_volume_attributes['capacity'] tgt_volume_attributes = self._get_volume_attributes(tgt_volume) if tgt_volume_attributes is not None: exception_msg = (_('create_volume_from_snapshot: target volume %s ' 'already exists, cannot create') % tgt_volume) LOG.error(exception_msg) raise exception.InvalidSnapshot(reason=exception_msg) snapshot_volume = {} snapshot_volume['name'] = tgt_volume snapshot_volume['size'] = src_volume_size self._create_volume(snapshot_volume, units='b') try: self._run_flashcopy(source_volume, tgt_volume) except Exception: with excutils.save_and_reraise_exception(): self._delete_volume(snapshot_volume, True) LOG.debug( _('leave: create_volume_from_snapshot: %s created successfully') % tgt_volume) def create_snapshot(self, snapshot): src_volume = snapshot['volume_name'] tgt_volume = snapshot['name'] tgt_volume_created = False LOG.debug(_('enter: create_snapshot: snapshot %(tgt)s from ' 'volume %(src)s') % {'tgt': tgt_volume, 'src': src_volume}) src_volume_attributes = self._get_volume_attributes(src_volume) if src_volume_attributes is None: exception_msg = ( _('create_snapshot: source volume %s does not exist') % src_volume) LOG.error(exception_msg) raise exception.VolumeNotFound(exception_msg, volume_id=src_volume) self._driver_assert('capacity' in src_volume_attributes, _('create_volume_from_snapshot: cannot get source ' 'volume %(src)s capacity from volume attributes ' '%(attr)s') % {'src': src_volume, 'attr': src_volume_attributes}) source_volume_size = src_volume_attributes['capacity'] tgt_volume_attributes = self._get_volume_attributes(tgt_volume) snapshot_volume = {} if tgt_volume_attributes is None: snapshot_volume['name'] = tgt_volume snapshot_volume['size'] = source_volume_size self._create_volume(snapshot_volume, units='b') tgt_volume_created = True else: self._driver_assert('capacity' in tgt_volume_attributes, _('create_volume_from_snapshot: cannot get source ' 'volume %(src)s capacity from volume attributes ' '%(attr)s') % {'src': tgt_volume, 'attr': tgt_volume_attributes}) target_volume_size = tgt_volume_attributes['capacity'] if target_volume_size != source_volume_size: exception_msg = ( _('create_snapshot: source %(src)s and target ' 'volume %(tgt)s have different capacities ' '(source:%(ssize)s target:%(tsize)s)') % {'src': src_volume, 'tgt': tgt_volume, 'ssize': source_volume_size, 'tsize': target_volume_size}) LOG.error(exception_msg) raise exception.InvalidSnapshot(reason=exception_msg) try: self._run_flashcopy(src_volume, tgt_volume) except exception.InvalidSnapshot: with excutils.save_and_reraise_exception(): if tgt_volume_created: self._delete_volume(snapshot_volume, True) LOG.debug(_('leave: create_snapshot: %s created successfully') % tgt_volume) def delete_snapshot(self, snapshot): self._delete_snapshot(snapshot, False) def _delete_snapshot(self, snapshot, force_opt): LOG.debug(_('enter: delete_snapshot: snapshot %s') % snapshot) snapshot_defined = self._is_volume_defined(snapshot['name']) if snapshot_defined: if force_opt: self._delete_volume(snapshot, force_opt) else: self.delete_volume(snapshot) LOG.debug(_('leave: delete_snapshot: snapshot %s') % snapshot) def _get_host_from_iscsiname(self, iscsi_name): LOG.debug(_('enter: _get_host_from_iscsiname: iSCSI initiator %s') % iscsi_name) ssh_cmd = 'lshost -delim !' out, err = self._run_ssh(ssh_cmd) if (len(out.strip()) == 0): return None err_msg = _('_get_host_from_iscsiname: ' 'failed with unexpected CLI output.\n' ' command: %(cmd)s\n stdout: %(out)s\n ' 'stderr: %(err)s') % {'cmd': ssh_cmd, 'out': str(out), 'err': str(err)} host_lines = out.strip().split('\n') self._driver_assert(len(host_lines) > 0, err_msg) header = host_lines.pop(0).split('!') self._driver_assert('name' in header, err_msg) name_index = header.index('name') hosts = map(lambda x: x.split('!')[name_index], host_lines) hostname = None for host in hosts: ssh_cmd = 'lshost -delim ! %s' % host out, err = self._run_ssh(ssh_cmd) self._driver_assert(len(out) > 0, _('_get_host_from_iscsiname: ' 'Unexpected response from CLI output. ' 'Command: %(cmd)s\n stdout: %(out)s\n stderr: %(err)s') % {'cmd': ssh_cmd, 'out': str(out), 'err': str(err)}) for attrib_line in out.split('\n'): attrib_name, foo, attrib_value = attrib_line.partition('!') if attrib_name == 'iscsi_name': if iscsi_name == attrib_value: hostname = host break if hostname is not None: break LOG.debug(_('leave: _get_host_from_iscsiname: iSCSI initiator %s') % iscsi_name) return hostname def _create_new_host(self, host_name, initiator_name): LOG.debug(_('enter: _create_new_host: host %(name)s with iSCSI ' 'initiator %(init)s') % {'name': host_name, 'init': initiator_name}) if isinstance(host_name, unicode): host_name = host_name.translate(self._unicode_host_name_filter) elif isinstance(host_name, str): host_name = host_name.translate(self._string_host_name_filter) else: msg = _('_create_new_host: cannot clean host name. Host name ' 'is not unicode or string') LOG.error(msg) raise exception.NoValidHost(reason=msg) host_name = '%s_%s' % (host_name, random.randint(10000, 99999)) out, err = self._run_ssh('mkhost -name "%s" -iscsiname "%s"' % (host_name, initiator_name)) self._driver_assert(len(out.strip()) > 0 and 'successfully created' in out, _('create host %(name)s with iSCSI initiator %(init)s - ' 'did not find success message in CLI output.\n ' 'stdout: %(out)s\n stderr: %(err)s\n') % {'name': host_name, 'init': initiator_name, 'out': str(out), 'err': str(err)}) LOG.debug(_('leave: _create_new_host: host %(host)s with iSCSI ' 'initiator %(init)s') % {'host': host_name, 'init': initiator_name}) return host_name def _delete_host(self, host_name): LOG.debug(_('enter: _delete_host: host %s ') % host_name) is_defined = self._is_host_defined(host_name) if is_defined: out, err = self._run_ssh('rmhost %s ' % host_name) else: LOG.info(_('warning: tried to delete host %(name)s but ' 'it does not exist.') % {'name': host_name}) LOG.debug(_('leave: _delete_host: host %s ') % host_name) def _is_volume_defined(self, volume_name): LOG.debug(_('enter: _is_volume_defined: volume %s ') % volume_name) volume_attributes = self._get_volume_attributes(volume_name) LOG.debug(_('leave: _is_volume_defined: volume %(vol)s with %(str)s ') % {'vol': volume_name, 'str': volume_attributes is not None}) if volume_attributes is None: return False else: return True def _is_host_defined(self, host_name): LOG.debug(_('enter: _is_host_defined: host %s ') % host_name) out, err = self._run_ssh('lshost -filtervalue name=%s -delim !' % host_name) if len(out.strip()) == 0: return False lines = out.strip().split('\n') self._driver_assert(len(lines) <= 2, _('_is_host_defined: Unexpected response from CLI output.\n ' 'stdout: %(out)s\n stderr: %(err)s\n') % {'out': str(out), 'err': str(err)}) if len(lines) == 2: host_info = self._get_hdr_dic(lines[0], lines[1], '!') host_name_from_storage = host_info['name'] self._driver_assert(host_name_from_storage == host_name, _('Data received for host %(host1)s instead of host ' '%(host2)s.\n ' 'stdout: %(out)s\n stderr: %(err)s\n') % {'host1': host_name_from_storage, 'host2': host_name, 'out': str(out), 'err': str(err)}) else: host_name_from_storage = None LOG.debug(_('leave: _is_host_defined: host %(host)s with %(str)s ') % { 'host': host_name, 'str': host_name_from_storage is not None}) if host_name_from_storage is None: return False else: return True def _get_hostvdisk_mappings(self, host_name): return_data = {} ssh_cmd = 'lshostvdiskmap -delim ! %s' % host_name out, err = self._run_ssh(ssh_cmd) mappings = out.strip().split('\n') if len(mappings) > 0: header = mappings.pop(0) for mapping_line in mappings: mapping_data = self._get_hdr_dic(header, mapping_line, '!') return_data[mapping_data['vdisk_name']] = mapping_data return return_data def _map_vol_to_host(self, volume_name, host_name): LOG.debug(_('enter: _map_vol_to_host: volume %(vol)s to ' 'host %(host)s') % {'vol': volume_name, 'host': host_name}) mapping_data = self._get_hostvdisk_mappings(host_name) mapped_flag = False result_lun = '-1' if volume_name in mapping_data: mapped_flag = True result_lun = mapping_data[volume_name]['SCSI_id'] else: lun_used = [] for k, v in mapping_data.iteritems(): lun_used.append(int(v['SCSI_id'])) lun_used.sort() result_lun = str(len(lun_used)) for index, n in enumerate(lun_used): if n > index: result_lun = str(index) if not mapped_flag: out, err = self._run_ssh('mkvdiskhostmap -host %s -scsi %s %s' % (host_name, result_lun, volume_name)) self._driver_assert(len(out.strip()) > 0 and 'successfully created' in out, _('_map_vol_to_host: mapping host %(host)s to ' 'volume %(vol)s with LUN ' '%(lun)s - did not find success message in CLI output. ' 'stdout: %(out)s\n stderr: %(err)s\n') % {'host': host_name, 'vol': volume_name, 'lun': result_lun, 'out': str(out), 'err': str(err)}) LOG.debug(_('leave: _map_vol_to_host: LUN %(lun)s, volume %(vol)s, ' 'host %(host)s') % {'lun': result_lun, 'vol': volume_name, 'host': host_name}) return result_lun def _get_flashcopy_mapping_attributes(self, fc_map_id): LOG.debug(_('enter: _get_flashcopy_mapping_attributes: mapping %s') % fc_map_id) fc_ls_map_cmd = ('lsfcmap -filtervalue id=%s -delim !' % fc_map_id) out, err = self._run_ssh(fc_ls_map_cmd) self._driver_assert(len(out) > 0, _('_get_flashcopy_mapping_attributes: ' 'Unexpected response from CLI output. ' 'Command: %(cmd)s\n stdout: %(out)s\n stderr: %(err)s') % {'cmd': fc_ls_map_cmd, 'out': str(out), 'err': str(err)}) lines = out.strip().split('\n') self._driver_assert(len(lines) <= 2, _('_get_flashcopy_mapping_attributes: ' 'Unexpected response from CLI output. ' 'Command: %(cmd)s\n stdout: %(out)s\n stderr: %(err)s') % {'cmd': fc_ls_map_cmd, 'out': str(out), 'err': str(err)}) if len(lines) == 2: attributes = self._get_hdr_dic(lines[0], lines[1], '!') else: attributes = None LOG.debug(_('leave: _get_flashcopy_mapping_attributes: mapping ' '%(id)s, attributes %(attr)s') % {'id': fc_map_id, 'attr': attributes}) return attributes def _get_volume_attributes(self, volume_name): LOG.debug(_('enter: _get_volume_attributes: volume %s') % volume_name) try: ssh_cmd = 'lsvdisk -bytes -delim ! %s ' % volume_name out, err = self._run_ssh(ssh_cmd) except exception.ProcessExecutionError as e: LOG.error(_('CLI Exception output:\n command: %(cmd)s\n ' 'stdout: %(out)s\n stderr: %(err)s') % {'cmd': ssh_cmd, 'out': e.stdout, 'err': e.stderr}) return None self._driver_assert(len(out) > 0, ('_get_volume_attributes: ' 'Unexpected response from CLI output. ' 'Command: %(cmd)s\n stdout: %(out)s\n stderr: %(err)s') % {'cmd': ssh_cmd, 'out': str(out), 'err': str(err)}) attributes = {} for attrib_line in out.split('\n'): # If '!' not found, return the string and two empty strings attrib_name, foo, attrib_value = attrib_line.partition('!') if attrib_name is not None and attrib_name.strip() > 0: attributes[attrib_name] = attrib_value LOG.debug(_('leave: _get_volume_attributes:\n volume %(vol)s\n ' 'attributes: %(attr)s') % {'vol': volume_name, 'attr': str(attributes)}) return attributes

true

1c3006ed4c173fcdda961ab21b61e392548c69c5

8,547

py

Python

homework_08/teste_diversidade.py

ufpa-organization-repositories/evolutionary-computing

e16786f9619e2b357b94ab91ff3a7b352e6a0d92

[ "MIT" ]

null

homework_08/teste_diversidade.py

ufpa-organization-repositories/evolutionary-computing

e16786f9619e2b357b94ab91ff3a7b352e6a0d92

[ "MIT" ]

null

homework_08/teste_diversidade.py

ufpa-organization-repositories/evolutionary-computing

e16786f9619e2b357b94ab91ff3a7b352e6a0d92

[ "MIT" ]

null

populacao = [[0.7187463206122816, ['011101001110001100100110', '100101001111000000001110']], [0.68102618759073, ['100101111000011110111011', '100101100010100110100100']], [0.6342542148451269, ['100111110001101100101110', '011011100011000111001000']], [0.6241986174388695, ['010111001001101001111110', '100001010010000101100001']], [0.6067886961900137, ['011011011110111011011100', '011100010010110010010000']], [0.5928225700022598, ['011111101011110001000011', '101001111011001001101100']], [0.584219196618116, ['100011111000000001001010', '010100100110111011001000']], [0.5833582107194295, ['010101101111111100111101', '100110010010010001010100']], [0.5472229567081915, ['011100100110110001111000', '101101100011010101110001']], [0.5329211648083871, ['100100101010000001101111', '001111100001100110011011']], [0.5326154278718859, ['011001010110101111001110', '100001011110110101010101']], [0.5282310619742139, ['100010111100101111100000', '110001110111011011111101']], [0.5214442858967496, ['010011101000111000101010', '101110011101010101101100']], [0.5196969217927273, ['101010011101000100110110', '001110111000010110001011']], [0.5172587209761046, ['010110001010010011100101', '001111110001101001011100']], [0.5145249560525812, ['110100100010111010010010', '010111111011100100101001']], [0.5132246833711624, ['110100111101000111000011', '011110101101011111100011']], [0.5127319356114696, ['101011000010001010100101', '001011101101110100011000']], [0.5123261530855516, ['010110111100011111101001', '001011101110000010010011']], [0.511792586739197, ['100111100011011101110001', '110010011101110001001101']], [0.5113004549955176, ['001111111000000110111101', '010011101110101110101001']], [0.5090593740706316, ['010000110011010001010010', '101110111000100101001100']], [0.5087896635485242, ['100001100010010011011000', '110001110100111010101110']], [0.5084744316358049, ['111000100010000101110111', '011010111100101110000001']], [0.5070905144251526, ['000110111011100011110111', '100111101101011111010011']], [0.5068205853526966, ['100100001110011111110000', '000101000111111011110110']], [0.5064607453442134, ['010010000111000111010110', '000111011111010101011100']], [0.5063263806377141, ['101100000111110010010011', '000110101001010001111000']], [0.5062346533156891, ['001011101100010101111101', '101000010010001110111111']], [0.5056703090925954, ['010100010111101101001100', '001100001110011000001111']], [0.5053438812924628, ['010100110011111100000101', '001000001110010000100010']], [0.505334187929147, ['100100011001100010001111', '000101010101111110010110']], [0.5049561175396251, ['101111010111010011100101', '001011000010111000000110']], [0.5042455849934674, ['111000101001110011001000', '101011101101110100010100']], [0.5041036223873756, ['010000011110000000110011', '111000110100010100000010']], [0.5037768518327882, ['100011011011111100010100', '000011111010001111001110']], [0.5037167968409552, ['111001000001111110010010', '001011101100010010010000']], [0.5036727677825407, ['011111010010010111110011', '111111000011011000100100']], [0.5035205973510747, ['111011000110001110110010', '101111001010100100101110']], [0.5033318890765699, ['000110011010101010101100', '110001100101001111011101']], [0.5032842065445811, ['110100011111100001110001', '000111010101011100101001']], [0.5032758702411534, ['110101100111001111111010', '001110001110110110000111']], [0.5032675929341657, ['000101001011001101000000', '001100100110110100100011']], [0.5029612751578049, ['010010111011010100111010', '000111010001011011111101']], [0.502740799162989, ['110000010100010111110110', '100000011101101000010100']], [0.5024640860265372, ['111111001111011111100001', '011101110000100000111000']], [0.5022702065127201, ['101111011001111011100110', '011010100101111000110111']], [0.5021512426803183, ['111011011011100010010100', '010101100101000110110101']], [0.5018871104159476, ['000100100101011110100011', '111100000101010100101111']], [0.5018462352965699, ['000000000101101101000000', '001011001010001100110111']], [0.5015561651248678, ['011101110111011001100111', '000000101101101100100000']], [0.501304728374417, ['101100001010100010110100', '001001101111101111011010']], [0.5012761169335559, ['101110111011110011111111', '111101110101101100000101']], [0.5009980399693558, ['010000011000011110001001', '110011111111010100110101']], [0.5009297316560789, ['111110101001011001010100', '111100110101011001110110']], [0.5008536157286538, ['111110001111000101100101', '000101110000000100101110']], [0.5007199352252496, ['101110101010111000101111', '101110110101101101001000']], [0.5006006776568536, ['000000100110001100001101', '111010111111010000010010']], [0.5005003983582097, ['110111101111101100011000', '001000100000010111100111']], [0.5004555945275694, ['000111011000011010101110', '101111001010100111010000']], [0.5003551274646579, ['100100110010110111011011', '110001101101010000010111']], [0.5002938326873326, ['001100111010111100011011', '111110011110100110101010']], [0.49994994549836447, ['000110101000001000010011', '001111001110111100010111']], [0.49961102429402826, ['111101011001010011001110', '111100011110101010010011']], [0.4989678975527242, ['101100101011011101110001', '011110001000101100001110']], [0.49891505125833413, ['001000001100101010011101', '111000000110110000010001']], [0.4988469295160771, ['101010101110011011011101', '000011100000001101100101']], [0.49825199163698425, ['000101010000010101001111', '001011010000111000101100']], [0.4980846796618078, ['100100111001001110100111', '000010111100101010011101']], [0.49795649100195205, ['100111110100110110010101', '111101011101010000110001']], [0.49794375436360994, ['001011010100001001001101', '111001000101001001001011']], [0.4978695994946748, ['110100011011101010001111', '110101001111000000000100']], [0.4974906338726385, ['101010111110111110100111', '110110010001111111000010']], [0.4971979064536933, ['111011110111011100111000', '100101110110011010100110']], [0.49669039383694424, ['010000101010010100110110', '000110011100110000111010']], [0.49657481845943346, ['110001000111101010101100', '110101011111010011000000']], [0.49651493142138214, ['111011110101110110001000', '010000101101010100100101']], [0.4958188916169864, ['110001110001100011101010', '111000111000001110100111']], [0.49324295192733053, ['000100011000011111011000', '011110000101101000000001']], [0.493108959350183, ['000100010101001110011010', '100000000101100010100111']], [0.4921658613458329, ['110101011000100010010010', '101100011100101001101001']], [0.4921006356769773, ['010010010000000111011000', '110101100010001111111110']], [0.4919531422253398, ['111000010101011011011111', '100010111110110011010000']], [0.49182007177827647, ['111001000100100001010011', '011010010100111101100101']], [0.491708056867424, ['011010100001110111011001', '110111111001111001101101']], [0.4885509974363045, ['100101101001100000101111', '110110111000101000101001']], [0.47787048805875665, ['101001111100000001101001', '110000111000110001101000']], [0.4753911295047857, ['010101111010110011011101', '101010110000111011111101']], [0.46980604588344066, ['110001011010111110111001', '100010101010000101110100']], [0.4678475431692213, ['101101110110000100110010', '010110101110011000010110']], [0.44893377098383047, ['101001111110110011011111', '101010100011110010110000']], [0.4375619418936983, ['010111110000010110101101', '010101010001001010010100']], [0.4235820879484121, ['011000111011001011101010', '101010011010010000101011']], [0.4145945206988787, ['100110000010001001101010', '011000110010101000011110']], [0.3806746119644495, ['100001001101001000011100', '010111101011000011011101']], [0.3686907763703363, ['011100110110101110010000', '100101100010011101111010']], [0.3477816576486814, ['011000000101110110010011', '011100100101010100011111']], [0.16263560725056742, ['100011100100001110111011', '011111011110000111001100']], [0.10465748888686299, ['100010110100001000011000', '011101110111001101110000']], [0.10351800098674369, ['011101100001111011010000', '011101011110101000010111']]] melhor = [0, 0, 0] pior = [1, 1, 1] print(melhor) for i in range(populacao.__len__()): print(i, populacao[i]) if populacao[i][0] > melhor[0]: melhor = populacao[i] if populacao[i][0] < pior[0]: pior = populacao[i] print(melhor, pior) diversidade_hamming_x = 0 diversidade_hamming_y = 0 for i in range(24): diversidade_hamming_x += abs(int(melhor[1][0][i]) - int(pior[1][0][i])) diversidade_hamming_y += abs(int(melhor[1][1][i]) - int(pior[1][1][i])) print(diversidade_hamming_x, diversidade_hamming_y)

474.833333

8,020

0.803323

populacao = [[0.7187463206122816, ['011101001110001100100110', '100101001111000000001110']], [0.68102618759073, ['100101111000011110111011', '100101100010100110100100']], [0.6342542148451269, ['100111110001101100101110', '011011100011000111001000']], [0.6241986174388695, ['010111001001101001111110', '100001010010000101100001']], [0.6067886961900137, ['011011011110111011011100', '011100010010110010010000']], [0.5928225700022598, ['011111101011110001000011', '101001111011001001101100']], [0.584219196618116, ['100011111000000001001010', '010100100110111011001000']], [0.5833582107194295, ['010101101111111100111101', '100110010010010001010100']], [0.5472229567081915, ['011100100110110001111000', '101101100011010101110001']], [0.5329211648083871, ['100100101010000001101111', '001111100001100110011011']], [0.5326154278718859, ['011001010110101111001110', '100001011110110101010101']], [0.5282310619742139, ['100010111100101111100000', '110001110111011011111101']], [0.5214442858967496, ['010011101000111000101010', '101110011101010101101100']], [0.5196969217927273, ['101010011101000100110110', '001110111000010110001011']], [0.5172587209761046, ['010110001010010011100101', '001111110001101001011100']], [0.5145249560525812, ['110100100010111010010010', '010111111011100100101001']], [0.5132246833711624, ['110100111101000111000011', '011110101101011111100011']], [0.5127319356114696, ['101011000010001010100101', '001011101101110100011000']], [0.5123261530855516, ['010110111100011111101001', '001011101110000010010011']], [0.511792586739197, ['100111100011011101110001', '110010011101110001001101']], [0.5113004549955176, ['001111111000000110111101', '010011101110101110101001']], [0.5090593740706316, ['010000110011010001010010', '101110111000100101001100']], [0.5087896635485242, ['100001100010010011011000', '110001110100111010101110']], [0.5084744316358049, ['111000100010000101110111', '011010111100101110000001']], [0.5070905144251526, ['000110111011100011110111', '100111101101011111010011']], [0.5068205853526966, ['100100001110011111110000', '000101000111111011110110']], [0.5064607453442134, ['010010000111000111010110', '000111011111010101011100']], [0.5063263806377141, ['101100000111110010010011', '000110101001010001111000']], [0.5062346533156891, ['001011101100010101111101', '101000010010001110111111']], [0.5056703090925954, ['010100010111101101001100', '001100001110011000001111']], [0.5053438812924628, ['010100110011111100000101', '001000001110010000100010']], [0.505334187929147, ['100100011001100010001111', '000101010101111110010110']], [0.5049561175396251, ['101111010111010011100101', '001011000010111000000110']], [0.5042455849934674, ['111000101001110011001000', '101011101101110100010100']], [0.5041036223873756, ['010000011110000000110011', '111000110100010100000010']], [0.5037768518327882, ['100011011011111100010100', '000011111010001111001110']], [0.5037167968409552, ['111001000001111110010010', '001011101100010010010000']], [0.5036727677825407, ['011111010010010111110011', '111111000011011000100100']], [0.5035205973510747, ['111011000110001110110010', '101111001010100100101110']], [0.5033318890765699, ['000110011010101010101100', '110001100101001111011101']], [0.5032842065445811, ['110100011111100001110001', '000111010101011100101001']], [0.5032758702411534, ['110101100111001111111010', '001110001110110110000111']], [0.5032675929341657, ['000101001011001101000000', '001100100110110100100011']], [0.5029612751578049, ['010010111011010100111010', '000111010001011011111101']], [0.502740799162989, ['110000010100010111110110', '100000011101101000010100']], [0.5024640860265372, ['111111001111011111100001', '011101110000100000111000']], [0.5022702065127201, ['101111011001111011100110', '011010100101111000110111']], [0.5021512426803183, ['111011011011100010010100', '010101100101000110110101']], [0.5018871104159476, ['000100100101011110100011', '111100000101010100101111']], [0.5018462352965699, ['000000000101101101000000', '001011001010001100110111']], [0.5015561651248678, ['011101110111011001100111', '000000101101101100100000']], [0.501304728374417, ['101100001010100010110100', '001001101111101111011010']], [0.5012761169335559, ['101110111011110011111111', '111101110101101100000101']], [0.5009980399693558, ['010000011000011110001001', '110011111111010100110101']], [0.5009297316560789, ['111110101001011001010100', '111100110101011001110110']], [0.5008536157286538, ['111110001111000101100101', '000101110000000100101110']], [0.5007199352252496, ['101110101010111000101111', '101110110101101101001000']], [0.5006006776568536, ['000000100110001100001101', '111010111111010000010010']], [0.5005003983582097, ['110111101111101100011000', '001000100000010111100111']], [0.5004555945275694, ['000111011000011010101110', '101111001010100111010000']], [0.5003551274646579, ['100100110010110111011011', '110001101101010000010111']], [0.5002938326873326, ['001100111010111100011011', '111110011110100110101010']], [0.49994994549836447, ['000110101000001000010011', '001111001110111100010111']], [0.49961102429402826, ['111101011001010011001110', '111100011110101010010011']], [0.4989678975527242, ['101100101011011101110001', '011110001000101100001110']], [0.49891505125833413, ['001000001100101010011101', '111000000110110000010001']], [0.4988469295160771, ['101010101110011011011101', '000011100000001101100101']], [0.49825199163698425, ['000101010000010101001111', '001011010000111000101100']], [0.4980846796618078, ['100100111001001110100111', '000010111100101010011101']], [0.49795649100195205, ['100111110100110110010101', '111101011101010000110001']], [0.49794375436360994, ['001011010100001001001101', '111001000101001001001011']], [0.4978695994946748, ['110100011011101010001111', '110101001111000000000100']], [0.4974906338726385, ['101010111110111110100111', '110110010001111111000010']], [0.4971979064536933, ['111011110111011100111000', '100101110110011010100110']], [0.49669039383694424, ['010000101010010100110110', '000110011100110000111010']], [0.49657481845943346, ['110001000111101010101100', '110101011111010011000000']], [0.49651493142138214, ['111011110101110110001000', '010000101101010100100101']], [0.4958188916169864, ['110001110001100011101010', '111000111000001110100111']], [0.49324295192733053, ['000100011000011111011000', '011110000101101000000001']], [0.493108959350183, ['000100010101001110011010', '100000000101100010100111']], [0.4921658613458329, ['110101011000100010010010', '101100011100101001101001']], [0.4921006356769773, ['010010010000000111011000', '110101100010001111111110']], [0.4919531422253398, ['111000010101011011011111', '100010111110110011010000']], [0.49182007177827647, ['111001000100100001010011', '011010010100111101100101']], [0.491708056867424, ['011010100001110111011001', '110111111001111001101101']], [0.4885509974363045, ['100101101001100000101111', '110110111000101000101001']], [0.47787048805875665, ['101001111100000001101001', '110000111000110001101000']], [0.4753911295047857, ['010101111010110011011101', '101010110000111011111101']], [0.46980604588344066, ['110001011010111110111001', '100010101010000101110100']], [0.4678475431692213, ['101101110110000100110010', '010110101110011000010110']], [0.44893377098383047, ['101001111110110011011111', '101010100011110010110000']], [0.4375619418936983, ['010111110000010110101101', '010101010001001010010100']], [0.4235820879484121, ['011000111011001011101010', '101010011010010000101011']], [0.4145945206988787, ['100110000010001001101010', '011000110010101000011110']], [0.3806746119644495, ['100001001101001000011100', '010111101011000011011101']], [0.3686907763703363, ['011100110110101110010000', '100101100010011101111010']], [0.3477816576486814, ['011000000101110110010011', '011100100101010100011111']], [0.16263560725056742, ['100011100100001110111011', '011111011110000111001100']], [0.10465748888686299, ['100010110100001000011000', '011101110111001101110000']], [0.10351800098674369, ['011101100001111011010000', '011101011110101000010111']]] melhor = [0, 0, 0] pior = [1, 1, 1] print(melhor) for i in range(populacao.__len__()): print(i, populacao[i]) if populacao[i][0] > melhor[0]: melhor = populacao[i] if populacao[i][0] < pior[0]: pior = populacao[i] print(melhor, pior) diversidade_hamming_x = 0 diversidade_hamming_y = 0 for i in range(24): diversidade_hamming_x += abs(int(melhor[1][0][i]) - int(pior[1][0][i])) diversidade_hamming_y += abs(int(melhor[1][1][i]) - int(pior[1][1][i])) print(diversidade_hamming_x, diversidade_hamming_y)

true

1c300766ce7df5c0b0d884a7c65d71f8177fd028

4,172

py

Python

nfr_badge/src/nfr_badge.py

rrajj/gha-checklist-badges

77785b93eadf6dc833d30b0e41f04f9b1e31aad8

[ "MIT" ]

null

nfr_badge/src/nfr_badge.py

rrajj/gha-checklist-badges

77785b93eadf6dc833d30b0e41f04f9b1e31aad8

[ "MIT" ]

null

nfr_badge/src/nfr_badge.py

rrajj/gha-checklist-badges

77785b93eadf6dc833d30b0e41f04f9b1e31aad8

[ "MIT" ]

null

#!/usr/bin/env python3 import typing import re import os import argparse import urllib.parse class Checklist: def __init__(self, fname: str): self.fname = fname self.content = self.get_file_content() def get_name(self) -> str: return Checklist.get_name_from_fname(self.fname) def get_file_content(self) -> str: with open(self.fname, 'r') as f: return f.read() def get_counters(self) -> (int, int, int): return Checklist.get_counters_from_content(self.content) @staticmethod def get_counters_from_content(content: str) -> (int, int, int): regex = r"- \[([ x])\] " matches = re.finditer(regex, content, re.MULTILINE) checked=int(0) unchecked=int(0) for _, match in enumerate(matches, start=1): if match.group(1) == 'x': checked+=1 continue if match.group(1) == ' ': unchecked+=1 continue return checked, unchecked, (checked + unchecked) @staticmethod def get_name_from_fname(fname: str) -> str: bn = os.path.basename(fname) return os.path.splitext(bn)[0] class Badge: @staticmethod def new_common_badge_url(badge_name: str, badge_value: str, badge_color: str): return ( "https://img.shields.io/badge/%s-%s-%s" % ( urllib.parse.quote(badge_name.replace('-', '--'), safe=''), urllib.parse.quote(badge_value, safe=''), badge_color ) ) @staticmethod def new_progress_badge_url(badge_name: str, total: int, passed: int ) -> str: progress = int(passed/total*100) color = "green" if (progress>=70) else "yellow" if (progress>=30) else "red" return Badge.new_common_badge_url( badge_name=badge_name, badge_value="%d%% %d/%d" % ( progress, passed, total ), badge_color=color ) @staticmethod def content_update_badge_url(content: str, badge_name: str, new_badge_url: str): regex = r"(\!\[%s\])$(.*?)$" % badge_name subst = "\\1(%s)" % new_badge_url result = re.sub(regex, subst, content, 0, re.MULTILINE) finded = re.findall(regex, content, re.MULTILINE) new_line = content[1 : ].find("\n") if len(finded) > 0: return result else: return content[:new_line + 1] + "![%s](%s) \n" % (badge_name, new_badge_url) + content[new_line + 1:] class ReadmeMD: def __init__(self, fname: str): self.fname = fname self.content = self.get_content() def get_content(self) -> str: return ReadmeMD.get_file_content(self.fname) def write_content(self, content: str): ReadmeMD.write_file_content(self.fname, content) self.content=content @staticmethod def get_file_content(fname: str) -> str: with open(fname, 'r') as f: return f.read() @staticmethod def write_file_content(fname, content: str): with open(fname, 'w') as f: f.write(content) def get_cli_args(): parser = argparse.ArgumentParser(description='NFR') parser.add_argument('--readme', type=str, required=True, help='Output readme file') parser.add_argument('fnames', type=str, nargs='+', help='Checklist files') args = parser.parse_args() return args.readme, args.fnames def main(): readme_fname, fnames = get_cli_args() readme = ReadmeMD(readme_fname) for fname in fnames: checklist = Checklist(fname) mdname = checklist.get_name() checked, _, total = checklist.get_counters() readme.write_content( content=Badge.content_update_badge_url( content=readme.content, badge_name=mdname, new_badge_url=Badge.new_progress_badge_url( badge_name=mdname, total=total, passed=checked, ) ) ) if __name__== "__main__": main()

29.8

113

0.575024

import typing import re import os import argparse import urllib.parse class Checklist: def __init__(self, fname: str): self.fname = fname self.content = self.get_file_content() def get_name(self) -> str: return Checklist.get_name_from_fname(self.fname) def get_file_content(self) -> str: with open(self.fname, 'r') as f: return f.read() def get_counters(self) -> (int, int, int): return Checklist.get_counters_from_content(self.content) @staticmethod def get_counters_from_content(content: str) -> (int, int, int): regex = r"- \[([ x])\] " matches = re.finditer(regex, content, re.MULTILINE) checked=int(0) unchecked=int(0) for _, match in enumerate(matches, start=1): if match.group(1) == 'x': checked+=1 continue if match.group(1) == ' ': unchecked+=1 continue return checked, unchecked, (checked + unchecked) @staticmethod def get_name_from_fname(fname: str) -> str: bn = os.path.basename(fname) return os.path.splitext(bn)[0] class Badge: @staticmethod def new_common_badge_url(badge_name: str, badge_value: str, badge_color: str): return ( "https://img.shields.io/badge/%s-%s-%s" % ( urllib.parse.quote(badge_name.replace('-', '--'), safe=''), urllib.parse.quote(badge_value, safe=''), badge_color ) ) @staticmethod def new_progress_badge_url(badge_name: str, total: int, passed: int ) -> str: progress = int(passed/total*100) color = "green" if (progress>=70) else "yellow" if (progress>=30) else "red" return Badge.new_common_badge_url( badge_name=badge_name, badge_value="%d%% %d/%d" % ( progress, passed, total ), badge_color=color ) @staticmethod def content_update_badge_url(content: str, badge_name: str, new_badge_url: str): regex = r"(\!\[%s\])$(.*?)$" % badge_name subst = "\\1(%s)" % new_badge_url result = re.sub(regex, subst, content, 0, re.MULTILINE) finded = re.findall(regex, content, re.MULTILINE) new_line = content[1 : ].find("\n") if len(finded) > 0: return result else: return content[:new_line + 1] + "![%s](%s) \n" % (badge_name, new_badge_url) + content[new_line + 1:] class ReadmeMD: def __init__(self, fname: str): self.fname = fname self.content = self.get_content() def get_content(self) -> str: return ReadmeMD.get_file_content(self.fname) def write_content(self, content: str): ReadmeMD.write_file_content(self.fname, content) self.content=content @staticmethod def get_file_content(fname: str) -> str: with open(fname, 'r') as f: return f.read() @staticmethod def write_file_content(fname, content: str): with open(fname, 'w') as f: f.write(content) def get_cli_args(): parser = argparse.ArgumentParser(description='NFR') parser.add_argument('--readme', type=str, required=True, help='Output readme file') parser.add_argument('fnames', type=str, nargs='+', help='Checklist files') args = parser.parse_args() return args.readme, args.fnames def main(): readme_fname, fnames = get_cli_args() readme = ReadmeMD(readme_fname) for fname in fnames: checklist = Checklist(fname) mdname = checklist.get_name() checked, _, total = checklist.get_counters() readme.write_content( content=Badge.content_update_badge_url( content=readme.content, badge_name=mdname, new_badge_url=Badge.new_progress_badge_url( badge_name=mdname, total=total, passed=checked, ) ) ) if __name__== "__main__": main()

true

1c3007fd1cfdf2397111890fc42efd0a2462af0b

8,732

py

Python

easyreg/seg_unet.py

norveclibalikci/easyreg-mirror

a16254733fe957cc4024923f8dce91412966a189

[ "Apache-2.0" ]

null

easyreg/seg_unet.py

norveclibalikci/easyreg-mirror

a16254733fe957cc4024923f8dce91412966a189

[ "Apache-2.0" ]

null

easyreg/seg_unet.py

norveclibalikci/easyreg-mirror

a16254733fe957cc4024923f8dce91412966a189

[ "Apache-2.0" ]

null

from .modules import Seg_resid from .utils import * import torch.nn as nn from data_pre.partition import partition class SegUnet(nn.Module): def __init__(self, opt=None): super(SegUnet, self).__init__() self.opt = opt seg_opt = opt['tsk_set'][('seg',{},"settings for seg task")] self.is_train = opt['tsk_set']["train"] self.num_class = seg_opt['class_num',-1,"the num of class"] use_bn = seg_opt["use_bn", True, "use the batch normalization"] patch_sz = opt['dataset']['seg']['patch_size',[-1,-1,-1],"the size of input patch"] overlap_sz = opt['dataset']['seg']['partition']['overlap_size',[-1,-1,-1],"the size of input patch"] patch_sz_itk = list(np.flipud(np.array(patch_sz))) overlap_sz_itk = list(np.flipud(np.array(overlap_sz))) self.img_sz = None self.unet = Seg_resid(self.num_class,bn=use_bn) self.print_count = 0 self.partition = partition(opt['dataset']['seg']['partition'],patch_sz_itk,overlap_sz_itk) self.ensemble_during_the_test = opt['tsk_set']['seg'][("ensemble_during_the_test",False,"do test phase ensemble, which needs the test phase data augmentation already done")] def set_loss_fn(self, loss_fn): """ set loss function""" self.loss_fn = loss_fn def get_loss(self, output, gt): loss = self.loss_fn.get_loss(output,gt) return loss def check_if_update_lr(self): return False, None def set_img_sz(self, img_sz): self.img_sz = img_sz def forward(self, input, is_train=True): if is_train: output = self.unet(input) else: with torch.no_grad(): if not self.is_train and self.ensemble_during_the_test: output = self.get_assemble_ensemble(input) else: output = self.get_assemble_pred(input) self.print_count += 1 return output def get_assemble_pred(self, input, split_size=8): output = [] input_split = torch.split(input, split_size) for input_sub in input_split: res = self.forward(input_sub) if isinstance(res, list): res = res[-1] output.append(res.detach().cpu()) pred_patched = torch.cat(output, dim=0) pred_patched = torch.max(pred_patched.data, 1)[1] output_np = self.partition.assemble(pred_patched,image_size=self.img_sz) return output_np def set_file_path(self, file_path, fname): self.file_path =file_path self.fname = fname def get_assemble_pred_for_ensemble(self, input, split_size=8): output = [] input_split = torch.split(input, split_size) for input_sub in input_split: res = self.forward(input_sub) if isinstance(res, list): res = res[-1] output.append(res.detach().cpu()) pred_patched = torch.cat(output, dim=0) return pred_patched def get_assemble_ensemble(self, input): import os from .reg_data_utils import read_txt_into_list, get_file_name from tools.image_rescale import save_image_with_given_reference import SimpleITK as sitk import torch import numpy as np from glob import glob from copy import deepcopy from mermaid.utils import compute_warped_image_multiNC patch_sz = self.opt['dataset']['seg']['patch_size', [-1, -1, -1], "the size of input patch"] overlap_sz = self.opt['dataset']['seg']['partition']['overlap_size', [-1, -1, -1], "the size of input patch"] option_p = self.opt['dataset']['seg'][('partition', {}, "settings for the partition")] patch_sz_itk = list(np.flipud(np.array(patch_sz))) overlap_sz_itk = list(np.flipud(np.array(overlap_sz))) corr_partition_pool = deepcopy(partition(option_p, patch_sz_itk, overlap_sz_itk)) def compute_warped_image_label(input, warped_pth, warped_type,inv_phi_pth,inv_switcher,num_max=50,weight_for_orig_img=0): warped_pth_list = glob(os.path.join(warped_pth, warped_type)) num_max = min(len(warped_pth_list),num_max) inv_phi_pth_list = [pth.replace(warped_pth,inv_phi_pth).replace(*inv_switcher) for pth in warped_pth_list] f = lambda pth: sitk.GetArrayFromImage(sitk.ReadImage(pth)) fname = get_file_name(self.fname[0]) f_warped = lambda x: get_file_name(x).find(fname+'_') == 0 warped_sub_list = list(filter(f_warped, warped_pth_list)) inv_phi_sub_list = list(filter(f_warped, inv_phi_pth_list)) warped_sub_list = warped_sub_list[:num_max] inv_phi_sub_list = inv_phi_sub_list[:num_max] num_aug = len(warped_sub_list) warped_list = [f(pth) for pth in warped_sub_list] inv_phi_list = [f(pth) for pth in inv_phi_sub_list] warped_img = np.stack(warped_list, 0)[:,None] #warped_img = torch.Tensor(warped_img)*2-1. warped_img = self.normalize_input(warped_img,None)#self.file_path[0][0]) warped_img = torch.Tensor(warped_img) inv_phi = np.stack(inv_phi_list, 0) inv_phi = np.transpose(inv_phi, (0, 4, 3, 2, 1)) inv_phi = torch.Tensor(inv_phi) img_input_sz = self.opt["dataset"]["img_after_resize"] differ_sz = any(np.array(warped_img.shape[2:]) != np.array(img_input_sz)) sz = np.array(self.img_sz) spacing = 1. / (sz - 1) output_np = np.zeros([1, self.num_class] + self.img_sz) if weight_for_orig_img!=0: tzero_img = self.get_assemble_pred_for_ensemble(input) tzero_pred = self.partition.assemble_multi_torch(tzero_img, image_size=self.img_sz) output_np = tzero_pred.cpu().numpy() * float(round(weight_for_orig_img*num_aug)) for i in range(num_aug): if differ_sz: warped_img_cur, _ = resample_image(warped_img[i:i+1].cuda(), [1, 1, 1], [1, 3] + self.img_sz) inv_phi_cur, _ = resample_image(inv_phi[i:i+1].cuda(), [1, 1, 1], [1, 1] + self.img_sz) warped_img_cur = warped_img_cur.detach().cpu() inv_phi_cur = inv_phi_cur.detach().cpu() else: warped_img_cur = warped_img[i:i+1] inv_phi_cur = inv_phi[i:i+1] sample = {"image":[warped_img_cur[0,0].numpy()]} sample_p =corr_partition_pool(sample) pred_patched = self.get_assemble_pred_for_ensemble(torch.Tensor(sample_p["image"]).cuda()) pred_patched = self.partition.assemble_multi_torch(pred_patched, image_size=self.img_sz) pred_patched = torch.nn.functional.softmax(pred_patched,1) pred_patched = compute_warped_image_multiNC(pred_patched.cuda(), inv_phi_cur.cuda(),spacing, spline_order=1, zero_boundary=True) output_np += pred_patched.cpu().numpy() res = torch.max(torch.Tensor(output_np), 1)[1] return res[None] seg_ensemble_opt = self.opt['tsk_set']['seg'][("seg_ensemble",{},"settings of test phase data ensemble")] warped_pth = seg_ensemble_opt[("warped_pth", None,"the folder path containing the warped image from the original image")] inv_phi_pth = seg_ensemble_opt[("inv_phi_pth",None,"the folder path containing the inverse transformation")] warped_type = seg_ensemble_opt[("warped_type","*_warped.nii.gz","the suffix of the augmented data")] inv_switcher = seg_ensemble_opt[("inv_switcher",["_warped.nii.gz","_inv_phi.nii.gz"],"the fname switcher from warped image to inverse transformation map")] num_max = seg_ensemble_opt[("num_max",20,"max num of augmentation for per test image")] weight_for_orig_img = seg_ensemble_opt[("weight_for_orig_img",0.0,"the weight of original image")] output_np = compute_warped_image_label(input, warped_pth, warped_type,inv_phi_pth,inv_switcher,num_max=num_max,weight_for_orig_img=weight_for_orig_img) return output_np def normalize_input(self,img,refer_img_path): import SimpleITK as sitk if refer_img_path is not None: refer_img = sitk.GetArrayFromImage(sitk.ReadImage(refer_img_path)) else: refer_img = img min_intensity = refer_img.min() max_intensity = refer_img.max() normalized_img = (img - refer_img.min()) / (max_intensity - min_intensity) normalized_img = normalized_img * 2 - 1 return normalized_img

46.946237

181

0.636853

from .modules import Seg_resid from .utils import * import torch.nn as nn from data_pre.partition import partition class SegUnet(nn.Module): def __init__(self, opt=None): super(SegUnet, self).__init__() self.opt = opt seg_opt = opt['tsk_set'][('seg',{},"settings for seg task")] self.is_train = opt['tsk_set']["train"] self.num_class = seg_opt['class_num',-1,"the num of class"] use_bn = seg_opt["use_bn", True, "use the batch normalization"] patch_sz = opt['dataset']['seg']['patch_size',[-1,-1,-1],"the size of input patch"] overlap_sz = opt['dataset']['seg']['partition']['overlap_size',[-1,-1,-1],"the size of input patch"] patch_sz_itk = list(np.flipud(np.array(patch_sz))) overlap_sz_itk = list(np.flipud(np.array(overlap_sz))) self.img_sz = None self.unet = Seg_resid(self.num_class,bn=use_bn) self.print_count = 0 self.partition = partition(opt['dataset']['seg']['partition'],patch_sz_itk,overlap_sz_itk) self.ensemble_during_the_test = opt['tsk_set']['seg'][("ensemble_during_the_test",False,"do test phase ensemble, which needs the test phase data augmentation already done")] def set_loss_fn(self, loss_fn): self.loss_fn = loss_fn def get_loss(self, output, gt): loss = self.loss_fn.get_loss(output,gt) return loss def check_if_update_lr(self): return False, None def set_img_sz(self, img_sz): self.img_sz = img_sz def forward(self, input, is_train=True): if is_train: output = self.unet(input) else: with torch.no_grad(): if not self.is_train and self.ensemble_during_the_test: output = self.get_assemble_ensemble(input) else: output = self.get_assemble_pred(input) self.print_count += 1 return output def get_assemble_pred(self, input, split_size=8): output = [] input_split = torch.split(input, split_size) for input_sub in input_split: res = self.forward(input_sub) if isinstance(res, list): res = res[-1] output.append(res.detach().cpu()) pred_patched = torch.cat(output, dim=0) pred_patched = torch.max(pred_patched.data, 1)[1] output_np = self.partition.assemble(pred_patched,image_size=self.img_sz) return output_np def set_file_path(self, file_path, fname): self.file_path =file_path self.fname = fname def get_assemble_pred_for_ensemble(self, input, split_size=8): output = [] input_split = torch.split(input, split_size) for input_sub in input_split: res = self.forward(input_sub) if isinstance(res, list): res = res[-1] output.append(res.detach().cpu()) pred_patched = torch.cat(output, dim=0) return pred_patched def get_assemble_ensemble(self, input): import os from .reg_data_utils import read_txt_into_list, get_file_name from tools.image_rescale import save_image_with_given_reference import SimpleITK as sitk import torch import numpy as np from glob import glob from copy import deepcopy from mermaid.utils import compute_warped_image_multiNC patch_sz = self.opt['dataset']['seg']['patch_size', [-1, -1, -1], "the size of input patch"] overlap_sz = self.opt['dataset']['seg']['partition']['overlap_size', [-1, -1, -1], "the size of input patch"] option_p = self.opt['dataset']['seg'][('partition', {}, "settings for the partition")] patch_sz_itk = list(np.flipud(np.array(patch_sz))) overlap_sz_itk = list(np.flipud(np.array(overlap_sz))) corr_partition_pool = deepcopy(partition(option_p, patch_sz_itk, overlap_sz_itk)) def compute_warped_image_label(input, warped_pth, warped_type,inv_phi_pth,inv_switcher,num_max=50,weight_for_orig_img=0): warped_pth_list = glob(os.path.join(warped_pth, warped_type)) num_max = min(len(warped_pth_list),num_max) inv_phi_pth_list = [pth.replace(warped_pth,inv_phi_pth).replace(*inv_switcher) for pth in warped_pth_list] f = lambda pth: sitk.GetArrayFromImage(sitk.ReadImage(pth)) fname = get_file_name(self.fname[0]) f_warped = lambda x: get_file_name(x).find(fname+'_') == 0 warped_sub_list = list(filter(f_warped, warped_pth_list)) inv_phi_sub_list = list(filter(f_warped, inv_phi_pth_list)) warped_sub_list = warped_sub_list[:num_max] inv_phi_sub_list = inv_phi_sub_list[:num_max] num_aug = len(warped_sub_list) warped_list = [f(pth) for pth in warped_sub_list] inv_phi_list = [f(pth) for pth in inv_phi_sub_list] warped_img = np.stack(warped_list, 0)[:,None] warped_img = self.normalize_input(warped_img,None) warped_img = torch.Tensor(warped_img) inv_phi = np.stack(inv_phi_list, 0) inv_phi = np.transpose(inv_phi, (0, 4, 3, 2, 1)) inv_phi = torch.Tensor(inv_phi) img_input_sz = self.opt["dataset"]["img_after_resize"] differ_sz = any(np.array(warped_img.shape[2:]) != np.array(img_input_sz)) sz = np.array(self.img_sz) spacing = 1. / (sz - 1) output_np = np.zeros([1, self.num_class] + self.img_sz) if weight_for_orig_img!=0: tzero_img = self.get_assemble_pred_for_ensemble(input) tzero_pred = self.partition.assemble_multi_torch(tzero_img, image_size=self.img_sz) output_np = tzero_pred.cpu().numpy() * float(round(weight_for_orig_img*num_aug)) for i in range(num_aug): if differ_sz: warped_img_cur, _ = resample_image(warped_img[i:i+1].cuda(), [1, 1, 1], [1, 3] + self.img_sz) inv_phi_cur, _ = resample_image(inv_phi[i:i+1].cuda(), [1, 1, 1], [1, 1] + self.img_sz) warped_img_cur = warped_img_cur.detach().cpu() inv_phi_cur = inv_phi_cur.detach().cpu() else: warped_img_cur = warped_img[i:i+1] inv_phi_cur = inv_phi[i:i+1] sample = {"image":[warped_img_cur[0,0].numpy()]} sample_p =corr_partition_pool(sample) pred_patched = self.get_assemble_pred_for_ensemble(torch.Tensor(sample_p["image"]).cuda()) pred_patched = self.partition.assemble_multi_torch(pred_patched, image_size=self.img_sz) pred_patched = torch.nn.functional.softmax(pred_patched,1) pred_patched = compute_warped_image_multiNC(pred_patched.cuda(), inv_phi_cur.cuda(),spacing, spline_order=1, zero_boundary=True) output_np += pred_patched.cpu().numpy() res = torch.max(torch.Tensor(output_np), 1)[1] return res[None] seg_ensemble_opt = self.opt['tsk_set']['seg'][("seg_ensemble",{},"settings of test phase data ensemble")] warped_pth = seg_ensemble_opt[("warped_pth", None,"the folder path containing the warped image from the original image")] inv_phi_pth = seg_ensemble_opt[("inv_phi_pth",None,"the folder path containing the inverse transformation")] warped_type = seg_ensemble_opt[("warped_type","*_warped.nii.gz","the suffix of the augmented data")] inv_switcher = seg_ensemble_opt[("inv_switcher",["_warped.nii.gz","_inv_phi.nii.gz"],"the fname switcher from warped image to inverse transformation map")] num_max = seg_ensemble_opt[("num_max",20,"max num of augmentation for per test image")] weight_for_orig_img = seg_ensemble_opt[("weight_for_orig_img",0.0,"the weight of original image")] output_np = compute_warped_image_label(input, warped_pth, warped_type,inv_phi_pth,inv_switcher,num_max=num_max,weight_for_orig_img=weight_for_orig_img) return output_np def normalize_input(self,img,refer_img_path): import SimpleITK as sitk if refer_img_path is not None: refer_img = sitk.GetArrayFromImage(sitk.ReadImage(refer_img_path)) else: refer_img = img min_intensity = refer_img.min() max_intensity = refer_img.max() normalized_img = (img - refer_img.min()) / (max_intensity - min_intensity) normalized_img = normalized_img * 2 - 1 return normalized_img

true

1c30094813589d02854b0a9a96e186cc2ccb5a7f

554

py

Python

sendpdf/templatetags/pdftags.py

kutakitu/django-sendpdf

9acf779a0ff476020926802c8615ece2932c98fc

[ "MIT" ]

1

2021-02-03T02:53:49.000Z

sendpdf/templatetags/pdftags.py

kutakitu/django-sendpdf

9acf779a0ff476020926802c8615ece2932c98fc

[ "MIT" ]

7

2020-06-05T16:50:49.000Z

2021-09-22T17:38:26.000Z

sendpdf/templatetags/pdftags.py

kutakitu/django-sendpdf

9acf779a0ff476020926802c8615ece2932c98fc

[ "MIT" ]

null

"""Template tags for the app""" # pylint: disable=invalid-name import os from django import template register = template.Library() _DIR = os.path.abspath(os.path.dirname(__file__)) @register.simple_tag def pdf_static(static_url, pdf=None): """Static files access Ensure they are accessed when rendering page as HTML and as PDF""" if pdf is not None: file = os.path.join( _DIR, os.pardir, "static", static_url ) return file return "/static/{}".format(static_url)

23.083333

70

0.629964

import os from django import template register = template.Library() _DIR = os.path.abspath(os.path.dirname(__file__)) @register.simple_tag def pdf_static(static_url, pdf=None): if pdf is not None: file = os.path.join( _DIR, os.pardir, "static", static_url ) return file return "/static/{}".format(static_url)

true

1c300b0716c3271a0bbfefb3bb87eee655696e0d

13,947

py

Python

idaes/apps/caprese/util.py

carldlaird/idaes-pse

cc7a32ca9fa788f483fa8ef85f3d1186ef4a596f

[ "RSA-MD" ]

112

2019-02-11T23:16:36.000Z

2022-03-23T20:59:57.000Z

idaes/apps/caprese/util.py

carldlaird/idaes-pse

cc7a32ca9fa788f483fa8ef85f3d1186ef4a596f

[ "RSA-MD" ]

621

2019-03-01T14:44:12.000Z

2022-03-31T19:49:25.000Z

idaes/apps/caprese/util.py

carldlaird/idaes-pse

cc7a32ca9fa788f483fa8ef85f3d1186ef4a596f

[ "RSA-MD" ]

154

2019-02-01T23:46:33.000Z

2022-03-23T15:07:10.000Z

# -*- coding: utf-8 -*- ################################################################################# # The Institute for the Design of Advanced Energy Systems Integrated Platform # Framework (IDAES IP) was produced under the DOE Institute for the # Design of Advanced Energy Systems (IDAES), and is copyright (c) 2018-2021 # by the software owners: The Regents of the University of California, through # Lawrence Berkeley National Laboratory, National Technology & Engineering # Solutions of Sandia, LLC, Carnegie Mellon University, West Virginia University # Research Corporation, et al. All rights reserved. # # Please see the files COPYRIGHT.md and LICENSE.md for full copyright and # license information. ################################################################################# """ A module of helper functions for working with flattened DAE models. """ from pyomo.environ import ( Constraint, Var, TerminationCondition, SolverFactory, ) from pyomo.common.collections import ComponentSet, ComponentMap from pyomo.dae.flatten import flatten_dae_components from pyomo.dae.set_utils import is_in_block_indexed_by from pyomo.core.expr.visitor import identify_variables from pyomo.core.base.constraint import _ConstraintData from pyomo.core.base.block import _BlockData from idaes.core.util.model_statistics import degrees_of_freedom from idaes.core.util.dyn_utils import ( get_activity_dict, deactivate_model_at, get_implicit_index_of_set, get_fixed_dict, deactivate_constraints_unindexed_by, ) from idaes.apps.caprese.common.config import NoiseBoundOption import idaes.logger as idaeslog import random __author__ = "Robert Parker" class CachedVarsContext(object): """ This is a simple class to cache the values of variables, for instance while a solve is performed, so that they may be loaded later. For example, to set values of disturbances different than those already loaded at t0 when solving for the steady state setpoint: >>> ctrl = nmpc.controller >>> disturbances = [ctrl.FIXED_BLOCK[0].var, ctrl.FIXED_BLOCK[1].var] >>> with CachedVarsContext(disturbances, [t0]): >>> for d in disturbances: >>> d[t0].set_value(1.5) >>> ctrl.solve_setpoint(solver) """ def __init__(self, varlist, tlist): if type(tlist) is not list: tlist = [tlist] self.n_t = len(tlist) self.vars = varlist self.tlist = tlist self.cache = [[None for j in range(self.n_t)] for i in range(len(self.vars))] def __enter__(self): for i in range(len(self.vars)): for j, t in enumerate(self.tlist): self.cache[i][j] = self.vars[i][t].value return self def __exit__(self, a, b, c): for i in range(len(self.vars)): for j, t in enumerate(self.tlist): self.vars[i][t].set_value(self.cache[i][j]) def initialize_by_element_in_range(model, time, t_start, t_end, time_linking_vars=[], dae_vars=[], max_linking_range=0, **kwargs): """Function for solving a square model, time element-by-time element, between specified start and end times. Args: model : Flowsheet model to solve t_start : Beginning of timespan over which to solve t_end : End of timespan over which to solve Kwargs: solver : Solver option used to solve portions of the square model outlvl : idaes.logger output level """ solver = kwargs.pop('solver', SolverFactory('ipopt')) outlvl = kwargs.pop('outlvl', idaeslog.NOTSET) init_log = idaeslog.getInitLogger('nmpc', outlvl) solver_log = idaeslog.getSolveLogger('nmpc', outlvl) solve_initial_conditions = kwargs.pop('solve_initial_conditions', False) #TODO: Move to docstring # Variables that will be fixed for time points outside the finite element # when constraints for a finite element are activated. # For a "normal" process, these should just be differential variables # (and maybe derivative variables). For a process with a (PID) controller, # these should also include variables used by the controller. # If these variables are not specified, # Timespan over which these variables will be fixed, counting backwards # from the first time point in the finite element (which will always be # fixed) # Should I specify max_linking_range as an integer number of finite # elements, an integer number of time points, or a float in actual time # units? Go with latter for now. assert t_start in time.get_finite_elements() assert t_end in time.get_finite_elements() #assert degrees_of_freedom(model) == 0 # No need to check dof here as we will check right before each solve #dae_vars = kwargs.pop('dae_vars', []) if not dae_vars: scalar_vars, dae_vars = flatten_dae_components(model, time, ctype=Var) for var in scalar_vars: var.fix() deactivate_constraints_unindexed_by(model, time) ncp = time.get_discretization_info()['ncp'] fe_in_range = [i for i, fe in enumerate(time.get_finite_elements()) if fe >= t_start and fe <= t_end] t_in_range = [t for t in time if t >= t_start and t <= t_end] fe_in_range.pop(0) n_fe_in_range = len(fe_in_range) was_originally_active = get_activity_dict(model) was_originally_fixed = get_fixed_dict(model) # Deactivate model if not solve_initial_conditions: time_list = [t for t in time] deactivated = deactivate_model_at(model, time, time_list, outlvl=idaeslog.ERROR) else: time_list = [t for t in time if t != time.first()] deactivated = deactivate_model_at(model, time, time_list, outlvl=idaeslog.ERROR) assert degrees_of_freedom(model) == 0 with idaeslog.solver_log(solver_log, level=idaeslog.DEBUG) as slc: results = solver.solve(model, tee=slc.tee) if results.solver.termination_condition == TerminationCondition.optimal: pass else: raise ValueError( 'Failed to solve for consistent initial conditions.' ) deactivated[time.first()] = deactivate_model_at(model, time, time.first(), outlvl=idaeslog.ERROR)[time.first()] # "Integration" loop for i in fe_in_range: t_prev = time.at((i-1)*ncp+1) fe = [time.at(k) for k in range((i-1)*ncp+2, i*ncp+2)] con_list = [] for t in fe: # These will be fixed vars in constraints at t # Probably not necessary to record at what t # they occur for comp in deactivated[t]: if was_originally_active[id(comp)]: comp.activate() if not time_linking_vars: if isinstance(comp, _ConstraintData): con_list.append(comp) elif isinstance(comp, _BlockData): # Active here should be independent of whether block # was active con_list.extend( list(comp.component_data_objects(Constraint, active=True))) if not time_linking_vars: fixed_vars = [] for con in con_list: for var in identify_variables(con.expr, include_fixed=False): # use var_locator/ComponentMap to get index somehow t_idx = get_implicit_index_of_set(var, time) if t_idx is None: assert not is_in_block_indexed_by(var, time) continue if t_idx <= t_prev: fixed_vars.append(var) var.fix() else: fixed_vars = [] time_range = [t for t in time if t_prev - t <= max_linking_range and t <= t_prev] time_range = [t_prev] for _slice in time_linking_vars: for t in time_range: #if not _slice[t].fixed: _slice[t].fix() fixed_vars.append(_slice[t]) # Here I assume that the only variables that can appear in # constraints at a different (later) time index are derivatives # and differential variables (they do so in the discretization # equations) and that they only participate at t_prev. # # This is not the case for, say, PID controllers, in which case # I should pass in a list of "complicating variables," then fix # them at all time points outside the finite element. # # Alternative solution is to identify_variables in each constraint # that is activated and fix those belonging to a previous finite # element. (Should not encounter variables belonging to a future # finite element.) # ^ This option is easier, less efficient # # In either case need to record whether variable was previously fixed # so I know if I should unfix it or not. for t in fe: for _slice in dae_vars: if not _slice[t].fixed: # Fixed DAE variables are time-dependent disturbances, # whose values should not be altered by this function. _slice[t].set_value(_slice[t_prev].value) assert degrees_of_freedom(model) == 0 with idaeslog.solver_log(solver_log, level=idaeslog.DEBUG) as slc: results = solver.solve(model, tee=slc.tee) if results.solver.termination_condition == TerminationCondition.optimal: pass else: raise ValueError( 'Failed to solve for finite element %s' %i ) for t in fe: for comp in deactivated[t]: comp.deactivate() for var in fixed_vars: if not was_originally_fixed[id(var)]: var.unfix() for t in time: for comp in deactivated[t]: if was_originally_active[id(comp)]: comp.activate() def get_violated_bounds(val, bounds): """ This function tests a value against a lower and an upper bound, returning which if either is violated, as well as a direction that the value needs to move for feasibility. Arguments: val: Value to be tested bounds: Tuple containing the lower, upper bounds """ lower = bounds[0] upper = bounds[1] if upper is not None: if val > upper: return (upper, -1) if lower is not None: if val < lower: return (lower, 1) return (None, 0) class MaxDiscardError(Exception): pass def apply_noise(val_list, noise_params, noise_function): """ Applies noise to each value in a list of values and returns the result. Noise is generated by a user-provided function that maps a value and parameters to a random value. """ result = [] for val, params in zip(val_list, noise_params): if type(params) is not tuple: # better be a scalar params = (params,) result.append(noise_function(val, *params)) return result def apply_bounded_noise_discard(val, params, noise_function, bounds, max_number_discards): i = 0 while i <= max_number_discards: newval = noise_function(val, *params) violated_bound, direction = get_violated_bounds(newval, bounds) if violated_bound is None: return newval else: # Discard. i += 1 # This could be caught by the caller to raise a more useful # error that includes the variable whose noise violates a # bound. raise MaxDiscardError( 'Max number of discards exceeded when applying noise.') def apply_bounded_noise_push(val, params, noise_function, bounds, bound_push): newval = noise_function(val, *params) violated_bound, direction = get_violated_bounds(newval, bounds) if not violated_bound: return newval return violated_bound + bound_push*direction def apply_bounded_noise_fail(val, params, noise_function, bounds): newval = noise_function(val, *params) violated_bound, direction = get_violated_bounds(newval, bounds) if violated_bound: raise RuntimeError( 'Applying noise caused a bound to be violated') return newval def apply_noise_with_bounds(val_list, noise_params, noise_function, bound_list, bound_option=NoiseBoundOption.DISCARD, max_number_discards=5, bound_push=0.0): result = [] for val, params, bounds in zip(val_list, noise_params, bound_list): if type(params) is not tuple: # better be a scalar # better check: if type(params) not in {sequence_types}... params = (params,) if bound_option == NoiseBoundOption.DISCARD: newval = apply_bounded_noise_discard(val, params, noise_function, bounds, max_number_discards) elif bound_option == NoiseBoundOption.PUSH: newval = apply_bounded_noise_push(val, params, noise_function, bounds, bound_push) elif bound_option == NoiseBoundOption.FAIL: newval = apply_bounded_noise_fail(val, params, noise_function, bounds) else: raise RuntimeError( 'Bound violation option not recognized') result.append(newval) return result

38.210959

81

0.617839

d(var)]: var.unfix() for t in time: for comp in deactivated[t]: if was_originally_active[id(comp)]: comp.activate() def get_violated_bounds(val, bounds): lower = bounds[0] upper = bounds[1] if upper is not None: if val > upper: return (upper, -1) if lower is not None: if val < lower: return (lower, 1) return (None, 0) class MaxDiscardError(Exception): pass def apply_noise(val_list, noise_params, noise_function): result = [] for val, params in zip(val_list, noise_params): if type(params) is not tuple: params = (params,) result.append(noise_function(val, *params)) return result def apply_bounded_noise_discard(val, params, noise_function, bounds, max_number_discards): i = 0 while i <= max_number_discards: newval = noise_function(val, *params) violated_bound, direction = get_violated_bounds(newval, bounds) if violated_bound is None: return newval else: i += 1 raise MaxDiscardError( 'Max number of discards exceeded when applying noise.') def apply_bounded_noise_push(val, params, noise_function, bounds, bound_push): newval = noise_function(val, *params) violated_bound, direction = get_violated_bounds(newval, bounds) if not violated_bound: return newval return violated_bound + bound_push*direction def apply_bounded_noise_fail(val, params, noise_function, bounds): newval = noise_function(val, *params) violated_bound, direction = get_violated_bounds(newval, bounds) if violated_bound: raise RuntimeError( 'Applying noise caused a bound to be violated') return newval def apply_noise_with_bounds(val_list, noise_params, noise_function, bound_list, bound_option=NoiseBoundOption.DISCARD, max_number_discards=5, bound_push=0.0): result = [] for val, params, bounds in zip(val_list, noise_params, bound_list): if type(params) is not tuple: params = (params,) if bound_option == NoiseBoundOption.DISCARD: newval = apply_bounded_noise_discard(val, params, noise_function, bounds, max_number_discards) elif bound_option == NoiseBoundOption.PUSH: newval = apply_bounded_noise_push(val, params, noise_function, bounds, bound_push) elif bound_option == NoiseBoundOption.FAIL: newval = apply_bounded_noise_fail(val, params, noise_function, bounds) else: raise RuntimeError( 'Bound violation option not recognized') result.append(newval) return result

true

1c300b9e48fb395b37683f0bf7739d58f7492cb3

107

py

Python

lab15/account/admin.py

alejo8591/angular-labs

5c55b966e832e5261554da3f41fc8786bab8dce6

[ "MIT" ]

null

lab15/account/admin.py

alejo8591/angular-labs

5c55b966e832e5261554da3f41fc8786bab8dce6

[ "MIT" ]

null

lab15/account/admin.py

alejo8591/angular-labs

5c55b966e832e5261554da3f41fc8786bab8dce6

[ "MIT" ]

null

from django.contrib import admin from account.models import UserProfile admin.site.register(UserProfile)

17.833333

38

0.841121

from django.contrib import admin from account.models import UserProfile admin.site.register(UserProfile)

true

1c300ea645b005cc85266fe54fb45e174b556b13

2,900

py

Python

tests/utils/tqdm_test.py

medecau/sciencebeam-utils

0253139f17c4208ccacdedf6d2c4eb2b062b7721

[ "MIT" ]

2

2019-07-17T14:53:07.000Z

2021-09-15T04:47:47.000Z

tests/utils/tqdm_test.py

medecau/sciencebeam-utils

0253139f17c4208ccacdedf6d2c4eb2b062b7721

[ "MIT" ]

108

2018-07-24T15:20:54.000Z

2022-03-28T16:57:39.000Z

tests/utils/tqdm_test.py

medecau/sciencebeam-utils

0253139f17c4208ccacdedf6d2c4eb2b062b7721

[ "MIT" ]

2

2020-02-07T10:58:48.000Z

2021-09-01T10:15:32.000Z

from __future__ import absolute_import import logging import sys from io import StringIO from sciencebeam_utils.utils.tqdm import ( redirect_logging_to_tqdm, tqdm_with_logging_redirect, TqdmLoggingHandler ) LOGGER = logging.getLogger(__name__) class TestRedirectLoggingToTqdm: def test_should_add_and_remove_tqdm_handler(self): logger = logging.Logger('test') with redirect_logging_to_tqdm(logger=logger): assert len(logger.handlers) == 1 assert isinstance(logger.handlers[0], TqdmLoggingHandler) assert not logger.handlers def test_should_remove_and_restore_console_handlers(self): logger = logging.Logger('test') stderr_console_handler = logging.StreamHandler(sys.stderr) stdout_console_handler = logging.StreamHandler(sys.stderr) logger.handlers = [stderr_console_handler, stdout_console_handler] with redirect_logging_to_tqdm(logger=logger): assert len(logger.handlers) == 1 assert isinstance(logger.handlers[0], TqdmLoggingHandler) assert logger.handlers == [stderr_console_handler, stdout_console_handler] def test_should_inherit_console_logger_formatter(self): logger = logging.Logger('test') formatter = logging.Formatter('custom: %(message)s') console_handler = logging.StreamHandler(sys.stderr) console_handler.setFormatter(formatter) logger.handlers = [console_handler] with redirect_logging_to_tqdm(logger=logger): assert logger.handlers[0].formatter == formatter def test_should_not_remove_stream_handlers_not_fot_stdout_or_stderr(self): logger = logging.Logger('test') stream_handler = logging.StreamHandler(StringIO()) logger.addHandler(stream_handler) with redirect_logging_to_tqdm(logger=logger): assert len(logger.handlers) == 2 assert logger.handlers[0] == stream_handler assert isinstance(logger.handlers[1], TqdmLoggingHandler) assert logger.handlers == [stream_handler] class TestTqdmWithLoggingRedirect: def test_should_add_and_remove_handler_from_root_logger_by_default(self): original_handlers = list(logging.root.handlers) with tqdm_with_logging_redirect(total=1) as pbar: assert isinstance(logging.root.handlers[-1], TqdmLoggingHandler) LOGGER.info('test') pbar.update(1) assert logging.root.handlers == original_handlers def test_should_add_and_remove_handler_from_custom_logger(self): logger = logging.Logger('test') with tqdm_with_logging_redirect(total=1, logger=logger) as pbar: assert len(logger.handlers) == 1 assert isinstance(logger.handlers[0], TqdmLoggingHandler) LOGGER.info('test') pbar.update(1) assert not logger.handlers

40.277778

82

0.713793

from __future__ import absolute_import import logging import sys from io import StringIO from sciencebeam_utils.utils.tqdm import ( redirect_logging_to_tqdm, tqdm_with_logging_redirect, TqdmLoggingHandler ) LOGGER = logging.getLogger(__name__) class TestRedirectLoggingToTqdm: def test_should_add_and_remove_tqdm_handler(self): logger = logging.Logger('test') with redirect_logging_to_tqdm(logger=logger): assert len(logger.handlers) == 1 assert isinstance(logger.handlers[0], TqdmLoggingHandler) assert not logger.handlers def test_should_remove_and_restore_console_handlers(self): logger = logging.Logger('test') stderr_console_handler = logging.StreamHandler(sys.stderr) stdout_console_handler = logging.StreamHandler(sys.stderr) logger.handlers = [stderr_console_handler, stdout_console_handler] with redirect_logging_to_tqdm(logger=logger): assert len(logger.handlers) == 1 assert isinstance(logger.handlers[0], TqdmLoggingHandler) assert logger.handlers == [stderr_console_handler, stdout_console_handler] def test_should_inherit_console_logger_formatter(self): logger = logging.Logger('test') formatter = logging.Formatter('custom: %(message)s') console_handler = logging.StreamHandler(sys.stderr) console_handler.setFormatter(formatter) logger.handlers = [console_handler] with redirect_logging_to_tqdm(logger=logger): assert logger.handlers[0].formatter == formatter def test_should_not_remove_stream_handlers_not_fot_stdout_or_stderr(self): logger = logging.Logger('test') stream_handler = logging.StreamHandler(StringIO()) logger.addHandler(stream_handler) with redirect_logging_to_tqdm(logger=logger): assert len(logger.handlers) == 2 assert logger.handlers[0] == stream_handler assert isinstance(logger.handlers[1], TqdmLoggingHandler) assert logger.handlers == [stream_handler] class TestTqdmWithLoggingRedirect: def test_should_add_and_remove_handler_from_root_logger_by_default(self): original_handlers = list(logging.root.handlers) with tqdm_with_logging_redirect(total=1) as pbar: assert isinstance(logging.root.handlers[-1], TqdmLoggingHandler) LOGGER.info('test') pbar.update(1) assert logging.root.handlers == original_handlers def test_should_add_and_remove_handler_from_custom_logger(self): logger = logging.Logger('test') with tqdm_with_logging_redirect(total=1, logger=logger) as pbar: assert len(logger.handlers) == 1 assert isinstance(logger.handlers[0], TqdmLoggingHandler) LOGGER.info('test') pbar.update(1) assert not logger.handlers

true

1c300eaca3c75f0dc625939b862d2b27551f5399

717

py

Python

src/twoSumII/search.py

rajitbanerjee/leetcode

720fcdd88d371e2d6592ceec8370a6760a77bb89

[ "CC0-1.0" ]

null

src/twoSumII/search.py

rajitbanerjee/leetcode

720fcdd88d371e2d6592ceec8370a6760a77bb89

[ "CC0-1.0" ]

null

src/twoSumII/search.py

rajitbanerjee/leetcode

720fcdd88d371e2d6592ceec8370a6760a77bb89

[ "CC0-1.0" ]

1

2021-04-28T18:17:55.000Z

from typing import List class Solution: def twoSum(self, numbers: List[int], target: int) -> List[int]: for i, n in enumerate(numbers): left, right = i + 1, len(numbers) - 1 while left <= right: mid = left + (right - left) // 2 if numbers[mid] == target - n: return [i + 1, mid + 1] elif numbers[mid] < target - n: left = mid + 1 else: right = mid - 1 return [-1] if __name__ == '__main__': nums = [2, 7, 11, 15] target = 9 print(f"Input: numbers = {nums}, target = {target}") print(f"Output: {Solution().twoSum(nums, target)}")

29.875

67

0.470014

from typing import List class Solution: def twoSum(self, numbers: List[int], target: int) -> List[int]: for i, n in enumerate(numbers): left, right = i + 1, len(numbers) - 1 while left <= right: mid = left + (right - left) // 2 if numbers[mid] == target - n: return [i + 1, mid + 1] elif numbers[mid] < target - n: left = mid + 1 else: right = mid - 1 return [-1] if __name__ == '__main__': nums = [2, 7, 11, 15] target = 9 print(f"Input: numbers = {nums}, target = {target}") print(f"Output: {Solution().twoSum(nums, target)}")

true

1c3010de71681acb956f98ba650a1d48f13db2b5

136

py

Python

app/tools/__init__.py

staneyffer/my_blog

db6220eddb591da5e6368744c9b86eca2cd9696e

[ "MIT" ]

null

app/tools/__init__.py

staneyffer/my_blog

db6220eddb591da5e6368744c9b86eca2cd9696e

[ "MIT" ]

3

2020-03-24T15:41:12.000Z

2021-02-02T21:43:38.000Z

app/tools/__init__.py

staneyffer/my_blog

db6220eddb591da5e6368744c9b86eca2cd9696e

[ "MIT" ]

null

# -*- coding: utf-8 -*- from flask import Blueprint tools = Blueprint('tools', __name__) from . import views, jinja_keys, pagination

17

43

0.705882

from flask import Blueprint tools = Blueprint('tools', __name__) from . import views, jinja_keys, pagination

true

1c3010f1d6e8270f52a5282e388f1f5fc39129db

1,728

py

Python

solum/api/handlers/service_handler.py

devdattakulkarni/test-solum

4e9ddb82d217116aa2c30a6f2581080cbdfae325

[ "Apache-2.0" ]

null

solum/api/handlers/service_handler.py

devdattakulkarni/test-solum

4e9ddb82d217116aa2c30a6f2581080cbdfae325

[ "Apache-2.0" ]

null

solum/api/handlers/service_handler.py

devdattakulkarni/test-solum

4e9ddb82d217116aa2c30a6f2581080cbdfae325

[ "Apache-2.0" ]

null

# Copyright 2014 - Rackspace # # Licensed under the Apache License, Version 2.0 (the "License"); you may # not use this file except in compliance with the License. You may obtain # a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, WITHOUT # WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the # License for the specific language governing permissions and limitations # under the License. import uuid from solum.api.handlers import handler from solum import objects class ServiceHandler(handler.Handler): """Fulfills a request on the service resource.""" def get(self, id): """Return a service.""" return objects.registry.Service.get_by_uuid(self.context, id) def update(self, id, data): """Modify a resource.""" updated = objects.registry.Service.update_and_save(self.context, id, data) return updated def delete(self, id): """Delete a resource.""" db_obj = objects.registry.Service.get_by_uuid(self.context, id) db_obj.destroy(self.context) def create(self, data): """Create a new resource.""" db_obj = objects.registry.Service() db_obj.update(data) db_obj.uuid = str(uuid.uuid4()) db_obj.user_id = self.context.user db_obj.project_id = self.context.tenant db_obj.create(self.context) return db_obj def get_all(self): """Return all services.""" return objects.registry.ServiceList.get_all(self.context)

33.230769

75

0.66088

import uuid from solum.api.handlers import handler from solum import objects class ServiceHandler(handler.Handler): def get(self, id): return objects.registry.Service.get_by_uuid(self.context, id) def update(self, id, data): updated = objects.registry.Service.update_and_save(self.context, id, data) return updated def delete(self, id): db_obj = objects.registry.Service.get_by_uuid(self.context, id) db_obj.destroy(self.context) def create(self, data): db_obj = objects.registry.Service() db_obj.update(data) db_obj.uuid = str(uuid.uuid4()) db_obj.user_id = self.context.user db_obj.project_id = self.context.tenant db_obj.create(self.context) return db_obj def get_all(self): return objects.registry.ServiceList.get_all(self.context)

true

1c3010ff357f572a4fba07a968d31746208dc1e6

3,463

py

Python

codechef_competition/nov_2020_long_challenge/ADADISH.py

souvikb07/DS-Algo-and-CP

6333e8f409fb7e6e7a0c42a91d5cf98c7a4d29a2

[ "MIT" ]

null

codechef_competition/nov_2020_long_challenge/ADADISH.py

souvikb07/DS-Algo-and-CP

6333e8f409fb7e6e7a0c42a91d5cf98c7a4d29a2

[ "MIT" ]

null

codechef_competition/nov_2020_long_challenge/ADADISH.py

souvikb07/DS-Algo-and-CP

6333e8f409fb7e6e7a0c42a91d5cf98c7a4d29a2

[ "MIT" ]

null

""" Ada and Dishes Chef Ada is preparing N dishes (numbered 1 through N). For each valid i, it takes Ci minutes to prepare the i-th dish. The dishes can be prepared in any order. Ada has a kitchen with two identical burners. For each valid i, to prepare the i-th dish, she puts it on one of the burners and after Ci minutes, removes it from this burner; the dish may not be removed from the burner before those Ci minutes pass, because otherwise it cools down and gets spoiled. Any two dishes may be prepared simultaneously, however, no two dishes may be on the same burner at the same time. Ada may remove a dish from a burner and put another dish on the same burner at the same time. What is the minimum time needed to prepare all dishes, i.e. reach the state where all dishes are prepared? Input The first line of the input contains a single integer T denoting the number of test cases. The description of T test cases follows. The first line of each test case contains a single integer N. The second line contains N space-separated integers C1,C2,…,CN. Output For each test case, print a single line containing one integer ― the minimum number of minutes needed to prepare all dishes. Constraints 1≤T≤1,000 1≤N≤4 1≤Ci≤5 for each valid i Subtasks Subtask #1 (1 points): C1=C2=…=CN Subtask #2 (99 points): original constraints Example Input 3 3 2 2 2 3 1 2 3 4 2 3 4 5 Example Output 4 3 7 Explanation Example case 1: Place the first two dishes on the burners, wait for two minutes, remove both dishes and prepare the last one on one burner. Example case 2: Place the first and third dish on the burners. When the first dish is prepared, remove it and put the second dish on the same burner. Example case 3: Place the third and fourth dish on the burners. When the third dish is prepared, remove it and put the second dish on the same burner. Similarly, replace the fourth dish (when it is prepared) by the first dish on the other burner. """ num_dishes=5 time_dishes=[2,3,4,5,1] if num_dishes == 1: print(time_dishes[0]) else: time_dishes.sort(reverse=True) # print(time_dishes) burners=[] i=0 time = 0 while i<=num_dishes: if i==0 and len(burners)==0: burners.extend(time_dishes[:2]) print(burners) min_time = min(burners) print(min_time) burners = [x - min_time for x in burners] print(burners) time = time+min_time print(time) burners.remove(0) print(burners) i+=2 elif i<num_dishes and len(burners)==1: print('step 2') burners.append(time_dishes[i]) min_time = min(burners) burners = [x - min_time for x in burners] print(burners) time = time+min_time print(time) burners.remove(0) print(burners) print('not empty',burners) print(i) i+=1 print(i) print('num dish', num_dishes) #break elif i==num_dishes and len(burners)==1: time= time+burners[0] print('step final', time) i+=1 print('final time', time) # cook your dish here for _ in range(int(input())): num_dishes = int(input()) time_dishes = list(map(int, input().split())) if num_dishes == 1: print(time_dishes[0]) else: time_dishes.sort(reverse=True) print(time_dishes)

33.95098

159

0.663298

num_dishes=5 time_dishes=[2,3,4,5,1] if num_dishes == 1: print(time_dishes[0]) else: time_dishes.sort(reverse=True) burners=[] i=0 time = 0 while i<=num_dishes: if i==0 and len(burners)==0: burners.extend(time_dishes[:2]) print(burners) min_time = min(burners) print(min_time) burners = [x - min_time for x in burners] print(burners) time = time+min_time print(time) burners.remove(0) print(burners) i+=2 elif i<num_dishes and len(burners)==1: print('step 2') burners.append(time_dishes[i]) min_time = min(burners) burners = [x - min_time for x in burners] print(burners) time = time+min_time print(time) burners.remove(0) print(burners) print('not empty',burners) print(i) i+=1 print(i) print('num dish', num_dishes) elif i==num_dishes and len(burners)==1: time= time+burners[0] print('step final', time) i+=1 print('final time', time) for _ in range(int(input())): num_dishes = int(input()) time_dishes = list(map(int, input().split())) if num_dishes == 1: print(time_dishes[0]) else: time_dishes.sort(reverse=True) print(time_dishes)

true

1c3011732b84a4b6984e1fbbcbbc0b70fadf6693

1,571

py

Python

utils/exceptions.py

whateverfw/Fixtures-Builder

39fa1631f2822eb08059047c1aa56016b79ce670

[ "MIT" ]

2

2020-07-03T12:25:53.000Z

2020-07-08T20:42:49.000Z

utils/exceptions.py

whateverfw/Fixtures-Builder

39fa1631f2822eb08059047c1aa56016b79ce670

[ "MIT" ]

null

utils/exceptions.py

whateverfw/Fixtures-Builder

39fa1631f2822eb08059047c1aa56016b79ce670

[ "MIT" ]

null

class InputError(Exception): def __init__(self) -> None: self.message = f''' Expected 2 arguments, got 1 You should run script via: <script_name> <file_name> e.g. >> main.py somename.csv ''' def __str__(self) -> str: return self.message class FileTypeError(Exception): def __init__(self, allowed_extensions) -> None: self.message = f''' This type is not supported. Should be one of the following {allowed_extensions} ''' def __str__(self) -> str: return self.message class ModeTypeError(Exception): def __init__(self, allowed_modes) -> None: self.message = f''' This input mode is not supported. Should be one of the following {allowed_modes} ''' def __str__(self) -> str: return self.message class MissingFileError(Exception): def __init__(self, file) -> None: self.message = f''' File {file} was not found in project directory. Remember that file should be placed in the same directory as <main.py> ''' def __str__(self) -> str: return self.message class InvalidColumnsAmountError(Exception): def __init__(self, user_columns_count, data_columns_count) -> None: self.message = f''' Number of columns that you specified - {user_columns_count} is greater than number of columns in csv file - {data_columns_count} ''' def __str__(self) -> str: return self.message

28.563636

87

0.605983

class InputError(Exception): def __init__(self) -> None: self.message = f''' Expected 2 arguments, got 1 You should run script via: <script_name> <file_name> e.g. >> main.py somename.csv ''' def __str__(self) -> str: return self.message class FileTypeError(Exception): def __init__(self, allowed_extensions) -> None: self.message = f''' This type is not supported. Should be one of the following {allowed_extensions} ''' def __str__(self) -> str: return self.message class ModeTypeError(Exception): def __init__(self, allowed_modes) -> None: self.message = f''' This input mode is not supported. Should be one of the following {allowed_modes} ''' def __str__(self) -> str: return self.message class MissingFileError(Exception): def __init__(self, file) -> None: self.message = f''' File {file} was not found in project directory. Remember that file should be placed in the same directory as <main.py> ''' def __str__(self) -> str: return self.message class InvalidColumnsAmountError(Exception): def __init__(self, user_columns_count, data_columns_count) -> None: self.message = f''' Number of columns that you specified - {user_columns_count} is greater than number of columns in csv file - {data_columns_count} ''' def __str__(self) -> str: return self.message

true

1c30117d7ec4fe8e22b3743475611d1c2b53cd5f

1,669

py

Python

odoons/utils/config.py

jiksaa/odoons

6845b5cd1ad73a1d44f04772b63431c5a54cfca7

[ "MIT" ]

null

odoons/utils/config.py

jiksaa/odoons

6845b5cd1ad73a1d44f04772b63431c5a54cfca7

[ "MIT" ]

3

2021-10-05T14:29:51.000Z

2021-10-17T21:52:41.000Z

odoons/utils/config.py

jiksaa/odoons

6845b5cd1ad73a1d44f04772b63431c5a54cfca7

[ "MIT" ]

null

import os from configparser import ConfigParser, ExtendedInterpolation from ruamel.yaml import YAML ADDONS_REQ_INSTALL_CONFIG = "install-requirements" OPT_APPLY_REQS = "apply-requirements" OPT_INSTALL_ODOO = "install-odoo-command" OPT_CONF_TEMPLATE = "config-template" OPT_CONF_DIR = "config-directory" OPT_BIN_DIR = "bin-directory" DEFAULT_OPTIONS = { OPT_APPLY_REQS: True, OPT_INSTALL_ODOO: True, OPT_CONF_TEMPLATE: "odoo.cfg.template", OPT_CONF_DIR: "etc", OPT_BIN_DIR: "bin", } def load_odoons_config(path): yaml = YAML(typ="safe") with open(path, "r") as file: odoons_file = yaml.load(file) if "odoons" not in odoons_file: raise Exception("missing odoons section in {}".format(path)) return { 'odoo': odoons_file["odoons"]["odoo"], "options": odoons_file["odoons"].get("options", {}), "addons": odoons_file["odoons"].get("addons", []), } def get_config_parser(): return ConfigParser(interpolation=ExtendedInterpolation(), strict=False) def get_git_addons_path(conf): """ Function computing addons path according to the given addons configuration dict() `conf` dict is expecting to follow the addons configuration entries structure This method mainly handle the standalone option which allows to use Git repository containing a standalone module. :param conf: addons configuration dict() :return: string representation of addons path """ abspath = os.path.abspath(conf["path"]) if "standalone" in conf and conf["standalone"]: abspath = os.path.abspath(os.path.join(conf["path"], conf["standalone"])) return abspath

29.280702

86

0.705812

import os from configparser import ConfigParser, ExtendedInterpolation from ruamel.yaml import YAML ADDONS_REQ_INSTALL_CONFIG = "install-requirements" OPT_APPLY_REQS = "apply-requirements" OPT_INSTALL_ODOO = "install-odoo-command" OPT_CONF_TEMPLATE = "config-template" OPT_CONF_DIR = "config-directory" OPT_BIN_DIR = "bin-directory" DEFAULT_OPTIONS = { OPT_APPLY_REQS: True, OPT_INSTALL_ODOO: True, OPT_CONF_TEMPLATE: "odoo.cfg.template", OPT_CONF_DIR: "etc", OPT_BIN_DIR: "bin", } def load_odoons_config(path): yaml = YAML(typ="safe") with open(path, "r") as file: odoons_file = yaml.load(file) if "odoons" not in odoons_file: raise Exception("missing odoons section in {}".format(path)) return { 'odoo': odoons_file["odoons"]["odoo"], "options": odoons_file["odoons"].get("options", {}), "addons": odoons_file["odoons"].get("addons", []), } def get_config_parser(): return ConfigParser(interpolation=ExtendedInterpolation(), strict=False) def get_git_addons_path(conf): abspath = os.path.abspath(conf["path"]) if "standalone" in conf and conf["standalone"]: abspath = os.path.abspath(os.path.join(conf["path"], conf["standalone"])) return abspath

true

1c3011a1aef962c0d178f92f5ead1609884ae9b8

6,176

py

Python

embedded_gremlin/predicate/base.py

CODAIT/embedded-gremlin

cdeb3b21204fee257b3e53f1afbd3efdca20a29b

[ "Apache-2.0" ]

null

embedded_gremlin/predicate/base.py

CODAIT/embedded-gremlin

cdeb3b21204fee257b3e53f1afbd3efdca20a29b

[ "Apache-2.0" ]

1

2020-08-18T20:51:13.000Z

2020-08-18T21:56:33.000Z

embedded_gremlin/predicate/base.py

CODAIT/embedded-gremlin

cdeb3b21204fee257b3e53f1afbd3efdca20a29b

[ "Apache-2.0" ]

1

2020-08-18T21:57:21.000Z

# # Copyright (c) 2020 IBM Corp. # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. # # base.py # # Abstract base classes for predicates. from abc import ABC from typing import Iterator import pandas as pd import numpy as np from typing import * from embedded_gremlin.traversal.base import GraphTraversal class VertexPredicate: """ Base class for Boolean predicates applied to individual vertices of the graph. """ def __init__(self, *children: "VertexPredicate"): self._children = children def __call__(self, vertices: pd.DataFrame) -> np.ndarray: """ :param vertices: DataFrame of vertices on which to apply the predicate :return: A numpy Boolean mask containing `True` for each row that satisfies the predicate """ raise NotImplementedError("Subclasses must implement this method.") def bind_aliases(self, parent: GraphTraversal) -> None: """ Bind any aliases to other parts of the current path to the appropriate vertices of the current path. :param parent: Tail node node in the current path. Must already be computed. """ self.bind_aliases_self(parent) for c in self._children: c.bind_aliases(parent) def bind_aliases_self(self, parent: GraphTraversal) -> None: """ Subclasses that reference other nodes of the current path should override this method. :param parent: Tail node node in the current path. Must already be computed. """ pass def modulate(self, modulator: Iterator[str]) -> None: """ Apply one or more modulators to this predicate. :param modulator: Infinite iterator backed by a circular buffer of string-valued modulators to apply round-robin style to the expression tree rooted at this node. """ self.modulate_self(modulator) for c in self._children: c.modulate(modulator) def modulate_self(self, modulator: Iterator[str]) -> None: """ Subclasses that consume an element of the modulators stream should override this method. :param modulator: Infinite iterator backed by a circular buffer of string-valued modulators to apply round-robin style to the expression tree rooted at this node. """ pass class ColumnPredicate(VertexPredicate, ABC): """ Abstract base class for VertexPredicates that only read one column and may need that column to be bound late, as in a `has` step. """ def __init__(self): VertexPredicate.__init__(self) self._target_col = None def modulate_self(self, modulator: Iterator[str]) -> None: self._target_col = next(modulator) @property def target_col(self) -> str: """ :returns: Name of the column on which this predicate will be applied. """ return self._target_col class BinaryPredicate(VertexPredicate, ABC): """ Abstract base class for Gremlin binary predicates. """ def __init__(self, target_alias: str, *children: "BinaryPredicate"): """ :param target_alias: Name of the second vertex to compare against. :param *children: Optional set of child predicates for propagating bindings """ VertexPredicate.__init__(self, *children) self._target_alias = target_alias self._left_col = None # Type: str self._right_col = None # Type: str self._right_input = None # Type: pd.Series def bind_aliases_self(self, parent: GraphTraversal) -> None: if self._right_col is not None: vertices = parent.alias_to_vertices(self._target_alias) self._right_input = vertices[self._right_col] else: # self._target_alias references a scalar-valued step _, self._right_input = parent.alias_to_step(self._target_alias) # The inputs are views on the vertices tables, so we need to reset the # Pandas indexes to prevent any vectorized operations in the subclass # from matching rows based on misaligned indexes. self._right_input = self._right_input.reset_index(drop=True) def modulate_self(self, modulator: Iterator[str]) -> None: self._left_col = next(modulator) self._right_col = next(modulator) if self._left_col is None: raise ValueError(f"Attempted to modulate first input column of {self} to " f"`None`. Currently only string values are supported, " f"because the first (left) input of a binary predicate " f"must be of type vertex.") def left_input(self, vertices: pd.DataFrame) -> pd.Series: """ :param vertices: DataFrame of vertices on which to apply the predicate, same as eponymous argument to `VertexPredicate.__call__()`. :return: First input to the binary predicate, taking into account any `by` modulators applied to this predicate. """ return vertices[self._left_col] def right_input(self) -> pd.Series: """ :return: Second input to the binary predicate, taking into account the values of `self.target_alias` and any `by` modulators applied to this predicate. """ return self._right_input @property def target_alias(self) -> str: """ :return: Name of the alias that the predicate uses to acquire the second argument to the binary predicate """ return self._target_alias

35.291429

86

0.655602

from abc import ABC from typing import Iterator import pandas as pd import numpy as np from typing import * from embedded_gremlin.traversal.base import GraphTraversal class VertexPredicate: def __init__(self, *children: "VertexPredicate"): self._children = children def __call__(self, vertices: pd.DataFrame) -> np.ndarray: raise NotImplementedError("Subclasses must implement this method.") def bind_aliases(self, parent: GraphTraversal) -> None: self.bind_aliases_self(parent) for c in self._children: c.bind_aliases(parent) def bind_aliases_self(self, parent: GraphTraversal) -> None: pass def modulate(self, modulator: Iterator[str]) -> None: self.modulate_self(modulator) for c in self._children: c.modulate(modulator) def modulate_self(self, modulator: Iterator[str]) -> None: pass class ColumnPredicate(VertexPredicate, ABC): def __init__(self): VertexPredicate.__init__(self) self._target_col = None def modulate_self(self, modulator: Iterator[str]) -> None: self._target_col = next(modulator) @property def target_col(self) -> str: return self._target_col class BinaryPredicate(VertexPredicate, ABC): def __init__(self, target_alias: str, *children: "BinaryPredicate"): VertexPredicate.__init__(self, *children) self._target_alias = target_alias self._left_col = None self._right_col = None self._right_input = None def bind_aliases_self(self, parent: GraphTraversal) -> None: if self._right_col is not None: vertices = parent.alias_to_vertices(self._target_alias) self._right_input = vertices[self._right_col] else: _, self._right_input = parent.alias_to_step(self._target_alias) self._right_input = self._right_input.reset_index(drop=True) def modulate_self(self, modulator: Iterator[str]) -> None: self._left_col = next(modulator) self._right_col = next(modulator) if self._left_col is None: raise ValueError(f"Attempted to modulate first input column of {self} to " f"`None`. Currently only string values are supported, " f"because the first (left) input of a binary predicate " f"must be of type vertex.") def left_input(self, vertices: pd.DataFrame) -> pd.Series: return vertices[self._left_col] def right_input(self) -> pd.Series: return self._right_input @property def target_alias(self) -> str: return self._target_alias

true

1c3011a5b4d5c4eb50c3cd4b0799bbb5202d5c1f

2,029

py

Python

api/tests/test_elections.py

gsbevilaqua/elections

3675cbac34bdc691cb9530a05c857cf7bbdd6bb3

[ "BSD-3-Clause" ]

null

api/tests/test_elections.py

gsbevilaqua/elections

3675cbac34bdc691cb9530a05c857cf7bbdd6bb3

[ "BSD-3-Clause" ]

null

api/tests/test_elections.py

gsbevilaqua/elections

3675cbac34bdc691cb9530a05c857cf7bbdd6bb3

[ "BSD-3-Clause" ]

null

import os,sys,inspect current_dir = os.path.dirname(os.path.abspath(inspect.getfile(inspect.currentframe()))) parent_dir = os.path.dirname(current_dir) sys.path.insert(0, parent_dir) from Elections import Elections from nose.tools import assert_equals elec = None elec2 = None def setup_module(module): global elec, elec2 print ("") # this is to get a newline after the dots print ("Setup...") elec = Elections(1000, [0, 0, 0, 0], 1) elec.reset() elec2 = Elections(1000, [0, 0, 0, 0, 0], 1, voter_profiles = [{"pop_percentage": 100, "scores": [10, 5, 0, -5, -10]}]) elec2.reset() elec2.create_candidates() elec2.create_voters() def teardown_module(module): print ("") print ("Teardown...") def test_create_candidates(): global elec elec.create_candidates() assert_equals(len(elec.candidates), 4) assert_equals(len(elec.votes), 4) def test_create_voters(): global elec elec.create_voters() assert_equals(len(elec.voters), 1000) elec3 = Elections(1000, [0, 0, 0, 0], 1, voter_profiles = [{"pop_percentage": 50, "scores": [-10, -5, 5, 10]}, {"pop_percentage": 50, "scores": [6, 3, 1, 0]}]) elec3.reset() elec3.create_voters() assert_equals(len(elec3.voters), 1000) def test_account_for_coalitions(): global elec2 length = len(elec2.voters) elec2._account_for_coalitions() assert_equals(len(elec2.voters), length) def test_sort_ranks(): global elec2 elec2.sort_ranks() assert len(elec2.sorted_voters) > 0 def test_sort_candidates(): global elec sor = elec.sort_candidates(elec.candidates) assert_equals(len(elec.candidates), len(sor)) def test_calculate_mean(): global elec2 assert_equals(elec2.calculate_mean([0]), (10, 1.0, False)) assert_equals(elec2.calculate_mean([1]), (5, 1.0, False)) assert_equals(elec2.calculate_mean([2]), (0, 0.0, False)) assert_equals(elec2.calculate_mean([3]), (-5, 0.0, False)) assert_equals(elec2.calculate_mean([4]), (-10, 0.0, False))

31.215385

163

0.678167

import os,sys,inspect current_dir = os.path.dirname(os.path.abspath(inspect.getfile(inspect.currentframe()))) parent_dir = os.path.dirname(current_dir) sys.path.insert(0, parent_dir) from Elections import Elections from nose.tools import assert_equals elec = None elec2 = None def setup_module(module): global elec, elec2 print ("") print ("Setup...") elec = Elections(1000, [0, 0, 0, 0], 1) elec.reset() elec2 = Elections(1000, [0, 0, 0, 0, 0], 1, voter_profiles = [{"pop_percentage": 100, "scores": [10, 5, 0, -5, -10]}]) elec2.reset() elec2.create_candidates() elec2.create_voters() def teardown_module(module): print ("") print ("Teardown...") def test_create_candidates(): global elec elec.create_candidates() assert_equals(len(elec.candidates), 4) assert_equals(len(elec.votes), 4) def test_create_voters(): global elec elec.create_voters() assert_equals(len(elec.voters), 1000) elec3 = Elections(1000, [0, 0, 0, 0], 1, voter_profiles = [{"pop_percentage": 50, "scores": [-10, -5, 5, 10]}, {"pop_percentage": 50, "scores": [6, 3, 1, 0]}]) elec3.reset() elec3.create_voters() assert_equals(len(elec3.voters), 1000) def test_account_for_coalitions(): global elec2 length = len(elec2.voters) elec2._account_for_coalitions() assert_equals(len(elec2.voters), length) def test_sort_ranks(): global elec2 elec2.sort_ranks() assert len(elec2.sorted_voters) > 0 def test_sort_candidates(): global elec sor = elec.sort_candidates(elec.candidates) assert_equals(len(elec.candidates), len(sor)) def test_calculate_mean(): global elec2 assert_equals(elec2.calculate_mean([0]), (10, 1.0, False)) assert_equals(elec2.calculate_mean([1]), (5, 1.0, False)) assert_equals(elec2.calculate_mean([2]), (0, 0.0, False)) assert_equals(elec2.calculate_mean([3]), (-5, 0.0, False)) assert_equals(elec2.calculate_mean([4]), (-10, 0.0, False))

true

1c3012c4521b2052ec93c1b4ceba47deebfcdad3

5,646

py

Python

common/bin/db_connections/influxdb.py

frankovacevich/aleph

9b01dcabf3c074e8617e50fffd35c9ee1960eab6

[ "MIT" ]

null

common/bin/db_connections/influxdb.py

frankovacevich/aleph

9b01dcabf3c074e8617e50fffd35c9ee1960eab6

[ "MIT" ]

null

common/bin/db_connections/influxdb.py

frankovacevich/aleph

9b01dcabf3c074e8617e50fffd35c9ee1960eab6

[ "MIT" ]

null

""" """ from influxdb import InfluxDBClient import datetime import math from dateutil.tz import tzutc class InfluxDBConnection: def __init__(self, username, password, database, server="localhost", port=8086): self.server = server self.port = port self.username = username self.password = password self.database = database ## self.client = None self.data_buffer = [] self.buffer_size = 15000 return # Connect to database def connect(self): self.client = InfluxDBClient(self.server, self.port, self.username, self.password, self.database) return def close(self): self.client.close() return # ========================================================================== # Operations (save, get, delete) # ========================================================================== def save_data(self, key, data): try: dat = {} for x in data: y = data[x] if isinstance(y, float) and (math.isinf(y) or math.isnan(y)): continue if isinstance(y, int): y = float(y) dat[x] = y item = {"measurement": key, "tags": {}, "fields": dat, "time": data["t"]} self.data_buffer.append(item) if len(self.data_buffer) >= self.buffer_size: self.client.write_points(self.data_buffer, database=self.database) self.data_buffer.clear() except: for item in self.data_buffer: try: self.client.write_points([item], database=self.database) except: pass self.data_buffer.clear() raise return def get_data(self, key, field, since, until, count): if key not in self.get_keys(): return [] since_t = since.strftime('%Y-%m-%d %H:%M:%S') until_t = until.strftime('%Y-%m-%d %H:%M:%S') # get field ids if field == "*": fields_str = "*" null_filter = "" else: if isinstance(field, str): field = [field] field_ids = [x for x in field] fields_str = ",".join(field_ids) null_filter = " AND (" + "".join([x + ' IS NOT NULL OR ' for x in field_ids])[0:-4] + ")" query = "SELECT " + fields_str + " FROM \"" + key + "\" WHERE time >= '" + since_t + "' AND time <= '" + until_t + "'" + "" + " ORDER BY time DESC LIMIT " + str(count) print(query) q = list(self.client.query(query)) if len(q) == 0: return [] result = q[0] for r in result: r["t"] = datetime.datetime.strptime(r["time"], "%Y-%m-%dT%H:%M:%SZ") r.pop("time") return result def get_data_by_id(self, key, id_): # should not be implemented on influx since update queries are not optimized # use another db engine to store id'd data raise Exception("Invalid method") def delete_data(self, key, since, until): since_t = since.strftime('%Y-%m-%d %H:%M:%S') until_t = until.strftime('%Y-%m-%d %H:%M:%S') query = "DELETE FROM \"" + key + "\" WHERE time >= '" + str(since_t) + "' AND time <= '" + str(until_t) + "'" q = list(self.client.query(query)) return q def delete_data_by_id(self, key, id_): # should not be implemented on influx since update queries are not optimized # use another db engine to store id'd data raise Exception("Invalid method") # ========================================================================== # Get keys and fields # ========================================================================== def get_keys(self): query = "SHOW MEASUREMENTS ON " + self.database q = self.client.query(query) if len(q) == 0: return [] return [x["name"] for x in list(q)[0]] def get_fields(self, key): query = 'SHOW FIELD KEYS ON ' + self.database + ' FROM "' + key + '"' q = self.client.query(query) if len(q) == 0: return [] return [x["fieldKey"] for x in list(q)[0]] def remove_key(self, key): self.client.drop_measurement(key) return def remove_field(self, key, field): raise Exception("Invalid method") def rename_key(self, key, new_key): query = f'SELECT * INTO "{new_key}" FROM "{key}"' q = self.client.query(query) query = f'DROP MEASUREMENT "{key}"' q = self.client.query(query) return def rename_field(self, key, field, new_field): raise Exception("Invalid method") # ========================================================================== # Metadata # ========================================================================== def get_metadata(self, key): raise Exception("Invalid method") def set_metadata(self, key, field, alias, description): raise Exception("Invalid method") # ========================================================================== # Other # ========================================================================== def count_all_records(self): keys = self.get_all_keys() all = {} total = 0 for key in keys: query = 'SELECT COUNT(t) FROM "' + key + '"' q = self.client.query(query) count = list(q)[0][0]["count"] total += count all[key] = count all["__total__"] = total return all

