hexsha
stringlengths
40
40
size
int64
4
996k
ext
stringclasses
8 values
lang
stringclasses
1 value
max_stars_repo_path
stringlengths
4
245
max_stars_repo_name
stringlengths
6
130
max_stars_repo_head_hexsha
stringlengths
40
40
max_stars_repo_licenses
listlengths
1
10
max_stars_count
int64
1
191k
max_stars_repo_stars_event_min_datetime
stringlengths
24
24
max_stars_repo_stars_event_max_datetime
stringlengths
24
24
max_issues_repo_path
stringlengths
4
245
max_issues_repo_name
stringlengths
6
130
max_issues_repo_head_hexsha
stringlengths
40
40
max_issues_repo_licenses
listlengths
1
10
max_issues_count
int64
1
67k
max_issues_repo_issues_event_min_datetime
stringlengths
24
24
max_issues_repo_issues_event_max_datetime
stringlengths
24
24
max_forks_repo_path
stringlengths
4
245
max_forks_repo_name
stringlengths
6
130
max_forks_repo_head_hexsha
stringlengths
40
40
max_forks_repo_licenses
listlengths
1
10
max_forks_count
int64
1
105k
max_forks_repo_forks_event_min_datetime
stringlengths
24
24
max_forks_repo_forks_event_max_datetime
stringlengths
24
24
content
stringlengths
4
996k
avg_line_length
float64
1.33
58.2k
max_line_length
int64
2
323k
alphanum_fraction
float64
0
0.97
content_no_comment
stringlengths
0
946k
is_comment_constant_removed
bool
2 classes
is_sharp_comment_removed
bool
1 class
f7f95f9615b05c360f3b746d960b369e9ed3a45d
1,570
py
Python
hddm/models/hddm_truncated.py
hddm-devs/hddm
fe119ec9834d56c78f8ee3cb59a616c8a5d082bf
[ "BSD-2-Clause-FreeBSD" ]
155
2015-01-10T22:44:55.000Z
2022-03-27T00:39:33.000Z
hddm/models/hddm_truncated.py
hddm-devs/hddm
fe119ec9834d56c78f8ee3cb59a616c8a5d082bf
[ "BSD-2-Clause-FreeBSD" ]
38
2015-09-26T11:48:56.000Z
2022-02-18T04:53:51.000Z
hddm/models/hddm_truncated.py
hddm-devs/hddm
fe119ec9834d56c78f8ee3cb59a616c8a5d082bf
[ "BSD-2-Clause-FreeBSD" ]
97
2015-01-21T09:03:41.000Z
2022-03-26T13:12:15.000Z
from collections import OrderedDict from hddm.models import HDDMBase class HDDMTruncated(HDDMBase): def _create_stochastic_knodes(self, include): knodes = OrderedDict() if "a" in include: knodes.update( self._create_family_trunc_normal("a", lower=1e-3, upper=1e3, value=1) ) if "v" in include: knodes.update(self._create_family_normal("v", value=0)) if "t" in include: knodes.update( self._create_family_trunc_normal("t", lower=1e-3, upper=1e3, value=0.01) ) if "sv" in include: # TW: Use kabuki.utils.HalfCauchy, S=10, value=1 instead? knodes.update( self._create_family_trunc_normal("sv", lower=0, upper=1e3, value=1) ) # knodes.update(self._create_family_exp('sv', value=1)) if "sz" in include: knodes.update( self._create_family_trunc_normal("sz", lower=0, upper=1, value=0.1) ) if "st" in include: knodes.update( self._create_family_trunc_normal("st", lower=0, upper=1e3, value=0.01) ) if "z" in include: knodes.update( self._create_family_trunc_normal("z", lower=0, upper=1, value=0.5) ) if "p_outlier" in include: knodes.update( self._create_family_trunc_normal( "p_outlier", lower=0, upper=1, value=0.05 ) ) return knodes
34.888889
88
0.543949
from collections import OrderedDict from hddm.models import HDDMBase class HDDMTruncated(HDDMBase): def _create_stochastic_knodes(self, include): knodes = OrderedDict() if "a" in include: knodes.update( self._create_family_trunc_normal("a", lower=1e-3, upper=1e3, value=1) ) if "v" in include: knodes.update(self._create_family_normal("v", value=0)) if "t" in include: knodes.update( self._create_family_trunc_normal("t", lower=1e-3, upper=1e3, value=0.01) ) if "sv" in include: knodes.update( self._create_family_trunc_normal("sv", lower=0, upper=1e3, value=1) ) if "sz" in include: knodes.update( self._create_family_trunc_normal("sz", lower=0, upper=1, value=0.1) ) if "st" in include: knodes.update( self._create_family_trunc_normal("st", lower=0, upper=1e3, value=0.01) ) if "z" in include: knodes.update( self._create_family_trunc_normal("z", lower=0, upper=1, value=0.5) ) if "p_outlier" in include: knodes.update( self._create_family_trunc_normal( "p_outlier", lower=0, upper=1, value=0.05 ) ) return knodes
true
true
f7f9600f84f07b15d9cbc2fb0ec3ee0ce608c06f
922
py
Python
bots/iam_group_delete_inline_policy.py
chkp-stuartgreen/cloud-bots
9ee36270675cb4efc1022bfec2013a7dce7ae8ca
[ "BSD-3-Clause" ]
68
2019-09-26T10:25:35.000Z
2022-03-27T01:32:46.000Z
bots/iam_group_delete_inline_policy.py
chkp-stuartgreen/cloud-bots
9ee36270675cb4efc1022bfec2013a7dce7ae8ca
[ "BSD-3-Clause" ]
18
2020-02-17T16:30:47.000Z
2021-09-26T14:14:54.000Z
bots/iam_group_delete_inline_policy.py
chkp-stuartgreen/cloud-bots
9ee36270675cb4efc1022bfec2013a7dce7ae8ca
[ "BSD-3-Clause" ]
42
2019-10-03T19:31:42.000Z
2022-03-21T19:29:12.000Z
""" ## iam_group_delete_inline_group What it does: Deletes a inline policy attached to iam group Usage: AUTO: iam_group_delete_inline_group Limitations: none """ import boto3 from botocore.exceptions import ClientError def run_action(session, rule, entity, params): iam_resource = session.resource('iam') iam_group = iam_resource.Group(entity['name']) # take the names of the policies that we need to delete inline_policies = [policy['name'] for policy in entity['inlinePolicies']] try: text_output = "" # iterates over the policies and delete the inline policies for policy in iam_group.policies.all(): if policy.name in inline_policies: policy.delete() text_output += f"Deleted inline policy '{policy.name}'\n" except ClientError as e: text_output = "Unexpected error: %s \n" % e return text_output
31.793103
77
0.67679
import boto3 from botocore.exceptions import ClientError def run_action(session, rule, entity, params): iam_resource = session.resource('iam') iam_group = iam_resource.Group(entity['name']) inline_policies = [policy['name'] for policy in entity['inlinePolicies']] try: text_output = "" for policy in iam_group.policies.all(): if policy.name in inline_policies: policy.delete() text_output += f"Deleted inline policy '{policy.name}'\n" except ClientError as e: text_output = "Unexpected error: %s \n" % e return text_output
true
true
f7f96074843d793b73779707a2acd560569b5b85
775
py
Python
conftest.py
DataFinnovation/Arelle
d4bf45f56fc9249f75ab22e6217dbe55f0510841
[ "Apache-2.0" ]
292
2015-01-27T03:31:51.000Z
2022-03-26T07:00:05.000Z
conftest.py
DataFinnovation/Arelle
d4bf45f56fc9249f75ab22e6217dbe55f0510841
[ "Apache-2.0" ]
94
2015-04-18T23:03:00.000Z
2022-03-28T17:24:55.000Z
conftest.py
DataFinnovation/Arelle
d4bf45f56fc9249f75ab22e6217dbe55f0510841
[ "Apache-2.0" ]
200
2015-01-13T03:55:47.000Z
2022-03-29T12:38:56.000Z
''' Created on May 14,2012 Use this module to start Arelle in py.test modes @author: Mark V Systems Limited (c) Copyright 2012 Mark V Systems Limited, All rights reserved. This module supports the conformance tests to validate that Arelle is working properly. See arelle_test.py. ''' import os def pytest_addoption(parser): tests_default = os.path.join(os.path.dirname(os.path.abspath(__file__)), os.path.join('arelle', os.path.join('config', 'arelle_test.ini'))) parser.addoption('--tests', default=tests_default, help='.ini file to load test suites from (default is arelle/confi/arelle_test.ini)')
32.291667
105
0.597419
import os def pytest_addoption(parser): tests_default = os.path.join(os.path.dirname(os.path.abspath(__file__)), os.path.join('arelle', os.path.join('config', 'arelle_test.ini'))) parser.addoption('--tests', default=tests_default, help='.ini file to load test suites from (default is arelle/confi/arelle_test.ini)')
true
true
f7f96088b00b62928af84ce163584586cc34a11e
5,026
py
Python
mordl/feat_tagger_model.py
fostroll/mordl
992d724f43709483901dd55d1f9aa80791dbccb2
[ "BSD-3-Clause" ]
5
2020-07-27T05:38:17.000Z
2021-12-30T09:44:07.000Z
mordl/feat_tagger_model.py
fostroll/mordl
992d724f43709483901dd55d1f9aa80791dbccb2
[ "BSD-3-Clause" ]
null
null
null
mordl/feat_tagger_model.py
fostroll/mordl
992d724f43709483901dd55d1f9aa80791dbccb2
[ "BSD-3-Clause" ]
null
null
null
# -*- coding: utf-8 -*- # MorDL project: NE tagger model # # Copyright (C) 2020-present by Sergei Ternovykh, Anastasiya Nikiforova # License: BSD, see LICENSE for details """ Provides FEAT tagger model inherited from `mordl.BaseTaggerModel`. """ from collections.abc import Iterable from junky import get_func_params from mordl.base_tagger_model import BaseTaggerModel from mordl.defaults import CONFIG_ATTR class FeatTaggerModel(BaseTaggerModel): """ The class for prediction the content of a key-value type field. Separated implementation (predict only one particular field at a time). Args: **num_labels** (`int`): the number of target labels. Don't forget to add `1` for padding. **labels_pad_idx** (`int`; default=-100): the index of padding element in the label vocabulary. You can specify here the real index of the padding intent, but we recommend to keep it as is (with default fake index) because in practice, learning on padding increasing the resulting model performance. If you stil want to experiment, along with specifying the real padding index, you may try not to add `1` to **num_labels** for the padding intent. The model then put random labels as tags for the padding part of the input, but they are ignored during the loss computation. **vec_emb_dim** (`int`; default is `None`): the incoming word-level embedding vector space dimensionality. **alphabet_size** (`int`): the length of character vocabulary for the internal character-level embedding layer. Relevant if either **rnn_emb_dim** or **cnn_emb_dim** is not `None`. **char_pad_idx** (`int`; default is `0`): the index of the padding element in the character vocabulary of the internal character-level embedding layer. Relevant if either **rnn_emb_dim** or **cnn_emb_dim** is not `None`. **rnn_emb_dim** (`int`; default is `None`): the internal character RNN (LSTM) embedding dimensionality. If `None`, the layer is skipped. **cnn_emb_dim** (`int`; default is `200`): the internal character CNN embedding dimensionality. If `None`, the layer is skipped. **cnn_kernels** (`list([int])`; default is `[1, 2, 3, 4, 5, 6]`): CNN kernel sizes of the internal CNN embedding layer. Relevant if **cnn_emb_dim** is not `None`. **upos_emb_dim** (`int`; default is `200`): the auxiliary UPOS label embedding dimensionality. **upos_num** (`int`): the length of UPOS vocabulary. **upos_pad_idx** (`int`; default is `0`): the index of padding element in the UPOS vocabulary. **emb_bn** (`bool`; default is `True`): whether batch normalization layer should be applied after the embedding concatenation. **emb_do** (`float`; default is `.2`): the dropout rate after the embedding concatenation. **final_emb_dim** (`int`; default is `512`): the output dimesionality of the linear transformation applying to concatenated embeddings. **pre_bn** (`bool`; default is `True`): whether batch normalization layer should be applied before the main part of the algorithm. **pre_do** (`float`; default is `.5`): the dropout rate before the main part of the algorithm. **lstm_layers** (`int`; default is `1`): the number of Bidirectional LSTM layers. If `None`, they are not created. **lstm_do** (`float`; default is `0`): the dropout between LSTM layers. Only relevant, if `lstm_layers` > `1`. **tran_layers** (`int`; default is `None`): the number of Transformer Encoder layers. If `None`, they are not created. **tran_heads** (`int`; default is `8`): the number of attention heads of Transformer Encoder layers. Only relevant, if `tran_layers` > `1`. **post_bn** (`bool`; default is `True`): whether batch normalization layer should be applied after the main part of the algorithm. **post_do** (`float`; default is `.4`): the dropout rate after the main part of the algorithm. """ def __init__(self, num_labels, labels_pad_idx=-100, vec_emb_dim=None, alphabet_size=0, char_pad_idx=0, rnn_emb_dim=None, cnn_emb_dim=200, cnn_kernels=[1, 2, 3, 4, 5, 6], upos_emb_dim=200, upos_num=0, upos_pad_idx=0, emb_bn=True, emb_do=.2, final_emb_dim=512, pre_bn=True, pre_do=.5, lstm_layers=1, lstm_do=0, tran_layers=None, tran_heads=8, post_bn=True, post_do=.4): if isinstance(cnn_kernels, Iterable): cnn_kernels = list(cnn_kernels) args, kwargs = get_func_params(FeatTaggerModel.__init__, locals()) kwargs_ = {x: y for x, y in kwargs.items() if x not in [ 'upos_emb_dim', 'upos_num', 'upos_pad_idx' ]} if upos_emb_dim: kwargs_['tag_emb_params'] = { 'dim': upos_emb_dim, 'num': upos_num, 'pad_idx': upos_pad_idx } super().__init__(*args, **kwargs_) setattr(self, CONFIG_ATTR, (args, kwargs))
43.327586
79
0.672503
from collections.abc import Iterable from junky import get_func_params from mordl.base_tagger_model import BaseTaggerModel from mordl.defaults import CONFIG_ATTR class FeatTaggerModel(BaseTaggerModel): def __init__(self, num_labels, labels_pad_idx=-100, vec_emb_dim=None, alphabet_size=0, char_pad_idx=0, rnn_emb_dim=None, cnn_emb_dim=200, cnn_kernels=[1, 2, 3, 4, 5, 6], upos_emb_dim=200, upos_num=0, upos_pad_idx=0, emb_bn=True, emb_do=.2, final_emb_dim=512, pre_bn=True, pre_do=.5, lstm_layers=1, lstm_do=0, tran_layers=None, tran_heads=8, post_bn=True, post_do=.4): if isinstance(cnn_kernels, Iterable): cnn_kernels = list(cnn_kernels) args, kwargs = get_func_params(FeatTaggerModel.__init__, locals()) kwargs_ = {x: y for x, y in kwargs.items() if x not in [ 'upos_emb_dim', 'upos_num', 'upos_pad_idx' ]} if upos_emb_dim: kwargs_['tag_emb_params'] = { 'dim': upos_emb_dim, 'num': upos_num, 'pad_idx': upos_pad_idx } super().__init__(*args, **kwargs_) setattr(self, CONFIG_ATTR, (args, kwargs))
true
true
f7f960c892da708be89832a6e7d3ee2cfb58ff29
5,775
py
Python
docs/source/conf.py
5amessi/camel_tools
4349f8ccda2cc5d017d3bd5683847cf92bbb1229
[ "MIT" ]
211
2019-03-26T02:56:16.000Z
2022-03-26T10:39:47.000Z
docs/source/conf.py
5amessi/camel_tools
4349f8ccda2cc5d017d3bd5683847cf92bbb1229
[ "MIT" ]
51
2019-09-11T09:41:02.000Z
2022-03-30T06:15:28.000Z
docs/source/conf.py
5amessi/camel_tools
4349f8ccda2cc5d017d3bd5683847cf92bbb1229
[ "MIT" ]
49
2018-12-27T06:58:05.000Z
2022-03-12T18:21:50.000Z
# -*- coding: utf-8 -*- # # Configuration file for the Sphinx documentation builder. # # This file does only contain a selection of the most common options. For a # full list see the documentation: # http://www.sphinx-doc.org/en/master/config # -- Path setup -------------------------------------------------------------- # If extensions (or modules to document with autodoc) are in another directory, # add these directories to sys.path here. If the directory is relative to the # documentation root, use os.path.abspath to make it absolute, like shown here. # # import os # import sys # sys.path.insert(0, os.path.abspath('.')) # -- Extension Imports ------------------------------------------------------- from recommonmark.parser import CommonMarkParser # -- Project information ----------------------------------------------------- project = 'camel_tools' copyright = '2018-2021, New York University Abu Dhabi' author = 'Ossama W. Obeid' # The short X.Y version version = '1.2' # The full version, including alpha/beta/rc tags release = '1.2.0' # -- General configuration --------------------------------------------------- # If your documentation needs a minimal Sphinx version, state it here. # # needs_sphinx = '1.0' # Add any Sphinx extension module names here, as strings. They can be # extensions coming with Sphinx (named 'sphinx.ext.*') or your custom # ones. extensions = [ 'sphinx.ext.napoleon', 'sphinx.ext.autodoc', 'sphinx.ext.githubpages', 'sphinx.ext.intersphinx' ] intersphinx_mapping = { 'python': ('https://docs.python.org/3', None) } # Add any paths that contain templates here, relative to this directory. templates_path = ['_templates'] # Source parsers source_parsers = { '.md': CommonMarkParser, } # The suffix(es) of source filenames. # You can specify multiple suffix as a list of string: # source_suffix = ['.rst', '.md'] # source_suffix = '.rst' # The master toctree document. master_doc = 'index' # The language for content autogenerated by Sphinx. Refer to documentation # for a list of supported languages. # # This is also used if you do content translation via gettext catalogs. # Usually you set "language" from the command line for these cases. language = None # List of patterns, relative to source directory, that match files and # directories to ignore when looking for source files. # This pattern also affects html_static_path and html_extra_path. exclude_patterns = [] # The name of the Pygments (syntax highlighting) style to use. pygments_style = None # -- Options for HTML output ------------------------------------------------- # The theme to use for HTML and HTML Help pages. See the documentation for # a list of builtin themes. # html_theme = 'sphinx_rtd_theme' # Theme options are theme-specific and customize the look and feel of a theme # further. For a list of options available for each theme, see the # documentation. # # html_theme_options = {} # Add any paths that contain custom static files (such as style sheets) here, # relative to this directory. They are copied after the builtin static files, # so a file named "default.css" will overwrite the builtin "default.css". html_static_path = ['_static'] # Custom sidebar templates, must be a dictionary that maps document names # to template names. # # The default sidebars (for documents that don't match any pattern) are # defined by theme itself. Builtin themes are using these templates by # default: ``['localtoc.html', 'relations.html', 'sourcelink.html', # 'searchbox.html']``. # # html_sidebars = {} # -- Options for HTMLHelp output --------------------------------------------- # Output file base name for HTML help builder. htmlhelp_basename = 'camel_tools_doc' # -- Options for LaTeX output ------------------------------------------------ latex_elements = { # The paper size ('letterpaper' or 'a4paper'). # # 'papersize': 'letterpaper', # The font size ('10pt', '11pt' or '12pt'). # # 'pointsize': '10pt', # Additional stuff for the LaTeX preamble. # # 'preamble': '', # Latex figure (float) alignment # # 'figure_align': 'htbp', } # Grouping the document tree into LaTeX files. List of tuples # (source start file, target name, title, # author, documentclass [howto, manual, or own class]). latex_documents = [ (master_doc, 'camel_tools.tex', 'CAMeL Tools Documentation', 'Ossama W. Obeid', 'manual'), ] # -- Options for manual page output ------------------------------------------ # One entry per manual page. List of tuples # (source start file, name, description, authors, manual section). man_pages = [ (master_doc, 'camel_tools', 'camel_tools Documentation', [author], 1) ] # -- Options for Texinfo output ---------------------------------------------- # Grouping the document tree into Texinfo files. List of tuples # (source start file, target name, title, author, # dir menu entry, description, category) texinfo_documents = [ (master_doc, 'camel_tools', 'camel_tools Documentation', author, 'camel_tools', 'A suite of Arabic natural language processing tools developed by the ' 'CAMeL Lab at New York University Abu Dhabi.', 'Miscellaneous'), ] # -- Options for Epub output ------------------------------------------------- # Bibliographic Dublin Core info. epub_title = project # The unique identifier of the text. This can be a ISBN number # or the project homepage. # # epub_identifier = '' # A unique identification for the text. # # epub_uid = '' # A list of files that should not be packed into the epub file. epub_exclude_files = ['search.html'] # -- Extension configuration ------------------------------------------------- autodoc_mock_imports = [ 'kenlm' ]
29.020101
79
0.645714
from recommonmark.parser import CommonMarkParser project = 'camel_tools' copyright = '2018-2021, New York University Abu Dhabi' author = 'Ossama W. Obeid' version = '1.2' release = '1.2.0' extensions = [ 'sphinx.ext.napoleon', 'sphinx.ext.autodoc', 'sphinx.ext.githubpages', 'sphinx.ext.intersphinx' ] intersphinx_mapping = { 'python': ('https://docs.python.org/3', None) } templates_path = ['_templates'] source_parsers = { '.md': CommonMarkParser, } source_suffix = ['.rst', '.md'] master_doc = 'index' language = None exclude_patterns = [] pygments_style = None html_theme = 'sphinx_rtd_theme' html_static_path = ['_static'] # defined by theme itself. Builtin themes are using these templates by # default: ``['localtoc.html', 'relations.html', 'sourcelink.html', # 'searchbox.html']``. # # html_sidebars = {} # -- Options for HTMLHelp output --------------------------------------------- # Output file base name for HTML help builder. htmlhelp_basename = 'camel_tools_doc' # -- Options for LaTeX output ------------------------------------------------ latex_elements = { # The paper size ('letterpaper' or 'a4paper'). # # 'papersize': 'letterpaper', # The font size ('10pt', '11pt' or '12pt'). # # 'pointsize': '10pt', # Additional stuff for the LaTeX preamble. # # 'preamble': '', # Latex figure (float) alignment # # 'figure_align': 'htbp', } # Grouping the document tree into LaTeX files. List of tuples # (source start file, target name, title, # author, documentclass [howto, manual, or own class]). latex_documents = [ (master_doc, 'camel_tools.tex', 'CAMeL Tools Documentation', 'Ossama W. Obeid', 'manual'), ] # -- Options for manual page output ------------------------------------------ # One entry per manual page. List of tuples # (source start file, name, description, authors, manual section). man_pages = [ (master_doc, 'camel_tools', 'camel_tools Documentation', [author], 1) ] # -- Options for Texinfo output ---------------------------------------------- # Grouping the document tree into Texinfo files. List of tuples # (source start file, target name, title, author, # dir menu entry, description, category) texinfo_documents = [ (master_doc, 'camel_tools', 'camel_tools Documentation', author, 'camel_tools', 'A suite of Arabic natural language processing tools developed by the ' 'CAMeL Lab at New York University Abu Dhabi.', 'Miscellaneous'), ] # -- Options for Epub output ------------------------------------------------- # Bibliographic Dublin Core info. epub_title = project # The unique identifier of the text. This can be a ISBN number # or the project homepage. # # epub_identifier = '' # A unique identification for the text. # # epub_uid = '' # A list of files that should not be packed into the epub file. epub_exclude_files = ['search.html'] # -- Extension configuration ------------------------------------------------- autodoc_mock_imports = [ 'kenlm' ]
true
true
f7f961931e4e2947a74e29289b0e354d789d7bdc
5,338
py
Python
generate.py
BookML/stylegan2-ada-pytorch
d4b2afe9c27e3c305b721bc886d2cb5229458eba
[ "BSD-Source-Code" ]
1,054
2020-06-19T01:32:35.000Z
2022-03-28T20:01:49.000Z
generate.py
BookML/stylegan2-ada-pytorch
d4b2afe9c27e3c305b721bc886d2cb5229458eba
[ "BSD-Source-Code" ]
88
2020-06-20T01:57:42.000Z
2022-03-31T23:45:04.000Z
generate.py
BookML/stylegan2-ada-pytorch
d4b2afe9c27e3c305b721bc886d2cb5229458eba
[ "BSD-Source-Code" ]
155
2020-06-19T02:45:43.000Z
2022-03-29T19:53:44.000Z
# Copyright (c) 2021, NVIDIA CORPORATION. All rights reserved. # # NVIDIA CORPORATION and its licensors retain all intellectual property # and proprietary rights in and to this software, related documentation # and any modifications thereto. Any use, reproduction, disclosure or # distribution of this software and related documentation without an express # license agreement from NVIDIA CORPORATION is strictly prohibited. """Generate images using pretrained network pickle.""" import os import re from typing import List, Optional import click import dnnlib import numpy as np import PIL.Image import torch import legacy #---------------------------------------------------------------------------- def num_range(s: str) -> List[int]: '''Accept either a comma separated list of numbers 'a,b,c' or a range 'a-c' and return as a list of ints.''' range_re = re.compile(r'^(\d+)-(\d+)$') m = range_re.match(s) if m: return list(range(int(m.group(1)), int(m.group(2))+1)) vals = s.split(',') return [int(x) for x in vals] #---------------------------------------------------------------------------- @click.command() @click.pass_context @click.option('--network', 'network_pkl', help='Network pickle filename', required=True) @click.option('--seeds', type=num_range, help='List of random seeds') @click.option('--trunc', 'truncation_psi', type=float, help='Truncation psi', default=1, show_default=True) @click.option('--class', 'class_idx', type=int, help='Class label (unconditional if not specified)') @click.option('--noise-mode', help='Noise mode', type=click.Choice(['const', 'random', 'none']), default='const', show_default=True) @click.option('--projected-w', help='Projection result file', type=str, metavar='FILE') @click.option('--outdir', help='Where to save the output images', type=str, required=True, metavar='DIR') def generate_images( ctx: click.Context, network_pkl: str, seeds: Optional[List[int]], truncation_psi: float, noise_mode: str, outdir: str, class_idx: Optional[int], projected_w: Optional[str] ): """Generate images using pretrained network pickle. Examples: \b # Generate curated MetFaces images without truncation (Fig.10 left) python generate.py --outdir=out --trunc=1 --seeds=85,265,297,849 \\ --network=https://nvlabs-fi-cdn.nvidia.com/stylegan2-ada-pytorch/pretrained/metfaces.pkl \b # Generate uncurated MetFaces images with truncation (Fig.12 upper left) python generate.py --outdir=out --trunc=0.7 --seeds=600-605 \\ --network=https://nvlabs-fi-cdn.nvidia.com/stylegan2-ada-pytorch/pretrained/metfaces.pkl \b # Generate class conditional CIFAR-10 images (Fig.17 left, Car) python generate.py --outdir=out --seeds=0-35 --class=1 \\ --network=https://nvlabs-fi-cdn.nvidia.com/stylegan2-ada-pytorch/pretrained/cifar10.pkl \b # Render an image from projected W python generate.py --outdir=out --projected_w=projected_w.npz \\ --network=https://nvlabs-fi-cdn.nvidia.com/stylegan2-ada-pytorch/pretrained/metfaces.pkl """ print('Loading networks from "%s"...' % network_pkl) device = torch.device('cuda') with dnnlib.util.open_url(network_pkl) as f: G = legacy.load_network_pkl(f)['G_ema'].to(device) # type: ignore os.makedirs(outdir, exist_ok=True) # Synthesize the result of a W projection. if projected_w is not None: if seeds is not None: print ('warn: --seeds is ignored when using --projected-w') print(f'Generating images from projected W "{projected_w}"') ws = np.load(projected_w)['w'] ws = torch.tensor(ws, device=device) # pylint: disable=not-callable assert ws.shape[1:] == (G.num_ws, G.w_dim) for idx, w in enumerate(ws): img = G.synthesis(w.unsqueeze(0), noise_mode=noise_mode) img = (img.permute(0, 2, 3, 1) * 127.5 + 128).clamp(0, 255).to(torch.uint8) img = PIL.Image.fromarray(img[0].cpu().numpy(), 'RGB').save(f'{outdir}/proj{idx:02d}.png') return if seeds is None: ctx.fail('--seeds option is required when not using --projected-w') # Labels. label = torch.zeros([1, G.c_dim], device=device) if G.c_dim != 0: if class_idx is None: ctx.fail('Must specify class label with --class when using a conditional network') label[:, class_idx] = 1 else: if class_idx is not None: print ('warn: --class=lbl ignored when running on an unconditional network') # Generate images. for seed_idx, seed in enumerate(seeds): print('Generating image for seed %d (%d/%d) ...' % (seed, seed_idx, len(seeds))) z = torch.from_numpy(np.random.RandomState(seed).randn(1, G.z_dim)).to(device) img = G(z, label, truncation_psi=truncation_psi, noise_mode=noise_mode) img = (img.permute(0, 2, 3, 1) * 127.5 + 128).clamp(0, 255).to(torch.uint8) PIL.Image.fromarray(img[0].cpu().numpy(), 'RGB').save(f'{outdir}/seed{seed:04d}.png') #---------------------------------------------------------------------------- if __name__ == "__main__": generate_images() # pylint: disable=no-value-for-parameter #----------------------------------------------------------------------------
41.061538
132
0.630948
import os import re from typing import List, Optional import click import dnnlib import numpy as np import PIL.Image import torch import legacy def num_range(s: str) -> List[int]: range_re = re.compile(r'^(\d+)-(\d+)$') m = range_re.match(s) if m: return list(range(int(m.group(1)), int(m.group(2))+1)) vals = s.split(',') return [int(x) for x in vals] @click.command() @click.pass_context @click.option('--network', 'network_pkl', help='Network pickle filename', required=True) @click.option('--seeds', type=num_range, help='List of random seeds') @click.option('--trunc', 'truncation_psi', type=float, help='Truncation psi', default=1, show_default=True) @click.option('--class', 'class_idx', type=int, help='Class label (unconditional if not specified)') @click.option('--noise-mode', help='Noise mode', type=click.Choice(['const', 'random', 'none']), default='const', show_default=True) @click.option('--projected-w', help='Projection result file', type=str, metavar='FILE') @click.option('--outdir', help='Where to save the output images', type=str, required=True, metavar='DIR') def generate_images( ctx: click.Context, network_pkl: str, seeds: Optional[List[int]], truncation_psi: float, noise_mode: str, outdir: str, class_idx: Optional[int], projected_w: Optional[str] ): print('Loading networks from "%s"...' % network_pkl) device = torch.device('cuda') with dnnlib.util.open_url(network_pkl) as f: G = legacy.load_network_pkl(f)['G_ema'].to(device) os.makedirs(outdir, exist_ok=True) if projected_w is not None: if seeds is not None: print ('warn: --seeds is ignored when using --projected-w') print(f'Generating images from projected W "{projected_w}"') ws = np.load(projected_w)['w'] ws = torch.tensor(ws, device=device) assert ws.shape[1:] == (G.num_ws, G.w_dim) for idx, w in enumerate(ws): img = G.synthesis(w.unsqueeze(0), noise_mode=noise_mode) img = (img.permute(0, 2, 3, 1) * 127.5 + 128).clamp(0, 255).to(torch.uint8) img = PIL.Image.fromarray(img[0].cpu().numpy(), 'RGB').save(f'{outdir}/proj{idx:02d}.png') return if seeds is None: ctx.fail('--seeds option is required when not using --projected-w') label = torch.zeros([1, G.c_dim], device=device) if G.c_dim != 0: if class_idx is None: ctx.fail('Must specify class label with --class when using a conditional network') label[:, class_idx] = 1 else: if class_idx is not None: print ('warn: --class=lbl ignored when running on an unconditional network') for seed_idx, seed in enumerate(seeds): print('Generating image for seed %d (%d/%d) ...' % (seed, seed_idx, len(seeds))) z = torch.from_numpy(np.random.RandomState(seed).randn(1, G.z_dim)).to(device) img = G(z, label, truncation_psi=truncation_psi, noise_mode=noise_mode) img = (img.permute(0, 2, 3, 1) * 127.5 + 128).clamp(0, 255).to(torch.uint8) PIL.Image.fromarray(img[0].cpu().numpy(), 'RGB').save(f'{outdir}/seed{seed:04d}.png') if __name__ == "__main__": generate_images()
true
true
f7f962fa41091aafdd1ac460ba5ee9435454c33e
7,832
py
Python
contrib/bitrpc/bitrpc.py
bitfawkes/eGold
2190beebd747a8ba4e34d39a7e945c72899f7666
[ "MIT" ]
null
null
null
contrib/bitrpc/bitrpc.py
bitfawkes/eGold
2190beebd747a8ba4e34d39a7e945c72899f7666
[ "MIT" ]
null
null
null
contrib/bitrpc/bitrpc.py
bitfawkes/eGold
2190beebd747a8ba4e34d39a7e945c72899f7666
[ "MIT" ]
null
null
null
from jsonrpc import ServiceProxy import sys import string # ===== BEGIN USER SETTINGS ===== # if you do not set these you will be prompted for a password for every command rpcuser = "" rpcpass = "" # ====== END USER SETTINGS ====== if rpcpass == "": access = ServiceProxy("http://127.0.0.1:9332") else: access = ServiceProxy("http://"+rpcuser+":"+rpcpass+"@127.0.0.1:9332") cmd = sys.argv[1].lower() if cmd == "backupwallet": try: path = raw_input("Enter destination path/filename: ") print access.backupwallet(path) except: print "\n---An error occurred---\n" elif cmd == "getaccount": try: addr = raw_input("Enter a eGold address: ") print access.getaccount(addr) except: print "\n---An error occurred---\n" elif cmd == "getaccountaddress": try: acct = raw_input("Enter an account name: ") print access.getaccountaddress(acct) except: print "\n---An error occurred---\n" elif cmd == "getaddressesbyaccount": try: acct = raw_input("Enter an account name: ") print access.getaddressesbyaccount(acct) except: print "\n---An error occurred---\n" elif cmd == "getbalance": try: acct = raw_input("Enter an account (optional): ") mc = raw_input("Minimum confirmations (optional): ") try: print access.getbalance(acct, mc) except: print access.getbalance() except: print "\n---An error occurred---\n" elif cmd == "getblockbycount": try: height = raw_input("Height: ") print access.getblockbycount(height) except: print "\n---An error occurred---\n" elif cmd == "getblockcount": try: print access.getblockcount() except: print "\n---An error occurred---\n" elif cmd == "getblocknumber": try: print access.getblocknumber() except: print "\n---An error occurred---\n" elif cmd == "getconnectioncount": try: print access.getconnectioncount() except: print "\n---An error occurred---\n" elif cmd == "getdifficulty": try: print access.getdifficulty() except: print "\n---An error occurred---\n" elif cmd == "getgenerate": try: print access.getgenerate() except: print "\n---An error occurred---\n" elif cmd == "gethashespersec": try: print access.gethashespersec() except: print "\n---An error occurred---\n" elif cmd == "getinfo": try: print access.getinfo() except: print "\n---An error occurred---\n" elif cmd == "getnewaddress": try: acct = raw_input("Enter an account name: ") try: print access.getnewaddress(acct) except: print access.getnewaddress() except: print "\n---An error occurred---\n" elif cmd == "getreceivedbyaccount": try: acct = raw_input("Enter an account (optional): ") mc = raw_input("Minimum confirmations (optional): ") try: print access.getreceivedbyaccount(acct, mc) except: print access.getreceivedbyaccount() except: print "\n---An error occurred---\n" elif cmd == "getreceivedbyaddress": try: addr = raw_input("Enter a eGold address (optional): ") mc = raw_input("Minimum confirmations (optional): ") try: print access.getreceivedbyaddress(addr, mc) except: print access.getreceivedbyaddress() except: print "\n---An error occurred---\n" elif cmd == "gettransaction": try: txid = raw_input("Enter a transaction ID: ") print access.gettransaction(txid) except: print "\n---An error occurred---\n" elif cmd == "getwork": try: data = raw_input("Data (optional): ") try: print access.gettransaction(data) except: print access.gettransaction() except: print "\n---An error occurred---\n" elif cmd == "help": try: cmd = raw_input("Command (optional): ") try: print access.help(cmd) except: print access.help() except: print "\n---An error occurred---\n" elif cmd == "listaccounts": try: mc = raw_input("Minimum confirmations (optional): ") try: print access.listaccounts(mc) except: print access.listaccounts() except: print "\n---An error occurred---\n" elif cmd == "listreceivedbyaccount": try: mc = raw_input("Minimum confirmations (optional): ") incemp = raw_input("Include empty? (true/false, optional): ") try: print access.listreceivedbyaccount(mc, incemp) except: print access.listreceivedbyaccount() except: print "\n---An error occurred---\n" elif cmd == "listreceivedbyaddress": try: mc = raw_input("Minimum confirmations (optional): ") incemp = raw_input("Include empty? (true/false, optional): ") try: print access.listreceivedbyaddress(mc, incemp) except: print access.listreceivedbyaddress() except: print "\n---An error occurred---\n" elif cmd == "listtransactions": try: acct = raw_input("Account (optional): ") count = raw_input("Number of transactions (optional): ") frm = raw_input("Skip (optional):") try: print access.listtransactions(acct, count, frm) except: print access.listtransactions() except: print "\n---An error occurred---\n" elif cmd == "move": try: frm = raw_input("From: ") to = raw_input("To: ") amt = raw_input("Amount:") mc = raw_input("Minimum confirmations (optional): ") comment = raw_input("Comment (optional): ") try: print access.move(frm, to, amt, mc, comment) except: print access.move(frm, to, amt) except: print "\n---An error occurred---\n" elif cmd == "sendfrom": try: frm = raw_input("From: ") to = raw_input("To: ") amt = raw_input("Amount:") mc = raw_input("Minimum confirmations (optional): ") comment = raw_input("Comment (optional): ") commentto = raw_input("Comment-to (optional): ") try: print access.sendfrom(frm, to, amt, mc, comment, commentto) except: print access.sendfrom(frm, to, amt) except: print "\n---An error occurred---\n" elif cmd == "sendmany": try: frm = raw_input("From: ") to = raw_input("To (in format address1:amount1,address2:amount2,...): ") mc = raw_input("Minimum confirmations (optional): ") comment = raw_input("Comment (optional): ") try: print access.sendmany(frm,to,mc,comment) except: print access.sendmany(frm,to) except: print "\n---An error occurred---\n" elif cmd == "sendtoaddress": try: to = raw_input("To (in format address1:amount1,address2:amount2,...): ") amt = raw_input("Amount:") comment = raw_input("Comment (optional): ") commentto = raw_input("Comment-to (optional): ") try: print access.sendtoaddress(to,amt,comment,commentto) except: print access.sendtoaddress(to,amt) except: print "\n---An error occurred---\n" elif cmd == "setaccount": try: addr = raw_input("Address: ") acct = raw_input("Account:") print access.setaccount(addr,acct) except: print "\n---An error occurred---\n" elif cmd == "setgenerate": try: gen= raw_input("Generate? (true/false): ") cpus = raw_input("Max processors/cores (-1 for unlimited, optional):") try: print access.setgenerate(gen, cpus) except: print access.setgenerate(gen) except: print "\n---An error occurred---\n" elif cmd == "settxfee": try: amt = raw_input("Amount:") print access.settxfee(amt) except: print "\n---An error occurred---\n" elif cmd == "stop": try: print access.stop() except: print "\n---An error occurred---\n" elif cmd == "validateaddress": try: addr = raw_input("Address: ") print access.validateaddress(addr) except: print "\n---An error occurred---\n" elif cmd == "walletpassphrase": try: pwd = raw_input("Enter wallet passphrase: ") access.walletpassphrase(pwd, 60) print "\n---Wallet unlocked---\n" except: print "\n---An error occurred---\n" elif cmd == "walletpassphrasechange": try: pwd = raw_input("Enter old wallet passphrase: ") pwd2 = raw_input("Enter new wallet passphrase: ") access.walletpassphrasechange(pwd, pwd2) print print "\n---Passphrase changed---\n" except: print print "\n---An error occurred---\n" print else: print "Command not found or not supported"
24.098462
79
0.668029
from jsonrpc import ServiceProxy import sys import string rpcuser = "" rpcpass = "" if rpcpass == "": access = ServiceProxy("http://127.0.0.1:9332") else: access = ServiceProxy("http://"+rpcuser+":"+rpcpass+"@127.0.0.1:9332") cmd = sys.argv[1].lower() if cmd == "backupwallet": try: path = raw_input("Enter destination path/filename: ") print access.backupwallet(path) except: print "\n---An error occurred---\n" elif cmd == "getaccount": try: addr = raw_input("Enter a eGold address: ") print access.getaccount(addr) except: print "\n---An error occurred---\n" elif cmd == "getaccountaddress": try: acct = raw_input("Enter an account name: ") print access.getaccountaddress(acct) except: print "\n---An error occurred---\n" elif cmd == "getaddressesbyaccount": try: acct = raw_input("Enter an account name: ") print access.getaddressesbyaccount(acct) except: print "\n---An error occurred---\n" elif cmd == "getbalance": try: acct = raw_input("Enter an account (optional): ") mc = raw_input("Minimum confirmations (optional): ") try: print access.getbalance(acct, mc) except: print access.getbalance() except: print "\n---An error occurred---\n" elif cmd == "getblockbycount": try: height = raw_input("Height: ") print access.getblockbycount(height) except: print "\n---An error occurred---\n" elif cmd == "getblockcount": try: print access.getblockcount() except: print "\n---An error occurred---\n" elif cmd == "getblocknumber": try: print access.getblocknumber() except: print "\n---An error occurred---\n" elif cmd == "getconnectioncount": try: print access.getconnectioncount() except: print "\n---An error occurred---\n" elif cmd == "getdifficulty": try: print access.getdifficulty() except: print "\n---An error occurred---\n" elif cmd == "getgenerate": try: print access.getgenerate() except: print "\n---An error occurred---\n" elif cmd == "gethashespersec": try: print access.gethashespersec() except: print "\n---An error occurred---\n" elif cmd == "getinfo": try: print access.getinfo() except: print "\n---An error occurred---\n" elif cmd == "getnewaddress": try: acct = raw_input("Enter an account name: ") try: print access.getnewaddress(acct) except: print access.getnewaddress() except: print "\n---An error occurred---\n" elif cmd == "getreceivedbyaccount": try: acct = raw_input("Enter an account (optional): ") mc = raw_input("Minimum confirmations (optional): ") try: print access.getreceivedbyaccount(acct, mc) except: print access.getreceivedbyaccount() except: print "\n---An error occurred---\n" elif cmd == "getreceivedbyaddress": try: addr = raw_input("Enter a eGold address (optional): ") mc = raw_input("Minimum confirmations (optional): ") try: print access.getreceivedbyaddress(addr, mc) except: print access.getreceivedbyaddress() except: print "\n---An error occurred---\n" elif cmd == "gettransaction": try: txid = raw_input("Enter a transaction ID: ") print access.gettransaction(txid) except: print "\n---An error occurred---\n" elif cmd == "getwork": try: data = raw_input("Data (optional): ") try: print access.gettransaction(data) except: print access.gettransaction() except: print "\n---An error occurred---\n" elif cmd == "help": try: cmd = raw_input("Command (optional): ") try: print access.help(cmd) except: print access.help() except: print "\n---An error occurred---\n" elif cmd == "listaccounts": try: mc = raw_input("Minimum confirmations (optional): ") try: print access.listaccounts(mc) except: print access.listaccounts() except: print "\n---An error occurred---\n" elif cmd == "listreceivedbyaccount": try: mc = raw_input("Minimum confirmations (optional): ") incemp = raw_input("Include empty? (true/false, optional): ") try: print access.listreceivedbyaccount(mc, incemp) except: print access.listreceivedbyaccount() except: print "\n---An error occurred---\n" elif cmd == "listreceivedbyaddress": try: mc = raw_input("Minimum confirmations (optional): ") incemp = raw_input("Include empty? (true/false, optional): ") try: print access.listreceivedbyaddress(mc, incemp) except: print access.listreceivedbyaddress() except: print "\n---An error occurred---\n" elif cmd == "listtransactions": try: acct = raw_input("Account (optional): ") count = raw_input("Number of transactions (optional): ") frm = raw_input("Skip (optional):") try: print access.listtransactions(acct, count, frm) except: print access.listtransactions() except: print "\n---An error occurred---\n" elif cmd == "move": try: frm = raw_input("From: ") to = raw_input("To: ") amt = raw_input("Amount:") mc = raw_input("Minimum confirmations (optional): ") comment = raw_input("Comment (optional): ") try: print access.move(frm, to, amt, mc, comment) except: print access.move(frm, to, amt) except: print "\n---An error occurred---\n" elif cmd == "sendfrom": try: frm = raw_input("From: ") to = raw_input("To: ") amt = raw_input("Amount:") mc = raw_input("Minimum confirmations (optional): ") comment = raw_input("Comment (optional): ") commentto = raw_input("Comment-to (optional): ") try: print access.sendfrom(frm, to, amt, mc, comment, commentto) except: print access.sendfrom(frm, to, amt) except: print "\n---An error occurred---\n" elif cmd == "sendmany": try: frm = raw_input("From: ") to = raw_input("To (in format address1:amount1,address2:amount2,...): ") mc = raw_input("Minimum confirmations (optional): ") comment = raw_input("Comment (optional): ") try: print access.sendmany(frm,to,mc,comment) except: print access.sendmany(frm,to) except: print "\n---An error occurred---\n" elif cmd == "sendtoaddress": try: to = raw_input("To (in format address1:amount1,address2:amount2,...): ") amt = raw_input("Amount:") comment = raw_input("Comment (optional): ") commentto = raw_input("Comment-to (optional): ") try: print access.sendtoaddress(to,amt,comment,commentto) except: print access.sendtoaddress(to,amt) except: print "\n---An error occurred---\n" elif cmd == "setaccount": try: addr = raw_input("Address: ") acct = raw_input("Account:") print access.setaccount(addr,acct) except: print "\n---An error occurred---\n" elif cmd == "setgenerate": try: gen= raw_input("Generate? (true/false): ") cpus = raw_input("Max processors/cores (-1 for unlimited, optional):") try: print access.setgenerate(gen, cpus) except: print access.setgenerate(gen) except: print "\n---An error occurred---\n" elif cmd == "settxfee": try: amt = raw_input("Amount:") print access.settxfee(amt) except: print "\n---An error occurred---\n" elif cmd == "stop": try: print access.stop() except: print "\n---An error occurred---\n" elif cmd == "validateaddress": try: addr = raw_input("Address: ") print access.validateaddress(addr) except: print "\n---An error occurred---\n" elif cmd == "walletpassphrase": try: pwd = raw_input("Enter wallet passphrase: ") access.walletpassphrase(pwd, 60) print "\n---Wallet unlocked---\n" except: print "\n---An error occurred---\n" elif cmd == "walletpassphrasechange": try: pwd = raw_input("Enter old wallet passphrase: ") pwd2 = raw_input("Enter new wallet passphrase: ") access.walletpassphrasechange(pwd, pwd2) print print "\n---Passphrase changed---\n" except: print print "\n---An error occurred---\n" print else: print "Command not found or not supported"
false
true
f7f9630dcfbb72ebf97d11826e56c1f315b8b6ab
16,981
py
Python
src/dispatch/plugins/dispatch_slack/events.py
KATO-Hiro/dispatch
d41f42c0ecf47c5c9012fc6d22046a8124bb7596
[ "Apache-2.0" ]
null
null
null
src/dispatch/plugins/dispatch_slack/events.py
KATO-Hiro/dispatch
d41f42c0ecf47c5c9012fc6d22046a8124bb7596
[ "Apache-2.0" ]
null
null
null
src/dispatch/plugins/dispatch_slack/events.py
KATO-Hiro/dispatch
d41f42c0ecf47c5c9012fc6d22046a8124bb7596
[ "Apache-2.0" ]
null
null
null
import pytz import logging import datetime from typing import List from pydantic import BaseModel from sqlalchemy import func from sqlalchemy.sql.functions import user from dispatch.nlp import build_phrase_matcher, build_term_vocab, extract_terms_from_text from dispatch.conversation import service as conversation_service from dispatch.event import service as event_service from dispatch.incident import flows as incident_flows from dispatch.incident import service as incident_service from dispatch.plugins.dispatch_slack.config import ( SlackConversationConfiguration, ) from dispatch.tag import service as tag_service from dispatch.individual import service as individual_service from dispatch.participant import service as participant_service from dispatch.participant_role.models import ParticipantRoleType from dispatch.plugins.dispatch_slack import service as dispatch_slack_service from dispatch.plugin import service as plugin_service from dispatch.monitor import service as monitor_service from dispatch.conversation.enums import ConversationButtonActions from dispatch.tag.models import Tag from .decorators import slack_background_task, get_organization_scope_from_channel_id from .service import get_user_email from .models import MonitorButton log = logging.getLogger(__name__) class EventBodyItem(BaseModel): """Body item of the Slack event.""" type: str = None channel: str = None ts: str = None class EventBody(BaseModel): """Body of the Slack event.""" channel: str = None channel_id: str = None channel_type: str = None deleted_ts: str = None event_ts: str = None thread_ts: str = None file_id: str = None hidden: bool = None inviter: str = None item: EventBodyItem = None item_user: str = None reaction: str = None subtype: str = None team: str = None text: str = None type: str user: str = None user_id: str = None class EventEnvelope(BaseModel): """Envelope of the Slack event.""" api_app_id: str = None authed_users: List[str] = [] challenge: str = None enterprise_id: str = None event: EventBody = None event_id: str = None event_time: int = None team_id: str = None token: str = None type: str def get_channel_id_from_event(event: EventEnvelope): """Returns the channel id from the Slack event.""" channel_id = "" if event.event.channel_id: return event.event.channel_id if event.event.channel: return event.event.channel if event.event.item.channel: return event.event.item.channel return channel_id def event_functions(event: EventEnvelope): """Interprets the events and routes it the appropriate function.""" event_mappings = { "member_joined_channel": [member_joined_channel], "member_left_channel": [member_left_channel], "message": [after_hours, ban_threads_warning, message_tagging, message_monitor], "message.groups": [], "message.im": [], "reaction_added": [handle_reaction_added_event], } return event_mappings.get(event.event.type, []) async def handle_slack_event(*, config, client, event, background_tasks): """Handles slack event message.""" user_id = event.event.user channel_id = get_channel_id_from_event(event) if user_id and channel_id: db_session = get_organization_scope_from_channel_id(channel_id=channel_id) if not db_session: log.info( f"Unable to determine organization associated with channel id. ChannelId: {channel_id}" ) return {"ok": ""} conversation = conversation_service.get_by_channel_id_ignoring_channel_type( db_session=db_session, channel_id=channel_id ) if conversation and dispatch_slack_service.is_user(config, user_id): # We resolve the user's email user_email = await dispatch_slack_service.get_user_email_async(client, user_id) # increment activity for user participant = participant_service.get_by_incident_id_and_email( db_session=db_session, incident_id=conversation.incident_id, email=user_email ) if participant.activity: participant.activity += 1 else: participant.activity = 1 db_session.commit() # Dispatch event functions to be executed in the background for f in event_functions(event): background_tasks.add_task( f, config=config, user_id=user_id, user_email=user_email, channel_id=channel_id, incident_id=conversation.incident_id, event=event, ) return {"ok": ""} @slack_background_task def handle_reaction_added_event( config: SlackConversationConfiguration, user_id: str, user_email: str, channel_id: str, incident_id: int, event: EventEnvelope = None, db_session=None, slack_client=None, ): """Handles an event where a reaction is added to a message.""" reaction = event.event.reaction if reaction == config.timeline_event_reaction: conversation_id = event.event.item.channel message_ts = event.event.item.ts message_ts_utc = datetime.datetime.utcfromtimestamp(float(message_ts)) # we fetch the message information response = dispatch_slack_service.list_conversation_messages( slack_client, conversation_id, latest=message_ts, limit=1, inclusive=1 ) message_text = response["messages"][0]["text"] message_sender_id = response["messages"][0]["user"] # we fetch the incident incident = incident_service.get(db_session=db_session, incident_id=incident_id) # we fetch the individual who sent the message message_sender_email = get_user_email(client=slack_client, user_id=message_sender_id) individual = individual_service.get_by_email_and_project( db_session=db_session, email=message_sender_email, project_id=incident.project.id ) # we log the event event_service.log( db_session=db_session, source="Slack Plugin - Conversation Management", description=f'"{message_text}," said {individual.name}', incident_id=incident_id, individual_id=individual.id, started_at=message_ts_utc, ) def is_business_hours(commander_tz: str): """Determines if it's currently office hours where the incident commander is located.""" now = datetime.datetime.now(pytz.timezone(commander_tz)) return now.weekday() not in [5, 6] and 9 <= now.hour < 17 @slack_background_task def after_hours( config: SlackConversationConfiguration, user_id: str, user_email: str, channel_id: str, incident_id: int, event: EventEnvelope = None, db_session=None, slack_client=None, ): """Notifies the user that this incident is current in after hours mode.""" # we ignore user channel and group join messages if event.event.subtype in ["channel_join", "group_join"]: return incident = incident_service.get(db_session=db_session, incident_id=incident_id) # get their timezone from slack commander_info = dispatch_slack_service.get_user_info_by_email( slack_client, email=incident.commander.individual.email ) commander_tz = commander_info["tz"] if not is_business_hours(commander_tz): # send ephermal message blocks = [ { "type": "section", "text": { "type": "mrkdwn", "text": ( ( f"Responses may be delayed. The current incident priority is *{incident.incident_priority.name}*" f" and your message was sent outside of the Incident Commander's working hours (Weekdays, 9am-5pm, {commander_tz} timezone)." ) ), }, } ] participant = participant_service.get_by_incident_id_and_email( db_session=db_session, incident_id=incident_id, email=user_email ) if not participant.after_hours_notification: dispatch_slack_service.send_ephemeral_message( slack_client, channel_id, user_id, "", blocks=blocks ) participant.after_hours_notification = True db_session.add(participant) db_session.commit() @slack_background_task def member_joined_channel( config: SlackConversationConfiguration, user_id: str, user_email: str, channel_id: str, incident_id: int, event: EventEnvelope, db_session=None, slack_client=None, ): """Handles the member_joined_channel slack event.""" participant = incident_flows.incident_add_or_reactivate_participant_flow( user_email=user_email, incident_id=incident_id, db_session=db_session ) if event.event.inviter: # we update the participant's metadata if not dispatch_slack_service.is_user(config, event.event.inviter): # we default to the incident commander when we don't know how the user was added added_by_participant = participant_service.get_by_incident_id_and_role( db_session=db_session, incident_id=incident_id, role=ParticipantRoleType.incident_commander, ) participant.added_by = added_by_participant participant.added_reason = ( f"Participant added by {added_by_participant.individual.name}" ) else: inviter_email = get_user_email(client=slack_client, user_id=event.event.inviter) added_by_participant = participant_service.get_by_incident_id_and_email( db_session=db_session, incident_id=incident_id, email=inviter_email ) participant.added_by = added_by_participant participant.added_reason = event.event.text db_session.add(participant) db_session.commit() @slack_background_task def member_left_channel( config: SlackConversationConfiguration, user_id: str, user_email: str, channel_id: str, incident_id: int, event: EventEnvelope, db_session=None, slack_client=None, ): """Handles the member_left_channel Slack event.""" incident_flows.incident_remove_participant_flow(user_email, incident_id, db_session=db_session) @slack_background_task def ban_threads_warning( config: SlackConversationConfiguration, user_id: str, user_email: str, channel_id: str, incident_id: int, event: EventEnvelope = None, db_session=None, slack_client=None, ): """Sends the user an ephemeral message if they use threads.""" if not config.ban_threads: return if event.event.thread_ts: # we should be able to look for `subtype == message_replied` once this bug is fixed # https://api.slack.com/events/message/message_replied # From Slack: Bug alert! This event is missing the subtype field when dispatched # over the Events API. Until it is fixed, examine message events' thread_ts value. # When present, it's a reply. To be doubly sure, compare a thread_ts to the top-level ts # value, when they differ the latter is a reply to the former. message = "Please refrain from using threads in incident related channels. Threads make it harder for incident participants to maintain context." dispatch_slack_service.send_ephemeral_message( slack_client, channel_id, user_id, message, thread_ts=event.event.thread_ts, ) @slack_background_task def message_tagging( config: SlackConversationConfiguration, user_id: str, user_email: str, channel_id: str, incident_id: int, event: EventEnvelope = None, db_session=None, slack_client=None, ): """Looks for incident tags in incident messages.""" text = event.event.text incident = incident_service.get(db_session=db_session, incident_id=incident_id) tags = tag_service.get_all(db_session=db_session, project_id=incident.project.id).all() tag_strings = [t.name.lower() for t in tags if t.discoverable] phrases = build_term_vocab(tag_strings) matcher = build_phrase_matcher("dispatch-tag", phrases) extracted_tags = list(set(extract_terms_from_text(text, matcher))) matched_tags = ( db_session.query(Tag) .filter(func.upper(Tag.name).in_([func.upper(t) for t in extracted_tags])) .all() ) incident.tags.extend(matched_tags) db_session.commit() @slack_background_task def message_monitor( config: SlackConversationConfiguration, user_id: str, user_email: str, channel_id: str, incident_id: int, event: EventEnvelope = None, db_session=None, slack_client=None, ): """Looks strings that are available for monitoring (usually links).""" text = event.event.text incident = incident_service.get(db_session=db_session, incident_id=incident_id) plugins = plugin_service.get_active_instances( db_session=db_session, project_id=incident.project.id, plugin_type="monitor" ) for p in plugins: for matcher in p.instance.get_matchers(): for match in matcher.finditer(text): match_data = match.groupdict() monitor = monitor_service.get_by_weblink( db_session=db_session, weblink=match_data["weblink"] ) # silence ignored matches if monitor: continue current_status = p.instance.get_match_status(match_data) if current_status: status_text = "" for k, v in current_status.items(): status_text += f"*{k.title()}*:\n{v.title()}\n" monitor_button = MonitorButton( incident_id=incident.id, plugin_instance_id=p.id, organization=incident.project.organization.slug, weblink=match_data["weblink"], action_type="monitor", ) ignore_button = MonitorButton( incident_id=incident.id, plugin_instance_id=p.id, organization=incident.project.organization.slug, weblink=match_data["weblink"], action_type="ignore", ) blocks = [ { "type": "section", "text": { "type": "mrkdwn", "text": f"Hi! Dispatch is able to help track the status of: \n {match_data['weblink']} \n\n Would you like for changes in it's status to be propagated to this incident channel?", }, }, { "type": "section", "text": { "type": "mrkdwn", "text": status_text, }, }, { "type": "actions", "block_id": f"{ConversationButtonActions.monitor_link}", "elements": [ { "type": "button", "text": { "type": "plain_text", "emoji": True, "text": "Monitor", }, "style": "primary", "value": monitor_button.json(), }, { "type": "button", "text": {"type": "plain_text", "emoji": True, "text": "Ignore"}, "style": "danger", "value": ignore_button.json(), }, ], }, ] dispatch_slack_service.send_ephemeral_message( slack_client, channel_id, user_id, "", blocks=blocks )
35.599581
210
0.611271