32.448276

175

0.481049

from influxdb import InfluxDBClient import datetime import math from dateutil.tz import tzutc class InfluxDBConnection: def __init__(self, username, password, database, server="localhost", port=8086): self.server = server self.port = port self.username = username self.password = password self.database = database self.client = None self.data_buffer = [] self.buffer_size = 15000 return def connect(self): self.client = InfluxDBClient(self.server, self.port, self.username, self.password, self.database) return def close(self): self.client.close() return def save_data(self, key, data): try: dat = {} for x in data: y = data[x] if isinstance(y, float) and (math.isinf(y) or math.isnan(y)): continue if isinstance(y, int): y = float(y) dat[x] = y item = {"measurement": key, "tags": {}, "fields": dat, "time": data["t"]} self.data_buffer.append(item) if len(self.data_buffer) >= self.buffer_size: self.client.write_points(self.data_buffer, database=self.database) self.data_buffer.clear() except: for item in self.data_buffer: try: self.client.write_points([item], database=self.database) except: pass self.data_buffer.clear() raise return def get_data(self, key, field, since, until, count): if key not in self.get_keys(): return [] since_t = since.strftime('%Y-%m-%d %H:%M:%S') until_t = until.strftime('%Y-%m-%d %H:%M:%S') if field == "*": fields_str = "*" null_filter = "" else: if isinstance(field, str): field = [field] field_ids = [x for x in field] fields_str = ",".join(field_ids) null_filter = " AND (" + "".join([x + ' IS NOT NULL OR ' for x in field_ids])[0:-4] + ")" query = "SELECT " + fields_str + " FROM \"" + key + "\" WHERE time >= '" + since_t + "' AND time <= '" + until_t + "'" + "" + " ORDER BY time DESC LIMIT " + str(count) print(query) q = list(self.client.query(query)) if len(q) == 0: return [] result = q[0] for r in result: r["t"] = datetime.datetime.strptime(r["time"], "%Y-%m-%dT%H:%M:%SZ") r.pop("time") return result def get_data_by_id(self, key, id_): raise Exception("Invalid method") def delete_data(self, key, since, until): since_t = since.strftime('%Y-%m-%d %H:%M:%S') until_t = until.strftime('%Y-%m-%d %H:%M:%S') query = "DELETE FROM \"" + key + "\" WHERE time >= '" + str(since_t) + "' AND time <= '" + str(until_t) + "'" q = list(self.client.query(query)) return q def delete_data_by_id(self, key, id_): # should not be implemented on influx since update queries are not optimized # use another db engine to store id'd data raise Exception("Invalid method") def get_keys(self): query = "SHOW MEASUREMENTS ON " + self.database q = self.client.query(query) if len(q) == 0: return [] return [x["name"] for x in list(q)[0]] def get_fields(self, key): query = 'SHOW FIELD KEYS ON ' + self.database + ' FROM "' + key + '"' q = self.client.query(query) if len(q) == 0: return [] return [x["fieldKey"] for x in list(q)[0]] def remove_key(self, key): self.client.drop_measurement(key) return def remove_field(self, key, field): raise Exception("Invalid method") def rename_key(self, key, new_key): query = f'SELECT * INTO "{new_key}" FROM "{key}"' q = self.client.query(query) query = f'DROP MEASUREMENT "{key}"' q = self.client.query(query) return def rename_field(self, key, field, new_field): raise Exception("Invalid method") def get_metadata(self, key): raise Exception("Invalid method") def set_metadata(self, key, field, alias, description): raise Exception("Invalid method") def count_all_records(self): keys = self.get_all_keys() all = {} total = 0 for key in keys: query = 'SELECT COUNT(t) FROM "' + key + '"' q = self.client.query(query) count = list(q)[0][0]["count"] total += count all[key] = count all["__total__"] = total return all

true

1c3013983f195866dba486e32c2df98ef07bea20

6,474

py

Python

sunpy/visualization/wcsaxes_compat.py

Naman9639/sunpy

24c0cfbd9b03d7f9554bc86036fac2b78a5fcc56

[ "BSD-2-Clause" ]

null

sunpy/visualization/wcsaxes_compat.py

Naman9639/sunpy

24c0cfbd9b03d7f9554bc86036fac2b78a5fcc56

[ "BSD-2-Clause" ]

null

sunpy/visualization/wcsaxes_compat.py

Naman9639/sunpy

24c0cfbd9b03d7f9554bc86036fac2b78a5fcc56

[ "BSD-2-Clause" ]

null

# -*- coding: utf-8 -*- """ Helpers and Functions to make WCSAxes work in SunPy """ import matplotlib.pyplot as plt import astropy.units as u try: from astropy.visualization import wcsaxes except ImportError: raise ImportError("Astropy >= 1.3 is required to use SunPy") # Force is put here to enable disabling all checks in this module. It should # only be used by tests and other such hacks. _FORCE_NO_WCSAXES = False __all__ = ['is_wcsaxes'] def is_wcsaxes(axes): """ Test a matplotlib Axes object to see if it is an instance of WCSAxes. Parameters ---------- axes : `matplotlib.axes` Object Axes to test Returns ------- result : `bool` Result of the test """ if not _FORCE_NO_WCSAXES: return isinstance(axes, wcsaxes.WCSAxes) else: return False def gca_wcs(wcs, fig=None, slices=None): """ Get the current axes, and return a WCSAxes if possible. Parameters ---------- wcs : `astropy.wcs.WCS` A `~astropy.wcs.WCS` object used to create a new axes. fig : `matplotlib.figure.Figure` The figure in which to check for the axes. slices : `tuple` ``slices`` is passed to `~astropy.visualization.wcsaxes.WCSAxes` to describe which two dimensions of the `~astropy.wcs.WCS` object are being plotted. This slices the multidimensional wcs object in the way it needs to be sliced. Returns ------- ax : `matplotlib.axes.Axes` or `~astropy.visualization.wcsaxes.WCSAxes` object. The current axes, or a new one if created. """ if not fig: fig = plt.gcf() if not len(fig.get_axes()): if not _FORCE_NO_WCSAXES: ax = plt.gca(projection=wcs, slices=slices) else: ax = plt.gca() else: ax = plt.gca() return ax def get_world_transform(axes): """ Get the transformation to world coordinates. If the axes is a `~astropy.visualization.wcsaxes.WCSAxes` instance this returns the transform to the ``'world'`` coordinates, otherwise it returns the transform to the matplotlib data coordinates, which are assumed to be in world coordinates. Parameters ---------- axes : `~astropy.visualization.wcsaxes.WCSAxes` or `~matplotlib.axes.Axes` object. The axes to get the transform from. Returns ------- transform : `~matplotlib.transforms.CompositeGenericTransform` The transformation object. """ if is_wcsaxes(axes): transform = axes.get_transform('world') else: transform = axes.transData return transform def solar_coord_type_from_ctype(ctype): """ Determine whether a particular WCS ctype corresponds to an angle or scalar coordinate. """ if ctype[2:4] == 'LN': if ctype[:4] in ['HPLN', 'HGLN']: return 'longitude', 180. return 'longitude', None elif ctype[2:4] == 'LT': return 'latitude', None else: return 'scalar', None def default_wcs_ticks(axes, units, ctypes): """ Set the ticks and axes type on a solar WCSAxes plot. """ if not isinstance(axes, wcsaxes.WCSAxes): raise TypeError("This axes is not a WCSAxes") x = axes.coords[0] y = axes.coords[1] if x.ticks.get_tick_out() == 'in': x.set_ticks(color='white') if y.ticks.get_tick_out() == 'in': y.set_ticks(color='white') x.set_ticks_position('bl') y.set_ticks_position('bl') xtype = solar_coord_type_from_ctype(ctypes[0]) ytype = solar_coord_type_from_ctype(ctypes[1]) x.set_coord_type(*xtype) y.set_coord_type(*ytype) if xtype[0] == 'scalar': x.set_major_formatter('x.x') elif units[0] is u.deg: x.set_major_formatter('d.d') elif units[0] is u.arcsec: x.set_major_formatter('s.s') else: x.set_major_formatter('x.x') if ytype[0] == 'scalar': x.set_major_formatter('x.x') elif units[1] is u.deg: y.set_major_formatter('d.d') elif units[1] is u.arcsec: y.set_major_formatter('s.s') else: y.set_major_formatter('x.x') def default_wcs_grid(axes, units, ctypes): """ Apply some default wcsaxes grid formatting. Parameters ---------- axes : `~astropy.visualization.wcsaxes.WCSAxes` object. The `~astropy.visualization.wcsaxes.WCSAxes` object to draw the world coordinate grid on. units : `tuple` The axes units axes x y order. """ default_wcs_ticks(axes, units, ctypes) axes.coords.grid(color='white', alpha=0.6, linestyle='dotted', linewidth=0.5) @u.quantity_input(grid_spacing=u.deg) def wcsaxes_heliographic_overlay(axes, grid_spacing=10*u.deg, **kwargs): """ Create a heliographic overlay using wcsaxes. Also draw a grid and label the top axes. Parameters ---------- axes : `~astropy.visualization.wcsaxes.WCSAxes` object. The `~astropy.visualization.wcsaxes.WCSAxes` object to create the HGS overlay on. grid_spacing: `~astropy.units.Quantity` Spacing for longitude and latitude grid in degrees. Returns ------- overlay : `~astropy.visualization.wcsaxes.WCSAxes` overlay The overlay object. Notes ----- Keywords are passed to `~astropy.visualization.wcsaxes.coordinates_map.CoordinatesMap.grid`. """ # Unpack spacing if isinstance(grid_spacing, u.Quantity) and grid_spacing.size == 1: lon_space = lat_space = grid_spacing elif grid_spacing.size == 2: lon_space, lat_space = grid_spacing else: raise ValueError("grid_spacing must be a Quantity of length one or two.") overlay = axes.get_coords_overlay('heliographic_stonyhurst') lon = overlay[0] lat = overlay[1] lon.coord_wrap = 180 lon.set_major_formatter('dd') lon.set_axislabel('Solar Longitude', minpad=0.8) lat.set_axislabel('Solar Latitude', minpad=0.9) lon.set_ticks_position('tr') lat.set_ticks_position('tr') grid_kw = {'color': 'white', 'zorder': 100, 'alpha': 0.5} grid_kw.update(kwargs) lon.set_ticks(spacing=lon_space, color=grid_kw['color']) lat.set_ticks(spacing=lat_space, color=grid_kw['color']) overlay.grid(**grid_kw) if axes.title: x, y = axes.title.get_position() axes.title.set_position([x, y + 0.08]) return overlay

25.690476

96

0.637319

import matplotlib.pyplot as plt import astropy.units as u try: from astropy.visualization import wcsaxes except ImportError: raise ImportError("Astropy >= 1.3 is required to use SunPy") _FORCE_NO_WCSAXES = False __all__ = ['is_wcsaxes'] def is_wcsaxes(axes): if not _FORCE_NO_WCSAXES: return isinstance(axes, wcsaxes.WCSAxes) else: return False def gca_wcs(wcs, fig=None, slices=None): if not fig: fig = plt.gcf() if not len(fig.get_axes()): if not _FORCE_NO_WCSAXES: ax = plt.gca(projection=wcs, slices=slices) else: ax = plt.gca() else: ax = plt.gca() return ax def get_world_transform(axes): if is_wcsaxes(axes): transform = axes.get_transform('world') else: transform = axes.transData return transform def solar_coord_type_from_ctype(ctype): if ctype[2:4] == 'LN': if ctype[:4] in ['HPLN', 'HGLN']: return 'longitude', 180. return 'longitude', None elif ctype[2:4] == 'LT': return 'latitude', None else: return 'scalar', None def default_wcs_ticks(axes, units, ctypes): if not isinstance(axes, wcsaxes.WCSAxes): raise TypeError("This axes is not a WCSAxes") x = axes.coords[0] y = axes.coords[1] if x.ticks.get_tick_out() == 'in': x.set_ticks(color='white') if y.ticks.get_tick_out() == 'in': y.set_ticks(color='white') x.set_ticks_position('bl') y.set_ticks_position('bl') xtype = solar_coord_type_from_ctype(ctypes[0]) ytype = solar_coord_type_from_ctype(ctypes[1]) x.set_coord_type(*xtype) y.set_coord_type(*ytype) if xtype[0] == 'scalar': x.set_major_formatter('x.x') elif units[0] is u.deg: x.set_major_formatter('d.d') elif units[0] is u.arcsec: x.set_major_formatter('s.s') else: x.set_major_formatter('x.x') if ytype[0] == 'scalar': x.set_major_formatter('x.x') elif units[1] is u.deg: y.set_major_formatter('d.d') elif units[1] is u.arcsec: y.set_major_formatter('s.s') else: y.set_major_formatter('x.x') def default_wcs_grid(axes, units, ctypes): default_wcs_ticks(axes, units, ctypes) axes.coords.grid(color='white', alpha=0.6, linestyle='dotted', linewidth=0.5) @u.quantity_input(grid_spacing=u.deg) def wcsaxes_heliographic_overlay(axes, grid_spacing=10*u.deg, **kwargs): if isinstance(grid_spacing, u.Quantity) and grid_spacing.size == 1: lon_space = lat_space = grid_spacing elif grid_spacing.size == 2: lon_space, lat_space = grid_spacing else: raise ValueError("grid_spacing must be a Quantity of length one or two.") overlay = axes.get_coords_overlay('heliographic_stonyhurst') lon = overlay[0] lat = overlay[1] lon.coord_wrap = 180 lon.set_major_formatter('dd') lon.set_axislabel('Solar Longitude', minpad=0.8) lat.set_axislabel('Solar Latitude', minpad=0.9) lon.set_ticks_position('tr') lat.set_ticks_position('tr') grid_kw = {'color': 'white', 'zorder': 100, 'alpha': 0.5} grid_kw.update(kwargs) lon.set_ticks(spacing=lon_space, color=grid_kw['color']) lat.set_ticks(spacing=lat_space, color=grid_kw['color']) overlay.grid(**grid_kw) if axes.title: x, y = axes.title.get_position() axes.title.set_position([x, y + 0.08]) return overlay

true

1c3013bd2cebdebd315d8f3d429bbca5d0355513

2,852

py

Python

tests/components/demo/test_geo_location.py

OpenPeerPower/openpeerpower

940a04a88e8f78e2d010dc912ad6905ae363503c

[ "Apache-2.0" ]

null

tests/components/demo/test_geo_location.py

OpenPeerPower/openpeerpower

940a04a88e8f78e2d010dc912ad6905ae363503c

[ "Apache-2.0" ]

null

tests/components/demo/test_geo_location.py

OpenPeerPower/openpeerpower

940a04a88e8f78e2d010dc912ad6905ae363503c

[ "Apache-2.0" ]

1

2019-04-24T14:10:08.000Z

"""The tests for the demo platform.""" import unittest from unittest.mock import patch from openpeerpower.components import geo_location from openpeerpower.components.demo.geo_location import ( DEFAULT_UNIT_OF_MEASUREMENT, DEFAULT_UPDATE_INTERVAL, NUMBER_OF_DEMO_DEVICES, ) from openpeerpower.setup import setup_component import openpeerpower.util.dt as dt_util from tests.common import ( assert_setup_component, fire_time_changed, get_test_open_peer_power, ) CONFIG = {geo_location.DOMAIN: [{"platform": "demo"}]} class TestDemoPlatform(unittest.TestCase): """Test the demo platform.""" def setUp(self): """Initialize values for this testcase class.""" self.opp = get_test_open_peer_power() def tearDown(self): """Stop everything that was started.""" self.opp.stop() def test_setup_platform(self): """Test setup of demo platform via configuration.""" utcnow = dt_util.utcnow() # Patching 'utcnow' to gain more control over the timed update. with patch("openpeerpower.util.dt.utcnow", return_value=utcnow): with assert_setup_component(1, geo_location.DOMAIN): assert setup_component(self.opp, geo_location.DOMAIN, CONFIG) self.opp.block_till_done() # In this test, one zone and geolocation entities have been # generated. all_states = [ self.opp.states.get(entity_id) for entity_id in self.opp.states.entity_ids(geo_location.DOMAIN) ] assert len(all_states) == NUMBER_OF_DEMO_DEVICES for state in all_states: # Check a single device's attributes. if state.domain != geo_location.DOMAIN: # ignore home zone state continue assert ( abs(state.attributes["latitude"] - self.opp.config.latitude) < 1.0 ) assert ( abs(state.attributes["longitude"] - self.opp.config.longitude) < 1.0 ) assert ( state.attributes["unit_of_measurement"] == DEFAULT_UNIT_OF_MEASUREMENT ) # Update (replaces 1 device). fire_time_changed(self.opp, utcnow + DEFAULT_UPDATE_INTERVAL) self.opp.block_till_done() # Get all states again, ensure that the number of states is still # the same, but the lists are different. all_states_updated = [ self.opp.states.get(entity_id) for entity_id in self.opp.states.entity_ids(geo_location.DOMAIN) ] assert len(all_states_updated) == NUMBER_OF_DEMO_DEVICES assert all_states != all_states_updated

36.564103

88

0.615007

import unittest from unittest.mock import patch from openpeerpower.components import geo_location from openpeerpower.components.demo.geo_location import ( DEFAULT_UNIT_OF_MEASUREMENT, DEFAULT_UPDATE_INTERVAL, NUMBER_OF_DEMO_DEVICES, ) from openpeerpower.setup import setup_component import openpeerpower.util.dt as dt_util from tests.common import ( assert_setup_component, fire_time_changed, get_test_open_peer_power, ) CONFIG = {geo_location.DOMAIN: [{"platform": "demo"}]} class TestDemoPlatform(unittest.TestCase): def setUp(self): self.opp = get_test_open_peer_power() def tearDown(self): self.opp.stop() def test_setup_platform(self): utcnow = dt_util.utcnow() with patch("openpeerpower.util.dt.utcnow", return_value=utcnow): with assert_setup_component(1, geo_location.DOMAIN): assert setup_component(self.opp, geo_location.DOMAIN, CONFIG) self.opp.block_till_done() all_states = [ self.opp.states.get(entity_id) for entity_id in self.opp.states.entity_ids(geo_location.DOMAIN) ] assert len(all_states) == NUMBER_OF_DEMO_DEVICES for state in all_states: if state.domain != geo_location.DOMAIN: # ignore home zone state continue assert ( abs(state.attributes["latitude"] - self.opp.config.latitude) < 1.0 ) assert ( abs(state.attributes["longitude"] - self.opp.config.longitude) < 1.0 ) assert ( state.attributes["unit_of_measurement"] == DEFAULT_UNIT_OF_MEASUREMENT ) # Update (replaces 1 device). fire_time_changed(self.opp, utcnow + DEFAULT_UPDATE_INTERVAL) self.opp.block_till_done() # Get all states again, ensure that the number of states is still # the same, but the lists are different. all_states_updated = [ self.opp.states.get(entity_id) for entity_id in self.opp.states.entity_ids(geo_location.DOMAIN) ] assert len(all_states_updated) == NUMBER_OF_DEMO_DEVICES assert all_states != all_states_updated

true

1c30141ccdd08330d522e5467a59ee6418280bb7

35,375

py

Python

bindings/python/crocoddyl/utils/quadruped.py

pFernbach/crocoddyl

cbf81a329e3abaf4ce1b4a8fab1431f93cd9a5c8

[ "BSD-3-Clause" ]

null

bindings/python/crocoddyl/utils/quadruped.py

pFernbach/crocoddyl

cbf81a329e3abaf4ce1b4a8fab1431f93cd9a5c8

[ "BSD-3-Clause" ]

null

bindings/python/crocoddyl/utils/quadruped.py

pFernbach/crocoddyl

cbf81a329e3abaf4ce1b4a8fab1431f93cd9a5c8

[ "BSD-3-Clause" ]

null

import crocoddyl import pinocchio import numpy as np class SimpleQuadrupedalGaitProblem: def __init__(self, rmodel, lfFoot, rfFoot, lhFoot, rhFoot): self.rmodel = rmodel self.rdata = rmodel.createData() self.state = crocoddyl.StateMultibody(self.rmodel) self.actuation = crocoddyl.ActuationModelFloatingBase(self.state) # Getting the frame id for all the legs self.lfFootId = self.rmodel.getFrameId(lfFoot) self.rfFootId = self.rmodel.getFrameId(rfFoot) self.lhFootId = self.rmodel.getFrameId(lhFoot) self.rhFootId = self.rmodel.getFrameId(rhFoot) # Defining default state q0 = self.rmodel.referenceConfigurations["standing"] self.rmodel.defaultState = np.concatenate([q0, np.zeros(self.rmodel.nv)]) self.firstStep = True # Defining the friction coefficient and normal self.mu = 0.7 self.nsurf = np.array([0., 0., 1.]) def createCoMProblem(self, x0, comGoTo, timeStep, numKnots): """ Create a shooting problem for a CoM forward/backward task. :param x0: initial state :param comGoTo: initial CoM motion :param timeStep: step time for each knot :param numKnots: number of knots per each phase :return shooting problem """ # Compute the current foot positions q0 = x0[:self.rmodel.nq] pinocchio.forwardKinematics(self.rmodel, self.rdata, q0) pinocchio.updateFramePlacements(self.rmodel, self.rdata) com0 = pinocchio.centerOfMass(self.rmodel, self.rdata, q0) # Defining the action models along the time instances comModels = [] # Creating the action model for the CoM task comForwardModels = [ self.createSwingFootModel( timeStep, [self.lfFootId, self.rfFootId, self.lhFootId, self.rhFootId], ) for k in range(numKnots) ] comForwardTermModel = self.createSwingFootModel(timeStep, [self.lfFootId, self.rfFootId, self.lhFootId, self.rhFootId], com0 + np.array([comGoTo, 0., 0.])) comForwardTermModel.differential.costs.costs['comTrack'].weight = 1e6 comBackwardModels = [ self.createSwingFootModel( timeStep, [self.lfFootId, self.rfFootId, self.lhFootId, self.rhFootId], ) for k in range(numKnots) ] comBackwardTermModel = self.createSwingFootModel(timeStep, [self.lfFootId, self.rfFootId, self.lhFootId, self.rhFootId], com0 + np.array([-comGoTo, 0., 0.])) comBackwardTermModel.differential.costs.costs['comTrack'].weight = 1e6 # Adding the CoM tasks comModels += comForwardModels + [comForwardTermModel] comModels += comBackwardModels + [comBackwardTermModel] # Defining the shooting problem problem = crocoddyl.ShootingProblem(x0, comModels, comModels[-1]) return problem def createCoMGoalProblem(self, x0, comGoTo, timeStep, numKnots): """ Create a shooting problem for a CoM position goal task. :param x0: initial state :param comGoTo: CoM position change target :param timeStep: step time for each knot :param numKnots: number of knots per each phase :return shooting problem """ # Compute the current foot positions q0 = self.rmodel.referenceConfigurations["standing"] pinocchio.forwardKinematics(self.rmodel, self.rdata, q0) pinocchio.updateFramePlacements(self.rmodel, self.rdata) com0 = pinocchio.centerOfMass(self.rmodel, self.rdata, q0) # Defining the action models along the time instances comModels = [] # Creating the action model for the CoM task comForwardModels = [ self.createSwingFootModel( timeStep, [self.lfFootId, self.rfFootId, self.lhFootId, self.rhFootId], ) for k in range(numKnots) ] comForwardTermModel = self.createSwingFootModel(timeStep, [self.lfFootId, self.rfFootId, self.lhFootId, self.rhFootId], com0 + np.array([comGoTo, 0., 0.])) comForwardTermModel.differential.costs.costs['comTrack'].weight = 1e6 # Adding the CoM tasks comModels += comForwardModels + [comForwardTermModel] # Defining the shooting problem problem = crocoddyl.ShootingProblem(x0, comModels, comModels[-1]) return problem def createWalkingProblem(self, x0, stepLength, stepHeight, timeStep, stepKnots, supportKnots): """ Create a shooting problem for a simple walking gait. :param x0: initial state :param stepLength: step length :param stepHeight: step height :param timeStep: step time for each knot :param stepKnots: number of knots for step phases :param supportKnots: number of knots for double support phases :return shooting problem """ # Compute the current foot positions q0 = x0[:self.rmodel.nq] pinocchio.forwardKinematics(self.rmodel, self.rdata, q0) pinocchio.updateFramePlacements(self.rmodel, self.rdata) rfFootPos0 = self.rdata.oMf[self.rfFootId].translation rhFootPos0 = self.rdata.oMf[self.rhFootId].translation lfFootPos0 = self.rdata.oMf[self.lfFootId].translation lhFootPos0 = self.rdata.oMf[self.lhFootId].translation comRef = (rfFootPos0 + rhFootPos0 + lfFootPos0 + lhFootPos0) / 4 comRef[2] = np.asscalar(pinocchio.centerOfMass(self.rmodel, self.rdata, q0)[2]) # Defining the action models along the time instances loco3dModel = [] doubleSupport = [ self.createSwingFootModel( timeStep, [self.lfFootId, self.rfFootId, self.lhFootId, self.rhFootId], ) for k in range(supportKnots) ] if self.firstStep is True: rhStep = self.createFootstepModels(comRef, [rhFootPos0], 0.5 * stepLength, stepHeight, timeStep, stepKnots, [self.lfFootId, self.rfFootId, self.lhFootId], [self.rhFootId]) rfStep = self.createFootstepModels(comRef, [rfFootPos0], 0.5 * stepLength, stepHeight, timeStep, stepKnots, [self.lfFootId, self.lhFootId, self.rhFootId], [self.rfFootId]) self.firstStep = False else: rhStep = self.createFootstepModels(comRef, [rhFootPos0], stepLength, stepHeight, timeStep, stepKnots, [self.lfFootId, self.rfFootId, self.lhFootId], [self.rhFootId]) rfStep = self.createFootstepModels(comRef, [rfFootPos0], stepLength, stepHeight, timeStep, stepKnots, [self.lfFootId, self.lhFootId, self.rhFootId], [self.rfFootId]) lhStep = self.createFootstepModels(comRef, [lhFootPos0], stepLength, stepHeight, timeStep, stepKnots, [self.lfFootId, self.rfFootId, self.rhFootId], [self.lhFootId]) lfStep = self.createFootstepModels(comRef, [lfFootPos0], stepLength, stepHeight, timeStep, stepKnots, [self.rfFootId, self.lhFootId, self.rhFootId], [self.lfFootId]) loco3dModel += doubleSupport + rhStep + rfStep loco3dModel += doubleSupport + lhStep + lfStep problem = crocoddyl.ShootingProblem(x0, loco3dModel, loco3dModel[-1]) return problem def createTrottingProblem(self, x0, stepLength, stepHeight, timeStep, stepKnots, supportKnots): """ Create a shooting problem for a simple trotting gait. :param x0: initial state :param stepLength: step length :param stepHeight: step height :param timeStep: step time for each knot :param stepKnots: number of knots for step phases :param supportKnots: number of knots for double support phases :return shooting problem """ # Compute the current foot positions q0 = x0[:self.rmodel.nq] pinocchio.forwardKinematics(self.rmodel, self.rdata, q0) pinocchio.updateFramePlacements(self.rmodel, self.rdata) rfFootPos0 = self.rdata.oMf[self.rfFootId].translation rhFootPos0 = self.rdata.oMf[self.rhFootId].translation lfFootPos0 = self.rdata.oMf[self.lfFootId].translation lhFootPos0 = self.rdata.oMf[self.lhFootId].translation comRef = (rfFootPos0 + rhFootPos0 + lfFootPos0 + lhFootPos0) / 4 comRef[2] = np.asscalar(pinocchio.centerOfMass(self.rmodel, self.rdata, q0)[2]) # Defining the action models along the time instances loco3dModel = [] doubleSupport = [ self.createSwingFootModel( timeStep, [self.lfFootId, self.rfFootId, self.lhFootId, self.rhFootId], ) for k in range(supportKnots) ] if self.firstStep is True: rflhStep = self.createFootstepModels(comRef, [rfFootPos0, lhFootPos0], 0.5 * stepLength, stepHeight, timeStep, stepKnots, [self.lfFootId, self.rhFootId], [self.rfFootId, self.lhFootId]) self.firstStep = False else: rflhStep = self.createFootstepModels(comRef, [rfFootPos0, lhFootPos0], stepLength, stepHeight, timeStep, stepKnots, [self.lfFootId, self.rhFootId], [self.rfFootId, self.lhFootId]) lfrhStep = self.createFootstepModels(comRef, [lfFootPos0, rhFootPos0], stepLength, stepHeight, timeStep, stepKnots, [self.rfFootId, self.lhFootId], [self.lfFootId, self.rhFootId]) loco3dModel += doubleSupport + rflhStep loco3dModel += doubleSupport + lfrhStep problem = crocoddyl.ShootingProblem(x0, loco3dModel, loco3dModel[-1]) return problem def createPacingProblem(self, x0, stepLength, stepHeight, timeStep, stepKnots, supportKnots): """ Create a shooting problem for a simple pacing gait. :param x0: initial state :param stepLength: step length :param stepHeight: step height :param timeStep: step time for each knot :param stepKnots: number of knots for step phases :param supportKnots: number of knots for double support phases :return shooting problem """ # Compute the current foot positions q0 = x0[:self.rmodel.nq] pinocchio.forwardKinematics(self.rmodel, self.rdata, q0) pinocchio.updateFramePlacements(self.rmodel, self.rdata) rfFootPos0 = self.rdata.oMf[self.rfFootId].translation rhFootPos0 = self.rdata.oMf[self.rhFootId].translation lfFootPos0 = self.rdata.oMf[self.lfFootId].translation lhFootPos0 = self.rdata.oMf[self.lhFootId].translation comRef = (rfFootPos0 + rhFootPos0 + lfFootPos0 + lhFootPos0) / 4 comRef[2] = np.asscalar(pinocchio.centerOfMass(self.rmodel, self.rdata, q0)[2]) # Defining the action models along the time instances loco3dModel = [] doubleSupport = [ self.createSwingFootModel( timeStep, [self.lfFootId, self.rfFootId, self.lhFootId, self.rhFootId], ) for k in range(supportKnots) ] if self.firstStep is True: rightSteps = self.createFootstepModels(comRef, [rfFootPos0, rhFootPos0], 0.5 * stepLength, stepHeight, timeStep, stepKnots, [self.lfFootId, self.lhFootId], [self.rfFootId, self.rhFootId]) self.firstStep = False else: rightSteps = self.createFootstepModels(comRef, [rfFootPos0, rhFootPos0], stepLength, stepHeight, timeStep, stepKnots, [self.lfFootId, self.lhFootId], [self.rfFootId, self.rhFootId]) leftSteps = self.createFootstepModels(comRef, [lfFootPos0, lhFootPos0], stepLength, stepHeight, timeStep, stepKnots, [self.rfFootId, self.rhFootId], [self.lfFootId, self.lhFootId]) loco3dModel += doubleSupport + rightSteps loco3dModel += doubleSupport + leftSteps problem = crocoddyl.ShootingProblem(x0, loco3dModel, loco3dModel[-1]) return problem def createBoundingProblem(self, x0, stepLength, stepHeight, timeStep, stepKnots, supportKnots): """ Create a shooting problem for a simple bounding gait. :param x0: initial state :param stepLength: step length :param stepHeight: step height :param timeStep: step time for each knot :param stepKnots: number of knots for step phases :param supportKnots: number of knots for double support phases :return shooting problem """ # Compute the current foot positions q0 = x0[:self.rmodel.nq] pinocchio.forwardKinematics(self.rmodel, self.rdata, q0) pinocchio.updateFramePlacements(self.rmodel, self.rdata) rfFootPos0 = self.rdata.oMf[self.rfFootId].translation rhFootPos0 = self.rdata.oMf[self.rhFootId].translation lfFootPos0 = self.rdata.oMf[self.lfFootId].translation lhFootPos0 = self.rdata.oMf[self.lhFootId].translation comRef = (rfFootPos0 + rhFootPos0 + lfFootPos0 + lhFootPos0) / 4 comRef[2] = np.asscalar(pinocchio.centerOfMass(self.rmodel, self.rdata, q0)[2]) # Defining the action models along the time instances loco3dModel = [] doubleSupport = [ self.createSwingFootModel(timeStep, [self.lfFootId, self.rfFootId, self.lhFootId, self.rhFootId]) for k in range(supportKnots) ] hindSteps = self.createFootstepModels(comRef, [lfFootPos0, rfFootPos0], stepLength, stepHeight, timeStep, stepKnots, [self.lhFootId, self.rhFootId], [self.lfFootId, self.rfFootId]) frontSteps = self.createFootstepModels(comRef, [lhFootPos0, rhFootPos0], stepLength, stepHeight, timeStep, stepKnots, [self.lfFootId, self.rfFootId], [self.lhFootId, self.rhFootId]) loco3dModel += doubleSupport + hindSteps loco3dModel += doubleSupport + frontSteps problem = crocoddyl.ShootingProblem(x0, loco3dModel, loco3dModel[-1]) return problem def createJumpingProblem(self, x0, jumpHeight, jumpLength, timeStep, groundKnots, flyingKnots): q0 = x0[:self.rmodel.nq] pinocchio.forwardKinematics(self.rmodel, self.rdata, q0) pinocchio.updateFramePlacements(self.rmodel, self.rdata) rfFootPos0 = self.rdata.oMf[self.rfFootId].translation rhFootPos0 = self.rdata.oMf[self.rhFootId].translation lfFootPos0 = self.rdata.oMf[self.lfFootId].translation lhFootPos0 = self.rdata.oMf[self.lhFootId].translation df = jumpLength[2] - rfFootPos0[2] rfFootPos0[2] = 0. rhFootPos0[2] = 0. lfFootPos0[2] = 0. lhFootPos0[2] = 0. comRef = (rfFootPos0 + rhFootPos0 + lfFootPos0 + lhFootPos0) / 4 comRef[2] = np.asscalar(pinocchio.centerOfMass(self.rmodel, self.rdata, q0)[2]) loco3dModel = [] takeOff = [ self.createSwingFootModel( timeStep, [self.lfFootId, self.rfFootId, self.lhFootId, self.rhFootId], ) for k in range(groundKnots) ] flyingUpPhase = [ self.createSwingFootModel( timeStep, [], np.array([jumpLength[0], jumpLength[1], jumpLength[2] + jumpHeight]) * (k + 1) / flyingKnots + comRef) for k in range(flyingKnots) ] flyingDownPhase = [] for k in range(flyingKnots): flyingDownPhase += [self.createSwingFootModel(timeStep, [])] f0 = jumpLength footTask = [ crocoddyl.FramePlacement(self.lfFootId, pinocchio.SE3(np.eye(3), lfFootPos0 + f0)), crocoddyl.FramePlacement(self.rfFootId, pinocchio.SE3(np.eye(3), rfFootPos0 + f0)), crocoddyl.FramePlacement(self.lhFootId, pinocchio.SE3(np.eye(3), lhFootPos0 + f0)), crocoddyl.FramePlacement(self.rhFootId, pinocchio.SE3(np.eye(3), rhFootPos0 + f0)) ] landingPhase = [ self.createFootSwitchModel([self.lfFootId, self.rfFootId, self.lhFootId, self.rhFootId], footTask, False) ] f0[2] = df landed = [ self.createSwingFootModel(timeStep, [self.lfFootId, self.rfFootId, self.lhFootId, self.rhFootId], comTask=comRef + f0) for k in range(groundKnots) ] loco3dModel += takeOff loco3dModel += flyingUpPhase loco3dModel += flyingDownPhase loco3dModel += landingPhase loco3dModel += landed problem = crocoddyl.ShootingProblem(x0, loco3dModel, loco3dModel[-1]) return problem def createFootstepModels(self, comPos0, feetPos0, stepLength, stepHeight, timeStep, numKnots, supportFootIds, swingFootIds): """ Action models for a footstep phase. :param comPos0, initial CoM position :param feetPos0: initial position of the swinging feet :param stepLength: step length :param stepHeight: step height :param timeStep: time step :param numKnots: number of knots for the footstep phase :param supportFootIds: Ids of the supporting feet :param swingFootIds: Ids of the swinging foot :return footstep action models """ numLegs = len(supportFootIds) + len(swingFootIds) comPercentage = float(len(swingFootIds)) / numLegs # Action models for the foot swing footSwingModel = [] for k in range(numKnots): swingFootTask = [] for i, p in zip(swingFootIds, feetPos0): # Defining a foot swing task given the step length # resKnot = numKnots % 2 phKnots = numKnots / 2 if k < phKnots: dp = np.array([stepLength * (k + 1) / numKnots, 0., stepHeight * k / phKnots]) elif k == phKnots: dp = np.array([stepLength * (k + 1) / numKnots, 0., stepHeight]) else: dp = np.array( [stepLength * (k + 1) / numKnots, 0., stepHeight * (1 - float(k - phKnots) / phKnots)]) tref = p + dp swingFootTask += [crocoddyl.FramePlacement(i, pinocchio.SE3(np.eye(3), tref))] comTask = np.array([stepLength * (k + 1) / numKnots, 0., 0.]) * comPercentage + comPos0 footSwingModel += [ self.createSwingFootModel(timeStep, supportFootIds, comTask=comTask, swingFootTask=swingFootTask) ] # Action model for the foot switch footSwitchModel = self.createFootSwitchModel(supportFootIds, swingFootTask) # Updating the current foot position for next step comPos0 += [stepLength * comPercentage, 0., 0.] for p in feetPos0: p += [stepLength, 0., 0.] return footSwingModel + [footSwitchModel] def createSwingFootModel(self, timeStep, supportFootIds, comTask=None, swingFootTask=None): """ Action model for a swing foot phase. :param timeStep: step duration of the action model :param supportFootIds: Ids of the constrained feet :param comTask: CoM task :param swingFootTask: swinging foot task :return action model for a swing foot phase """ # Creating a 3D multi-contact model, and then including the supporting # foot contactModel = crocoddyl.ContactModelMultiple(self.state, self.actuation.nu) for i in supportFootIds: xref = crocoddyl.FrameTranslation(i, np.array([0., 0., 0.])) supportContactModel = crocoddyl.ContactModel3D(self.state, xref, self.actuation.nu, np.array([0., 50.])) contactModel.addContact(self.rmodel.frames[i].name + "_contact", supportContactModel) # Creating the cost model for a contact phase costModel = crocoddyl.CostModelSum(self.state, self.actuation.nu) if isinstance(comTask, np.ndarray): comTrack = crocoddyl.CostModelCoMPosition(self.state, comTask, self.actuation.nu) costModel.addCost("comTrack", comTrack, 1e6) for i in supportFootIds: cone = crocoddyl.FrictionCone(self.nsurf, self.mu, 4, False) frictionCone = crocoddyl.CostModelContactFrictionCone( self.state, crocoddyl.ActivationModelQuadraticBarrier(crocoddyl.ActivationBounds(cone.lb, cone.ub)), crocoddyl.FrameFrictionCone(i, cone), self.actuation.nu) costModel.addCost(self.rmodel.frames[i].name + "_frictionCone", frictionCone, 1e1) if swingFootTask is not None: for i in swingFootTask: xref = crocoddyl.FrameTranslation(i.id, i.placement.translation) footTrack = crocoddyl.CostModelFrameTranslation(self.state, xref, self.actuation.nu) costModel.addCost(self.rmodel.frames[i.id].name + "_footTrack", footTrack, 1e6) stateWeights = np.array([0.] * 3 + [500.] * 3 + [0.01] * (self.rmodel.nv - 6) + [10.] * 6 + [1.] * (self.rmodel.nv - 6)) stateReg = crocoddyl.CostModelState(self.state, crocoddyl.ActivationModelWeightedQuad(stateWeights**2), self.rmodel.defaultState, self.actuation.nu) ctrlReg = crocoddyl.CostModelControl(self.state, self.actuation.nu) costModel.addCost("stateReg", stateReg, 1e1) costModel.addCost("ctrlReg", ctrlReg, 1e-1) lb = np.concatenate([self.state.lb[1:self.state.nv + 1], self.state.lb[-self.state.nv:]]) ub = np.concatenate([self.state.ub[1:self.state.nv + 1], self.state.ub[-self.state.nv:]]) stateBounds = crocoddyl.CostModelState( self.state, crocoddyl.ActivationModelQuadraticBarrier(crocoddyl.ActivationBounds(lb, ub)), 0 * self.rmodel.defaultState, self.actuation.nu) costModel.addCost("stateBounds", stateBounds, 1e3) # Creating the action model for the KKT dynamics with simpletic Euler # integration scheme dmodel = crocoddyl.DifferentialActionModelContactFwdDynamics(self.state, self.actuation, contactModel, costModel, 0., True) model = crocoddyl.IntegratedActionModelEuler(dmodel, timeStep) return model def createFootSwitchModel(self, supportFootIds, swingFootTask, pseudoImpulse=False): """ Action model for a foot switch phase. :param supportFootIds: Ids of the constrained feet :param swingFootTask: swinging foot task :param pseudoImpulse: true for pseudo-impulse models, otherwise it uses the impulse model :return action model for a foot switch phase """ if pseudoImpulse: return self.createPseudoImpulseModel(supportFootIds, swingFootTask) else: return self.createImpulseModel(supportFootIds, swingFootTask) def createPseudoImpulseModel(self, supportFootIds, swingFootTask): """ Action model for pseudo-impulse models. A pseudo-impulse model consists of adding high-penalty cost for the contact velocities. :param supportFootIds: Ids of the constrained feet :param swingFootTask: swinging foot task :return pseudo-impulse differential action model """ # Creating a 3D multi-contact model, and then including the supporting # foot contactModel = crocoddyl.ContactModelMultiple(self.state, self.actuation.nu) for i in supportFootIds: xref = crocoddyl.FrameTranslation(i, np.array([0., 0., 0.])) supportContactModel = crocoddyl.ContactModel3D(self.state, xref, self.actuation.nu, np.array([0., 50.])) contactModel.addContact(self.rmodel.frames[i].name + "_contact", supportContactModel) # Creating the cost model for a contact phase costModel = crocoddyl.CostModelSum(self.state, self.actuation.nu) for i in supportFootIds: cone = crocoddyl.FrictionCone(self.nsurf, self.mu, 4, False) frictionCone = crocoddyl.CostModelContactFrictionCone( self.state, crocoddyl.ActivationModelQuadraticBarrier(crocoddyl.ActivationBounds(cone.lb, cone.ub)), crocoddyl.FrameFrictionCone(i, cone), self.actuation.nu) costModel.addCost(self.rmodel.frames[i].name + "_frictionCone", frictionCone, 1e1) if swingFootTask is not None: for i in swingFootTask: xref = crocoddyl.FrameTranslation(i.frame, i.oMf.translation) vref = crocoddyl.FrameMotion(i.frame, pinocchio.Motion.Zero()) footTrack = crocoddyl.CostModelFrameTranslation(self.state, xref, self.actuation.nu) impulseFootVelCost = crocoddyl.CostModelFrameVelocity(self.state, vref, self.actuation.nu) costModel.addCost(self.rmodel.frames[i.frame].name + "_footTrack", footTrack, 1e7) costModel.addCost(self.rmodel.frames[i.frame].name + "_impulseVel", impulseFootVelCost, 1e6) stateWeights = np.array([0.] * 3 + [500.] * 3 + [0.01] * (self.rmodel.nv - 6) + [10.] * self.rmodel.nv) stateReg = crocoddyl.CostModelState(self.state, crocoddyl.ActivationModelWeightedQuad(stateWeights**2), self.rmodel.defaultState, self.actuation.nu) ctrlReg = crocoddyl.CostModelControl(self.state, self.actuation.nu) costModel.addCost("stateReg", stateReg, 1e1) costModel.addCost("ctrlReg", ctrlReg, 1e-3) # Creating the action model for the KKT dynamics with simpletic Euler # integration scheme dmodel = crocoddyl.DifferentialActionModelContactFwdDynamics(self.state, self.actuation, contactModel, costModel, 0., True) model = crocoddyl.IntegratedActionModelEuler(dmodel, 0.) return model def createImpulseModel(self, supportFootIds, swingFootTask, JMinvJt_damping=1e-12, r_coeff=0.0): """ Action model for impulse models. An impulse model consists of describing the impulse dynamics against a set of contacts. :param supportFootIds: Ids of the constrained feet :param swingFootTask: swinging foot task :return impulse action model """ # Creating a 3D multi-contact model, and then including the supporting foot impulseModel = crocoddyl.ImpulseModelMultiple(self.state) for i in supportFootIds: supportContactModel = crocoddyl.ImpulseModel3D(self.state, i) impulseModel.addImpulse(self.rmodel.frames[i].name + "_impulse", supportContactModel) # Creating the cost model for a contact phase costModel = crocoddyl.CostModelSum(self.state, 0) if swingFootTask is not None: for i in swingFootTask: xref = crocoddyl.FrameTranslation(i.id, i.placement.translation) footTrack = crocoddyl.CostModelFrameTranslation(self.state, xref, 0) costModel.addCost(self.rmodel.frames[i.id].name + "_footTrack", footTrack, 1e7) stateWeights = np.array([1.] * 6 + [10.] * (self.rmodel.nv - 6) + [10.] * self.rmodel.nv) stateReg = crocoddyl.CostModelState(self.state, crocoddyl.ActivationModelWeightedQuad(stateWeights**2), self.rmodel.defaultState, 0) costModel.addCost("stateReg", stateReg, 1e1) # Creating the action model for the KKT dynamics with simpletic Euler # integration scheme model = crocoddyl.ActionModelImpulseFwdDynamics(self.state, impulseModel, costModel) model.JMinvJt_damping = JMinvJt_damping model.r_coeff = r_coeff return model def plotSolution(solver, bounds=True, figIndex=1, figTitle="", show=True): import matplotlib.pyplot as plt xs, us = [], [] if bounds: us_lb, us_ub = [], [] xs_lb, xs_ub = [], [] if isinstance(solver, list): rmodel = solver[0].problem.runningModels[0].state.pinocchio for s in solver: xs.extend(s.xs[:-1]) us.extend(s.us) if bounds: models = s.problem.runningModels.tolist() + [s.problem.terminalModel] for m in models: us_lb += [m.u_lb] us_ub += [m.u_ub] xs_lb += [m.state.lb] xs_ub += [m.state.ub] else: rmodel = solver.problem.runningModels[0].state.pinocchio xs, us = solver.xs, solver.us if bounds: models = solver.problem.runningModels.tolist() + [solver.problem.terminalModel] for m in models: us_lb += [m.u_lb] us_ub += [m.u_ub] xs_lb += [m.state.lb] xs_ub += [m.state.ub] # Getting the state and control trajectories nx, nq, nu = xs[0].shape[0], rmodel.nq, us[0].shape[0] X = [0.] * nx U = [0.] * nu if bounds: U_LB = [0.] * nu U_UB = [0.] * nu X_LB = [0.] * nx X_UB = [0.] * nx for i in range(nx): X[i] = [np.asscalar(x[i]) for x in xs] if bounds: X_LB[i] = [np.asscalar(x[i]) for x in xs_lb] X_UB[i] = [np.asscalar(x[i]) for x in xs_ub] for i in range(nu): U[i] = [np.asscalar(u[i]) if u.shape[0] != 0 else 0 for u in us] if bounds: U_LB[i] = [np.asscalar(u[i]) if u.shape[0] != 0 else np.nan for u in us_lb] U_UB[i] = [np.asscalar(u[i]) if u.shape[0] != 0 else np.nan for u in us_ub] # Plotting the joint positions, velocities and torques plt.figure(figIndex) plt.suptitle(figTitle) legJointNames = ['HAA', 'HFE', 'KFE'] # LF foot plt.subplot(4, 3, 1) plt.title('joint position [rad]') [plt.plot(X[k], label=legJointNames[i]) for i, k in enumerate(range(7, 10))] if bounds: [plt.plot(X_LB[k], '--r') for i, k in enumerate(range(7, 10))] [plt.plot(X_UB[k], '--r') for i, k in enumerate(range(7, 10))] plt.ylabel('LF') plt.legend() plt.subplot(4, 3, 2) plt.title('joint velocity [rad/s]') [plt.plot(X[k], label=legJointNames[i]) for i, k in enumerate(range(nq + 6, nq + 9))] if bounds: [plt.plot(X_LB[k], '--r') for i, k in enumerate(range(nq + 6, nq + 9))] [plt.plot(X_UB[k], '--r') for i, k in enumerate(range(nq + 6, nq + 9))] plt.ylabel('LF') plt.legend() plt.subplot(4, 3, 3) plt.title('joint torque [Nm]') [plt.plot(U[k], label=legJointNames[i]) for i, k in enumerate(range(0, 3))] if bounds: [plt.plot(U_LB[k], '--r') for i, k in enumerate(range(0, 3))] [plt.plot(U_UB[k], '--r') for i, k in enumerate(range(0, 3))] plt.ylabel('LF') plt.legend() # LH foot plt.subplot(4, 3, 4) [plt.plot(X[k], label=legJointNames[i]) for i, k in enumerate(range(10, 13))] if bounds: [plt.plot(X_LB[k], '--r') for i, k in enumerate(range(10, 13))] [plt.plot(X_UB[k], '--r') for i, k in enumerate(range(10, 13))] plt.ylabel('LH') plt.legend() plt.subplot(4, 3, 5) [plt.plot(X[k], label=legJointNames[i]) for i, k in enumerate(range(nq + 9, nq + 12))] if bounds: [plt.plot(X_LB[k], '--r') for i, k in enumerate(range(nq + 9, nq + 12))] [plt.plot(X_UB[k], '--r') for i, k in enumerate(range(nq + 9, nq + 12))] plt.ylabel('LH') plt.legend() plt.subplot(4, 3, 6) [plt.plot(U[k], label=legJointNames[i]) for i, k in enumerate(range(3, 6))] if bounds: [plt.plot(U_LB[k], '--r') for i, k in enumerate(range(3, 6))] [plt.plot(U_UB[k], '--r') for i, k in enumerate(range(3, 6))] plt.ylabel('LH') plt.legend() # RF foot plt.subplot(4, 3, 7) [plt.plot(X[k], label=legJointNames[i]) for i, k in enumerate(range(13, 16))] if bounds: [plt.plot(X_LB[k], '--r') for i, k in enumerate(range(13, 16))] [plt.plot(X_UB[k], '--r') for i, k in enumerate(range(13, 16))] plt.ylabel('RF') plt.legend() plt.subplot(4, 3, 8) [plt.plot(X[k], label=legJointNames[i]) for i, k in enumerate(range(nq + 12, nq + 15))] if bounds: [plt.plot(X_LB[k], '--r') for i, k in enumerate(range(nq + 12, nq + 15))] [plt.plot(X_UB[k], '--r') for i, k in enumerate(range(nq + 12, nq + 15))] plt.ylabel('RF') plt.legend() plt.subplot(4, 3, 9) [plt.plot(U[k], label=legJointNames[i]) for i, k in enumerate(range(6, 9))] if bounds: [plt.plot(U_LB[k], '--r') for i, k in enumerate(range(6, 9))] [plt.plot(U_UB[k], '--r') for i, k in enumerate(range(6, 9))] plt.ylabel('RF') plt.legend() # RH foot plt.subplot(4, 3, 10) [plt.plot(X[k], label=legJointNames[i]) for i, k in enumerate(range(16, 19))] if bounds: [plt.plot(X_LB[k], '--r') for i, k in enumerate(range(16, 19))] [plt.plot(X_UB[k], '--r') for i, k in enumerate(range(16, 19))] plt.ylabel('RH') plt.xlabel('knots') plt.legend() plt.subplot(4, 3, 11) [plt.plot(X[k], label=legJointNames[i]) for i, k in enumerate(range(nq + 15, nq + 18))] if bounds: [plt.plot(X_LB[k], '--r') for i, k in enumerate(range(nq + 15, nq + 18))] [plt.plot(X_UB[k], '--r') for i, k in enumerate(range(nq + 15, nq + 18))] plt.ylabel('RH') plt.xlabel('knots') plt.legend() plt.subplot(4, 3, 12) [plt.plot(U[k], label=legJointNames[i]) for i, k in enumerate(range(9, 12))] if bounds: [plt.plot(U_LB[k], '--r') for i, k in enumerate(range(9, 12))] [plt.plot(U_UB[k], '--r') for i, k in enumerate(range(9, 12))] plt.ylabel('RH') plt.legend() plt.xlabel('knots') plt.figure(figIndex + 1) plt.suptitle(figTitle) rdata = rmodel.createData() Cx = [] Cy = [] for x in xs: q = x[:nq] c = pinocchio.centerOfMass(rmodel, rdata, q) Cx.append(np.asscalar(c[0])) Cy.append(np.asscalar(c[1])) plt.plot(Cx, Cy) plt.title('CoM position') plt.xlabel('x [m]') plt.ylabel('y [m]') plt.grid(True) if show: plt.show()

48.860497

119

0.607322

import crocoddyl import pinocchio import numpy as np class SimpleQuadrupedalGaitProblem: def __init__(self, rmodel, lfFoot, rfFoot, lhFoot, rhFoot): self.rmodel = rmodel self.rdata = rmodel.createData() self.state = crocoddyl.StateMultibody(self.rmodel) self.actuation = crocoddyl.ActuationModelFloatingBase(self.state) self.lfFootId = self.rmodel.getFrameId(lfFoot) self.rfFootId = self.rmodel.getFrameId(rfFoot) self.lhFootId = self.rmodel.getFrameId(lhFoot) self.rhFootId = self.rmodel.getFrameId(rhFoot) q0 = self.rmodel.referenceConfigurations["standing"] self.rmodel.defaultState = np.concatenate([q0, np.zeros(self.rmodel.nv)]) self.firstStep = True self.mu = 0.7 self.nsurf = np.array([0., 0., 1.]) def createCoMProblem(self, x0, comGoTo, timeStep, numKnots): q0 = x0[:self.rmodel.nq] pinocchio.forwardKinematics(self.rmodel, self.rdata, q0) pinocchio.updateFramePlacements(self.rmodel, self.rdata) com0 = pinocchio.centerOfMass(self.rmodel, self.rdata, q0) comModels = [] comForwardModels = [ self.createSwingFootModel( timeStep, [self.lfFootId, self.rfFootId, self.lhFootId, self.rhFootId], ) for k in range(numKnots) ] comForwardTermModel = self.createSwingFootModel(timeStep, [self.lfFootId, self.rfFootId, self.lhFootId, self.rhFootId], com0 + np.array([comGoTo, 0., 0.])) comForwardTermModel.differential.costs.costs['comTrack'].weight = 1e6 comBackwardModels = [ self.createSwingFootModel( timeStep, [self.lfFootId, self.rfFootId, self.lhFootId, self.rhFootId], ) for k in range(numKnots) ] comBackwardTermModel = self.createSwingFootModel(timeStep, [self.lfFootId, self.rfFootId, self.lhFootId, self.rhFootId], com0 + np.array([-comGoTo, 0., 0.])) comBackwardTermModel.differential.costs.costs['comTrack'].weight = 1e6 comModels += comForwardModels + [comForwardTermModel] comModels += comBackwardModels + [comBackwardTermModel] problem = crocoddyl.ShootingProblem(x0, comModels, comModels[-1]) return problem def createCoMGoalProblem(self, x0, comGoTo, timeStep, numKnots): q0 = self.rmodel.referenceConfigurations["standing"] pinocchio.forwardKinematics(self.rmodel, self.rdata, q0) pinocchio.updateFramePlacements(self.rmodel, self.rdata) com0 = pinocchio.centerOfMass(self.rmodel, self.rdata, q0) comModels = [] comForwardModels = [ self.createSwingFootModel( timeStep, [self.lfFootId, self.rfFootId, self.lhFootId, self.rhFootId], ) for k in range(numKnots) ] comForwardTermModel = self.createSwingFootModel(timeStep, [self.lfFootId, self.rfFootId, self.lhFootId, self.rhFootId], com0 + np.array([comGoTo, 0., 0.])) comForwardTermModel.differential.costs.costs['comTrack'].weight = 1e6 comModels += comForwardModels + [comForwardTermModel] problem = crocoddyl.ShootingProblem(x0, comModels, comModels[-1]) return problem def createWalkingProblem(self, x0, stepLength, stepHeight, timeStep, stepKnots, supportKnots): q0 = x0[:self.rmodel.nq] pinocchio.forwardKinematics(self.rmodel, self.rdata, q0) pinocchio.updateFramePlacements(self.rmodel, self.rdata) rfFootPos0 = self.rdata.oMf[self.rfFootId].translation rhFootPos0 = self.rdata.oMf[self.rhFootId].translation lfFootPos0 = self.rdata.oMf[self.lfFootId].translation lhFootPos0 = self.rdata.oMf[self.lhFootId].translation comRef = (rfFootPos0 + rhFootPos0 + lfFootPos0 + lhFootPos0) / 4 comRef[2] = np.asscalar(pinocchio.centerOfMass(self.rmodel, self.rdata, q0)[2]) loco3dModel = [] doubleSupport = [ self.createSwingFootModel( timeStep, [self.lfFootId, self.rfFootId, self.lhFootId, self.rhFootId], ) for k in range(supportKnots) ] if self.firstStep is True: rhStep = self.createFootstepModels(comRef, [rhFootPos0], 0.5 * stepLength, stepHeight, timeStep, stepKnots, [self.lfFootId, self.rfFootId, self.lhFootId], [self.rhFootId]) rfStep = self.createFootstepModels(comRef, [rfFootPos0], 0.5 * stepLength, stepHeight, timeStep, stepKnots, [self.lfFootId, self.lhFootId, self.rhFootId], [self.rfFootId]) self.firstStep = False else: rhStep = self.createFootstepModels(comRef, [rhFootPos0], stepLength, stepHeight, timeStep, stepKnots, [self.lfFootId, self.rfFootId, self.lhFootId], [self.rhFootId]) rfStep = self.createFootstepModels(comRef, [rfFootPos0], stepLength, stepHeight, timeStep, stepKnots, [self.lfFootId, self.lhFootId, self.rhFootId], [self.rfFootId]) lhStep = self.createFootstepModels(comRef, [lhFootPos0], stepLength, stepHeight, timeStep, stepKnots, [self.lfFootId, self.rfFootId, self.rhFootId], [self.lhFootId]) lfStep = self.createFootstepModels(comRef, [lfFootPos0], stepLength, stepHeight, timeStep, stepKnots, [self.rfFootId, self.lhFootId, self.rhFootId], [self.lfFootId]) loco3dModel += doubleSupport + rhStep + rfStep loco3dModel += doubleSupport + lhStep + lfStep problem = crocoddyl.ShootingProblem(x0, loco3dModel, loco3dModel[-1]) return problem def createTrottingProblem(self, x0, stepLength, stepHeight, timeStep, stepKnots, supportKnots): q0 = x0[:self.rmodel.nq] pinocchio.forwardKinematics(self.rmodel, self.rdata, q0) pinocchio.updateFramePlacements(self.rmodel, self.rdata) rfFootPos0 = self.rdata.oMf[self.rfFootId].translation rhFootPos0 = self.rdata.oMf[self.rhFootId].translation lfFootPos0 = self.rdata.oMf[self.lfFootId].translation lhFootPos0 = self.rdata.oMf[self.lhFootId].translation comRef = (rfFootPos0 + rhFootPos0 + lfFootPos0 + lhFootPos0) / 4 comRef[2] = np.asscalar(pinocchio.centerOfMass(self.rmodel, self.rdata, q0)[2]) loco3dModel = [] doubleSupport = [ self.createSwingFootModel( timeStep, [self.lfFootId, self.rfFootId, self.lhFootId, self.rhFootId], ) for k in range(supportKnots) ] if self.firstStep is True: rflhStep = self.createFootstepModels(comRef, [rfFootPos0, lhFootPos0], 0.5 * stepLength, stepHeight, timeStep, stepKnots, [self.lfFootId, self.rhFootId], [self.rfFootId, self.lhFootId]) self.firstStep = False else: rflhStep = self.createFootstepModels(comRef, [rfFootPos0, lhFootPos0], stepLength, stepHeight, timeStep, stepKnots, [self.lfFootId, self.rhFootId], [self.rfFootId, self.lhFootId]) lfrhStep = self.createFootstepModels(comRef, [lfFootPos0, rhFootPos0], stepLength, stepHeight, timeStep, stepKnots, [self.rfFootId, self.lhFootId], [self.lfFootId, self.rhFootId]) loco3dModel += doubleSupport + rflhStep loco3dModel += doubleSupport + lfrhStep problem = crocoddyl.ShootingProblem(x0, loco3dModel, loco3dModel[-1]) return problem def createPacingProblem(self, x0, stepLength, stepHeight, timeStep, stepKnots, supportKnots): q0 = x0[:self.rmodel.nq] pinocchio.forwardKinematics(self.rmodel, self.rdata, q0) pinocchio.updateFramePlacements(self.rmodel, self.rdata) rfFootPos0 = self.rdata.oMf[self.rfFootId].translation rhFootPos0 = self.rdata.oMf[self.rhFootId].translation lfFootPos0 = self.rdata.oMf[self.lfFootId].translation lhFootPos0 = self.rdata.oMf[self.lhFootId].translation comRef = (rfFootPos0 + rhFootPos0 + lfFootPos0 + lhFootPos0) / 4 comRef[2] = np.asscalar(pinocchio.centerOfMass(self.rmodel, self.rdata, q0)[2]) loco3dModel = [] doubleSupport = [ self.createSwingFootModel( timeStep, [self.lfFootId, self.rfFootId, self.lhFootId, self.rhFootId], ) for k in range(supportKnots) ] if self.firstStep is True: rightSteps = self.createFootstepModels(comRef, [rfFootPos0, rhFootPos0], 0.5 * stepLength, stepHeight, timeStep, stepKnots, [self.lfFootId, self.lhFootId], [self.rfFootId, self.rhFootId]) self.firstStep = False else: rightSteps = self.createFootstepModels(comRef, [rfFootPos0, rhFootPos0], stepLength, stepHeight, timeStep, stepKnots, [self.lfFootId, self.lhFootId], [self.rfFootId, self.rhFootId]) leftSteps = self.createFootstepModels(comRef, [lfFootPos0, lhFootPos0], stepLength, stepHeight, timeStep, stepKnots, [self.rfFootId, self.rhFootId], [self.lfFootId, self.lhFootId]) loco3dModel += doubleSupport + rightSteps loco3dModel += doubleSupport + leftSteps problem = crocoddyl.ShootingProblem(x0, loco3dModel, loco3dModel[-1]) return problem def createBoundingProblem(self, x0, stepLength, stepHeight, timeStep, stepKnots, supportKnots): q0 = x0[:self.rmodel.nq] pinocchio.forwardKinematics(self.rmodel, self.rdata, q0) pinocchio.updateFramePlacements(self.rmodel, self.rdata) rfFootPos0 = self.rdata.oMf[self.rfFootId].translation rhFootPos0 = self.rdata.oMf[self.rhFootId].translation lfFootPos0 = self.rdata.oMf[self.lfFootId].translation lhFootPos0 = self.rdata.oMf[self.lhFootId].translation comRef = (rfFootPos0 + rhFootPos0 + lfFootPos0 + lhFootPos0) / 4 comRef[2] = np.asscalar(pinocchio.centerOfMass(self.rmodel, self.rdata, q0)[2]) loco3dModel = [] doubleSupport = [ self.createSwingFootModel(timeStep, [self.lfFootId, self.rfFootId, self.lhFootId, self.rhFootId]) for k in range(supportKnots) ] hindSteps = self.createFootstepModels(comRef, [lfFootPos0, rfFootPos0], stepLength, stepHeight, timeStep, stepKnots, [self.lhFootId, self.rhFootId], [self.lfFootId, self.rfFootId]) frontSteps = self.createFootstepModels(comRef, [lhFootPos0, rhFootPos0], stepLength, stepHeight, timeStep, stepKnots, [self.lfFootId, self.rfFootId], [self.lhFootId, self.rhFootId]) loco3dModel += doubleSupport + hindSteps loco3dModel += doubleSupport + frontSteps problem = crocoddyl.ShootingProblem(x0, loco3dModel, loco3dModel[-1]) return problem def createJumpingProblem(self, x0, jumpHeight, jumpLength, timeStep, groundKnots, flyingKnots): q0 = x0[:self.rmodel.nq] pinocchio.forwardKinematics(self.rmodel, self.rdata, q0) pinocchio.updateFramePlacements(self.rmodel, self.rdata) rfFootPos0 = self.rdata.oMf[self.rfFootId].translation rhFootPos0 = self.rdata.oMf[self.rhFootId].translation lfFootPos0 = self.rdata.oMf[self.lfFootId].translation lhFootPos0 = self.rdata.oMf[self.lhFootId].translation df = jumpLength[2] - rfFootPos0[2] rfFootPos0[2] = 0. rhFootPos0[2] = 0. lfFootPos0[2] = 0. lhFootPos0[2] = 0. comRef = (rfFootPos0 + rhFootPos0 + lfFootPos0 + lhFootPos0) / 4 comRef[2] = np.asscalar(pinocchio.centerOfMass(self.rmodel, self.rdata, q0)[2]) loco3dModel = [] takeOff = [ self.createSwingFootModel( timeStep, [self.lfFootId, self.rfFootId, self.lhFootId, self.rhFootId], ) for k in range(groundKnots) ] flyingUpPhase = [ self.createSwingFootModel( timeStep, [], np.array([jumpLength[0], jumpLength[1], jumpLength[2] + jumpHeight]) * (k + 1) / flyingKnots + comRef) for k in range(flyingKnots) ] flyingDownPhase = [] for k in range(flyingKnots): flyingDownPhase += [self.createSwingFootModel(timeStep, [])] f0 = jumpLength footTask = [ crocoddyl.FramePlacement(self.lfFootId, pinocchio.SE3(np.eye(3), lfFootPos0 + f0)), crocoddyl.FramePlacement(self.rfFootId, pinocchio.SE3(np.eye(3), rfFootPos0 + f0)), crocoddyl.FramePlacement(self.lhFootId, pinocchio.SE3(np.eye(3), lhFootPos0 + f0)), crocoddyl.FramePlacement(self.rhFootId, pinocchio.SE3(np.eye(3), rhFootPos0 + f0)) ] landingPhase = [ self.createFootSwitchModel([self.lfFootId, self.rfFootId, self.lhFootId, self.rhFootId], footTask, False) ] f0[2] = df landed = [ self.createSwingFootModel(timeStep, [self.lfFootId, self.rfFootId, self.lhFootId, self.rhFootId], comTask=comRef + f0) for k in range(groundKnots) ] loco3dModel += takeOff loco3dModel += flyingUpPhase loco3dModel += flyingDownPhase loco3dModel += landingPhase loco3dModel += landed problem = crocoddyl.ShootingProblem(x0, loco3dModel, loco3dModel[-1]) return problem def createFootstepModels(self, comPos0, feetPos0, stepLength, stepHeight, timeStep, numKnots, supportFootIds, swingFootIds): numLegs = len(supportFootIds) + len(swingFootIds) comPercentage = float(len(swingFootIds)) / numLegs footSwingModel = [] for k in range(numKnots): swingFootTask = [] for i, p in zip(swingFootIds, feetPos0): phKnots = numKnots / 2 if k < phKnots: dp = np.array([stepLength * (k + 1) / numKnots, 0., stepHeight * k / phKnots]) elif k == phKnots: dp = np.array([stepLength * (k + 1) / numKnots, 0., stepHeight]) else: dp = np.array( [stepLength * (k + 1) / numKnots, 0., stepHeight * (1 - float(k - phKnots) / phKnots)]) tref = p + dp swingFootTask += [crocoddyl.FramePlacement(i, pinocchio.SE3(np.eye(3), tref))] comTask = np.array([stepLength * (k + 1) / numKnots, 0., 0.]) * comPercentage + comPos0 footSwingModel += [ self.createSwingFootModel(timeStep, supportFootIds, comTask=comTask, swingFootTask=swingFootTask) ] footSwitchModel = self.createFootSwitchModel(supportFootIds, swingFootTask) comPos0 += [stepLength * comPercentage, 0., 0.] for p in feetPos0: p += [stepLength, 0., 0.] return footSwingModel + [footSwitchModel] def createSwingFootModel(self, timeStep, supportFootIds, comTask=None, swingFootTask=None): contactModel = crocoddyl.ContactModelMultiple(self.state, self.actuation.nu) for i in supportFootIds: xref = crocoddyl.FrameTranslation(i, np.array([0., 0., 0.])) supportContactModel = crocoddyl.ContactModel3D(self.state, xref, self.actuation.nu, np.array([0., 50.])) contactModel.addContact(self.rmodel.frames[i].name + "_contact", supportContactModel) costModel = crocoddyl.CostModelSum(self.state, self.actuation.nu) if isinstance(comTask, np.ndarray): comTrack = crocoddyl.CostModelCoMPosition(self.state, comTask, self.actuation.nu) costModel.addCost("comTrack", comTrack, 1e6) for i in supportFootIds: cone = crocoddyl.FrictionCone(self.nsurf, self.mu, 4, False) frictionCone = crocoddyl.CostModelContactFrictionCone( self.state, crocoddyl.ActivationModelQuadraticBarrier(crocoddyl.ActivationBounds(cone.lb, cone.ub)), crocoddyl.FrameFrictionCone(i, cone), self.actuation.nu) costModel.addCost(self.rmodel.frames[i].name + "_frictionCone", frictionCone, 1e1) if swingFootTask is not None: for i in swingFootTask: xref = crocoddyl.FrameTranslation(i.id, i.placement.translation) footTrack = crocoddyl.CostModelFrameTranslation(self.state, xref, self.actuation.nu) costModel.addCost(self.rmodel.frames[i.id].name + "_footTrack", footTrack, 1e6) stateWeights = np.array([0.] * 3 + [500.] * 3 + [0.01] * (self.rmodel.nv - 6) + [10.] * 6 + [1.] * (self.rmodel.nv - 6)) stateReg = crocoddyl.CostModelState(self.state, crocoddyl.ActivationModelWeightedQuad(stateWeights**2), self.rmodel.defaultState, self.actuation.nu) ctrlReg = crocoddyl.CostModelControl(self.state, self.actuation.nu) costModel.addCost("stateReg", stateReg, 1e1) costModel.addCost("ctrlReg", ctrlReg, 1e-1) lb = np.concatenate([self.state.lb[1:self.state.nv + 1], self.state.lb[-self.state.nv:]]) ub = np.concatenate([self.state.ub[1:self.state.nv + 1], self.state.ub[-self.state.nv:]]) stateBounds = crocoddyl.CostModelState( self.state, crocoddyl.ActivationModelQuadraticBarrier(crocoddyl.ActivationBounds(lb, ub)), 0 * self.rmodel.defaultState, self.actuation.nu) costModel.addCost("stateBounds", stateBounds, 1e3) dmodel = crocoddyl.DifferentialActionModelContactFwdDynamics(self.state, self.actuation, contactModel, costModel, 0., True) model = crocoddyl.IntegratedActionModelEuler(dmodel, timeStep) return model def createFootSwitchModel(self, supportFootIds, swingFootTask, pseudoImpulse=False): if pseudoImpulse: return self.createPseudoImpulseModel(supportFootIds, swingFootTask) else: return self.createImpulseModel(supportFootIds, swingFootTask) def createPseudoImpulseModel(self, supportFootIds, swingFootTask): contactModel = crocoddyl.ContactModelMultiple(self.state, self.actuation.nu) for i in supportFootIds: xref = crocoddyl.FrameTranslation(i, np.array([0., 0., 0.])) supportContactModel = crocoddyl.ContactModel3D(self.state, xref, self.actuation.nu, np.array([0., 50.])) contactModel.addContact(self.rmodel.frames[i].name + "_contact", supportContactModel) costModel = crocoddyl.CostModelSum(self.state, self.actuation.nu) for i in supportFootIds: cone = crocoddyl.FrictionCone(self.nsurf, self.mu, 4, False) frictionCone = crocoddyl.CostModelContactFrictionCone( self.state, crocoddyl.ActivationModelQuadraticBarrier(crocoddyl.ActivationBounds(cone.lb, cone.ub)), crocoddyl.FrameFrictionCone(i, cone), self.actuation.nu) costModel.addCost(self.rmodel.frames[i].name + "_frictionCone", frictionCone, 1e1) if swingFootTask is not None: for i in swingFootTask: xref = crocoddyl.FrameTranslation(i.frame, i.oMf.translation) vref = crocoddyl.FrameMotion(i.frame, pinocchio.Motion.Zero()) footTrack = crocoddyl.CostModelFrameTranslation(self.state, xref, self.actuation.nu) impulseFootVelCost = crocoddyl.CostModelFrameVelocity(self.state, vref, self.actuation.nu) costModel.addCost(self.rmodel.frames[i.frame].name + "_footTrack", footTrack, 1e7) costModel.addCost(self.rmodel.frames[i.frame].name + "_impulseVel", impulseFootVelCost, 1e6) stateWeights = np.array([0.] * 3 + [500.] * 3 + [0.01] * (self.rmodel.nv - 6) + [10.] * self.rmodel.nv) stateReg = crocoddyl.CostModelState(self.state, crocoddyl.ActivationModelWeightedQuad(stateWeights**2), self.rmodel.defaultState, self.actuation.nu) ctrlReg = crocoddyl.CostModelControl(self.state, self.actuation.nu) costModel.addCost("stateReg", stateReg, 1e1) costModel.addCost("ctrlReg", ctrlReg, 1e-3) dmodel = crocoddyl.DifferentialActionModelContactFwdDynamics(self.state, self.actuation, contactModel, costModel, 0., True) model = crocoddyl.IntegratedActionModelEuler(dmodel, 0.) return model def createImpulseModel(self, supportFootIds, swingFootTask, JMinvJt_damping=1e-12, r_coeff=0.0): impulseModel = crocoddyl.ImpulseModelMultiple(self.state) for i in supportFootIds: supportContactModel = crocoddyl.ImpulseModel3D(self.state, i) impulseModel.addImpulse(self.rmodel.frames[i].name + "_impulse", supportContactModel) costModel = crocoddyl.CostModelSum(self.state, 0) if swingFootTask is not None: for i in swingFootTask: xref = crocoddyl.FrameTranslation(i.id, i.placement.translation) footTrack = crocoddyl.CostModelFrameTranslation(self.state, xref, 0) costModel.addCost(self.rmodel.frames[i.id].name + "_footTrack", footTrack, 1e7) stateWeights = np.array([1.] * 6 + [10.] * (self.rmodel.nv - 6) + [10.] * self.rmodel.nv) stateReg = crocoddyl.CostModelState(self.state, crocoddyl.ActivationModelWeightedQuad(stateWeights**2), self.rmodel.defaultState, 0) costModel.addCost("stateReg", stateReg, 1e1) model = crocoddyl.ActionModelImpulseFwdDynamics(self.state, impulseModel, costModel) model.JMinvJt_damping = JMinvJt_damping model.r_coeff = r_coeff return model def plotSolution(solver, bounds=True, figIndex=1, figTitle="", show=True): import matplotlib.pyplot as plt xs, us = [], [] if bounds: us_lb, us_ub = [], [] xs_lb, xs_ub = [], [] if isinstance(solver, list): rmodel = solver[0].problem.runningModels[0].state.pinocchio for s in solver: xs.extend(s.xs[:-1]) us.extend(s.us) if bounds: models = s.problem.runningModels.tolist() + [s.problem.terminalModel] for m in models: us_lb += [m.u_lb] us_ub += [m.u_ub] xs_lb += [m.state.lb] xs_ub += [m.state.ub] else: rmodel = solver.problem.runningModels[0].state.pinocchio xs, us = solver.xs, solver.us if bounds: models = solver.problem.runningModels.tolist() + [solver.problem.terminalModel] for m in models: us_lb += [m.u_lb] us_ub += [m.u_ub] xs_lb += [m.state.lb] xs_ub += [m.state.ub] nx, nq, nu = xs[0].shape[0], rmodel.nq, us[0].shape[0] X = [0.] * nx U = [0.] * nu if bounds: U_LB = [0.] * nu U_UB = [0.] * nu X_LB = [0.] * nx X_UB = [0.] * nx for i in range(nx): X[i] = [np.asscalar(x[i]) for x in xs] if bounds: X_LB[i] = [np.asscalar(x[i]) for x in xs_lb] X_UB[i] = [np.asscalar(x[i]) for x in xs_ub] for i in range(nu): U[i] = [np.asscalar(u[i]) if u.shape[0] != 0 else 0 for u in us] if bounds: U_LB[i] = [np.asscalar(u[i]) if u.shape[0] != 0 else np.nan for u in us_lb] U_UB[i] = [np.asscalar(u[i]) if u.shape[0] != 0 else np.nan for u in us_ub] plt.figure(figIndex) plt.suptitle(figTitle) legJointNames = ['HAA', 'HFE', 'KFE'] plt.subplot(4, 3, 1) plt.title('joint position [rad]') [plt.plot(X[k], label=legJointNames[i]) for i, k in enumerate(range(7, 10))] if bounds: [plt.plot(X_LB[k], '--r') for i, k in enumerate(range(7, 10))] [plt.plot(X_UB[k], '--r') for i, k in enumerate(range(7, 10))] plt.ylabel('LF') plt.legend() plt.subplot(4, 3, 2) plt.title('joint velocity [rad/s]') [plt.plot(X[k], label=legJointNames[i]) for i, k in enumerate(range(nq + 6, nq + 9))] if bounds: [plt.plot(X_LB[k], '--r') for i, k in enumerate(range(nq + 6, nq + 9))] [plt.plot(X_UB[k], '--r') for i, k in enumerate(range(nq + 6, nq + 9))] plt.ylabel('LF') plt.legend() plt.subplot(4, 3, 3) plt.title('joint torque [Nm]') [plt.plot(U[k], label=legJointNames[i]) for i, k in enumerate(range(0, 3))] if bounds: [plt.plot(U_LB[k], '--r') for i, k in enumerate(range(0, 3))] [plt.plot(U_UB[k], '--r') for i, k in enumerate(range(0, 3))] plt.ylabel('LF') plt.legend() plt.subplot(4, 3, 4) [plt.plot(X[k], label=legJointNames[i]) for i, k in enumerate(range(10, 13))] if bounds: [plt.plot(X_LB[k], '--r') for i, k in enumerate(range(10, 13))] [plt.plot(X_UB[k], '--r') for i, k in enumerate(range(10, 13))] plt.ylabel('LH') plt.legend() plt.subplot(4, 3, 5) [plt.plot(X[k], label=legJointNames[i]) for i, k in enumerate(range(nq + 9, nq + 12))] if bounds: [plt.plot(X_LB[k], '--r') for i, k in enumerate(range(nq + 9, nq + 12))] [plt.plot(X_UB[k], '--r') for i, k in enumerate(range(nq + 9, nq + 12))] plt.ylabel('LH') plt.legend() plt.subplot(4, 3, 6) [plt.plot(U[k], label=legJointNames[i]) for i, k in enumerate(range(3, 6))] if bounds: [plt.plot(U_LB[k], '--r') for i, k in enumerate(range(3, 6))] [plt.plot(U_UB[k], '--r') for i, k in enumerate(range(3, 6))] plt.ylabel('LH') plt.legend() plt.subplot(4, 3, 7) [plt.plot(X[k], label=legJointNames[i]) for i, k in enumerate(range(13, 16))] if bounds: [plt.plot(X_LB[k], '--r') for i, k in enumerate(range(13, 16))] [plt.plot(X_UB[k], '--r') for i, k in enumerate(range(13, 16))] plt.ylabel('RF') plt.legend() plt.subplot(4, 3, 8) [plt.plot(X[k], label=legJointNames[i]) for i, k in enumerate(range(nq + 12, nq + 15))] if bounds: [plt.plot(X_LB[k], '--r') for i, k in enumerate(range(nq + 12, nq + 15))] [plt.plot(X_UB[k], '--r') for i, k in enumerate(range(nq + 12, nq + 15))] plt.ylabel('RF') plt.legend() plt.subplot(4, 3, 9) [plt.plot(U[k], label=legJointNames[i]) for i, k in enumerate(range(6, 9))] if bounds: [plt.plot(U_LB[k], '--r') for i, k in enumerate(range(6, 9))] [plt.plot(U_UB[k], '--r') for i, k in enumerate(range(6, 9))] plt.ylabel('RF') plt.legend() plt.subplot(4, 3, 10) [plt.plot(X[k], label=legJointNames[i]) for i, k in enumerate(range(16, 19))] if bounds: [plt.plot(X_LB[k], '--r') for i, k in enumerate(range(16, 19))] [plt.plot(X_UB[k], '--r') for i, k in enumerate(range(16, 19))] plt.ylabel('RH') plt.xlabel('knots') plt.legend() plt.subplot(4, 3, 11) [plt.plot(X[k], label=legJointNames[i]) for i, k in enumerate(range(nq + 15, nq + 18))] if bounds: [plt.plot(X_LB[k], '--r') for i, k in enumerate(range(nq + 15, nq + 18))] [plt.plot(X_UB[k], '--r') for i, k in enumerate(range(nq + 15, nq + 18))] plt.ylabel('RH') plt.xlabel('knots') plt.legend() plt.subplot(4, 3, 12) [plt.plot(U[k], label=legJointNames[i]) for i, k in enumerate(range(9, 12))] if bounds: [plt.plot(U_LB[k], '--r') for i, k in enumerate(range(9, 12))] [plt.plot(U_UB[k], '--r') for i, k in enumerate(range(9, 12))] plt.ylabel('RH') plt.legend() plt.xlabel('knots') plt.figure(figIndex + 1) plt.suptitle(figTitle) rdata = rmodel.createData() Cx = [] Cy = [] for x in xs: q = x[:nq] c = pinocchio.centerOfMass(rmodel, rdata, q) Cx.append(np.asscalar(c[0])) Cy.append(np.asscalar(c[1])) plt.plot(Cx, Cy) plt.title('CoM position') plt.xlabel('x [m]') plt.ylabel('y [m]') plt.grid(True) if show: plt.show()

true

1c3014f133ce0417cca626cf3e8e7c76faf83681

455

py

Python

plotly/validators/histogram2dcontour/_zsrc.py

gnestor/plotly.py

a8ae062795ddbf9867b8578fe6d9e244948c15ff

[ "MIT" ]

12

2020-04-18T18:10:22.000Z

2021-12-06T10:11:15.000Z

plotly/validators/histogram2dcontour/_zsrc.py

Vesauza/plotly.py

e53e626d59495d440341751f60aeff73ff365c28

[ "MIT" ]

27

2020-04-28T21:23:12.000Z

2021-06-25T15:36:38.000Z

plotly/validators/histogram2dcontour/_zsrc.py

Vesauza/plotly.py

e53e626d59495d440341751f60aeff73ff365c28

[ "MIT" ]

6

2020-04-18T23:07:08.000Z

2021-11-18T07:53:06.000Z

import _plotly_utils.basevalidators class ZsrcValidator(_plotly_utils.basevalidators.SrcValidator): def __init__( self, plotly_name='zsrc', parent_name='histogram2dcontour', **kwargs ): super(ZsrcValidator, self).__init__( plotly_name=plotly_name, parent_name=parent_name, edit_type=kwargs.pop('edit_type', 'none'), role=kwargs.pop('role', 'info'), **kwargs )

28.4375

76

0.630769

import _plotly_utils.basevalidators class ZsrcValidator(_plotly_utils.basevalidators.SrcValidator): def __init__( self, plotly_name='zsrc', parent_name='histogram2dcontour', **kwargs ): super(ZsrcValidator, self).__init__( plotly_name=plotly_name, parent_name=parent_name, edit_type=kwargs.pop('edit_type', 'none'), role=kwargs.pop('role', 'info'), **kwargs )

true

1c3016aefbeb82d751c16adfb3029bb4fb855ea9

665

py

Python

tests/src/metrics/recall_vs_loc.py

bellwethers-in-se/issueCloseTime

e5e00c9625da0793dc8e7985fd88b0ca0b35f7d3

[ "MIT" ]

9

2017-07-27T10:32:48.000Z

2021-07-01T11:51:51.000Z

tests/src/metrics/recall_vs_loc.py

bellwethers-in-se/issueCloseTime

e5e00c9625da0793dc8e7985fd88b0ca0b35f7d3

[ "MIT" ]

11

2016-03-15T16:27:47.000Z

2019-09-05T02:25:08.000Z

tests/src/metrics/recall_vs_loc.py

bellwethers-in-se/issueCloseTime

e5e00c9625da0793dc8e7985fd88b0ca0b35f7d3

[ "MIT" ]

5

2017-01-28T22:45:34.000Z

2019-12-04T13:15:10.000Z

from __future__ import print_function, division import numpy as np from pdb import set_trace def get_curve(loc, actual, predicted): sorted_loc = np.array(loc)[np.argsort(loc)] sorted_act = np.array(actual)[np.argsort(loc)] sorted_prd = np.array(predicted)[np.argsort(loc)] recall, loc = [], [] tp, fn, Pd = 0, 0, 0 for a, p, l in zip(sorted_act, sorted_prd, sorted_loc): tp += 1 if a == 1 and p == 1 else 0 fn += 1 if a == 1 and p == 0 else 0 Pd = tp / (tp + fn) if (tp + fn) > 0 else Pd loc.append(l) recall.append(int(Pd * 100)) auc = np.trapz(recall, loc) / 100 return recall, loc, auc

30.227273

59

0.598496

from __future__ import print_function, division import numpy as np from pdb import set_trace def get_curve(loc, actual, predicted): sorted_loc = np.array(loc)[np.argsort(loc)] sorted_act = np.array(actual)[np.argsort(loc)] sorted_prd = np.array(predicted)[np.argsort(loc)] recall, loc = [], [] tp, fn, Pd = 0, 0, 0 for a, p, l in zip(sorted_act, sorted_prd, sorted_loc): tp += 1 if a == 1 and p == 1 else 0 fn += 1 if a == 1 and p == 0 else 0 Pd = tp / (tp + fn) if (tp + fn) > 0 else Pd loc.append(l) recall.append(int(Pd * 100)) auc = np.trapz(recall, loc) / 100 return recall, loc, auc

true

1c3016bf5a6af05377f952d07ae5fcdd8087d536

1,357

py

Python

dash_docs/reusable_components/WorkspaceBlurb.py

jbampton/dash-docs

33348057877ebd33622b514fc6073038c431976a

[ "MIT" ]

null

dash_docs/reusable_components/WorkspaceBlurb.py

jbampton/dash-docs

33348057877ebd33622b514fc6073038c431976a

[ "MIT" ]

null

dash_docs/reusable_components/WorkspaceBlurb.py

jbampton/dash-docs

33348057877ebd33622b514fc6073038c431976a

[ "MIT" ]

null

import dash_core_components as dcc import dash_html_components as html def image(vendor): return html.A( [ html.Img( src='/assets/images/dds/{}-logo.png'.format(vendor) ), html.Div( 'Install Dash Enterprise on {}'.format(vendor), className='label' ) ], href='https://plotly.com/dash/{}'.format(vendor), className='azure' ) WorkspaceBlurb = html.Div([ html.Blockquote([dcc.Markdown( ''' Dash Enterprise is the fastest way to write & deploy Dash apps and Jupyter notebooks. Dash Enterprise can be installed on the Kubernetes services of [AWS](https://go.plotly.com/dash-aws), [Azure](https://go.plotly.com/dash-azure), GCP, or an [on-premise Linux Server](https://plotly.com/dash/on-premises-linux/?utm_source=docs&utm_medium=workspace&utm_campaign=nov&utm_content=linux). 10% of the Fortune 500 uses Dash Enterprise to productionize AI and data science apps. [Find out if your company is using Dash Enterprise](https://go.plotly.com/company-lookup) '''), html.Div([ image('Azure'), html.Div(className='spacer'), image('AWS'), ], className='azure-parent') ]) ])

31.55814

150

0.582903

import dash_core_components as dcc import dash_html_components as html def image(vendor): return html.A( [ html.Img( src='/assets/images/dds/{}-logo.png'.format(vendor) ), html.Div( 'Install Dash Enterprise on {}'.format(vendor), className='label' ) ], href='https://plotly.com/dash/{}'.format(vendor), className='azure' ) WorkspaceBlurb = html.Div([ html.Blockquote([dcc.Markdown( ''' Dash Enterprise is the fastest way to write & deploy Dash apps and Jupyter notebooks. Dash Enterprise can be installed on the Kubernetes services of [AWS](https://go.plotly.com/dash-aws), [Azure](https://go.plotly.com/dash-azure), GCP, or an [on-premise Linux Server](https://plotly.com/dash/on-premises-linux/?utm_source=docs&utm_medium=workspace&utm_campaign=nov&utm_content=linux). 10% of the Fortune 500 uses Dash Enterprise to productionize AI and data science apps. [Find out if your company is using Dash Enterprise](https://go.plotly.com/company-lookup) '''), html.Div([ image('Azure'), html.Div(className='spacer'), image('AWS'), ], className='azure-parent') ]) ])

true

1c3018d33d41f38ee26f5532c311979cf53838ae

554

py

Python

waffle/migrations/0004_update_everyone_nullbooleanfield.py

DavidCain/django-waffle

006626cac66af6034b88d60712e87509b792cc97

[ "BSD-3-Clause" ]

313

2015-01-04T11:47:41.000Z

2018-10-31T09:47:28.000Z

waffle/migrations/0004_update_everyone_nullbooleanfield.py

DavidCain/django-waffle

006626cac66af6034b88d60712e87509b792cc97

[ "BSD-3-Clause" ]

167

2015-01-02T18:10:17.000Z

2018-11-03T18:11:06.000Z

waffle/migrations/0004_update_everyone_nullbooleanfield.py

DavidCain/django-waffle

006626cac66af6034b88d60712e87509b792cc97

[ "BSD-3-Clause" ]

138

2015-01-06T21:10:04.000Z

2018-10-11T12:44:57.000Z

# Generated by Django 3.0.9 on 2020-08-18 04:55 from django.db import migrations, models class Migration(migrations.Migration): dependencies = [ ('waffle', '0003_update_strings_for_i18n'), ] operations = [ migrations.AlterField( model_name='flag', name='everyone', field=models.BooleanField(blank=True, help_text='Flip this flag on (Yes) or off (No) for everyone, overriding all other settings. Leave as Unknown to use normally.', null=True, verbose_name='Everyone'), ), ]

29.157895

214

0.649819

from django.db import migrations, models class Migration(migrations.Migration): dependencies = [ ('waffle', '0003_update_strings_for_i18n'), ] operations = [ migrations.AlterField( model_name='flag', name='everyone', field=models.BooleanField(blank=True, help_text='Flip this flag on (Yes) or off (No) for everyone, overriding all other settings. Leave as Unknown to use normally.', null=True, verbose_name='Everyone'), ), ]

true

1c30192485317796fd46fb75d6de82b58e94da2a

4,717

py

Python

src/rogerthat/bizz/debugging.py

goubertbrent/oca-backend

b9f59cc02568aecb55d4b54aec05245790ea25fd

[ "Apache-2.0" ]

null

src/rogerthat/bizz/debugging.py

goubertbrent/oca-backend

b9f59cc02568aecb55d4b54aec05245790ea25fd

[ "Apache-2.0" ]

null

src/rogerthat/bizz/debugging.py

goubertbrent/oca-backend

b9f59cc02568aecb55d4b54aec05245790ea25fd

[ "Apache-2.0" ]

null

# -*- coding: utf-8 -*- # Copyright 2020 Green Valley Belgium NV # # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. # # @@license_version:1.7@@ import base64 from google.appengine.ext import deferred, db from mcfw.properties import azzert from mcfw.rpc import returns, arguments from rogerthat.bizz.system import start_log_forwarding, delete_xmpp_account from rogerthat.consts import SCHEDULED_QUEUE from rogerthat.dal.mobile import get_mobile_by_id, get_user_active_mobiles from rogerthat.models import StartDebuggingRequest, CurrentlyForwardingLogs from rogerthat.rpc import users from rogerthat.settings import get_server_settings from rogerthat.utils import channel, now, try_or_defer from rogerthat.utils.crypto import encrypt_value, md5 from rogerthat.utils.transactions import on_trans_committed @returns(CurrentlyForwardingLogs) @arguments(app_user=users.User, timeout=(int, long)) def start_admin_debugging(app_user, timeout): mobiles = list(get_user_active_mobiles(app_user)) azzert(len(mobiles) == 1) settings = get_server_settings() jid = base64.b64encode(encrypt_value(md5(settings.secret), users.get_current_user().email().encode('utf8'))) password = None type_ = CurrentlyForwardingLogs.TYPE_GAE_CHANNEL_API def trans(): debug_request = StartDebuggingRequest(key=StartDebuggingRequest.create_key(app_user, jid), timestamp=now()) db.put_async(debug_request) deferred.defer(stop_debugging, app_user, jid, debug_request=debug_request, notify_user=False, _countdown=timeout * 60, _transactional=True, _queue=SCHEDULED_QUEUE) return start_log_forwarding(app_user, jid, xmpp_target_password=password, type_=type_) xg_on = db.create_transaction_options(xg=True) return db.run_in_transaction_options(xg_on, trans) @returns() @arguments(app_user=users.User, mobile_id=unicode) def start_debugging(app_user, mobile_id): settings = get_server_settings() domain = settings.jabberDomain target_jid = "kick.%s/debug:%s" % (domain, base64.b64encode(app_user.email().encode('utf-8'))) def trans(mobile): debug_request = StartDebuggingRequest(key=StartDebuggingRequest.create_key(app_user, mobile_id), timestamp=now()) db.put_async(debug_request) start_log_forwarding(app_user, target_jid, mobile=mobile) deferred.defer(stop_debugging, app_user, mobile_id, debug_request=debug_request, _countdown=30 * 60, _transactional=True, _queue=SCHEDULED_QUEUE) xg_on = db.create_transaction_options(xg=True) db.run_in_transaction_options(xg_on, trans, get_mobile_by_id(mobile_id)) @returns() @arguments(app_user=users.User, mobile_id=unicode, debug_request=StartDebuggingRequest, notify_user=bool) def stop_debugging(app_user, mobile_id, debug_request=None, notify_user=True): # debug_request is not None when debug session timed out def trans(mobile): stopped = False debug_request_from_ds = db.get(StartDebuggingRequest.create_key(app_user, mobile_id)) if debug_request_from_ds: if not debug_request or debug_request.timestamp == debug_request_from_ds.timestamp: db.delete_async(debug_request_from_ds) start_log_forwarding(app_user, None, mobile) # target_jid=None ==> will stop log forwarding stopped = True if debug_request_from_ds.target_id.startswith('dbg_'): on_trans_committed(try_or_defer, delete_xmpp_account, debug_request_from_ds.target_id, None) return stopped # stop debugging session after timeout, or when user closed the debugging dialog in the web UI xg_on = db.create_transaction_options(xg=True) stopped = db.run_in_transaction_options(xg_on, trans, get_mobile_by_id(mobile_id)) if stopped and notify_user: channel.send_message(app_user, 'rogerthat.settings.stopped_debugging') @returns() @arguments(app_user=users.User, message=unicode) def forward_log(app_user, message): channel.send_message(app_user, 'rogerthat.settings.log', message=message, silent=True) # don't slog

44.084112

112

0.744541

import base64 from google.appengine.ext import deferred, db from mcfw.properties import azzert from mcfw.rpc import returns, arguments from rogerthat.bizz.system import start_log_forwarding, delete_xmpp_account from rogerthat.consts import SCHEDULED_QUEUE from rogerthat.dal.mobile import get_mobile_by_id, get_user_active_mobiles from rogerthat.models import StartDebuggingRequest, CurrentlyForwardingLogs from rogerthat.rpc import users from rogerthat.settings import get_server_settings from rogerthat.utils import channel, now, try_or_defer from rogerthat.utils.crypto import encrypt_value, md5 from rogerthat.utils.transactions import on_trans_committed @returns(CurrentlyForwardingLogs) @arguments(app_user=users.User, timeout=(int, long)) def start_admin_debugging(app_user, timeout): mobiles = list(get_user_active_mobiles(app_user)) azzert(len(mobiles) == 1) settings = get_server_settings() jid = base64.b64encode(encrypt_value(md5(settings.secret), users.get_current_user().email().encode('utf8'))) password = None type_ = CurrentlyForwardingLogs.TYPE_GAE_CHANNEL_API def trans(): debug_request = StartDebuggingRequest(key=StartDebuggingRequest.create_key(app_user, jid), timestamp=now()) db.put_async(debug_request) deferred.defer(stop_debugging, app_user, jid, debug_request=debug_request, notify_user=False, _countdown=timeout * 60, _transactional=True, _queue=SCHEDULED_QUEUE) return start_log_forwarding(app_user, jid, xmpp_target_password=password, type_=type_) xg_on = db.create_transaction_options(xg=True) return db.run_in_transaction_options(xg_on, trans) @returns() @arguments(app_user=users.User, mobile_id=unicode) def start_debugging(app_user, mobile_id): settings = get_server_settings() domain = settings.jabberDomain target_jid = "kick.%s/debug:%s" % (domain, base64.b64encode(app_user.email().encode('utf-8'))) def trans(mobile): debug_request = StartDebuggingRequest(key=StartDebuggingRequest.create_key(app_user, mobile_id), timestamp=now()) db.put_async(debug_request) start_log_forwarding(app_user, target_jid, mobile=mobile) deferred.defer(stop_debugging, app_user, mobile_id, debug_request=debug_request, _countdown=30 * 60, _transactional=True, _queue=SCHEDULED_QUEUE) xg_on = db.create_transaction_options(xg=True) db.run_in_transaction_options(xg_on, trans, get_mobile_by_id(mobile_id)) @returns() @arguments(app_user=users.User, mobile_id=unicode, debug_request=StartDebuggingRequest, notify_user=bool) def stop_debugging(app_user, mobile_id, debug_request=None, notify_user=True): def trans(mobile): stopped = False debug_request_from_ds = db.get(StartDebuggingRequest.create_key(app_user, mobile_id)) if debug_request_from_ds: if not debug_request or debug_request.timestamp == debug_request_from_ds.timestamp: db.delete_async(debug_request_from_ds) start_log_forwarding(app_user, None, mobile) stopped = True if debug_request_from_ds.target_id.startswith('dbg_'): on_trans_committed(try_or_defer, delete_xmpp_account, debug_request_from_ds.target_id, None) return stopped xg_on = db.create_transaction_options(xg=True) stopped = db.run_in_transaction_options(xg_on, trans, get_mobile_by_id(mobile_id)) if stopped and notify_user: channel.send_message(app_user, 'rogerthat.settings.stopped_debugging') @returns() @arguments(app_user=users.User, message=unicode) def forward_log(app_user, message): channel.send_message(app_user, 'rogerthat.settings.log', message=message, silent=True)

true

1c301ba946adcd8381d52d5601d669c6459a142b

405

py

Python

rand_param_envs/gym/envs/classic_control/__init__.py

erinaldi/MetaRL

6dfb8d2e63a1802ca7ef9c28f6ab1a758d07f871

[ "MIT" ]

24

2021-03-24T07:14:52.000Z

2022-03-17T08:15:44.000Z

rand_param_envs/gym/envs/classic_control/__init__.py

erinaldi/MetaRL

6dfb8d2e63a1802ca7ef9c28f6ab1a758d07f871

[ "MIT" ]

12

2021-02-02T22:53:59.000Z

2022-03-12T00:41:30.000Z

rand_param_envs/gym/envs/classic_control/__init__.py

erinaldi/MetaRL

6dfb8d2e63a1802ca7ef9c28f6ab1a758d07f871

[ "MIT" ]

6

2021-04-12T18:49:47.000Z

2021-09-07T05:33:22.000Z

from rand_param_envs.gym.envs.classic_control.cartpole import CartPoleEnv from rand_param_envs.gym.envs.classic_control.mountain_car import MountainCarEnv from rand_param_envs.gym.envs.classic_control.continuous_mountain_car import Continuous_MountainCarEnv from rand_param_envs.gym.envs.classic_control.pendulum import PendulumEnv from rand_param_envs.gym.envs.classic_control.acrobot import AcrobotEnv

57.857143

102

0.898765

from rand_param_envs.gym.envs.classic_control.cartpole import CartPoleEnv from rand_param_envs.gym.envs.classic_control.mountain_car import MountainCarEnv from rand_param_envs.gym.envs.classic_control.continuous_mountain_car import Continuous_MountainCarEnv from rand_param_envs.gym.envs.classic_control.pendulum import PendulumEnv from rand_param_envs.gym.envs.classic_control.acrobot import AcrobotEnv

true

1c301c0af1297402d729bdd00ef91beeec46e0f8

1,294

py

Python

doc/source/cookbook/halo_profiler.py

cphyc/yt_astro_analysis

68fbf5370d716734fcd31a95cbd108efff46980a

[ "BSD-3-Clause-Clear" ]

null

doc/source/cookbook/halo_profiler.py

cphyc/yt_astro_analysis

68fbf5370d716734fcd31a95cbd108efff46980a

[ "BSD-3-Clause-Clear" ]

null

doc/source/cookbook/halo_profiler.py

cphyc/yt_astro_analysis

68fbf5370d716734fcd31a95cbd108efff46980a

[ "BSD-3-Clause-Clear" ]

null

import yt from yt.extensions.astro_analysis.halo_analysis.api import HaloCatalog # Load the data set with the full simulation information # and rockstar halos data_ds = yt.load('Enzo_64/RD0006/RedshiftOutput0006') halos_ds = yt.load('rockstar_halos/halos_0.0.bin') # Instantiate a catalog using those two parameter files hc = HaloCatalog(data_ds=data_ds, halos_ds=halos_ds) # Filter out less massive halos hc.add_filter("quantity_value", "particle_mass", ">", 1e14, "Msun") # This recipe creates a spherical data container, computes # radial profiles, and calculates r_200 and M_200. hc.add_recipe("calculate_virial_quantities", ["radius", "matter_mass"]) # Create a sphere container with radius 5x r_200. field_params = dict(virial_radius=('quantity', 'radius_200')) hc.add_callback('sphere', radius_field='radius_200', factor=5, field_parameters=field_params) # Compute profiles of T vs. r/r_200 hc.add_callback('profile', ['virial_radius_fraction'], [('gas', 'temperature')], storage='virial_profiles', weight_field='cell_mass', accumulation=False, output_dir='profiles') # Save the profiles hc.add_callback("save_profiles", storage="virial_profiles", output_dir="profiles") hc.create()

35.944444

71

0.722566

import yt from yt.extensions.astro_analysis.halo_analysis.api import HaloCatalog data_ds = yt.load('Enzo_64/RD0006/RedshiftOutput0006') halos_ds = yt.load('rockstar_halos/halos_0.0.bin') hc = HaloCatalog(data_ds=data_ds, halos_ds=halos_ds) hc.add_filter("quantity_value", "particle_mass", ">", 1e14, "Msun") hc.add_recipe("calculate_virial_quantities", ["radius", "matter_mass"]) field_params = dict(virial_radius=('quantity', 'radius_200')) hc.add_callback('sphere', radius_field='radius_200', factor=5, field_parameters=field_params) hc.add_callback('profile', ['virial_radius_fraction'], [('gas', 'temperature')], storage='virial_profiles', weight_field='cell_mass', accumulation=False, output_dir='profiles') hc.add_callback("save_profiles", storage="virial_profiles", output_dir="profiles") hc.create()

true

1c301ce7b9000ab96cc831f7a72d44f6394b3e08

10,714

py

Python

plugins/Channel/test.py

atr000/Limnoria

1f60a9487ca4114f040135fb14cabc155a041918

[ "BSD-3-Clause" ]

null

plugins/Channel/test.py

atr000/Limnoria

1f60a9487ca4114f040135fb14cabc155a041918

[ "BSD-3-Clause" ]

null

plugins/Channel/test.py

atr000/Limnoria

1f60a9487ca4114f040135fb14cabc155a041918

[ "BSD-3-Clause" ]