import pytz import logging import datetime from typing import List from pydantic import BaseModel from sqlalchemy import func from sqlalchemy.sql.functions import user from dispatch.nlp import build_phrase_matcher, build_term_vocab, extract_terms_from_text from dispatch.conversation import service as conversation_service from dispatch.event import service as event_service from dispatch.incident import flows as incident_flows from dispatch.incident import service as incident_service from dispatch.plugins.dispatch_slack.config import ( SlackConversationConfiguration, ) from dispatch.tag import service as tag_service from dispatch.individual import service as individual_service from dispatch.participant import service as participant_service from dispatch.participant_role.models import ParticipantRoleType from dispatch.plugins.dispatch_slack import service as dispatch_slack_service from dispatch.plugin import service as plugin_service from dispatch.monitor import service as monitor_service from dispatch.conversation.enums import ConversationButtonActions from dispatch.tag.models import Tag from .decorators import slack_background_task, get_organization_scope_from_channel_id from .service import get_user_email from .models import MonitorButton log = logging.getLogger(__name__) class EventBodyItem(BaseModel): type: str = None channel: str = None ts: str = None class EventBody(BaseModel): channel: str = None channel_id: str = None channel_type: str = None deleted_ts: str = None event_ts: str = None thread_ts: str = None file_id: str = None hidden: bool = None inviter: str = None item: EventBodyItem = None item_user: str = None reaction: str = None subtype: str = None team: str = None text: str = None type: str user: str = None user_id: str = None class EventEnvelope(BaseModel): api_app_id: str = None authed_users: List[str] = [] challenge: str = None enterprise_id: str = None event: EventBody = None event_id: str = None event_time: int = None team_id: str = None token: str = None type: str def get_channel_id_from_event(event: EventEnvelope): channel_id = "" if event.event.channel_id: return event.event.channel_id if event.event.channel: return event.event.channel if event.event.item.channel: return event.event.item.channel return channel_id def event_functions(event: EventEnvelope): event_mappings = { "member_joined_channel": [member_joined_channel], "member_left_channel": [member_left_channel], "message": [after_hours, ban_threads_warning, message_tagging, message_monitor], "message.groups": [], "message.im": [], "reaction_added": [handle_reaction_added_event], } return event_mappings.get(event.event.type, []) async def handle_slack_event(*, config, client, event, background_tasks): user_id = event.event.user channel_id = get_channel_id_from_event(event) if user_id and channel_id: db_session = get_organization_scope_from_channel_id(channel_id=channel_id) if not db_session: log.info( f"Unable to determine organization associated with channel id. ChannelId: {channel_id}" ) return {"ok": ""} conversation = conversation_service.get_by_channel_id_ignoring_channel_type( db_session=db_session, channel_id=channel_id ) if conversation and dispatch_slack_service.is_user(config, user_id): user_email = await dispatch_slack_service.get_user_email_async(client, user_id) # increment activity for user participant = participant_service.get_by_incident_id_and_email( db_session=db_session, incident_id=conversation.incident_id, email=user_email ) if participant.activity: participant.activity += 1 else: participant.activity = 1 db_session.commit() # Dispatch event functions to be executed in the background for f in event_functions(event): background_tasks.add_task( f, config=config, user_id=user_id, user_email=user_email, channel_id=channel_id, incident_id=conversation.incident_id, event=event, ) return {"ok": ""} @slack_background_task def handle_reaction_added_event( config: SlackConversationConfiguration, user_id: str, user_email: str, channel_id: str, incident_id: int, event: EventEnvelope = None, db_session=None, slack_client=None, ): reaction = event.event.reaction if reaction == config.timeline_event_reaction: conversation_id = event.event.item.channel message_ts = event.event.item.ts message_ts_utc = datetime.datetime.utcfromtimestamp(float(message_ts)) # we fetch the message information response = dispatch_slack_service.list_conversation_messages( slack_client, conversation_id, latest=message_ts, limit=1, inclusive=1 ) message_text = response["messages"][0]["text"] message_sender_id = response["messages"][0]["user"] # we fetch the incident incident = incident_service.get(db_session=db_session, incident_id=incident_id) # we fetch the individual who sent the message message_sender_email = get_user_email(client=slack_client, user_id=message_sender_id) individual = individual_service.get_by_email_and_project( db_session=db_session, email=message_sender_email, project_id=incident.project.id ) # we log the event event_service.log( db_session=db_session, source="Slack Plugin - Conversation Management", description=f'"{message_text}," said {individual.name}', incident_id=incident_id, individual_id=individual.id, started_at=message_ts_utc, ) def is_business_hours(commander_tz: str): now = datetime.datetime.now(pytz.timezone(commander_tz)) return now.weekday() not in [5, 6] and 9 <= now.hour < 17 @slack_background_task def after_hours( config: SlackConversationConfiguration, user_id: str, user_email: str, channel_id: str, incident_id: int, event: EventEnvelope = None, db_session=None, slack_client=None, ): # we ignore user channel and group join messages if event.event.subtype in ["channel_join", "group_join"]: return incident = incident_service.get(db_session=db_session, incident_id=incident_id) # get their timezone from slack commander_info = dispatch_slack_service.get_user_info_by_email( slack_client, email=incident.commander.individual.email ) commander_tz = commander_info["tz"] if not is_business_hours(commander_tz): # send ephermal message blocks = [ { "type": "section", "text": { "type": "mrkdwn", "text": ( ( f"Responses may be delayed. The current incident priority is *{incident.incident_priority.name}*" f" and your message was sent outside of the Incident Commander's working hours (Weekdays, 9am-5pm, {commander_tz} timezone)." ) ), }, } ] participant = participant_service.get_by_incident_id_and_email( db_session=db_session, incident_id=incident_id, email=user_email ) if not participant.after_hours_notification: dispatch_slack_service.send_ephemeral_message( slack_client, channel_id, user_id, "", blocks=blocks ) participant.after_hours_notification = True db_session.add(participant) db_session.commit() @slack_background_task def member_joined_channel( config: SlackConversationConfiguration, user_id: str, user_email: str, channel_id: str, incident_id: int, event: EventEnvelope, db_session=None, slack_client=None, ): participant = incident_flows.incident_add_or_reactivate_participant_flow( user_email=user_email, incident_id=incident_id, db_session=db_session ) if event.event.inviter: if not dispatch_slack_service.is_user(config, event.event.inviter): # we default to the incident commander when we don't know how the user was added added_by_participant = participant_service.get_by_incident_id_and_role( db_session=db_session, incident_id=incident_id, role=ParticipantRoleType.incident_commander, ) participant.added_by = added_by_participant participant.added_reason = ( f"Participant added by {added_by_participant.individual.name}" ) else: inviter_email = get_user_email(client=slack_client, user_id=event.event.inviter) added_by_participant = participant_service.get_by_incident_id_and_email( db_session=db_session, incident_id=incident_id, email=inviter_email ) participant.added_by = added_by_participant participant.added_reason = event.event.text db_session.add(participant) db_session.commit() @slack_background_task def member_left_channel( config: SlackConversationConfiguration, user_id: str, user_email: str, channel_id: str, incident_id: int, event: EventEnvelope, db_session=None, slack_client=None, ): incident_flows.incident_remove_participant_flow(user_email, incident_id, db_session=db_session) @slack_background_task def ban_threads_warning( config: SlackConversationConfiguration, user_id: str, user_email: str, channel_id: str, incident_id: int, event: EventEnvelope = None, db_session=None, slack_client=None, ): if not config.ban_threads: return if event.event.thread_ts: # When present, it's a reply. To be doubly sure, compare a thread_ts to the top-level ts message = "Please refrain from using threads in incident related channels. Threads make it harder for incident participants to maintain context." dispatch_slack_service.send_ephemeral_message( slack_client, channel_id, user_id, message, thread_ts=event.event.thread_ts, ) @slack_background_task def message_tagging( config: SlackConversationConfiguration, user_id: str, user_email: str, channel_id: str, incident_id: int, event: EventEnvelope = None, db_session=None, slack_client=None, ): text = event.event.text incident = incident_service.get(db_session=db_session, incident_id=incident_id) tags = tag_service.get_all(db_session=db_session, project_id=incident.project.id).all() tag_strings = [t.name.lower() for t in tags if t.discoverable] phrases = build_term_vocab(tag_strings) matcher = build_phrase_matcher("dispatch-tag", phrases) extracted_tags = list(set(extract_terms_from_text(text, matcher))) matched_tags = ( db_session.query(Tag) .filter(func.upper(Tag.name).in_([func.upper(t) for t in extracted_tags])) .all() ) incident.tags.extend(matched_tags) db_session.commit() @slack_background_task def message_monitor( config: SlackConversationConfiguration, user_id: str, user_email: str, channel_id: str, incident_id: int, event: EventEnvelope = None, db_session=None, slack_client=None, ): text = event.event.text incident = incident_service.get(db_session=db_session, incident_id=incident_id) plugins = plugin_service.get_active_instances( db_session=db_session, project_id=incident.project.id, plugin_type="monitor" ) for p in plugins: for matcher in p.instance.get_matchers(): for match in matcher.finditer(text): match_data = match.groupdict() monitor = monitor_service.get_by_weblink( db_session=db_session, weblink=match_data["weblink"] ) if monitor: continue current_status = p.instance.get_match_status(match_data) if current_status: status_text = "" for k, v in current_status.items(): status_text += f"*{k.title()}*:\n{v.title()}\n" monitor_button = MonitorButton( incident_id=incident.id, plugin_instance_id=p.id, organization=incident.project.organization.slug, weblink=match_data["weblink"], action_type="monitor", ) ignore_button = MonitorButton( incident_id=incident.id, plugin_instance_id=p.id, organization=incident.project.organization.slug, weblink=match_data["weblink"], action_type="ignore", ) blocks = [ { "type": "section", "text": { "type": "mrkdwn", "text": f"Hi! Dispatch is able to help track the status of: \n {match_data['weblink']} \n\n Would you like for changes in it's status to be propagated to this incident channel?", }, }, { "type": "section", "text": { "type": "mrkdwn", "text": status_text, }, }, { "type": "actions", "block_id": f"{ConversationButtonActions.monitor_link}", "elements": [ { "type": "button", "text": { "type": "plain_text", "emoji": True, "text": "Monitor", }, "style": "primary", "value": monitor_button.json(), }, { "type": "button", "text": {"type": "plain_text", "emoji": True, "text": "Ignore"}, "style": "danger", "value": ignore_button.json(), }, ], }, ] dispatch_slack_service.send_ephemeral_message( slack_client, channel_id, user_id, "", blocks=blocks )
true
true
f7f96352842d13a838c3183d27862860ba1a89c1
568
py
Python
bdc_collection_builder/blueprint.py
rodolfolotte/bdc-collection-builder
62583f6c25bca79e7e1b5503bc6308298838c877
[ "MIT" ]
null
null
null
bdc_collection_builder/blueprint.py
rodolfolotte/bdc-collection-builder
62583f6c25bca79e7e1b5503bc6308298838c877
[ "MIT" ]
null
null
null
bdc_collection_builder/blueprint.py
rodolfolotte/bdc-collection-builder
62583f6c25bca79e7e1b5503bc6308298838c877
[ "MIT" ]
null
null
null
# # This file is part of Brazil Data Cube Collection Builder. # Copyright (C) 2019-2020 INPE. # # Brazil Data Cube Collection Builder is free software; you can redistribute it and/or modify it # under the terms of the MIT License; see LICENSE file for more details. # """Define Brazil Data Cube Scripts Blueprint strategy.""" from flask import Blueprint from flask_restplus import Api from .collections.controller import api as radcor_ns bp = Blueprint('bdc_collection_builder', __name__, url_prefix='/api') api = Api(bp, doc=False) api.add_namespace(radcor_ns)
27.047619
96
0.771127
from flask import Blueprint from flask_restplus import Api from .collections.controller import api as radcor_ns bp = Blueprint('bdc_collection_builder', __name__, url_prefix='/api') api = Api(bp, doc=False) api.add_namespace(radcor_ns)
true
true
f7f968fe5bc66e4b54b01da42710d70c4059ce43
522
py
Python
things/urls.py
kylehoac/DjangoX_Lab
ec4f5c3e595c7d91aeeddfdcb8cad40243d91758
[ "MIT" ]
null
null
null
things/urls.py
kylehoac/DjangoX_Lab
ec4f5c3e595c7d91aeeddfdcb8cad40243d91758
[ "MIT" ]
null
null
null
things/urls.py
kylehoac/DjangoX_Lab
ec4f5c3e595c7d91aeeddfdcb8cad40243d91758
[ "MIT" ]
null
null
null
from django.urls import path from .views import ( ThingListView, ThingDetailView, ThingCreateView, ThingUpdateView, ThingDeleteView ) urlpatterns = [ path('', ThingListView.as_view(), name='thing_list'), path('<int:pk>/',ThingDetailView.as_view(), name='thing_detail'), path('create/',ThingCreateView.as_view(), name='thing_create'), path('<int:pk>/update/',ThingUpdateView.as_view(), name='thing_update'), path('<int:pk>/delete/',ThingDeleteView.as_view(), name='thing_delete'), ]
32.625
76
0.693487
from django.urls import path from .views import ( ThingListView, ThingDetailView, ThingCreateView, ThingUpdateView, ThingDeleteView ) urlpatterns = [ path('', ThingListView.as_view(), name='thing_list'), path('<int:pk>/',ThingDetailView.as_view(), name='thing_detail'), path('create/',ThingCreateView.as_view(), name='thing_create'), path('<int:pk>/update/',ThingUpdateView.as_view(), name='thing_update'), path('<int:pk>/delete/',ThingDeleteView.as_view(), name='thing_delete'), ]
true
true
f7f969c00bb76b4b3919c34f0a9081ad3cbee407
5,080
py
Python
tests/resources/serializers/test_csl_serializer.py
utnapischtim/invenio-rdm-records
436bd2f4f6a75713db87ebf19d9cb962176d3899
[ "MIT" ]
10
2020-01-17T10:13:09.000Z
2022-03-17T10:14:41.000Z
tests/resources/serializers/test_csl_serializer.py
utnapischtim/invenio-rdm-records
436bd2f4f6a75713db87ebf19d9cb962176d3899
[ "MIT" ]
570
2019-08-15T16:35:25.000Z
2022-03-31T13:46:17.000Z
tests/resources/serializers/test_csl_serializer.py
utnapischtim/invenio-rdm-records
436bd2f4f6a75713db87ebf19d9cb962176d3899
[ "MIT" ]
57
2019-09-04T09:25:29.000Z
2022-03-30T19:32:55.000Z
# -*- coding: utf-8 -*- # # Copyright (C) 2021 CERN. # # Invenio-RDM-Records is free software; you can redistribute it and/or modify # it under the terms of the MIT License; see LICENSE file for more details. """Resources serializers tests.""" from copy import deepcopy from citeproc_styles import get_style_filepath from invenio_rdm_records.proxies import current_rdm_records from invenio_rdm_records.records.api import RDMRecord from invenio_rdm_records.resources.serializers import CSLJSONSerializer, \ StringCitationSerializer from invenio_rdm_records.resources.serializers.csl import get_citation_string from invenio_rdm_records.resources.serializers.csl.schema import CSLJSONSchema def test_csl_json_serializer(running_app, full_record): """Test JSON CLS Serializer.""" # if the record is created this field will be present full_record["id"] = "12345-abcde" expected_data = { "publisher": "InvenioRDM", "DOI": "10.5281/inveniordm.1234", "language": "dan", "title": "InvenioRDM", "issued": {"date-parts": [["2018"], ["2020", "09"]]}, "abstract": "A description with HTML tags", "author": [ { "family": "Nielsen", "given": "Lars Holm", } ], "note": "Funding by European Commission ROR 1234.", "version": "v1.0", "type": "graphic", "id": "12345-abcde", } serializer = CSLJSONSerializer() serialized_record = serializer.dump_one(full_record) assert serialized_record == expected_data # test wrong publication date rec_wrong_date = deepcopy(full_record) rec_wrong_date["metadata"]["publication_date"] = "wrong" expected = deepcopy(expected_data) del expected["issued"] # missing assert serialized_record == expected_data def test_citation_string_serializer_records_list( running_app, client, es_clear, minimal_record, superuser_identity, ): """Test Citation String Serializer for a list of records.""" service = current_rdm_records.records_service default_style = StringCitationSerializer._default_style default_locale = StringCitationSerializer._default_locale headers = {"Accept": "text/x-bibliography"} expected_data = [] for _ in range(3): draft = service.create(superuser_identity, minimal_record) record = service.publish(superuser_identity, draft.id) expected_record_data = get_citation_string( CSLJSONSchema().dump(record), record.id, locale=default_locale, style=get_style_filepath(default_style), ) expected_data.append(expected_record_data) RDMRecord.index.refresh() response = client.get("/records", headers=headers) response_data = response.get_data(as_text=True) assert response.status_code == 200 assert response.headers["content-type"] == "text/plain" for citation in expected_data: assert citation in response_data def test_citation_string_serializer_record( running_app, client, es_clear, minimal_record, superuser_identity, ): """Test Citation String Serializer for single records.""" service = current_rdm_records.records_service draft = service.create(superuser_identity, minimal_record) record = service.publish(superuser_identity, draft.id) _id = record.id _url = f"/records/{_id}" headers = {"Accept": "text/x-bibliography"} default_style = StringCitationSerializer._default_style default_locale = StringCitationSerializer._default_locale test_cases = [ ( f"{_url}?style=3d-printing-in-medicine&locale=es-ES", "3d-printing-in-medicine", "es-ES", 200, ), (f"{_url}?locale=es-ES", default_style, "es-ES", 200), ( f"{_url}?style=3d-printing-in-medicine", "3d-printing-in-medicine", default_locale, 200, ), (f"{_url}", default_style, default_locale, 200), (f"{_url}?style=Unknown_style", "Unknown_style", default_locale, 400), (f"{_url}?locale=Unknown_locale", default_style, default_locale, 200), ] for url, expected_style, expected_locale, expected_status in test_cases: response = client.get(url, headers=headers) assert response.status_code == expected_status body = response.get_data(as_text=True) if expected_status == 200: assert response.headers["content-type"] == "text/plain" expected_data = get_citation_string( CSLJSONSchema().dump(record), _id, locale=expected_locale, style=get_style_filepath(expected_style), ) assert expected_data == body elif expected_status == 400: # in case of error, the response is JSON assert response.headers["content-type"] == "application/json" assert f"Citation string style not found." in body
33.421053
78
0.658465
from copy import deepcopy from citeproc_styles import get_style_filepath from invenio_rdm_records.proxies import current_rdm_records from invenio_rdm_records.records.api import RDMRecord from invenio_rdm_records.resources.serializers import CSLJSONSerializer, \ StringCitationSerializer from invenio_rdm_records.resources.serializers.csl import get_citation_string from invenio_rdm_records.resources.serializers.csl.schema import CSLJSONSchema def test_csl_json_serializer(running_app, full_record): full_record["id"] = "12345-abcde" expected_data = { "publisher": "InvenioRDM", "DOI": "10.5281/inveniordm.1234", "language": "dan", "title": "InvenioRDM", "issued": {"date-parts": [["2018"], ["2020", "09"]]}, "abstract": "A description with HTML tags", "author": [ { "family": "Nielsen", "given": "Lars Holm", } ], "note": "Funding by European Commission ROR 1234.", "version": "v1.0", "type": "graphic", "id": "12345-abcde", } serializer = CSLJSONSerializer() serialized_record = serializer.dump_one(full_record) assert serialized_record == expected_data rec_wrong_date = deepcopy(full_record) rec_wrong_date["metadata"]["publication_date"] = "wrong" expected = deepcopy(expected_data) del expected["issued"] assert serialized_record == expected_data def test_citation_string_serializer_records_list( running_app, client, es_clear, minimal_record, superuser_identity, ): service = current_rdm_records.records_service default_style = StringCitationSerializer._default_style default_locale = StringCitationSerializer._default_locale headers = {"Accept": "text/x-bibliography"} expected_data = [] for _ in range(3): draft = service.create(superuser_identity, minimal_record) record = service.publish(superuser_identity, draft.id) expected_record_data = get_citation_string( CSLJSONSchema().dump(record), record.id, locale=default_locale, style=get_style_filepath(default_style), ) expected_data.append(expected_record_data) RDMRecord.index.refresh() response = client.get("/records", headers=headers) response_data = response.get_data(as_text=True) assert response.status_code == 200 assert response.headers["content-type"] == "text/plain" for citation in expected_data: assert citation in response_data def test_citation_string_serializer_record( running_app, client, es_clear, minimal_record, superuser_identity, ): service = current_rdm_records.records_service draft = service.create(superuser_identity, minimal_record) record = service.publish(superuser_identity, draft.id) _id = record.id _url = f"/records/{_id}" headers = {"Accept": "text/x-bibliography"} default_style = StringCitationSerializer._default_style default_locale = StringCitationSerializer._default_locale test_cases = [ ( f"{_url}?style=3d-printing-in-medicine&locale=es-ES", "3d-printing-in-medicine", "es-ES", 200, ), (f"{_url}?locale=es-ES", default_style, "es-ES", 200), ( f"{_url}?style=3d-printing-in-medicine", "3d-printing-in-medicine", default_locale, 200, ), (f"{_url}", default_style, default_locale, 200), (f"{_url}?style=Unknown_style", "Unknown_style", default_locale, 400), (f"{_url}?locale=Unknown_locale", default_style, default_locale, 200), ] for url, expected_style, expected_locale, expected_status in test_cases: response = client.get(url, headers=headers) assert response.status_code == expected_status body = response.get_data(as_text=True) if expected_status == 200: assert response.headers["content-type"] == "text/plain" expected_data = get_citation_string( CSLJSONSchema().dump(record), _id, locale=expected_locale, style=get_style_filepath(expected_style), ) assert expected_data == body elif expected_status == 400: assert response.headers["content-type"] == "application/json" assert f"Citation string style not found." in body
true
true
f7f969c1a6ac200c2d56dd055a94745f011c80dd
1,479
py
Python
andrew/generategenomes.py
ajclaros/rl_legged_walker
26d0e124ef38045943449c2772b966571117683b
[ "MIT" ]
null
null
null
andrew/generategenomes.py
ajclaros/rl_legged_walker
26d0e124ef38045943449c2772b966571117683b
[ "MIT" ]
null
null
null
andrew/generategenomes.py
ajclaros/rl_legged_walker
26d0e124ef38045943449c2772b966571117683b
[ "MIT" ]
null
null
null
import numpy as np import os from fitnessFunction import fitnessFunction import pandas as pd #filename = "two_neuron-step1.npy" genome_arr = np.load(filename) best = genome_arr[3] #index = 0 select_genome = 7 #lower_fitness = np.load("./genomes/scalinggenome-{select_genome}.npy") # uncomment to generate new scaling genome for j in range(1): #lower_fitness = np.zeros((best.shape)) #for i in range(lower_fitness.size): # lower_fitness[i] = - np.random.uniform(0, 0.4) #np.save(f"./genomes/scalinggenome-{select_genome}.npy",lower_fitness) #genome9 start 6130 #delete 7 print(j) points = [0.6, 0.5, 0.4, 0.3, 0.2, 0.1] for i in range(10000): save_fitness = best+lower_fitness*(i*10**-4) fit = fitnessFunction(save_fitness) print(fit) #print(fit, end=" ", flush=False) point_delete = [] if not (i % 100): print(i, end=' ', flush=False) for point in points: if fit<point+0.02 and fit> point-0.02: print(f"index{i}") print("saving fit of {} to {}".format(fit, point)) # np.save(f"./perturbations/{point}/p-{select_genome}-{i}.npy", save_fitness) point_delete.append(points.index(point)) break for ind in point_delete: points.pop(ind) print(f"points left:{points}") #find genome with fitness in range 0.1 genome 5, #lowest fitness before before given range
32.866667
92
0.617309
import numpy as np import os from fitnessFunction import fitnessFunction import pandas as pd genome_arr = np.load(filename) best = genome_arr[3] select_genome = 7 for j in range(1): print(j) points = [0.6, 0.5, 0.4, 0.3, 0.2, 0.1] for i in range(10000): save_fitness = best+lower_fitness*(i*10**-4) fit = fitnessFunction(save_fitness) print(fit) point_delete = [] if not (i % 100): print(i, end=' ', flush=False) for point in points: if fit<point+0.02 and fit> point-0.02: print(f"index{i}") print("saving fit of {} to {}".format(fit, point)) point_delete.append(points.index(point)) break for ind in point_delete: points.pop(ind) print(f"points left:{points}")
true
true
f7f969d3f63f785ff953f69cad230024a7cf5eae
243
py
Python
PyEvolv/assets/font.py
peerlator/PyEvolv
7f5644e2ea22257f34547c9b050bc4cdd4f3bdec
[ "MIT" ]
1
2018-08-02T19:42:35.000Z
2018-08-02T19:42:35.000Z
PyEvolv/assets/font.py
peerlator/PyEvolv
7f5644e2ea22257f34547c9b050bc4cdd4f3bdec
[ "MIT" ]
1
2018-08-02T19:41:58.000Z
2018-08-05T17:53:17.000Z
PyEvolv/assets/font.py
peerlator/PyEvolv
7f5644e2ea22257f34547c9b050bc4cdd4f3bdec
[ "MIT" ]
null
null
null
import pygame import PyEvolv import os pygame.font.init() path = os.path.join(PyEvolv.__path__[0], 'assets', 'Arial.ttf') FONT = pygame.font.Font(path, 20) def get_font(size:int) -> pygame.font.Font: return pygame.font.Font(path, size)
20.25
63
0.720165
import pygame import PyEvolv import os pygame.font.init() path = os.path.join(PyEvolv.__path__[0], 'assets', 'Arial.ttf') FONT = pygame.font.Font(path, 20) def get_font(size:int) -> pygame.font.Font: return pygame.font.Font(path, size)
true
true
f7f96bd1f2cdb6be9177a9e421651ecb01b38e5c
1,529
py
Python
engine/config_storage.py
hive-engine/distribution-engine-smt
9ed4fddbae17342700a4ba0f24c667c8b853c793
[ "MIT" ]
null
null
null
engine/config_storage.py
hive-engine/distribution-engine-smt
9ed4fddbae17342700a4ba0f24c667c8b853c793
[ "MIT" ]
null
null
null
engine/config_storage.py
hive-engine/distribution-engine-smt
9ed4fddbae17342700a4ba0f24c667c8b853c793
[ "MIT" ]
null
null
null
# This Python file uses the following encoding: utf-8 from __future__ import absolute_import from __future__ import division from __future__ import print_function from __future__ import unicode_literals from builtins import bytes from builtins import object from beemgraphenebase.py23 import py23_bytes, bytes_types from sqlalchemy.dialects.postgresql import insert as pg_insert import shutil import time import os import json import sqlite3 from appdirs import user_data_dir from datetime import datetime, timedelta from beem.utils import formatTimeString, addTzInfo import logging from binascii import hexlify import random import hashlib import dataset from sqlalchemy import and_ log = logging.getLogger(__name__) log.setLevel(logging.DEBUG) log.addHandler(logging.StreamHandler()) timeformat = "%Y%m%d-%H%M%S" HIVED = 1 ENGINE_SIDECHAIN = 2 class ConfigurationDB(object): """ This is the trx storage class """ __tablename__ = 'configuration' def __init__(self, db): self.db = db def get(self): table = self.db[self.__tablename__] return table.find_one(id=HIVED) def get_engine(self): table = self.db[self.__tablename__] return table.find_one(id=ENGINE_SIDECHAIN) def upsert(self, data): data["id"]= HIVED table = self.db[self.__tablename__] table.upsert(data, ['id']) def upsert_engine(self, data): data["id"]= ENGINE_SIDECHAIN table = self.db[self.__tablename__] table.upsert(data, ['id'])
25.915254
62
0.734467
from __future__ import absolute_import from __future__ import division from __future__ import print_function from __future__ import unicode_literals from builtins import bytes from builtins import object from beemgraphenebase.py23 import py23_bytes, bytes_types from sqlalchemy.dialects.postgresql import insert as pg_insert import shutil import time import os import json import sqlite3 from appdirs import user_data_dir from datetime import datetime, timedelta from beem.utils import formatTimeString, addTzInfo import logging from binascii import hexlify import random import hashlib import dataset from sqlalchemy import and_ log = logging.getLogger(__name__) log.setLevel(logging.DEBUG) log.addHandler(logging.StreamHandler()) timeformat = "%Y%m%d-%H%M%S" HIVED = 1 ENGINE_SIDECHAIN = 2 class ConfigurationDB(object): __tablename__ = 'configuration' def __init__(self, db): self.db = db def get(self): table = self.db[self.__tablename__] return table.find_one(id=HIVED) def get_engine(self): table = self.db[self.__tablename__] return table.find_one(id=ENGINE_SIDECHAIN) def upsert(self, data): data["id"]= HIVED table = self.db[self.__tablename__] table.upsert(data, ['id']) def upsert_engine(self, data): data["id"]= ENGINE_SIDECHAIN table = self.db[self.__tablename__] table.upsert(data, ['id'])
true
true
f7f96c62879766d126c79a1e1f6e5517705c2a98
1,628
py
Python
backend/main.py
le-kag/Fast-API-backend
1693c293ddf4a7060a9a1604f7d189c6a81ff48d
[ "MIT" ]
null
null
null
backend/main.py
le-kag/Fast-API-backend
1693c293ddf4a7060a9a1604f7d189c6a81ff48d
[ "MIT" ]
null
null
null
backend/main.py
le-kag/Fast-API-backend
1693c293ddf4a7060a9a1604f7d189c6a81ff48d
[ "MIT" ]
null
null
null
from fastapi import FastAPI, HTTPException from fastapi.middleware.cors import CORSMiddleware from model import Todo app = FastAPI() from database import ( fetch_one_todo, fetch_all_todos, create_todo, update_todo, remove_todo ) origins = ['https://localhost:3000'] app.add_middleware( CORSMiddleware, allow_origins=origins, allow_credentials = True, allow_methods=["*"], allow_headers=["*"], ) @app.get("/") async def read_root(): return {"Hello": "World"} @app.get("/api/todo") async def get_todo(): response = await fetch_all_todos() return response @app.get("/api/todo/{title}", response_model=Todo) async def get_todo_by_title(title): response = await fetch_one_todo(title) if response: return response raise HTTPException(404, f"There is no todo with the title {title}") @app.post("/api/todo/", response_model=Todo) async def post_todo(todo: Todo): response = await create_todo(todo.dict()) if response: return response raise HTTPException(400, "Something went wrong") @app.put("/api/todo/{title}/", response_model=Todo) async def put_todo(title: str, desc: str): response = await update_todo(title, desc) if response: return response raise HTTPException(404, f"There is no todo with the title {title}") @app.delete("/api/todo/{title}") async def delete_todo(title): response = await remove_todo(title) if response: return "Successfully deleted todo" raise HTTPException(404, f"There is no todo with the title {title}")
26.688525
73
0.670147
from fastapi import FastAPI, HTTPException from fastapi.middleware.cors import CORSMiddleware from model import Todo app = FastAPI() from database import ( fetch_one_todo, fetch_all_todos, create_todo, update_todo, remove_todo ) origins = ['https://localhost:3000'] app.add_middleware( CORSMiddleware, allow_origins=origins, allow_credentials = True, allow_methods=["*"], allow_headers=["*"], ) @app.get("/") async def read_root(): return {"Hello": "World"} @app.get("/api/todo") async def get_todo(): response = await fetch_all_todos() return response @app.get("/api/todo/{title}", response_model=Todo) async def get_todo_by_title(title): response = await fetch_one_todo(title) if response: return response raise HTTPException(404, f"There is no todo with the title {title}") @app.post("/api/todo/", response_model=Todo) async def post_todo(todo: Todo): response = await create_todo(todo.dict()) if response: return response raise HTTPException(400, "Something went wrong") @app.put("/api/todo/{title}/", response_model=Todo) async def put_todo(title: str, desc: str): response = await update_todo(title, desc) if response: return response raise HTTPException(404, f"There is no todo with the title {title}") @app.delete("/api/todo/{title}") async def delete_todo(title): response = await remove_todo(title) if response: return "Successfully deleted todo" raise HTTPException(404, f"There is no todo with the title {title}")
true
true
f7f96c7d03d0113e3a094765f6a9a9e0330e097d
14,456
py
Python
openpype/hosts/standalonepublisher/plugins/publish/extract_harmony_zip.py
dangerstudios/OpenPype
10ddcc4699137888616eec57cd7fac9648189714
[ "MIT" ]
null
null
null
openpype/hosts/standalonepublisher/plugins/publish/extract_harmony_zip.py
dangerstudios/OpenPype
10ddcc4699137888616eec57cd7fac9648189714
[ "MIT" ]
null
null
null
openpype/hosts/standalonepublisher/plugins/publish/extract_harmony_zip.py
dangerstudios/OpenPype
10ddcc4699137888616eec57cd7fac9648189714
[ "MIT" ]
null
null
null
# -*- coding: utf-8 -*- """Extract Harmony scene from zip file.""" import glob import os import shutil import six import sys import tempfile import zipfile import pyblish.api from avalon import api, io import openpype.api class ExtractHarmonyZip(openpype.api.Extractor): """Extract Harmony zip.""" # Pyblish settings label = "Extract Harmony zip" order = pyblish.api.ExtractorOrder + 0.02 hosts = ["standalonepublisher"] families = ["scene"] # Properties session = None task_types = None task_statuses = None assetversion_statuses = None # Presets create_workfile = True default_task = "harmonyIngest" default_task_type = "Ingest" default_task_status = "Ingested" assetversion_status = "Ingested" def process(self, instance): """Plugin entry point.""" context = instance.context self.session = context.data["ftrackSession"] asset_doc = context.data["assetEntity"] # asset_name = instance.data["asset"] subset_name = instance.data["subset"] instance_name = instance.data["name"] family = instance.data["family"] task = context.data["anatomyData"]["task"] or self.default_task project_entity = instance.context.data["projectEntity"] ftrack_id = asset_doc["data"]["ftrackId"] repres = instance.data["representations"] submitted_staging_dir = repres[0]["stagingDir"] submitted_files = repres[0]["files"] # Get all the ftrack entities needed # Asset Entity query = 'AssetBuild where id is "{}"'.format(ftrack_id) asset_entity = self.session.query(query).first() # Project Entity query = 'Project where full_name is "{}"'.format( project_entity["name"] ) project_entity = self.session.query(query).one() # Get Task types and Statuses for creation if needed self.task_types = self._get_all_task_types(project_entity) self.task_statuses = self.get_all_task_statuses(project_entity) # Get Statuses of AssetVersions self.assetversion_statuses = self.get_all_assetversion_statuses( project_entity ) # Setup the status that we want for the AssetVersion if self.assetversion_status: instance.data["assetversion_status"] = self.assetversion_status # Create the default_task if it does not exist if task == self.default_task: existing_tasks = [] entity_children = asset_entity.get('children', []) for child in entity_children: if child.entity_type.lower() == 'task': existing_tasks.append(child['name'].lower()) if task.lower() in existing_tasks: print("Task {} already exists".format(task)) else: self.create_task( name=task, task_type=self.default_task_type, task_status=self.default_task_status, parent=asset_entity, ) # Find latest version latest_version = self._find_last_version(subset_name, asset_doc) version_number = 1 if latest_version is not None: version_number += latest_version self.log.info( "Next version of instance \"{}\" will be {}".format( instance_name, version_number ) ) # update instance info instance.data["task"] = task instance.data["version_name"] = "{}_{}".format(subset_name, task) instance.data["family"] = family instance.data["subset"] = subset_name instance.data["version"] = version_number instance.data["latestVersion"] = latest_version instance.data["anatomyData"].update({ "subset": subset_name, "family": family, "version": version_number }) # Copy `families` and check if `family` is not in current families families = instance.data.get("families") or list() if families: families = list(set(families)) instance.data["families"] = families # Prepare staging dir for new instance and zip + sanitize scene name staging_dir = tempfile.mkdtemp(prefix="pyblish_tmp_") # Handle if the representation is a .zip and not an .xstage pre_staged = False if submitted_files.endswith(".zip"): submitted_zip_file = os.path.join(submitted_staging_dir, submitted_files ).replace("\\", "/") pre_staged = self.sanitize_prezipped_project(instance, submitted_zip_file, staging_dir) # Get the file to work with source_dir = str(repres[0]["stagingDir"]) source_file = str(repres[0]["files"]) staging_scene_dir = os.path.join(staging_dir, "scene") staging_scene = os.path.join(staging_scene_dir, source_file) # If the file is an .xstage / directory, we must stage it if not pre_staged: shutil.copytree(source_dir, staging_scene_dir) # Rename this latest file as 'scene.xstage' # This is is determined in the collector from the latest scene in a # submitted directory / directory the submitted .xstage is in. # In the case of a zip file being submitted, this is determined within # the self.sanitize_project() method in this extractor. os.rename(staging_scene, os.path.join(staging_scene_dir, "scene.xstage") ) # Required to set the current directory where the zip will end up os.chdir(staging_dir) # Create the zip file zip_filepath = shutil.make_archive(os.path.basename(source_dir), "zip", staging_scene_dir ) zip_filename = os.path.basename(zip_filepath) self.log.info("Zip file: {}".format(zip_filepath)) # Setup representation new_repre = { "name": "zip", "ext": "zip", "files": zip_filename, "stagingDir": staging_dir } self.log.debug( "Creating new representation: {}".format(new_repre) ) instance.data["representations"] = [new_repre] self.log.debug("Completed prep of zipped Harmony scene: {}" .format(zip_filepath) ) # If this extractor is setup to also extract a workfile... if self.create_workfile: workfile_path = self.extract_workfile(instance, staging_scene ) self.log.debug("Extracted Workfile to: {}".format(workfile_path)) def extract_workfile(self, instance, staging_scene): """Extract a valid workfile for this corresponding publish. Args: instance (:class:`pyblish.api.Instance`): Instance data. staging_scene (str): path of staging scene. Returns: str: Path to workdir. """ # Since the staging scene was renamed to "scene.xstage" for publish # rename the staging scene in the temp stagingdir staging_scene = os.path.join(os.path.dirname(staging_scene), "scene.xstage") # Setup the data needed to form a valid work path filename anatomy = openpype.api.Anatomy() project_entity = instance.context.data["projectEntity"] data = { "root": api.registered_root(), "project": { "name": project_entity["name"], "code": project_entity["data"].get("code", '') }, "asset": instance.data["asset"], "hierarchy": openpype.api.get_hierarchy(instance.data["asset"]), "family": instance.data["family"], "task": instance.data.get("task"), "subset": instance.data["subset"], "version": 1, "ext": "zip", } # Get a valid work filename first with version 1 file_template = anatomy.templates["work"]["file"] anatomy_filled = anatomy.format(data) work_path = anatomy_filled["work"]["path"] # Get the final work filename with the proper version data["version"] = api.last_workfile_with_version( os.path.dirname(work_path), file_template, data, [".zip"] )[1] work_path = anatomy_filled["work"]["path"] base_name = os.path.splitext(os.path.basename(work_path))[0] staging_work_path = os.path.join(os.path.dirname(staging_scene), base_name + ".xstage" ) # Rename this latest file after the workfile path filename os.rename(staging_scene, staging_work_path) # Required to set the current directory where the zip will end up os.chdir(os.path.dirname(os.path.dirname(staging_scene))) # Create the zip file zip_filepath = shutil.make_archive(base_name, "zip", os.path.dirname(staging_scene) ) self.log.info(staging_scene) self.log.info(work_path) self.log.info(staging_work_path) self.log.info(os.path.dirname(os.path.dirname(staging_scene))) self.log.info(base_name) self.log.info(zip_filepath) # Create the work path on disk if it does not exist os.makedirs(os.path.dirname(work_path), exist_ok=True) shutil.copy(zip_filepath, work_path) return work_path def sanitize_prezipped_project( self, instance, zip_filepath, staging_dir): """Fix when a zip contains a folder. Handle zip file root contains folder instead of the project. Args: instance (:class:`pyblish.api.Instance`): Instance data. zip_filepath (str): Path to zip. staging_dir (str): Path to staging directory. """ zip = zipfile.ZipFile(zip_filepath) zip_contents = zipfile.ZipFile.namelist(zip) # Determine if any xstage file is in root of zip project_in_root = [pth for pth in zip_contents if "/" not in pth and pth.endswith(".xstage")] staging_scene_dir = os.path.join(staging_dir, "scene") # The project is nested, so we must extract and move it if not project_in_root: staging_tmp_dir = os.path.join(staging_dir, "tmp") with zipfile.ZipFile(zip_filepath, "r") as zip_ref: zip_ref.extractall(staging_tmp_dir) nested_project_folder = os.path.join(staging_tmp_dir, zip_contents[0] ) shutil.copytree(nested_project_folder, staging_scene_dir) else: # The project is not nested, so we just extract to scene folder with zipfile.ZipFile(zip_filepath, "r") as zip_ref: zip_ref.extractall(staging_scene_dir) latest_file = max(glob.iglob(staging_scene_dir + "/*.xstage"), key=os.path.getctime).replace("\\", "/") instance.data["representations"][0]["stagingDir"] = staging_scene_dir instance.data["representations"][0]["files"] = os.path.basename( latest_file) # We have staged the scene already so return True return True def _find_last_version(self, subset_name, asset_doc): """Find last version of subset.""" subset_doc = io.find_one({ "type": "subset", "name": subset_name, "parent": asset_doc["_id"] }) if subset_doc is None: self.log.debug("Subset entity does not exist yet.") else: version_doc = io.find_one( { "type": "version", "parent": subset_doc["_id"] }, sort=[("name", -1)] ) if version_doc: return int(version_doc["name"]) return None def _get_all_task_types(self, project): """Get all task types.""" tasks = {} proj_template = project['project_schema'] temp_task_types = proj_template['_task_type_schema']['types'] for type in temp_task_types: if type['name'] not in tasks: tasks[type['name']] = type return tasks def _get_all_task_statuses(self, project): """Get all statuses of tasks.""" statuses = {} proj_template = project['project_schema'] temp_task_statuses = proj_template.get_statuses("Task") for status in temp_task_statuses: if status['name'] not in statuses: statuses[status['name']] = status return statuses def _get_all_assetversion_statuses(self, project): """Get statuses of all asset versions.""" statuses = {} proj_template = project['project_schema'] temp_task_statuses = proj_template.get_statuses("AssetVersion") for status in temp_task_statuses: if status['name'] not in statuses: statuses[status['name']] = status return statuses def _create_task(self, name, task_type, parent, task_status): """Create task.""" task_data = { 'name': name, 'parent': parent, } self.log.info(task_type) task_data['type'] = self.task_types[task_type] task_data['status'] = self.task_statuses[task_status] self.log.info(task_data) task = self.session.create('Task', task_data) try: self.session.commit() except Exception: tp, value, tb = sys.exc_info() self.session.rollback() six.reraise(tp, value, tb) return task
35.693827
78
0.571251
import glob import os import shutil import six import sys import tempfile import zipfile import pyblish.api from avalon import api, io import openpype.api class ExtractHarmonyZip(openpype.api.Extractor): label = "Extract Harmony zip" order = pyblish.api.ExtractorOrder + 0.02 hosts = ["standalonepublisher"] families = ["scene"] session = None task_types = None task_statuses = None assetversion_statuses = None create_workfile = True default_task = "harmonyIngest" default_task_type = "Ingest" default_task_status = "Ingested" assetversion_status = "Ingested" def process(self, instance): context = instance.context self.session = context.data["ftrackSession"] asset_doc = context.data["assetEntity"] subset_name = instance.data["subset"] instance_name = instance.data["name"] family = instance.data["family"] task = context.data["anatomyData"]["task"] or self.default_task project_entity = instance.context.data["projectEntity"] ftrack_id = asset_doc["data"]["ftrackId"] repres = instance.data["representations"] submitted_staging_dir = repres[0]["stagingDir"] submitted_files = repres[0]["files"] query = 'AssetBuild where id is "{}"'.format(ftrack_id) asset_entity = self.session.query(query).first() query = 'Project where full_name is "{}"'.format( project_entity["name"] ) project_entity = self.session.query(query).one() self.task_types = self._get_all_task_types(project_entity) self.task_statuses = self.get_all_task_statuses(project_entity) self.assetversion_statuses = self.get_all_assetversion_statuses( project_entity ) if self.assetversion_status: instance.data["assetversion_status"] = self.assetversion_status if task == self.default_task: existing_tasks = [] entity_children = asset_entity.get('children', []) for child in entity_children: if child.entity_type.lower() == 'task': existing_tasks.append(child['name'].lower()) if task.lower() in existing_tasks: print("Task {} already exists".format(task)) else: self.create_task( name=task, task_type=self.default_task_type, task_status=self.default_task_status, parent=asset_entity, ) latest_version = self._find_last_version(subset_name, asset_doc) version_number = 1 if latest_version is not None: version_number += latest_version self.log.info( "Next version of instance \"{}\" will be {}".format( instance_name, version_number ) ) instance.data["task"] = task instance.data["version_name"] = "{}_{}".format(subset_name, task) instance.data["family"] = family instance.data["subset"] = subset_name instance.data["version"] = version_number instance.data["latestVersion"] = latest_version instance.data["anatomyData"].update({ "subset": subset_name, "family": family, "version": version_number }) families = instance.data.get("families") or list() if families: families = list(set(families)) instance.data["families"] = families staging_dir = tempfile.mkdtemp(prefix="pyblish_tmp_") pre_staged = False if submitted_files.endswith(".zip"): submitted_zip_file = os.path.join(submitted_staging_dir, submitted_files ).replace("\\", "/") pre_staged = self.sanitize_prezipped_project(instance, submitted_zip_file, staging_dir) source_dir = str(repres[0]["stagingDir"]) source_file = str(repres[0]["files"]) staging_scene_dir = os.path.join(staging_dir, "scene") staging_scene = os.path.join(staging_scene_dir, source_file) if not pre_staged: shutil.copytree(source_dir, staging_scene_dir) os.rename(staging_scene, os.path.join(staging_scene_dir, "scene.xstage") ) os.chdir(staging_dir) zip_filepath = shutil.make_archive(os.path.basename(source_dir), "zip", staging_scene_dir ) zip_filename = os.path.basename(zip_filepath) self.log.info("Zip file: {}".format(zip_filepath)) new_repre = { "name": "zip", "ext": "zip", "files": zip_filename, "stagingDir": staging_dir } self.log.debug( "Creating new representation: {}".format(new_repre) ) instance.data["representations"] = [new_repre] self.log.debug("Completed prep of zipped Harmony scene: {}" .format(zip_filepath) ) if self.create_workfile: workfile_path = self.extract_workfile(instance, staging_scene ) self.log.debug("Extracted Workfile to: {}".format(workfile_path)) def extract_workfile(self, instance, staging_scene): staging_scene = os.path.join(os.path.dirname(staging_scene), "scene.xstage") anatomy = openpype.api.Anatomy() project_entity = instance.context.data["projectEntity"] data = { "root": api.registered_root(), "project": { "name": project_entity["name"], "code": project_entity["data"].get("code", '') }, "asset": instance.data["asset"], "hierarchy": openpype.api.get_hierarchy(instance.data["asset"]), "family": instance.data["family"], "task": instance.data.get("task"), "subset": instance.data["subset"], "version": 1, "ext": "zip", } file_template = anatomy.templates["work"]["file"] anatomy_filled = anatomy.format(data) work_path = anatomy_filled["work"]["path"] data["version"] = api.last_workfile_with_version( os.path.dirname(work_path), file_template, data, [".zip"] )[1] work_path = anatomy_filled["work"]["path"] base_name = os.path.splitext(os.path.basename(work_path))[0] staging_work_path = os.path.join(os.path.dirname(staging_scene), base_name + ".xstage" ) os.rename(staging_scene, staging_work_path) os.chdir(os.path.dirname(os.path.dirname(staging_scene))) zip_filepath = shutil.make_archive(base_name, "zip", os.path.dirname(staging_scene) ) self.log.info(staging_scene) self.log.info(work_path) self.log.info(staging_work_path) self.log.info(os.path.dirname(os.path.dirname(staging_scene))) self.log.info(base_name) self.log.info(zip_filepath) os.makedirs(os.path.dirname(work_path), exist_ok=True) shutil.copy(zip_filepath, work_path) return work_path def sanitize_prezipped_project( self, instance, zip_filepath, staging_dir): zip = zipfile.ZipFile(zip_filepath) zip_contents = zipfile.ZipFile.namelist(zip) project_in_root = [pth for pth in zip_contents if "/" not in pth and pth.endswith(".xstage")] staging_scene_dir = os.path.join(staging_dir, "scene") if not project_in_root: staging_tmp_dir = os.path.join(staging_dir, "tmp") with zipfile.ZipFile(zip_filepath, "r") as zip_ref: zip_ref.extractall(staging_tmp_dir) nested_project_folder = os.path.join(staging_tmp_dir, zip_contents[0] ) shutil.copytree(nested_project_folder, staging_scene_dir) else: with zipfile.ZipFile(zip_filepath, "r") as zip_ref: zip_ref.extractall(staging_scene_dir) latest_file = max(glob.iglob(staging_scene_dir + "/*.xstage"), key=os.path.getctime).replace("\\", "/") instance.data["representations"][0]["stagingDir"] = staging_scene_dir instance.data["representations"][0]["files"] = os.path.basename( latest_file) return True def _find_last_version(self, subset_name, asset_doc): subset_doc = io.find_one({ "type": "subset", "name": subset_name, "parent": asset_doc["_id"] }) if subset_doc is None: self.log.debug("Subset entity does not exist yet.") else: version_doc = io.find_one( { "type": "version", "parent": subset_doc["_id"] }, sort=[("name", -1)] ) if version_doc: return int(version_doc["name"]) return None def _get_all_task_types(self, project): tasks = {} proj_template = project['project_schema'] temp_task_types = proj_template['_task_type_schema']['types'] for type in temp_task_types: if type['name'] not in tasks: tasks[type['name']] = type return tasks def _get_all_task_statuses(self, project): statuses = {} proj_template = project['project_schema'] temp_task_statuses = proj_template.get_statuses("Task") for status in temp_task_statuses: if status['name'] not in statuses: statuses[status['name']] = status return statuses def _get_all_assetversion_statuses(self, project): statuses = {} proj_template = project['project_schema'] temp_task_statuses = proj_template.get_statuses("AssetVersion") for status in temp_task_statuses: if status['name'] not in statuses: statuses[status['name']] = status return statuses def _create_task(self, name, task_type, parent, task_status): task_data = { 'name': name, 'parent': parent, } self.log.info(task_type) task_data['type'] = self.task_types[task_type] task_data['status'] = self.task_statuses[task_status] self.log.info(task_data) task = self.session.create('Task', task_data) try: self.session.commit() except Exception: tp, value, tb = sys.exc_info() self.session.rollback() six.reraise(tp, value, tb) return task
true
true
f7f96c9ff5efcfd0c01cd37a8ca34ec81c088922
10,447
py
Python
Lib/robofab/test/testSupport.py
Vectro-Type-Foundry/robofab
cd65d78292d24358c98dce53d283314cdc85878e
[ "BSD-3-Clause" ]
61
2015-01-17T10:15:45.000Z
2018-12-02T13:53:02.000Z
Lib/robofab/test/testSupport.py
Vectro-Type-Foundry/robofab
cd65d78292d24358c98dce53d283314cdc85878e
[ "BSD-3-Clause" ]
37
2015-01-05T23:44:56.000Z
2018-03-16T19:05:28.000Z
Lib/robofab/test/testSupport.py
Vectro-Type-Foundry/robofab
cd65d78292d24358c98dce53d283314cdc85878e
[ "BSD-3-Clause" ]
25
2015-01-08T19:49:36.000Z
2018-10-29T00:36:46.000Z
"""Miscellaneous helpers for our test suite.""" import sys import os import types import unittest def getDemoFontPath(): """Return the path to Data/DemoFont.ufo/.""" import robofab root = os.path.dirname(os.path.dirname(os.path.dirname(robofab.__file__))) return os.path.join(root, "Data", "DemoFont.ufo") def getDemoFontGlyphSetPath(): """Return the path to Data/DemoFont.ufo/glyphs/.""" return os.path.join(getDemoFontPath(), "glyphs") def _gatherTestCasesFromCallerByMagic(): # UGLY magic: fetch TestClass subclasses from the globals of our # caller's caller. frame = sys._getframe(2) return _gatherTestCasesFromDict(frame.f_globals) def _gatherTestCasesFromDict(d): testCases = [] for ob in d.values(): if isinstance(ob, type) and issubclass(ob, unittest.TestCase): testCases.append(ob) return testCases def runTests(testCases=None, verbosity=1): """Run a series of tests.""" if testCases is None: testCases = _gatherTestCasesFromCallerByMagic() loader = unittest.TestLoader() suites = [] for testCase in testCases: suites.append(loader.loadTestsFromTestCase(testCase)) testRunner = unittest.TextTestRunner(verbosity=verbosity) testSuite = unittest.TestSuite(suites) testRunner.run(testSuite) # font info values used by several tests fontInfoVersion1 = { "familyName" : "Some Font (Family Name)", "styleName" : "Regular (Style Name)", "fullName" : "Some Font-Regular (Postscript Full Name)", "fontName" : "SomeFont-Regular (Postscript Font Name)", "menuName" : "Some Font Regular (Style Map Family Name)", "fontStyle" : 64, "note" : "A note.", "versionMajor" : 1, "versionMinor" : 0, "year" : 2008, "copyright" : "Copyright Some Foundry.", "notice" : "Some Font by Some Designer for Some Foundry.", "trademark" : "Trademark Some Foundry", "license" : "License info for Some Foundry.", "licenseURL" : "http://somefoundry.com/license", "createdBy" : "Some Foundry", "designer" : "Some Designer", "designerURL" : "http://somedesigner.com", "vendorURL" : "http://somefoundry.com", "unitsPerEm" : 1000, "ascender" : 750, "descender" : -250, "capHeight" : 750, "xHeight" : 500, "defaultWidth" : 400, "slantAngle" : -12.5, "italicAngle" : -12.5, "widthName" : "Medium (normal)", "weightName" : "Medium", "weightValue" : 500, "fondName" : "SomeFont Regular (FOND Name)", "otFamilyName" : "Some Font (Preferred Family Name)", "otStyleName" : "Regular (Preferred Subfamily Name)", "otMacName" : "Some Font Regular (Compatible Full Name)", "msCharSet" : 0, "fondID" : 15000, "uniqueID" : 4000000, "ttVendor" : "SOME", "ttUniqueID" : "OpenType name Table Unique ID", "ttVersion" : "OpenType name Table Version", } fontInfoVersion2 = { "familyName" : "Some Font (Family Name)", "styleName" : "Regular (Style Name)", "styleMapFamilyName" : "Some Font Regular (Style Map Family Name)", "styleMapStyleName" : "regular", "versionMajor" : 1, "versionMinor" : 0, "year" : 2008, "copyright" : "Copyright Some Foundry.", "trademark" : "Trademark Some Foundry", "unitsPerEm" : 1000, "descender" : -250, "xHeight" : 500, "capHeight" : 750, "ascender" : 750, "italicAngle" : -12.5, "note" : "A note.", "openTypeHeadCreated" : "2000/01/01 00:00:00", "openTypeHeadLowestRecPPEM" : 10, "openTypeHeadFlags" : [0, 1], "openTypeHheaAscender" : 750, "openTypeHheaDescender" : -250, "openTypeHheaLineGap" : 200, "openTypeHheaCaretSlopeRise" : 1, "openTypeHheaCaretSlopeRun" : 0, "openTypeHheaCaretOffset" : 0, "openTypeNameDesigner" : "Some Designer", "openTypeNameDesignerURL" : "http://somedesigner.com", "openTypeNameManufacturer" : "Some Foundry", "openTypeNameManufacturerURL" : "http://somefoundry.com", "openTypeNameLicense" : "License info for Some Foundry.", "openTypeNameLicenseURL" : "http://somefoundry.com/license", "openTypeNameVersion" : "OpenType name Table Version", "openTypeNameUniqueID" : "OpenType name Table Unique ID", "openTypeNameDescription" : "Some Font by Some Designer for Some Foundry.", "openTypeNamePreferredFamilyName" : "Some Font (Preferred Family Name)", "openTypeNamePreferredSubfamilyName" : "Regular (Preferred Subfamily Name)", "openTypeNameCompatibleFullName" : "Some Font Regular (Compatible Full Name)", "openTypeNameSampleText" : "Sample Text for Some Font.", "openTypeNameWWSFamilyName" : "Some Font (WWS Family Name)", "openTypeNameWWSSubfamilyName" : "Regular (WWS Subfamily Name)", "openTypeOS2WidthClass" : 5, "openTypeOS2WeightClass" : 500, "openTypeOS2Selection" : [3], "openTypeOS2VendorID" : "SOME", "openTypeOS2Panose" : [0, 1, 2, 3, 4, 5, 6, 7, 8, 9], "openTypeOS2FamilyClass" : [1, 1], "openTypeOS2UnicodeRanges" : [0, 1], "openTypeOS2CodePageRanges" : [0, 1], "openTypeOS2TypoAscender" : 750, "openTypeOS2TypoDescender" : -250, "openTypeOS2TypoLineGap" : 200, "openTypeOS2WinAscent" : 750, "openTypeOS2WinDescent" : -250, "openTypeOS2Type" : [], "openTypeOS2SubscriptXSize" : 200, "openTypeOS2SubscriptYSize" : 400, "openTypeOS2SubscriptXOffset" : 0, "openTypeOS2SubscriptYOffset" : -100, "openTypeOS2SuperscriptXSize" : 200, "openTypeOS2SuperscriptYSize" : 400, "openTypeOS2SuperscriptXOffset" : 0, "openTypeOS2SuperscriptYOffset" : 200, "openTypeOS2StrikeoutSize" : 20, "openTypeOS2StrikeoutPosition" : 300, "openTypeVheaVertTypoAscender" : 750, "openTypeVheaVertTypoDescender" : -250, "openTypeVheaVertTypoLineGap" : 200, "openTypeVheaCaretSlopeRise" : 0, "openTypeVheaCaretSlopeRun" : 1, "openTypeVheaCaretOffset" : 0, "postscriptFontName" : "SomeFont-Regular (Postscript Font Name)", "postscriptFullName" : "Some Font-Regular (Postscript Full Name)", "postscriptSlantAngle" : -12.5, "postscriptUniqueID" : 4000000, "postscriptUnderlineThickness" : 20, "postscriptUnderlinePosition" : -200, "postscriptIsFixedPitch" : False, "postscriptBlueValues" : [500, 510], "postscriptOtherBlues" : [-250, -260], "postscriptFamilyBlues" : [500, 510], "postscriptFamilyOtherBlues" : [-250, -260], "postscriptStemSnapH" : [100, 120], "postscriptStemSnapV" : [80, 90], "postscriptBlueFuzz" : 1, "postscriptBlueShift" : 7, "postscriptBlueScale" : 0.039625, "postscriptForceBold" : True, "postscriptDefaultWidthX" : 400, "postscriptNominalWidthX" : 400, "postscriptWeightName" : "Medium", "postscriptDefaultCharacter" : ".notdef", "postscriptWindowsCharacterSet" : 1, "macintoshFONDFamilyID" : 15000, "macintoshFONDName" : "SomeFont Regular (FOND Name)", } expectedFontInfo1To2Conversion = { "familyName" : "Some Font (Family Name)", "styleMapFamilyName" : "Some Font Regular (Style Map Family Name)", "styleMapStyleName" : "regular", "styleName" : "Regular (Style Name)", "unitsPerEm" : 1000, "ascender" : 750, "capHeight" : 750, "xHeight" : 500, "descender" : -250, "italicAngle" : -12.5, "versionMajor" : 1, "versionMinor" : 0, "year" : 2008, "copyright" : "Copyright Some Foundry.", "trademark" : "Trademark Some Foundry", "note" : "A note.", "macintoshFONDFamilyID" : 15000, "macintoshFONDName" : "SomeFont Regular (FOND Name)", "openTypeNameCompatibleFullName" : "Some Font Regular (Compatible Full Name)", "openTypeNameDescription" : "Some Font by Some Designer for Some Foundry.", "openTypeNameDesigner" : "Some Designer", "openTypeNameDesignerURL" : "http://somedesigner.com", "openTypeNameLicense" : "License info for Some Foundry.", "openTypeNameLicenseURL" : "http://somefoundry.com/license", "openTypeNameManufacturer" : "Some Foundry", "openTypeNameManufacturerURL" : "http://somefoundry.com", "openTypeNamePreferredFamilyName" : "Some Font (Preferred Family Name)", "openTypeNamePreferredSubfamilyName": "Regular (Preferred Subfamily Name)", "openTypeNameCompatibleFullName" : "Some Font Regular (Compatible Full Name)", "openTypeNameUniqueID" : "OpenType name Table Unique ID", "openTypeNameVersion" : "OpenType name Table Version", "openTypeOS2VendorID" : "SOME", "openTypeOS2WeightClass" : 500, "openTypeOS2WidthClass" : 5, "postscriptDefaultWidthX" : 400, "postscriptFontName" : "SomeFont-Regular (Postscript Font Name)", "postscriptFullName" : "Some Font-Regular (Postscript Full Name)", "postscriptSlantAngle" : -12.5, "postscriptUniqueID" : 4000000, "postscriptWeightName" : "Medium", "postscriptWindowsCharacterSet" : 1 } expectedFontInfo2To1Conversion = { "familyName" : "Some Font (Family Name)", "menuName" : "Some Font Regular (Style Map Family Name)", "fontStyle" : 64, "styleName" : "Regular (Style Name)", "unitsPerEm" : 1000, "ascender" : 750, "capHeight" : 750, "xHeight" : 500, "descender" : -250, "italicAngle" : -12.5, "versionMajor" : 1, "versionMinor" : 0, "copyright" : "Copyright Some Foundry.", "trademark" : "Trademark Some Foundry", "note" : "A note.", "fondID" : 15000, "fondName" : "SomeFont Regular (FOND Name)", "fullName" : "Some Font Regular (Compatible Full Name)", "notice" : "Some Font by Some Designer for Some Foundry.", "designer" : "Some Designer", "designerURL" : "http://somedesigner.com", "license" : "License info for Some Foundry.", "licenseURL" : "http://somefoundry.com/license", "createdBy" : "Some Foundry", "vendorURL" : "http://somefoundry.com", "otFamilyName" : "Some Font (Preferred Family Name)", "otStyleName" : "Regular (Preferred Subfamily Name)", "otMacName" : "Some Font Regular (Compatible Full Name)", "ttUniqueID" : "OpenType name Table Unique ID", "ttVersion" : "OpenType name Table Version", "ttVendor" : "SOME", "weightValue" : 500, "widthName" : "Medium (normal)", "defaultWidth" : 400, "fontName" : "SomeFont-Regular (Postscript Font Name)", "fullName" : "Some Font-Regular (Postscript Full Name)", "slantAngle" : -12.5, "uniqueID" : 4000000, "weightName" : "Medium", "msCharSet" : 0, "year" : 2008 }
37.444444
80
0.667273
import sys import os import types import unittest def getDemoFontPath(): import robofab root = os.path.dirname(os.path.dirname(os.path.dirname(robofab.__file__))) return os.path.join(root, "Data", "DemoFont.ufo") def getDemoFontGlyphSetPath(): return os.path.join(getDemoFontPath(), "glyphs") def _gatherTestCasesFromCallerByMagic(): frame = sys._getframe(2) return _gatherTestCasesFromDict(frame.f_globals) def _gatherTestCasesFromDict(d): testCases = [] for ob in d.values(): if isinstance(ob, type) and issubclass(ob, unittest.TestCase): testCases.append(ob) return testCases def runTests(testCases=None, verbosity=1): if testCases is None: testCases = _gatherTestCasesFromCallerByMagic() loader = unittest.TestLoader() suites = [] for testCase in testCases: suites.append(loader.loadTestsFromTestCase(testCase)) testRunner = unittest.TextTestRunner(verbosity=verbosity) testSuite = unittest.TestSuite(suites) testRunner.run(testSuite) # font info values used by several tests fontInfoVersion1 = { "familyName" : "Some Font (Family Name)", "styleName" : "Regular (Style Name)", "fullName" : "Some Font-Regular (Postscript Full Name)", "fontName" : "SomeFont-Regular (Postscript Font Name)", "menuName" : "Some Font Regular (Style Map Family Name)", "fontStyle" : 64, "note" : "A note.", "versionMajor" : 1, "versionMinor" : 0, "year" : 2008, "copyright" : "Copyright Some Foundry.", "notice" : "Some Font by Some Designer for Some Foundry.", "trademark" : "Trademark Some Foundry", "license" : "License info for Some Foundry.", "licenseURL" : "http://somefoundry.com/license", "createdBy" : "Some Foundry", "designer" : "Some Designer", "designerURL" : "http://somedesigner.com", "vendorURL" : "http://somefoundry.com", "unitsPerEm" : 1000, "ascender" : 750, "descender" : -250, "capHeight" : 750, "xHeight" : 500, "defaultWidth" : 400, "slantAngle" : -12.5, "italicAngle" : -12.5, "widthName" : "Medium (normal)", "weightName" : "Medium", "weightValue" : 500, "fondName" : "SomeFont Regular (FOND Name)", "otFamilyName" : "Some Font (Preferred Family Name)", "otStyleName" : "Regular (Preferred Subfamily Name)", "otMacName" : "Some Font Regular (Compatible Full Name)", "msCharSet" : 0, "fondID" : 15000, "uniqueID" : 4000000, "ttVendor" : "SOME", "ttUniqueID" : "OpenType name Table Unique ID", "ttVersion" : "OpenType name Table Version", } fontInfoVersion2 = { "familyName" : "Some Font (Family Name)", "styleName" : "Regular (Style Name)", "styleMapFamilyName" : "Some Font Regular (Style Map Family Name)", "styleMapStyleName" : "regular", "versionMajor" : 1, "versionMinor" : 0, "year" : 2008, "copyright" : "Copyright Some Foundry.", "trademark" : "Trademark Some Foundry", "unitsPerEm" : 1000, "descender" : -250, "xHeight" : 500, "capHeight" : 750, "ascender" : 750, "italicAngle" : -12.5, "note" : "A note.", "openTypeHeadCreated" : "2000/01/01 00:00:00", "openTypeHeadLowestRecPPEM" : 10, "openTypeHeadFlags" : [0, 1], "openTypeHheaAscender" : 750, "openTypeHheaDescender" : -250, "openTypeHheaLineGap" : 200, "openTypeHheaCaretSlopeRise" : 1, "openTypeHheaCaretSlopeRun" : 0, "openTypeHheaCaretOffset" : 0, "openTypeNameDesigner" : "Some Designer", "openTypeNameDesignerURL" : "http://somedesigner.com", "openTypeNameManufacturer" : "Some Foundry", "openTypeNameManufacturerURL" : "http://somefoundry.com", "openTypeNameLicense" : "License info for Some Foundry.", "openTypeNameLicenseURL" : "http://somefoundry.com/license", "openTypeNameVersion" : "OpenType name Table Version", "openTypeNameUniqueID" : "OpenType name Table Unique ID", "openTypeNameDescription" : "Some Font by Some Designer for Some Foundry.", "openTypeNamePreferredFamilyName" : "Some Font (Preferred Family Name)", "openTypeNamePreferredSubfamilyName" : "Regular (Preferred Subfamily Name)", "openTypeNameCompatibleFullName" : "Some Font Regular (Compatible Full Name)", "openTypeNameSampleText" : "Sample Text for Some Font.", "openTypeNameWWSFamilyName" : "Some Font (WWS Family Name)", "openTypeNameWWSSubfamilyName" : "Regular (WWS Subfamily Name)", "openTypeOS2WidthClass" : 5, "openTypeOS2WeightClass" : 500, "openTypeOS2Selection" : [3], "openTypeOS2VendorID" : "SOME", "openTypeOS2Panose" : [0, 1, 2, 3, 4, 5, 6, 7, 8, 9], "openTypeOS2FamilyClass" : [1, 1], "openTypeOS2UnicodeRanges" : [0, 1], "openTypeOS2CodePageRanges" : [0, 1], "openTypeOS2TypoAscender" : 750, "openTypeOS2TypoDescender" : -250, "openTypeOS2TypoLineGap" : 200, "openTypeOS2WinAscent" : 750, "openTypeOS2WinDescent" : -250, "openTypeOS2Type" : [], "openTypeOS2SubscriptXSize" : 200, "openTypeOS2SubscriptYSize" : 400, "openTypeOS2SubscriptXOffset" : 0, "openTypeOS2SubscriptYOffset" : -100, "openTypeOS2SuperscriptXSize" : 200, "openTypeOS2SuperscriptYSize" : 400, "openTypeOS2SuperscriptXOffset" : 0, "openTypeOS2SuperscriptYOffset" : 200, "openTypeOS2StrikeoutSize" : 20, "openTypeOS2StrikeoutPosition" : 300, "openTypeVheaVertTypoAscender" : 750, "openTypeVheaVertTypoDescender" : -250, "openTypeVheaVertTypoLineGap" : 200, "openTypeVheaCaretSlopeRise" : 0, "openTypeVheaCaretSlopeRun" : 1, "openTypeVheaCaretOffset" : 0, "postscriptFontName" : "SomeFont-Regular (Postscript Font Name)", "postscriptFullName" : "Some Font-Regular (Postscript Full Name)", "postscriptSlantAngle" : -12.5, "postscriptUniqueID" : 4000000, "postscriptUnderlineThickness" : 20, "postscriptUnderlinePosition" : -200, "postscriptIsFixedPitch" : False, "postscriptBlueValues" : [500, 510], "postscriptOtherBlues" : [-250, -260], "postscriptFamilyBlues" : [500, 510], "postscriptFamilyOtherBlues" : [-250, -260], "postscriptStemSnapH" : [100, 120], "postscriptStemSnapV" : [80, 90], "postscriptBlueFuzz" : 1, "postscriptBlueShift" : 7, "postscriptBlueScale" : 0.039625, "postscriptForceBold" : True, "postscriptDefaultWidthX" : 400, "postscriptNominalWidthX" : 400, "postscriptWeightName" : "Medium", "postscriptDefaultCharacter" : ".notdef", "postscriptWindowsCharacterSet" : 1, "macintoshFONDFamilyID" : 15000, "macintoshFONDName" : "SomeFont Regular (FOND Name)", } expectedFontInfo1To2Conversion = { "familyName" : "Some Font (Family Name)", "styleMapFamilyName" : "Some Font Regular (Style Map Family Name)", "styleMapStyleName" : "regular", "styleName" : "Regular (Style Name)", "unitsPerEm" : 1000, "ascender" : 750, "capHeight" : 750, "xHeight" : 500, "descender" : -250, "italicAngle" : -12.5, "versionMajor" : 1, "versionMinor" : 0, "year" : 2008, "copyright" : "Copyright Some Foundry.", "trademark" : "Trademark Some Foundry", "note" : "A note.", "macintoshFONDFamilyID" : 15000, "macintoshFONDName" : "SomeFont Regular (FOND Name)", "openTypeNameCompatibleFullName" : "Some Font Regular (Compatible Full Name)", "openTypeNameDescription" : "Some Font by Some Designer for Some Foundry.", "openTypeNameDesigner" : "Some Designer", "openTypeNameDesignerURL" : "http://somedesigner.com", "openTypeNameLicense" : "License info for Some Foundry.", "openTypeNameLicenseURL" : "http://somefoundry.com/license", "openTypeNameManufacturer" : "Some Foundry", "openTypeNameManufacturerURL" : "http://somefoundry.com", "openTypeNamePreferredFamilyName" : "Some Font (Preferred Family Name)", "openTypeNamePreferredSubfamilyName": "Regular (Preferred Subfamily Name)", "openTypeNameCompatibleFullName" : "Some Font Regular (Compatible Full Name)", "openTypeNameUniqueID" : "OpenType name Table Unique ID", "openTypeNameVersion" : "OpenType name Table Version", "openTypeOS2VendorID" : "SOME", "openTypeOS2WeightClass" : 500, "openTypeOS2WidthClass" : 5, "postscriptDefaultWidthX" : 400, "postscriptFontName" : "SomeFont-Regular (Postscript Font Name)", "postscriptFullName" : "Some Font-Regular (Postscript Full Name)", "postscriptSlantAngle" : -12.5, "postscriptUniqueID" : 4000000, "postscriptWeightName" : "Medium", "postscriptWindowsCharacterSet" : 1 } expectedFontInfo2To1Conversion = { "familyName" : "Some Font (Family Name)", "menuName" : "Some Font Regular (Style Map Family Name)", "fontStyle" : 64, "styleName" : "Regular (Style Name)", "unitsPerEm" : 1000, "ascender" : 750, "capHeight" : 750, "xHeight" : 500, "descender" : -250, "italicAngle" : -12.5, "versionMajor" : 1, "versionMinor" : 0, "copyright" : "Copyright Some Foundry.", "trademark" : "Trademark Some Foundry", "note" : "A note.", "fondID" : 15000, "fondName" : "SomeFont Regular (FOND Name)", "fullName" : "Some Font Regular (Compatible Full Name)", "notice" : "Some Font by Some Designer for Some Foundry.", "designer" : "Some Designer", "designerURL" : "http://somedesigner.com", "license" : "License info for Some Foundry.", "licenseURL" : "http://somefoundry.com/license", "createdBy" : "Some Foundry", "vendorURL" : "http://somefoundry.com", "otFamilyName" : "Some Font (Preferred Family Name)", "otStyleName" : "Regular (Preferred Subfamily Name)", "otMacName" : "Some Font Regular (Compatible Full Name)", "ttUniqueID" : "OpenType name Table Unique ID", "ttVersion" : "OpenType name Table Version", "ttVendor" : "SOME", "weightValue" : 500, "widthName" : "Medium (normal)", "defaultWidth" : 400, "fontName" : "SomeFont-Regular (Postscript Font Name)", "fullName" : "Some Font-Regular (Postscript Full Name)", "slantAngle" : -12.5, "uniqueID" : 4000000, "weightName" : "Medium", "msCharSet" : 0, "year" : 2008 }
true
true
f7f96cad2bd048ed76edc8ed9412ff9b6f5b5f7a
618
py
Python
train_restore_use_models/preprocess_data.py
MECLabTUDA/QA_med_data
72897cb2d8e520dde6b88318c23bca32eb9210d7
[ "MIT" ]
null
null
null
train_restore_use_models/preprocess_data.py
MECLabTUDA/QA_med_data
72897cb2d8e520dde6b88318c23bca32eb9210d7
[ "MIT" ]
null
null
null
train_restore_use_models/preprocess_data.py
MECLabTUDA/QA_med_data
72897cb2d8e520dde6b88318c23bca32eb9210d7
[ "MIT" ]
null
null
null
# Import needed libraries from mp.data.datasets.dataset_JIP_cnn import JIPDataset def preprocess_data(config): r"""This function is used to load the original data from the workflow and preprocesses it by saving it in the preprocessed workflow.""" JIP = JIPDataset(img_size=config['input_shape'], num_intensities=config['num_intensities'], data_type=config['data_type'],\ augmentation=config['augmentation'], gpu=True, cuda=config['device'], msg_bot=config['msg_bot'],\ nr_images=config['nr_images'], restore=config['restore']) return JIP.preprocess()
56.181818
127
0.703883
from mp.data.datasets.dataset_JIP_cnn import JIPDataset def preprocess_data(config): JIP = JIPDataset(img_size=config['input_shape'], num_intensities=config['num_intensities'], data_type=config['data_type'],\ augmentation=config['augmentation'], gpu=True, cuda=config['device'], msg_bot=config['msg_bot'],\ nr_images=config['nr_images'], restore=config['restore']) return JIP.preprocess()
true
true
f7f96ce53153034f0c909c1981ee2b1921cf1720
733
py
Python
netforce_hr/netforce_hr/migrations/improve_payroll.py
nfco/netforce
35252eecd0a6633ab9d82162e9e3ff57d4da029a
[ "MIT" ]
27
2015-09-30T23:53:30.000Z
2021-06-07T04:56:25.000Z
netforce_hr/netforce_hr/migrations/improve_payroll.py
nfco/netforce
35252eecd0a6633ab9d82162e9e3ff57d4da029a
[ "MIT" ]
191
2015-10-08T11:46:30.000Z
2019-11-14T02:24:36.000Z
netforce_hr/netforce_hr/migrations/improve_payroll.py
nfco/netforce
35252eecd0a6633ab9d82162e9e3ff57d4da029a
[ "MIT" ]
32
2015-10-01T03:59:43.000Z
2022-01-13T07:31:05.000Z
from netforce.model import get_model from netforce import migration from netforce.access import set_active_user, get_active_user class Migration(migration.Migration): _name="improve.payroll" _version="2.10.0" def migrate(self): user_id=get_active_user() set_active_user(1) for payslip in get_model("hr.payslip").search_browse([]): if not payslip.state: payslip.write({ 'state': 'draft', }) for payrun in get_model("hr.payrun").search_browse([]): if not payrun.state: payrun.write({ 'state': 'draft', }) set_active_user(user_id) Migration.register()
28.192308
65
0.582538
from netforce.model import get_model from netforce import migration from netforce.access import set_active_user, get_active_user class Migration(migration.Migration): _name="improve.payroll" _version="2.10.0" def migrate(self): user_id=get_active_user() set_active_user(1) for payslip in get_model("hr.payslip").search_browse([]): if not payslip.state: payslip.write({ 'state': 'draft', }) for payrun in get_model("hr.payrun").search_browse([]): if not payrun.state: payrun.write({ 'state': 'draft', }) set_active_user(user_id) Migration.register()
true
true
f7f96edf1cbfedce8446f049553d598fd1d6ecfa
951
py
Python
examples/advanced/ray_example/ray_compose_example.py
packerliu/hydra
3e1debd53eb15229950d170086e563d27cb54a04
[ "MIT" ]
1
2020-07-13T09:06:16.000Z
2020-07-13T09:06:16.000Z
examples/advanced/ray_example/ray_compose_example.py
packerliu/hydra
3e1debd53eb15229950d170086e563d27cb54a04
[ "MIT" ]
6
2021-03-01T21:23:23.000Z
2022-02-27T09:15:03.000Z
examples/advanced/ray_example/ray_compose_example.py
packerliu/hydra
3e1debd53eb15229950d170086e563d27cb54a04
[ "MIT" ]
1
2021-04-22T08:47:44.000Z
2021-04-22T08:47:44.000Z
# Copyright (c) Facebook, Inc. and its affiliates. All Rights Reserved import time from typing import List, Tuple import ray from omegaconf import DictConfig import hydra from hydra.experimental import compose @ray.remote # type: ignore def train(overrides: List[str], cfg: DictConfig) -> Tuple[List[str], float]: print(cfg.pretty()) time.sleep(5) return overrides, 0.9 @hydra.main(config_path="conf", config_name="config") def main(cfg: DictConfig) -> None: ray.init(**cfg.ray.init) results = [] for model in ["alexnet", "resnet"]: for dataset in ["cifar10", "imagenet"]: overrides = [f"dataset={dataset}", f"model={model}"] run_cfg = compose(overrides=overrides) ret = train.remote(overrides, run_cfg) results.append(ret) for overrides, score in ray.get(results): print(f"Result from {overrides} : {score}") if __name__ == "__main__": main()
25.702703
76
0.654048
import time from typing import List, Tuple import ray from omegaconf import DictConfig import hydra from hydra.experimental import compose @ray.remote def train(overrides: List[str], cfg: DictConfig) -> Tuple[List[str], float]: print(cfg.pretty()) time.sleep(5) return overrides, 0.9 @hydra.main(config_path="conf", config_name="config") def main(cfg: DictConfig) -> None: ray.init(**cfg.ray.init) results = [] for model in ["alexnet", "resnet"]: for dataset in ["cifar10", "imagenet"]: overrides = [f"dataset={dataset}", f"model={model}"] run_cfg = compose(overrides=overrides) ret = train.remote(overrides, run_cfg) results.append(ret) for overrides, score in ray.get(results): print(f"Result from {overrides} : {score}") if __name__ == "__main__": main()
true
true
f7f96f6a4891149c611ba417bcbaabbc514043af
2,644
py
Python
packages/syft/src/syft/core/node/common/action/greenlets_switch.py
jackbandy/PySyft
0e20e90abab6a7a7ca672d6eedfa1e7f83c4981b
[ "Apache-2.0" ]
null
null
null
packages/syft/src/syft/core/node/common/action/greenlets_switch.py
jackbandy/PySyft
0e20e90abab6a7a7ca672d6eedfa1e7f83c4981b
[ "Apache-2.0" ]
null
null
null
packages/syft/src/syft/core/node/common/action/greenlets_switch.py
jackbandy/PySyft
0e20e90abab6a7a7ca672d6eedfa1e7f83c4981b
[ "Apache-2.0" ]
null
null
null
# stdlib from typing import Tuple # third party import gevent # relative from .....logger import critical from ....common.uid import UID from ....store.storeable_object import StorableObject from ...abstract.node import AbstractNode def retrieve_object( node: AbstractNode, id_at_location: UID, path: str, proxy_only: bool = False ) -> StorableObject: # A hard time limit is set on celery worker which prevents infinite execution. ctr = 0 while True: store_obj = node.store.get_or_none(key=id_at_location, proxy_only=proxy_only) if store_obj is None: if ctr % 1500 == 0: critical( f"execute_action on {path} failed due to missing object" + f" at: {id_at_location}" ) # Implicit context switch between greenlets. gevent.sleep(0) ctr += 1 else: return store_obj def beaver_retrieve_object( node: AbstractNode, id_at_location: UID, nr_parties: int ) -> StorableObject: # relative from .beaver_action import BEAVER_CACHE # A hard time limit is set on celery worker which prevents infinite execution. ctr = 0 while True: store_obj = BEAVER_CACHE.get(id_at_location, None) # type: ignore if store_obj is None or len(store_obj.data) != nr_parties: if ctr % 1500 == 0: critical( f"Beaver Retrieval failed for {nr_parties} parties due to missing object" + f" at: {id_at_location} values: {store_obj}" ) # Implicit context switch between greenlets. gevent.sleep(0) ctr += 1 else: return store_obj def crypto_store_retrieve_object( # type: ignore op_str: str, **kwargs, ) -> Tuple: # relative from ....smpc.store.exceptions import EmptyPrimitiveStore from ....tensor.smpc.share_tensor import ShareTensor crypto_store = ShareTensor.crypto_store # A hard time limit is set on celery worker which prevents infinite execution. ctr = 0 while True: try: store_values = crypto_store.get_primitives_from_store( op_str, **kwargs # type: ignore ) return tuple(store_values) except EmptyPrimitiveStore: if ctr % 1500 == 0: critical( f"Crypto Store Retrieval failed for parties due to missing object: {EmptyPrimitiveStore}" ) # Implicit context switch between greenlets. gevent.sleep(0) ctr += 1
31.47619
109
0.607035
from typing import Tuple import gevent from .....logger import critical from ....common.uid import UID from ....store.storeable_object import StorableObject from ...abstract.node import AbstractNode def retrieve_object( node: AbstractNode, id_at_location: UID, path: str, proxy_only: bool = False ) -> StorableObject: ctr = 0 while True: store_obj = node.store.get_or_none(key=id_at_location, proxy_only=proxy_only) if store_obj is None: if ctr % 1500 == 0: critical( f"execute_action on {path} failed due to missing object" + f" at: {id_at_location}" ) gevent.sleep(0) ctr += 1 else: return store_obj def beaver_retrieve_object( node: AbstractNode, id_at_location: UID, nr_parties: int ) -> StorableObject: from .beaver_action import BEAVER_CACHE ctr = 0 while True: store_obj = BEAVER_CACHE.get(id_at_location, None) if store_obj is None or len(store_obj.data) != nr_parties: if ctr % 1500 == 0: critical( f"Beaver Retrieval failed for {nr_parties} parties due to missing object" + f" at: {id_at_location} values: {store_obj}" ) gevent.sleep(0) ctr += 1 else: return store_obj def crypto_store_retrieve_object( op_str: str, **kwargs, ) -> Tuple: from ....smpc.store.exceptions import EmptyPrimitiveStore from ....tensor.smpc.share_tensor import ShareTensor crypto_store = ShareTensor.crypto_store ctr = 0 while True: try: store_values = crypto_store.get_primitives_from_store( op_str, **kwargs ) return tuple(store_values) except EmptyPrimitiveStore: if ctr % 1500 == 0: critical( f"Crypto Store Retrieval failed for parties due to missing object: {EmptyPrimitiveStore}" ) gevent.sleep(0) ctr += 1
true
true
f7f96f874be80cf5419958b278dd1ee46fd52ba6
13,181
py
Python
dogechia/rpc/rpc_server.py
hagbardcelene/doge-chia
72bdf0a7b20a579fe4645f0cb132955e181e1c44
[ "Apache-2.0" ]
27
2021-07-06T16:33:50.000Z
2022-02-19T21:11:25.000Z
dogechia/rpc/rpc_server.py
hagbardcelene/doge-chia
72bdf0a7b20a579fe4645f0cb132955e181e1c44
[ "Apache-2.0" ]
15
2021-07-07T02:32:59.000Z
2021-10-15T21:19:51.000Z
dogechia/rpc/rpc_server.py
hagbardcelene/doge-chia
72bdf0a7b20a579fe4645f0cb132955e181e1c44
[ "Apache-2.0" ]
12
2021-07-08T15:36:20.000Z
2022-03-15T08:34:01.000Z
import asyncio import json import logging import traceback from pathlib import Path from typing import Any, Callable, Dict, List, Optional import aiohttp from dogechia.server.outbound_message import NodeType from dogechia.server.server import ssl_context_for_server from dogechia.types.peer_info import PeerInfo from dogechia.util.byte_types import hexstr_to_bytes from dogechia.util.ints import uint16 from dogechia.util.json_util import dict_to_json_str, obj_to_response from dogechia.util.ws_message import create_payload, create_payload_dict, format_response, pong log = logging.getLogger(__name__) class RpcServer: """ Implementation of RPC server. """ def __init__(self, rpc_api: Any, service_name: str, stop_cb: Callable, root_path, net_config): self.rpc_api = rpc_api self.stop_cb: Callable = stop_cb self.log = log self.shut_down = False self.websocket: Optional[aiohttp.ClientWebSocketResponse] = None self.service_name = service_name self.root_path = root_path self.net_config = net_config self.crt_path = root_path / net_config["daemon_ssl"]["private_crt"] self.key_path = root_path / net_config["daemon_ssl"]["private_key"] self.ca_cert_path = root_path / net_config["private_ssl_ca"]["crt"] self.ca_key_path = root_path / net_config["private_ssl_ca"]["key"] self.ssl_context = ssl_context_for_server(self.ca_cert_path, self.ca_key_path, self.crt_path, self.key_path) async def stop(self): self.shut_down = True if self.websocket is not None: await self.websocket.close() async def _state_changed(self, *args): if self.websocket is None: return None payloads: List[Dict] = await self.rpc_api._state_changed(*args) change = args[0] if change == "add_connection" or change == "close_connection" or change == "peer_changed_peak": data = await self.get_connections({}) if data is not None: payload = create_payload_dict( "get_connections", data, self.service_name, "wallet_ui", ) payloads.append(payload) for payload in payloads: if "success" not in payload["data"]: payload["data"]["success"] = True try: await self.websocket.send_str(dict_to_json_str(payload)) except Exception: tb = traceback.format_exc() self.log.warning(f"Sending data failed. Exception {tb}.") def state_changed(self, *args): if self.websocket is None: return None asyncio.create_task(self._state_changed(*args)) def _wrap_http_handler(self, f) -> Callable: async def inner(request) -> aiohttp.web.Response: request_data = await request.json() try: res_object = await f(request_data) if res_object is None: res_object = {} if "success" not in res_object: res_object["success"] = True except Exception as e: tb = traceback.format_exc() self.log.warning(f"Error while handling message: {tb}") if len(e.args) > 0: res_object = {"success": False, "error": f"{e.args[0]}"} else: res_object = {"success": False, "error": f"{e}"} return obj_to_response(res_object) return inner async def get_connections(self, request: Dict) -> Dict: if self.rpc_api.service.server is None: raise ValueError("Global connections is not set") if self.rpc_api.service.server._local_type is NodeType.FULL_NODE: # TODO add peaks for peers connections = self.rpc_api.service.server.get_connections() con_info = [] if self.rpc_api.service.sync_store is not None: peak_store = self.rpc_api.service.sync_store.peer_to_peak else: peak_store = None for con in connections: if peak_store is not None and con.peer_node_id in peak_store: peak_hash, peak_height, peak_weight = peak_store[con.peer_node_id] else: peak_height = None peak_hash = None peak_weight = None con_dict = { "type": con.connection_type, "local_port": con.local_port, "peer_host": con.peer_host, "peer_port": con.peer_port, "peer_server_port": con.peer_server_port, "node_id": con.peer_node_id, "creation_time": con.creation_time, "bytes_read": con.bytes_read, "bytes_written": con.bytes_written, "last_message_time": con.last_message_time, "peak_height": peak_height, "peak_weight": peak_weight, "peak_hash": peak_hash, } con_info.append(con_dict) else: connections = self.rpc_api.service.server.get_connections() con_info = [ { "type": con.connection_type, "local_port": con.local_port, "peer_host": con.peer_host, "peer_port": con.peer_port, "peer_server_port": con.peer_server_port, "node_id": con.peer_node_id, "creation_time": con.creation_time, "bytes_read": con.bytes_read, "bytes_written": con.bytes_written, "last_message_time": con.last_message_time, } for con in connections ] return {"connections": con_info} async def open_connection(self, request: Dict): host = request["host"] port = request["port"] target_node: PeerInfo = PeerInfo(host, uint16(int(port))) on_connect = None if hasattr(self.rpc_api.service, "on_connect"): on_connect = self.rpc_api.service.on_connect if getattr(self.rpc_api.service, "server", None) is None or not ( await self.rpc_api.service.server.start_client(target_node, on_connect) ): raise ValueError("Start client failed, or server is not set") return {} async def close_connection(self, request: Dict): node_id = hexstr_to_bytes(request["node_id"]) if self.rpc_api.service.server is None: raise aiohttp.web.HTTPInternalServerError() connections_to_close = [c for c in self.rpc_api.service.server.get_connections() if c.peer_node_id == node_id] if len(connections_to_close) == 0: raise ValueError(f"Connection with node_id {node_id.hex()} does not exist") for connection in connections_to_close: await connection.close() return {} async def stop_node(self, request): """ Shuts down the node. """ if self.stop_cb is not None: self.stop_cb() return {} async def ws_api(self, message): """ This function gets called when new message is received via websocket. """ command = message["command"] if message["ack"]: return None data = None if "data" in message: data = message["data"] if command == "ping": return pong() f = getattr(self, command, None) if f is not None: return await f(data) f = getattr(self.rpc_api, command, None) if f is not None: return await f(data) raise ValueError(f"unknown_command {command}") async def safe_handle(self, websocket, payload): message = None try: message = json.loads(payload) self.log.debug(f"Rpc call <- {message['command']}") response = await self.ws_api(message) # Only respond if we return something from api call if response is not None: log.debug(f"Rpc response -> {message['command']}") # Set success to true automatically (unless it's already set) if "success" not in response: response["success"] = True await websocket.send_str(format_response(message, response)) except Exception as e: tb = traceback.format_exc() self.log.warning(f"Error while handling message: {tb}") if message is not None: error = e.args[0] if e.args else e res = {"success": False, "error": f"{error}"} await websocket.send_str(format_response(message, res)) async def connection(self, ws): data = {"service": self.service_name} payload = create_payload("register_service", data, self.service_name, "daemon") await ws.send_str(payload) while True: msg = await ws.receive() if msg.type == aiohttp.WSMsgType.TEXT: message = msg.data.strip() # self.log.info(f"received message: {message}") await self.safe_handle(ws, message) elif msg.type == aiohttp.WSMsgType.BINARY: self.log.debug("Received binary data") elif msg.type == aiohttp.WSMsgType.PING: self.log.debug("Ping received") await ws.pong() elif msg.type == aiohttp.WSMsgType.PONG: self.log.debug("Pong received") else: if msg.type == aiohttp.WSMsgType.CLOSE: self.log.debug("Closing RPC websocket") await ws.close() elif msg.type == aiohttp.WSMsgType.ERROR: self.log.error("Error during receive %s" % ws.exception()) elif msg.type == aiohttp.WSMsgType.CLOSED: pass break await ws.close() async def connect_to_daemon(self, self_hostname: str, daemon_port: uint16): while True: try: if self.shut_down: break async with aiohttp.ClientSession() as session: async with session.ws_connect( f"wss://{self_hostname}:{daemon_port}", autoclose=True, autoping=True, heartbeat=60, ssl_context=self.ssl_context, max_msg_size=100 * 1024 * 1024, ) as ws: self.websocket = ws await self.connection(ws) self.websocket = None except aiohttp.ClientConnectorError: self.log.warning(f"Cannot connect to daemon at ws://{self_hostname}:{daemon_port}") except Exception as e: tb = traceback.format_exc() self.log.warning(f"Exception: {tb} {type(e)}") await asyncio.sleep(2) async def start_rpc_server( rpc_api: Any, self_hostname: str, daemon_port: uint16, rpc_port: uint16, stop_cb: Callable, root_path: Path, net_config, connect_to_daemon=True, ): """ Starts an HTTP server with the following RPC methods, to be used by local clients to query the node. """ app = aiohttp.web.Application() rpc_server = RpcServer(rpc_api, rpc_api.service_name, stop_cb, root_path, net_config) rpc_server.rpc_api.service._set_state_changed_callback(rpc_server.state_changed) http_routes: Dict[str, Callable] = rpc_api.get_routes() routes = [aiohttp.web.post(route, rpc_server._wrap_http_handler(func)) for (route, func) in http_routes.items()] routes += [ aiohttp.web.post( "/get_connections", rpc_server._wrap_http_handler(rpc_server.get_connections), ), aiohttp.web.post( "/open_connection", rpc_server._wrap_http_handler(rpc_server.open_connection), ), aiohttp.web.post( "/close_connection", rpc_server._wrap_http_handler(rpc_server.close_connection), ), aiohttp.web.post("/stop_node", rpc_server._wrap_http_handler(rpc_server.stop_node)), ] app.add_routes(routes) if connect_to_daemon: daemon_connection = asyncio.create_task(rpc_server.connect_to_daemon(self_hostname, daemon_port)) runner = aiohttp.web.AppRunner(app, access_log=None) await runner.setup() site = aiohttp.web.TCPSite(runner, self_hostname, int(rpc_port), ssl_context=rpc_server.ssl_context) await site.start() async def cleanup(): await rpc_server.stop() await runner.cleanup() if connect_to_daemon: await daemon_connection return cleanup
39.11276
118
0.578257
import asyncio import json import logging import traceback from pathlib import Path from typing import Any, Callable, Dict, List, Optional import aiohttp from dogechia.server.outbound_message import NodeType from dogechia.server.server import ssl_context_for_server from dogechia.types.peer_info import PeerInfo from dogechia.util.byte_types import hexstr_to_bytes from dogechia.util.ints import uint16 from dogechia.util.json_util import dict_to_json_str, obj_to_response from dogechia.util.ws_message import create_payload, create_payload_dict, format_response, pong log = logging.getLogger(__name__) class RpcServer: def __init__(self, rpc_api: Any, service_name: str, stop_cb: Callable, root_path, net_config): self.rpc_api = rpc_api self.stop_cb: Callable = stop_cb self.log = log self.shut_down = False self.websocket: Optional[aiohttp.ClientWebSocketResponse] = None self.service_name = service_name self.root_path = root_path self.net_config = net_config self.crt_path = root_path / net_config["daemon_ssl"]["private_crt"] self.key_path = root_path / net_config["daemon_ssl"]["private_key"] self.ca_cert_path = root_path / net_config["private_ssl_ca"]["crt"] self.ca_key_path = root_path / net_config["private_ssl_ca"]["key"] self.ssl_context = ssl_context_for_server(self.ca_cert_path, self.ca_key_path, self.crt_path, self.key_path) async def stop(self): self.shut_down = True if self.websocket is not None: await self.websocket.close() async def _state_changed(self, *args): if self.websocket is None: return None payloads: List[Dict] = await self.rpc_api._state_changed(*args) change = args[0] if change == "add_connection" or change == "close_connection" or change == "peer_changed_peak": data = await self.get_connections({}) if data is not None: payload = create_payload_dict( "get_connections", data, self.service_name, "wallet_ui", ) payloads.append(payload) for payload in payloads: if "success" not in payload["data"]: payload["data"]["success"] = True try: await self.websocket.send_str(dict_to_json_str(payload)) except Exception: tb = traceback.format_exc() self.log.warning(f"Sending data failed. Exception {tb}.") def state_changed(self, *args): if self.websocket is None: return None asyncio.create_task(self._state_changed(*args)) def _wrap_http_handler(self, f) -> Callable: async def inner(request) -> aiohttp.web.Response: request_data = await request.json() try: res_object = await f(request_data) if res_object is None: res_object = {} if "success" not in res_object: res_object["success"] = True except Exception as e: tb = traceback.format_exc() self.log.warning(f"Error while handling message: {tb}") if len(e.args) > 0: res_object = {"success": False, "error": f"{e.args[0]}"} else: res_object = {"success": False, "error": f"{e}"} return obj_to_response(res_object) return inner async def get_connections(self, request: Dict) -> Dict: if self.rpc_api.service.server is None: raise ValueError("Global connections is not set") if self.rpc_api.service.server._local_type is NodeType.FULL_NODE: connections = self.rpc_api.service.server.get_connections() con_info = [] if self.rpc_api.service.sync_store is not None: peak_store = self.rpc_api.service.sync_store.peer_to_peak else: peak_store = None for con in connections: if peak_store is not None and con.peer_node_id in peak_store: peak_hash, peak_height, peak_weight = peak_store[con.peer_node_id] else: peak_height = None peak_hash = None peak_weight = None con_dict = { "type": con.connection_type, "local_port": con.local_port, "peer_host": con.peer_host, "peer_port": con.peer_port, "peer_server_port": con.peer_server_port, "node_id": con.peer_node_id, "creation_time": con.creation_time, "bytes_read": con.bytes_read, "bytes_written": con.bytes_written, "last_message_time": con.last_message_time, "peak_height": peak_height, "peak_weight": peak_weight, "peak_hash": peak_hash, } con_info.append(con_dict) else: connections = self.rpc_api.service.server.get_connections() con_info = [ { "type": con.connection_type, "local_port": con.local_port, "peer_host": con.peer_host, "peer_port": con.peer_port, "peer_server_port": con.peer_server_port, "node_id": con.peer_node_id, "creation_time": con.creation_time, "bytes_read": con.bytes_read, "bytes_written": con.bytes_written, "last_message_time": con.last_message_time, } for con in connections ] return {"connections": con_info} async def open_connection(self, request: Dict): host = request["host"] port = request["port"] target_node: PeerInfo = PeerInfo(host, uint16(int(port))) on_connect = None if hasattr(self.rpc_api.service, "on_connect"): on_connect = self.rpc_api.service.on_connect if getattr(self.rpc_api.service, "server", None) is None or not ( await self.rpc_api.service.server.start_client(target_node, on_connect) ): raise ValueError("Start client failed, or server is not set") return {} async def close_connection(self, request: Dict): node_id = hexstr_to_bytes(request["node_id"]) if self.rpc_api.service.server is None: raise aiohttp.web.HTTPInternalServerError() connections_to_close = [c for c in self.rpc_api.service.server.get_connections() if c.peer_node_id == node_id] if len(connections_to_close) == 0: raise ValueError(f"Connection with node_id {node_id.hex()} does not exist") for connection in connections_to_close: await connection.close() return {} async def stop_node(self, request): if self.stop_cb is not None: self.stop_cb() return {} async def ws_api(self, message): command = message["command"] if message["ack"]: return None data = None if "data" in message: data = message["data"] if command == "ping": return pong() f = getattr(self, command, None) if f is not None: return await f(data) f = getattr(self.rpc_api, command, None) if f is not None: return await f(data) raise ValueError(f"unknown_command {command}") async def safe_handle(self, websocket, payload): message = None try: message = json.loads(payload) self.log.debug(f"Rpc call <- {message['command']}") response = await self.ws_api(message) if response is not None: log.debug(f"Rpc response -> {message['command']}") if "success" not in response: response["success"] = True await websocket.send_str(format_response(message, response)) except Exception as e: tb = traceback.format_exc() self.log.warning(f"Error while handling message: {tb}") if message is not None: error = e.args[0] if e.args else e res = {"success": False, "error": f"{error}"} await websocket.send_str(format_response(message, res)) async def connection(self, ws): data = {"service": self.service_name} payload = create_payload("register_service", data, self.service_name, "daemon") await ws.send_str(payload) while True: msg = await ws.receive() if msg.type == aiohttp.WSMsgType.TEXT: message = msg.data.strip() # self.log.info(f"received message: {message}") await self.safe_handle(ws, message) elif msg.type == aiohttp.WSMsgType.BINARY: self.log.debug("Received binary data") elif msg.type == aiohttp.WSMsgType.PING: self.log.debug("Ping received") await ws.pong() elif msg.type == aiohttp.WSMsgType.PONG: self.log.debug("Pong received") else: if msg.type == aiohttp.WSMsgType.CLOSE: self.log.debug("Closing RPC websocket") await ws.close() elif msg.type == aiohttp.WSMsgType.ERROR: self.log.error("Error during receive %s" % ws.exception()) elif msg.type == aiohttp.WSMsgType.CLOSED: pass break await ws.close() async def connect_to_daemon(self, self_hostname: str, daemon_port: uint16): while True: try: if self.shut_down: break async with aiohttp.ClientSession() as session: async with session.ws_connect( f"wss://{self_hostname}:{daemon_port}", autoclose=True, autoping=True, heartbeat=60, ssl_context=self.ssl_context, max_msg_size=100 * 1024 * 1024, ) as ws: self.websocket = ws await self.connection(ws) self.websocket = None except aiohttp.ClientConnectorError: self.log.warning(f"Cannot connect to daemon at ws://{self_hostname}:{daemon_port}") except Exception as e: tb = traceback.format_exc() self.log.warning(f"Exception: {tb} {type(e)}") await asyncio.sleep(2) async def start_rpc_server( rpc_api: Any, self_hostname: str, daemon_port: uint16, rpc_port: uint16, stop_cb: Callable, root_path: Path, net_config, connect_to_daemon=True, ): app = aiohttp.web.Application() rpc_server = RpcServer(rpc_api, rpc_api.service_name, stop_cb, root_path, net_config) rpc_server.rpc_api.service._set_state_changed_callback(rpc_server.state_changed) http_routes: Dict[str, Callable] = rpc_api.get_routes() routes = [aiohttp.web.post(route, rpc_server._wrap_http_handler(func)) for (route, func) in http_routes.items()] routes += [ aiohttp.web.post( "/get_connections", rpc_server._wrap_http_handler(rpc_server.get_connections), ), aiohttp.web.post( "/open_connection", rpc_server._wrap_http_handler(rpc_server.open_connection), ), aiohttp.web.post( "/close_connection", rpc_server._wrap_http_handler(rpc_server.close_connection), ), aiohttp.web.post("/stop_node", rpc_server._wrap_http_handler(rpc_server.stop_node)), ] app.add_routes(routes) if connect_to_daemon: daemon_connection = asyncio.create_task(rpc_server.connect_to_daemon(self_hostname, daemon_port)) runner = aiohttp.web.AppRunner(app, access_log=None) await runner.setup() site = aiohttp.web.TCPSite(runner, self_hostname, int(rpc_port), ssl_context=rpc_server.ssl_context) await site.start() async def cleanup(): await rpc_server.stop() await runner.cleanup() if connect_to_daemon: await daemon_connection return cleanup
true
true
f7f96f983bda46c5b75f7d737b58070da9dd7d64
1,469
py
Python
app/config.py
chrislaskey/kingdom
be82551824adadfc0c70e08b188eb45adae974c1
[ "MIT" ]
6
2015-02-17T23:40:42.000Z
2021-11-04T17:22:57.000Z
app/config.py
chrislaskey/tree-tracker
23597af0fe3c58cd57622cb01b303ed7743dc0e1
[ "MIT" ]
null
null
null
app/config.py
chrislaskey/tree-tracker
23597af0fe3c58cd57622cb01b303ed7743dc0e1
[ "MIT" ]
1
2020-04-20T05:50:02.000Z
2020-04-20T05:50:02.000Z
from os import path basedir = path.abspath(path.dirname(__file__)) # Flask # See: http://flask.pocoo.org/docs/config/ DEBUG = True TESTING = False SECRET_KEY = 'Academicam omnem quaestionem duabus formis a Cicerone esse expositam olim cognitum est' # Flask-SQLAlchemy # See: http://pythonhosted.org/Flask-SQLAlchemy/config.html SQLALCHEMY_DATABASE_URI = 'sqlite:///' + path.join(basedir, '../app.db') # Flask-Mail # See: http://pythonhosted.org/flask-mail/ MAIL_SERVER = 'localhost' MAIL_PORT = 25 MAIL_USE_TLS = False MAIL_USE_SSL = False MAIL_DEBUG = DEBUG MAIL_USERNAME = None MAIL_PASSWORD = None MAIL_DEFAULT_SENDER = None MAIL_MAX_EMAILS = None MAIL_SUPPRESS_SEND = TESTING # Flask-Security # See: http://pythonhosted.org/Flask-Security/configuration.html SECURITY_PASSWORD_HASH = 'bcrypt' SECURITY_PASSWORD_SALT = 'SnK2na02nlnmsWsna01nvmac1SNAncKS9acn3m11aZmQEiAk9314jXma' SECURITY_EMAIL_SENDER = 'no-reply@localhost' SECURITY_LOGIN_URL = '/login' SECURITY_LOGOUT_URL = '/logout' SECURITY_TRACKABLE = True SECURITY_RECOVERABLE = True SECURITY_RESET_URL = '/login/reset-password' SECURITY_CHANGEABLE = True SECURITY_CHANGE_URL = '/login/change-password' SECURITY_REGISTERABLE = True SECURITY_REGISTER_URL = '/signup' SECURITY_CONFIRMABLE = True SECURITY_CONFIRM_URL = '/signup/confirm' SECURITY_CONFIRM_EMAIL_WITHIN = '7 days' SECURITY_LOGIN_WITHOUT_CONFIRMATION = DEBUG # Flask-WTF # See: https://flask-wtf.readthedocs.org/en/latest/ CSRF_ENABLED = True
28.25
101
0.79646
from os import path basedir = path.abspath(path.dirname(__file__)) DEBUG = True TESTING = False SECRET_KEY = 'Academicam omnem quaestionem duabus formis a Cicerone esse expositam olim cognitum est' SQLALCHEMY_DATABASE_URI = 'sqlite:///' + path.join(basedir, '../app.db') MAIL_SERVER = 'localhost' MAIL_PORT = 25 MAIL_USE_TLS = False MAIL_USE_SSL = False MAIL_DEBUG = DEBUG MAIL_USERNAME = None MAIL_PASSWORD = None MAIL_DEFAULT_SENDER = None MAIL_MAX_EMAILS = None MAIL_SUPPRESS_SEND = TESTING SECURITY_PASSWORD_HASH = 'bcrypt' SECURITY_PASSWORD_SALT = 'SnK2na02nlnmsWsna01nvmac1SNAncKS9acn3m11aZmQEiAk9314jXma' SECURITY_EMAIL_SENDER = 'no-reply@localhost' SECURITY_LOGIN_URL = '/login' SECURITY_LOGOUT_URL = '/logout' SECURITY_TRACKABLE = True SECURITY_RECOVERABLE = True SECURITY_RESET_URL = '/login/reset-password' SECURITY_CHANGEABLE = True SECURITY_CHANGE_URL = '/login/change-password' SECURITY_REGISTERABLE = True SECURITY_REGISTER_URL = '/signup' SECURITY_CONFIRMABLE = True SECURITY_CONFIRM_URL = '/signup/confirm' SECURITY_CONFIRM_EMAIL_WITHIN = '7 days' SECURITY_LOGIN_WITHOUT_CONFIRMATION = DEBUG CSRF_ENABLED = True
true
true
f7f96fad38a39cdc2329b349296bcc7034330c2b
14,272
py
Python
libcloud/test/dns/test_liquidweb.py
atsaki/libcloud
ae85479e835494e196e2f6e79aae9a475603d8ac
[ "Apache-2.0" ]
3
2016-06-03T03:40:18.000Z
2018-09-24T05:28:47.000Z
libcloud/test/dns/test_liquidweb.py
atsaki/libcloud
ae85479e835494e196e2f6e79aae9a475603d8ac
[ "Apache-2.0" ]
1
2015-10-26T21:29:56.000Z
2015-10-27T17:29:20.000Z
libcloud/test/dns/test_liquidweb.py
atsaki/libcloud
ae85479e835494e196e2f6e79aae9a475603d8ac
[ "Apache-2.0" ]
2
2018-09-24T05:28:42.000Z
2020-12-31T05:11:04.000Z
# Licensed to the Apache Software Foundation (ASF) under one or more # contributor license agreements. See the NOTICE file distributed with # this work for additional information regarding copyright ownership. # The ASF licenses this file to You under the Apache License, Version 2.0 # (the "License"); you may not use this file except in compliance with # the License. You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. import sys import unittest from libcloud.utils.py3 import httplib from libcloud.dns.drivers.liquidweb import LiquidWebDNSDriver from libcloud.test import MockHttp from libcloud.test.file_fixtures import DNSFileFixtures from libcloud.test.secrets import DNS_PARAMS_LIQUIDWEB from libcloud.dns.types import ZoneDoesNotExistError, ZoneAlreadyExistsError from libcloud.dns.types import RecordDoesNotExistError from libcloud.dns.types import RecordType from libcloud.dns.base import Zone, Record class LiquidWebTests(unittest.TestCase): def setUp(self): LiquidWebMockHttp.type = None LiquidWebDNSDriver.connectionCls.conn_classes = ( None, LiquidWebMockHttp) self.driver = LiquidWebDNSDriver(*DNS_PARAMS_LIQUIDWEB) self.test_zone = Zone(id='11', type='master', ttl=None, domain='example.com', extra={}, driver=self.driver) self.test_record = Record(id='13', type=RecordType.A, name='example.com', zone=self.test_zone, data='127.0.0.1', driver=self, extra={}) def assertHasKeys(self, dictionary, keys): for key in keys: self.assertTrue(key in dictionary, 'key "%s" not in dictionary' % (key)) def test_list_zones_empty(self): LiquidWebMockHttp.type = 'EMPTY_ZONES_LIST' zones = self.driver.list_zones() self.assertEqual(zones, []) def test_list_zones_success(self): zones = self.driver.list_zones() self.assertEqual(len(zones), 3) zone = zones[0] self.assertEqual(zone.id, '378451') self.assertEqual(zone.domain, 'blogtest.com') self.assertEqual(zone.type, 'NATIVE') self.assertEqual(zone.driver, self.driver) self.assertEqual(zone.ttl, None) second_zone = zones[1] self.assertEqual(second_zone.id, '378449') self.assertEqual(second_zone.domain, 'oltjanotest.com') self.assertEqual(second_zone.type, 'NATIVE') self.assertEqual(second_zone.driver, self.driver) self.assertEqual(second_zone.ttl, None) third_zone = zones[2] self.assertEqual(third_zone.id, '378450') self.assertEqual(third_zone.domain, 'pythontest.com') self.assertEqual(third_zone.type, 'NATIVE') self.assertEqual(third_zone.driver, self.driver) self.assertEqual(third_zone.ttl, None) def test_get_zone_zone_does_not_exist(self): LiquidWebMockHttp.type = 'ZONE_DOES_NOT_EXIST' try: self.driver.get_zone(zone_id='13') except ZoneDoesNotExistError: e = sys.exc_info()[1] self.assertEqual(e.zone_id, '13') else: self.fail('Exception was not thrown') def test_get_zone_success(self): LiquidWebMockHttp.type = 'GET_ZONE_SUCCESS' zone = self.driver.get_zone(zone_id='13') self.assertEqual(zone.id, '13') self.assertEqual(zone.domain, 'blogtest.com') self.assertEqual(zone.type, 'NATIVE') self.assertEqual(zone.ttl, None) self.assertEqual(zone.driver, self.driver) def test_delete_zone_success(self): LiquidWebMockHttp.type = 'DELETE_ZONE_SUCCESS' zone = self.test_zone status = self.driver.delete_zone(zone=zone) self.assertEqual(status, True) def test_delete_zone_zone_does_not_exist(self): LiquidWebMockHttp.type = 'DELETE_ZONE_ZONE_DOES_NOT_EXIST' zone = self.test_zone try: self.driver.delete_zone(zone=zone) except ZoneDoesNotExistError: e = sys.exc_info()[1] self.assertEqual(e.zone_id, '11') else: self.fail('Exception was not thrown') def test_create_zone_success(self): LiquidWebMockHttp.type = 'CREATE_ZONE_SUCCESS' zone = self.driver.create_zone(domain='test.com') self.assertEqual(zone.id, '13') self.assertEqual(zone.domain, 'test.com') self.assertEqual(zone.type, 'NATIVE') self.assertEqual(zone.ttl, None) self.assertEqual(zone.driver, self.driver) def test_create_zone_zone_zone_already_exists(self): LiquidWebMockHttp.type = 'CREATE_ZONE_ZONE_ALREADY_EXISTS' try: self.driver.create_zone(domain='test.com') except ZoneAlreadyExistsError: e = sys.exc_info()[1] self.assertEqual(e.zone_id, 'test.com') else: self.fail('Exception was not thrown') def test_list_records_empty(self): LiquidWebMockHttp.type = 'EMPTY_RECORDS_LIST' zone = self.test_zone records = self.driver.list_records(zone=zone) self.assertEqual(records, []) def test_list_records_success(self): LiquidWebMockHttp.type = 'LIST_RECORDS_SUCCESS' zone = self.test_zone records = self.driver.list_records(zone=zone) self.assertEqual(len(records), 3) record = records[0] self.assertEqual(record.id, '13') self.assertEqual(record.type, 'A') self.assertEqual(record.name, 'nerd.domain.com') self.assertEqual(record.data, '127.0.0.1') self.assertEqual(record.zone, self.test_zone) self.assertEqual(record.zone.id, '11') second_record = records[1] self.assertEqual(second_record.id, '11') self.assertEqual(second_record.type, 'A') self.assertEqual(second_record.name, 'thisboy.domain.com') self.assertEqual(second_record.data, '127.0.0.1') self.assertEqual(second_record.zone, self.test_zone) third_record = records[2] self.assertEqual(third_record.id, '10') self.assertEqual(third_record.type, 'A') self.assertEqual(third_record.name, 'visitor.domain.com') self.assertEqual(third_record.data, '127.0.0.1') self.assertEqual(third_record.zone, self.test_zone) def test_get_record_record_does_not_exist(self): LiquidWebMockHttp.type = 'GET_RECORD_RECORD_DOES_NOT_EXIST' try: self.driver.get_record(zone_id='13', record_id='13') except RecordDoesNotExistError: e = sys.exc_info()[1] self.assertEqual(e.record_id, '13') else: self.fail('Exception was not thrown') def test_get_record_success(self): LiquidWebMockHttp.type = 'GET_RECORD_SUCCESS' record = self.driver.get_record(zone_id='13', record_id='13') self.assertEqual(record.id, '13') self.assertEqual(record.type, 'A') self.assertEqual(record.name, 'nerd.domain.com') self.assertEqual(record.data, '127.0.0.1') def test_update_record_success(self): LiquidWebMockHttp.type = 'GET_RECORD_SUCCESS' record = self.driver.get_record(zone_id='13', record_id='13') self.assertEqual(record.id, '13') self.assertEqual(record.type, 'A') self.assertEqual(record.name, 'nerd.domain.com') self.assertEqual(record.data, '127.0.0.1') self.assertEqual(record.extra.get('ttl'), 300) LiquidWebMockHttp.type = '' record1 = self.driver.update_record(record=record, name=record.name, type=record.type, data=record.data, extra={'ttl': 5600}) self.assertEqual(record1.id, '13') self.assertEqual(record1.type, 'A') self.assertEqual(record1.name, 'nerd.domain.com') self.assertEqual(record1.data, '127.0.0.1') self.assertEqual(record1.extra.get('ttl'), 5600) def test_delete_record_success(self): LiquidWebMockHttp.type = 'DELETE_RECORD_SUCCESS' record = self.test_record status = self.driver.delete_record(record=record) self.assertEqual(status, True) def test_delete_record_RECORD_DOES_NOT_EXIST_ERROR(self): LiquidWebMockHttp.type = 'DELETE_RECORD_RECORD_DOES_NOT_EXIST' record = self.test_record try: self.driver.delete_record(record=record) except RecordDoesNotExistError: e = sys.exc_info()[1] self.assertEqual(e.record_id, '13') else: self.fail('Exception was not thrown') def test_create_record_success(self): pass def test_record_already_exists_error(self): pass class LiquidWebMockHttp(MockHttp): fixtures = DNSFileFixtures('liquidweb') def _v1_Network_DNS_Zone_list(self, method, url, body, headers): body = self.fixtures.load('zones_list.json') return (httplib.OK, body, {}, httplib.responses[httplib.OK]) def _v1_Network_DNS_Zone_list_EMPTY_ZONES_LIST(self, method, url, body, headers): body = self.fixtures.load('empty_zones_list.json') return (httplib.OK, body, {}, httplib.responses[httplib.OK]) def _v1_Network_DNS_Zone_details_ZONE_DOES_NOT_EXIST(self, method, url, body, headers): body = self.fixtures.load('zone_does_not_exist.json') return (httplib.OK, body, {}, httplib.responses[httplib.OK]) def _v1_Network_DNS_Zone_details_GET_ZONE_SUCCESS(self, method, url, body, headers): body = self.fixtures.load('get_zone.json') return (httplib.OK, body, {}, httplib.responses[httplib.OK]) def _v1_Network_DNS_Zone_delete_DELETE_ZONE_SUCCESS(self, method, url, body, headers): body = self.fixtures.load('delete_zone_success.json') return (httplib.OK, body, {}, httplib.responses[httplib.OK]) def _v1_Network_DNS_Zone_delete_DELETE_ZONE_ZONE_DOES_NOT_EXIST( self, method, url, body, headers): body = self.fixtures.load('zone_does_not_exist.json') return (httplib.OK, body, {}, httplib.responses[httplib.OK]) def _v1_Network_DNS_Zone_create_CREATE_ZONE_SUCCESS(self, method, url, body, headers): body = self.fixtures.load('create_zone_success.json') return (httplib.OK, body, {}, httplib.responses[httplib.OK]) def _v1_Network_DNS_Zone_create_CREATE_ZONE_ZONE_ALREADY_EXISTS( self, method, url, body, headers): body = self.fixtures.load('duplicate_record.json') return (httplib.OK, body, {}, httplib.responses[httplib.OK]) def _v1_Network_DNS_Record_list_EMPTY_RECORDS_LIST(self, method, url, body, headers): body = self.fixtures.load('empty_records_list.json') return (httplib.OK, body, {}, httplib.responses[httplib.OK]) def _v1_Network_DNS_Record_list_LIST_RECORDS_SUCCESS(self, method, url, body, headers): body = self.fixtures.load('records_list.json') return (httplib.OK, body, {}, httplib.responses[httplib.OK]) def _v1_Network_DNS_Record_details_GET_RECORD_RECORD_DOES_NOT_EXIST( self, method, url, body, headers): body = self.fixtures.load('record_does_not_exist.json') return (httplib.OK, body, {}, httplib.responses[httplib.OK]) def _v1_Network_DNS_Zone_details_GET_RECORD_RECORD_DOES_NOT_EXIST( self, method, url, body, headers): body = self.fixtures.load('get_zone.json') return (httplib.OK, body, {}, httplib.responses[httplib.OK]) def _v1_Network_DNS_Zone_details_GET_RECORD_SUCCESS(self, method, url, body, headers): body = self.fixtures.load('get_zone.json') return (httplib.OK, body, {}, httplib.responses[httplib.OK]) def _v1_Network_DNS_Record_details_GET_RECORD_SUCCESS(self, method, url, body, headers): body = self.fixtures.load('get_record.json') return (httplib.OK, body, {}, httplib.responses[httplib.OK]) def _v1_Network_DNS_Record_delete_DELETE_RECORD_SUCCESS(self, method, url, body, headers): body = self.fixtures.load('delete_record.json') return (httplib.OK, body, {}, httplib.responses[httplib.OK]) def _v1_Network_DNS_Record_delete_DELETE_RECORD_RECORD_DOES_NOT_EXIST( self, method, url, body, headers): body = self.fixtures.load('record_does_not_exist.json') return (httplib.OK, body, {}, httplib.responses[httplib.OK]) def _v1_Network_DNS_Record_create_CREATE_RECORD_SUCCESS(self, method, url, body, headers): body = self.fixtures.load('') return (httplib.OK, body, {}, httplib.responses[httplib.OK]) def _v1_Network_DNS_Record_ALREADY_EXISTS_ERROR(self, method, url, body, headers): body = self.fixtures.load('') return (httplib.OK, body, {}, httplib.responses[httplib.OK]) def _v1_Network_DNS_Record_update(self, method, url, body, headers): body = self.fixtures.load('update_record.json') return (httplib.OK, body, {}, httplib.responses[httplib.OK]) if __name__ == '__main__': sys.exit(unittest.main())
42.350148
79
0.639364
import sys import unittest from libcloud.utils.py3 import httplib from libcloud.dns.drivers.liquidweb import LiquidWebDNSDriver from libcloud.test import MockHttp from libcloud.test.file_fixtures import DNSFileFixtures from libcloud.test.secrets import DNS_PARAMS_LIQUIDWEB from libcloud.dns.types import ZoneDoesNotExistError, ZoneAlreadyExistsError from libcloud.dns.types import RecordDoesNotExistError from libcloud.dns.types import RecordType from libcloud.dns.base import Zone, Record class LiquidWebTests(unittest.TestCase): def setUp(self): LiquidWebMockHttp.type = None LiquidWebDNSDriver.connectionCls.conn_classes = ( None, LiquidWebMockHttp) self.driver = LiquidWebDNSDriver(*DNS_PARAMS_LIQUIDWEB) self.test_zone = Zone(id='11', type='master', ttl=None, domain='example.com', extra={}, driver=self.driver) self.test_record = Record(id='13', type=RecordType.A, name='example.com', zone=self.test_zone, data='127.0.0.1', driver=self, extra={}) def assertHasKeys(self, dictionary, keys): for key in keys: self.assertTrue(key in dictionary, 'key "%s" not in dictionary' % (key)) def test_list_zones_empty(self): LiquidWebMockHttp.type = 'EMPTY_ZONES_LIST' zones = self.driver.list_zones() self.assertEqual(zones, []) def test_list_zones_success(self): zones = self.driver.list_zones() self.assertEqual(len(zones), 3) zone = zones[0] self.assertEqual(zone.id, '378451') self.assertEqual(zone.domain, 'blogtest.com') self.assertEqual(zone.type, 'NATIVE') self.assertEqual(zone.driver, self.driver) self.assertEqual(zone.ttl, None) second_zone = zones[1] self.assertEqual(second_zone.id, '378449') self.assertEqual(second_zone.domain, 'oltjanotest.com') self.assertEqual(second_zone.type, 'NATIVE') self.assertEqual(second_zone.driver, self.driver) self.assertEqual(second_zone.ttl, None) third_zone = zones[2] self.assertEqual(third_zone.id, '378450') self.assertEqual(third_zone.domain, 'pythontest.com') self.assertEqual(third_zone.type, 'NATIVE') self.assertEqual(third_zone.driver, self.driver) self.assertEqual(third_zone.ttl, None) def test_get_zone_zone_does_not_exist(self): LiquidWebMockHttp.type = 'ZONE_DOES_NOT_EXIST' try: self.driver.get_zone(zone_id='13') except ZoneDoesNotExistError: e = sys.exc_info()[1] self.assertEqual(e.zone_id, '13') else: self.fail('Exception was not thrown') def test_get_zone_success(self): LiquidWebMockHttp.type = 'GET_ZONE_SUCCESS' zone = self.driver.get_zone(zone_id='13') self.assertEqual(zone.id, '13') self.assertEqual(zone.domain, 'blogtest.com') self.assertEqual(zone.type, 'NATIVE') self.assertEqual(zone.ttl, None) self.assertEqual(zone.driver, self.driver) def test_delete_zone_success(self): LiquidWebMockHttp.type = 'DELETE_ZONE_SUCCESS' zone = self.test_zone status = self.driver.delete_zone(zone=zone) self.assertEqual(status, True) def test_delete_zone_zone_does_not_exist(self): LiquidWebMockHttp.type = 'DELETE_ZONE_ZONE_DOES_NOT_EXIST' zone = self.test_zone try: self.driver.delete_zone(zone=zone) except ZoneDoesNotExistError: e = sys.exc_info()[1] self.assertEqual(e.zone_id, '11') else: self.fail('Exception was not thrown') def test_create_zone_success(self): LiquidWebMockHttp.type = 'CREATE_ZONE_SUCCESS' zone = self.driver.create_zone(domain='test.com') self.assertEqual(zone.id, '13') self.assertEqual(zone.domain, 'test.com') self.assertEqual(zone.type, 'NATIVE') self.assertEqual(zone.ttl, None) self.assertEqual(zone.driver, self.driver) def test_create_zone_zone_zone_already_exists(self): LiquidWebMockHttp.type = 'CREATE_ZONE_ZONE_ALREADY_EXISTS' try: self.driver.create_zone(domain='test.com') except ZoneAlreadyExistsError: e = sys.exc_info()[1] self.assertEqual(e.zone_id, 'test.com') else: self.fail('Exception was not thrown') def test_list_records_empty(self): LiquidWebMockHttp.type = 'EMPTY_RECORDS_LIST' zone = self.test_zone records = self.driver.list_records(zone=zone) self.assertEqual(records, []) def test_list_records_success(self): LiquidWebMockHttp.type = 'LIST_RECORDS_SUCCESS' zone = self.test_zone records = self.driver.list_records(zone=zone) self.assertEqual(len(records), 3) record = records[0] self.assertEqual(record.id, '13') self.assertEqual(record.type, 'A') self.assertEqual(record.name, 'nerd.domain.com') self.assertEqual(record.data, '127.0.0.1') self.assertEqual(record.zone, self.test_zone) self.assertEqual(record.zone.id, '11') second_record = records[1] self.assertEqual(second_record.id, '11') self.assertEqual(second_record.type, 'A') self.assertEqual(second_record.name, 'thisboy.domain.com') self.assertEqual(second_record.data, '127.0.0.1') self.assertEqual(second_record.zone, self.test_zone) third_record = records[2] self.assertEqual(third_record.id, '10') self.assertEqual(third_record.type, 'A') self.assertEqual(third_record.name, 'visitor.domain.com') self.assertEqual(third_record.data, '127.0.0.1') self.assertEqual(third_record.zone, self.test_zone) def test_get_record_record_does_not_exist(self): LiquidWebMockHttp.type = 'GET_RECORD_RECORD_DOES_NOT_EXIST' try: self.driver.get_record(zone_id='13', record_id='13') except RecordDoesNotExistError: e = sys.exc_info()[1] self.assertEqual(e.record_id, '13') else: self.fail('Exception was not thrown') def test_get_record_success(self): LiquidWebMockHttp.type = 'GET_RECORD_SUCCESS' record = self.driver.get_record(zone_id='13', record_id='13') self.assertEqual(record.id, '13') self.assertEqual(record.type, 'A') self.assertEqual(record.name, 'nerd.domain.com') self.assertEqual(record.data, '127.0.0.1') def test_update_record_success(self): LiquidWebMockHttp.type = 'GET_RECORD_SUCCESS' record = self.driver.get_record(zone_id='13', record_id='13') self.assertEqual(record.id, '13') self.assertEqual(record.type, 'A') self.assertEqual(record.name, 'nerd.domain.com') self.assertEqual(record.data, '127.0.0.1') self.assertEqual(record.extra.get('ttl'), 300) LiquidWebMockHttp.type = '' record1 = self.driver.update_record(record=record, name=record.name, type=record.type, data=record.data, extra={'ttl': 5600}) self.assertEqual(record1.id, '13') self.assertEqual(record1.type, 'A') self.assertEqual(record1.name, 'nerd.domain.com') self.assertEqual(record1.data, '127.0.0.1') self.assertEqual(record1.extra.get('ttl'), 5600) def test_delete_record_success(self): LiquidWebMockHttp.type = 'DELETE_RECORD_SUCCESS' record = self.test_record status = self.driver.delete_record(record=record) self.assertEqual(status, True) def test_delete_record_RECORD_DOES_NOT_EXIST_ERROR(self): LiquidWebMockHttp.type = 'DELETE_RECORD_RECORD_DOES_NOT_EXIST' record = self.test_record try: self.driver.delete_record(record=record) except RecordDoesNotExistError: e = sys.exc_info()[1] self.assertEqual(e.record_id, '13') else: self.fail('Exception was not thrown') def test_create_record_success(self): pass def test_record_already_exists_error(self): pass class LiquidWebMockHttp(MockHttp): fixtures = DNSFileFixtures('liquidweb') def _v1_Network_DNS_Zone_list(self, method, url, body, headers): body = self.fixtures.load('zones_list.json') return (httplib.OK, body, {}, httplib.responses[httplib.OK]) def _v1_Network_DNS_Zone_list_EMPTY_ZONES_LIST(self, method, url, body, headers): body = self.fixtures.load('empty_zones_list.json') return (httplib.OK, body, {}, httplib.responses[httplib.OK]) def _v1_Network_DNS_Zone_details_ZONE_DOES_NOT_EXIST(self, method, url, body, headers): body = self.fixtures.load('zone_does_not_exist.json') return (httplib.OK, body, {}, httplib.responses[httplib.OK]) def _v1_Network_DNS_Zone_details_GET_ZONE_SUCCESS(self, method, url, body, headers): body = self.fixtures.load('get_zone.json') return (httplib.OK, body, {}, httplib.responses[httplib.OK]) def _v1_Network_DNS_Zone_delete_DELETE_ZONE_SUCCESS(self, method, url, body, headers): body = self.fixtures.load('delete_zone_success.json') return (httplib.OK, body, {}, httplib.responses[httplib.OK]) def _v1_Network_DNS_Zone_delete_DELETE_ZONE_ZONE_DOES_NOT_EXIST( self, method, url, body, headers): body = self.fixtures.load('zone_does_not_exist.json') return (httplib.OK, body, {}, httplib.responses[httplib.OK]) def _v1_Network_DNS_Zone_create_CREATE_ZONE_SUCCESS(self, method, url, body, headers): body = self.fixtures.load('create_zone_success.json') return (httplib.OK, body, {}, httplib.responses[httplib.OK]) def _v1_Network_DNS_Zone_create_CREATE_ZONE_ZONE_ALREADY_EXISTS( self, method, url, body, headers): body = self.fixtures.load('duplicate_record.json') return (httplib.OK, body, {}, httplib.responses[httplib.OK]) def _v1_Network_DNS_Record_list_EMPTY_RECORDS_LIST(self, method, url, body, headers): body = self.fixtures.load('empty_records_list.json') return (httplib.OK, body, {}, httplib.responses[httplib.OK]) def _v1_Network_DNS_Record_list_LIST_RECORDS_SUCCESS(self, method, url, body, headers): body = self.fixtures.load('records_list.json') return (httplib.OK, body, {}, httplib.responses[httplib.OK]) def _v1_Network_DNS_Record_details_GET_RECORD_RECORD_DOES_NOT_EXIST( self, method, url, body, headers): body = self.fixtures.load('record_does_not_exist.json') return (httplib.OK, body, {}, httplib.responses[httplib.OK]) def _v1_Network_DNS_Zone_details_GET_RECORD_RECORD_DOES_NOT_EXIST( self, method, url, body, headers): body = self.fixtures.load('get_zone.json') return (httplib.OK, body, {}, httplib.responses[httplib.OK]) def _v1_Network_DNS_Zone_details_GET_RECORD_SUCCESS(self, method, url, body, headers): body = self.fixtures.load('get_zone.json') return (httplib.OK, body, {}, httplib.responses[httplib.OK]) def _v1_Network_DNS_Record_details_GET_RECORD_SUCCESS(self, method, url, body, headers): body = self.fixtures.load('get_record.json') return (httplib.OK, body, {}, httplib.responses[httplib.OK]) def _v1_Network_DNS_Record_delete_DELETE_RECORD_SUCCESS(self, method, url, body, headers): body = self.fixtures.load('delete_record.json') return (httplib.OK, body, {}, httplib.responses[httplib.OK]) def _v1_Network_DNS_Record_delete_DELETE_RECORD_RECORD_DOES_NOT_EXIST( self, method, url, body, headers): body = self.fixtures.load('record_does_not_exist.json') return (httplib.OK, body, {}, httplib.responses[httplib.OK]) def _v1_Network_DNS_Record_create_CREATE_RECORD_SUCCESS(self, method, url, body, headers): body = self.fixtures.load('') return (httplib.OK, body, {}, httplib.responses[httplib.OK]) def _v1_Network_DNS_Record_ALREADY_EXISTS_ERROR(self, method, url, body, headers): body = self.fixtures.load('') return (httplib.OK, body, {}, httplib.responses[httplib.OK]) def _v1_Network_DNS_Record_update(self, method, url, body, headers): body = self.fixtures.load('update_record.json') return (httplib.OK, body, {}, httplib.responses[httplib.OK]) if __name__ == '__main__': sys.exit(unittest.main())