1

2021-01-23T21:20:57.000Z

### # Copyright (c) 2002-2005, Jeremiah Fincher # Copyright (c) 2009, James Vega # All rights reserved. # # Redistribution and use in source and binary forms, with or without # modification, are permitted provided that the following conditions are met: # # * Redistributions of source code must retain the above copyright notice, # this list of conditions, and the following disclaimer. # * Redistributions in binary form must reproduce the above copyright notice, # this list of conditions, and the following disclaimer in the # documentation and/or other materials provided with the distribution. # * Neither the name of the author of this software nor the name of # contributors to this software may be used to endorse or promote products # derived from this software without specific prior written consent. # # THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" # AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE # IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE # ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR CONTRIBUTORS BE # LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR # CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF # SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS # INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN # CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) # ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE # POSSIBILITY OF SUCH DAMAGE. ### from supybot.test import * import supybot.conf as conf import supybot.ircdb as ircdb import supybot.ircmsgs as ircmsgs class ChannelTestCase(ChannelPluginTestCase): plugins = ('Channel', 'User') def setUp(self): super(ChannelTestCase, self).setUp() self.irc.state.channels[self.channel].addUser('foo') self.irc.state.channels[self.channel].addUser('bar') def testLobotomies(self): self.assertRegexp('lobotomy list', 'not.*any') ## def testCapabilities(self): ## self.prefix = 'foo!bar@baz' ## self.irc.feedMsg(ircmsgs.privmsg(self.irc.nick, 'register foo bar', ## prefix=self.prefix)) ## u = ircdb.users.getUser(0) ## u.addCapability('%s.op' % self.channel) ## ircdb.users.setUser(u) ## self.assertNotError(' ') ## self.assertResponse('user capabilities foo', '[]') ## self.assertNotError('channel addcapability foo op') ## self.assertRegexp('channel capabilities foo', 'op') ## self.assertNotError('channel removecapability foo op') ## self.assertResponse('user capabilities foo', '[]') def testCapabilities(self): self.assertNotError('channel capability list') self.assertNotError('channel capability set -foo') self.assertNotError('channel capability unset -foo') self.assertError('channel capability unset -foo') self.assertNotError('channel capability set -foo bar baz') self.assertRegexp('channel capability list', 'baz') self.assertNotError('channel capability unset -foo baz') self.assertError('channel capability unset baz') def testEnableDisable(self): self.assertNotRegexp('channel capability list', '-Channel') self.assertError('channel enable channel') self.assertNotError('channel disable channel') self.assertRegexp('channel capability list', '-Channel') self.assertNotError('channel enable channel') self.assertNotRegexp('channel capability list', '-Channel') self.assertNotError('channel disable channel nicks') self.assertRegexp('channel capability list', '-Channel.nicks') self.assertNotError('channel enable channel nicks') self.assertNotRegexp('channel capability list', '-Channel.nicks') self.assertNotRegexp('channel capability list', 'nicks') self.assertNotError('channel disable nicks') self.assertRegexp('channel capability list', 'nicks') self.assertNotError('channel enable nicks') self.assertError('channel disable invalidPlugin') self.assertError('channel disable channel invalidCommand') def testUnban(self): self.assertError('unban foo!bar@baz') self.irc.feedMsg(ircmsgs.op(self.channel, self.nick)) m = self.getMsg('unban foo!bar@baz') self.assertEqual(m.command, 'MODE') self.assertEqual(m.args, (self.channel, '-b', 'foo!bar@baz')) self.assertNoResponse(' ', 2) def testErrorsWithoutOps(self): for s in 'op deop halfop dehalfop voice devoice kick invite'.split(): self.assertError('%s foo' % s) self.irc.feedMsg(ircmsgs.op(self.channel, self.nick)) self.assertNotError('%s foo' % s) self.irc.feedMsg(ircmsgs.deop(self.channel, self.nick)) def testWontDeItself(self): for s in 'deop dehalfop devoice'.split(): self.irc.feedMsg(ircmsgs.op(self.channel, self.nick)) self.assertError('%s %s' % (s, self.nick)) def testOp(self): self.assertError('op') self.irc.feedMsg(ircmsgs.op(self.channel, self.nick)) self.assertNotError('op') m = self.getMsg('op foo') self.failUnless(m.command == 'MODE' and m.args == (self.channel, '+o', 'foo')) m = self.getMsg('op foo bar') self.failUnless(m.command == 'MODE' and m.args == (self.channel, '+o', 'foo')) m = self.irc.takeMsg() self.failUnless(m.command == 'MODE' and m.args == (self.channel, '+o', 'bar')) self.irc.state.supported['MODES'] = 2 m = self.getMsg('op foo bar') try: self.failUnless(m.command == 'MODE' and m.args == (self.channel, '+oo', 'foo', 'bar')) finally: self.irc.state.supported['MODES'] = 1 def testHalfOp(self): self.assertError('halfop') self.irc.feedMsg(ircmsgs.op(self.channel, self.nick)) self.assertNotError('halfop') m = self.getMsg('halfop foo') self.failUnless(m.command == 'MODE' and m.args == (self.channel, '+h', 'foo')) m = self.getMsg('halfop foo bar') self.failUnless(m.command == 'MODE' and m.args == (self.channel, '+h', 'foo')) m = self.irc.takeMsg() self.failUnless(m.command == 'MODE' and m.args == (self.channel, '+h', 'bar')) def testVoice(self): self.assertError('voice') self.irc.feedMsg(ircmsgs.op(self.channel, self.nick)) self.assertNotError('voice') m = self.getMsg('voice foo') self.failUnless(m.command == 'MODE' and m.args == (self.channel, '+v', 'foo')) m = self.getMsg('voice foo bar') self.failUnless(m.command == 'MODE' and m.args == (self.channel, '+v', 'foo')) m = self.irc.takeMsg() self.failUnless(m.command == 'MODE' and m.args == (self.channel, '+v', 'bar')) def assertBan(self, query, hostmask, **kwargs): m = self.getMsg(query, **kwargs) self.assertEqual(m, ircmsgs.ban(self.channel, hostmask)) m = self.getMsg(' ') self.assertEqual(m.command, 'KICK') ## def testKban(self): ## self.irc.prefix = 'something!else@somehwere.else' ## self.irc.nick = 'something' ## self.irc.feedMsg(ircmsgs.join(self.channel, ## prefix='foobar!user@host.domain.tld')) ## self.assertError('kban foobar') ## self.irc.feedMsg(ircmsgs.op(self.channel, self.irc.nick)) ## self.assertError('kban foobar -1') ## self.assertBan('kban foobar', '*!*@*.domain.tld') ## self.assertBan('kban --exact foobar', 'foobar!user@host.domain.tld') ## self.assertBan('kban --host foobar', '*!*@host.domain.tld') ## self.assertBan('kban --user foobar', '*!user@*') ## self.assertBan('kban --nick foobar', 'foobar!*@*') ## self.assertBan('kban --nick --user foobar', 'foobar!user@*') ## self.assertBan('kban --nick --host foobar', ## 'foobar!*@host.domain.tld') ## self.assertBan('kban --user --host foobar', '*!user@host.domain.tld') ## self.assertBan('kban --nick --user --host foobar', ## 'foobar!user@host.domain.tld') ## self.assertNotRegexp('kban adlkfajsdlfkjsd', 'KeyError') ## self.assertNotRegexp('kban foobar time', 'ValueError') ## self.assertError('kban %s' % self.irc.nick) def testBan(self): origban = conf.supybot.protocols.irc.banmask() try: conf.supybot.protocols.irc.banmask.setValue(['exact']) self.assertNotError('ban add foo!bar@baz') self.assertNotError('ban remove foo!bar@baz') orig = conf.supybot.protocols.irc.strictRfc() try: conf.supybot.protocols.irc.strictRfc.setValue(True) # something wonky is going on here. irc.error (src/Channel.py|449) # is being called but the assert is failing self.assertError('ban add not!a.hostmask') self.assertNotRegexp('ban add not!a.hostmask', 'KeyError') finally: conf.supybot.protocols.irc.strictRfc.setValue(orig) finally: conf.supybot.protocols.irc.banmask.setValue(origban) def testIgnore(self): orig = conf.supybot.protocols.irc.banmask() def ignore(given, expect=None): if expect is None: expect = given self.assertNotError('channel ignore add %s' % given) self.assertResponse('channel ignore list', "'%s'" % expect) self.assertNotError('channel ignore remove %s' % expect) self.assertRegexp('channel ignore list', 'not currently') try: ignore('foo!bar@baz', '*!bar@baz') ignore('foo!*@*') conf.supybot.protocols.irc.banmask.setValue(['exact']) ignore('foo!bar@baz') ignore('foo!*@*') self.assertError('ban add not!a.hostmask') finally: conf.supybot.protocols.irc.banmask.setValue(orig) def testNicks(self): self.assertResponse('channel nicks', 'bar, foo, and test') self.assertResponse('channel nicks --count', '3') # vim:set shiftwidth=4 softtabstop=4 expandtab textwidth=79:

46.380952

82

0.617416

rom supybot.test import * import supybot.conf as conf import supybot.ircdb as ircdb import supybot.ircmsgs as ircmsgs class ChannelTestCase(ChannelPluginTestCase): plugins = ('Channel', 'User') def setUp(self): super(ChannelTestCase, self).setUp() self.irc.state.channels[self.channel].addUser('foo') self.irc.state.channels[self.channel].addUser('bar') def testLobotomies(self): self.assertRegexp('lobotomy list', 'not.*any') ble channel') self.assertNotError('channel disable channel') self.assertRegexp('channel capability list', '-Channel') self.assertNotError('channel enable channel') self.assertNotRegexp('channel capability list', '-Channel') self.assertNotError('channel disable channel nicks') self.assertRegexp('channel capability list', '-Channel.nicks') self.assertNotError('channel enable channel nicks') self.assertNotRegexp('channel capability list', '-Channel.nicks') self.assertNotRegexp('channel capability list', 'nicks') self.assertNotError('channel disable nicks') self.assertRegexp('channel capability list', 'nicks') self.assertNotError('channel enable nicks') self.assertError('channel disable invalidPlugin') self.assertError('channel disable channel invalidCommand') def testUnban(self): self.assertError('unban foo!bar@baz') self.irc.feedMsg(ircmsgs.op(self.channel, self.nick)) m = self.getMsg('unban foo!bar@baz') self.assertEqual(m.command, 'MODE') self.assertEqual(m.args, (self.channel, '-b', 'foo!bar@baz')) self.assertNoResponse(' ', 2) def testErrorsWithoutOps(self): for s in 'op deop halfop dehalfop voice devoice kick invite'.split(): self.assertError('%s foo' % s) self.irc.feedMsg(ircmsgs.op(self.channel, self.nick)) self.assertNotError('%s foo' % s) self.irc.feedMsg(ircmsgs.deop(self.channel, self.nick)) def testWontDeItself(self): for s in 'deop dehalfop devoice'.split(): self.irc.feedMsg(ircmsgs.op(self.channel, self.nick)) self.assertError('%s %s' % (s, self.nick)) def testOp(self): self.assertError('op') self.irc.feedMsg(ircmsgs.op(self.channel, self.nick)) self.assertNotError('op') m = self.getMsg('op foo') self.failUnless(m.command == 'MODE' and m.args == (self.channel, '+o', 'foo')) m = self.getMsg('op foo bar') self.failUnless(m.command == 'MODE' and m.args == (self.channel, '+o', 'foo')) m = self.irc.takeMsg() self.failUnless(m.command == 'MODE' and m.args == (self.channel, '+o', 'bar')) self.irc.state.supported['MODES'] = 2 m = self.getMsg('op foo bar') try: self.failUnless(m.command == 'MODE' and m.args == (self.channel, '+oo', 'foo', 'bar')) finally: self.irc.state.supported['MODES'] = 1 def testHalfOp(self): self.assertError('halfop') self.irc.feedMsg(ircmsgs.op(self.channel, self.nick)) self.assertNotError('halfop') m = self.getMsg('halfop foo') self.failUnless(m.command == 'MODE' and m.args == (self.channel, '+h', 'foo')) m = self.getMsg('halfop foo bar') self.failUnless(m.command == 'MODE' and m.args == (self.channel, '+h', 'foo')) m = self.irc.takeMsg() self.failUnless(m.command == 'MODE' and m.args == (self.channel, '+h', 'bar')) def testVoice(self): self.assertError('voice') self.irc.feedMsg(ircmsgs.op(self.channel, self.nick)) self.assertNotError('voice') m = self.getMsg('voice foo') self.failUnless(m.command == 'MODE' and m.args == (self.channel, '+v', 'foo')) m = self.getMsg('voice foo bar') self.failUnless(m.command == 'MODE' and m.args == (self.channel, '+v', 'foo')) m = self.irc.takeMsg() self.failUnless(m.command == 'MODE' and m.args == (self.channel, '+v', 'bar')) def assertBan(self, query, hostmask, **kwargs): m = self.getMsg(query, **kwargs) self.assertEqual(m, ircmsgs.ban(self.channel, hostmask)) m = self.getMsg(' ') self.assertEqual(m.command, 'KICK') ignore('foo!bar@baz', '*!bar@baz') ignore('foo!*@*') conf.supybot.protocols.irc.banmask.setValue(['exact']) ignore('foo!bar@baz') ignore('foo!*@*') self.assertError('ban add not!a.hostmask') finally: conf.supybot.protocols.irc.banmask.setValue(orig) def testNicks(self): self.assertResponse('channel nicks', 'bar, foo, and test') self.assertResponse('channel nicks --count', '3')

true

1c301d0241b470c8b887c9d429844e8d2f0f4a77

5,954

py

Python

cloud/cdk/baseline_cdk/resources/cfnres_iot_fleet.py

MartinMReed/aws-iot-baseline

61bdc51708e6f4480d0117a43f0adde5f6a63506

[ "MIT" ]

1

2021-12-31T05:05:30.000Z

cloud/cdk/baseline_cdk/resources/cfnres_iot_fleet.py

nelsestu/thing-expert

2e105d718c386258d8efdb329ea60da1072ffbe8

[ "MIT" ]

null

cloud/cdk/baseline_cdk/resources/cfnres_iot_fleet.py

nelsestu/thing-expert

2e105d718c386258d8efdb329ea60da1072ffbe8

[ "MIT" ]

1

2021-04-05T23:44:12.000Z

import os import zipfile from aws_cdk import aws_cloudformation from aws_cdk import aws_iam from aws_cdk import aws_lambda from aws_cdk import core from aws_cdk.core import RemovalPolicy from baseline_cdk.resources import cfnres_log_group from baseline_cdk.util import cdk from baseline_cdk.util.hash import file_sha1 from baseline_cdk.util.os import shell from baseline_cdk.util.zip import exclude_pycache from baseline_cdk.util.zip import zip_all lambda_type = 'cfnres-iot-fleet' def create_layer_zip() -> str: this_dir = os.path.abspath(os.path.dirname(os.path.abspath(__file__))) cloud_dir = os.path.abspath(f'{this_dir}/../../..') layer_dir = f'{cdk.outdir}/{cdk.app_name}/lambda-{lambda_type}-layer' layer_zip = f'{cdk.outdir}/{cdk.app_name}/lambda-{lambda_type}-layer.zip' if not os.path.exists(layer_dir): os.makedirs(layer_dir) shell(f'bash {cloud_dir}/scripts/aws-lambda-pip.sh' f' -pyver 3.7' f' -out "{layer_dir}/python/lib/python3.7/site-packages"' f' -req "{this_dir}/cfnres/iot_fleet/requirements.txt"') with zipfile.ZipFile(layer_zip, 'w', zipfile.ZIP_DEFLATED) as zip: zip_all(zip, f'{layer_dir}', exclude_pycache, path='python') return layer_zip def create_lambda_zip() -> str: this_dir = os.path.abspath(os.path.dirname(os.path.abspath(__file__))) lambda_zip = f'{cdk.outdir}/{cdk.app_name}/lambda-{lambda_type}.zip' with zipfile.ZipFile(lambda_zip, 'w', zipfile.ZIP_DEFLATED) as zip: zip.write(f'{this_dir}/cfnres/iot_fleet/index.py', arcname='index.py') return lambda_zip def create_lambda(stack: core.Stack, iot_scope: core.Construct) -> aws_lambda.CfnFunction: lambda_scope = core.Construct(iot_scope, 'FleetLambda') layer_zip = create_layer_zip() lambda_zip = create_lambda_zip() layer_asset = stack.synthesizer.add_file_asset( file_name=layer_zip, packaging=core.FileAssetPackaging.FILE, source_hash=file_sha1(layer_zip) ) lambda_asset = stack.synthesizer.add_file_asset( file_name=lambda_zip, packaging=core.FileAssetPackaging.FILE, source_hash=file_sha1(lambda_zip) ) lambda_role = aws_iam.CfnRole( lambda_scope, 'ExecutionRole', role_name=f'{cdk.app_name}-lambda-{lambda_type}', assume_role_policy_document={ 'Version': '2012-10-17', 'Statement': [{ 'Effect': 'Allow', 'Action': 'sts:AssumeRole', 'Principal': { 'Service': 'lambda.amazonaws.com', **({'AWS': f'arn:aws:iam::{stack.account}:root'} if cdk.debug_lambda_roles else {}) } }] }, managed_policy_arns=[ 'arn:aws:iam::aws:policy/service-role/AWSLambdaBasicExecutionRole' ], policies=[aws_iam.CfnRole.PolicyProperty( policy_name=f'{cdk.app_name}-lambda-{lambda_type}', policy_document={ 'Version': '2012-10-17', 'Statement': [{ 'Effect': 'Allow', 'Action': [ 'iot:UpdateCertificate', 'iot:DeleteCertificate', 'iot:DeleteThing', 'iot:ListAttachedPolicies', 'iot:DetachPolicy', 'iot:ListThingPrincipals', 'iot:DetachThingPrincipal', 'iot:ListThings', 'iot:ListPrincipalThings', 'iot:ListTagsForResource', 'events:PutRule', 'events:DeleteRule', 'events:PutTargets', 'events:RemoveTargets', 'lambda:AddPermission', 'lambda:RemovePermission' ], 'Resource': '*' }] } )] ) lambda_layer = aws_lambda.CfnLayerVersion( lambda_scope, 'Layer', layer_name=f'{cdk.app_name}-{lambda_type}', compatible_runtimes=['python3.7'], content=aws_lambda.CfnLayerVersion.ContentProperty( s3_bucket=layer_asset.bucket_name, s3_key=layer_asset.object_key ) ) lambda_function = aws_lambda.CfnFunction( lambda_scope, 'Function', function_name=f'{cdk.app_name}-{lambda_type}', runtime='python3.7', code=aws_lambda.CfnFunction.CodeProperty( s3_bucket=lambda_asset.bucket_name, s3_key=lambda_asset.object_key ), handler='index.handle', layers=[lambda_layer.ref], memory_size=128, timeout=600, role=lambda_role.attr_arn ) lambda_function.add_depends_on(lambda_role) # use a custom CfnLogGroup to avoid errors if the group still exists (failed deployment) cfnres_log_group.CfnLogGroup( stack, lambda_scope, 'LogGroup', log_group_name=f'/aws/lambda/{lambda_function.ref}', retention_in_days=7, ) return lambda_function def create(stack: core.Stack) -> None: iot_scope: core.Construct = cdk.find_resource(stack, 'Iot') lambda_function = create_lambda(stack, iot_scope) custom_resource = aws_cloudformation.CfnCustomResource( iot_scope, 'Fleet', service_token=lambda_function.attr_arn ) custom_resource.add_override('Type', 'Custom::IotFleet') custom_resource.add_override('Properties.ThingTypeName', cdk.app_name) custom_resource.add_override('Properties.ThingRemovalPolicy', RemovalPolicy.DESTROY) custom_resource.add_depends_on(lambda_function) # make sure this runs first when destroying the stack for child in iot_scope.node.children: if isinstance(child, core.CfnResource): custom_resource.add_depends_on(child)

34.416185

103

0.620591

import os import zipfile from aws_cdk import aws_cloudformation from aws_cdk import aws_iam from aws_cdk import aws_lambda from aws_cdk import core from aws_cdk.core import RemovalPolicy from baseline_cdk.resources import cfnres_log_group from baseline_cdk.util import cdk from baseline_cdk.util.hash import file_sha1 from baseline_cdk.util.os import shell from baseline_cdk.util.zip import exclude_pycache from baseline_cdk.util.zip import zip_all lambda_type = 'cfnres-iot-fleet' def create_layer_zip() -> str: this_dir = os.path.abspath(os.path.dirname(os.path.abspath(__file__))) cloud_dir = os.path.abspath(f'{this_dir}/../../..') layer_dir = f'{cdk.outdir}/{cdk.app_name}/lambda-{lambda_type}-layer' layer_zip = f'{cdk.outdir}/{cdk.app_name}/lambda-{lambda_type}-layer.zip' if not os.path.exists(layer_dir): os.makedirs(layer_dir) shell(f'bash {cloud_dir}/scripts/aws-lambda-pip.sh' f' -pyver 3.7' f' -out "{layer_dir}/python/lib/python3.7/site-packages"' f' -req "{this_dir}/cfnres/iot_fleet/requirements.txt"') with zipfile.ZipFile(layer_zip, 'w', zipfile.ZIP_DEFLATED) as zip: zip_all(zip, f'{layer_dir}', exclude_pycache, path='python') return layer_zip def create_lambda_zip() -> str: this_dir = os.path.abspath(os.path.dirname(os.path.abspath(__file__))) lambda_zip = f'{cdk.outdir}/{cdk.app_name}/lambda-{lambda_type}.zip' with zipfile.ZipFile(lambda_zip, 'w', zipfile.ZIP_DEFLATED) as zip: zip.write(f'{this_dir}/cfnres/iot_fleet/index.py', arcname='index.py') return lambda_zip def create_lambda(stack: core.Stack, iot_scope: core.Construct) -> aws_lambda.CfnFunction: lambda_scope = core.Construct(iot_scope, 'FleetLambda') layer_zip = create_layer_zip() lambda_zip = create_lambda_zip() layer_asset = stack.synthesizer.add_file_asset( file_name=layer_zip, packaging=core.FileAssetPackaging.FILE, source_hash=file_sha1(layer_zip) ) lambda_asset = stack.synthesizer.add_file_asset( file_name=lambda_zip, packaging=core.FileAssetPackaging.FILE, source_hash=file_sha1(lambda_zip) ) lambda_role = aws_iam.CfnRole( lambda_scope, 'ExecutionRole', role_name=f'{cdk.app_name}-lambda-{lambda_type}', assume_role_policy_document={ 'Version': '2012-10-17', 'Statement': [{ 'Effect': 'Allow', 'Action': 'sts:AssumeRole', 'Principal': { 'Service': 'lambda.amazonaws.com', **({'AWS': f'arn:aws:iam::{stack.account}:root'} if cdk.debug_lambda_roles else {}) } }] }, managed_policy_arns=[ 'arn:aws:iam::aws:policy/service-role/AWSLambdaBasicExecutionRole' ], policies=[aws_iam.CfnRole.PolicyProperty( policy_name=f'{cdk.app_name}-lambda-{lambda_type}', policy_document={ 'Version': '2012-10-17', 'Statement': [{ 'Effect': 'Allow', 'Action': [ 'iot:UpdateCertificate', 'iot:DeleteCertificate', 'iot:DeleteThing', 'iot:ListAttachedPolicies', 'iot:DetachPolicy', 'iot:ListThingPrincipals', 'iot:DetachThingPrincipal', 'iot:ListThings', 'iot:ListPrincipalThings', 'iot:ListTagsForResource', 'events:PutRule', 'events:DeleteRule', 'events:PutTargets', 'events:RemoveTargets', 'lambda:AddPermission', 'lambda:RemovePermission' ], 'Resource': '*' }] } )] ) lambda_layer = aws_lambda.CfnLayerVersion( lambda_scope, 'Layer', layer_name=f'{cdk.app_name}-{lambda_type}', compatible_runtimes=['python3.7'], content=aws_lambda.CfnLayerVersion.ContentProperty( s3_bucket=layer_asset.bucket_name, s3_key=layer_asset.object_key ) ) lambda_function = aws_lambda.CfnFunction( lambda_scope, 'Function', function_name=f'{cdk.app_name}-{lambda_type}', runtime='python3.7', code=aws_lambda.CfnFunction.CodeProperty( s3_bucket=lambda_asset.bucket_name, s3_key=lambda_asset.object_key ), handler='index.handle', layers=[lambda_layer.ref], memory_size=128, timeout=600, role=lambda_role.attr_arn ) lambda_function.add_depends_on(lambda_role) cfnres_log_group.CfnLogGroup( stack, lambda_scope, 'LogGroup', log_group_name=f'/aws/lambda/{lambda_function.ref}', retention_in_days=7, ) return lambda_function def create(stack: core.Stack) -> None: iot_scope: core.Construct = cdk.find_resource(stack, 'Iot') lambda_function = create_lambda(stack, iot_scope) custom_resource = aws_cloudformation.CfnCustomResource( iot_scope, 'Fleet', service_token=lambda_function.attr_arn ) custom_resource.add_override('Type', 'Custom::IotFleet') custom_resource.add_override('Properties.ThingTypeName', cdk.app_name) custom_resource.add_override('Properties.ThingRemovalPolicy', RemovalPolicy.DESTROY) custom_resource.add_depends_on(lambda_function) for child in iot_scope.node.children: if isinstance(child, core.CfnResource): custom_resource.add_depends_on(child)

true

1c301e36e501a99e2df8a590d3a6447d4a83d534

422

py

Python

cadastros/migrations/0006_pcvaga_data_criacao.py

lhggomes/vagas

84b429d642f1703d067ce12735875a8b95769b3f

[ "Unlicense" ]

null

cadastros/migrations/0006_pcvaga_data_criacao.py

lhggomes/vagas

84b429d642f1703d067ce12735875a8b95769b3f

[ "Unlicense" ]

null

cadastros/migrations/0006_pcvaga_data_criacao.py

lhggomes/vagas

84b429d642f1703d067ce12735875a8b95769b3f

[ "Unlicense" ]

null

# Generated by Django 3.1.4 on 2020-12-20 02:30 import datetime from django.db import migrations, models class Migration(migrations.Migration): dependencies = [ ('cadastros', '0005_auto_20201208_2339'), ] operations = [ migrations.AddField( model_name='pcvaga', name='data_criacao', field=models.DateField(default=datetime.date.today), ), ]

21.1

64

0.623223

import datetime from django.db import migrations, models class Migration(migrations.Migration): dependencies = [ ('cadastros', '0005_auto_20201208_2339'), ] operations = [ migrations.AddField( model_name='pcvaga', name='data_criacao', field=models.DateField(default=datetime.date.today), ), ]

true

1c301f3501a192ccb0b9ef84509c69d14ee42689

68

py

Python

psi/data/api.py

bburan/psiexperiment

9b70f7f0b4a4379d8c3fc463e1df272153afd247

[ "MIT" ]

5

2016-05-26T13:46:00.000Z

2020-03-03T13:07:47.000Z

psi/data/api.py

bburan/psiexperiment

9b70f7f0b4a4379d8c3fc463e1df272153afd247

[ "MIT" ]

2

2018-04-17T15:06:35.000Z

2019-03-25T18:13:10.000Z

psi/data/api.py

psiexperiment/psiexperiment

2701558e1d0637b8a5d6762912dfb5c183f3be87

[ "MIT" ]

3

2020-04-17T15:03:36.000Z

2022-01-14T23:19:29.000Z

from .plots import FFTContainer, PlotContainer, ResultPlot, ViewBox

34

67

0.838235

from .plots import FFTContainer, PlotContainer, ResultPlot, ViewBox

true

1c301f6cb8cae54e2b472abd80d09c9c70abf531

13,322

py

Python

ctapipe/reco/HillasReconstructor.py

mpecimotika/ctapipe

ffd7930921f7139b761fbf1208da16dd302e97a6

[ "BSD-3-Clause" ]

null

ctapipe/reco/HillasReconstructor.py

mpecimotika/ctapipe

ffd7930921f7139b761fbf1208da16dd302e97a6

[ "BSD-3-Clause" ]

null

ctapipe/reco/HillasReconstructor.py

mpecimotika/ctapipe

ffd7930921f7139b761fbf1208da16dd302e97a6

[ "BSD-3-Clause" ]

null

""" Line-intersection-based fitting. Contact: Tino Michael <Tino.Michael@cea.fr> """ from ctapipe.reco.reco_algorithms import Reconstructor from ctapipe.io.containers import ReconstructedShowerContainer from ctapipe.coordinates import HorizonFrame, CameraFrame, GroundFrame, TiltedGroundFrame, project_to_ground from astropy.coordinates import SkyCoord, spherical_to_cartesian, cartesian_to_spherical from itertools import combinations import numpy as np from astropy import units as u __all__ = ['HillasReconstructor', 'TooFewTelescopesException', 'HillasPlane'] class TooFewTelescopesException(Exception): pass def angle(v1, v2): """ computes the angle between two vectors assuming carthesian coordinates Parameters ---------- v1 : numpy array v2 : numpy array Returns ------- the angle between v1 and v2 as a dimensioned astropy quantity """ norm = np.linalg.norm(v1) * np.linalg.norm(v2) return np.arccos(np.clip(v1.dot(v2) / norm, -1.0, 1.0)) def normalise(vec): """ Sets the length of the vector to 1 without changing its direction Parameters ---------- vec : numpy array Returns ------- numpy array with the same direction but length of 1 """ try: return vec / np.linalg.norm(vec) except ZeroDivisionError: return vec def line_line_intersection_3d(uvw_vectors, origins): ''' Intersection of many lines in 3d. See https://en.wikipedia.org/wiki/Line%E2%80%93line_intersection ''' C = [] S = [] for n, pos in zip(uvw_vectors, origins): n = n.reshape((3, 1)) norm_matrix = (n @ n.T) - np.eye(3) C.append(norm_matrix @ pos) S.append(norm_matrix) S = np.array(S).sum(axis=0) C = np.array(C).sum(axis=0) return np.linalg.inv(S) @ C class HillasReconstructor(Reconstructor): """ class that reconstructs the direction of an atmospheric shower using a simple hillas parametrisation of the camera images it provides a direction estimate in two steps and an estimate for the shower's impact position on the ground. so far, it does neither provide an energy estimator nor an uncertainty on the reconstructed parameters """ def __init__(self, config=None, tool=None, **kwargs): super().__init__(config=config, parent=tool, **kwargs) self.hillas_planes = {} def predict(self, hillas_dict, inst, pointing_alt, pointing_az): ''' The function you want to call for the reconstruction of the event. It takes care of setting up the event and consecutively calls the functions for the direction and core position reconstruction. Shower parameters not reconstructed by this class are set to np.nan Parameters ----------- hillas_dict: dict dictionary with telescope IDs as key and HillasParametersContainer instances as values inst : ctapipe.io.InstrumentContainer instrumental description pointing_alt: dict[astropy.coordinates.Angle] dict mapping telescope ids to pointing altitude pointing_az: dict[astropy.coordinates.Angle] dict mapping telescope ids to pointing azimuth Raises ------ TooFewTelescopesException if len(hillas_dict) < 2 ''' # stereoscopy needs at least two telescopes if len(hillas_dict) < 2: raise TooFewTelescopesException( "need at least two telescopes, have {}" .format(len(hillas_dict))) self.initialize_hillas_planes( hillas_dict, inst.subarray, pointing_alt, pointing_az ) # algebraic direction estimate direction, err_est_dir = self.estimate_direction() alt = u.Quantity(list(pointing_alt.values())) az = u.Quantity(list(pointing_az.values())) if np.any(alt != alt[0]) or np.any(az != az[0]): raise ValueError('Divergent pointing not supported') pointing_direction = SkyCoord(alt=alt[0], az=az[0], frame='altaz') # core position estimate using a geometric approach core_pos = self.estimate_core_position(hillas_dict, pointing_direction) # container class for reconstructed showers result = ReconstructedShowerContainer() _, lat, lon = cartesian_to_spherical(*direction) # estimate max height of shower h_max = self.estimate_h_max() # astropy's coordinates system rotates counter-clockwise. # Apparently we assume it to be clockwise. result.alt, result.az = lat, -lon result.core_x = core_pos[0] result.core_y = core_pos[1] result.core_uncert = np.nan result.tel_ids = [h for h in hillas_dict.keys()] result.average_size = np.mean([h.intensity for h in hillas_dict.values()]) result.is_valid = True result.alt_uncert = err_est_dir result.az_uncert = np.nan result.h_max = h_max result.h_max_uncert = np.nan result.goodness_of_fit = np.nan return result def initialize_hillas_planes( self, hillas_dict, subarray, pointing_alt, pointing_az ): """ creates a dictionary of :class:`.HillasPlane` from a dictionary of hillas parameters Parameters ---------- hillas_dict : dictionary dictionary of hillas moments subarray : ctapipe.instrument.SubarrayDescription subarray information tel_phi, tel_theta : dictionaries dictionaries of the orientation angles of the telescopes needs to contain at least the same keys as in `hillas_dict` """ self.hillas_planes = {} for tel_id, moments in hillas_dict.items(): # we just need any point on the main shower axis a bit away from the cog p2_x = moments.x + 0.1 * u.m * np.cos(moments.psi) p2_y = moments.y + 0.1 * u.m * np.sin(moments.psi) focal_length = subarray.tel[tel_id].optics.equivalent_focal_length pointing = SkyCoord( alt=pointing_alt[tel_id], az=pointing_az[tel_id], frame='altaz' ) hf = HorizonFrame( array_direction=pointing, pointing_direction=pointing ) cf = CameraFrame( focal_length=focal_length, array_direction=pointing, pointing_direction=pointing, ) cog_coord = SkyCoord(x=moments.x, y=moments.y, frame=cf) cog_coord = cog_coord.transform_to(hf) p2_coord = SkyCoord(x=p2_x, y=p2_y, frame=cf) p2_coord = p2_coord.transform_to(hf) circle = HillasPlane( p1=cog_coord, p2=p2_coord, telescope_position=subarray.positions[tel_id], weight=moments.intensity * (moments.length / moments.width), ) self.hillas_planes[tel_id] = circle def estimate_direction(self): """calculates the origin of the gamma as the weighted average direction of the intersections of all hillas planes Returns ------- gamma : shape (3) numpy array direction of origin of the reconstructed shower as a 3D vector crossings : shape (n,3) list an error esimate """ crossings = [] for perm in combinations(self.hillas_planes.values(), 2): n1, n2 = perm[0].norm, perm[1].norm # cross product automatically weighs in the angle between # the two vectors: narrower angles have less impact, # perpendicular vectors have the most crossing = np.cross(n1, n2) # two great circles cross each other twice (one would be # the origin, the other one the direction of the gamma) it # doesn't matter which we pick but it should at least be # consistent: make sure to always take the "upper" solution if crossing[2] < 0: crossing *= -1 crossings.append(crossing * perm[0].weight * perm[1].weight) result = normalise(np.sum(crossings, axis=0)) off_angles = [angle(result, cross) for cross in crossings] * u.rad err_est_dir = np.average( off_angles, weights=[len(cross) for cross in crossings] ) return result, err_est_dir def estimate_core_position(self, hillas_dict, pointing_direction): ''' Estimate the core position by intersection the major ellipse lines of each telescope. Parameters ----------- hillas_dict: dict[HillasContainer] dictionary of hillas moments pointing_direction: SkyCoord[AltAz] Pointing direction of the array Returns ----------- core_x: u.Quantity estimated x position of impact core_y: u.Quantity estimated y position of impact ''' psi = u.Quantity([h.psi for h in hillas_dict.values()]) z = np.zeros(len(psi)) uvw_vectors = np.column_stack([np.cos(psi).value, np.sin(psi).value, z]) tilted_frame = TiltedGroundFrame(pointing_direction=pointing_direction) ground_frame = GroundFrame(pointing_direction=pointing_direction) positions = [ ( SkyCoord(*plane.pos, frame=ground_frame) .transform_to(tilted_frame) .cartesian.xyz ) for plane in self.hillas_planes.values() ] core_position = line_line_intersection_3d(uvw_vectors, positions) core_pos_tilted = SkyCoord( x=core_position[0] * u.m, y=core_position[1] * u.m, frame=tilted_frame ) core_pos = project_to_ground(core_pos_tilted) return core_pos.x, core_pos.y def estimate_h_max(self): ''' Estimate the max height by intersecting the lines of the cog directions of each telescope. Parameters ----------- hillas_dict : dictionary dictionary of hillas moments subarray : ctapipe.instrument.SubarrayDescription subarray information Returns ----------- astropy.unit.Quantity the estimated max height ''' uvw_vectors = np.array([plane.a for plane in self.hillas_planes.values()]) positions = [plane.pos for plane in self.hillas_planes.values()] # not sure if its better to return the length of the vector of the z component return np.linalg.norm(line_line_intersection_3d(uvw_vectors, positions)) * u.m class HillasPlane: """ a tiny helper class to collect some parameters for each great great circle Stores some vectors a, b, and c These vectors are eucledian [x, y, z] where positive z values point towards the sky and x and y are parallel to the ground. """ def __init__(self, p1, p2, telescope_position, weight=1): """The constructor takes two coordinates in the horizontal frame (alt, az) which define a plane perpedicular to the camera. Parameters ----------- p1: astropy.coordinates.SkyCoord One of two direction vectors which define the plane. This coordinate has to be defined in the ctapipe.coordinates.HorizonFrame p2: astropy.coordinates.SkyCoord One of two direction vectors which define the plane. This coordinate has to be defined in the ctapipe.coordinates.HorizonFrame telescope_position: np.array(3) Position of the telescope on the ground weight : float, optional weight of this plane for later use during the reconstruction Notes ----- c: numpy.ndarray(3) :math:`\vec c = (\vec a \times \vec b) \times \vec a` :math:`\rightarrow` a and c form an orthogonal base for the great circle (only orthonormal if a and b are of unit-length) norm: numpy.ndarray(3) normal vector of the circle's plane, perpendicular to a, b and c """ self.pos = telescope_position # astropy's coordinates system rotates counter clockwise. Apparently we assume it to # be clockwise self.a = np.array(spherical_to_cartesian(1, p1.alt, -p1.az)).ravel() self.b = np.array(spherical_to_cartesian(1, p2.alt, -p2.az)).ravel() # a and c form an orthogonal basis for the great circle # not really necessary since the norm can be calculated # with a and b just as well self.c = np.cross(np.cross(self.a, self.b), self.a) # normal vector for the plane defined by the great circle self.norm = normalise(np.cross(self.a, self.c)) # some weight for this circle # (put e.g. uncertainty on the Hillas parameters # or number of PE in here) self.weight = weight

33.388471

108

0.617325

from ctapipe.reco.reco_algorithms import Reconstructor from ctapipe.io.containers import ReconstructedShowerContainer from ctapipe.coordinates import HorizonFrame, CameraFrame, GroundFrame, TiltedGroundFrame, project_to_ground from astropy.coordinates import SkyCoord, spherical_to_cartesian, cartesian_to_spherical from itertools import combinations import numpy as np from astropy import units as u __all__ = ['HillasReconstructor', 'TooFewTelescopesException', 'HillasPlane'] class TooFewTelescopesException(Exception): pass def angle(v1, v2): norm = np.linalg.norm(v1) * np.linalg.norm(v2) return np.arccos(np.clip(v1.dot(v2) / norm, -1.0, 1.0)) def normalise(vec): try: return vec / np.linalg.norm(vec) except ZeroDivisionError: return vec def line_line_intersection_3d(uvw_vectors, origins): C = [] S = [] for n, pos in zip(uvw_vectors, origins): n = n.reshape((3, 1)) norm_matrix = (n @ n.T) - np.eye(3) C.append(norm_matrix @ pos) S.append(norm_matrix) S = np.array(S).sum(axis=0) C = np.array(C).sum(axis=0) return np.linalg.inv(S) @ C class HillasReconstructor(Reconstructor): def __init__(self, config=None, tool=None, **kwargs): super().__init__(config=config, parent=tool, **kwargs) self.hillas_planes = {} def predict(self, hillas_dict, inst, pointing_alt, pointing_az): if len(hillas_dict) < 2: raise TooFewTelescopesException( "need at least two telescopes, have {}" .format(len(hillas_dict))) self.initialize_hillas_planes( hillas_dict, inst.subarray, pointing_alt, pointing_az ) direction, err_est_dir = self.estimate_direction() alt = u.Quantity(list(pointing_alt.values())) az = u.Quantity(list(pointing_az.values())) if np.any(alt != alt[0]) or np.any(az != az[0]): raise ValueError('Divergent pointing not supported') pointing_direction = SkyCoord(alt=alt[0], az=az[0], frame='altaz') core_pos = self.estimate_core_position(hillas_dict, pointing_direction) result = ReconstructedShowerContainer() _, lat, lon = cartesian_to_spherical(*direction) h_max = self.estimate_h_max() # Apparently we assume it to be clockwise. result.alt, result.az = lat, -lon result.core_x = core_pos[0] result.core_y = core_pos[1] result.core_uncert = np.nan result.tel_ids = [h for h in hillas_dict.keys()] result.average_size = np.mean([h.intensity for h in hillas_dict.values()]) result.is_valid = True result.alt_uncert = err_est_dir result.az_uncert = np.nan result.h_max = h_max result.h_max_uncert = np.nan result.goodness_of_fit = np.nan return result def initialize_hillas_planes( self, hillas_dict, subarray, pointing_alt, pointing_az ): self.hillas_planes = {} for tel_id, moments in hillas_dict.items(): # we just need any point on the main shower axis a bit away from the cog p2_x = moments.x + 0.1 * u.m * np.cos(moments.psi) p2_y = moments.y + 0.1 * u.m * np.sin(moments.psi) focal_length = subarray.tel[tel_id].optics.equivalent_focal_length pointing = SkyCoord( alt=pointing_alt[tel_id], az=pointing_az[tel_id], frame='altaz' ) hf = HorizonFrame( array_direction=pointing, pointing_direction=pointing ) cf = CameraFrame( focal_length=focal_length, array_direction=pointing, pointing_direction=pointing, ) cog_coord = SkyCoord(x=moments.x, y=moments.y, frame=cf) cog_coord = cog_coord.transform_to(hf) p2_coord = SkyCoord(x=p2_x, y=p2_y, frame=cf) p2_coord = p2_coord.transform_to(hf) circle = HillasPlane( p1=cog_coord, p2=p2_coord, telescope_position=subarray.positions[tel_id], weight=moments.intensity * (moments.length / moments.width), ) self.hillas_planes[tel_id] = circle def estimate_direction(self): crossings = [] for perm in combinations(self.hillas_planes.values(), 2): n1, n2 = perm[0].norm, perm[1].norm # cross product automatically weighs in the angle between # the two vectors: narrower angles have less impact, # perpendicular vectors have the most crossing = np.cross(n1, n2) # two great circles cross each other twice (one would be # the origin, the other one the direction of the gamma) it # doesn't matter which we pick but it should at least be if crossing[2] < 0: crossing *= -1 crossings.append(crossing * perm[0].weight * perm[1].weight) result = normalise(np.sum(crossings, axis=0)) off_angles = [angle(result, cross) for cross in crossings] * u.rad err_est_dir = np.average( off_angles, weights=[len(cross) for cross in crossings] ) return result, err_est_dir def estimate_core_position(self, hillas_dict, pointing_direction): psi = u.Quantity([h.psi for h in hillas_dict.values()]) z = np.zeros(len(psi)) uvw_vectors = np.column_stack([np.cos(psi).value, np.sin(psi).value, z]) tilted_frame = TiltedGroundFrame(pointing_direction=pointing_direction) ground_frame = GroundFrame(pointing_direction=pointing_direction) positions = [ ( SkyCoord(*plane.pos, frame=ground_frame) .transform_to(tilted_frame) .cartesian.xyz ) for plane in self.hillas_planes.values() ] core_position = line_line_intersection_3d(uvw_vectors, positions) core_pos_tilted = SkyCoord( x=core_position[0] * u.m, y=core_position[1] * u.m, frame=tilted_frame ) core_pos = project_to_ground(core_pos_tilted) return core_pos.x, core_pos.y def estimate_h_max(self): uvw_vectors = np.array([plane.a for plane in self.hillas_planes.values()]) positions = [plane.pos for plane in self.hillas_planes.values()] return np.linalg.norm(line_line_intersection_3d(uvw_vectors, positions)) * u.m class HillasPlane: def __init__(self, p1, p2, telescope_position, weight=1): self.pos = telescope_position # be clockwise self.a = np.array(spherical_to_cartesian(1, p1.alt, -p1.az)).ravel() self.b = np.array(spherical_to_cartesian(1, p2.alt, -p2.az)).ravel() # a and c form an orthogonal basis for the great circle # not really necessary since the norm can be calculated # with a and b just as well self.c = np.cross(np.cross(self.a, self.b), self.a) # normal vector for the plane defined by the great circle self.norm = normalise(np.cross(self.a, self.c)) # some weight for this circle # (put e.g. uncertainty on the Hillas parameters # or number of PE in here) self.weight = weight

true

1c301fc86aa3e71ef49092f8fcb7561db23b5210

91

py

Python

plugins/googleanalytics/kpireport_googleanalytics/__init__.py

diurnalist/kpireporter

b3ce9ca52567405557ea12f45c1a7fda076d746a

[ "BlueOak-1.0.0", "Apache-2.0" ]

9

2021-05-17T05:32:46.000Z

2022-03-16T22:49:26.000Z

plugins/googleanalytics/kpireport_googleanalytics/__init__.py

diurnalist/kpireporter

b3ce9ca52567405557ea12f45c1a7fda076d746a

[ "BlueOak-1.0.0", "Apache-2.0" ]

4

2020-10-10T23:38:20.000Z

2020-11-08T22:41:24.000Z

plugins/googleanalytics/kpireport_googleanalytics/__init__.py

diurnalist/kpireporter

b3ce9ca52567405557ea12f45c1a7fda076d746a

[ "BlueOak-1.0.0", "Apache-2.0" ]

1

2021-01-12T02:49:04.000Z

from .datasource import GoogleAnalyticsDatasource __all__ = ["GoogleAnalyticsDatasource"]

22.75

49

0.846154

from .datasource import GoogleAnalyticsDatasource __all__ = ["GoogleAnalyticsDatasource"]

true

1c302026c6f18a359f53fe88062140ac1d30261b

890

py

Python

tests/test_table_metadata.py

Synicix/DJ-GUI-API

9afcf242f5f62c7d03c219380bf8490b46257f58

[ "MIT" ]

null

tests/test_table_metadata.py

Synicix/DJ-GUI-API

9afcf242f5f62c7d03c219380bf8490b46257f58

[ "MIT" ]

null

tests/test_table_metadata.py

Synicix/DJ-GUI-API

9afcf242f5f62c7d03c219380bf8490b46257f58

[ "MIT" ]

null

from . import SCHEMA_PREFIX, client, token, connection, schemas_simple def test_definition(token, client, schemas_simple): simple1, simple2 = schemas_simple REST_definition = client.post('/get_table_definition', headers=dict(Authorization=f'Bearer {token}'), json=dict(schemaName=simple1.database, tableName='TableB')).data assert f'{simple1.database}.TableA' in REST_definition.decode('utf-8') REST_definition = client.post('/get_table_definition', headers=dict(Authorization=f'Bearer {token}'), json=dict(schemaName=simple2.database, tableName='DiffTableB')).data assert f'`{simple1.database}`.`#table_a`' in REST_definition.decode('utf-8')

52.352941

80

0.573034

from . import SCHEMA_PREFIX, client, token, connection, schemas_simple def test_definition(token, client, schemas_simple): simple1, simple2 = schemas_simple REST_definition = client.post('/get_table_definition', headers=dict(Authorization=f'Bearer {token}'), json=dict(schemaName=simple1.database, tableName='TableB')).data assert f'{simple1.database}.TableA' in REST_definition.decode('utf-8') REST_definition = client.post('/get_table_definition', headers=dict(Authorization=f'Bearer {token}'), json=dict(schemaName=simple2.database, tableName='DiffTableB')).data assert f'`{simple1.database}`.`#table_a`' in REST_definition.decode('utf-8')

true

1c3022538e0d8a8157a20448e2808121b074799c

4,841

py

Python

app.py

parzibyte/camara_vigilancia_flask_python_opencv

ef4e186066128fbf4aac7bf9b5073443c1a432ea

[ "MIT" ]

2

2021-03-04T11:39:13.000Z

2021-10-09T00:25:01.000Z

app.py

parzibyte/camara_vigilancia_flask_python_opencv

ef4e186066128fbf4aac7bf9b5073443c1a432ea

[ "MIT" ]

null

app.py

parzibyte/camara_vigilancia_flask_python_opencv

ef4e186066128fbf4aac7bf9b5073443c1a432ea

[ "MIT" ]

null

""" ____ _____ _ _ _ | _ \ | __ \ (_) | | | | |_) |_ _ | |__) |_ _ _ __ _____| |__ _ _| |_ ___ | _ <| | | | | ___/ _` | '__|_ / | '_ \| | | | __/ _ \ | |_) | |_| | | | | (_| | | / /| | |_) | |_| | || __/ |____/ \__, | |_| \__,_|_| /___|_|_.__/ \__, |\__\___| __/ | __/ | |___/ |___/ ____________________________________ / Si necesitas ayuda, contáctame en \ \ https://parzibyte.me / ------------------------------------ \ ^__^ \ (oo)\_______ (__)\ )\/\ ||----w | || || Creado por Parzibyte (https://parzibyte.me). ------------------------------------------------------------------------------------------------ Si el código es útil para ti, puedes agradecerme siguiéndome: https://parzibyte.me/blog/sigueme/ Y compartiendo mi blog con tus amigos También tengo canal de YouTube: https://www.youtube.com/channel/UCroP4BTWjfM0CkGB6AFUoBg?sub_confirmation=1 ------------------------------------------------------------------------------------------------ """ import cv2 import utiles from flask import Flask, render_template, Response, jsonify app = Flask(__name__) # Si tienes varias cámaras puedes acceder a ellas en 1, 2, etcétera (en lugar de 0) camara = cv2.VideoCapture(0) """ Configuraciones de vídeo """ FRAMES_VIDEO = 20.0 RESOLUCION_VIDEO = (640, 480) # Marca de agua # https://docs.opencv.org/master/d6/d6e/group__imgproc__draw.html#ga5126f47f883d730f633d74f07456c576 UBICACION_FECHA_HORA = (0, 15) FUENTE_FECHA_Y_HORA = cv2.FONT_HERSHEY_PLAIN ESCALA_FUENTE = 1 COLOR_FECHA_HORA = (255, 255, 255) GROSOR_TEXTO = 1 TIPO_LINEA_TEXTO = cv2.LINE_AA # El código de 4 dígitos. En windows me parece que se soporta el XVID fourcc = cv2.VideoWriter_fourcc(*'XVID') archivo_video = None grabando = False def agregar_fecha_hora_frame(frame): cv2.putText(frame, utiles.fecha_y_hora(), UBICACION_FECHA_HORA, FUENTE_FECHA_Y_HORA, ESCALA_FUENTE, COLOR_FECHA_HORA, GROSOR_TEXTO, TIPO_LINEA_TEXTO) # Una función generadora para stremear la cámara # https://flask.palletsprojects.com/en/1.1.x/patterns/streaming/ def generador_frames(): while True: ok, imagen = obtener_frame_camara() if not ok: break else: # Regresar la imagen en modo de respuesta HTTP yield b"--frame\r\nContent-Type: image/jpeg\r\n\r\n" + imagen + b"\r\n" def obtener_frame_camara(): ok, frame = camara.read() if not ok: return False, None agregar_fecha_hora_frame(frame) # Escribir en el vídeo en caso de que se esté grabando if grabando and archivo_video is not None: archivo_video.write(frame) # Codificar la imagen como JPG _, bufer = cv2.imencode(".jpg", frame) imagen = bufer.tobytes() return True, imagen # Cuando visiten la ruta @app.route("/streaming_camara") def streaming_camara(): return Response(generador_frames(), mimetype='multipart/x-mixed-replace; boundary=frame') # Cuando toman la foto @app.route("/tomar_foto_descargar") def descargar_foto(): ok, frame = obtener_frame_camara() if not ok: abort(500) return respuesta = Response(frame) respuesta.headers["Content-Type"] = "image/jpeg" respuesta.headers["Content-Transfer-Encoding"] = "Binary" respuesta.headers["Content-Disposition"] = "attachment; filename=\"foto.jpg\"" return respuesta @app.route("/tomar_foto_guardar") def guardar_foto(): nombre_foto = utiles.obtener_uuid() + ".jpg" ok, frame = camara.read() if ok: agregar_fecha_hora_frame(frame) cv2.imwrite(nombre_foto, frame) return jsonify({ "ok": ok, "nombre_foto": nombre_foto, }) # Cuando visiten /, servimos el index.html @app.route('/') def index(): return render_template("index.html") @app.route("/comenzar_grabacion") def comenzar_grabacion(): global grabando global archivo_video if grabando and archivo_video: return jsonify(False) nombre = utiles.fecha_y_hora_para_nombre_archivo() + ".avi" archivo_video = cv2.VideoWriter( nombre, fourcc, FRAMES_VIDEO, RESOLUCION_VIDEO) grabando = True return jsonify(True) @app.route("/detener_grabacion") def detener_grabacion(): global grabando global archivo_video if not grabando or not archivo_video: return jsonify(False) grabando = False archivo_video.release() archivo_video = None return jsonify(True) @app.route("/estado_grabacion") def estado_grabacion(): return jsonify(grabando) if __name__ == "__main__": app.run(debug=True, host="0.0.0.0")

29.882716

107

0.606899

import cv2 import utiles from flask import Flask, render_template, Response, jsonify app = Flask(__name__) camara = cv2.VideoCapture(0) FRAMES_VIDEO = 20.0 RESOLUCION_VIDEO = (640, 480) NTE_FECHA_Y_HORA = cv2.FONT_HERSHEY_PLAIN ESCALA_FUENTE = 1 COLOR_FECHA_HORA = (255, 255, 255) GROSOR_TEXTO = 1 TIPO_LINEA_TEXTO = cv2.LINE_AA fourcc = cv2.VideoWriter_fourcc(*'XVID') archivo_video = None grabando = False def agregar_fecha_hora_frame(frame): cv2.putText(frame, utiles.fecha_y_hora(), UBICACION_FECHA_HORA, FUENTE_FECHA_Y_HORA, ESCALA_FUENTE, COLOR_FECHA_HORA, GROSOR_TEXTO, TIPO_LINEA_TEXTO) def generador_frames(): while True: ok, imagen = obtener_frame_camara() if not ok: break else: yield b"--frame\r\nContent-Type: image/jpeg\r\n\r\n" + imagen + b"\r\n" def obtener_frame_camara(): ok, frame = camara.read() if not ok: return False, None agregar_fecha_hora_frame(frame) if grabando and archivo_video is not None: archivo_video.write(frame) _, bufer = cv2.imencode(".jpg", frame) imagen = bufer.tobytes() return True, imagen @app.route("/streaming_camara") def streaming_camara(): return Response(generador_frames(), mimetype='multipart/x-mixed-replace; boundary=frame') @app.route("/tomar_foto_descargar") def descargar_foto(): ok, frame = obtener_frame_camara() if not ok: abort(500) return respuesta = Response(frame) respuesta.headers["Content-Type"] = "image/jpeg" respuesta.headers["Content-Transfer-Encoding"] = "Binary" respuesta.headers["Content-Disposition"] = "attachment; filename=\"foto.jpg\"" return respuesta @app.route("/tomar_foto_guardar") def guardar_foto(): nombre_foto = utiles.obtener_uuid() + ".jpg" ok, frame = camara.read() if ok: agregar_fecha_hora_frame(frame) cv2.imwrite(nombre_foto, frame) return jsonify({ "ok": ok, "nombre_foto": nombre_foto, }) @app.route('/') def index(): return render_template("index.html") @app.route("/comenzar_grabacion") def comenzar_grabacion(): global grabando global archivo_video if grabando and archivo_video: return jsonify(False) nombre = utiles.fecha_y_hora_para_nombre_archivo() + ".avi" archivo_video = cv2.VideoWriter( nombre, fourcc, FRAMES_VIDEO, RESOLUCION_VIDEO) grabando = True return jsonify(True) @app.route("/detener_grabacion") def detener_grabacion(): global grabando global archivo_video if not grabando or not archivo_video: return jsonify(False) grabando = False archivo_video.release() archivo_video = None return jsonify(True) @app.route("/estado_grabacion") def estado_grabacion(): return jsonify(grabando) if __name__ == "__main__": app.run(debug=True, host="0.0.0.0")

true

1c3023b6c0572515d2d8db0cd59ac6cbd42856ee

728

py

Python

memex-datawake-stream/src/datawakeio/data_connector.py

fritojay/Datawake-Legacy

67fe147ee20a540ebe32d5d7a4fdb97708c0bb2e

[ "Apache-2.0" ]

5

2015-11-11T18:54:21.000Z

2018-03-03T22:25:12.000Z

memex-datawake-stream/src/datawakeio/data_connector.py

fritojay/Datawake-Legacy

67fe147ee20a540ebe32d5d7a4fdb97708c0bb2e

[ "Apache-2.0" ]

null

memex-datawake-stream/src/datawakeio/data_connector.py

fritojay/Datawake-Legacy

67fe147ee20a540ebe32d5d7a4fdb97708c0bb2e

[ "Apache-2.0" ]

3

2015-10-29T10:22:52.000Z

2017-09-01T19:34:21.000Z

class ExtractedDataConnector: def __init__(self): pass def open(self): raise NotImplementedError("Implement open()") def close(self): raise NotImplementedError("Implement close()") def _check_conn(self): raise NotImplementedError("Implement _checkConn()") def insert_entities(self, url, entity_type, entity_values): raise NotImplementedError("Implement insertEntities()") def insert_domain_entities(self, domain,url, entity_type, entity_values): raise NotImplementedError("Implement insertDomainEntities()") def get_domain_entity_matches(self, domain, type, values): raise NotImplementedError("Implement getEntityMatches()")

20.8

77

0.70467

class ExtractedDataConnector: def __init__(self): pass def open(self): raise NotImplementedError("Implement open()") def close(self): raise NotImplementedError("Implement close()") def _check_conn(self): raise NotImplementedError("Implement _checkConn()") def insert_entities(self, url, entity_type, entity_values): raise NotImplementedError("Implement insertEntities()") def insert_domain_entities(self, domain,url, entity_type, entity_values): raise NotImplementedError("Implement insertDomainEntities()") def get_domain_entity_matches(self, domain, type, values): raise NotImplementedError("Implement getEntityMatches()")

true

1c3023eb4b1e14ac3f341041f735ae9f153653cd

20,551

py

Python

v0.5/classification_and_detection/python/main.py

goldgeisser/inference

42c68883f6f60bf6e0d0253c1bb797a285e2d5f2

[ "Apache-2.0" ]

null

v0.5/classification_and_detection/python/main.py

goldgeisser/inference

42c68883f6f60bf6e0d0253c1bb797a285e2d5f2

[ "Apache-2.0" ]

null

v0.5/classification_and_detection/python/main.py

goldgeisser/inference

42c68883f6f60bf6e0d0253c1bb797a285e2d5f2

[ "Apache-2.0" ]

1

2018-11-20T16:59:07.000Z

""" mlperf inference benchmarking tool """ from __future__ import division from __future__ import print_function from __future__ import unicode_literals import argparse import array import collections import json import logging import os import threading import time from queue import Queue import mlperf_loadgen as lg import numpy as np import dataset import imagenet import coco logging.basicConfig(level=logging.INFO) log = logging.getLogger("main") NANO_SEC = 1e9 MILLI_SEC = 1000 # pylint: disable=missing-docstring # the datasets we support SUPPORTED_DATASETS = { "imagenet": (imagenet.Imagenet, dataset.pre_process_vgg, dataset.PostProcessCommon(offset=-1), {"image_size": [224, 224, 3]}), "imagenet_mobilenet": (imagenet.Imagenet, dataset.pre_process_mobilenet, dataset.PostProcessArgMax(offset=-1), {"image_size": [224, 224, 3]}), "coco-300": (coco.Coco, dataset.pre_process_coco_mobilenet, coco.PostProcessCoco(), {"image_size": [300, 300, 3]}), "coco-300-pt": (coco.Coco, dataset.pre_process_coco_pt_mobilenet, coco.PostProcessCocoPt(False,0.3), {"image_size": [300, 300, 3]}), "coco-1200": (coco.Coco, dataset.pre_process_coco_resnet34, coco.PostProcessCoco(), {"image_size": [1200, 1200, 3]}), "coco-1200-onnx": (coco.Coco, dataset.pre_process_coco_resnet34, coco.PostProcessCocoOnnx(), {"image_size": [1200, 1200, 3]}), "coco-1200-pt": (coco.Coco, dataset.pre_process_coco_resnet34, coco.PostProcessCocoPt(True,0.05), {"image_size": [1200, 1200, 3]}), "coco-1200-tf": (coco.Coco, dataset.pre_process_coco_resnet34, coco.PostProcessCocoTf(), {"image_size": [1200, 1200, 3]}), } # pre-defined command line options so simplify things. They are used as defaults and can be # overwritten from command line DEFAULT_LATENCY = "0.100" LATENCY_RESNET50 = "0.015" LATENCY_MOBILENET = "0.010" LATENCY_SSD_MOBILENET = "0.010" # FIXME: change once final value is known LATENCY_SSD_RESNET34 = "0.100" SUPPORTED_PROFILES = { "defaults": { "dataset": "imagenet", "backend": "tensorflow", "cache": 0, "queries-single": 1024, "queries-multi": 24576, "max-latency": DEFAULT_LATENCY, "max-batchsize": 32, }, # resnet "resnet50-tf": { "inputs": "input_tensor:0", "outputs": "ArgMax:0", "dataset": "imagenet", "backend": "tensorflow", "max-latency": LATENCY_RESNET50, }, "resnet50-onnxruntime": { "dataset": "imagenet", "outputs": "ArgMax:0", "backend": "onnxruntime", "max-latency": LATENCY_RESNET50, }, # mobilenet "mobilenet-tf": { "inputs": "input:0", "outputs": "MobilenetV1/Predictions/Reshape_1:0", "dataset": "imagenet_mobilenet", "backend": "tensorflow", "max-latency": LATENCY_MOBILENET, }, "mobilenet-onnxruntime": { "dataset": "imagenet_mobilenet", "outputs": "MobilenetV1/Predictions/Reshape_1:0", "backend": "onnxruntime", "max-latency": LATENCY_MOBILENET, }, # ssd-mobilenet "ssd-mobilenet-tf": { "inputs": "image_tensor:0", "outputs": "num_detections:0,detection_boxes:0,detection_scores:0,detection_classes:0", "dataset": "coco-300", "backend": "tensorflow", "max-latency": LATENCY_SSD_MOBILENET, }, "ssd-mobilenet-pytorch": { "inputs": "image", "outputs": "bboxes,labels,scores", "dataset": "coco-300-pt", "backend": "pytorch-native", "max-latency": LATENCY_SSD_MOBILENET, }, "ssd-mobilenet-onnxruntime": { "dataset": "coco-300", "outputs": "num_detections:0,detection_boxes:0,detection_scores:0,detection_classes:0", "backend": "onnxruntime", "data-format": "NHWC", "max-latency": LATENCY_SSD_MOBILENET, }, # ssd-resnet34 "ssd-resnet34-tf": { "inputs": "image:0", "outputs": "detection_bboxes:0,detection_classes:0,detection_scores:0", "dataset": "coco-1200-tf", "backend": "tensorflow", "data-format": "NCHW", "max-latency": LATENCY_SSD_RESNET34, }, "ssd-resnet34-pytorch": { "inputs": "image", "outputs": "bboxes,labels,scores", "dataset": "coco-1200-pt", "backend": "pytorch-native", "max-latency": LATENCY_SSD_RESNET34, }, "ssd-resnet34-onnxruntime": { "dataset": "coco-1200-onnx", "inputs": "image", "outputs": "bboxes,labels,scores", "backend": "onnxruntime", "data-format": "NCHW", "max-batchsize": 1, "max-latency": LATENCY_SSD_RESNET34, }, "ssd-resnet34-onnxruntime-tf": { "dataset": "coco-1200-tf", "inputs": "image:0", "outputs": "detection_bboxes:0,detection_classes:0,detection_scores:0", "backend": "onnxruntime", "data-format": "NHWC", "max-latency": LATENCY_SSD_RESNET34, }, } SCENARIO_MAP = { "SingleStream": lg.TestScenario.SingleStream, "MultiStream": lg.TestScenario.MultiStream, "Server": lg.TestScenario.Server, "Offline": lg.TestScenario.Offline, } last_timeing = [] def get_args(): """Parse commandline.""" parser = argparse.ArgumentParser() parser.add_argument("--dataset", choices=SUPPORTED_DATASETS.keys(), help="dataset") parser.add_argument("--dataset-path", required=True, help="path to the dataset") parser.add_argument("--dataset-list", help="path to the dataset list") parser.add_argument("--data-format", choices=["NCHW", "NHWC"], help="data format") parser.add_argument("--profile", choices=SUPPORTED_PROFILES.keys(), help="standard profiles") parser.add_argument("--scenario", default="SingleStream", help="mlperf benchmark scenario, list of " + str(list(SCENARIO_MAP.keys()))) parser.add_argument("--queries-single", type=int, default=1024, help="mlperf number of queries for SingleStream") parser.add_argument("--queries-offline", type=int, default=24576, help="mlperf number of queries for Offline") parser.add_argument("--queries-multi", type=int, default=24576, help="mlperf number of queries for MultiStream,Server") parser.add_argument("--max-batchsize", type=int, help="max batch size in a single inference") parser.add_argument("--model", required=True, help="model file") parser.add_argument("--output", help="test results") parser.add_argument("--inputs", help="model inputs") parser.add_argument("--outputs", help="model outputs") parser.add_argument("--backend", help="runtime to use") parser.add_argument("--threads", default=os.cpu_count(), type=int, help="threads") parser.add_argument("--time", type=int, help="time to scan in seconds") parser.add_argument("--count", type=int, help="dataset items to use") parser.add_argument("--qps", type=int, default=10, help="target qps estimate") parser.add_argument("--max-latency", type=str, help="mlperf max latency in 99pct tile") parser.add_argument("--cache", type=int, default=0, help="use cache") parser.add_argument("--accuracy", action="store_true", help="enable accuracy pass") parser.add_argument("--find-peak-performance", action="store_true", help="enable finding peak performance pass") args = parser.parse_args() # don't use defaults in argparser. Instead we default to a dict, override that with a profile # and take this as default unless command line give defaults = SUPPORTED_PROFILES["defaults"] if args.profile: profile = SUPPORTED_PROFILES[args.profile] defaults.update(profile) for k, v in defaults.items(): kc = k.replace("-", "_") if getattr(args, kc) is None: setattr(args, kc, v) if args.inputs: args.inputs = args.inputs.split(",") if args.outputs: args.outputs = args.outputs.split(",") if args.max_latency: args.max_latency = [float(i) for i in args.max_latency.split(",")] try: args.scenario = [SCENARIO_MAP[scenario] for scenario in args.scenario.split(",")] except: parser.error("valid scanarios:" + str(list(SCENARIO_MAP.keys()))) return args def get_backend(backend): if backend == "tensorflow": from backend_tf import BackendTensorflow backend = BackendTensorflow() elif backend == "onnxruntime": from backend_onnxruntime import BackendOnnxruntime backend = BackendOnnxruntime() elif backend == "null": from backend_null import BackendNull backend = BackendNull() elif backend == "pytorch": from backend_pytorch import BackendPytorch backend = BackendPytorch() elif backend == "pytorch-native": from backend_pytorch_native import BackendPytorchNative backend = BackendPytorchNative() elif backend == "tflite": from backend_tflite import BackendTflite backend = BackendTflite() else: raise ValueError("unknown backend: " + backend) return backend class Item: """An item that we queue for processing by the thread pool.""" def __init__(self, query_id, content_id, img, label=None): self.query_id = query_id self.content_id = content_id self.img = img self.label = label self.start = time.time() class RunnerBase: def __init__(self, model, ds, threads, post_proc=None, max_batchsize=128): self.take_accuracy = False self.ds = ds self.model = model self.post_process = post_proc self.threads = threads self.take_accuracy = False self.max_batchsize = max_batchsize self.result_timing = [] def handle_tasks(self, tasks_queue): pass def start_run(self, result_dict, take_accuracy): self.result_dict = result_dict self.result_timing = [] self.take_accuracy = take_accuracy self.post_process.start() def run_one_item(self, qitem): # run the prediction processed_results = [] try: results = self.model.predict({self.model.inputs[0]: qitem.img}) processed_results = self.post_process(results, qitem.content_id, qitem.label, self.result_dict) if self.take_accuracy: self.post_process.add_results(processed_results) self.result_timing.append(time.time() - qitem.start) except Exception as ex: # pylint: disable=broad-except src = [self.ds.get_item_loc(i) for i in qitem.content_id] log.error("thread: failed on contentid=%s, %s", src, ex) # since post_process will not run, fake empty responses processed_results = [[]] * len(qitem.query_id) finally: response_array_refs = [] response = [] for idx, query_id in enumerate(qitem.query_id): response_array = array.array("B", np.array(processed_results[idx], np.float32).tobytes()) response_array_refs.append(response_array) bi = response_array.buffer_info() response.append(lg.QuerySampleResponse(query_id, bi[0], bi[1])) lg.QuerySamplesComplete(response) def enqueue(self, query_samples): idx = [q.index for q in query_samples] query_id = [q.id for q in query_samples] if len(query_samples) < self.max_batchsize: data, label = self.ds.get_samples(idx) self.run_one_item(Item(query_id, idx, data, label)) else: bs = self.max_batchsize for i in range(0, len(idx), bs): data, label = self.ds.get_samples(idx[i:i+bs]) self.run_one_item(Item(query_id[i:i+bs], idx[i:i+bs], data, label)) def finish(self): pass class QueueRunner(RunnerBase): def __init__(self, model, ds, threads, post_proc=None, max_batchsize=128): super().__init__(model, ds, threads, post_proc, max_batchsize) self.tasks = Queue(maxsize=threads * 4) self.workers = [] self.result_dict = {} for _ in range(self.threads): worker = threading.Thread(target=self.handle_tasks, args=(self.tasks,)) worker.daemon = True self.workers.append(worker) worker.start() def handle_tasks(self, tasks_queue): """Worker thread.""" while True: qitem = tasks_queue.get() if qitem is None: # None in the queue indicates the parent want us to exit tasks_queue.task_done() break self.run_one_item(qitem) tasks_queue.task_done() def enqueue(self, query_samples): idx = [q.index for q in query_samples] query_id = [q.id for q in query_samples] if len(query_samples) < self.max_batchsize: data, label = self.ds.get_samples(idx) self.tasks.put(Item(query_id, idx, data, label)) else: bs = self.max_batchsize for i in range(0, len(idx), bs): ie = i + bs data, label = self.ds.get_samples(idx[i:ie]) self.tasks.put(Item(query_id[i:ie], idx[i:ie], data, label)) def finish(self): # exit all threads for _ in self.workers: self.tasks.put(None) for worker in self.workers: worker.join() def add_results(final_results, name, result_dict, result_list, took, show_accuracy=False): percentiles = [50., 80., 90., 95., 99., 99.9] buckets = np.percentile(result_list, percentiles).tolist() buckets_str = ",".join(["{}:{:.4f}".format(p, b) for p, b in zip(percentiles, buckets)]) if result_dict["total"] == 0: result_dict["total"] = len(result_list) # this is what we record for each run result = { "took": took, "mean": np.mean(result_list), "percentiles": {str(k): v for k, v in zip(percentiles, buckets)}, "qps": len(result_list) / took, "count": len(result_list), "good_items": result_dict["good"], "total_items": result_dict["total"], } acc_str = "" if show_accuracy: result["accuracy"] = 100. * result_dict["good"] / result_dict["total"] acc_str = ", acc={:.3f}%".format(result["accuracy"]) if "mAP" in result_dict: result["mAP"] = 100. * result_dict["mAP"] acc_str += ", mAP={:.3f}%".format(result["mAP"]) # add the result to the result dict final_results[name] = result # to stdout print("{} qps={:.2f}, mean={:.4f}, time={:.3f}{}, queries={}, tiles={}".format( name, result["qps"], result["mean"], took, acc_str, len(result_list), buckets_str)) def main(): global last_timeing args = get_args() log.info(args) # find backend backend = get_backend(args.backend) # override image format if given image_format = args.data_format if args.data_format else backend.image_format() # --count applies to accuracy mode only and can be used to limit the number of images # for testing. For perf model we always limit count to 200. count = args.count if not count: if not args.accuracy: count = 200 # dataset to use wanted_dataset, pre_proc, post_proc, kwargs = SUPPORTED_DATASETS[args.dataset] ds = wanted_dataset(data_path=args.dataset_path, image_list=args.dataset_list, name=args.dataset, image_format=image_format, pre_process=pre_proc, use_cache=args.cache, count=count, **kwargs) # load model to backend model = backend.load(args.model, inputs=args.inputs, outputs=args.outputs) final_results = { "runtime": model.name(), "version": model.version(), "time": int(time.time()), "cmdline": str(args), } # # make one pass over the dataset to validate accuracy # count = ds.get_item_count() # warmup ds.load_query_samples([0]) for _ in range(5): img, _ = ds.get_samples([0]) _ = backend.predict({backend.inputs[0]: img}) ds.unload_query_samples(None) for scenario in args.scenario: runner_map = { lg.TestScenario.SingleStream: RunnerBase, lg.TestScenario.MultiStream: QueueRunner, lg.TestScenario.Server: QueueRunner, lg.TestScenario.Offline: QueueRunner } runner = runner_map[scenario](model, ds, args.threads, post_proc=post_proc, max_batchsize=args.max_batchsize) def issue_queries(query_samples): runner.enqueue(query_samples) def flush_queries(): pass def process_latencies(latencies_ns): # called by loadgen to show us the recorded latencies global last_timeing last_timeing = [t / NANO_SEC for t in latencies_ns] settings = lg.TestSettings() settings.scenario = scenario settings.mode = lg.TestMode.PerformanceOnly if args.accuracy: settings.mode = lg.TestMode.AccuracyOnly if args.find_peak_performance: settings.mode = lg.TestMode.FindPeakPerformance if args.time: # override the time we want to run settings.min_duration_ms = args.time * MILLI_SEC settings.max_duration_ms = args.time * MILLI_SEC if args.qps: qps = float(args.qps) settings.server_target_qps = qps settings.offline_expected_qps = qps if scenario == lg.TestScenario.SingleStream: settings.min_query_count = args.queries_single settings.max_query_count = args.queries_single elif scenario == lg.TestScenario.MultiStream: settings.min_query_count = args.queries_multi settings.max_query_count = args.queries_multi settings.multi_stream_samples_per_query = 4 elif scenario == lg.TestScenario.Server: max_latency = args.max_latency elif scenario == lg.TestScenario.Offline: settings.min_query_count = args.queries_offline settings.max_query_count = args.queries_offline sut = lg.ConstructSUT(issue_queries, flush_queries, process_latencies) qsl = lg.ConstructQSL(count, min(count, 1000), ds.load_query_samples, ds.unload_query_samples) if scenario == lg.TestScenario.Server: for target_latency in max_latency: log.info("starting {}, latency={}".format(scenario, target_latency)) settings.server_target_latency_ns = int(target_latency * NANO_SEC) result_dict = {"good": 0, "total": 0, "scenario": str(scenario)} runner.start_run(result_dict, args.accuracy) lg.StartTest(sut, qsl, settings) if not last_timeing: last_timeing = runner.result_timing if args.accuracy: post_proc.finalize(result_dict, ds, output_dir=os.path.dirname(args.output)) add_results(final_results, "{}-{}".format(scenario, target_latency), result_dict, last_timeing, time.time() - ds.last_loaded, args.accuracy) else: log.info("starting {}".format(scenario)) result_dict = {"good": 0, "total": 0, "scenario": str(scenario)} runner.start_run(result_dict, args.accuracy) lg.StartTest(sut, qsl, settings) if not last_timeing: last_timeing = runner.result_timing if args.accuracy: post_proc.finalize(result_dict, ds, output_dir=os.path.dirname(args.output)) add_results(final_results, "{}".format(scenario), result_dict, last_timeing, time.time() - ds.last_loaded, args.accuracy) runner.finish() lg.DestroyQSL(qsl) lg.DestroySUT(sut) # # write final results # if args.output: with open(args.output, "w") as f: json.dump(final_results, f, sort_keys=True, indent=4) if __name__ == "__main__": main()

36.895871

117

0.618753

from __future__ import division from __future__ import print_function from __future__ import unicode_literals import argparse import array import collections import json import logging import os import threading import time from queue import Queue import mlperf_loadgen as lg import numpy as np import dataset import imagenet import coco logging.basicConfig(level=logging.INFO) log = logging.getLogger("main") NANO_SEC = 1e9 MILLI_SEC = 1000 SUPPORTED_DATASETS = { "imagenet": (imagenet.Imagenet, dataset.pre_process_vgg, dataset.PostProcessCommon(offset=-1), {"image_size": [224, 224, 3]}), "imagenet_mobilenet": (imagenet.Imagenet, dataset.pre_process_mobilenet, dataset.PostProcessArgMax(offset=-1), {"image_size": [224, 224, 3]}), "coco-300": (coco.Coco, dataset.pre_process_coco_mobilenet, coco.PostProcessCoco(), {"image_size": [300, 300, 3]}), "coco-300-pt": (coco.Coco, dataset.pre_process_coco_pt_mobilenet, coco.PostProcessCocoPt(False,0.3), {"image_size": [300, 300, 3]}), "coco-1200": (coco.Coco, dataset.pre_process_coco_resnet34, coco.PostProcessCoco(), {"image_size": [1200, 1200, 3]}), "coco-1200-onnx": (coco.Coco, dataset.pre_process_coco_resnet34, coco.PostProcessCocoOnnx(), {"image_size": [1200, 1200, 3]}), "coco-1200-pt": (coco.Coco, dataset.pre_process_coco_resnet34, coco.PostProcessCocoPt(True,0.05), {"image_size": [1200, 1200, 3]}), "coco-1200-tf": (coco.Coco, dataset.pre_process_coco_resnet34, coco.PostProcessCocoTf(), {"image_size": [1200, 1200, 3]}), } DEFAULT_LATENCY = "0.100" LATENCY_RESNET50 = "0.015" LATENCY_MOBILENET = "0.010" LATENCY_SSD_MOBILENET = "0.010" LATENCY_SSD_RESNET34 = "0.100" SUPPORTED_PROFILES = { "defaults": { "dataset": "imagenet", "backend": "tensorflow", "cache": 0, "queries-single": 1024, "queries-multi": 24576, "max-latency": DEFAULT_LATENCY, "max-batchsize": 32, }, "resnet50-tf": { "inputs": "input_tensor:0", "outputs": "ArgMax:0", "dataset": "imagenet", "backend": "tensorflow", "max-latency": LATENCY_RESNET50, }, "resnet50-onnxruntime": { "dataset": "imagenet", "outputs": "ArgMax:0", "backend": "onnxruntime", "max-latency": LATENCY_RESNET50, }, "mobilenet-tf": { "inputs": "input:0", "outputs": "MobilenetV1/Predictions/Reshape_1:0", "dataset": "imagenet_mobilenet", "backend": "tensorflow", "max-latency": LATENCY_MOBILENET, }, "mobilenet-onnxruntime": { "dataset": "imagenet_mobilenet", "outputs": "MobilenetV1/Predictions/Reshape_1:0", "backend": "onnxruntime", "max-latency": LATENCY_MOBILENET, }, "ssd-mobilenet-tf": { "inputs": "image_tensor:0", "outputs": "num_detections:0,detection_boxes:0,detection_scores:0,detection_classes:0", "dataset": "coco-300", "backend": "tensorflow", "max-latency": LATENCY_SSD_MOBILENET, }, "ssd-mobilenet-pytorch": { "inputs": "image", "outputs": "bboxes,labels,scores", "dataset": "coco-300-pt", "backend": "pytorch-native", "max-latency": LATENCY_SSD_MOBILENET, }, "ssd-mobilenet-onnxruntime": { "dataset": "coco-300", "outputs": "num_detections:0,detection_boxes:0,detection_scores:0,detection_classes:0", "backend": "onnxruntime", "data-format": "NHWC", "max-latency": LATENCY_SSD_MOBILENET, }, "ssd-resnet34-tf": { "inputs": "image:0", "outputs": "detection_bboxes:0,detection_classes:0,detection_scores:0", "dataset": "coco-1200-tf", "backend": "tensorflow", "data-format": "NCHW", "max-latency": LATENCY_SSD_RESNET34, }, "ssd-resnet34-pytorch": { "inputs": "image", "outputs": "bboxes,labels,scores", "dataset": "coco-1200-pt", "backend": "pytorch-native", "max-latency": LATENCY_SSD_RESNET34, }, "ssd-resnet34-onnxruntime": { "dataset": "coco-1200-onnx", "inputs": "image", "outputs": "bboxes,labels,scores", "backend": "onnxruntime", "data-format": "NCHW", "max-batchsize": 1, "max-latency": LATENCY_SSD_RESNET34, }, "ssd-resnet34-onnxruntime-tf": { "dataset": "coco-1200-tf", "inputs": "image:0", "outputs": "detection_bboxes:0,detection_classes:0,detection_scores:0", "backend": "onnxruntime", "data-format": "NHWC", "max-latency": LATENCY_SSD_RESNET34, }, } SCENARIO_MAP = { "SingleStream": lg.TestScenario.SingleStream, "MultiStream": lg.TestScenario.MultiStream, "Server": lg.TestScenario.Server, "Offline": lg.TestScenario.Offline, } last_timeing = [] def get_args(): parser = argparse.ArgumentParser() parser.add_argument("--dataset", choices=SUPPORTED_DATASETS.keys(), help="dataset") parser.add_argument("--dataset-path", required=True, help="path to the dataset") parser.add_argument("--dataset-list", help="path to the dataset list") parser.add_argument("--data-format", choices=["NCHW", "NHWC"], help="data format") parser.add_argument("--profile", choices=SUPPORTED_PROFILES.keys(), help="standard profiles") parser.add_argument("--scenario", default="SingleStream", help="mlperf benchmark scenario, list of " + str(list(SCENARIO_MAP.keys()))) parser.add_argument("--queries-single", type=int, default=1024, help="mlperf number of queries for SingleStream") parser.add_argument("--queries-offline", type=int, default=24576, help="mlperf number of queries for Offline") parser.add_argument("--queries-multi", type=int, default=24576, help="mlperf number of queries for MultiStream,Server") parser.add_argument("--max-batchsize", type=int, help="max batch size in a single inference") parser.add_argument("--model", required=True, help="model file") parser.add_argument("--output", help="test results") parser.add_argument("--inputs", help="model inputs") parser.add_argument("--outputs", help="model outputs") parser.add_argument("--backend", help="runtime to use") parser.add_argument("--threads", default=os.cpu_count(), type=int, help="threads") parser.add_argument("--time", type=int, help="time to scan in seconds") parser.add_argument("--count", type=int, help="dataset items to use") parser.add_argument("--qps", type=int, default=10, help="target qps estimate") parser.add_argument("--max-latency", type=str, help="mlperf max latency in 99pct tile") parser.add_argument("--cache", type=int, default=0, help="use cache") parser.add_argument("--accuracy", action="store_true", help="enable accuracy pass") parser.add_argument("--find-peak-performance", action="store_true", help="enable finding peak performance pass") args = parser.parse_args() # and take this as default unless command line give defaults = SUPPORTED_PROFILES["defaults"] if args.profile: profile = SUPPORTED_PROFILES[args.profile] defaults.update(profile) for k, v in defaults.items(): kc = k.replace("-", "_") if getattr(args, kc) is None: setattr(args, kc, v) if args.inputs: args.inputs = args.inputs.split(",") if args.outputs: args.outputs = args.outputs.split(",") if args.max_latency: args.max_latency = [float(i) for i in args.max_latency.split(",")] try: args.scenario = [SCENARIO_MAP[scenario] for scenario in args.scenario.split(",")] except: parser.error("valid scanarios:" + str(list(SCENARIO_MAP.keys()))) return args def get_backend(backend): if backend == "tensorflow": from backend_tf import BackendTensorflow backend = BackendTensorflow() elif backend == "onnxruntime": from backend_onnxruntime import BackendOnnxruntime backend = BackendOnnxruntime() elif backend == "null": from backend_null import BackendNull backend = BackendNull() elif backend == "pytorch": from backend_pytorch import BackendPytorch backend = BackendPytorch() elif backend == "pytorch-native": from backend_pytorch_native import BackendPytorchNative backend = BackendPytorchNative() elif backend == "tflite": from backend_tflite import BackendTflite backend = BackendTflite() else: raise ValueError("unknown backend: " + backend) return backend class Item: def __init__(self, query_id, content_id, img, label=None): self.query_id = query_id self.content_id = content_id self.img = img self.label = label self.start = time.time() class RunnerBase: def __init__(self, model, ds, threads, post_proc=None, max_batchsize=128): self.take_accuracy = False self.ds = ds self.model = model self.post_process = post_proc self.threads = threads self.take_accuracy = False self.max_batchsize = max_batchsize self.result_timing = [] def handle_tasks(self, tasks_queue): pass def start_run(self, result_dict, take_accuracy): self.result_dict = result_dict self.result_timing = [] self.take_accuracy = take_accuracy self.post_process.start() def run_one_item(self, qitem): # run the prediction processed_results = [] try: results = self.model.predict({self.model.inputs[0]: qitem.img}) processed_results = self.post_process(results, qitem.content_id, qitem.label, self.result_dict) if self.take_accuracy: self.post_process.add_results(processed_results) self.result_timing.append(time.time() - qitem.start) except Exception as ex: # pylint: disable=broad-except src = [self.ds.get_item_loc(i) for i in qitem.content_id] log.error("thread: failed on contentid=%s, %s", src, ex) # since post_process will not run, fake empty responses processed_results = [[]] * len(qitem.query_id) finally: response_array_refs = [] response = [] for idx, query_id in enumerate(qitem.query_id): response_array = array.array("B", np.array(processed_results[idx], np.float32).tobytes()) response_array_refs.append(response_array) bi = response_array.buffer_info() response.append(lg.QuerySampleResponse(query_id, bi[0], bi[1])) lg.QuerySamplesComplete(response) def enqueue(self, query_samples): idx = [q.index for q in query_samples] query_id = [q.id for q in query_samples] if len(query_samples) < self.max_batchsize: data, label = self.ds.get_samples(idx) self.run_one_item(Item(query_id, idx, data, label)) else: bs = self.max_batchsize for i in range(0, len(idx), bs): data, label = self.ds.get_samples(idx[i:i+bs]) self.run_one_item(Item(query_id[i:i+bs], idx[i:i+bs], data, label)) def finish(self): pass class QueueRunner(RunnerBase): def __init__(self, model, ds, threads, post_proc=None, max_batchsize=128): super().__init__(model, ds, threads, post_proc, max_batchsize) self.tasks = Queue(maxsize=threads * 4) self.workers = [] self.result_dict = {} for _ in range(self.threads): worker = threading.Thread(target=self.handle_tasks, args=(self.tasks,)) worker.daemon = True self.workers.append(worker) worker.start() def handle_tasks(self, tasks_queue): while True: qitem = tasks_queue.get() if qitem is None: # None in the queue indicates the parent want us to exit tasks_queue.task_done() break self.run_one_item(qitem) tasks_queue.task_done() def enqueue(self, query_samples): idx = [q.index for q in query_samples] query_id = [q.id for q in query_samples] if len(query_samples) < self.max_batchsize: data, label = self.ds.get_samples(idx) self.tasks.put(Item(query_id, idx, data, label)) else: bs = self.max_batchsize for i in range(0, len(idx), bs): ie = i + bs data, label = self.ds.get_samples(idx[i:ie]) self.tasks.put(Item(query_id[i:ie], idx[i:ie], data, label)) def finish(self): # exit all threads for _ in self.workers: self.tasks.put(None) for worker in self.workers: worker.join() def add_results(final_results, name, result_dict, result_list, took, show_accuracy=False): percentiles = [50., 80., 90., 95., 99., 99.9] buckets = np.percentile(result_list, percentiles).tolist() buckets_str = ",".join(["{}:{:.4f}".format(p, b) for p, b in zip(percentiles, buckets)]) if result_dict["total"] == 0: result_dict["total"] = len(result_list) # this is what we record for each run result = { "took": took, "mean": np.mean(result_list), "percentiles": {str(k): v for k, v in zip(percentiles, buckets)}, "qps": len(result_list) / took, "count": len(result_list), "good_items": result_dict["good"], "total_items": result_dict["total"], } acc_str = "" if show_accuracy: result["accuracy"] = 100. * result_dict["good"] / result_dict["total"] acc_str = ", acc={:.3f}%".format(result["accuracy"]) if "mAP" in result_dict: result["mAP"] = 100. * result_dict["mAP"] acc_str += ", mAP={:.3f}%".format(result["mAP"]) # add the result to the result dict final_results[name] = result # to stdout print("{} qps={:.2f}, mean={:.4f}, time={:.3f}{}, queries={}, tiles={}".format( name, result["qps"], result["mean"], took, acc_str, len(result_list), buckets_str)) def main(): global last_timeing args = get_args() log.info(args) # find backend backend = get_backend(args.backend) # override image format if given image_format = args.data_format if args.data_format else backend.image_format() # --count applies to accuracy mode only and can be used to limit the number of images # for testing. For perf model we always limit count to 200. count = args.count if not count: if not args.accuracy: count = 200 # dataset to use wanted_dataset, pre_proc, post_proc, kwargs = SUPPORTED_DATASETS[args.dataset] ds = wanted_dataset(data_path=args.dataset_path, image_list=args.dataset_list, name=args.dataset, image_format=image_format, pre_process=pre_proc, use_cache=args.cache, count=count, **kwargs) # load model to backend model = backend.load(args.model, inputs=args.inputs, outputs=args.outputs) final_results = { "runtime": model.name(), "version": model.version(), "time": int(time.time()), "cmdline": str(args), } # # make one pass over the dataset to validate accuracy # count = ds.get_item_count() # warmup ds.load_query_samples([0]) for _ in range(5): img, _ = ds.get_samples([0]) _ = backend.predict({backend.inputs[0]: img}) ds.unload_query_samples(None) for scenario in args.scenario: runner_map = { lg.TestScenario.SingleStream: RunnerBase, lg.TestScenario.MultiStream: QueueRunner, lg.TestScenario.Server: QueueRunner, lg.TestScenario.Offline: QueueRunner } runner = runner_map[scenario](model, ds, args.threads, post_proc=post_proc, max_batchsize=args.max_batchsize) def issue_queries(query_samples): runner.enqueue(query_samples) def flush_queries(): pass def process_latencies(latencies_ns): # called by loadgen to show us the recorded latencies global last_timeing last_timeing = [t / NANO_SEC for t in latencies_ns] settings = lg.TestSettings() settings.scenario = scenario settings.mode = lg.TestMode.PerformanceOnly if args.accuracy: settings.mode = lg.TestMode.AccuracyOnly if args.find_peak_performance: settings.mode = lg.TestMode.FindPeakPerformance if args.time: # override the time we want to run settings.min_duration_ms = args.time * MILLI_SEC settings.max_duration_ms = args.time * MILLI_SEC if args.qps: qps = float(args.qps) settings.server_target_qps = qps settings.offline_expected_qps = qps if scenario == lg.TestScenario.SingleStream: settings.min_query_count = args.queries_single settings.max_query_count = args.queries_single elif scenario == lg.TestScenario.MultiStream: settings.min_query_count = args.queries_multi settings.max_query_count = args.queries_multi settings.multi_stream_samples_per_query = 4 elif scenario == lg.TestScenario.Server: max_latency = args.max_latency elif scenario == lg.TestScenario.Offline: settings.min_query_count = args.queries_offline settings.max_query_count = args.queries_offline sut = lg.ConstructSUT(issue_queries, flush_queries, process_latencies) qsl = lg.ConstructQSL(count, min(count, 1000), ds.load_query_samples, ds.unload_query_samples) if scenario == lg.TestScenario.Server: for target_latency in max_latency: log.info("starting {}, latency={}".format(scenario, target_latency)) settings.server_target_latency_ns = int(target_latency * NANO_SEC) result_dict = {"good": 0, "total": 0, "scenario": str(scenario)} runner.start_run(result_dict, args.accuracy) lg.StartTest(sut, qsl, settings) if not last_timeing: last_timeing = runner.result_timing if args.accuracy: post_proc.finalize(result_dict, ds, output_dir=os.path.dirname(args.output)) add_results(final_results, "{}-{}".format(scenario, target_latency), result_dict, last_timeing, time.time() - ds.last_loaded, args.accuracy) else: log.info("starting {}".format(scenario)) result_dict = {"good": 0, "total": 0, "scenario": str(scenario)} runner.start_run(result_dict, args.accuracy) lg.StartTest(sut, qsl, settings) if not last_timeing: last_timeing = runner.result_timing if args.accuracy: post_proc.finalize(result_dict, ds, output_dir=os.path.dirname(args.output)) add_results(final_results, "{}".format(scenario), result_dict, last_timeing, time.time() - ds.last_loaded, args.accuracy) runner.finish() lg.DestroyQSL(qsl) lg.DestroySUT(sut) # # write final results # if args.output: with open(args.output, "w") as f: json.dump(final_results, f, sort_keys=True, indent=4) if __name__ == "__main__": main()

true

1c302425028a7aa9aebab9f105a5f7dcc50bb75b

65

py

Python

hobo/__main__.py

mikewaters/hobo

d3a5376b55a99096488f3f2ad8e42b533de73114

[ "MIT" ]

null

hobo/__main__.py

mikewaters/hobo

d3a5376b55a99096488f3f2ad8e42b533de73114

[ "MIT" ]

4

2015-05-07T14:06:44.000Z

2015-05-08T17:03:27.000Z

hobo/__main__.py

mikewaters/hobo

d3a5376b55a99096488f3f2ad8e42b533de73114

[ "MIT" ]

null

import sys from hobo.cli import main sys.exit(0 if main() else 1)

21.666667

28

0.753846

import sys from hobo.cli import main sys.exit(0 if main() else 1)

true

1c302609075c3022a8f0051bb2399c8416c54fdc

7,961

py

Python

FClip/postprocess.py

Delay-Xili/F-Clip

ea5a7b2ddba8f4baf57e62962b479d8f0447bd65

[ "MIT" ]

93

2021-04-22T03:20:27.000Z

2022-03-27T02:21:49.000Z

FClip/postprocess.py

Delay-Xili/F-Clip

ea5a7b2ddba8f4baf57e62962b479d8f0447bd65

[ "MIT" ]

10

2021-04-23T09:30:37.000Z

2022-02-28T10:24:41.000Z

FClip/postprocess.py

Delay-Xili/F-Clip

ea5a7b2ddba8f4baf57e62962b479d8f0447bd65

[ "MIT" ]

9

2021-04-22T05:21:26.000Z

2022-03-17T07:57:45.000Z

import numpy as np import torch def pline(x1, y1, x2, y2, x, y): """the L2 distance from n(x,y) to line n1 n2""" px = x2 - x1 py = y2 - y1 dd = px * px + py * py u = ((x - x1) * px + (y - y1) * py) / max(1e-9, float(dd)) dx = x1 + u * px - x dy = y1 + u * py - y return dx * dx + dy * dy def psegment(x1, y1, x2, y2, x, y): px = x2 - x1 py = y2 - y1 dd = px * px + py * py u = max(min(((x - x1) * px + (y - y1) * py) / float(dd), 1), 0) dx = x1 + u * px - x dy = y1 + u * py - y return dx * dx + dy * dy def plambda(x1, y1, x2, y2, x, y): """ project the n(x,y) on line n1(x1, y1), n2(x2, y2), the plambda will return the ratio of line (n n1) for line (n1, n2) :return: """ px = x2 - x1 py = y2 - y1 dd = px * px + py * py return ((x - x1) * px + (y - y1) * py) / max(1e-9, float(dd)) def postprocess(lines, scores, threshold=0.01, tol=1e9, do_clip=False): nlines, nscores = [], [] for (p, q), score in zip(lines, scores): start, end = 0, 1 for a, b in nlines: if ( min( max(pline(*p, *q, *a), pline(*p, *q, *b)), max(pline(*a, *b, *p), pline(*a, *b, *q)), ) > threshold ** 2 ): continue lambda_a = plambda(*p, *q, *a) lambda_b = plambda(*p, *q, *b) if lambda_a > lambda_b: lambda_a, lambda_b = lambda_b, lambda_a lambda_a -= tol lambda_b += tol # case 1: skip (if not do_clip) # current line cover the existent line which has higher score. if start < lambda_a and lambda_b < end: # start = 10 # drop continue # not intersect # no overlap if lambda_b < start or lambda_a > end: continue # cover # the current line be covered by line with higher score if lambda_a <= start and end <= lambda_b: start = 10 # drop break # case 2 & 3: if lambda_a <= start and start <= lambda_b: start = lambda_b if lambda_a <= end and end <= lambda_b: end = lambda_a if start >= end: break if start >= end: continue nlines.append(np.array([p + (q - p) * start, p + (q - p) * end])) nscores.append(score) return np.array(nlines), np.array(nscores) def acc_postprocess(gtlines, lines, scores, threshold=1, is_cover=True, is_becover=True, overlap_fraction=0): lines1 = gtlines.copy() lines2 = lines.copy() def get_u_line(_lines, points): """N lines to M points u score and l2 distance""" p = _lines[:, 1] - _lines[:, 0] # (N, 2) dd = np.sum(p ** 2, -1) # (N,) pv1 = points[:, None] - _lines[:, 0][None] # (M, N, 2) inner_u = np.sum(pv1 * p[None], -1) # (M, N) u = inner_u / np.clip(dd[None], 1e-9, 1e9) # (M, N) v1p = - points[:, None] + _lines[:, 0][None] # (M, N, 2) d = v1p + u[:, :, None] * p[None] # (M, N ,2) pline = np.sum(d ** 2, -1) # (M, N) return u.transpose(), pline.transpose() # (N, M) lambda_a12, pqa12 = get_u_line(lines1, lines2[:, 0]) lambda_b12, pqb12 = get_u_line(lines1, lines2[:, 1]) dis12 = np.concatenate([pqa12[:, :, None], pqb12[:, :, None]], -1) dist12 = np.amax(dis12, -1) lambda_a21, pqa21 = get_u_line(lines2, lines1[:, 0]) lambda_b21, pqb21 = get_u_line(lines2, lines1[:, 1]) dis21 = np.concatenate([pqa21[:, :, None], pqb21[:, :, None]], -1) dist21 = np.amax(dis21, -1) distmin = np.concatenate([dist12[:, :, None], np.transpose(dist21)[:, :, None]], -1) distm = np.amin(distmin, -1) mask = distm < threshold if (lines1 == lines2).all(): diag = np.eye(len(mask)).astype(np.bool) mask[diag] = False k = 0 hit = np.zeros((len(mask),)).astype(np.bool) lambda_a = lambda_a12 # each row means all u for one line lambda_b = lambda_b12 while k < len(mask) - 2: if hit[k]: k += 1 continue else: cline = mask[k, k+1:] cline_ab = np.concatenate([lambda_a[k, k+1:][None], lambda_b[k, k+1:][None]], 0) cline_a = np.amin(cline_ab, 0) cline_b = np.amax(cline_ab, 0) cover = (cline_a > 0) & (cline_b < 1) be_covered = (cline_a < 0) & (cline_b > 1) overlap1 = (cline_a < 0) & (cline_b > overlap_fraction) overlap2 = (cline_a < 1 - overlap_fraction) & (cline_b > 1) overlap = overlap1 | overlap2 if is_cover: remove = cover # cover | be_covered else: remove = np.zeros_like(cover).astype(np.bool) if is_becover: remove = remove | be_covered if overlap_fraction > 0: remove = remove | overlap hit[k+1:] = hit[k+1:] | (cline & remove) k += 1 drop = ~hit return lines[drop], scores[drop] def acc_postprocess_torch(gtlines, lines, scores, threshold=1, is_cover=True, is_becover=True, overlap_fraction=0): lines1 = gtlines.clone() lines2 = lines.clone() def get_u_line(_lines, points): """N lines to M points u score and l2 distance""" p = _lines[:, 1] - _lines[:, 0] # (N, 2) dd = (p ** 2).sum(-1) # (N,) pv1 = points[:, None] - _lines[:, 0][None] # (M, N, 2) inner_u = torch.sum(pv1 * p[None], -1) # (M, N) u = inner_u / dd[None].clamp(1e-9, 1e9) # (M, N) v1p = - points[:, None] + _lines[:, 0][None] # (M, N, 2) d = v1p + u[:, :, None] * p[None] # (M, N ,2) pline = (d ** 2).sum(-1) # (M, N) return u.transpose(0, 1), pline.transpose(0, 1) # (N, M) lambda_a12, pqa12 = get_u_line(lines1, lines2[:, 0]) lambda_b12, pqb12 = get_u_line(lines1, lines2[:, 1]) dis12 = torch.cat([pqa12[:, :, None], pqb12[:, :, None]], -1) dist12, _ = torch.max(dis12, -1) lambda_a21, pqa21 = get_u_line(lines2, lines1[:, 0]) lambda_b21, pqb21 = get_u_line(lines2, lines1[:, 1]) dis21 = torch.cat([pqa21[:, :, None], pqb21[:, :, None]], -1) dist21, _ = torch.max(dis21, -1) distmin = torch.cat([dist12[:, :, None], dist21.transpose(0, 1)[:, :, None]], -1) distm, _ = torch.min(distmin, -1) mask = distm < threshold if (lines1 == lines2).all(): diag = torch.eye(len(mask)).bool() # diag = np.eye(len(mask)).astype(np.bool) mask[diag] = False k = 0 hit = torch.zeros((len(mask),), device=mask.device).bool() lambda_a = lambda_a12 # each row means all u for one line lambda_b = lambda_b12 while k < len(mask) - 2: if hit[k]: k += 1 continue else: cline = mask[k, k+1:] cline_ab = torch.cat([lambda_a[k, k+1:][None], lambda_b[k, k+1:][None]], 0) cline_a, _ = torch.min(cline_ab, 0) cline_b, _ = torch.max(cline_ab, 0) cover = (cline_a > 0) & (cline_b < 1) be_covered = (cline_a < 0) & (cline_b > 1) overlap1 = (cline_a < 0) & (cline_b > overlap_fraction) overlap2 = (cline_a < 1 - overlap_fraction) & (cline_b > 1) overlap = overlap1 | overlap2 if is_cover: remove = cover # cover | be_covered else: remove = torch.zeros_like(cover).bool() if is_becover: remove = remove | be_covered if overlap_fraction > 0: remove = remove | overlap hit[k+1:] = hit[k+1:] | (cline & remove) k += 1 drop = ~hit return lines[drop], scores[drop]

32.361789

115

0.495415

import numpy as np import torch def pline(x1, y1, x2, y2, x, y): px = x2 - x1 py = y2 - y1 dd = px * px + py * py u = ((x - x1) * px + (y - y1) * py) / max(1e-9, float(dd)) dx = x1 + u * px - x dy = y1 + u * py - y return dx * dx + dy * dy def psegment(x1, y1, x2, y2, x, y): px = x2 - x1 py = y2 - y1 dd = px * px + py * py u = max(min(((x - x1) * px + (y - y1) * py) / float(dd), 1), 0) dx = x1 + u * px - x dy = y1 + u * py - y return dx * dx + dy * dy def plambda(x1, y1, x2, y2, x, y): px = x2 - x1 py = y2 - y1 dd = px * px + py * py return ((x - x1) * px + (y - y1) * py) / max(1e-9, float(dd)) def postprocess(lines, scores, threshold=0.01, tol=1e9, do_clip=False): nlines, nscores = [], [] for (p, q), score in zip(lines, scores): start, end = 0, 1 for a, b in nlines: if ( min( max(pline(*p, *q, *a), pline(*p, *q, *b)), max(pline(*a, *b, *p), pline(*a, *b, *q)), ) > threshold ** 2 ): continue lambda_a = plambda(*p, *q, *a) lambda_b = plambda(*p, *q, *b) if lambda_a > lambda_b: lambda_a, lambda_b = lambda_b, lambda_a lambda_a -= tol lambda_b += tol if start < lambda_a and lambda_b < end: continue if lambda_b < start or lambda_a > end: continue if lambda_a <= start and end <= lambda_b: start = 10 break if lambda_a <= start and start <= lambda_b: start = lambda_b if lambda_a <= end and end <= lambda_b: end = lambda_a if start >= end: break if start >= end: continue nlines.append(np.array([p + (q - p) * start, p + (q - p) * end])) nscores.append(score) return np.array(nlines), np.array(nscores) def acc_postprocess(gtlines, lines, scores, threshold=1, is_cover=True, is_becover=True, overlap_fraction=0): lines1 = gtlines.copy() lines2 = lines.copy() def get_u_line(_lines, points): p = _lines[:, 1] - _lines[:, 0] dd = np.sum(p ** 2, -1) pv1 = points[:, None] - _lines[:, 0][None] inner_u = np.sum(pv1 * p[None], -1) u = inner_u / np.clip(dd[None], 1e-9, 1e9) v1p = - points[:, None] + _lines[:, 0][None] d = v1p + u[:, :, None] * p[None] pline = np.sum(d ** 2, -1) return u.transpose(), pline.transpose() lambda_a12, pqa12 = get_u_line(lines1, lines2[:, 0]) lambda_b12, pqb12 = get_u_line(lines1, lines2[:, 1]) dis12 = np.concatenate([pqa12[:, :, None], pqb12[:, :, None]], -1) dist12 = np.amax(dis12, -1) lambda_a21, pqa21 = get_u_line(lines2, lines1[:, 0]) lambda_b21, pqb21 = get_u_line(lines2, lines1[:, 1]) dis21 = np.concatenate([pqa21[:, :, None], pqb21[:, :, None]], -1) dist21 = np.amax(dis21, -1) distmin = np.concatenate([dist12[:, :, None], np.transpose(dist21)[:, :, None]], -1) distm = np.amin(distmin, -1) mask = distm < threshold if (lines1 == lines2).all(): diag = np.eye(len(mask)).astype(np.bool) mask[diag] = False k = 0 hit = np.zeros((len(mask),)).astype(np.bool) lambda_a = lambda_a12 lambda_b = lambda_b12 while k < len(mask) - 2: if hit[k]: k += 1 continue else: cline = mask[k, k+1:] cline_ab = np.concatenate([lambda_a[k, k+1:][None], lambda_b[k, k+1:][None]], 0) cline_a = np.amin(cline_ab, 0) cline_b = np.amax(cline_ab, 0) cover = (cline_a > 0) & (cline_b < 1) be_covered = (cline_a < 0) & (cline_b > 1) overlap1 = (cline_a < 0) & (cline_b > overlap_fraction) overlap2 = (cline_a < 1 - overlap_fraction) & (cline_b > 1) overlap = overlap1 | overlap2 if is_cover: remove = cover else: remove = np.zeros_like(cover).astype(np.bool) if is_becover: remove = remove | be_covered if overlap_fraction > 0: remove = remove | overlap hit[k+1:] = hit[k+1:] | (cline & remove) k += 1 drop = ~hit return lines[drop], scores[drop] def acc_postprocess_torch(gtlines, lines, scores, threshold=1, is_cover=True, is_becover=True, overlap_fraction=0): lines1 = gtlines.clone() lines2 = lines.clone() def get_u_line(_lines, points): p = _lines[:, 1] - _lines[:, 0] dd = (p ** 2).sum(-1) pv1 = points[:, None] - _lines[:, 0][None] inner_u = torch.sum(pv1 * p[None], -1) u = inner_u / dd[None].clamp(1e-9, 1e9) v1p = - points[:, None] + _lines[:, 0][None] d = v1p + u[:, :, None] * p[None] pline = (d ** 2).sum(-1) return u.transpose(0, 1), pline.transpose(0, 1) lambda_a12, pqa12 = get_u_line(lines1, lines2[:, 0]) lambda_b12, pqb12 = get_u_line(lines1, lines2[:, 1]) dis12 = torch.cat([pqa12[:, :, None], pqb12[:, :, None]], -1) dist12, _ = torch.max(dis12, -1) lambda_a21, pqa21 = get_u_line(lines2, lines1[:, 0]) lambda_b21, pqb21 = get_u_line(lines2, lines1[:, 1]) dis21 = torch.cat([pqa21[:, :, None], pqb21[:, :, None]], -1) dist21, _ = torch.max(dis21, -1) distmin = torch.cat([dist12[:, :, None], dist21.transpose(0, 1)[:, :, None]], -1) distm, _ = torch.min(distmin, -1) mask = distm < threshold if (lines1 == lines2).all(): diag = torch.eye(len(mask)).bool() mask[diag] = False k = 0 hit = torch.zeros((len(mask),), device=mask.device).bool() lambda_a = lambda_a12 lambda_b = lambda_b12 while k < len(mask) - 2: if hit[k]: k += 1 continue else: cline = mask[k, k+1:] cline_ab = torch.cat([lambda_a[k, k+1:][None], lambda_b[k, k+1:][None]], 0) cline_a, _ = torch.min(cline_ab, 0) cline_b, _ = torch.max(cline_ab, 0) cover = (cline_a > 0) & (cline_b < 1) be_covered = (cline_a < 0) & (cline_b > 1) overlap1 = (cline_a < 0) & (cline_b > overlap_fraction) overlap2 = (cline_a < 1 - overlap_fraction) & (cline_b > 1) overlap = overlap1 | overlap2 if is_cover: remove = cover else: remove = torch.zeros_like(cover).bool() if is_becover: remove = remove | be_covered if overlap_fraction > 0: remove = remove | overlap hit[k+1:] = hit[k+1:] | (cline & remove) k += 1 drop = ~hit return lines[drop], scores[drop]

true

1c3026900b6f2bd8aa4de380eff71a596a25b011

950

py

Python

forms.py

HarrySng/itoi

b2b23dea542299c3c0156b5e32994a154323b881

[ "MIT" ]

null

forms.py

HarrySng/itoi

b2b23dea542299c3c0156b5e32994a154323b881

[ "MIT" ]

null

forms.py

HarrySng/itoi

b2b23dea542299c3c0156b5e32994a154323b881

[ "MIT" ]

null

from flask_wtf import FlaskForm, Form from flask_wtf.file import FileField, FileRequired from wtforms import StringField, IntegerField, TextAreaField, DateTimeField, BooleanField, SelectField, PasswordField, SubmitField from wtforms.validators import DataRequired, Optional class loginForm(FlaskForm): mngrID = StringField('Enter User ID:', validators=[DataRequired()]) pswd = PasswordField('Enter password:', validators=[DataRequired()]) key = StringField('Enter Org Key', validators=[DataRequired()]) submit = SubmitField('Login') class signupForm(FlaskForm): mngrID = StringField('Enter Manager ID', validators=[DataRequired()]) pswd = PasswordField('Enter password:', validators=[DataRequired()]) cpswd = PasswordField('Confirm password:', validators=[DataRequired()]) emailID = StringField('Enter Email ID', validators=[DataRequired()]) key = StringField('Enter Org Key', validators=[DataRequired()]) submit = SubmitField('Register')