true
true
f7f96fbf03212b6ead2f3ae676c9fb9b8ef0fcbe
1,059
py
Python
platform/ext/target/nxp/lpcxpresso55s69/scripts/flash_bl2.py
urutva/trusted-firmware-m
e7f1c4c42b3322c8d4077060b433c87b508283b9
[ "BSD-3-Clause" ]
null
null
null
platform/ext/target/nxp/lpcxpresso55s69/scripts/flash_bl2.py
urutva/trusted-firmware-m
e7f1c4c42b3322c8d4077060b433c87b508283b9
[ "BSD-3-Clause" ]
null
null
null
platform/ext/target/nxp/lpcxpresso55s69/scripts/flash_bl2.py
urutva/trusted-firmware-m
e7f1c4c42b3322c8d4077060b433c87b508283b9
[ "BSD-3-Clause" ]
1
2021-04-21T20:53:02.000Z
2021-04-21T20:53:02.000Z
# Copyright (c) 2020, Linaro. All rights reserved. # Copyright (c) 2020, Arm Limited. All rights reserved. # Copyright (c) 2021, NXP Semiconductors. All rights reserved. # SPDX-License-Identifier: BSD-3-Clause import os import platform os.chdir('../../../../../../build') # Flash with JLinkExe FILE = "flash.jlink" if os.path.isfile(FILE): if platform.system() == 'Windows': os.system('del /f FILE') else: os.system('rm -rf FILE') os.system('echo r >> ' + FILE) os.system('echo erase >> ' + FILE) os.system('echo loadfile bin/bl2.hex >> ' + FILE) os.system('echo loadfile bin/tfm_s_signed.bin 0x8000 >> ' + FILE) os.system('echo loadfile bin/tfm_ns_signed.bin 0x30000 >> ' + FILE) os.system('echo r >> ' + FILE) os.system('echo go >> ' + FILE) os.system('echo exit >> ' + FILE) if platform.system() == 'Windows': os.system('JLink -device lpc55s69 -if swd -speed 2000 -autoconnect 1 -commanderscript ' + FILE) else: os.system('JLinkExe -device lpc55s69 -if swd -speed 2000 -autoconnect 1 -commanderscript ' +FILE)
31.147059
101
0.658168
import os import platform os.chdir('../../../../../../build') FILE = "flash.jlink" if os.path.isfile(FILE): if platform.system() == 'Windows': os.system('del /f FILE') else: os.system('rm -rf FILE') os.system('echo r >> ' + FILE) os.system('echo erase >> ' + FILE) os.system('echo loadfile bin/bl2.hex >> ' + FILE) os.system('echo loadfile bin/tfm_s_signed.bin 0x8000 >> ' + FILE) os.system('echo loadfile bin/tfm_ns_signed.bin 0x30000 >> ' + FILE) os.system('echo r >> ' + FILE) os.system('echo go >> ' + FILE) os.system('echo exit >> ' + FILE) if platform.system() == 'Windows': os.system('JLink -device lpc55s69 -if swd -speed 2000 -autoconnect 1 -commanderscript ' + FILE) else: os.system('JLinkExe -device lpc55s69 -if swd -speed 2000 -autoconnect 1 -commanderscript ' +FILE)
true
true
f7f970bd9d2b7f847e30117422df856dca92f41f
5,861
py
Python
causal_bald/application/workflows/active_learning.py
anndvision/causal-bald
4e58ef0afa4ba7c4e12342e6052b39a93c95c680
[ "Apache-2.0" ]
8
2021-10-30T17:25:28.000Z
2022-03-25T16:02:07.000Z
causal_bald/application/workflows/active_learning.py
anndvision/causal-bald
4e58ef0afa4ba7c4e12342e6052b39a93c95c680
[ "Apache-2.0" ]
3
2021-12-03T12:00:07.000Z
2021-12-11T11:36:23.000Z
causal_bald/application/workflows/active_learning.py
anndvision/causal-bald
4e58ef0afa4ba7c4e12342e6052b39a93c95c680
[ "Apache-2.0" ]
5
2021-10-30T13:19:09.000Z
2022-02-06T18:31:05.000Z
import json import numpy as np import scipy.stats from copy import deepcopy from causal_bald.library import models from causal_bald.library import datasets from causal_bald.library import acquisitions from causal_bald.application.workflows import utils def active_learner(model_name, config, experiment_dir, trial): # Set dataset seeds dataset_name = config.get("dataset_name") config["ds_train"]["seed"] = trial config["ds_valid"]["seed"] = trial + 1 if dataset_name == "synthetic" else trial config["ds_test"]["seed"] = trial + 2 if dataset_name == "synthetic" else trial # Get datasets ds_active = datasets.ActiveLearningDataset( datasets.DATASETS.get(dataset_name)(**config.get("ds_train")) ) ds_valid = datasets.DATASETS.get(dataset_name)(**config.get("ds_valid")) # Set the trial dir experiment_dir = utils.DIRECTORIES[model_name]( base_dir=experiment_dir, config=config ) trial_dir = experiment_dir / f"trial-{trial:03d}" trial_dir.mkdir(parents=True, exist_ok=True) # Write config for downstream use config_path = trial_dir / "config.json" with config_path.open(mode="w") as cp: json.dump(config, cp) # Get the acquisition function acquisition_function = acquisitions.FUNCTIONS.get( config.get("acquisition_function") ) # Train pi model if needed by acquisition pt = get_propensities(trial_dir=trial_dir, config=config) # Do active learning loop step_size = config.get("step_size") warm_start_size = config.get("warm_start_size") max_acquisitions = config.get("max_acquisitions") temperature = config.get("temperature") use_gumbel = config.get("use_gumbel") for i in range(max_acquisitions): batch_size = warm_start_size if i == 0 else step_size acquisition_dir = trial_dir / f"acquisition-{i:03d}" acquired_path = acquisition_dir / "aquired.json" if not acquired_path.exists(): if i == 0: scores = acquisitions.random( mu_0=None, mu_1=None, t=ds_active.dataset.t, pt=pt, temperature=None )[ds_active.pool_dataset.indices] else: # Predict pool set mu_0, mu_1 = utils.PREDICT_FUNCTIONS[model_name]( dataset=ds_active.dataset, job_dir=trial_dir / f"acquisition-{i-1:03d}", config=config, ) # Get acquisition scores scores = ( acquisition_function( mu_0=mu_0, mu_1=mu_1, t=ds_active.dataset.t, pt=pt, temperature=temperature if temperature > 0.0 else 1.0, ) )[ds_active.pool_dataset.indices] if temperature > 0.0: if use_gumbel: p = scores + scipy.stats.gumbel_r.rvs( loc=0, scale=1, size=len(scores), random_state=None, ) idx = np.argpartition(p, -batch_size)[-batch_size:] else: scores = np.exp(scores) p = scores / scores.sum() idx = np.random.choice( range(len(p)), replace=False, p=p, size=batch_size, ) else: idx = np.argsort(scores)[-batch_size:] ds_active.acquire(idx) # Train model utils.TRAIN_FUNCTIONS[model_name]( ds_train=ds_active.training_dataset, ds_valid=ds_valid, job_dir=acquisition_dir, config=config, dim_input=ds_active.dataset.dim_input, ) # Save acuired points with acquired_path.open(mode="w") as ap: json.dump( {"aquired_indices": [int(a) for a in ds_active.acquired_indices]}, ap, ) def get_propensities(trial_dir, config): dataset_name = config.get("dataset_name") dim_hidden = config.get("dim_hidden") depth = config.get("depth") negative_slope = config.get("negative_slope") dropout_rate = config.get("dropout_rate") spectral_norm = config.get("spectral_norm") learning_rate = config.get("learning_rate") batch_size = config.get("batch_size") epochs = config.get("epochs") if config.get("acquisition_function") in ["pi", "mu-pi"]: config_pi_train = deepcopy(config.get("ds_train")) config_pi_train["mode"] = "pi" ds_pi_train = datasets.DATASETS.get(dataset_name)(**config_pi_train) pi_dir = trial_dir / "pi" pi_model = models.NeuralNetwork( job_dir=pi_dir, architecture="resnet", dim_input=ds_pi_train.dim_input, dim_hidden=dim_hidden, dim_output=1, depth=depth, negative_slope=negative_slope, batch_norm=False, spectral_norm=spectral_norm, dropout_rate=dropout_rate, weight_decay=(0.5 * (1 - config.get("dropout_rate"))) / len(ds_pi_train), learning_rate=learning_rate, batch_size=batch_size, epochs=epochs, patience=10, num_workers=0, seed=config.get("seed"), ) if not (pi_dir / "best_checkpoint.pt").exists(): config_pi_valid = deepcopy(config.get("ds_valid")) config_pi_valid["mode"] = "pi" ds_pi_valid = datasets.DATASETS.get(dataset_name)(**config_pi_valid) pi_model.fit(ds_pi_train, ds_pi_valid) pi_model.load() return pi_model.predict_mean(ds_pi_train).ravel() else: return None
39.870748
88
0.586077
import json import numpy as np import scipy.stats from copy import deepcopy from causal_bald.library import models from causal_bald.library import datasets from causal_bald.library import acquisitions from causal_bald.application.workflows import utils def active_learner(model_name, config, experiment_dir, trial): dataset_name = config.get("dataset_name") config["ds_train"]["seed"] = trial config["ds_valid"]["seed"] = trial + 1 if dataset_name == "synthetic" else trial config["ds_test"]["seed"] = trial + 2 if dataset_name == "synthetic" else trial ds_active = datasets.ActiveLearningDataset( datasets.DATASETS.get(dataset_name)(**config.get("ds_train")) ) ds_valid = datasets.DATASETS.get(dataset_name)(**config.get("ds_valid")) experiment_dir = utils.DIRECTORIES[model_name]( base_dir=experiment_dir, config=config ) trial_dir = experiment_dir / f"trial-{trial:03d}" trial_dir.mkdir(parents=True, exist_ok=True) config_path = trial_dir / "config.json" with config_path.open(mode="w") as cp: json.dump(config, cp) acquisition_function = acquisitions.FUNCTIONS.get( config.get("acquisition_function") ) pt = get_propensities(trial_dir=trial_dir, config=config) step_size = config.get("step_size") warm_start_size = config.get("warm_start_size") max_acquisitions = config.get("max_acquisitions") temperature = config.get("temperature") use_gumbel = config.get("use_gumbel") for i in range(max_acquisitions): batch_size = warm_start_size if i == 0 else step_size acquisition_dir = trial_dir / f"acquisition-{i:03d}" acquired_path = acquisition_dir / "aquired.json" if not acquired_path.exists(): if i == 0: scores = acquisitions.random( mu_0=None, mu_1=None, t=ds_active.dataset.t, pt=pt, temperature=None )[ds_active.pool_dataset.indices] else: mu_0, mu_1 = utils.PREDICT_FUNCTIONS[model_name]( dataset=ds_active.dataset, job_dir=trial_dir / f"acquisition-{i-1:03d}", config=config, ) scores = ( acquisition_function( mu_0=mu_0, mu_1=mu_1, t=ds_active.dataset.t, pt=pt, temperature=temperature if temperature > 0.0 else 1.0, ) )[ds_active.pool_dataset.indices] if temperature > 0.0: if use_gumbel: p = scores + scipy.stats.gumbel_r.rvs( loc=0, scale=1, size=len(scores), random_state=None, ) idx = np.argpartition(p, -batch_size)[-batch_size:] else: scores = np.exp(scores) p = scores / scores.sum() idx = np.random.choice( range(len(p)), replace=False, p=p, size=batch_size, ) else: idx = np.argsort(scores)[-batch_size:] ds_active.acquire(idx) utils.TRAIN_FUNCTIONS[model_name]( ds_train=ds_active.training_dataset, ds_valid=ds_valid, job_dir=acquisition_dir, config=config, dim_input=ds_active.dataset.dim_input, ) with acquired_path.open(mode="w") as ap: json.dump( {"aquired_indices": [int(a) for a in ds_active.acquired_indices]}, ap, ) def get_propensities(trial_dir, config): dataset_name = config.get("dataset_name") dim_hidden = config.get("dim_hidden") depth = config.get("depth") negative_slope = config.get("negative_slope") dropout_rate = config.get("dropout_rate") spectral_norm = config.get("spectral_norm") learning_rate = config.get("learning_rate") batch_size = config.get("batch_size") epochs = config.get("epochs") if config.get("acquisition_function") in ["pi", "mu-pi"]: config_pi_train = deepcopy(config.get("ds_train")) config_pi_train["mode"] = "pi" ds_pi_train = datasets.DATASETS.get(dataset_name)(**config_pi_train) pi_dir = trial_dir / "pi" pi_model = models.NeuralNetwork( job_dir=pi_dir, architecture="resnet", dim_input=ds_pi_train.dim_input, dim_hidden=dim_hidden, dim_output=1, depth=depth, negative_slope=negative_slope, batch_norm=False, spectral_norm=spectral_norm, dropout_rate=dropout_rate, weight_decay=(0.5 * (1 - config.get("dropout_rate"))) / len(ds_pi_train), learning_rate=learning_rate, batch_size=batch_size, epochs=epochs, patience=10, num_workers=0, seed=config.get("seed"), ) if not (pi_dir / "best_checkpoint.pt").exists(): config_pi_valid = deepcopy(config.get("ds_valid")) config_pi_valid["mode"] = "pi" ds_pi_valid = datasets.DATASETS.get(dataset_name)(**config_pi_valid) pi_model.fit(ds_pi_train, ds_pi_valid) pi_model.load() return pi_model.predict_mean(ds_pi_train).ravel() else: return None
true
true
f7f97112714120a52a4be60858c4a6a2b38f22c3
2,901
py
Python
models/resnext_block.py
khiemledev/Basic_CNNs_TensorFlow2
be2c90f2a63ae13b7586a1e4114c2bc42a825c83
[ "MIT" ]
497
2019-10-14T03:57:31.000Z
2022-03-30T08:49:51.000Z
models/resnext_block.py
khiemledev/Basic_CNNs_TensorFlow2
be2c90f2a63ae13b7586a1e4114c2bc42a825c83
[ "MIT" ]
33
2019-10-23T02:42:27.000Z
2022-03-07T01:56:13.000Z
models/resnext_block.py
khiemledev/Basic_CNNs_TensorFlow2
be2c90f2a63ae13b7586a1e4114c2bc42a825c83
[ "MIT" ]
190
2019-10-31T14:38:28.000Z
2022-03-30T07:42:36.000Z
import tensorflow as tf from models.group_convolution import get_group_conv class ResNeXt_BottleNeck(tf.keras.layers.Layer): def __init__(self, filters, strides, groups): super(ResNeXt_BottleNeck, self).__init__() self.conv1 = tf.keras.layers.Conv2D(filters=filters, kernel_size=(1, 1), strides=1, padding="same") self.bn1 = tf.keras.layers.BatchNormalization() # self.group_conv = tf.keras.layers.Conv2D(filters=filters, # kernel_size=(3, 3), # strides=strides, # padding="same", # groups=groups) self.group_conv = get_group_conv(in_channels=filters, out_channels=filters, kernel_size=(3, 3), strides=strides, padding="same", groups=groups) self.bn2 = tf.keras.layers.BatchNormalization() self.conv2 = tf.keras.layers.Conv2D(filters=2 * filters, kernel_size=(1, 1), strides=1, padding="same") self.bn3 = tf.keras.layers.BatchNormalization() self.shortcut_conv = tf.keras.layers.Conv2D(filters=2 * filters, kernel_size=(1, 1), strides=strides, padding="same") self.shortcut_bn = tf.keras.layers.BatchNormalization() def call(self, inputs, training=None, **kwargs): x = self.conv1(inputs) x = self.bn1(x, training=training) x = tf.nn.relu(x) x = self.group_conv(x) x = self.bn2(x, training=training) x = tf.nn.relu(x) x = self.conv2(x) x = self.bn3(x, training=training) shortcut = self.shortcut_conv(inputs) shortcut = self.shortcut_bn(shortcut, training=training) output = tf.nn.relu(tf.keras.layers.add([x, shortcut])) return output def build_ResNeXt_block(filters, strides, groups, repeat_num): block = tf.keras.Sequential() block.add(ResNeXt_BottleNeck(filters=filters, strides=strides, groups=groups)) for _ in range(1, repeat_num): block.add(ResNeXt_BottleNeck(filters=filters, strides=1, groups=groups)) return block
45.328125
72
0.45605
import tensorflow as tf from models.group_convolution import get_group_conv class ResNeXt_BottleNeck(tf.keras.layers.Layer): def __init__(self, filters, strides, groups): super(ResNeXt_BottleNeck, self).__init__() self.conv1 = tf.keras.layers.Conv2D(filters=filters, kernel_size=(1, 1), strides=1, padding="same") self.bn1 = tf.keras.layers.BatchNormalization() self.group_conv = get_group_conv(in_channels=filters, out_channels=filters, kernel_size=(3, 3), strides=strides, padding="same", groups=groups) self.bn2 = tf.keras.layers.BatchNormalization() self.conv2 = tf.keras.layers.Conv2D(filters=2 * filters, kernel_size=(1, 1), strides=1, padding="same") self.bn3 = tf.keras.layers.BatchNormalization() self.shortcut_conv = tf.keras.layers.Conv2D(filters=2 * filters, kernel_size=(1, 1), strides=strides, padding="same") self.shortcut_bn = tf.keras.layers.BatchNormalization() def call(self, inputs, training=None, **kwargs): x = self.conv1(inputs) x = self.bn1(x, training=training) x = tf.nn.relu(x) x = self.group_conv(x) x = self.bn2(x, training=training) x = tf.nn.relu(x) x = self.conv2(x) x = self.bn3(x, training=training) shortcut = self.shortcut_conv(inputs) shortcut = self.shortcut_bn(shortcut, training=training) output = tf.nn.relu(tf.keras.layers.add([x, shortcut])) return output def build_ResNeXt_block(filters, strides, groups, repeat_num): block = tf.keras.Sequential() block.add(ResNeXt_BottleNeck(filters=filters, strides=strides, groups=groups)) for _ in range(1, repeat_num): block.add(ResNeXt_BottleNeck(filters=filters, strides=1, groups=groups)) return block
true
true
f7f97151ef25bf25f7f3247b2596badf1e172fa4
4,147
py
Python
activitysim/abm/models/util/trip.py
SEMCOG/SEMCOG_ActSim
cc18cce84b2e4b5f380f58c7919953d2cd03ee73
[ "BSD-3-Clause" ]
null
null
null
activitysim/abm/models/util/trip.py
SEMCOG/SEMCOG_ActSim
cc18cce84b2e4b5f380f58c7919953d2cd03ee73
[ "BSD-3-Clause" ]
1
2021-06-30T23:39:37.000Z
2021-06-30T23:39:37.000Z
activitysim/abm/models/util/trip.py
SEMCOG/SEMCOG_ActSim
cc18cce84b2e4b5f380f58c7919953d2cd03ee73
[ "BSD-3-Clause" ]
null
null
null
# ActivitySim # See full license in LICENSE.txt. import logging import numpy as np from activitysim.core.util import assign_in_place logger = logging.getLogger(__name__) def failed_trip_cohorts(trips, failed): # outbound trips in a tour with a failed outbound trip bad_outbound_trips = \ trips.outbound & (trips.tour_id.isin(trips.tour_id[failed & trips.outbound])) # inbound trips in a tour with a failed inbound trip bad_inbound_trips = \ ~trips.outbound & (trips.tour_id.isin(trips.tour_id[failed & ~trips.outbound])) bad_trips = bad_outbound_trips | bad_inbound_trips return bad_trips def flag_failed_trip_leg_mates(trips_df, col_name): """ set boolean flag column of specified name to identify failed trip leg_mates in place """ failed_trip_leg_mates = failed_trip_cohorts(trips_df, trips_df.failed) & ~trips_df.failed trips_df.loc[failed_trip_leg_mates, col_name] = True # handle outbound and inbound legs independently # for ob in [True, False]: # same_leg = (trips_df.outbound == ob) # # tour_ids of all tours with a failed trip in this (outbound or inbound) leg direction # bad_tours = trips_df.tour_id[trips_df.failed & same_leg].unique() # # not-failed leg_mates of all failed trips in this (outbound or inbound) leg direction # failed_trip_leg_mates = same_leg & (trips_df.tour_id.isin(bad_tours)) & ~trips_df.failed # # set the flag column # trips_df.loc[failed_trip_leg_mates, col_name] = True def cleanup_failed_trips(trips): """ drop failed trips and cleanup fields in leg_mates: trip_num assign new ordinal trip num after failed trips are dropped trip_count assign new count of trips in leg, sans failed trips first update first flag as we may have dropped first trip (last trip can't fail) next_trip_id assign id of next trip in leg after failed trips are dropped """ if trips.failed.any(): logger.warning("cleanup_failed_trips dropping %s failed trips" % trips.failed.sum()) trips['patch'] = False flag_failed_trip_leg_mates(trips, 'patch') # drop the original failures trips = trips[~trips.failed] # increasing trip_id order patch_trips = trips[trips.patch].sort_index() # recompute fields dependent on trip_num sequence grouped = patch_trips.groupby(['tour_id', 'outbound']) patch_trips['trip_num'] = grouped.cumcount() + 1 patch_trips['trip_count'] = patch_trips['trip_num'] + grouped.cumcount(ascending=False) assign_in_place(trips, patch_trips[['trip_num', 'trip_count']]) del trips['patch'] del trips['failed'] return trips def generate_alternative_sizes(max_duration, max_trips): """ Builds a lookup Numpy array pattern sizes based on the number of trips in the leg and the duration available to the leg. :param max_duration: :param max_trips: :return: """ def np_shift(xs, n, fill_zero=True): if n >= 0: shift_array = np.concatenate((np.full(n, np.nan), xs[:-n])) else: shift_array = np.concatenate((xs[-n:], np.full(-n, np.nan))) return np.nan_to_num(shift_array, np.nan).astype(np.int) if fill_zero else shift_array levels = np.empty([max_trips, max_duration + max_trips]) levels[0] = np.arange(1, max_duration + max_trips + 1) for level in np.arange(1, max_trips): levels[level] = np_shift(np.cumsum(np_shift(levels[level - 1], 1)), -1, fill_zero=False) return levels[:, :max_duration+1].astype(int) def get_time_windows(residual, level): """ :param residual: :param level: :return: """ ranges = [] for a in np.arange(residual + 1): if level > 1: windows = get_time_windows(residual - a, level - 1) width_dim = len(windows.shape) - 1 ranges.append(np.vstack([np.repeat(a, windows.shape[width_dim]), windows])) else: return np.arange(residual + 1) return np.concatenate(ranges, axis=1)
33.176
98
0.667712
import logging import numpy as np from activitysim.core.util import assign_in_place logger = logging.getLogger(__name__) def failed_trip_cohorts(trips, failed): bad_outbound_trips = \ trips.outbound & (trips.tour_id.isin(trips.tour_id[failed & trips.outbound])) bad_inbound_trips = \ ~trips.outbound & (trips.tour_id.isin(trips.tour_id[failed & ~trips.outbound])) bad_trips = bad_outbound_trips | bad_inbound_trips return bad_trips def flag_failed_trip_leg_mates(trips_df, col_name): failed_trip_leg_mates = failed_trip_cohorts(trips_df, trips_df.failed) & ~trips_df.failed trips_df.loc[failed_trip_leg_mates, col_name] = True ips['patch'] = False flag_failed_trip_leg_mates(trips, 'patch') trips = trips[~trips.failed] patch_trips = trips[trips.patch].sort_index() grouped = patch_trips.groupby(['tour_id', 'outbound']) patch_trips['trip_num'] = grouped.cumcount() + 1 patch_trips['trip_count'] = patch_trips['trip_num'] + grouped.cumcount(ascending=False) assign_in_place(trips, patch_trips[['trip_num', 'trip_count']]) del trips['patch'] del trips['failed'] return trips def generate_alternative_sizes(max_duration, max_trips): def np_shift(xs, n, fill_zero=True): if n >= 0: shift_array = np.concatenate((np.full(n, np.nan), xs[:-n])) else: shift_array = np.concatenate((xs[-n:], np.full(-n, np.nan))) return np.nan_to_num(shift_array, np.nan).astype(np.int) if fill_zero else shift_array levels = np.empty([max_trips, max_duration + max_trips]) levels[0] = np.arange(1, max_duration + max_trips + 1) for level in np.arange(1, max_trips): levels[level] = np_shift(np.cumsum(np_shift(levels[level - 1], 1)), -1, fill_zero=False) return levels[:, :max_duration+1].astype(int) def get_time_windows(residual, level): ranges = [] for a in np.arange(residual + 1): if level > 1: windows = get_time_windows(residual - a, level - 1) width_dim = len(windows.shape) - 1 ranges.append(np.vstack([np.repeat(a, windows.shape[width_dim]), windows])) else: return np.arange(residual + 1) return np.concatenate(ranges, axis=1)
true
true
f7f97213cbe2905bf394290f9e0800fa04ba6522
15,701
py
Python
sphinx/ext/graphviz.py
eqvinox/sphinx
cf5afec11753b73faecdc6670e2c28d16e410034
[ "BSD-2-Clause" ]
null
null
null
sphinx/ext/graphviz.py
eqvinox/sphinx
cf5afec11753b73faecdc6670e2c28d16e410034
[ "BSD-2-Clause" ]
null
null
null
sphinx/ext/graphviz.py
eqvinox/sphinx
cf5afec11753b73faecdc6670e2c28d16e410034
[ "BSD-2-Clause" ]
null
null
null
# -*- coding: utf-8 -*- """ sphinx.ext.graphviz ~~~~~~~~~~~~~~~~~~~ Allow graphviz-formatted graphs to be included in Sphinx-generated documents inline. :copyright: Copyright 2007-2018 by the Sphinx team, see AUTHORS. :license: BSD, see LICENSE for details. """ import posixpath import re from hashlib import sha1 from os import path from subprocess import Popen, PIPE from docutils import nodes from docutils.parsers.rst import directives from docutils.statemachine import ViewList from six import text_type import sphinx from sphinx.errors import SphinxError from sphinx.locale import _, __ from sphinx.util import logging from sphinx.util.docutils import SphinxDirective from sphinx.util.fileutil import copy_asset_file from sphinx.util.i18n import search_image_for_language from sphinx.util.osutil import ensuredir, ENOENT, EPIPE, EINVAL if False: # For type annotation from docutils.parsers.rst import Directive # NOQA from typing import Any, Dict, List, Tuple # NOQA from sphinx.application import Sphinx # NOQA logger = logging.getLogger(__name__) class GraphvizError(SphinxError): category = 'Graphviz error' class ClickableMapDefinition: """A manipulator for clickable map file of graphviz.""" maptag_re = re.compile('<map id="(.*?)"') href_re = re.compile('href=".*?"') def __init__(self, filename, content, dot=''): # type: (unicode, unicode, unicode) -> None self.id = None # type: unicode self.filename = filename self.content = content.splitlines() self.clickable = [] # type: List[unicode] self.parse(dot=dot) def parse(self, dot=None): # type: (unicode) -> None matched = self.maptag_re.match(self.content[0]) # type: ignore if not matched: raise GraphvizError('Invalid clickable map file found: %s' % self.filename) self.id = matched.group(1) if self.id == '%3': # graphviz generates wrong ID if graph name not specified # https://gitlab.com/graphviz/graphviz/issues/1327 hashed = sha1(dot.encode('utf-8')).hexdigest() self.id = 'grapviz%s' % hashed[-10:] self.content[0] = self.content[0].replace('%3', self.id) for line in self.content: if self.href_re.search(line): # type: ignore self.clickable.append(line) def generate_clickable_map(self): # type: () -> unicode """Generate clickable map tags if clickable item exists. If not exists, this only returns empty string. """ if self.clickable: return '\n'.join([self.content[0]] + self.clickable + [self.content[-1]]) else: return '' class graphviz(nodes.General, nodes.Inline, nodes.Element): pass def figure_wrapper(directive, node, caption): # type: (Directive, nodes.Node, unicode) -> nodes.figure figure_node = nodes.figure('', node) if 'align' in node: figure_node['align'] = node.attributes.pop('align') parsed = nodes.Element() directive.state.nested_parse(ViewList([caption], source=''), directive.content_offset, parsed) caption_node = nodes.caption(parsed[0].rawsource, '', *parsed[0].children) caption_node.source = parsed[0].source caption_node.line = parsed[0].line figure_node += caption_node return figure_node def align_spec(argument): # type: (Any) -> bool return directives.choice(argument, ('left', 'center', 'right')) class Graphviz(SphinxDirective): """ Directive to insert arbitrary dot markup. """ has_content = True required_arguments = 0 optional_arguments = 1 final_argument_whitespace = False option_spec = { 'alt': directives.unchanged, 'align': align_spec, 'caption': directives.unchanged, 'graphviz_dot': directives.unchanged, 'name': directives.unchanged, } def run(self): # type: () -> List[nodes.Node] if self.arguments: document = self.state.document if self.content: return [document.reporter.warning( __('Graphviz directive cannot have both content and ' 'a filename argument'), line=self.lineno)] argument = search_image_for_language(self.arguments[0], self.env) rel_filename, filename = self.env.relfn2path(argument) self.env.note_dependency(rel_filename) try: with open(filename, 'r', encoding='utf-8') as fp: # type: ignore dotcode = fp.read() except (IOError, OSError): return [document.reporter.warning( __('External Graphviz file %r not found or reading ' 'it failed') % filename, line=self.lineno)] else: dotcode = '\n'.join(self.content) if not dotcode.strip(): return [self.state_machine.reporter.warning( __('Ignoring "graphviz" directive without content.'), line=self.lineno)] node = graphviz() node['code'] = dotcode node['options'] = {'docname': self.env.docname} if 'graphviz_dot' in self.options: node['options']['graphviz_dot'] = self.options['graphviz_dot'] if 'alt' in self.options: node['alt'] = self.options['alt'] if 'align' in self.options: node['align'] = self.options['align'] caption = self.options.get('caption') if caption: node = figure_wrapper(self, node, caption) self.add_name(node) return [node] class GraphvizSimple(SphinxDirective): """ Directive to insert arbitrary dot markup. """ has_content = True required_arguments = 1 optional_arguments = 0 final_argument_whitespace = False option_spec = { 'alt': directives.unchanged, 'align': align_spec, 'caption': directives.unchanged, 'graphviz_dot': directives.unchanged, 'name': directives.unchanged, } def run(self): # type: () -> List[nodes.Node] node = graphviz() node['code'] = '%s %s {\n%s\n}\n' % \ (self.name, self.arguments[0], '\n'.join(self.content)) node['options'] = { 'docname': path.splitext(self.state.document.current_source)[0], } if 'graphviz_dot' in self.options: node['options']['graphviz_dot'] = self.options['graphviz_dot'] if 'alt' in self.options: node['alt'] = self.options['alt'] if 'align' in self.options: node['align'] = self.options['align'] caption = self.options.get('caption') if caption: node = figure_wrapper(self, node, caption) self.add_name(node) return [node] def render_dot(self, code, options, format, prefix='graphviz'): # type: (nodes.NodeVisitor, unicode, Dict, unicode, unicode) -> Tuple[unicode, unicode] """Render graphviz code into a PNG or PDF output file.""" graphviz_dot = options.get('graphviz_dot', self.builder.config.graphviz_dot) hashkey = (code + str(options) + str(graphviz_dot) + str(self.builder.config.graphviz_dot_args)).encode('utf-8') fname = '%s-%s.%s' % (prefix, sha1(hashkey).hexdigest(), format) relfn = posixpath.join(self.builder.imgpath, fname) outfn = path.join(self.builder.outdir, self.builder.imagedir, fname) if path.isfile(outfn): return relfn, outfn if (hasattr(self.builder, '_graphviz_warned_dot') and self.builder._graphviz_warned_dot.get(graphviz_dot)): return None, None ensuredir(path.dirname(outfn)) # graphviz expects UTF-8 by default if isinstance(code, text_type): code = code.encode('utf-8') dot_args = [graphviz_dot] dot_args.extend(self.builder.config.graphviz_dot_args) dot_args.extend(['-T' + format, '-o' + outfn]) docname = options.get('docname', 'index') cwd = path.dirname(path.join(self.builder.srcdir, docname)) if format == 'png': dot_args.extend(['-Tcmapx', '-o%s.map' % outfn]) try: p = Popen(dot_args, stdout=PIPE, stdin=PIPE, stderr=PIPE, cwd=cwd) except OSError as err: if err.errno != ENOENT: # No such file or directory raise logger.warning(__('dot command %r cannot be run (needed for graphviz ' 'output), check the graphviz_dot setting'), graphviz_dot) if not hasattr(self.builder, '_graphviz_warned_dot'): self.builder._graphviz_warned_dot = {} self.builder._graphviz_warned_dot[graphviz_dot] = True return None, None try: # Graphviz may close standard input when an error occurs, # resulting in a broken pipe on communicate() stdout, stderr = p.communicate(code) except (OSError, IOError) as err: if err.errno not in (EPIPE, EINVAL): raise # in this case, read the standard output and standard error streams # directly, to get the error message(s) stdout, stderr = p.stdout.read(), p.stderr.read() p.wait() if p.returncode != 0: raise GraphvizError(__('dot exited with error:\n[stderr]\n%s\n' '[stdout]\n%s') % (stderr, stdout)) if not path.isfile(outfn): raise GraphvizError(__('dot did not produce an output file:\n[stderr]\n%s\n' '[stdout]\n%s') % (stderr, stdout)) return relfn, outfn def render_dot_html(self, node, code, options, prefix='graphviz', imgcls=None, alt=None): # type: (nodes.NodeVisitor, graphviz, unicode, Dict, unicode, unicode, unicode) -> Tuple[unicode, unicode] # NOQA format = self.builder.config.graphviz_output_format try: if format not in ('png', 'svg'): raise GraphvizError(__("graphviz_output_format must be one of 'png', " "'svg', but is %r") % format) fname, outfn = render_dot(self, code, options, format, prefix) except GraphvizError as exc: logger.warning(__('dot code %r: %s'), code, text_type(exc)) raise nodes.SkipNode if imgcls: imgcls += " graphviz" else: imgcls = "graphviz" if fname is None: self.body.append(self.encode(code)) else: if alt is None: alt = node.get('alt', self.encode(code).strip()) if 'align' in node: self.body.append('<div align="%s" class="align-%s">' % (node['align'], node['align'])) if format == 'svg': self.body.append('<div class="graphviz">') self.body.append('<object data="%s" type="image/svg+xml" class="%s">\n' % (fname, imgcls)) self.body.append('<p class="warning">%s</p>' % alt) self.body.append('</object></div>\n') else: with open(outfn + '.map', 'r', encoding='utf-8') as mapfile: # type: ignore imgmap = ClickableMapDefinition(outfn + '.map', mapfile.read(), dot=code) if imgmap.clickable: # has a map self.body.append('<div class="graphviz">') self.body.append('<img src="%s" alt="%s" usemap="#%s" class="%s" />' % (fname, alt, imgmap.id, imgcls)) self.body.append('</div>\n') self.body.append(imgmap.generate_clickable_map()) else: # nothing in image map self.body.append('<div class="graphviz">') self.body.append('<img src="%s" alt="%s" class="%s" />' % (fname, alt, imgcls)) self.body.append('</div>\n') if 'align' in node: self.body.append('</div>\n') raise nodes.SkipNode def html_visit_graphviz(self, node): # type: (nodes.NodeVisitor, graphviz) -> None render_dot_html(self, node, node['code'], node['options']) def render_dot_latex(self, node, code, options, prefix='graphviz'): # type: (nodes.NodeVisitor, graphviz, unicode, Dict, unicode) -> None try: fname, outfn = render_dot(self, code, options, 'pdf', prefix) except GraphvizError as exc: logger.warning(__('dot code %r: %s'), code, text_type(exc)) raise nodes.SkipNode is_inline = self.is_inline(node) if not is_inline: pre = '' post = '' if 'align' in node: if node['align'] == 'left': pre = '{' post = r'\hspace*{\fill}}' elif node['align'] == 'right': pre = r'{\hspace*{\fill}' post = '}' elif node['align'] == 'center': pre = r'{\hfill' post = r'\hspace*{\fill}}' self.body.append('\n%s' % pre) self.body.append(r'\sphinxincludegraphics[]{%s}' % fname) if not is_inline: self.body.append('%s\n' % post) raise nodes.SkipNode def latex_visit_graphviz(self, node): # type: (nodes.NodeVisitor, graphviz) -> None render_dot_latex(self, node, node['code'], node['options']) def render_dot_texinfo(self, node, code, options, prefix='graphviz'): # type: (nodes.NodeVisitor, graphviz, unicode, Dict, unicode) -> None try: fname, outfn = render_dot(self, code, options, 'png', prefix) except GraphvizError as exc: logger.warning(__('dot code %r: %s'), code, text_type(exc)) raise nodes.SkipNode if fname is not None: self.body.append('@image{%s,,,[graphviz],png}\n' % fname[:-4]) raise nodes.SkipNode def texinfo_visit_graphviz(self, node): # type: (nodes.NodeVisitor, graphviz) -> None render_dot_texinfo(self, node, node['code'], node['options']) def text_visit_graphviz(self, node): # type: (nodes.NodeVisitor, graphviz) -> None if 'alt' in node.attributes: self.add_text(_('[graph: %s]') % node['alt']) else: self.add_text(_('[graph]')) raise nodes.SkipNode def man_visit_graphviz(self, node): # type: (nodes.NodeVisitor, graphviz) -> None if 'alt' in node.attributes: self.body.append(_('[graph: %s]') % node['alt']) else: self.body.append(_('[graph]')) raise nodes.SkipNode def on_build_finished(app, exc): # type: (Sphinx, Exception) -> None if exc is None: src = path.join(sphinx.package_dir, 'templates', 'graphviz', 'graphviz.css') dst = path.join(app.outdir, '_static') copy_asset_file(src, dst) def setup(app): # type: (Sphinx) -> Dict[unicode, Any] app.add_node(graphviz, html=(html_visit_graphviz, None), latex=(latex_visit_graphviz, None), texinfo=(texinfo_visit_graphviz, None), text=(text_visit_graphviz, None), man=(man_visit_graphviz, None)) app.add_directive('graphviz', Graphviz) app.add_directive('graph', GraphvizSimple) app.add_directive('digraph', GraphvizSimple) app.add_config_value('graphviz_dot', 'dot', 'html') app.add_config_value('graphviz_dot_args', [], 'html') app.add_config_value('graphviz_output_format', 'png', 'html') app.add_css_file('graphviz.css') app.connect('build-finished', on_build_finished) return {'version': sphinx.__display_version__, 'parallel_read_safe': True}
36.094253
118
0.593274
import posixpath import re from hashlib import sha1 from os import path from subprocess import Popen, PIPE from docutils import nodes from docutils.parsers.rst import directives from docutils.statemachine import ViewList from six import text_type import sphinx from sphinx.errors import SphinxError from sphinx.locale import _, __ from sphinx.util import logging from sphinx.util.docutils import SphinxDirective from sphinx.util.fileutil import copy_asset_file from sphinx.util.i18n import search_image_for_language from sphinx.util.osutil import ensuredir, ENOENT, EPIPE, EINVAL if False: from docutils.parsers.rst import Directive from typing import Any, Dict, List, Tuple from sphinx.application import Sphinx logger = logging.getLogger(__name__) class GraphvizError(SphinxError): category = 'Graphviz error' class ClickableMapDefinition: maptag_re = re.compile('<map id="(.*?)"') href_re = re.compile('href=".*?"') def __init__(self, filename, content, dot=''): self.id = None self.filename = filename self.content = content.splitlines() self.clickable = [] self.parse(dot=dot) def parse(self, dot=None): matched = self.maptag_re.match(self.content[0]) if not matched: raise GraphvizError('Invalid clickable map file found: %s' % self.filename) self.id = matched.group(1) if self.id == '%3': hashed = sha1(dot.encode('utf-8')).hexdigest() self.id = 'grapviz%s' % hashed[-10:] self.content[0] = self.content[0].replace('%3', self.id) for line in self.content: if self.href_re.search(line): self.clickable.append(line) def generate_clickable_map(self): if self.clickable: return '\n'.join([self.content[0]] + self.clickable + [self.content[-1]]) else: return '' class graphviz(nodes.General, nodes.Inline, nodes.Element): pass def figure_wrapper(directive, node, caption): figure_node = nodes.figure('', node) if 'align' in node: figure_node['align'] = node.attributes.pop('align') parsed = nodes.Element() directive.state.nested_parse(ViewList([caption], source=''), directive.content_offset, parsed) caption_node = nodes.caption(parsed[0].rawsource, '', *parsed[0].children) caption_node.source = parsed[0].source caption_node.line = parsed[0].line figure_node += caption_node return figure_node def align_spec(argument): return directives.choice(argument, ('left', 'center', 'right')) class Graphviz(SphinxDirective): has_content = True required_arguments = 0 optional_arguments = 1 final_argument_whitespace = False option_spec = { 'alt': directives.unchanged, 'align': align_spec, 'caption': directives.unchanged, 'graphviz_dot': directives.unchanged, 'name': directives.unchanged, } def run(self): if self.arguments: document = self.state.document if self.content: return [document.reporter.warning( __('Graphviz directive cannot have both content and ' 'a filename argument'), line=self.lineno)] argument = search_image_for_language(self.arguments[0], self.env) rel_filename, filename = self.env.relfn2path(argument) self.env.note_dependency(rel_filename) try: with open(filename, 'r', encoding='utf-8') as fp: dotcode = fp.read() except (IOError, OSError): return [document.reporter.warning( __('External Graphviz file %r not found or reading ' 'it failed') % filename, line=self.lineno)] else: dotcode = '\n'.join(self.content) if not dotcode.strip(): return [self.state_machine.reporter.warning( __('Ignoring "graphviz" directive without content.'), line=self.lineno)] node = graphviz() node['code'] = dotcode node['options'] = {'docname': self.env.docname} if 'graphviz_dot' in self.options: node['options']['graphviz_dot'] = self.options['graphviz_dot'] if 'alt' in self.options: node['alt'] = self.options['alt'] if 'align' in self.options: node['align'] = self.options['align'] caption = self.options.get('caption') if caption: node = figure_wrapper(self, node, caption) self.add_name(node) return [node] class GraphvizSimple(SphinxDirective): has_content = True required_arguments = 1 optional_arguments = 0 final_argument_whitespace = False option_spec = { 'alt': directives.unchanged, 'align': align_spec, 'caption': directives.unchanged, 'graphviz_dot': directives.unchanged, 'name': directives.unchanged, } def run(self): node = graphviz() node['code'] = '%s %s {\n%s\n}\n' % \ (self.name, self.arguments[0], '\n'.join(self.content)) node['options'] = { 'docname': path.splitext(self.state.document.current_source)[0], } if 'graphviz_dot' in self.options: node['options']['graphviz_dot'] = self.options['graphviz_dot'] if 'alt' in self.options: node['alt'] = self.options['alt'] if 'align' in self.options: node['align'] = self.options['align'] caption = self.options.get('caption') if caption: node = figure_wrapper(self, node, caption) self.add_name(node) return [node] def render_dot(self, code, options, format, prefix='graphviz'): graphviz_dot = options.get('graphviz_dot', self.builder.config.graphviz_dot) hashkey = (code + str(options) + str(graphviz_dot) + str(self.builder.config.graphviz_dot_args)).encode('utf-8') fname = '%s-%s.%s' % (prefix, sha1(hashkey).hexdigest(), format) relfn = posixpath.join(self.builder.imgpath, fname) outfn = path.join(self.builder.outdir, self.builder.imagedir, fname) if path.isfile(outfn): return relfn, outfn if (hasattr(self.builder, '_graphviz_warned_dot') and self.builder._graphviz_warned_dot.get(graphviz_dot)): return None, None ensuredir(path.dirname(outfn)) if isinstance(code, text_type): code = code.encode('utf-8') dot_args = [graphviz_dot] dot_args.extend(self.builder.config.graphviz_dot_args) dot_args.extend(['-T' + format, '-o' + outfn]) docname = options.get('docname', 'index') cwd = path.dirname(path.join(self.builder.srcdir, docname)) if format == 'png': dot_args.extend(['-Tcmapx', '-o%s.map' % outfn]) try: p = Popen(dot_args, stdout=PIPE, stdin=PIPE, stderr=PIPE, cwd=cwd) except OSError as err: if err.errno != ENOENT: raise logger.warning(__('dot command %r cannot be run (needed for graphviz ' 'output), check the graphviz_dot setting'), graphviz_dot) if not hasattr(self.builder, '_graphviz_warned_dot'): self.builder._graphviz_warned_dot = {} self.builder._graphviz_warned_dot[graphviz_dot] = True return None, None try: stdout, stderr = p.communicate(code) except (OSError, IOError) as err: if err.errno not in (EPIPE, EINVAL): raise stdout, stderr = p.stdout.read(), p.stderr.read() p.wait() if p.returncode != 0: raise GraphvizError(__('dot exited with error:\n[stderr]\n%s\n' '[stdout]\n%s') % (stderr, stdout)) if not path.isfile(outfn): raise GraphvizError(__('dot did not produce an output file:\n[stderr]\n%s\n' '[stdout]\n%s') % (stderr, stdout)) return relfn, outfn def render_dot_html(self, node, code, options, prefix='graphviz', imgcls=None, alt=None): ormat = self.builder.config.graphviz_output_format try: if format not in ('png', 'svg'): raise GraphvizError(__("graphviz_output_format must be one of 'png', " "'svg', but is %r") % format) fname, outfn = render_dot(self, code, options, format, prefix) except GraphvizError as exc: logger.warning(__('dot code %r: %s'), code, text_type(exc)) raise nodes.SkipNode if imgcls: imgcls += " graphviz" else: imgcls = "graphviz" if fname is None: self.body.append(self.encode(code)) else: if alt is None: alt = node.get('alt', self.encode(code).strip()) if 'align' in node: self.body.append('<div align="%s" class="align-%s">' % (node['align'], node['align'])) if format == 'svg': self.body.append('<div class="graphviz">') self.body.append('<object data="%s" type="image/svg+xml" class="%s">\n' % (fname, imgcls)) self.body.append('<p class="warning">%s</p>' % alt) self.body.append('</object></div>\n') else: with open(outfn + '.map', 'r', encoding='utf-8') as mapfile: imgmap = ClickableMapDefinition(outfn + '.map', mapfile.read(), dot=code) if imgmap.clickable: self.body.append('<div class="graphviz">') self.body.append('<img src="%s" alt="%s" usemap="#%s" class="%s" />' % (fname, alt, imgmap.id, imgcls)) self.body.append('</div>\n') self.body.append(imgmap.generate_clickable_map()) else: self.body.append('<div class="graphviz">') self.body.append('<img src="%s" alt="%s" class="%s" />' % (fname, alt, imgcls)) self.body.append('</div>\n') if 'align' in node: self.body.append('</div>\n') raise nodes.SkipNode def html_visit_graphviz(self, node): render_dot_html(self, node, node['code'], node['options']) def render_dot_latex(self, node, code, options, prefix='graphviz'): try: fname, outfn = render_dot(self, code, options, 'pdf', prefix) except GraphvizError as exc: logger.warning(__('dot code %r: %s'), code, text_type(exc)) raise nodes.SkipNode is_inline = self.is_inline(node) if not is_inline: pre = '' post = '' if 'align' in node: if node['align'] == 'left': pre = '{' post = r'\hspace*{\fill}}' elif node['align'] == 'right': pre = r'{\hspace*{\fill}' post = '}' elif node['align'] == 'center': pre = r'{\hfill' post = r'\hspace*{\fill}}' self.body.append('\n%s' % pre) self.body.append(r'\sphinxincludegraphics[]{%s}' % fname) if not is_inline: self.body.append('%s\n' % post) raise nodes.SkipNode def latex_visit_graphviz(self, node): render_dot_latex(self, node, node['code'], node['options']) def render_dot_texinfo(self, node, code, options, prefix='graphviz'): try: fname, outfn = render_dot(self, code, options, 'png', prefix) except GraphvizError as exc: logger.warning(__('dot code %r: %s'), code, text_type(exc)) raise nodes.SkipNode if fname is not None: self.body.append('@image{%s,,,[graphviz],png}\n' % fname[:-4]) raise nodes.SkipNode def texinfo_visit_graphviz(self, node): render_dot_texinfo(self, node, node['code'], node['options']) def text_visit_graphviz(self, node): if 'alt' in node.attributes: self.add_text(_('[graph: %s]') % node['alt']) else: self.add_text(_('[graph]')) raise nodes.SkipNode def man_visit_graphviz(self, node): if 'alt' in node.attributes: self.body.append(_('[graph: %s]') % node['alt']) else: self.body.append(_('[graph]')) raise nodes.SkipNode def on_build_finished(app, exc): if exc is None: src = path.join(sphinx.package_dir, 'templates', 'graphviz', 'graphviz.css') dst = path.join(app.outdir, '_static') copy_asset_file(src, dst) def setup(app): app.add_node(graphviz, html=(html_visit_graphviz, None), latex=(latex_visit_graphviz, None), texinfo=(texinfo_visit_graphviz, None), text=(text_visit_graphviz, None), man=(man_visit_graphviz, None)) app.add_directive('graphviz', Graphviz) app.add_directive('graph', GraphvizSimple) app.add_directive('digraph', GraphvizSimple) app.add_config_value('graphviz_dot', 'dot', 'html') app.add_config_value('graphviz_dot_args', [], 'html') app.add_config_value('graphviz_output_format', 'png', 'html') app.add_css_file('graphviz.css') app.connect('build-finished', on_build_finished) return {'version': sphinx.__display_version__, 'parallel_read_safe': True}
true
true
f7f9732e25e8eb7f546f3c8c9cb822a0610bd658
706
py
Python
MDRSREID/Trainer/evaluation_creation/PGFA_Evaluation/extract_part_label.py
nickhuang1996/HJL-re-id
107b25f31c961f360f69560cfddd78dfc0da3291
[ "MIT" ]
43
2020-09-20T09:40:04.000Z
2022-03-29T11:25:22.000Z
MDRSREID/Trainer/evaluation_creation/PGFA_Evaluation/extract_part_label.py
nickhuang1996/HJL-re-id
107b25f31c961f360f69560cfddd78dfc0da3291
[ "MIT" ]
19
2020-10-05T05:35:38.000Z
2021-12-10T03:17:31.000Z
MDRSREID/Trainer/evaluation_creation/PGFA_Evaluation/extract_part_label.py
nickhuang1996/HJL-re-id
107b25f31c961f360f69560cfddd78dfc0da3291
[ "MIT" ]
18
2020-10-01T14:41:53.000Z
2021-09-02T06:57:57.000Z
from MDRSREID.utils.data_utils.evaluations.PGFA.part_label import part_label_generate import torch def extract_part_label(item, cfg): imgnames, imgheights = item['test_pose_path'], item['height'] N = len(imgnames) # part_label_batch = torch.FloatTensor(N, 1, cfg.model.num_parts).zero_() part_label_batch = torch.FloatTensor(N, cfg.model.num_parts).zero_() i = 0 for imgname, height in zip(imgnames, imgheights): part_label = part_label_generate(imgname, cfg.model.num_parts, height.item()) part_label = torch.from_numpy(part_label) # part_label = part_label.unsqueeze(0) part_label_batch[i] = part_label i += 1 return part_label_batch
39.222222
85
0.715297
from MDRSREID.utils.data_utils.evaluations.PGFA.part_label import part_label_generate import torch def extract_part_label(item, cfg): imgnames, imgheights = item['test_pose_path'], item['height'] N = len(imgnames) part_label_batch = torch.FloatTensor(N, cfg.model.num_parts).zero_() i = 0 for imgname, height in zip(imgnames, imgheights): part_label = part_label_generate(imgname, cfg.model.num_parts, height.item()) part_label = torch.from_numpy(part_label) part_label_batch[i] = part_label i += 1 return part_label_batch
true
true
f7f97410d7a2f375c897d4fee26504933d2350d8
2,028
py
Python
src/leetcode_2009_minimum_number_of_operations_to_make_array_continuous.py
sungho-joo/leetcode2github
ce7730ef40f6051df23681dd3c0e1e657abba620
[ "MIT" ]
null
null
null
src/leetcode_2009_minimum_number_of_operations_to_make_array_continuous.py
sungho-joo/leetcode2github
ce7730ef40f6051df23681dd3c0e1e657abba620
[ "MIT" ]
null
null
null
src/leetcode_2009_minimum_number_of_operations_to_make_array_continuous.py
sungho-joo/leetcode2github
ce7730ef40f6051df23681dd3c0e1e657abba620
[ "MIT" ]
null
null
null
# @l2g 2009 python3 # [2009] Minimum Number of Operations to Make Array Continuous # Difficulty: Hard # https://leetcode.com/problems/minimum-number-of-operations-to-make-array-continuous # # You are given an integer array nums.In one operation, # you can replace any element in nums with any integer. # nums is considered continuous if both of the following conditions are fulfilled: # # All elements in nums are unique. # The difference between the maximum element and the minimum element in nums equals nums.length - 1. # # For example, nums = [4, 2, 5, 3] is continuous, but nums = [1, 2, 3, 5, 6] is not continuous. # Return the minimum number of operations to make nums continuous. # # Example 1: # # Input: nums = [4,2,5,3] # Output: 0 # Explanation: nums is already continuous. # # Example 2: # # Input: nums = [1,2,3,5,6] # Output: 1 # Explanation: One possible solution is to change the last element to 4. # The resulting array is [1,2,3,5,4], which is continuous. # # Example 3: # # Input: nums = [1,10,100,1000] # Output: 3 # Explanation: One possible solution is to: # - Change the second element to 2. # - Change the third element to 3. # - Change the fourth element to 4. # The resulting array is [1,2,3,4], which is continuous. # # # Constraints: # # 1 <= nums.length <= 10^5 # 1 <= nums[i] <= 10^9 # # import bisect from typing import List class Solution: def minOperations(self, nums: List[int]) -> int: num_set = set(nums) sorted_key = sorted(num_set) + [float("inf")] max_occupied = -1 for i in range(len(num_set)): range_end = sorted_key[i] + len(nums) - 1 ind = bisect.bisect_left(sorted_key, range_end) if sorted_key[ind] == range_end: ind += 1 max_occupied = max(max_occupied, ind - i) if ind == len(nums): break return len(nums) - max_occupied if __name__ == "__main__": import os import pytest pytest.main([os.path.join("tests", "test_2009.py")])
27.780822
100
0.65286
import bisect from typing import List class Solution: def minOperations(self, nums: List[int]) -> int: num_set = set(nums) sorted_key = sorted(num_set) + [float("inf")] max_occupied = -1 for i in range(len(num_set)): range_end = sorted_key[i] + len(nums) - 1 ind = bisect.bisect_left(sorted_key, range_end) if sorted_key[ind] == range_end: ind += 1 max_occupied = max(max_occupied, ind - i) if ind == len(nums): break return len(nums) - max_occupied if __name__ == "__main__": import os import pytest pytest.main([os.path.join("tests", "test_2009.py")])
true
true
f7f9742f0a387bb74dbdfff0fc48a7450a5e8809
2,228
py
Python
clinicaml/pipelines/t1_freesurfer_longitudinal/t1_freesurfer_longitudinal_correction_cli.py
HorlavaNastassya/clinica
65424423e319f981f0b20ebd6bb82060aab271c2
[ "MIT" ]
null
null
null
clinicaml/pipelines/t1_freesurfer_longitudinal/t1_freesurfer_longitudinal_correction_cli.py
HorlavaNastassya/clinica
65424423e319f981f0b20ebd6bb82060aab271c2
[ "MIT" ]
null
null
null
clinicaml/pipelines/t1_freesurfer_longitudinal/t1_freesurfer_longitudinal_correction_cli.py
HorlavaNastassya/clinica
65424423e319f981f0b20ebd6bb82060aab271c2
[ "MIT" ]
null
null
null
# coding: utf8 import clinicaml.engine as ce class T1FreeSurferLongitudinalCorrectionCLI(ce.CmdParser): def define_name(self): """Define the sub-command name to run this pipeline.""" self._name = "t1-freesurfer-longitudinal-correction" def define_description(self): """Define a description of this pipeline.""" self._description = ( "Longitudinal pre-processing correction of T1w images with FreeSurfer:\n" "http://clinica.run/doc/Pipelines/T1_FreeSurfer_Longitudinal/" ) def define_options(self): from clinicaml.engine.cmdparser import PIPELINE_CATEGORIES # Clinica compulsory arguments (e.g. BIDS, CAPS, group_label) clinica_comp = self._args.add_argument_group( PIPELINE_CATEGORIES["CLINICA_COMPULSORY"] ) clinica_comp.add_argument("caps_directory", help="Path to the CAPS directory.") # Clinica standard arguments (e.g. --n_procs) self.add_clinica_standard_arguments(add_overwrite_flag=True) def run_command(self, args): """Run the pipeline with defined args.""" from networkx import Graph from clinicaml.utils.ux import print_crash_files_and_exit, print_end_pipeline from .t1_freesurfer_longitudinal_correction_pipeline import ( T1FreeSurferLongitudinalCorrection, ) pipeline = T1FreeSurferLongitudinalCorrection( caps_directory=self.absolute_path(args.caps_directory), tsv_file=self.absolute_path(args.subjects_sessions_tsv), base_dir=self.absolute_path(args.working_directory), name="t1-freesurfer-longitudinal-correction", overwrite_caps=args.overwrite_outputs, ) if args.n_procs: exec_pipeline = pipeline.run( plugin="MultiProc", plugin_args={"n_procs": args.n_procs} ) else: exec_pipeline = pipeline.run() if isinstance(exec_pipeline, Graph): print_end_pipeline( self.name, pipeline.base_dir, pipeline.base_dir_was_specified ) else: print_crash_files_and_exit(args.logname, pipeline.base_dir)
36.52459
87
0.667415
import clinicaml.engine as ce class T1FreeSurferLongitudinalCorrectionCLI(ce.CmdParser): def define_name(self): self._name = "t1-freesurfer-longitudinal-correction" def define_description(self): self._description = ( "Longitudinal pre-processing correction of T1w images with FreeSurfer:\n" "http://clinica.run/doc/Pipelines/T1_FreeSurfer_Longitudinal/" ) def define_options(self): from clinicaml.engine.cmdparser import PIPELINE_CATEGORIES clinica_comp = self._args.add_argument_group( PIPELINE_CATEGORIES["CLINICA_COMPULSORY"] ) clinica_comp.add_argument("caps_directory", help="Path to the CAPS directory.") self.add_clinica_standard_arguments(add_overwrite_flag=True) def run_command(self, args): from networkx import Graph from clinicaml.utils.ux import print_crash_files_and_exit, print_end_pipeline from .t1_freesurfer_longitudinal_correction_pipeline import ( T1FreeSurferLongitudinalCorrection, ) pipeline = T1FreeSurferLongitudinalCorrection( caps_directory=self.absolute_path(args.caps_directory), tsv_file=self.absolute_path(args.subjects_sessions_tsv), base_dir=self.absolute_path(args.working_directory), name="t1-freesurfer-longitudinal-correction", overwrite_caps=args.overwrite_outputs, ) if args.n_procs: exec_pipeline = pipeline.run( plugin="MultiProc", plugin_args={"n_procs": args.n_procs} ) else: exec_pipeline = pipeline.run() if isinstance(exec_pipeline, Graph): print_end_pipeline( self.name, pipeline.base_dir, pipeline.base_dir_was_specified ) else: print_crash_files_and_exit(args.logname, pipeline.base_dir)
true
true
f7f974932af9192b7b0309274e49c97198fbcc6c
5,138
py
Python
recipes/Python/580696_DBF_reader_writer__selective_fields/recipe-580696.py
tdiprima/code
61a74f5f93da087d27c70b2efe779ac6bd2a3b4f
[ "MIT" ]
2,023
2017-07-29T09:34:46.000Z
2022-03-24T08:00:45.000Z
recipes/Python/580696_DBF_reader_writer__selective_fields/recipe-580696.py
unhacker/code
73b09edc1b9850c557a79296655f140ce5e853db
[ "MIT" ]
32
2017-09-02T17:20:08.000Z
2022-02-11T17:49:37.000Z
recipes/Python/580696_DBF_reader_writer__selective_fields/recipe-580696.py
unhacker/code
73b09edc1b9850c557a79296655f140ce5e853db
[ "MIT" ]
780
2017-07-28T19:23:28.000Z
2022-03-25T20:39:41.000Z
import struct, datetime, decimal, itertools from collections import namedtuple FI = namedtuple('FieldInfo', ('name', 'typ', 'size', 'deci', 'fmt', 'fmtsiz', 'keep', 'seekme')) def dbfreader(f, names, nullreplace=None): """Returns an iterator over records in a Xbase DBF file. The first row returned contains the field names. The second row contains field specs: (type, size, decimal places). Subsequent rows contain the data records. If a record is marked as deleted, it is skipped. names is the field names to extract. The value of nullreplace is used with data of type 'N' as a replacement for '\0'. File should be opened for binary reads. """ # See DBF format spec at: # http://www.pgts.com.au/download/public/xbase.htm#DBF_STRUCT numrec, lenheader = struct.unpack('<xxxxLH22x', f.read(32)) numfields = (lenheader - 33) // 32 fields = [FI('DeletionFlag', 'C', 1, 0, '1s', struct.calcsize('1s'), True, 0)] # discarded in main loop for fieldno in xrange(numfields): name, typ, size, deci = struct.unpack('<11sc4xBB14x', f.read(32)) name = name.replace('\0', '') # eliminate NULs from string fmt = str(size) + 's' prev = fields[fieldno] fi = FI(name, typ, size, deci, fmt, struct.calcsize(fmt), name in names, prev.seekme + prev.size) fields.append(fi) selfields = [field for field in fields if field.keep] yield [field.name for field in selfields[1:]] yield [tuple(field[1:4]) for field in selfields[1:]] terminator = f.read(1) assert terminator == '\r' for i in xrange(numrec): refaddr = f.tell() record = [] for field in selfields: f.seek(refaddr + field.seekme) record.append(struct.unpack(field.fmt, f.read(field.fmtsiz))[0]) if record[0] != ' ': continue # deleted record result = [] for sf, value in itertools.izip(selfields, record): if sf.name == 'DeletionFlag': continue if sf.typ == "N": value = value.replace('\0', '').lstrip() if value == '': value = nullreplace elif sf.deci: value = decimal.Decimal(value) else: value = int(value) elif sf.typ == 'D': y, m, d = int(value[:4]), int(value[4:6]), int(value[6:8]) value = datetime.date(y, m, d) elif sf.typ == 'L': value = (value in 'YyTt' and 'T') or (value in 'NnFf' and 'F') or '?' elif sf.typ == 'F': value = float(value) result.append(value) f.seek(refaddr + fields[-1].seekme + fields[-1].fmtsiz) yield result def dbfwriter(f, fieldnames, fieldspecs, records, nullreplace=None): """Return a string suitable for writing directly to a binary dbf file. File f should be open for writing in a binary mode. Fieldnames should be no longer than ten characters and not include \x00. Fieldspecs are in the form (type, size, deci) where type is one of: C for ascii character data M for ascii character memo data (real memo fields not supported) D for datetime objects N for ints or decimal objects L for logical values 'T', 'F', or '?' size is the field width deci is the number of decimal places in the provided decimal object Records can be an iterable over the records (sequences of field values). The value of nullreplace is compared with values of type N and, if equal, replaced with '\0' in the output. """ # header info ver = 3 now = datetime.datetime.now() yr, mon, day = now.year-1900, now.month, now.day numrec = len(records) numfields = len(fieldspecs) lenheader = numfields * 32 + 33 lenrecord = sum(field[1] for field in fieldspecs) + 1 hdr = struct.pack('<BBBBLHH20x', ver, yr, mon, day, numrec, lenheader, lenrecord) f.write(hdr) # field specs for name, (typ, size, deci) in itertools.izip(fieldnames, fieldspecs): name = name.ljust(11, '\x00') fld = struct.pack('<11sc4xBB14x', name, typ, size, deci) f.write(fld) # terminator f.write('\r') # records for record in records: f.write(' ') # deletion flag for (typ, size, deci), value in itertools.izip(fieldspecs, record): if typ == "N": if value != nullreplace: value = str(value).rjust(size, ' ') else: value = '\0'.rjust(size, ' ') elif typ == 'D': value = value.strftime('%Y%m%d') elif typ == 'L': value = str(value)[0].upper() else: value = str(value)[:size].ljust(size, ' ') assert len(value) == size f.write(value) # End of file f.write('\x1A')