52.777778

130

0.776842

from flask_wtf import FlaskForm, Form from flask_wtf.file import FileField, FileRequired from wtforms import StringField, IntegerField, TextAreaField, DateTimeField, BooleanField, SelectField, PasswordField, SubmitField from wtforms.validators import DataRequired, Optional class loginForm(FlaskForm): mngrID = StringField('Enter User ID:', validators=[DataRequired()]) pswd = PasswordField('Enter password:', validators=[DataRequired()]) key = StringField('Enter Org Key', validators=[DataRequired()]) submit = SubmitField('Login') class signupForm(FlaskForm): mngrID = StringField('Enter Manager ID', validators=[DataRequired()]) pswd = PasswordField('Enter password:', validators=[DataRequired()]) cpswd = PasswordField('Confirm password:', validators=[DataRequired()]) emailID = StringField('Enter Email ID', validators=[DataRequired()]) key = StringField('Enter Org Key', validators=[DataRequired()]) submit = SubmitField('Register')

true

1c30272f6c0631c8d6b19553eea6f9d98f4e42c1

1,635

py

Python

data_loader.py

Deepika1108/Facial-Expression-Recognition

7e37c0a5e69d1e8d5af429af4a43c70371c9cecf

[ "MIT" ]

87

2019-12-02T03:21:08.000Z

2022-02-28T05:15:33.000Z

data_loader.py

Deepika1108/Facial-Expression-Recognition

7e37c0a5e69d1e8d5af429af4a43c70371c9cecf

[ "MIT" ]

12

2019-12-14T05:56:01.000Z

2021-11-29T02:51:32.000Z

data_loader.py

Deepika1108/Facial-Expression-Recognition

7e37c0a5e69d1e8d5af429af4a43c70371c9cecf

[ "MIT" ]

23

2019-12-16T04:56:39.000Z

2022-03-14T03:15:52.000Z

import torch import os from PIL import Image import random import numpy as np import pickle import torchvision.transforms as transforms from .ckplus_res import CKPlusResDataset from .mmi_res import MMIResDataset from .affectnet import AffectNetDataset from .base_dataset import BaseDataset def create_dataloader(opt): data_loader = DataLoader() data_loader.initialize(opt) return data_loader class DataLoader: def name(self): return self.dataset.name() + "_Loader" def create_datase(self): # specify which dataset to load here loaded_dataset = os.path.basename(self.opt.data_root.strip('/')) if 'CK' in loaded_dataset: dataset = CKPlusResDataset() elif 'MMI' in loaded_dataset: dataset = MMIResDataset() elif 'Affect' in loaded_dataset: dataset = AffectNetDataset() else: dataset = BaseDataset() dataset.initialize(self.opt) return dataset def initialize(self, opt): self.opt = opt self.dataset = self.create_datase() self.dataloader = torch.utils.data.DataLoader( self.dataset, batch_size=opt.batch_size, shuffle=not opt.serial_batches, num_workers=int(opt.n_threads) ) def __len__(self): return min(len(self.dataset), self.opt.max_dataset_size) def __iter__(self): for i, data in enumerate(self.dataloader): if i * self.opt.batch_size >= self.opt.max_dataset_size: break yield data

29.196429

73

0.628746

import torch import os from PIL import Image import random import numpy as np import pickle import torchvision.transforms as transforms from .ckplus_res import CKPlusResDataset from .mmi_res import MMIResDataset from .affectnet import AffectNetDataset from .base_dataset import BaseDataset def create_dataloader(opt): data_loader = DataLoader() data_loader.initialize(opt) return data_loader class DataLoader: def name(self): return self.dataset.name() + "_Loader" def create_datase(self): loaded_dataset = os.path.basename(self.opt.data_root.strip('/')) if 'CK' in loaded_dataset: dataset = CKPlusResDataset() elif 'MMI' in loaded_dataset: dataset = MMIResDataset() elif 'Affect' in loaded_dataset: dataset = AffectNetDataset() else: dataset = BaseDataset() dataset.initialize(self.opt) return dataset def initialize(self, opt): self.opt = opt self.dataset = self.create_datase() self.dataloader = torch.utils.data.DataLoader( self.dataset, batch_size=opt.batch_size, shuffle=not opt.serial_batches, num_workers=int(opt.n_threads) ) def __len__(self): return min(len(self.dataset), self.opt.max_dataset_size) def __iter__(self): for i, data in enumerate(self.dataloader): if i * self.opt.batch_size >= self.opt.max_dataset_size: break yield data

true

1c30273cd6a8c1868c1f8b91a8863bd016068a59

1,130

py

Python

backend/storage.py

lakshbhasin/VoterValidation

2249f387046b5039b650e3b5c63b9d3d3b7aea8f

[ "Apache-2.0" ]

6

2018-11-02T14:10:54.000Z

2020-07-14T02:38:03.000Z

backend/storage.py

lakshbhasin/VoterValidation

2249f387046b5039b650e3b5c63b9d3d3b7aea8f

[ "Apache-2.0" ]

2

2021-06-10T20:56:46.000Z

2021-06-10T20:58:54.000Z

backend/storage.py

lakshbhasin/VoterValidation

2249f387046b5039b650e3b5c63b9d3d3b7aea8f

[ "Apache-2.0" ]

null

""" Adapted from http://condopilot.com/blog/web/how-setup-gzip-compressor-and-aws-s3-django/ """ from django.core.files.storage import get_storage_class from storages.backends.s3boto import S3BotoStorage from backend.settings import STATICFILES_LOCATION class CachedS3BotoStorage(S3BotoStorage): """ S3 storage backend that caches files locally (on the same server as the Django application), too (so we can see what static files have changed and whether a new compressed version needs to be created). """ location = STATICFILES_LOCATION def __init__(self, *args, **kwargs): super(CachedS3BotoStorage, self).__init__(*args, **kwargs) self.local_storage = get_storage_class( "compressor.storage.CompressorFileStorage")() def save(self, name, content): """ A workaround to save non-gzipped content locally. """ non_gzipped_file_content = content.file name = super(CachedS3BotoStorage, self).save(name, content) content.file = non_gzipped_file_content self.local_storage._save(name, content) return name

34.242424

75

0.709735

from django.core.files.storage import get_storage_class from storages.backends.s3boto import S3BotoStorage from backend.settings import STATICFILES_LOCATION class CachedS3BotoStorage(S3BotoStorage): location = STATICFILES_LOCATION def __init__(self, *args, **kwargs): super(CachedS3BotoStorage, self).__init__(*args, **kwargs) self.local_storage = get_storage_class( "compressor.storage.CompressorFileStorage")() def save(self, name, content): non_gzipped_file_content = content.file name = super(CachedS3BotoStorage, self).save(name, content) content.file = non_gzipped_file_content self.local_storage._save(name, content) return name

true

1c3028185d8c41fdc39aa16889e8966955df26ad

730

py

Python

anees/migrations/0038_auto_20200928_0507.py

ashish2020kashyap/cessini

9713fd76d2e31a95266ec69da2abc98424a46e52

[ "MIT" ]

null

anees/migrations/0038_auto_20200928_0507.py

ashish2020kashyap/cessini

9713fd76d2e31a95266ec69da2abc98424a46e52

[ "MIT" ]

null

anees/migrations/0038_auto_20200928_0507.py

ashish2020kashyap/cessini

9713fd76d2e31a95266ec69da2abc98424a46e52

[ "MIT" ]

null

# Generated by Django 3.1.1 on 2020-09-28 05:07 from django.db import migrations, models import django.db.models.deletion class Migration(migrations.Migration): dependencies = [ ('anees', '0037_auto_20200928_0504'), ] operations = [ migrations.AlterField( model_name='campmail', name='camp', field=models.ManyToManyField(blank=True, null=True, related_name='emailings', to='anees.Email'), ), migrations.AlterField( model_name='campmail', name='customer_mail', field=models.ForeignKey(null=True, on_delete=django.db.models.deletion.SET_NULL, related_name='customermail', to='anees.campaign'), ), ]

29.2

143

0.634247

from django.db import migrations, models import django.db.models.deletion class Migration(migrations.Migration): dependencies = [ ('anees', '0037_auto_20200928_0504'), ] operations = [ migrations.AlterField( model_name='campmail', name='camp', field=models.ManyToManyField(blank=True, null=True, related_name='emailings', to='anees.Email'), ), migrations.AlterField( model_name='campmail', name='customer_mail', field=models.ForeignKey(null=True, on_delete=django.db.models.deletion.SET_NULL, related_name='customermail', to='anees.campaign'), ), ]

true

1c3028b675a02c0d60e802724ad657e807832f03

11,058

py

Python

msgraph/cli/command_modules/groups/azext_groups/vendored_sdks/groups/operations/_groups_onenote_section_groups_sections_pages_parent_notebook_sections_operations.py

microsoftgraph/msgraph-cli-archived

489f70bf4ede1ce67b84bfb31e66da3e4db76062

[ "MIT" ]

null

msgraph/cli/command_modules/groups/azext_groups/vendored_sdks/groups/operations/_groups_onenote_section_groups_sections_pages_parent_notebook_sections_operations.py

microsoftgraph/msgraph-cli-archived

489f70bf4ede1ce67b84bfb31e66da3e4db76062

[ "MIT" ]

22

2022-03-29T22:54:37.000Z

2022-03-29T22:55:27.000Z

msgraph/cli/command_modules/groups/azext_groups/vendored_sdks/groups/operations/_groups_onenote_section_groups_sections_pages_parent_notebook_sections_operations.py

microsoftgraph/msgraph-cli-archived

489f70bf4ede1ce67b84bfb31e66da3e4db76062

[ "MIT" ]

null

# coding=utf-8 # -------------------------------------------------------------------------- # Copyright (c) Microsoft Corporation. All rights reserved. # Licensed under the MIT License. See License.txt in the project root for license information. # Code generated by Microsoft (R) AutoRest Code Generator. # Changes may cause incorrect behavior and will be lost if the code is regenerated. # -------------------------------------------------------------------------- from typing import TYPE_CHECKING import warnings from azure.core.exceptions import ClientAuthenticationError, HttpResponseError, ResourceExistsError, ResourceNotFoundError, map_error from azure.core.pipeline import PipelineResponse from azure.core.pipeline.transport import HttpRequest, HttpResponse from azure.mgmt.core.exceptions import ARMErrorFormat from .. import models if TYPE_CHECKING: # pylint: disable=unused-import,ungrouped-imports from typing import Any, Callable, Dict, Generic, Optional, TypeVar T = TypeVar('T') ClsType = Optional[Callable[[PipelineResponse[HttpRequest, HttpResponse], T, Dict[str, Any]], Any]] class GroupsOnenoteSectionGroupsSectionsPagesParentNotebookSectionsOperations(object): """GroupsOnenoteSectionGroupsSectionsPagesParentNotebookSectionsOperations operations. You should not instantiate this class directly. Instead, you should create a Client instance that instantiates it for you and attaches it as an attribute. :ivar models: Alias to model classes used in this operation group. :type models: ~groups.models :param client: Client for service requests. :param config: Configuration of service client. :param serializer: An object model serializer. :param deserializer: An object model deserializer. """ models = models def __init__(self, client, config, serializer, deserializer): self._client = client self._serialize = serializer self._deserialize = deserializer self._config = config def copy_to_notebook( self, group_id, # type: str section_group_id, # type: str onenote_section_id, # type: str onenote_page_id, # type: str onenote_section_id1, # type: str body, # type: "models.Paths1Ku8ThmGroupsGroupIdOnenoteSectiongroupsSectiongroupIdSectionsOnenotesectionIdPagesOnenotepageIdParentnotebookSectionsOnenotesectionId1MicrosoftGraphCopytonotebookPostRequestbodyContentApplicationJsonSchema" **kwargs # type: Any ): # type: (...) -> "models.MicrosoftGraphOnenoteOperation" """Invoke action copyToNotebook. Invoke action copyToNotebook. :param group_id: key: id of group. :type group_id: str :param section_group_id: key: id of sectionGroup. :type section_group_id: str :param onenote_section_id: key: id of onenoteSection. :type onenote_section_id: str :param onenote_page_id: key: id of onenotePage. :type onenote_page_id: str :param onenote_section_id1: key: id of onenoteSection. :type onenote_section_id1: str :param body: Action parameters. :type body: ~groups.models.Paths1Ku8ThmGroupsGroupIdOnenoteSectiongroupsSectiongroupIdSectionsOnenotesectionIdPagesOnenotepageIdParentnotebookSectionsOnenotesectionId1MicrosoftGraphCopytonotebookPostRequestbodyContentApplicationJsonSchema :keyword callable cls: A custom type or function that will be passed the direct response :return: MicrosoftGraphOnenoteOperation, or the result of cls(response) :rtype: ~groups.models.MicrosoftGraphOnenoteOperation :raises: ~azure.core.exceptions.HttpResponseError """ cls = kwargs.pop('cls', None) # type: ClsType["models.MicrosoftGraphOnenoteOperation"] error_map = { 401: ClientAuthenticationError, 404: ResourceNotFoundError, 409: ResourceExistsError } error_map.update(kwargs.pop('error_map', {})) content_type = kwargs.pop("content_type", "application/json") accept = "application/json" # Construct URL url = self.copy_to_notebook.metadata['url'] # type: ignore path_format_arguments = { 'group-id': self._serialize.url("group_id", group_id, 'str'), 'sectionGroup-id': self._serialize.url("section_group_id", section_group_id, 'str'), 'onenoteSection-id': self._serialize.url("onenote_section_id", onenote_section_id, 'str'), 'onenotePage-id': self._serialize.url("onenote_page_id", onenote_page_id, 'str'), 'onenoteSection-id1': self._serialize.url("onenote_section_id1", onenote_section_id1, 'str'), } url = self._client.format_url(url, **path_format_arguments) # Construct parameters query_parameters = {} # type: Dict[str, Any] # Construct headers header_parameters = {} # type: Dict[str, Any] header_parameters['Content-Type'] = self._serialize.header("content_type", content_type, 'str') header_parameters['Accept'] = self._serialize.header("accept", accept, 'str') body_content_kwargs = {} # type: Dict[str, Any] body_content = self._serialize.body(body, 'Paths1Ku8ThmGroupsGroupIdOnenoteSectiongroupsSectiongroupIdSectionsOnenotesectionIdPagesOnenotepageIdParentnotebookSectionsOnenotesectionId1MicrosoftGraphCopytonotebookPostRequestbodyContentApplicationJsonSchema') body_content_kwargs['content'] = body_content request = self._client.post(url, query_parameters, header_parameters, **body_content_kwargs) pipeline_response = self._client._pipeline.run(request, stream=False, **kwargs) response = pipeline_response.http_response if response.status_code not in [200]: map_error(status_code=response.status_code, response=response, error_map=error_map) error = self._deserialize(models.OdataError, response) raise HttpResponseError(response=response, model=error, error_format=ARMErrorFormat) deserialized = self._deserialize('MicrosoftGraphOnenoteOperation', pipeline_response) if cls: return cls(pipeline_response, deserialized, {}) return deserialized copy_to_notebook.metadata = {'url': '/groups/{group-id}/onenote/sectionGroups/{sectionGroup-id}/sections/{onenoteSection-id}/pages/{onenotePage-id}/parentNotebook/sections/{onenoteSection-id1}/microsoft.graph.copyToNotebook'} # type: ignore def copy_to_section_group( self, group_id, # type: str section_group_id, # type: str onenote_section_id, # type: str onenote_page_id, # type: str onenote_section_id1, # type: str body, # type: "models.Paths17T903XGroupsGroupIdOnenoteSectiongroupsSectiongroupIdSectionsOnenotesectionIdPagesOnenotepageIdParentnotebookSectionsOnenotesectionId1MicrosoftGraphCopytosectiongroupPostRequestbodyContentApplicationJsonSchema" **kwargs # type: Any ): # type: (...) -> "models.MicrosoftGraphOnenoteOperation" """Invoke action copyToSectionGroup. Invoke action copyToSectionGroup. :param group_id: key: id of group. :type group_id: str :param section_group_id: key: id of sectionGroup. :type section_group_id: str :param onenote_section_id: key: id of onenoteSection. :type onenote_section_id: str :param onenote_page_id: key: id of onenotePage. :type onenote_page_id: str :param onenote_section_id1: key: id of onenoteSection. :type onenote_section_id1: str :param body: Action parameters. :type body: ~groups.models.Paths17T903XGroupsGroupIdOnenoteSectiongroupsSectiongroupIdSectionsOnenotesectionIdPagesOnenotepageIdParentnotebookSectionsOnenotesectionId1MicrosoftGraphCopytosectiongroupPostRequestbodyContentApplicationJsonSchema :keyword callable cls: A custom type or function that will be passed the direct response :return: MicrosoftGraphOnenoteOperation, or the result of cls(response) :rtype: ~groups.models.MicrosoftGraphOnenoteOperation :raises: ~azure.core.exceptions.HttpResponseError """ cls = kwargs.pop('cls', None) # type: ClsType["models.MicrosoftGraphOnenoteOperation"] error_map = { 401: ClientAuthenticationError, 404: ResourceNotFoundError, 409: ResourceExistsError } error_map.update(kwargs.pop('error_map', {})) content_type = kwargs.pop("content_type", "application/json") accept = "application/json" # Construct URL url = self.copy_to_section_group.metadata['url'] # type: ignore path_format_arguments = { 'group-id': self._serialize.url("group_id", group_id, 'str'), 'sectionGroup-id': self._serialize.url("section_group_id", section_group_id, 'str'), 'onenoteSection-id': self._serialize.url("onenote_section_id", onenote_section_id, 'str'), 'onenotePage-id': self._serialize.url("onenote_page_id", onenote_page_id, 'str'), 'onenoteSection-id1': self._serialize.url("onenote_section_id1", onenote_section_id1, 'str'), } url = self._client.format_url(url, **path_format_arguments) # Construct parameters query_parameters = {} # type: Dict[str, Any] # Construct headers header_parameters = {} # type: Dict[str, Any] header_parameters['Content-Type'] = self._serialize.header("content_type", content_type, 'str') header_parameters['Accept'] = self._serialize.header("accept", accept, 'str') body_content_kwargs = {} # type: Dict[str, Any] body_content = self._serialize.body(body, 'Paths17T903XGroupsGroupIdOnenoteSectiongroupsSectiongroupIdSectionsOnenotesectionIdPagesOnenotepageIdParentnotebookSectionsOnenotesectionId1MicrosoftGraphCopytosectiongroupPostRequestbodyContentApplicationJsonSchema') body_content_kwargs['content'] = body_content request = self._client.post(url, query_parameters, header_parameters, **body_content_kwargs) pipeline_response = self._client._pipeline.run(request, stream=False, **kwargs) response = pipeline_response.http_response if response.status_code not in [200]: map_error(status_code=response.status_code, response=response, error_map=error_map) error = self._deserialize(models.OdataError, response) raise HttpResponseError(response=response, model=error, error_format=ARMErrorFormat) deserialized = self._deserialize('MicrosoftGraphOnenoteOperation', pipeline_response) if cls: return cls(pipeline_response, deserialized, {}) return deserialized copy_to_section_group.metadata = {'url': '/groups/{group-id}/onenote/sectionGroups/{sectionGroup-id}/sections/{onenoteSection-id}/pages/{onenotePage-id}/parentNotebook/sections/{onenoteSection-id1}/microsoft.graph.copyToSectionGroup'} # type: ignore

54.205882

268

0.714324

from typing import TYPE_CHECKING import warnings from azure.core.exceptions import ClientAuthenticationError, HttpResponseError, ResourceExistsError, ResourceNotFoundError, map_error from azure.core.pipeline import PipelineResponse from azure.core.pipeline.transport import HttpRequest, HttpResponse from azure.mgmt.core.exceptions import ARMErrorFormat from .. import models if TYPE_CHECKING: from typing import Any, Callable, Dict, Generic, Optional, TypeVar T = TypeVar('T') ClsType = Optional[Callable[[PipelineResponse[HttpRequest, HttpResponse], T, Dict[str, Any]], Any]] class GroupsOnenoteSectionGroupsSectionsPagesParentNotebookSectionsOperations(object): models = models def __init__(self, client, config, serializer, deserializer): self._client = client self._serialize = serializer self._deserialize = deserializer self._config = config def copy_to_notebook( self, group_id, section_group_id, onenote_section_id, onenote_page_id, onenote_section_id1, body, **kwargs ): cls = kwargs.pop('cls', None) error_map = { 401: ClientAuthenticationError, 404: ResourceNotFoundError, 409: ResourceExistsError } error_map.update(kwargs.pop('error_map', {})) content_type = kwargs.pop("content_type", "application/json") accept = "application/json" url = self.copy_to_notebook.metadata['url'] path_format_arguments = { 'group-id': self._serialize.url("group_id", group_id, 'str'), 'sectionGroup-id': self._serialize.url("section_group_id", section_group_id, 'str'), 'onenoteSection-id': self._serialize.url("onenote_section_id", onenote_section_id, 'str'), 'onenotePage-id': self._serialize.url("onenote_page_id", onenote_page_id, 'str'), 'onenoteSection-id1': self._serialize.url("onenote_section_id1", onenote_section_id1, 'str'), } url = self._client.format_url(url, **path_format_arguments) query_parameters = {} header_parameters = {} header_parameters['Content-Type'] = self._serialize.header("content_type", content_type, 'str') header_parameters['Accept'] = self._serialize.header("accept", accept, 'str') body_content_kwargs = {} body_content = self._serialize.body(body, 'Paths1Ku8ThmGroupsGroupIdOnenoteSectiongroupsSectiongroupIdSectionsOnenotesectionIdPagesOnenotepageIdParentnotebookSectionsOnenotesectionId1MicrosoftGraphCopytonotebookPostRequestbodyContentApplicationJsonSchema') body_content_kwargs['content'] = body_content request = self._client.post(url, query_parameters, header_parameters, **body_content_kwargs) pipeline_response = self._client._pipeline.run(request, stream=False, **kwargs) response = pipeline_response.http_response if response.status_code not in [200]: map_error(status_code=response.status_code, response=response, error_map=error_map) error = self._deserialize(models.OdataError, response) raise HttpResponseError(response=response, model=error, error_format=ARMErrorFormat) deserialized = self._deserialize('MicrosoftGraphOnenoteOperation', pipeline_response) if cls: return cls(pipeline_response, deserialized, {}) return deserialized copy_to_notebook.metadata = {'url': '/groups/{group-id}/onenote/sectionGroups/{sectionGroup-id}/sections/{onenoteSection-id}/pages/{onenotePage-id}/parentNotebook/sections/{onenoteSection-id1}/microsoft.graph.copyToNotebook'} def copy_to_section_group( self, group_id, section_group_id, onenote_section_id, onenote_page_id, onenote_section_id1, body, **kwargs ): cls = kwargs.pop('cls', None) error_map = { 401: ClientAuthenticationError, 404: ResourceNotFoundError, 409: ResourceExistsError } error_map.update(kwargs.pop('error_map', {})) content_type = kwargs.pop("content_type", "application/json") accept = "application/json" url = self.copy_to_section_group.metadata['url'] path_format_arguments = { 'group-id': self._serialize.url("group_id", group_id, 'str'), 'sectionGroup-id': self._serialize.url("section_group_id", section_group_id, 'str'), 'onenoteSection-id': self._serialize.url("onenote_section_id", onenote_section_id, 'str'), 'onenotePage-id': self._serialize.url("onenote_page_id", onenote_page_id, 'str'), 'onenoteSection-id1': self._serialize.url("onenote_section_id1", onenote_section_id1, 'str'), } url = self._client.format_url(url, **path_format_arguments) query_parameters = {} header_parameters = {} header_parameters['Content-Type'] = self._serialize.header("content_type", content_type, 'str') header_parameters['Accept'] = self._serialize.header("accept", accept, 'str') body_content_kwargs = {} body_content = self._serialize.body(body, 'Paths17T903XGroupsGroupIdOnenoteSectiongroupsSectiongroupIdSectionsOnenotesectionIdPagesOnenotepageIdParentnotebookSectionsOnenotesectionId1MicrosoftGraphCopytosectiongroupPostRequestbodyContentApplicationJsonSchema') body_content_kwargs['content'] = body_content request = self._client.post(url, query_parameters, header_parameters, **body_content_kwargs) pipeline_response = self._client._pipeline.run(request, stream=False, **kwargs) response = pipeline_response.http_response if response.status_code not in [200]: map_error(status_code=response.status_code, response=response, error_map=error_map) error = self._deserialize(models.OdataError, response) raise HttpResponseError(response=response, model=error, error_format=ARMErrorFormat) deserialized = self._deserialize('MicrosoftGraphOnenoteOperation', pipeline_response) if cls: return cls(pipeline_response, deserialized, {}) return deserialized copy_to_section_group.metadata = {'url': '/groups/{group-id}/onenote/sectionGroups/{sectionGroup-id}/sections/{onenoteSection-id}/pages/{onenotePage-id}/parentNotebook/sections/{onenoteSection-id1}/microsoft.graph.copyToSectionGroup'}

true

1c3028bb8bd3f560b3d10a49db839605d65b5e44

4,631

py

Python

aptl3/tests/test_am.py

matteoterruzzi/aptl3

680ab58ffa79d0eee293729d36f677a588350519

[ "MIT" ]

null

aptl3/tests/test_am.py

matteoterruzzi/aptl3

680ab58ffa79d0eee293729d36f677a588350519

[ "MIT" ]

null

aptl3/tests/test_am.py

matteoterruzzi/aptl3

680ab58ffa79d0eee293729d36f677a588350519

[ "MIT" ]

null

import itertools import time from typing import Any from ..am import ActorSystem, MapActor, Actor def double(x): return 2 * x def test_empty_system(): with ActorSystem(maxsize=0, use_multiprocessing=False) as s: s.start() print(s.status) print(s.status) def test_simple_actor(): with ActorSystem(maxsize=0, use_multiprocessing=False) as s: s.add_thread('str', MapActor(str, 'main')) s.add_mailbox('main') s.start() s.tell('str', 42) out = s.ask('main') assert out == '42' print(s.status) print(s.status) def test_mixed_actors(): n = 100 with ActorSystem(maxsize=n, use_multiprocessing=True) as s: s.add_process("double", MapActor(double, "str"), pool=2) s.add_thread("str", MapActor(str, "main"), pool=2) s.add_mailbox("main") s.start() for _ in range(3): for __ in range(n): s.tell("double", 21) out = [s.ask("main") for _ in range(n)] assert out == ["42"] * n, out assert s.pending == 0 def test_actor_system_exit(): n = 100 with ActorSystem(maxsize=0) as s: s.add_thread("str", MapActor(str, "sleep")) s.add_thread("sleep", MapActor(lambda x: [x, time.sleep(0.01)][0], "main"), pool=10) s.add_collector("main") s.start() for _ in range(n): s.tell("str", 42) assert not s.is_alive, repr(s) assert s.pending == 0, s.status back = 0 for got in s.ask_available('main'): assert got == "42" back += 1 assert back == n, (back, n, s.status) print(s.status) def test_actor_system_stop_exit(): delay = 0.01 n = 100 _tic = time.perf_counter() with ActorSystem(maxsize=0) as s: s.add_thread("sleep", MapActor(time.sleep, "main")) s.add_collector("main") s.start() for _ in range(n): s.tell("sleep", delay) assert s.ask("main") is None # will wait 1 * delay s.stop() print(s.status) print() # this will appear in the backtrace of s.__exit__ # will wait 1 * delay while finishing the job that was started before s.stop() assert s.pending == 0, s.status # 'main' collector is expected to contain 0 or 1 msg at this point. print(s.status) _elapsed = time.perf_counter() - _tic print(f'elapsed: {_elapsed*1000:.0f}ms') assert _elapsed < 10 * delay, _elapsed # NOTE: 2 * delay is expected; 4 * delay should be enough on a slow system. def test_actor_system_join_pending(): for test_i in range(100): n = 100 with ActorSystem(maxsize=0) as s: s.add_thread('input', MapActor(str, 'main')) s.add_collector('main') s.start() for i in range(n): s.tell('input', i) if test_i % 2 == 0: s.finish() # It should have no effect. Let's skip it in half of the tests. s.join_pending() print('before stop', s.status) s.stop() print('after exit ', s.status) assert list(map(s.ask, itertools.repeat('main', n))) == list(map(str, range(n))) def test_actor_system_request_finish_batch(): n = 100 class BatchingActor(Actor): def receive(self, msg: Any): _batch = list(itertools.chain( [msg], self.ask_available(None, block=not self.finish_requested), )) return 'main', _batch with ActorSystem(maxsize=0) as s: s.add_thread('batch', BatchingActor()) s.add_collector('main') s.start() for i in range(n): s.tell('batch', i) print('before finish:', s.status) s.finish() print('before exit:', s.status) print() print('exited:', s.status) num_batches = 0 concatenated = [] while len(concatenated) < n: batch = s.ask('main') print('batch:', batch) assert 1 <= len(batch) <= n, batch concatenated.extend(batch) num_batches += 1 assert concatenated == list(range(n)), concatenated assert num_batches == 1 # finish is requested after all `tell` if __name__ == '__main__': import multiprocessing multiprocessing.set_start_method('spawn') # fork is default on unix, but windows uses spawn, which pickles actors. test_empty_system() test_simple_actor() test_actor_system_request_finish_batch() test_actor_system_join_pending() test_actor_system_stop_exit() test_actor_system_exit() test_mixed_actors()

30.267974

119

0.585403

import itertools import time from typing import Any from ..am import ActorSystem, MapActor, Actor def double(x): return 2 * x def test_empty_system(): with ActorSystem(maxsize=0, use_multiprocessing=False) as s: s.start() print(s.status) print(s.status) def test_simple_actor(): with ActorSystem(maxsize=0, use_multiprocessing=False) as s: s.add_thread('str', MapActor(str, 'main')) s.add_mailbox('main') s.start() s.tell('str', 42) out = s.ask('main') assert out == '42' print(s.status) print(s.status) def test_mixed_actors(): n = 100 with ActorSystem(maxsize=n, use_multiprocessing=True) as s: s.add_process("double", MapActor(double, "str"), pool=2) s.add_thread("str", MapActor(str, "main"), pool=2) s.add_mailbox("main") s.start() for _ in range(3): for __ in range(n): s.tell("double", 21) out = [s.ask("main") for _ in range(n)] assert out == ["42"] * n, out assert s.pending == 0 def test_actor_system_exit(): n = 100 with ActorSystem(maxsize=0) as s: s.add_thread("str", MapActor(str, "sleep")) s.add_thread("sleep", MapActor(lambda x: [x, time.sleep(0.01)][0], "main"), pool=10) s.add_collector("main") s.start() for _ in range(n): s.tell("str", 42) assert not s.is_alive, repr(s) assert s.pending == 0, s.status back = 0 for got in s.ask_available('main'): assert got == "42" back += 1 assert back == n, (back, n, s.status) print(s.status) def test_actor_system_stop_exit(): delay = 0.01 n = 100 _tic = time.perf_counter() with ActorSystem(maxsize=0) as s: s.add_thread("sleep", MapActor(time.sleep, "main")) s.add_collector("main") s.start() for _ in range(n): s.tell("sleep", delay) assert s.ask("main") is None s.stop() print(s.status) print() assert s.pending == 0, s.status print(s.status) _elapsed = time.perf_counter() - _tic print(f'elapsed: {_elapsed*1000:.0f}ms') assert _elapsed < 10 * delay, _elapsed def test_actor_system_join_pending(): for test_i in range(100): n = 100 with ActorSystem(maxsize=0) as s: s.add_thread('input', MapActor(str, 'main')) s.add_collector('main') s.start() for i in range(n): s.tell('input', i) if test_i % 2 == 0: s.finish() s.join_pending() print('before stop', s.status) s.stop() print('after exit ', s.status) assert list(map(s.ask, itertools.repeat('main', n))) == list(map(str, range(n))) def test_actor_system_request_finish_batch(): n = 100 class BatchingActor(Actor): def receive(self, msg: Any): _batch = list(itertools.chain( [msg], self.ask_available(None, block=not self.finish_requested), )) return 'main', _batch with ActorSystem(maxsize=0) as s: s.add_thread('batch', BatchingActor()) s.add_collector('main') s.start() for i in range(n): s.tell('batch', i) print('before finish:', s.status) s.finish() print('before exit:', s.status) print() print('exited:', s.status) num_batches = 0 concatenated = [] while len(concatenated) < n: batch = s.ask('main') print('batch:', batch) assert 1 <= len(batch) <= n, batch concatenated.extend(batch) num_batches += 1 assert concatenated == list(range(n)), concatenated assert num_batches == 1 # finish is requested after all `tell` if __name__ == '__main__': import multiprocessing multiprocessing.set_start_method('spawn') # fork is default on unix, but windows uses spawn, which pickles actors. test_empty_system() test_simple_actor() test_actor_system_request_finish_batch() test_actor_system_join_pending() test_actor_system_stop_exit() test_actor_system_exit() test_mixed_actors()

true

1c3029102b8a50c6094ed7e50625d167e115f7b7

467

py

Python

omtool/visualizer/draw_parameters.py

Kraysent/OMTool

abb293ee359720d622ed0c4ecdf90967171007c8

[ "Apache-2.0" ]

null

omtool/visualizer/draw_parameters.py

Kraysent/OMTool

abb293ee359720d622ed0c4ecdf90967171007c8

[ "Apache-2.0" ]

51

2021-12-05T13:31:51.000Z

2022-03-27T16:05:04.000Z

omtool/visualizer/draw_parameters.py

Kraysent/OMTool

abb293ee359720d622ed0c4ecdf90967171007c8

[ "Apache-2.0" ]

null

from dataclasses import dataclass from typing import Any, Tuple import matplotlib as mpl @dataclass class DrawParameters: id: str markersize: float = 0.1 linestyle: str = 'None' color: str = 'b' marker: str = 'o' is_density_plot: bool = False resolution: int = 100 extent: Tuple[int, int, int, int] = (0, 100, 0, 100) cmap: str = 'ocean_r' cmapnorm: Any = mpl.colors.LogNorm() label: str = None channel: str = 'b'

22.238095

56

0.631692

from dataclasses import dataclass from typing import Any, Tuple import matplotlib as mpl @dataclass class DrawParameters: id: str markersize: float = 0.1 linestyle: str = 'None' color: str = 'b' marker: str = 'o' is_density_plot: bool = False resolution: int = 100 extent: Tuple[int, int, int, int] = (0, 100, 0, 100) cmap: str = 'ocean_r' cmapnorm: Any = mpl.colors.LogNorm() label: str = None channel: str = 'b'

true

1c30295399e59dfc6f9d4cba1970aea2e3d81c57

1,422

py

Python

data_analysis.py

PatriceC/MLProjectISDP2020

64e83824690ccde2714d915c70fb00b20aa66a42

[ "MIT" ]

1

2021-01-23T01:04:00.000Z

data_analysis.py

cor3ntino/Time-Series-Prediction-with-Deep-Learning-for-Road-Trafic-Data

e8eefdf2e630a53e09f88550357b67732f2bccd0

[ "MIT" ]

null

data_analysis.py

cor3ntino/Time-Series-Prediction-with-Deep-Learning-for-Road-Trafic-Data

e8eefdf2e630a53e09f88550357b67732f2bccd0

[ "MIT" ]

1

2021-01-19T16:57:27.000Z

# -*- coding: utf-8 -*- """ Created on Fri Nov 27 19:19:45 2020 @author: Patrice CHANOL & Corentin MORVAN--CHAUMEIL """ import pandas as pd import matplotlib.pyplot as plt # %% Load Data data_load = pd.read_csv('./Radar_Traffic_Counts.csv') data_load = data_load.drop(columns=['Time Bin', 'location_name']) data_load['Direction'] = data_load['Direction'].astype('category').cat.codes # %% Select set col = ['Direction', 'location_latitude', 'location_longitude', 'Year', 'Month', 'Day of Week', 'Day', 'Hour'] data_pd = data_load.groupby(col)['Volume'].sum().reset_index() data_pd['Date'] = pd.to_datetime(data_pd[['Year', 'Month', 'Day', 'Hour']]) data_pd.index = data_pd['Date'] data_pd_0 = data_pd[data_pd['Direction'] == 0].sort_values(['Year', 'Month', 'Day', 'Hour']) # data_pd_0 = data_pd[(data_pd['Direction'] == 0) & (data_pd['location_latitude']==30.268652000000003) & (data_pd['location_longitude']==-97.759929)].sort_values(['Year', 'Month', 'Day', 'Hour']) plt.figure(0) data_pd_0[(data_pd_0['Date'] >= '2018-07-09') & (data_pd_0['Date'] <= '2018-08-10')]['Volume'].plot(label='Mois du 09/07/18 au 10/08/18') data_pd_0[(data_pd_0['Date'] >= '2018-07-09') & (data_pd_0['Date'] < '2018-07-16')]['Volume'].plot(label='Semaine 09/07 du 15/07') data_pd_0.loc['2018-07-16', 'Volume'].plot(label='Journée du 16/07') plt.ylabel("Volume") plt.title("Du 09/07/18 au 10/08/18") plt.legend() plt.show()

36.461538

195

0.668776

import pandas as pd import matplotlib.pyplot as plt data_load = pd.read_csv('./Radar_Traffic_Counts.csv') data_load = data_load.drop(columns=['Time Bin', 'location_name']) data_load['Direction'] = data_load['Direction'].astype('category').cat.codes col = ['Direction', 'location_latitude', 'location_longitude', 'Year', 'Month', 'Day of Week', 'Day', 'Hour'] data_pd = data_load.groupby(col)['Volume'].sum().reset_index() data_pd['Date'] = pd.to_datetime(data_pd[['Year', 'Month', 'Day', 'Hour']]) data_pd.index = data_pd['Date'] data_pd_0 = data_pd[data_pd['Direction'] == 0].sort_values(['Year', 'Month', 'Day', 'Hour']) plt.figure(0) data_pd_0[(data_pd_0['Date'] >= '2018-07-09') & (data_pd_0['Date'] <= '2018-08-10')]['Volume'].plot(label='Mois du 09/07/18 au 10/08/18') data_pd_0[(data_pd_0['Date'] >= '2018-07-09') & (data_pd_0['Date'] < '2018-07-16')]['Volume'].plot(label='Semaine 09/07 du 15/07') data_pd_0.loc['2018-07-16', 'Volume'].plot(label='Journée du 16/07') plt.ylabel("Volume") plt.title("Du 09/07/18 au 10/08/18") plt.legend() plt.show()

true

1c3029a9d34293ddf7ec3cf7a9c97844a4285f5f

22,629

py

Python

homeassistant/const.py

SergioBPereira/core

4501906da369e23b304857b8a3512798696f26a0

[ "Apache-2.0" ]

null

homeassistant/const.py

SergioBPereira/core

4501906da369e23b304857b8a3512798696f26a0

[ "Apache-2.0" ]

62

2020-11-17T06:56:37.000Z

2022-03-23T18:24:45.000Z

homeassistant/const.py

SergioBPereira/core

4501906da369e23b304857b8a3512798696f26a0

[ "Apache-2.0" ]

2

2021-01-26T07:41:33.000Z

2021-01-26T07:45:11.000Z

"""Constants used by Home Assistant components.""" from __future__ import annotations from typing import Final MAJOR_VERSION: Final = 2021 MINOR_VERSION: Final = 11 PATCH_VERSION: Final = "0.dev0" __short_version__: Final = f"{MAJOR_VERSION}.{MINOR_VERSION}" __version__: Final = f"{__short_version__}.{PATCH_VERSION}" REQUIRED_PYTHON_VER: Final[tuple[int, int, int]] = (3, 8, 0) # Truthy date string triggers showing related deprecation warning messages. REQUIRED_NEXT_PYTHON_VER: Final[tuple[int, int, int]] = (3, 9, 0) REQUIRED_NEXT_PYTHON_HA_RELEASE: Final = "2022.1" # Format for platform files PLATFORM_FORMAT: Final = "{platform}.{domain}" # Can be used to specify a catch all when registering state or event listeners. MATCH_ALL: Final = "*" # Entity target all constant ENTITY_MATCH_NONE: Final = "none" ENTITY_MATCH_ALL: Final = "all" # If no name is specified DEVICE_DEFAULT_NAME: Final = "Unnamed Device" # Max characters for data stored in the recorder (changes to these limits would require # a database migration) MAX_LENGTH_EVENT_EVENT_TYPE: Final = 64 MAX_LENGTH_EVENT_ORIGIN: Final = 32 MAX_LENGTH_EVENT_CONTEXT_ID: Final = 36 MAX_LENGTH_STATE_DOMAIN: Final = 64 MAX_LENGTH_STATE_ENTITY_ID: Final = 255 MAX_LENGTH_STATE_STATE: Final = 255 # Sun events SUN_EVENT_SUNSET: Final = "sunset" SUN_EVENT_SUNRISE: Final = "sunrise" # #### CONFIG #### CONF_ABOVE: Final = "above" CONF_ACCESS_TOKEN: Final = "access_token" CONF_ADDRESS: Final = "address" CONF_AFTER: Final = "after" CONF_ALIAS: Final = "alias" CONF_ALLOWLIST_EXTERNAL_URLS: Final = "allowlist_external_urls" CONF_API_KEY: Final = "api_key" CONF_API_TOKEN: Final = "api_token" CONF_API_VERSION: Final = "api_version" CONF_ARMING_TIME: Final = "arming_time" CONF_AT: Final = "at" CONF_ATTRIBUTE: Final = "attribute" CONF_AUTH_MFA_MODULES: Final = "auth_mfa_modules" CONF_AUTH_PROVIDERS: Final = "auth_providers" CONF_AUTHENTICATION: Final = "authentication" CONF_BASE: Final = "base" CONF_BEFORE: Final = "before" CONF_BELOW: Final = "below" CONF_BINARY_SENSORS: Final = "binary_sensors" CONF_BRIGHTNESS: Final = "brightness" CONF_BROADCAST_ADDRESS: Final = "broadcast_address" CONF_BROADCAST_PORT: Final = "broadcast_port" CONF_CHOOSE: Final = "choose" CONF_CLIENT_ID: Final = "client_id" CONF_CLIENT_SECRET: Final = "client_secret" CONF_CODE: Final = "code" CONF_COLOR_TEMP: Final = "color_temp" CONF_COMMAND: Final = "command" CONF_COMMAND_CLOSE: Final = "command_close" CONF_COMMAND_OFF: Final = "command_off" CONF_COMMAND_ON: Final = "command_on" CONF_COMMAND_OPEN: Final = "command_open" CONF_COMMAND_STATE: Final = "command_state" CONF_COMMAND_STOP: Final = "command_stop" CONF_CONDITION: Final = "condition" CONF_CONDITIONS: Final = "conditions" CONF_CONTINUE_ON_TIMEOUT: Final = "continue_on_timeout" CONF_COUNT: Final = "count" CONF_COVERS: Final = "covers" CONF_CURRENCY: Final = "currency" CONF_CUSTOMIZE: Final = "customize" CONF_CUSTOMIZE_DOMAIN: Final = "customize_domain" CONF_CUSTOMIZE_GLOB: Final = "customize_glob" CONF_DEFAULT: Final = "default" CONF_DELAY: Final = "delay" CONF_DELAY_TIME: Final = "delay_time" CONF_DESCRIPTION: Final = "description" CONF_DEVICE: Final = "device" CONF_DEVICES: Final = "devices" CONF_DEVICE_CLASS: Final = "device_class" CONF_DEVICE_ID: Final = "device_id" CONF_DISARM_AFTER_TRIGGER: Final = "disarm_after_trigger" CONF_DISCOVERY: Final = "discovery" CONF_DISKS: Final = "disks" CONF_DISPLAY_CURRENCY: Final = "display_currency" CONF_DISPLAY_OPTIONS: Final = "display_options" CONF_DOMAIN: Final = "domain" CONF_DOMAINS: Final = "domains" CONF_EFFECT: Final = "effect" CONF_ELEVATION: Final = "elevation" CONF_EMAIL: Final = "email" CONF_ENTITIES: Final = "entities" CONF_ENTITY_CATEGORY: Final = "entity_category" CONF_ENTITY_ID: Final = "entity_id" CONF_ENTITY_NAMESPACE: Final = "entity_namespace" CONF_ENTITY_PICTURE_TEMPLATE: Final = "entity_picture_template" CONF_EVENT: Final = "event" CONF_EVENT_DATA: Final = "event_data" CONF_EVENT_DATA_TEMPLATE: Final = "event_data_template" CONF_EXCLUDE: Final = "exclude" CONF_EXTERNAL_URL: Final = "external_url" CONF_FILENAME: Final = "filename" CONF_FILE_PATH: Final = "file_path" CONF_FOR: Final = "for" CONF_FORCE_UPDATE: Final = "force_update" CONF_FRIENDLY_NAME: Final = "friendly_name" CONF_FRIENDLY_NAME_TEMPLATE: Final = "friendly_name_template" CONF_HEADERS: Final = "headers" CONF_HOST: Final = "host" CONF_HOSTS: Final = "hosts" CONF_HS: Final = "hs" CONF_ICON: Final = "icon" CONF_ICON_TEMPLATE: Final = "icon_template" CONF_ID: Final = "id" CONF_INCLUDE: Final = "include" CONF_INTERNAL_URL: Final = "internal_url" CONF_IP_ADDRESS: Final = "ip_address" CONF_LATITUDE: Final = "latitude" CONF_LEGACY_TEMPLATES: Final = "legacy_templates" CONF_LIGHTS: Final = "lights" CONF_LONGITUDE: Final = "longitude" CONF_MAC: Final = "mac" CONF_MAXIMUM: Final = "maximum" CONF_MEDIA_DIRS: Final = "media_dirs" CONF_METHOD: Final = "method" CONF_MINIMUM: Final = "minimum" CONF_MODE: Final = "mode" CONF_MONITORED_CONDITIONS: Final = "monitored_conditions" CONF_MONITORED_VARIABLES: Final = "monitored_variables" CONF_NAME: Final = "name" CONF_OFFSET: Final = "offset" CONF_OPTIMISTIC: Final = "optimistic" CONF_PACKAGES: Final = "packages" CONF_PARAMS: Final = "params" CONF_PASSWORD: Final = "password" CONF_PATH: Final = "path" CONF_PAYLOAD: Final = "payload" CONF_PAYLOAD_OFF: Final = "payload_off" CONF_PAYLOAD_ON: Final = "payload_on" CONF_PENDING_TIME: Final = "pending_time" CONF_PIN: Final = "pin" CONF_PLATFORM: Final = "platform" CONF_PORT: Final = "port" CONF_PREFIX: Final = "prefix" CONF_PROFILE_NAME: Final = "profile_name" CONF_PROTOCOL: Final = "protocol" CONF_PROXY_SSL: Final = "proxy_ssl" CONF_QUOTE: Final = "quote" CONF_RADIUS: Final = "radius" CONF_RECIPIENT: Final = "recipient" CONF_REGION: Final = "region" CONF_REPEAT: Final = "repeat" CONF_RESOURCE: Final = "resource" CONF_RESOURCES: Final = "resources" CONF_RESOURCE_TEMPLATE: Final = "resource_template" CONF_RGB: Final = "rgb" CONF_ROOM: Final = "room" CONF_SCAN_INTERVAL: Final = "scan_interval" CONF_SCENE: Final = "scene" CONF_SELECTOR: Final = "selector" CONF_SENDER: Final = "sender" CONF_SENSORS: Final = "sensors" CONF_SENSOR_TYPE: Final = "sensor_type" CONF_SEQUENCE: Final = "sequence" CONF_SERVICE: Final = "service" CONF_SERVICE_DATA: Final = "data" CONF_SERVICE_TEMPLATE: Final = "service_template" CONF_SHOW_ON_MAP: Final = "show_on_map" CONF_SLAVE: Final = "slave" CONF_SOURCE: Final = "source" CONF_SSL: Final = "ssl" CONF_STATE: Final = "state" CONF_STATE_TEMPLATE: Final = "state_template" CONF_STRUCTURE: Final = "structure" CONF_SWITCHES: Final = "switches" CONF_TARGET: Final = "target" CONF_TEMPERATURE_UNIT: Final = "temperature_unit" CONF_TIMEOUT: Final = "timeout" CONF_TIME_ZONE: Final = "time_zone" CONF_TOKEN: Final = "token" CONF_TRIGGER_TIME: Final = "trigger_time" CONF_TTL: Final = "ttl" CONF_TYPE: Final = "type" CONF_UNIQUE_ID: Final = "unique_id" CONF_UNIT_OF_MEASUREMENT: Final = "unit_of_measurement" CONF_UNIT_SYSTEM: Final = "unit_system" CONF_UNTIL: Final = "until" CONF_URL: Final = "url" CONF_USERNAME: Final = "username" CONF_VALUE_TEMPLATE: Final = "value_template" CONF_VARIABLES: Final = "variables" CONF_VERIFY_SSL: Final = "verify_ssl" CONF_WAIT_FOR_TRIGGER: Final = "wait_for_trigger" CONF_WAIT_TEMPLATE: Final = "wait_template" CONF_WEBHOOK_ID: Final = "webhook_id" CONF_WEEKDAY: Final = "weekday" CONF_WHILE: Final = "while" CONF_WHITELIST: Final = "whitelist" CONF_ALLOWLIST_EXTERNAL_DIRS: Final = "allowlist_external_dirs" LEGACY_CONF_WHITELIST_EXTERNAL_DIRS: Final = "whitelist_external_dirs" CONF_WHITE_VALUE: Final = "white_value" CONF_XY: Final = "xy" CONF_ZONE: Final = "zone" # #### EVENTS #### EVENT_CALL_SERVICE: Final = "call_service" EVENT_COMPONENT_LOADED: Final = "component_loaded" EVENT_CORE_CONFIG_UPDATE: Final = "core_config_updated" EVENT_HOMEASSISTANT_CLOSE: Final = "homeassistant_close" EVENT_HOMEASSISTANT_START: Final = "homeassistant_start" EVENT_HOMEASSISTANT_STARTED: Final = "homeassistant_started" EVENT_HOMEASSISTANT_STOP: Final = "homeassistant_stop" EVENT_HOMEASSISTANT_FINAL_WRITE: Final = "homeassistant_final_write" EVENT_LOGBOOK_ENTRY: Final = "logbook_entry" EVENT_SERVICE_REGISTERED: Final = "service_registered" EVENT_SERVICE_REMOVED: Final = "service_removed" EVENT_STATE_CHANGED: Final = "state_changed" EVENT_THEMES_UPDATED: Final = "themes_updated" EVENT_TIMER_OUT_OF_SYNC: Final = "timer_out_of_sync" EVENT_TIME_CHANGED: Final = "time_changed" # #### DEVICE CLASSES #### DEVICE_CLASS_AQI: Final = "aqi" DEVICE_CLASS_BATTERY: Final = "battery" DEVICE_CLASS_CO: Final = "carbon_monoxide" DEVICE_CLASS_CO2: Final = "carbon_dioxide" DEVICE_CLASS_CURRENT: Final = "current" DEVICE_CLASS_DATE: Final = "date" DEVICE_CLASS_ENERGY: Final = "energy" DEVICE_CLASS_HUMIDITY: Final = "humidity" DEVICE_CLASS_ILLUMINANCE: Final = "illuminance" DEVICE_CLASS_MONETARY: Final = "monetary" DEVICE_CLASS_NITROGEN_DIOXIDE = "nitrogen_dioxide" DEVICE_CLASS_NITROGEN_MONOXIDE = "nitrogen_monoxide" DEVICE_CLASS_NITROUS_OXIDE = "nitrous_oxide" DEVICE_CLASS_OZONE: Final = "ozone" DEVICE_CLASS_POWER_FACTOR: Final = "power_factor" DEVICE_CLASS_POWER: Final = "power" DEVICE_CLASS_PM25: Final = "pm25" DEVICE_CLASS_PM1: Final = "pm1" DEVICE_CLASS_PM10: Final = "pm10" DEVICE_CLASS_PRESSURE: Final = "pressure" DEVICE_CLASS_SIGNAL_STRENGTH: Final = "signal_strength" DEVICE_CLASS_SULPHUR_DIOXIDE = "sulphur_dioxide" DEVICE_CLASS_TEMPERATURE: Final = "temperature" DEVICE_CLASS_TIMESTAMP: Final = "timestamp" DEVICE_CLASS_VOLTAGE: Final = "voltage" DEVICE_CLASS_VOLATILE_ORGANIC_COMPOUNDS = "volatile_organic_compounds" DEVICE_CLASS_GAS: Final = "gas" # #### STATES #### STATE_ON: Final = "on" STATE_OFF: Final = "off" STATE_HOME: Final = "home" STATE_NOT_HOME: Final = "not_home" STATE_UNKNOWN: Final = "unknown" STATE_OPEN: Final = "open" STATE_OPENING: Final = "opening" STATE_CLOSED: Final = "closed" STATE_CLOSING: Final = "closing" STATE_PLAYING: Final = "playing" STATE_PAUSED: Final = "paused" STATE_IDLE: Final = "idle" STATE_STANDBY: Final = "standby" STATE_ALARM_DISARMED: Final = "disarmed" STATE_ALARM_ARMED_HOME: Final = "armed_home" STATE_ALARM_ARMED_AWAY: Final = "armed_away" STATE_ALARM_ARMED_NIGHT: Final = "armed_night" STATE_ALARM_ARMED_VACATION: Final = "armed_vacation" STATE_ALARM_ARMED_CUSTOM_BYPASS: Final = "armed_custom_bypass" STATE_ALARM_PENDING: Final = "pending" STATE_ALARM_ARMING: Final = "arming" STATE_ALARM_DISARMING: Final = "disarming" STATE_ALARM_TRIGGERED: Final = "triggered" STATE_LOCKED: Final = "locked" STATE_UNLOCKED: Final = "unlocked" STATE_LOCKING: Final = "locking" STATE_UNLOCKING: Final = "unlocking" STATE_JAMMED: Final = "jammed" STATE_UNAVAILABLE: Final = "unavailable" STATE_OK: Final = "ok" STATE_PROBLEM: Final = "problem" # #### STATE AND EVENT ATTRIBUTES #### # Attribution ATTR_ATTRIBUTION: Final = "attribution" # Credentials ATTR_CREDENTIALS: Final = "credentials" # Contains time-related attributes ATTR_NOW: Final = "now" ATTR_DATE: Final = "date" ATTR_TIME: Final = "time" ATTR_SECONDS: Final = "seconds" # Contains domain, service for a SERVICE_CALL event ATTR_DOMAIN: Final = "domain" ATTR_SERVICE: Final = "service" ATTR_SERVICE_DATA: Final = "service_data" # IDs ATTR_ID: Final = "id" # Name ATTR_NAME: Final = "name" # Contains one string or a list of strings, each being an entity id ATTR_ENTITY_ID: Final = "entity_id" # Contains one string or a list of strings, each being an area id ATTR_AREA_ID: Final = "area_id" # Contains one string, the device ID ATTR_DEVICE_ID: Final = "device_id" # String with a friendly name for the entity ATTR_FRIENDLY_NAME: Final = "friendly_name" # A picture to represent entity ATTR_ENTITY_PICTURE: Final = "entity_picture" ATTR_IDENTIFIERS: Final = "identifiers" # Icon to use in the frontend ATTR_ICON: Final = "icon" # The unit of measurement if applicable ATTR_UNIT_OF_MEASUREMENT: Final = "unit_of_measurement" CONF_UNIT_SYSTEM_METRIC: Final = "metric" CONF_UNIT_SYSTEM_IMPERIAL: Final = "imperial" # Electrical attributes ATTR_VOLTAGE: Final = "voltage" # Location of the device/sensor ATTR_LOCATION: Final = "location" ATTR_MODE: Final = "mode" ATTR_MANUFACTURER: Final = "manufacturer" ATTR_MODEL: Final = "model" ATTR_SW_VERSION: Final = "sw_version" ATTR_BATTERY_CHARGING: Final = "battery_charging" ATTR_BATTERY_LEVEL: Final = "battery_level" ATTR_WAKEUP: Final = "wake_up_interval" # For devices which support a code attribute ATTR_CODE: Final = "code" ATTR_CODE_FORMAT: Final = "code_format" # For calling a device specific command ATTR_COMMAND: Final = "command" # For devices which support an armed state ATTR_ARMED: Final = "device_armed" # For devices which support a locked state ATTR_LOCKED: Final = "locked" # For sensors that support 'tripping', eg. motion and door sensors ATTR_TRIPPED: Final = "device_tripped" # For sensors that support 'tripping' this holds the most recent # time the device was tripped ATTR_LAST_TRIP_TIME: Final = "last_tripped_time" # For all entity's, this hold whether or not it should be hidden ATTR_HIDDEN: Final = "hidden" # Location of the entity ATTR_LATITUDE: Final = "latitude" ATTR_LONGITUDE: Final = "longitude" # Accuracy of location in meters ATTR_GPS_ACCURACY: Final = "gps_accuracy" # If state is assumed ATTR_ASSUMED_STATE: Final = "assumed_state" ATTR_STATE: Final = "state" ATTR_EDITABLE: Final = "editable" ATTR_OPTION: Final = "option" # The entity has been restored with restore state ATTR_RESTORED: Final = "restored" # Bitfield of supported component features for the entity ATTR_SUPPORTED_FEATURES: Final = "supported_features" # Class of device within its domain ATTR_DEVICE_CLASS: Final = "device_class" # Temperature attribute ATTR_TEMPERATURE: Final = "temperature" # #### UNITS OF MEASUREMENT #### # Power units POWER_WATT: Final = "W" POWER_KILO_WATT: Final = "kW" POWER_VOLT_AMPERE: Final = "VA" # Energy units ENERGY_WATT_HOUR: Final = "Wh" ENERGY_KILO_WATT_HOUR: Final = "kWh" # Electric_current units ELECTRIC_CURRENT_MILLIAMPERE: Final = "mA" ELECTRIC_CURRENT_AMPERE: Final = "A" # Electric_potential units ELECTRIC_POTENTIAL_MILLIVOLT: Final = "mV" ELECTRIC_POTENTIAL_VOLT: Final = "V" # Degree units DEGREE: Final = "°" # Currency units CURRENCY_EURO: Final = "€" CURRENCY_DOLLAR: Final = "$" CURRENCY_CENT: Final = "¢" # Temperature units TEMP_CELSIUS: Final = "°C" TEMP_FAHRENHEIT: Final = "°F" TEMP_KELVIN: Final = "K" # Time units TIME_MICROSECONDS: Final = "μs" TIME_MILLISECONDS: Final = "ms" TIME_SECONDS: Final = "s" TIME_MINUTES: Final = "min" TIME_HOURS: Final = "h" TIME_DAYS: Final = "d" TIME_WEEKS: Final = "w" TIME_MONTHS: Final = "m" TIME_YEARS: Final = "y" # Length units LENGTH_MILLIMETERS: Final = "mm" LENGTH_CENTIMETERS: Final = "cm" LENGTH_METERS: Final = "m" LENGTH_KILOMETERS: Final = "km" LENGTH_INCHES: Final = "in" LENGTH_FEET: Final = "ft" LENGTH_YARD: Final = "yd" LENGTH_MILES: Final = "mi" # Frequency units FREQUENCY_HERTZ: Final = "Hz" FREQUENCY_MEGAHERTZ: Final = "MHz" FREQUENCY_GIGAHERTZ: Final = "GHz" # Pressure units PRESSURE_PA: Final = "Pa" PRESSURE_HPA: Final = "hPa" PRESSURE_KPA: Final = "kPa" PRESSURE_BAR: Final = "bar" PRESSURE_MBAR: Final = "mbar" PRESSURE_INHG: Final = "inHg" PRESSURE_PSI: Final = "psi" # Sound pressure units SOUND_PRESSURE_DB: Final = "dB" SOUND_PRESSURE_WEIGHTED_DBA: Final = "dBa" # Volume units VOLUME_LITERS: Final = "L" VOLUME_MILLILITERS: Final = "mL" VOLUME_CUBIC_METERS: Final = "m³" VOLUME_CUBIC_FEET: Final = "ft³" VOLUME_GALLONS: Final = "gal" VOLUME_FLUID_OUNCE: Final = "fl. oz." # Volume Flow Rate units VOLUME_FLOW_RATE_CUBIC_METERS_PER_HOUR: Final = "m³/h" VOLUME_FLOW_RATE_CUBIC_FEET_PER_MINUTE: Final = "ft³/m" # Area units AREA_SQUARE_METERS: Final = "m²" # Mass units MASS_GRAMS: Final = "g" MASS_KILOGRAMS: Final = "kg" MASS_MILLIGRAMS: Final = "mg" MASS_MICROGRAMS: Final = "µg" MASS_OUNCES: Final = "oz" MASS_POUNDS: Final = "lb" # Conductivity units CONDUCTIVITY: Final = "µS/cm" # Light units LIGHT_LUX: Final = "lx" # UV Index units UV_INDEX: Final = "UV index" # Percentage units PERCENTAGE: Final = "%" # Irradiation units IRRADIATION_WATTS_PER_SQUARE_METER: Final = "W/m²" IRRADIATION_BTUS_PER_HOUR_SQUARE_FOOT: Final = "BTU/(h×ft²)" # Precipitation units PRECIPITATION_MILLIMETERS_PER_HOUR: Final = "mm/h" PRECIPITATION_INCHES: Final = "in" PRECIPITATION_INCHES_PER_HOUR: Final = "in/h" # Concentration units CONCENTRATION_MICROGRAMS_PER_CUBIC_METER: Final = "µg/m³" CONCENTRATION_MILLIGRAMS_PER_CUBIC_METER: Final = "mg/m³" CONCENTRATION_MICROGRAMS_PER_CUBIC_FOOT: Final = "μg/ft³" CONCENTRATION_PARTS_PER_CUBIC_METER: Final = "p/m³" CONCENTRATION_PARTS_PER_MILLION: Final = "ppm" CONCENTRATION_PARTS_PER_BILLION: Final = "ppb" # Speed units SPEED_MILLIMETERS_PER_DAY: Final = "mm/d" SPEED_INCHES_PER_DAY: Final = "in/d" SPEED_METERS_PER_SECOND: Final = "m/s" SPEED_INCHES_PER_HOUR: Final = "in/h" SPEED_KILOMETERS_PER_HOUR: Final = "km/h" SPEED_MILES_PER_HOUR: Final = "mph" # Signal_strength units SIGNAL_STRENGTH_DECIBELS: Final = "dB" SIGNAL_STRENGTH_DECIBELS_MILLIWATT: Final = "dBm" # Data units DATA_BITS: Final = "bit" DATA_KILOBITS: Final = "kbit" DATA_MEGABITS: Final = "Mbit" DATA_GIGABITS: Final = "Gbit" DATA_BYTES: Final = "B" DATA_KILOBYTES: Final = "kB" DATA_MEGABYTES: Final = "MB" DATA_GIGABYTES: Final = "GB" DATA_TERABYTES: Final = "TB" DATA_PETABYTES: Final = "PB" DATA_EXABYTES: Final = "EB" DATA_ZETTABYTES: Final = "ZB" DATA_YOTTABYTES: Final = "YB" DATA_KIBIBYTES: Final = "KiB" DATA_MEBIBYTES: Final = "MiB" DATA_GIBIBYTES: Final = "GiB" DATA_TEBIBYTES: Final = "TiB" DATA_PEBIBYTES: Final = "PiB" DATA_EXBIBYTES: Final = "EiB" DATA_ZEBIBYTES: Final = "ZiB" DATA_YOBIBYTES: Final = "YiB" # Data_rate units DATA_RATE_BITS_PER_SECOND: Final = "bit/s" DATA_RATE_KILOBITS_PER_SECOND: Final = "kbit/s" DATA_RATE_MEGABITS_PER_SECOND: Final = "Mbit/s" DATA_RATE_GIGABITS_PER_SECOND: Final = "Gbit/s" DATA_RATE_BYTES_PER_SECOND: Final = "B/s" DATA_RATE_KILOBYTES_PER_SECOND: Final = "kB/s" DATA_RATE_MEGABYTES_PER_SECOND: Final = "MB/s" DATA_RATE_GIGABYTES_PER_SECOND: Final = "GB/s" DATA_RATE_KIBIBYTES_PER_SECOND: Final = "KiB/s" DATA_RATE_MEBIBYTES_PER_SECOND: Final = "MiB/s" DATA_RATE_GIBIBYTES_PER_SECOND: Final = "GiB/s" # #### SERVICES #### SERVICE_HOMEASSISTANT_STOP: Final = "stop" SERVICE_HOMEASSISTANT_RESTART: Final = "restart" SERVICE_TURN_ON: Final = "turn_on" SERVICE_TURN_OFF: Final = "turn_off" SERVICE_TOGGLE: Final = "toggle" SERVICE_RELOAD: Final = "reload" SERVICE_VOLUME_UP: Final = "volume_up" SERVICE_VOLUME_DOWN: Final = "volume_down" SERVICE_VOLUME_MUTE: Final = "volume_mute" SERVICE_VOLUME_SET: Final = "volume_set" SERVICE_MEDIA_PLAY_PAUSE: Final = "media_play_pause" SERVICE_MEDIA_PLAY: Final = "media_play" SERVICE_MEDIA_PAUSE: Final = "media_pause" SERVICE_MEDIA_STOP: Final = "media_stop" SERVICE_MEDIA_NEXT_TRACK: Final = "media_next_track" SERVICE_MEDIA_PREVIOUS_TRACK: Final = "media_previous_track" SERVICE_MEDIA_SEEK: Final = "media_seek" SERVICE_REPEAT_SET: Final = "repeat_set" SERVICE_SHUFFLE_SET: Final = "shuffle_set" SERVICE_ALARM_DISARM: Final = "alarm_disarm" SERVICE_ALARM_ARM_HOME: Final = "alarm_arm_home" SERVICE_ALARM_ARM_AWAY: Final = "alarm_arm_away" SERVICE_ALARM_ARM_NIGHT: Final = "alarm_arm_night" SERVICE_ALARM_ARM_VACATION: Final = "alarm_arm_vacation" SERVICE_ALARM_ARM_CUSTOM_BYPASS: Final = "alarm_arm_custom_bypass" SERVICE_ALARM_TRIGGER: Final = "alarm_trigger" SERVICE_LOCK: Final = "lock" SERVICE_UNLOCK: Final = "unlock" SERVICE_OPEN: Final = "open" SERVICE_CLOSE: Final = "close" SERVICE_CLOSE_COVER: Final = "close_cover" SERVICE_CLOSE_COVER_TILT: Final = "close_cover_tilt" SERVICE_OPEN_COVER: Final = "open_cover" SERVICE_OPEN_COVER_TILT: Final = "open_cover_tilt" SERVICE_SAVE_PERSISTENT_STATES: Final = "save_persistent_states" SERVICE_SET_COVER_POSITION: Final = "set_cover_position" SERVICE_SET_COVER_TILT_POSITION: Final = "set_cover_tilt_position" SERVICE_STOP_COVER: Final = "stop_cover" SERVICE_STOP_COVER_TILT: Final = "stop_cover_tilt" SERVICE_TOGGLE_COVER_TILT: Final = "toggle_cover_tilt" SERVICE_SELECT_OPTION: Final = "select_option" # #### API / REMOTE #### SERVER_PORT: Final = 8123 URL_ROOT: Final = "/" URL_API: Final = "/api/" URL_API_STREAM: Final = "/api/stream" URL_API_CONFIG: Final = "/api/config" URL_API_DISCOVERY_INFO: Final = "/api/discovery_info" URL_API_STATES: Final = "/api/states" URL_API_STATES_ENTITY: Final = "/api/states/{}" URL_API_EVENTS: Final = "/api/events" URL_API_EVENTS_EVENT: Final = "/api/events/{}" URL_API_SERVICES: Final = "/api/services" URL_API_SERVICES_SERVICE: Final = "/api/services/{}/{}" URL_API_COMPONENTS: Final = "/api/components" URL_API_ERROR_LOG: Final = "/api/error_log" URL_API_LOG_OUT: Final = "/api/log_out" URL_API_TEMPLATE: Final = "/api/template" HTTP_OK: Final = 200 HTTP_CREATED: Final = 201 HTTP_ACCEPTED: Final = 202 HTTP_MOVED_PERMANENTLY: Final = 301 HTTP_BAD_REQUEST: Final = 400 HTTP_UNAUTHORIZED: Final = 401 HTTP_FORBIDDEN: Final = 403 HTTP_NOT_FOUND: Final = 404 HTTP_METHOD_NOT_ALLOWED: Final = 405 HTTP_UNPROCESSABLE_ENTITY: Final = 422 HTTP_TOO_MANY_REQUESTS: Final = 429 HTTP_INTERNAL_SERVER_ERROR: Final = 500 HTTP_BAD_GATEWAY: Final = 502 HTTP_SERVICE_UNAVAILABLE: Final = 503 HTTP_BASIC_AUTHENTICATION: Final = "basic" HTTP_BEARER_AUTHENTICATION: Final = "bearer_token" HTTP_DIGEST_AUTHENTICATION: Final = "digest" HTTP_HEADER_X_REQUESTED_WITH: Final = "X-Requested-With" CONTENT_TYPE_JSON: Final = "application/json" CONTENT_TYPE_MULTIPART: Final = "multipart/x-mixed-replace; boundary={}" CONTENT_TYPE_TEXT_PLAIN: Final = "text/plain" # The exit code to send to request a restart RESTART_EXIT_CODE: Final = 100 UNIT_NOT_RECOGNIZED_TEMPLATE: Final = "{} is not a recognized {} unit." LENGTH: Final = "length" MASS: Final = "mass" PRESSURE: Final = "pressure" VOLUME: Final = "volume" TEMPERATURE: Final = "temperature" SPEED_MS: Final = "speed_ms" ILLUMINANCE: Final = "illuminance" WEEKDAYS: Final[list[str]] = ["mon", "tue", "wed", "thu", "fri", "sat", "sun"] # The degree of precision for platforms PRECISION_WHOLE: Final = 1 PRECISION_HALVES: Final = 0.5 PRECISION_TENTHS: Final = 0.1 # Static list of entities that will never be exposed to # cloud, alexa, or google_home components CLOUD_NEVER_EXPOSED_ENTITIES: Final[list[str]] = ["group.all_locks"] # The ID of the Home Assistant Cast App CAST_APP_ID_HOMEASSISTANT: Final = "B12CE3CA" ENTITY_CATEGORY_CONFIG: Final = "config" ENTITY_CATEGORY_DIAGNOSTIC: Final = "diagnostic"

31.827004

87

0.776526

from __future__ import annotations from typing import Final MAJOR_VERSION: Final = 2021 MINOR_VERSION: Final = 11 PATCH_VERSION: Final = "0.dev0" __short_version__: Final = f"{MAJOR_VERSION}.{MINOR_VERSION}" __version__: Final = f"{__short_version__}.{PATCH_VERSION}" REQUIRED_PYTHON_VER: Final[tuple[int, int, int]] = (3, 8, 0) REQUIRED_NEXT_PYTHON_VER: Final[tuple[int, int, int]] = (3, 9, 0) REQUIRED_NEXT_PYTHON_HA_RELEASE: Final = "2022.1" PLATFORM_FORMAT: Final = "{platform}.{domain}" MATCH_ALL: Final = "*" ENTITY_MATCH_NONE: Final = "none" ENTITY_MATCH_ALL: Final = "all" DEVICE_DEFAULT_NAME: Final = "Unnamed Device" MAX_LENGTH_EVENT_EVENT_TYPE: Final = 64 MAX_LENGTH_EVENT_ORIGIN: Final = 32 MAX_LENGTH_EVENT_CONTEXT_ID: Final = 36 MAX_LENGTH_STATE_DOMAIN: Final = 64 MAX_LENGTH_STATE_ENTITY_ID: Final = 255 MAX_LENGTH_STATE_STATE: Final = 255 SUN_EVENT_SUNSET: Final = "sunset" SUN_EVENT_SUNRISE: Final = "sunrise" n" CONF_ADDRESS: Final = "address" CONF_AFTER: Final = "after" CONF_ALIAS: Final = "alias" CONF_ALLOWLIST_EXTERNAL_URLS: Final = "allowlist_external_urls" CONF_API_KEY: Final = "api_key" CONF_API_TOKEN: Final = "api_token" CONF_API_VERSION: Final = "api_version" CONF_ARMING_TIME: Final = "arming_time" CONF_AT: Final = "at" CONF_ATTRIBUTE: Final = "attribute" CONF_AUTH_MFA_MODULES: Final = "auth_mfa_modules" CONF_AUTH_PROVIDERS: Final = "auth_providers" CONF_AUTHENTICATION: Final = "authentication" CONF_BASE: Final = "base" CONF_BEFORE: Final = "before" CONF_BELOW: Final = "below" CONF_BINARY_SENSORS: Final = "binary_sensors" CONF_BRIGHTNESS: Final = "brightness" CONF_BROADCAST_ADDRESS: Final = "broadcast_address" CONF_BROADCAST_PORT: Final = "broadcast_port" CONF_CHOOSE: Final = "choose" CONF_CLIENT_ID: Final = "client_id" CONF_CLIENT_SECRET: Final = "client_secret" CONF_CODE: Final = "code" CONF_COLOR_TEMP: Final = "color_temp" CONF_COMMAND: Final = "command" CONF_COMMAND_CLOSE: Final = "command_close" CONF_COMMAND_OFF: Final = "command_off" CONF_COMMAND_ON: Final = "command_on" CONF_COMMAND_OPEN: Final = "command_open" CONF_COMMAND_STATE: Final = "command_state" CONF_COMMAND_STOP: Final = "command_stop" CONF_CONDITION: Final = "condition" CONF_CONDITIONS: Final = "conditions" CONF_CONTINUE_ON_TIMEOUT: Final = "continue_on_timeout" CONF_COUNT: Final = "count" CONF_COVERS: Final = "covers" CONF_CURRENCY: Final = "currency" CONF_CUSTOMIZE: Final = "customize" CONF_CUSTOMIZE_DOMAIN: Final = "customize_domain" CONF_CUSTOMIZE_GLOB: Final = "customize_glob" CONF_DEFAULT: Final = "default" CONF_DELAY: Final = "delay" CONF_DELAY_TIME: Final = "delay_time" CONF_DESCRIPTION: Final = "description" CONF_DEVICE: Final = "device" CONF_DEVICES: Final = "devices" CONF_DEVICE_CLASS: Final = "device_class" CONF_DEVICE_ID: Final = "device_id" CONF_DISARM_AFTER_TRIGGER: Final = "disarm_after_trigger" CONF_DISCOVERY: Final = "discovery" CONF_DISKS: Final = "disks" CONF_DISPLAY_CURRENCY: Final = "display_currency" CONF_DISPLAY_OPTIONS: Final = "display_options" CONF_DOMAIN: Final = "domain" CONF_DOMAINS: Final = "domains" CONF_EFFECT: Final = "effect" CONF_ELEVATION: Final = "elevation" CONF_EMAIL: Final = "email" CONF_ENTITIES: Final = "entities" CONF_ENTITY_CATEGORY: Final = "entity_category" CONF_ENTITY_ID: Final = "entity_id" CONF_ENTITY_NAMESPACE: Final = "entity_namespace" CONF_ENTITY_PICTURE_TEMPLATE: Final = "entity_picture_template" CONF_EVENT: Final = "event" CONF_EVENT_DATA: Final = "event_data" CONF_EVENT_DATA_TEMPLATE: Final = "event_data_template" CONF_EXCLUDE: Final = "exclude" CONF_EXTERNAL_URL: Final = "external_url" CONF_FILENAME: Final = "filename" CONF_FILE_PATH: Final = "file_path" CONF_FOR: Final = "for" CONF_FORCE_UPDATE: Final = "force_update" CONF_FRIENDLY_NAME: Final = "friendly_name" CONF_FRIENDLY_NAME_TEMPLATE: Final = "friendly_name_template" CONF_HEADERS: Final = "headers" CONF_HOST: Final = "host" CONF_HOSTS: Final = "hosts" CONF_HS: Final = "hs" CONF_ICON: Final = "icon" CONF_ICON_TEMPLATE: Final = "icon_template" CONF_ID: Final = "id" CONF_INCLUDE: Final = "include" CONF_INTERNAL_URL: Final = "internal_url" CONF_IP_ADDRESS: Final = "ip_address" CONF_LATITUDE: Final = "latitude" CONF_LEGACY_TEMPLATES: Final = "legacy_templates" CONF_LIGHTS: Final = "lights" CONF_LONGITUDE: Final = "longitude" CONF_MAC: Final = "mac" CONF_MAXIMUM: Final = "maximum" CONF_MEDIA_DIRS: Final = "media_dirs" CONF_METHOD: Final = "method" CONF_MINIMUM: Final = "minimum" CONF_MODE: Final = "mode" CONF_MONITORED_CONDITIONS: Final = "monitored_conditions" CONF_MONITORED_VARIABLES: Final = "monitored_variables" CONF_NAME: Final = "name" CONF_OFFSET: Final = "offset" CONF_OPTIMISTIC: Final = "optimistic" CONF_PACKAGES: Final = "packages" CONF_PARAMS: Final = "params" CONF_PASSWORD: Final = "password" CONF_PATH: Final = "path" CONF_PAYLOAD: Final = "payload" CONF_PAYLOAD_OFF: Final = "payload_off" CONF_PAYLOAD_ON: Final = "payload_on" CONF_PENDING_TIME: Final = "pending_time" CONF_PIN: Final = "pin" CONF_PLATFORM: Final = "platform" CONF_PORT: Final = "port" CONF_PREFIX: Final = "prefix" CONF_PROFILE_NAME: Final = "profile_name" CONF_PROTOCOL: Final = "protocol" CONF_PROXY_SSL: Final = "proxy_ssl" CONF_QUOTE: Final = "quote" CONF_RADIUS: Final = "radius" CONF_RECIPIENT: Final = "recipient" CONF_REGION: Final = "region" CONF_REPEAT: Final = "repeat" CONF_RESOURCE: Final = "resource" CONF_RESOURCES: Final = "resources" CONF_RESOURCE_TEMPLATE: Final = "resource_template" CONF_RGB: Final = "rgb" CONF_ROOM: Final = "room" CONF_SCAN_INTERVAL: Final = "scan_interval" CONF_SCENE: Final = "scene" CONF_SELECTOR: Final = "selector" CONF_SENDER: Final = "sender" CONF_SENSORS: Final = "sensors" CONF_SENSOR_TYPE: Final = "sensor_type" CONF_SEQUENCE: Final = "sequence" CONF_SERVICE: Final = "service" CONF_SERVICE_DATA: Final = "data" CONF_SERVICE_TEMPLATE: Final = "service_template" CONF_SHOW_ON_MAP: Final = "show_on_map" CONF_SLAVE: Final = "slave" CONF_SOURCE: Final = "source" CONF_SSL: Final = "ssl" CONF_STATE: Final = "state" CONF_STATE_TEMPLATE: Final = "state_template" CONF_STRUCTURE: Final = "structure" CONF_SWITCHES: Final = "switches" CONF_TARGET: Final = "target" CONF_TEMPERATURE_UNIT: Final = "temperature_unit" CONF_TIMEOUT: Final = "timeout" CONF_TIME_ZONE: Final = "time_zone" CONF_TOKEN: Final = "token" CONF_TRIGGER_TIME: Final = "trigger_time" CONF_TTL: Final = "ttl" CONF_TYPE: Final = "type" CONF_UNIQUE_ID: Final = "unique_id" CONF_UNIT_OF_MEASUREMENT: Final = "unit_of_measurement" CONF_UNIT_SYSTEM: Final = "unit_system" CONF_UNTIL: Final = "until" CONF_URL: Final = "url" CONF_USERNAME: Final = "username" CONF_VALUE_TEMPLATE: Final = "value_template" CONF_VARIABLES: Final = "variables" CONF_VERIFY_SSL: Final = "verify_ssl" CONF_WAIT_FOR_TRIGGER: Final = "wait_for_trigger" CONF_WAIT_TEMPLATE: Final = "wait_template" CONF_WEBHOOK_ID: Final = "webhook_id" CONF_WEEKDAY: Final = "weekday" CONF_WHILE: Final = "while" CONF_WHITELIST: Final = "whitelist" CONF_ALLOWLIST_EXTERNAL_DIRS: Final = "allowlist_external_dirs" LEGACY_CONF_WHITELIST_EXTERNAL_DIRS: Final = "whitelist_external_dirs" CONF_WHITE_VALUE: Final = "white_value" CONF_XY: Final = "xy" CONF_ZONE: Final = "zone" Final = "component_loaded" EVENT_CORE_CONFIG_UPDATE: Final = "core_config_updated" EVENT_HOMEASSISTANT_CLOSE: Final = "homeassistant_close" EVENT_HOMEASSISTANT_START: Final = "homeassistant_start" EVENT_HOMEASSISTANT_STARTED: Final = "homeassistant_started" EVENT_HOMEASSISTANT_STOP: Final = "homeassistant_stop" EVENT_HOMEASSISTANT_FINAL_WRITE: Final = "homeassistant_final_write" EVENT_LOGBOOK_ENTRY: Final = "logbook_entry" EVENT_SERVICE_REGISTERED: Final = "service_registered" EVENT_SERVICE_REMOVED: Final = "service_removed" EVENT_STATE_CHANGED: Final = "state_changed" EVENT_THEMES_UPDATED: Final = "themes_updated" EVENT_TIMER_OUT_OF_SYNC: Final = "timer_out_of_sync" EVENT_TIME_CHANGED: Final = "time_changed" arbon_monoxide" DEVICE_CLASS_CO2: Final = "carbon_dioxide" DEVICE_CLASS_CURRENT: Final = "current" DEVICE_CLASS_DATE: Final = "date" DEVICE_CLASS_ENERGY: Final = "energy" DEVICE_CLASS_HUMIDITY: Final = "humidity" DEVICE_CLASS_ILLUMINANCE: Final = "illuminance" DEVICE_CLASS_MONETARY: Final = "monetary" DEVICE_CLASS_NITROGEN_DIOXIDE = "nitrogen_dioxide" DEVICE_CLASS_NITROGEN_MONOXIDE = "nitrogen_monoxide" DEVICE_CLASS_NITROUS_OXIDE = "nitrous_oxide" DEVICE_CLASS_OZONE: Final = "ozone" DEVICE_CLASS_POWER_FACTOR: Final = "power_factor" DEVICE_CLASS_POWER: Final = "power" DEVICE_CLASS_PM25: Final = "pm25" DEVICE_CLASS_PM1: Final = "pm1" DEVICE_CLASS_PM10: Final = "pm10" DEVICE_CLASS_PRESSURE: Final = "pressure" DEVICE_CLASS_SIGNAL_STRENGTH: Final = "signal_strength" DEVICE_CLASS_SULPHUR_DIOXIDE = "sulphur_dioxide" DEVICE_CLASS_TEMPERATURE: Final = "temperature" DEVICE_CLASS_TIMESTAMP: Final = "timestamp" DEVICE_CLASS_VOLTAGE: Final = "voltage" DEVICE_CLASS_VOLATILE_ORGANIC_COMPOUNDS = "volatile_organic_compounds" DEVICE_CLASS_GAS: Final = "gas" "home" STATE_NOT_HOME: Final = "not_home" STATE_UNKNOWN: Final = "unknown" STATE_OPEN: Final = "open" STATE_OPENING: Final = "opening" STATE_CLOSED: Final = "closed" STATE_CLOSING: Final = "closing" STATE_PLAYING: Final = "playing" STATE_PAUSED: Final = "paused" STATE_IDLE: Final = "idle" STATE_STANDBY: Final = "standby" STATE_ALARM_DISARMED: Final = "disarmed" STATE_ALARM_ARMED_HOME: Final = "armed_home" STATE_ALARM_ARMED_AWAY: Final = "armed_away" STATE_ALARM_ARMED_NIGHT: Final = "armed_night" STATE_ALARM_ARMED_VACATION: Final = "armed_vacation" STATE_ALARM_ARMED_CUSTOM_BYPASS: Final = "armed_custom_bypass" STATE_ALARM_PENDING: Final = "pending" STATE_ALARM_ARMING: Final = "arming" STATE_ALARM_DISARMING: Final = "disarming" STATE_ALARM_TRIGGERED: Final = "triggered" STATE_LOCKED: Final = "locked" STATE_UNLOCKED: Final = "unlocked" STATE_LOCKING: Final = "locking" STATE_UNLOCKING: Final = "unlocking" STATE_JAMMED: Final = "jammed" STATE_UNAVAILABLE: Final = "unavailable" STATE_OK: Final = "ok" STATE_PROBLEM: Final = "problem" inal = "time" ATTR_SECONDS: Final = "seconds" ATTR_DOMAIN: Final = "domain" ATTR_SERVICE: Final = "service" ATTR_SERVICE_DATA: Final = "service_data" ATTR_ID: Final = "id" ATTR_NAME: Final = "name" ATTR_ENTITY_ID: Final = "entity_id" ATTR_AREA_ID: Final = "area_id" ATTR_DEVICE_ID: Final = "device_id" ATTR_FRIENDLY_NAME: Final = "friendly_name" ATTR_ENTITY_PICTURE: Final = "entity_picture" ATTR_IDENTIFIERS: Final = "identifiers" ATTR_ICON: Final = "icon" ATTR_UNIT_OF_MEASUREMENT: Final = "unit_of_measurement" CONF_UNIT_SYSTEM_METRIC: Final = "metric" CONF_UNIT_SYSTEM_IMPERIAL: Final = "imperial" ATTR_VOLTAGE: Final = "voltage" ATTR_LOCATION: Final = "location" ATTR_MODE: Final = "mode" ATTR_MANUFACTURER: Final = "manufacturer" ATTR_MODEL: Final = "model" ATTR_SW_VERSION: Final = "sw_version" ATTR_BATTERY_CHARGING: Final = "battery_charging" ATTR_BATTERY_LEVEL: Final = "battery_level" ATTR_WAKEUP: Final = "wake_up_interval" ATTR_CODE: Final = "code" ATTR_CODE_FORMAT: Final = "code_format" ATTR_COMMAND: Final = "command" ATTR_ARMED: Final = "device_armed" ATTR_LOCKED: Final = "locked" ATTR_TRIPPED: Final = "device_tripped" ATTR_LAST_TRIP_TIME: Final = "last_tripped_time" ATTR_HIDDEN: Final = "hidden" # Location of the entity ATTR_LATITUDE: Final = "latitude" ATTR_LONGITUDE: Final = "longitude" # Accuracy of location in meters ATTR_GPS_ACCURACY: Final = "gps_accuracy" # If state is assumed ATTR_ASSUMED_STATE: Final = "assumed_state" ATTR_STATE: Final = "state" ATTR_EDITABLE: Final = "editable" ATTR_OPTION: Final = "option" # The entity has been restored with restore state ATTR_RESTORED: Final = "restored" # Bitfield of supported component features for the entity ATTR_SUPPORTED_FEATURES: Final = "supported_features" # Class of device within its domain ATTR_DEVICE_CLASS: Final = "device_class" # Temperature attribute ATTR_TEMPERATURE: Final = "temperature" # #### UNITS OF MEASUREMENT #### # Power units POWER_WATT: Final = "W" POWER_KILO_WATT: Final = "kW" POWER_VOLT_AMPERE: Final = "VA" # Energy units ENERGY_WATT_HOUR: Final = "Wh" ENERGY_KILO_WATT_HOUR: Final = "kWh" # Electric_current units ELECTRIC_CURRENT_MILLIAMPERE: Final = "mA" ELECTRIC_CURRENT_AMPERE: Final = "A" # Electric_potential units ELECTRIC_POTENTIAL_MILLIVOLT: Final = "mV" ELECTRIC_POTENTIAL_VOLT: Final = "V" # Degree units DEGREE: Final = "°" # Currency units CURRENCY_EURO: Final = "€" CURRENCY_DOLLAR: Final = "$" CURRENCY_CENT: Final = "¢" # Temperature units TEMP_CELSIUS: Final = "°C" TEMP_FAHRENHEIT: Final = "°F" TEMP_KELVIN: Final = "K" # Time units TIME_MICROSECONDS: Final = "μs" TIME_MILLISECONDS: Final = "ms" TIME_SECONDS: Final = "s" TIME_MINUTES: Final = "min" TIME_HOURS: Final = "h" TIME_DAYS: Final = "d" TIME_WEEKS: Final = "w" TIME_MONTHS: Final = "m" TIME_YEARS: Final = "y" # Length units LENGTH_MILLIMETERS: Final = "mm" LENGTH_CENTIMETERS: Final = "cm" LENGTH_METERS: Final = "m" LENGTH_KILOMETERS: Final = "km" LENGTH_INCHES: Final = "in" LENGTH_FEET: Final = "ft" LENGTH_YARD: Final = "yd" LENGTH_MILES: Final = "mi" # Frequency units FREQUENCY_HERTZ: Final = "Hz" FREQUENCY_MEGAHERTZ: Final = "MHz" FREQUENCY_GIGAHERTZ: Final = "GHz" # Pressure units PRESSURE_PA: Final = "Pa" PRESSURE_HPA: Final = "hPa" PRESSURE_KPA: Final = "kPa" PRESSURE_BAR: Final = "bar" PRESSURE_MBAR: Final = "mbar" PRESSURE_INHG: Final = "inHg" PRESSURE_PSI: Final = "psi" # Sound pressure units SOUND_PRESSURE_DB: Final = "dB" SOUND_PRESSURE_WEIGHTED_DBA: Final = "dBa" # Volume units VOLUME_LITERS: Final = "L" VOLUME_MILLILITERS: Final = "mL" VOLUME_CUBIC_METERS: Final = "m³" VOLUME_CUBIC_FEET: Final = "ft³" VOLUME_GALLONS: Final = "gal" VOLUME_FLUID_OUNCE: Final = "fl. oz." # Volume Flow Rate units VOLUME_FLOW_RATE_CUBIC_METERS_PER_HOUR: Final = "m³/h" VOLUME_FLOW_RATE_CUBIC_FEET_PER_MINUTE: Final = "ft³/m" # Area units AREA_SQUARE_METERS: Final = "m²" # Mass units MASS_GRAMS: Final = "g" MASS_KILOGRAMS: Final = "kg" MASS_MILLIGRAMS: Final = "mg" MASS_MICROGRAMS: Final = "µg" MASS_OUNCES: Final = "oz" MASS_POUNDS: Final = "lb" # Conductivity units CONDUCTIVITY: Final = "µS/cm" # Light units LIGHT_LUX: Final = "lx" # UV Index units UV_INDEX: Final = "UV index" # Percentage units PERCENTAGE: Final = "%" # Irradiation units IRRADIATION_WATTS_PER_SQUARE_METER: Final = "W/m²" IRRADIATION_BTUS_PER_HOUR_SQUARE_FOOT: Final = "BTU/(h×ft²)" # Precipitation units PRECIPITATION_MILLIMETERS_PER_HOUR: Final = "mm/h" PRECIPITATION_INCHES: Final = "in" PRECIPITATION_INCHES_PER_HOUR: Final = "in/h" # Concentration units CONCENTRATION_MICROGRAMS_PER_CUBIC_METER: Final = "µg/m³" CONCENTRATION_MILLIGRAMS_PER_CUBIC_METER: Final = "mg/m³" CONCENTRATION_MICROGRAMS_PER_CUBIC_FOOT: Final = "μg/ft³" CONCENTRATION_PARTS_PER_CUBIC_METER: Final = "p/m³" CONCENTRATION_PARTS_PER_MILLION: Final = "ppm" CONCENTRATION_PARTS_PER_BILLION: Final = "ppb" # Speed units SPEED_MILLIMETERS_PER_DAY: Final = "mm/d" SPEED_INCHES_PER_DAY: Final = "in/d" SPEED_METERS_PER_SECOND: Final = "m/s" SPEED_INCHES_PER_HOUR: Final = "in/h" SPEED_KILOMETERS_PER_HOUR: Final = "km/h" SPEED_MILES_PER_HOUR: Final = "mph" # Signal_strength units SIGNAL_STRENGTH_DECIBELS: Final = "dB" SIGNAL_STRENGTH_DECIBELS_MILLIWATT: Final = "dBm" # Data units DATA_BITS: Final = "bit" DATA_KILOBITS: Final = "kbit" DATA_MEGABITS: Final = "Mbit" DATA_GIGABITS: Final = "Gbit" DATA_BYTES: Final = "B" DATA_KILOBYTES: Final = "kB" DATA_MEGABYTES: Final = "MB" DATA_GIGABYTES: Final = "GB" DATA_TERABYTES: Final = "TB" DATA_PETABYTES: Final = "PB" DATA_EXABYTES: Final = "EB" DATA_ZETTABYTES: Final = "ZB" DATA_YOTTABYTES: Final = "YB" DATA_KIBIBYTES: Final = "KiB" DATA_MEBIBYTES: Final = "MiB" DATA_GIBIBYTES: Final = "GiB" DATA_TEBIBYTES: Final = "TiB" DATA_PEBIBYTES: Final = "PiB" DATA_EXBIBYTES: Final = "EiB" DATA_ZEBIBYTES: Final = "ZiB" DATA_YOBIBYTES: Final = "YiB" # Data_rate units DATA_RATE_BITS_PER_SECOND: Final = "bit/s" DATA_RATE_KILOBITS_PER_SECOND: Final = "kbit/s" DATA_RATE_MEGABITS_PER_SECOND: Final = "Mbit/s" DATA_RATE_GIGABITS_PER_SECOND: Final = "Gbit/s" DATA_RATE_BYTES_PER_SECOND: Final = "B/s" DATA_RATE_KILOBYTES_PER_SECOND: Final = "kB/s" DATA_RATE_MEGABYTES_PER_SECOND: Final = "MB/s" DATA_RATE_GIGABYTES_PER_SECOND: Final = "GB/s" DATA_RATE_KIBIBYTES_PER_SECOND: Final = "KiB/s" DATA_RATE_MEBIBYTES_PER_SECOND: Final = "MiB/s" DATA_RATE_GIBIBYTES_PER_SECOND: Final = "GiB/s" # #### SERVICES #### SERVICE_HOMEASSISTANT_STOP: Final = "stop" SERVICE_HOMEASSISTANT_RESTART: Final = "restart" SERVICE_TURN_ON: Final = "turn_on" SERVICE_TURN_OFF: Final = "turn_off" SERVICE_TOGGLE: Final = "toggle" SERVICE_RELOAD: Final = "reload" SERVICE_VOLUME_UP: Final = "volume_up" SERVICE_VOLUME_DOWN: Final = "volume_down" SERVICE_VOLUME_MUTE: Final = "volume_mute" SERVICE_VOLUME_SET: Final = "volume_set" SERVICE_MEDIA_PLAY_PAUSE: Final = "media_play_pause" SERVICE_MEDIA_PLAY: Final = "media_play" SERVICE_MEDIA_PAUSE: Final = "media_pause" SERVICE_MEDIA_STOP: Final = "media_stop" SERVICE_MEDIA_NEXT_TRACK: Final = "media_next_track" SERVICE_MEDIA_PREVIOUS_TRACK: Final = "media_previous_track" SERVICE_MEDIA_SEEK: Final = "media_seek" SERVICE_REPEAT_SET: Final = "repeat_set" SERVICE_SHUFFLE_SET: Final = "shuffle_set" SERVICE_ALARM_DISARM: Final = "alarm_disarm" SERVICE_ALARM_ARM_HOME: Final = "alarm_arm_home" SERVICE_ALARM_ARM_AWAY: Final = "alarm_arm_away" SERVICE_ALARM_ARM_NIGHT: Final = "alarm_arm_night" SERVICE_ALARM_ARM_VACATION: Final = "alarm_arm_vacation" SERVICE_ALARM_ARM_CUSTOM_BYPASS: Final = "alarm_arm_custom_bypass" SERVICE_ALARM_TRIGGER: Final = "alarm_trigger" SERVICE_LOCK: Final = "lock" SERVICE_UNLOCK: Final = "unlock" SERVICE_OPEN: Final = "open" SERVICE_CLOSE: Final = "close" SERVICE_CLOSE_COVER: Final = "close_cover" SERVICE_CLOSE_COVER_TILT: Final = "close_cover_tilt" SERVICE_OPEN_COVER: Final = "open_cover" SERVICE_OPEN_COVER_TILT: Final = "open_cover_tilt" SERVICE_SAVE_PERSISTENT_STATES: Final = "save_persistent_states" SERVICE_SET_COVER_POSITION: Final = "set_cover_position" SERVICE_SET_COVER_TILT_POSITION: Final = "set_cover_tilt_position" SERVICE_STOP_COVER: Final = "stop_cover" SERVICE_STOP_COVER_TILT: Final = "stop_cover_tilt" SERVICE_TOGGLE_COVER_TILT: Final = "toggle_cover_tilt" SERVICE_SELECT_OPTION: Final = "select_option" # #### API / REMOTE #### SERVER_PORT: Final = 8123 URL_ROOT: Final = "/" URL_API: Final = "/api/" URL_API_STREAM: Final = "/api/stream" URL_API_CONFIG: Final = "/api/config" URL_API_DISCOVERY_INFO: Final = "/api/discovery_info" URL_API_STATES: Final = "/api/states" URL_API_STATES_ENTITY: Final = "/api/states/{}" URL_API_EVENTS: Final = "/api/events" URL_API_EVENTS_EVENT: Final = "/api/events/{}" URL_API_SERVICES: Final = "/api/services" URL_API_SERVICES_SERVICE: Final = "/api/services/{}/{}" URL_API_COMPONENTS: Final = "/api/components" URL_API_ERROR_LOG: Final = "/api/error_log" URL_API_LOG_OUT: Final = "/api/log_out" URL_API_TEMPLATE: Final = "/api/template" HTTP_OK: Final = 200 HTTP_CREATED: Final = 201 HTTP_ACCEPTED: Final = 202 HTTP_MOVED_PERMANENTLY: Final = 301 HTTP_BAD_REQUEST: Final = 400 HTTP_UNAUTHORIZED: Final = 401 HTTP_FORBIDDEN: Final = 403 HTTP_NOT_FOUND: Final = 404 HTTP_METHOD_NOT_ALLOWED: Final = 405 HTTP_UNPROCESSABLE_ENTITY: Final = 422 HTTP_TOO_MANY_REQUESTS: Final = 429 HTTP_INTERNAL_SERVER_ERROR: Final = 500 HTTP_BAD_GATEWAY: Final = 502 HTTP_SERVICE_UNAVAILABLE: Final = 503 HTTP_BASIC_AUTHENTICATION: Final = "basic" HTTP_BEARER_AUTHENTICATION: Final = "bearer_token" HTTP_DIGEST_AUTHENTICATION: Final = "digest" HTTP_HEADER_X_REQUESTED_WITH: Final = "X-Requested-With" CONTENT_TYPE_JSON: Final = "application/json" CONTENT_TYPE_MULTIPART: Final = "multipart/x-mixed-replace; boundary={}" CONTENT_TYPE_TEXT_PLAIN: Final = "text/plain" # The exit code to send to request a restart RESTART_EXIT_CODE: Final = 100 UNIT_NOT_RECOGNIZED_TEMPLATE: Final = "{} is not a recognized {} unit." LENGTH: Final = "length" MASS: Final = "mass" PRESSURE: Final = "pressure" VOLUME: Final = "volume" TEMPERATURE: Final = "temperature" SPEED_MS: Final = "speed_ms" ILLUMINANCE: Final = "illuminance" WEEKDAYS: Final[list[str]] = ["mon", "tue", "wed", "thu", "fri", "sat", "sun"] # The degree of precision for platforms PRECISION_WHOLE: Final = 1 PRECISION_HALVES: Final = 0.5 PRECISION_TENTHS: Final = 0.1 # Static list of entities that will never be exposed to # cloud, alexa, or google_home components CLOUD_NEVER_EXPOSED_ENTITIES: Final[list[str]] = ["group.all_locks"] # The ID of the Home Assistant Cast App CAST_APP_ID_HOMEASSISTANT: Final = "B12CE3CA" ENTITY_CATEGORY_CONFIG: Final = "config" ENTITY_CATEGORY_DIAGNOSTIC: Final = "diagnostic"

true

1c302afc00f8455b99cd49949b9ddea989f339e9

12,495

py

Python

cinder/backup/drivers/swift.py

alexpilotti/cinder-ci-fixes

c0ed2ab8cc6b1197e426cd6c58c3b582624d1cfd

[ "Apache-2.0" ]

null

cinder/backup/drivers/swift.py

alexpilotti/cinder-ci-fixes

c0ed2ab8cc6b1197e426cd6c58c3b582624d1cfd

[ "Apache-2.0" ]

null

cinder/backup/drivers/swift.py

alexpilotti/cinder-ci-fixes

c0ed2ab8cc6b1197e426cd6c58c3b582624d1cfd

[ "Apache-2.0" ]

null

# Copyright (C) 2012 Hewlett-Packard Development Company, L.P. # Copyright (c) 2014 TrilioData, Inc # Copyright (c) 2015 EMC Corporation # Copyright (C) 2015 Kevin Fox <kevin@efox.cc> # Copyright (C) 2015 Tom Barron <tpb@dyncloud.net> # All Rights Reserved. # # Licensed under the Apache License, Version 2.0 (the "License"); you may # not use this file except in compliance with the License. You may obtain # a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, WITHOUT # WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the # License for the specific language governing permissions and limitations # under the License. """Implementation of a backup service that uses Swift as the backend **Related Flags** :backup_swift_url: The URL of the Swift endpoint (default: None, use catalog). :swift_catalog_info: Info to match when looking for swift in the service ' catalog. :backup_swift_object_size: The size in bytes of the Swift objects used for volume backups (default: 52428800). :backup_swift_retry_attempts: The number of retries to make for Swift operations (default: 10). :backup_swift_retry_backoff: The backoff time in seconds between retrying failed Swift operations (default: 10). :backup_compression_algorithm: Compression algorithm to use for volume backups. Supported options are: None (to disable), zlib and bz2 (default: zlib) """ import hashlib import socket from oslo_config import cfg from oslo_log import log as logging from oslo_utils import timeutils import six from swiftclient import client as swift from cinder.backup import chunkeddriver from cinder import exception from cinder.i18n import _ from cinder.i18n import _LE LOG = logging.getLogger(__name__) swiftbackup_service_opts = [ cfg.StrOpt('backup_swift_url', default=None, help='The URL of the Swift endpoint'), cfg.StrOpt('swift_catalog_info', default='object-store:swift:publicURL', help='Info to match when looking for swift in the service ' 'catalog. Format is: separated values of the form: ' '<service_type>:<service_name>:<endpoint_type> - ' 'Only used if backup_swift_url is unset'), cfg.StrOpt('backup_swift_auth', default='per_user', help='Swift authentication mechanism'), cfg.StrOpt('backup_swift_auth_version', default='1', help='Swift authentication version. Specify "1" for auth 1.0' ', or "2" for auth 2.0'), cfg.StrOpt('backup_swift_tenant', default=None, help='Swift tenant/account name. Required when connecting' ' to an auth 2.0 system'), cfg.StrOpt('backup_swift_user', default=None, help='Swift user name'), cfg.StrOpt('backup_swift_key', default=None, help='Swift key for authentication'), cfg.StrOpt('backup_swift_container', default='volumebackups', help='The default Swift container to use'), cfg.IntOpt('backup_swift_object_size', default=52428800, help='The size in bytes of Swift backup objects'), cfg.IntOpt('backup_swift_block_size', default=32768, help='The size in bytes that changes are tracked ' 'for incremental backups. backup_swift_object_size ' 'has to be multiple of backup_swift_block_size.'), cfg.IntOpt('backup_swift_retry_attempts', default=3, help='The number of retries to make for Swift operations'), cfg.IntOpt('backup_swift_retry_backoff', default=2, help='The backoff time in seconds between Swift retries'), cfg.BoolOpt('backup_swift_enable_progress_timer', default=True, help='Enable or Disable the timer to send the periodic ' 'progress notifications to Ceilometer when backing ' 'up the volume to the Swift backend storage. The ' 'default value is True to enable the timer.'), ] CONF = cfg.CONF CONF.register_opts(swiftbackup_service_opts) class SwiftBackupDriver(chunkeddriver.ChunkedBackupDriver): """Provides backup, restore and delete of backup objects within Swift.""" def __init__(self, context, db_driver=None): chunk_size_bytes = CONF.backup_swift_object_size sha_block_size_bytes = CONF.backup_swift_block_size backup_default_container = CONF.backup_swift_container enable_progress_timer = CONF.backup_swift_enable_progress_timer super(SwiftBackupDriver, self).__init__(context, chunk_size_bytes, sha_block_size_bytes, backup_default_container, enable_progress_timer, db_driver) if CONF.backup_swift_url is None: self.swift_url = None info = CONF.swift_catalog_info try: service_type, service_name, endpoint_type = info.split(':') except ValueError: raise exception.BackupDriverException(_( "Failed to parse the configuration option " "'swift_catalog_info', must be in the form " "<service_type>:<service_name>:<endpoint_type>")) for entry in context.service_catalog: if entry.get('type') == service_type: self.swift_url = entry.get( 'endpoints')[0].get(endpoint_type) else: self.swift_url = '%s%s' % (CONF.backup_swift_url, context.project_id) if self.swift_url is None: raise exception.BackupDriverException(_( "Could not determine which Swift endpoint to use. This can " " either be set in the service catalog or with the " " cinder.conf config option 'backup_swift_url'.")) LOG.debug("Using swift URL %s", self.swift_url) self.swift_attempts = CONF.backup_swift_retry_attempts self.swift_backoff = CONF.backup_swift_retry_backoff LOG.debug('Connect to %s in "%s" mode', CONF.backup_swift_url, CONF.backup_swift_auth) if CONF.backup_swift_auth == 'single_user': if CONF.backup_swift_user is None: LOG.error(_LE("single_user auth mode enabled, " "but %(param)s not set"), {'param': 'backup_swift_user'}) raise exception.ParameterNotFound(param='backup_swift_user') self.conn = swift.Connection( authurl=CONF.backup_swift_url, auth_version=CONF.backup_swift_auth_version, tenant_name=CONF.backup_swift_tenant, user=CONF.backup_swift_user, key=CONF.backup_swift_key, retries=self.swift_attempts, starting_backoff=self.swift_backoff) else: self.conn = swift.Connection(retries=self.swift_attempts, preauthurl=self.swift_url, preauthtoken=self.context.auth_token, starting_backoff=self.swift_backoff) class SwiftObjectWriter: def __init__(self, container, object_name, conn): self.container = container self.object_name = object_name self.conn = conn self.data = '' def __enter__(self): return self def __exit__(self, exc_type, exc_value, traceback): self.close() def write(self, data): self.data += data def close(self): reader = six.StringIO(self.data) try: etag = self.conn.put_object(self.container, self.object_name, reader, content_length=reader.len) except socket.error as err: raise exception.SwiftConnectionFailed(reason=err) LOG.debug('swift MD5 for %(object_name)s: %(etag)s', {'object_name': self.object_name, 'etag': etag, }) md5 = hashlib.md5(self.data).hexdigest() LOG.debug('backup MD5 for %(object_name)s: %(md5)s', {'object_name': self.object_name, 'md5': md5}) if etag != md5: err = _('error writing object to swift, MD5 of object in ' 'swift %(etag)s is not the same as MD5 of object sent ' 'to swift %(md5)s'), {'etag': etag, 'md5': md5} raise exception.InvalidBackup(reason=err) return md5 class SwiftObjectReader: def __init__(self, container, object_name, conn): self.container = container self.object_name = object_name self.conn = conn def __enter__(self): return self def __exit__(self, exc_type, exc_value, traceback): pass def read(self): try: (_resp, body) = self.conn.get_object(self.container, self.object_name) except socket.error as err: raise exception.SwiftConnectionFailed(reason=err) return body def put_container(self, container): """Create the container if needed. No failure if it pre-exists.""" try: self.conn.put_container(container) except socket.error as err: raise exception.SwiftConnectionFailed(reason=err) return def get_container_entries(self, container, prefix): """Get container entry names""" try: swift_objects = self.conn.get_container(container, prefix=prefix, full_listing=True)[1] except socket.error as err: raise exception.SwiftConnectionFailed(reason=err) swift_object_names = [swift_obj['name'] for swift_obj in swift_objects] return swift_object_names def get_object_writer(self, container, object_name, extra_metadata=None): """Returns a writer object that stores a chunk of volume data in a Swift object store. """ return self.SwiftObjectWriter(container, object_name, self.conn) def get_object_reader(self, container, object_name, extra_metadata=None): """Returns a reader object that retrieves a chunk of backed-up volume data from a Swift object store. """ return self.SwiftObjectReader(container, object_name, self.conn) def delete_object(self, container, object_name): """Deletes a backup object from a Swift object store.""" try: self.conn.delete_object(container, object_name) except socket.error as err: raise exception.SwiftConnectionFailed(reason=err) def _generate_object_name_prefix(self, backup): """Generates a Swift backup object name prefix.""" az = 'az_%s' % self.az backup_name = '%s_backup_%s' % (az, backup['id']) volume = 'volume_%s' % (backup['volume_id']) timestamp = timeutils.strtime(fmt="%Y%m%d%H%M%S") prefix = volume + '/' + timestamp + '/' + backup_name LOG.debug('generate_object_name_prefix: %s', prefix) return prefix def update_container_name(self, backup, container): """Use the container name as provided - don't update.""" return container def get_extra_metadata(self, backup, volume): """Swift driver does not use any extra metadata.""" return None def get_backup_driver(context): return SwiftBackupDriver(context)

43.842105

82

0.595118

import hashlib import socket from oslo_config import cfg from oslo_log import log as logging from oslo_utils import timeutils import six from swiftclient import client as swift from cinder.backup import chunkeddriver from cinder import exception from cinder.i18n import _ from cinder.i18n import _LE LOG = logging.getLogger(__name__) swiftbackup_service_opts = [ cfg.StrOpt('backup_swift_url', default=None, help='The URL of the Swift endpoint'), cfg.StrOpt('swift_catalog_info', default='object-store:swift:publicURL', help='Info to match when looking for swift in the service ' 'catalog. Format is: separated values of the form: ' '<service_type>:<service_name>:<endpoint_type> - ' 'Only used if backup_swift_url is unset'), cfg.StrOpt('backup_swift_auth', default='per_user', help='Swift authentication mechanism'), cfg.StrOpt('backup_swift_auth_version', default='1', help='Swift authentication version. Specify "1" for auth 1.0' ', or "2" for auth 2.0'), cfg.StrOpt('backup_swift_tenant', default=None, help='Swift tenant/account name. Required when connecting' ' to an auth 2.0 system'), cfg.StrOpt('backup_swift_user', default=None, help='Swift user name'), cfg.StrOpt('backup_swift_key', default=None, help='Swift key for authentication'), cfg.StrOpt('backup_swift_container', default='volumebackups', help='The default Swift container to use'), cfg.IntOpt('backup_swift_object_size', default=52428800, help='The size in bytes of Swift backup objects'), cfg.IntOpt('backup_swift_block_size', default=32768, help='The size in bytes that changes are tracked ' 'for incremental backups. backup_swift_object_size ' 'has to be multiple of backup_swift_block_size.'), cfg.IntOpt('backup_swift_retry_attempts', default=3, help='The number of retries to make for Swift operations'), cfg.IntOpt('backup_swift_retry_backoff', default=2, help='The backoff time in seconds between Swift retries'), cfg.BoolOpt('backup_swift_enable_progress_timer', default=True, help='Enable or Disable the timer to send the periodic ' 'progress notifications to Ceilometer when backing ' 'up the volume to the Swift backend storage. The ' 'default value is True to enable the timer.'), ] CONF = cfg.CONF CONF.register_opts(swiftbackup_service_opts) class SwiftBackupDriver(chunkeddriver.ChunkedBackupDriver): def __init__(self, context, db_driver=None): chunk_size_bytes = CONF.backup_swift_object_size sha_block_size_bytes = CONF.backup_swift_block_size backup_default_container = CONF.backup_swift_container enable_progress_timer = CONF.backup_swift_enable_progress_timer super(SwiftBackupDriver, self).__init__(context, chunk_size_bytes, sha_block_size_bytes, backup_default_container, enable_progress_timer, db_driver) if CONF.backup_swift_url is None: self.swift_url = None info = CONF.swift_catalog_info try: service_type, service_name, endpoint_type = info.split(':') except ValueError: raise exception.BackupDriverException(_( "Failed to parse the configuration option " "'swift_catalog_info', must be in the form " "<service_type>:<service_name>:<endpoint_type>")) for entry in context.service_catalog: if entry.get('type') == service_type: self.swift_url = entry.get( 'endpoints')[0].get(endpoint_type) else: self.swift_url = '%s%s' % (CONF.backup_swift_url, context.project_id) if self.swift_url is None: raise exception.BackupDriverException(_( "Could not determine which Swift endpoint to use. This can " " either be set in the service catalog or with the " " cinder.conf config option 'backup_swift_url'.")) LOG.debug("Using swift URL %s", self.swift_url) self.swift_attempts = CONF.backup_swift_retry_attempts self.swift_backoff = CONF.backup_swift_retry_backoff LOG.debug('Connect to %s in "%s" mode', CONF.backup_swift_url, CONF.backup_swift_auth) if CONF.backup_swift_auth == 'single_user': if CONF.backup_swift_user is None: LOG.error(_LE("single_user auth mode enabled, " "but %(param)s not set"), {'param': 'backup_swift_user'}) raise exception.ParameterNotFound(param='backup_swift_user') self.conn = swift.Connection( authurl=CONF.backup_swift_url, auth_version=CONF.backup_swift_auth_version, tenant_name=CONF.backup_swift_tenant, user=CONF.backup_swift_user, key=CONF.backup_swift_key, retries=self.swift_attempts, starting_backoff=self.swift_backoff) else: self.conn = swift.Connection(retries=self.swift_attempts, preauthurl=self.swift_url, preauthtoken=self.context.auth_token, starting_backoff=self.swift_backoff) class SwiftObjectWriter: def __init__(self, container, object_name, conn): self.container = container self.object_name = object_name self.conn = conn self.data = '' def __enter__(self): return self def __exit__(self, exc_type, exc_value, traceback): self.close() def write(self, data): self.data += data def close(self): reader = six.StringIO(self.data) try: etag = self.conn.put_object(self.container, self.object_name, reader, content_length=reader.len) except socket.error as err: raise exception.SwiftConnectionFailed(reason=err) LOG.debug('swift MD5 for %(object_name)s: %(etag)s', {'object_name': self.object_name, 'etag': etag, }) md5 = hashlib.md5(self.data).hexdigest() LOG.debug('backup MD5 for %(object_name)s: %(md5)s', {'object_name': self.object_name, 'md5': md5}) if etag != md5: err = _('error writing object to swift, MD5 of object in ' 'swift %(etag)s is not the same as MD5 of object sent ' 'to swift %(md5)s'), {'etag': etag, 'md5': md5} raise exception.InvalidBackup(reason=err) return md5 class SwiftObjectReader: def __init__(self, container, object_name, conn): self.container = container self.object_name = object_name self.conn = conn def __enter__(self): return self def __exit__(self, exc_type, exc_value, traceback): pass def read(self): try: (_resp, body) = self.conn.get_object(self.container, self.object_name) except socket.error as err: raise exception.SwiftConnectionFailed(reason=err) return body def put_container(self, container): try: self.conn.put_container(container) except socket.error as err: raise exception.SwiftConnectionFailed(reason=err) return def get_container_entries(self, container, prefix): try: swift_objects = self.conn.get_container(container, prefix=prefix, full_listing=True)[1] except socket.error as err: raise exception.SwiftConnectionFailed(reason=err) swift_object_names = [swift_obj['name'] for swift_obj in swift_objects] return swift_object_names def get_object_writer(self, container, object_name, extra_metadata=None): return self.SwiftObjectWriter(container, object_name, self.conn) def get_object_reader(self, container, object_name, extra_metadata=None): return self.SwiftObjectReader(container, object_name, self.conn) def delete_object(self, container, object_name): try: self.conn.delete_object(container, object_name) except socket.error as err: raise exception.SwiftConnectionFailed(reason=err) def _generate_object_name_prefix(self, backup): az = 'az_%s' % self.az backup_name = '%s_backup_%s' % (az, backup['id']) volume = 'volume_%s' % (backup['volume_id']) timestamp = timeutils.strtime(fmt="%Y%m%d%H%M%S") prefix = volume + '/' + timestamp + '/' + backup_name LOG.debug('generate_object_name_prefix: %s', prefix) return prefix def update_container_name(self, backup, container): return container def get_extra_metadata(self, backup, volume): return None def get_backup_driver(context): return SwiftBackupDriver(context)

true

1c302b36a64e07516c35eec3aeae4bd8e31bf0eb

14,805

py

Python

sdk/python/pulumi_azure_native/redhatopenshift/v20200430/_inputs.py

sebtelko/pulumi-azure-native

711ec021b5c73da05611c56c8a35adb0ce3244e4

[ "Apache-2.0" ]

null

sdk/python/pulumi_azure_native/redhatopenshift/v20200430/_inputs.py

sebtelko/pulumi-azure-native

711ec021b5c73da05611c56c8a35adb0ce3244e4

[ "Apache-2.0" ]

null

sdk/python/pulumi_azure_native/redhatopenshift/v20200430/_inputs.py

sebtelko/pulumi-azure-native

711ec021b5c73da05611c56c8a35adb0ce3244e4

[ "Apache-2.0" ]

null

# coding=utf-8 # *** WARNING: this file was generated by the Pulumi SDK Generator. *** # *** Do not edit by hand unless you're certain you know what you are doing! *** import warnings import pulumi import pulumi.runtime from typing import Any, Mapping, Optional, Sequence, Union, overload from ... import _utilities __all__ = [ 'APIServerProfileArgs', 'ClusterProfileArgs', 'ConsoleProfileArgs', 'IngressProfileArgs', 'MasterProfileArgs', 'NetworkProfileArgs', 'ServicePrincipalProfileArgs', 'WorkerProfileArgs', ] @pulumi.input_type class APIServerProfileArgs: def __init__(__self__, *, ip: Optional[pulumi.Input[str]] = None, url: Optional[pulumi.Input[str]] = None, visibility: Optional[pulumi.Input[str]] = None): """ APIServerProfile represents an API server profile. :param pulumi.Input[str] ip: The IP of the cluster API server (immutable). :param pulumi.Input[str] url: The URL to access the cluster API server (immutable). :param pulumi.Input[str] visibility: API server visibility (immutable). """ if ip is not None: pulumi.set(__self__, "ip", ip) if url is not None: pulumi.set(__self__, "url", url) if visibility is not None: pulumi.set(__self__, "visibility", visibility) @property @pulumi.getter def ip(self) -> Optional[pulumi.Input[str]]: """ The IP of the cluster API server (immutable). """ return pulumi.get(self, "ip") @ip.setter def ip(self, value: Optional[pulumi.Input[str]]): pulumi.set(self, "ip", value) @property @pulumi.getter def url(self) -> Optional[pulumi.Input[str]]: """ The URL to access the cluster API server (immutable). """ return pulumi.get(self, "url") @url.setter def url(self, value: Optional[pulumi.Input[str]]): pulumi.set(self, "url", value) @property @pulumi.getter def visibility(self) -> Optional[pulumi.Input[str]]: """ API server visibility (immutable). """ return pulumi.get(self, "visibility") @visibility.setter def visibility(self, value: Optional[pulumi.Input[str]]): pulumi.set(self, "visibility", value) @pulumi.input_type class ClusterProfileArgs: def __init__(__self__, *, domain: Optional[pulumi.Input[str]] = None, pull_secret: Optional[pulumi.Input[str]] = None, resource_group_id: Optional[pulumi.Input[str]] = None, version: Optional[pulumi.Input[str]] = None): """ ClusterProfile represents a cluster profile. :param pulumi.Input[str] domain: The domain for the cluster (immutable). :param pulumi.Input[str] pull_secret: The pull secret for the cluster (immutable). :param pulumi.Input[str] resource_group_id: The ID of the cluster resource group (immutable). :param pulumi.Input[str] version: The version of the cluster (immutable). """ if domain is not None: pulumi.set(__self__, "domain", domain) if pull_secret is not None: pulumi.set(__self__, "pull_secret", pull_secret) if resource_group_id is not None: pulumi.set(__self__, "resource_group_id", resource_group_id) if version is not None: pulumi.set(__self__, "version", version) @property @pulumi.getter def domain(self) -> Optional[pulumi.Input[str]]: """ The domain for the cluster (immutable). """ return pulumi.get(self, "domain") @domain.setter def domain(self, value: Optional[pulumi.Input[str]]): pulumi.set(self, "domain", value) @property @pulumi.getter(name="pullSecret") def pull_secret(self) -> Optional[pulumi.Input[str]]: """ The pull secret for the cluster (immutable). """ return pulumi.get(self, "pull_secret") @pull_secret.setter def pull_secret(self, value: Optional[pulumi.Input[str]]): pulumi.set(self, "pull_secret", value) @property @pulumi.getter(name="resourceGroupId") def resource_group_id(self) -> Optional[pulumi.Input[str]]: """ The ID of the cluster resource group (immutable). """ return pulumi.get(self, "resource_group_id") @resource_group_id.setter def resource_group_id(self, value: Optional[pulumi.Input[str]]): pulumi.set(self, "resource_group_id", value) @property @pulumi.getter def version(self) -> Optional[pulumi.Input[str]]: """ The version of the cluster (immutable). """ return pulumi.get(self, "version") @version.setter def version(self, value: Optional[pulumi.Input[str]]): pulumi.set(self, "version", value) @pulumi.input_type class ConsoleProfileArgs: def __init__(__self__, *, url: Optional[pulumi.Input[str]] = None): """ ConsoleProfile represents a console profile. :param pulumi.Input[str] url: The URL to access the cluster console (immutable). """ if url is not None: pulumi.set(__self__, "url", url) @property @pulumi.getter def url(self) -> Optional[pulumi.Input[str]]: """ The URL to access the cluster console (immutable). """ return pulumi.get(self, "url") @url.setter def url(self, value: Optional[pulumi.Input[str]]): pulumi.set(self, "url", value) @pulumi.input_type class IngressProfileArgs: def __init__(__self__, *, ip: Optional[pulumi.Input[str]] = None, name: Optional[pulumi.Input[str]] = None, visibility: Optional[pulumi.Input[str]] = None): """ IngressProfile represents an ingress profile. :param pulumi.Input[str] ip: The IP of the ingress (immutable). :param pulumi.Input[str] name: The ingress profile name. Must be "default" (immutable). :param pulumi.Input[str] visibility: Ingress visibility (immutable). """ if ip is not None: pulumi.set(__self__, "ip", ip) if name is not None: pulumi.set(__self__, "name", name) if visibility is not None: pulumi.set(__self__, "visibility", visibility) @property @pulumi.getter def ip(self) -> Optional[pulumi.Input[str]]: """ The IP of the ingress (immutable). """ return pulumi.get(self, "ip") @ip.setter def ip(self, value: Optional[pulumi.Input[str]]): pulumi.set(self, "ip", value) @property @pulumi.getter def name(self) -> Optional[pulumi.Input[str]]: """ The ingress profile name. Must be "default" (immutable). """ return pulumi.get(self, "name") @name.setter def name(self, value: Optional[pulumi.Input[str]]): pulumi.set(self, "name", value) @property @pulumi.getter def visibility(self) -> Optional[pulumi.Input[str]]: """ Ingress visibility (immutable). """ return pulumi.get(self, "visibility") @visibility.setter def visibility(self, value: Optional[pulumi.Input[str]]): pulumi.set(self, "visibility", value) @pulumi.input_type class MasterProfileArgs: def __init__(__self__, *, subnet_id: Optional[pulumi.Input[str]] = None, vm_size: Optional[pulumi.Input[str]] = None): """ MasterProfile represents a master profile. :param pulumi.Input[str] subnet_id: The Azure resource ID of the master subnet (immutable). :param pulumi.Input[str] vm_size: The size of the master VMs (immutable). """ if subnet_id is not None: pulumi.set(__self__, "subnet_id", subnet_id) if vm_size is not None: pulumi.set(__self__, "vm_size", vm_size) @property @pulumi.getter(name="subnetId") def subnet_id(self) -> Optional[pulumi.Input[str]]: """ The Azure resource ID of the master subnet (immutable). """ return pulumi.get(self, "subnet_id") @subnet_id.setter def subnet_id(self, value: Optional[pulumi.Input[str]]): pulumi.set(self, "subnet_id", value) @property @pulumi.getter(name="vmSize") def vm_size(self) -> Optional[pulumi.Input[str]]: """ The size of the master VMs (immutable). """ return pulumi.get(self, "vm_size") @vm_size.setter def vm_size(self, value: Optional[pulumi.Input[str]]): pulumi.set(self, "vm_size", value) @pulumi.input_type class NetworkProfileArgs: def __init__(__self__, *, pod_cidr: Optional[pulumi.Input[str]] = None, service_cidr: Optional[pulumi.Input[str]] = None): """ NetworkProfile represents a network profile. :param pulumi.Input[str] pod_cidr: The CIDR used for OpenShift/Kubernetes Pods (immutable). :param pulumi.Input[str] service_cidr: The CIDR used for OpenShift/Kubernetes Services (immutable). """ if pod_cidr is not None: pulumi.set(__self__, "pod_cidr", pod_cidr) if service_cidr is not None: pulumi.set(__self__, "service_cidr", service_cidr) @property @pulumi.getter(name="podCidr") def pod_cidr(self) -> Optional[pulumi.Input[str]]: """ The CIDR used for OpenShift/Kubernetes Pods (immutable). """ return pulumi.get(self, "pod_cidr") @pod_cidr.setter def pod_cidr(self, value: Optional[pulumi.Input[str]]): pulumi.set(self, "pod_cidr", value) @property @pulumi.getter(name="serviceCidr") def service_cidr(self) -> Optional[pulumi.Input[str]]: """ The CIDR used for OpenShift/Kubernetes Services (immutable). """ return pulumi.get(self, "service_cidr") @service_cidr.setter def service_cidr(self, value: Optional[pulumi.Input[str]]): pulumi.set(self, "service_cidr", value) @pulumi.input_type class ServicePrincipalProfileArgs: def __init__(__self__, *, client_id: Optional[pulumi.Input[str]] = None, client_secret: Optional[pulumi.Input[str]] = None): """ ServicePrincipalProfile represents a service principal profile. :param pulumi.Input[str] client_id: The client ID used for the cluster (immutable). :param pulumi.Input[str] client_secret: The client secret used for the cluster (immutable). """ if client_id is not None: pulumi.set(__self__, "client_id", client_id) if client_secret is not None: pulumi.set(__self__, "client_secret", client_secret) @property @pulumi.getter(name="clientId") def client_id(self) -> Optional[pulumi.Input[str]]: """ The client ID used for the cluster (immutable). """ return pulumi.get(self, "client_id") @client_id.setter def client_id(self, value: Optional[pulumi.Input[str]]): pulumi.set(self, "client_id", value) @property @pulumi.getter(name="clientSecret") def client_secret(self) -> Optional[pulumi.Input[str]]: """ The client secret used for the cluster (immutable). """ return pulumi.get(self, "client_secret") @client_secret.setter def client_secret(self, value: Optional[pulumi.Input[str]]): pulumi.set(self, "client_secret", value) @pulumi.input_type class WorkerProfileArgs: def __init__(__self__, *, count: Optional[pulumi.Input[int]] = None, disk_size_gb: Optional[pulumi.Input[int]] = None, name: Optional[pulumi.Input[str]] = None, subnet_id: Optional[pulumi.Input[str]] = None, vm_size: Optional[pulumi.Input[str]] = None): """ WorkerProfile represents a worker profile. :param pulumi.Input[int] count: The number of worker VMs. Must be between 3 and 20 (immutable). :param pulumi.Input[int] disk_size_gb: The disk size of the worker VMs. Must be 128 or greater (immutable). :param pulumi.Input[str] name: The worker profile name. Must be "worker" (immutable). :param pulumi.Input[str] subnet_id: The Azure resource ID of the worker subnet (immutable). :param pulumi.Input[str] vm_size: The size of the worker VMs (immutable). """ if count is not None: pulumi.set(__self__, "count", count) if disk_size_gb is not None: pulumi.set(__self__, "disk_size_gb", disk_size_gb) if name is not None: pulumi.set(__self__, "name", name) if subnet_id is not None: pulumi.set(__self__, "subnet_id", subnet_id) if vm_size is not None: pulumi.set(__self__, "vm_size", vm_size) @property @pulumi.getter def count(self) -> Optional[pulumi.Input[int]]: """ The number of worker VMs. Must be between 3 and 20 (immutable). """ return pulumi.get(self, "count") @count.setter def count(self, value: Optional[pulumi.Input[int]]): pulumi.set(self, "count", value) @property @pulumi.getter(name="diskSizeGB") def disk_size_gb(self) -> Optional[pulumi.Input[int]]: """ The disk size of the worker VMs. Must be 128 or greater (immutable). """ return pulumi.get(self, "disk_size_gb") @disk_size_gb.setter def disk_size_gb(self, value: Optional[pulumi.Input[int]]): pulumi.set(self, "disk_size_gb", value) @property @pulumi.getter def name(self) -> Optional[pulumi.Input[str]]: """ The worker profile name. Must be "worker" (immutable). """ return pulumi.get(self, "name") @name.setter def name(self, value: Optional[pulumi.Input[str]]): pulumi.set(self, "name", value) @property @pulumi.getter(name="subnetId") def subnet_id(self) -> Optional[pulumi.Input[str]]: """ The Azure resource ID of the worker subnet (immutable). """ return pulumi.get(self, "subnet_id") @subnet_id.setter def subnet_id(self, value: Optional[pulumi.Input[str]]): pulumi.set(self, "subnet_id", value) @property @pulumi.getter(name="vmSize") def vm_size(self) -> Optional[pulumi.Input[str]]: """ The size of the worker VMs (immutable). """ return pulumi.get(self, "vm_size") @vm_size.setter def vm_size(self, value: Optional[pulumi.Input[str]]): pulumi.set(self, "vm_size", value)

33.80137

116

0.614725

import warnings import pulumi import pulumi.runtime from typing import Any, Mapping, Optional, Sequence, Union, overload from ... import _utilities __all__ = [ 'APIServerProfileArgs', 'ClusterProfileArgs', 'ConsoleProfileArgs', 'IngressProfileArgs', 'MasterProfileArgs', 'NetworkProfileArgs', 'ServicePrincipalProfileArgs', 'WorkerProfileArgs', ] @pulumi.input_type class APIServerProfileArgs: def __init__(__self__, *, ip: Optional[pulumi.Input[str]] = None, url: Optional[pulumi.Input[str]] = None, visibility: Optional[pulumi.Input[str]] = None): if ip is not None: pulumi.set(__self__, "ip", ip) if url is not None: pulumi.set(__self__, "url", url) if visibility is not None: pulumi.set(__self__, "visibility", visibility) @property @pulumi.getter def ip(self) -> Optional[pulumi.Input[str]]: return pulumi.get(self, "ip") @ip.setter def ip(self, value: Optional[pulumi.Input[str]]): pulumi.set(self, "ip", value) @property @pulumi.getter def url(self) -> Optional[pulumi.Input[str]]: return pulumi.get(self, "url") @url.setter def url(self, value: Optional[pulumi.Input[str]]): pulumi.set(self, "url", value) @property @pulumi.getter def visibility(self) -> Optional[pulumi.Input[str]]: return pulumi.get(self, "visibility") @visibility.setter def visibility(self, value: Optional[pulumi.Input[str]]): pulumi.set(self, "visibility", value) @pulumi.input_type class ClusterProfileArgs: def __init__(__self__, *, domain: Optional[pulumi.Input[str]] = None, pull_secret: Optional[pulumi.Input[str]] = None, resource_group_id: Optional[pulumi.Input[str]] = None, version: Optional[pulumi.Input[str]] = None): if domain is not None: pulumi.set(__self__, "domain", domain) if pull_secret is not None: pulumi.set(__self__, "pull_secret", pull_secret) if resource_group_id is not None: pulumi.set(__self__, "resource_group_id", resource_group_id) if version is not None: pulumi.set(__self__, "version", version) @property @pulumi.getter def domain(self) -> Optional[pulumi.Input[str]]: return pulumi.get(self, "domain") @domain.setter def domain(self, value: Optional[pulumi.Input[str]]): pulumi.set(self, "domain", value) @property @pulumi.getter(name="pullSecret") def pull_secret(self) -> Optional[pulumi.Input[str]]: return pulumi.get(self, "pull_secret") @pull_secret.setter def pull_secret(self, value: Optional[pulumi.Input[str]]): pulumi.set(self, "pull_secret", value) @property @pulumi.getter(name="resourceGroupId") def resource_group_id(self) -> Optional[pulumi.Input[str]]: return pulumi.get(self, "resource_group_id") @resource_group_id.setter def resource_group_id(self, value: Optional[pulumi.Input[str]]): pulumi.set(self, "resource_group_id", value) @property @pulumi.getter def version(self) -> Optional[pulumi.Input[str]]: return pulumi.get(self, "version") @version.setter def version(self, value: Optional[pulumi.Input[str]]): pulumi.set(self, "version", value) @pulumi.input_type class ConsoleProfileArgs: def __init__(__self__, *, url: Optional[pulumi.Input[str]] = None): if url is not None: pulumi.set(__self__, "url", url) @property @pulumi.getter def url(self) -> Optional[pulumi.Input[str]]: return pulumi.get(self, "url") @url.setter def url(self, value: Optional[pulumi.Input[str]]): pulumi.set(self, "url", value) @pulumi.input_type class IngressProfileArgs: def __init__(__self__, *, ip: Optional[pulumi.Input[str]] = None, name: Optional[pulumi.Input[str]] = None, visibility: Optional[pulumi.Input[str]] = None): if ip is not None: pulumi.set(__self__, "ip", ip) if name is not None: pulumi.set(__self__, "name", name) if visibility is not None: pulumi.set(__self__, "visibility", visibility) @property @pulumi.getter def ip(self) -> Optional[pulumi.Input[str]]: return pulumi.get(self, "ip") @ip.setter def ip(self, value: Optional[pulumi.Input[str]]): pulumi.set(self, "ip", value) @property @pulumi.getter def name(self) -> Optional[pulumi.Input[str]]: return pulumi.get(self, "name") @name.setter def name(self, value: Optional[pulumi.Input[str]]): pulumi.set(self, "name", value) @property @pulumi.getter def visibility(self) -> Optional[pulumi.Input[str]]: return pulumi.get(self, "visibility") @visibility.setter def visibility(self, value: Optional[pulumi.Input[str]]): pulumi.set(self, "visibility", value) @pulumi.input_type class MasterProfileArgs: def __init__(__self__, *, subnet_id: Optional[pulumi.Input[str]] = None, vm_size: Optional[pulumi.Input[str]] = None): if subnet_id is not None: pulumi.set(__self__, "subnet_id", subnet_id) if vm_size is not None: pulumi.set(__self__, "vm_size", vm_size) @property @pulumi.getter(name="subnetId") def subnet_id(self) -> Optional[pulumi.Input[str]]: return pulumi.get(self, "subnet_id") @subnet_id.setter def subnet_id(self, value: Optional[pulumi.Input[str]]): pulumi.set(self, "subnet_id", value) @property @pulumi.getter(name="vmSize") def vm_size(self) -> Optional[pulumi.Input[str]]: return pulumi.get(self, "vm_size") @vm_size.setter def vm_size(self, value: Optional[pulumi.Input[str]]): pulumi.set(self, "vm_size", value) @pulumi.input_type class NetworkProfileArgs: def __init__(__self__, *, pod_cidr: Optional[pulumi.Input[str]] = None, service_cidr: Optional[pulumi.Input[str]] = None): if pod_cidr is not None: pulumi.set(__self__, "pod_cidr", pod_cidr) if service_cidr is not None: pulumi.set(__self__, "service_cidr", service_cidr) @property @pulumi.getter(name="podCidr") def pod_cidr(self) -> Optional[pulumi.Input[str]]: return pulumi.get(self, "pod_cidr") @pod_cidr.setter def pod_cidr(self, value: Optional[pulumi.Input[str]]): pulumi.set(self, "pod_cidr", value) @property @pulumi.getter(name="serviceCidr") def service_cidr(self) -> Optional[pulumi.Input[str]]: return pulumi.get(self, "service_cidr") @service_cidr.setter def service_cidr(self, value: Optional[pulumi.Input[str]]): pulumi.set(self, "service_cidr", value) @pulumi.input_type class ServicePrincipalProfileArgs: def __init__(__self__, *, client_id: Optional[pulumi.Input[str]] = None, client_secret: Optional[pulumi.Input[str]] = None): if client_id is not None: pulumi.set(__self__, "client_id", client_id) if client_secret is not None: pulumi.set(__self__, "client_secret", client_secret) @property @pulumi.getter(name="clientId") def client_id(self) -> Optional[pulumi.Input[str]]: return pulumi.get(self, "client_id") @client_id.setter def client_id(self, value: Optional[pulumi.Input[str]]): pulumi.set(self, "client_id", value) @property @pulumi.getter(name="clientSecret") def client_secret(self) -> Optional[pulumi.Input[str]]: return pulumi.get(self, "client_secret") @client_secret.setter def client_secret(self, value: Optional[pulumi.Input[str]]): pulumi.set(self, "client_secret", value) @pulumi.input_type class WorkerProfileArgs: def __init__(__self__, *, count: Optional[pulumi.Input[int]] = None, disk_size_gb: Optional[pulumi.Input[int]] = None, name: Optional[pulumi.Input[str]] = None, subnet_id: Optional[pulumi.Input[str]] = None, vm_size: Optional[pulumi.Input[str]] = None): if count is not None: pulumi.set(__self__, "count", count) if disk_size_gb is not None: pulumi.set(__self__, "disk_size_gb", disk_size_gb) if name is not None: pulumi.set(__self__, "name", name) if subnet_id is not None: pulumi.set(__self__, "subnet_id", subnet_id) if vm_size is not None: pulumi.set(__self__, "vm_size", vm_size) @property @pulumi.getter def count(self) -> Optional[pulumi.Input[int]]: return pulumi.get(self, "count") @count.setter def count(self, value: Optional[pulumi.Input[int]]): pulumi.set(self, "count", value) @property @pulumi.getter(name="diskSizeGB") def disk_size_gb(self) -> Optional[pulumi.Input[int]]: return pulumi.get(self, "disk_size_gb") @disk_size_gb.setter def disk_size_gb(self, value: Optional[pulumi.Input[int]]): pulumi.set(self, "disk_size_gb", value) @property @pulumi.getter def name(self) -> Optional[pulumi.Input[str]]: return pulumi.get(self, "name") @name.setter def name(self, value: Optional[pulumi.Input[str]]): pulumi.set(self, "name", value) @property @pulumi.getter(name="subnetId") def subnet_id(self) -> Optional[pulumi.Input[str]]: return pulumi.get(self, "subnet_id") @subnet_id.setter def subnet_id(self, value: Optional[pulumi.Input[str]]): pulumi.set(self, "subnet_id", value) @property @pulumi.getter(name="vmSize") def vm_size(self) -> Optional[pulumi.Input[str]]: return pulumi.get(self, "vm_size") @vm_size.setter def vm_size(self, value: Optional[pulumi.Input[str]]): pulumi.set(self, "vm_size", value)

true

1c302b5bad3090eca8357dc6c7bb7abb57c6c22b

471

py

Python

terminator/display.py

radarsh/terminator

4979d9f57d4d2206114e401c4b7013db5f187f70

[ "Apache-2.0" ]

9

2015-02-27T16:21:26.000Z

2020-03-19T07:47:18.000Z

terminator/display.py

radarsh/bashmon

4979d9f57d4d2206114e401c4b7013db5f187f70

[ "Apache-2.0" ]

9

2015-03-02T09:46:09.000Z

2017-09-29T18:03:41.000Z

terminator/display.py

radarsh/bashmon

4979d9f57d4d2206114e401c4b7013db5f187f70

[ "Apache-2.0" ]

5

2015-03-13T14:14:34.000Z

2019-09-12T07:11:52.000Z

import os from platform import system import terminator.formatter as formatter import terminator.arguments as arguments def term_width(): return arguments.terminal_width or os.get_terminal_size().columns def clear_screen(): if system() == 'Windows': os.system('cls') else: os.system('clear') def repaint(jobs): clear_screen() for job in jobs: _formatter = formatter.Formatter(job) print(_formatter.job_display())

20.478261

69

0.694268

import os from platform import system import terminator.formatter as formatter import terminator.arguments as arguments def term_width(): return arguments.terminal_width or os.get_terminal_size().columns def clear_screen(): if system() == 'Windows': os.system('cls') else: os.system('clear') def repaint(jobs): clear_screen() for job in jobs: _formatter = formatter.Formatter(job) print(_formatter.job_display())

true

1c302bc8c309a1d8c1b579797a0a5f35ea31626b

351

py

Python

test/linkage-agent/manual/time_test_manual_test_10k-x-6.py

greshje/linkage-agent-tools

bc3a041c74cfe96950a0e3c011dd6a0185ad912d

[ "Apache-2.0" ]

1

2020-06-25T19:57:56.000Z

test/linkage-agent/manual/time_test_manual_test_10k-x-6.py

greshje/linkage-agent-tools

bc3a041c74cfe96950a0e3c011dd6a0185ad912d

[ "Apache-2.0" ]

1

2021-10-01T15:13:15.000Z

test/linkage-agent/manual/time_test_manual_test_10k-x-6.py

greshje/linkage-agent-tools

bc3a041c74cfe96950a0e3c011dd6a0185ad912d

[ "Apache-2.0" ]

null

# ------ # # This test is not part of the automated test suite. It is intended to be # run manually after the data folder has been copied to C:\test. # # This module exists primarily to enable debugging of the process called by the cmd line # # ------ import time_test as tt if __name__ == "__main__": tt.run_test("C:\\test\\test-set-10k-x-6")

25.071429

88

0.68661

import time_test as tt if __name__ == "__main__": tt.run_test("C:\\test\\test-set-10k-x-6")

true

1c302bf040036bd5a89e90813fd96cc42d886097

5,141

py

Python

peeringdb_server/templatetags/util.py

WEBZCC/peeringdb

9f74fb8a1148eb613179f9fb16bb5d17b86f9c04

[ "BSD-2-Clause" ]

null

peeringdb_server/templatetags/util.py

WEBZCC/peeringdb

9f74fb8a1148eb613179f9fb16bb5d17b86f9c04

[ "BSD-2-Clause" ]

null

peeringdb_server/templatetags/util.py

WEBZCC/peeringdb

9f74fb8a1148eb613179f9fb16bb5d17b86f9c04

[ "BSD-2-Clause" ]

null

from django import template from django.utils.translation import ugettext_lazy as _ from django.utils.safestring import mark_safe import datetime from peeringdb_server.models import ( InternetExchange, Network, Facility, Organization, PARTNERSHIP_LEVELS, format_speed, ) from peeringdb_server.views import DoNotRender from peeringdb_server.org_admin_views import permission_ids from peeringdb_server.inet import RdapException from django_countries import countries from django_namespace_perms.util import get_permission_flag import tld import random import markdown import bleach countries_dict = dict(countries) register = template.Library() @register.filter def editable_list_value(row): if row.get("value") or row.get("value_label"): return _(row.get("value_label", row.get("value"))) elif row.get("blank") and row.get("value") == "": return row.get("blank") return "" @register.filter def shuffle(val): rmp = [r for r in val] random.shuffle(rmp) return rmp @register.filter def blank_sub(val, row): if val == "" and row.get("blank"): return row.get("blank") return val @register.filter def org_permission_id_xl(org, id): return permission_ids(org).get(id) @register.filter def check_perms(v, op): flg = get_permission_flag(op) return v & flg == flg @register.filter def user_org_group(org, user): if org.admin_usergroup.user_set.filter(id=user.id).exists(): return "admin" elif org.usergroup.user_set.filter(id=user.id).exists(): return "member" return "" @register.filter def ownership_warning(org, user): email_domain = user.email.split("@")[1] b = False for url in [tld.get_tld(u) for u in org.urls]: if email_domain == url: b = True break if not b: for rdap in list(org.rdap_collect.values()): try: if user.validate_rdap_relationship(rdap): b = True break except RdapException as exc: # we don't need to do anything with the rdap exception here, as it will # be raised apropriately when the request is sent off pass if not b: return mark_safe( '<span class="attention">{}</span>'.format( _( "Your email address does not match the domain information we have on file for this organization." ) ) ) return "" @register.filter def long_country_name(v): if type(v) == str: return countries_dict.get(v, v) else: return v.name @register.filter def as_bool(v): if not v or v == "0": return False return True @register.filter def fallback(a, b): if not a: return b return a @register.filter def is_dict(value): return type(value) == dict @register.filter def is_bool(value): return type(value) == bool @register.filter def is_none(value): return type(value) is None @register.filter def none_blank(value): if value is None: return "" return value @register.filter def dont_render(value): return type(value) is DoNotRender @register.filter def age(dt): seconds = (datetime.datetime.now().replace(tzinfo=dt.tzinfo) - dt).total_seconds() if seconds < 60: return "%d %s" % (seconds, _("seconds ago")) elif seconds < 3600: return "%d %s" % (seconds / 60, _("minutes ago")) elif seconds < 86400: return "%d %s" % (seconds / 3600, _("hours ago")) else: return "%d %s" % (seconds / 86400, _("days ago")) @register.filter def ref_tag(value): if hasattr(value, "_handleref"): return value._handleref.tag elif value == "InternetExchange": return InternetExchange.handleref.tag elif value == "Network": return Network.handleref.tag elif value == "Facility": return Facility.handleref.tag elif value == "Organization": return Organization.handleref.tag return "unknown" @register.filter def autocomplete_preload_net(value): if not value: return "" qset = Network.objects.filter(status="ok", id__in=value.split(",")) return ",".join([f"{net.id};{net.name}" for net in qset]) @register.filter def pretty_speed(value): if not value: return "" try: return format_speed(value) except ValueError: return value @register.filter def partnership_label(level): return dict(PARTNERSHIP_LEVELS).get(level, "Unknown") @register.filter def render_markdown(value): markdown_tags = [ "h1", "h2", "h3", "h4", "h5", "h6", "b", "i", "strong", "em", "tt", "p", "br", "span", "div", "blockquote", "code", "hr", "ul", "ol", "li", "dd", "dt", "a", ] return bleach.clean( markdown.markdown(value), tags=markdown_tags, protocols=["http", "https"] )

21.876596

117

0.60922

from django import template from django.utils.translation import ugettext_lazy as _ from django.utils.safestring import mark_safe import datetime from peeringdb_server.models import ( InternetExchange, Network, Facility, Organization, PARTNERSHIP_LEVELS, format_speed, ) from peeringdb_server.views import DoNotRender from peeringdb_server.org_admin_views import permission_ids from peeringdb_server.inet import RdapException from django_countries import countries from django_namespace_perms.util import get_permission_flag import tld import random import markdown import bleach countries_dict = dict(countries) register = template.Library() @register.filter def editable_list_value(row): if row.get("value") or row.get("value_label"): return _(row.get("value_label", row.get("value"))) elif row.get("blank") and row.get("value") == "": return row.get("blank") return "" @register.filter def shuffle(val): rmp = [r for r in val] random.shuffle(rmp) return rmp @register.filter def blank_sub(val, row): if val == "" and row.get("blank"): return row.get("blank") return val @register.filter def org_permission_id_xl(org, id): return permission_ids(org).get(id) @register.filter def check_perms(v, op): flg = get_permission_flag(op) return v & flg == flg @register.filter def user_org_group(org, user): if org.admin_usergroup.user_set.filter(id=user.id).exists(): return "admin" elif org.usergroup.user_set.filter(id=user.id).exists(): return "member" return "" @register.filter def ownership_warning(org, user): email_domain = user.email.split("@")[1] b = False for url in [tld.get_tld(u) for u in org.urls]: if email_domain == url: b = True break if not b: for rdap in list(org.rdap_collect.values()): try: if user.validate_rdap_relationship(rdap): b = True break except RdapException as exc: # be raised apropriately when the request is sent off pass if not b: return mark_safe( '<span class="attention">{}</span>'.format( _( "Your email address does not match the domain information we have on file for this organization." ) ) ) return "" @register.filter def long_country_name(v): if type(v) == str: return countries_dict.get(v, v) else: return v.name @register.filter def as_bool(v): if not v or v == "0": return False return True @register.filter def fallback(a, b): if not a: return b return a @register.filter def is_dict(value): return type(value) == dict @register.filter def is_bool(value): return type(value) == bool @register.filter def is_none(value): return type(value) is None @register.filter def none_blank(value): if value is None: return "" return value @register.filter def dont_render(value): return type(value) is DoNotRender @register.filter def age(dt): seconds = (datetime.datetime.now().replace(tzinfo=dt.tzinfo) - dt).total_seconds() if seconds < 60: return "%d %s" % (seconds, _("seconds ago")) elif seconds < 3600: return "%d %s" % (seconds / 60, _("minutes ago")) elif seconds < 86400: return "%d %s" % (seconds / 3600, _("hours ago")) else: return "%d %s" % (seconds / 86400, _("days ago")) @register.filter def ref_tag(value): if hasattr(value, "_handleref"): return value._handleref.tag elif value == "InternetExchange": return InternetExchange.handleref.tag elif value == "Network": return Network.handleref.tag elif value == "Facility": return Facility.handleref.tag elif value == "Organization": return Organization.handleref.tag return "unknown" @register.filter def autocomplete_preload_net(value): if not value: return "" qset = Network.objects.filter(status="ok", id__in=value.split(",")) return ",".join([f"{net.id};{net.name}" for net in qset]) @register.filter def pretty_speed(value): if not value: return "" try: return format_speed(value) except ValueError: return value @register.filter def partnership_label(level): return dict(PARTNERSHIP_LEVELS).get(level, "Unknown") @register.filter def render_markdown(value): markdown_tags = [ "h1", "h2", "h3", "h4", "h5", "h6", "b", "i", "strong", "em", "tt", "p", "br", "span", "div", "blockquote", "code", "hr", "ul", "ol", "li", "dd", "dt", "a", ] return bleach.clean( markdown.markdown(value), tags=markdown_tags, protocols=["http", "https"] )

true

1c302c7b2dd41ddcf61c38ff298d35f5958f5fbe

1,663

py

Python

setup.py

massarom/pypackinit

c5860e60b6eaa5d66fab53e3795fd524618ca9da

[ "MIT" ]

null

setup.py

massarom/pypackinit

c5860e60b6eaa5d66fab53e3795fd524618ca9da

[ "MIT" ]

null

setup.py

massarom/pypackinit

c5860e60b6eaa5d66fab53e3795fd524618ca9da

[ "MIT" ]

null

# -*- coding: utf-8 -*- """Example setup.py file This example setup file is adapted from https://github.com/pypa/sampleproject and is not supposed to be and exahustive list of options accepted by the setuptools' function `setup`. You should read the respective documentation, which can be found at https://setuptools.readthedocs.io/en/latest/setuptools.html The original License and Copyright for this setup file follows: Copyright (c) 2016 The Python Packaging Authority (PyPA) Permission is hereby granted, free of charge, to any person obtaining a copy of this software and associated documentation files (the "Software"), to deal in the Software without restriction, including without limitation the rights to use, copy, modify, merge, publish, distribute, sublicense, and/or sell copies of the Software, and to permit persons to whom the Software is furnished to do so, subject to the following conditions: The above copyright notice and this permission notice shall be included in all copies or substantial portions of the Software. THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. """ from setuptools import setup, find_packages setup( py_modules=["pypackinit"], entry_points={"console_scripts": ["ppinit = pypackinit:main"]}, )

44.945946

81

0.790138

from setuptools import setup, find_packages setup( py_modules=["pypackinit"], entry_points={"console_scripts": ["ppinit = pypackinit:main"]}, )

true

1c302dc39798038ca1e819bf63f1a0d88093d9b5

2,279

py

Python

test_service.py

michhar/azureml-keras-yolov3-custom

3f52a48bf865a221e70432cfcb6e6afa73c3b001

[ "MIT" ]

12

2019-11-20T21:19:22.000Z

2021-11-09T11:32:35.000Z

test_service.py

michhar/azureml-keras-yolov3-custom

3f52a48bf865a221e70432cfcb6e6afa73c3b001

[ "MIT" ]

9

2019-11-16T21:07:07.000Z

2022-02-10T02:14:16.000Z

test_service.py

michhar/azureml-keras-yolov3-custom

3f52a48bf865a221e70432cfcb6e6afa73c3b001

[ "MIT" ]

6

2019-11-22T03:42:58.000Z

2021-08-28T03:51:21.000Z

""" Use Python requests to call web service Set an environment variable SCORING_URI to the scoring URL before running and set environment variable WEBSERVICE_KEY to the webservice key if in the cloud (omit if testing a local service). """ import requests from requests.exceptions import HTTPError import numpy as np import matplotlib.pyplot as plt import argparse import os import json from PIL import Image from io import BytesIO import base64 def arg_parse(): """ Parse arguments """ parser = argparse.ArgumentParser( description='This script is for calling the HTTP REST API for Azure ML cloud service') parser.add_argument("--image", dest='image', help="Image file", type=str) return parser.parse_args() def get_service(ws, name): """Get the web service object from Azure ML workspace that matches name""" webservices = ws.webservices service = None for servicename, webservice in webservices.items(): if name == servicename: service = webservice break return service def main(img_file): """Call Azure ML webservice, sending image and returning inference results""" scoring_uri = os.getenv('SCORING_URI', '') # Construction input data json string # input_data = plt.imread(img_file) # input_data = {"data": [input_data.tolist()] } pil_img = Image.open(img_file) buff = BytesIO() pil_img.save(buff, format="JPEG") new_image_string = json.dumps({'data': base64.b64encode(buff.getvalue()).decode("utf-8")}) with open('request.txt', 'w') as f: f.write(new_image_string) headers = {'Content-Type':'application/json', 'Authorization': 'Bearer ' + os.getenv('WEBSERVICE_KEY', '')} try: resp = requests.post(scoring_uri, new_image_string, headers=headers) # If the response was successful, no Exception will be raised resp.raise_for_status() except HTTPError as http_err: print(f'HTTP error occurred: {http_err}') except Exception as err: print(f'Other error occurred: {err}') else: print('Success!') print(resp.text) if __name__ == "__main__": args = arg_parse() main(args.image)

29.597403

111

0.66301

import requests from requests.exceptions import HTTPError import numpy as np import matplotlib.pyplot as plt import argparse import os import json from PIL import Image from io import BytesIO import base64 def arg_parse(): parser = argparse.ArgumentParser( description='This script is for calling the HTTP REST API for Azure ML cloud service') parser.add_argument("--image", dest='image', help="Image file", type=str) return parser.parse_args() def get_service(ws, name): webservices = ws.webservices service = None for servicename, webservice in webservices.items(): if name == servicename: service = webservice break return service def main(img_file): scoring_uri = os.getenv('SCORING_URI', '') pil_img = Image.open(img_file) buff = BytesIO() pil_img.save(buff, format="JPEG") new_image_string = json.dumps({'data': base64.b64encode(buff.getvalue()).decode("utf-8")}) with open('request.txt', 'w') as f: f.write(new_image_string) headers = {'Content-Type':'application/json', 'Authorization': 'Bearer ' + os.getenv('WEBSERVICE_KEY', '')} try: resp = requests.post(scoring_uri, new_image_string, headers=headers) resp.raise_for_status() except HTTPError as http_err: print(f'HTTP error occurred: {http_err}') except Exception as err: print(f'Other error occurred: {err}') else: print('Success!') print(resp.text) if __name__ == "__main__": args = arg_parse() main(args.image)

true

1c302e6be5a1a45bc57efd3bec3653f92d393f2b

654

py

Python

p9.py

JasonD1997/Machine-Learning-Programs

81e54ccaf2ca4bd7e2d79ed0e538f13cb355c0bf

[ "MIT" ]

null

p9.py

JasonD1997/Machine-Learning-Programs

81e54ccaf2ca4bd7e2d79ed0e538f13cb355c0bf

[ "MIT" ]

null

p9.py

JasonD1997/Machine-Learning-Programs

81e54ccaf2ca4bd7e2d79ed0e538f13cb355c0bf

[ "MIT" ]

null

from sklearn.model_selection import train_test_split from sklearn.neighbors import KNeighborsClassifier from sklearn.metrics import classification_report,confusion_matrix from sklearn import datasets iris=datasets.load_iris() iris_data=iris.data iris_labels=iris.target print(iris_data) print(iris_labels) x_train,x_test,y_train,y_test=train_test_split(iris_data,iris_labels,test_size=0.30) classifier=KNeighborsClassifier(n_neighbors=5) classifier.fit(x_train,y_train) y_pred=classifier.predict(x_test) print('confusion matrix is as follows') print(confusion_matrix(y_test,y_pred)) print('Accuracy metrics') print(classification_report(y_test,y_pred))

34.421053

84

0.860856

from sklearn.model_selection import train_test_split from sklearn.neighbors import KNeighborsClassifier from sklearn.metrics import classification_report,confusion_matrix from sklearn import datasets iris=datasets.load_iris() iris_data=iris.data iris_labels=iris.target print(iris_data) print(iris_labels) x_train,x_test,y_train,y_test=train_test_split(iris_data,iris_labels,test_size=0.30) classifier=KNeighborsClassifier(n_neighbors=5) classifier.fit(x_train,y_train) y_pred=classifier.predict(x_test) print('confusion matrix is as follows') print(confusion_matrix(y_test,y_pred)) print('Accuracy metrics') print(classification_report(y_test,y_pred))

true

1c30304757f5dcc3fcbb4ba2ba9ecb42d0cd0d8d

1,922

py

Python

gpfit/xfoil/constraint_set.py

appliedopt/gpfit

3c8025f12ba5360fdeb71c270e55d4c93e1676fd

[ "MIT" ]

6

2017-12-10T11:27:03.000Z

2021-12-28T18:12:32.000Z

gpfit/xfoil/constraint_set.py

appliedopt/gpfit

3c8025f12ba5360fdeb71c270e55d4c93e1676fd

[ "MIT" ]

49

2017-10-16T17:15:55.000Z

2021-10-19T06:32:27.000Z

gpfit/xfoil/constraint_set.py

appliedopt/gpfit

3c8025f12ba5360fdeb71c270e55d4c93e1676fd

[ "MIT" ]

1

2017-12-10T08:47:26.000Z

"""xfoil constraint set""" import numpy as np from gpfit.constraint_set import FitConstraintSet from .wrapper import xfoil_comparison # pylint: disable=too-many-arguments class XfoilFit(FitConstraintSet): """Special FitConstraintSet that can post-solve compare result to XFOIL Arguments (in addition to the arguments to FitConstraintSet) --------- airfoil: airfoil of fitted data str (e.g. "xxx.dat", "naca xxxx") """ def __init__( self, fitdata, ivar=None, dvars=None, name="", err_margin=None, airfoil=False ): super().__init__( fitdata, ivar=ivar, dvars=dvars, name=name, err_margin=err_margin ) self.airfoil = airfoil def process_result(self, result): """ if data comes from Xfoil and airfoil is provided check against xfoil """ super().process_result(result) if self.mfac not in result["sensitivities"]["constants"]: return if np.amax([abs(result["sensitivities"]["constants"][self.mfac])]) < 1e-5: return if not self.airfoil: return cl, re = 0.0, 0.0 for dvar in self.dvars: if "Re" in str(dvar): re = result(dvar) if "C_L" in str(dvar): cl = result(dvar) cd = result(self.ivar) if not hasattr(cl, "__len__") and hasattr(re, "__len__"): cl = [cl]*len(re) err, cdx = xfoil_comparison(self.airfoil, cl, re, cd) ind = np.where(err > 0.05)[0] for i in ind: modelstr = ", ".join(self.ivar.descr["models"]) msg = ( f"Drag error for {modelstr} is {err[i]:.2f}. Re={re[i]:.1f};" f" CL={cl[i]:.4f}; Xfoil cd={cd[i]:.6f}, GP sol cd={cdx[i]:.6f}" ) print(f"Warning: {msg}")

32.576271

85

0.540583

import numpy as np from gpfit.constraint_set import FitConstraintSet from .wrapper import xfoil_comparison class XfoilFit(FitConstraintSet): def __init__( self, fitdata, ivar=None, dvars=None, name="", err_margin=None, airfoil=False ): super().__init__( fitdata, ivar=ivar, dvars=dvars, name=name, err_margin=err_margin ) self.airfoil = airfoil def process_result(self, result): super().process_result(result) if self.mfac not in result["sensitivities"]["constants"]: return if np.amax([abs(result["sensitivities"]["constants"][self.mfac])]) < 1e-5: return if not self.airfoil: return cl, re = 0.0, 0.0 for dvar in self.dvars: if "Re" in str(dvar): re = result(dvar) if "C_L" in str(dvar): cl = result(dvar) cd = result(self.ivar) if not hasattr(cl, "__len__") and hasattr(re, "__len__"): cl = [cl]*len(re) err, cdx = xfoil_comparison(self.airfoil, cl, re, cd) ind = np.where(err > 0.05)[0] for i in ind: modelstr = ", ".join(self.ivar.descr["models"]) msg = ( f"Drag error for {modelstr} is {err[i]:.2f}. Re={re[i]:.1f};" f" CL={cl[i]:.4f}; Xfoil cd={cd[i]:.6f}, GP sol cd={cdx[i]:.6f}" ) print(f"Warning: {msg}")

true

1c30319c69766804d9361859d13d841c20dbd931

2,816

py

Python

src/sn7_baseline_prep_funcs.py

ordinaryname/CosmiQ_SN7_Baseline

db486f834b5f4a0a917098c63c1bbfe432350789

[ "Apache-2.0" ]

null

src/sn7_baseline_prep_funcs.py

ordinaryname/CosmiQ_SN7_Baseline

db486f834b5f4a0a917098c63c1bbfe432350789

[ "Apache-2.0" ]

null

src/sn7_baseline_prep_funcs.py

ordinaryname/CosmiQ_SN7_Baseline

db486f834b5f4a0a917098c63c1bbfe432350789

[ "Apache-2.0" ]

null

#!/usr/bin/env python3 # -*- coding: utf-8 -*- """ Created on Tue Aug 25 14:11:02 2020 @author: avanetten """ import multiprocessing import pandas as pd import numpy as np import skimage import gdal import os import solaris as sol from solaris.raster.image import create_multiband_geotiff from solaris.utils.core import _check_gdf_load def map_wrapper(x): '''For multi-threading''' return x[0](*(x[1:])) def make_geojsons_and_masks(name_root, image_path, json_path, output_path_mask, output_path_mask_fbc=None): ''' Make the stuffins mask_fbc is an (optional) three-channel fbc (footprint, boundary, raw) mask ''' print(" name_root:", name_root) # filter out null geoms (this is always a worthy check) gdf_tmp = _check_gdf_load(json_path) if len(gdf_tmp) == 0: gdf_nonull = gdf_tmp else: gdf_nonull = gdf_tmp[gdf_tmp.geometry.notnull()] try: im_tmp = skimage.io.imread(image_path) except: print("Error loading image %s, skipping..." %(image_path)) return # handle empty geojsons if len(gdf_nonull) == 0: # create masks # mask 1 has 1 channel # mask_fbc has 3 channel print(" Empty labels for name_root!", name_root) im = gdal.Open(image_path) proj = im.GetProjection() geo = im.GetGeoTransform() im = im.ReadAsArray() # set masks to 0 everywhere mask_arr = np.zeros((1, im.shape[1], im.shape[2])) create_multiband_geotiff(mask_arr, output_path_mask, proj, geo) if output_path_mask_fbc: mask_arr = np.zeros((3, im.shape[1], im.shape[2])) create_multiband_geotiff(mask_arr, output_path_mask_fbc, proj, geo) return # make masks (single channel) # https://github.com/CosmiQ/solaris/blob/master/docs/tutorials/notebooks/api_masks_tutorial.ipynb f_mask = sol.vector.mask.df_to_px_mask(df=gdf_nonull, out_file=output_path_mask, channels=['footprint'], reference_im=image_path, shape=(im_tmp.shape[0], im_tmp.shape[1])) # three channel mask (contact channel, if used, takes forever) # https://github.com/CosmiQ/solaris/blob/master/docs/tutorials/notebooks/api_masks_tutorial.ipynb if output_path_mask_fbc: fbc_mask = sol.vector.mask.df_to_px_mask(df=gdf_nonull, out_file=output_path_mask_fbc, channels=['band1', 'band2', 'band3'], reference_im=image_path, boundary_width=4, meters=True, shape=(im_tmp.shape[0], im_tmp.shape[1])) return

34.341463

101

0.610085

import multiprocessing import pandas as pd import numpy as np import skimage import gdal import os import solaris as sol from solaris.raster.image import create_multiband_geotiff from solaris.utils.core import _check_gdf_load def map_wrapper(x): return x[0](*(x[1:])) def make_geojsons_and_masks(name_root, image_path, json_path, output_path_mask, output_path_mask_fbc=None): print(" name_root:", name_root) gdf_tmp = _check_gdf_load(json_path) if len(gdf_tmp) == 0: gdf_nonull = gdf_tmp else: gdf_nonull = gdf_tmp[gdf_tmp.geometry.notnull()] try: im_tmp = skimage.io.imread(image_path) except: print("Error loading image %s, skipping..." %(image_path)) return if len(gdf_nonull) == 0: print(" Empty labels for name_root!", name_root) im = gdal.Open(image_path) proj = im.GetProjection() geo = im.GetGeoTransform() im = im.ReadAsArray() mask_arr = np.zeros((1, im.shape[1], im.shape[2])) create_multiband_geotiff(mask_arr, output_path_mask, proj, geo) if output_path_mask_fbc: mask_arr = np.zeros((3, im.shape[1], im.shape[2])) create_multiband_geotiff(mask_arr, output_path_mask_fbc, proj, geo) return f_mask = sol.vector.mask.df_to_px_mask(df=gdf_nonull, out_file=output_path_mask, channels=['footprint'], reference_im=image_path, shape=(im_tmp.shape[0], im_tmp.shape[1])) if output_path_mask_fbc: fbc_mask = sol.vector.mask.df_to_px_mask(df=gdf_nonull, out_file=output_path_mask_fbc, channels=['band1', 'band2', 'band3'], reference_im=image_path, boundary_width=4, meters=True, shape=(im_tmp.shape[0], im_tmp.shape[1])) return

true

1c303396e9863a9c89da3336cb44e63eaf8e0bf8

1,526

py

Python

comment/models.py

abdukhashimov/django-rest-blog-2

ae12c24f95b3a8f216c85a8f32c47e215118ce07

[ "MIT" ]

null

comment/models.py

abdukhashimov/django-rest-blog-2

ae12c24f95b3a8f216c85a8f32c47e215118ce07

[ "MIT" ]

null

comment/models.py

abdukhashimov/django-rest-blog-2

ae12c24f95b3a8f216c85a8f32c47e215118ce07

[ "MIT" ]

null

from django.db import models from post.models import Post from django.contrib.auth import get_user_model from django.contrib.admin.utils import NestedObjects class CommentManager(models.Manager): def get_parent_comment(self, id): return super( CommentManager, self ).get_queryset().filter(id=id, parent_id__isnull=True) def get_child_comment(self, id): parents = Comment.objects.filter(id=id) collector = NestedObjects(using='default') collector.collect(parents) collector.data[parents[0].__class__].remove(parents[0]) return collector.data[parents[0].__class__] class Comment(models.Model): user = models.ForeignKey(get_user_model(), on_delete=models.CASCADE) comment = models.TextField() created_at = models.DateTimeField(auto_now_add=True) parent = models.ForeignKey( 'self', related_name='reply', null=True, blank=True, on_delete=models.CASCADE ) post = models.ForeignKey( Post, related_name='comments', on_delete=models.CASCADE) class Meta: ordering = ['-created_at', ] objects = CommentManager() def __str__(self): if self.parent is None: return "{}'s comment".format(str(self.user)) return "{}'s reply".format(str(self.user)) # @property # def parent_comment(self): # return Comment.objects.get_parent_comment(self.id) @property def child_comments(self): return Comment.objects.get_child_comment(self.id)

31.142857

72

0.680865

from django.db import models from post.models import Post from django.contrib.auth import get_user_model from django.contrib.admin.utils import NestedObjects class CommentManager(models.Manager): def get_parent_comment(self, id): return super( CommentManager, self ).get_queryset().filter(id=id, parent_id__isnull=True) def get_child_comment(self, id): parents = Comment.objects.filter(id=id) collector = NestedObjects(using='default') collector.collect(parents) collector.data[parents[0].__class__].remove(parents[0]) return collector.data[parents[0].__class__] class Comment(models.Model): user = models.ForeignKey(get_user_model(), on_delete=models.CASCADE) comment = models.TextField() created_at = models.DateTimeField(auto_now_add=True) parent = models.ForeignKey( 'self', related_name='reply', null=True, blank=True, on_delete=models.CASCADE ) post = models.ForeignKey( Post, related_name='comments', on_delete=models.CASCADE) class Meta: ordering = ['-created_at', ] objects = CommentManager() def __str__(self): if self.parent is None: return "{}'s comment".format(str(self.user)) return "{}'s reply".format(str(self.user)) @property def child_comments(self): return Comment.objects.get_child_comment(self.id)

true

1c303427d85e89b55d8a992ea275e68e7213ab06

1,532

py

Python

src/dictionaries/cuhk/setup_data.py

aaronhktan/jyut-dict

d1a3f22af224f35cde312b7e664d3e392c8af3db

[ "MIT" ]

52

2019-01-20T20:40:15.000Z

2022-03-11T01:29:34.000Z

src/dictionaries/cuhk/setup_data.py

aaronhktan/jyut-dict

d1a3f22af224f35cde312b7e664d3e392c8af3db

[ "MIT" ]

58

2019-01-30T06:35:53.000Z

2022-02-20T03:33:18.000Z

src/dictionaries/cuhk/setup_data.py

aaronhktan/jyut-dict

d1a3f22af224f35cde312b7e664d3e392c8af3db

[ "MIT" ]

1

2021-08-03T03:46:36.000Z

from bs4 import BeautifulSoup import requests import sys if len(sys.argv) != 2: print("Usage: python3 script.py output_filename.txt") sys.exit(1) r = requests.get("https://apps.itsc.cuhk.edu.hk/hanyu/Page/Terms.aspx") soup = BeautifulSoup(r.text, "html.parser") # Extract links to each category main_panel = soup.find("div", id="MainContent_panelTermsIndex") main_table = main_panel.find("tbody").find("tr") columns = main_table.find_all( "td" ) # Yes, each column in the table is a <td>. Why? I don't know either. category_links = [] for column in columns: rows = column.find_all("td") for row in rows: if row.find("a"): category_links.append( "https://apps.itsc.cuhk.edu.hk/hanyu/Page/" + row.find("a").get("href") ) # Extract links for each word in each category word_links = [] for category_link in category_links: print(f"Getting data for category {category_link}...") r = requests.get(category_link) soup = BeautifulSoup(r.text, "html.parser") main_table = soup.find("div", id="MainContent_panelTermsQuery").find("table") word_link_elems = main_table.find_all("a") for word_link_elem in word_link_elems: word_links.append( word_link_elem.get_text() + "\t" + "https://apps.itsc.cuhk.edu.hk/hanyu/Page/" + word_link_elem.get("href") + "\n" ) # Write all links to file with open(sys.argv[1], "w") as output_file: output_file.writelines(word_links)

30.64

87

0.650783

from bs4 import BeautifulSoup import requests import sys if len(sys.argv) != 2: print("Usage: python3 script.py output_filename.txt") sys.exit(1) r = requests.get("https://apps.itsc.cuhk.edu.hk/hanyu/Page/Terms.aspx") soup = BeautifulSoup(r.text, "html.parser") main_panel = soup.find("div", id="MainContent_panelTermsIndex") main_table = main_panel.find("tbody").find("tr") columns = main_table.find_all( "td" ) category_links = [] for column in columns: rows = column.find_all("td") for row in rows: if row.find("a"): category_links.append( "https://apps.itsc.cuhk.edu.hk/hanyu/Page/" + row.find("a").get("href") ) # Extract links for each word in each category word_links = [] for category_link in category_links: print(f"Getting data for category {category_link}...") r = requests.get(category_link) soup = BeautifulSoup(r.text, "html.parser") main_table = soup.find("div", id="MainContent_panelTermsQuery").find("table") word_link_elems = main_table.find_all("a") for word_link_elem in word_link_elems: word_links.append( word_link_elem.get_text() + "\t" + "https://apps.itsc.cuhk.edu.hk/hanyu/Page/" + word_link_elem.get("href") + "\n" ) # Write all links to file with open(sys.argv[1], "w") as output_file: output_file.writelines(word_links)

true

1c3034837475e5316df55c05060f253699b61e3a

207,999

py

Python

ryu/ofproto/ofproto_v1_4_parser.py

alanquillin/ryu

5552348c7c0a425313e2d5085d40d9729c8cc95e

[ "Apache-2.0" ]

null

ryu/ofproto/ofproto_v1_4_parser.py

alanquillin/ryu

5552348c7c0a425313e2d5085d40d9729c8cc95e

[ "Apache-2.0" ]

null

ryu/ofproto/ofproto_v1_4_parser.py

alanquillin/ryu

5552348c7c0a425313e2d5085d40d9729c8cc95e

[ "Apache-2.0" ]