36.964029
85
0.557999
import struct, datetime, decimal, itertools from collections import namedtuple FI = namedtuple('FieldInfo', ('name', 'typ', 'size', 'deci', 'fmt', 'fmtsiz', 'keep', 'seekme')) def dbfreader(f, names, nullreplace=None): c, lenheader = struct.unpack('<xxxxLH22x', f.read(32)) numfields = (lenheader - 33) // 32 fields = [FI('DeletionFlag', 'C', 1, 0, '1s', struct.calcsize('1s'), True, 0)] for fieldno in xrange(numfields): name, typ, size, deci = struct.unpack('<11sc4xBB14x', f.read(32)) name = name.replace('\0', '') fmt = str(size) + 's' prev = fields[fieldno] fi = FI(name, typ, size, deci, fmt, struct.calcsize(fmt), name in names, prev.seekme + prev.size) fields.append(fi) selfields = [field for field in fields if field.keep] yield [field.name for field in selfields[1:]] yield [tuple(field[1:4]) for field in selfields[1:]] terminator = f.read(1) assert terminator == '\r' for i in xrange(numrec): refaddr = f.tell() record = [] for field in selfields: f.seek(refaddr + field.seekme) record.append(struct.unpack(field.fmt, f.read(field.fmtsiz))[0]) if record[0] != ' ': continue result = [] for sf, value in itertools.izip(selfields, record): if sf.name == 'DeletionFlag': continue if sf.typ == "N": value = value.replace('\0', '').lstrip() if value == '': value = nullreplace elif sf.deci: value = decimal.Decimal(value) else: value = int(value) elif sf.typ == 'D': y, m, d = int(value[:4]), int(value[4:6]), int(value[6:8]) value = datetime.date(y, m, d) elif sf.typ == 'L': value = (value in 'YyTt' and 'T') or (value in 'NnFf' and 'F') or '?' elif sf.typ == 'F': value = float(value) result.append(value) f.seek(refaddr + fields[-1].seekme + fields[-1].fmtsiz) yield result def dbfwriter(f, fieldnames, fieldspecs, records, nullreplace=None): ver = 3 now = datetime.datetime.now() yr, mon, day = now.year-1900, now.month, now.day numrec = len(records) numfields = len(fieldspecs) lenheader = numfields * 32 + 33 lenrecord = sum(field[1] for field in fieldspecs) + 1 hdr = struct.pack('<BBBBLHH20x', ver, yr, mon, day, numrec, lenheader, lenrecord) f.write(hdr) for name, (typ, size, deci) in itertools.izip(fieldnames, fieldspecs): name = name.ljust(11, '\x00') fld = struct.pack('<11sc4xBB14x', name, typ, size, deci) f.write(fld) f.write('\r') for record in records: f.write(' ') for (typ, size, deci), value in itertools.izip(fieldspecs, record): if typ == "N": if value != nullreplace: value = str(value).rjust(size, ' ') else: value = '\0'.rjust(size, ' ') elif typ == 'D': value = value.strftime('%Y%m%d') elif typ == 'L': value = str(value)[0].upper() else: value = str(value)[:size].ljust(size, ' ') assert len(value) == size f.write(value) f.write('\x1A')
true
true
f7f975abfa2c6f8e6d00282620a5619b2ea07ce0
1,100
py
Python
Fenetres_Infinies/app.py
Origin4/PythonChallenges
49f88c9e7341b9cd9ae4432ddd5117ed7d217b7e
[ "MIT" ]
6
2019-11-13T17:49:26.000Z
2021-11-15T09:44:44.000Z
Fenetres_Infinies/app.py
Origin4/PythonChallenges
49f88c9e7341b9cd9ae4432ddd5117ed7d217b7e
[ "MIT" ]
null
null
null
Fenetres_Infinies/app.py
Origin4/PythonChallenges
49f88c9e7341b9cd9ae4432ddd5117ed7d217b7e
[ "MIT" ]
7
2019-11-22T16:08:14.000Z
2021-08-24T15:02:19.000Z
from PySide2 import QtWidgets # pip install PySide2 fenetres = [] # liste qui contient toutes les fenêtres ouvertes def mettreAJourNombreFenetre(): nombreDeFenetres = len(fenetres) for fenetre in fenetres: fenetre.resultatNombreFenetre.setText(f'Nombre de fenêtres : {nombreDeFenetres}') def creerFenetre(): fenetres.append(Fenetre()) mettreAJourNombreFenetre() class Fenetre(QtWidgets.QWidget): def __init__(self): super(Fenetre, self).__init__() self.setWindowTitle('Application') self.resize(280, 50) layout = QtWidgets.QVBoxLayout(self) button = QtWidgets.QPushButton('Cliquez sur le bouton') self.resultatNombreFenetre = QtWidgets.QLineEdit('Nombre de fenêtres : 0') layout.addWidget(button) layout.addWidget(self.resultatNombreFenetre) button.clicked.connect(creerFenetre) self.show() def closeEvent(self, event): del fenetres[fenetres.index(self)] mettreAJourNombreFenetre() event.accept() app = QtWidgets.QApplication([]) creerFenetre() app.exec_()
31.428571
89
0.699091
from PySide2 import QtWidgets fenetres = [] def mettreAJourNombreFenetre(): nombreDeFenetres = len(fenetres) for fenetre in fenetres: fenetre.resultatNombreFenetre.setText(f'Nombre de fenêtres : {nombreDeFenetres}') def creerFenetre(): fenetres.append(Fenetre()) mettreAJourNombreFenetre() class Fenetre(QtWidgets.QWidget): def __init__(self): super(Fenetre, self).__init__() self.setWindowTitle('Application') self.resize(280, 50) layout = QtWidgets.QVBoxLayout(self) button = QtWidgets.QPushButton('Cliquez sur le bouton') self.resultatNombreFenetre = QtWidgets.QLineEdit('Nombre de fenêtres : 0') layout.addWidget(button) layout.addWidget(self.resultatNombreFenetre) button.clicked.connect(creerFenetre) self.show() def closeEvent(self, event): del fenetres[fenetres.index(self)] mettreAJourNombreFenetre() event.accept() app = QtWidgets.QApplication([]) creerFenetre() app.exec_()
true
true
f7f9771f579cf993bef9434348f065621ffd4f7e
2,747
py
Python
pages/process.py
rsmecking/Predicting_women_shoe_prices
41190d37c264664cbec46c64ff2df5e488c6018b
[ "MIT" ]
null
null
null
pages/process.py
rsmecking/Predicting_women_shoe_prices
41190d37c264664cbec46c64ff2df5e488c6018b
[ "MIT" ]
null
null
null
pages/process.py
rsmecking/Predicting_women_shoe_prices
41190d37c264664cbec46c64ff2df5e488c6018b
[ "MIT" ]
null
null
null
# Imports from 3rd party libraries import dash import dash_bootstrap_components as dbc import dash_core_components as dcc import dash_html_components as html from dash.dependencies import Input, Output # Imports from this application from app import app # 1 column layout # https://dash-bootstrap-components.opensource.faculty.ai/l/components/layout column1 = dbc.Col( [ dcc.Markdown( """ #### Process Much of the [data](https://www.kaggle.com/datafiniti/womens-shoes-prices#7210_1.csv) was not very usable for prediction purposes. I needed to do a lot of feature engineering to obtain any usable to get any predictability for the target, ‘price’. Nearly every feature used for the the project I extracted from the ‘name’ column because most of the descriptive words were contained within the name. Example being 4” heeled pumps. Pumps imply that there is a heel to the shoe, so I created a column ‘has_heel’ that searched for keywords like pump and heel. I originally had in the range of 500 columns but realized having that many inputs for an app would but cumbersome. ##### Target Below are all the prices (the target), of all the shoes graphed. We can see that most shoes are in the $50 range. My mean shoe price was $65 but the median was around $52. The graph in orange, is the prices logged. This allows the more extreme prices to be evenly "weighted" or more defined like it is shown in the blue graph. Logarithmic scaling shrinks or compresses the more common outcomes, while expanding the lesser. You’re not able to see prices but it allows for better representing the values, specifically when shown visually. ![](assets/Price_graphed.PNG) ![](assets/Price_y_loged.PNG) ##### Machine Learning Models I ran the data through a linear , random forest, and XGBoots regression ML pipelines. Every model was able to beat the baseline, inferring I was able to train the models correctly. Baseline Below is a graph showing a validation curve. This is used to find the best parameters to obtain a good fitting model through iderations. Linear regression is being deprecated (removed) from the process so I had it run with root mean squared error or RMSE. As shown in the graph after a certain amount of attempts it will start to level out meaning it has optimized the learning potential. ![](assets/XGB_Val_Curve.png) """ ), ], ) layout = dbc.Row([column1])
49.053571
132
0.67601
import dash import dash_bootstrap_components as dbc import dash_core_components as dcc import dash_html_components as html from dash.dependencies import Input, Output from app import app column1 = dbc.Col( [ dcc.Markdown( """ #### Process Much of the [data](https://www.kaggle.com/datafiniti/womens-shoes-prices#7210_1.csv) was not very usable for prediction purposes. I needed to do a lot of feature engineering to obtain any usable to get any predictability for the target, ‘price’. Nearly every feature used for the the project I extracted from the ‘name’ column because most of the descriptive words were contained within the name. Example being 4” heeled pumps. Pumps imply that there is a heel to the shoe, so I created a column ‘has_heel’ that searched for keywords like pump and heel. I originally had in the range of 500 columns but realized having that many inputs for an app would but cumbersome. ##### Target Below are all the prices (the target), of all the shoes graphed. We can see that most shoes are in the $50 range. My mean shoe price was $65 but the median was around $52. The graph in orange, is the prices logged. This allows the more extreme prices to be evenly "weighted" or more defined like it is shown in the blue graph. Logarithmic scaling shrinks or compresses the more common outcomes, while expanding the lesser. You’re not able to see prices but it allows for better representing the values, specifically when shown visually. ![](assets/Price_graphed.PNG) ![](assets/Price_y_loged.PNG) ##### Machine Learning Models I ran the data through a linear , random forest, and XGBoots regression ML pipelines. Every model was able to beat the baseline, inferring I was able to train the models correctly. Baseline Below is a graph showing a validation curve. This is used to find the best parameters to obtain a good fitting model through iderations. Linear regression is being deprecated (removed) from the process so I had it run with root mean squared error or RMSE. As shown in the graph after a certain amount of attempts it will start to level out meaning it has optimized the learning potential. ![](assets/XGB_Val_Curve.png) """ ), ], ) layout = dbc.Row([column1])
true
true
f7f97739bd2ab8edd48d60f1478b7773aadd9be1
9,349
py
Python
opgc/core/repository_service.py
DirtyBoyz/opgc_backend
3fc7160d9d637378a358d4fc161fae495a18f0bd
[ "MIT" ]
9
2020-08-19T02:49:03.000Z
2022-03-04T10:50:18.000Z
opgc/core/repository_service.py
DirtyBoyz/opgc_backend
3fc7160d9d637378a358d4fc161fae495a18f0bd
[ "MIT" ]
7
2021-07-20T15:13:07.000Z
2022-03-08T13:14:43.000Z
opgc/core/repository_service.py
DirtyBoyz/opgc_backend
3fc7160d9d637378a358d4fc161fae495a18f0bd
[ "MIT" ]
2
2021-08-13T08:05:34.000Z
2022-02-28T05:51:06.000Z
import asyncio import json from typing import Optional import aiohttp import requests from django.conf import settings from apps.githubs.models import GithubUser, Repository, Language, UserLanguage from core.github_dto import RepositoryDto from utils.exceptions import manage_api_call_fail, REASON_FORBIDDEN PER_PAGE = 50 class RepositoryService: def __init__(self, github_user: GithubUser): self.github_user = github_user self.total_contribution = 0 self.total_stargazers_count = 0 self.repositories = [] # 업데이트할 레포지토리 리스트 self.new_repository_list = [] # 새로 생성될 레포지토리 리스트 self.update_language_dict = {} # 업데이트할 language @staticmethod def create_dto(repository_data: dict) -> RepositoryDto: return RepositoryDto(**repository_data) def update_repositories(self) -> bool: """ 레포지토리 업데이트 함수 """ # 유저의 현재 모든 repository를 가져온다. user_repositories = list(Repository.objects.filter(github_user=self.github_user)) # loop = asyncio.get_event_loop() loop = asyncio.new_event_loop() asyncio.set_event_loop(loop) loop.run_until_complete(self.update_repository_futures(self.repositories, user_repositories)) if self.new_repository_list: Repository.objects.bulk_create(self.new_repository_list) # 남아 있는 user_repository는 삭제된 repository라 DB에서도 삭제 해준다. repo_ids = [] for repo in user_repositories: repo_ids.append(repo.id) if repo_ids: Repository.objects.filter(id__in=repo_ids).delete() return True def create_repository(self, repository: RepositoryDto) -> (int, Optional[Repository]): contribution = 0 languages = '' is_contributor = False new_repository = None if repository.fork is True: return 0, None # User 가 Repository 의 contributor 인지 확인한다. # contributions 와 language 확인을 위해 아래 로직을 타야함 # Too many Contributor 403 오류인 경우만 어쩔수 없이 contributions 확인 불가 params = {'per_page': PER_PAGE, 'page': 1} for i in range(0, (self.github_user.public_repos // PER_PAGE) + 1): params['page'] = i + 1 res = requests.get(repository.contributors_url, headers=settings.GITHUB_API_HEADER) if res.status_code != 200: fail_type = manage_api_call_fail(self.github_user, res.status_code) if fail_type == REASON_FORBIDDEN: break else: try: contributors = json.loads(res.content) except json.JSONDecodeError: return contribution, new_repository for contributor in contributors: # User 타입이고 contributor 가 본인인 경우 (깃헙에서 대소문자 구분을 하지않아서 lower 처리후 비교) if contributor.get('type') == 'User' and \ contributor.get('login').lower() == self.github_user.username.lower(): contribution = contributor.get('contributions', 0) if contribution > 0: languages = self.record_language(repository.languages_url) is_contributor = True break if is_contributor: break if is_contributor or repository.owner.lower() == self.github_user.username.lower(): # contributor 이거나 owner 인 경우 new_repository = Repository( github_user=self.github_user, name=repository.name, full_name=repository.full_name, owner=repository.owner, contribution=contribution, stargazers_count=repository.stargazers_count, rep_language=repository.language if repository.language else '', languages=languages ) self.total_stargazers_count += repository.stargazers_count return contribution, new_repository def record_language(self, languages_url: str) -> str: """ repository 에서 사용중인 언어를 찾아서 dictionary에 type과 count를 저장 - count : 해당 언어로 작성된 코드의 바이트 수. """ res = requests.get(languages_url, headers=settings.GITHUB_API_HEADER) if res.status_code != 200: manage_api_call_fail(self.github_user, res.status_code) try: languages_data = json.loads(res.content) except json.JSONDecodeError: return '' if languages_data: for _type, count in languages_data.items(): if not self.update_language_dict.get(_type): self.update_language_dict[_type] = count else: self.update_language_dict[_type] += count return json.dumps(list(languages_data.keys())) return '' def update_or_create_language(self): """ 새로 추가된 언어를 만들고 User가 사용하는 언어사용 count(byte 수)를 업데이트 해주는 함수 """ # DB에 없던 Language 생성 new_language_list = [] exists_languages = set(Language.objects.filter( type__in=self.update_language_dict.keys()).values_list('type', flat=True) ) new_languages = set(self.update_language_dict.keys()) - exists_languages for language in new_languages: new_language_list.append(Language(type=language)) if new_language_list: Language.objects.bulk_create(new_language_list) # 가존에 있던 UserLanguage 업데이트 new_user_languages = [] user_language_qs = UserLanguage.objects.prefetch_related('language').filter( github_user_id=self.github_user.id, language__type__in=self.update_language_dict.keys() ) for user_language in user_language_qs: if user_language.language.type in self.update_language_dict.keys(): count = self.update_language_dict.pop(user_language.language.type) if user_language.number != count: user_language.number = count user_language.save(update_fields=['number']) # 새로운 UserLanguage 생성 languages = Language.objects.filter(type__in=self.update_language_dict.keys()) for language in languages: new_user_languages.append( UserLanguage( github_user_id=self.github_user.id, language_id=language.id, number=self.update_language_dict.pop(language.type) ) ) if new_user_languages: UserLanguage.objects.bulk_create(new_user_languages) async def update_repository(self, repository: RepositoryDto, user_repositories: list): # 코루틴 정의 is_exist_repo = False for idx, user_repo in enumerate(user_repositories): if user_repo.full_name == repository.full_name and user_repo.owner == repository.owner: is_exist_repo = True user_repositories.pop(idx) update_fields = [] contribution = 0 # User가 Repository의 contributor 인지 확인한다. async with aiohttp.ClientSession() as session: async with session.get(repository.contributors_url, headers=settings.GITHUB_API_HEADER) as res: response_data = await res.text() response_status = res.status if response_status == 200: for contributor in json.loads(response_data): # User 타입이고 contributor 가 본인인 경우 (깃헙에서 대소문자 구분을 하지않아서 lower 처리후 비교) if contributor.get('type') == 'User' and \ contributor.get('login').lower() == self.github_user.username.lower(): contribution = contributor.get('contributions') # languages number update self.record_language(repository.languages_url) # repository update if user_repo.contribution != contribution: user_repo.contribution = contribution update_fields.append('contribution') # repository update if user_repo.stargazers_count != repository.stargazers_count: user_repo.stargazers_count = repository.stargazers_count update_fields.append('stargazers_count') if update_fields: user_repo.save(update_fields=update_fields) self.total_stargazers_count += repository.stargazers_count self.total_contribution += contribution break # 새로운 레포지토리 if not is_exist_repo: _contribution, new_repository = self.create_repository(repository) if new_repository: self.new_repository_list.append(new_repository) self.total_contribution += _contribution async def update_repository_futures(self, repositories, user_repositories: list): futures = [ asyncio.ensure_future(self.update_repository(repository, user_repositories)) for repository in repositories ] await asyncio.gather(*futures)
38.473251
119
0.6083
import asyncio import json from typing import Optional import aiohttp import requests from django.conf import settings from apps.githubs.models import GithubUser, Repository, Language, UserLanguage from core.github_dto import RepositoryDto from utils.exceptions import manage_api_call_fail, REASON_FORBIDDEN PER_PAGE = 50 class RepositoryService: def __init__(self, github_user: GithubUser): self.github_user = github_user self.total_contribution = 0 self.total_stargazers_count = 0 self.repositories = [] self.new_repository_list = [] self.update_language_dict = {} @staticmethod def create_dto(repository_data: dict) -> RepositoryDto: return RepositoryDto(**repository_data) def update_repositories(self) -> bool: user_repositories = list(Repository.objects.filter(github_user=self.github_user)) loop = asyncio.new_event_loop() asyncio.set_event_loop(loop) loop.run_until_complete(self.update_repository_futures(self.repositories, user_repositories)) if self.new_repository_list: Repository.objects.bulk_create(self.new_repository_list) repo_ids = [] for repo in user_repositories: repo_ids.append(repo.id) if repo_ids: Repository.objects.filter(id__in=repo_ids).delete() return True def create_repository(self, repository: RepositoryDto) -> (int, Optional[Repository]): contribution = 0 languages = '' is_contributor = False new_repository = None if repository.fork is True: return 0, None params = {'per_page': PER_PAGE, 'page': 1} for i in range(0, (self.github_user.public_repos // PER_PAGE) + 1): params['page'] = i + 1 res = requests.get(repository.contributors_url, headers=settings.GITHUB_API_HEADER) if res.status_code != 200: fail_type = manage_api_call_fail(self.github_user, res.status_code) if fail_type == REASON_FORBIDDEN: break else: try: contributors = json.loads(res.content) except json.JSONDecodeError: return contribution, new_repository for contributor in contributors: if contributor.get('type') == 'User' and \ contributor.get('login').lower() == self.github_user.username.lower(): contribution = contributor.get('contributions', 0) if contribution > 0: languages = self.record_language(repository.languages_url) is_contributor = True break if is_contributor: break if is_contributor or repository.owner.lower() == self.github_user.username.lower(): new_repository = Repository( github_user=self.github_user, name=repository.name, full_name=repository.full_name, owner=repository.owner, contribution=contribution, stargazers_count=repository.stargazers_count, rep_language=repository.language if repository.language else '', languages=languages ) self.total_stargazers_count += repository.stargazers_count return contribution, new_repository def record_language(self, languages_url: str) -> str: res = requests.get(languages_url, headers=settings.GITHUB_API_HEADER) if res.status_code != 200: manage_api_call_fail(self.github_user, res.status_code) try: languages_data = json.loads(res.content) except json.JSONDecodeError: return '' if languages_data: for _type, count in languages_data.items(): if not self.update_language_dict.get(_type): self.update_language_dict[_type] = count else: self.update_language_dict[_type] += count return json.dumps(list(languages_data.keys())) return '' def update_or_create_language(self): new_language_list = [] exists_languages = set(Language.objects.filter( type__in=self.update_language_dict.keys()).values_list('type', flat=True) ) new_languages = set(self.update_language_dict.keys()) - exists_languages for language in new_languages: new_language_list.append(Language(type=language)) if new_language_list: Language.objects.bulk_create(new_language_list) new_user_languages = [] user_language_qs = UserLanguage.objects.prefetch_related('language').filter( github_user_id=self.github_user.id, language__type__in=self.update_language_dict.keys() ) for user_language in user_language_qs: if user_language.language.type in self.update_language_dict.keys(): count = self.update_language_dict.pop(user_language.language.type) if user_language.number != count: user_language.number = count user_language.save(update_fields=['number']) languages = Language.objects.filter(type__in=self.update_language_dict.keys()) for language in languages: new_user_languages.append( UserLanguage( github_user_id=self.github_user.id, language_id=language.id, number=self.update_language_dict.pop(language.type) ) ) if new_user_languages: UserLanguage.objects.bulk_create(new_user_languages) async def update_repository(self, repository: RepositoryDto, user_repositories: list): is_exist_repo = False for idx, user_repo in enumerate(user_repositories): if user_repo.full_name == repository.full_name and user_repo.owner == repository.owner: is_exist_repo = True user_repositories.pop(idx) update_fields = [] contribution = 0 async with aiohttp.ClientSession() as session: async with session.get(repository.contributors_url, headers=settings.GITHUB_API_HEADER) as res: response_data = await res.text() response_status = res.status if response_status == 200: for contributor in json.loads(response_data): if contributor.get('type') == 'User' and \ contributor.get('login').lower() == self.github_user.username.lower(): contribution = contributor.get('contributions') self.record_language(repository.languages_url) if user_repo.contribution != contribution: user_repo.contribution = contribution update_fields.append('contribution') if user_repo.stargazers_count != repository.stargazers_count: user_repo.stargazers_count = repository.stargazers_count update_fields.append('stargazers_count') if update_fields: user_repo.save(update_fields=update_fields) self.total_stargazers_count += repository.stargazers_count self.total_contribution += contribution break if not is_exist_repo: _contribution, new_repository = self.create_repository(repository) if new_repository: self.new_repository_list.append(new_repository) self.total_contribution += _contribution async def update_repository_futures(self, repositories, user_repositories: list): futures = [ asyncio.ensure_future(self.update_repository(repository, user_repositories)) for repository in repositories ] await asyncio.gather(*futures)
true
true
f7f9795116bbb7e1b5db590159da85ef14de3507
11,880
py
Python
mapping.py
adamkoziol/mixedReferenceMapping
5c3d04172a85246f237d59cec498b51ca11f196a
[ "MIT" ]
null
null
null
mapping.py
adamkoziol/mixedReferenceMapping
5c3d04172a85246f237d59cec498b51ca11f196a
[ "MIT" ]
null
null
null
mapping.py
adamkoziol/mixedReferenceMapping
5c3d04172a85246f237d59cec498b51ca11f196a
[ "MIT" ]
null
null
null
#!/usr/bin/env python from threading import Thread from Bio.Sequencing.Applications import * import SPAdesPipeline.OLCspades.metadataprinter as metadataprinter from SPAdesPipeline.OLCspades.bowtie import * from geneSipprV2.objectOriented.createObject import * try: from cStringIO import StringIO except ImportError: from StringIO import StringIO __author__ = 'adamkoziol' class Mapper(object): def mapping(self): # Create the object printtime('Moving files and creating objects', self.starttime) self.runmetadata = ObjectCreation(self) metadataprinter.MetadataPrinter(self) printtime('Performing reference mapping', self.starttime) for i in range(len(self.runmetadata.samples)): # Send the threads to threads = Thread(target=self.map, args=()) # Set the daemon to True - something to do with thread management threads.setDaemon(True) # Start the threading threads.start() # In order to keep from running too many cpu intensive processes concurrently (multi-threaded applications # being run in a multi-threaded fashion), decrease the number of threads used in the applications to a minimum # of four depending on how many samples are being processed numthreads = self.cpus / len(self.runmetadata.samples) numthreads = numthreads if numthreads >= 4 else 4 for sample in self.runmetadata.samples: # Create the analysis type attribute setattr(sample, self.analysistype, GenObject()) # Set the path/name for the bam and sorted bam files to be created sample[self.analysistype].bam = '{}/{}.bam'.format(sample.general.outputdirectory, sample.name) sample[self.analysistype].sortedbam = '{}/{}_sorted.bam'.format(sample.general.outputdirectory, sample.name) # Set the output name depending on whether the bam files are to be sorted or not output = sample[self.analysistype].bam if not self.sort else sample[self.analysistype].sortedbam # Remove the file extension of the bait file for use in the indexing command sample[self.analysistype].referencenoext = self.referencefile.split('.')[0] # Use bowtie2 wrapper to create index the target file bowtie2build = Bowtie2BuildCommandLine(reference=self.referencefile, bt2=sample[self.analysistype].referencenoext) # If the indexing option is specified, include the sort command samsort = SamtoolsSortCommandline(input_bam=output, o=True, out_prefix="-") # Create a list of programs to which data are piped as part of the reference mapping samtools = [ # Use samtools wrapper to set up the samtools view SamtoolsViewCommandline(b=True, S=True, input_file="-") ] if self.sort: samtools.append(samsort) # Add custom parameters to a dictionary to be used in the bowtie2 alignment wrapper if len(sample.general.trimmedcorrectedfastqfiles) == 1: indict = {'-U': sample.general.trimmedcorrectedfastqfiles[0], '--threads': numthreads } else: indict = {'m1': sample.general.trimmedcorrectedfastqfiles[0], 'm2': sample.general.trimmedcorrectedfastqfiles[1], '--threads': numthreads } # Create the bowtie2 reference mapping command bowtie2align = Bowtie2CommandLine(bt2=sample[self.analysistype].referencenoext, threads=numthreads, samtools=samtools, **indict) # Add the commands (as strings) to the metadata sample[self.analysistype].bowtie2align = str(bowtie2align) sample[self.analysistype].bowtie2build = str(bowtie2build) # Get variables ready for the bam moving step sample[self.analysistype].bampath = os.path.join(self.path, 'bamfiles') sample[self.analysistype].bamcollection = \ '{}/{}'.format(sample[self.analysistype].bampath, os.path.basename(sample[self.analysistype].bam)) # Add the commands to the queue. Note that the commands would usually be set as attributes of the sample # but there was an issue with their serialization when printing out the metadata if not os.path.isfile(sample[self.analysistype].referencenoext + '.1.bt2'): stdoutbowtieindex, stderrbowtieindex = map(StringIO, bowtie2build(cwd=self.referencepath)) # Write any error to a log file if stderrbowtieindex: # Write the standard error to log, bowtie2 puts alignment summary here with open(os.path.join(self.referencepath, '{}_bowtie_index.log'.format(self.analysistype)), 'ab+') as log: log.writelines(logstr(bowtie2build, stderrbowtieindex.getvalue(), stdoutbowtieindex.getvalue())) # Close the stdout and stderr streams stdoutbowtieindex.close() stderrbowtieindex.close() # Populate the queue self.mapqueue.put((sample, bowtie2build, bowtie2align, output)) self.mapqueue.join() metadataprinter.MetadataPrinter(self) def map(self): import shutil while True: # Get the necessary values from the queue sample, bowtie2build, bowtie2align, output = self.mapqueue.get() # Only run the functions if the sorted bam files and the indexed bait file do not exist if not os.path.isfile(output) and not os.path. \ isfile(sample[self.analysistype].bamcollection): # Set stdout to a stringIO stream stdout, stderr = map(StringIO, bowtie2align(cwd=sample.general.outputdirectory)) if stderr: # Write the standard error to log, bowtie2 puts alignment summary here with open(os.path.join(sample.general.outputdirectory, '{}_bowtie_samtools.log'.format(self.analysistype)), 'ab+') as log: log.writelines(logstr(bowtie2align, stderr.getvalue(), stdout.getvalue())) stdout.close() stderr.close() if self.sort: # Perform indexing # Only index if the index file doesn't exist if not os.path.isfile(output + '.bai'): samtoolsindex = SamtoolsIndexCommandline(input=output) # Set stdout to a stringIO stream stdout, stderr = map(StringIO, samtoolsindex(cwd=sample.general.outputdirectory)) if stderr: # Write the standard error to log, bowtie2 puts alignment summary here with open(os.path.join(sample.general.outputdirectory, '{}_bowtie_index.log'.format(self.analysistype)), 'ab+') as log: log.writelines(logstr(samtoolsindex, stderr.getvalue(), stdout.getvalue())) stdout.close() stderr.close() else: make_path(sample[self.analysistype].bampath) # Move the bam file to a common location if not os.path.isfile(sample[self.analysistype].bamcollection): shutil.move(sample[self.analysistype].bam, sample[self.analysistype].bamcollection) self.mapqueue.task_done() def __init__(self, args, pipelinecommit, startingtime, scriptpath): from Queue import Queue import multiprocessing from glob import glob # Initialise variables self.commit = str(pipelinecommit) self.starttime = startingtime self.homepath = scriptpath # Define variables based on supplied arguments self.args = args self.path = os.path.join(args.path, '') assert os.path.isdir(self.path), u'Supplied path is not a valid directory {0!r:s}'.format(self.path) self.sequencepath = os.path.join(args.sequencepath, '') assert os.path.isdir(self.sequencepath), u'Sequence folder is not a valid directory {0!r:s}' \ .format(self.sequencepath) self.referencepath = os.path.join(args.referencepath, '') assert os.path.isdir(self.sequencepath), u'Reference folder is not a valid directory {0!r:s}' \ .format(self.referencepath) try: self.referencefile = glob('{}*.fa*'.format(self.referencepath))[0] except IndexError: print 'Cannot find a .fa/.fas/.fasta reference file in the supplied reference path: {}' \ .format(self.referencepath) quit() # Use the argument for the number of threads to use, or default to the number of cpus in the system self.cpus = int(args.threads if args.threads else multiprocessing.cpu_count()) # Determine whether BAM files need to be sorted and indexed self.sort = args.index self.runmetadata = MetadataObject() self.mapqueue = Queue(maxsize=self.cpus) self.analysistype = 'referencemapping' # Run the analyses self.mapping() if __name__ == '__main__': import subprocess import time import os # Argument parser for user-inputted values, and a nifty help menu from argparse import ArgumentParser # Get the current commit of the pipeline from git # Extract the path of the current script from the full path + file name homepath = os.path.split(os.path.abspath(__file__))[0] # Find the commit of the script by running a command to change to the directory containing the script and run # a git command to return the short version of the commit hash commit = subprocess.Popen('cd {} && git rev-parse --short HEAD'.format(homepath), shell=True, stdout=subprocess.PIPE).communicate()[0].rstrip() # Parser for arguments parser = ArgumentParser(description='Perform modelling of parameters for GeneSipping') parser.add_argument('path', help='Specify input directory') parser.add_argument('-s', '--sequencepath', required=True, help='Path of .fastq(.gz) files to process.') parser.add_argument('-r', '--referencepath', required=True, help='Path to folder containing a single fasta file to be used as the reference genome') parser.add_argument('-t', '--threads', help='Number of threads. Default is the number of cores in the system') parser.add_argument('-i', '--index', action='store_true', help='Sort and index the bam files') # Get the arguments into an object arguments = parser.parse_args() # Define the start time start = time.time() # Run the script Mapper(arguments, commit, start, homepath) # Print a bold, green exit statement print '\033[92m' + '\033[1m' + "\nElapsed Time: %0.2f seconds" % (time.time() - start) + '\033[0m'
55.255814
120
0.599074
from threading import Thread from Bio.Sequencing.Applications import * import SPAdesPipeline.OLCspades.metadataprinter as metadataprinter from SPAdesPipeline.OLCspades.bowtie import * from geneSipprV2.objectOriented.createObject import * try: from cStringIO import StringIO except ImportError: from StringIO import StringIO __author__ = 'adamkoziol' class Mapper(object): def mapping(self): printtime('Moving files and creating objects', self.starttime) self.runmetadata = ObjectCreation(self) metadataprinter.MetadataPrinter(self) printtime('Performing reference mapping', self.starttime) for i in range(len(self.runmetadata.samples)): threads = Thread(target=self.map, args=()) threads.setDaemon(True) threads.start() numthreads = self.cpus / len(self.runmetadata.samples) numthreads = numthreads if numthreads >= 4 else 4 for sample in self.runmetadata.samples: setattr(sample, self.analysistype, GenObject()) sample[self.analysistype].bam = '{}/{}.bam'.format(sample.general.outputdirectory, sample.name) sample[self.analysistype].sortedbam = '{}/{}_sorted.bam'.format(sample.general.outputdirectory, sample.name) output = sample[self.analysistype].bam if not self.sort else sample[self.analysistype].sortedbam sample[self.analysistype].referencenoext = self.referencefile.split('.')[0] bowtie2build = Bowtie2BuildCommandLine(reference=self.referencefile, bt2=sample[self.analysistype].referencenoext) samsort = SamtoolsSortCommandline(input_bam=output, o=True, out_prefix="-") samtools = [ SamtoolsViewCommandline(b=True, S=True, input_file="-") ] if self.sort: samtools.append(samsort) if len(sample.general.trimmedcorrectedfastqfiles) == 1: indict = {'-U': sample.general.trimmedcorrectedfastqfiles[0], '--threads': numthreads } else: indict = {'m1': sample.general.trimmedcorrectedfastqfiles[0], 'm2': sample.general.trimmedcorrectedfastqfiles[1], '--threads': numthreads } bowtie2align = Bowtie2CommandLine(bt2=sample[self.analysistype].referencenoext, threads=numthreads, samtools=samtools, **indict) sample[self.analysistype].bowtie2align = str(bowtie2align) sample[self.analysistype].bowtie2build = str(bowtie2build) sample[self.analysistype].bampath = os.path.join(self.path, 'bamfiles') sample[self.analysistype].bamcollection = \ '{}/{}'.format(sample[self.analysistype].bampath, os.path.basename(sample[self.analysistype].bam)) if not os.path.isfile(sample[self.analysistype].referencenoext + '.1.bt2'): stdoutbowtieindex, stderrbowtieindex = map(StringIO, bowtie2build(cwd=self.referencepath)) if stderrbowtieindex: with open(os.path.join(self.referencepath, '{}_bowtie_index.log'.format(self.analysistype)), 'ab+') as log: log.writelines(logstr(bowtie2build, stderrbowtieindex.getvalue(), stdoutbowtieindex.getvalue())) stdoutbowtieindex.close() stderrbowtieindex.close() self.mapqueue.put((sample, bowtie2build, bowtie2align, output)) self.mapqueue.join() metadataprinter.MetadataPrinter(self) def map(self): import shutil while True: sample, bowtie2build, bowtie2align, output = self.mapqueue.get() if not os.path.isfile(output) and not os.path. \ isfile(sample[self.analysistype].bamcollection): stdout, stderr = map(StringIO, bowtie2align(cwd=sample.general.outputdirectory)) if stderr: with open(os.path.join(sample.general.outputdirectory, '{}_bowtie_samtools.log'.format(self.analysistype)), 'ab+') as log: log.writelines(logstr(bowtie2align, stderr.getvalue(), stdout.getvalue())) stdout.close() stderr.close() if self.sort: if not os.path.isfile(output + '.bai'): samtoolsindex = SamtoolsIndexCommandline(input=output) # Set stdout to a stringIO stream stdout, stderr = map(StringIO, samtoolsindex(cwd=sample.general.outputdirectory)) if stderr: # Write the standard error to log, bowtie2 puts alignment summary here with open(os.path.join(sample.general.outputdirectory, '{}_bowtie_index.log'.format(self.analysistype)), 'ab+') as log: log.writelines(logstr(samtoolsindex, stderr.getvalue(), stdout.getvalue())) stdout.close() stderr.close() else: make_path(sample[self.analysistype].bampath) # Move the bam file to a common location if not os.path.isfile(sample[self.analysistype].bamcollection): shutil.move(sample[self.analysistype].bam, sample[self.analysistype].bamcollection) self.mapqueue.task_done() def __init__(self, args, pipelinecommit, startingtime, scriptpath): from Queue import Queue import multiprocessing from glob import glob # Initialise variables self.commit = str(pipelinecommit) self.starttime = startingtime self.homepath = scriptpath # Define variables based on supplied arguments self.args = args self.path = os.path.join(args.path, '') assert os.path.isdir(self.path), u'Supplied path is not a valid directory {0!r:s}'.format(self.path) self.sequencepath = os.path.join(args.sequencepath, '') assert os.path.isdir(self.sequencepath), u'Sequence folder is not a valid directory {0!r:s}' \ .format(self.sequencepath) self.referencepath = os.path.join(args.referencepath, '') assert os.path.isdir(self.sequencepath), u'Reference folder is not a valid directory {0!r:s}' \ .format(self.referencepath) try: self.referencefile = glob('{}*.fa*'.format(self.referencepath))[0] except IndexError: print 'Cannot find a .fa/.fas/.fasta reference file in the supplied reference path: {}' \ .format(self.referencepath) quit() # Use the argument for the number of threads to use, or default to the number of cpus in the system self.cpus = int(args.threads if args.threads else multiprocessing.cpu_count()) # Determine whether BAM files need to be sorted and indexed self.sort = args.index self.runmetadata = MetadataObject() self.mapqueue = Queue(maxsize=self.cpus) self.analysistype = 'referencemapping' # Run the analyses self.mapping() if __name__ == '__main__': import subprocess import time import os # Argument parser for user-inputted values, and a nifty help menu from argparse import ArgumentParser # Get the current commit of the pipeline from git # Extract the path of the current script from the full path + file name homepath = os.path.split(os.path.abspath(__file__))[0] # Find the commit of the script by running a command to change to the directory containing the script and run # a git command to return the short version of the commit hash commit = subprocess.Popen('cd {} && git rev-parse --short HEAD'.format(homepath), shell=True, stdout=subprocess.PIPE).communicate()[0].rstrip() # Parser for arguments parser = ArgumentParser(description='Perform modelling of parameters for GeneSipping') parser.add_argument('path', help='Specify input directory') parser.add_argument('-s', '--sequencepath', required=True, help='Path of .fastq(.gz) files to process.') parser.add_argument('-r', '--referencepath', required=True, help='Path to folder containing a single fasta file to be used as the reference genome') parser.add_argument('-t', '--threads', help='Number of threads. Default is the number of cores in the system') parser.add_argument('-i', '--index', action='store_true', help='Sort and index the bam files') # Get the arguments into an object arguments = parser.parse_args() # Define the start time start = time.time() # Run the script Mapper(arguments, commit, start, homepath) # Print a bold, green exit statement print '\033[92m' + '\033[1m' + "\nElapsed Time: %0.2f seconds" % (time.time() - start) + '\033[0m'
false
true
f7f979a5902f70cdcbf2377197c39d30c8952c5d
3,968
py
Python
src/lib/detectors/ddd.py
tanaydw/CenterNet
91c2ccd2c8a063db8c8ec101adfd4c6830cd47eb
[ "MIT" ]
null
null
null
src/lib/detectors/ddd.py
tanaydw/CenterNet
91c2ccd2c8a063db8c8ec101adfd4c6830cd47eb
[ "MIT" ]
null
null
null
src/lib/detectors/ddd.py
tanaydw/CenterNet
91c2ccd2c8a063db8c8ec101adfd4c6830cd47eb
[ "MIT" ]
null
null
null
from __future__ import absolute_import from __future__ import division from __future__ import print_function import cv2 import numpy as np from progress.bar import Bar import time import torch from models.decode import ddd_decode from models.utils import flip_tensor from utils.image import get_affine_transform from utils.post_process import ddd_post_process from utils.debugger import Debugger from utils.ddd_utils import compute_box_3d, project_to_image, alpha2rot_y from utils.ddd_utils import draw_box_3d, unproject_2d_to_3d from .base_detector import BaseDetector class DddDetector(BaseDetector): def __init__(self, opt): super(DddDetector, self).__init__(opt) self.calib = np.array([[707.0493, 0, 604.0814, 45.75831], [0, 707.0493, 180.5066, -0.3454157], [0, 0, 1., 0.004981016]], dtype=np.float32) def pre_process(self, image, scale, calib=None): height, width = image.shape[0:2] inp_height, inp_width = self.opt.input_h, self.opt.input_w c = np.array([width / 2, height / 2], dtype=np.float32) if self.opt.keep_res: s = np.array([inp_width, inp_height], dtype=np.int32) else: s = np.array([width, height], dtype=np.int32) trans_input = get_affine_transform(c, s, 0, [inp_width, inp_height]) resized_image = image #cv2.resize(image, (width, height)) inp_image = cv2.warpAffine( resized_image, trans_input, (inp_width, inp_height), flags=cv2.INTER_LINEAR) inp_image = (inp_image.astype(np.float32) / 255.) inp_image = (inp_image - self.mean) / self.std images = inp_image.transpose(2, 0, 1)[np.newaxis, ...] calib = np.array(calib, dtype=np.float32) if calib is not None \ else self.calib images = torch.from_numpy(images) meta = {'c': c, 's': s, 'out_height': inp_height // self.opt.down_ratio, 'out_width': inp_width // self.opt.down_ratio, 'calib': calib} return images, meta def process(self, images, return_time=False): with torch.no_grad(): torch.cuda.synchronize() output = self.model(images)[-1] output['hm'] = output['hm'].sigmoid_() output['dep'] = 1. / (output['dep'].sigmoid() + 1e-6) - 1. wh = output['wh'] if self.opt.reg_bbox else None reg = output['reg'] if self.opt.reg_offset else None torch.cuda.synchronize() forward_time = time.time() dets = ddd_decode(output['hm'], output['rot'], output['dep'], output['dim'], wh=wh, reg=reg, K=self.opt.K) if return_time: return output, dets, forward_time else: return output, dets def post_process(self, dets, meta, scale=1): dets = dets.detach().cpu().numpy() detections = ddd_post_process( dets.copy(), [meta['c']], [meta['s']], [meta['calib']], self.opt) self.this_calib = meta['calib'] return detections[0] def merge_outputs(self, detections): results = detections[0] for j in range(1, self.num_classes + 1): if len(results[j] > 0): keep_inds = (results[j][:, -1] > self.opt.peak_thresh) results[j] = results[j][keep_inds] return results def debug(self, debugger, images, dets, output, scale=1): dets = dets.detach().cpu().numpy() img = images[0].detach().cpu().numpy().transpose(1, 2, 0) img = ((img * self.std + self.mean) * 255).astype(np.uint8) pred = debugger.gen_colormap(output['hm'][0].detach().cpu().numpy()) debugger.add_blend_img(img, pred, 'pred_hm') debugger.add_ct_detection( img, dets[0], show_box=self.opt.reg_bbox, center_thresh=self.opt.vis_thresh, img_id='det_pred') def show_results(self, debugger, image, results): debugger.add_3d_detection( image, results, self.this_calib, center_thresh=self.opt.vis_thresh, img_id='add_pred') debugger.add_bird_view( results, center_thresh=self.opt.vis_thresh, img_id='bird_pred')
37.790476
73
0.657258
from __future__ import absolute_import from __future__ import division from __future__ import print_function import cv2 import numpy as np from progress.bar import Bar import time import torch from models.decode import ddd_decode from models.utils import flip_tensor from utils.image import get_affine_transform from utils.post_process import ddd_post_process from utils.debugger import Debugger from utils.ddd_utils import compute_box_3d, project_to_image, alpha2rot_y from utils.ddd_utils import draw_box_3d, unproject_2d_to_3d from .base_detector import BaseDetector class DddDetector(BaseDetector): def __init__(self, opt): super(DddDetector, self).__init__(opt) self.calib = np.array([[707.0493, 0, 604.0814, 45.75831], [0, 707.0493, 180.5066, -0.3454157], [0, 0, 1., 0.004981016]], dtype=np.float32) def pre_process(self, image, scale, calib=None): height, width = image.shape[0:2] inp_height, inp_width = self.opt.input_h, self.opt.input_w c = np.array([width / 2, height / 2], dtype=np.float32) if self.opt.keep_res: s = np.array([inp_width, inp_height], dtype=np.int32) else: s = np.array([width, height], dtype=np.int32) trans_input = get_affine_transform(c, s, 0, [inp_width, inp_height]) resized_image = image inp_image = cv2.warpAffine( resized_image, trans_input, (inp_width, inp_height), flags=cv2.INTER_LINEAR) inp_image = (inp_image.astype(np.float32) / 255.) inp_image = (inp_image - self.mean) / self.std images = inp_image.transpose(2, 0, 1)[np.newaxis, ...] calib = np.array(calib, dtype=np.float32) if calib is not None \ else self.calib images = torch.from_numpy(images) meta = {'c': c, 's': s, 'out_height': inp_height // self.opt.down_ratio, 'out_width': inp_width // self.opt.down_ratio, 'calib': calib} return images, meta def process(self, images, return_time=False): with torch.no_grad(): torch.cuda.synchronize() output = self.model(images)[-1] output['hm'] = output['hm'].sigmoid_() output['dep'] = 1. / (output['dep'].sigmoid() + 1e-6) - 1. wh = output['wh'] if self.opt.reg_bbox else None reg = output['reg'] if self.opt.reg_offset else None torch.cuda.synchronize() forward_time = time.time() dets = ddd_decode(output['hm'], output['rot'], output['dep'], output['dim'], wh=wh, reg=reg, K=self.opt.K) if return_time: return output, dets, forward_time else: return output, dets def post_process(self, dets, meta, scale=1): dets = dets.detach().cpu().numpy() detections = ddd_post_process( dets.copy(), [meta['c']], [meta['s']], [meta['calib']], self.opt) self.this_calib = meta['calib'] return detections[0] def merge_outputs(self, detections): results = detections[0] for j in range(1, self.num_classes + 1): if len(results[j] > 0): keep_inds = (results[j][:, -1] > self.opt.peak_thresh) results[j] = results[j][keep_inds] return results def debug(self, debugger, images, dets, output, scale=1): dets = dets.detach().cpu().numpy() img = images[0].detach().cpu().numpy().transpose(1, 2, 0) img = ((img * self.std + self.mean) * 255).astype(np.uint8) pred = debugger.gen_colormap(output['hm'][0].detach().cpu().numpy()) debugger.add_blend_img(img, pred, 'pred_hm') debugger.add_ct_detection( img, dets[0], show_box=self.opt.reg_bbox, center_thresh=self.opt.vis_thresh, img_id='det_pred') def show_results(self, debugger, image, results): debugger.add_3d_detection( image, results, self.this_calib, center_thresh=self.opt.vis_thresh, img_id='add_pred') debugger.add_bird_view( results, center_thresh=self.opt.vis_thresh, img_id='bird_pred')
true
true
f7f979bd9ca137771d56153f1cf48fdee6e1509e
622
py
Python
tests/models.py
ThibaultVigier/django-auth-ldap
5c3fbdc9058bdaffb40127dd77d0bf692ecec379
[ "BSD-2-Clause" ]
1
2020-10-20T03:35:08.000Z
2020-10-20T03:35:08.000Z
tests/models.py
ThibaultVigier/django-auth-ldap
5c3fbdc9058bdaffb40127dd77d0bf692ecec379
[ "BSD-2-Clause" ]
null
null
null
tests/models.py
ThibaultVigier/django-auth-ldap
5c3fbdc9058bdaffb40127dd77d0bf692ecec379
[ "BSD-2-Clause" ]
null
null
null
from __future__ import unicode_literals from django.contrib.auth.models import AbstractBaseUser from django.db import models class TestUser(AbstractBaseUser): identifier = models.CharField(max_length=40, unique=True, db_index=True) uid_number = models.IntegerField() USERNAME_FIELD = 'identifier' def get_full_name(self): return self.identifier def get_short_name(self): return self.identifier def get_first_name(self): return 'Alice' def set_first_name(self, value): raise Exception('Oops...') first_name = property(get_first_name, set_first_name)
23.923077
76
0.726688
from __future__ import unicode_literals from django.contrib.auth.models import AbstractBaseUser from django.db import models class TestUser(AbstractBaseUser): identifier = models.CharField(max_length=40, unique=True, db_index=True) uid_number = models.IntegerField() USERNAME_FIELD = 'identifier' def get_full_name(self): return self.identifier def get_short_name(self): return self.identifier def get_first_name(self): return 'Alice' def set_first_name(self, value): raise Exception('Oops...') first_name = property(get_first_name, set_first_name)
true
true
f7f97c9ed4943d03be2e548c11e3a04ace6831f2
52
py
Python
app/__init__.py
jiazifa/blog
4165d69af9ee9adf573e7e4ed6c913e53254901b
[ "MIT" ]
null
null
null
app/__init__.py
jiazifa/blog
4165d69af9ee9adf573e7e4ed6c913e53254901b
[ "MIT" ]
null
null
null
app/__init__.py
jiazifa/blog
4165d69af9ee9adf573e7e4ed6c913e53254901b
[ "MIT" ]
null
null
null
# -*- coding: utf-8 -*- from .app import create_app
17.333333
27
0.634615
from .app import create_app
true
true
f7f97cc08531b78399b4a00dbd96d42936b9dfd3
4,545
py
Python
app.py
shanur00029/Faster-R-CNN-model-dockerization
ace64a39c040df93deaf2f61de73a2561498a9eb
[ "Unlicense" ]
2
2020-02-10T13:11:01.000Z
2020-02-14T16:42:03.000Z
app.py
shanur00029/Faster-R-CNN-model-dockerization
ace64a39c040df93deaf2f61de73a2561498a9eb
[ "Unlicense" ]
null
null
null
app.py
shanur00029/Faster-R-CNN-model-dockerization
ace64a39c040df93deaf2f61de73a2561498a9eb
[ "Unlicense" ]
3
2020-02-10T13:10:55.000Z
2020-02-26T04:42:37.000Z
from __future__ import division from __future__ import print_function from __future__ import absolute_import from flask import Flask, url_for, send_from_directory, request import logging, os from werkzeug import secure_filename from test_deploy import testfunction, mainf import random import pprint import sys import time import numpy as np from optparse import OptionParser import pickle import math import cv2 import copy from matplotlib import pyplot as plt import tensorflow as tf import pandas as pd import os from flask import Flask, render_template, request, redirect, url_for, send_from_directory from sklearn.metrics import average_precision_score from keras import backend as K from keras.optimizers import Adam, SGD, RMSprop from keras.layers import Flatten, Dense, Input, Conv2D, MaxPooling2D, Dropout from keras.layers import GlobalAveragePooling2D, GlobalMaxPooling2D, TimeDistributed from keras.engine.topology import get_source_inputs from keras.utils import layer_utils from keras.utils.data_utils import get_file from keras.objectives import categorical_crossentropy from keras.models import Model from keras.utils import generic_utils from keras.engine import Layer, InputSpec from keras import initializers, regularizers #app = Flask(__name__) app = Flask(__name__, template_folder='templates') file_handler = logging.FileHandler('server.log') app.logger.addHandler(file_handler) app.logger.setLevel(logging.INFO) PROJECT_HOME = os.path.dirname(os.path.realpath(__file__)) UPLOAD_FOLDER = '{}/uploads/'.format(PROJECT_HOME) app.config['UPLOAD_FOLDER'] = UPLOAD_FOLDER @app.route('/') def index(): return render_template('hello.html') def create_new_folder(local_dir): newpath = local_dir if not os.path.exists(newpath): os.makedirs(newpath) return newpath @app.route('/upload', methods = ['POST']) def upload(): app.logger.info(PROJECT_HOME) if request.method == 'POST' and request.files['image']: app.logger.info(app.config['UPLOAD_FOLDER']) img = request.files['image'] img_name = secure_filename(img.filename) create_new_folder(app.config['UPLOAD_FOLDER']) saved_path = os.path.join(app.config['UPLOAD_FOLDER'], img_name) app.logger.info("saving {}".format(saved_path)) img.save(saved_path) im_path, im_name = mainf(saved_path) return send_from_directory(im_path, im_name, as_attachment=False) else: return "Where is the image?" class Config: def __init__(self): # Print the process or not self.verbose = True # Name of base network self.network = 'vgg' # Setting for data augmentation self.use_horizontal_flips = False self.use_vertical_flips = False self.rot_90 = False # Anchor box scales # Note that if im_size is smaller, anchor_box_scales should be scaled # Original anchor_box_scales in the paper is [128, 256, 512] self.anchor_box_scales = [64, 128, 256] # Anchor box ratios self.anchor_box_ratios = [[1, 1], [1./math.sqrt(2), 2./math.sqrt(2)], [2./math.sqrt(2), 1./math.sqrt(2)]] # Size to resize the smallest side of the image # Original setting in paper is 600. Set to 300 in here to save training time self.im_size = 300 # image channel-wise mean to subtract self.img_channel_mean = [103.939, 116.779, 123.68] self.img_scaling_factor = 1.0 # number of ROIs at once self.num_rois = 4 # stride at the RPN (this depends on the network configuration) self.rpn_stride = 16 self.balanced_classes = False # scaling the stdev self.std_scaling = 4.0 self.classifier_regr_std = [8.0, 8.0, 4.0, 4.0] # overlaps for RPN self.rpn_min_overlap = 0.3 self.rpn_max_overlap = 0.7 # overlaps for classifier ROIs self.classifier_min_overlap = 0.1 self.classifier_max_overlap = 0.5 # placeholder for the class mapping, automatically generated by the parser self.class_mapping = None self.model_path = None if __name__ == '__main__': app.run(host='0.0.0.0', debug=False)
30.099338
121
0.660286
from __future__ import division from __future__ import print_function from __future__ import absolute_import from flask import Flask, url_for, send_from_directory, request import logging, os from werkzeug import secure_filename from test_deploy import testfunction, mainf import random import pprint import sys import time import numpy as np from optparse import OptionParser import pickle import math import cv2 import copy from matplotlib import pyplot as plt import tensorflow as tf import pandas as pd import os from flask import Flask, render_template, request, redirect, url_for, send_from_directory from sklearn.metrics import average_precision_score from keras import backend as K from keras.optimizers import Adam, SGD, RMSprop from keras.layers import Flatten, Dense, Input, Conv2D, MaxPooling2D, Dropout from keras.layers import GlobalAveragePooling2D, GlobalMaxPooling2D, TimeDistributed from keras.engine.topology import get_source_inputs from keras.utils import layer_utils from keras.utils.data_utils import get_file from keras.objectives import categorical_crossentropy from keras.models import Model from keras.utils import generic_utils from keras.engine import Layer, InputSpec from keras import initializers, regularizers app = Flask(__name__, template_folder='templates') file_handler = logging.FileHandler('server.log') app.logger.addHandler(file_handler) app.logger.setLevel(logging.INFO) PROJECT_HOME = os.path.dirname(os.path.realpath(__file__)) UPLOAD_FOLDER = '{}/uploads/'.format(PROJECT_HOME) app.config['UPLOAD_FOLDER'] = UPLOAD_FOLDER @app.route('/') def index(): return render_template('hello.html') def create_new_folder(local_dir): newpath = local_dir if not os.path.exists(newpath): os.makedirs(newpath) return newpath @app.route('/upload', methods = ['POST']) def upload(): app.logger.info(PROJECT_HOME) if request.method == 'POST' and request.files['image']: app.logger.info(app.config['UPLOAD_FOLDER']) img = request.files['image'] img_name = secure_filename(img.filename) create_new_folder(app.config['UPLOAD_FOLDER']) saved_path = os.path.join(app.config['UPLOAD_FOLDER'], img_name) app.logger.info("saving {}".format(saved_path)) img.save(saved_path) im_path, im_name = mainf(saved_path) return send_from_directory(im_path, im_name, as_attachment=False) else: return "Where is the image?" class Config: def __init__(self): self.verbose = True self.network = 'vgg' self.use_horizontal_flips = False self.use_vertical_flips = False self.rot_90 = False self.anchor_box_scales = [64, 128, 256] self.anchor_box_ratios = [[1, 1], [1./math.sqrt(2), 2./math.sqrt(2)], [2./math.sqrt(2), 1./math.sqrt(2)]] self.im_size = 300 self.img_channel_mean = [103.939, 116.779, 123.68] self.img_scaling_factor = 1.0 self.num_rois = 4 self.rpn_stride = 16 self.balanced_classes = False self.std_scaling = 4.0 self.classifier_regr_std = [8.0, 8.0, 4.0, 4.0] self.rpn_min_overlap = 0.3 self.rpn_max_overlap = 0.7 self.classifier_min_overlap = 0.1 self.classifier_max_overlap = 0.5 self.class_mapping = None self.model_path = None if __name__ == '__main__': app.run(host='0.0.0.0', debug=False)
true
true
f7f97dd50702066aff03feda3fafdac8e6f30661
4,127
py
Python
benchmark/test_loads.py
heroku/pghstore
31de76a7431ca280b1d9138bd6baf1ac767ea0ea
[ "MIT" ]
2
2021-03-29T06:39:04.000Z
2021-08-04T06:40:17.000Z
benchmark/test_loads.py
heroku/pghstore
31de76a7431ca280b1d9138bd6baf1ac767ea0ea
[ "MIT" ]
12
2017-08-22T15:43:09.000Z
2020-05-06T17:12:49.000Z
benchmark/test_loads.py
heroku/pghstore
31de76a7431ca280b1d9138bd6baf1ac767ea0ea
[ "MIT" ]
2
2017-08-19T12:24:52.000Z
2019-10-06T18:53:49.000Z