null

# Copyright (C) 2012, 2013, 2014 Nippon Telegraph and Telephone Corporation. # Copyright (C) 2012, 2013 Isaku Yamahata <yamahata at valinux co jp> # # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or # implied. # See the License for the specific language governing permissions and # limitations under the License. """ Decoder/Encoder implementations of OpenFlow 1.4. """ import six import struct from ryu.lib import addrconv from ryu.lib.pack_utils import msg_pack_into from ryu import utils from ryu.ofproto.ofproto_parser import StringifyMixin, MsgBase, MsgInMsgBase, msg_str_attr from ryu.ofproto import ether from ryu.ofproto import nx_actions from ryu.ofproto import ofproto_parser from ryu.ofproto import ofproto_common from ryu.ofproto import ofproto_v1_4 as ofproto _MSG_PARSERS = {} def _set_msg_type(msg_type): def _set_cls_msg_type(cls): cls.cls_msg_type = msg_type return cls return _set_cls_msg_type def _register_parser(cls): '''class decorator to register msg parser''' assert cls.cls_msg_type is not None assert cls.cls_msg_type not in _MSG_PARSERS _MSG_PARSERS[cls.cls_msg_type] = cls.parser return cls @ofproto_parser.register_msg_parser(ofproto.OFP_VERSION) def msg_parser(datapath, version, msg_type, msg_len, xid, buf): parser = _MSG_PARSERS.get(msg_type) return parser(datapath, version, msg_type, msg_len, xid, buf) @_register_parser @_set_msg_type(ofproto.OFPT_HELLO) class OFPHello(MsgBase): """ Hello message When connection is started, the hello message is exchanged between a switch and a controller. This message is handled by the Ryu framework, so the Ryu application do not need to process this typically. ========== ========================================================= Attribute Description ========== ========================================================= elements list of ``OFPHelloElemVersionBitmap`` instance ========== ========================================================= """ def __init__(self, datapath, elements=None): elements = elements if elements else [] super(OFPHello, self).__init__(datapath) self.elements = elements @classmethod def parser(cls, datapath, version, msg_type, msg_len, xid, buf): msg = super(OFPHello, cls).parser(datapath, version, msg_type, msg_len, xid, buf) offset = ofproto.OFP_HELLO_HEADER_SIZE elems = [] while offset < msg.msg_len: type_, length = struct.unpack_from( ofproto.OFP_HELLO_ELEM_HEADER_PACK_STR, msg.buf, offset) # better to register Hello Element classes but currently # Only VerisonBitmap is supported so let's be simple. if type_ == ofproto.OFPHET_VERSIONBITMAP: elem = OFPHelloElemVersionBitmap.parser(msg.buf, offset) elems.append(elem) offset += length msg.elements = elems return msg class OFPHelloElemVersionBitmap(StringifyMixin): """ Version bitmap Hello Element ========== ========================================================= Attribute Description ========== ========================================================= versions list of versions of OpenFlow protocol a device supports ========== ========================================================= """ def __init__(self, versions, type_=None, length=None): super(OFPHelloElemVersionBitmap, self).__init__() self.type = ofproto.OFPHET_VERSIONBITMAP self.length = None self._bitmaps = None self.versions = versions @classmethod def parser(cls, buf, offset): type_, length = struct.unpack_from( ofproto.OFP_HELLO_ELEM_VERSIONBITMAP_HEADER_PACK_STR, buf, offset) assert type_ == ofproto.OFPHET_VERSIONBITMAP bitmaps_len = (length - ofproto.OFP_HELLO_ELEM_VERSIONBITMAP_HEADER_SIZE) offset += ofproto.OFP_HELLO_ELEM_VERSIONBITMAP_HEADER_SIZE bitmaps = [] while bitmaps_len >= 4: bitmap = struct.unpack_from('!I', buf, offset) bitmaps.append(bitmap[0]) offset += 4 bitmaps_len -= 4 versions = [i * 32 + shift for i, bitmap in enumerate(bitmaps) for shift in range(31) if bitmap & (1 << shift)] elem = cls(versions) elem.length = length elem._bitmaps = bitmaps return elem @_register_parser @_set_msg_type(ofproto.OFPT_ECHO_REQUEST) class OFPEchoRequest(MsgBase): """ Echo request message This message is handled by the Ryu framework, so the Ryu application do not need to process this typically. ========== ========================================================= Attribute Description ========== ========================================================= data An arbitrary length data ========== ========================================================= Example:: def send_echo_request(self, datapath, data): ofp = datapath.ofproto ofp_parser = datapath.ofproto_parser req = ofp_parser.OFPEchoRequest(datapath, data) datapath.send_msg(req) @set_ev_cls(ofp_event.EventOFPEchoRequest, [HANDSHAKE_DISPATCHER, CONFIG_DISPATCHER, MAIN_DISPATCHER]) def echo_request_handler(self, ev): self.logger.debug('OFPEchoRequest received: data=%s', utils.hex_array(ev.msg.data)) """ def __init__(self, datapath, data=None): super(OFPEchoRequest, self).__init__(datapath) self.data = data @classmethod def parser(cls, datapath, version, msg_type, msg_len, xid, buf): msg = super(OFPEchoRequest, cls).parser(datapath, version, msg_type, msg_len, xid, buf) msg.data = msg.buf[ofproto.OFP_HEADER_SIZE:] return msg def _serialize_body(self): if self.data is not None: self.buf += self.data @_register_parser @_set_msg_type(ofproto.OFPT_ERROR) class OFPErrorMsg(MsgBase): """ Error message The switch notifies controller of problems by this message. ========== ========================================================= Attribute Description ========== ========================================================= type High level type of error code Details depending on the type data Variable length data depending on the type and code ========== ========================================================= ``type`` attribute corresponds to ``type_`` parameter of __init__. Types and codes are defined in ``ryu.ofproto.ofproto``. ============================= =========== Type Code ============================= =========== OFPET_HELLO_FAILED OFPHFC_* OFPET_BAD_REQUEST OFPBRC_* OFPET_BAD_ACTION OFPBAC_* OFPET_BAD_INSTRUCTION OFPBIC_* OFPET_BAD_MATCH OFPBMC_* OFPET_FLOW_MOD_FAILED OFPFMFC_* OFPET_GROUP_MOD_FAILED OFPGMFC_* OFPET_PORT_MOD_FAILED OFPPMFC_* OFPET_TABLE_MOD_FAILED OFPTMFC_* OFPET_QUEUE_OP_FAILED OFPQOFC_* OFPET_SWITCH_CONFIG_FAILED OFPSCFC_* OFPET_ROLE_REQUEST_FAILED OFPRRFC_* OFPET_METER_MOD_FAILED OFPMMFC_* OFPET_TABLE_FEATURES_FAILED OFPTFFC_* OFPET_EXPERIMENTER N/A ============================= =========== Example:: @set_ev_cls(ofp_event.EventOFPErrorMsg, [HANDSHAKE_DISPATCHER, CONFIG_DISPATCHER, MAIN_DISPATCHER]) def error_msg_handler(self, ev): msg = ev.msg self.logger.debug('OFPErrorMsg received: type=0x%02x code=0x%02x ' 'message=%s', msg.type, msg.code, utils.hex_array(msg.data)) """ def __init__(self, datapath, type_=None, code=None, data=None): super(OFPErrorMsg, self).__init__(datapath) self.type = type_ self.code = code self.data = data @classmethod def parser(cls, datapath, version, msg_type, msg_len, xid, buf): type_, = struct.unpack_from('!H', six.binary_type(buf), ofproto.OFP_HEADER_SIZE) if type_ == ofproto.OFPET_EXPERIMENTER: return OFPErrorExperimenterMsg.parser(datapath, version, msg_type, msg_len, xid, buf) msg = super(OFPErrorMsg, cls).parser(datapath, version, msg_type, msg_len, xid, buf) msg.type, msg.code = struct.unpack_from( ofproto.OFP_ERROR_MSG_PACK_STR, msg.buf, ofproto.OFP_HEADER_SIZE) msg.data = msg.buf[ofproto.OFP_ERROR_MSG_SIZE:] return msg def _serialize_body(self): assert self.data is not None msg_pack_into(ofproto.OFP_ERROR_MSG_PACK_STR, self.buf, ofproto.OFP_HEADER_SIZE, self.type, self.code) self.buf += self.data class OFPErrorExperimenterMsg(MsgBase): def __init__(self, datapath, type_=None, exp_type=None, experimenter=None, data=None): super(OFPErrorExperimenterMsg, self).__init__(datapath) self.type = ofproto.OFPET_EXPERIMENTER self.exp_type = exp_type self.experimenter = experimenter self.data = data @classmethod def parser(cls, datapath, version, msg_type, msg_len, xid, buf): cls.cls_msg_type = msg_type msg = super(OFPErrorExperimenterMsg, cls).parser( datapath, version, msg_type, msg_len, xid, buf) msg.type, msg.exp_type, msg.experimenter = struct.unpack_from( ofproto.OFP_ERROR_EXPERIMENTER_MSG_PACK_STR, msg.buf, ofproto.OFP_HEADER_SIZE) msg.data = msg.buf[ofproto.OFP_ERROR_EXPERIMENTER_MSG_SIZE:] return msg def _serialize_body(self): assert self.data is not None msg_pack_into(ofproto.OFP_ERROR_EXPERIMENTER_MSG_PACK_STR, self.buf, ofproto.OFP_HEADER_SIZE, self.type, self.exp_type, self.experimenter) self.buf += self.data @_register_parser @_set_msg_type(ofproto.OFPT_ECHO_REPLY) class OFPEchoReply(MsgBase): """ Echo reply message This message is handled by the Ryu framework, so the Ryu application do not need to process this typically. ========== ========================================================= Attribute Description ========== ========================================================= data An arbitrary length data ========== ========================================================= Example:: def send_echo_reply(self, datapath, data): ofp_parser = datapath.ofproto_parser reply = ofp_parser.OFPEchoReply(datapath, data) datapath.send_msg(reply) @set_ev_cls(ofp_event.EventOFPEchoReply, [HANDSHAKE_DISPATCHER, CONFIG_DISPATCHER, MAIN_DISPATCHER]) def echo_reply_handler(self, ev): self.logger.debug('OFPEchoReply received: data=%s', utils.hex_array(ev.msg.data)) """ def __init__(self, datapath, data=None): super(OFPEchoReply, self).__init__(datapath) self.data = data @classmethod def parser(cls, datapath, version, msg_type, msg_len, xid, buf): msg = super(OFPEchoReply, cls).parser(datapath, version, msg_type, msg_len, xid, buf) msg.data = msg.buf[ofproto.OFP_HEADER_SIZE:] return msg def _serialize_body(self): assert self.data is not None self.buf += self.data @_set_msg_type(ofproto.OFPT_FEATURES_REQUEST) class OFPFeaturesRequest(MsgBase): """ Features request message The controller sends a feature request to the switch upon session establishment. This message is handled by the Ryu framework, so the Ryu application do not need to process this typically. Example:: def send_features_request(self, datapath): ofp_parser = datapath.ofproto_parser req = ofp_parser.OFPFeaturesRequest(datapath) datapath.send_msg(req) """ def __init__(self, datapath): super(OFPFeaturesRequest, self).__init__(datapath) @_register_parser @_set_msg_type(ofproto.OFPT_EXPERIMENTER) class OFPExperimenter(MsgBase): """ Experimenter extension message ============= ========================================================= Attribute Description ============= ========================================================= experimenter Experimenter ID exp_type Experimenter defined data Experimenter defined arbitrary additional data ============= ========================================================= """ def __init__(self, datapath, experimenter=None, exp_type=None, data=None): super(OFPExperimenter, self).__init__(datapath) self.experimenter = experimenter self.exp_type = exp_type self.data = data @classmethod def parser(cls, datapath, version, msg_type, msg_len, xid, buf): msg = super(OFPExperimenter, cls).parser(datapath, version, msg_type, msg_len, xid, buf) (msg.experimenter, msg.exp_type) = struct.unpack_from( ofproto.OFP_EXPERIMENTER_HEADER_PACK_STR, msg.buf, ofproto.OFP_HEADER_SIZE) msg.data = msg.buf[ofproto.OFP_EXPERIMENTER_HEADER_SIZE:] return msg def _serialize_body(self): assert self.data is not None msg_pack_into(ofproto.OFP_EXPERIMENTER_HEADER_PACK_STR, self.buf, ofproto.OFP_HEADER_SIZE, self.experimenter, self.exp_type) self.buf += self.data @_register_parser @_set_msg_type(ofproto.OFPT_FEATURES_REPLY) class OFPSwitchFeatures(MsgBase): """ Features reply message The switch responds with a features reply message to a features request. This message is handled by the Ryu framework, so the Ryu application do not need to process this typically. Example:: @set_ev_cls(ofp_event.EventOFPSwitchFeatures, CONFIG_DISPATCHER) def switch_features_handler(self, ev): msg = ev.msg self.logger.debug('OFPSwitchFeatures received: ' 'datapath_id=0x%016x n_buffers=%d ' 'n_tables=%d auxiliary_id=%d ' 'capabilities=0x%08x', msg.datapath_id, msg.n_buffers, msg.n_tables, msg.auxiliary_id, msg.capabilities) """ def __init__(self, datapath, datapath_id=None, n_buffers=None, n_tables=None, auxiliary_id=None, capabilities=None): super(OFPSwitchFeatures, self).__init__(datapath) self.datapath_id = datapath_id self.n_buffers = n_buffers self.n_tables = n_tables self.auxiliary_id = auxiliary_id self.capabilities = capabilities @classmethod def parser(cls, datapath, version, msg_type, msg_len, xid, buf): msg = super(OFPSwitchFeatures, cls).parser(datapath, version, msg_type, msg_len, xid, buf) (msg.datapath_id, msg.n_buffers, msg.n_tables, msg.auxiliary_id, msg.capabilities, msg._reserved) = struct.unpack_from( ofproto.OFP_SWITCH_FEATURES_PACK_STR, msg.buf, ofproto.OFP_HEADER_SIZE) return msg @_set_msg_type(ofproto.OFPT_GET_CONFIG_REQUEST) class OFPGetConfigRequest(MsgBase): """ Get config request message The controller sends a get config request to query configuration parameters in the switch. Example:: def send_get_config_request(self, datapath): ofp_parser = datapath.ofproto_parser req = ofp_parser.OFPGetConfigRequest(datapath) datapath.send_msg(req) """ def __init__(self, datapath): super(OFPGetConfigRequest, self).__init__(datapath) @_register_parser @_set_msg_type(ofproto.OFPT_GET_CONFIG_REPLY) class OFPGetConfigReply(MsgBase): """ Get config reply message The switch responds to a configuration request with a get config reply message. ============= ========================================================= Attribute Description ============= ========================================================= flags Bitmap of the following flags. | OFPC_FRAG_NORMAL | OFPC_FRAG_DROP | OFPC_FRAG_REASM miss_send_len Max bytes of new flow that datapath should send to the controller ============= ========================================================= Example:: @set_ev_cls(ofp_event.EventOFPGetConfigReply, MAIN_DISPATCHER) def get_config_reply_handler(self, ev): msg = ev.msg dp = msg.datapath ofp = dp.ofproto flags = [] if msg.flags & ofp.OFPC_FRAG_NORMAL: flags.append('NORMAL') if msg.flags & ofp.OFPC_FRAG_DROP: flags.append('DROP') if msg.flags & ofp.OFPC_FRAG_REASM: flags.append('REASM') self.logger.debug('OFPGetConfigReply received: ' 'flags=%s miss_send_len=%d', ','.join(flags), msg.miss_send_len) """ def __init__(self, datapath, flags=None, miss_send_len=None): super(OFPGetConfigReply, self).__init__(datapath) self.flags = flags self.miss_send_len = miss_send_len @classmethod def parser(cls, datapath, version, msg_type, msg_len, xid, buf): msg = super(OFPGetConfigReply, cls).parser(datapath, version, msg_type, msg_len, xid, buf) msg.flags, msg.miss_send_len = struct.unpack_from( ofproto.OFP_SWITCH_CONFIG_PACK_STR, msg.buf, ofproto.OFP_HEADER_SIZE) return msg @_set_msg_type(ofproto.OFPT_SET_CONFIG) class OFPSetConfig(MsgBase): """ Set config request message The controller sends a set config request message to set configuraion parameters. ============= ========================================================= Attribute Description ============= ========================================================= flags Bitmap of the following flags. | OFPC_FRAG_NORMAL | OFPC_FRAG_DROP | OFPC_FRAG_REASM miss_send_len Max bytes of new flow that datapath should send to the controller ============= ========================================================= Example:: def send_set_config(self, datapath): ofp = datapath.ofproto ofp_parser = datapath.ofproto_parser req = ofp_parser.OFPSetConfig(datapath, ofp.OFPC_FRAG_NORMAL, 256) datapath.send_msg(req) """ def __init__(self, datapath, flags=0, miss_send_len=0): super(OFPSetConfig, self).__init__(datapath) self.flags = flags self.miss_send_len = miss_send_len def _serialize_body(self): assert self.flags is not None assert self.miss_send_len is not None msg_pack_into(ofproto.OFP_SWITCH_CONFIG_PACK_STR, self.buf, ofproto.OFP_HEADER_SIZE, self.flags, self.miss_send_len) class OFPMatch(StringifyMixin): """ Flow Match Structure This class is implementation of the flow match structure having compose/query API. You can define the flow match by the keyword arguments. The following arguments are available. ================ =============== ================================== Argument Value Description ================ =============== ================================== in_port Integer 32bit Switch input port in_phy_port Integer 32bit Switch physical input port metadata Integer 64bit Metadata passed between tables eth_dst MAC address Ethernet destination address eth_src MAC address Ethernet source address eth_type Integer 16bit Ethernet frame type vlan_vid Integer 16bit VLAN id vlan_pcp Integer 8bit VLAN priority ip_dscp Integer 8bit IP DSCP (6 bits in ToS field) ip_ecn Integer 8bit IP ECN (2 bits in ToS field) ip_proto Integer 8bit IP protocol ipv4_src IPv4 address IPv4 source address ipv4_dst IPv4 address IPv4 destination address tcp_src Integer 16bit TCP source port tcp_dst Integer 16bit TCP destination port udp_src Integer 16bit UDP source port udp_dst Integer 16bit UDP destination port sctp_src Integer 16bit SCTP source port sctp_dst Integer 16bit SCTP destination port icmpv4_type Integer 8bit ICMP type icmpv4_code Integer 8bit ICMP code arp_op Integer 16bit ARP opcode arp_spa IPv4 address ARP source IPv4 address arp_tpa IPv4 address ARP target IPv4 address arp_sha MAC address ARP source hardware address arp_tha MAC address ARP target hardware address ipv6_src IPv6 address IPv6 source address ipv6_dst IPv6 address IPv6 destination address ipv6_flabel Integer 32bit IPv6 Flow Label icmpv6_type Integer 8bit ICMPv6 type icmpv6_code Integer 8bit ICMPv6 code ipv6_nd_target IPv6 address Target address for ND ipv6_nd_sll MAC address Source link-layer for ND ipv6_nd_tll MAC address Target link-layer for ND mpls_label Integer 32bit MPLS label mpls_tc Integer 8bit MPLS TC mpls_bos Integer 8bit MPLS BoS bit pbb_isid Integer 24bit PBB I-SID tunnel_id Integer 64bit Logical Port Metadata ipv6_exthdr Integer 16bit IPv6 Extension Header pseudo-field pbb_uca Integer 8bit PBB UCA header field tcp_flags Integer 16bit TCP flags (EXT-109 ONF Extension) actset_output Integer 32bit Output port from action set metadata (EXT-233 ONF Extension) ================ =============== ================================== Example:: >>> # compose >>> match = parser.OFPMatch( ... in_port=1, ... eth_type=0x86dd, ... ipv6_src=('2001:db8:bd05:1d2:288a:1fc0:1:10ee', ... 'ffff:ffff:ffff:ffff::'), ... ipv6_dst='2001:db8:bd05:1d2:288a:1fc0:1:10ee') >>> # query >>> if 'ipv6_src' in match: ... print match['ipv6_src'] ... ('2001:db8:bd05:1d2:288a:1fc0:1:10ee', 'ffff:ffff:ffff:ffff::') .. Note:: For the list of the supported Nicira experimenter matches, please refer to :ref:`ryu.ofproto.nx_match <nx_match_structures>`. .. Note:: For VLAN id match field, special values are defined in OpenFlow Spec. 1) Packets with and without a VLAN tag - Example:: match = parser.OFPMatch() - Packet Matching ====================== ===== non-VLAN-tagged MATCH VLAN-tagged(vlan_id=3) MATCH VLAN-tagged(vlan_id=5) MATCH ====================== ===== 2) Only packets without a VLAN tag - Example:: match = parser.OFPMatch(vlan_vid=0x0000) - Packet Matching ====================== ===== non-VLAN-tagged MATCH VLAN-tagged(vlan_id=3) x VLAN-tagged(vlan_id=5) x ====================== ===== 3) Only packets with a VLAN tag regardless of its value - Example:: match = parser.OFPMatch(vlan_vid=(0x1000, 0x1000)) - Packet Matching ====================== ===== non-VLAN-tagged x VLAN-tagged(vlan_id=3) MATCH VLAN-tagged(vlan_id=5) MATCH ====================== ===== 4) Only packets with VLAN tag and VID equal - Example:: match = parser.OFPMatch(vlan_vid=(0x1000 | 3)) - Packet Matching ====================== ===== non-VLAN-tagged x VLAN-tagged(vlan_id=3) MATCH VLAN-tagged(vlan_id=5) x ====================== ===== """ def __init__(self, type_=None, length=None, _ordered_fields=None, **kwargs): super(OFPMatch, self).__init__() self.type = ofproto.OFPMT_OXM self.length = length if _ordered_fields is not None: assert not kwargs self._fields2 = _ordered_fields else: kwargs = dict(ofproto.oxm_normalize_user(k, v) for (k, v) in kwargs.items()) fields = [ofproto.oxm_from_user(k, v) for (k, v) in kwargs.items()] # assumption: sorting by OXM type values makes fields # meet ordering requirements (eg. eth_type before ipv4_src) fields.sort( key=lambda x: x[0][0] if isinstance(x[0], tuple) else x[0]) self._fields2 = [ofproto.oxm_to_user(n, v, m) for (n, v, m) in fields] @classmethod def parser(cls, buf, offset): """ Returns an object which is generated from a buffer including the expression of the wire protocol of the flow match. """ match = OFPMatch() type_, length = struct.unpack_from('!HH', buf, offset) match.type = type_ match.length = length # ofp_match adjustment offset += 4 length -= 4 fields = [] while length > 0: n, value, mask, field_len = ofproto.oxm_parse(buf, offset) k, uv = ofproto.oxm_to_user(n, value, mask) fields.append((k, uv)) offset += field_len length -= field_len match._fields2 = fields return match def serialize(self, buf, offset): """ Outputs the expression of the wire protocol of the flow match into the buf. Returns the output length. """ fields = [ofproto.oxm_from_user(k, uv) for (k, uv) in self._fields2] hdr_pack_str = '!HH' field_offset = offset + struct.calcsize(hdr_pack_str) for (n, value, mask) in fields: field_offset += ofproto.oxm_serialize(n, value, mask, buf, field_offset) length = field_offset - offset msg_pack_into(hdr_pack_str, buf, offset, ofproto.OFPMT_OXM, length) self.length = length pad_len = utils.round_up(length, 8) - length msg_pack_into("%dx" % pad_len, buf, field_offset) return length + pad_len def __getitem__(self, key): return dict(self._fields2)[key] def __contains__(self, key): return key in dict(self._fields2) def iteritems(self): return iter(dict(self._fields2).items()) def items(self): return self._fields2 def get(self, key, default=None): return dict(self._fields2).get(key, default) def stringify_attrs(self): yield "oxm_fields", dict(self._fields2) def to_jsondict(self): """ Returns a dict expressing the flow match. """ body = {"oxm_fields": [ofproto.oxm_to_jsondict(k, uv) for k, uv in self._fields2], "length": self.length, "type": self.type} return {self.__class__.__name__: body} @classmethod def from_jsondict(cls, dict_): """ Returns an object which is generated from a dict. Exception raises: KeyError -- Unknown match field is defined in dict """ fields = [ofproto.oxm_from_jsondict(f) for f in dict_['oxm_fields']] return OFPMatch(_ordered_fields=fields) class OFPPropUnknown(StringifyMixin): def __init__(self, type_=None, length=None, buf=None): self.buf = buf @classmethod def parser(cls, buf): return cls(buf=buf) class OFPPropBase(StringifyMixin): _PACK_STR = '!HH' # _TYPES = {} must be an attribute of subclass def __init__(self, type_, length=None): self.type = type_ self.length = length @classmethod def register_type(cls, type_): def _register_type(subcls): cls._TYPES[type_] = subcls return subcls return _register_type @classmethod def parse(cls, buf): (type_, length) = struct.unpack_from(cls._PACK_STR, buf, 0) rest = buf[utils.round_up(length, 8):] try: subcls = cls._TYPES[type_] except KeyError: subcls = OFPPropUnknown prop = subcls.parser(buf) prop.type = type_ prop.length = length return prop, rest @classmethod def get_rest(cls, buf): (type_, length) = struct.unpack_from(cls._PACK_STR, buf, 0) offset = struct.calcsize(cls._PACK_STR) return buf[offset:length] def serialize(self): # Body # serialize_body should be implemented by subclass body = bytearray() body += self.serialize_body() # fixup self.length = len(body) + struct.calcsize(self._PACK_STR) # Header buf = bytearray() msg_pack_into(self._PACK_STR, buf, 0, self.type, self.length) buf += body # Pad pad_len = utils.round_up(self.length, 8) - self.length msg_pack_into("%dx" % pad_len, buf, len(buf)) return buf class OFPPropCommonExperimenter4ByteData(StringifyMixin): _PACK_STR = '!HHII' _EXPERIMENTER_DATA_PACK_STR = '!I' _EXPERIMENTER_DATA_SIZE = 4 def __init__(self, type_=None, length=None, experimenter=None, exp_type=None, data=bytearray()): self.type = type_ self.length = length self.experimenter = experimenter self.exp_type = exp_type self.data = data @classmethod def parser(cls, buf): (type_, length, experimenter, exp_type) = struct.unpack_from( ofproto.OFP_PROP_EXPERIMENTER_PACK_STR, buf, 0) rest = buf[ofproto.OFP_PROP_EXPERIMENTER_SIZE:length] data = [] while rest: (d,) = struct.unpack_from( cls._EXPERIMENTER_DATA_PACK_STR, rest, 0) data.append(d) rest = rest[cls._EXPERIMENTER_DATA_SIZE:] return cls(type_, length, experimenter, exp_type, data) def serialize(self): offset = 0 bin_data = bytearray() for d in self.data: msg_pack_into(self._EXPERIMENTER_DATA_PACK_STR, bin_data, offset, d) offset += self._EXPERIMENTER_DATA_SIZE # fixup self.length = struct.calcsize(self._PACK_STR) self.length += len(bin_data) buf = bytearray() msg_pack_into(self._PACK_STR, buf, 0, self.type, self.length, self.experimenter, self.exp_type) buf += bin_data # Pad pad_len = utils.round_up(self.length, 8) - self.length msg_pack_into("%dx" % pad_len, buf, len(buf)) return buf class OFPPortDescProp(OFPPropBase): _TYPES = {} @OFPPortDescProp.register_type(ofproto.OFPPDPT_ETHERNET) class OFPPortDescPropEthernet(OFPPortDescProp): def __init__(self, type_=None, length=None, curr=None, advertised=None, supported=None, peer=None, curr_speed=None, max_speed=None): self.type = type_ self.length = length self.curr = curr self.advertised = advertised self.supported = supported self.peer = peer self.curr_speed = curr_speed self.max_speed = max_speed @classmethod def parser(cls, buf): ether = cls() (ether.type, ether.length, ether.curr, ether.advertised, ether.supported, ether.peer, ether.curr_speed, ether.max_speed) = struct.unpack_from( ofproto.OFP_PORT_DESC_PROP_ETHERNET_PACK_STR, buf, 0) return ether @OFPPortDescProp.register_type(ofproto.OFPPDPT_OPTICAL) class OFPPortDescPropOptical(OFPPortDescProp): def __init__(self, type_=None, length=None, supported=None, tx_min_freq_lmda=None, tx_max_freq_lmda=None, tx_grid_freq_lmda=None, rx_min_freq_lmda=None, rx_max_freq_lmda=None, rx_grid_freq_lmda=None, tx_pwr_min=None, tx_pwr_max=None): self.type = type_ self.length = length self.supported = supported self.tx_min_freq_lmda = tx_min_freq_lmda self.tx_max_freq_lmda = tx_max_freq_lmda self.tx_grid_freq_lmda = tx_grid_freq_lmda self.rx_min_freq_lmda = rx_min_freq_lmda self.rx_max_freq_lmda = rx_max_freq_lmda self.rx_grid_freq_lmda = rx_grid_freq_lmda self.tx_pwr_min = tx_pwr_min self.tx_pwr_max = tx_pwr_max @classmethod def parser(cls, buf): optical = cls() (optical.type, optical.length, optical.supported, optical.tx_min_freq_lmda, optical.tx_max_freq_lmda, optical.tx_grid_freq_lmda, optical.rx_min_freq_lmda, optical.rx_max_freq_lmda, optical.rx_grid_freq_lmda, optical.tx_pwr_min, optical.tx_pwr_max) = struct.unpack_from( ofproto.OFP_PORT_DESC_PROP_OPTICAL_PACK_STR, buf, 0) return optical @OFPPortDescProp.register_type(ofproto.OFPPDPT_EXPERIMENTER) class OFPPortDescPropExperimenter(OFPPropCommonExperimenter4ByteData): pass class OFPTableModProp(OFPPropBase): _TYPES = {} @OFPTableModProp.register_type(ofproto.OFPTMPT_EVICTION) class OFPTableModPropEviction(OFPTableModProp): def __init__(self, type_=None, length=None, flags=None): self.type = type_ self.length = length self.flags = flags @classmethod def parser(cls, buf): eviction = cls() (eviction.type, eviction.length, eviction.flags) = struct.unpack_from( ofproto.OFP_TABLE_MOD_PROP_EVICTION_PACK_STR, buf, 0) return eviction def serialize(self): # fixup self.length = ofproto.OFP_TABLE_MOD_PROP_EVICTION_SIZE buf = bytearray() msg_pack_into(ofproto.OFP_TABLE_MOD_PROP_EVICTION_PACK_STR, buf, 0, self.type, self.length, self.flags) return buf @OFPTableModProp.register_type(ofproto.OFPTMPT_VACANCY) class OFPTableModPropVacancy(OFPTableModProp): def __init__(self, type_=None, length=None, vacancy_down=None, vacancy_up=None, vacancy=None): self.type = type_ self.length = length self.vacancy_down = vacancy_down self.vacancy_up = vacancy_up self.vacancy = vacancy @classmethod def parser(cls, buf): vacancy = cls() (vacancy.type, vacancy.length, vacancy.vacancy_down, vacancy.vacancy_up, vacancy.vacancy) = struct.unpack_from( ofproto.OFP_TABLE_MOD_PROP_VACANCY_PACK_STR, buf, 0) return vacancy def serialize(self): # fixup self.length = ofproto.OFP_TABLE_MOD_PROP_VACANCY_SIZE buf = bytearray() msg_pack_into(ofproto.OFP_TABLE_MOD_PROP_VACANCY_PACK_STR, buf, 0, self.type, self.length, self.vacancy_down, self.vacancy_up, self.vacancy) return buf @OFPTableModProp.register_type(ofproto.OFPTMPT_EXPERIMENTER) class OFPTableModPropExperimenter(OFPPropCommonExperimenter4ByteData): pass class OFPQueueDescProp(OFPPropBase): _TYPES = {} @OFPQueueDescProp.register_type(ofproto.OFPQDPT_MIN_RATE) class OFPQueueDescPropMinRate(OFPQueueDescProp): def __init__(self, type_=None, length=None, rate=None): self.type = type_ self.length = length self.rate = rate @classmethod def parser(cls, buf): minrate = cls() (minrate.type, minrate.length, minrate.rate) = struct.unpack_from( ofproto.OFP_QUEUE_DESC_PROP_MIN_RATE_PACK_STR, buf, 0) return minrate @OFPQueueDescProp.register_type(ofproto.OFPQDPT_MAX_RATE) class OFPQueueDescPropMaxRate(OFPQueueDescProp): def __init__(self, type_=None, length=None, rate=None): self.type = type_ self.length = length self.rate = rate @classmethod def parser(cls, buf): maxrate = cls() (maxrate.type, maxrate.length, maxrate.rate) = struct.unpack_from( ofproto.OFP_QUEUE_DESC_PROP_MAX_RATE_PACK_STR, buf, 0) return maxrate @OFPQueueDescProp.register_type(ofproto.OFPQDPT_EXPERIMENTER) class OFPQueueDescPropExperimenter(OFPPropCommonExperimenter4ByteData): pass class OFPRoleProp(OFPPropBase): _TYPES = {} @OFPRoleProp.register_type(ofproto.OFPRPT_EXPERIMENTER) class OFPRolePropExperimenter(OFPPropCommonExperimenter4ByteData): pass class OFPBundleProp(OFPPropBase): _TYPES = {} @OFPBundleProp.register_type(ofproto.OFPRPT_EXPERIMENTER) class OFPBundlePropExperimenter(OFPPropCommonExperimenter4ByteData): pass @_register_parser @_set_msg_type(ofproto.OFPT_PACKET_IN) class OFPPacketIn(MsgBase): """ Packet-In message The switch sends the packet that received to the controller by this message. ============= ========================================================= Attribute Description ============= ========================================================= buffer_id ID assigned by datapath total_len Full length of frame reason Reason packet is being sent. | OFPR_TABLE_MISS | OFPR_APPLY_ACTION | OFPR_INVALID_TTL | OFPR_ACTION_SET | OFPR_GROUP | OFPR_PACKET_OUT table_id ID of the table that was looked up cookie Cookie of the flow entry that was looked up match Instance of ``OFPMatch`` data Ethernet frame ============= ========================================================= Example:: @set_ev_cls(ofp_event.EventOFPPacketIn, MAIN_DISPATCHER) def packet_in_handler(self, ev): msg = ev.msg dp = msg.datapath ofp = dp.ofproto if msg.reason == ofp.TABLE_MISS: reason = 'TABLE MISS' elif msg.reason == ofp.OFPR_APPLY_ACTION: reason = 'APPLY ACTION' elif msg.reason == ofp.OFPR_INVALID_TTL: reason = 'INVALID TTL' elif msg.reason == ofp.OFPR_ACTION_SET: reason = 'ACTION SET' elif msg.reason == ofp.OFPR_GROUP: reason = 'GROUP' elif msg.reason == ofp.OFPR_PACKET_OUT: reason = 'PACKET OUT' else: reason = 'unknown' self.logger.debug('OFPPacketIn received: ' 'buffer_id=%x total_len=%d reason=%s ' 'table_id=%d cookie=%d match=%s data=%s', msg.buffer_id, msg.total_len, reason, msg.table_id, msg.cookie, msg.match, utils.hex_array(msg.data)) """ def __init__(self, datapath, buffer_id=None, total_len=None, reason=None, table_id=None, cookie=None, match=None, data=None): super(OFPPacketIn, self).__init__(datapath) self.buffer_id = buffer_id self.total_len = total_len self.reason = reason self.table_id = table_id self.cookie = cookie self.match = match self.data = data @classmethod def parser(cls, datapath, version, msg_type, msg_len, xid, buf): msg = super(OFPPacketIn, cls).parser(datapath, version, msg_type, msg_len, xid, buf) (msg.buffer_id, msg.total_len, msg.reason, msg.table_id, msg.cookie) = struct.unpack_from( ofproto.OFP_PACKET_IN_PACK_STR, msg.buf, ofproto.OFP_HEADER_SIZE) msg.match = OFPMatch.parser(msg.buf, ofproto.OFP_PACKET_IN_SIZE - ofproto.OFP_MATCH_SIZE) match_len = utils.round_up(msg.match.length, 8) msg.data = msg.buf[(ofproto.OFP_PACKET_IN_SIZE - ofproto.OFP_MATCH_SIZE + match_len + 2):] if msg.total_len < len(msg.data): # discard padding for 8-byte alignment of OFP packet msg.data = msg.data[:msg.total_len] return msg @_register_parser @_set_msg_type(ofproto.OFPT_FLOW_REMOVED) class OFPFlowRemoved(MsgBase): """ Flow removed message When flow entries time out or are deleted, the switch notifies controller with this message. ================ ====================================================== Attribute Description ================ ====================================================== cookie Opaque controller-issued identifier priority Priority level of flow entry reason One of the following values. | OFPRR_IDLE_TIMEOUT | OFPRR_HARD_TIMEOUT | OFPRR_DELETE | OFPRR_GROUP_DELETE | OFPRR_METER_DELETE | OFPRR_EVICTION table_id ID of the table duration_sec Time flow was alive in seconds duration_nsec Time flow was alive in nanoseconds beyond duration_sec idle_timeout Idle timeout from original flow mod hard_timeout Hard timeout from original flow mod packet_count Number of packets that was associated with the flow byte_count Number of bytes that was associated with the flow match Instance of ``OFPMatch`` ================ ====================================================== Example:: @set_ev_cls(ofp_event.EventOFPFlowRemoved, MAIN_DISPATCHER) def flow_removed_handler(self, ev): msg = ev.msg dp = msg.datapath ofp = dp.ofproto if msg.reason == ofp.OFPRR_IDLE_TIMEOUT: reason = 'IDLE TIMEOUT' elif msg.reason == ofp.OFPRR_HARD_TIMEOUT: reason = 'HARD TIMEOUT' elif msg.reason == ofp.OFPRR_DELETE: reason = 'DELETE' elif msg.reason == ofp.OFPRR_GROUP_DELETE: reason = 'GROUP DELETE' else: reason = 'unknown' self.logger.debug('OFPFlowRemoved received: ' 'cookie=%d priority=%d reason=%s table_id=%d ' 'duration_sec=%d duration_nsec=%d ' 'idle_timeout=%d hard_timeout=%d ' 'packet_count=%d byte_count=%d match.fields=%s', msg.cookie, msg.priority, reason, msg.table_id, msg.duration_sec, msg.duration_nsec, msg.idle_timeout, msg.hard_timeout, msg.packet_count, msg.byte_count, msg.match) """ def __init__(self, datapath, cookie=None, priority=None, reason=None, table_id=None, duration_sec=None, duration_nsec=None, idle_timeout=None, hard_timeout=None, packet_count=None, byte_count=None, match=None): super(OFPFlowRemoved, self).__init__(datapath) self.cookie = cookie self.priority = priority self.reason = reason self.table_id = table_id self.duration_sec = duration_sec self.duration_nsec = duration_nsec self.idle_timeout = idle_timeout self.hard_timeout = hard_timeout self.packet_count = packet_count self.byte_count = byte_count self.match = match @classmethod def parser(cls, datapath, version, msg_type, msg_len, xid, buf): msg = super(OFPFlowRemoved, cls).parser(datapath, version, msg_type, msg_len, xid, buf) (msg.cookie, msg.priority, msg.reason, msg.table_id, msg.duration_sec, msg.duration_nsec, msg.idle_timeout, msg.hard_timeout, msg.packet_count, msg.byte_count) = struct.unpack_from( ofproto.OFP_FLOW_REMOVED_PACK_STR0, msg.buf, ofproto.OFP_HEADER_SIZE) offset = (ofproto.OFP_FLOW_REMOVED_SIZE - ofproto.OFP_MATCH_SIZE) msg.match = OFPMatch.parser(msg.buf, offset) return msg class OFPPort(StringifyMixin): """ Description of a port ========== ========================================================= Attribute Description ========== ========================================================= port_no Port number and it uniquely identifies a port within a switch. length Length of ofp_port (excluding padding). hw_addr MAC address for the port. name Null-terminated string containing a human-readable name for the interface. config Bitmap of port configration flags. | OFPPC_PORT_DOWN | OFPPC_NO_RECV | OFPPC_NO_FWD | OFPPC_NO_PACKET_IN state Bitmap of port state flags. | OFPPS_LINK_DOWN | OFPPS_BLOCKED | OFPPS_LIVE properties List of ``OFPPortDescProp`` subclass instance ========== ========================================================= """ _TYPE = { 'ascii': [ 'hw_addr', ], 'utf-8': [ # OF spec is unclear about the encoding of name. # we assumes UTF-8, which is used by OVS. 'name', ] } def __init__(self, port_no=None, length=None, hw_addr=None, name=None, config=None, state=None, properties=None): super(OFPPort, self).__init__() self.port_no = port_no self.length = length self.hw_addr = hw_addr self.name = name self.config = config self.state = state self.properties = properties @classmethod def parser(cls, buf, offset): (port_no, length, hw_addr, name, config, state) = struct.unpack_from( ofproto.OFP_PORT_PACK_STR, buf, offset) hw_addr = addrconv.mac.bin_to_text(hw_addr) name = name.rstrip(b'\0') props = [] rest = buf[offset + ofproto.OFP_PORT_SIZE:offset + length] while rest: p, rest = OFPPortDescProp.parse(rest) props.append(p) ofpport = cls(port_no, length, hw_addr, name, config, state, props) return ofpport class OFPTableDesc(StringifyMixin): def __init__(self, length=None, table_id=None, config=None, properties=None): super(OFPTableDesc, self).__init__() self.table_id = table_id self.length = length self.config = config self.properties = properties @classmethod def parser(cls, buf, offset): (length, table_id, config) = struct.unpack_from( ofproto.OFP_TABLE_DESC_PACK_STR, buf, offset) props = [] rest = buf[offset + ofproto.OFP_TABLE_DESC_SIZE:offset + length] while rest: p, rest = OFPTableModProp.parse(rest) props.append(p) ofptabledesc = cls(length, table_id, config, props) return ofptabledesc class OFPQueueDesc(StringifyMixin): def __init__(self, port_no=None, queue_id=None, len_=None, properties=None): super(OFPQueueDesc, self).__init__() self.port_no = port_no self.queue_id = queue_id self.len = len_ self.properties = properties @classmethod def parser(cls, buf, offset): (port_no, queue_id, len_) = struct.unpack_from( ofproto.OFP_QUEUE_DESC_PACK_STR, buf, offset) props = [] rest = buf[offset + ofproto.OFP_QUEUE_DESC_SIZE:offset + len_] while rest: p, rest = OFPQueueDescProp.parse(rest) props.append(p) ofpqueuedesc = cls(port_no, queue_id, len_, props) return ofpqueuedesc def _set_stats_type(stats_type, stats_body_cls): def _set_cls_stats_type(cls): cls.cls_stats_type = stats_type cls.cls_stats_body_cls = stats_body_cls return cls return _set_cls_stats_type @_set_msg_type(ofproto.OFPT_MULTIPART_REQUEST) class OFPMultipartRequest(MsgBase): def __init__(self, datapath, flags): super(OFPMultipartRequest, self).__init__(datapath) self.type = self.__class__.cls_stats_type self.flags = flags def _serialize_stats_body(self): pass def _serialize_body(self): msg_pack_into(ofproto.OFP_MULTIPART_REQUEST_PACK_STR, self.buf, ofproto.OFP_HEADER_SIZE, self.type, self.flags) self._serialize_stats_body() @_register_parser @_set_msg_type(ofproto.OFPT_METER_MOD) class OFPMeterMod(MsgBase): """ Meter modification message The controller sends this message to modify the meter. ================ ====================================================== Attribute Description ================ ====================================================== command One of the following values. | OFPMC_ADD | OFPMC_MODIFY | OFPMC_DELETE flags Bitmap of the following flags. | OFPMF_KBPS | OFPMF_PKTPS | OFPMF_BURST | OFPMF_STATS meter_id Meter instance bands list of the following class instance. | OFPMeterBandDrop | OFPMeterBandDscpRemark | OFPMeterBandExperimenter ================ ====================================================== """ def __init__(self, datapath, command=ofproto.OFPMC_ADD, flags=ofproto.OFPMF_KBPS, meter_id=1, bands=None): bands = bands if bands else [] super(OFPMeterMod, self).__init__(datapath) self.command = command self.flags = flags self.meter_id = meter_id self.bands = bands @classmethod def parser(cls, datapath, version, msg_type, msg_len, xid, buf): msg = super(OFPMeterMod, cls).parser( datapath, version, msg_type, msg_len, xid, buf) (msg.command, msg.flags, msg.meter_id) = struct.unpack_from( ofproto.OFP_METER_MOD_PACK_STR, buf, ofproto.OFP_HEADER_SIZE) offset = ofproto.OFP_METER_MOD_SIZE msg.bands = [] while offset < msg.msg_len: band = OFPMeterBandHeader.parser(buf, offset) msg.bands.append(band) offset += band.len return msg def _serialize_body(self): msg_pack_into(ofproto.OFP_METER_MOD_PACK_STR, self.buf, ofproto.OFP_HEADER_SIZE, self.command, self.flags, self.meter_id) offset = ofproto.OFP_METER_MOD_SIZE for b in self.bands: b.serialize(self.buf, offset) offset += b.len @_set_msg_type(ofproto.OFPT_TABLE_MOD) class OFPTableMod(MsgBase): """ Flow table configuration message The controller sends this message to configure table state. ================ ====================================================== Attribute Description ================ ====================================================== table_id ID of the table (OFPTT_ALL indicates all tables) config Bitmap of configuration flags. | OFPTC_EVICTION | OFPTC_VACANCY_EVENTS properties List of ``OFPTableModProp`` subclass instance ================ ====================================================== Example:: def send_table_mod(self, datapath): ofp = datapath.ofproto ofp_parser = datapath.ofproto_parser req = ofp_parser.OFPTableMod(datapath, 1, 3) flags = ofp.OFPTC_VACANCY_EVENTS properties = [ofp_parser.OFPTableModPropEviction(flags)] req = ofp_parser.OFPTableMod(datapath, 1, 3, properties) datapath.send_msg(req) """ def __init__(self, datapath, table_id, config, properties): super(OFPTableMod, self).__init__(datapath) self.table_id = table_id self.config = config self.properties = properties def _serialize_body(self): props_buf = bytearray() for p in self.properties: props_buf += p.serialize() msg_pack_into(ofproto.OFP_TABLE_MOD_PACK_STR, self.buf, ofproto.OFP_HEADER_SIZE, self.table_id, self.config) self.buf += props_buf @_register_parser @_set_msg_type(ofproto.OFPT_MULTIPART_REPLY) class OFPMultipartReply(MsgBase): _STATS_MSG_TYPES = {} @staticmethod def register_stats_type(body_single_struct=False): def _register_stats_type(cls): assert cls.cls_stats_type is not None assert cls.cls_stats_type not in OFPMultipartReply._STATS_MSG_TYPES assert cls.cls_stats_body_cls is not None cls.cls_body_single_struct = body_single_struct OFPMultipartReply._STATS_MSG_TYPES[cls.cls_stats_type] = cls return cls return _register_stats_type def __init__(self, datapath, body=None, flags=None): super(OFPMultipartReply, self).__init__(datapath) self.body = body self.flags = flags @classmethod def parser_stats_body(cls, buf, msg_len, offset): body_cls = cls.cls_stats_body_cls body = [] while offset < msg_len: entry = body_cls.parser(buf, offset) body.append(entry) offset += entry.length if cls.cls_body_single_struct: return body[0] return body @classmethod def parser_stats(cls, datapath, version, msg_type, msg_len, xid, buf): msg = MsgBase.parser.__func__( cls, datapath, version, msg_type, msg_len, xid, buf) msg.body = msg.parser_stats_body(msg.buf, msg.msg_len, ofproto.OFP_MULTIPART_REPLY_SIZE) return msg @classmethod def parser(cls, datapath, version, msg_type, msg_len, xid, buf): type_, flags = struct.unpack_from( ofproto.OFP_MULTIPART_REPLY_PACK_STR, six.binary_type(buf), ofproto.OFP_HEADER_SIZE) stats_type_cls = cls._STATS_MSG_TYPES.get(type_) msg = super(OFPMultipartReply, stats_type_cls).parser( datapath, version, msg_type, msg_len, xid, buf) msg.type = type_ msg.flags = flags offset = ofproto.OFP_MULTIPART_REPLY_SIZE body = [] while offset < msg_len: b = stats_type_cls.cls_stats_body_cls.parser(msg.buf, offset) body.append(b) offset += b.length if hasattr(b, 'length') else b.len if stats_type_cls.cls_body_single_struct: msg.body = body[0] else: msg.body = body return msg class OFPDescStats(ofproto_parser.namedtuple('OFPDescStats', ( 'mfr_desc', 'hw_desc', 'sw_desc', 'serial_num', 'dp_desc'))): _TYPE = { 'ascii': [ 'mfr_desc', 'hw_desc', 'sw_desc', 'serial_num', 'dp_desc', ] } @classmethod def parser(cls, buf, offset): desc = struct.unpack_from(ofproto.OFP_DESC_PACK_STR, buf, offset) desc = list(desc) desc = [x.rstrip(b'\0') for x in desc] stats = cls(*desc) stats.length = ofproto.OFP_DESC_SIZE return stats @_set_stats_type(ofproto.OFPMP_DESC, OFPDescStats) @_set_msg_type(ofproto.OFPT_MULTIPART_REQUEST) class OFPDescStatsRequest(OFPMultipartRequest): """ Description statistics request message The controller uses this message to query description of the switch. ================ ====================================================== Attribute Description ================ ====================================================== flags Zero or ``OFPMPF_REQ_MORE`` ================ ====================================================== Example:: def send_desc_stats_request(self, datapath): ofp_parser = datapath.ofproto_parser req = ofp_parser.OFPDescStatsRequest(datapath, 0) datapath.send_msg(req) """ def __init__(self, datapath, flags=0, type_=None): super(OFPDescStatsRequest, self).__init__(datapath, flags) @OFPMultipartReply.register_stats_type(body_single_struct=True) @_set_stats_type(ofproto.OFPMP_DESC, OFPDescStats) @_set_msg_type(ofproto.OFPT_MULTIPART_REPLY) class OFPDescStatsReply(OFPMultipartReply): """ Description statistics reply message The switch responds with this message to a description statistics request. ================ ====================================================== Attribute Description ================ ====================================================== body Instance of ``OFPDescStats`` ================ ====================================================== Example:: @set_ev_cls(ofp_event.EventOFPDescStatsReply, MAIN_DISPATCHER) def desc_stats_reply_handler(self, ev): body = ev.msg.body self.logger.debug('DescStats: mfr_desc=%s hw_desc=%s sw_desc=%s ' 'serial_num=%s dp_desc=%s', body.mfr_desc, body.hw_desc, body.sw_desc, body.serial_num, body.dp_desc) """ def __init__(self, datapath, type_=None, **kwargs): super(OFPDescStatsReply, self).__init__(datapath, **kwargs) class OFPTableFeaturesStats(StringifyMixin): _TYPE = { 'utf-8': [ # OF spec is unclear about the encoding of name. # we assumes UTF-8. 'name', ] } def __init__(self, table_id=None, name=None, metadata_match=None, metadata_write=None, config=None, max_entries=None, properties=None, length=None): super(OFPTableFeaturesStats, self).__init__() self.length = None self.table_id = table_id self.name = name self.metadata_match = metadata_match self.metadata_write = metadata_write self.config = config self.max_entries = max_entries self.properties = properties @classmethod def parser(cls, buf, offset): table_features = cls() (table_features.length, table_features.table_id, name, table_features.metadata_match, table_features.metadata_write, table_features.config, table_features.max_entries ) = struct.unpack_from(ofproto.OFP_TABLE_FEATURES_PACK_STR, buf, offset) table_features.name = name.rstrip(b'\0') props = [] rest = buf[offset + ofproto.OFP_TABLE_FEATURES_SIZE: offset + table_features.length] while rest: p, rest = OFPTableFeatureProp.parse(rest) props.append(p) table_features.properties = props return table_features def serialize(self): # fixup bin_props = bytearray() for p in self.properties: bin_props += p.serialize() self.length = ofproto.OFP_TABLE_FEATURES_SIZE + len(bin_props) buf = bytearray() msg_pack_into(ofproto.OFP_TABLE_FEATURES_PACK_STR, buf, 0, self.length, self.table_id, self.name, self.metadata_match, self.metadata_write, self.config, self.max_entries) return buf + bin_props class OFPTableFeatureProp(OFPPropBase): _TYPES = {} class OFPInstructionId(StringifyMixin): _PACK_STR = '!HH' # type, len def __init__(self, type_, len_=None): self.type = type_ self.len = len_ # XXX experimenter @classmethod def parse(cls, buf): (type_, len_,) = struct.unpack_from(cls._PACK_STR, six.binary_type(buf), 0) rest = buf[len_:] return cls(type_=type_, len_=len_), rest def serialize(self): # fixup self.len = struct.calcsize(self._PACK_STR) buf = bytearray() msg_pack_into(self._PACK_STR, buf, 0, self.type, self.len) return buf @OFPTableFeatureProp.register_type(ofproto.OFPTFPT_INSTRUCTIONS) @OFPTableFeatureProp.register_type(ofproto.OFPTFPT_INSTRUCTIONS_MISS) class OFPTableFeaturePropInstructions(OFPTableFeatureProp): def __init__(self, type_=None, length=None, instruction_ids=None): instruction_ids = instruction_ids if instruction_ids else [] super(OFPTableFeaturePropInstructions, self).__init__(type_, length) self.instruction_ids = instruction_ids @classmethod def parser(cls, buf): rest = cls.get_rest(buf) ids = [] while rest: i, rest = OFPInstructionId.parse(rest) ids.append(i) return cls(instruction_ids=ids) def serialize_body(self): bin_ids = bytearray() for i in self.instruction_ids: bin_ids += i.serialize() return bin_ids # Implementation note: While OpenFlow 1.3.2 shares the same ofp_action_header # for flow_mod and table_features, we have separate classes. We named this # class to match with OpenFlow 1.4's name. (ofp_action_id) class OFPActionId(StringifyMixin): _PACK_STR = '!HH' # type, len def __init__(self, type_, len_=None): self.type = type_ self.len = len_ # XXX experimenter @classmethod def parse(cls, buf): (type_, len_,) = struct.unpack_from(cls._PACK_STR, six.binary_type(buf), 0) rest = buf[len_:] return cls(type_=type_, len_=len_), rest def serialize(self): # fixup self.len = struct.calcsize(self._PACK_STR) buf = bytearray() msg_pack_into(self._PACK_STR, buf, 0, self.type, self.len) return buf @OFPTableFeatureProp.register_type(ofproto.OFPTFPT_WRITE_ACTIONS) @OFPTableFeatureProp.register_type(ofproto.OFPTFPT_WRITE_ACTIONS_MISS) @OFPTableFeatureProp.register_type(ofproto.OFPTFPT_APPLY_ACTIONS) @OFPTableFeatureProp.register_type(ofproto.OFPTFPT_APPLY_ACTIONS_MISS) class OFPTableFeaturePropActions(OFPTableFeatureProp): def __init__(self, type_=None, length=None, action_ids=None): action_ids = action_ids if action_ids else [] super(OFPTableFeaturePropActions, self).__init__(type_, length) self.action_ids = action_ids @classmethod def parser(cls, buf): rest = cls.get_rest(buf) ids = [] while rest: i, rest = OFPActionId.parse(rest) ids.append(i) return cls(action_ids=ids) def serialize_body(self): bin_ids = bytearray() for i in self.action_ids: bin_ids += i.serialize() return bin_ids @OFPTableFeatureProp.register_type(ofproto.OFPTFPT_NEXT_TABLES) @OFPTableFeatureProp.register_type(ofproto.OFPTFPT_NEXT_TABLES_MISS) @OFPTableFeatureProp.register_type(ofproto.OFPTFPT_TABLE_SYNC_FROM) class OFPTableFeaturePropNextTables(OFPTableFeatureProp): _TABLE_ID_PACK_STR = '!B' def __init__(self, type_=None, length=None, table_ids=None): table_ids = table_ids if table_ids else [] super(OFPTableFeaturePropNextTables, self).__init__(type_, length) self.table_ids = table_ids @classmethod def parser(cls, buf): rest = cls.get_rest(buf) ids = [] while rest: (i,) = struct.unpack_from(cls._TABLE_ID_PACK_STR, six.binary_type(rest), 0) rest = rest[struct.calcsize(cls._TABLE_ID_PACK_STR):] ids.append(i) return cls(table_ids=ids) def serialize_body(self): bin_ids = bytearray() for i in self.table_ids: bin_id = bytearray() msg_pack_into(self._TABLE_ID_PACK_STR, bin_id, 0, i) bin_ids += bin_id return bin_ids # Implementation note: OFPOxmId is specific to this implementation. # It does not have a corresponding structure in the specification. # (the specification uses plain uint32_t for non-experimenter OXMs # and uint64_t for experimenter OXMs.) # # i have taken a look at some of software switch implementations # but they all look broken or incomplete. according to the spec, # oxm_hasmask should be 1 if a switch supports masking for the type. # the right value for oxm_length is not clear from the spec. # update: OpenFlow 1.3.3 "clarified" that oxm_length here is the payload # length. it's still unclear if it should be doubled for hasmask or not, # though. # ofsoftswitch13 # oxm_hasmask always 0 # oxm_length same as ofp_match etc (as without mask) # linc/of_protocol # oxm_hasmask always 0 # oxm_length always 0 # ovs: # seems in flux as of writing this [20141003] class OFPOxmId(StringifyMixin): _PACK_STR = '!I' # oxm header _EXPERIMENTER_ID_PACK_STR = '!I' _TYPE = { 'ascii': [ 'type', ], } def __init__(self, type_, hasmask=False, length=None): self.type = type_ self.hasmask = hasmask self.length = length @classmethod def parse(cls, buf): (oxm,) = struct.unpack_from(cls._PACK_STR, six.binary_type(buf), 0) # oxm (32 bit) == class (16) | field (7) | hasmask (1) | length (8) # in case of experimenter OXMs, another 32 bit value # (experimenter id) follows. (type_, _v) = ofproto.oxm_to_user(oxm >> (1 + 8), None, None) rest = buf[struct.calcsize(cls._PACK_STR):] hasmask = ofproto.oxm_tlv_header_extract_hasmask(oxm) length = oxm & 0xff # XXX see the comment on OFPOxmId class_ = oxm >> (7 + 1 + 8) if class_ == ofproto.OFPXMC_EXPERIMENTER: (exp_id,) = struct.unpack_from(cls._EXPERIMENTER_ID_PACK_STR, six.binary_type(rest), 0) rest = rest[struct.calcsize(cls._EXPERIMENTER_ID_PACK_STR):] subcls = OFPExperimenterOxmId return subcls(type_=type_, exp_id=exp_id, hasmask=hasmask, length=length), rest else: return cls(type_=type_, hasmask=hasmask, length=length), rest def serialize(self): # fixup self.length = 0 # XXX see the comment on OFPOxmId (n, _v, _m) = ofproto.oxm_from_user(self.type, None) oxm = (n << (1 + 8)) | (self.hasmask << 8) | self.length buf = bytearray() msg_pack_into(self._PACK_STR, buf, 0, oxm) assert n >> 7 != ofproto.OFPXMC_EXPERIMENTER return buf class OFPExperimenterOxmId(OFPOxmId): def __init__(self, type_, exp_id, hasmask=False, length=None): super(OFPExperimenterOxmId, self).__init__(type_=type_, hasmask=hasmask, length=length) self.exp_id = exp_id def serialize(self): buf = super(OFPExperimenterOxmId, self).serialize() msg_pack_into(self._EXPERIMENTER_ID_PACK_STR, buf, struct.calcsize(self._PACK_STR), self.exp_id) @OFPTableFeatureProp.register_type(ofproto.OFPTFPT_MATCH) @OFPTableFeatureProp.register_type(ofproto.OFPTFPT_WILDCARDS) @OFPTableFeatureProp.register_type(ofproto.OFPTFPT_WRITE_SETFIELD) @OFPTableFeatureProp.register_type(ofproto.OFPTFPT_WRITE_SETFIELD_MISS) @OFPTableFeatureProp.register_type(ofproto.OFPTFPT_APPLY_SETFIELD) @OFPTableFeatureProp.register_type(ofproto.OFPTFPT_APPLY_SETFIELD_MISS) class OFPTableFeaturePropOxm(OFPTableFeatureProp): def __init__(self, type_=None, length=None, oxm_ids=None): oxm_ids = oxm_ids if oxm_ids else [] super(OFPTableFeaturePropOxm, self).__init__(type_, length) self.oxm_ids = oxm_ids @classmethod def parser(cls, buf): rest = cls.get_rest(buf) ids = [] while rest: i, rest = OFPOxmId.parse(rest) ids.append(i) return cls(oxm_ids=ids) def serialize_body(self): bin_ids = bytearray() for i in self.oxm_ids: bin_ids += i.serialize() return bin_ids @OFPTableFeatureProp.register_type(ofproto.OFPTFPT_EXPERIMENTER) @OFPTableFeatureProp.register_type(ofproto.OFPTFPT_EXPERIMENTER_MISS) class OFPTableFeaturePropExperimenter(OFPPropCommonExperimenter4ByteData): pass @_set_stats_type(ofproto.OFPMP_TABLE_FEATURES, OFPTableFeaturesStats) @_set_msg_type(ofproto.OFPT_MULTIPART_REQUEST) class OFPTableFeaturesStatsRequest(OFPMultipartRequest): """ Table features statistics request message The controller uses this message to query table features. ================ ====================================================== Attribute Description ================ ====================================================== body List of ``OFPTableFeaturesStats`` instances. The default is []. ================ ====================================================== """ def __init__(self, datapath, flags=0, body=None, type_=None): body = body if body else [] super(OFPTableFeaturesStatsRequest, self).__init__(datapath, flags) self.body = body def _serialize_stats_body(self): bin_body = bytearray() for p in self.body: bin_body += p.serialize() self.buf += bin_body @OFPMultipartReply.register_stats_type() @_set_stats_type(ofproto.OFPMP_TABLE_FEATURES, OFPTableFeaturesStats) @_set_msg_type(ofproto.OFPT_MULTIPART_REPLY) class OFPTableFeaturesStatsReply(OFPMultipartReply): """ Table features statistics reply message The switch responds with this message to a table features statistics request. ================ ====================================================== Attribute Description ================ ====================================================== body List of ``OFPTableFeaturesStats`` instance ================ ====================================================== """ def __init__(self, datapath, type_=None, **kwargs): super(OFPTableFeaturesStatsReply, self).__init__(datapath, **kwargs) @_set_stats_type(ofproto.OFPMP_PORT_DESC, OFPPort) @_set_msg_type(ofproto.OFPT_MULTIPART_REQUEST) class OFPPortDescStatsRequest(OFPMultipartRequest): """ Port description request message The controller uses this message to query description of all the ports. ================ ====================================================== Attribute Description ================ ====================================================== flags Zero or ``OFPMPF_REQ_MORE`` ================ ====================================================== Example:: def send_port_desc_stats_request(self, datapath): ofp_parser = datapath.ofproto_parser req = ofp_parser.OFPPortDescStatsRequest(datapath, 0) datapath.send_msg(req) """ def __init__(self, datapath, flags=0, type_=None): super(OFPPortDescStatsRequest, self).__init__(datapath, flags) @OFPMultipartReply.register_stats_type() @_set_stats_type(ofproto.OFPMP_PORT_DESC, OFPPort) @_set_msg_type(ofproto.OFPT_MULTIPART_REPLY) class OFPPortDescStatsReply(OFPMultipartReply): """ Port description reply message The switch responds with this message to a port description request. ================ ====================================================== Attribute Description ================ ====================================================== body List of ``OFPPort`` instance ================ ====================================================== Example:: @set_ev_cls(ofp_event.EventOFPPortDescStatsReply, MAIN_DISPATCHER) def port_desc_stats_reply_handler(self, ev): ports = [] for p in ev.msg.body: ports.append('port_no=%d hw_addr=%s name=%s config=0x%08x ' 'state=0x%08x properties=%s' % (p.port_no, p.hw_addr, p.name, p.config, p.state, repr(p.properties))) self.logger.debug('OFPPortDescStatsReply received: %s', ports) """ def __init__(self, datapath, type_=None, **kwargs): super(OFPPortDescStatsReply, self).__init__(datapath, **kwargs) @_set_stats_type(ofproto.OFPMP_TABLE_DESC, OFPTableDesc) @_set_msg_type(ofproto.OFPT_MULTIPART_REQUEST) class OFPTableDescStatsRequest(OFPMultipartRequest): """ Table description request message The controller uses this message to query description of all the tables. ================ ====================================================== Attribute Description ================ ====================================================== flags Zero or ``OFPMPF_REQ_MORE`` ================ ====================================================== Example:: def send_table_desc_stats_request(self, datapath): ofp_parser = datapath.ofproto_parser req = ofp_parser.OFPTableDescStatsRequest(datapath, 0) datapath.send_msg(req) """ def __init__(self, datapath, flags=0, type_=None): super(OFPTableDescStatsRequest, self).__init__(datapath, flags) @OFPMultipartReply.register_stats_type() @_set_stats_type(ofproto.OFPMP_TABLE_DESC, OFPTableDesc) @_set_msg_type(ofproto.OFPT_MULTIPART_REPLY) class OFPTableDescStatsReply(OFPMultipartReply): """ Table description reply message The switch responds with this message to a table description request. ================ ====================================================== Attribute Description ================ ====================================================== body List of ``OFPTableDesc`` instance ================ ====================================================== Example:: @set_ev_cls(ofp_event.EventOFPTableDescStatsReply, MAIN_DISPATCHER) def table_desc_stats_reply_handler(self, ev): tables = [] for p in ev.msg.body: tables.append('table_id=%d config=0x%08x properties=%s' % (p.table_id, p.config, repr(p.properties))) self.logger.debug('OFPTableDescStatsReply received: %s', tables) """ def __init__(self, datapath, type_=None, **kwargs): super(OFPTableDescStatsReply, self).__init__(datapath, **kwargs) @_set_stats_type(ofproto.OFPMP_QUEUE_DESC, OFPQueueDesc) @_set_msg_type(ofproto.OFPT_MULTIPART_REQUEST) class OFPQueueDescStatsRequest(OFPMultipartRequest): """ Queue description request message The controller uses this message to query description of all the queues. ================ ====================================================== Attribute Description ================ ====================================================== flags Zero or ``OFPMPF_REQ_MORE`` port_no Port number to read (OFPP_ANY for all ports) queue_id ID of queue to read (OFPQ_ALL for all queues) ================ ====================================================== Example:: def send_queue_desc_stats_request(self, datapath): ofp = datapath.ofproto ofp_parser = datapath.ofproto_parser req = ofp_parser.OFPQueueDescStatsRequest(datapath, 0, ofp.OFPP_ANY, ofp.OFPQ_ALL) datapath.send_msg(req) """ def __init__(self, datapath, flags=0, port_no=ofproto.OFPP_ANY, queue_id=ofproto.OFPQ_ALL, type_=None): super(OFPQueueDescStatsRequest, self).__init__(datapath, flags) self.port_no = port_no self.queue_id = queue_id def _serialize_stats_body(self): msg_pack_into(ofproto.OFP_QUEUE_DESC_REQUEST_PACK_STR, self.buf, ofproto.OFP_MULTIPART_REQUEST_SIZE, self.port_no, self.queue_id) @OFPMultipartReply.register_stats_type() @_set_stats_type(ofproto.OFPMP_QUEUE_DESC, OFPQueueDesc) @_set_msg_type(ofproto.OFPT_MULTIPART_REPLY) class OFPQueueDescStatsReply(OFPMultipartReply): """ Queue description reply message The switch responds with this message to a queue description request. ================ ====================================================== Attribute Description ================ ====================================================== body List of ``OFPQueueDesc`` instance ================ ====================================================== Example:: @set_ev_cls(ofp_event.EventOFPQueueDescStatsReply, MAIN_DISPATCHER) def queue_desc_stats_reply_handler(self, ev): queues = [] for q in ev.msg.body: queues.append('port_no=%d queue_id=0x%08x properties=%s' % (q.port_no, q.queue_id, repr(q.properties))) self.logger.debug('OFPQueueDescStatsReply received: %s', queues) """ def __init__(self, datapath, type_=None, **kwargs): super(OFPQueueDescStatsReply, self).__init__(datapath, **kwargs) class OFPQueueStatsProp(OFPPropBase): _TYPES = {} @OFPQueueStatsProp.register_type(ofproto.OFPQSPT_EXPERIMENTER) class OFPQueueStatsPropExperimenter(OFPPropCommonExperimenter4ByteData): pass class OFPQueueStats(StringifyMixin): def __init__(self, length=None, port_no=None, queue_id=None, tx_bytes=None, tx_packets=None, tx_errors=None, duration_sec=None, duration_nsec=None, properties=None): super(OFPQueueStats, self).__init__() self.length = length self.port_no = port_no self.queue_id = queue_id self.tx_bytes = tx_bytes self.tx_packets = tx_packets self.tx_errors = tx_errors self.duration_sec = duration_sec self.duration_nsec = duration_nsec self.properties = properties @classmethod def parser(cls, buf, offset): (length, port_no, queue_id, tx_bytes, tx_packets, tx_errors, duration_sec, duration_nsec) = struct.unpack_from( ofproto.OFP_QUEUE_STATS_PACK_STR, buf, offset) props = [] rest = buf[offset + ofproto.OFP_QUEUE_STATS_SIZE:offset + length] while rest: p, rest = OFPQueueStatsProp.parse(rest) props.append(p) stats = cls(length, port_no, queue_id, tx_bytes, tx_packets, tx_errors, duration_sec, duration_nsec, props) return stats @_set_stats_type(ofproto.OFPMP_QUEUE_STATS, OFPQueueStats) @_set_msg_type(ofproto.OFPT_MULTIPART_REQUEST) class OFPQueueStatsRequest(OFPMultipartRequest): """ Queue statistics request message The controller uses this message to query queue statictics. ================ ====================================================== Attribute Description ================ ====================================================== flags Zero or ``OFPMPF_REQ_MORE`` port_no Port number to read queue_id ID of queue to read ================ ====================================================== Example:: def send_queue_stats_request(self, datapath): ofp = datapath.ofproto ofp_parser = datapath.ofproto_parser req = ofp_parser.OFPQueueStatsRequest(datapath, 0, ofp.OFPP_ANY, ofp.OFPQ_ALL) datapath.send_msg(req) """ def __init__(self, datapath, flags=0, port_no=ofproto.OFPP_ANY, queue_id=ofproto.OFPQ_ALL, type_=None): super(OFPQueueStatsRequest, self).__init__(datapath, flags) self.port_no = port_no self.queue_id = queue_id def _serialize_stats_body(self): msg_pack_into(ofproto.OFP_QUEUE_STATS_REQUEST_PACK_STR, self.buf, ofproto.OFP_MULTIPART_REQUEST_SIZE, self.port_no, self.queue_id) @OFPMultipartReply.register_stats_type() @_set_stats_type(ofproto.OFPMP_QUEUE_STATS, OFPQueueStats) @_set_msg_type(ofproto.OFPT_MULTIPART_REPLY) class OFPQueueStatsReply(OFPMultipartReply): """ Queue statistics reply message The switch responds with this message to an aggregate flow statistics request. ================ ====================================================== Attribute Description ================ ====================================================== body List of ``OFPQueueStats`` instance ================ ====================================================== Example:: @set_ev_cls(ofp_event.EventOFPQueueStatsReply, MAIN_DISPATCHER) def queue_stats_reply_handler(self, ev): queues = [] for stat in ev.msg.body: queues.append('port_no=%d queue_id=%d ' 'tx_bytes=%d tx_packets=%d tx_errors=%d ' 'duration_sec=%d duration_nsec=%d' 'properties=%s' % (stat.port_no, stat.queue_id, stat.tx_bytes, stat.tx_packets, stat.tx_errors, stat.duration_sec, stat.duration_nsec, repr(stat.properties))) self.logger.debug('QueueStats: %s', queues) """ def __init__(self, datapath, type_=None, **kwargs): super(OFPQueueStatsReply, self).__init__(datapath, **kwargs) class OFPBucketCounter(StringifyMixin): def __init__(self, packet_count, byte_count): super(OFPBucketCounter, self).__init__() self.packet_count = packet_count self.byte_count = byte_count @classmethod def parser(cls, buf, offset): packet_count, byte_count = struct.unpack_from( ofproto.OFP_BUCKET_COUNTER_PACK_STR, buf, offset) return cls(packet_count, byte_count) class OFPGroupStats(StringifyMixin): def __init__(self, length=None, group_id=None, ref_count=None, packet_count=None, byte_count=None, duration_sec=None, duration_nsec=None, bucket_stats=None): super(OFPGroupStats, self).__init__() self.length = length self.group_id = group_id self.ref_count = ref_count self.packet_count = packet_count self.byte_count = byte_count self.duration_sec = duration_sec self.duration_nsec = duration_nsec self.bucket_stats = bucket_stats @classmethod def parser(cls, buf, offset): group = struct.unpack_from(ofproto.OFP_GROUP_STATS_PACK_STR, buf, offset) group_stats = cls(*group) group_stats.bucket_stats = [] total_len = group_stats.length + offset offset += ofproto.OFP_GROUP_STATS_SIZE while total_len > offset: b = OFPBucketCounter.parser(buf, offset) group_stats.bucket_stats.append(b) offset += ofproto.OFP_BUCKET_COUNTER_SIZE return group_stats @_set_stats_type(ofproto.OFPMP_GROUP, OFPGroupStats) @_set_msg_type(ofproto.OFPT_MULTIPART_REQUEST) class OFPGroupStatsRequest(OFPMultipartRequest): """ Group statistics request message The controller uses this message to query statistics of one or more groups. ================ ====================================================== Attribute Description ================ ====================================================== flags Zero or ``OFPMPF_REQ_MORE`` group_id ID of group to read (OFPG_ALL to all groups) ================ ====================================================== Example:: def send_group_stats_request(self, datapath): ofp = datapath.ofproto ofp_parser = datapath.ofproto_parser req = ofp_parser.OFPGroupStatsRequest(datapath, 0, ofp.OFPG_ALL) datapath.send_msg(req) """ def __init__(self, datapath, flags=0, group_id=ofproto.OFPG_ALL, type_=None): super(OFPGroupStatsRequest, self).__init__(datapath, flags) self.group_id = group_id def _serialize_stats_body(self): msg_pack_into(ofproto.OFP_GROUP_STATS_REQUEST_PACK_STR, self.buf, ofproto.OFP_MULTIPART_REQUEST_SIZE, self.group_id) @OFPMultipartReply.register_stats_type() @_set_stats_type(ofproto.OFPMP_GROUP, OFPGroupStats) @_set_msg_type(ofproto.OFPT_MULTIPART_REPLY) class OFPGroupStatsReply(OFPMultipartReply): """ Group statistics reply message The switch responds with this message to a group statistics request. ================ ====================================================== Attribute Description ================ ====================================================== body List of ``OFPGroupStats`` instance ================ ====================================================== Example:: @set_ev_cls(ofp_event.EventOFPGroupStatsReply, MAIN_DISPATCHER) def group_stats_reply_handler(self, ev): groups = [] for stat in ev.msg.body: groups.append('length=%d group_id=%d ' 'ref_count=%d packet_count=%d byte_count=%d ' 'duration_sec=%d duration_nsec=%d' % (stat.length, stat.group_id, stat.ref_count, stat.packet_count, stat.byte_count, stat.duration_sec, stat.duration_nsec)) self.logger.debug('GroupStats: %s', groups) """ def __init__(self, datapath, type_=None, **kwargs): super(OFPGroupStatsReply, self).__init__(datapath, **kwargs) class OFPGroupDescStats(StringifyMixin): def __init__(self, type_=None, group_id=None, buckets=None, length=None): super(OFPGroupDescStats, self).__init__() self.type = type_ self.group_id = group_id self.buckets = buckets @classmethod def parser(cls, buf, offset): stats = cls() (stats.length, stats.type, stats.group_id) = struct.unpack_from( ofproto.OFP_GROUP_DESC_STATS_PACK_STR, buf, offset) offset += ofproto.OFP_GROUP_DESC_STATS_SIZE stats.buckets = [] length = ofproto.OFP_GROUP_DESC_STATS_SIZE while length < stats.length: bucket = OFPBucket.parser(buf, offset) stats.buckets.append(bucket) offset += bucket.len length += bucket.len return stats @_set_stats_type(ofproto.OFPMP_GROUP_DESC, OFPGroupDescStats) @_set_msg_type(ofproto.OFPT_MULTIPART_REQUEST) class OFPGroupDescStatsRequest(OFPMultipartRequest): """ Group description request message The controller uses this message to list the set of groups on a switch. ================ ====================================================== Attribute Description ================ ====================================================== flags Zero or ``OFPMPF_REQ_MORE`` ================ ====================================================== Example:: def send_group_desc_stats_request(self, datapath): ofp = datapath.ofproto ofp_parser = datapath.ofproto_parser req = ofp_parser.OFPGroupDescStatsRequest(datapath, 0) datapath.send_msg(req) """ def __init__(self, datapath, flags=0, type_=None): super(OFPGroupDescStatsRequest, self).__init__(datapath, flags) @OFPMultipartReply.register_stats_type() @_set_stats_type(ofproto.OFPMP_GROUP_DESC, OFPGroupDescStats) @_set_msg_type(ofproto.OFPT_MULTIPART_REPLY) class OFPGroupDescStatsReply(OFPMultipartReply): """ Group description reply message The switch responds with this message to a group description request. ================ ====================================================== Attribute Description ================ ====================================================== body List of ``OFPGroupDescStats`` instance ================ ====================================================== Example:: @set_ev_cls(ofp_event.EventOFPGroupDescStatsReply, MAIN_DISPATCHER) def group_desc_stats_reply_handler(self, ev): descs = [] for stat in ev.msg.body: descs.append('length=%d type=%d group_id=%d ' 'buckets=%s' % (stat.length, stat.type, stat.group_id, stat.bucket)) self.logger.debug('GroupDescStats: %s', descs) """ def __init__(self, datapath, type_=None, **kwargs): super(OFPGroupDescStatsReply, self).__init__(datapath, **kwargs) class OFPGroupFeaturesStats(ofproto_parser.namedtuple('OFPGroupFeaturesStats', ('types', 'capabilities', 'max_groups', 'actions'))): @classmethod def parser(cls, buf, offset): group_features = struct.unpack_from( ofproto.OFP_GROUP_FEATURES_PACK_STR, buf, offset) types = group_features[0] capabilities = group_features[1] max_groups = list(group_features[2:6]) actions = list(group_features[6:10]) stats = cls(types, capabilities, max_groups, actions) stats.length = ofproto.OFP_GROUP_FEATURES_SIZE return stats @_set_stats_type(ofproto.OFPMP_GROUP_FEATURES, OFPGroupFeaturesStats) @_set_msg_type(ofproto.OFPT_MULTIPART_REQUEST) class OFPGroupFeaturesStatsRequest(OFPMultipartRequest): """ Group features request message The controller uses this message to list the capabilities of groups on a switch. ================ ====================================================== Attribute Description ================ ====================================================== flags Zero or ``OFPMPF_REQ_MORE`` ================ ====================================================== Example:: def send_group_features_stats_request(self, datapath): ofp_parser = datapath.ofproto_parser req = ofp_parser.OFPGroupFeaturesStatsRequest(datapath, 0) datapath.send_msg(req) """ def __init__(self, datapath, flags=0, type_=None): super(OFPGroupFeaturesStatsRequest, self).__init__(datapath, flags) @OFPMultipartReply.register_stats_type(body_single_struct=True) @_set_stats_type(ofproto.OFPMP_GROUP_FEATURES, OFPGroupFeaturesStats) @_set_msg_type(ofproto.OFPT_MULTIPART_REPLY) class OFPGroupFeaturesStatsReply(OFPMultipartReply): """ Group features reply message The switch responds with this message to a group features request. ================ ====================================================== Attribute Description ================ ====================================================== body Instance of ``OFPGroupFeaturesStats`` ================ ====================================================== Example:: @set_ev_cls(ofp_event.EventOFPGroupFeaturesStatsReply, MAIN_DISPATCHER) def group_features_stats_reply_handler(self, ev): body = ev.msg.body self.logger.debug('GroupFeaturesStats: types=%d ' 'capabilities=0x%08x max_groups=%s ' 'actions=%s', body.types, body.capabilities, body.max_groups, body.actions) """ def __init__(self, datapath, type_=None, **kwargs): super(OFPGroupFeaturesStatsReply, self).__init__(datapath, **kwargs) class OFPMeterBandStats(StringifyMixin): def __init__(self, packet_band_count, byte_band_count): super(OFPMeterBandStats, self).__init__() self.packet_band_count = packet_band_count self.byte_band_count = byte_band_count @classmethod def parser(cls, buf, offset): band_stats = struct.unpack_from( ofproto.OFP_METER_BAND_STATS_PACK_STR, buf, offset) return cls(*band_stats) class OFPMeterStats(StringifyMixin): def __init__(self, meter_id=None, flow_count=None, packet_in_count=None, byte_in_count=None, duration_sec=None, duration_nsec=None, band_stats=None, len_=None): super(OFPMeterStats, self).__init__() self.meter_id = meter_id self.len = 0 self.flow_count = flow_count self.packet_in_count = packet_in_count self.byte_in_count = byte_in_count self.duration_sec = duration_sec self.duration_nsec = duration_nsec self.band_stats = band_stats @classmethod def parser(cls, buf, offset): meter_stats = cls() (meter_stats.meter_id, meter_stats.len, meter_stats.flow_count, meter_stats.packet_in_count, meter_stats.byte_in_count, meter_stats.duration_sec, meter_stats.duration_nsec) = struct.unpack_from( ofproto.OFP_METER_STATS_PACK_STR, buf, offset) offset += ofproto.OFP_METER_STATS_SIZE meter_stats.band_stats = [] length = ofproto.OFP_METER_STATS_SIZE while length < meter_stats.len: band_stats = OFPMeterBandStats.parser(buf, offset) meter_stats.band_stats.append(band_stats) offset += ofproto.OFP_METER_BAND_STATS_SIZE length += ofproto.OFP_METER_BAND_STATS_SIZE return meter_stats @_set_stats_type(ofproto.OFPMP_METER, OFPMeterStats) @_set_msg_type(ofproto.OFPT_MULTIPART_REQUEST) class OFPMeterStatsRequest(OFPMultipartRequest): """ Meter statistics request message The controller uses this message to query statistics for one or more meters. ================ ====================================================== Attribute Description ================ ====================================================== flags Zero or ``OFPMPF_REQ_MORE`` meter_id ID of meter to read (OFPM_ALL to all meters) ================ ====================================================== Example:: def send_meter_stats_request(self, datapath): ofp = datapath.ofproto ofp_parser = datapath.ofproto_parser req = ofp_parser.OFPMeterStatsRequest(datapath, 0, ofp.OFPM_ALL) datapath.send_msg(req) """ def __init__(self, datapath, flags=0, meter_id=ofproto.OFPM_ALL, type_=None): super(OFPMeterStatsRequest, self).__init__(datapath, flags) self.meter_id = meter_id def _serialize_stats_body(self): msg_pack_into(ofproto.OFP_METER_MULTIPART_REQUEST_PACK_STR, self.buf, ofproto.OFP_MULTIPART_REQUEST_SIZE, self.meter_id) @OFPMultipartReply.register_stats_type() @_set_stats_type(ofproto.OFPMP_METER, OFPMeterStats) @_set_msg_type(ofproto.OFPT_MULTIPART_REPLY) class OFPMeterStatsReply(OFPMultipartReply): """ Meter statistics reply message The switch responds with this message to a meter statistics request. ================ ====================================================== Attribute Description ================ ====================================================== body List of ``OFPMeterStats`` instance ================ ====================================================== Example:: @set_ev_cls(ofp_event.EventOFPMeterStatsReply, MAIN_DISPATCHER) def meter_stats_reply_handler(self, ev): meters = [] for stat in ev.msg.body: meters.append('meter_id=0x%08x len=%d flow_count=%d ' 'packet_in_count=%d byte_in_count=%d ' 'duration_sec=%d duration_nsec=%d ' 'band_stats=%s' % (stat.meter_id, stat.len, stat.flow_count, stat.packet_in_count, stat.byte_in_count, stat.duration_sec, stat.duration_nsec, stat.band_stats)) self.logger.debug('MeterStats: %s', meters) """ def __init__(self, datapath, type_=None, **kwargs): super(OFPMeterStatsReply, self).__init__(datapath, **kwargs) class OFPMeterBand(StringifyMixin): def __init__(self, type_, len_): super(OFPMeterBand, self).__init__() self.type = type_ self.len = len_ class OFPMeterBandHeader(OFPMeterBand): _METER_BAND = {} @staticmethod def register_meter_band_type(type_, len_): def _register_meter_band_type(cls): OFPMeterBandHeader._METER_BAND[type_] = cls cls.cls_meter_band_type = type_ cls.cls_meter_band_len = len_ return cls return _register_meter_band_type def __init__(self): cls = self.__class__ super(OFPMeterBandHeader, self).__init__(cls.cls_meter_band_type, cls.cls_meter_band_len) @classmethod def parser(cls, buf, offset): type_, len_, _rate, _burst_size = struct.unpack_from( ofproto.OFP_METER_BAND_HEADER_PACK_STR, buf, offset) cls_ = cls._METER_BAND[type_] assert cls_.cls_meter_band_len == len_ return cls_.parser(buf, offset) @OFPMeterBandHeader.register_meter_band_type( ofproto.OFPMBT_DROP, ofproto.OFP_METER_BAND_DROP_SIZE) class OFPMeterBandDrop(OFPMeterBandHeader): def __init__(self, rate=0, burst_size=0, type_=None, len_=None): super(OFPMeterBandDrop, self).__init__() self.rate = rate self.burst_size = burst_size def serialize(self, buf, offset): msg_pack_into(ofproto.OFP_METER_BAND_DROP_PACK_STR, buf, offset, self.type, self.len, self.rate, self.burst_size) @classmethod def parser(cls, buf, offset): type_, len_, rate, burst_size = struct.unpack_from( ofproto.OFP_METER_BAND_DROP_PACK_STR, buf, offset) assert cls.cls_meter_band_type == type_ assert cls.cls_meter_band_len == len_ return cls(rate, burst_size) @OFPMeterBandHeader.register_meter_band_type( ofproto.OFPMBT_DSCP_REMARK, ofproto.OFP_METER_BAND_DSCP_REMARK_SIZE) class OFPMeterBandDscpRemark(OFPMeterBandHeader): def __init__(self, rate=0, burst_size=0, prec_level=0, type_=None, len_=None): super(OFPMeterBandDscpRemark, self).__init__() self.rate = rate self.burst_size = burst_size self.prec_level = prec_level def serialize(self, buf, offset): msg_pack_into(ofproto.OFP_METER_BAND_DSCP_REMARK_PACK_STR, buf, offset, self.type, self.len, self.rate, self.burst_size, self.prec_level) @classmethod def parser(cls, buf, offset): type_, len_, rate, burst_size, prec_level = struct.unpack_from( ofproto.OFP_METER_BAND_DSCP_REMARK_PACK_STR, buf, offset) assert cls.cls_meter_band_type == type_ assert cls.cls_meter_band_len == len_ return cls(rate, burst_size, prec_level) @OFPMeterBandHeader.register_meter_band_type( ofproto.OFPMBT_EXPERIMENTER, ofproto.OFP_METER_BAND_EXPERIMENTER_SIZE) class OFPMeterBandExperimenter(OFPMeterBandHeader): def __init__(self, rate=0, burst_size=0, experimenter=None, type_=None, len_=None): super(OFPMeterBandExperimenter, self).__init__() self.rate = rate self.burst_size = burst_size self.experimenter = experimenter def serialize(self, buf, offset): msg_pack_into(ofproto.OFP_METER_BAND_EXPERIMENTER_PACK_STR, buf, offset, self.type, self.len, self.rate, self.burst_size, self.experimenter) @classmethod def parser(cls, buf, offset): type_, len_, rate, burst_size, experimenter = struct.unpack_from( ofproto.OFP_METER_BAND_EXPERIMENTER_PACK_STR, buf, offset) assert cls.cls_meter_band_type == type_ assert cls.cls_meter_band_len == len_ return cls(rate, burst_size, experimenter) class OFPMeterConfigStats(StringifyMixin): def __init__(self, flags=None, meter_id=None, bands=None, length=None): super(OFPMeterConfigStats, self).__init__() self.length = None self.flags = flags self.meter_id = meter_id self.bands = bands @classmethod def parser(cls, buf, offset): meter_config = cls() (meter_config.length, meter_config.flags, meter_config.meter_id) = struct.unpack_from( ofproto.OFP_METER_CONFIG_PACK_STR, buf, offset) offset += ofproto.OFP_METER_CONFIG_SIZE meter_config.bands = [] length = ofproto.OFP_METER_CONFIG_SIZE while length < meter_config.length: band = OFPMeterBandHeader.parser(buf, offset) meter_config.bands.append(band) offset += band.len length += band.len return meter_config @_set_stats_type(ofproto.OFPMP_METER_CONFIG, OFPMeterConfigStats) @_set_msg_type(ofproto.OFPT_MULTIPART_REQUEST) class OFPMeterConfigStatsRequest(OFPMultipartRequest): """ Meter configuration statistics request message The controller uses this message to query configuration for one or more meters. ================ ====================================================== Attribute Description ================ ====================================================== flags Zero or ``OFPMPF_REQ_MORE`` meter_id ID of meter to read (OFPM_ALL to all meters) ================ ====================================================== Example:: def send_meter_config_stats_request(self, datapath): ofp = datapath.ofproto ofp_parser = datapath.ofproto_parser req = ofp_parser.OFPMeterConfigStatsRequest(datapath, 0, ofp.OFPM_ALL) datapath.send_msg(req) """ def __init__(self, datapath, flags=0, meter_id=ofproto.OFPM_ALL, type_=None): super(OFPMeterConfigStatsRequest, self).__init__(datapath, flags) self.meter_id = meter_id def _serialize_stats_body(self): msg_pack_into(ofproto.OFP_METER_MULTIPART_REQUEST_PACK_STR, self.buf, ofproto.OFP_MULTIPART_REQUEST_SIZE, self.meter_id) @OFPMultipartReply.register_stats_type() @_set_stats_type(ofproto.OFPMP_METER_CONFIG, OFPMeterConfigStats) @_set_msg_type(ofproto.OFPT_MULTIPART_REPLY) class OFPMeterConfigStatsReply(OFPMultipartReply): """ Meter configuration statistics reply message The switch responds with this message to a meter configuration statistics request. ================ ====================================================== Attribute Description ================ ====================================================== body List of ``OFPMeterConfigStats`` instance ================ ====================================================== Example:: @set_ev_cls(ofp_event.EventOFPMeterConfigStatsReply, MAIN_DISPATCHER) def meter_config_stats_reply_handler(self, ev): configs = [] for stat in ev.msg.body: configs.append('length=%d flags=0x%04x meter_id=0x%08x ' 'bands=%s' % (stat.length, stat.flags, stat.meter_id, stat.bands)) self.logger.debug('MeterConfigStats: %s', configs) """ def __init__(self, datapath, type_=None, **kwargs): super(OFPMeterConfigStatsReply, self).__init__(datapath, **kwargs) class OFPMeterFeaturesStats(ofproto_parser.namedtuple('OFPMeterFeaturesStats', ('max_meter', 'band_types', 'capabilities', 'max_bands', 'max_color'))): @classmethod def parser(cls, buf, offset): meter_features = struct.unpack_from( ofproto.OFP_METER_FEATURES_PACK_STR, buf, offset) stats = cls(*meter_features) stats.length = ofproto.OFP_METER_FEATURES_SIZE return stats @_set_stats_type(ofproto.OFPMP_METER_FEATURES, OFPMeterFeaturesStats) @_set_msg_type(ofproto.OFPT_MULTIPART_REQUEST) class OFPMeterFeaturesStatsRequest(OFPMultipartRequest): """ Meter features statistics request message The controller uses this message to query the set of features of the metering subsystem. ================ ====================================================== Attribute Description ================ ====================================================== flags Zero or ``OFPMPF_REQ_MORE`` ================ ====================================================== Example:: def send_meter_features_stats_request(self, datapath): ofp_parser = datapath.ofproto_parser req = ofp_parser.OFPMeterFeaturesStatsRequest(datapath, 0) datapath.send_msg(req) """ def __init__(self, datapath, flags=0, type_=None): super(OFPMeterFeaturesStatsRequest, self).__init__(datapath, flags) @OFPMultipartReply.register_stats_type() @_set_stats_type(ofproto.OFPMP_METER_FEATURES, OFPMeterFeaturesStats) @_set_msg_type(ofproto.OFPT_MULTIPART_REPLY) class OFPMeterFeaturesStatsReply(OFPMultipartReply): """ Meter features statistics reply message The switch responds with this message to a meter features statistics request. ================ ====================================================== Attribute Description ================ ====================================================== body List of ``OFPMeterFeaturesStats`` instance ================ ====================================================== Example:: @set_ev_cls(ofp_event.EventOFPMeterFeaturesStatsReply, MAIN_DISPATCHER) def meter_features_stats_reply_handler(self, ev): features = [] for stat in ev.msg.body: features.append('max_meter=%d band_types=0x%08x ' 'capabilities=0x%08x max_bands=%d ' 'max_color=%d' % (stat.max_meter, stat.band_types, stat.capabilities, stat.max_bands, stat.max_color)) self.logger.debug('MeterFeaturesStats: %s', features) """ def __init__(self, datapath, type_=None, **kwargs): super(OFPMeterFeaturesStatsReply, self).__init__(datapath, **kwargs) class OFPFlowUpdate(StringifyMixin): def __init__(self, length, event): super(OFPFlowUpdate, self).__init__() self.length = length self.event = event class OFPFlowUpdateHeader(OFPFlowUpdate): _EVENT = {} @staticmethod def register_flow_update_event(event, length): def _register_flow_update_event(cls): OFPFlowUpdateHeader._EVENT[event] = cls cls.cls_flow_update_event = event cls.cls_flow_update_length = length return cls return _register_flow_update_event def __init__(self, length=None, event=None): cls = self.__class__ super(OFPFlowUpdateHeader, self).__init__(length, cls.cls_flow_update_event) self.length = length @classmethod def parser(cls, buf, offset): length, event = struct.unpack_from( ofproto.OFP_FLOW_UPDATE_HEADER_PACK_STR, buf, offset) cls_ = cls._EVENT[event] return cls_.parser(buf, offset) @OFPFlowUpdateHeader.register_flow_update_event( ofproto.OFPFME_INITIAL, ofproto.OFP_FLOW_UPDATE_FULL_SIZE) @OFPFlowUpdateHeader.register_flow_update_event( ofproto.OFPFME_ADDED, ofproto.OFP_FLOW_UPDATE_FULL_SIZE) @OFPFlowUpdateHeader.register_flow_update_event( ofproto.OFPFME_REMOVED, ofproto.OFP_FLOW_UPDATE_FULL_SIZE) @OFPFlowUpdateHeader.register_flow_update_event( ofproto.OFPFME_MODIFIED, ofproto.OFP_FLOW_UPDATE_FULL_SIZE) class OFPFlowUpdateFull(OFPFlowUpdateHeader): def __init__(self, length=None, event=None, table_id=None, reason=None, idle_timeout=None, hard_timeout=None, priority=None, cookie=None, match=None, instructions=None): instructions = instructions if instructions else [] super(OFPFlowUpdateFull, self).__init__(length, event) self.table_id = table_id self.reason = reason self.idle_timeout = idle_timeout self.hard_timeout = hard_timeout self.priority = priority self.cookie = cookie self.match = match assert (event != ofproto.OFPFME_REMOVED or len(instructions) == 0) for i in instructions: assert isinstance(i, OFPInstruction) self.instructions = instructions @classmethod def parser(cls, buf, offset): (length, event, table_id, reason, idle_timeout, hard_timeout, priority, cookie) = struct.unpack_from(ofproto.OFP_FLOW_UPDATE_FULL_0_PACK_STR, buf, offset) offset += ofproto.OFP_FLOW_UPDATE_FULL_0_SIZE assert cls.cls_flow_update_length <= length assert cls.cls_flow_update_event == event match = OFPMatch.parser(buf, offset) match_length = utils.round_up(match.length, 8) offset += match_length inst_length = (length - ofproto.OFP_FLOW_UPDATE_FULL_0_SIZE - match_length) instructions = [] while inst_length > 0: inst = OFPInstruction.parser(buf, offset) instructions.append(inst) offset += inst.len inst_length -= inst.len return cls(length, event, table_id, reason, idle_timeout, hard_timeout, priority, cookie, match, instructions) @OFPFlowUpdateHeader.register_flow_update_event( ofproto.OFPFME_ABBREV, ofproto.OFP_FLOW_UPDATE_ABBREV_SIZE) class OFPFlowUpdateAbbrev(OFPFlowUpdateHeader): def __init__(self, length=None, event=None, xid=None): super(OFPFlowUpdateAbbrev, self).__init__(length, event) self.xid = xid @classmethod def parser(cls, buf, offset): length, event, xid = struct.unpack_from( ofproto.OFP_FLOW_UPDATE_ABBREV_PACK_STR, buf, offset) assert cls.cls_flow_update_length == length assert cls.cls_flow_update_event == event return cls(length, event, xid) @OFPFlowUpdateHeader.register_flow_update_event( ofproto.OFPFME_PAUSED, ofproto.OFP_FLOW_UPDATE_PAUSED_SIZE) @OFPFlowUpdateHeader.register_flow_update_event( ofproto.OFPFME_RESUMED, ofproto.OFP_FLOW_UPDATE_PAUSED_SIZE) class OFPFlowUpdatePaused(OFPFlowUpdateHeader): @classmethod def parser(cls, buf, offset): length, event = struct.unpack_from( ofproto.OFP_FLOW_UPDATE_PAUSED_PACK_STR, buf, offset) assert cls.cls_flow_update_length == length assert cls.cls_flow_update_event == event return cls(length, event) class OFPFlowMonitorRequestBase(OFPMultipartRequest): def __init__(self, datapath, flags, monitor_id, out_port, out_group, monitor_flags, table_id, command, match): super(OFPFlowMonitorRequestBase, self).__init__(datapath, flags) self.monitor_id = monitor_id self.out_port = out_port self.out_group = out_group self.monitor_flags = monitor_flags self.table_id = table_id self.command = command self.match = match def _serialize_stats_body(self): offset = ofproto.OFP_MULTIPART_REQUEST_SIZE msg_pack_into(ofproto.OFP_FLOW_MONITOR_REQUEST_0_PACK_STR, self.buf, offset, self.monitor_id, self.out_port, self.out_group, self.monitor_flags, self.table_id, self.command) offset += ofproto.OFP_FLOW_MONITOR_REQUEST_0_SIZE self.match.serialize(self.buf, offset) @_set_stats_type(ofproto.OFPMP_FLOW_MONITOR, OFPFlowUpdateHeader) @_set_msg_type(ofproto.OFPT_MULTIPART_REQUEST) class OFPFlowMonitorRequest(OFPFlowMonitorRequestBase): """ Flow monitor request message The controller uses this message to query flow monitors. ================ ====================================================== Attribute Description ================ ====================================================== flags Zero or ``OFPMPF_REQ_MORE`` monitor_id Controller-assigned ID for this monitor out_port Require matching entries to include this as an output port out_group Require matching entries to include this as an output group monitor_flags Bitmap of the following flags. | OFPFMF_INITIAL | OFPFMF_ADD | OFPFMF_REMOVED | OFPFMF_MODIFY | OFPFMF_INSTRUCTIONS | OFPFMF_NO_ABBREV | OFPFMF_ONLY_OWN table_id ID of table to monitor command One of the following values. | OFPFMC_ADD | OFPFMC_MODIFY | OFPFMC_DELETE match Instance of ``OFPMatch`` ================ ====================================================== Example:: def send_flow_monitor_request(self, datapath): ofp = datapath.ofproto ofp_parser = datapath.ofproto_parser monitor_flags = [ofp.OFPFMF_INITIAL, ofp.OFPFMF_ONLY_OWN] match = ofp_parser.OFPMatch(in_port=1) req = ofp_parser.OFPFlowMonitorRequest(datapath, 0, 10000, ofp.OFPP_ANY, ofp.OFPG_ANY, monitor_flags, ofp.OFPTT_ALL, ofp.OFPFMC_ADD, match) datapath.send_msg(req) """ def __init__(self, datapath, flags=0, monitor_id=0, out_port=ofproto.OFPP_ANY, out_group=ofproto.OFPG_ANY, monitor_flags=0, table_id=ofproto.OFPTT_ALL, command=ofproto.OFPFMC_ADD, match=None, type_=None): if match is None: match = OFPMatch() super(OFPFlowMonitorRequest, self).__init__(datapath, flags, monitor_id, out_port, out_group, monitor_flags, table_id, command, match) @OFPMultipartReply.register_stats_type() @_set_stats_type(ofproto.OFPMP_FLOW_MONITOR, OFPFlowUpdateHeader) @_set_msg_type(ofproto.OFPT_MULTIPART_REPLY) class OFPFlowMonitorReply(OFPMultipartReply): """ Flow monitor reply message The switch responds with this message to a flow monitor request. ================ ====================================================== Attribute Description ================ ====================================================== body List of list of the following class instance. | OFPFlowMonitorFull | OFPFlowMonitorAbbrev | OFPFlowMonitorPaused ================ ====================================================== Example:: @set_ev_cls(ofp_event.EventOFPFlowMonitorReply, MAIN_DISPATCHER) def flow_monitor_reply_handler(self, ev): msg = ev.msg dp = msg.datapath ofp = dp.ofproto flow_updates = [] for update in msg.body: update_str = 'length=%d event=%d' % (update.length, update.event) if (update.event == ofp.OFPFME_INITIAL or update.event == ofp.OFPFME_ADDED or update.event == ofp.OFPFME_REMOVED or update.event == ofp.OFPFME_MODIFIED): update_str += 'table_id=%d reason=%d idle_timeout=%d ' 'hard_timeout=%d priority=%d cookie=%d ' 'match=%d instructions=%s' % (update.table_id, update.reason, update.idle_timeout, update.hard_timeout, update.priority, update.cookie, update.match, update.instructions) elif update.event == ofp.OFPFME_ABBREV: update_str += 'xid=%d' % (update.xid) flow_updates.append(update_str) self.logger.debug('FlowUpdates: %s', flow_updates) """ def __init__(self, datapath, type_=None, **kwargs): super(OFPFlowMonitorReply, self).__init__(datapath, **kwargs) class OFPExperimenterMultipart(ofproto_parser.namedtuple( 'OFPExperimenterMultipart', ('experimenter', 'exp_type', 'data'))): """ The body of OFPExperimenterStatsReply multipart messages. ================ ====================================================== Attribute Description ================ ====================================================== experimenter Experimenter ID exp_type Experimenter defined data Experimenter defined additional data ================ ====================================================== """ @classmethod def parser(cls, buf, offset): args = struct.unpack_from( ofproto.OFP_EXPERIMENTER_MULTIPART_HEADER_PACK_STR, buf, offset) args = list(args) args.append(buf[offset + ofproto.OFP_EXPERIMENTER_MULTIPART_HEADER_SIZE:]) stats = cls(*args) stats.length = ofproto.OFP_METER_FEATURES_SIZE return stats def serialize(self): buf = bytearray() msg_pack_into(ofproto.OFP_EXPERIMENTER_MULTIPART_HEADER_PACK_STR, buf, 0, self.experimenter, self.exp_type) return buf + self.data class OFPExperimenterStatsRequestBase(OFPMultipartRequest): def __init__(self, datapath, flags, experimenter, exp_type, type_=None): super(OFPExperimenterStatsRequestBase, self).__init__(datapath, flags) self.experimenter = experimenter self.exp_type = exp_type @_set_stats_type(ofproto.OFPMP_EXPERIMENTER, OFPExperimenterMultipart) @_set_msg_type(ofproto.OFPT_MULTIPART_REQUEST) class OFPExperimenterStatsRequest(OFPExperimenterStatsRequestBase): """ Experimenter multipart request message ================ ====================================================== Attribute Description ================ ====================================================== flags Zero or ``OFPMPF_REQ_MORE`` experimenter Experimenter ID exp_type Experimenter defined data Experimenter defined additional data ================ ====================================================== """ def __init__(self, datapath, flags, experimenter, exp_type, data, type_=None): super(OFPExperimenterStatsRequest, self).__init__(datapath, flags, experimenter, exp_type, type_) self.data = data def _serialize_stats_body(self): body = OFPExperimenterMultipart(experimenter=self.experimenter, exp_type=self.exp_type, data=self.data) self.buf += body.serialize() @OFPMultipartReply.register_stats_type(body_single_struct=True) @_set_stats_type(ofproto.OFPMP_EXPERIMENTER, OFPExperimenterMultipart) @_set_msg_type(ofproto.OFPT_MULTIPART_REPLY) class OFPExperimenterStatsReply(OFPMultipartReply): """ Experimenter multipart reply message ================ ====================================================== Attribute Description ================ ====================================================== body An ``OFPExperimenterMultipart`` instance ================ ====================================================== """ def __init__(self, datapath, type_=None, **kwargs): super(OFPExperimenterStatsReply, self).__init__(datapath, **kwargs) class OFPFlowStats(StringifyMixin): def __init__(self, table_id=None, duration_sec=None, duration_nsec=None, priority=None, idle_timeout=None, hard_timeout=None, flags=None, importance=None, cookie=None, packet_count=None, byte_count=None, match=None, instructions=None, length=None): super(OFPFlowStats, self).__init__() self.table_id = table_id self.duration_sec = duration_sec self.duration_nsec = duration_nsec self.priority = priority self.idle_timeout = idle_timeout self.hard_timeout = hard_timeout self.flags = flags self.importance = importance self.cookie = cookie self.packet_count = packet_count self.byte_count = byte_count self.match = match self.instructions = instructions self.length = length @classmethod def parser(cls, buf, offset): flow_stats = cls() (flow_stats.length, flow_stats.table_id, flow_stats.duration_sec, flow_stats.duration_nsec, flow_stats.priority, flow_stats.idle_timeout, flow_stats.hard_timeout, flow_stats.flags, flow_stats.importance, flow_stats.cookie, flow_stats.packet_count, flow_stats.byte_count) = struct.unpack_from( ofproto.OFP_FLOW_STATS_0_PACK_STR, buf, offset) offset += ofproto.OFP_FLOW_STATS_0_SIZE flow_stats.match = OFPMatch.parser(buf, offset) match_length = utils.round_up(flow_stats.match.length, 8) inst_length = (flow_stats.length - (ofproto.OFP_FLOW_STATS_SIZE - ofproto.OFP_MATCH_SIZE + match_length)) offset += match_length instructions = [] while inst_length > 0: inst = OFPInstruction.parser(buf, offset) instructions.append(inst) offset += inst.len inst_length -= inst.len flow_stats.instructions = instructions return flow_stats class OFPFlowStatsRequestBase(OFPMultipartRequest): def __init__(self, datapath, flags, table_id, out_port, out_group, cookie, cookie_mask, match): super(OFPFlowStatsRequestBase, self).__init__(datapath, flags) self.table_id = table_id self.out_port = out_port self.out_group = out_group self.cookie = cookie self.cookie_mask = cookie_mask self.match = match def _serialize_stats_body(self): offset = ofproto.OFP_MULTIPART_REQUEST_SIZE msg_pack_into(ofproto.OFP_FLOW_STATS_REQUEST_0_PACK_STR, self.buf, offset, self.table_id, self.out_port, self.out_group, self.cookie, self.cookie_mask) offset += ofproto.OFP_FLOW_STATS_REQUEST_0_SIZE self.match.serialize(self.buf, offset) @_set_stats_type(ofproto.OFPMP_FLOW, OFPFlowStats) @_set_msg_type(ofproto.OFPT_MULTIPART_REQUEST) class OFPFlowStatsRequest(OFPFlowStatsRequestBase): """ Individual flow statistics request message The controller uses this message to query individual flow statistics. ================ ====================================================== Attribute Description ================ ====================================================== flags Zero or ``OFPMPF_REQ_MORE`` table_id ID of table to read out_port Require matching entries to include this as an output port out_group Require matching entries to include this as an output group cookie Require matching entries to contain this cookie value cookie_mask Mask used to restrict the cookie bits that must match match Instance of ``OFPMatch`` ================ ====================================================== Example:: def send_flow_stats_request(self, datapath): ofp = datapath.ofproto ofp_parser = datapath.ofproto_parser cookie = cookie_mask = 0 match = ofp_parser.OFPMatch(in_port=1) req = ofp_parser.OFPFlowStatsRequest(datapath, 0, ofp.OFPTT_ALL, ofp.OFPP_ANY, ofp.OFPG_ANY, cookie, cookie_mask, match) datapath.send_msg(req) """ def __init__(self, datapath, flags=0, table_id=ofproto.OFPTT_ALL, out_port=ofproto.OFPP_ANY, out_group=ofproto.OFPG_ANY, cookie=0, cookie_mask=0, match=None, type_=None): if match is None: match = OFPMatch() super(OFPFlowStatsRequest, self).__init__(datapath, flags, table_id, out_port, out_group, cookie, cookie_mask, match) @OFPMultipartReply.register_stats_type() @_set_stats_type(ofproto.OFPMP_FLOW, OFPFlowStats) @_set_msg_type(ofproto.OFPT_MULTIPART_REPLY) class OFPFlowStatsReply(OFPMultipartReply): """ Individual flow statistics reply message The switch responds with this message to an individual flow statistics request. ================ ====================================================== Attribute Description ================ ====================================================== body List of ``OFPFlowStats`` instance ================ ====================================================== Example:: @set_ev_cls(ofp_event.EventOFPFlowStatsReply, MAIN_DISPATCHER) def flow_stats_reply_handler(self, ev): flows = [] for stat in ev.msg.body: flows.append('table_id=%s ' 'duration_sec=%d duration_nsec=%d ' 'priority=%d ' 'idle_timeout=%d hard_timeout=%d flags=0x%04x ' 'importance=%d cookie=%d packet_count=%d ' 'byte_count=%d match=%s instructions=%s' % (stat.table_id, stat.duration_sec, stat.duration_nsec, stat.priority, stat.idle_timeout, stat.hard_timeout, stat.flags, stat.importance, stat.cookie, stat.packet_count, stat.byte_count, stat.match, stat.instructions)) self.logger.debug('FlowStats: %s', flows) """ def __init__(self, datapath, type_=None, **kwargs): super(OFPFlowStatsReply, self).__init__(datapath, **kwargs) class OFPAggregateStats(ofproto_parser.namedtuple('OFPAggregateStats', ( 'packet_count', 'byte_count', 'flow_count'))): @classmethod def parser(cls, buf, offset): agg = struct.unpack_from( ofproto.OFP_AGGREGATE_STATS_REPLY_PACK_STR, buf, offset) stats = cls(*agg) stats.length = ofproto.OFP_AGGREGATE_STATS_REPLY_SIZE return stats @_set_stats_type(ofproto.OFPMP_AGGREGATE, OFPAggregateStats) @_set_msg_type(ofproto.OFPT_MULTIPART_REQUEST) class OFPAggregateStatsRequest(OFPFlowStatsRequestBase): """ Aggregate flow statistics request message The controller uses this message to query aggregate flow statictics. ================ ====================================================== Attribute Description ================ ====================================================== flags Zero or ``OFPMPF_REQ_MORE`` table_id ID of table to read out_port Require matching entries to include this as an output port out_group Require matching entries to include this as an output group cookie Require matching entries to contain this cookie value cookie_mask Mask used to restrict the cookie bits that must match match Instance of ``OFPMatch`` ================ ====================================================== Example:: def send_aggregate_stats_request(self, datapath): ofp = datapath.ofproto ofp_parser = datapath.ofproto_parser cookie = cookie_mask = 0 match = ofp_parser.OFPMatch(in_port=1) req = ofp_parser.OFPAggregateStatsRequest(datapath, 0, ofp.OFPTT_ALL, ofp.OFPP_ANY, ofp.OFPG_ANY, cookie, cookie_mask, match) datapath.send_msg(req) """ def __init__(self, datapath, flags, table_id, out_port, out_group, cookie, cookie_mask, match, type_=None): super(OFPAggregateStatsRequest, self).__init__(datapath, flags, table_id, out_port, out_group, cookie, cookie_mask, match) @OFPMultipartReply.register_stats_type(body_single_struct=True) @_set_stats_type(ofproto.OFPMP_AGGREGATE, OFPAggregateStats) @_set_msg_type(ofproto.OFPT_MULTIPART_REPLY) class OFPAggregateStatsReply(OFPMultipartReply): """ Aggregate flow statistics reply message The switch responds with this message to an aggregate flow statistics request. ================ ====================================================== Attribute Description ================ ====================================================== body Instance of ``OFPAggregateStats`` ================ ====================================================== Example:: @set_ev_cls(ofp_event.EventOFPAggregateStatsReply, MAIN_DISPATCHER) def aggregate_stats_reply_handler(self, ev): body = ev.msg.body self.logger.debug('AggregateStats: packet_count=%d byte_count=%d ' 'flow_count=%d', body.packet_count, body.byte_count, body.flow_count) """ def __init__(self, datapath, type_=None, **kwargs): super(OFPAggregateStatsReply, self).__init__(datapath, **kwargs) class OFPTableStats(ofproto_parser.namedtuple('OFPTableStats', ( 'table_id', 'active_count', 'lookup_count', 'matched_count'))): @classmethod def parser(cls, buf, offset): tbl = struct.unpack_from(ofproto.OFP_TABLE_STATS_PACK_STR, buf, offset) stats = cls(*tbl) stats.length = ofproto.OFP_TABLE_STATS_SIZE return stats @_set_stats_type(ofproto.OFPMP_TABLE, OFPTableStats) @_set_msg_type(ofproto.OFPT_MULTIPART_REQUEST) class OFPTableStatsRequest(OFPMultipartRequest): """ Table statistics request message The controller uses this message to query flow table statictics. ================ ====================================================== Attribute Description ================ ====================================================== flags Zero or ``OFPMPF_REQ_MORE`` ================ ====================================================== Example:: def send_table_stats_request(self, datapath): ofp_parser = datapath.ofproto_parser req = ofp_parser.OFPTableStatsRequest(datapath, 0) datapath.send_msg(req) """ def __init__(self, datapath, flags, type_=None): super(OFPTableStatsRequest, self).__init__(datapath, flags) @OFPMultipartReply.register_stats_type() @_set_stats_type(ofproto.OFPMP_TABLE, OFPTableStats) @_set_msg_type(ofproto.OFPT_MULTIPART_REPLY) class OFPTableStatsReply(OFPMultipartReply): """ Table statistics reply message The switch responds with this message to a table statistics request. ================ ====================================================== Attribute Description ================ ====================================================== body List of ``OFPTableStats`` instance ================ ====================================================== Example:: @set_ev_cls(ofp_event.EventOFPTableStatsReply, MAIN_DISPATCHER) def table_stats_reply_handler(self, ev): tables = [] for stat in ev.msg.body: tables.append('table_id=%d active_count=%d lookup_count=%d ' ' matched_count=%d' % (stat.table_id, stat.active_count, stat.lookup_count, stat.matched_count)) self.logger.debug('TableStats: %s', tables) """ def __init__(self, datapath, type_=None, **kwargs): super(OFPTableStatsReply, self).__init__(datapath, **kwargs) class OFPPortStatsProp(OFPPropBase): _TYPES = {} @OFPPortStatsProp.register_type(ofproto.OFPPSPT_ETHERNET) class OFPPortStatsPropEthernet(OFPPortStatsProp): def __init__(self, type_=None, length=None, rx_frame_err=None, rx_over_err=None, rx_crc_err=None, collisions=None): self.type = type_ self.length = length self.rx_frame_err = rx_frame_err self.rx_over_err = rx_over_err self.rx_crc_err = rx_crc_err self.collisions = collisions @classmethod def parser(cls, buf): ether = cls() (ether.type, ether.length, ether.rx_frame_err, ether.rx_over_err, ether.rx_crc_err, ether.collisions) = struct.unpack_from( ofproto.OFP_PORT_STATS_PROP_ETHERNET_PACK_STR, buf, 0) return ether @OFPPortStatsProp.register_type(ofproto.OFPPSPT_OPTICAL) class OFPPortStatsPropOptical(OFPPortStatsProp): def __init__(self, type_=None, length=None, flags=None, tx_freq_lmda=None, tx_offset=None, tx_grid_span=None, rx_freq_lmda=None, rx_offset=None, rx_grid_span=None, tx_pwr=None, rx_pwr=None, bias_current=None, temperature=None): self.type = type_ self.length = length self.flags = flags self.tx_freq_lmda = tx_freq_lmda self.tx_offset = tx_offset self.tx_grid_span = tx_grid_span self.rx_freq_lmda = rx_freq_lmda self.rx_offset = rx_offset self.rx_grid_span = rx_grid_span self.tx_pwr = tx_pwr self.rx_pwr = rx_pwr self.bias_current = bias_current self.temperature = temperature @classmethod def parser(cls, buf): optical = cls() (optical.type, optical.length, optical.flags, optical.tx_freq_lmda, optical.tx_offset, optical.tx_grid_span, optical.rx_freq_lmda, optical.rx_offset, optical.rx_grid_span, optical.tx_pwr, optical.rx_pwr, optical.bias_current, optical.temperature) = struct.unpack_from( ofproto.OFP_PORT_STATS_PROP_OPTICAL_PACK_STR, buf, 0) return optical @OFPPortStatsProp.register_type(ofproto.OFPPSPT_EXPERIMENTER) class OFPPortStatsPropExperimenter(OFPPropCommonExperimenter4ByteData): pass class OFPPortStats(StringifyMixin): def __init__(self, length=None, port_no=None, duration_sec=None, duration_nsec=None, rx_packets=None, tx_packets=None, rx_bytes=None, tx_bytes=None, rx_dropped=None, tx_dropped=None, rx_errors=None, tx_errors=None, properties=None): super(OFPPortStats, self).__init__() self.length = length self.port_no = port_no self.duration_sec = duration_sec self.duration_nsec = duration_nsec self.rx_packets = rx_packets self.tx_packets = tx_packets self.rx_bytes = rx_bytes self.tx_bytes = tx_bytes self.rx_dropped = rx_dropped self.tx_dropped = tx_dropped self.rx_errors = rx_errors self.tx_errors = tx_errors self.properties = properties @classmethod def parser(cls, buf, offset): (length, port_no, duration_sec, duration_nsec, rx_packets, tx_packets, rx_bytes, tx_bytes, rx_dropped, tx_dropped, rx_errors, tx_errors) = struct.unpack_from( ofproto.OFP_PORT_STATS_PACK_STR, buf, offset) props = [] rest = buf[offset + ofproto.OFP_PORT_STATS_SIZE:offset + length] while rest: p, rest = OFPPortStatsProp.parse(rest) props.append(p) stats = cls(length, port_no, duration_sec, duration_nsec, rx_packets, tx_packets, rx_bytes, tx_bytes, rx_dropped, tx_dropped, rx_errors, tx_errors, props) return stats @_set_stats_type(ofproto.OFPMP_PORT_STATS, OFPPortStats) @_set_msg_type(ofproto.OFPT_MULTIPART_REQUEST) class OFPPortStatsRequest(OFPMultipartRequest): """ Port statistics request message The controller uses this message to query information about ports statistics. ================ ====================================================== Attribute Description ================ ====================================================== flags Zero or ``OFPMPF_REQ_MORE`` port_no Port number to read (OFPP_ANY to all ports) ================ ====================================================== Example:: def send_port_stats_request(self, datapath): ofp = datapath.ofproto ofp_parser = datapath.ofproto_parser req = ofp_parser.OFPPortStatsRequest(datapath, 0, ofp.OFPP_ANY) datapath.send_msg(req) """ def __init__(self, datapath, flags, port_no, type_=None): super(OFPPortStatsRequest, self).__init__(datapath, flags) self.port_no = port_no def _serialize_stats_body(self): msg_pack_into(ofproto.OFP_PORT_STATS_REQUEST_PACK_STR, self.buf, ofproto.OFP_MULTIPART_REQUEST_SIZE, self.port_no) @OFPMultipartReply.register_stats_type() @_set_stats_type(ofproto.OFPMP_PORT_STATS, OFPPortStats) @_set_msg_type(ofproto.OFPT_MULTIPART_REPLY) class OFPPortStatsReply(OFPMultipartReply): """ Port statistics reply message The switch responds with this message to a port statistics request. ================ ====================================================== Attribute Description ================ ====================================================== body List of ``OFPPortStats`` instance ================ ====================================================== Example:: @set_ev_cls(ofp_event.EventOFPPortStatsReply, MAIN_DISPATCHER) def port_stats_reply_handler(self, ev): ports = [] for stat in ev.msg.body: ports.append(stat.length, stat.port_no, stat.duration_sec, stat.duration_nsec, stat.rx_packets, stat.tx_packets, stat.rx_bytes, stat.tx_bytes, stat.rx_dropped, stat.tx_dropped, stat.rx_errors, stat.tx_errors, repr(stat.properties)) self.logger.debug('PortStats: %s', ports) """ def __init__(self, datapath, type_=None, **kwargs): super(OFPPortStatsReply, self).__init__(datapath, **kwargs) @_set_msg_type(ofproto.OFPT_BARRIER_REQUEST) class OFPBarrierRequest(MsgBase): """ Barrier request message The controller sends this message to ensure message dependencies have been met or receive notifications for completed operations. Example:: def send_barrier_request(self, datapath): ofp_parser = datapath.ofproto_parser req = ofp_parser.OFPBarrierRequest(datapath) datapath.send_msg(req) """ def __init__(self, datapath): super(OFPBarrierRequest, self).__init__(datapath) @_register_parser @_set_msg_type(ofproto.OFPT_BARRIER_REPLY) class OFPBarrierReply(MsgBase): """ Barrier reply message The switch responds with this message to a barrier request. Example:: @set_ev_cls(ofp_event.EventOFPBarrierReply, MAIN_DISPATCHER) def barrier_reply_handler(self, ev): self.logger.debug('OFPBarrierReply received') """ def __init__(self, datapath): super(OFPBarrierReply, self).__init__(datapath) @_register_parser @_set_msg_type(ofproto.OFPT_PORT_STATUS) class OFPPortStatus(MsgBase): """ Port status message The switch notifies controller of change of ports. ================ ====================================================== Attribute Description ================ ====================================================== reason One of the following values. | OFPPR_ADD | OFPPR_DELETE | OFPPR_MODIFY desc instance of ``OFPPort`` ================ ====================================================== Example:: @set_ev_cls(ofp_event.EventOFPPortStatus, MAIN_DISPATCHER) def port_status_handler(self, ev): msg = ev.msg dp = msg.datapath ofp = dp.ofproto if msg.reason == ofp.OFPPR_ADD: reason = 'ADD' elif msg.reason == ofp.OFPPR_DELETE: reason = 'DELETE' elif msg.reason == ofp.OFPPR_MODIFY: reason = 'MODIFY' else: reason = 'unknown' self.logger.debug('OFPPortStatus received: reason=%s desc=%s', reason, msg.desc) """ def __init__(self, datapath, reason=None, desc=None): super(OFPPortStatus, self).__init__(datapath) self.reason = reason self.desc = desc @classmethod def parser(cls, datapath, version, msg_type, msg_len, xid, buf): msg = super(OFPPortStatus, cls).parser(datapath, version, msg_type, msg_len, xid, buf) msg.reason = struct.unpack_from( ofproto.OFP_PORT_STATUS_PACK_STR, msg.buf, ofproto.OFP_HEADER_SIZE)[0] msg.desc = OFPPort.parser(msg.buf, ofproto.OFP_PORT_STATUS_DESC_OFFSET) return msg @_register_parser @_set_msg_type(ofproto.OFPT_ROLE_STATUS) class OFPRoleStatus(MsgBase): """ Role status message The switch notifies controller of change of role. ================ ====================================================== Attribute Description ================ ====================================================== role One of the following values. | OFPCR_ROLE_NOCHANGE | OFPCR_ROLE_EQUAL | OFPCR_ROLE_MASTER reason One of the following values. | OFPCRR_MASTER_REQUEST | OFPCRR_CONFIG | OFPCRR_EXPERIMENTER generation_id Master Election Generation ID properties List of ``OFPRoleProp`` subclass instance ================ ====================================================== Example:: @set_ev_cls(ofp_event.EventOFPRoleStatus, MAIN_DISPATCHER) def role_status_handler(self, ev): msg = ev.msg dp = msg.datapath ofp = dp.ofproto if msg.role == ofp.OFPCR_ROLE_NOCHANGE: role = 'ROLE NOCHANGE' elif msg.role == ofp.OFPCR_ROLE_EQUAL: role = 'ROLE EQUAL' elif msg.role == ofp.OFPCR_ROLE_MASTER: role = 'ROLE MASTER' else: role = 'unknown' if msg.reason == ofp.OFPCRR_MASTER_REQUEST: reason = 'MASTER REQUEST' elif msg.reason == ofp.OFPCRR_CONFIG: reason = 'CONFIG' elif msg.reason == ofp.OFPCRR_EXPERIMENTER: reason = 'EXPERIMENTER' else: reason = 'unknown' self.logger.debug('OFPRoleStatus received: role=%s reason=%s ' 'generation_id=%d properties=%s', role, reason, msg.generation_id, repr(msg.properties)) """ def __init__(self, datapath, role=None, reason=None, generation_id=None, properties=None): super(OFPRoleStatus, self).__init__(datapath) self.role = role self.reason = reason self.generation_id = generation_id self.properties = properties @classmethod def parser(cls, datapath, version, msg_type, msg_len, xid, buf): msg = super(OFPRoleStatus, cls).parser(datapath, version, msg_type, msg_len, xid, buf) (msg.role, msg.reason, msg.generation_id) = struct.unpack_from( ofproto.OFP_ROLE_STATUS_PACK_STR, msg.buf, ofproto.OFP_HEADER_SIZE) msg.properties = [] rest = msg.buf[ofproto.OFP_ROLE_STATUS_SIZE:] while rest: p, rest = OFPRoleProp.parse(rest) msg.properties.append(p) return msg @_register_parser @_set_msg_type(ofproto.OFPT_TABLE_STATUS) class OFPTableStatus(MsgBase): """ Table status message The switch notifies controller of change of table status. ================ ====================================================== Attribute Description ================ ====================================================== reason One of the following values. | OFPTR_VACANCY_DOWN | OFPTR_VACANCY_UP table ``OFPTableDesc`` instance ================ ====================================================== Example:: @set_ev_cls(ofp_event.EventOFPTableStatus, MAIN_DISPATCHER) def table(self, ev): msg = ev.msg dp = msg.datapath ofp = dp.ofproto if msg.reason == ofp.OFPTR_VACANCY_DOWN: reason = 'VACANCY_DOWN' elif msg.reason == ofp.OFPTR_VACANCY_UP: reason = 'VACANCY_UP' else: reason = 'unknown' self.logger.debug('OFPTableStatus received: reason=%s ' 'table_id=%d config=0x%08x properties=%s', reason, msg.table.table_id, msg.table.config, repr(msg.table.properties)) """ def __init__(self, datapath, reason=None, table=None): super(OFPTableStatus, self).__init__(datapath) self.reason = reason self.table = table @classmethod def parser(cls, datapath, version, msg_type, msg_len, xid, buf): msg = super(OFPTableStatus, cls).parser(datapath, version, msg_type, msg_len, xid, buf) (msg.reason,) = struct.unpack_from(ofproto.OFP_TABLE_STATUS_0_PACK_STR, msg.buf, ofproto.OFP_HEADER_SIZE) msg.table = OFPTableDesc.parser(msg.buf, ofproto.OFP_TABLE_STATUS_0_SIZE) return msg @_register_parser @_set_msg_type(ofproto.OFPT_REQUESTFORWARD) class OFPRequestForward(MsgInMsgBase): """ Forwarded request message The swtich forwards request messages from one controller to other controllers. ================ ====================================================== Attribute Description ================ ====================================================== request ``OFPGroupMod`` or ``OFPMeterMod`` instance ================ ====================================================== Example:: @set_ev_cls(ofp_event.EventOFPRequestForward, MAIN_DISPATCHER) def request_forward_handler(self, ev): msg = ev.msg dp = msg.datapath ofp = dp.ofproto if msg.request.msg_type == ofp.OFPT_GROUP_MOD: self.logger.debug( 'OFPRequestForward received: request=OFPGroupMod(' 'command=%d, type=%d, group_id=%d, buckets=%s)', msg.request.command, msg.request.type, msg.request.group_id, msg.request.buckets) elif msg.request.msg_type == ofp.OFPT_METER_MOD: self.logger.debug( 'OFPRequestForward received: request=OFPMeterMod(' 'command=%d, flags=%d, meter_id=%d, bands=%s)', msg.request.command, msg.request.flags, msg.request.meter_id, msg.request.bands) else: self.logger.debug( 'OFPRequestForward received: request=Unknown') """ def __init__(self, datapath, request=None): super(OFPRequestForward, self).__init__(datapath) self.request = request @classmethod def parser(cls, datapath, version, msg_type, msg_len, xid, buf): msg = super(OFPRequestForward, cls).parser( datapath, version, msg_type, msg_len, xid, buf) req_buf = buf[ofproto.OFP_HEADER_SIZE:] (_ver, _type, _len, _xid) = ofproto_parser.header(req_buf) msg.request = ofproto_parser.msg( datapath, _ver, _type, _len, _xid, req_buf) return msg def _serialize_body(self): assert isinstance(self.request, (OFPGroupMod, OFPMeterMod)) self.request.serialize() self.buf += self.request.buf @_set_msg_type(ofproto.OFPT_PACKET_OUT) class OFPPacketOut(MsgBase): """ Packet-Out message The controller uses this message to send a packet out throught the switch. ================ ====================================================== Attribute Description ================ ====================================================== buffer_id ID assigned by datapath (OFP_NO_BUFFER if none) in_port Packet's input port or ``OFPP_CONTROLLER`` actions list of OpenFlow action class data Packet data ================ ====================================================== Example:: def send_packet_out(self, datapath, buffer_id, in_port): ofp = datapath.ofproto ofp_parser = datapath.ofproto_parser actions = [ofp_parser.OFPActionOutput(ofp.OFPP_FLOOD, 0)] req = ofp_parser.OFPPacketOut(datapath, buffer_id, in_port, actions) datapath.send_msg(req) """ def __init__(self, datapath, buffer_id=None, in_port=None, actions=None, data=None, actions_len=None): assert in_port is not None super(OFPPacketOut, self).__init__(datapath) self.buffer_id = buffer_id self.in_port = in_port self.actions_len = 0 self.actions = actions self.data = data def _serialize_body(self): self.actions_len = 0 offset = ofproto.OFP_PACKET_OUT_SIZE for a in self.actions: a.serialize(self.buf, offset) offset += a.len self.actions_len += a.len if self.data is not None: assert self.buffer_id == 0xffffffff self.buf += self.data msg_pack_into(ofproto.OFP_PACKET_OUT_PACK_STR, self.buf, ofproto.OFP_HEADER_SIZE, self.buffer_id, self.in_port, self.actions_len) @_set_msg_type(ofproto.OFPT_FLOW_MOD) class OFPFlowMod(MsgBase): """ Modify Flow entry message The controller sends this message to modify the flow table. ================ ====================================================== Attribute Description ================ ====================================================== cookie Opaque controller-issued identifier cookie_mask Mask used to restrict the cookie bits that must match when the command is ``OPFFC_MODIFY*`` or ``OFPFC_DELETE*`` table_id ID of the table to put the flow in command One of the following values. | OFPFC_ADD | OFPFC_MODIFY | OFPFC_MODIFY_STRICT | OFPFC_DELETE | OFPFC_DELETE_STRICT idle_timeout Idle time before discarding (seconds) hard_timeout Max time before discarding (seconds) priority Priority level of flow entry buffer_id Buffered packet to apply to (or OFP_NO_BUFFER) out_port For ``OFPFC_DELETE*`` commands, require matching entries to include this as an output port out_group For ``OFPFC_DELETE*`` commands, require matching entries to include this as an output group flags Bitmap of the following flags. | OFPFF_SEND_FLOW_REM | OFPFF_CHECK_OVERLAP | OFPFF_RESET_COUNTS | OFPFF_NO_PKT_COUNTS | OFPFF_NO_BYT_COUNTS importance Eviction precedence match Instance of ``OFPMatch`` instructions list of ``OFPInstruction*`` instance ================ ====================================================== Example:: def send_flow_mod(self, datapath): ofp = datapath.ofproto ofp_parser = datapath.ofproto_parser cookie = cookie_mask = 0 table_id = 0 idle_timeout = hard_timeout = 0 priority = 32768 buffer_id = ofp.OFP_NO_BUFFER importance = 0 match = ofp_parser.OFPMatch(in_port=1, eth_dst='ff:ff:ff:ff:ff:ff') actions = [ofp_parser.OFPActionOutput(ofp.OFPP_NORMAL, 0)] inst = [ofp_parser.OFPInstructionActions(ofp.OFPIT_APPLY_ACTIONS, actions)] req = ofp_parser.OFPFlowMod(datapath, cookie, cookie_mask, table_id, ofp.OFPFC_ADD, idle_timeout, hard_timeout, priority, buffer_id, ofp.OFPP_ANY, ofp.OFPG_ANY, ofp.OFPFF_SEND_FLOW_REM, importance, match, inst) datapath.send_msg(req) """ def __init__(self, datapath, cookie=0, cookie_mask=0, table_id=0, command=ofproto.OFPFC_ADD, idle_timeout=0, hard_timeout=0, priority=ofproto.OFP_DEFAULT_PRIORITY, buffer_id=ofproto.OFP_NO_BUFFER, out_port=0, out_group=0, flags=0, importance=0, match=None, instructions=None): instructions = instructions if instructions else [] super(OFPFlowMod, self).__init__(datapath) self.cookie = cookie self.cookie_mask = cookie_mask self.table_id = table_id self.command = command self.idle_timeout = idle_timeout self.hard_timeout = hard_timeout self.priority = priority self.buffer_id = buffer_id self.out_port = out_port self.out_group = out_group self.flags = flags self.importance = importance if match is None: match = OFPMatch() assert isinstance(match, OFPMatch) self.match = match for i in instructions: assert isinstance(i, OFPInstruction) self.instructions = instructions def _serialize_body(self): msg_pack_into(ofproto.OFP_FLOW_MOD_PACK_STR0, self.buf, ofproto.OFP_HEADER_SIZE, self.cookie, self.cookie_mask, self.table_id, self.command, self.idle_timeout, self.hard_timeout, self.priority, self.buffer_id, self.out_port, self.out_group, self.flags, self.importance) offset = (ofproto.OFP_FLOW_MOD_SIZE - ofproto.OFP_MATCH_SIZE) match_len = self.match.serialize(self.buf, offset) offset += match_len for inst in self.instructions: inst.serialize(self.buf, offset) offset += inst.len class OFPInstruction(StringifyMixin): _INSTRUCTION_TYPES = {} @staticmethod def register_instruction_type(types): def _register_instruction_type(cls): for type_ in types: OFPInstruction._INSTRUCTION_TYPES[type_] = cls return cls return _register_instruction_type @classmethod def parser(cls, buf, offset): (type_, len_) = struct.unpack_from('!HH', buf, offset) cls_ = cls._INSTRUCTION_TYPES.get(type_) return cls_.parser(buf, offset) @OFPInstruction.register_instruction_type([ofproto.OFPIT_GOTO_TABLE]) class OFPInstructionGotoTable(OFPInstruction): """ Goto table instruction This instruction indicates the next table in the processing pipeline. ================ ====================================================== Attribute Description ================ ====================================================== table_id Next table ================ ====================================================== """ def __init__(self, table_id, type_=None, len_=None): super(OFPInstructionGotoTable, self).__init__() self.type = ofproto.OFPIT_GOTO_TABLE self.len = ofproto.OFP_INSTRUCTION_GOTO_TABLE_SIZE self.table_id = table_id @classmethod def parser(cls, buf, offset): (type_, len_, table_id) = struct.unpack_from( ofproto.OFP_INSTRUCTION_GOTO_TABLE_PACK_STR, buf, offset) return cls(table_id) def serialize(self, buf, offset): msg_pack_into(ofproto.OFP_INSTRUCTION_GOTO_TABLE_PACK_STR, buf, offset, self.type, self.len, self.table_id) @OFPInstruction.register_instruction_type([ofproto.OFPIT_WRITE_METADATA]) class OFPInstructionWriteMetadata(OFPInstruction): """ Write metadata instruction This instruction writes the masked metadata value into the metadata field. ================ ====================================================== Attribute Description ================ ====================================================== metadata Metadata value to write metadata_mask Metadata write bitmask ================ ====================================================== """ def __init__(self, metadata, metadata_mask, type_=None, len_=None): super(OFPInstructionWriteMetadata, self).__init__() self.type = ofproto.OFPIT_WRITE_METADATA self.len = ofproto.OFP_INSTRUCTION_WRITE_METADATA_SIZE self.metadata = metadata self.metadata_mask = metadata_mask @classmethod def parser(cls, buf, offset): (type_, len_, metadata, metadata_mask) = struct.unpack_from( ofproto.OFP_INSTRUCTION_WRITE_METADATA_PACK_STR, buf, offset) return cls(metadata, metadata_mask) def serialize(self, buf, offset): msg_pack_into(ofproto.OFP_INSTRUCTION_WRITE_METADATA_PACK_STR, buf, offset, self.type, self.len, self.metadata, self.metadata_mask) @OFPInstruction.register_instruction_type([ofproto.OFPIT_WRITE_ACTIONS, ofproto.OFPIT_APPLY_ACTIONS, ofproto.OFPIT_CLEAR_ACTIONS]) class OFPInstructionActions(OFPInstruction): """ Actions instruction This instruction writes/applies/clears the actions. ================ ====================================================== Attribute Description ================ ====================================================== type One of following values. | OFPIT_WRITE_ACTIONS | OFPIT_APPLY_ACTIONS | OFPIT_CLEAR_ACTIONS actions list of OpenFlow action class ================ ====================================================== ``type`` attribute corresponds to ``type_`` parameter of __init__. """ def __init__(self, type_, actions=None, len_=None): super(OFPInstructionActions, self).__init__() self.type = type_ for a in actions: assert isinstance(a, OFPAction) self.actions = actions @classmethod def parser(cls, buf, offset): (type_, len_) = struct.unpack_from( ofproto.OFP_INSTRUCTION_ACTIONS_PACK_STR, buf, offset) offset += ofproto.OFP_INSTRUCTION_ACTIONS_SIZE actions = [] actions_len = len_ - ofproto.OFP_INSTRUCTION_ACTIONS_SIZE while actions_len > 0: a = OFPAction.parser(buf, offset) actions.append(a) actions_len -= a.len offset += a.len inst = cls(type_, actions) inst.len = len_ return inst def serialize(self, buf, offset): action_offset = offset + ofproto.OFP_INSTRUCTION_ACTIONS_SIZE if self.actions: for a in self.actions: a.serialize(buf, action_offset) action_offset += a.len self.len = action_offset - offset pad_len = utils.round_up(self.len, 8) - self.len msg_pack_into("%dx" % pad_len, buf, action_offset) self.len += pad_len msg_pack_into(ofproto.OFP_INSTRUCTION_ACTIONS_PACK_STR, buf, offset, self.type, self.len) @OFPInstruction.register_instruction_type([ofproto.OFPIT_METER]) class OFPInstructionMeter(OFPInstruction): """ Meter instruction This instruction applies the meter. ================ ====================================================== Attribute Description ================ ====================================================== meter_id Meter instance ================ ====================================================== """ def __init__(self, meter_id=1, type_=None, len_=None): super(OFPInstructionMeter, self).__init__() self.type = ofproto.OFPIT_METER self.len = ofproto.OFP_INSTRUCTION_METER_SIZE self.meter_id = meter_id @classmethod def parser(cls, buf, offset): (type_, len_, meter_id) = struct.unpack_from( ofproto.OFP_INSTRUCTION_METER_PACK_STR, buf, offset) return cls(meter_id) def serialize(self, buf, offset): msg_pack_into(ofproto.OFP_INSTRUCTION_METER_PACK_STR, buf, offset, self.type, self.len, self.meter_id) class OFPActionHeader(StringifyMixin): def __init__(self, type_, len_): self.type = type_ self.len = len_ def serialize(self, buf, offset): msg_pack_into(ofproto.OFP_ACTION_HEADER_PACK_STR, buf, offset, self.type, self.len) class OFPAction(OFPActionHeader): _ACTION_TYPES = {} @staticmethod def register_action_type(type_, len_): def _register_action_type(cls): cls.cls_action_type = type_ cls.cls_action_len = len_ OFPAction._ACTION_TYPES[cls.cls_action_type] = cls return cls return _register_action_type def __init__(self): cls = self.__class__ super(OFPAction, self).__init__(cls.cls_action_type, cls.cls_action_len) @classmethod def parser(cls, buf, offset): type_, len_ = struct.unpack_from( ofproto.OFP_ACTION_HEADER_PACK_STR, buf, offset) cls_ = cls._ACTION_TYPES.get(type_) assert cls_ is not None return cls_.parser(buf, offset) @OFPAction.register_action_type(ofproto.OFPAT_OUTPUT, ofproto.OFP_ACTION_OUTPUT_SIZE) class OFPActionOutput(OFPAction): """ Output action This action indicates output a packet to the switch port. ================ ====================================================== Attribute Description ================ ====================================================== port Output port max_len Max length to send to controller ================ ====================================================== """ def __init__(self, port, max_len=ofproto.OFPCML_MAX, type_=None, len_=None): super(OFPActionOutput, self).__init__() self.port = port self.max_len = max_len @classmethod def parser(cls, buf, offset): type_, len_, port, max_len = struct.unpack_from( ofproto.OFP_ACTION_OUTPUT_PACK_STR, buf, offset) return cls(port, max_len) def serialize(self, buf, offset): msg_pack_into(ofproto.OFP_ACTION_OUTPUT_PACK_STR, buf, offset, self.type, self.len, self.port, self.max_len) @OFPAction.register_action_type(ofproto.OFPAT_GROUP, ofproto.OFP_ACTION_GROUP_SIZE) class OFPActionGroup(OFPAction): """ Group action This action indicates the group used to process the packet. ================ ====================================================== Attribute Description ================ ====================================================== group_id Group identifier ================ ====================================================== """ def __init__(self, group_id=0, type_=None, len_=None): super(OFPActionGroup, self).__init__() self.group_id = group_id @classmethod def parser(cls, buf, offset): (type_, len_, group_id) = struct.unpack_from( ofproto.OFP_ACTION_GROUP_PACK_STR, buf, offset) return cls(group_id) def serialize(self, buf, offset): msg_pack_into(ofproto.OFP_ACTION_GROUP_PACK_STR, buf, offset, self.type, self.len, self.group_id) @OFPAction.register_action_type(ofproto.OFPAT_SET_QUEUE, ofproto.OFP_ACTION_SET_QUEUE_SIZE) class OFPActionSetQueue(OFPAction): """ Set queue action This action sets the queue id that will be used to map a flow to an already-configured queue on a port. ================ ====================================================== Attribute Description ================ ====================================================== queue_id Queue ID for the packets ================ ====================================================== """ def __init__(self, queue_id, type_=None, len_=None): super(OFPActionSetQueue, self).__init__() self.queue_id = queue_id @classmethod def parser(cls, buf, offset): (type_, len_, queue_id) = struct.unpack_from( ofproto.OFP_ACTION_SET_QUEUE_PACK_STR, buf, offset) return cls(queue_id) def serialize(self, buf, offset): msg_pack_into(ofproto.OFP_ACTION_SET_QUEUE_PACK_STR, buf, offset, self.type, self.len, self.queue_id) @OFPAction.register_action_type(ofproto.OFPAT_SET_MPLS_TTL, ofproto.OFP_ACTION_MPLS_TTL_SIZE) class OFPActionSetMplsTtl(OFPAction): """ Set MPLS TTL action This action sets the MPLS TTL. ================ ====================================================== Attribute Description ================ ====================================================== mpls_ttl MPLS TTL ================ ====================================================== """ def __init__(self, mpls_ttl, type_=None, len_=None): super(OFPActionSetMplsTtl, self).__init__() self.mpls_ttl = mpls_ttl @classmethod def parser(cls, buf, offset): (type_, len_, mpls_ttl) = struct.unpack_from( ofproto.OFP_ACTION_MPLS_TTL_PACK_STR, buf, offset) return cls(mpls_ttl) def serialize(self, buf, offset): msg_pack_into(ofproto.OFP_ACTION_MPLS_TTL_PACK_STR, buf, offset, self.type, self.len, self.mpls_ttl) @OFPAction.register_action_type(ofproto.OFPAT_DEC_MPLS_TTL, ofproto.OFP_ACTION_HEADER_SIZE) class OFPActionDecMplsTtl(OFPAction): """ Decrement MPLS TTL action This action decrements the MPLS TTL. """ def __init__(self, type_=None, len_=None): super(OFPActionDecMplsTtl, self).__init__() @classmethod def parser(cls, buf, offset): (type_, len_) = struct.unpack_from( ofproto.OFP_ACTION_HEADER_PACK_STR, buf, offset) return cls() @OFPAction.register_action_type(ofproto.OFPAT_SET_NW_TTL, ofproto.OFP_ACTION_NW_TTL_SIZE) class OFPActionSetNwTtl(OFPAction): """ Set IP TTL action This action sets the IP TTL. ================ ====================================================== Attribute Description ================ ====================================================== nw_ttl IP TTL ================ ====================================================== """ def __init__(self, nw_ttl, type_=None, len_=None): super(OFPActionSetNwTtl, self).__init__() self.nw_ttl = nw_ttl @classmethod def parser(cls, buf, offset): (type_, len_, nw_ttl) = struct.unpack_from( ofproto.OFP_ACTION_NW_TTL_PACK_STR, buf, offset) return cls(nw_ttl) def serialize(self, buf, offset): msg_pack_into(ofproto.OFP_ACTION_NW_TTL_PACK_STR, buf, offset, self.type, self.len, self.nw_ttl) @OFPAction.register_action_type(ofproto.OFPAT_DEC_NW_TTL, ofproto.OFP_ACTION_HEADER_SIZE) class OFPActionDecNwTtl(OFPAction): """ Decrement IP TTL action This action decrements the IP TTL. """ def __init__(self, type_=None, len_=None): super(OFPActionDecNwTtl, self).__init__() @classmethod def parser(cls, buf, offset): (type_, len_) = struct.unpack_from( ofproto.OFP_ACTION_HEADER_PACK_STR, buf, offset) return cls() @OFPAction.register_action_type(ofproto.OFPAT_COPY_TTL_OUT, ofproto.OFP_ACTION_HEADER_SIZE) class OFPActionCopyTtlOut(OFPAction): """ Copy TTL Out action This action copies the TTL from the next-to-outermost header with TTL to the outermost header with TTL. """ def __init__(self, type_=None, len_=None): super(OFPActionCopyTtlOut, self).__init__() @classmethod def parser(cls, buf, offset): (type_, len_) = struct.unpack_from( ofproto.OFP_ACTION_HEADER_PACK_STR, buf, offset) return cls() @OFPAction.register_action_type(ofproto.OFPAT_COPY_TTL_IN, ofproto.OFP_ACTION_HEADER_SIZE) class OFPActionCopyTtlIn(OFPAction): """ Copy TTL In action This action copies the TTL from the outermost header with TTL to the next-to-outermost header with TTL. """ def __init__(self, type_=None, len_=None): super(OFPActionCopyTtlIn, self).__init__() @classmethod def parser(cls, buf, offset): (type_, len_) = struct.unpack_from( ofproto.OFP_ACTION_HEADER_PACK_STR, buf, offset) return cls() @OFPAction.register_action_type(ofproto.OFPAT_PUSH_VLAN, ofproto.OFP_ACTION_PUSH_SIZE) class OFPActionPushVlan(OFPAction): """ Push VLAN action This action pushes a new VLAN tag to the packet. ================ ====================================================== Attribute Description ================ ====================================================== ethertype Ether type. The default is 802.1Q. (0x8100) ================ ====================================================== """ def __init__(self, ethertype=ether.ETH_TYPE_8021Q, type_=None, len_=None): super(OFPActionPushVlan, self).__init__() self.ethertype = ethertype @classmethod def parser(cls, buf, offset): (type_, len_, ethertype) = struct.unpack_from( ofproto.OFP_ACTION_PUSH_PACK_STR, buf, offset) return cls(ethertype) def serialize(self, buf, offset): msg_pack_into(ofproto.OFP_ACTION_PUSH_PACK_STR, buf, offset, self.type, self.len, self.ethertype) @OFPAction.register_action_type(ofproto.OFPAT_PUSH_MPLS, ofproto.OFP_ACTION_PUSH_SIZE) class OFPActionPushMpls(OFPAction): """ Push MPLS action This action pushes a new MPLS header to the packet. ================ ====================================================== Attribute Description ================ ====================================================== ethertype Ether type ================ ====================================================== """ def __init__(self, ethertype=ether.ETH_TYPE_MPLS, type_=None, len_=None): super(OFPActionPushMpls, self).__init__() self.ethertype = ethertype @classmethod def parser(cls, buf, offset): (type_, len_, ethertype) = struct.unpack_from( ofproto.OFP_ACTION_PUSH_PACK_STR, buf, offset) return cls(ethertype) def serialize(self, buf, offset): msg_pack_into(ofproto.OFP_ACTION_PUSH_PACK_STR, buf, offset, self.type, self.len, self.ethertype) @OFPAction.register_action_type(ofproto.OFPAT_POP_VLAN, ofproto.OFP_ACTION_HEADER_SIZE) class OFPActionPopVlan(OFPAction): """ Pop VLAN action This action pops the outermost VLAN tag from the packet. """ def __init__(self, type_=None, len_=None): super(OFPActionPopVlan, self).__init__() @classmethod def parser(cls, buf, offset): (type_, len_) = struct.unpack_from( ofproto.OFP_ACTION_HEADER_PACK_STR, buf, offset) return cls() @OFPAction.register_action_type(ofproto.OFPAT_POP_MPLS, ofproto.OFP_ACTION_POP_MPLS_SIZE) class OFPActionPopMpls(OFPAction): """ Pop MPLS action This action pops the MPLS header from the packet. """ def __init__(self, ethertype=ether.ETH_TYPE_IP, type_=None, len_=None): super(OFPActionPopMpls, self).__init__() self.ethertype = ethertype @classmethod def parser(cls, buf, offset): (type_, len_, ethertype) = struct.unpack_from( ofproto.OFP_ACTION_POP_MPLS_PACK_STR, buf, offset) return cls(ethertype) def serialize(self, buf, offset): msg_pack_into(ofproto.OFP_ACTION_POP_MPLS_PACK_STR, buf, offset, self.type, self.len, self.ethertype) @OFPAction.register_action_type(ofproto.OFPAT_SET_FIELD, ofproto.OFP_ACTION_SET_FIELD_SIZE) class OFPActionSetField(OFPAction): """ Set field action This action modifies a header field in the packet. The set of keywords available for this is same as OFPMatch. Example:: set_field = OFPActionSetField(eth_src="00:00:00:00:00:00") """ def __init__(self, field=None, **kwargs): super(OFPActionSetField, self).__init__() assert len(kwargs) == 1 key = list(kwargs.keys())[0] value = kwargs[key] assert isinstance(key, (str, six.text_type)) assert not isinstance(value, tuple) # no mask self.key = key self.value = value @classmethod def parser(cls, buf, offset): (type_, len_) = struct.unpack_from( ofproto.OFP_ACTION_SET_FIELD_PACK_STR, buf, offset) (n, value, mask, _len) = ofproto.oxm_parse(buf, offset + 4) k, uv = ofproto.oxm_to_user(n, value, mask) action = cls(**{k: uv}) action.len = len_ return action def serialize(self, buf, offset): n, value, mask = ofproto.oxm_from_user(self.key, self.value) len_ = ofproto.oxm_serialize(n, value, mask, buf, offset + 4) self.len = utils.round_up(4 + len_, 8) msg_pack_into('!HH', buf, offset, self.type, self.len) pad_len = self.len - (4 + len_) msg_pack_into("%dx" % pad_len, buf, offset + 4 + len_) def to_jsondict(self): return { self.__class__.__name__: { 'field': ofproto.oxm_to_jsondict(self.key, self.value), "len": self.len, "type": self.type } } @classmethod def from_jsondict(cls, dict_): k, v = ofproto.oxm_from_jsondict(dict_['field']) return OFPActionSetField(**{k: v}) def stringify_attrs(self): yield (self.key, self.value) @OFPAction.register_action_type(ofproto.OFPAT_PUSH_PBB, ofproto.OFP_ACTION_PUSH_SIZE) class OFPActionPushPbb(OFPAction): """ Push PBB action This action pushes a new PBB header to the packet. ================ ====================================================== Attribute Description ================ ====================================================== ethertype Ether type ================ ====================================================== """ def __init__(self, ethertype, type_=None, len_=None): super(OFPActionPushPbb, self).__init__() self.ethertype = ethertype @classmethod def parser(cls, buf, offset): (type_, len_, ethertype) = struct.unpack_from( ofproto.OFP_ACTION_PUSH_PACK_STR, buf, offset) return cls(ethertype) def serialize(self, buf, offset): msg_pack_into(ofproto.OFP_ACTION_PUSH_PACK_STR, buf, offset, self.type, self.len, self.ethertype) @OFPAction.register_action_type(ofproto.OFPAT_POP_PBB, ofproto.OFP_ACTION_HEADER_SIZE) class OFPActionPopPbb(OFPAction): """ Pop PBB action This action pops the outermost PBB service instance header from the packet. """ def __init__(self, type_=None, len_=None): super(OFPActionPopPbb, self).__init__() @classmethod def parser(cls, buf, offset): (type_, len_) = struct.unpack_from( ofproto.OFP_ACTION_HEADER_PACK_STR, buf, offset) return cls() @OFPAction.register_action_type( ofproto.OFPAT_EXPERIMENTER, ofproto.OFP_ACTION_EXPERIMENTER_HEADER_SIZE) class OFPActionExperimenter(OFPAction): """ Experimenter action This action is an extensible action for the experimenter. ================ ====================================================== Attribute Description ================ ====================================================== experimenter Experimenter ID ================ ====================================================== .. Note:: For the list of the supported Nicira experimenter actions, please refer to :ref:`ryu.ofproto.nx_actions <nx_actions_structures>`. """ def __init__(self, experimenter): super(OFPActionExperimenter, self).__init__() self.type = ofproto.OFPAT_EXPERIMENTER self.experimenter = experimenter self.len = None @classmethod def parser(cls, buf, offset): (type_, len_, experimenter) = struct.unpack_from( ofproto.OFP_ACTION_EXPERIMENTER_HEADER_PACK_STR, buf, offset) data = buf[(offset + ofproto.OFP_ACTION_EXPERIMENTER_HEADER_SIZE ): offset + len_] if experimenter == ofproto_common.NX_EXPERIMENTER_ID: obj = NXAction.parse(data) else: obj = OFPActionExperimenterUnknown(experimenter, data) obj.len = len_ return obj def serialize(self, buf, offset): msg_pack_into(ofproto.OFP_ACTION_EXPERIMENTER_HEADER_PACK_STR, buf, offset, self.type, self.len, self.experimenter) class OFPActionExperimenterUnknown(OFPActionExperimenter): def __init__(self, experimenter, data=None, type_=None, len_=None): super(OFPActionExperimenterUnknown, self).__init__(experimenter=experimenter) self.data = data def serialize(self, buf, offset): # fixup data = self.data if data is None: data = bytearray() self.len = (utils.round_up(len(data), 8) + ofproto.OFP_ACTION_EXPERIMENTER_HEADER_SIZE) super(OFPActionExperimenterUnknown, self).serialize(buf, offset) msg_pack_into('!%ds' % len(self.data), buf, offset + ofproto.OFP_ACTION_EXPERIMENTER_HEADER_SIZE, self.data) @_register_parser @_set_msg_type(ofproto.OFPT_GROUP_MOD) class OFPGroupMod(MsgBase): """ Modify group entry message The controller sends this message to modify the group table. ================ ====================================================== Attribute Description ================ ====================================================== command One of the following values. | OFPGC_ADD | OFPGC_MODIFY | OFPGC_DELETE type One of the following values. | OFPGT_ALL | OFPGT_SELECT | OFPGT_INDIRECT | OFPGT_FF group_id Group identifier buckets list of ``OFPBucket`` ================ ====================================================== ``type`` attribute corresponds to ``type_`` parameter of __init__. Example:: def send_group_mod(self, datapath): ofp = datapath.ofproto ofp_parser = datapath.ofproto_parser port = 1 max_len = 2000 actions = [ofp_parser.OFPActionOutput(port, max_len)] weight = 100 watch_port = 0 watch_group = 0 buckets = [ofp_parser.OFPBucket(weight, watch_port, watch_group, actions)] group_id = 1 req = ofp_parser.OFPGroupMod(datapath, ofp.OFPGC_ADD, ofp.OFPGT_SELECT, group_id, buckets) datapath.send_msg(req) """ def __init__(self, datapath, command=ofproto.OFPGC_ADD, type_=ofproto.OFPGT_ALL, group_id=0, buckets=None): buckets = buckets if buckets else [] super(OFPGroupMod, self).__init__(datapath) self.command = command self.type = type_ self.group_id = group_id self.buckets = buckets @classmethod def parser(cls, datapath, version, msg_type, msg_len, xid, buf): msg = super(OFPGroupMod, cls).parser( datapath, version, msg_type, msg_len, xid, buf) (msg.command, msg.type, msg.group_id) = struct.unpack_from( ofproto.OFP_GROUP_MOD_PACK_STR, buf, ofproto.OFP_HEADER_SIZE) offset = ofproto.OFP_GROUP_MOD_SIZE msg.buckets = [] while offset < msg.msg_len: bucket = OFPBucket.parser(buf, offset) msg.buckets.append(bucket) offset += bucket.len return msg def _serialize_body(self): msg_pack_into(ofproto.OFP_GROUP_MOD_PACK_STR, self.buf, ofproto.OFP_HEADER_SIZE, self.command, self.type, self.group_id) offset = ofproto.OFP_GROUP_MOD_SIZE for b in self.buckets: b.serialize(self.buf, offset) offset += b.len class OFPPortModProp(OFPPropBase): _TYPES = {} class OFPPortModPropEthernet(OFPPortModProp): def __init__(self, type_=None, length=None, advertise=None): self.type = type_ self.advertise = advertise def serialize(self): # fixup self.length = struct.calcsize( ofproto.OFP_PORT_MOD_PROP_ETHERNET_PACK_STR) buf = bytearray() msg_pack_into(ofproto.OFP_PORT_MOD_PROP_ETHERNET_PACK_STR, buf, 0, self.type, self.length, self.advertise) return buf class OFPPortModPropOptical(OFPPortModProp): def __init__(self, type_=None, length=None, configure=None, freq_lmda=None, fl_offset=None, grid_span=None, tx_pwr=None): self.type = type_ self.length = length self.configure = configure self.freq_lmda = freq_lmda self.fl_offset = fl_offset self.grid_span = grid_span self.tx_pwr = tx_pwr def serialize(self): # fixup self.length = struct.calcsize( ofproto.OFP_PORT_MOD_PROP_OPTICAL_PACK_STR) buf = bytearray() msg_pack_into(ofproto.OFP_PORT_MOD_PROP_OPTICAL_PACK_STR, buf, 0, self.type, self.length, self.configure, self.freq_lmda, self.fl_offset, self.grid_span, self.tx_pwr) return buf class OFPPortModPropExperimenter(OFPPropCommonExperimenter4ByteData): pass @_set_msg_type(ofproto.OFPT_PORT_MOD) class OFPPortMod(MsgBase): """ Port modification message The controller sneds this message to modify the behavior of the port. ================ ====================================================== Attribute Description ================ ====================================================== port_no Port number to modify hw_addr The hardware address that must be the same as hw_addr of ``OFPPort`` of ``OFPSwitchFeatures`` config Bitmap of configuration flags. | OFPPC_PORT_DOWN | OFPPC_NO_RECV | OFPPC_NO_FWD | OFPPC_NO_PACKET_IN mask Bitmap of configuration flags above to be changed properties List of ``OFPPortModProp`` subclass instance ================ ====================================================== Example:: def send_port_mod(self, datapath): ofp = datapath.ofproto ofp_parser = datapath.ofproto_parser port_no = 3 hw_addr = 'fa:c8:e8:76:1d:7e' config = 0 mask = (ofp.OFPPC_PORT_DOWN | ofp.OFPPC_NO_RECV | ofp.OFPPC_NO_FWD | ofp.OFPPC_NO_PACKET_IN) advertise = (ofp.OFPPF_10MB_HD | ofp.OFPPF_100MB_FD | ofp.OFPPF_1GB_FD | ofp.OFPPF_COPPER | ofp.OFPPF_AUTONEG | ofp.OFPPF_PAUSE | ofp.OFPPF_PAUSE_ASYM) properties = [ofp_parser.OFPPortModPropEthernet(advertise)] req = ofp_parser.OFPPortMod(datapath, port_no, hw_addr, config, mask, properties) datapath.send_msg(req) """ _TYPE = { 'ascii': [ 'hw_addr', ] } def __init__(self, datapath, port_no=0, hw_addr='00:00:00:00:00:00', config=0, mask=0, properties=None): super(OFPPortMod, self).__init__(datapath) self.port_no = port_no self.hw_addr = hw_addr self.config = config self.mask = mask self.properties = properties or [] def _serialize_body(self): bin_props = bytearray() for p in self.properties: bin_props += p.serialize() msg_pack_into(ofproto.OFP_PORT_MOD_PACK_STR, self.buf, ofproto.OFP_HEADER_SIZE, self.port_no, addrconv.mac.text_to_bin(self.hw_addr), self.config, self.mask) self.buf += bin_props class OFPBucket(StringifyMixin): def __init__(self, weight=0, watch_port=ofproto.OFPP_ANY, watch_group=ofproto.OFPG_ANY, actions=None, len_=None): super(OFPBucket, self).__init__() self.weight = weight self.watch_port = watch_port self.watch_group = watch_group self.actions = actions @classmethod def parser(cls, buf, offset): (len_, weight, watch_port, watch_group) = struct.unpack_from( ofproto.OFP_BUCKET_PACK_STR, buf, offset) msg = cls(weight, watch_port, watch_group, []) msg.len = len_ length = ofproto.OFP_BUCKET_SIZE offset += ofproto.OFP_BUCKET_SIZE while length < msg.len: action = OFPAction.parser(buf, offset) msg.actions.append(action) offset += action.len length += action.len return msg def serialize(self, buf, offset): action_offset = offset + ofproto.OFP_BUCKET_SIZE action_len = 0 for a in self.actions: a.serialize(buf, action_offset) action_offset += a.len action_len += a.len self.len = utils.round_up(ofproto.OFP_BUCKET_SIZE + action_len, 8) msg_pack_into(ofproto.OFP_BUCKET_PACK_STR, buf, offset, self.len, self.weight, self.watch_port, self.watch_group) @_set_msg_type(ofproto.OFPT_ROLE_REQUEST) class OFPRoleRequest(MsgBase): """ Role request message The controller uses this message to change its role. ================ ====================================================== Attribute Description ================ ====================================================== role One of the following values. | OFPCR_ROLE_NOCHANGE | OFPCR_ROLE_EQUAL | OFPCR_ROLE_MASTER | OFPCR_ROLE_SLAVE generation_id Master Election Generation ID ================ ====================================================== Example:: def send_role_request(self, datapath): ofp = datapath.ofproto ofp_parser = datapath.ofproto_parser req = ofp_parser.OFPRoleRequest(datapath, ofp.OFPCR_ROLE_EQUAL, 0) datapath.send_msg(req) """ def __init__(self, datapath, role=None, generation_id=None): super(OFPRoleRequest, self).__init__(datapath) self.role = role self.generation_id = generation_id def _serialize_body(self): assert self.role is not None assert self.generation_id is not None msg_pack_into(ofproto.OFP_ROLE_REQUEST_PACK_STR, self.buf, ofproto.OFP_HEADER_SIZE, self.role, self.generation_id) @_register_parser @_set_msg_type(ofproto.OFPT_ROLE_REPLY) class OFPRoleReply(MsgBase): """ Role reply message The switch responds with this message to a role request. ================ ====================================================== Attribute Description ================ ====================================================== role One of the following values. | OFPCR_ROLE_NOCHANGE | OFPCR_ROLE_EQUAL | OFPCR_ROLE_MASTER | OFPCR_ROLE_SLAVE generation_id Master Election Generation ID ================ ====================================================== Example:: @set_ev_cls(ofp_event.EventOFPRoleReply, MAIN_DISPATCHER) def role_reply_handler(self, ev): msg = ev.msg dp = msg.datapath ofp = dp.ofproto if msg.role == ofp.OFPCR_ROLE_NOCHANGE: role = 'NOCHANGE' elif msg.role == ofp.OFPCR_ROLE_EQUAL: role = 'EQUAL' elif msg.role == ofp.OFPCR_ROLE_MASTER: role = 'MASTER' elif msg.role == ofp.OFPCR_ROLE_SLAVE: role = 'SLAVE' else: role = 'unknown' self.logger.debug('OFPRoleReply received: ' 'role=%s generation_id=%d', role, msg.generation_id) """ def __init__(self, datapath, role=None, generation_id=None): super(OFPRoleReply, self).__init__(datapath) self.role = role self.generation_id = generation_id @classmethod def parser(cls, datapath, version, msg_type, msg_len, xid, buf): msg = super(OFPRoleReply, cls).parser(datapath, version, msg_type, msg_len, xid, buf) (msg.role, msg.generation_id) = struct.unpack_from( ofproto.OFP_ROLE_REQUEST_PACK_STR, msg.buf, ofproto.OFP_HEADER_SIZE) return msg class OFPAsyncConfigProp(OFPPropBase): _TYPES = {} @OFPAsyncConfigProp.register_type(ofproto.OFPACPT_PACKET_IN_SLAVE) @OFPAsyncConfigProp.register_type(ofproto.OFPACPT_PACKET_IN_MASTER) @OFPAsyncConfigProp.register_type(ofproto.OFPACPT_PORT_STATUS_SLAVE) @OFPAsyncConfigProp.register_type(ofproto.OFPACPT_PORT_STATUS_MASTER) @OFPAsyncConfigProp.register_type(ofproto.OFPACPT_FLOW_REMOVED_SLAVE) @OFPAsyncConfigProp.register_type(ofproto.OFPACPT_FLOW_REMOVED_MASTER) @OFPAsyncConfigProp.register_type(ofproto.OFPACPT_ROLE_STATUS_SLAVE) @OFPAsyncConfigProp.register_type(ofproto.OFPACPT_ROLE_STATUS_MASTER) @OFPAsyncConfigProp.register_type(ofproto.OFPACPT_TABLE_STATUS_SLAVE) @OFPAsyncConfigProp.register_type(ofproto.OFPACPT_TABLE_STATUS_MASTER) @OFPAsyncConfigProp.register_type(ofproto.OFPACPT_REQUESTFORWARD_SLAVE) @OFPAsyncConfigProp.register_type(ofproto.OFPACPT_REQUESTFORWARD_MASTER) class OFPAsyncConfigPropReasons(OFPAsyncConfigProp): def __init__(self, type_=None, length=None, mask=None): self.type = type_ self.length = length self.mask = mask @classmethod def parser(cls, buf): reasons = cls() (reasons.type, reasons.length, reasons.mask) = struct.unpack_from( ofproto.OFP_ASYNC_CONFIG_PROP_REASONS_PACK_STR, buf, 0) return reasons def serialize(self): # fixup self.length = ofproto.OFP_ASYNC_CONFIG_PROP_REASONS_SIZE buf = bytearray() msg_pack_into(ofproto.OFP_ASYNC_CONFIG_PROP_REASONS_PACK_STR, buf, 0, self.type, self.length, self.mask) return buf @OFPAsyncConfigProp.register_type(ofproto.OFPTFPT_EXPERIMENTER_SLAVE) @OFPAsyncConfigProp.register_type(ofproto.OFPTFPT_EXPERIMENTER_MASTER) class OFPAsyncConfigPropExperimenter(OFPPropCommonExperimenter4ByteData): pass @_set_msg_type(ofproto.OFPT_GET_ASYNC_REQUEST) class OFPGetAsyncRequest(MsgBase): """ Get asynchronous configuration request message The controller uses this message to query the asynchronous message. Example:: def send_get_async_request(self, datapath): ofp_parser = datapath.ofproto_parser req = ofp_parser.OFPGetAsyncRequest(datapath) datapath.send_msg(req) """ def __init__(self, datapath): super(OFPGetAsyncRequest, self).__init__(datapath) @_register_parser @_set_msg_type(ofproto.OFPT_GET_ASYNC_REPLY) class OFPGetAsyncReply(MsgBase): """ Get asynchronous configuration reply message The switch responds with this message to a get asynchronous configuration request. ================== ==================================================== Attribute Description ================== ==================================================== properties List of ``OFPAsyncConfigProp`` subclass instances ================== ==================================================== Example:: @set_ev_cls(ofp_event.EventOFPGetAsyncReply, MAIN_DISPATCHER) def get_async_reply_handler(self, ev): msg = ev.msg self.logger.debug('OFPGetAsyncReply received: ' 'properties=%s', repr(msg.properties)) """ def __init__(self, datapath, properties=None): super(OFPGetAsyncReply, self).__init__(datapath) self.properties = properties @classmethod def parser(cls, datapath, version, msg_type, msg_len, xid, buf): msg = super(OFPGetAsyncReply, cls).parser(datapath, version, msg_type, msg_len, xid, buf) msg.properties = [] rest = msg.buf[ofproto.OFP_HEADER_SIZE:] while rest: p, rest = OFPAsyncConfigProp.parse(rest) msg.properties.append(p) return msg @_set_msg_type(ofproto.OFPT_SET_ASYNC) class OFPSetAsync(MsgBase): """ Set asynchronous configuration message The controller sends this message to set the asynchronous messages that it wants to receive on a given OpneFlow channel. ================== ==================================================== Attribute Description ================== ==================================================== properties List of ``OFPAsyncConfigProp`` subclass instances ================== ==================================================== Example:: def send_set_async(self, datapath): ofp = datapath.ofproto ofp_parser = datapath.ofproto_parser properties = [ofp_parser.OFPAsyncConfigPropReasons( 8, ofp_parser.OFPACPT_PACKET_IN_SLAVE, (ofp_parser.OFPR_APPLY_ACTION | ofp_parser.OFPR_INVALID_TTL)), ofp_parser.OFPAsyncConfigPropExperimenter( ofp.OFPTFPT_EXPERIMENTER_MASTER, 16, 100, 2, bytearray())] req = ofp_parser.OFPSetAsync(datapath, properties) datapath.send_msg(req) """ def __init__(self, datapath, properties=None): super(OFPSetAsync, self).__init__(datapath) self.properties = properties def _serialize_body(self): bin_props = bytearray() for p in self.properties: bin_props += p.serialize() self.buf += bin_props @_set_msg_type(ofproto.OFPT_BUNDLE_CONTROL) class OFPBundleCtrlMsg(MsgBase): """ Bundle control message The controller uses this message to create, destroy and commit bundles ================ ====================================================== Attribute Description ================ ====================================================== bundle_id Id of the bundle type One of the following values. | OFPBCT_OPEN_REQUEST | OFPBCT_OPEN_REPLY | OFPBCT_CLOSE_REQUEST | OFPBCT_CLOSE_REPLY | OFPBCT_COMMIT_REQUEST | OFPBCT_COMMIT_REPLY | OFPBCT_DISCARD_REQUEST | OFPBCT_DISCARD_REPLY flags Bitmap of the following flags. | OFPBF_ATOMIC | OFPBF_ORDERED properties List of ``OFPBundleProp`` subclass instance ================ ====================================================== Example:: def send_bundle_control(self, datapath): ofp = datapath.ofproto ofp_parser = datapath.ofproto_parser req = ofp_parser.OFPBundleCtrlMsg(datapath, 7, ofp.OFPBCT_OPEN_REQUEST, [ofp.OFPBF_ATOMIC], []) datapath.send_msg(req) """ def __init__(self, datapath, bundle_id, type_, flags, properties): super(OFPBundleCtrlMsg, self).__init__(datapath) self.bundle_id = bundle_id self.type = type_ self.flags = flags self.properties = properties def _serialize_body(self): bin_props = bytearray() for p in self.properties: bin_props += p.serialize() msg_pack_into(ofproto.OFP_BUNDLE_CTRL_MSG_PACK_STR, self.buf, ofproto.OFP_HEADER_SIZE, self.bundle_id, self.type, self.flags) self.buf += bin_props @_set_msg_type(ofproto.OFPT_BUNDLE_ADD_MESSAGE) class OFPBundleAddMsg(MsgInMsgBase): """ Bundle control message The controller uses this message to create, destroy and commit bundles ================ ====================================================== Attribute Description ================ ====================================================== bundle_id Id of the bundle flags Bitmap of the following flags. | OFPBF_ATOMIC | OFPBF_ORDERED message ``MsgBase`` subclass instance properties List of ``OFPBundleProp`` subclass instance ================ ====================================================== Example:: def send_bundle_add_message(self, datapath): ofp = datapath.ofproto ofp_parser = datapath.ofproto_parser msg = ofp_parser.OFPRoleRequest(datapath, ofp.OFPCR_ROLE_EQUAL, 0) req = ofp_parser.OFPBundleAddMsg(datapath, 7, [ofp.OFPBF_ATOMIC], msg, []) datapath.send_msg(req) """ def __init__(self, datapath, bundle_id, flags, message, properties): super(OFPBundleAddMsg, self).__init__(datapath) self.bundle_id = bundle_id self.flags = flags self.message = message self.properties = properties def _serialize_body(self): # The xid of the inner message must be the same as # that of the outer message (OF1.4.0 7.3.9.2) if self.message.xid != self.xid: self.message.set_xid(self.xid) # Message self.message.serialize() tail_buf = self.message.buf # Pad if len(self.properties) > 0: message_len = len(tail_buf) pad_len = utils.round_up(message_len, 8) - message_len msg_pack_into("%dx" % pad_len, tail_buf, message_len) # Properties for p in self.properties: tail_buf += p.serialize() # Head msg_pack_into(ofproto.OFP_BUNDLE_ADD_MSG_0_PACK_STR, self.buf, ofproto.OFP_HEADER_SIZE, self.bundle_id, self.flags) # Finish self.buf += tail_buf nx_actions.generate( 'ryu.ofproto.ofproto_v1_4', 'ryu.ofproto.ofproto_v1_4_parser' )