# -*- coding: utf-8 -*- from __future__ import print_function import unittest import timeit from functools import partial from math import floor try: from pghstore import _speedups as cpghstore except ImportError: cpghstore = None from pghstore import _native as pypghstore names = [ "", '"name"=>"Norge/Noreg"', '"name"=>"Norge/Noreg", "name:af"=>"Noorwe\xc3\xab"', '"name"=>"Norge/Noreg", "name:af"=>"Noorwe\xc3\xab", "name:ar"=>NULL', '"name"=>"Norge/Noreg", "name:af"=>"Noorwe\xc3\xab", "name:ar"=>"\xd8\xa7\xd9\x84\xd9\x86\xd8\xb1\xd9\x88\xd9\x8a\xd8\xac", "name:be"=>"\xd0\x9d\xd0\xb0\xd1\x80\xd0\xb2\xd0\xb5\xd0\xb3\xd1\x96\xd1\x8f", "name:br"=>"Norvegia", "name:ca"=>"Noruega", "name:cs"=>"Norsko", "name:cy"=>"Norwy", "name:da"=>"Norge", "name:de"=>"Norwegen", "name:el"=>"\xce\x9d\xce\xbf\xcf\x81\xce\xb2\xce\xb7\xce\xb3\xce\xaf\xce\xb1", "name:en"=>"Norway", "name:eo"=>"Norvegio", "name:es"=>"Noruega", "name:et"=>"Norra", "name:fa"=>"\xd9\x86\xd8\xb1\xd9\x88\xda\x98", "name:fi"=>"Norja", "name:fo"=>"Noregur", "name:fr"=>"Norv\xc3\xa8ge", "name:fy"=>"Noarwegen", "name:ga"=>"An Iorua", "name:gd"=>"Nirribhidh", "name:he"=>"\xd7\xa0\xd7\x95\xd7\xa8\xd7\x95\xd7\x95\xd7\x92\xd7\x99\xd7\x94", "name:hr"=>"Norve\xc5\xa1ka", "name:hu"=>"Norv\xc3\xa9gia", "name:hy"=>"\xd5\x86\xd5\xb8\xd6\x80\xd5\xbe\xd5\xa5\xd5\xa3\xd5\xab\xd5\xa1", "name:id"=>"Norwegia", "name:is"=>"Noregur", "name:it"=>"Norvegia", "name:ja"=>"\xe3\x83\x8e\xe3\x83\xab\xe3\x82\xa6\xe3\x82\xa7\xe3\x83\xbc", "name:la"=>"Norvegia", "name:lb"=>"Norwegen", "name:li"=>"Noorwege", "name:lt"=>"Norvegija", "name:lv"=>"Norv\xc4\x93\xc4\xa3ija", "name:mn"=>"\xd0\x9d\xd0\xbe\xd1\x80\xd0\xb2\xd0\xb5\xd0\xb3\xd0\xb8", "name:nb"=>"Norge", "name:nl"=>"Noorwegen", "name:nn"=>"Noreg", "name:no"=>"Norge", "name:pl"=>"Norwegia", "name:ru"=>"\xd0\x9d\xd0\xbe\xd1\x80\xd0\xb2\xd0\xb5\xd0\xb3\xd0\xb8\xd1\x8f", "name:sk"=>"N\xc3\xb3rsko", "name:sl"=>"Norve\xc5\xa1ka", "name:sv"=>"Norge", "name:th"=>"\xe0\xb8\x9b\xe0\xb8\xa3\xe0\xb8\xb0\xe0\xb9\x80\xe0\xb8\x97\xe0\xb8\xa8\xe0\xb8\x99\xe0\xb8\xad\xe0\xb8\xa3\xe0\xb9\x8c\xe0\xb9\x80\xe0\xb8\xa7\xe0\xb8\xa2\xe0\xb9\x8c", "name:tr"=>"Norve\xc3\xa7", "name:uk"=>"\xd0\x9d\xd0\xbe\xd1\x80\xd0\xb2\xd0\xb5\xd0\xb3\xd1\x96\xd1\x8f", "name:vi"=>"Na Uy", "name:zh"=>"\xe6\x8c\xaa\xe5\xa8\x81", "name:haw"=>"Nolewai", "name:zh_py"=>"Nuowei", "name:zh_pyt"=>"Nu\xc3\xb3w\xc4\x93i", "official_name"=>"Kongeriket Norge", "official_name:be"=>"\xd0\x9a\xd0\xb0\xd1\x80\xd0\xb0\xd0\xbb\xd0\xb5\xd1\x9e\xd1\x81\xd1\x82\xd0\xb2\xd0\xb0 \xd0\x9d\xd0\xb0\xd1\x80\xd0\xb2\xd0\xb5\xd0\xb3\xd1\x96\xd1\x8f", "official_name:el"=>"\xce\x92\xce\xb1\xcf\x83\xce\xaf\xce\xbb\xce\xb5\xce\xb9\xce\xbf \xcf\x84\xce\xb7\xcf\x82 \xce\x9d\xce\xbf\xcf\x81\xce\xb2\xce\xb7\xce\xb3\xce\xaf\xce\xb1\xcf\x82", "official_name:en"=>"Kingdom of Norway", "official_name:id"=>"Kerajaan Norwegia", "official_name:it"=>"Regno di Norvegia", "official_name:ja"=>"\xe3\x83\x8e\xe3\x83\xab\xe3\x82\xa6\xe3\x82\xa7\xe3\x83\xbc\xe7\x8e\x8b\xe5\x9b\xbd", "official_name:lb"=>"Kinneksr\xc3\xa4ich Norwegen", "official_name:lt"=>"Norvegijos Karalyst\xc4\x97", "official_name:sk"=>"N\xc3\xb3rske kr\xc3\xa1\xc4\xbeovstvo", "official_name:sv"=>"Konungariket Norge", "official_name:vi"=>"V\xc6\xb0\xc6\xa1ng qu\xe1\xbb\x91c Na Uy"', ] tmpl = ".. n=%i, strlen=%i, cpghstore.loads (%.2fs) is %ix faster than pghstore.loads (%.2fs)" tmpl_2 = ".. n=%i, dictlen=%i, pghstore.dumps (%.2fs)" class LoadsBenchmark(unittest.TestCase): def test_loads(self): n = 100000 print("") for name in names: pg_time = timeit.timeit(partial(pypghstore.loads, name), number=n) if cpghstore is not None: cpg_time = timeit.timeit(partial(cpghstore.loads, name), number=n) self.assertTrue(cpg_time < pg_time) print( tmpl % (n, len(name), cpg_time, floor(pg_time / cpg_time), pg_time) ) else: print(tmpl_2 % (n, len(name), pg_time)) if __name__ == "__main__": LoadsBenchmark().test_loads()
89.717391
2,856
0.64914
from __future__ import print_function import unittest import timeit from functools import partial from math import floor try: from pghstore import _speedups as cpghstore except ImportError: cpghstore = None from pghstore import _native as pypghstore names = [ "", '"name"=>"Norge/Noreg"', '"name"=>"Norge/Noreg", "name:af"=>"Noorwe\xc3\xab"', '"name"=>"Norge/Noreg", "name:af"=>"Noorwe\xc3\xab", "name:ar"=>NULL', '"name"=>"Norge/Noreg", "name:af"=>"Noorwe\xc3\xab", "name:ar"=>"\xd8\xa7\xd9\x84\xd9\x86\xd8\xb1\xd9\x88\xd9\x8a\xd8\xac", "name:be"=>"\xd0\x9d\xd0\xb0\xd1\x80\xd0\xb2\xd0\xb5\xd0\xb3\xd1\x96\xd1\x8f", "name:br"=>"Norvegia", "name:ca"=>"Noruega", "name:cs"=>"Norsko", "name:cy"=>"Norwy", "name:da"=>"Norge", "name:de"=>"Norwegen", "name:el"=>"\xce\x9d\xce\xbf\xcf\x81\xce\xb2\xce\xb7\xce\xb3\xce\xaf\xce\xb1", "name:en"=>"Norway", "name:eo"=>"Norvegio", "name:es"=>"Noruega", "name:et"=>"Norra", "name:fa"=>"\xd9\x86\xd8\xb1\xd9\x88\xda\x98", "name:fi"=>"Norja", "name:fo"=>"Noregur", "name:fr"=>"Norv\xc3\xa8ge", "name:fy"=>"Noarwegen", "name:ga"=>"An Iorua", "name:gd"=>"Nirribhidh", "name:he"=>"\xd7\xa0\xd7\x95\xd7\xa8\xd7\x95\xd7\x95\xd7\x92\xd7\x99\xd7\x94", "name:hr"=>"Norve\xc5\xa1ka", "name:hu"=>"Norv\xc3\xa9gia", "name:hy"=>"\xd5\x86\xd5\xb8\xd6\x80\xd5\xbe\xd5\xa5\xd5\xa3\xd5\xab\xd5\xa1", "name:id"=>"Norwegia", "name:is"=>"Noregur", "name:it"=>"Norvegia", "name:ja"=>"\xe3\x83\x8e\xe3\x83\xab\xe3\x82\xa6\xe3\x82\xa7\xe3\x83\xbc", "name:la"=>"Norvegia", "name:lb"=>"Norwegen", "name:li"=>"Noorwege", "name:lt"=>"Norvegija", "name:lv"=>"Norv\xc4\x93\xc4\xa3ija", "name:mn"=>"\xd0\x9d\xd0\xbe\xd1\x80\xd0\xb2\xd0\xb5\xd0\xb3\xd0\xb8", "name:nb"=>"Norge", "name:nl"=>"Noorwegen", "name:nn"=>"Noreg", "name:no"=>"Norge", "name:pl"=>"Norwegia", "name:ru"=>"\xd0\x9d\xd0\xbe\xd1\x80\xd0\xb2\xd0\xb5\xd0\xb3\xd0\xb8\xd1\x8f", "name:sk"=>"N\xc3\xb3rsko", "name:sl"=>"Norve\xc5\xa1ka", "name:sv"=>"Norge", "name:th"=>"\xe0\xb8\x9b\xe0\xb8\xa3\xe0\xb8\xb0\xe0\xb9\x80\xe0\xb8\x97\xe0\xb8\xa8\xe0\xb8\x99\xe0\xb8\xad\xe0\xb8\xa3\xe0\xb9\x8c\xe0\xb9\x80\xe0\xb8\xa7\xe0\xb8\xa2\xe0\xb9\x8c", "name:tr"=>"Norve\xc3\xa7", "name:uk"=>"\xd0\x9d\xd0\xbe\xd1\x80\xd0\xb2\xd0\xb5\xd0\xb3\xd1\x96\xd1\x8f", "name:vi"=>"Na Uy", "name:zh"=>"\xe6\x8c\xaa\xe5\xa8\x81", "name:haw"=>"Nolewai", "name:zh_py"=>"Nuowei", "name:zh_pyt"=>"Nu\xc3\xb3w\xc4\x93i", "official_name"=>"Kongeriket Norge", "official_name:be"=>"\xd0\x9a\xd0\xb0\xd1\x80\xd0\xb0\xd0\xbb\xd0\xb5\xd1\x9e\xd1\x81\xd1\x82\xd0\xb2\xd0\xb0 \xd0\x9d\xd0\xb0\xd1\x80\xd0\xb2\xd0\xb5\xd0\xb3\xd1\x96\xd1\x8f", "official_name:el"=>"\xce\x92\xce\xb1\xcf\x83\xce\xaf\xce\xbb\xce\xb5\xce\xb9\xce\xbf \xcf\x84\xce\xb7\xcf\x82 \xce\x9d\xce\xbf\xcf\x81\xce\xb2\xce\xb7\xce\xb3\xce\xaf\xce\xb1\xcf\x82", "official_name:en"=>"Kingdom of Norway", "official_name:id"=>"Kerajaan Norwegia", "official_name:it"=>"Regno di Norvegia", "official_name:ja"=>"\xe3\x83\x8e\xe3\x83\xab\xe3\x82\xa6\xe3\x82\xa7\xe3\x83\xbc\xe7\x8e\x8b\xe5\x9b\xbd", "official_name:lb"=>"Kinneksr\xc3\xa4ich Norwegen", "official_name:lt"=>"Norvegijos Karalyst\xc4\x97", "official_name:sk"=>"N\xc3\xb3rske kr\xc3\xa1\xc4\xbeovstvo", "official_name:sv"=>"Konungariket Norge", "official_name:vi"=>"V\xc6\xb0\xc6\xa1ng qu\xe1\xbb\x91c Na Uy"', ] tmpl = ".. n=%i, strlen=%i, cpghstore.loads (%.2fs) is %ix faster than pghstore.loads (%.2fs)" tmpl_2 = ".. n=%i, dictlen=%i, pghstore.dumps (%.2fs)" class LoadsBenchmark(unittest.TestCase): def test_loads(self): n = 100000 print("") for name in names: pg_time = timeit.timeit(partial(pypghstore.loads, name), number=n) if cpghstore is not None: cpg_time = timeit.timeit(partial(cpghstore.loads, name), number=n) self.assertTrue(cpg_time < pg_time) print( tmpl % (n, len(name), cpg_time, floor(pg_time / cpg_time), pg_time) ) else: print(tmpl_2 % (n, len(name), pg_time)) if __name__ == "__main__": LoadsBenchmark().test_loads()
true
true
f7f97eea171aeafdaed314fe22447d5c68e6b9fd
2,221
py
Python
applications/shop/models/paymentmethod/iban.py
dev-easyshares/mighty
a6cf473fb8cfbf5b92db68c7b068fc8ae2911b8b
[ "MIT" ]
null
null
null
applications/shop/models/paymentmethod/iban.py
dev-easyshares/mighty
a6cf473fb8cfbf5b92db68c7b068fc8ae2911b8b
[ "MIT" ]
1
2022-03-12T00:57:37.000Z
2022-03-12T00:57:37.000Z
applications/shop/models/paymentmethod/iban.py
dev-easyshares/mighty
a6cf473fb8cfbf5b92db68c7b068fc8ae2911b8b
[ "MIT" ]
null
null
null
from django.conf import settings from django.core.exceptions import ValidationError from mighty.applications.shop.apps import sepas_test, ShopConfig from schwifty import IBAN, BIC from dateutil.relativedelta import relativedelta import re class IbanModel: @property def readable_iban(self): return ' '.join([self.iban[i:i+4] for i in range(0, len(self.iban), 4)]) @property def str_iban(self): return "%s/%s" % (self.readable_iban, self.bic) @property def iban_readable(self): return " ".join(self.iban[i:i+4] for i in range(0, len(self.iban), 4)) @property def mask_iban(self): iban = self.readable_cb[0:4]+re.sub(r"[a-zA-Z0-9]", '*', self.iban_readable[4:-4])+self.iban_readable[-4:] return "%s/%s" % (iban, self.bic) @property def is_valid_ibanlib(self): self.iban = re.sub(r"\s+", "", self.iban, flags=re.UNICODE) try: iban = IBAN(self.iban) if not self.bic: self.bic = str(iban.bic) return True except ValueError: return False @property def is_valid_bic(self): try: if self.bic: BIC(self.bic) return True except ValueError: return False @property def is_exist_iban(self): if ShopConfig.subscription_for == 'group': qs = type(self).objects.filter(iban=self.iban, bic=self.bic, group=self.group) else: qs = type(self).objects.filter(iban=self.iban, bic=self.bic, user=self.user) if self.pk: qs = qs.exclude(pk=self.pk) return False if qs.exists() else True @property def is_valid_iban(self): if not settings.DEBUG and self.iban in sepas_test(): raise ValidationError(code='invalid_iban', message='invalid IBAN') if not self.iban or not self.is_valid_ibanlib: raise ValidationError(code='invalid_iban', message='invalid IBAN') if not self.is_valid_bic: raise ValidationError(code='invalid_bic', message='invalid BIC') if not self.is_exist_iban: raise ValidationError(code='already_iban', message='IBAN already exist')
34.703125
114
0.620891
from django.conf import settings from django.core.exceptions import ValidationError from mighty.applications.shop.apps import sepas_test, ShopConfig from schwifty import IBAN, BIC from dateutil.relativedelta import relativedelta import re class IbanModel: @property def readable_iban(self): return ' '.join([self.iban[i:i+4] for i in range(0, len(self.iban), 4)]) @property def str_iban(self): return "%s/%s" % (self.readable_iban, self.bic) @property def iban_readable(self): return " ".join(self.iban[i:i+4] for i in range(0, len(self.iban), 4)) @property def mask_iban(self): iban = self.readable_cb[0:4]+re.sub(r"[a-zA-Z0-9]", '*', self.iban_readable[4:-4])+self.iban_readable[-4:] return "%s/%s" % (iban, self.bic) @property def is_valid_ibanlib(self): self.iban = re.sub(r"\s+", "", self.iban, flags=re.UNICODE) try: iban = IBAN(self.iban) if not self.bic: self.bic = str(iban.bic) return True except ValueError: return False @property def is_valid_bic(self): try: if self.bic: BIC(self.bic) return True except ValueError: return False @property def is_exist_iban(self): if ShopConfig.subscription_for == 'group': qs = type(self).objects.filter(iban=self.iban, bic=self.bic, group=self.group) else: qs = type(self).objects.filter(iban=self.iban, bic=self.bic, user=self.user) if self.pk: qs = qs.exclude(pk=self.pk) return False if qs.exists() else True @property def is_valid_iban(self): if not settings.DEBUG and self.iban in sepas_test(): raise ValidationError(code='invalid_iban', message='invalid IBAN') if not self.iban or not self.is_valid_ibanlib: raise ValidationError(code='invalid_iban', message='invalid IBAN') if not self.is_valid_bic: raise ValidationError(code='invalid_bic', message='invalid BIC') if not self.is_exist_iban: raise ValidationError(code='already_iban', message='IBAN already exist')
true
true
f7f97f1e083b2da4fa3985b5f7f8c3ebce4b3a87
3,091
py
Python
benchmark/startCirq2377.py
UCLA-SEAL/QDiff
d968cbc47fe926b7f88b4adf10490f1edd6f8819
[ "BSD-3-Clause" ]
null
null
null
benchmark/startCirq2377.py
UCLA-SEAL/QDiff
d968cbc47fe926b7f88b4adf10490f1edd6f8819
[ "BSD-3-Clause" ]
null
null
null
benchmark/startCirq2377.py
UCLA-SEAL/QDiff
d968cbc47fe926b7f88b4adf10490f1edd6f8819
[ "BSD-3-Clause" ]
null
null
null
#!/usr/bin/env python # -*- coding: utf-8 -*- # @Time : 5/15/20 4:49 PM # @File : grover.py # qubit number=4 # total number=40 import cirq import cirq.google as cg from typing import Optional import sys from math import log2 import numpy as np #thatsNoCode from cirq.contrib.svg import SVGCircuit # Symbols for the rotation angles in the QAOA circuit. def make_circuit(n: int, input_qubit): c = cirq.Circuit() # circuit begin c.append(cirq.H.on(input_qubit[0])) # number=9 c.append(cirq.H.on(input_qubit[1])) # number=2 c.append(cirq.H.on(input_qubit[2])) # number=3 c.append(cirq.Z.on(input_qubit[3])) # number=29 c.append(cirq.H.on(input_qubit[3])) # number=4 c.append(cirq.H.on(input_qubit[0])) # number=5 c.append(cirq.H.on(input_qubit[1])) # number=6 c.append(cirq.H.on(input_qubit[2])) # number=7 c.append(cirq.H.on(input_qubit[3])) # number=8 c.append(cirq.H.on(input_qubit[3])) # number=31 c.append(cirq.CZ.on(input_qubit[0],input_qubit[3])) # number=32 c.append(cirq.H.on(input_qubit[3])) # number=33 c.append(cirq.X.on(input_qubit[3])) # number=27 c.append(cirq.H.on(input_qubit[3])) # number=34 c.append(cirq.CZ.on(input_qubit[0],input_qubit[3])) # number=35 c.append(cirq.H.on(input_qubit[3])) # number=36 c.append(cirq.H.on(input_qubit[0])) # number=37 c.append(cirq.CZ.on(input_qubit[2],input_qubit[0])) # number=38 c.append(cirq.H.on(input_qubit[0])) # number=39 c.append(cirq.H.on(input_qubit[0])) # number=14 c.append(cirq.H.on(input_qubit[1])) # number=30 c.append(cirq.CZ.on(input_qubit[2],input_qubit[0])) # number=15 c.append(cirq.H.on(input_qubit[0])) # number=16 c.append(cirq.CNOT.on(input_qubit[0],input_qubit[2])) # number=20 c.append(cirq.X.on(input_qubit[2])) # number=21 c.append(cirq.CNOT.on(input_qubit[0],input_qubit[2])) # number=22 c.append(cirq.CNOT.on(input_qubit[0],input_qubit[2])) # number=17 c.append(cirq.CNOT.on(input_qubit[0],input_qubit[2])) # number=23 c.append(cirq.X.on(input_qubit[2])) # number=24 c.append(cirq.CNOT.on(input_qubit[0],input_qubit[2])) # number=25 c.append(cirq.CNOT.on(input_qubit[0],input_qubit[2])) # number=19 # circuit end c.append(cirq.measure(*input_qubit, key='result')) return c def bitstring(bits): return ''.join(str(int(b)) for b in bits) if __name__ == '__main__': qubit_count = 4 input_qubits = [cirq.GridQubit(i, 0) for i in range(qubit_count)] circuit = make_circuit(qubit_count,input_qubits) circuit = cg.optimized_for_sycamore(circuit, optimizer_type='sqrt_iswap') circuit_sample_count =2000 simulator = cirq.Simulator() result = simulator.run(circuit, repetitions=circuit_sample_count) frequencies = result.histogram(key='result', fold_func=bitstring) writefile = open("../data/startCirq2377.csv","w+") print(format(frequencies),file=writefile) print("results end", file=writefile) print(circuit.__len__(), file=writefile) print(circuit,file=writefile) writefile.close()
36.364706
77
0.681333
import cirq import cirq.google as cg from typing import Optional import sys from math import log2 import numpy as np from cirq.contrib.svg import SVGCircuit def make_circuit(n: int, input_qubit): c = cirq.Circuit() c.append(cirq.H.on(input_qubit[0])) c.append(cirq.H.on(input_qubit[1])) c.append(cirq.H.on(input_qubit[2])) c.append(cirq.Z.on(input_qubit[3])) c.append(cirq.H.on(input_qubit[3])) c.append(cirq.H.on(input_qubit[0])) c.append(cirq.H.on(input_qubit[1])) c.append(cirq.H.on(input_qubit[2])) c.append(cirq.H.on(input_qubit[3])) c.append(cirq.H.on(input_qubit[3])) c.append(cirq.CZ.on(input_qubit[0],input_qubit[3])) c.append(cirq.H.on(input_qubit[3])) c.append(cirq.X.on(input_qubit[3])) c.append(cirq.H.on(input_qubit[3])) c.append(cirq.CZ.on(input_qubit[0],input_qubit[3])) c.append(cirq.H.on(input_qubit[3])) c.append(cirq.H.on(input_qubit[0])) c.append(cirq.CZ.on(input_qubit[2],input_qubit[0])) c.append(cirq.H.on(input_qubit[0])) c.append(cirq.H.on(input_qubit[0])) c.append(cirq.H.on(input_qubit[1])) c.append(cirq.CZ.on(input_qubit[2],input_qubit[0])) c.append(cirq.H.on(input_qubit[0])) c.append(cirq.CNOT.on(input_qubit[0],input_qubit[2])) c.append(cirq.X.on(input_qubit[2])) c.append(cirq.CNOT.on(input_qubit[0],input_qubit[2])) c.append(cirq.CNOT.on(input_qubit[0],input_qubit[2])) c.append(cirq.CNOT.on(input_qubit[0],input_qubit[2])) c.append(cirq.X.on(input_qubit[2])) c.append(cirq.CNOT.on(input_qubit[0],input_qubit[2])) c.append(cirq.CNOT.on(input_qubit[0],input_qubit[2])) c.append(cirq.measure(*input_qubit, key='result')) return c def bitstring(bits): return ''.join(str(int(b)) for b in bits) if __name__ == '__main__': qubit_count = 4 input_qubits = [cirq.GridQubit(i, 0) for i in range(qubit_count)] circuit = make_circuit(qubit_count,input_qubits) circuit = cg.optimized_for_sycamore(circuit, optimizer_type='sqrt_iswap') circuit_sample_count =2000 simulator = cirq.Simulator() result = simulator.run(circuit, repetitions=circuit_sample_count) frequencies = result.histogram(key='result', fold_func=bitstring) writefile = open("../data/startCirq2377.csv","w+") print(format(frequencies),file=writefile) print("results end", file=writefile) print(circuit.__len__(), file=writefile) print(circuit,file=writefile) writefile.close()
true
true
f7f97f56258036a48aa42fcf4d54582e19df6e67
3,117
py
Python
Django/DjangoT1.11_LTS/55_Pengenalan User Permission Checks/mywebsite/settings.py
Akhadafi/WEB-Framework
4547a682ac1f007aa6f97512baf76b92ef1c9b9a
[ "MIT" ]
null
null
null
Django/DjangoT1.11_LTS/55_Pengenalan User Permission Checks/mywebsite/settings.py
Akhadafi/WEB-Framework
4547a682ac1f007aa6f97512baf76b92ef1c9b9a
[ "MIT" ]
null
null
null
Django/DjangoT1.11_LTS/55_Pengenalan User Permission Checks/mywebsite/settings.py
Akhadafi/WEB-Framework
4547a682ac1f007aa6f97512baf76b92ef1c9b9a
[ "MIT" ]
null
null
null
""" Django settings for mywebsite project. Generated by 'django-admin startproject' using Django 1.11.20. For more information on this file, see https://docs.djangoproject.com/en/1.11/topics/settings/ For the full list of settings and their values, see https://docs.djangoproject.com/en/1.11/ref/settings/ """ import os # Build paths inside the project like this: os.path.join(BASE_DIR, ...) BASE_DIR = os.path.dirname(os.path.dirname(os.path.abspath(__file__))) # Quick-start development settings - unsuitable for production # See https://docs.djangoproject.com/en/1.11/howto/deployment/checklist/ # SECURITY WARNING: keep the secret key used in production secret! SECRET_KEY = '0l3t_qz$+ocv=^ss6vux!#+ep831tg2jh2p2@wmntbm+dbm2sy' # SECURITY WARNING: don't run with debug turned on in production! DEBUG = True ALLOWED_HOSTS = [] # Application definition INSTALLED_APPS = [ 'django.contrib.admin', 'django.contrib.auth', 'django.contrib.contenttypes', 'django.contrib.sessions', 'django.contrib.messages', 'django.contrib.staticfiles', ] MIDDLEWARE = [ 'django.middleware.security.SecurityMiddleware', 'django.contrib.sessions.middleware.SessionMiddleware', 'django.middleware.common.CommonMiddleware', 'django.middleware.csrf.CsrfViewMiddleware', 'django.contrib.auth.middleware.AuthenticationMiddleware', 'django.contrib.messages.middleware.MessageMiddleware', 'django.middleware.clickjacking.XFrameOptionsMiddleware', ] ROOT_URLCONF = 'mywebsite.urls' TEMPLATES = [ { 'BACKEND': 'django.template.backends.django.DjangoTemplates', 'DIRS': ['templates'], 'APP_DIRS': True, 'OPTIONS': { 'context_processors': [ 'django.template.context_processors.debug', 'django.template.context_processors.request', 'django.contrib.auth.context_processors.auth', 'django.contrib.messages.context_processors.messages', ], }, }, ] WSGI_APPLICATION = 'mywebsite.wsgi.application' # Database # https://docs.djangoproject.com/en/1.11/ref/settings/#databases DATABASES = { 'default': { 'ENGINE': 'django.db.backends.sqlite3', 'NAME': os.path.join(BASE_DIR, 'db.sqlite3'), } } # Password validation # https://docs.djangoproject.com/en/1.11/ref/settings/#auth-password-validators AUTH_PASSWORD_VALIDATORS = [ { 'NAME': 'django.contrib.auth.password_validation.UserAttributeSimilarityValidator', }, { 'NAME': 'django.contrib.auth.password_validation.MinimumLengthValidator', }, { 'NAME': 'django.contrib.auth.password_validation.CommonPasswordValidator', }, { 'NAME': 'django.contrib.auth.password_validation.NumericPasswordValidator', }, ] # Internationalization # https://docs.djangoproject.com/en/1.11/topics/i18n/ LANGUAGE_CODE = 'en-us' TIME_ZONE = 'UTC' USE_I18N = True USE_L10N = True USE_TZ = True # Static files (CSS, JavaScript, Images) # https://docs.djangoproject.com/en/1.11/howto/static-files/ STATIC_URL = '/static/'
25.760331
91
0.69907
import os BASE_DIR = os.path.dirname(os.path.dirname(os.path.abspath(__file__))) SECRET_KEY = '0l3t_qz$+ocv=^ss6vux!#+ep831tg2jh2p2@wmntbm+dbm2sy' DEBUG = True ALLOWED_HOSTS = [] # Application definition INSTALLED_APPS = [ 'django.contrib.admin', 'django.contrib.auth', 'django.contrib.contenttypes', 'django.contrib.sessions', 'django.contrib.messages', 'django.contrib.staticfiles', ] MIDDLEWARE = [ 'django.middleware.security.SecurityMiddleware', 'django.contrib.sessions.middleware.SessionMiddleware', 'django.middleware.common.CommonMiddleware', 'django.middleware.csrf.CsrfViewMiddleware', 'django.contrib.auth.middleware.AuthenticationMiddleware', 'django.contrib.messages.middleware.MessageMiddleware', 'django.middleware.clickjacking.XFrameOptionsMiddleware', ] ROOT_URLCONF = 'mywebsite.urls' TEMPLATES = [ { 'BACKEND': 'django.template.backends.django.DjangoTemplates', 'DIRS': ['templates'], 'APP_DIRS': True, 'OPTIONS': { 'context_processors': [ 'django.template.context_processors.debug', 'django.template.context_processors.request', 'django.contrib.auth.context_processors.auth', 'django.contrib.messages.context_processors.messages', ], }, }, ] WSGI_APPLICATION = 'mywebsite.wsgi.application' # Database # https://docs.djangoproject.com/en/1.11/ref/settings/#databases DATABASES = { 'default': { 'ENGINE': 'django.db.backends.sqlite3', 'NAME': os.path.join(BASE_DIR, 'db.sqlite3'), } } # Password validation # https://docs.djangoproject.com/en/1.11/ref/settings/#auth-password-validators AUTH_PASSWORD_VALIDATORS = [ { 'NAME': 'django.contrib.auth.password_validation.UserAttributeSimilarityValidator', }, { 'NAME': 'django.contrib.auth.password_validation.MinimumLengthValidator', }, { 'NAME': 'django.contrib.auth.password_validation.CommonPasswordValidator', }, { 'NAME': 'django.contrib.auth.password_validation.NumericPasswordValidator', }, ] # Internationalization # https://docs.djangoproject.com/en/1.11/topics/i18n/ LANGUAGE_CODE = 'en-us' TIME_ZONE = 'UTC' USE_I18N = True USE_L10N = True USE_TZ = True # Static files (CSS, JavaScript, Images) # https://docs.djangoproject.com/en/1.11/howto/static-files/ STATIC_URL = '/static/'
true
true
f7f97fbddca8345981dcfbe6d3e65b14bef4616e
8,544
py
Python
sunpy/map/tests/test_map_factory.py
TomAugspurger/sunpy
cad2d473f6aff05df5fe787c781cb7d004959b94
[ "BSD-2-Clause" ]
null
null
null
sunpy/map/tests/test_map_factory.py
TomAugspurger/sunpy
cad2d473f6aff05df5fe787c781cb7d004959b94
[ "BSD-2-Clause" ]
null
null
null
sunpy/map/tests/test_map_factory.py
TomAugspurger/sunpy
cad2d473f6aff05df5fe787c781cb7d004959b94
[ "BSD-2-Clause" ]
null
null
null
# -*- coding: utf-8 -*- """ Created on Fri Jun 21 15:05:09 2013 @author: stuart """ import os import tempfile import pathlib import pytest import numpy as np from astropy.io import fits from astropy.wcs import WCS import sunpy import sunpy.map import sunpy.data.test filepath = sunpy.data.test.rootdir a_list_of_many = [os.fspath(f) for f in pathlib.Path(filepath, "EIT").glob("*")] a_fname = a_list_of_many[0] AIA_171_IMAGE = os.path.join(filepath, 'aia_171_level1.fits') RHESSI_IMAGE = os.path.join(filepath, 'hsi_image_20101016_191218.fits') #============================================================================== # Map Factory Tests #============================================================================== class TestMap: def test_mapsequence(self): # Test making a MapSequence sequence = sunpy.map.Map(a_list_of_many, sequence=True) assert isinstance(sequence, sunpy.map.MapSequence) def test_composite(self): # Test making a CompositeMap comp = sunpy.map.Map(AIA_171_IMAGE, RHESSI_IMAGE, composite=True) assert isinstance(comp, sunpy.map.CompositeMap) def test_patterns(self): # Test different Map pattern matching # File name eitmap = sunpy.map.Map(a_fname) assert isinstance(eitmap, sunpy.map.GenericMap) # Directory directory = pathlib.Path(filepath, "EIT") maps = sunpy.map.Map(os.fspath(directory)) assert isinstance(maps, list) assert ([isinstance(amap, sunpy.map.GenericMap) for amap in maps]) # Test that returned maps are sorted files_sorted = sorted(list(directory.glob('*'))) maps_sorted = [sunpy.map.Map(os.fspath(f)) for f in files_sorted] assert all([m.date == m_s.date for m, m_s in zip(maps, maps_sorted)]) # Pathlib path = pathlib.Path(a_fname) eitmap = sunpy.map.Map(path) assert isinstance(eitmap, sunpy.map.GenericMap) maps = sunpy.map.Map(directory) assert isinstance(maps, list) assert ([isinstance(amap, sunpy.map.GenericMap) for amap in maps]) # Glob pattern = os.path.join(filepath, "EIT", "*") maps = sunpy.map.Map(pattern) assert isinstance(maps, list) assert ([isinstance(amap, sunpy.map.GenericMap) for amap in maps]) # Test that returned maps are sorted files_sorted = sorted(list(pathlib.Path(pattern).parent.glob('*'))) maps_sorted = [sunpy.map.Map(os.fspath(f)) for f in files_sorted] assert all([m.date == m_s.date for m, m_s in zip(maps, maps_sorted)]) # Single character wildcard (?) pattern = os.path.join(filepath, "EIT", "efz20040301.0?0010_s.fits") maps = sunpy.map.Map(pattern) assert isinstance(maps, list) assert len(maps) == 7 assert ([isinstance(amap, sunpy.map.GenericMap) for amap in maps]) # Character ranges pattern = os.path.join(filepath, "EIT", "efz20040301.0[2-6]0010_s.fits") maps = sunpy.map.Map(pattern) assert isinstance(maps, list) assert len(maps) == 4 assert ([isinstance(amap, sunpy.map.GenericMap) for amap in maps]) # Already a Map amap = sunpy.map.Map(maps[0]) assert isinstance(amap, sunpy.map.GenericMap) # A list of filenames maps = sunpy.map.Map(a_list_of_many) assert isinstance(maps, list) assert ([isinstance(amap, sunpy.map.GenericMap) for amap in maps]) # Data-header pair in a tuple pair_map = sunpy.map.Map((amap.data, amap.meta)) assert isinstance(pair_map, sunpy.map.GenericMap) # Data-header pair not in a tuple pair_map = sunpy.map.Map(amap.data, amap.meta) assert isinstance(pair_map, sunpy.map.GenericMap) # Data-wcs object pair in tuple pair_map = sunpy.map.Map((amap.data, WCS(AIA_171_IMAGE))) assert isinstance(pair_map, sunpy.map.GenericMap) # Data-wcs object pair not in a tuple pair_map = sunpy.map.Map(amap.data, WCS(AIA_171_IMAGE)) assert isinstance(pair_map, sunpy.map.GenericMap) # Data-header from FITS with fits.open(a_fname) as hdul: data = hdul[0].data header = hdul[0].header pair_map = sunpy.map.Map((data, header)) assert isinstance(pair_map, sunpy.map.GenericMap) pair_map, pair_map = sunpy.map.Map(((data, header), (data, header))) assert isinstance(pair_map, sunpy.map.GenericMap) pair_map = sunpy.map.Map(data, header) assert isinstance(pair_map, sunpy.map.GenericMap) # Custom Map data = np.arange(0, 100).reshape(10, 10) header = {'cdelt1': 10, 'cdelt2': 10, 'telescop': 'sunpy', 'cunit1': 'arcsec', 'cunit2': 'arcsec'} pair_map = sunpy.map.Map(data, header) assert isinstance(pair_map, sunpy.map.GenericMap) # requires dask array to run properly def test_dask_array(self): dask_array = pytest.importorskip('dask.array') amap = sunpy.map.Map(AIA_171_IMAGE) da = dask_array.from_array(amap.data, chunks=(1, 1)) pair_map = sunpy.map.Map(da, amap.meta) assert isinstance(pair_map, sunpy.map.GenericMap) # requires sqlalchemy to run properly def test_databaseentry(self): sqlalchemy = pytest.importorskip('sqlalchemy') sunpy_database = pytest.importorskip('sunpy.database') db = sunpy_database.Database(url='sqlite://', default_waveunit='angstrom') db.add_from_file(a_fname) res = db.get_entry_by_id(1) db_map = sunpy.map.Map(res) assert isinstance(db_map, sunpy.map.GenericMap) @pytest.mark.remote_data def test_url_pattern(self): # A URL amap = sunpy.map.Map("http://data.sunpy.org/sample-data/AIA20110319_105400_0171.fits") assert isinstance(amap, sunpy.map.GenericMap) def test_save(self): # Test save out eitmap = sunpy.map.Map(a_fname) afilename = tempfile.NamedTemporaryFile(suffix='fits').name eitmap.save(afilename, filetype='fits', overwrite=True) backin = sunpy.map.Map(afilename) assert isinstance(backin, sunpy.map.sources.EITMap) #============================================================================== # Sources Tests #============================================================================== def test_sdo(self): # Test an AIAMap aia = sunpy.map.Map(AIA_171_IMAGE) assert isinstance(aia, sunpy.map.sources.AIAMap) # TODO: Test a HMIMap def test_soho(self): # Test EITMap, LASCOMap & MDIMap eit = sunpy.map.Map(os.path.join(filepath, "EIT", "efz20040301.000010_s.fits")) assert isinstance(eit, sunpy.map.sources.EITMap) lasco = sunpy.map.Map(os.path.join(filepath, "lasco_c2_25299383_s.fts")) assert isinstance(lasco, sunpy.map.sources.LASCOMap) mdi_c = sunpy.map.Map(os.path.join(filepath, "mdi_fd_Ic_6h_01d.5871.0000_s.fits")) assert isinstance(mdi_c, sunpy.map.sources.MDIMap) mdi_m = sunpy.map.Map(os.path.join(filepath, "mdi_fd_M_96m_01d.5874.0005_s.fits")) assert isinstance(mdi_m, sunpy.map.sources.MDIMap) def test_stereo(self): # Test EUVIMap & CORMap & HIMap euvi = sunpy.map.Map(os.path.join(filepath, "euvi_20090615_000900_n4euA_s.fts")) assert isinstance(euvi, sunpy.map.sources.EUVIMap) cor = sunpy.map.Map(os.path.join(filepath, "cor1_20090615_000500_s4c1A.fts")) assert isinstance(cor, sunpy.map.sources.CORMap) hi = sunpy.map.Map(os.path.join(filepath, "hi_20110910_114721_s7h2A.fts")) assert isinstance(hi, sunpy.map.sources.HIMap) def test_rhessi(self): # Test RHESSIMap rhessi = sunpy.map.Map(RHESSI_IMAGE) assert isinstance(rhessi, sunpy.map.sources.RHESSIMap) def test_sot(self): # Test SOTMap sot = sunpy.map.Map(os.path.join(filepath, "FGMG4_20110214_030443.7.fits")) assert isinstance(sot, sunpy.map.sources.SOTMap) def test_swap(self): # Test SWAPMap swap = sunpy.map.Map(os.path.join(filepath, "swap_lv1_20140606_000113.fits")) assert isinstance(swap, sunpy.map.sources.SWAPMap) def test_xrt(self): # Test XRTMap xrt = sunpy.map.Map(os.path.join(filepath, "HinodeXRT.fits")) assert isinstance(xrt, sunpy.map.sources.XRTMap) # TODO: Test SXTMap
38.660633
94
0.628394
import os import tempfile import pathlib import pytest import numpy as np from astropy.io import fits from astropy.wcs import WCS import sunpy import sunpy.map import sunpy.data.test filepath = sunpy.data.test.rootdir a_list_of_many = [os.fspath(f) for f in pathlib.Path(filepath, "EIT").glob("*")] a_fname = a_list_of_many[0] AIA_171_IMAGE = os.path.join(filepath, 'aia_171_level1.fits') RHESSI_IMAGE = os.path.join(filepath, 'hsi_image_20101016_191218.fits') class TestMap: def test_mapsequence(self): sequence = sunpy.map.Map(a_list_of_many, sequence=True) assert isinstance(sequence, sunpy.map.MapSequence) def test_composite(self): comp = sunpy.map.Map(AIA_171_IMAGE, RHESSI_IMAGE, composite=True) assert isinstance(comp, sunpy.map.CompositeMap) def test_patterns(self): eitmap = sunpy.map.Map(a_fname) assert isinstance(eitmap, sunpy.map.GenericMap) directory = pathlib.Path(filepath, "EIT") maps = sunpy.map.Map(os.fspath(directory)) assert isinstance(maps, list) assert ([isinstance(amap, sunpy.map.GenericMap) for amap in maps]) files_sorted = sorted(list(directory.glob('*'))) maps_sorted = [sunpy.map.Map(os.fspath(f)) for f in files_sorted] assert all([m.date == m_s.date for m, m_s in zip(maps, maps_sorted)]) path = pathlib.Path(a_fname) eitmap = sunpy.map.Map(path) assert isinstance(eitmap, sunpy.map.GenericMap) maps = sunpy.map.Map(directory) assert isinstance(maps, list) assert ([isinstance(amap, sunpy.map.GenericMap) for amap in maps]) pattern = os.path.join(filepath, "EIT", "*") maps = sunpy.map.Map(pattern) assert isinstance(maps, list) assert ([isinstance(amap, sunpy.map.GenericMap) for amap in maps]) files_sorted = sorted(list(pathlib.Path(pattern).parent.glob('*'))) maps_sorted = [sunpy.map.Map(os.fspath(f)) for f in files_sorted] assert all([m.date == m_s.date for m, m_s in zip(maps, maps_sorted)]) pattern = os.path.join(filepath, "EIT", "efz20040301.0?0010_s.fits") maps = sunpy.map.Map(pattern) assert isinstance(maps, list) assert len(maps) == 7 assert ([isinstance(amap, sunpy.map.GenericMap) for amap in maps]) pattern = os.path.join(filepath, "EIT", "efz20040301.0[2-6]0010_s.fits") maps = sunpy.map.Map(pattern) assert isinstance(maps, list) assert len(maps) == 4 assert ([isinstance(amap, sunpy.map.GenericMap) for amap in maps]) amap = sunpy.map.Map(maps[0]) assert isinstance(amap, sunpy.map.GenericMap) maps = sunpy.map.Map(a_list_of_many) assert isinstance(maps, list) assert ([isinstance(amap, sunpy.map.GenericMap) for amap in maps]) pair_map = sunpy.map.Map((amap.data, amap.meta)) assert isinstance(pair_map, sunpy.map.GenericMap) pair_map = sunpy.map.Map(amap.data, amap.meta) assert isinstance(pair_map, sunpy.map.GenericMap) pair_map = sunpy.map.Map((amap.data, WCS(AIA_171_IMAGE))) assert isinstance(pair_map, sunpy.map.GenericMap) pair_map = sunpy.map.Map(amap.data, WCS(AIA_171_IMAGE)) assert isinstance(pair_map, sunpy.map.GenericMap) with fits.open(a_fname) as hdul: data = hdul[0].data header = hdul[0].header pair_map = sunpy.map.Map((data, header)) assert isinstance(pair_map, sunpy.map.GenericMap) pair_map, pair_map = sunpy.map.Map(((data, header), (data, header))) assert isinstance(pair_map, sunpy.map.GenericMap) pair_map = sunpy.map.Map(data, header) assert isinstance(pair_map, sunpy.map.GenericMap) data = np.arange(0, 100).reshape(10, 10) header = {'cdelt1': 10, 'cdelt2': 10, 'telescop': 'sunpy', 'cunit1': 'arcsec', 'cunit2': 'arcsec'} pair_map = sunpy.map.Map(data, header) assert isinstance(pair_map, sunpy.map.GenericMap) def test_dask_array(self): dask_array = pytest.importorskip('dask.array') amap = sunpy.map.Map(AIA_171_IMAGE) da = dask_array.from_array(amap.data, chunks=(1, 1)) pair_map = sunpy.map.Map(da, amap.meta) assert isinstance(pair_map, sunpy.map.GenericMap) def test_databaseentry(self): sqlalchemy = pytest.importorskip('sqlalchemy') sunpy_database = pytest.importorskip('sunpy.database') db = sunpy_database.Database(url='sqlite://', default_waveunit='angstrom') db.add_from_file(a_fname) res = db.get_entry_by_id(1) db_map = sunpy.map.Map(res) assert isinstance(db_map, sunpy.map.GenericMap) @pytest.mark.remote_data def test_url_pattern(self): amap = sunpy.map.Map("http://data.sunpy.org/sample-data/AIA20110319_105400_0171.fits") assert isinstance(amap, sunpy.map.GenericMap) def test_save(self): eitmap = sunpy.map.Map(a_fname) afilename = tempfile.NamedTemporaryFile(suffix='fits').name eitmap.save(afilename, filetype='fits', overwrite=True) backin = sunpy.map.Map(afilename) assert isinstance(backin, sunpy.map.sources.EITMap) def test_sdo(self): aia = sunpy.map.Map(AIA_171_IMAGE) assert isinstance(aia, sunpy.map.sources.AIAMap) def test_soho(self): eit = sunpy.map.Map(os.path.join(filepath, "EIT", "efz20040301.000010_s.fits")) assert isinstance(eit, sunpy.map.sources.EITMap) lasco = sunpy.map.Map(os.path.join(filepath, "lasco_c2_25299383_s.fts")) assert isinstance(lasco, sunpy.map.sources.LASCOMap) mdi_c = sunpy.map.Map(os.path.join(filepath, "mdi_fd_Ic_6h_01d.5871.0000_s.fits")) assert isinstance(mdi_c, sunpy.map.sources.MDIMap) mdi_m = sunpy.map.Map(os.path.join(filepath, "mdi_fd_M_96m_01d.5874.0005_s.fits")) assert isinstance(mdi_m, sunpy.map.sources.MDIMap) def test_stereo(self): euvi = sunpy.map.Map(os.path.join(filepath, "euvi_20090615_000900_n4euA_s.fts")) assert isinstance(euvi, sunpy.map.sources.EUVIMap) cor = sunpy.map.Map(os.path.join(filepath, "cor1_20090615_000500_s4c1A.fts")) assert isinstance(cor, sunpy.map.sources.CORMap) hi = sunpy.map.Map(os.path.join(filepath, "hi_20110910_114721_s7h2A.fts")) assert isinstance(hi, sunpy.map.sources.HIMap) def test_rhessi(self): rhessi = sunpy.map.Map(RHESSI_IMAGE) assert isinstance(rhessi, sunpy.map.sources.RHESSIMap) def test_sot(self): sot = sunpy.map.Map(os.path.join(filepath, "FGMG4_20110214_030443.7.fits")) assert isinstance(sot, sunpy.map.sources.SOTMap) def test_swap(self): swap = sunpy.map.Map(os.path.join(filepath, "swap_lv1_20140606_000113.fits")) assert isinstance(swap, sunpy.map.sources.SWAPMap) def test_xrt(self): xrt = sunpy.map.Map(os.path.join(filepath, "HinodeXRT.fits")) assert isinstance(xrt, sunpy.map.sources.XRTMap)
true
true
f7f98051be59a9ce5dfd5c781777950cb599deef
492
py
Python
conv_serial.py
gpu0/nnet
0fd5c718c2d03cab91d4a4fd4963b12df241a9de
[ "MIT" ]
null
null
null
conv_serial.py
gpu0/nnet
0fd5c718c2d03cab91d4a4fd4963b12df241a9de
[ "MIT" ]
null
null
null
conv_serial.py
gpu0/nnet
0fd5c718c2d03cab91d4a4fd4963b12df241a9de
[ "MIT" ]
null
null
null
import multiprocessing import numpy as np numThreads = 8 numRows = 32000 numCols = 3 numOut = 2 stride = numRows / numThreads X = np.ones((numRows, numCols)) W = np.ones((numCols, numOut)) B = np.ones((numRows, numOut)) def conv(idx): for i in range(100000): X[idx*stride:idx*stride+stride].dot(W) + B[idx*stride:idx*stride+stride] return X[idx*stride:idx*stride+stride].dot(W) + B[idx*stride:idx*stride+stride] if __name__=='__main__': for i in range(numThreads): conv(i)
21.391304
81
0.697154
import multiprocessing import numpy as np numThreads = 8 numRows = 32000 numCols = 3 numOut = 2 stride = numRows / numThreads X = np.ones((numRows, numCols)) W = np.ones((numCols, numOut)) B = np.ones((numRows, numOut)) def conv(idx): for i in range(100000): X[idx*stride:idx*stride+stride].dot(W) + B[idx*stride:idx*stride+stride] return X[idx*stride:idx*stride+stride].dot(W) + B[idx*stride:idx*stride+stride] if __name__=='__main__': for i in range(numThreads): conv(i)
true
true
f7f980870d9219f3d403b290299070d59e3a0261
6,279
py
Python
tests/contrib/operators/test_mssql_to_gcs_operator.py
is2co/airflow
48f400541d19601d1571d07cf65f55c649884b87
[ "Apache-2.0" ]
2
2020-10-12T05:21:27.000Z
2021-07-07T09:23:47.000Z
tests/contrib/operators/test_mssql_to_gcs_operator.py
is2co/airflow
48f400541d19601d1571d07cf65f55c649884b87
[ "Apache-2.0" ]
3
2021-03-11T06:46:16.000Z
2021-09-29T17:48:20.000Z
tests/contrib/operators/test_mssql_to_gcs_operator.py
is2co/airflow
48f400541d19601d1571d07cf65f55c649884b87
[ "Apache-2.0" ]
1
2019-08-21T10:13:08.000Z
2019-08-21T10:13:08.000Z
# -*- coding: utf-8 -*- # # Licensed to the Apache Software Foundation (ASF) under one # or more contributor license agreements. See the NOTICE file # distributed with this work for additional information # regarding copyright ownership. The ASF licenses this file # to you under the Apache License, Version 2.0 (the # "License"); you may not use this file except in compliance # with the License. You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, # software distributed under the License is distributed on an # "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY # KIND, either express or implied. See the License for the # specific language governing permissions and limitations # under the License. import unittest from airflow.contrib.operators.mssql_to_gcs import \ MsSqlToGoogleCloudStorageOperator from tests.compat import mock TASK_ID = 'test-mssql-to-gcs' MSSQL_CONN_ID = 'mssql_conn_test' SQL = 'select 1' BUCKET = 'gs://test' JSON_FILENAME = 'test_{}.ndjson' GZIP = False ROWS = [ ('mock_row_content_1', 42), ('mock_row_content_2', 43), ('mock_row_content_3', 44) ] CURSOR_DESCRIPTION = ( ('some_str', 0, None, None, None, None, None), ('some_num', 3, None, None, None, None, None) ) NDJSON_LINES = [ b'{"some_num": 42, "some_str": "mock_row_content_1"}\n', b'{"some_num": 43, "some_str": "mock_row_content_2"}\n', b'{"some_num": 44, "some_str": "mock_row_content_3"}\n' ] SCHEMA_FILENAME = 'schema_test.json' SCHEMA_JSON = [ b'[{"mode": "NULLABLE", "name": "some_str", "type": "STRING"}, ', b'{"mode": "NULLABLE", "name": "some_num", "type": "INTEGER"}]' ] class MsSqlToGoogleCloudStorageOperatorTest(unittest.TestCase): def test_init(self): """Test MySqlToGoogleCloudStorageOperator instance is properly initialized.""" op = MsSqlToGoogleCloudStorageOperator( task_id=TASK_ID, sql=SQL, bucket=BUCKET, filename=JSON_FILENAME) self.assertEqual(op.task_id, TASK_ID) self.assertEqual(op.sql, SQL) self.assertEqual(op.bucket, BUCKET) self.assertEqual(op.filename, JSON_FILENAME) @mock.patch('airflow.contrib.operators.mssql_to_gcs.MsSqlHook') @mock.patch('airflow.contrib.operators.sql_to_gcs.GoogleCloudStorageHook') def test_exec_success_json(self, gcs_hook_mock_class, mssql_hook_mock_class): """Test successful run of execute function for JSON""" op = MsSqlToGoogleCloudStorageOperator( task_id=TASK_ID, mssql_conn_id=MSSQL_CONN_ID, sql=SQL, bucket=BUCKET, filename=JSON_FILENAME) mssql_hook_mock = mssql_hook_mock_class.return_value mssql_hook_mock.get_conn().cursor().__iter__.return_value = iter(ROWS) mssql_hook_mock.get_conn().cursor().description = CURSOR_DESCRIPTION gcs_hook_mock = gcs_hook_mock_class.return_value def _assert_upload(bucket, obj, tmp_filename, mime_type=None, gzip=False): self.assertEqual(BUCKET, bucket) self.assertEqual(JSON_FILENAME.format(0), obj) self.assertEqual('application/json', mime_type) self.assertEqual(GZIP, gzip) with open(tmp_filename, 'rb') as file: self.assertEqual(b''.join(NDJSON_LINES), file.read()) gcs_hook_mock.upload.side_effect = _assert_upload op.execute(None) mssql_hook_mock_class.assert_called_once_with(mssql_conn_id=MSSQL_CONN_ID) mssql_hook_mock.get_conn().cursor().execute.assert_called_once_with(SQL) @mock.patch('airflow.contrib.operators.mssql_to_gcs.MsSqlHook') @mock.patch('airflow.contrib.operators.sql_to_gcs.GoogleCloudStorageHook') def test_file_splitting(self, gcs_hook_mock_class, mssql_hook_mock_class): """Test that ndjson is split by approx_max_file_size_bytes param.""" mssql_hook_mock = mssql_hook_mock_class.return_value mssql_hook_mock.get_conn().cursor().__iter__.return_value = iter(ROWS) mssql_hook_mock.get_conn().cursor().description = CURSOR_DESCRIPTION gcs_hook_mock = gcs_hook_mock_class.return_value expected_upload = { JSON_FILENAME.format(0): b''.join(NDJSON_LINES[:2]), JSON_FILENAME.format(1): NDJSON_LINES[2], } def _assert_upload(bucket, obj, tmp_filename, mime_type=None, gzip=False): self.assertEqual(BUCKET, bucket) self.assertEqual('application/json', mime_type) self.assertEqual(GZIP, gzip) with open(tmp_filename, 'rb') as file: self.assertEqual(expected_upload[obj], file.read()) gcs_hook_mock.upload.side_effect = _assert_upload op = MsSqlToGoogleCloudStorageOperator( task_id=TASK_ID, sql=SQL, bucket=BUCKET, filename=JSON_FILENAME, approx_max_file_size_bytes=len(expected_upload[JSON_FILENAME.format(0)])) op.execute(None) @mock.patch('airflow.contrib.operators.mssql_to_gcs.MsSqlHook') @mock.patch('airflow.contrib.operators.sql_to_gcs.GoogleCloudStorageHook') def test_schema_file(self, gcs_hook_mock_class, mssql_hook_mock_class): """Test writing schema files.""" mssql_hook_mock = mssql_hook_mock_class.return_value mssql_hook_mock.get_conn().cursor().__iter__.return_value = iter(ROWS) mssql_hook_mock.get_conn().cursor().description = CURSOR_DESCRIPTION gcs_hook_mock = gcs_hook_mock_class.return_value def _assert_upload(bucket, obj, tmp_filename, mime_type, gzip): # pylint: disable=unused-argument if obj == SCHEMA_FILENAME: with open(tmp_filename, 'rb') as file: self.assertEqual(b''.join(SCHEMA_JSON), file.read()) gcs_hook_mock.upload.side_effect = _assert_upload op = MsSqlToGoogleCloudStorageOperator( task_id=TASK_ID, sql=SQL, bucket=BUCKET, filename=JSON_FILENAME, schema_filename=SCHEMA_FILENAME) op.execute(None) # once for the file and once for the schema self.assertEqual(2, gcs_hook_mock.upload.call_count)
40.509677
106
0.691352
import unittest from airflow.contrib.operators.mssql_to_gcs import \ MsSqlToGoogleCloudStorageOperator from tests.compat import mock TASK_ID = 'test-mssql-to-gcs' MSSQL_CONN_ID = 'mssql_conn_test' SQL = 'select 1' BUCKET = 'gs://test' JSON_FILENAME = 'test_{}.ndjson' GZIP = False ROWS = [ ('mock_row_content_1', 42), ('mock_row_content_2', 43), ('mock_row_content_3', 44) ] CURSOR_DESCRIPTION = ( ('some_str', 0, None, None, None, None, None), ('some_num', 3, None, None, None, None, None) ) NDJSON_LINES = [ b'{"some_num": 42, "some_str": "mock_row_content_1"}\n', b'{"some_num": 43, "some_str": "mock_row_content_2"}\n', b'{"some_num": 44, "some_str": "mock_row_content_3"}\n' ] SCHEMA_FILENAME = 'schema_test.json' SCHEMA_JSON = [ b'[{"mode": "NULLABLE", "name": "some_str", "type": "STRING"}, ', b'{"mode": "NULLABLE", "name": "some_num", "type": "INTEGER"}]' ] class MsSqlToGoogleCloudStorageOperatorTest(unittest.TestCase): def test_init(self): op = MsSqlToGoogleCloudStorageOperator( task_id=TASK_ID, sql=SQL, bucket=BUCKET, filename=JSON_FILENAME) self.assertEqual(op.task_id, TASK_ID) self.assertEqual(op.sql, SQL) self.assertEqual(op.bucket, BUCKET) self.assertEqual(op.filename, JSON_FILENAME) @mock.patch('airflow.contrib.operators.mssql_to_gcs.MsSqlHook') @mock.patch('airflow.contrib.operators.sql_to_gcs.GoogleCloudStorageHook') def test_exec_success_json(self, gcs_hook_mock_class, mssql_hook_mock_class): op = MsSqlToGoogleCloudStorageOperator( task_id=TASK_ID, mssql_conn_id=MSSQL_CONN_ID, sql=SQL, bucket=BUCKET, filename=JSON_FILENAME) mssql_hook_mock = mssql_hook_mock_class.return_value mssql_hook_mock.get_conn().cursor().__iter__.return_value = iter(ROWS) mssql_hook_mock.get_conn().cursor().description = CURSOR_DESCRIPTION gcs_hook_mock = gcs_hook_mock_class.return_value def _assert_upload(bucket, obj, tmp_filename, mime_type=None, gzip=False): self.assertEqual(BUCKET, bucket) self.assertEqual(JSON_FILENAME.format(0), obj) self.assertEqual('application/json', mime_type) self.assertEqual(GZIP, gzip) with open(tmp_filename, 'rb') as file: self.assertEqual(b''.join(NDJSON_LINES), file.read()) gcs_hook_mock.upload.side_effect = _assert_upload op.execute(None) mssql_hook_mock_class.assert_called_once_with(mssql_conn_id=MSSQL_CONN_ID) mssql_hook_mock.get_conn().cursor().execute.assert_called_once_with(SQL) @mock.patch('airflow.contrib.operators.mssql_to_gcs.MsSqlHook') @mock.patch('airflow.contrib.operators.sql_to_gcs.GoogleCloudStorageHook') def test_file_splitting(self, gcs_hook_mock_class, mssql_hook_mock_class): mssql_hook_mock = mssql_hook_mock_class.return_value mssql_hook_mock.get_conn().cursor().__iter__.return_value = iter(ROWS) mssql_hook_mock.get_conn().cursor().description = CURSOR_DESCRIPTION gcs_hook_mock = gcs_hook_mock_class.return_value expected_upload = { JSON_FILENAME.format(0): b''.join(NDJSON_LINES[:2]), JSON_FILENAME.format(1): NDJSON_LINES[2], } def _assert_upload(bucket, obj, tmp_filename, mime_type=None, gzip=False): self.assertEqual(BUCKET, bucket) self.assertEqual('application/json', mime_type) self.assertEqual(GZIP, gzip) with open(tmp_filename, 'rb') as file: self.assertEqual(expected_upload[obj], file.read()) gcs_hook_mock.upload.side_effect = _assert_upload op = MsSqlToGoogleCloudStorageOperator( task_id=TASK_ID, sql=SQL, bucket=BUCKET, filename=JSON_FILENAME, approx_max_file_size_bytes=len(expected_upload[JSON_FILENAME.format(0)])) op.execute(None) @mock.patch('airflow.contrib.operators.mssql_to_gcs.MsSqlHook') @mock.patch('airflow.contrib.operators.sql_to_gcs.GoogleCloudStorageHook') def test_schema_file(self, gcs_hook_mock_class, mssql_hook_mock_class): mssql_hook_mock = mssql_hook_mock_class.return_value mssql_hook_mock.get_conn().cursor().__iter__.return_value = iter(ROWS) mssql_hook_mock.get_conn().cursor().description = CURSOR_DESCRIPTION gcs_hook_mock = gcs_hook_mock_class.return_value def _assert_upload(bucket, obj, tmp_filename, mime_type, gzip): if obj == SCHEMA_FILENAME: with open(tmp_filename, 'rb') as file: self.assertEqual(b''.join(SCHEMA_JSON), file.read()) gcs_hook_mock.upload.side_effect = _assert_upload op = MsSqlToGoogleCloudStorageOperator( task_id=TASK_ID, sql=SQL, bucket=BUCKET, filename=JSON_FILENAME, schema_filename=SCHEMA_FILENAME) op.execute(None) self.assertEqual(2, gcs_hook_mock.upload.call_count)
true
true
f7f9812cea08e9a63697df520d7b14ad0213b115
238
py
Python
examples/whitenoise.py
ianling/wavebender
df66a466a73f609a5b71700836f7f344bda409de
[ "MIT" ]
null
null
null
examples/whitenoise.py
ianling/wavebender
df66a466a73f609a5b71700836f7f344bda409de
[ "MIT" ]
null
null
null
examples/whitenoise.py
ianling/wavebender
df66a466a73f609a5b71700836f7f344bda409de
[ "MIT" ]
null
null
null
#!/usr/bin/env python3 from sys import stdout from wavebender import * channels = ((white_noise(amplitude=0.1),),) samples = compute_samples(channels, 44100 * 60 * 1) write_wavefile(stdout.buffer, samples, 44100 * 60 * 1, nchannels=1)
23.8
67
0.731092
from sys import stdout from wavebender import * channels = ((white_noise(amplitude=0.1),),) samples = compute_samples(channels, 44100 * 60 * 1) write_wavefile(stdout.buffer, samples, 44100 * 60 * 1, nchannels=1)
true
true
f7f981d8ac7649d2cb17c4e71307cebdafe2372d
430
py
Python
day030/key-error-handling/main.py
rainleander/100daysofcode
0391170af80b251e7fb3a78a60b55c3145e4551a
[ "Apache-2.0" ]
8
2021-01-25T09:14:41.000Z
2021-11-24T12:29:26.000Z
day030/key-error-handling/main.py
rainleander/100daysofcode
0391170af80b251e7fb3a78a60b55c3145e4551a
[ "Apache-2.0" ]
null
null
null
day030/key-error-handling/main.py
rainleander/100daysofcode
0391170af80b251e7fb3a78a60b55c3145e4551a
[ "Apache-2.0" ]
null
null
null
facebook_posts = [ {'Likes': 21, 'Comments': 2}, {'Likes': 13, 'Comments': 2, 'Shares': 1}, {'Likes': 33, 'Comments': 8, 'Shares': 3}, {'Comments': 4, 'Shares': 2}, {'Comments': 1, 'Shares': 1}, {'Likes': 19, 'Comments': 3} ] total_likes = 0 for post in facebook_posts: try: total_likes = total_likes + post['Likes'] except KeyError: total_likes = total_likes print(total_likes)
22.631579
49
0.569767
facebook_posts = [ {'Likes': 21, 'Comments': 2}, {'Likes': 13, 'Comments': 2, 'Shares': 1}, {'Likes': 33, 'Comments': 8, 'Shares': 3}, {'Comments': 4, 'Shares': 2}, {'Comments': 1, 'Shares': 1}, {'Likes': 19, 'Comments': 3} ] total_likes = 0 for post in facebook_posts: try: total_likes = total_likes + post['Likes'] except KeyError: total_likes = total_likes print(total_likes)
true
true
f7f9821a027108b6432d49abb278aa65fe04225e
1,604
py
Python
pylibssh/event.py
arisada/pylibssh
7110499e1463f4edc24e8f2736b2d71f5c34a0ae
[ "BSD-3-Clause" ]
1
2017-03-28T12:23:11.000Z
2017-03-28T12:23:11.000Z
pylibssh/event.py
arisada/pylibssh
7110499e1463f4edc24e8f2736b2d71f5c34a0ae
[ "BSD-3-Clause" ]
null
null
null
pylibssh/event.py
arisada/pylibssh
7110499e1463f4edc24e8f2736b2d71f5c34a0ae
[ "BSD-3-Clause" ]
null
null
null
from . import api from api import lib class EventFdCallbacks(object): fd = None def __init__ (self, fd): self.fd = fd def pollEvent(self, fd, revent): if(self.fd.fileno() != fd): raise RuntimeException("Different fd in callbacks") if (revent & select.POLLIN): self.pollInEvent() if (revent & select.POLLERR): self.pollErrEvent() if (revent & select.POLLOUT): self.pollOutEvent() return 0 def pollInEvent(self): pass def pollOutEvent(self): pass def pollErrEvent(self): pass def _event_function(fd, revent, userargp): return userargp.pollEvent(fd, revent) _event_cb_object = api.event_cb(_event_function) class Event(object): event = None def __init__(self): self.event = lib.ssh_event_new() def __del__(self): if (self.event is not None): lib.ssh_event_free(self.event) self.event=None def addSession(self, session): lib.ssh_event_add_session(self.event, session.session) def removeSession(self, session): lib.ssh_event_remove_session(self.event, session.session) def doPoll(self, timeout=-1): rc = lib.ssh_event_dopoll(self.event, timeout) if (rc == SSH_ERROR): raise RuntimeError("event_dopoll failed") return rc def addFd(self, fdcallback, events): lib.ssh_event_add_fd(self.event, fdcallback.fd.fileno(), events, _event_cb_object, fdcallback) def removeFd(self, fd): lib.ssh_event_remove_fd(self.event, fd)
30.846154
102
0.63404
from . import api from api import lib class EventFdCallbacks(object): fd = None def __init__ (self, fd): self.fd = fd def pollEvent(self, fd, revent): if(self.fd.fileno() != fd): raise RuntimeException("Different fd in callbacks") if (revent & select.POLLIN): self.pollInEvent() if (revent & select.POLLERR): self.pollErrEvent() if (revent & select.POLLOUT): self.pollOutEvent() return 0 def pollInEvent(self): pass def pollOutEvent(self): pass def pollErrEvent(self): pass def _event_function(fd, revent, userargp): return userargp.pollEvent(fd, revent) _event_cb_object = api.event_cb(_event_function) class Event(object): event = None def __init__(self): self.event = lib.ssh_event_new() def __del__(self): if (self.event is not None): lib.ssh_event_free(self.event) self.event=None def addSession(self, session): lib.ssh_event_add_session(self.event, session.session) def removeSession(self, session): lib.ssh_event_remove_session(self.event, session.session) def doPoll(self, timeout=-1): rc = lib.ssh_event_dopoll(self.event, timeout) if (rc == SSH_ERROR): raise RuntimeError("event_dopoll failed") return rc def addFd(self, fdcallback, events): lib.ssh_event_add_fd(self.event, fdcallback.fd.fileno(), events, _event_cb_object, fdcallback) def removeFd(self, fd): lib.ssh_event_remove_fd(self.event, fd)
true
true
f7f98225c32f97b3bf539de83c54ea5542da77c6
862
py
Python
switch_model/wecc/get_inputs/post_process_steps/reserve_technologies.py
REAM-lab/switch
00af4508e34bdc460925950808dc7f87a0a064ff
[ "ECL-2.0", "Apache-2.0" ]
4
2021-06-03T00:23:57.000Z
2022-02-05T13:51:00.000Z
switch_model/wecc/get_inputs/post_process_steps/reserve_technologies.py
REAM-lab/switch
00af4508e34bdc460925950808dc7f87a0a064ff
[ "ECL-2.0", "Apache-2.0" ]
61
2021-05-07T23:46:20.000Z
2022-02-17T01:19:17.000Z
switch_model/wecc/get_inputs/post_process_steps/reserve_technologies.py
RAEL-Berkeley/switch
00af4508e34bdc460925950808dc7f87a0a064ff
[ "ECL-2.0", "Apache-2.0" ]
4
2018-02-05T02:01:01.000Z
2020-11-17T22:14:26.000Z
""" This post-process selects which technologies can provide reserves""" # Standard packages import os import shutil # Third-party packages import pandas as pd from switch_model.wecc.get_inputs.register_post_process import post_process_step @post_process_step( msg="Removing fossil fuels from reserves.", ) def post_process(_): """This function sets to zero the column that allows each candidate technology to provide""" fname = "generation_projects_info.csv" df = pd.read_csv(fname) # Energy sources to exclude from reserves filter_techs = ["ResidualFuelOil", "Gas", "DistillateFuelOil", "Coal"] # Set to zero column that allows technology to provide reserves df.loc[ df["gen_energy_source"].isin(filter_techs), "gen_can_provide_cap_reserves" ] = 0 # Save file again df.to_csv(fname, index=False)
26.9375
85
0.733179
import os import shutil import pandas as pd from switch_model.wecc.get_inputs.register_post_process import post_process_step @post_process_step( msg="Removing fossil fuels from reserves.", ) def post_process(_): fname = "generation_projects_info.csv" df = pd.read_csv(fname) filter_techs = ["ResidualFuelOil", "Gas", "DistillateFuelOil", "Coal"] df.loc[ df["gen_energy_source"].isin(filter_techs), "gen_can_provide_cap_reserves" ] = 0 df.to_csv(fname, index=False)
true
true
f7f982fdde0a534d0ccd114800ec898f43ca4ea5
365
py
Python
mmpose/utils/collect_env.py
jlgzb/mmpose
0ecf06e3580f141f6ab44645768a0d6d8ba48383
[ "Apache-2.0" ]
367
2022-01-14T03:32:25.000Z
2022-03-31T04:48:20.000Z
mmpose/utils/collect_env.py
jlgzb/mmpose
0ecf06e3580f141f6ab44645768a0d6d8ba48383
[ "Apache-2.0" ]
27
2022-01-27T07:12:49.000Z
2022-03-31T04:31:13.000Z
mmpose/utils/collect_env.py
jlgzb/mmpose
0ecf06e3580f141f6ab44645768a0d6d8ba48383
[ "Apache-2.0" ]
53
2022-01-18T11:21:43.000Z
2022-03-31T06:42:41.000Z
from mmcv.utils import collect_env as collect_basic_env from mmcv.utils import get_git_hash import mmpose def collect_env(): env_info = collect_basic_env() env_info['MMPose'] = (mmpose.__version__ + '+' + get_git_hash(digits=7)) return env_info if __name__ == '__main__': for name, val in collect_env().items(): print(f'{name}: {val}')
22.8125
76
0.69589
from mmcv.utils import collect_env as collect_basic_env from mmcv.utils import get_git_hash import mmpose def collect_env(): env_info = collect_basic_env() env_info['MMPose'] = (mmpose.__version__ + '+' + get_git_hash(digits=7)) return env_info if __name__ == '__main__': for name, val in collect_env().items(): print(f'{name}: {val}')
true
true
f7f983c8808f2a82989a8ce0a5fa7c82b51eb0e7
27,077
py
Python
Python Simulator/Frontier Exploration/backup/1 (initial backup)/Faigl.py
yiorgosk/Path-Planning-Simulator
84847d0068a3fd6fa30098b99a75dff237768a73
[ "MIT" ]
50
2018-11-15T08:42:49.000Z
2022-03-20T10:51:58.000Z
Python Simulator/Frontier Exploration/backup/1 (initial backup)/Faigl.py
yiorgosk/Path-Planning-Simulator
84847d0068a3fd6fa30098b99a75dff237768a73
[ "MIT" ]
null
null
null
Python Simulator/Frontier Exploration/backup/1 (initial backup)/Faigl.py
yiorgosk/Path-Planning-Simulator
84847d0068a3fd6fa30098b99a75dff237768a73
[ "MIT" ]
24
2019-02-03T06:11:58.000Z
2022-03-15T06:18:39.000Z
# The MIT License (MIT) # Copyright (c) 2015 INSPIRE Lab, BITS Pilani # Permission is hereby granted, free of charge, to any person obtaining a copy # of this software and associated documentation files (the "Software"), to deal # in the Software without restriction, including without limitation the rights # to use, copy, modify, merge, publish, distribute, sublicense, and/or sell # copies of the Software, and to permit persons to whom the Software is # furnished to do so, subject to the following conditions: # The above copyright notice and this permission notice shall be included in all # copies or substantial portions of the Software. # THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR # IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, # FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE # AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER # LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, # OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE # SOFTWARE. """ Provides an implementation of the Frontier Clustering algorithm. """ import math import random import sys import time import AStar import Cluster import GridWorld import Hungarian import kmeans import Robot from collections import defaultdict from tsp_solver.greedy import solve_tsp # The Faigl class class Faigl: """ height and width specify the dimensions of the environment obstacles is a list of locations which are to be initialized as obstacles R specifies the range of communication numRobots specifies the number of robot objects to be initialized initLocs specifies the initial locations for each of the robots k specifies the size of the population of configuration changes T specifies the number of time steps to run the simulation for base specifies the coordinates of the base station """ def __init__(self, height, width, obstacles, numRobots, initLocs, T = 10): # Initialize the grid world self.gridworld = GridWorld.GridWorld(height, width, obstacles) self.centroid = [] self.cluster = kmeans.kmeans() # Initialize a list of robots self.robots = [Robot.Robot(j+1, -1, -1) for j in range(numRobots)] # Initialize the starting location of each robot i = 0 #self.allotted=Cell.Cell(0,0) for initLoc in initLocs: # If any robot is placed out of bounds or on an obstacle, print an error message and exit currentPoint = (initLoc[0], initLoc[1]) if not self.gridworld.inBounds(currentPoint) or not self.gridworld.passable(currentPoint): print 'Initial location', currentPoint, 'is not possible' sys.exit(-1) # Otherwise, modify the current location of the robot to currentPoint self.robots[i].setLocation(initLoc[0], initLoc[1]) # Update that particular grid cell's occupied status self.gridworld.cells[initLoc[0]][initLoc[1]].occupied = True self.gridworld.cells[initLoc[0]][initLoc[1]].visited = True i += 1 # Initialize other parameters of the algorithm # Height of the Grid self.height = height # Width of the Grid self.width = width # List of Clusters (obtained using K-Means clustering) self.frontierClusters=[] # Number of Robots self.numRobots = numRobots # Parameter for adaptive K-Means self.K = self.numRobots # Time steps for which the algorithm is run self.T = T # Variable to indicate whether reclustering should be performed self.reclusterFlag = True # Centroids of clusters self.centroids = [] # Number of time steps elapsed self.t = 0 # Time taken to exhaust the frontier self.completionTime = 0 # Set to True on completion self.completedFlag = False # List of Frontier Cells self.frontier = [] # New Positions of each of the Robots self.newPos = [] # Population of Configuration Changes self.cfgc = [] # Number of Stalls (Used only for simulating Rooker's work) self.stalls = 0 # Keeps track of whether the Final Stats were displayed self.printedFinalStats = False # Keeps track of Possible Configurations self.possible = [] # Keeps track of Number of Cells Visited # (Initialize this to self.numRobots, since the starting locations of the robots are considered visited) self.visited = self.numRobots self.sumNewVisited = numRobots # Flag to switch between A* and Manhattan distance self.aStarFlag = False # Define value for infinity self.infinity = 10000000 # Flag to switch between Hungarian and Greedy assignment self.hungarianFlag = True # Flag to switch between Greedy and Random Motion Planner self.randomMotionPlan = False # Variable to store the number of robots that do not make a move in the current iteration self.currentEights = 0 # Variable to store the total number of moves made by the robots self.totalMoves = 0 # Variable to store the volume of cells allocated self.volume = 0 # Variable to store the percentage of allotted cells explored self.exploredCells = 0 # Variable to store the number of times clustering occurred self.timesClustered = 0 # Defines the threshold percentage self.thresholdPercentage = 1.0 # Flag to determine if reallocation is required self.reallocateFlag = False # Flag to determine if printing of logs is required self.printLog = False # We also initialize an instance of AStar, which helps us in computing Manhattan distance self.astar = AStar.AStar() # Method to print the current gridworld to the output descriptor def printGrid(self): ## Comment this later frontier = self.computeFrontier() ## print 'occupied cells:' for i in range(self.height): for j in range(self.width): if self.gridworld.cells[i][j].occupied == True: print i, j print 'robot locations:' for robot in self.robots: print robot.curX, robot.curY for i in range(self.height): for j in range(self.width): # If the current cell is an obstacle, print # if self.gridworld.cells[i][j].obstacle == True: sys.stdout.write(' # ') # If the current cell is occupied by a robot, print its id elif self.gridworld.cells[i][j].occupied == True: robotId = 0 for robot in self.robots: if robot.curX == i and robot.curY == j: robotId = robot.id temp = ' ' + str(robotId) + ' ' sys.stdout.write(temp) # If the current cell is a frontier, print a | elif (i, j) in frontier: sys.stdout.write(' | ') # Otherwise, print - else: if self.gridworld.cells[i][j].visited == True: sys.stdout.write(' . ') else: sys.stdout.write(' - ') sys.stdout.write('\n') # Method to print the status of each cell to the output descriptor def printVisitedStatus(self): visited = 0 visitable = self.height * self.width for i in range(self.height): for j in range(self.width): # If the current cell is an obstacle, print # if self.gridworld.cells[i][j].visited == True: sys.stdout.write(' 1 ') visited += 1 # If the current cell is a frontier, print a | else: sys.stdout.write(' 0 ') if self.gridworld.cells[i][j].obstacle == True: visitable -= 1 sys.stdout.write('\n') print 'visited:', visited, ' of ', visitable print 'stalls:', self.stalls return self.completionTime # Method to print the final statistics to the output descriptor # The final stats should be printed only once # i.e., either when T steps have elapsed or when the frontier is empty def printFinalStats(self, force = 0): # if self.t != self.T: # if self.completedFlag == False or self.printedFinalStats == True: # return # print 'Time taken:', self.t visitednow=0 visitable = self.height * self.width for i in range(self.height): for j in range(self.width): # If the current cell is an obstacle, print # if self.gridworld.cells[i][j].visited == True: visitednow += 1 # If the current cell is a frontier, print a | else: if self.gridworld.cells[i][j].obstacle == True: visitable -= 1 metric = self.visited / visitable # print (visitednow - self.visited) if self.printLog == True: print 'visitednow', visitednow ## redundancy = (self.numRobots - self.currentEights) - (visitednow - self.visited) if self.printLog == True: print 'redundancy:', redundancy ## # print self.currentEights self.exploredCells += (visitednow - self.visited) self.visited = visitednow numMoves = self.numRobots - self.currentEights self.totalMoves += numMoves if self.printLog == True: print 'totalMoves:', self.totalMoves ## print 'self.exploredCells:', self.exploredCells ## self.printedFinalStats = True return # Method to compute the frontier def computeFrontier(self): frontier = [] # Iterate over all cells in the grid for i in range(self.height): for j in range(self.width): # We compute 8-neighbors for only those cells that haven't been visited or are obstacles # Only such cells are possible candidates for the frontier if self.gridworld.cells[i][j].visited == False and self.gridworld.cells[i][j].obstacle == False: point = (i, j) neighbors = self.gridworld.get8Neighbors(point) # Now we see if there is at least one neighbor of the current cell which has been visited # In such a case, the current cell would become a frontier cell frontierFlag = False for nbhr in neighbors: if self.gridworld.cells[nbhr[0]][nbhr[1]].visited == True: frontierFlag = True if frontierFlag == True: frontier.append((i, j)) return frontier # Method to delete lone cells def deleteLoneCells(self): # Kill cells using the rules from Conway's Game of Life for i in range(self.height): for j in range(self.width): if self.gridworld.cells[i][j].visited == True: continue else: visitedNeighbors = 0 neighbors = self.gridworld.get8Neighbors((i, j)) for neighbor in neighbors: if self.gridworld.cells[neighbor[0]][neighbor[1]].visited == True: visitedNeighbors += 1 if visitedNeighbors == len(neighbors): self.gridworld.cells[i][j].visited = True frontier = self.computeFrontier() return frontier # Method to compute the new locations of each robot, given a command vector def getNewPositions(self, cmd): newPos = [] for i in range(self.numRobots): nextX, nextY = self.gridworld.getNextPos(self.robots[i].curX, self.robots[i].curY, cmd[i]) newPos.append((nextX, nextY)) return newPos # Method to check if a given configuration is possible # We return an integer that describes the nature of the impossibility of a configuration # 0 denotes that all robots move into non-obstacle cells # 1 denotes that two robots occupy the same cell # 2 denotes that one robot encounters an obstacle def isCfgPossible(self, cfg): # We first compute the new positions and see if two next positions coincide # newPos = self.getNewPositions(cfg) if any(self.newPos.count(element) > 1 for element in self.newPos) == True: return 1 # Now we check if some robot encounters an obstacle retval = 0 for i in range(self.numRobots): if self.gridworld.checkCommand(self.robots[i].curX, self.robots[i].curY, cfg[i]) == False: retval = 2 # Otherwise, the configuration is possible return retval def allocateFrontiers(self): cmd = [] # Allocate robots to clusters if self.reallocateFlag == True: """ If hungarianFlag is set to True, perform Hungarian assignment Else, perform greedy assignment. """ # Hungarian assignment if self.hungarianFlag == True: # Determine the cost matrix costMatrix = [] # Get the distance of each robot to its nearest cell in the cluster for i in range(self.numRobots): closestDist = self.infinity cost = [] for cluster in self.frontierClusters: closestDistToCluster = self.infinity for point in cluster: if self.aStarFlag == True: path, distanceToPoint = self.astar.aStarSearch(self.gridworld, (self.robots[i].curX, self.robots[i].curY), (point[0], point[1])) distanceToPoint = distanceToPoint[(point[0], point[1])] else: distanceToPoint = abs(self.robots[i].curX - point[0]) + abs(self.robots[i].curY - point[1]) if distanceToPoint < closestDistToCluster: closestDistToCluster = distanceToPoint cost.append(closestDistToCluster) costMatrix.append(cost) costMatrix = zip(*costMatrix) # print 'costMatrixHere:', costMatrix, self.K # for centroid in self.centroids: # # Denotes the distance from each robot to the current centroid # cost = [] # for robot in self.robots: # # Note the confusing notation # # manhattan has been used for bot manhattan and A* distances # if self.aStarFlag == True: # path, manhattan = self.astar.aStarSearch(self.gridworld, (robot.curX, robot.curY), (centroid.x, centroid.y)) # manhattan = manhattan[(centroid.x, centroid.y)] # else: # manhattan = abs(robot.curX - centroid.x) + abs(robot.curY - centroid.y) # cost.append(manhattan) # costMatrix.append(cost) if self.K < self.numRobots: additionalRows = self.numRobots - self.K cost = [0 for j in range(self.numRobots)] for i in range(additionalRows): costMatrix.append(cost) # if self.K < self.numRobots: # print 'costMatrix: ', costMatrix, 'self.K:', self.K """Create an instance of the Hungarian assignment class""" hungarian = Hungarian.Hungarian() hungarian.calculate(costMatrix) results = hungarian.get_results() # print 'Total Potential: ', hungarian.get_total_potential() # if self.K < self.numRobots: # print 'Hungarian results:', results # Choose only those allotments where the id of the cluster is less than self.K if self.K < self.numRobots: def filterFunction(parameter): return parameter[0] < self.K-1 results = filter(filterFunction, results) # print 'results:', results # Perform the assignment for result in results: self.centroids[result[0]].allotted = result[1] robotList = [i for i in range(self.numRobots)] for result in results: if result[1] in robotList: robotList.remove(result[1]) # print 'robotList', robotList, self.K for robot in robotList: clusterObject = Cluster.Cluster(self.robots[robot].curX, self.robots[robot].curY) clusterObject.allotted = robot self.centroids.append(clusterObject) # print 'prevClusters:', self.frontierClusters self.frontierClusters.append([(self.robots[robot].curX, self.robots[robot].curY)]) # if robot < self.K: # self.frontierClusters[robot] = ([(self.robots[robot].curX, self.robots[robot].curY)]) # else: # self.frontierClusters.append([(self.robots[robot].curX, self.robots[robot].curY)]) # print 'clusters:', self.frontierClusters # Greedy assignment else: totalPotential = 0 # Iterate over the list of cluster centroids for j in range(self.numRobots): robotPos = (self.robots[0].curX, self.robots[0].curY) centroidPos = (self.centroids[j].x, self.centroids[j].y) if self.aStarFlag == True: path, tmp = self.astar.aStarSearch(self.gridworld, robotPos, (self.infinity, self.infinity)) # tmp = tmp[(self.infinity, self.infinity)] tmp = self.infinity else: tmp = self.infinity # Iterate over the list of robots for i in range(self.numRobots): robotPos = (self.robots[i].curX, self.robots[i].curY) if self.aStarFlag == True: path, tempdist = self.astar.aStarSearch(self.gridworld, robotPos, centroidPos) tempdist = tempdist[centroidPos] else: tempdist = abs(robotPos[0]-centroidPos[0]) + abs(robotPos[1]-centroidPos[1]) allottedflag = False # Check if the robot has already been allotted a centroid for k in range(self.numRobots): if self.centroids[k].allotted==i: allottedflag = True # If it hasn't been allotted if tmp >= tempdist and allottedflag == False: tmp = tempdist self.centroids[j].allotted = i totalPotential += tmp # print 'Total Potential: ', totalPotential "Motion planning" shouldRecluster = False for i in range(self.numRobots): # If randomMotionPlan is True, use random motion planning # i.e., visit each cluster cell in the order in which K-Means returned it if self.randomMotionPlan == True: isJobless = True """ Determine the cluster that was allotted the ith robot Store it in temp """ for j in range(self.numRobots): if self.centroids[j].allotted==i: temp=j break # print 'robot', i, 'given cluster', temp # Iterate over each frontier cell for cellgen in self.frontierClusters[temp]: # Mark the cell as not done thisisdone=0 # Check if the cell has been visited already # If yes mark this as done for j in range(self.gridworld.height): for k in range(self.gridworld.width): if self.gridworld.cells[j][k].x == cellgen[0] and self.gridworld.cells[j][k].y == cellgen[1] and self.gridworld.cells[j][k].visited==True: thisisdone=1 # If it has not been marked as done, allot this cell to the robot # The variable 'isJobless' denotes if the robots frontier cluster is jobless now if thisisdone==0: allotted_frontier=cellgen isJobless = False break # Otherwise, use the greedy motion plan else: isJobless = True # To each robot, allocate the closest cell in its allotted frontier # For that, initialize the least distance to infinity dist = self.infinity ## If any error occurs, maybe commenting this line would resolve it # Store the cluster number allotted to the ith robot for j in range(self.numRobots): if self.centroids[j].allotted == i: allottedCluster = j break # print 'robot', i, 'given cluster', j dists = [] if self.aStarFlag == True: path, dist = self.astar.aStarSearch(self.gridworld, (0, 0), (self.infinity, self.infinity)) dist = self.infinity # print 'dist:', dist else: dist = self.infinity # Iterate over each frontier cell in the ith robot's cluster for cellgen in self.frontierClusters[allottedCluster]: # Mark the cell as not done thisIsDone = 0 robotPos = (self.robots[i].curX, self.robots[i].curY) cellPos = (cellgen[0], cellgen[1]) # Check if the cell has been visited already # If yes mark this as done if self.gridworld.cells[cellgen[0]][cellgen[1]].visited == True: thisIsDone = 1 # If it has not been marked as done, allot this cell to the robot # The variable 'isJobless' denotes if the robots frontier cluster is jobless now if thisIsDone == 0: if self.aStarFlag == True: path, tempDist = self.astar.aStarSearch(self.gridworld, robotPos, cellPos) tempDist = tempDist[cellPos] else: tempDist = abs(robotPos[0] - cellPos[0]) + abs(robotPos[1] - cellPos[1]) dists.append(tempDist) if tempDist < dist: dist = tempDist allotted_frontier = cellgen isJobless = False # print 'dist:', dists, dist # print i, isJobless """ Move the ith robot closer to its allotted frontier """ # If all cells in the robot's assigned cluster have been explored, the robot waits in the same cell if self.volume > 0: exploredPercentage = self.exploredCells / (self.volume * 1.0) if self.printLog == True: print 'self.exploredCells:', self.exploredCells ## # print 'exploredPercentage:', exploredPercentage if self.thresholdPercentage <= 0.1: self.thresholdPercentage = 0.1 else: # print '#########twenty-five iterations:', self.t / 25 if self.t < 200: self.thresholdPercentage = 0.5 else: if self.t > 600 and self.t < 800: self.thresholdPercentage = 0.5 else: self.thresholdPercentage = 0.5 - 0.01*(self.t / 25) """Uncomment these lines to revert to the old plan""" # # if isJobless == True or exploredPercentage >= self.thresholdPercentage: # if exploredPercentage >= self.thresholdPercentage: # # genmax stores the command that is given to a robot # # Kindly do not worry about the variable naming style # # It was all Arjun's creativity and it shall be fixed soon # shouldRecluster = True # genmax = 8 # # self.exploredCells = 0 # ?? if isJobless == True: # or exploredPercentage >= self.thresholdPercentage: genmax = 8 shouldRecluster = True # if exploredPercentage >= self.thresholdPercentage: # shouldRecluster = True # Otherwise, it visits the cell else: # possCells stores the current 8-neighbors of the ith robot possCells=[] possCells = self.gridworld.get8Neighbors((self.robots[i].curX, self.robots[i].curY)) # If using A* if self.aStarFlag == True: path, tmp = self.astar.aStarSearch(self.gridworld, possCells[0], allotted_frontier) tmp = tmp[allotted_frontier] # If A* is not being used, Manhattan distance is used else: tmp = abs(possCells[0][0]-allotted_frontier[0]) + abs(possCells[0][1]-allotted_frontier[1]) # Here's yet another name from our creative genius (Arjun) # This variable is initialized with the first of its 8-neighbors thechosenone=possCells[0] # For each neighbor of the ith robot for nextcell in possCells: # If using A* if self.aStarFlag == True: path, tmp1 = self.astar.aStarSearch(self.gridworld, nextcell, allotted_frontier) tmp1 = tmp1[allotted_frontier] # If A* is not being used, Manhattan distance is used else: tmp1=abs(nextcell[0]-allotted_frontier[0]) + abs(nextcell[1]-allotted_frontier[1]) # if tmp>=tmp1: ## Error ? if tmp1 < tmp: # path, tmp = self.astar.aStarSearch(self.gridworld, nextcell, allotted_frontier) tmp=tmp1; thechosenone = nextcell genmax=self.gridworld.getcmd(thechosenone[0], thechosenone[1], self.robots[i].curX, self.robots[i].curY) cmd.append(genmax) # print 'cmd:', cmd # for i in range(len(cmd)): # temp = str(cmd[i]) # sys.stdout.write(temp) # sys.stdout.write(' ') # sys.stdout.write('\n') return cmd, shouldRecluster def executeBestCfgc(self, bestCfgc): i = 0 for cmd in bestCfgc: tempX = self.robots[i].curX tempY = self.robots[i].curY if self.gridworld.checkCommand(tempX, tempY, cmd) == True: nextX, nextY = self.gridworld.getNextPos(tempX, tempY, cmd) self.gridworld.cells[tempX][tempY].occupied = False self.robots[i].curX = nextX self.robots[i].curY = nextY self.gridworld.cells[nextX][nextY].occupied = True self.gridworld.cells[nextX][nextY].visited = True i += 1 # Run the algorithm for 1 iteration def runOneIter(self): # If t time steps have already expired, return self.t += 1 if self.t >= self.T: if self.printedFinalStats == False: self.printFinalStats() return # Else, run the algorithm for one time step self.frontier = self.computeFrontier() if self.frontier == []: if self.completedFlag == False: self.completedFlag = True self.completionTime = self.t # print 'Completed in time', self.completionTime self.printFinalStats() return # self.frontier = self.deleteLoneCells() if len(self.frontier) < self.numRobots: self.K = len(self.frontier) else: self.K = self.numRobots # If reclusterFlag is true, then perform K-Means clustering if self.reclusterFlag == True: if self.printLog == True: print 'volume:', len(self.frontier) ## self.exploredCells = 0 self.volume = len(self.frontier) if self.K != 1: self.centroids, self.frontierClusters = self.cluster.Kmeanscluster(self.frontier, self.K) # K-Means doesn't accept K = 1, so handle that case separately # by creating a centroid for that cell alone else: clusterObject = Cluster.Cluster(self.frontier[0][0], self.frontier[0][1]) self.centroids = [clusterObject] self.frontierClusters = [self.frontier] self.timesClustered += 1 # Calculating a few values in order to plot dispersion # (not of any use to the algorithm) centroidOfCentroids = () sumX = 0 sumY = 0 for centroid in self.centroids: sumX += centroid.x sumY += centroid.y if self.centroids != 0: tempX = int(sumX / len(self.centroids)) tempY = int(sumY / len(self.centroids)) # print tempX, tempY centroidOfCentroids = (tempX, tempY) sumOfDistances = 0 for centroid in self.centroids: # sumOfDistances += (abs(centroid.x - centroidOfCentroids[0]) + abs(centroid.y - centroidOfCentroids[1])) sumOfDistances += (((centroid.x - centroidOfCentroids[0])*(centroid.x - centroidOfCentroids[0])) + ((centroid.y - centroidOfCentroids[1]) * (centroid.y - centroidOfCentroids[1]))) print sumOfDistances self.reallocateFlag = True # Perform frontier allocation bestCfgc, shouldRecluster = self.allocateFrontiers() self.currentEights = 0 for cfg in bestCfgc: if cfg == 8: self.currentEights += 1 # print shouldRecluster if shouldRecluster == True and self.K == self.numRobots: self.reclusterFlag = True return else: self.reclusterFlag = False # if shouldRecluster == True and self.K < self.numRobots: # bestCfgc, shouldRecluster = self.allocateFrontiers() # print self.t, shouldRecluster # self.reclusterFlag = True for i in range(self.numRobots): for cellgen in self.frontierClusters[i]: for j in range(self.gridworld.height): for k in range(self.gridworld.width): if self.gridworld.cells[j][k].x == cellgen[0] and self.gridworld.cells[j][k].y == cellgen[1] and self.gridworld.cells[j][k].visited==False: # self.reclusterFlag = False self.gridworld.cells[j][k].cluster=i break # #print 'not jobless' self.executeBestCfgc(bestCfgc) # time.sleep(1) # Print the final statistics self.printFinalStats()
34.449109
184
0.664069
""" Provides an implementation of the Frontier Clustering algorithm. """ import math import random import sys import time import AStar import Cluster import GridWorld import Hungarian import kmeans import Robot from collections import defaultdict from tsp_solver.greedy import solve_tsp class Faigl: """ height and width specify the dimensions of the environment obstacles is a list of locations which are to be initialized as obstacles R specifies the range of communication numRobots specifies the number of robot objects to be initialized initLocs specifies the initial locations for each of the robots k specifies the size of the population of configuration changes T specifies the number of time steps to run the simulation for base specifies the coordinates of the base station """ def __init__(self, height, width, obstacles, numRobots, initLocs, T = 10): self.gridworld = GridWorld.GridWorld(height, width, obstacles) self.centroid = [] self.cluster = kmeans.kmeans() self.robots = [Robot.Robot(j+1, -1, -1) for j in range(numRobots)] i = 0 for initLoc in initLocs: currentPoint = (initLoc[0], initLoc[1]) if not self.gridworld.inBounds(currentPoint) or not self.gridworld.passable(currentPoint): print 'Initial location', currentPoint, 'is not possible' sys.exit(-1) self.robots[i].setLocation(initLoc[0], initLoc[1]) self.gridworld.cells[initLoc[0]][initLoc[1]].occupied = True self.gridworld.cells[initLoc[0]][initLoc[1]].visited = True i += 1 # Initialize other parameters of the algorithm # Height of the Grid self.height = height # Width of the Grid self.width = width # List of Clusters (obtained using K-Means clustering) self.frontierClusters=[] # Number of Robots self.numRobots = numRobots # Parameter for adaptive K-Means self.K = self.numRobots # Time steps for which the algorithm is run self.T = T # Variable to indicate whether reclustering should be performed self.reclusterFlag = True # Centroids of clusters self.centroids = [] # Number of time steps elapsed self.t = 0 # Time taken to exhaust the frontier self.completionTime = 0 # Set to True on completion self.completedFlag = False # List of Frontier Cells self.frontier = [] # New Positions of each of the Robots self.newPos = [] # Population of Configuration Changes self.cfgc = [] # Number of Stalls (Used only for simulating Rooker's work) self.stalls = 0 self.printedFinalStats = False self.possible = [] self.visited = self.numRobots self.sumNewVisited = numRobots self.aStarFlag = False self.infinity = 10000000 self.hungarianFlag = True self.randomMotionPlan = False self.currentEights = 0 self.totalMoves = 0 self.volume = 0 self.exploredCells = 0 self.timesClustered = 0 self.thresholdPercentage = 1.0 self.reallocateFlag = False self.printLog = False self.astar = AStar.AStar() def printGrid(self): mputeFrontier() print 'occupied cells:' for i in range(self.height): for j in range(self.width): if self.gridworld.cells[i][j].occupied == True: print i, j print 'robot locations:' for robot in self.robots: print robot.curX, robot.curY for i in range(self.height): for j in range(self.width): if self.gridworld.cells[i][j].obstacle == True: sys.stdout.write(' # ') elif self.gridworld.cells[i][j].occupied == True: robotId = 0 for robot in self.robots: if robot.curX == i and robot.curY == j: robotId = robot.id temp = ' ' + str(robotId) + ' ' sys.stdout.write(temp) elif (i, j) in frontier: sys.stdout.write(' | ') else: if self.gridworld.cells[i][j].visited == True: sys.stdout.write(' . ') else: sys.stdout.write(' - ') sys.stdout.write('\n') def printVisitedStatus(self): visited = 0 visitable = self.height * self.width for i in range(self.height): for j in range(self.width): if self.gridworld.cells[i][j].visited == True: sys.stdout.write(' 1 ') visited += 1 else: sys.stdout.write(' 0 ') if self.gridworld.cells[i][j].obstacle == True: visitable -= 1 sys.stdout.write('\n') print 'visited:', visited, ' of ', visitable print 'stalls:', self.stalls return self.completionTime def printFinalStats(self, force = 0): visitednow=0 visitable = self.height * self.width for i in range(self.height): for j in range(self.width): if self.gridworld.cells[i][j].visited == True: visitednow += 1 else: if self.gridworld.cells[i][j].obstacle == True: visitable -= 1 metric = self.visited / visitable if self.printLog == True: print 'visitednow', visitednow redundancy = (self.numRobots - self.currentEights) - (visitednow - self.visited) if self.printLog == True: print 'redundancy:', redundancy self.exploredCells += (visitednow - self.visited) self.visited = visitednow numMoves = self.numRobots - self.currentEights self.totalMoves += numMoves if self.printLog == True: print 'totalMoves:', self.totalMoves print 'self.exploredCells:', self.exploredCells self.printedFinalStats = True return def computeFrontier(self): frontier = [] for i in range(self.height): for j in range(self.width): # Only such cells are possible candidates for the frontier if self.gridworld.cells[i][j].visited == False and self.gridworld.cells[i][j].obstacle == False: point = (i, j) neighbors = self.gridworld.get8Neighbors(point) # Now we see if there is at least one neighbor of the current cell which has been visited # In such a case, the current cell would become a frontier cell frontierFlag = False for nbhr in neighbors: if self.gridworld.cells[nbhr[0]][nbhr[1]].visited == True: frontierFlag = True if frontierFlag == True: frontier.append((i, j)) return frontier # Method to delete lone cells def deleteLoneCells(self): # Kill cells using the rules from Conway's Game of Life for i in range(self.height): for j in range(self.width): if self.gridworld.cells[i][j].visited == True: continue else: visitedNeighbors = 0 neighbors = self.gridworld.get8Neighbors((i, j)) for neighbor in neighbors: if self.gridworld.cells[neighbor[0]][neighbor[1]].visited == True: visitedNeighbors += 1 if visitedNeighbors == len(neighbors): self.gridworld.cells[i][j].visited = True frontier = self.computeFrontier() return frontier def getNewPositions(self, cmd): newPos = [] for i in range(self.numRobots): nextX, nextY = self.gridworld.getNextPos(self.robots[i].curX, self.robots[i].curY, cmd[i]) newPos.append((nextX, nextY)) return newPos def isCfgPossible(self, cfg): if any(self.newPos.count(element) > 1 for element in self.newPos) == True: return 1 retval = 0 for i in range(self.numRobots): if self.gridworld.checkCommand(self.robots[i].curX, self.robots[i].curY, cfg[i]) == False: retval = 2 return retval def allocateFrontiers(self): cmd = [] if self.reallocateFlag == True: """ If hungarianFlag is set to True, perform Hungarian assignment Else, perform greedy assignment. """ if self.hungarianFlag == True: costMatrix = [] for i in range(self.numRobots): closestDist = self.infinity cost = [] for cluster in self.frontierClusters: closestDistToCluster = self.infinity for point in cluster: if self.aStarFlag == True: path, distanceToPoint = self.astar.aStarSearch(self.gridworld, (self.robots[i].curX, self.robots[i].curY), (point[0], point[1])) distanceToPoint = distanceToPoint[(point[0], point[1])] else: distanceToPoint = abs(self.robots[i].curX - point[0]) + abs(self.robots[i].curY - point[1]) if distanceToPoint < closestDistToCluster: closestDistToCluster = distanceToPoint cost.append(closestDistToCluster) costMatrix.append(cost) costMatrix = zip(*costMatrix) t = [0 for j in range(self.numRobots)] for i in range(additionalRows): costMatrix.append(cost) """Create an instance of the Hungarian assignment class""" hungarian = Hungarian.Hungarian() hungarian.calculate(costMatrix) results = hungarian.get_results() if self.K < self.numRobots: def filterFunction(parameter): return parameter[0] < self.K-1 results = filter(filterFunction, results) for result in results: self.centroids[result[0]].allotted = result[1] robotList = [i for i in range(self.numRobots)] for result in results: if result[1] in robotList: robotList.remove(result[1]) for robot in robotList: clusterObject = Cluster.Cluster(self.robots[robot].curX, self.robots[robot].curY) clusterObject.allotted = robot self.centroids.append(clusterObject) self.frontierClusters.append([(self.robots[robot].curX, self.robots[robot].curY)]) else: totalPotential = 0 for j in range(self.numRobots): robotPos = (self.robots[0].curX, self.robots[0].curY) centroidPos = (self.centroids[j].x, self.centroids[j].y) if self.aStarFlag == True: path, tmp = self.astar.aStarSearch(self.gridworld, robotPos, (self.infinity, self.infinity)) tmp = self.infinity else: tmp = self.infinity for i in range(self.numRobots): robotPos = (self.robots[i].curX, self.robots[i].curY) if self.aStarFlag == True: path, tempdist = self.astar.aStarSearch(self.gridworld, robotPos, centroidPos) tempdist = tempdist[centroidPos] else: tempdist = abs(robotPos[0]-centroidPos[0]) + abs(robotPos[1]-centroidPos[1]) allottedflag = False for k in range(self.numRobots): if self.centroids[k].allotted==i: allottedflag = True if tmp >= tempdist and allottedflag == False: tmp = tempdist self.centroids[j].allotted = i totalPotential += tmp # print 'Total Potential: ', totalPotential "Motion planning" shouldRecluster = False for i in range(self.numRobots): # If randomMotionPlan is True, use random motion planning # i.e., visit each cluster cell in the order in which K-Means returned it if self.randomMotionPlan == True: isJobless = True """ Determine the cluster that was allotted the ith robot Store it in temp """ for j in range(self.numRobots): if self.centroids[j].allotted==i: temp=j break # print 'robot', i, 'given cluster', temp # Iterate over each frontier cell for cellgen in self.frontierClusters[temp]: # Mark the cell as not done thisisdone=0 # Check if the cell has been visited already # If yes mark this as done for j in range(self.gridworld.height): for k in range(self.gridworld.width): if self.gridworld.cells[j][k].x == cellgen[0] and self.gridworld.cells[j][k].y == cellgen[1] and self.gridworld.cells[j][k].visited==True: thisisdone=1 # If it has not been marked as done, allot this cell to the robot # The variable 'isJobless' denotes if the robots frontier cluster is jobless now if thisisdone==0: allotted_frontier=cellgen isJobless = False break # Otherwise, use the greedy motion plan else: isJobless = True # To each robot, allocate the closest cell in its allotted frontier # For that, initialize the least distance to infinity dist = self.infinity ## If any error occurs, maybe commenting this line would resolve it # Store the cluster number allotted to the ith robot for j in range(self.numRobots): if self.centroids[j].allotted == i: allottedCluster = j break # print 'robot', i, 'given cluster', j dists = [] if self.aStarFlag == True: path, dist = self.astar.aStarSearch(self.gridworld, (0, 0), (self.infinity, self.infinity)) dist = self.infinity # print 'dist:', dist else: dist = self.infinity # Iterate over each frontier cell in the ith robot's cluster for cellgen in self.frontierClusters[allottedCluster]: thisIsDone = 0 robotPos = (self.robots[i].curX, self.robots[i].curY) cellPos = (cellgen[0], cellgen[1]) if self.gridworld.cells[cellgen[0]][cellgen[1]].visited == True: thisIsDone = 1 if thisIsDone == 0: if self.aStarFlag == True: path, tempDist = self.astar.aStarSearch(self.gridworld, robotPos, cellPos) tempDist = tempDist[cellPos] else: tempDist = abs(robotPos[0] - cellPos[0]) + abs(robotPos[1] - cellPos[1]) dists.append(tempDist) if tempDist < dist: dist = tempDist allotted_frontier = cellgen isJobless = False """ Move the ith robot closer to its allotted frontier """ if self.volume > 0: exploredPercentage = self.exploredCells / (self.volume * 1.0) if self.printLog == True: print 'self.exploredCells:', self.exploredCells ## # print 'exploredPercentage:', exploredPercentage if self.thresholdPercentage <= 0.1: self.thresholdPercentage = 0.1 else: # print 'resholdPercentage: # if exploredPercentage >= self.thresholdPercentage: # # genmax stores the command that is given to a robot # # Kindly do not worry about the variable naming style # # It was all Arjun's creativity and it shall be fixed soon nmax = 8 shouldRecluster = True else: possCells=[] possCells = self.gridworld.get8Neighbors((self.robots[i].curX, self.robots[i].curY)) if self.aStarFlag == True: path, tmp = self.astar.aStarSearch(self.gridworld, possCells[0], allotted_frontier) tmp = tmp[allotted_frontier] else: tmp = abs(possCells[0][0]-allotted_frontier[0]) + abs(possCells[0][1]-allotted_frontier[1]) # This variable is initialized with the first of its 8-neighbors thechosenone=possCells[0] # For each neighbor of the ith robot for nextcell in possCells: # If using A* if self.aStarFlag == True: path, tmp1 = self.astar.aStarSearch(self.gridworld, nextcell, allotted_frontier) tmp1 = tmp1[allotted_frontier] # If A* is not being used, Manhattan distance is used else: tmp1=abs(nextcell[0]-allotted_frontier[0]) + abs(nextcell[1]-allotted_frontier[1]) # if tmp>=tmp1: ## Error ? if tmp1 < tmp: # path, tmp = self.astar.aStarSearch(self.gridworld, nextcell, allotted_frontier) tmp=tmp1; thechosenone = nextcell genmax=self.gridworld.getcmd(thechosenone[0], thechosenone[1], self.robots[i].curX, self.robots[i].curY) cmd.append(genmax) # print 'cmd:', cmd # for i in range(len(cmd)): # temp = str(cmd[i]) # sys.stdout.write(temp) # sys.stdout.write(' ') # sys.stdout.write('\n') return cmd, shouldRecluster def executeBestCfgc(self, bestCfgc): i = 0 for cmd in bestCfgc: tempX = self.robots[i].curX tempY = self.robots[i].curY if self.gridworld.checkCommand(tempX, tempY, cmd) == True: nextX, nextY = self.gridworld.getNextPos(tempX, tempY, cmd) self.gridworld.cells[tempX][tempY].occupied = False self.robots[i].curX = nextX self.robots[i].curY = nextY self.gridworld.cells[nextX][nextY].occupied = True self.gridworld.cells[nextX][nextY].visited = True i += 1 # Run the algorithm for 1 iteration def runOneIter(self): # If t time steps have already expired, return self.t += 1 if self.t >= self.T: if self.printedFinalStats == False: self.printFinalStats() return # Else, run the algorithm for one time step self.frontier = self.computeFrontier() if self.frontier == []: if self.completedFlag == False: self.completedFlag = True self.completionTime = self.t # print 'Completed in time', self.completionTime self.printFinalStats() return # self.frontier = self.deleteLoneCells() if len(self.frontier) < self.numRobots: self.K = len(self.frontier) else: self.K = self.numRobots # If reclusterFlag is true, then perform K-Means clustering if self.reclusterFlag == True: if self.printLog == True: print 'volume:', len(self.frontier) ## self.exploredCells = 0 self.volume = len(self.frontier) if self.K != 1: self.centroids, self.frontierClusters = self.cluster.Kmeanscluster(self.frontier, self.K) # K-Means doesn't accept K = 1, so handle that case separately else: clusterObject = Cluster.Cluster(self.frontier[0][0], self.frontier[0][1]) self.centroids = [clusterObject] self.frontierClusters = [self.frontier] self.timesClustered += 1 centroidOfCentroids = () sumX = 0 sumY = 0 for centroid in self.centroids: sumX += centroid.x sumY += centroid.y if self.centroids != 0: tempX = int(sumX / len(self.centroids)) tempY = int(sumY / len(self.centroids)) centroidOfCentroids = (tempX, tempY) sumOfDistances = 0 for centroid in self.centroids: sumOfDistances += (((centroid.x - centroidOfCentroids[0])*(centroid.x - centroidOfCentroids[0])) + ((centroid.y - centroidOfCentroids[1]) * (centroid.y - centroidOfCentroids[1]))) print sumOfDistances self.reallocateFlag = True bestCfgc, shouldRecluster = self.allocateFrontiers() self.currentEights = 0 for cfg in bestCfgc: if cfg == 8: self.currentEights += 1 if shouldRecluster == True and self.K == self.numRobots: self.reclusterFlag = True return else: self.reclusterFlag = False for i in range(self.numRobots): for cellgen in self.frontierClusters[i]: for j in range(self.gridworld.height): for k in range(self.gridworld.width): if self.gridworld.cells[j][k].x == cellgen[0] and self.gridworld.cells[j][k].y == cellgen[1] and self.gridworld.cells[j][k].visited==False: self.gridworld.cells[j][k].cluster=i break Cfgc(bestCfgc) self.printFinalStats()
false
true
f7f984532f4d4eee71e4b32e9e717f0c2370479a
7,476
py
Python
code/main_vehicule.py
fokoa/byzantine_kmeans-msc_thesis
b116cb2222cd0e1334db7df493ec453dd299b985
[ "MIT" ]
null
null
null
code/main_vehicule.py
fokoa/byzantine_kmeans-msc_thesis
b116cb2222cd0e1334db7df493ec453dd299b985
[ "MIT" ]
null
null
null
code/main_vehicule.py
fokoa/byzantine_kmeans-msc_thesis
b116cb2222cd0e1334db7df493ec453dd299b985
[ "MIT" ]
null
null
null
#!usr/bin/python3 # -*- coding : utf8 -*- import sys; import getopt; import warnings; from mpi4py import MPI; import numpy as np; import pandas as pd; import matplotlib.pyplot as plt; from mpl_toolkits.mplot3d import Axes3D; from sklearn import decomposition; from sklearn.cluster import KMeans; from kmeans_resilient import KMeansResilient as KMR; from functions import *; pd.set_option('max_column', None); warnings.filterwarnings('ignore'); # MPI initialization comm = MPI.COMM_WORLD; P = comm.Get_size(); rank = comm.Get_rank(); def check_option(opt_arg): """ Check the arguments passed as parameters by the command prompt Parameters : ----------- opt_arg : str Arguments and options passed by the command prompt Return : ------- opts : list Argument list args : list Option list """ try: opts, args = opt_arg; except getopt.GetoptError as err: print(err); print("Use :\t", sys.argv[0], "-b 5 \n\t", "or:", sys.argv[0], "--byzantine 5"); sys.exit(-1); for opt, val in opts: if opt in ("-b", "--byzantine"): if val.isdigit() == False: raise ValueError("Enter an integer as number" "of byzantine machines."); elif opt in ("-h", "--help"): print("Use:", sys.argv[0], "-b 5\n", "or:", sys.argv[0], "--byzantine 5"); sys.exit(-1); else: print("unhandled options"); sys.exit(-1); return opts, args; def check_Nbyzan(opts, P): """ Check and get the number of Byzantine machines that we are going to simulate Parameters : ----------- opts : str Options passed by the command prompt P : int Total number of machines (nodes or workers). 1 coodinator ans the ramaining are workers Return : ------- n_byzantines : int (entire natural) Number of byzantine machines that we are going to simulate """ if len(opts) == 0: n_byzantines = 0; n_byzantines = int(opts[0][1]); if n_byzantines < 0 or n_byzantines > P - 1: raise ValueError("Number of byzantine must be an integer " "< number of workers or >= 0"); return n_byzantines; def sort_centroides(centroids): """ Sort centroids according to their norms Parameters : ----------- centroids : ndarray of shape (k, n_features) All centroids of clusters where k is number of clusters Return : ------- tmp : ndarray of shape (k, n_features) Sorted centroids """ tmp = np.zeros((centroids.shape)); normes = {}; for centroid in range(0, centroids.shape[0]): norm = np.linalg.norm(centroids[centroid]); normes[norm] = centroid; i=0; for norm in sorted(normes): tmp[i] = centroids[normes[norm]]; i = i + 1; return tmp; def comparaison_cluster(X, label_km, label_by, label_co): """ Plot all the formed clusters Parameters : ----------- X : ndarray of shape (n_samples, n_features) Samples to be clustered label_km : list of length 2 The first is labels obtained with K-means The second is number of clusters label_by : list of length 2 The first is labels obtained with byzantin K-means The second is number of byzantines label_co : ndarray of shape (n_samples, ) Label obtained by correcting byzantines in byzantin K-means """ pca = decomposition.PCA(n_components = 3); X_reduced = pca.fit_transform(X); x_axis = [val[0] for val in X_reduced]; y_axis = [val[1] for val in X_reduced]; z_axis = [val[2] for val in X_reduced]; fig = plt.figure(figsize=plt.figaspect(0.5), facecolor="w"); ax = fig.add_subplot(1, 3, 1, projection='3d'); plt.title('%d-means'%(label_km[1])); ax.scatter(x_axis, y_axis, z_axis, c=label_km[0]); ax = fig.add_subplot(1, 3, 2, projection='3d'); plt.title('%d Byzantines' % (label_by[1])); ax.scatter(x_axis, y_axis, z_axis, c=label_by[0]); ax = fig.add_subplot(1, 3, 3, projection='3d'); ax.scatter(x_axis, y_axis, z_axis, c=label_co); plt.title('Correction'); plt.show(); def main(): # Check options and number of byzantines opts, arg = check_option(getopt.getopt(sys.argv[1:], "b:", ["byzantine="])); n_byzantines = check_Nbyzan(opts, P); # Load dataset xaa = pd.read_csv("data/Statlog vehicule silhouette/xaa.dat", header=None, sep='\s+'); xab = pd.read_csv("data/Statlog vehicule silhouette/xab.dat", header=None, sep='\s+'); xac = pd.read_csv("data/Statlog vehicule silhouette/xac.dat", header=None, sep='\s+'); xad = pd.read_csv("data/Statlog vehicule silhouette/xad.dat", header=None, sep='\s+'); xae = pd.read_csv("data/Statlog vehicule silhouette/xae.dat", header=None, sep='\s+'); xaf = pd.read_csv("data/Statlog vehicule silhouette/xaf.dat", header=None, sep='\s+'); xag = pd.read_csv("data/Statlog vehicule silhouette/xag.dat", header=None, sep='\s+'); xah = pd.read_csv("data/Statlog vehicule silhouette/xah.dat", header=None, sep='\s+'); xai = pd.read_csv("data/Statlog vehicule silhouette/xai.dat", header=None, sep='\s+'); # Concatate all data xa data = pd.concat([xaa, xab, xac, xad, xae, xaf, xag, xah, xai], ignore_index=True); # Column to fit cols = data.columns.difference([18]); X = data[cols].values; y = data[18].values; # Model km = KMR(n_clusters=4, n_init=10, n_iter=50, seed=2); by = KMR(n_clusters=4, n_init=10, n_iter=50, seed=2, n_byzantines=n_byzantines); co = KMR(n_clusters=4, n_init=10, n_iter=50, seed=2, n_byzantines=n_byzantines, correction=True); # Fit km.fit(X); by.fit(X); co.fit(X); # Sort centroides km.centroids_ = sort_centroides(km.centroids_); by.centroids_ = sort_centroides(by.centroids_); co.centroids_ = sort_centroides(co.centroids_); # Plot if rank == 0: # print('\nKmeans centroids:\n' , km.centroids_); # print('Byzantine centroids:\n', by.centroids_); # print('Correct centroids:\n', co.centroids_); print('\nKmeans inertia:\n', km.inertia_); print('\nByzantine inertia:\n', by.inertia_); print('\nCorrection inertia:\n', co.inertia_); # mis_1 = by.misclassified(X, km.labels_, by.labels_); # mis_2 = co.misclassified(X, km.labels_, co.labels_); # print('\nByzantine has %d data point misclassified.' % (mis_1)); # print('\nCorrection has %d data point misclassified.' % (mis_2)); comparaison_cluster(X, [km.labels_, km.n_clusters], [by.labels_, by.n_byzantines], co.labels_); if __name__ == "__main__": main();
27.688889
75
0.563938
import sys; import getopt; import warnings; from mpi4py import MPI; import numpy as np; import pandas as pd; import matplotlib.pyplot as plt; from mpl_toolkits.mplot3d import Axes3D; from sklearn import decomposition; from sklearn.cluster import KMeans; from kmeans_resilient import KMeansResilient as KMR; from functions import *; pd.set_option('max_column', None); warnings.filterwarnings('ignore'); comm = MPI.COMM_WORLD; P = comm.Get_size(); rank = comm.Get_rank(); def check_option(opt_arg): try: opts, args = opt_arg; except getopt.GetoptError as err: print(err); print("Use :\t", sys.argv[0], "-b 5 \n\t", "or:", sys.argv[0], "--byzantine 5"); sys.exit(-1); for opt, val in opts: if opt in ("-b", "--byzantine"): if val.isdigit() == False: raise ValueError("Enter an integer as number" "of byzantine machines."); elif opt in ("-h", "--help"): print("Use:", sys.argv[0], "-b 5\n", "or:", sys.argv[0], "--byzantine 5"); sys.exit(-1); else: print("unhandled options"); sys.exit(-1); return opts, args; def check_Nbyzan(opts, P): if len(opts) == 0: n_byzantines = 0; n_byzantines = int(opts[0][1]); if n_byzantines < 0 or n_byzantines > P - 1: raise ValueError("Number of byzantine must be an integer " "< number of workers or >= 0"); return n_byzantines; def sort_centroides(centroids): tmp = np.zeros((centroids.shape)); normes = {}; for centroid in range(0, centroids.shape[0]): norm = np.linalg.norm(centroids[centroid]); normes[norm] = centroid; i=0; for norm in sorted(normes): tmp[i] = centroids[normes[norm]]; i = i + 1; return tmp; def comparaison_cluster(X, label_km, label_by, label_co): pca = decomposition.PCA(n_components = 3); X_reduced = pca.fit_transform(X); x_axis = [val[0] for val in X_reduced]; y_axis = [val[1] for val in X_reduced]; z_axis = [val[2] for val in X_reduced]; fig = plt.figure(figsize=plt.figaspect(0.5), facecolor="w"); ax = fig.add_subplot(1, 3, 1, projection='3d'); plt.title('%d-means'%(label_km[1])); ax.scatter(x_axis, y_axis, z_axis, c=label_km[0]); ax = fig.add_subplot(1, 3, 2, projection='3d'); plt.title('%d Byzantines' % (label_by[1])); ax.scatter(x_axis, y_axis, z_axis, c=label_by[0]); ax = fig.add_subplot(1, 3, 3, projection='3d'); ax.scatter(x_axis, y_axis, z_axis, c=label_co); plt.title('Correction'); plt.show(); def main(): opts, arg = check_option(getopt.getopt(sys.argv[1:], "b:", ["byzantine="])); n_byzantines = check_Nbyzan(opts, P); xaa = pd.read_csv("data/Statlog vehicule silhouette/xaa.dat", header=None, sep='\s+'); xab = pd.read_csv("data/Statlog vehicule silhouette/xab.dat", header=None, sep='\s+'); xac = pd.read_csv("data/Statlog vehicule silhouette/xac.dat", header=None, sep='\s+'); xad = pd.read_csv("data/Statlog vehicule silhouette/xad.dat", header=None, sep='\s+'); xae = pd.read_csv("data/Statlog vehicule silhouette/xae.dat", header=None, sep='\s+'); xaf = pd.read_csv("data/Statlog vehicule silhouette/xaf.dat", header=None, sep='\s+'); xag = pd.read_csv("data/Statlog vehicule silhouette/xag.dat", header=None, sep='\s+'); xah = pd.read_csv("data/Statlog vehicule silhouette/xah.dat", header=None, sep='\s+'); xai = pd.read_csv("data/Statlog vehicule silhouette/xai.dat", header=None, sep='\s+'); data = pd.concat([xaa, xab, xac, xad, xae, xaf, xag, xah, xai], ignore_index=True); cols = data.columns.difference([18]); X = data[cols].values; y = data[18].values; km = KMR(n_clusters=4, n_init=10, n_iter=50, seed=2); by = KMR(n_clusters=4, n_init=10, n_iter=50, seed=2, n_byzantines=n_byzantines); co = KMR(n_clusters=4, n_init=10, n_iter=50, seed=2, n_byzantines=n_byzantines, correction=True); km.fit(X); by.fit(X); co.fit(X); km.centroids_ = sort_centroides(km.centroids_); by.centroids_ = sort_centroides(by.centroids_); co.centroids_ = sort_centroides(co.centroids_); if rank == 0: print('\nKmeans inertia:\n', km.inertia_); print('\nByzantine inertia:\n', by.inertia_); print('\nCorrection inertia:\n', co.inertia_); comparaison_cluster(X, [km.labels_, km.n_clusters], [by.labels_, by.n_byzantines], co.labels_); if __name__ == "__main__": main();
true
true
f7f984e969f29607cfa83a0f9c6f5d92fbf7a72d
264
py
Python
.vscode/extensions/ms-python.python-2020.3.69010/pythonFiles/lib/python/old_ptvsd/ptvsd/reraise2.py
anish-sk/dotfiles
144508dd9afdc141f8f4e6bec3ddb408f92a9827
[ "MIT" ]
5
2019-04-30T02:46:37.000Z
2021-08-22T08:39:11.000Z
.vscode/extensions/ms-python.python-2020.3.69010/pythonFiles/lib/python/old_ptvsd/ptvsd/reraise2.py
anish-sk/dotfiles
144508dd9afdc141f8f4e6bec3ddb408f92a9827
[ "MIT" ]
12
2015-10-30T19:20:28.000Z
2021-04-23T15:59:58.000Z
vscode/extensions/ms-python.python-2020.3.69010/pythonFiles/lib/python/old_ptvsd/ptvsd/reraise2.py
Adespinoza/dotfiles
e2509402a7fd2623a3ea401b6f9fcbf6a372fc60
[ "CC0-1.0" ]
5
2015-09-16T07:50:06.000Z
2019-09-09T14:33:46.000Z
# Copyright (c) Microsoft Corporation. All rights reserved. # Licensed under the MIT License. See LICENSE in the project root # for license information. def reraise(exc_info): # TODO: docstring raise exc_info[0], exc_info[1], exc_info[2] # noqa
29.333333
66
0.708333
def reraise(exc_info): raise exc_info[0], exc_info[1], exc_info[2]
false
true
f7f986315190de3e8b8b526ed7e77f3ffb4e7979
2,130
py
Python
app/models/UserModel.py
sanif/Simple-Blog-Flask
3f84a1acf418e8c72cb6c2f3194371a635df0628
[ "MIT" ]
null
null
null
app/models/UserModel.py
sanif/Simple-Blog-Flask
3f84a1acf418e8c72cb6c2f3194371a635df0628
[ "MIT" ]
null
null
null
app/models/UserModel.py
sanif/Simple-Blog-Flask
3f84a1acf418e8c72cb6c2f3194371a635df0628
[ "MIT" ]
null
null
null
# src/models/UserModel.py import datetime from flask_restful import Resource from safrs.base import SAFRSBase import app.models.PostModel from . import BaseModel, bcrypt, db, ma class UserModel(BaseModel): """ User Model """ # table name __tablename__ = 'users' id = db.Column(db.Integer, primary_key=True) name = db.Column(db.String(128), nullable=False) username = db.Column(db.String(128), unique=True, nullable=False) password = db.Column(db.String(128), nullable=True) created_at = db.Column(db.DateTime) modified_at = db.Column(db.DateTime) posts = db.relationship('PostModel', backref='users', lazy=True) # http_methods = {"GET", "POST"} # class constructor def save(self): db.session.add(self) db.session.commit() def update(self, data): for key, item in data.items(): if key == 'password': # add this new line self.password = self.__generate_hash( item) # add this new line setattr(self, key, item) self.modified_at = datetime.datetime.utcnow() db.session.commit() def delete(self): db.session.delete(self) db.session.commit() def __generate_hash(self, password): return bcrypt.generate_password_hash( password, rounds=10).decode("utf-8") def check_hash(self, password): return bcrypt.check_password_hash(self.password, password) @staticmethod def get_all_users(): return UserModel.query.all() @staticmethod def get_one_user(id): return UserModel.query.get(id) @staticmethod def get_user_by_username(username): return UserModel.query.filter_by(username=username).first() def __repr(self): return '<username {}>'.format(self.username) class UserSchema(ma.SQLAlchemySchema): """ User Schema """ class Meta: model = UserModel id = ma.auto_field() name = ma.auto_field() username = ma.auto_field() created_at = ma.auto_field() modified_at = ma.auto_field() posts = ma.auto_field()
25.97561
69
0.640376
import datetime from flask_restful import Resource from safrs.base import SAFRSBase import app.models.PostModel from . import BaseModel, bcrypt, db, ma class UserModel(BaseModel): __tablename__ = 'users' id = db.Column(db.Integer, primary_key=True) name = db.Column(db.String(128), nullable=False) username = db.Column(db.String(128), unique=True, nullable=False) password = db.Column(db.String(128), nullable=True) created_at = db.Column(db.DateTime) modified_at = db.Column(db.DateTime) posts = db.relationship('PostModel', backref='users', lazy=True) def save(self): db.session.add(self) db.session.commit() def update(self, data): for key, item in data.items(): if key == 'password': self.password = self.__generate_hash( item) setattr(self, key, item) self.modified_at = datetime.datetime.utcnow() db.session.commit() def delete(self): db.session.delete(self) db.session.commit() def __generate_hash(self, password): return bcrypt.generate_password_hash( password, rounds=10).decode("utf-8") def check_hash(self, password): return bcrypt.check_password_hash(self.password, password) @staticmethod def get_all_users(): return UserModel.query.all() @staticmethod def get_one_user(id): return UserModel.query.get(id) @staticmethod def get_user_by_username(username): return UserModel.query.filter_by(username=username).first() def __repr(self): return '<username {}>'.format(self.username) class UserSchema(ma.SQLAlchemySchema): class Meta: model = UserModel id = ma.auto_field() name = ma.auto_field() username = ma.auto_field() created_at = ma.auto_field() modified_at = ma.auto_field() posts = ma.auto_field()
true
true
f7f9869adde2802b8a5d98e792e95d6a617f55e6
628
py
Python
test/test_binary_heap.py
paolodelia99/Python-C-Algorithms
9113ad566e4e659c1f16135c2d3abd3a4c57a46e
[ "MIT" ]
2
2021-02-13T10:58:58.000Z
2021-03-16T09:56:01.000Z
test/test_binary_heap.py
paolodelia99/Python-C-Algorithms
9113ad566e4e659c1f16135c2d3abd3a4c57a46e
[ "MIT" ]
null
null
null
test/test_binary_heap.py
paolodelia99/Python-C-Algorithms
9113ad566e4e659c1f16135c2d3abd3a4c57a46e
[ "MIT" ]
null
null
null
import nose import binary_heap BinaryHeap = binary_heap.BinaryHeap def test_binary_heap_101(): b = BinaryHeap() nose.tools.assert_is_instance(b, BinaryHeap) def test_binary_heap_num_entries(): b = BinaryHeap() nose.tools.assert_equal(b.num_entries(), 0) def test_binary_heap_insert(): b = BinaryHeap() b.insert("Paolo") b.insert("CIao") nose.tools.assert_equal(b.num_entries(), 2) def test_binary_heap_pop(): b = BinaryHeap() b.insert("Paolo") b.insert("CIao") max_el = b.pop() nose.tools.assert_equal(b.num_entries(), 1) nose.tools.assert_equal(max_el, "CIao")
19.625
48
0.687898
import nose import binary_heap BinaryHeap = binary_heap.BinaryHeap def test_binary_heap_101(): b = BinaryHeap() nose.tools.assert_is_instance(b, BinaryHeap) def test_binary_heap_num_entries(): b = BinaryHeap() nose.tools.assert_equal(b.num_entries(), 0) def test_binary_heap_insert(): b = BinaryHeap() b.insert("Paolo") b.insert("CIao") nose.tools.assert_equal(b.num_entries(), 2) def test_binary_heap_pop(): b = BinaryHeap() b.insert("Paolo") b.insert("CIao") max_el = b.pop() nose.tools.assert_equal(b.num_entries(), 1) nose.tools.assert_equal(max_el, "CIao")
true
true
f7f9885c0793993b3a37de767e80561374f8c7b4
13,021
py
Python
dataset/leadbang.py
liqile1/OCNet.pytorch
5fb733adbf178ccc8040197057e3277896b3dc12
[ "MIT" ]
null
null
null
dataset/leadbang.py
liqile1/OCNet.pytorch
5fb733adbf178ccc8040197057e3277896b3dc12
[ "MIT" ]
null
null
null
dataset/leadbang.py
liqile1/OCNet.pytorch
5fb733adbf178ccc8040197057e3277896b3dc12
[ "MIT" ]
null
null
null
##+++++++++++++++++++++++++++++++++++++++++++++++++++++++++++++++++++++++++ ## Created by: speedinghzl02 ## Modified by: RainbowSecret ## Microsoft Research ## yuyua@microsoft.com ## Copyright (c) 2018 ## ## This source code is licensed under the MIT-style license found in the ## LICENSE file in the root directory of this source tree ##+++++++++++++++++++++++++++++++++++++++++++++++++++++++++++++++++++++++++ import cv2 import pdb import collections import matplotlib.pyplot as plt import numpy as np import os import os.path as osp from PIL import Image, ImageOps, ImageFilter import random import torch import torchvision from torch.utils import data import torchvision.transforms as transforms class LeadBangTrain(data.Dataset): def __init__(self, root, max_iters=None, scale=True, mirror=True, ignore_label=255, use_aug=False, network="resnet101"): self.root = root # self.crop_h, self.crop_w = crop_size self.crop_h = 480 self.crop_w = 480 self.img_width = 512 self.img_height = 512 self.scale = scale self.ignore_label = ignore_label self.is_mirror = mirror self.use_aug = use_aug self.network = network self.files = [] self.cache_img = {} self.cache_label = {} self.item_idx_list = [] for item_idx in range(1, 1463): self.item_idx_list.append(item_idx) img_path = 'source/' + str(item_idx) + ".bmp" label_path = 'label/' + str(item_idx) + ".bmp" img_file = osp.join(self.root, img_path) label_file = osp.join(self.root, label_path) print('label file: ', label_file) self.files.append({ "img": img_file, "label": label_file, "name": str(item_idx), "weight": 1 }) self.cache_img[item_idx] = cv2.imread(img_file) self.cache_label[item_idx] = 255 - cv2.imread(label_file, 0) print('{} images are loaded!'.format(1462)) def __len__(self): return len(self.files) def generate_scale_label(self, image, label): f_scale = 0.5 + random.randint(0, 16) / 10.0 image = cv2.resize(image, None, fx=f_scale, fy=f_scale, interpolation = cv2.INTER_LINEAR) label = cv2.resize(label, None, fx=f_scale, fy=f_scale, interpolation = cv2.INTER_NEAREST) return image, label def rescale(self, image, label): image = cv2.resize(image, (self.img_width, self.img_height)) label = cv2.resize(label, (self.img_width, self.img_height)) return image, label def id2trainId(self, label, reverse=False): label_copy = label.copy() if reverse: for v, k in self.id_to_trainid.items(): label_copy[label == k] = v else: for k, v in self.id_to_trainid.items(): label_copy[label == k] = v return label_copy def get_rotate_angle(self, angle_min, angle_max, angle_delta): count = int((angle_max - angle_min) / angle_delta) delta = random.random() * (count + 1) * angle_delta angle = angle_min + delta if angle < angle_min: angle = angle_min if angle > angle_max: angle = angle_max return angle def rotate(self, image, angle, border_value=None): center = (self.img_width // 2, self.img_height // 2) M = cv2.getRotationMatrix2D(center, angle, 1) if border_value is None: rotated = cv2.warpAffine(image, M, (self.img_width, self.img_height)) else: rotated = cv2.warpAffine(image, M, (self.img_width, self.img_height), borderValue=(int(border_value),)) return rotated def get_border_value(self, mat): r = mat.shape[0] c = mat.shape[1] return (mat[1][1] + mat[1][c - 2] + mat[r-2][1] + mat[r-2][c-2] + mat[2][2] + mat[2][c - 3] + mat[r-3][2] + mat[r-3][c-3]) / 8.0 def rotate_img_lb(self, image, label, angle): b = image[0] g = image[1] r = image[2] # (102.9801, 115.9465, 122.7717) # b = self.rotate(b, angle, border_value=255 - 102.9801) # g = self.rotate(g, angle, border_value=255-115.9465) # r = self.rotate(r, angle, border_value=255-122.7717) b = self.rotate(b, angle, border_value=self.get_border_value(b)) g = self.rotate(g, angle, border_value=self.get_border_value(g)) r = self.rotate(r, angle, border_value=self.get_border_value(r)) label = self.rotate(label, angle) image = np.asarray([b, g, r], dtype=np.float32) ret, label = cv2.threshold(label, 127, 255, cv2.THRESH_BINARY) return image, label def adv_img_lb(self, img, lb): # brightness img += (random.random() * 10 - 5) # rotate angle = self.get_rotate_angle(-180, 180, 5) img, lb = self.rotate_img_lb(img, lb, angle) # flip lr if random.random() < 0.5: img = img[:,:,::-1] lb = lb[:,::-1] # flip ud if random.random() < 0.5: img = img[:,::-1,:] lb = lb[::-1,:] return img, lb def __getitem__(self, index): datafiles = self.files[index] item_idx = self.item_idx_list[index] image = self.cache_img[item_idx].copy() label = self.cache_label[item_idx].copy() size = image.shape name = datafiles["name"] image, label = self.rescale(image, label) image = np.array(image, dtype=np.float32) if self.network == "resnet101": # mean = (102.9801, 115.9465, 122.7717) # "mean_value_b" : 141.29403686523437, # "mean_value_g" : 123.58832550048828, # "mean_value_r" : 172.43679809570312, mean = (172.43679809570312, 123.58832550048828, 141.29403686523437) image = image[:,:,::-1] image -= mean elif self.network == "mobilenetv2": mean = (0.485, 0.456, 0.406) var = (0.229, 0.224, 0.225) # print("network: {}, mean: {}, var: {}".format(self.network, mean, var)) image = image[:,:,::-1] image /= 255 image -= mean image /= var elif self.network == "wide_resnet38": mean = (0.41738699, 0.45732192, 0.46886091) var = (0.25685097, 0.26509955, 0.29067996) image = image[:,:,::-1] image /= 255 image -= mean image /= var image = image.transpose((2, 0, 1)) image, label = self.adv_img_lb(image, label) img_h, img_w = label.shape h_off = random.randint(0, img_h - self.crop_h) w_off = random.randint(0, img_w - self.crop_w) image = np.asarray(image[:,h_off : h_off+self.crop_h, w_off : w_off+self.crop_w], np.float32) label = np.asarray(label[h_off : h_off+self.crop_h, w_off : w_off+self.crop_w], np.float32) # [0, 255] => [0, 1] ret, label = cv2.threshold(label, 127, 1, cv2.THRESH_BINARY) label = np.array(label, dtype=np.int64) return image.copy(), label.copy(), np.array(size), name class LeadBangTest(data.Dataset): def __init__(self, root, max_iters=None, scale=True, mirror=True, ignore_label=255, network="resnet101"): self.root = root # self.crop_h, self.crop_w = crop_size self.crop_h = 512 self.crop_w = 512 self.img_width = 512 self.img_height = 512 self.scale = scale self.ignore_label = ignore_label self.is_mirror = mirror self.network = network self.files = [] self.cache_img = {} self.cache_label = {} self.item_idx_list = [] for item_idx in range(1463, 2352): self.item_idx_list.append(item_idx) img_path = 'source/' + str(item_idx) + ".bmp" label_path = 'label/' + str(item_idx) + ".bmp" img_file = osp.join(self.root, img_path) label_file = osp.join(self.root, label_path) self.files.append({ "img": img_file, "label": label_file, "name": str(item_idx), "weight": 1 }) print("label: ", label_file) self.cache_img[item_idx] = cv2.imread(img_file) self.cache_label[item_idx] = 255-cv2.imread(label_file, 0) print('{} images are loaded!'.format(2352-1463)) def __len__(self): return len(self.files) def id2trainId(self, label, reverse=False): label_copy = label.copy() if reverse: for v, k in self.id_to_trainid.items(): label_copy[label == k] = v else: for k, v in self.id_to_trainid.items(): label_copy[label == k] = v return label_copy def rescale(self, image, label): image = cv2.resize(image, (self.img_width, self.img_height)) label = cv2.resize(label, (self.img_width, self.img_height)) return image, label def __getitem__(self, index): datafiles = self.files[index] item_idx = self.item_idx_list[index] image = self.cache_img[item_idx].copy() label = self.cache_label[item_idx].copy() size = image.shape name = datafiles["name"] image, label = self.rescale(image, label) image = np.array(image, dtype=np.float32) if self.network == "resnet101": # mean = (102.9801, 115.9465, 122.7717) mean = (172.43679809570312, 123.58832550048828, 141.29403686523437) image = image[:,:,::-1] image -= mean elif self.network == "mobilenetv2": mean = (0.485, 0.456, 0.406) var = (0.229, 0.224, 0.225) # print("network: {}, mean: {}, var: {}".format(self.network, mean, var)) image = image[:,:,::-1] image /= 255 image -= mean image /= var elif self.network == "wide_resnet38": mean = (0.41738699, 0.45732192, 0.46886091) var = (0.25685097, 0.26509955, 0.29067996) image = image[:,:,::-1] image /= 255 image -= mean image /= var image = image.transpose((2, 0, 1)) img_h, img_w = label.shape h_off = random.randint(0, img_h - self.crop_h) w_off = random.randint(0, img_w - self.crop_w) image = np.asarray(image[:,h_off : h_off+self.crop_h, w_off : w_off+self.crop_w], np.float32) label = np.asarray(label[h_off : h_off+self.crop_h, w_off : w_off+self.crop_w], np.float32) # [0, 255] => [0, 1] ret, label = cv2.threshold(label, 127, 1, cv2.THRESH_BINARY) label = np.array(label, dtype=np.int64) label = np.asarray(label, dtype=np.int64) return image.copy(), label.copy(), np.array(size), name def test_train_leadbang(): dst = LeadBangTrain("./leadbang/") trainloader = data.DataLoader(dst, batch_size=1, num_workers=0) with open("./list/cityscapes/trainval.lst") as f: train_list = f.readlines() train_list = [x.strip() for x in train_list] f_w = open("./list/cityscapes/bus_truck_train.lst", "w") for i, dt in enumerate(trainloader): imgs, labels, _, name = dt img = imgs.numpy() lb = labels.numpy() print(name) print(img.shape) print(lb.shape) name = name[0] img = np.transpose(img[0], (1,2,0)) img += (172.43679809570312, 123.58832550048828, 141.29403686523437) img = img[:,:,::-1] img = np.array(img, dtype=np.uint8) lb = 255 - lb[0] * 255 lb = np.asarray(lb, dtype=np.uint8) cv2.imshow( "img", img) cv2.imshow( "lb", lb) cv2.waitKey(0) def test_test_leadbang(): dst = LeadBangTest("./leadbang/") trainloader = data.DataLoader(dst, batch_size=1, num_workers=0) with open("./list/cityscapes/trainval.lst") as f: train_list = f.readlines() train_list = [x.strip() for x in train_list] f_w = open("./list/cityscapes/bus_truck_train.lst", "w") for i, dt in enumerate(trainloader): imgs, labels, _, name = dt img = imgs.numpy() lb = labels.numpy() print(name) print(img.shape) print(lb.shape) name = name[0] img = np.transpose(img[0], (1,2,0)) img += (172.43679809570312, 123.58832550048828, 141.29403686523437) img = img[:,:,::-1] img = np.array(img, dtype=np.uint8) lb = 255 - lb[0] * 255 lb = np.asarray(lb, dtype=np.uint8) cv2.imshow( "img", img) cv2.imshow( "lb", lb) cv2.waitKey(0) if __name__ == '__main__': test_train_leadbang() # test_test_leadbang()