36.74894

90

0.568157

import six import struct from ryu.lib import addrconv from ryu.lib.pack_utils import msg_pack_into from ryu import utils from ryu.ofproto.ofproto_parser import StringifyMixin, MsgBase, MsgInMsgBase, msg_str_attr from ryu.ofproto import ether from ryu.ofproto import nx_actions from ryu.ofproto import ofproto_parser from ryu.ofproto import ofproto_common from ryu.ofproto import ofproto_v1_4 as ofproto _MSG_PARSERS = {} def _set_msg_type(msg_type): def _set_cls_msg_type(cls): cls.cls_msg_type = msg_type return cls return _set_cls_msg_type def _register_parser(cls): assert cls.cls_msg_type is not None assert cls.cls_msg_type not in _MSG_PARSERS _MSG_PARSERS[cls.cls_msg_type] = cls.parser return cls @ofproto_parser.register_msg_parser(ofproto.OFP_VERSION) def msg_parser(datapath, version, msg_type, msg_len, xid, buf): parser = _MSG_PARSERS.get(msg_type) return parser(datapath, version, msg_type, msg_len, xid, buf) @_register_parser @_set_msg_type(ofproto.OFPT_HELLO) class OFPHello(MsgBase): def __init__(self, datapath, elements=None): elements = elements if elements else [] super(OFPHello, self).__init__(datapath) self.elements = elements @classmethod def parser(cls, datapath, version, msg_type, msg_len, xid, buf): msg = super(OFPHello, cls).parser(datapath, version, msg_type, msg_len, xid, buf) offset = ofproto.OFP_HELLO_HEADER_SIZE elems = [] while offset < msg.msg_len: type_, length = struct.unpack_from( ofproto.OFP_HELLO_ELEM_HEADER_PACK_STR, msg.buf, offset) if type_ == ofproto.OFPHET_VERSIONBITMAP: elem = OFPHelloElemVersionBitmap.parser(msg.buf, offset) elems.append(elem) offset += length msg.elements = elems return msg class OFPHelloElemVersionBitmap(StringifyMixin): def __init__(self, versions, type_=None, length=None): super(OFPHelloElemVersionBitmap, self).__init__() self.type = ofproto.OFPHET_VERSIONBITMAP self.length = None self._bitmaps = None self.versions = versions @classmethod def parser(cls, buf, offset): type_, length = struct.unpack_from( ofproto.OFP_HELLO_ELEM_VERSIONBITMAP_HEADER_PACK_STR, buf, offset) assert type_ == ofproto.OFPHET_VERSIONBITMAP bitmaps_len = (length - ofproto.OFP_HELLO_ELEM_VERSIONBITMAP_HEADER_SIZE) offset += ofproto.OFP_HELLO_ELEM_VERSIONBITMAP_HEADER_SIZE bitmaps = [] while bitmaps_len >= 4: bitmap = struct.unpack_from('!I', buf, offset) bitmaps.append(bitmap[0]) offset += 4 bitmaps_len -= 4 versions = [i * 32 + shift for i, bitmap in enumerate(bitmaps) for shift in range(31) if bitmap & (1 << shift)] elem = cls(versions) elem.length = length elem._bitmaps = bitmaps return elem @_register_parser @_set_msg_type(ofproto.OFPT_ECHO_REQUEST) class OFPEchoRequest(MsgBase): def __init__(self, datapath, data=None): super(OFPEchoRequest, self).__init__(datapath) self.data = data @classmethod def parser(cls, datapath, version, msg_type, msg_len, xid, buf): msg = super(OFPEchoRequest, cls).parser(datapath, version, msg_type, msg_len, xid, buf) msg.data = msg.buf[ofproto.OFP_HEADER_SIZE:] return msg def _serialize_body(self): if self.data is not None: self.buf += self.data @_register_parser @_set_msg_type(ofproto.OFPT_ERROR) class OFPErrorMsg(MsgBase): def __init__(self, datapath, type_=None, code=None, data=None): super(OFPErrorMsg, self).__init__(datapath) self.type = type_ self.code = code self.data = data @classmethod def parser(cls, datapath, version, msg_type, msg_len, xid, buf): type_, = struct.unpack_from('!H', six.binary_type(buf), ofproto.OFP_HEADER_SIZE) if type_ == ofproto.OFPET_EXPERIMENTER: return OFPErrorExperimenterMsg.parser(datapath, version, msg_type, msg_len, xid, buf) msg = super(OFPErrorMsg, cls).parser(datapath, version, msg_type, msg_len, xid, buf) msg.type, msg.code = struct.unpack_from( ofproto.OFP_ERROR_MSG_PACK_STR, msg.buf, ofproto.OFP_HEADER_SIZE) msg.data = msg.buf[ofproto.OFP_ERROR_MSG_SIZE:] return msg def _serialize_body(self): assert self.data is not None msg_pack_into(ofproto.OFP_ERROR_MSG_PACK_STR, self.buf, ofproto.OFP_HEADER_SIZE, self.type, self.code) self.buf += self.data class OFPErrorExperimenterMsg(MsgBase): def __init__(self, datapath, type_=None, exp_type=None, experimenter=None, data=None): super(OFPErrorExperimenterMsg, self).__init__(datapath) self.type = ofproto.OFPET_EXPERIMENTER self.exp_type = exp_type self.experimenter = experimenter self.data = data @classmethod def parser(cls, datapath, version, msg_type, msg_len, xid, buf): cls.cls_msg_type = msg_type msg = super(OFPErrorExperimenterMsg, cls).parser( datapath, version, msg_type, msg_len, xid, buf) msg.type, msg.exp_type, msg.experimenter = struct.unpack_from( ofproto.OFP_ERROR_EXPERIMENTER_MSG_PACK_STR, msg.buf, ofproto.OFP_HEADER_SIZE) msg.data = msg.buf[ofproto.OFP_ERROR_EXPERIMENTER_MSG_SIZE:] return msg def _serialize_body(self): assert self.data is not None msg_pack_into(ofproto.OFP_ERROR_EXPERIMENTER_MSG_PACK_STR, self.buf, ofproto.OFP_HEADER_SIZE, self.type, self.exp_type, self.experimenter) self.buf += self.data @_register_parser @_set_msg_type(ofproto.OFPT_ECHO_REPLY) class OFPEchoReply(MsgBase): def __init__(self, datapath, data=None): super(OFPEchoReply, self).__init__(datapath) self.data = data @classmethod def parser(cls, datapath, version, msg_type, msg_len, xid, buf): msg = super(OFPEchoReply, cls).parser(datapath, version, msg_type, msg_len, xid, buf) msg.data = msg.buf[ofproto.OFP_HEADER_SIZE:] return msg def _serialize_body(self): assert self.data is not None self.buf += self.data @_set_msg_type(ofproto.OFPT_FEATURES_REQUEST) class OFPFeaturesRequest(MsgBase): def __init__(self, datapath): super(OFPFeaturesRequest, self).__init__(datapath) @_register_parser @_set_msg_type(ofproto.OFPT_EXPERIMENTER) class OFPExperimenter(MsgBase): def __init__(self, datapath, experimenter=None, exp_type=None, data=None): super(OFPExperimenter, self).__init__(datapath) self.experimenter = experimenter self.exp_type = exp_type self.data = data @classmethod def parser(cls, datapath, version, msg_type, msg_len, xid, buf): msg = super(OFPExperimenter, cls).parser(datapath, version, msg_type, msg_len, xid, buf) (msg.experimenter, msg.exp_type) = struct.unpack_from( ofproto.OFP_EXPERIMENTER_HEADER_PACK_STR, msg.buf, ofproto.OFP_HEADER_SIZE) msg.data = msg.buf[ofproto.OFP_EXPERIMENTER_HEADER_SIZE:] return msg def _serialize_body(self): assert self.data is not None msg_pack_into(ofproto.OFP_EXPERIMENTER_HEADER_PACK_STR, self.buf, ofproto.OFP_HEADER_SIZE, self.experimenter, self.exp_type) self.buf += self.data @_register_parser @_set_msg_type(ofproto.OFPT_FEATURES_REPLY) class OFPSwitchFeatures(MsgBase): def __init__(self, datapath, datapath_id=None, n_buffers=None, n_tables=None, auxiliary_id=None, capabilities=None): super(OFPSwitchFeatures, self).__init__(datapath) self.datapath_id = datapath_id self.n_buffers = n_buffers self.n_tables = n_tables self.auxiliary_id = auxiliary_id self.capabilities = capabilities @classmethod def parser(cls, datapath, version, msg_type, msg_len, xid, buf): msg = super(OFPSwitchFeatures, cls).parser(datapath, version, msg_type, msg_len, xid, buf) (msg.datapath_id, msg.n_buffers, msg.n_tables, msg.auxiliary_id, msg.capabilities, msg._reserved) = struct.unpack_from( ofproto.OFP_SWITCH_FEATURES_PACK_STR, msg.buf, ofproto.OFP_HEADER_SIZE) return msg @_set_msg_type(ofproto.OFPT_GET_CONFIG_REQUEST) class OFPGetConfigRequest(MsgBase): def __init__(self, datapath): super(OFPGetConfigRequest, self).__init__(datapath) @_register_parser @_set_msg_type(ofproto.OFPT_GET_CONFIG_REPLY) class OFPGetConfigReply(MsgBase): def __init__(self, datapath, flags=None, miss_send_len=None): super(OFPGetConfigReply, self).__init__(datapath) self.flags = flags self.miss_send_len = miss_send_len @classmethod def parser(cls, datapath, version, msg_type, msg_len, xid, buf): msg = super(OFPGetConfigReply, cls).parser(datapath, version, msg_type, msg_len, xid, buf) msg.flags, msg.miss_send_len = struct.unpack_from( ofproto.OFP_SWITCH_CONFIG_PACK_STR, msg.buf, ofproto.OFP_HEADER_SIZE) return msg @_set_msg_type(ofproto.OFPT_SET_CONFIG) class OFPSetConfig(MsgBase): def __init__(self, datapath, flags=0, miss_send_len=0): super(OFPSetConfig, self).__init__(datapath) self.flags = flags self.miss_send_len = miss_send_len def _serialize_body(self): assert self.flags is not None assert self.miss_send_len is not None msg_pack_into(ofproto.OFP_SWITCH_CONFIG_PACK_STR, self.buf, ofproto.OFP_HEADER_SIZE, self.flags, self.miss_send_len) class OFPMatch(StringifyMixin): def __init__(self, type_=None, length=None, _ordered_fields=None, **kwargs): super(OFPMatch, self).__init__() self.type = ofproto.OFPMT_OXM self.length = length if _ordered_fields is not None: assert not kwargs self._fields2 = _ordered_fields else: kwargs = dict(ofproto.oxm_normalize_user(k, v) for (k, v) in kwargs.items()) fields = [ofproto.oxm_from_user(k, v) for (k, v) in kwargs.items()] # assumption: sorting by OXM type values makes fields # meet ordering requirements (eg. eth_type before ipv4_src) fields.sort( key=lambda x: x[0][0] if isinstance(x[0], tuple) else x[0]) self._fields2 = [ofproto.oxm_to_user(n, v, m) for (n, v, m) in fields] @classmethod def parser(cls, buf, offset): match = OFPMatch() type_, length = struct.unpack_from('!HH', buf, offset) match.type = type_ match.length = length # ofp_match adjustment offset += 4 length -= 4 fields = [] while length > 0: n, value, mask, field_len = ofproto.oxm_parse(buf, offset) k, uv = ofproto.oxm_to_user(n, value, mask) fields.append((k, uv)) offset += field_len length -= field_len match._fields2 = fields return match def serialize(self, buf, offset): fields = [ofproto.oxm_from_user(k, uv) for (k, uv) in self._fields2] hdr_pack_str = '!HH' field_offset = offset + struct.calcsize(hdr_pack_str) for (n, value, mask) in fields: field_offset += ofproto.oxm_serialize(n, value, mask, buf, field_offset) length = field_offset - offset msg_pack_into(hdr_pack_str, buf, offset, ofproto.OFPMT_OXM, length) self.length = length pad_len = utils.round_up(length, 8) - length msg_pack_into("%dx" % pad_len, buf, field_offset) return length + pad_len def __getitem__(self, key): return dict(self._fields2)[key] def __contains__(self, key): return key in dict(self._fields2) def iteritems(self): return iter(dict(self._fields2).items()) def items(self): return self._fields2 def get(self, key, default=None): return dict(self._fields2).get(key, default) def stringify_attrs(self): yield "oxm_fields", dict(self._fields2) def to_jsondict(self): body = {"oxm_fields": [ofproto.oxm_to_jsondict(k, uv) for k, uv in self._fields2], "length": self.length, "type": self.type} return {self.__class__.__name__: body} @classmethod def from_jsondict(cls, dict_): fields = [ofproto.oxm_from_jsondict(f) for f in dict_['oxm_fields']] return OFPMatch(_ordered_fields=fields) class OFPPropUnknown(StringifyMixin): def __init__(self, type_=None, length=None, buf=None): self.buf = buf @classmethod def parser(cls, buf): return cls(buf=buf) class OFPPropBase(StringifyMixin): _PACK_STR = '!HH' # _TYPES = {} must be an attribute of subclass def __init__(self, type_, length=None): self.type = type_ self.length = length @classmethod def register_type(cls, type_): def _register_type(subcls): cls._TYPES[type_] = subcls return subcls return _register_type @classmethod def parse(cls, buf): (type_, length) = struct.unpack_from(cls._PACK_STR, buf, 0) rest = buf[utils.round_up(length, 8):] try: subcls = cls._TYPES[type_] except KeyError: subcls = OFPPropUnknown prop = subcls.parser(buf) prop.type = type_ prop.length = length return prop, rest @classmethod def get_rest(cls, buf): (type_, length) = struct.unpack_from(cls._PACK_STR, buf, 0) offset = struct.calcsize(cls._PACK_STR) return buf[offset:length] def serialize(self): # Body # serialize_body should be implemented by subclass body = bytearray() body += self.serialize_body() # fixup self.length = len(body) + struct.calcsize(self._PACK_STR) # Header buf = bytearray() msg_pack_into(self._PACK_STR, buf, 0, self.type, self.length) buf += body # Pad pad_len = utils.round_up(self.length, 8) - self.length msg_pack_into("%dx" % pad_len, buf, len(buf)) return buf class OFPPropCommonExperimenter4ByteData(StringifyMixin): _PACK_STR = '!HHII' _EXPERIMENTER_DATA_PACK_STR = '!I' _EXPERIMENTER_DATA_SIZE = 4 def __init__(self, type_=None, length=None, experimenter=None, exp_type=None, data=bytearray()): self.type = type_ self.length = length self.experimenter = experimenter self.exp_type = exp_type self.data = data @classmethod def parser(cls, buf): (type_, length, experimenter, exp_type) = struct.unpack_from( ofproto.OFP_PROP_EXPERIMENTER_PACK_STR, buf, 0) rest = buf[ofproto.OFP_PROP_EXPERIMENTER_SIZE:length] data = [] while rest: (d,) = struct.unpack_from( cls._EXPERIMENTER_DATA_PACK_STR, rest, 0) data.append(d) rest = rest[cls._EXPERIMENTER_DATA_SIZE:] return cls(type_, length, experimenter, exp_type, data) def serialize(self): offset = 0 bin_data = bytearray() for d in self.data: msg_pack_into(self._EXPERIMENTER_DATA_PACK_STR, bin_data, offset, d) offset += self._EXPERIMENTER_DATA_SIZE # fixup self.length = struct.calcsize(self._PACK_STR) self.length += len(bin_data) buf = bytearray() msg_pack_into(self._PACK_STR, buf, 0, self.type, self.length, self.experimenter, self.exp_type) buf += bin_data # Pad pad_len = utils.round_up(self.length, 8) - self.length msg_pack_into("%dx" % pad_len, buf, len(buf)) return buf class OFPPortDescProp(OFPPropBase): _TYPES = {} @OFPPortDescProp.register_type(ofproto.OFPPDPT_ETHERNET) class OFPPortDescPropEthernet(OFPPortDescProp): def __init__(self, type_=None, length=None, curr=None, advertised=None, supported=None, peer=None, curr_speed=None, max_speed=None): self.type = type_ self.length = length self.curr = curr self.advertised = advertised self.supported = supported self.peer = peer self.curr_speed = curr_speed self.max_speed = max_speed @classmethod def parser(cls, buf): ether = cls() (ether.type, ether.length, ether.curr, ether.advertised, ether.supported, ether.peer, ether.curr_speed, ether.max_speed) = struct.unpack_from( ofproto.OFP_PORT_DESC_PROP_ETHERNET_PACK_STR, buf, 0) return ether @OFPPortDescProp.register_type(ofproto.OFPPDPT_OPTICAL) class OFPPortDescPropOptical(OFPPortDescProp): def __init__(self, type_=None, length=None, supported=None, tx_min_freq_lmda=None, tx_max_freq_lmda=None, tx_grid_freq_lmda=None, rx_min_freq_lmda=None, rx_max_freq_lmda=None, rx_grid_freq_lmda=None, tx_pwr_min=None, tx_pwr_max=None): self.type = type_ self.length = length self.supported = supported self.tx_min_freq_lmda = tx_min_freq_lmda self.tx_max_freq_lmda = tx_max_freq_lmda self.tx_grid_freq_lmda = tx_grid_freq_lmda self.rx_min_freq_lmda = rx_min_freq_lmda self.rx_max_freq_lmda = rx_max_freq_lmda self.rx_grid_freq_lmda = rx_grid_freq_lmda self.tx_pwr_min = tx_pwr_min self.tx_pwr_max = tx_pwr_max @classmethod def parser(cls, buf): optical = cls() (optical.type, optical.length, optical.supported, optical.tx_min_freq_lmda, optical.tx_max_freq_lmda, optical.tx_grid_freq_lmda, optical.rx_min_freq_lmda, optical.rx_max_freq_lmda, optical.rx_grid_freq_lmda, optical.tx_pwr_min, optical.tx_pwr_max) = struct.unpack_from( ofproto.OFP_PORT_DESC_PROP_OPTICAL_PACK_STR, buf, 0) return optical @OFPPortDescProp.register_type(ofproto.OFPPDPT_EXPERIMENTER) class OFPPortDescPropExperimenter(OFPPropCommonExperimenter4ByteData): pass class OFPTableModProp(OFPPropBase): _TYPES = {} @OFPTableModProp.register_type(ofproto.OFPTMPT_EVICTION) class OFPTableModPropEviction(OFPTableModProp): def __init__(self, type_=None, length=None, flags=None): self.type = type_ self.length = length self.flags = flags @classmethod def parser(cls, buf): eviction = cls() (eviction.type, eviction.length, eviction.flags) = struct.unpack_from( ofproto.OFP_TABLE_MOD_PROP_EVICTION_PACK_STR, buf, 0) return eviction def serialize(self): # fixup self.length = ofproto.OFP_TABLE_MOD_PROP_EVICTION_SIZE buf = bytearray() msg_pack_into(ofproto.OFP_TABLE_MOD_PROP_EVICTION_PACK_STR, buf, 0, self.type, self.length, self.flags) return buf @OFPTableModProp.register_type(ofproto.OFPTMPT_VACANCY) class OFPTableModPropVacancy(OFPTableModProp): def __init__(self, type_=None, length=None, vacancy_down=None, vacancy_up=None, vacancy=None): self.type = type_ self.length = length self.vacancy_down = vacancy_down self.vacancy_up = vacancy_up self.vacancy = vacancy @classmethod def parser(cls, buf): vacancy = cls() (vacancy.type, vacancy.length, vacancy.vacancy_down, vacancy.vacancy_up, vacancy.vacancy) = struct.unpack_from( ofproto.OFP_TABLE_MOD_PROP_VACANCY_PACK_STR, buf, 0) return vacancy def serialize(self): # fixup self.length = ofproto.OFP_TABLE_MOD_PROP_VACANCY_SIZE buf = bytearray() msg_pack_into(ofproto.OFP_TABLE_MOD_PROP_VACANCY_PACK_STR, buf, 0, self.type, self.length, self.vacancy_down, self.vacancy_up, self.vacancy) return buf @OFPTableModProp.register_type(ofproto.OFPTMPT_EXPERIMENTER) class OFPTableModPropExperimenter(OFPPropCommonExperimenter4ByteData): pass class OFPQueueDescProp(OFPPropBase): _TYPES = {} @OFPQueueDescProp.register_type(ofproto.OFPQDPT_MIN_RATE) class OFPQueueDescPropMinRate(OFPQueueDescProp): def __init__(self, type_=None, length=None, rate=None): self.type = type_ self.length = length self.rate = rate @classmethod def parser(cls, buf): minrate = cls() (minrate.type, minrate.length, minrate.rate) = struct.unpack_from( ofproto.OFP_QUEUE_DESC_PROP_MIN_RATE_PACK_STR, buf, 0) return minrate @OFPQueueDescProp.register_type(ofproto.OFPQDPT_MAX_RATE) class OFPQueueDescPropMaxRate(OFPQueueDescProp): def __init__(self, type_=None, length=None, rate=None): self.type = type_ self.length = length self.rate = rate @classmethod def parser(cls, buf): maxrate = cls() (maxrate.type, maxrate.length, maxrate.rate) = struct.unpack_from( ofproto.OFP_QUEUE_DESC_PROP_MAX_RATE_PACK_STR, buf, 0) return maxrate @OFPQueueDescProp.register_type(ofproto.OFPQDPT_EXPERIMENTER) class OFPQueueDescPropExperimenter(OFPPropCommonExperimenter4ByteData): pass class OFPRoleProp(OFPPropBase): _TYPES = {} @OFPRoleProp.register_type(ofproto.OFPRPT_EXPERIMENTER) class OFPRolePropExperimenter(OFPPropCommonExperimenter4ByteData): pass class OFPBundleProp(OFPPropBase): _TYPES = {} @OFPBundleProp.register_type(ofproto.OFPRPT_EXPERIMENTER) class OFPBundlePropExperimenter(OFPPropCommonExperimenter4ByteData): pass @_register_parser @_set_msg_type(ofproto.OFPT_PACKET_IN) class OFPPacketIn(MsgBase): def __init__(self, datapath, buffer_id=None, total_len=None, reason=None, table_id=None, cookie=None, match=None, data=None): super(OFPPacketIn, self).__init__(datapath) self.buffer_id = buffer_id self.total_len = total_len self.reason = reason self.table_id = table_id self.cookie = cookie self.match = match self.data = data @classmethod def parser(cls, datapath, version, msg_type, msg_len, xid, buf): msg = super(OFPPacketIn, cls).parser(datapath, version, msg_type, msg_len, xid, buf) (msg.buffer_id, msg.total_len, msg.reason, msg.table_id, msg.cookie) = struct.unpack_from( ofproto.OFP_PACKET_IN_PACK_STR, msg.buf, ofproto.OFP_HEADER_SIZE) msg.match = OFPMatch.parser(msg.buf, ofproto.OFP_PACKET_IN_SIZE - ofproto.OFP_MATCH_SIZE) match_len = utils.round_up(msg.match.length, 8) msg.data = msg.buf[(ofproto.OFP_PACKET_IN_SIZE - ofproto.OFP_MATCH_SIZE + match_len + 2):] if msg.total_len < len(msg.data): # discard padding for 8-byte alignment of OFP packet msg.data = msg.data[:msg.total_len] return msg @_register_parser @_set_msg_type(ofproto.OFPT_FLOW_REMOVED) class OFPFlowRemoved(MsgBase): def __init__(self, datapath, cookie=None, priority=None, reason=None, table_id=None, duration_sec=None, duration_nsec=None, idle_timeout=None, hard_timeout=None, packet_count=None, byte_count=None, match=None): super(OFPFlowRemoved, self).__init__(datapath) self.cookie = cookie self.priority = priority self.reason = reason self.table_id = table_id self.duration_sec = duration_sec self.duration_nsec = duration_nsec self.idle_timeout = idle_timeout self.hard_timeout = hard_timeout self.packet_count = packet_count self.byte_count = byte_count self.match = match @classmethod def parser(cls, datapath, version, msg_type, msg_len, xid, buf): msg = super(OFPFlowRemoved, cls).parser(datapath, version, msg_type, msg_len, xid, buf) (msg.cookie, msg.priority, msg.reason, msg.table_id, msg.duration_sec, msg.duration_nsec, msg.idle_timeout, msg.hard_timeout, msg.packet_count, msg.byte_count) = struct.unpack_from( ofproto.OFP_FLOW_REMOVED_PACK_STR0, msg.buf, ofproto.OFP_HEADER_SIZE) offset = (ofproto.OFP_FLOW_REMOVED_SIZE - ofproto.OFP_MATCH_SIZE) msg.match = OFPMatch.parser(msg.buf, offset) return msg class OFPPort(StringifyMixin): _TYPE = { 'ascii': [ 'hw_addr', ], 'utf-8': [ # OF spec is unclear about the encoding of name. # we assumes UTF-8, which is used by OVS. 'name', ] } def __init__(self, port_no=None, length=None, hw_addr=None, name=None, config=None, state=None, properties=None): super(OFPPort, self).__init__() self.port_no = port_no self.length = length self.hw_addr = hw_addr self.name = name self.config = config self.state = state self.properties = properties @classmethod def parser(cls, buf, offset): (port_no, length, hw_addr, name, config, state) = struct.unpack_from( ofproto.OFP_PORT_PACK_STR, buf, offset) hw_addr = addrconv.mac.bin_to_text(hw_addr) name = name.rstrip(b'\0') props = [] rest = buf[offset + ofproto.OFP_PORT_SIZE:offset + length] while rest: p, rest = OFPPortDescProp.parse(rest) props.append(p) ofpport = cls(port_no, length, hw_addr, name, config, state, props) return ofpport class OFPTableDesc(StringifyMixin): def __init__(self, length=None, table_id=None, config=None, properties=None): super(OFPTableDesc, self).__init__() self.table_id = table_id self.length = length self.config = config self.properties = properties @classmethod def parser(cls, buf, offset): (length, table_id, config) = struct.unpack_from( ofproto.OFP_TABLE_DESC_PACK_STR, buf, offset) props = [] rest = buf[offset + ofproto.OFP_TABLE_DESC_SIZE:offset + length] while rest: p, rest = OFPTableModProp.parse(rest) props.append(p) ofptabledesc = cls(length, table_id, config, props) return ofptabledesc class OFPQueueDesc(StringifyMixin): def __init__(self, port_no=None, queue_id=None, len_=None, properties=None): super(OFPQueueDesc, self).__init__() self.port_no = port_no self.queue_id = queue_id self.len = len_ self.properties = properties @classmethod def parser(cls, buf, offset): (port_no, queue_id, len_) = struct.unpack_from( ofproto.OFP_QUEUE_DESC_PACK_STR, buf, offset) props = [] rest = buf[offset + ofproto.OFP_QUEUE_DESC_SIZE:offset + len_] while rest: p, rest = OFPQueueDescProp.parse(rest) props.append(p) ofpqueuedesc = cls(port_no, queue_id, len_, props) return ofpqueuedesc def _set_stats_type(stats_type, stats_body_cls): def _set_cls_stats_type(cls): cls.cls_stats_type = stats_type cls.cls_stats_body_cls = stats_body_cls return cls return _set_cls_stats_type @_set_msg_type(ofproto.OFPT_MULTIPART_REQUEST) class OFPMultipartRequest(MsgBase): def __init__(self, datapath, flags): super(OFPMultipartRequest, self).__init__(datapath) self.type = self.__class__.cls_stats_type self.flags = flags def _serialize_stats_body(self): pass def _serialize_body(self): msg_pack_into(ofproto.OFP_MULTIPART_REQUEST_PACK_STR, self.buf, ofproto.OFP_HEADER_SIZE, self.type, self.flags) self._serialize_stats_body() @_register_parser @_set_msg_type(ofproto.OFPT_METER_MOD) class OFPMeterMod(MsgBase): def __init__(self, datapath, command=ofproto.OFPMC_ADD, flags=ofproto.OFPMF_KBPS, meter_id=1, bands=None): bands = bands if bands else [] super(OFPMeterMod, self).__init__(datapath) self.command = command self.flags = flags self.meter_id = meter_id self.bands = bands @classmethod def parser(cls, datapath, version, msg_type, msg_len, xid, buf): msg = super(OFPMeterMod, cls).parser( datapath, version, msg_type, msg_len, xid, buf) (msg.command, msg.flags, msg.meter_id) = struct.unpack_from( ofproto.OFP_METER_MOD_PACK_STR, buf, ofproto.OFP_HEADER_SIZE) offset = ofproto.OFP_METER_MOD_SIZE msg.bands = [] while offset < msg.msg_len: band = OFPMeterBandHeader.parser(buf, offset) msg.bands.append(band) offset += band.len return msg def _serialize_body(self): msg_pack_into(ofproto.OFP_METER_MOD_PACK_STR, self.buf, ofproto.OFP_HEADER_SIZE, self.command, self.flags, self.meter_id) offset = ofproto.OFP_METER_MOD_SIZE for b in self.bands: b.serialize(self.buf, offset) offset += b.len @_set_msg_type(ofproto.OFPT_TABLE_MOD) class OFPTableMod(MsgBase): def __init__(self, datapath, table_id, config, properties): super(OFPTableMod, self).__init__(datapath) self.table_id = table_id self.config = config self.properties = properties def _serialize_body(self): props_buf = bytearray() for p in self.properties: props_buf += p.serialize() msg_pack_into(ofproto.OFP_TABLE_MOD_PACK_STR, self.buf, ofproto.OFP_HEADER_SIZE, self.table_id, self.config) self.buf += props_buf @_register_parser @_set_msg_type(ofproto.OFPT_MULTIPART_REPLY) class OFPMultipartReply(MsgBase): _STATS_MSG_TYPES = {} @staticmethod def register_stats_type(body_single_struct=False): def _register_stats_type(cls): assert cls.cls_stats_type is not None assert cls.cls_stats_type not in OFPMultipartReply._STATS_MSG_TYPES assert cls.cls_stats_body_cls is not None cls.cls_body_single_struct = body_single_struct OFPMultipartReply._STATS_MSG_TYPES[cls.cls_stats_type] = cls return cls return _register_stats_type def __init__(self, datapath, body=None, flags=None): super(OFPMultipartReply, self).__init__(datapath) self.body = body self.flags = flags @classmethod def parser_stats_body(cls, buf, msg_len, offset): body_cls = cls.cls_stats_body_cls body = [] while offset < msg_len: entry = body_cls.parser(buf, offset) body.append(entry) offset += entry.length if cls.cls_body_single_struct: return body[0] return body @classmethod def parser_stats(cls, datapath, version, msg_type, msg_len, xid, buf): msg = MsgBase.parser.__func__( cls, datapath, version, msg_type, msg_len, xid, buf) msg.body = msg.parser_stats_body(msg.buf, msg.msg_len, ofproto.OFP_MULTIPART_REPLY_SIZE) return msg @classmethod def parser(cls, datapath, version, msg_type, msg_len, xid, buf): type_, flags = struct.unpack_from( ofproto.OFP_MULTIPART_REPLY_PACK_STR, six.binary_type(buf), ofproto.OFP_HEADER_SIZE) stats_type_cls = cls._STATS_MSG_TYPES.get(type_) msg = super(OFPMultipartReply, stats_type_cls).parser( datapath, version, msg_type, msg_len, xid, buf) msg.type = type_ msg.flags = flags offset = ofproto.OFP_MULTIPART_REPLY_SIZE body = [] while offset < msg_len: b = stats_type_cls.cls_stats_body_cls.parser(msg.buf, offset) body.append(b) offset += b.length if hasattr(b, 'length') else b.len if stats_type_cls.cls_body_single_struct: msg.body = body[0] else: msg.body = body return msg class OFPDescStats(ofproto_parser.namedtuple('OFPDescStats', ( 'mfr_desc', 'hw_desc', 'sw_desc', 'serial_num', 'dp_desc'))): _TYPE = { 'ascii': [ 'mfr_desc', 'hw_desc', 'sw_desc', 'serial_num', 'dp_desc', ] } @classmethod def parser(cls, buf, offset): desc = struct.unpack_from(ofproto.OFP_DESC_PACK_STR, buf, offset) desc = list(desc) desc = [x.rstrip(b'\0') for x in desc] stats = cls(*desc) stats.length = ofproto.OFP_DESC_SIZE return stats @_set_stats_type(ofproto.OFPMP_DESC, OFPDescStats) @_set_msg_type(ofproto.OFPT_MULTIPART_REQUEST) class OFPDescStatsRequest(OFPMultipartRequest): def __init__(self, datapath, flags=0, type_=None): super(OFPDescStatsRequest, self).__init__(datapath, flags) @OFPMultipartReply.register_stats_type(body_single_struct=True) @_set_stats_type(ofproto.OFPMP_DESC, OFPDescStats) @_set_msg_type(ofproto.OFPT_MULTIPART_REPLY) class OFPDescStatsReply(OFPMultipartReply): def __init__(self, datapath, type_=None, **kwargs): super(OFPDescStatsReply, self).__init__(datapath, **kwargs) class OFPTableFeaturesStats(StringifyMixin): _TYPE = { 'utf-8': [ # OF spec is unclear about the encoding of name. # we assumes UTF-8. 'name', ] } def __init__(self, table_id=None, name=None, metadata_match=None, metadata_write=None, config=None, max_entries=None, properties=None, length=None): super(OFPTableFeaturesStats, self).__init__() self.length = None self.table_id = table_id self.name = name self.metadata_match = metadata_match self.metadata_write = metadata_write self.config = config self.max_entries = max_entries self.properties = properties @classmethod def parser(cls, buf, offset): table_features = cls() (table_features.length, table_features.table_id, name, table_features.metadata_match, table_features.metadata_write, table_features.config, table_features.max_entries ) = struct.unpack_from(ofproto.OFP_TABLE_FEATURES_PACK_STR, buf, offset) table_features.name = name.rstrip(b'\0') props = [] rest = buf[offset + ofproto.OFP_TABLE_FEATURES_SIZE: offset + table_features.length] while rest: p, rest = OFPTableFeatureProp.parse(rest) props.append(p) table_features.properties = props return table_features def serialize(self): # fixup bin_props = bytearray() for p in self.properties: bin_props += p.serialize() self.length = ofproto.OFP_TABLE_FEATURES_SIZE + len(bin_props) buf = bytearray() msg_pack_into(ofproto.OFP_TABLE_FEATURES_PACK_STR, buf, 0, self.length, self.table_id, self.name, self.metadata_match, self.metadata_write, self.config, self.max_entries) return buf + bin_props class OFPTableFeatureProp(OFPPropBase): _TYPES = {} class OFPInstructionId(StringifyMixin): _PACK_STR = '!HH' # type, len def __init__(self, type_, len_=None): self.type = type_ self.len = len_ # XXX experimenter @classmethod def parse(cls, buf): (type_, len_,) = struct.unpack_from(cls._PACK_STR, six.binary_type(buf), 0) rest = buf[len_:] return cls(type_=type_, len_=len_), rest def serialize(self): # fixup self.len = struct.calcsize(self._PACK_STR) buf = bytearray() msg_pack_into(self._PACK_STR, buf, 0, self.type, self.len) return buf @OFPTableFeatureProp.register_type(ofproto.OFPTFPT_INSTRUCTIONS) @OFPTableFeatureProp.register_type(ofproto.OFPTFPT_INSTRUCTIONS_MISS) class OFPTableFeaturePropInstructions(OFPTableFeatureProp): def __init__(self, type_=None, length=None, instruction_ids=None): instruction_ids = instruction_ids if instruction_ids else [] super(OFPTableFeaturePropInstructions, self).__init__(type_, length) self.instruction_ids = instruction_ids @classmethod def parser(cls, buf): rest = cls.get_rest(buf) ids = [] while rest: i, rest = OFPInstructionId.parse(rest) ids.append(i) return cls(instruction_ids=ids) def serialize_body(self): bin_ids = bytearray() for i in self.instruction_ids: bin_ids += i.serialize() return bin_ids # Implementation note: While OpenFlow 1.3.2 shares the same ofp_action_header # for flow_mod and table_features, we have separate classes. We named this # class to match with OpenFlow 1.4's name. (ofp_action_id) class OFPActionId(StringifyMixin): _PACK_STR = '!HH' def __init__(self, type_, len_=None): self.type = type_ self.len = len_ @classmethod def parse(cls, buf): (type_, len_,) = struct.unpack_from(cls._PACK_STR, six.binary_type(buf), 0) rest = buf[len_:] return cls(type_=type_, len_=len_), rest def serialize(self): self.len = struct.calcsize(self._PACK_STR) buf = bytearray() msg_pack_into(self._PACK_STR, buf, 0, self.type, self.len) return buf @OFPTableFeatureProp.register_type(ofproto.OFPTFPT_WRITE_ACTIONS) @OFPTableFeatureProp.register_type(ofproto.OFPTFPT_WRITE_ACTIONS_MISS) @OFPTableFeatureProp.register_type(ofproto.OFPTFPT_APPLY_ACTIONS) @OFPTableFeatureProp.register_type(ofproto.OFPTFPT_APPLY_ACTIONS_MISS) class OFPTableFeaturePropActions(OFPTableFeatureProp): def __init__(self, type_=None, length=None, action_ids=None): action_ids = action_ids if action_ids else [] super(OFPTableFeaturePropActions, self).__init__(type_, length) self.action_ids = action_ids @classmethod def parser(cls, buf): rest = cls.get_rest(buf) ids = [] while rest: i, rest = OFPActionId.parse(rest) ids.append(i) return cls(action_ids=ids) def serialize_body(self): bin_ids = bytearray() for i in self.action_ids: bin_ids += i.serialize() return bin_ids @OFPTableFeatureProp.register_type(ofproto.OFPTFPT_NEXT_TABLES) @OFPTableFeatureProp.register_type(ofproto.OFPTFPT_NEXT_TABLES_MISS) @OFPTableFeatureProp.register_type(ofproto.OFPTFPT_TABLE_SYNC_FROM) class OFPTableFeaturePropNextTables(OFPTableFeatureProp): _TABLE_ID_PACK_STR = '!B' def __init__(self, type_=None, length=None, table_ids=None): table_ids = table_ids if table_ids else [] super(OFPTableFeaturePropNextTables, self).__init__(type_, length) self.table_ids = table_ids @classmethod def parser(cls, buf): rest = cls.get_rest(buf) ids = [] while rest: (i,) = struct.unpack_from(cls._TABLE_ID_PACK_STR, six.binary_type(rest), 0) rest = rest[struct.calcsize(cls._TABLE_ID_PACK_STR):] ids.append(i) return cls(table_ids=ids) def serialize_body(self): bin_ids = bytearray() for i in self.table_ids: bin_id = bytearray() msg_pack_into(self._TABLE_ID_PACK_STR, bin_id, 0, i) bin_ids += bin_id return bin_ids # though. # ofsoftswitch13 # oxm_hasmask always 0 # oxm_length same as ofp_match etc (as without mask) # linc/of_protocol # oxm_hasmask always 0 # oxm_length always 0 # ovs: # seems in flux as of writing this [20141003] class OFPOxmId(StringifyMixin): _PACK_STR = '!I' # oxm header _EXPERIMENTER_ID_PACK_STR = '!I' _TYPE = { 'ascii': [ 'type', ], } def __init__(self, type_, hasmask=False, length=None): self.type = type_ self.hasmask = hasmask self.length = length @classmethod def parse(cls, buf): (oxm,) = struct.unpack_from(cls._PACK_STR, six.binary_type(buf), 0) # oxm (32 bit) == class (16) | field (7) | hasmask (1) | length (8) # in case of experimenter OXMs, another 32 bit value # (experimenter id) follows. (type_, _v) = ofproto.oxm_to_user(oxm >> (1 + 8), None, None) rest = buf[struct.calcsize(cls._PACK_STR):] hasmask = ofproto.oxm_tlv_header_extract_hasmask(oxm) length = oxm & 0xff # XXX see the comment on OFPOxmId class_ = oxm >> (7 + 1 + 8) if class_ == ofproto.OFPXMC_EXPERIMENTER: (exp_id,) = struct.unpack_from(cls._EXPERIMENTER_ID_PACK_STR, six.binary_type(rest), 0) rest = rest[struct.calcsize(cls._EXPERIMENTER_ID_PACK_STR):] subcls = OFPExperimenterOxmId return subcls(type_=type_, exp_id=exp_id, hasmask=hasmask, length=length), rest else: return cls(type_=type_, hasmask=hasmask, length=length), rest def serialize(self): # fixup self.length = 0 # XXX see the comment on OFPOxmId (n, _v, _m) = ofproto.oxm_from_user(self.type, None) oxm = (n << (1 + 8)) | (self.hasmask << 8) | self.length buf = bytearray() msg_pack_into(self._PACK_STR, buf, 0, oxm) assert n >> 7 != ofproto.OFPXMC_EXPERIMENTER return buf class OFPExperimenterOxmId(OFPOxmId): def __init__(self, type_, exp_id, hasmask=False, length=None): super(OFPExperimenterOxmId, self).__init__(type_=type_, hasmask=hasmask, length=length) self.exp_id = exp_id def serialize(self): buf = super(OFPExperimenterOxmId, self).serialize() msg_pack_into(self._EXPERIMENTER_ID_PACK_STR, buf, struct.calcsize(self._PACK_STR), self.exp_id) @OFPTableFeatureProp.register_type(ofproto.OFPTFPT_MATCH) @OFPTableFeatureProp.register_type(ofproto.OFPTFPT_WILDCARDS) @OFPTableFeatureProp.register_type(ofproto.OFPTFPT_WRITE_SETFIELD) @OFPTableFeatureProp.register_type(ofproto.OFPTFPT_WRITE_SETFIELD_MISS) @OFPTableFeatureProp.register_type(ofproto.OFPTFPT_APPLY_SETFIELD) @OFPTableFeatureProp.register_type(ofproto.OFPTFPT_APPLY_SETFIELD_MISS) class OFPTableFeaturePropOxm(OFPTableFeatureProp): def __init__(self, type_=None, length=None, oxm_ids=None): oxm_ids = oxm_ids if oxm_ids else [] super(OFPTableFeaturePropOxm, self).__init__(type_, length) self.oxm_ids = oxm_ids @classmethod def parser(cls, buf): rest = cls.get_rest(buf) ids = [] while rest: i, rest = OFPOxmId.parse(rest) ids.append(i) return cls(oxm_ids=ids) def serialize_body(self): bin_ids = bytearray() for i in self.oxm_ids: bin_ids += i.serialize() return bin_ids @OFPTableFeatureProp.register_type(ofproto.OFPTFPT_EXPERIMENTER) @OFPTableFeatureProp.register_type(ofproto.OFPTFPT_EXPERIMENTER_MISS) class OFPTableFeaturePropExperimenter(OFPPropCommonExperimenter4ByteData): pass @_set_stats_type(ofproto.OFPMP_TABLE_FEATURES, OFPTableFeaturesStats) @_set_msg_type(ofproto.OFPT_MULTIPART_REQUEST) class OFPTableFeaturesStatsRequest(OFPMultipartRequest): def __init__(self, datapath, flags=0, body=None, type_=None): body = body if body else [] super(OFPTableFeaturesStatsRequest, self).__init__(datapath, flags) self.body = body def _serialize_stats_body(self): bin_body = bytearray() for p in self.body: bin_body += p.serialize() self.buf += bin_body @OFPMultipartReply.register_stats_type() @_set_stats_type(ofproto.OFPMP_TABLE_FEATURES, OFPTableFeaturesStats) @_set_msg_type(ofproto.OFPT_MULTIPART_REPLY) class OFPTableFeaturesStatsReply(OFPMultipartReply): def __init__(self, datapath, type_=None, **kwargs): super(OFPTableFeaturesStatsReply, self).__init__(datapath, **kwargs) @_set_stats_type(ofproto.OFPMP_PORT_DESC, OFPPort) @_set_msg_type(ofproto.OFPT_MULTIPART_REQUEST) class OFPPortDescStatsRequest(OFPMultipartRequest): def __init__(self, datapath, flags=0, type_=None): super(OFPPortDescStatsRequest, self).__init__(datapath, flags) @OFPMultipartReply.register_stats_type() @_set_stats_type(ofproto.OFPMP_PORT_DESC, OFPPort) @_set_msg_type(ofproto.OFPT_MULTIPART_REPLY) class OFPPortDescStatsReply(OFPMultipartReply): def __init__(self, datapath, type_=None, **kwargs): super(OFPPortDescStatsReply, self).__init__(datapath, **kwargs) @_set_stats_type(ofproto.OFPMP_TABLE_DESC, OFPTableDesc) @_set_msg_type(ofproto.OFPT_MULTIPART_REQUEST) class OFPTableDescStatsRequest(OFPMultipartRequest): def __init__(self, datapath, flags=0, type_=None): super(OFPTableDescStatsRequest, self).__init__(datapath, flags) @OFPMultipartReply.register_stats_type() @_set_stats_type(ofproto.OFPMP_TABLE_DESC, OFPTableDesc) @_set_msg_type(ofproto.OFPT_MULTIPART_REPLY) class OFPTableDescStatsReply(OFPMultipartReply): def __init__(self, datapath, type_=None, **kwargs): super(OFPTableDescStatsReply, self).__init__(datapath, **kwargs) @_set_stats_type(ofproto.OFPMP_QUEUE_DESC, OFPQueueDesc) @_set_msg_type(ofproto.OFPT_MULTIPART_REQUEST) class OFPQueueDescStatsRequest(OFPMultipartRequest): def __init__(self, datapath, flags=0, port_no=ofproto.OFPP_ANY, queue_id=ofproto.OFPQ_ALL, type_=None): super(OFPQueueDescStatsRequest, self).__init__(datapath, flags) self.port_no = port_no self.queue_id = queue_id def _serialize_stats_body(self): msg_pack_into(ofproto.OFP_QUEUE_DESC_REQUEST_PACK_STR, self.buf, ofproto.OFP_MULTIPART_REQUEST_SIZE, self.port_no, self.queue_id) @OFPMultipartReply.register_stats_type() @_set_stats_type(ofproto.OFPMP_QUEUE_DESC, OFPQueueDesc) @_set_msg_type(ofproto.OFPT_MULTIPART_REPLY) class OFPQueueDescStatsReply(OFPMultipartReply): def __init__(self, datapath, type_=None, **kwargs): super(OFPQueueDescStatsReply, self).__init__(datapath, **kwargs) class OFPQueueStatsProp(OFPPropBase): _TYPES = {} @OFPQueueStatsProp.register_type(ofproto.OFPQSPT_EXPERIMENTER) class OFPQueueStatsPropExperimenter(OFPPropCommonExperimenter4ByteData): pass class OFPQueueStats(StringifyMixin): def __init__(self, length=None, port_no=None, queue_id=None, tx_bytes=None, tx_packets=None, tx_errors=None, duration_sec=None, duration_nsec=None, properties=None): super(OFPQueueStats, self).__init__() self.length = length self.port_no = port_no self.queue_id = queue_id self.tx_bytes = tx_bytes self.tx_packets = tx_packets self.tx_errors = tx_errors self.duration_sec = duration_sec self.duration_nsec = duration_nsec self.properties = properties @classmethod def parser(cls, buf, offset): (length, port_no, queue_id, tx_bytes, tx_packets, tx_errors, duration_sec, duration_nsec) = struct.unpack_from( ofproto.OFP_QUEUE_STATS_PACK_STR, buf, offset) props = [] rest = buf[offset + ofproto.OFP_QUEUE_STATS_SIZE:offset + length] while rest: p, rest = OFPQueueStatsProp.parse(rest) props.append(p) stats = cls(length, port_no, queue_id, tx_bytes, tx_packets, tx_errors, duration_sec, duration_nsec, props) return stats @_set_stats_type(ofproto.OFPMP_QUEUE_STATS, OFPQueueStats) @_set_msg_type(ofproto.OFPT_MULTIPART_REQUEST) class OFPQueueStatsRequest(OFPMultipartRequest): def __init__(self, datapath, flags=0, port_no=ofproto.OFPP_ANY, queue_id=ofproto.OFPQ_ALL, type_=None): super(OFPQueueStatsRequest, self).__init__(datapath, flags) self.port_no = port_no self.queue_id = queue_id def _serialize_stats_body(self): msg_pack_into(ofproto.OFP_QUEUE_STATS_REQUEST_PACK_STR, self.buf, ofproto.OFP_MULTIPART_REQUEST_SIZE, self.port_no, self.queue_id) @OFPMultipartReply.register_stats_type() @_set_stats_type(ofproto.OFPMP_QUEUE_STATS, OFPQueueStats) @_set_msg_type(ofproto.OFPT_MULTIPART_REPLY) class OFPQueueStatsReply(OFPMultipartReply): def __init__(self, datapath, type_=None, **kwargs): super(OFPQueueStatsReply, self).__init__(datapath, **kwargs) class OFPBucketCounter(StringifyMixin): def __init__(self, packet_count, byte_count): super(OFPBucketCounter, self).__init__() self.packet_count = packet_count self.byte_count = byte_count @classmethod def parser(cls, buf, offset): packet_count, byte_count = struct.unpack_from( ofproto.OFP_BUCKET_COUNTER_PACK_STR, buf, offset) return cls(packet_count, byte_count) class OFPGroupStats(StringifyMixin): def __init__(self, length=None, group_id=None, ref_count=None, packet_count=None, byte_count=None, duration_sec=None, duration_nsec=None, bucket_stats=None): super(OFPGroupStats, self).__init__() self.length = length self.group_id = group_id self.ref_count = ref_count self.packet_count = packet_count self.byte_count = byte_count self.duration_sec = duration_sec self.duration_nsec = duration_nsec self.bucket_stats = bucket_stats @classmethod def parser(cls, buf, offset): group = struct.unpack_from(ofproto.OFP_GROUP_STATS_PACK_STR, buf, offset) group_stats = cls(*group) group_stats.bucket_stats = [] total_len = group_stats.length + offset offset += ofproto.OFP_GROUP_STATS_SIZE while total_len > offset: b = OFPBucketCounter.parser(buf, offset) group_stats.bucket_stats.append(b) offset += ofproto.OFP_BUCKET_COUNTER_SIZE return group_stats @_set_stats_type(ofproto.OFPMP_GROUP, OFPGroupStats) @_set_msg_type(ofproto.OFPT_MULTIPART_REQUEST) class OFPGroupStatsRequest(OFPMultipartRequest): def __init__(self, datapath, flags=0, group_id=ofproto.OFPG_ALL, type_=None): super(OFPGroupStatsRequest, self).__init__(datapath, flags) self.group_id = group_id def _serialize_stats_body(self): msg_pack_into(ofproto.OFP_GROUP_STATS_REQUEST_PACK_STR, self.buf, ofproto.OFP_MULTIPART_REQUEST_SIZE, self.group_id) @OFPMultipartReply.register_stats_type() @_set_stats_type(ofproto.OFPMP_GROUP, OFPGroupStats) @_set_msg_type(ofproto.OFPT_MULTIPART_REPLY) class OFPGroupStatsReply(OFPMultipartReply): def __init__(self, datapath, type_=None, **kwargs): super(OFPGroupStatsReply, self).__init__(datapath, **kwargs) class OFPGroupDescStats(StringifyMixin): def __init__(self, type_=None, group_id=None, buckets=None, length=None): super(OFPGroupDescStats, self).__init__() self.type = type_ self.group_id = group_id self.buckets = buckets @classmethod def parser(cls, buf, offset): stats = cls() (stats.length, stats.type, stats.group_id) = struct.unpack_from( ofproto.OFP_GROUP_DESC_STATS_PACK_STR, buf, offset) offset += ofproto.OFP_GROUP_DESC_STATS_SIZE stats.buckets = [] length = ofproto.OFP_GROUP_DESC_STATS_SIZE while length < stats.length: bucket = OFPBucket.parser(buf, offset) stats.buckets.append(bucket) offset += bucket.len length += bucket.len return stats @_set_stats_type(ofproto.OFPMP_GROUP_DESC, OFPGroupDescStats) @_set_msg_type(ofproto.OFPT_MULTIPART_REQUEST) class OFPGroupDescStatsRequest(OFPMultipartRequest): def __init__(self, datapath, flags=0, type_=None): super(OFPGroupDescStatsRequest, self).__init__(datapath, flags) @OFPMultipartReply.register_stats_type() @_set_stats_type(ofproto.OFPMP_GROUP_DESC, OFPGroupDescStats) @_set_msg_type(ofproto.OFPT_MULTIPART_REPLY) class OFPGroupDescStatsReply(OFPMultipartReply): def __init__(self, datapath, type_=None, **kwargs): super(OFPGroupDescStatsReply, self).__init__(datapath, **kwargs) class OFPGroupFeaturesStats(ofproto_parser.namedtuple('OFPGroupFeaturesStats', ('types', 'capabilities', 'max_groups', 'actions'))): @classmethod def parser(cls, buf, offset): group_features = struct.unpack_from( ofproto.OFP_GROUP_FEATURES_PACK_STR, buf, offset) types = group_features[0] capabilities = group_features[1] max_groups = list(group_features[2:6]) actions = list(group_features[6:10]) stats = cls(types, capabilities, max_groups, actions) stats.length = ofproto.OFP_GROUP_FEATURES_SIZE return stats @_set_stats_type(ofproto.OFPMP_GROUP_FEATURES, OFPGroupFeaturesStats) @_set_msg_type(ofproto.OFPT_MULTIPART_REQUEST) class OFPGroupFeaturesStatsRequest(OFPMultipartRequest): def __init__(self, datapath, flags=0, type_=None): super(OFPGroupFeaturesStatsRequest, self).__init__(datapath, flags) @OFPMultipartReply.register_stats_type(body_single_struct=True) @_set_stats_type(ofproto.OFPMP_GROUP_FEATURES, OFPGroupFeaturesStats) @_set_msg_type(ofproto.OFPT_MULTIPART_REPLY) class OFPGroupFeaturesStatsReply(OFPMultipartReply): def __init__(self, datapath, type_=None, **kwargs): super(OFPGroupFeaturesStatsReply, self).__init__(datapath, **kwargs) class OFPMeterBandStats(StringifyMixin): def __init__(self, packet_band_count, byte_band_count): super(OFPMeterBandStats, self).__init__() self.packet_band_count = packet_band_count self.byte_band_count = byte_band_count @classmethod def parser(cls, buf, offset): band_stats = struct.unpack_from( ofproto.OFP_METER_BAND_STATS_PACK_STR, buf, offset) return cls(*band_stats) class OFPMeterStats(StringifyMixin): def __init__(self, meter_id=None, flow_count=None, packet_in_count=None, byte_in_count=None, duration_sec=None, duration_nsec=None, band_stats=None, len_=None): super(OFPMeterStats, self).__init__() self.meter_id = meter_id self.len = 0 self.flow_count = flow_count self.packet_in_count = packet_in_count self.byte_in_count = byte_in_count self.duration_sec = duration_sec self.duration_nsec = duration_nsec self.band_stats = band_stats @classmethod def parser(cls, buf, offset): meter_stats = cls() (meter_stats.meter_id, meter_stats.len, meter_stats.flow_count, meter_stats.packet_in_count, meter_stats.byte_in_count, meter_stats.duration_sec, meter_stats.duration_nsec) = struct.unpack_from( ofproto.OFP_METER_STATS_PACK_STR, buf, offset) offset += ofproto.OFP_METER_STATS_SIZE meter_stats.band_stats = [] length = ofproto.OFP_METER_STATS_SIZE while length < meter_stats.len: band_stats = OFPMeterBandStats.parser(buf, offset) meter_stats.band_stats.append(band_stats) offset += ofproto.OFP_METER_BAND_STATS_SIZE length += ofproto.OFP_METER_BAND_STATS_SIZE return meter_stats @_set_stats_type(ofproto.OFPMP_METER, OFPMeterStats) @_set_msg_type(ofproto.OFPT_MULTIPART_REQUEST) class OFPMeterStatsRequest(OFPMultipartRequest): def __init__(self, datapath, flags=0, meter_id=ofproto.OFPM_ALL, type_=None): super(OFPMeterStatsRequest, self).__init__(datapath, flags) self.meter_id = meter_id def _serialize_stats_body(self): msg_pack_into(ofproto.OFP_METER_MULTIPART_REQUEST_PACK_STR, self.buf, ofproto.OFP_MULTIPART_REQUEST_SIZE, self.meter_id) @OFPMultipartReply.register_stats_type() @_set_stats_type(ofproto.OFPMP_METER, OFPMeterStats) @_set_msg_type(ofproto.OFPT_MULTIPART_REPLY) class OFPMeterStatsReply(OFPMultipartReply): def __init__(self, datapath, type_=None, **kwargs): super(OFPMeterStatsReply, self).__init__(datapath, **kwargs) class OFPMeterBand(StringifyMixin): def __init__(self, type_, len_): super(OFPMeterBand, self).__init__() self.type = type_ self.len = len_ class OFPMeterBandHeader(OFPMeterBand): _METER_BAND = {} @staticmethod def register_meter_band_type(type_, len_): def _register_meter_band_type(cls): OFPMeterBandHeader._METER_BAND[type_] = cls cls.cls_meter_band_type = type_ cls.cls_meter_band_len = len_ return cls return _register_meter_band_type def __init__(self): cls = self.__class__ super(OFPMeterBandHeader, self).__init__(cls.cls_meter_band_type, cls.cls_meter_band_len) @classmethod def parser(cls, buf, offset): type_, len_, _rate, _burst_size = struct.unpack_from( ofproto.OFP_METER_BAND_HEADER_PACK_STR, buf, offset) cls_ = cls._METER_BAND[type_] assert cls_.cls_meter_band_len == len_ return cls_.parser(buf, offset) @OFPMeterBandHeader.register_meter_band_type( ofproto.OFPMBT_DROP, ofproto.OFP_METER_BAND_DROP_SIZE) class OFPMeterBandDrop(OFPMeterBandHeader): def __init__(self, rate=0, burst_size=0, type_=None, len_=None): super(OFPMeterBandDrop, self).__init__() self.rate = rate self.burst_size = burst_size def serialize(self, buf, offset): msg_pack_into(ofproto.OFP_METER_BAND_DROP_PACK_STR, buf, offset, self.type, self.len, self.rate, self.burst_size) @classmethod def parser(cls, buf, offset): type_, len_, rate, burst_size = struct.unpack_from( ofproto.OFP_METER_BAND_DROP_PACK_STR, buf, offset) assert cls.cls_meter_band_type == type_ assert cls.cls_meter_band_len == len_ return cls(rate, burst_size) @OFPMeterBandHeader.register_meter_band_type( ofproto.OFPMBT_DSCP_REMARK, ofproto.OFP_METER_BAND_DSCP_REMARK_SIZE) class OFPMeterBandDscpRemark(OFPMeterBandHeader): def __init__(self, rate=0, burst_size=0, prec_level=0, type_=None, len_=None): super(OFPMeterBandDscpRemark, self).__init__() self.rate = rate self.burst_size = burst_size self.prec_level = prec_level def serialize(self, buf, offset): msg_pack_into(ofproto.OFP_METER_BAND_DSCP_REMARK_PACK_STR, buf, offset, self.type, self.len, self.rate, self.burst_size, self.prec_level) @classmethod def parser(cls, buf, offset): type_, len_, rate, burst_size, prec_level = struct.unpack_from( ofproto.OFP_METER_BAND_DSCP_REMARK_PACK_STR, buf, offset) assert cls.cls_meter_band_type == type_ assert cls.cls_meter_band_len == len_ return cls(rate, burst_size, prec_level) @OFPMeterBandHeader.register_meter_band_type( ofproto.OFPMBT_EXPERIMENTER, ofproto.OFP_METER_BAND_EXPERIMENTER_SIZE) class OFPMeterBandExperimenter(OFPMeterBandHeader): def __init__(self, rate=0, burst_size=0, experimenter=None, type_=None, len_=None): super(OFPMeterBandExperimenter, self).__init__() self.rate = rate self.burst_size = burst_size self.experimenter = experimenter def serialize(self, buf, offset): msg_pack_into(ofproto.OFP_METER_BAND_EXPERIMENTER_PACK_STR, buf, offset, self.type, self.len, self.rate, self.burst_size, self.experimenter) @classmethod def parser(cls, buf, offset): type_, len_, rate, burst_size, experimenter = struct.unpack_from( ofproto.OFP_METER_BAND_EXPERIMENTER_PACK_STR, buf, offset) assert cls.cls_meter_band_type == type_ assert cls.cls_meter_band_len == len_ return cls(rate, burst_size, experimenter) class OFPMeterConfigStats(StringifyMixin): def __init__(self, flags=None, meter_id=None, bands=None, length=None): super(OFPMeterConfigStats, self).__init__() self.length = None self.flags = flags self.meter_id = meter_id self.bands = bands @classmethod def parser(cls, buf, offset): meter_config = cls() (meter_config.length, meter_config.flags, meter_config.meter_id) = struct.unpack_from( ofproto.OFP_METER_CONFIG_PACK_STR, buf, offset) offset += ofproto.OFP_METER_CONFIG_SIZE meter_config.bands = [] length = ofproto.OFP_METER_CONFIG_SIZE while length < meter_config.length: band = OFPMeterBandHeader.parser(buf, offset) meter_config.bands.append(band) offset += band.len length += band.len return meter_config @_set_stats_type(ofproto.OFPMP_METER_CONFIG, OFPMeterConfigStats) @_set_msg_type(ofproto.OFPT_MULTIPART_REQUEST) class OFPMeterConfigStatsRequest(OFPMultipartRequest): def __init__(self, datapath, flags=0, meter_id=ofproto.OFPM_ALL, type_=None): super(OFPMeterConfigStatsRequest, self).__init__(datapath, flags) self.meter_id = meter_id def _serialize_stats_body(self): msg_pack_into(ofproto.OFP_METER_MULTIPART_REQUEST_PACK_STR, self.buf, ofproto.OFP_MULTIPART_REQUEST_SIZE, self.meter_id) @OFPMultipartReply.register_stats_type() @_set_stats_type(ofproto.OFPMP_METER_CONFIG, OFPMeterConfigStats) @_set_msg_type(ofproto.OFPT_MULTIPART_REPLY) class OFPMeterConfigStatsReply(OFPMultipartReply): def __init__(self, datapath, type_=None, **kwargs): super(OFPMeterConfigStatsReply, self).__init__(datapath, **kwargs) class OFPMeterFeaturesStats(ofproto_parser.namedtuple('OFPMeterFeaturesStats', ('max_meter', 'band_types', 'capabilities', 'max_bands', 'max_color'))): @classmethod def parser(cls, buf, offset): meter_features = struct.unpack_from( ofproto.OFP_METER_FEATURES_PACK_STR, buf, offset) stats = cls(*meter_features) stats.length = ofproto.OFP_METER_FEATURES_SIZE return stats @_set_stats_type(ofproto.OFPMP_METER_FEATURES, OFPMeterFeaturesStats) @_set_msg_type(ofproto.OFPT_MULTIPART_REQUEST) class OFPMeterFeaturesStatsRequest(OFPMultipartRequest): def __init__(self, datapath, flags=0, type_=None): super(OFPMeterFeaturesStatsRequest, self).__init__(datapath, flags) @OFPMultipartReply.register_stats_type() @_set_stats_type(ofproto.OFPMP_METER_FEATURES, OFPMeterFeaturesStats) @_set_msg_type(ofproto.OFPT_MULTIPART_REPLY) class OFPMeterFeaturesStatsReply(OFPMultipartReply): def __init__(self, datapath, type_=None, **kwargs): super(OFPMeterFeaturesStatsReply, self).__init__(datapath, **kwargs) class OFPFlowUpdate(StringifyMixin): def __init__(self, length, event): super(OFPFlowUpdate, self).__init__() self.length = length self.event = event class OFPFlowUpdateHeader(OFPFlowUpdate): _EVENT = {} @staticmethod def register_flow_update_event(event, length): def _register_flow_update_event(cls): OFPFlowUpdateHeader._EVENT[event] = cls cls.cls_flow_update_event = event cls.cls_flow_update_length = length return cls return _register_flow_update_event def __init__(self, length=None, event=None): cls = self.__class__ super(OFPFlowUpdateHeader, self).__init__(length, cls.cls_flow_update_event) self.length = length @classmethod def parser(cls, buf, offset): length, event = struct.unpack_from( ofproto.OFP_FLOW_UPDATE_HEADER_PACK_STR, buf, offset) cls_ = cls._EVENT[event] return cls_.parser(buf, offset) @OFPFlowUpdateHeader.register_flow_update_event( ofproto.OFPFME_INITIAL, ofproto.OFP_FLOW_UPDATE_FULL_SIZE) @OFPFlowUpdateHeader.register_flow_update_event( ofproto.OFPFME_ADDED, ofproto.OFP_FLOW_UPDATE_FULL_SIZE) @OFPFlowUpdateHeader.register_flow_update_event( ofproto.OFPFME_REMOVED, ofproto.OFP_FLOW_UPDATE_FULL_SIZE) @OFPFlowUpdateHeader.register_flow_update_event( ofproto.OFPFME_MODIFIED, ofproto.OFP_FLOW_UPDATE_FULL_SIZE) class OFPFlowUpdateFull(OFPFlowUpdateHeader): def __init__(self, length=None, event=None, table_id=None, reason=None, idle_timeout=None, hard_timeout=None, priority=None, cookie=None, match=None, instructions=None): instructions = instructions if instructions else [] super(OFPFlowUpdateFull, self).__init__(length, event) self.table_id = table_id self.reason = reason self.idle_timeout = idle_timeout self.hard_timeout = hard_timeout self.priority = priority self.cookie = cookie self.match = match assert (event != ofproto.OFPFME_REMOVED or len(instructions) == 0) for i in instructions: assert isinstance(i, OFPInstruction) self.instructions = instructions @classmethod def parser(cls, buf, offset): (length, event, table_id, reason, idle_timeout, hard_timeout, priority, cookie) = struct.unpack_from(ofproto.OFP_FLOW_UPDATE_FULL_0_PACK_STR, buf, offset) offset += ofproto.OFP_FLOW_UPDATE_FULL_0_SIZE assert cls.cls_flow_update_length <= length assert cls.cls_flow_update_event == event match = OFPMatch.parser(buf, offset) match_length = utils.round_up(match.length, 8) offset += match_length inst_length = (length - ofproto.OFP_FLOW_UPDATE_FULL_0_SIZE - match_length) instructions = [] while inst_length > 0: inst = OFPInstruction.parser(buf, offset) instructions.append(inst) offset += inst.len inst_length -= inst.len return cls(length, event, table_id, reason, idle_timeout, hard_timeout, priority, cookie, match, instructions) @OFPFlowUpdateHeader.register_flow_update_event( ofproto.OFPFME_ABBREV, ofproto.OFP_FLOW_UPDATE_ABBREV_SIZE) class OFPFlowUpdateAbbrev(OFPFlowUpdateHeader): def __init__(self, length=None, event=None, xid=None): super(OFPFlowUpdateAbbrev, self).__init__(length, event) self.xid = xid @classmethod def parser(cls, buf, offset): length, event, xid = struct.unpack_from( ofproto.OFP_FLOW_UPDATE_ABBREV_PACK_STR, buf, offset) assert cls.cls_flow_update_length == length assert cls.cls_flow_update_event == event return cls(length, event, xid) @OFPFlowUpdateHeader.register_flow_update_event( ofproto.OFPFME_PAUSED, ofproto.OFP_FLOW_UPDATE_PAUSED_SIZE) @OFPFlowUpdateHeader.register_flow_update_event( ofproto.OFPFME_RESUMED, ofproto.OFP_FLOW_UPDATE_PAUSED_SIZE) class OFPFlowUpdatePaused(OFPFlowUpdateHeader): @classmethod def parser(cls, buf, offset): length, event = struct.unpack_from( ofproto.OFP_FLOW_UPDATE_PAUSED_PACK_STR, buf, offset) assert cls.cls_flow_update_length == length assert cls.cls_flow_update_event == event return cls(length, event) class OFPFlowMonitorRequestBase(OFPMultipartRequest): def __init__(self, datapath, flags, monitor_id, out_port, out_group, monitor_flags, table_id, command, match): super(OFPFlowMonitorRequestBase, self).__init__(datapath, flags) self.monitor_id = monitor_id self.out_port = out_port self.out_group = out_group self.monitor_flags = monitor_flags self.table_id = table_id self.command = command self.match = match def _serialize_stats_body(self): offset = ofproto.OFP_MULTIPART_REQUEST_SIZE msg_pack_into(ofproto.OFP_FLOW_MONITOR_REQUEST_0_PACK_STR, self.buf, offset, self.monitor_id, self.out_port, self.out_group, self.monitor_flags, self.table_id, self.command) offset += ofproto.OFP_FLOW_MONITOR_REQUEST_0_SIZE self.match.serialize(self.buf, offset) @_set_stats_type(ofproto.OFPMP_FLOW_MONITOR, OFPFlowUpdateHeader) @_set_msg_type(ofproto.OFPT_MULTIPART_REQUEST) class OFPFlowMonitorRequest(OFPFlowMonitorRequestBase): def __init__(self, datapath, flags=0, monitor_id=0, out_port=ofproto.OFPP_ANY, out_group=ofproto.OFPG_ANY, monitor_flags=0, table_id=ofproto.OFPTT_ALL, command=ofproto.OFPFMC_ADD, match=None, type_=None): if match is None: match = OFPMatch() super(OFPFlowMonitorRequest, self).__init__(datapath, flags, monitor_id, out_port, out_group, monitor_flags, table_id, command, match) @OFPMultipartReply.register_stats_type() @_set_stats_type(ofproto.OFPMP_FLOW_MONITOR, OFPFlowUpdateHeader) @_set_msg_type(ofproto.OFPT_MULTIPART_REPLY) class OFPFlowMonitorReply(OFPMultipartReply): def __init__(self, datapath, type_=None, **kwargs): super(OFPFlowMonitorReply, self).__init__(datapath, **kwargs) class OFPExperimenterMultipart(ofproto_parser.namedtuple( 'OFPExperimenterMultipart', ('experimenter', 'exp_type', 'data'))): @classmethod def parser(cls, buf, offset): args = struct.unpack_from( ofproto.OFP_EXPERIMENTER_MULTIPART_HEADER_PACK_STR, buf, offset) args = list(args) args.append(buf[offset + ofproto.OFP_EXPERIMENTER_MULTIPART_HEADER_SIZE:]) stats = cls(*args) stats.length = ofproto.OFP_METER_FEATURES_SIZE return stats def serialize(self): buf = bytearray() msg_pack_into(ofproto.OFP_EXPERIMENTER_MULTIPART_HEADER_PACK_STR, buf, 0, self.experimenter, self.exp_type) return buf + self.data class OFPExperimenterStatsRequestBase(OFPMultipartRequest): def __init__(self, datapath, flags, experimenter, exp_type, type_=None): super(OFPExperimenterStatsRequestBase, self).__init__(datapath, flags) self.experimenter = experimenter self.exp_type = exp_type @_set_stats_type(ofproto.OFPMP_EXPERIMENTER, OFPExperimenterMultipart) @_set_msg_type(ofproto.OFPT_MULTIPART_REQUEST) class OFPExperimenterStatsRequest(OFPExperimenterStatsRequestBase): def __init__(self, datapath, flags, experimenter, exp_type, data, type_=None): super(OFPExperimenterStatsRequest, self).__init__(datapath, flags, experimenter, exp_type, type_) self.data = data def _serialize_stats_body(self): body = OFPExperimenterMultipart(experimenter=self.experimenter, exp_type=self.exp_type, data=self.data) self.buf += body.serialize() @OFPMultipartReply.register_stats_type(body_single_struct=True) @_set_stats_type(ofproto.OFPMP_EXPERIMENTER, OFPExperimenterMultipart) @_set_msg_type(ofproto.OFPT_MULTIPART_REPLY) class OFPExperimenterStatsReply(OFPMultipartReply): def __init__(self, datapath, type_=None, **kwargs): super(OFPExperimenterStatsReply, self).__init__(datapath, **kwargs) class OFPFlowStats(StringifyMixin): def __init__(self, table_id=None, duration_sec=None, duration_nsec=None, priority=None, idle_timeout=None, hard_timeout=None, flags=None, importance=None, cookie=None, packet_count=None, byte_count=None, match=None, instructions=None, length=None): super(OFPFlowStats, self).__init__() self.table_id = table_id self.duration_sec = duration_sec self.duration_nsec = duration_nsec self.priority = priority self.idle_timeout = idle_timeout self.hard_timeout = hard_timeout self.flags = flags self.importance = importance self.cookie = cookie self.packet_count = packet_count self.byte_count = byte_count self.match = match self.instructions = instructions self.length = length @classmethod def parser(cls, buf, offset): flow_stats = cls() (flow_stats.length, flow_stats.table_id, flow_stats.duration_sec, flow_stats.duration_nsec, flow_stats.priority, flow_stats.idle_timeout, flow_stats.hard_timeout, flow_stats.flags, flow_stats.importance, flow_stats.cookie, flow_stats.packet_count, flow_stats.byte_count) = struct.unpack_from( ofproto.OFP_FLOW_STATS_0_PACK_STR, buf, offset) offset += ofproto.OFP_FLOW_STATS_0_SIZE flow_stats.match = OFPMatch.parser(buf, offset) match_length = utils.round_up(flow_stats.match.length, 8) inst_length = (flow_stats.length - (ofproto.OFP_FLOW_STATS_SIZE - ofproto.OFP_MATCH_SIZE + match_length)) offset += match_length instructions = [] while inst_length > 0: inst = OFPInstruction.parser(buf, offset) instructions.append(inst) offset += inst.len inst_length -= inst.len flow_stats.instructions = instructions return flow_stats class OFPFlowStatsRequestBase(OFPMultipartRequest): def __init__(self, datapath, flags, table_id, out_port, out_group, cookie, cookie_mask, match): super(OFPFlowStatsRequestBase, self).__init__(datapath, flags) self.table_id = table_id self.out_port = out_port self.out_group = out_group self.cookie = cookie self.cookie_mask = cookie_mask self.match = match def _serialize_stats_body(self): offset = ofproto.OFP_MULTIPART_REQUEST_SIZE msg_pack_into(ofproto.OFP_FLOW_STATS_REQUEST_0_PACK_STR, self.buf, offset, self.table_id, self.out_port, self.out_group, self.cookie, self.cookie_mask) offset += ofproto.OFP_FLOW_STATS_REQUEST_0_SIZE self.match.serialize(self.buf, offset) @_set_stats_type(ofproto.OFPMP_FLOW, OFPFlowStats) @_set_msg_type(ofproto.OFPT_MULTIPART_REQUEST) class OFPFlowStatsRequest(OFPFlowStatsRequestBase): def __init__(self, datapath, flags=0, table_id=ofproto.OFPTT_ALL, out_port=ofproto.OFPP_ANY, out_group=ofproto.OFPG_ANY, cookie=0, cookie_mask=0, match=None, type_=None): if match is None: match = OFPMatch() super(OFPFlowStatsRequest, self).__init__(datapath, flags, table_id, out_port, out_group, cookie, cookie_mask, match) @OFPMultipartReply.register_stats_type() @_set_stats_type(ofproto.OFPMP_FLOW, OFPFlowStats) @_set_msg_type(ofproto.OFPT_MULTIPART_REPLY) class OFPFlowStatsReply(OFPMultipartReply): def __init__(self, datapath, type_=None, **kwargs): super(OFPFlowStatsReply, self).__init__(datapath, **kwargs) class OFPAggregateStats(ofproto_parser.namedtuple('OFPAggregateStats', ( 'packet_count', 'byte_count', 'flow_count'))): @classmethod def parser(cls, buf, offset): agg = struct.unpack_from( ofproto.OFP_AGGREGATE_STATS_REPLY_PACK_STR, buf, offset) stats = cls(*agg) stats.length = ofproto.OFP_AGGREGATE_STATS_REPLY_SIZE return stats @_set_stats_type(ofproto.OFPMP_AGGREGATE, OFPAggregateStats) @_set_msg_type(ofproto.OFPT_MULTIPART_REQUEST) class OFPAggregateStatsRequest(OFPFlowStatsRequestBase): def __init__(self, datapath, flags, table_id, out_port, out_group, cookie, cookie_mask, match, type_=None): super(OFPAggregateStatsRequest, self).__init__(datapath, flags, table_id, out_port, out_group, cookie, cookie_mask, match) @OFPMultipartReply.register_stats_type(body_single_struct=True) @_set_stats_type(ofproto.OFPMP_AGGREGATE, OFPAggregateStats) @_set_msg_type(ofproto.OFPT_MULTIPART_REPLY) class OFPAggregateStatsReply(OFPMultipartReply): def __init__(self, datapath, type_=None, **kwargs): super(OFPAggregateStatsReply, self).__init__(datapath, **kwargs) class OFPTableStats(ofproto_parser.namedtuple('OFPTableStats', ( 'table_id', 'active_count', 'lookup_count', 'matched_count'))): @classmethod def parser(cls, buf, offset): tbl = struct.unpack_from(ofproto.OFP_TABLE_STATS_PACK_STR, buf, offset) stats = cls(*tbl) stats.length = ofproto.OFP_TABLE_STATS_SIZE return stats @_set_stats_type(ofproto.OFPMP_TABLE, OFPTableStats) @_set_msg_type(ofproto.OFPT_MULTIPART_REQUEST) class OFPTableStatsRequest(OFPMultipartRequest): def __init__(self, datapath, flags, type_=None): super(OFPTableStatsRequest, self).__init__(datapath, flags) @OFPMultipartReply.register_stats_type() @_set_stats_type(ofproto.OFPMP_TABLE, OFPTableStats) @_set_msg_type(ofproto.OFPT_MULTIPART_REPLY) class OFPTableStatsReply(OFPMultipartReply): def __init__(self, datapath, type_=None, **kwargs): super(OFPTableStatsReply, self).__init__(datapath, **kwargs) class OFPPortStatsProp(OFPPropBase): _TYPES = {} @OFPPortStatsProp.register_type(ofproto.OFPPSPT_ETHERNET) class OFPPortStatsPropEthernet(OFPPortStatsProp): def __init__(self, type_=None, length=None, rx_frame_err=None, rx_over_err=None, rx_crc_err=None, collisions=None): self.type = type_ self.length = length self.rx_frame_err = rx_frame_err self.rx_over_err = rx_over_err self.rx_crc_err = rx_crc_err self.collisions = collisions @classmethod def parser(cls, buf): ether = cls() (ether.type, ether.length, ether.rx_frame_err, ether.rx_over_err, ether.rx_crc_err, ether.collisions) = struct.unpack_from( ofproto.OFP_PORT_STATS_PROP_ETHERNET_PACK_STR, buf, 0) return ether @OFPPortStatsProp.register_type(ofproto.OFPPSPT_OPTICAL) class OFPPortStatsPropOptical(OFPPortStatsProp): def __init__(self, type_=None, length=None, flags=None, tx_freq_lmda=None, tx_offset=None, tx_grid_span=None, rx_freq_lmda=None, rx_offset=None, rx_grid_span=None, tx_pwr=None, rx_pwr=None, bias_current=None, temperature=None): self.type = type_ self.length = length self.flags = flags self.tx_freq_lmda = tx_freq_lmda self.tx_offset = tx_offset self.tx_grid_span = tx_grid_span self.rx_freq_lmda = rx_freq_lmda self.rx_offset = rx_offset self.rx_grid_span = rx_grid_span self.tx_pwr = tx_pwr self.rx_pwr = rx_pwr self.bias_current = bias_current self.temperature = temperature @classmethod def parser(cls, buf): optical = cls() (optical.type, optical.length, optical.flags, optical.tx_freq_lmda, optical.tx_offset, optical.tx_grid_span, optical.rx_freq_lmda, optical.rx_offset, optical.rx_grid_span, optical.tx_pwr, optical.rx_pwr, optical.bias_current, optical.temperature) = struct.unpack_from( ofproto.OFP_PORT_STATS_PROP_OPTICAL_PACK_STR, buf, 0) return optical @OFPPortStatsProp.register_type(ofproto.OFPPSPT_EXPERIMENTER) class OFPPortStatsPropExperimenter(OFPPropCommonExperimenter4ByteData): pass class OFPPortStats(StringifyMixin): def __init__(self, length=None, port_no=None, duration_sec=None, duration_nsec=None, rx_packets=None, tx_packets=None, rx_bytes=None, tx_bytes=None, rx_dropped=None, tx_dropped=None, rx_errors=None, tx_errors=None, properties=None): super(OFPPortStats, self).__init__() self.length = length self.port_no = port_no self.duration_sec = duration_sec self.duration_nsec = duration_nsec self.rx_packets = rx_packets self.tx_packets = tx_packets self.rx_bytes = rx_bytes self.tx_bytes = tx_bytes self.rx_dropped = rx_dropped self.tx_dropped = tx_dropped self.rx_errors = rx_errors self.tx_errors = tx_errors self.properties = properties @classmethod def parser(cls, buf, offset): (length, port_no, duration_sec, duration_nsec, rx_packets, tx_packets, rx_bytes, tx_bytes, rx_dropped, tx_dropped, rx_errors, tx_errors) = struct.unpack_from( ofproto.OFP_PORT_STATS_PACK_STR, buf, offset) props = [] rest = buf[offset + ofproto.OFP_PORT_STATS_SIZE:offset + length] while rest: p, rest = OFPPortStatsProp.parse(rest) props.append(p) stats = cls(length, port_no, duration_sec, duration_nsec, rx_packets, tx_packets, rx_bytes, tx_bytes, rx_dropped, tx_dropped, rx_errors, tx_errors, props) return stats @_set_stats_type(ofproto.OFPMP_PORT_STATS, OFPPortStats) @_set_msg_type(ofproto.OFPT_MULTIPART_REQUEST) class OFPPortStatsRequest(OFPMultipartRequest): def __init__(self, datapath, flags, port_no, type_=None): super(OFPPortStatsRequest, self).__init__(datapath, flags) self.port_no = port_no def _serialize_stats_body(self): msg_pack_into(ofproto.OFP_PORT_STATS_REQUEST_PACK_STR, self.buf, ofproto.OFP_MULTIPART_REQUEST_SIZE, self.port_no) @OFPMultipartReply.register_stats_type() @_set_stats_type(ofproto.OFPMP_PORT_STATS, OFPPortStats) @_set_msg_type(ofproto.OFPT_MULTIPART_REPLY) class OFPPortStatsReply(OFPMultipartReply): def __init__(self, datapath, type_=None, **kwargs): super(OFPPortStatsReply, self).__init__(datapath, **kwargs) @_set_msg_type(ofproto.OFPT_BARRIER_REQUEST) class OFPBarrierRequest(MsgBase): def __init__(self, datapath): super(OFPBarrierRequest, self).__init__(datapath) @_register_parser @_set_msg_type(ofproto.OFPT_BARRIER_REPLY) class OFPBarrierReply(MsgBase): def __init__(self, datapath): super(OFPBarrierReply, self).__init__(datapath) @_register_parser @_set_msg_type(ofproto.OFPT_PORT_STATUS) class OFPPortStatus(MsgBase): def __init__(self, datapath, reason=None, desc=None): super(OFPPortStatus, self).__init__(datapath) self.reason = reason self.desc = desc @classmethod def parser(cls, datapath, version, msg_type, msg_len, xid, buf): msg = super(OFPPortStatus, cls).parser(datapath, version, msg_type, msg_len, xid, buf) msg.reason = struct.unpack_from( ofproto.OFP_PORT_STATUS_PACK_STR, msg.buf, ofproto.OFP_HEADER_SIZE)[0] msg.desc = OFPPort.parser(msg.buf, ofproto.OFP_PORT_STATUS_DESC_OFFSET) return msg @_register_parser @_set_msg_type(ofproto.OFPT_ROLE_STATUS) class OFPRoleStatus(MsgBase): def __init__(self, datapath, role=None, reason=None, generation_id=None, properties=None): super(OFPRoleStatus, self).__init__(datapath) self.role = role self.reason = reason self.generation_id = generation_id self.properties = properties @classmethod def parser(cls, datapath, version, msg_type, msg_len, xid, buf): msg = super(OFPRoleStatus, cls).parser(datapath, version, msg_type, msg_len, xid, buf) (msg.role, msg.reason, msg.generation_id) = struct.unpack_from( ofproto.OFP_ROLE_STATUS_PACK_STR, msg.buf, ofproto.OFP_HEADER_SIZE) msg.properties = [] rest = msg.buf[ofproto.OFP_ROLE_STATUS_SIZE:] while rest: p, rest = OFPRoleProp.parse(rest) msg.properties.append(p) return msg @_register_parser @_set_msg_type(ofproto.OFPT_TABLE_STATUS) class OFPTableStatus(MsgBase): def __init__(self, datapath, reason=None, table=None): super(OFPTableStatus, self).__init__(datapath) self.reason = reason self.table = table @classmethod def parser(cls, datapath, version, msg_type, msg_len, xid, buf): msg = super(OFPTableStatus, cls).parser(datapath, version, msg_type, msg_len, xid, buf) (msg.reason,) = struct.unpack_from(ofproto.OFP_TABLE_STATUS_0_PACK_STR, msg.buf, ofproto.OFP_HEADER_SIZE) msg.table = OFPTableDesc.parser(msg.buf, ofproto.OFP_TABLE_STATUS_0_SIZE) return msg @_register_parser @_set_msg_type(ofproto.OFPT_REQUESTFORWARD) class OFPRequestForward(MsgInMsgBase): def __init__(self, datapath, request=None): super(OFPRequestForward, self).__init__(datapath) self.request = request @classmethod def parser(cls, datapath, version, msg_type, msg_len, xid, buf): msg = super(OFPRequestForward, cls).parser( datapath, version, msg_type, msg_len, xid, buf) req_buf = buf[ofproto.OFP_HEADER_SIZE:] (_ver, _type, _len, _xid) = ofproto_parser.header(req_buf) msg.request = ofproto_parser.msg( datapath, _ver, _type, _len, _xid, req_buf) return msg def _serialize_body(self): assert isinstance(self.request, (OFPGroupMod, OFPMeterMod)) self.request.serialize() self.buf += self.request.buf @_set_msg_type(ofproto.OFPT_PACKET_OUT) class OFPPacketOut(MsgBase): def __init__(self, datapath, buffer_id=None, in_port=None, actions=None, data=None, actions_len=None): assert in_port is not None super(OFPPacketOut, self).__init__(datapath) self.buffer_id = buffer_id self.in_port = in_port self.actions_len = 0 self.actions = actions self.data = data def _serialize_body(self): self.actions_len = 0 offset = ofproto.OFP_PACKET_OUT_SIZE for a in self.actions: a.serialize(self.buf, offset) offset += a.len self.actions_len += a.len if self.data is not None: assert self.buffer_id == 0xffffffff self.buf += self.data msg_pack_into(ofproto.OFP_PACKET_OUT_PACK_STR, self.buf, ofproto.OFP_HEADER_SIZE, self.buffer_id, self.in_port, self.actions_len) @_set_msg_type(ofproto.OFPT_FLOW_MOD) class OFPFlowMod(MsgBase): def __init__(self, datapath, cookie=0, cookie_mask=0, table_id=0, command=ofproto.OFPFC_ADD, idle_timeout=0, hard_timeout=0, priority=ofproto.OFP_DEFAULT_PRIORITY, buffer_id=ofproto.OFP_NO_BUFFER, out_port=0, out_group=0, flags=0, importance=0, match=None, instructions=None): instructions = instructions if instructions else [] super(OFPFlowMod, self).__init__(datapath) self.cookie = cookie self.cookie_mask = cookie_mask self.table_id = table_id self.command = command self.idle_timeout = idle_timeout self.hard_timeout = hard_timeout self.priority = priority self.buffer_id = buffer_id self.out_port = out_port self.out_group = out_group self.flags = flags self.importance = importance if match is None: match = OFPMatch() assert isinstance(match, OFPMatch) self.match = match for i in instructions: assert isinstance(i, OFPInstruction) self.instructions = instructions def _serialize_body(self): msg_pack_into(ofproto.OFP_FLOW_MOD_PACK_STR0, self.buf, ofproto.OFP_HEADER_SIZE, self.cookie, self.cookie_mask, self.table_id, self.command, self.idle_timeout, self.hard_timeout, self.priority, self.buffer_id, self.out_port, self.out_group, self.flags, self.importance) offset = (ofproto.OFP_FLOW_MOD_SIZE - ofproto.OFP_MATCH_SIZE) match_len = self.match.serialize(self.buf, offset) offset += match_len for inst in self.instructions: inst.serialize(self.buf, offset) offset += inst.len class OFPInstruction(StringifyMixin): _INSTRUCTION_TYPES = {} @staticmethod def register_instruction_type(types): def _register_instruction_type(cls): for type_ in types: OFPInstruction._INSTRUCTION_TYPES[type_] = cls return cls return _register_instruction_type @classmethod def parser(cls, buf, offset): (type_, len_) = struct.unpack_from('!HH', buf, offset) cls_ = cls._INSTRUCTION_TYPES.get(type_) return cls_.parser(buf, offset) @OFPInstruction.register_instruction_type([ofproto.OFPIT_GOTO_TABLE]) class OFPInstructionGotoTable(OFPInstruction): def __init__(self, table_id, type_=None, len_=None): super(OFPInstructionGotoTable, self).__init__() self.type = ofproto.OFPIT_GOTO_TABLE self.len = ofproto.OFP_INSTRUCTION_GOTO_TABLE_SIZE self.table_id = table_id @classmethod def parser(cls, buf, offset): (type_, len_, table_id) = struct.unpack_from( ofproto.OFP_INSTRUCTION_GOTO_TABLE_PACK_STR, buf, offset) return cls(table_id) def serialize(self, buf, offset): msg_pack_into(ofproto.OFP_INSTRUCTION_GOTO_TABLE_PACK_STR, buf, offset, self.type, self.len, self.table_id) @OFPInstruction.register_instruction_type([ofproto.OFPIT_WRITE_METADATA]) class OFPInstructionWriteMetadata(OFPInstruction): def __init__(self, metadata, metadata_mask, type_=None, len_=None): super(OFPInstructionWriteMetadata, self).__init__() self.type = ofproto.OFPIT_WRITE_METADATA self.len = ofproto.OFP_INSTRUCTION_WRITE_METADATA_SIZE self.metadata = metadata self.metadata_mask = metadata_mask @classmethod def parser(cls, buf, offset): (type_, len_, metadata, metadata_mask) = struct.unpack_from( ofproto.OFP_INSTRUCTION_WRITE_METADATA_PACK_STR, buf, offset) return cls(metadata, metadata_mask) def serialize(self, buf, offset): msg_pack_into(ofproto.OFP_INSTRUCTION_WRITE_METADATA_PACK_STR, buf, offset, self.type, self.len, self.metadata, self.metadata_mask) @OFPInstruction.register_instruction_type([ofproto.OFPIT_WRITE_ACTIONS, ofproto.OFPIT_APPLY_ACTIONS, ofproto.OFPIT_CLEAR_ACTIONS]) class OFPInstructionActions(OFPInstruction): def __init__(self, type_, actions=None, len_=None): super(OFPInstructionActions, self).__init__() self.type = type_ for a in actions: assert isinstance(a, OFPAction) self.actions = actions @classmethod def parser(cls, buf, offset): (type_, len_) = struct.unpack_from( ofproto.OFP_INSTRUCTION_ACTIONS_PACK_STR, buf, offset) offset += ofproto.OFP_INSTRUCTION_ACTIONS_SIZE actions = [] actions_len = len_ - ofproto.OFP_INSTRUCTION_ACTIONS_SIZE while actions_len > 0: a = OFPAction.parser(buf, offset) actions.append(a) actions_len -= a.len offset += a.len inst = cls(type_, actions) inst.len = len_ return inst def serialize(self, buf, offset): action_offset = offset + ofproto.OFP_INSTRUCTION_ACTIONS_SIZE if self.actions: for a in self.actions: a.serialize(buf, action_offset) action_offset += a.len self.len = action_offset - offset pad_len = utils.round_up(self.len, 8) - self.len msg_pack_into("%dx" % pad_len, buf, action_offset) self.len += pad_len msg_pack_into(ofproto.OFP_INSTRUCTION_ACTIONS_PACK_STR, buf, offset, self.type, self.len) @OFPInstruction.register_instruction_type([ofproto.OFPIT_METER]) class OFPInstructionMeter(OFPInstruction): def __init__(self, meter_id=1, type_=None, len_=None): super(OFPInstructionMeter, self).__init__() self.type = ofproto.OFPIT_METER self.len = ofproto.OFP_INSTRUCTION_METER_SIZE self.meter_id = meter_id @classmethod def parser(cls, buf, offset): (type_, len_, meter_id) = struct.unpack_from( ofproto.OFP_INSTRUCTION_METER_PACK_STR, buf, offset) return cls(meter_id) def serialize(self, buf, offset): msg_pack_into(ofproto.OFP_INSTRUCTION_METER_PACK_STR, buf, offset, self.type, self.len, self.meter_id) class OFPActionHeader(StringifyMixin): def __init__(self, type_, len_): self.type = type_ self.len = len_ def serialize(self, buf, offset): msg_pack_into(ofproto.OFP_ACTION_HEADER_PACK_STR, buf, offset, self.type, self.len) class OFPAction(OFPActionHeader): _ACTION_TYPES = {} @staticmethod def register_action_type(type_, len_): def _register_action_type(cls): cls.cls_action_type = type_ cls.cls_action_len = len_ OFPAction._ACTION_TYPES[cls.cls_action_type] = cls return cls return _register_action_type def __init__(self): cls = self.__class__ super(OFPAction, self).__init__(cls.cls_action_type, cls.cls_action_len) @classmethod def parser(cls, buf, offset): type_, len_ = struct.unpack_from( ofproto.OFP_ACTION_HEADER_PACK_STR, buf, offset) cls_ = cls._ACTION_TYPES.get(type_) assert cls_ is not None return cls_.parser(buf, offset) @OFPAction.register_action_type(ofproto.OFPAT_OUTPUT, ofproto.OFP_ACTION_OUTPUT_SIZE) class OFPActionOutput(OFPAction): def __init__(self, port, max_len=ofproto.OFPCML_MAX, type_=None, len_=None): super(OFPActionOutput, self).__init__() self.port = port self.max_len = max_len @classmethod def parser(cls, buf, offset): type_, len_, port, max_len = struct.unpack_from( ofproto.OFP_ACTION_OUTPUT_PACK_STR, buf, offset) return cls(port, max_len) def serialize(self, buf, offset): msg_pack_into(ofproto.OFP_ACTION_OUTPUT_PACK_STR, buf, offset, self.type, self.len, self.port, self.max_len) @OFPAction.register_action_type(ofproto.OFPAT_GROUP, ofproto.OFP_ACTION_GROUP_SIZE) class OFPActionGroup(OFPAction): def __init__(self, group_id=0, type_=None, len_=None): super(OFPActionGroup, self).__init__() self.group_id = group_id @classmethod def parser(cls, buf, offset): (type_, len_, group_id) = struct.unpack_from( ofproto.OFP_ACTION_GROUP_PACK_STR, buf, offset) return cls(group_id) def serialize(self, buf, offset): msg_pack_into(ofproto.OFP_ACTION_GROUP_PACK_STR, buf, offset, self.type, self.len, self.group_id) @OFPAction.register_action_type(ofproto.OFPAT_SET_QUEUE, ofproto.OFP_ACTION_SET_QUEUE_SIZE) class OFPActionSetQueue(OFPAction): def __init__(self, queue_id, type_=None, len_=None): super(OFPActionSetQueue, self).__init__() self.queue_id = queue_id @classmethod def parser(cls, buf, offset): (type_, len_, queue_id) = struct.unpack_from( ofproto.OFP_ACTION_SET_QUEUE_PACK_STR, buf, offset) return cls(queue_id) def serialize(self, buf, offset): msg_pack_into(ofproto.OFP_ACTION_SET_QUEUE_PACK_STR, buf, offset, self.type, self.len, self.queue_id) @OFPAction.register_action_type(ofproto.OFPAT_SET_MPLS_TTL, ofproto.OFP_ACTION_MPLS_TTL_SIZE) class OFPActionSetMplsTtl(OFPAction): def __init__(self, mpls_ttl, type_=None, len_=None): super(OFPActionSetMplsTtl, self).__init__() self.mpls_ttl = mpls_ttl @classmethod def parser(cls, buf, offset): (type_, len_, mpls_ttl) = struct.unpack_from( ofproto.OFP_ACTION_MPLS_TTL_PACK_STR, buf, offset) return cls(mpls_ttl) def serialize(self, buf, offset): msg_pack_into(ofproto.OFP_ACTION_MPLS_TTL_PACK_STR, buf, offset, self.type, self.len, self.mpls_ttl) @OFPAction.register_action_type(ofproto.OFPAT_DEC_MPLS_TTL, ofproto.OFP_ACTION_HEADER_SIZE) class OFPActionDecMplsTtl(OFPAction): def __init__(self, type_=None, len_=None): super(OFPActionDecMplsTtl, self).__init__() @classmethod def parser(cls, buf, offset): (type_, len_) = struct.unpack_from( ofproto.OFP_ACTION_HEADER_PACK_STR, buf, offset) return cls() @OFPAction.register_action_type(ofproto.OFPAT_SET_NW_TTL, ofproto.OFP_ACTION_NW_TTL_SIZE) class OFPActionSetNwTtl(OFPAction): def __init__(self, nw_ttl, type_=None, len_=None): super(OFPActionSetNwTtl, self).__init__() self.nw_ttl = nw_ttl @classmethod def parser(cls, buf, offset): (type_, len_, nw_ttl) = struct.unpack_from( ofproto.OFP_ACTION_NW_TTL_PACK_STR, buf, offset) return cls(nw_ttl) def serialize(self, buf, offset): msg_pack_into(ofproto.OFP_ACTION_NW_TTL_PACK_STR, buf, offset, self.type, self.len, self.nw_ttl) @OFPAction.register_action_type(ofproto.OFPAT_DEC_NW_TTL, ofproto.OFP_ACTION_HEADER_SIZE) class OFPActionDecNwTtl(OFPAction): def __init__(self, type_=None, len_=None): super(OFPActionDecNwTtl, self).__init__() @classmethod def parser(cls, buf, offset): (type_, len_) = struct.unpack_from( ofproto.OFP_ACTION_HEADER_PACK_STR, buf, offset) return cls() @OFPAction.register_action_type(ofproto.OFPAT_COPY_TTL_OUT, ofproto.OFP_ACTION_HEADER_SIZE) class OFPActionCopyTtlOut(OFPAction): def __init__(self, type_=None, len_=None): super(OFPActionCopyTtlOut, self).__init__() @classmethod def parser(cls, buf, offset): (type_, len_) = struct.unpack_from( ofproto.OFP_ACTION_HEADER_PACK_STR, buf, offset) return cls() @OFPAction.register_action_type(ofproto.OFPAT_COPY_TTL_IN, ofproto.OFP_ACTION_HEADER_SIZE) class OFPActionCopyTtlIn(OFPAction): def __init__(self, type_=None, len_=None): super(OFPActionCopyTtlIn, self).__init__() @classmethod def parser(cls, buf, offset): (type_, len_) = struct.unpack_from( ofproto.OFP_ACTION_HEADER_PACK_STR, buf, offset) return cls() @OFPAction.register_action_type(ofproto.OFPAT_PUSH_VLAN, ofproto.OFP_ACTION_PUSH_SIZE) class OFPActionPushVlan(OFPAction): def __init__(self, ethertype=ether.ETH_TYPE_8021Q, type_=None, len_=None): super(OFPActionPushVlan, self).__init__() self.ethertype = ethertype @classmethod def parser(cls, buf, offset): (type_, len_, ethertype) = struct.unpack_from( ofproto.OFP_ACTION_PUSH_PACK_STR, buf, offset) return cls(ethertype) def serialize(self, buf, offset): msg_pack_into(ofproto.OFP_ACTION_PUSH_PACK_STR, buf, offset, self.type, self.len, self.ethertype) @OFPAction.register_action_type(ofproto.OFPAT_PUSH_MPLS, ofproto.OFP_ACTION_PUSH_SIZE) class OFPActionPushMpls(OFPAction): def __init__(self, ethertype=ether.ETH_TYPE_MPLS, type_=None, len_=None): super(OFPActionPushMpls, self).__init__() self.ethertype = ethertype @classmethod def parser(cls, buf, offset): (type_, len_, ethertype) = struct.unpack_from( ofproto.OFP_ACTION_PUSH_PACK_STR, buf, offset) return cls(ethertype) def serialize(self, buf, offset): msg_pack_into(ofproto.OFP_ACTION_PUSH_PACK_STR, buf, offset, self.type, self.len, self.ethertype) @OFPAction.register_action_type(ofproto.OFPAT_POP_VLAN, ofproto.OFP_ACTION_HEADER_SIZE) class OFPActionPopVlan(OFPAction): def __init__(self, type_=None, len_=None): super(OFPActionPopVlan, self).__init__() @classmethod def parser(cls, buf, offset): (type_, len_) = struct.unpack_from( ofproto.OFP_ACTION_HEADER_PACK_STR, buf, offset) return cls() @OFPAction.register_action_type(ofproto.OFPAT_POP_MPLS, ofproto.OFP_ACTION_POP_MPLS_SIZE) class OFPActionPopMpls(OFPAction): def __init__(self, ethertype=ether.ETH_TYPE_IP, type_=None, len_=None): super(OFPActionPopMpls, self).__init__() self.ethertype = ethertype @classmethod def parser(cls, buf, offset): (type_, len_, ethertype) = struct.unpack_from( ofproto.OFP_ACTION_POP_MPLS_PACK_STR, buf, offset) return cls(ethertype) def serialize(self, buf, offset): msg_pack_into(ofproto.OFP_ACTION_POP_MPLS_PACK_STR, buf, offset, self.type, self.len, self.ethertype) @OFPAction.register_action_type(ofproto.OFPAT_SET_FIELD, ofproto.OFP_ACTION_SET_FIELD_SIZE) class OFPActionSetField(OFPAction): def __init__(self, field=None, **kwargs): super(OFPActionSetField, self).__init__() assert len(kwargs) == 1 key = list(kwargs.keys())[0] value = kwargs[key] assert isinstance(key, (str, six.text_type)) assert not isinstance(value, tuple) # no mask self.key = key self.value = value @classmethod def parser(cls, buf, offset): (type_, len_) = struct.unpack_from( ofproto.OFP_ACTION_SET_FIELD_PACK_STR, buf, offset) (n, value, mask, _len) = ofproto.oxm_parse(buf, offset + 4) k, uv = ofproto.oxm_to_user(n, value, mask) action = cls(**{k: uv}) action.len = len_ return action def serialize(self, buf, offset): n, value, mask = ofproto.oxm_from_user(self.key, self.value) len_ = ofproto.oxm_serialize(n, value, mask, buf, offset + 4) self.len = utils.round_up(4 + len_, 8) msg_pack_into('!HH', buf, offset, self.type, self.len) pad_len = self.len - (4 + len_) msg_pack_into("%dx" % pad_len, buf, offset + 4 + len_) def to_jsondict(self): return { self.__class__.__name__: { 'field': ofproto.oxm_to_jsondict(self.key, self.value), "len": self.len, "type": self.type } } @classmethod def from_jsondict(cls, dict_): k, v = ofproto.oxm_from_jsondict(dict_['field']) return OFPActionSetField(**{k: v}) def stringify_attrs(self): yield (self.key, self.value) @OFPAction.register_action_type(ofproto.OFPAT_PUSH_PBB, ofproto.OFP_ACTION_PUSH_SIZE) class OFPActionPushPbb(OFPAction): def __init__(self, ethertype, type_=None, len_=None): super(OFPActionPushPbb, self).__init__() self.ethertype = ethertype @classmethod def parser(cls, buf, offset): (type_, len_, ethertype) = struct.unpack_from( ofproto.OFP_ACTION_PUSH_PACK_STR, buf, offset) return cls(ethertype) def serialize(self, buf, offset): msg_pack_into(ofproto.OFP_ACTION_PUSH_PACK_STR, buf, offset, self.type, self.len, self.ethertype) @OFPAction.register_action_type(ofproto.OFPAT_POP_PBB, ofproto.OFP_ACTION_HEADER_SIZE) class OFPActionPopPbb(OFPAction): def __init__(self, type_=None, len_=None): super(OFPActionPopPbb, self).__init__() @classmethod def parser(cls, buf, offset): (type_, len_) = struct.unpack_from( ofproto.OFP_ACTION_HEADER_PACK_STR, buf, offset) return cls() @OFPAction.register_action_type( ofproto.OFPAT_EXPERIMENTER, ofproto.OFP_ACTION_EXPERIMENTER_HEADER_SIZE) class OFPActionExperimenter(OFPAction): def __init__(self, experimenter): super(OFPActionExperimenter, self).__init__() self.type = ofproto.OFPAT_EXPERIMENTER self.experimenter = experimenter self.len = None @classmethod def parser(cls, buf, offset): (type_, len_, experimenter) = struct.unpack_from( ofproto.OFP_ACTION_EXPERIMENTER_HEADER_PACK_STR, buf, offset) data = buf[(offset + ofproto.OFP_ACTION_EXPERIMENTER_HEADER_SIZE ): offset + len_] if experimenter == ofproto_common.NX_EXPERIMENTER_ID: obj = NXAction.parse(data) else: obj = OFPActionExperimenterUnknown(experimenter, data) obj.len = len_ return obj def serialize(self, buf, offset): msg_pack_into(ofproto.OFP_ACTION_EXPERIMENTER_HEADER_PACK_STR, buf, offset, self.type, self.len, self.experimenter) class OFPActionExperimenterUnknown(OFPActionExperimenter): def __init__(self, experimenter, data=None, type_=None, len_=None): super(OFPActionExperimenterUnknown, self).__init__(experimenter=experimenter) self.data = data def serialize(self, buf, offset): # fixup data = self.data if data is None: data = bytearray() self.len = (utils.round_up(len(data), 8) + ofproto.OFP_ACTION_EXPERIMENTER_HEADER_SIZE) super(OFPActionExperimenterUnknown, self).serialize(buf, offset) msg_pack_into('!%ds' % len(self.data), buf, offset + ofproto.OFP_ACTION_EXPERIMENTER_HEADER_SIZE, self.data) @_register_parser @_set_msg_type(ofproto.OFPT_GROUP_MOD) class OFPGroupMod(MsgBase): def __init__(self, datapath, command=ofproto.OFPGC_ADD, type_=ofproto.OFPGT_ALL, group_id=0, buckets=None): buckets = buckets if buckets else [] super(OFPGroupMod, self).__init__(datapath) self.command = command self.type = type_ self.group_id = group_id self.buckets = buckets @classmethod def parser(cls, datapath, version, msg_type, msg_len, xid, buf): msg = super(OFPGroupMod, cls).parser( datapath, version, msg_type, msg_len, xid, buf) (msg.command, msg.type, msg.group_id) = struct.unpack_from( ofproto.OFP_GROUP_MOD_PACK_STR, buf, ofproto.OFP_HEADER_SIZE) offset = ofproto.OFP_GROUP_MOD_SIZE msg.buckets = [] while offset < msg.msg_len: bucket = OFPBucket.parser(buf, offset) msg.buckets.append(bucket) offset += bucket.len return msg def _serialize_body(self): msg_pack_into(ofproto.OFP_GROUP_MOD_PACK_STR, self.buf, ofproto.OFP_HEADER_SIZE, self.command, self.type, self.group_id) offset = ofproto.OFP_GROUP_MOD_SIZE for b in self.buckets: b.serialize(self.buf, offset) offset += b.len class OFPPortModProp(OFPPropBase): _TYPES = {} class OFPPortModPropEthernet(OFPPortModProp): def __init__(self, type_=None, length=None, advertise=None): self.type = type_ self.advertise = advertise def serialize(self): # fixup self.length = struct.calcsize( ofproto.OFP_PORT_MOD_PROP_ETHERNET_PACK_STR) buf = bytearray() msg_pack_into(ofproto.OFP_PORT_MOD_PROP_ETHERNET_PACK_STR, buf, 0, self.type, self.length, self.advertise) return buf class OFPPortModPropOptical(OFPPortModProp): def __init__(self, type_=None, length=None, configure=None, freq_lmda=None, fl_offset=None, grid_span=None, tx_pwr=None): self.type = type_ self.length = length self.configure = configure self.freq_lmda = freq_lmda self.fl_offset = fl_offset self.grid_span = grid_span self.tx_pwr = tx_pwr def serialize(self): # fixup self.length = struct.calcsize( ofproto.OFP_PORT_MOD_PROP_OPTICAL_PACK_STR) buf = bytearray() msg_pack_into(ofproto.OFP_PORT_MOD_PROP_OPTICAL_PACK_STR, buf, 0, self.type, self.length, self.configure, self.freq_lmda, self.fl_offset, self.grid_span, self.tx_pwr) return buf class OFPPortModPropExperimenter(OFPPropCommonExperimenter4ByteData): pass @_set_msg_type(ofproto.OFPT_PORT_MOD) class OFPPortMod(MsgBase): _TYPE = { 'ascii': [ 'hw_addr', ] } def __init__(self, datapath, port_no=0, hw_addr='00:00:00:00:00:00', config=0, mask=0, properties=None): super(OFPPortMod, self).__init__(datapath) self.port_no = port_no self.hw_addr = hw_addr self.config = config self.mask = mask self.properties = properties or [] def _serialize_body(self): bin_props = bytearray() for p in self.properties: bin_props += p.serialize() msg_pack_into(ofproto.OFP_PORT_MOD_PACK_STR, self.buf, ofproto.OFP_HEADER_SIZE, self.port_no, addrconv.mac.text_to_bin(self.hw_addr), self.config, self.mask) self.buf += bin_props class OFPBucket(StringifyMixin): def __init__(self, weight=0, watch_port=ofproto.OFPP_ANY, watch_group=ofproto.OFPG_ANY, actions=None, len_=None): super(OFPBucket, self).__init__() self.weight = weight self.watch_port = watch_port self.watch_group = watch_group self.actions = actions @classmethod def parser(cls, buf, offset): (len_, weight, watch_port, watch_group) = struct.unpack_from( ofproto.OFP_BUCKET_PACK_STR, buf, offset) msg = cls(weight, watch_port, watch_group, []) msg.len = len_ length = ofproto.OFP_BUCKET_SIZE offset += ofproto.OFP_BUCKET_SIZE while length < msg.len: action = OFPAction.parser(buf, offset) msg.actions.append(action) offset += action.len length += action.len return msg def serialize(self, buf, offset): action_offset = offset + ofproto.OFP_BUCKET_SIZE action_len = 0 for a in self.actions: a.serialize(buf, action_offset) action_offset += a.len action_len += a.len self.len = utils.round_up(ofproto.OFP_BUCKET_SIZE + action_len, 8) msg_pack_into(ofproto.OFP_BUCKET_PACK_STR, buf, offset, self.len, self.weight, self.watch_port, self.watch_group) @_set_msg_type(ofproto.OFPT_ROLE_REQUEST) class OFPRoleRequest(MsgBase): def __init__(self, datapath, role=None, generation_id=None): super(OFPRoleRequest, self).__init__(datapath) self.role = role self.generation_id = generation_id def _serialize_body(self): assert self.role is not None assert self.generation_id is not None msg_pack_into(ofproto.OFP_ROLE_REQUEST_PACK_STR, self.buf, ofproto.OFP_HEADER_SIZE, self.role, self.generation_id) @_register_parser @_set_msg_type(ofproto.OFPT_ROLE_REPLY) class OFPRoleReply(MsgBase): def __init__(self, datapath, role=None, generation_id=None): super(OFPRoleReply, self).__init__(datapath) self.role = role self.generation_id = generation_id @classmethod def parser(cls, datapath, version, msg_type, msg_len, xid, buf): msg = super(OFPRoleReply, cls).parser(datapath, version, msg_type, msg_len, xid, buf) (msg.role, msg.generation_id) = struct.unpack_from( ofproto.OFP_ROLE_REQUEST_PACK_STR, msg.buf, ofproto.OFP_HEADER_SIZE) return msg class OFPAsyncConfigProp(OFPPropBase): _TYPES = {} @OFPAsyncConfigProp.register_type(ofproto.OFPACPT_PACKET_IN_SLAVE) @OFPAsyncConfigProp.register_type(ofproto.OFPACPT_PACKET_IN_MASTER) @OFPAsyncConfigProp.register_type(ofproto.OFPACPT_PORT_STATUS_SLAVE) @OFPAsyncConfigProp.register_type(ofproto.OFPACPT_PORT_STATUS_MASTER) @OFPAsyncConfigProp.register_type(ofproto.OFPACPT_FLOW_REMOVED_SLAVE) @OFPAsyncConfigProp.register_type(ofproto.OFPACPT_FLOW_REMOVED_MASTER) @OFPAsyncConfigProp.register_type(ofproto.OFPACPT_ROLE_STATUS_SLAVE) @OFPAsyncConfigProp.register_type(ofproto.OFPACPT_ROLE_STATUS_MASTER) @OFPAsyncConfigProp.register_type(ofproto.OFPACPT_TABLE_STATUS_SLAVE) @OFPAsyncConfigProp.register_type(ofproto.OFPACPT_TABLE_STATUS_MASTER) @OFPAsyncConfigProp.register_type(ofproto.OFPACPT_REQUESTFORWARD_SLAVE) @OFPAsyncConfigProp.register_type(ofproto.OFPACPT_REQUESTFORWARD_MASTER) class OFPAsyncConfigPropReasons(OFPAsyncConfigProp): def __init__(self, type_=None, length=None, mask=None): self.type = type_ self.length = length self.mask = mask @classmethod def parser(cls, buf): reasons = cls() (reasons.type, reasons.length, reasons.mask) = struct.unpack_from( ofproto.OFP_ASYNC_CONFIG_PROP_REASONS_PACK_STR, buf, 0) return reasons def serialize(self): # fixup self.length = ofproto.OFP_ASYNC_CONFIG_PROP_REASONS_SIZE buf = bytearray() msg_pack_into(ofproto.OFP_ASYNC_CONFIG_PROP_REASONS_PACK_STR, buf, 0, self.type, self.length, self.mask) return buf @OFPAsyncConfigProp.register_type(ofproto.OFPTFPT_EXPERIMENTER_SLAVE) @OFPAsyncConfigProp.register_type(ofproto.OFPTFPT_EXPERIMENTER_MASTER) class OFPAsyncConfigPropExperimenter(OFPPropCommonExperimenter4ByteData): pass @_set_msg_type(ofproto.OFPT_GET_ASYNC_REQUEST) class OFPGetAsyncRequest(MsgBase): def __init__(self, datapath): super(OFPGetAsyncRequest, self).__init__(datapath) @_register_parser @_set_msg_type(ofproto.OFPT_GET_ASYNC_REPLY) class OFPGetAsyncReply(MsgBase): def __init__(self, datapath, properties=None): super(OFPGetAsyncReply, self).__init__(datapath) self.properties = properties @classmethod def parser(cls, datapath, version, msg_type, msg_len, xid, buf): msg = super(OFPGetAsyncReply, cls).parser(datapath, version, msg_type, msg_len, xid, buf) msg.properties = [] rest = msg.buf[ofproto.OFP_HEADER_SIZE:] while rest: p, rest = OFPAsyncConfigProp.parse(rest) msg.properties.append(p) return msg @_set_msg_type(ofproto.OFPT_SET_ASYNC) class OFPSetAsync(MsgBase): def __init__(self, datapath, properties=None): super(OFPSetAsync, self).__init__(datapath) self.properties = properties def _serialize_body(self): bin_props = bytearray() for p in self.properties: bin_props += p.serialize() self.buf += bin_props @_set_msg_type(ofproto.OFPT_BUNDLE_CONTROL) class OFPBundleCtrlMsg(MsgBase): def __init__(self, datapath, bundle_id, type_, flags, properties): super(OFPBundleCtrlMsg, self).__init__(datapath) self.bundle_id = bundle_id self.type = type_ self.flags = flags self.properties = properties def _serialize_body(self): bin_props = bytearray() for p in self.properties: bin_props += p.serialize() msg_pack_into(ofproto.OFP_BUNDLE_CTRL_MSG_PACK_STR, self.buf, ofproto.OFP_HEADER_SIZE, self.bundle_id, self.type, self.flags) self.buf += bin_props @_set_msg_type(ofproto.OFPT_BUNDLE_ADD_MESSAGE) class OFPBundleAddMsg(MsgInMsgBase): def __init__(self, datapath, bundle_id, flags, message, properties): super(OFPBundleAddMsg, self).__init__(datapath) self.bundle_id = bundle_id self.flags = flags self.message = message self.properties = properties def _serialize_body(self): # The xid of the inner message must be the same as # that of the outer message (OF1.4.0 7.3.9.2) if self.message.xid != self.xid: self.message.set_xid(self.xid) # Message self.message.serialize() tail_buf = self.message.buf # Pad if len(self.properties) > 0: message_len = len(tail_buf) pad_len = utils.round_up(message_len, 8) - message_len msg_pack_into("%dx" % pad_len, tail_buf, message_len) # Properties for p in self.properties: tail_buf += p.serialize() # Head msg_pack_into(ofproto.OFP_BUNDLE_ADD_MSG_0_PACK_STR, self.buf, ofproto.OFP_HEADER_SIZE, self.bundle_id, self.flags) # Finish self.buf += tail_buf nx_actions.generate( 'ryu.ofproto.ofproto_v1_4', 'ryu.ofproto.ofproto_v1_4_parser' )

true

1c3034e026a4b7927b1b22737c8e3921a53b0a31

9,812

py

Python

ymir/backend/src/ymir_app/app/api/api_v1/endpoints/projects.py

Zhang-SJ930104/ymir

dd6481be6f229ade4cf8fba64ef44a15357430c4

[ "Apache-2.0" ]

null

ymir/backend/src/ymir_app/app/api/api_v1/endpoints/projects.py

Zhang-SJ930104/ymir

dd6481be6f229ade4cf8fba64ef44a15357430c4

[ "Apache-2.0" ]

1

2022-01-18T09:28:29.000Z

ymir/backend/src/ymir_app/app/api/api_v1/endpoints/projects.py

Aryalfrat/ymir

d4617ed00ef67a77ab4e1944763f608bface4be6

[ "Apache-2.0" ]

null

import enum import json import time from typing import Any from fastapi import APIRouter, Depends, Path, Query, BackgroundTasks from fastapi.logger import logger from sqlalchemy.orm import Session from app import crud, models, schemas from app.api import deps from app.api.errors.errors import ( ProjectNotFound, DuplicateProjectError, FailedToCreateProject, FailedToConnectClickHouse, NoDatasetPermission, DatasetNotFound, ) from app.config import settings from app.constants.state import ResultState, RunningStates, TaskType, TrainingType from app.utils.cache import CacheClient from app.utils.clickhouse import YmirClickHouse from app.utils.ymir_controller import ControllerClient, gen_task_hash from app.libs.projects import setup_sample_project_in_background from app.libs.keywords import add_keywords from common_utils.labels import UserLabels router = APIRouter() class SortField(enum.Enum): id = "id" create_datetime = "create_datetime" @router.get("/", response_model=schemas.ProjectPaginationOut) def list_projects( db: Session = Depends(deps.get_db), current_user: models.User = Depends(deps.get_current_active_user), name: str = Query(None), start_time: int = Query(None, description="from this timestamp"), end_time: int = Query(None, description="to this timestamp"), offset: int = Query(None), limit: int = Query(None), order_by: SortField = Query(SortField.id), is_desc: bool = Query(True), ) -> Any: """ Get projects list filter: - name order_by: - id - create_datetime """ projects, total = crud.project.get_multi_projects( db, user_id=current_user.id, name=name, offset=offset, limit=limit, order_by=order_by.name, is_desc=is_desc, start_time=start_time, end_time=end_time, ) return {"result": {"total": total, "items": projects}} @router.post("/samples", response_model=schemas.ProjectOut) def create_sample_project( *, db: Session = Depends(deps.get_db), current_user: models.User = Depends(deps.get_current_active_user), user_labels: UserLabels = Depends(deps.get_user_labels), controller_client: ControllerClient = Depends(deps.get_controller_client), background_tasks: BackgroundTasks, cache: CacheClient = Depends(deps.get_cache), ) -> Any: """ Create sample project """ project_name = f"sample_project_{current_user.username}_{time.time()}" project_in = schemas.ProjectCreate( name=project_name, training_keywords=settings.SAMPLE_PROJECT_KEYWORDS, chunk_size=1, is_example=True, ) project = crud.project.create_project(db, user_id=current_user.id, obj_in=project_in) project_task_hash = gen_task_hash(current_user.id, project.id) try: training_classes = user_labels.get_class_ids(names_or_aliases=settings.SAMPLE_PROJECT_KEYWORDS) except KeyError: # todo refactor keywords dependencies to handle ensure given keywords exist add_keywords(controller_client, cache, current_user.id, settings.SAMPLE_PROJECT_KEYWORDS) user_labels = controller_client.get_labels_of_user(current_user.id) training_classes = user_labels.get_class_ids(names_or_aliases=settings.SAMPLE_PROJECT_KEYWORDS) try: resp = controller_client.create_project( user_id=current_user.id, project_id=project.id, task_id=project_task_hash, args={"training_classes": training_classes}, ) logger.info("[create task] controller response: %s", resp) except ValueError: crud.project.soft_remove(db, id=project.id) raise FailedToCreateProject() background_tasks.add_task( setup_sample_project_in_background, db, controller_client, project_name=project.name, project_id=project.id, user_id=current_user.id, project_task_hash=project_task_hash, ) return {"result": project} @router.post("/", response_model=schemas.ProjectOut) def create_project( *, db: Session = Depends(deps.get_db), current_user: models.User = Depends(deps.get_current_active_user), project_in: schemas.ProjectCreate, controller_client: ControllerClient = Depends(deps.get_controller_client), user_labels: UserLabels = Depends(deps.get_user_labels), clickhouse: YmirClickHouse = Depends(deps.get_clickhouse_client), ) -> Any: """ Create project """ if crud.project.is_duplicated_name(db, user_id=current_user.id, name=project_in.name): raise DuplicateProjectError() # 1.create project to get task_id for sending to controller project = crud.project.create_project(db, user_id=current_user.id, obj_in=project_in) task_id = gen_task_hash(current_user.id, project.id) training_classes = user_labels.get_class_ids(names_or_aliases=project_in.training_keywords) # 2.send to controller try: resp = controller_client.create_project( user_id=current_user.id, project_id=project.id, task_id=task_id, args={"training_classes": training_classes}, ) logger.info("[create task] controller response: %s", resp) except ValueError: crud.project.soft_remove(db, id=project.id) raise FailedToCreateProject() # 3.create task info task = crud.task.create_placeholder( db, type_=TaskType.create_project, user_id=current_user.id, project_id=project.id ) # 3.create dataset group to build dataset info dataset_name = f"{project_in.name}_training_dataset" dataset_paras = schemas.DatasetGroupCreate(name=dataset_name, project_id=project.id, user_id=current_user.id) dataset_group = crud.dataset_group.create_with_user_id(db, user_id=current_user.id, obj_in=dataset_paras) # 4.create init dataset dataset_in = schemas.DatasetCreate( name=dataset_name, hash=task_id, dataset_group_id=dataset_group.id, project_id=project.id, user_id=current_user.id, source=task.type, result_state=ResultState.ready, task_id=task.id, ) initial_dataset = crud.dataset.create_with_version(db, obj_in=dataset_in) # 5.update project info project = crud.project.update_resources( db, project_id=project.id, project_update=schemas.ProjectUpdate( training_dataset_group_id=dataset_group.id, initial_training_dataset_id=initial_dataset.id ), ) try: clickhouse.save_project_parameter( dt=project.create_datetime, user_id=project.user_id, id_=project.id, name=project.name, training_type=TrainingType(project.training_type).name, training_keywords=json.loads(project.training_keywords), ) except FailedToConnectClickHouse: # clickhouse metric shouldn't block create task process logger.exception( "[create project metrics] failed to write project(%s) stats to clickhouse, continue anyway", project.name, ) logger.info("[create project] project record created: %s", project) return {"result": project} @router.get( "/{project_id}", response_model=schemas.ProjectOut, ) def get_project( *, db: Session = Depends(deps.get_db), project_id: int = Path(...), current_user: models.User = Depends(deps.get_current_active_user), ) -> Any: """ Get a project detail """ project = crud.project.get_by_user_and_id(db, user_id=current_user.id, id=project_id) if not project: raise ProjectNotFound() return {"result": project} @router.patch( "/{project_id}", response_model=schemas.ProjectOut, ) def update_project( *, db: Session = Depends(deps.get_db), project_id: int = Path(...), project_update: schemas.ProjectUpdate, current_user: models.User = Depends(deps.get_current_active_user), ) -> Any: """ Setting up a project """ project = crud.project.get_by_user_and_id(db, user_id=current_user.id, id=project_id) if not project: raise ProjectNotFound() if project_update.initial_training_dataset_id is not None: dataset = crud.dataset.get(db, id=project_update.initial_training_dataset_id) if not dataset: raise DatasetNotFound() if project.training_dataset_group_id != dataset.dataset_group_id: raise NoDatasetPermission() project = crud.project.update_resources(db, project_id=project.id, project_update=project_update) return {"result": project} @router.delete( "/{project_id}", response_model=schemas.ProjectOut, ) def delete_project( *, db: Session = Depends(deps.get_db), project_id: int = Path(...), controller_client: ControllerClient = Depends(deps.get_controller_client), current_user: models.User = Depends(deps.get_current_active_user), ) -> Any: """ Delete project, and terminate all tasks """ project = crud.project.get_by_user_and_id(db, user_id=current_user.id, id=project_id) if not project: raise ProjectNotFound() project = crud.project.soft_remove(db, id=project_id) unfinished_tasks = crud.task.get_tasks_by_states( db, states=RunningStates, including_deleted=True, project_id=project_id, ) for task in unfinished_tasks: try: controller_client.terminate_task(user_id=current_user.id, task_hash=task.hash, task_type=task.type) except Exception: logger.info(f"Failed to terminate task: {task.hash} of project_id: {project_id}") continue return {"result": project}

33.037037

113

0.698227

import enum import json import time from typing import Any from fastapi import APIRouter, Depends, Path, Query, BackgroundTasks from fastapi.logger import logger from sqlalchemy.orm import Session from app import crud, models, schemas from app.api import deps from app.api.errors.errors import ( ProjectNotFound, DuplicateProjectError, FailedToCreateProject, FailedToConnectClickHouse, NoDatasetPermission, DatasetNotFound, ) from app.config import settings from app.constants.state import ResultState, RunningStates, TaskType, TrainingType from app.utils.cache import CacheClient from app.utils.clickhouse import YmirClickHouse from app.utils.ymir_controller import ControllerClient, gen_task_hash from app.libs.projects import setup_sample_project_in_background from app.libs.keywords import add_keywords from common_utils.labels import UserLabels router = APIRouter() class SortField(enum.Enum): id = "id" create_datetime = "create_datetime" @router.get("/", response_model=schemas.ProjectPaginationOut) def list_projects( db: Session = Depends(deps.get_db), current_user: models.User = Depends(deps.get_current_active_user), name: str = Query(None), start_time: int = Query(None, description="from this timestamp"), end_time: int = Query(None, description="to this timestamp"), offset: int = Query(None), limit: int = Query(None), order_by: SortField = Query(SortField.id), is_desc: bool = Query(True), ) -> Any: projects, total = crud.project.get_multi_projects( db, user_id=current_user.id, name=name, offset=offset, limit=limit, order_by=order_by.name, is_desc=is_desc, start_time=start_time, end_time=end_time, ) return {"result": {"total": total, "items": projects}} @router.post("/samples", response_model=schemas.ProjectOut) def create_sample_project( *, db: Session = Depends(deps.get_db), current_user: models.User = Depends(deps.get_current_active_user), user_labels: UserLabels = Depends(deps.get_user_labels), controller_client: ControllerClient = Depends(deps.get_controller_client), background_tasks: BackgroundTasks, cache: CacheClient = Depends(deps.get_cache), ) -> Any: project_name = f"sample_project_{current_user.username}_{time.time()}" project_in = schemas.ProjectCreate( name=project_name, training_keywords=settings.SAMPLE_PROJECT_KEYWORDS, chunk_size=1, is_example=True, ) project = crud.project.create_project(db, user_id=current_user.id, obj_in=project_in) project_task_hash = gen_task_hash(current_user.id, project.id) try: training_classes = user_labels.get_class_ids(names_or_aliases=settings.SAMPLE_PROJECT_KEYWORDS) except KeyError: add_keywords(controller_client, cache, current_user.id, settings.SAMPLE_PROJECT_KEYWORDS) user_labels = controller_client.get_labels_of_user(current_user.id) training_classes = user_labels.get_class_ids(names_or_aliases=settings.SAMPLE_PROJECT_KEYWORDS) try: resp = controller_client.create_project( user_id=current_user.id, project_id=project.id, task_id=project_task_hash, args={"training_classes": training_classes}, ) logger.info("[create task] controller response: %s", resp) except ValueError: crud.project.soft_remove(db, id=project.id) raise FailedToCreateProject() background_tasks.add_task( setup_sample_project_in_background, db, controller_client, project_name=project.name, project_id=project.id, user_id=current_user.id, project_task_hash=project_task_hash, ) return {"result": project} @router.post("/", response_model=schemas.ProjectOut) def create_project( *, db: Session = Depends(deps.get_db), current_user: models.User = Depends(deps.get_current_active_user), project_in: schemas.ProjectCreate, controller_client: ControllerClient = Depends(deps.get_controller_client), user_labels: UserLabels = Depends(deps.get_user_labels), clickhouse: YmirClickHouse = Depends(deps.get_clickhouse_client), ) -> Any: if crud.project.is_duplicated_name(db, user_id=current_user.id, name=project_in.name): raise DuplicateProjectError() project = crud.project.create_project(db, user_id=current_user.id, obj_in=project_in) task_id = gen_task_hash(current_user.id, project.id) training_classes = user_labels.get_class_ids(names_or_aliases=project_in.training_keywords) try: resp = controller_client.create_project( user_id=current_user.id, project_id=project.id, task_id=task_id, args={"training_classes": training_classes}, ) logger.info("[create task] controller response: %s", resp) except ValueError: crud.project.soft_remove(db, id=project.id) raise FailedToCreateProject() task = crud.task.create_placeholder( db, type_=TaskType.create_project, user_id=current_user.id, project_id=project.id ) dataset_name = f"{project_in.name}_training_dataset" dataset_paras = schemas.DatasetGroupCreate(name=dataset_name, project_id=project.id, user_id=current_user.id) dataset_group = crud.dataset_group.create_with_user_id(db, user_id=current_user.id, obj_in=dataset_paras) dataset_in = schemas.DatasetCreate( name=dataset_name, hash=task_id, dataset_group_id=dataset_group.id, project_id=project.id, user_id=current_user.id, source=task.type, result_state=ResultState.ready, task_id=task.id, ) initial_dataset = crud.dataset.create_with_version(db, obj_in=dataset_in) project = crud.project.update_resources( db, project_id=project.id, project_update=schemas.ProjectUpdate( training_dataset_group_id=dataset_group.id, initial_training_dataset_id=initial_dataset.id ), ) try: clickhouse.save_project_parameter( dt=project.create_datetime, user_id=project.user_id, id_=project.id, name=project.name, training_type=TrainingType(project.training_type).name, training_keywords=json.loads(project.training_keywords), ) except FailedToConnectClickHouse: logger.exception( "[create project metrics] failed to write project(%s) stats to clickhouse, continue anyway", project.name, ) logger.info("[create project] project record created: %s", project) return {"result": project} @router.get( "/{project_id}", response_model=schemas.ProjectOut, ) def get_project( *, db: Session = Depends(deps.get_db), project_id: int = Path(...), current_user: models.User = Depends(deps.get_current_active_user), ) -> Any: project = crud.project.get_by_user_and_id(db, user_id=current_user.id, id=project_id) if not project: raise ProjectNotFound() return {"result": project} @router.patch( "/{project_id}", response_model=schemas.ProjectOut, ) def update_project( *, db: Session = Depends(deps.get_db), project_id: int = Path(...), project_update: schemas.ProjectUpdate, current_user: models.User = Depends(deps.get_current_active_user), ) -> Any: project = crud.project.get_by_user_and_id(db, user_id=current_user.id, id=project_id) if not project: raise ProjectNotFound() if project_update.initial_training_dataset_id is not None: dataset = crud.dataset.get(db, id=project_update.initial_training_dataset_id) if not dataset: raise DatasetNotFound() if project.training_dataset_group_id != dataset.dataset_group_id: raise NoDatasetPermission() project = crud.project.update_resources(db, project_id=project.id, project_update=project_update) return {"result": project} @router.delete( "/{project_id}", response_model=schemas.ProjectOut, ) def delete_project( *, db: Session = Depends(deps.get_db), project_id: int = Path(...), controller_client: ControllerClient = Depends(deps.get_controller_client), current_user: models.User = Depends(deps.get_current_active_user), ) -> Any: project = crud.project.get_by_user_and_id(db, user_id=current_user.id, id=project_id) if not project: raise ProjectNotFound() project = crud.project.soft_remove(db, id=project_id) unfinished_tasks = crud.task.get_tasks_by_states( db, states=RunningStates, including_deleted=True, project_id=project_id, ) for task in unfinished_tasks: try: controller_client.terminate_task(user_id=current_user.id, task_hash=task.hash, task_type=task.type) except Exception: logger.info(f"Failed to terminate task: {task.hash} of project_id: {project_id}") continue return {"result": project}

true

1c30375076d1a9e4b146b86d5824aa4268b2444f

3,190

py

Python

code/ReID_net/scripts/postproc/crf/crf_davis.py

MTonyM/PReMVOS

3d01f0c6156628083a4c8441b4b57622c500e04e

[ "MIT" ]

140

2018-10-25T11:58:34.000Z

2022-01-18T15:29:38.000Z

code/ReID_net/scripts/postproc/crf/crf_davis.py

MTonyM/PReMVOS

3d01f0c6156628083a4c8441b4b57622c500e04e

[ "MIT" ]

18

2018-11-21T04:48:03.000Z

2020-09-14T09:30:56.000Z

code/ReID_net/scripts/postproc/crf/crf_davis.py

MTonyM/PReMVOS

3d01f0c6156628083a4c8441b4b57622c500e04e

[ "MIT" ]

32

2018-10-25T11:58:57.000Z

2021-12-27T06:13:45.000Z

#!/usr/bin/env python import pydensecrf.densecrf as dcrf from pydensecrf.utils import unary_from_softmax from scipy.ndimage import imread from scipy.misc import imsave import pickle import numpy import glob import os import matplotlib.pyplot as plt from joblib import Parallel, delayed import sys imgs_path = "/work/mahadevan/data/DAVIS/JPEGImages/480p/" annots_path = "/work/mahadevan/data/DAVIS/Annotations/480p/" preds_path_prefix = "/home/mahadevan/vision/savitar/forwarded/" def convert_path(inp): sp = inp.split("/") fwd_idx = sp.index("forwarded") seq = sp[fwd_idx + 3] fn = sp[-1] im_path = imgs_path + seq + "/" + fn.replace(".pickle", ".jpg") gt_path = annots_path + seq + "/" + fn.replace(".pickle", ".png") sp[fwd_idx + 1] += "_crf" sp[-1] = sp[-1].replace(".pickle", ".png") out_path = "/".join(sp) return im_path, gt_path, out_path def mkdir_p(d): try: os.makedirs(d) except OSError as err: if err.errno != 17: raise def apply_crf(im, pred): im = numpy.ascontiguousarray(im) pred = numpy.ascontiguousarray(pred.swapaxes(0, 2).swapaxes(1, 2)) d = dcrf.DenseCRF2D(854, 480, 2) # width, height, nlabels unaries = unary_from_softmax(pred, scale=1.0) d.setUnaryEnergy(unaries) #print im.shape # print annot.shape #print pred.shape d.addPairwiseGaussian(sxy=0.220880737269, compat=1.24845093352) d.addPairwiseBilateral(sxy=22.3761305044, srgb=7.70254062277, rgbim=im, compat=1.40326787165) processed = d.inference(12) res = numpy.argmax(processed, axis=0).reshape(480, 854) return res def do_seq(seq, model, save=True): preds_path = preds_path_prefix + model + "/valid/" files = sorted(glob.glob(preds_path + seq + "/*.pickle")) ious = [] for f in files: pred_path = f im_path, gt_path, out_path = convert_path(f) pred = pickle.load(open(pred_path)) im = imread(im_path) res = apply_crf(im, pred).astype("uint8") * 255 # before = numpy.argmax(pred, axis=2) if save: dir_ = "/".join(out_path.split("/")[:-1]) mkdir_p(dir_) imsave(out_path, res) #compute iou as well groundtruth = imread(gt_path) I = numpy.logical_and(res == 255, groundtruth == 255).sum() U = numpy.logical_or(res == 255, groundtruth == 255).sum() IOU = float(I) / U ious.append(IOU) print(out_path, "IOU", IOU) # plt.imshow(before) # plt.figure() # plt.imshow(res) # plt.show() return numpy.mean(ious[1:-1]) def main(): #seqs = ["blackswan", "bmx-trees", "breakdance", "camel", "car-roundabout", "car-shadow", "cows", "dance-twirl", # "dog", "drift-chicane", "drift-straight", "goat", "horsejump-high", "kite-surf", "libby", "motocross-jump", # "paragliding-launch", "parkour", "scooter-black", "soapbox"] seqs = ["dance-twirl"] save = True assert len(sys.argv) == 2 model = sys.argv[1] #model = "paper_nomask_DAVIS1_oneshot1_4" #ious = [] #for seq in seqs: # iou = do_seq(seq, save=save) # print iou # ious.append(iou) ious = Parallel(n_jobs=20)(delayed(do_seq)(seq, model, save=save) for seq in seqs) print(ious) print(numpy.mean(ious)) if __name__ == "__main__": main()

26.806723

118

0.658307

import pydensecrf.densecrf as dcrf from pydensecrf.utils import unary_from_softmax from scipy.ndimage import imread from scipy.misc import imsave import pickle import numpy import glob import os import matplotlib.pyplot as plt from joblib import Parallel, delayed import sys imgs_path = "/work/mahadevan/data/DAVIS/JPEGImages/480p/" annots_path = "/work/mahadevan/data/DAVIS/Annotations/480p/" preds_path_prefix = "/home/mahadevan/vision/savitar/forwarded/" def convert_path(inp): sp = inp.split("/") fwd_idx = sp.index("forwarded") seq = sp[fwd_idx + 3] fn = sp[-1] im_path = imgs_path + seq + "/" + fn.replace(".pickle", ".jpg") gt_path = annots_path + seq + "/" + fn.replace(".pickle", ".png") sp[fwd_idx + 1] += "_crf" sp[-1] = sp[-1].replace(".pickle", ".png") out_path = "/".join(sp) return im_path, gt_path, out_path def mkdir_p(d): try: os.makedirs(d) except OSError as err: if err.errno != 17: raise def apply_crf(im, pred): im = numpy.ascontiguousarray(im) pred = numpy.ascontiguousarray(pred.swapaxes(0, 2).swapaxes(1, 2)) d = dcrf.DenseCRF2D(854, 480, 2) unaries = unary_from_softmax(pred, scale=1.0) d.setUnaryEnergy(unaries) d.addPairwiseGaussian(sxy=0.220880737269, compat=1.24845093352) d.addPairwiseBilateral(sxy=22.3761305044, srgb=7.70254062277, rgbim=im, compat=1.40326787165) processed = d.inference(12) res = numpy.argmax(processed, axis=0).reshape(480, 854) return res def do_seq(seq, model, save=True): preds_path = preds_path_prefix + model + "/valid/" files = sorted(glob.glob(preds_path + seq + "/*.pickle")) ious = [] for f in files: pred_path = f im_path, gt_path, out_path = convert_path(f) pred = pickle.load(open(pred_path)) im = imread(im_path) res = apply_crf(im, pred).astype("uint8") * 255 if save: dir_ = "/".join(out_path.split("/")[:-1]) mkdir_p(dir_) imsave(out_path, res) groundtruth = imread(gt_path) I = numpy.logical_and(res == 255, groundtruth == 255).sum() U = numpy.logical_or(res == 255, groundtruth == 255).sum() IOU = float(I) / U ious.append(IOU) print(out_path, "IOU", IOU) return numpy.mean(ious[1:-1]) def main(): seqs = ["dance-twirl"] save = True assert len(sys.argv) == 2 model = sys.argv[1] ious = Parallel(n_jobs=20)(delayed(do_seq)(seq, model, save=save) for seq in seqs) print(ious) print(numpy.mean(ious)) if __name__ == "__main__": main()

true

1c30385f9a3584b953548dfaf122c9c827e4f11e

85

py

Python

yuri/exceptions.py

kanade0404/yuri

dcea86566a176be96fac0a5db19d59595e234269

[ "MIT" ]

null

yuri/exceptions.py

kanade0404/yuri

dcea86566a176be96fac0a5db19d59595e234269

[ "MIT" ]

null

yuri/exceptions.py

kanade0404/yuri

dcea86566a176be96fac0a5db19d59595e234269

[ "MIT" ]

null

class YuriException(Exception): pass class RouteError(YuriException): pass

12.142857

32

0.741176

class YuriException(Exception): pass class RouteError(YuriException): pass

true

1c3038e5ab80989a97904ddbf9925efa252264be

15,485

py

Python

salt/modules/boto_cloudtrail.py

ahammond/salt

945b21b70dbe708716d7b009a2005ef0acf76e6b

[ "Apache-2.0" ]

null

salt/modules/boto_cloudtrail.py

ahammond/salt

945b21b70dbe708716d7b009a2005ef0acf76e6b

[ "Apache-2.0" ]

null

salt/modules/boto_cloudtrail.py

ahammond/salt

945b21b70dbe708716d7b009a2005ef0acf76e6b

[ "Apache-2.0" ]

null

# -*- coding: utf-8 -*- ''' Connection module for Amazon CloudTrail .. versionadded:: 2016.3.0 :configuration: This module accepts explicit Lambda credentials but can also utilize IAM roles assigned to the instance through Instance Profiles. Dynamic credentials are then automatically obtained from AWS API and no further configuration is necessary. More Information available at: .. code-block:: text http://docs.aws.amazon.com/AWSEC2/latest/UserGuide/iam-roles-for-amazon-ec2.html If IAM roles are not used you need to specify them either in a pillar or in the minion's config file: .. code-block:: yaml cloudtrail.keyid: GKTADJGHEIQSXMKKRBJ08H cloudtrail.key: askdjghsdfjkghWupUjasdflkdfklgjsdfjajkghs A region may also be specified in the configuration: .. code-block:: yaml cloudtrail.region: us-east-1 If a region is not specified, the default is us-east-1. It's also possible to specify key, keyid and region via a profile, either as a passed in dict, or as a string to pull from pillars or minion config: .. code-block:: yaml myprofile: keyid: GKTADJGHEIQSXMKKRBJ08H key: askdjghsdfjkghWupUjasdflkdfklgjsdfjajkghs region: us-east-1 :depends: boto3 ''' # keep lint from choking on _get_conn and _cache_id #pylint: disable=E0602 # Import Python libs from __future__ import absolute_import import logging from distutils.version import LooseVersion as _LooseVersion # pylint: disable=import-error,no-name-in-module # Import Salt libs import salt.utils.boto3 import salt.utils.compat import salt.utils log = logging.getLogger(__name__) # Import third party libs # pylint: disable=import-error try: #pylint: disable=unused-import import boto import boto3 #pylint: enable=unused-import from botocore.exceptions import ClientError logging.getLogger('boto3').setLevel(logging.CRITICAL) HAS_BOTO = True except ImportError: HAS_BOTO = False # pylint: enable=import-error def __virtual__(): ''' Only load if boto libraries exist and if boto libraries are greater than a given version. ''' required_boto3_version = '1.2.5' # the boto_lambda execution module relies on the connect_to_region() method # which was added in boto 2.8.0 # https://github.com/boto/boto/commit/33ac26b416fbb48a60602542b4ce15dcc7029f12 if not HAS_BOTO: return (False, 'The boto_cloudtrial module could not be loaded: boto libraries not found') elif _LooseVersion(boto3.__version__) < _LooseVersion(required_boto3_version): return (False, 'The boto_cloudtrial module could not be loaded: ' 'boto version {0} or later must be installed.'.format(required_boto3_version)) else: return True def __init__(opts): salt.utils.compat.pack_dunder(__name__) if HAS_BOTO: __utils__['boto3.assign_funcs'](__name__, 'cloudtrail') def exists(Name, region=None, key=None, keyid=None, profile=None): ''' Given a trail name, check to see if the given trail exists. Returns True if the given trail exists and returns False if the given trail does not exist. CLI Example: .. code-block:: bash salt myminion boto_cloudtrail.exists mytrail ''' try: conn = _get_conn(region=region, key=key, keyid=keyid, profile=profile) conn.get_trail_status(Name=Name) return {'exists': True} except ClientError as e: err = salt.utils.boto3.get_error(e) if e.response.get('Error', {}).get('Code') == 'TrailNotFoundException': return {'exists': False} return {'error': err} def create(Name, S3BucketName, S3KeyPrefix=None, SnsTopicName=None, IncludeGlobalServiceEvents=None, IsMultiRegionTrail=None, EnableLogFileValidation=None, CloudWatchLogsLogGroupArn=None, CloudWatchLogsRoleArn=None, KmsKeyId=None, region=None, key=None, keyid=None, profile=None): ''' Given a valid config, create a trail. Returns {created: true} if the trail was created and returns {created: False} if the trail was not created. CLI Example: .. code-block:: bash salt myminion boto_cloudtrail.create my_trail my_bucket ''' try: conn = _get_conn(region=region, key=key, keyid=keyid, profile=profile) kwargs = {} for arg in ('S3KeyPrefix', 'SnsTopicName', 'IncludeGlobalServiceEvents', 'IsMultiRegionTrail', 'EnableLogFileValidation', 'CloudWatchLogsLogGroupArn', 'CloudWatchLogsRoleArn', 'KmsKeyId'): if locals()[arg] is not None: kwargs[arg] = locals()[arg] trail = conn.create_trail(Name=Name, S3BucketName=S3BucketName, **kwargs) if trail: log.info('The newly created trail name is {0}'.format(trail['Name'])) return {'created': True, 'name': trail['Name']} else: log.warning('Trail was not created') return {'created': False} except ClientError as e: return {'created': False, 'error': salt.utils.boto3.get_error(e)} def delete(Name, region=None, key=None, keyid=None, profile=None): ''' Given a trail name, delete it. Returns {deleted: true} if the trail was deleted and returns {deleted: false} if the trail was not deleted. CLI Example: .. code-block:: bash salt myminion boto_cloudtrail.delete mytrail ''' try: conn = _get_conn(region=region, key=key, keyid=keyid, profile=profile) conn.delete_trail(Name=Name) return {'deleted': True} except ClientError as e: return {'deleted': False, 'error': salt.utils.boto3.get_error(e)} def describe(Name, region=None, key=None, keyid=None, profile=None): ''' Given a trail name describe its properties. Returns a dictionary of interesting properties. CLI Example: .. code-block:: bash salt myminion boto_cloudtrail.describe mytrail ''' try: conn = _get_conn(region=region, key=key, keyid=keyid, profile=profile) trails = conn.describe_trails(trailNameList=[Name]) if trails and len(trails.get('trailList', [])) > 0: keys = ('Name', 'S3BucketName', 'S3KeyPrefix', 'SnsTopicName', 'IncludeGlobalServiceEvents', 'IsMultiRegionTrail', 'HomeRegion', 'TrailARN', 'LogFileValidationEnabled', 'CloudWatchLogsLogGroupArn', 'CloudWatchLogsRoleArn', 'KmsKeyId') trail = trails['trailList'].pop() return {'trail': dict([(k, trail.get(k)) for k in keys])} else: return {'trail': None} except ClientError as e: err = salt.utils.boto3.get_error(e) if e.response.get('Error', {}).get('Code') == 'TrailNotFoundException': return {'trail': None} return {'error': salt.utils.boto3.get_error(e)} def status(Name, region=None, key=None, keyid=None, profile=None): ''' Given a trail name describe its properties. Returns a dictionary of interesting properties. CLI Example: .. code-block:: bash salt myminion boto_cloudtrail.describe mytrail ''' try: conn = _get_conn(region=region, key=key, keyid=keyid, profile=profile) trail = conn.get_trail_status(Name=Name) if trail: keys = ('IsLogging', 'LatestDeliveryError', 'LatestNotificationError', 'LatestDeliveryTime', 'LatestNotificationTime', 'StartLoggingTime', 'StopLoggingTime', 'LatestCloudWatchLogsDeliveryError', 'LatestCloudWatchLogsDeliveryTime', 'LatestDigestDeliveryTime', 'LatestDigestDeliveryError', 'LatestDeliveryAttemptTime', 'LatestNotificationAttemptTime', 'LatestNotificationAttemptSucceeded', 'LatestDeliveryAttemptSucceeded', 'TimeLoggingStarted', 'TimeLoggingStopped') return {'trail': dict([(k, trail.get(k)) for k in keys])} else: return {'trail': None} except ClientError as e: err = salt.utils.boto3.get_error(e) if e.response.get('Error', {}).get('Code') == 'TrailNotFoundException': return {'trail': None} return {'error': salt.utils.boto3.get_error(e)} def list(region=None, key=None, keyid=None, profile=None): ''' List all trails Returns list of trails CLI Example: .. code-block:: yaml policies: - {...} - {...} ''' try: conn = _get_conn(region=region, key=key, keyid=keyid, profile=profile) trails = conn.describe_trails() if not bool(trails.get('trailList')): log.warning('No trails found') return {'trails': trails.get('trailList', [])} except ClientError as e: return {'error': salt.utils.boto3.get_error(e)} def update(Name, S3BucketName, S3KeyPrefix=None, SnsTopicName=None, IncludeGlobalServiceEvents=None, IsMultiRegionTrail=None, EnableLogFileValidation=None, CloudWatchLogsLogGroupArn=None, CloudWatchLogsRoleArn=None, KmsKeyId=None, region=None, key=None, keyid=None, profile=None): ''' Given a valid config, update a trail. Returns {created: true} if the trail was created and returns {created: False} if the trail was not created. CLI Example: .. code-block:: bash salt myminion boto_cloudtrail.update my_trail my_bucket ''' try: conn = _get_conn(region=region, key=key, keyid=keyid, profile=profile) kwargs = {} for arg in ('S3KeyPrefix', 'SnsTopicName', 'IncludeGlobalServiceEvents', 'IsMultiRegionTrail', 'EnableLogFileValidation', 'CloudWatchLogsLogGroupArn', 'CloudWatchLogsRoleArn', 'KmsKeyId'): if locals()[arg] is not None: kwargs[arg] = locals()[arg] trail = conn.update_trail(Name=Name, S3BucketName=S3BucketName, **kwargs) if trail: log.info('The updated trail name is {0}'.format(trail['Name'])) return {'updated': True, 'name': trail['Name']} else: log.warning('Trail was not created') return {'updated': False} except ClientError as e: return {'updated': False, 'error': salt.utils.boto3.get_error(e)} def start_logging(Name, region=None, key=None, keyid=None, profile=None): ''' Start logging for a trail Returns {started: true} if the trail was started and returns {started: False} if the trail was not started. CLI Example: .. code-block:: bash salt myminion boto_cloudtrail.start_logging my_trail ''' try: conn = _get_conn(region=region, key=key, keyid=keyid, profile=profile) conn.start_logging(Name=Name) return {'started': True} except ClientError as e: return {'started': False, 'error': salt.utils.boto3.get_error(e)} def stop_logging(Name, region=None, key=None, keyid=None, profile=None): ''' Stop logging for a trail Returns {stopped: true} if the trail was stopped and returns {stopped: False} if the trail was not stopped. CLI Example: .. code-block:: bash salt myminion boto_cloudtrail.stop_logging my_trail ''' try: conn = _get_conn(region=region, key=key, keyid=keyid, profile=profile) conn.stop_logging(Name=Name) return {'stopped': True} except ClientError as e: return {'stopped': False, 'error': salt.utils.boto3.get_error(e)} def _get_trail_arn(name, region=None, key=None, keyid=None, profile=None): if name.startswith('arn:aws:cloudtrail:'): return name account_id = __salt__['boto_iam.get_account_id']( region=region, key=key, keyid=keyid, profile=profile ) if profile and 'region' in profile: region = profile['region'] if region is None: region = 'us-east-1' return 'arn:aws:cloudtrail:{0}:{1}:trail/{2}'.format(region, account_id, name) def add_tags(Name, region=None, key=None, keyid=None, profile=None, **kwargs): ''' Add tags to a trail Returns {tagged: true} if the trail was tagged and returns {tagged: False} if the trail was not tagged. CLI Example: .. code-block:: bash salt myminion boto_cloudtrail.add_tags my_trail tag_a=tag_value tag_b=tag_value ''' try: conn = _get_conn(region=region, key=key, keyid=keyid, profile=profile) tagslist = [] for k, v in kwargs.iteritems(): if str(k).startswith('__'): continue tagslist.append({'Key': str(k), 'Value': str(v)}) conn.add_tags(ResourceId=_get_trail_arn(Name, region=region, key=key, keyid=keyid, profile=profile), TagsList=tagslist) return {'tagged': True} except ClientError as e: return {'tagged': False, 'error': salt.utils.boto3.get_error(e)} def remove_tags(Name, region=None, key=None, keyid=None, profile=None, **kwargs): ''' Remove tags from a trail Returns {tagged: true} if the trail was tagged and returns {tagged: False} if the trail was not tagged. CLI Example: .. code-block:: bash salt myminion boto_cloudtrail.remove_tags my_trail tag_a=tag_value tag_b=tag_value ''' try: conn = _get_conn(region=region, key=key, keyid=keyid, profile=profile) tagslist = [] for k, v in kwargs.iteritems(): if str(k).startswith('__'): continue tagslist.append({'Key': str(k), 'Value': str(v)}) conn.remove_tags(ResourceId=_get_trail_arn(Name, region=region, key=key, keyid=keyid, profile=profile), TagsList=tagslist) return {'tagged': True} except ClientError as e: return {'tagged': False, 'error': salt.utils.boto3.get_error(e)} def list_tags(Name, region=None, key=None, keyid=None, profile=None): ''' List tags of a trail Returns: tags: - {...} - {...} CLI Example: .. code-block:: bash salt myminion boto_cloudtrail.list_tags my_trail ''' try: conn = _get_conn(region=region, key=key, keyid=keyid, profile=profile) rid = _get_trail_arn(Name, region=region, key=key, keyid=keyid, profile=profile) ret = conn.list_tags(ResourceIdList=[rid]) tlist = ret.get('ResourceTagList', []).pop().get('TagsList') tagdict = {} for tag in tlist: tagdict[tag.get('Key')] = tag.get('Value') return {'tags': tagdict} except ClientError as e: return {'error': salt.utils.boto3.get_error(e)}

30.846614

109

0.614982

from __future__ import absolute_import import logging from distutils.version import LooseVersion as _LooseVersion import salt.utils.boto3 import salt.utils.compat import salt.utils log = logging.getLogger(__name__) try: import boto import boto3 from botocore.exceptions import ClientError logging.getLogger('boto3').setLevel(logging.CRITICAL) HAS_BOTO = True except ImportError: HAS_BOTO = False def __virtual__(): required_boto3_version = '1.2.5' if not HAS_BOTO: return (False, 'The boto_cloudtrial module could not be loaded: boto libraries not found') elif _LooseVersion(boto3.__version__) < _LooseVersion(required_boto3_version): return (False, 'The boto_cloudtrial module could not be loaded: ' 'boto version {0} or later must be installed.'.format(required_boto3_version)) else: return True def __init__(opts): salt.utils.compat.pack_dunder(__name__) if HAS_BOTO: __utils__['boto3.assign_funcs'](__name__, 'cloudtrail') def exists(Name, region=None, key=None, keyid=None, profile=None): try: conn = _get_conn(region=region, key=key, keyid=keyid, profile=profile) conn.get_trail_status(Name=Name) return {'exists': True} except ClientError as e: err = salt.utils.boto3.get_error(e) if e.response.get('Error', {}).get('Code') == 'TrailNotFoundException': return {'exists': False} return {'error': err} def create(Name, S3BucketName, S3KeyPrefix=None, SnsTopicName=None, IncludeGlobalServiceEvents=None, IsMultiRegionTrail=None, EnableLogFileValidation=None, CloudWatchLogsLogGroupArn=None, CloudWatchLogsRoleArn=None, KmsKeyId=None, region=None, key=None, keyid=None, profile=None): try: conn = _get_conn(region=region, key=key, keyid=keyid, profile=profile) kwargs = {} for arg in ('S3KeyPrefix', 'SnsTopicName', 'IncludeGlobalServiceEvents', 'IsMultiRegionTrail', 'EnableLogFileValidation', 'CloudWatchLogsLogGroupArn', 'CloudWatchLogsRoleArn', 'KmsKeyId'): if locals()[arg] is not None: kwargs[arg] = locals()[arg] trail = conn.create_trail(Name=Name, S3BucketName=S3BucketName, **kwargs) if trail: log.info('The newly created trail name is {0}'.format(trail['Name'])) return {'created': True, 'name': trail['Name']} else: log.warning('Trail was not created') return {'created': False} except ClientError as e: return {'created': False, 'error': salt.utils.boto3.get_error(e)} def delete(Name, region=None, key=None, keyid=None, profile=None): try: conn = _get_conn(region=region, key=key, keyid=keyid, profile=profile) conn.delete_trail(Name=Name) return {'deleted': True} except ClientError as e: return {'deleted': False, 'error': salt.utils.boto3.get_error(e)} def describe(Name, region=None, key=None, keyid=None, profile=None): try: conn = _get_conn(region=region, key=key, keyid=keyid, profile=profile) trails = conn.describe_trails(trailNameList=[Name]) if trails and len(trails.get('trailList', [])) > 0: keys = ('Name', 'S3BucketName', 'S3KeyPrefix', 'SnsTopicName', 'IncludeGlobalServiceEvents', 'IsMultiRegionTrail', 'HomeRegion', 'TrailARN', 'LogFileValidationEnabled', 'CloudWatchLogsLogGroupArn', 'CloudWatchLogsRoleArn', 'KmsKeyId') trail = trails['trailList'].pop() return {'trail': dict([(k, trail.get(k)) for k in keys])} else: return {'trail': None} except ClientError as e: err = salt.utils.boto3.get_error(e) if e.response.get('Error', {}).get('Code') == 'TrailNotFoundException': return {'trail': None} return {'error': salt.utils.boto3.get_error(e)} def status(Name, region=None, key=None, keyid=None, profile=None): try: conn = _get_conn(region=region, key=key, keyid=keyid, profile=profile) trail = conn.get_trail_status(Name=Name) if trail: keys = ('IsLogging', 'LatestDeliveryError', 'LatestNotificationError', 'LatestDeliveryTime', 'LatestNotificationTime', 'StartLoggingTime', 'StopLoggingTime', 'LatestCloudWatchLogsDeliveryError', 'LatestCloudWatchLogsDeliveryTime', 'LatestDigestDeliveryTime', 'LatestDigestDeliveryError', 'LatestDeliveryAttemptTime', 'LatestNotificationAttemptTime', 'LatestNotificationAttemptSucceeded', 'LatestDeliveryAttemptSucceeded', 'TimeLoggingStarted', 'TimeLoggingStopped') return {'trail': dict([(k, trail.get(k)) for k in keys])} else: return {'trail': None} except ClientError as e: err = salt.utils.boto3.get_error(e) if e.response.get('Error', {}).get('Code') == 'TrailNotFoundException': return {'trail': None} return {'error': salt.utils.boto3.get_error(e)} def list(region=None, key=None, keyid=None, profile=None): try: conn = _get_conn(region=region, key=key, keyid=keyid, profile=profile) trails = conn.describe_trails() if not bool(trails.get('trailList')): log.warning('No trails found') return {'trails': trails.get('trailList', [])} except ClientError as e: return {'error': salt.utils.boto3.get_error(e)} def update(Name, S3BucketName, S3KeyPrefix=None, SnsTopicName=None, IncludeGlobalServiceEvents=None, IsMultiRegionTrail=None, EnableLogFileValidation=None, CloudWatchLogsLogGroupArn=None, CloudWatchLogsRoleArn=None, KmsKeyId=None, region=None, key=None, keyid=None, profile=None): try: conn = _get_conn(region=region, key=key, keyid=keyid, profile=profile) kwargs = {} for arg in ('S3KeyPrefix', 'SnsTopicName', 'IncludeGlobalServiceEvents', 'IsMultiRegionTrail', 'EnableLogFileValidation', 'CloudWatchLogsLogGroupArn', 'CloudWatchLogsRoleArn', 'KmsKeyId'): if locals()[arg] is not None: kwargs[arg] = locals()[arg] trail = conn.update_trail(Name=Name, S3BucketName=S3BucketName, **kwargs) if trail: log.info('The updated trail name is {0}'.format(trail['Name'])) return {'updated': True, 'name': trail['Name']} else: log.warning('Trail was not created') return {'updated': False} except ClientError as e: return {'updated': False, 'error': salt.utils.boto3.get_error(e)} def start_logging(Name, region=None, key=None, keyid=None, profile=None): try: conn = _get_conn(region=region, key=key, keyid=keyid, profile=profile) conn.start_logging(Name=Name) return {'started': True} except ClientError as e: return {'started': False, 'error': salt.utils.boto3.get_error(e)} def stop_logging(Name, region=None, key=None, keyid=None, profile=None): try: conn = _get_conn(region=region, key=key, keyid=keyid, profile=profile) conn.stop_logging(Name=Name) return {'stopped': True} except ClientError as e: return {'stopped': False, 'error': salt.utils.boto3.get_error(e)} def _get_trail_arn(name, region=None, key=None, keyid=None, profile=None): if name.startswith('arn:aws:cloudtrail:'): return name account_id = __salt__['boto_iam.get_account_id']( region=region, key=key, keyid=keyid, profile=profile ) if profile and 'region' in profile: region = profile['region'] if region is None: region = 'us-east-1' return 'arn:aws:cloudtrail:{0}:{1}:trail/{2}'.format(region, account_id, name) def add_tags(Name, region=None, key=None, keyid=None, profile=None, **kwargs): try: conn = _get_conn(region=region, key=key, keyid=keyid, profile=profile) tagslist = [] for k, v in kwargs.iteritems(): if str(k).startswith('__'): continue tagslist.append({'Key': str(k), 'Value': str(v)}) conn.add_tags(ResourceId=_get_trail_arn(Name, region=region, key=key, keyid=keyid, profile=profile), TagsList=tagslist) return {'tagged': True} except ClientError as e: return {'tagged': False, 'error': salt.utils.boto3.get_error(e)} def remove_tags(Name, region=None, key=None, keyid=None, profile=None, **kwargs): try: conn = _get_conn(region=region, key=key, keyid=keyid, profile=profile) tagslist = [] for k, v in kwargs.iteritems(): if str(k).startswith('__'): continue tagslist.append({'Key': str(k), 'Value': str(v)}) conn.remove_tags(ResourceId=_get_trail_arn(Name, region=region, key=key, keyid=keyid, profile=profile), TagsList=tagslist) return {'tagged': True} except ClientError as e: return {'tagged': False, 'error': salt.utils.boto3.get_error(e)} def list_tags(Name, region=None, key=None, keyid=None, profile=None): try: conn = _get_conn(region=region, key=key, keyid=keyid, profile=profile) rid = _get_trail_arn(Name, region=region, key=key, keyid=keyid, profile=profile) ret = conn.list_tags(ResourceIdList=[rid]) tlist = ret.get('ResourceTagList', []).pop().get('TagsList') tagdict = {} for tag in tlist: tagdict[tag.get('Key')] = tag.get('Value') return {'tags': tagdict} except ClientError as e: return {'error': salt.utils.boto3.get_error(e)}

true

1c3039638c64ad046537ebe5a2c3abd3d2dd9cc1

5,342

py

Python

scripts/makebrainstools.py

reckbo/ppl

916d96188a43bbc5915020edfa12f14895b5f66c

[ "BSD-3-Clause" ]

null

scripts/makebrainstools.py

reckbo/ppl

916d96188a43bbc5915020edfa12f14895b5f66c

[ "BSD-3-Clause" ]

null

scripts/makebrainstools.py

reckbo/ppl

916d96188a43bbc5915020edfa12f14895b5f66c

[ "BSD-3-Clause" ]

null

#!/usr/bin/env python from __future__ import print_function from plumbum import local, FG, cli from plumbum.cmd import git, cmake, make import logging from util import logfmt import sys logger = logging.getLogger() logging.basicConfig(level=logging.DEBUG, format=logfmt(__file__)) class App(cli.Application): DESCRIPTION = "Downloads and compiles BRAINSTools binaries. Output is 'BRAINSTools-bin-<hash>'." prefix = cli.SwitchAttr('-d', cli.ExistingDirectory, help="Root directory in which to install repo", default=local.path('/data/pnl/soft')) githash = cli.SwitchAttr('-g', help='GitHub hash commit. If omitted will get latest commit from the master branch.') def main(): srcdir = self.prefix / "BRAINSTools" blddir = self.prefix / "BRAINSTools-build" logging.info("Get source:") if not srcdir.exists(): repo = 'https://github.com/BRAINSia/BRAINSTools.git' git("clone", repo, srcdir) else: with local.cwd(srcdir): git("fetch", "origin") if self.githash is not None: git("checkout", args.githash) clone_hash = git("rev-parse", "--short", "HEAD")[:-1] # remove trailing \n logging.info("Build code:") blddir.mkdir() with local.cwd(blddir): cmake(srcdir ,"-DBRAINSTools_INSTALL_DEVELOPMENT=OFF" ,"-DBRAINSTools_MAX_TEST_LEVEL=0" ,"-DBRAINSTools_SUPERBUILD=ON" ,"-DBRAINSTools_USE_QT=OFF" ,"-DBRAINS_DEBUG_IMAGE_WRITE=OFF" ,"-DBUILD_STYLE_UTILS=OFF" ,"-DBUILD_TESTING=OFF" ,"-DCMAKE_BUILD_TYPE=Release" ,"-DCMAKE_COLOR_MAKEFILE=ON" ,"-DCMAKE_EXE_LINKER_FLAGS=' '" ,"-DCMAKE_EXE_LINKER_FLAGS_DEBUG=" ,"-DCMAKE_EXE_LINKER_FLAGS_MINSIZEREL=" ,"-DCMAKE_EXE_LINKER_FLAGS_RELEASE=" ,"-DCMAKE_EXE_LINKER_FLAGS_RELWITHDEBINFO=" ,"-DCMAKE_EXPORT_COMPILE_COMMANDS=OFF" ,"-DCMAKE_INSTALL_PREFIX:PATH=/usr/local" ,"-DCMAKE_MODULE_LINKER_FLAGS=' '" ,"-DCMAKE_MODULE_LINKER_FLAGS_DEBUG=" ,"-DCMAKE_MODULE_LINKER_FLAGS_MINSIZEREL=" ,"-DCMAKE_MODULE_LINKER_FLAGS_RELEASE=" ,"-DCMAKE_MODULE_LINKER_FLAGS_RELWITHDEBINFO=" ,"-DCMAKE_PROJECT_NAME:STATIC=SuperBuild_BRAINSTools" ,"-DCMAKE_SHARED_LINKER_FLAGS=' '" ,"-DCMAKE_SHARED_LINKER_FLAGS_DEBUG=" ,"-DCMAKE_SHARED_LINKER_FLAGS_MINSIZEREL=" ,"-DCMAKE_SHARED_LINKER_FLAGS_RELEASE=" ,"-DCMAKE_SHARED_LINKER_FLAGS_RELWITHDEBINFO=" ,"-DCMAKE_SKIP_INSTALL_RPATH=NO" ,"-DCMAKE_SKIP_RPATH=NO" ,"-DCMAKE_STATIC_LINKER_FLAGS=" ,"-DCMAKE_STATIC_LINKER_FLAGS_DEBUG=" ,"-DCMAKE_STATIC_LINKER_FLAGS_MINSIZEREL=" ,"-DCMAKE_STATIC_LINKER_FLAGS_RELEASE=" ,"-DCMAKE_STATIC_LINKER_FLAGS_RELWITHDEBINFO=" ,"-DCMAKE_USE_RELATIVE_PATHS=OFF" ,"-DCMAKE_VERBOSE_MAKEFILE=FALSE" ,"-DCOVERAGE_EXTRA_FLAGS=-l" ,"-DCTEST_SUBMIT_RETRY_COUNT=3" ,"-DCTEST_SUBMIT_RETRY_DELAY=5" ,"-DDART_TESTING_TIMEOUT=1500" ,"-DEXTERNAL_PROJECT_BUILD_TYPE=Release" ,"-DFORCE_EXTERNAL_BUILDS=OFF" ,"-DITK_VERSION_MAJOR=4" ,"-DSuperBuild_BRAINSTools_BUILD_DICOM_SUPPORT=ON" ,"-DSuperBuild_BRAINSTools_USE_CTKAPPLAUNCHER=OFF" ,"-DSuperBuild_BRAINSTools_USE_GIT_PROTOCOL=ON" ,"-DUSE_ANTS=ON" ,"-DUSE_AutoWorkup=OFF" ,"-DUSE_BRAINSABC=OFF" ,"-DUSE_BRAINSConstellationDetector=OFF" ,"-DUSE_BRAINSContinuousClass=OFF" ,"-DUSE_BRAINSCreateLabelMapFromProbabilityMaps=OFF" ,"-DUSE_BRAINSCut=OFF" ,"-DUSE_BRAINSDWICleanup=OFF" ,"-DUSE_BRAINSDemonWarp=OFF" ,"-DUSE_BRAINSFit=OFF" ,"-DUSE_BRAINSInitializedControlPoints=OFF" ,"-DUSE_BRAINSLabelStats=OFF" ,"-DUSE_BRAINSLandmarkInitializer=OFF" ,"-DUSE_BRAINSMultiModeSegment=OFF" ,"-DUSE_BRAINSMultiSTAPLE=OFF" ,"-DUSE_BRAINSMush=OFF" ,"-DUSE_BRAINSPosteriorToContinuousClass=OFF" ,"-DUSE_BRAINSROIAuto=OFF" ,"-DUSE_BRAINSResample=OFF" ,"-DUSE_BRAINSSnapShotWriter=OFF" ,"-DUSE_BRAINSStripRotation=OFF" ,"-DUSE_BRAINSSurfaceTools=OFF" ,"-DUSE_BRAINSTalairach=OFF" ,"-DUSE_BRAINSTransformConvert=OFF" ,"-DUSE_ConvertBetweenFileFormats=ON" ,"-DUSE_DWIConvert=ON" ,"-DUSE_DebugImageViewer=OFF" ,"-DUSE_GTRACT=OFF" ,"-DUSE_ICCDEF=OFF" ,"-DUSE_ImageCalculator=OFF" ,"-DUSE_ReferenceAtlas=OFF" ,"-DUSE_SYSTEM_DCMTK=OFF" ,"-DUSE_SYSTEM_ITK=OFF" ,"-DUSE_SYSTEM_SlicerExecutionModel=OFF" ,"-DUSE_SYSTEM_VTK=OFF" ,"-DVTK_GIT_REPOSITORY=git://vtk.org/VTK.git" ) make['all'] & FG outbin = self.prefix / 'BRAINSTools-bin-'+clone_hash (blddir / 'bin').move(outbin) if __name__ == '__main__': main()

41.734375

142

0.610446

from __future__ import print_function from plumbum import local, FG, cli from plumbum.cmd import git, cmake, make import logging from util import logfmt import sys logger = logging.getLogger() logging.basicConfig(level=logging.DEBUG, format=logfmt(__file__)) class App(cli.Application): DESCRIPTION = "Downloads and compiles BRAINSTools binaries. Output is 'BRAINSTools-bin-<hash>'." prefix = cli.SwitchAttr('-d', cli.ExistingDirectory, help="Root directory in which to install repo", default=local.path('/data/pnl/soft')) githash = cli.SwitchAttr('-g', help='GitHub hash commit. If omitted will get latest commit from the master branch.') def main(): srcdir = self.prefix / "BRAINSTools" blddir = self.prefix / "BRAINSTools-build" logging.info("Get source:") if not srcdir.exists(): repo = 'https://github.com/BRAINSia/BRAINSTools.git' git("clone", repo, srcdir) else: with local.cwd(srcdir): git("fetch", "origin") if self.githash is not None: git("checkout", args.githash) clone_hash = git("rev-parse", "--short", "HEAD")[:-1] logging.info("Build code:") blddir.mkdir() with local.cwd(blddir): cmake(srcdir ,"-DBRAINSTools_INSTALL_DEVELOPMENT=OFF" ,"-DBRAINSTools_MAX_TEST_LEVEL=0" ,"-DBRAINSTools_SUPERBUILD=ON" ,"-DBRAINSTools_USE_QT=OFF" ,"-DBRAINS_DEBUG_IMAGE_WRITE=OFF" ,"-DBUILD_STYLE_UTILS=OFF" ,"-DBUILD_TESTING=OFF" ,"-DCMAKE_BUILD_TYPE=Release" ,"-DCMAKE_COLOR_MAKEFILE=ON" ,"-DCMAKE_EXE_LINKER_FLAGS=' '" ,"-DCMAKE_EXE_LINKER_FLAGS_DEBUG=" ,"-DCMAKE_EXE_LINKER_FLAGS_MINSIZEREL=" ,"-DCMAKE_EXE_LINKER_FLAGS_RELEASE=" ,"-DCMAKE_EXE_LINKER_FLAGS_RELWITHDEBINFO=" ,"-DCMAKE_EXPORT_COMPILE_COMMANDS=OFF" ,"-DCMAKE_INSTALL_PREFIX:PATH=/usr/local" ,"-DCMAKE_MODULE_LINKER_FLAGS=' '" ,"-DCMAKE_MODULE_LINKER_FLAGS_DEBUG=" ,"-DCMAKE_MODULE_LINKER_FLAGS_MINSIZEREL=" ,"-DCMAKE_MODULE_LINKER_FLAGS_RELEASE=" ,"-DCMAKE_MODULE_LINKER_FLAGS_RELWITHDEBINFO=" ,"-DCMAKE_PROJECT_NAME:STATIC=SuperBuild_BRAINSTools" ,"-DCMAKE_SHARED_LINKER_FLAGS=' '" ,"-DCMAKE_SHARED_LINKER_FLAGS_DEBUG=" ,"-DCMAKE_SHARED_LINKER_FLAGS_MINSIZEREL=" ,"-DCMAKE_SHARED_LINKER_FLAGS_RELEASE=" ,"-DCMAKE_SHARED_LINKER_FLAGS_RELWITHDEBINFO=" ,"-DCMAKE_SKIP_INSTALL_RPATH=NO" ,"-DCMAKE_SKIP_RPATH=NO" ,"-DCMAKE_STATIC_LINKER_FLAGS=" ,"-DCMAKE_STATIC_LINKER_FLAGS_DEBUG=" ,"-DCMAKE_STATIC_LINKER_FLAGS_MINSIZEREL=" ,"-DCMAKE_STATIC_LINKER_FLAGS_RELEASE=" ,"-DCMAKE_STATIC_LINKER_FLAGS_RELWITHDEBINFO=" ,"-DCMAKE_USE_RELATIVE_PATHS=OFF" ,"-DCMAKE_VERBOSE_MAKEFILE=FALSE" ,"-DCOVERAGE_EXTRA_FLAGS=-l" ,"-DCTEST_SUBMIT_RETRY_COUNT=3" ,"-DCTEST_SUBMIT_RETRY_DELAY=5" ,"-DDART_TESTING_TIMEOUT=1500" ,"-DEXTERNAL_PROJECT_BUILD_TYPE=Release" ,"-DFORCE_EXTERNAL_BUILDS=OFF" ,"-DITK_VERSION_MAJOR=4" ,"-DSuperBuild_BRAINSTools_BUILD_DICOM_SUPPORT=ON" ,"-DSuperBuild_BRAINSTools_USE_CTKAPPLAUNCHER=OFF" ,"-DSuperBuild_BRAINSTools_USE_GIT_PROTOCOL=ON" ,"-DUSE_ANTS=ON" ,"-DUSE_AutoWorkup=OFF" ,"-DUSE_BRAINSABC=OFF" ,"-DUSE_BRAINSConstellationDetector=OFF" ,"-DUSE_BRAINSContinuousClass=OFF" ,"-DUSE_BRAINSCreateLabelMapFromProbabilityMaps=OFF" ,"-DUSE_BRAINSCut=OFF" ,"-DUSE_BRAINSDWICleanup=OFF" ,"-DUSE_BRAINSDemonWarp=OFF" ,"-DUSE_BRAINSFit=OFF" ,"-DUSE_BRAINSInitializedControlPoints=OFF" ,"-DUSE_BRAINSLabelStats=OFF" ,"-DUSE_BRAINSLandmarkInitializer=OFF" ,"-DUSE_BRAINSMultiModeSegment=OFF" ,"-DUSE_BRAINSMultiSTAPLE=OFF" ,"-DUSE_BRAINSMush=OFF" ,"-DUSE_BRAINSPosteriorToContinuousClass=OFF" ,"-DUSE_BRAINSROIAuto=OFF" ,"-DUSE_BRAINSResample=OFF" ,"-DUSE_BRAINSSnapShotWriter=OFF" ,"-DUSE_BRAINSStripRotation=OFF" ,"-DUSE_BRAINSSurfaceTools=OFF" ,"-DUSE_BRAINSTalairach=OFF" ,"-DUSE_BRAINSTransformConvert=OFF" ,"-DUSE_ConvertBetweenFileFormats=ON" ,"-DUSE_DWIConvert=ON" ,"-DUSE_DebugImageViewer=OFF" ,"-DUSE_GTRACT=OFF" ,"-DUSE_ICCDEF=OFF" ,"-DUSE_ImageCalculator=OFF" ,"-DUSE_ReferenceAtlas=OFF" ,"-DUSE_SYSTEM_DCMTK=OFF" ,"-DUSE_SYSTEM_ITK=OFF" ,"-DUSE_SYSTEM_SlicerExecutionModel=OFF" ,"-DUSE_SYSTEM_VTK=OFF" ,"-DVTK_GIT_REPOSITORY=git://vtk.org/VTK.git" ) make['all'] & FG outbin = self.prefix / 'BRAINSTools-bin-'+clone_hash (blddir / 'bin').move(outbin) if __name__ == '__main__': main()

true