36.069252
136
0.558098
e=True, mirror=True, ignore_label=255, use_aug=False, network="resnet101"): self.root = root self.crop_h = 480 self.crop_w = 480 self.img_width = 512 self.img_height = 512 self.scale = scale self.ignore_label = ignore_label self.is_mirror = mirror self.use_aug = use_aug self.network = network self.files = [] self.cache_img = {} self.cache_label = {} self.item_idx_list = [] for item_idx in range(1, 1463): self.item_idx_list.append(item_idx) img_path = 'source/' + str(item_idx) + ".bmp" label_path = 'label/' + str(item_idx) + ".bmp" img_file = osp.join(self.root, img_path) label_file = osp.join(self.root, label_path) print('label file: ', label_file) self.files.append({ "img": img_file, "label": label_file, "name": str(item_idx), "weight": 1 }) self.cache_img[item_idx] = cv2.imread(img_file) self.cache_label[item_idx] = 255 - cv2.imread(label_file, 0) print('{} images are loaded!'.format(1462)) def __len__(self): return len(self.files) def generate_scale_label(self, image, label): f_scale = 0.5 + random.randint(0, 16) / 10.0 image = cv2.resize(image, None, fx=f_scale, fy=f_scale, interpolation = cv2.INTER_LINEAR) label = cv2.resize(label, None, fx=f_scale, fy=f_scale, interpolation = cv2.INTER_NEAREST) return image, label def rescale(self, image, label): image = cv2.resize(image, (self.img_width, self.img_height)) label = cv2.resize(label, (self.img_width, self.img_height)) return image, label def id2trainId(self, label, reverse=False): label_copy = label.copy() if reverse: for v, k in self.id_to_trainid.items(): label_copy[label == k] = v else: for k, v in self.id_to_trainid.items(): label_copy[label == k] = v return label_copy def get_rotate_angle(self, angle_min, angle_max, angle_delta): count = int((angle_max - angle_min) / angle_delta) delta = random.random() * (count + 1) * angle_delta angle = angle_min + delta if angle < angle_min: angle = angle_min if angle > angle_max: angle = angle_max return angle def rotate(self, image, angle, border_value=None): center = (self.img_width // 2, self.img_height // 2) M = cv2.getRotationMatrix2D(center, angle, 1) if border_value is None: rotated = cv2.warpAffine(image, M, (self.img_width, self.img_height)) else: rotated = cv2.warpAffine(image, M, (self.img_width, self.img_height), borderValue=(int(border_value),)) return rotated def get_border_value(self, mat): r = mat.shape[0] c = mat.shape[1] return (mat[1][1] + mat[1][c - 2] + mat[r-2][1] + mat[r-2][c-2] + mat[2][2] + mat[2][c - 3] + mat[r-3][2] + mat[r-3][c-3]) / 8.0 def rotate_img_lb(self, image, label, angle): b = image[0] g = image[1] r = image[2] b = self.rotate(b, angle, border_value=self.get_border_value(b)) g = self.rotate(g, angle, border_value=self.get_border_value(g)) r = self.rotate(r, angle, border_value=self.get_border_value(r)) label = self.rotate(label, angle) image = np.asarray([b, g, r], dtype=np.float32) ret, label = cv2.threshold(label, 127, 255, cv2.THRESH_BINARY) return image, label def adv_img_lb(self, img, lb): img += (random.random() * 10 - 5) angle = self.get_rotate_angle(-180, 180, 5) img, lb = self.rotate_img_lb(img, lb, angle) if random.random() < 0.5: img = img[:,:,::-1] lb = lb[:,::-1] if random.random() < 0.5: img = img[:,::-1,:] lb = lb[::-1,:] return img, lb def __getitem__(self, index): datafiles = self.files[index] item_idx = self.item_idx_list[index] image = self.cache_img[item_idx].copy() label = self.cache_label[item_idx].copy() size = image.shape name = datafiles["name"] image, label = self.rescale(image, label) image = np.array(image, dtype=np.float32) if self.network == "resnet101": mean = (172.43679809570312, 123.58832550048828, 141.29403686523437) image = image[:,:,::-1] image -= mean elif self.network == "mobilenetv2": mean = (0.485, 0.456, 0.406) var = (0.229, 0.224, 0.225) image = image[:,:,::-1] image /= 255 image -= mean image /= var elif self.network == "wide_resnet38": mean = (0.41738699, 0.45732192, 0.46886091) var = (0.25685097, 0.26509955, 0.29067996) image = image[:,:,::-1] image /= 255 image -= mean image /= var image = image.transpose((2, 0, 1)) image, label = self.adv_img_lb(image, label) img_h, img_w = label.shape h_off = random.randint(0, img_h - self.crop_h) w_off = random.randint(0, img_w - self.crop_w) image = np.asarray(image[:,h_off : h_off+self.crop_h, w_off : w_off+self.crop_w], np.float32) label = np.asarray(label[h_off : h_off+self.crop_h, w_off : w_off+self.crop_w], np.float32) ret, label = cv2.threshold(label, 127, 1, cv2.THRESH_BINARY) label = np.array(label, dtype=np.int64) return image.copy(), label.copy(), np.array(size), name class LeadBangTest(data.Dataset): def __init__(self, root, max_iters=None, scale=True, mirror=True, ignore_label=255, network="resnet101"): self.root = root self.crop_h = 512 self.crop_w = 512 self.img_width = 512 self.img_height = 512 self.scale = scale self.ignore_label = ignore_label self.is_mirror = mirror self.network = network self.files = [] self.cache_img = {} self.cache_label = {} self.item_idx_list = [] for item_idx in range(1463, 2352): self.item_idx_list.append(item_idx) img_path = 'source/' + str(item_idx) + ".bmp" label_path = 'label/' + str(item_idx) + ".bmp" img_file = osp.join(self.root, img_path) label_file = osp.join(self.root, label_path) self.files.append({ "img": img_file, "label": label_file, "name": str(item_idx), "weight": 1 }) print("label: ", label_file) self.cache_img[item_idx] = cv2.imread(img_file) self.cache_label[item_idx] = 255-cv2.imread(label_file, 0) print('{} images are loaded!'.format(2352-1463)) def __len__(self): return len(self.files) def id2trainId(self, label, reverse=False): label_copy = label.copy() if reverse: for v, k in self.id_to_trainid.items(): label_copy[label == k] = v else: for k, v in self.id_to_trainid.items(): label_copy[label == k] = v return label_copy def rescale(self, image, label): image = cv2.resize(image, (self.img_width, self.img_height)) label = cv2.resize(label, (self.img_width, self.img_height)) return image, label def __getitem__(self, index): datafiles = self.files[index] item_idx = self.item_idx_list[index] image = self.cache_img[item_idx].copy() label = self.cache_label[item_idx].copy() size = image.shape name = datafiles["name"] image, label = self.rescale(image, label) image = np.array(image, dtype=np.float32) if self.network == "resnet101": mean = (172.43679809570312, 123.58832550048828, 141.29403686523437) image = image[:,:,::-1] image -= mean elif self.network == "mobilenetv2": mean = (0.485, 0.456, 0.406) var = (0.229, 0.224, 0.225) image = image[:,:,::-1] image /= 255 image -= mean image /= var elif self.network == "wide_resnet38": mean = (0.41738699, 0.45732192, 0.46886091) var = (0.25685097, 0.26509955, 0.29067996) image = image[:,:,::-1] image /= 255 image -= mean image /= var image = image.transpose((2, 0, 1)) img_h, img_w = label.shape h_off = random.randint(0, img_h - self.crop_h) w_off = random.randint(0, img_w - self.crop_w) image = np.asarray(image[:,h_off : h_off+self.crop_h, w_off : w_off+self.crop_w], np.float32) label = np.asarray(label[h_off : h_off+self.crop_h, w_off : w_off+self.crop_w], np.float32) ret, label = cv2.threshold(label, 127, 1, cv2.THRESH_BINARY) label = np.array(label, dtype=np.int64) label = np.asarray(label, dtype=np.int64) return image.copy(), label.copy(), np.array(size), name def test_train_leadbang(): dst = LeadBangTrain("./leadbang/") trainloader = data.DataLoader(dst, batch_size=1, num_workers=0) with open("./list/cityscapes/trainval.lst") as f: train_list = f.readlines() train_list = [x.strip() for x in train_list] f_w = open("./list/cityscapes/bus_truck_train.lst", "w") for i, dt in enumerate(trainloader): imgs, labels, _, name = dt img = imgs.numpy() lb = labels.numpy() print(name) print(img.shape) print(lb.shape) name = name[0] img = np.transpose(img[0], (1,2,0)) img += (172.43679809570312, 123.58832550048828, 141.29403686523437) img = img[:,:,::-1] img = np.array(img, dtype=np.uint8) lb = 255 - lb[0] * 255 lb = np.asarray(lb, dtype=np.uint8) cv2.imshow( "img", img) cv2.imshow( "lb", lb) cv2.waitKey(0) def test_test_leadbang(): dst = LeadBangTest("./leadbang/") trainloader = data.DataLoader(dst, batch_size=1, num_workers=0) with open("./list/cityscapes/trainval.lst") as f: train_list = f.readlines() train_list = [x.strip() for x in train_list] f_w = open("./list/cityscapes/bus_truck_train.lst", "w") for i, dt in enumerate(trainloader): imgs, labels, _, name = dt img = imgs.numpy() lb = labels.numpy() print(name) print(img.shape) print(lb.shape) name = name[0] img = np.transpose(img[0], (1,2,0)) img += (172.43679809570312, 123.58832550048828, 141.29403686523437) img = img[:,:,::-1] img = np.array(img, dtype=np.uint8) lb = 255 - lb[0] * 255 lb = np.asarray(lb, dtype=np.uint8) cv2.imshow( "img", img) cv2.imshow( "lb", lb) cv2.waitKey(0) if __name__ == '__main__': test_train_leadbang()
true
true
f7f988e26776eaa47c64078a1aae3b28165ff015
24,376
py
Python
electrum/plugins/coldcard/coldcard.py
c4pt000/electrum-radiocoin
7cb5f618a9aa8cd03d60191624a0e57cc24646d2
[ "MIT" ]
null
null
null
electrum/plugins/coldcard/coldcard.py
c4pt000/electrum-radiocoin
7cb5f618a9aa8cd03d60191624a0e57cc24646d2
[ "MIT" ]
null
null
null
electrum/plugins/coldcard/coldcard.py
c4pt000/electrum-radiocoin
7cb5f618a9aa8cd03d60191624a0e57cc24646d2
[ "MIT" ]
null
null
null
# # Coldcard Electrum plugin main code. # # import os, time, io import traceback from typing import TYPE_CHECKING, Optional import struct from electrum import bip32 from electrum.bip32 import BIP32Node, InvalidMasterKeyVersionBytes from electrum.i18n import _ from electrum.plugin import Device, hook, runs_in_hwd_thread from electrum.keystore import Hardware_KeyStore, KeyStoreWithMPK from electrum.transaction import PartialTransaction from electrum.wallet import Standard_Wallet, Multisig_Wallet, Abstract_Wallet from electrum.util import bfh, bh2u, versiontuple, UserFacingException from electrum.base_wizard import ScriptTypeNotSupported from electrum.logging import get_logger from ..hw_wallet import HW_PluginBase, HardwareClientBase from ..hw_wallet.plugin import LibraryFoundButUnusable, only_hook_if_libraries_available _logger = get_logger(__name__) try: import hid from ckcc.protocol import CCProtocolPacker, CCProtocolUnpacker from ckcc.protocol import CCProtoError, CCUserRefused, CCBusyError from ckcc.constants import (MAX_MSG_LEN, MAX_BLK_LEN, MSG_SIGNING_MAX_LENGTH, MAX_TXN_LEN, AF_CLASSIC, AF_P2SH, AF_P2WPKH, AF_P2WSH, AF_P2WPKH_P2SH, AF_P2WSH_P2SH) from ckcc.client import ColdcardDevice, COINKITE_VID, CKCC_PID, CKCC_SIMULATOR_PATH requirements_ok = True class ElectrumColdcardDevice(ColdcardDevice): # avoid use of pycoin for MiTM message signature test def mitm_verify(self, sig, expect_xpub): # verify a signature (65 bytes) over the session key, using the master bip32 node # - customized to use specific EC library of Electrum. pubkey = BIP32Node.from_xkey(expect_xpub).eckey try: pubkey.verify_message_hash(sig[1:65], self.session_key) return True except: return False except ImportError as e: if not (isinstance(e, ModuleNotFoundError) and e.name == 'ckcc'): _logger.exception('error importing coldcard plugin deps') requirements_ok = False COINKITE_VID = 0xd13e CKCC_PID = 0xcc10 CKCC_SIMULATED_PID = CKCC_PID ^ 0x55aa class CKCCClient(HardwareClientBase): def __init__(self, plugin, handler, dev_path, *, is_simulator=False): HardwareClientBase.__init__(self, plugin=plugin) self.device = plugin.device self.handler = handler # if we know what the (xfp, xpub) "should be" then track it here self._expected_device = None if is_simulator: self.dev = ElectrumColdcardDevice(dev_path, encrypt=True) else: # open the real HID device hd = hid.device(path=dev_path) hd.open_path(dev_path) self.dev = ElectrumColdcardDevice(dev=hd, encrypt=True) # NOTE: MiTM test is delayed until we have a hint as to what XPUB we # should expect. It's also kinda slow. def __repr__(self): return '<CKCCClient: xfp=%s label=%r>' % (xfp2str(self.dev.master_fingerprint), self.label()) @runs_in_hwd_thread def verify_connection(self, expected_xfp: int, expected_xpub=None): ex = (expected_xfp, expected_xpub) if self._expected_device == ex: # all is as expected return if expected_xpub is None: expected_xpub = self.dev.master_xpub if ((self._expected_device is not None) or (self.dev.master_fingerprint != expected_xfp) or (self.dev.master_xpub != expected_xpub)): # probably indicating programing error, not hacking _logger.info(f"xpubs. reported by device: {self.dev.master_xpub}. " f"stored in file: {expected_xpub}") raise RuntimeError("Expecting %s but that's not what's connected?!" % xfp2str(expected_xfp)) # check signature over session key # - mitm might have lied about xfp and xpub up to here # - important that we use value capture at wallet creation time, not some value # we read over USB today self.dev.check_mitm(expected_xpub=expected_xpub) self._expected_device = ex if not getattr(self, 'ckcc_xpub', None): self.ckcc_xpub = expected_xpub _logger.info("Successfully verified against MiTM") def is_pairable(self): # can't do anything w/ devices that aren't setup (this code not normally reachable) return bool(self.dev.master_xpub) @runs_in_hwd_thread def close(self): # close the HID device (so can be reused) self.dev.close() self.dev = None def is_initialized(self): return bool(self.dev.master_xpub) def label(self): # 'label' of this Coldcard. Warning: gets saved into wallet file, which might # not be encrypted, so better for privacy if based on xpub/fingerprint rather than # USB serial number. if self.dev.is_simulator: lab = 'Coldcard Simulator ' + xfp2str(self.dev.master_fingerprint) elif not self.dev.master_fingerprint: # failback; not expected lab = 'Coldcard #' + self.dev.serial else: lab = 'Coldcard ' + xfp2str(self.dev.master_fingerprint) return lab def manipulate_keystore_dict_during_wizard_setup(self, d: dict): master_xpub = self.dev.master_xpub if master_xpub is not None: try: node = BIP32Node.from_xkey(master_xpub) except InvalidMasterKeyVersionBytes: raise UserFacingException( _('Invalid xpub magic. Make sure your {} device is set to the correct chain.').format(self.device) + ' ' + _('You might have to unplug and plug it in again.') ) from None d['ckcc_xpub'] = master_xpub @runs_in_hwd_thread def has_usable_connection_with_device(self): # Do end-to-end ping test try: self.ping_check() return True except: return False @runs_in_hwd_thread def get_xpub(self, bip32_path, xtype): assert xtype in ColdcardPlugin.SUPPORTED_XTYPES _logger.info('Derive xtype = %r' % xtype) xpub = self.dev.send_recv(CCProtocolPacker.get_xpub(bip32_path), timeout=5000) # TODO handle timeout? # change type of xpub to the requested type try: node = BIP32Node.from_xkey(xpub) except InvalidMasterKeyVersionBytes: raise UserFacingException(_('Invalid xpub magic. Make sure your {} device is set to the correct chain.') .format(self.device)) from None if xtype != 'standard': xpub = node._replace(xtype=xtype).to_xpub() return xpub @runs_in_hwd_thread def ping_check(self): # check connection is working assert self.dev.session_key, 'not encrypted?' req = b'1234 Electrum Plugin 4321' # free up to 59 bytes try: echo = self.dev.send_recv(CCProtocolPacker.ping(req)) assert echo == req except: raise RuntimeError("Communication trouble with Coldcard") @runs_in_hwd_thread def show_address(self, path, addr_fmt): # prompt user w/ address, also returns it immediately. return self.dev.send_recv(CCProtocolPacker.show_address(path, addr_fmt), timeout=None) @runs_in_hwd_thread def show_p2sh_address(self, *args, **kws): # prompt user w/ p2sh address, also returns it immediately. return self.dev.send_recv(CCProtocolPacker.show_p2sh_address(*args, **kws), timeout=None) @runs_in_hwd_thread def get_version(self): # gives list of strings return self.dev.send_recv(CCProtocolPacker.version(), timeout=1000).split('\n') @runs_in_hwd_thread def sign_message_start(self, path, msg): # this starts the UX experience. self.dev.send_recv(CCProtocolPacker.sign_message(msg, path), timeout=None) @runs_in_hwd_thread def sign_message_poll(self): # poll device... if user has approved, will get tuple: (addr, sig) else None return self.dev.send_recv(CCProtocolPacker.get_signed_msg(), timeout=None) @runs_in_hwd_thread def sign_transaction_start(self, raw_psbt: bytes, *, finalize: bool = False): # Multiple steps to sign: # - upload binary # - start signing UX # - wait for coldcard to complete process, or have it refused. # - download resulting txn assert 20 <= len(raw_psbt) < MAX_TXN_LEN, 'PSBT is too big' dlen, chk = self.dev.upload_file(raw_psbt) resp = self.dev.send_recv(CCProtocolPacker.sign_transaction(dlen, chk, finalize=finalize), timeout=None) if resp != None: raise ValueError(resp) @runs_in_hwd_thread def sign_transaction_poll(self): # poll device... if user has approved, will get tuple: (legnth, checksum) else None return self.dev.send_recv(CCProtocolPacker.get_signed_txn(), timeout=None) @runs_in_hwd_thread def download_file(self, length, checksum, file_number=1): # get a file return self.dev.download_file(length, checksum, file_number=file_number) class Coldcard_KeyStore(Hardware_KeyStore): hw_type = 'coldcard' device = 'Coldcard' plugin: 'ColdcardPlugin' def __init__(self, d): Hardware_KeyStore.__init__(self, d) # Errors and other user interaction is done through the wallet's # handler. The handler is per-window and preserved across # device reconnects self.force_watching_only = False self.ux_busy = False # we need to know at least the fingerprint of the master xpub to verify against MiTM # - device reports these value during encryption setup process # - full xpub value now optional self.ckcc_xpub = d.get('ckcc_xpub', None) def dump(self): # our additions to the stored data about keystore -- only during creation? d = Hardware_KeyStore.dump(self) d['ckcc_xpub'] = self.ckcc_xpub return d def get_xfp_int(self) -> int: xfp = self.get_root_fingerprint() assert xfp is not None return xfp_int_from_xfp_bytes(bfh(xfp)) def get_client(self): # called when user tries to do something like view address, sign somthing. # - not called during probing/setup # - will fail if indicated device can't produce the xpub (at derivation) expected rv = self.plugin.get_client(self) if rv: xfp_int = self.get_xfp_int() rv.verify_connection(xfp_int, self.ckcc_xpub) return rv def give_error(self, message, clear_client=False): self.logger.info(message) if not self.ux_busy: self.handler.show_error(message) else: self.ux_busy = False if clear_client: self.client = None raise UserFacingException(message) def wrap_busy(func): # decorator: function takes over the UX on the device. def wrapper(self, *args, **kwargs): try: self.ux_busy = True return func(self, *args, **kwargs) finally: self.ux_busy = False return wrapper def decrypt_message(self, pubkey, message, password): raise UserFacingException(_('Encryption and decryption are currently not supported for {}').format(self.device)) @wrap_busy def sign_message(self, sequence, message, password): # Sign a message on device. Since we have big screen, of course we # have to show the message unabiguously there first! try: msg = message.encode('ascii', errors='strict') assert 1 <= len(msg) <= MSG_SIGNING_MAX_LENGTH except (UnicodeError, AssertionError): # there are other restrictions on message content, # but let the device enforce and report those self.handler.show_error('Only short (%d max) ASCII messages can be signed.' % MSG_SIGNING_MAX_LENGTH) return b'' path = self.get_derivation_prefix() + ("/%d/%d" % sequence) try: cl = self.get_client() try: self.handler.show_message("Signing message (using %s)..." % path) cl.sign_message_start(path, msg) while 1: # How to kill some time, without locking UI? time.sleep(0.250) resp = cl.sign_message_poll() if resp is not None: break finally: self.handler.finished() assert len(resp) == 2 addr, raw_sig = resp # already encoded in Radiocoin fashion, binary. assert 40 < len(raw_sig) <= 65 return raw_sig except (CCUserRefused, CCBusyError) as exc: self.handler.show_error(str(exc)) except CCProtoError as exc: self.logger.exception('Error showing address') self.handler.show_error('{}\n\n{}'.format( _('Error showing address') + ':', str(exc))) except Exception as e: self.give_error(e, True) # give empty bytes for error cases; it seems to clear the old signature box return b'' @wrap_busy def sign_transaction(self, tx, password): # Upload PSBT for signing. # - we can also work offline (without paired device present) if tx.is_complete(): return client = self.get_client() assert client.dev.master_fingerprint == self.get_xfp_int() raw_psbt = tx.serialize_as_bytes() try: try: self.handler.show_message("Authorize Transaction...") client.sign_transaction_start(raw_psbt) while 1: # How to kill some time, without locking UI? time.sleep(0.250) resp = client.sign_transaction_poll() if resp is not None: break rlen, rsha = resp # download the resulting txn. raw_resp = client.download_file(rlen, rsha) finally: self.handler.finished() except (CCUserRefused, CCBusyError) as exc: self.logger.info(f'Did not sign: {exc}') self.handler.show_error(str(exc)) return except BaseException as e: self.logger.exception('') self.give_error(e, True) return tx2 = PartialTransaction.from_raw_psbt(raw_resp) # apply partial signatures back into txn tx.combine_with_other_psbt(tx2) # caller's logic looks at tx now and if it's sufficiently signed, # will send it if that's the user's intent. @staticmethod def _encode_txin_type(txin_type): # Map from Electrum code names to our code numbers. return {'standard': AF_CLASSIC, 'p2pkh': AF_CLASSIC, 'p2sh': AF_P2SH, 'p2wpkh-p2sh': AF_P2WPKH_P2SH, 'p2wpkh': AF_P2WPKH, 'p2wsh-p2sh': AF_P2WSH_P2SH, 'p2wsh': AF_P2WSH, }[txin_type] @wrap_busy def show_address(self, sequence, txin_type): client = self.get_client() address_path = self.get_derivation_prefix()[2:] + "/%d/%d"%sequence addr_fmt = self._encode_txin_type(txin_type) try: try: self.handler.show_message(_("Showing address ...")) dev_addr = client.show_address(address_path, addr_fmt) # we could double check address here finally: self.handler.finished() except CCProtoError as exc: self.logger.exception('Error showing address') self.handler.show_error('{}\n\n{}'.format( _('Error showing address') + ':', str(exc))) except BaseException as exc: self.logger.exception('') self.handler.show_error(exc) @wrap_busy def show_p2sh_address(self, M, script, xfp_paths, txin_type): client = self.get_client() addr_fmt = self._encode_txin_type(txin_type) try: try: self.handler.show_message(_("Showing address ...")) dev_addr = client.show_p2sh_address(M, xfp_paths, script, addr_fmt=addr_fmt) # we could double check address here finally: self.handler.finished() except CCProtoError as exc: self.logger.exception('Error showing address') self.handler.show_error('{}.\n{}\n\n{}'.format( _('Error showing address'), _('Make sure you have imported the correct wallet description ' 'file on the device for this multisig wallet.'), str(exc))) except BaseException as exc: self.logger.exception('') self.handler.show_error(exc) class ColdcardPlugin(HW_PluginBase): keystore_class = Coldcard_KeyStore minimum_library = (0, 7, 7) DEVICE_IDS = [ (COINKITE_VID, CKCC_PID), (COINKITE_VID, CKCC_SIMULATED_PID) ] SUPPORTED_XTYPES = ('standard', 'p2wpkh-p2sh', 'p2wpkh', 'p2wsh-p2sh', 'p2wsh') def __init__(self, parent, config, name): HW_PluginBase.__init__(self, parent, config, name) self.libraries_available = self.check_libraries_available() if not self.libraries_available: return self.device_manager().register_devices(self.DEVICE_IDS, plugin=self) self.device_manager().register_enumerate_func(self.detect_simulator) def get_library_version(self): import ckcc try: version = ckcc.__version__ except AttributeError: version = 'unknown' if requirements_ok: return version else: raise LibraryFoundButUnusable(library_version=version) def detect_simulator(self): # if there is a simulator running on this machine, # return details about it so it's offered as a pairing choice fn = CKCC_SIMULATOR_PATH if os.path.exists(fn): return [Device(path=fn, interface_number=-1, id_=fn, product_key=(COINKITE_VID, CKCC_SIMULATED_PID), usage_page=0, transport_ui_string='simulator')] return [] @runs_in_hwd_thread def create_client(self, device, handler): if handler: self.handler = handler # We are given a HID device, or at least some details about it. # Not sure why not we aren't just given a HID library handle, but # the 'path' is unabiguous, so we'll use that. try: rv = CKCCClient(self, handler, device.path, is_simulator=(device.product_key[1] == CKCC_SIMULATED_PID)) return rv except Exception as e: self.logger.exception('late failure connecting to device?') return None def setup_device(self, device_info, wizard, purpose): device_id = device_info.device.id_ client = self.scan_and_create_client_for_device(device_id=device_id, wizard=wizard) return client def get_xpub(self, device_id, derivation, xtype, wizard): # this seems to be part of the pairing process only, not during normal ops? # base_wizard:on_hw_derivation if xtype not in self.SUPPORTED_XTYPES: raise ScriptTypeNotSupported(_('This type of script is not supported with {}.').format(self.device)) client = self.scan_and_create_client_for_device(device_id=device_id, wizard=wizard) client.ping_check() xpub = client.get_xpub(derivation, xtype) return xpub @runs_in_hwd_thread def get_client(self, keystore, force_pair=True, *, devices=None, allow_user_interaction=True) -> Optional['CKCCClient']: # Acquire a connection to the hardware device (via USB) client = super().get_client(keystore, force_pair, devices=devices, allow_user_interaction=allow_user_interaction) if client is not None: client.ping_check() return client @staticmethod def export_ms_wallet(wallet: Multisig_Wallet, fp, name): # Build the text file Coldcard needs to understand the multisig wallet # it is participating in. All involved Coldcards can share same file. assert isinstance(wallet, Multisig_Wallet) print('# Exported from Electrum', file=fp) print(f'Name: {name:.20s}', file=fp) print(f'Policy: {wallet.m} of {wallet.n}', file=fp) print(f'Format: {wallet.txin_type.upper()}', file=fp) xpubs = [] for xpub, ks in zip(wallet.get_master_public_keys(), wallet.get_keystores()): # type: str, KeyStoreWithMPK fp_bytes, der_full = ks.get_fp_and_derivation_to_be_used_in_partial_tx(der_suffix=[], only_der_suffix=False) fp_hex = fp_bytes.hex().upper() der_prefix_str = bip32.convert_bip32_intpath_to_strpath(der_full) xpubs.append((fp_hex, xpub, der_prefix_str)) # Before v3.2.1 derivation didn't matter too much to the Coldcard, since it # could use key path data from PSBT or USB request as needed. However, # derivation data is now required. print('', file=fp) assert len(xpubs) == wallet.n for xfp, xpub, der_prefix in xpubs: print(f'Derivation: {der_prefix}', file=fp) print(f'{xfp}: {xpub}\n', file=fp) def show_address(self, wallet, address, keystore: 'Coldcard_KeyStore' = None): if keystore is None: keystore = wallet.get_keystore() if not self.show_address_helper(wallet, address, keystore): return txin_type = wallet.get_txin_type(address) # Standard_Wallet => not multisig, must be bip32 if type(wallet) is Standard_Wallet: sequence = wallet.get_address_index(address) keystore.show_address(sequence, txin_type) elif type(wallet) is Multisig_Wallet: assert isinstance(wallet, Multisig_Wallet) # only here for type-hints in IDE # More involved for P2SH/P2WSH addresses: need M, and all public keys, and their # derivation paths. Must construct script, and track fingerprints+paths for # all those keys pubkey_deriv_info = wallet.get_public_keys_with_deriv_info(address) pubkey_hexes = sorted([pk.hex() for pk in list(pubkey_deriv_info)]) xfp_paths = [] for pubkey_hex in pubkey_hexes: pubkey = bytes.fromhex(pubkey_hex) ks, der_suffix = pubkey_deriv_info[pubkey] fp_bytes, der_full = ks.get_fp_and_derivation_to_be_used_in_partial_tx(der_suffix, only_der_suffix=False) xfp_int = xfp_int_from_xfp_bytes(fp_bytes) xfp_paths.append([xfp_int] + list(der_full)) script = bfh(wallet.pubkeys_to_scriptcode(pubkey_hexes)) keystore.show_p2sh_address(wallet.m, script, xfp_paths, txin_type) else: keystore.handler.show_error(_('This function is only available for standard wallets when using {}.').format(self.device)) return def xfp_int_from_xfp_bytes(fp_bytes: bytes) -> int: return int.from_bytes(fp_bytes, byteorder="little", signed=False) def xfp2str(xfp: int) -> str: # Standardized way to show an xpub's fingerprint... it's a 4-byte string # and not really an integer. Used to show as '0x%08x' but that's wrong endian. return struct.pack('<I', xfp).hex().lower() # EOF
38.147105
133
0.623154
import os, time, io import traceback from typing import TYPE_CHECKING, Optional import struct from electrum import bip32 from electrum.bip32 import BIP32Node, InvalidMasterKeyVersionBytes from electrum.i18n import _ from electrum.plugin import Device, hook, runs_in_hwd_thread from electrum.keystore import Hardware_KeyStore, KeyStoreWithMPK from electrum.transaction import PartialTransaction from electrum.wallet import Standard_Wallet, Multisig_Wallet, Abstract_Wallet from electrum.util import bfh, bh2u, versiontuple, UserFacingException from electrum.base_wizard import ScriptTypeNotSupported from electrum.logging import get_logger from ..hw_wallet import HW_PluginBase, HardwareClientBase from ..hw_wallet.plugin import LibraryFoundButUnusable, only_hook_if_libraries_available _logger = get_logger(__name__) try: import hid from ckcc.protocol import CCProtocolPacker, CCProtocolUnpacker from ckcc.protocol import CCProtoError, CCUserRefused, CCBusyError from ckcc.constants import (MAX_MSG_LEN, MAX_BLK_LEN, MSG_SIGNING_MAX_LENGTH, MAX_TXN_LEN, AF_CLASSIC, AF_P2SH, AF_P2WPKH, AF_P2WSH, AF_P2WPKH_P2SH, AF_P2WSH_P2SH) from ckcc.client import ColdcardDevice, COINKITE_VID, CKCC_PID, CKCC_SIMULATOR_PATH requirements_ok = True class ElectrumColdcardDevice(ColdcardDevice): def mitm_verify(self, sig, expect_xpub): pubkey = BIP32Node.from_xkey(expect_xpub).eckey try: pubkey.verify_message_hash(sig[1:65], self.session_key) return True except: return False except ImportError as e: if not (isinstance(e, ModuleNotFoundError) and e.name == 'ckcc'): _logger.exception('error importing coldcard plugin deps') requirements_ok = False COINKITE_VID = 0xd13e CKCC_PID = 0xcc10 CKCC_SIMULATED_PID = CKCC_PID ^ 0x55aa class CKCCClient(HardwareClientBase): def __init__(self, plugin, handler, dev_path, *, is_simulator=False): HardwareClientBase.__init__(self, plugin=plugin) self.device = plugin.device self.handler = handler self._expected_device = None if is_simulator: self.dev = ElectrumColdcardDevice(dev_path, encrypt=True) else: hd = hid.device(path=dev_path) hd.open_path(dev_path) self.dev = ElectrumColdcardDevice(dev=hd, encrypt=True) def __repr__(self): return '<CKCCClient: xfp=%s label=%r>' % (xfp2str(self.dev.master_fingerprint), self.label()) @runs_in_hwd_thread def verify_connection(self, expected_xfp: int, expected_xpub=None): ex = (expected_xfp, expected_xpub) if self._expected_device == ex: # all is as expected return if expected_xpub is None: expected_xpub = self.dev.master_xpub if ((self._expected_device is not None) or (self.dev.master_fingerprint != expected_xfp) or (self.dev.master_xpub != expected_xpub)): # probably indicating programing error, not hacking _logger.info(f"xpubs. reported by device: {self.dev.master_xpub}. " f"stored in file: {expected_xpub}") raise RuntimeError("Expecting %s but that's not what's connected?!" % xfp2str(expected_xfp)) # check signature over session key # - mitm might have lied about xfp and xpub up to here # - important that we use value capture at wallet creation time, not some value # we read over USB today self.dev.check_mitm(expected_xpub=expected_xpub) self._expected_device = ex if not getattr(self, 'ckcc_xpub', None): self.ckcc_xpub = expected_xpub _logger.info("Successfully verified against MiTM") def is_pairable(self): # can't do anything w/ devices that aren't setup (this code not normally reachable) return bool(self.dev.master_xpub) @runs_in_hwd_thread def close(self): # close the HID device (so can be reused) self.dev.close() self.dev = None def is_initialized(self): return bool(self.dev.master_xpub) def label(self): # 'label' of this Coldcard. Warning: gets saved into wallet file, which might # not be encrypted, so better for privacy if based on xpub/fingerprint rather than # USB serial number. if self.dev.is_simulator: lab = 'Coldcard Simulator ' + xfp2str(self.dev.master_fingerprint) elif not self.dev.master_fingerprint: # failback; not expected lab = 'Coldcard else: lab = 'Coldcard ' + xfp2str(self.dev.master_fingerprint) return lab def manipulate_keystore_dict_during_wizard_setup(self, d: dict): master_xpub = self.dev.master_xpub if master_xpub is not None: try: node = BIP32Node.from_xkey(master_xpub) except InvalidMasterKeyVersionBytes: raise UserFacingException( _('Invalid xpub magic. Make sure your {} device is set to the correct chain.').format(self.device) + ' ' + _('You might have to unplug and plug it in again.') ) from None d['ckcc_xpub'] = master_xpub @runs_in_hwd_thread def has_usable_connection_with_device(self): # Do end-to-end ping test try: self.ping_check() return True except: return False @runs_in_hwd_thread def get_xpub(self, bip32_path, xtype): assert xtype in ColdcardPlugin.SUPPORTED_XTYPES _logger.info('Derive xtype = %r' % xtype) xpub = self.dev.send_recv(CCProtocolPacker.get_xpub(bip32_path), timeout=5000) # TODO handle timeout? # change type of xpub to the requested type try: node = BIP32Node.from_xkey(xpub) except InvalidMasterKeyVersionBytes: raise UserFacingException(_('Invalid xpub magic. Make sure your {} device is set to the correct chain.') .format(self.device)) from None if xtype != 'standard': xpub = node._replace(xtype=xtype).to_xpub() return xpub @runs_in_hwd_thread def ping_check(self): # check connection is working assert self.dev.session_key, 'not encrypted?' req = b'1234 Electrum Plugin 4321' # free up to 59 bytes try: echo = self.dev.send_recv(CCProtocolPacker.ping(req)) assert echo == req except: raise RuntimeError("Communication trouble with Coldcard") @runs_in_hwd_thread def show_address(self, path, addr_fmt): # prompt user w/ address, also returns it immediately. return self.dev.send_recv(CCProtocolPacker.show_address(path, addr_fmt), timeout=None) @runs_in_hwd_thread def show_p2sh_address(self, *args, **kws): # prompt user w/ p2sh address, also returns it immediately. return self.dev.send_recv(CCProtocolPacker.show_p2sh_address(*args, **kws), timeout=None) @runs_in_hwd_thread def get_version(self): # gives list of strings return self.dev.send_recv(CCProtocolPacker.version(), timeout=1000).split('\n') @runs_in_hwd_thread def sign_message_start(self, path, msg): # this starts the UX experience. self.dev.send_recv(CCProtocolPacker.sign_message(msg, path), timeout=None) @runs_in_hwd_thread def sign_message_poll(self): # poll device... if user has approved, will get tuple: (addr, sig) else None return self.dev.send_recv(CCProtocolPacker.get_signed_msg(), timeout=None) @runs_in_hwd_thread def sign_transaction_start(self, raw_psbt: bytes, *, finalize: bool = False): # Multiple steps to sign: # - upload binary # - start signing UX # - wait for coldcard to complete process, or have it refused. # - download resulting txn assert 20 <= len(raw_psbt) < MAX_TXN_LEN, 'PSBT is too big' dlen, chk = self.dev.upload_file(raw_psbt) resp = self.dev.send_recv(CCProtocolPacker.sign_transaction(dlen, chk, finalize=finalize), timeout=None) if resp != None: raise ValueError(resp) @runs_in_hwd_thread def sign_transaction_poll(self): # poll device... if user has approved, will get tuple: (legnth, checksum) else None return self.dev.send_recv(CCProtocolPacker.get_signed_txn(), timeout=None) @runs_in_hwd_thread def download_file(self, length, checksum, file_number=1): # get a file return self.dev.download_file(length, checksum, file_number=file_number) class Coldcard_KeyStore(Hardware_KeyStore): hw_type = 'coldcard' device = 'Coldcard' plugin: 'ColdcardPlugin' def __init__(self, d): Hardware_KeyStore.__init__(self, d) # Errors and other user interaction is done through the wallet's self.force_watching_only = False self.ux_busy = False self.ckcc_xpub = d.get('ckcc_xpub', None) def dump(self): d = Hardware_KeyStore.dump(self) d['ckcc_xpub'] = self.ckcc_xpub return d def get_xfp_int(self) -> int: xfp = self.get_root_fingerprint() assert xfp is not None return xfp_int_from_xfp_bytes(bfh(xfp)) def get_client(self): rv = self.plugin.get_client(self) if rv: xfp_int = self.get_xfp_int() rv.verify_connection(xfp_int, self.ckcc_xpub) return rv def give_error(self, message, clear_client=False): self.logger.info(message) if not self.ux_busy: self.handler.show_error(message) else: self.ux_busy = False if clear_client: self.client = None raise UserFacingException(message) def wrap_busy(func): # decorator: function takes over the UX on the device. def wrapper(self, *args, **kwargs): try: self.ux_busy = True return func(self, *args, **kwargs) finally: self.ux_busy = False return wrapper def decrypt_message(self, pubkey, message, password): raise UserFacingException(_('Encryption and decryption are currently not supported for {}').format(self.device)) @wrap_busy def sign_message(self, sequence, message, password): # Sign a message on device. Since we have big screen, of course we # have to show the message unabiguously there first! try: msg = message.encode('ascii', errors='strict') assert 1 <= len(msg) <= MSG_SIGNING_MAX_LENGTH except (UnicodeError, AssertionError): # there are other restrictions on message content, # but let the device enforce and report those self.handler.show_error('Only short (%d max) ASCII messages can be signed.' % MSG_SIGNING_MAX_LENGTH) return b'' path = self.get_derivation_prefix() + ("/%d/%d" % sequence) try: cl = self.get_client() try: self.handler.show_message("Signing message (using %s)..." % path) cl.sign_message_start(path, msg) while 1: # How to kill some time, without locking UI? time.sleep(0.250) resp = cl.sign_message_poll() if resp is not None: break finally: self.handler.finished() assert len(resp) == 2 addr, raw_sig = resp # already encoded in Radiocoin fashion, binary. assert 40 < len(raw_sig) <= 65 return raw_sig except (CCUserRefused, CCBusyError) as exc: self.handler.show_error(str(exc)) except CCProtoError as exc: self.logger.exception('Error showing address') self.handler.show_error('{}\n\n{}'.format( _('Error showing address') + ':', str(exc))) except Exception as e: self.give_error(e, True) # give empty bytes for error cases; it seems to clear the old signature box return b'' @wrap_busy def sign_transaction(self, tx, password): # Upload PSBT for signing. # - we can also work offline (without paired device present) if tx.is_complete(): return client = self.get_client() assert client.dev.master_fingerprint == self.get_xfp_int() raw_psbt = tx.serialize_as_bytes() try: try: self.handler.show_message("Authorize Transaction...") client.sign_transaction_start(raw_psbt) while 1: # How to kill some time, without locking UI? time.sleep(0.250) resp = client.sign_transaction_poll() if resp is not None: break rlen, rsha = resp # download the resulting txn. raw_resp = client.download_file(rlen, rsha) finally: self.handler.finished() except (CCUserRefused, CCBusyError) as exc: self.logger.info(f'Did not sign: {exc}') self.handler.show_error(str(exc)) return except BaseException as e: self.logger.exception('') self.give_error(e, True) return tx2 = PartialTransaction.from_raw_psbt(raw_resp) # apply partial signatures back into txn tx.combine_with_other_psbt(tx2) # caller's logic looks at tx now and if it's sufficiently signed, # will send it if that's the user's intent. @staticmethod def _encode_txin_type(txin_type): # Map from Electrum code names to our code numbers. return {'standard': AF_CLASSIC, 'p2pkh': AF_CLASSIC, 'p2sh': AF_P2SH, 'p2wpkh-p2sh': AF_P2WPKH_P2SH, 'p2wpkh': AF_P2WPKH, 'p2wsh-p2sh': AF_P2WSH_P2SH, 'p2wsh': AF_P2WSH, }[txin_type] @wrap_busy def show_address(self, sequence, txin_type): client = self.get_client() address_path = self.get_derivation_prefix()[2:] + "/%d/%d"%sequence addr_fmt = self._encode_txin_type(txin_type) try: try: self.handler.show_message(_("Showing address ...")) dev_addr = client.show_address(address_path, addr_fmt) # we could double check address here finally: self.handler.finished() except CCProtoError as exc: self.logger.exception('Error showing address') self.handler.show_error('{}\n\n{}'.format( _('Error showing address') + ':', str(exc))) except BaseException as exc: self.logger.exception('') self.handler.show_error(exc) @wrap_busy def show_p2sh_address(self, M, script, xfp_paths, txin_type): client = self.get_client() addr_fmt = self._encode_txin_type(txin_type) try: try: self.handler.show_message(_("Showing address ...")) dev_addr = client.show_p2sh_address(M, xfp_paths, script, addr_fmt=addr_fmt) # we could double check address here finally: self.handler.finished() except CCProtoError as exc: self.logger.exception('Error showing address') self.handler.show_error('{}.\n{}\n\n{}'.format( _('Error showing address'), _('Make sure you have imported the correct wallet description ' 'file on the device for this multisig wallet.'), str(exc))) except BaseException as exc: self.logger.exception('') self.handler.show_error(exc) class ColdcardPlugin(HW_PluginBase): keystore_class = Coldcard_KeyStore minimum_library = (0, 7, 7) DEVICE_IDS = [ (COINKITE_VID, CKCC_PID), (COINKITE_VID, CKCC_SIMULATED_PID) ] SUPPORTED_XTYPES = ('standard', 'p2wpkh-p2sh', 'p2wpkh', 'p2wsh-p2sh', 'p2wsh') def __init__(self, parent, config, name): HW_PluginBase.__init__(self, parent, config, name) self.libraries_available = self.check_libraries_available() if not self.libraries_available: return self.device_manager().register_devices(self.DEVICE_IDS, plugin=self) self.device_manager().register_enumerate_func(self.detect_simulator) def get_library_version(self): import ckcc try: version = ckcc.__version__ except AttributeError: version = 'unknown' if requirements_ok: return version else: raise LibraryFoundButUnusable(library_version=version) def detect_simulator(self): # if there is a simulator running on this machine, # return details about it so it's offered as a pairing choice fn = CKCC_SIMULATOR_PATH if os.path.exists(fn): return [Device(path=fn, interface_number=-1, id_=fn, product_key=(COINKITE_VID, CKCC_SIMULATED_PID), usage_page=0, transport_ui_string='simulator')] return [] @runs_in_hwd_thread def create_client(self, device, handler): if handler: self.handler = handler # the 'path' is unabiguous, so we'll use that. try: rv = CKCCClient(self, handler, device.path, is_simulator=(device.product_key[1] == CKCC_SIMULATED_PID)) return rv except Exception as e: self.logger.exception('late failure connecting to device?') return None def setup_device(self, device_info, wizard, purpose): device_id = device_info.device.id_ client = self.scan_and_create_client_for_device(device_id=device_id, wizard=wizard) return client def get_xpub(self, device_id, derivation, xtype, wizard): if xtype not in self.SUPPORTED_XTYPES: raise ScriptTypeNotSupported(_('This type of script is not supported with {}.').format(self.device)) client = self.scan_and_create_client_for_device(device_id=device_id, wizard=wizard) client.ping_check() xpub = client.get_xpub(derivation, xtype) return xpub @runs_in_hwd_thread def get_client(self, keystore, force_pair=True, *, devices=None, allow_user_interaction=True) -> Optional['CKCCClient']: client = super().get_client(keystore, force_pair, devices=devices, allow_user_interaction=allow_user_interaction) if client is not None: client.ping_check() return client @staticmethod def export_ms_wallet(wallet: Multisig_Wallet, fp, name): assert isinstance(wallet, Multisig_Wallet) print('# Exported from Electrum', file=fp) print(f'Name: {name:.20s}', file=fp) print(f'Policy: {wallet.m} of {wallet.n}', file=fp) print(f'Format: {wallet.txin_type.upper()}', file=fp) xpubs = [] for xpub, ks in zip(wallet.get_master_public_keys(), wallet.get_keystores()): fp_bytes, der_full = ks.get_fp_and_derivation_to_be_used_in_partial_tx(der_suffix=[], only_der_suffix=False) fp_hex = fp_bytes.hex().upper() der_prefix_str = bip32.convert_bip32_intpath_to_strpath(der_full) xpubs.append((fp_hex, xpub, der_prefix_str)) # could use key path data from PSBT or USB request as needed. However, # derivation data is now required. print('', file=fp) assert len(xpubs) == wallet.n for xfp, xpub, der_prefix in xpubs: print(f'Derivation: {der_prefix}', file=fp) print(f'{xfp}: {xpub}\n', file=fp) def show_address(self, wallet, address, keystore: 'Coldcard_KeyStore' = None): if keystore is None: keystore = wallet.get_keystore() if not self.show_address_helper(wallet, address, keystore): return txin_type = wallet.get_txin_type(address) # Standard_Wallet => not multisig, must be bip32 if type(wallet) is Standard_Wallet: sequence = wallet.get_address_index(address) keystore.show_address(sequence, txin_type) elif type(wallet) is Multisig_Wallet: assert isinstance(wallet, Multisig_Wallet) # only here for type-hints in IDE # More involved for P2SH/P2WSH addresses: need M, and all public keys, and their # derivation paths. Must construct script, and track fingerprints+paths for # all those keys pubkey_deriv_info = wallet.get_public_keys_with_deriv_info(address) pubkey_hexes = sorted([pk.hex() for pk in list(pubkey_deriv_info)]) xfp_paths = [] for pubkey_hex in pubkey_hexes: pubkey = bytes.fromhex(pubkey_hex) ks, der_suffix = pubkey_deriv_info[pubkey] fp_bytes, der_full = ks.get_fp_and_derivation_to_be_used_in_partial_tx(der_suffix, only_der_suffix=False) xfp_int = xfp_int_from_xfp_bytes(fp_bytes) xfp_paths.append([xfp_int] + list(der_full)) script = bfh(wallet.pubkeys_to_scriptcode(pubkey_hexes)) keystore.show_p2sh_address(wallet.m, script, xfp_paths, txin_type) else: keystore.handler.show_error(_('This function is only available for standard wallets when using {}.').format(self.device)) return def xfp_int_from_xfp_bytes(fp_bytes: bytes) -> int: return int.from_bytes(fp_bytes, byteorder="little", signed=False) def xfp2str(xfp: int) -> str: # Standardized way to show an xpub's fingerprint... it's a 4-byte string # and not really an integer. Used to show as '0x%08x' but that's wrong endian. return struct.pack('<I', xfp).hex().lower()
true
true
f7f9891821484758d545693da5d745fe3cada3a3
794
py
Python
tests/containers/analyzer_result.py
nflexfo/plaso
5da7aa51c39b593773687fdf20a93ba35fc492b4
[ "Apache-2.0" ]
27
2019-04-05T12:01:49.000Z
2022-02-08T02:26:25.000Z
tests/containers/analyzer_result.py
nflexfo/plaso
5da7aa51c39b593773687fdf20a93ba35fc492b4
[ "Apache-2.0" ]
null
null
null
tests/containers/analyzer_result.py
nflexfo/plaso
5da7aa51c39b593773687fdf20a93ba35fc492b4
[ "Apache-2.0" ]
8
2019-11-28T08:06:34.000Z
2020-08-29T13:53:30.000Z
#!/usr/bin/env python3 # -*- coding: utf-8 -*- """Tests for the analyzer result attribute container.""" from __future__ import unicode_literals import unittest from plaso.containers import analyzer_result from tests import test_lib as shared_test_lib class AnalyzerResultTest(shared_test_lib.BaseTestCase): """Tests for the analyzer result attribute container.""" def testGetAttributeNames(self): """Tests the GetAttributeNames function.""" attribute_container = analyzer_result.AnalyzerResult() expected_attribute_names = [ 'analyzer_name', 'attribute_name', 'attribute_value'] attribute_names = sorted(attribute_container.GetAttributeNames()) self.assertEqual(attribute_names, expected_attribute_names) if __name__ == '__main__': unittest.main()
25.612903
69
0.765743
from __future__ import unicode_literals import unittest from plaso.containers import analyzer_result from tests import test_lib as shared_test_lib class AnalyzerResultTest(shared_test_lib.BaseTestCase): def testGetAttributeNames(self): attribute_container = analyzer_result.AnalyzerResult() expected_attribute_names = [ 'analyzer_name', 'attribute_name', 'attribute_value'] attribute_names = sorted(attribute_container.GetAttributeNames()) self.assertEqual(attribute_names, expected_attribute_names) if __name__ == '__main__': unittest.main()
true
true
f7f98a57a27938c31d74bb67d3e4bbd2181b089c
4,305
py
Python
sdk/eventhub/azure-mgmt-eventhub/azure/mgmt/eventhub/v2018_01_01_preview/_event_hub_management_client.py
iscai-msft/azure-sdk-for-python
83715b95c41e519d5be7f1180195e2fba136fc0f
[ "MIT" ]
null
null
null
sdk/eventhub/azure-mgmt-eventhub/azure/mgmt/eventhub/v2018_01_01_preview/_event_hub_management_client.py
iscai-msft/azure-sdk-for-python
83715b95c41e519d5be7f1180195e2fba136fc0f
[ "MIT" ]
226
2019-07-24T07:57:21.000Z
2019-10-15T01:07:24.000Z
sdk/eventhub/azure-mgmt-eventhub/azure/mgmt/eventhub/v2018_01_01_preview/_event_hub_management_client.py
iscai-msft/azure-sdk-for-python
83715b95c41e519d5be7f1180195e2fba136fc0f
[ "MIT" ]
2
2021-05-23T16:46:31.000Z
2021-05-26T23:51:09.000Z
# coding=utf-8 # -------------------------------------------------------------------------- # Copyright (c) Microsoft Corporation. All rights reserved. # Licensed under the MIT License. See License.txt in the project root for # license information. # # Code generated by Microsoft (R) AutoRest Code Generator. # Changes may cause incorrect behavior and will be lost if the code is # regenerated. # -------------------------------------------------------------------------- from msrest.service_client import SDKClient from msrest import Serializer, Deserializer from ._configuration import EventHubManagementClientConfiguration from .operations import ClustersOperations from .operations import NamespacesOperations from .operations import ConfigurationOperations from .operations import DisasterRecoveryConfigsOperations from .operations import EventHubsOperations from .operations import ConsumerGroupsOperations from .operations import Operations from .operations import RegionsOperations from . import models class EventHubManagementClient(SDKClient): """EventHubManagementClient :ivar config: Configuration for client. :vartype config: EventHubManagementClientConfiguration :ivar clusters: Clusters operations :vartype clusters: azure.mgmt.eventhub.v2018_01_01_preview.operations.ClustersOperations :ivar namespaces: Namespaces operations :vartype namespaces: azure.mgmt.eventhub.v2018_01_01_preview.operations.NamespacesOperations :ivar configuration: Configuration operations :vartype configuration: azure.mgmt.eventhub.v2018_01_01_preview.operations.ConfigurationOperations :ivar disaster_recovery_configs: DisasterRecoveryConfigs operations :vartype disaster_recovery_configs: azure.mgmt.eventhub.v2018_01_01_preview.operations.DisasterRecoveryConfigsOperations :ivar event_hubs: EventHubs operations :vartype event_hubs: azure.mgmt.eventhub.v2018_01_01_preview.operations.EventHubsOperations :ivar consumer_groups: ConsumerGroups operations :vartype consumer_groups: azure.mgmt.eventhub.v2018_01_01_preview.operations.ConsumerGroupsOperations :ivar operations: Operations operations :vartype operations: azure.mgmt.eventhub.v2018_01_01_preview.operations.Operations :ivar regions: Regions operations :vartype regions: azure.mgmt.eventhub.v2018_01_01_preview.operations.RegionsOperations :param credentials: Credentials needed for the client to connect to Azure. :type credentials: :mod:`A msrestazure Credentials object<msrestazure.azure_active_directory>` :param subscription_id: Subscription credentials that uniquely identify a Microsoft Azure subscription. The subscription ID forms part of the URI for every service call. :type subscription_id: str :param str base_url: Service URL """ def __init__( self, credentials, subscription_id, base_url=None): self.config = EventHubManagementClientConfiguration(credentials, subscription_id, base_url) super(EventHubManagementClient, self).__init__(self.config.credentials, self.config) client_models = {k: v for k, v in models.__dict__.items() if isinstance(v, type)} self._serialize = Serializer(client_models) self._deserialize = Deserializer(client_models) self.clusters = ClustersOperations( self._client, self.config, self._serialize, self._deserialize) self.namespaces = NamespacesOperations( self._client, self.config, self._serialize, self._deserialize) self.configuration = ConfigurationOperations( self._client, self.config, self._serialize, self._deserialize) self.disaster_recovery_configs = DisasterRecoveryConfigsOperations( self._client, self.config, self._serialize, self._deserialize) self.event_hubs = EventHubsOperations( self._client, self.config, self._serialize, self._deserialize) self.consumer_groups = ConsumerGroupsOperations( self._client, self.config, self._serialize, self._deserialize) self.operations = Operations( self._client, self.config, self._serialize, self._deserialize) self.regions = RegionsOperations( self._client, self.config, self._serialize, self._deserialize)
50.05814
124
0.75122
from msrest.service_client import SDKClient from msrest import Serializer, Deserializer from ._configuration import EventHubManagementClientConfiguration from .operations import ClustersOperations from .operations import NamespacesOperations from .operations import ConfigurationOperations from .operations import DisasterRecoveryConfigsOperations from .operations import EventHubsOperations from .operations import ConsumerGroupsOperations from .operations import Operations from .operations import RegionsOperations from . import models class EventHubManagementClient(SDKClient): def __init__( self, credentials, subscription_id, base_url=None): self.config = EventHubManagementClientConfiguration(credentials, subscription_id, base_url) super(EventHubManagementClient, self).__init__(self.config.credentials, self.config) client_models = {k: v for k, v in models.__dict__.items() if isinstance(v, type)} self._serialize = Serializer(client_models) self._deserialize = Deserializer(client_models) self.clusters = ClustersOperations( self._client, self.config, self._serialize, self._deserialize) self.namespaces = NamespacesOperations( self._client, self.config, self._serialize, self._deserialize) self.configuration = ConfigurationOperations( self._client, self.config, self._serialize, self._deserialize) self.disaster_recovery_configs = DisasterRecoveryConfigsOperations( self._client, self.config, self._serialize, self._deserialize) self.event_hubs = EventHubsOperations( self._client, self.config, self._serialize, self._deserialize) self.consumer_groups = ConsumerGroupsOperations( self._client, self.config, self._serialize, self._deserialize) self.operations = Operations( self._client, self.config, self._serialize, self._deserialize) self.regions = RegionsOperations( self._client, self.config, self._serialize, self._deserialize)
true
true
f7f98aa681c10e3fb1cd5f5a827238e8b3aab7bf
2,961
py
Python
sequence_server_wrapper/examples/example_device.py
vstadnytskyi/sequence-server-wrapper
1ee23638752a969f51b11a65a3b7652874efe8c5
[ "BSD-3-Clause" ]
null
null
null
sequence_server_wrapper/examples/example_device.py
vstadnytskyi/sequence-server-wrapper
1ee23638752a969f51b11a65a3b7652874efe8c5
[ "BSD-3-Clause" ]
null
null
null
sequence_server_wrapper/examples/example_device.py
vstadnytskyi/sequence-server-wrapper
1ee23638752a969f51b11a65a3b7652874efe8c5
[ "BSD-3-Clause" ]
null
null
null
#!/usr/bin/env python3 from logging import debug, info, warning, error from time import sleep import traceback class DeviceExample(): def __init__(self): self.io = None self.trajectory = None self.idle_value = 0.0 def init(self): from time import sleep """ orderly initialization """ debug('Conducting orderly initialization of the Example Device') sleep(1) def parse_CMD(self,cmd): def linear(start=0,end=10,step=1): from numpy import arange return list(arange(start,end,step)) try: lst = eval(cmd) except: lst = None if type(lst) is list: return {'flag':True, 'values':lst} else: return {'flag':False, 'values':[]} def set_VAL(self,value): self._VAL = value sleep(0.5) def get_VAL(self): return self._VAL VAL = property(get_VAL,set_VAL) def io_execute(self,pv_name, value): """ """ from time import sleep print(f'io_execute received: {pv_name},{value}') response = '' if pv_name == 'CMD': self.io_put(pv_name = 'ACK',value = 0) self.io_put(pv_name = 'values',value = []) reply = self.parse_CMD(value) response = ""+str(int(reply['flag'])) self.trajectory = reply['values'] if reply['flag'] == False: response += f"{'failed to eval the command'}" self.io_put(pv_name = 'values',value = reply['values']) sleep(1) self.io_put(pv_name = 'ACK',value = response) if pv_name == 'Nested_Indices': print(f'io_execute inside if pv_name == Nested_Indices: {"Nested_Indices"}') print(bytes(value)) index = eval(bytes(value))['test.server'] self.io_put(pv_name = 'ACK',value = 0) try: if self.trajectory is not None: self.VAL = self.trajectory[index] else: self.VAL = self.idle_value flag = True resp = ' ' except: resp = traceback.format_exc() print(resp) flag = False print(self.VAL) response += resp self.io_put(pv_name = 'VAL',value = self.VAL) self.io_put(pv_name = 'message',value = response) self.io_put(pv_name = 'ACK',value = 1) print('response:',reply,response) def io_put(self,pv_name, value): print(f'DeviceExample.io_put: {pv_name},{value}') if self.io is not None: if pv_name == 'VAL': self.io.io_put_queue.put({pv_name: value}) else: self.io.seq.io_put_queue.put({pv_name: value}) if __name__ is '__main__': device = DeviceExample() device.init()
30.214286
88
0.524147
from logging import debug, info, warning, error from time import sleep import traceback class DeviceExample(): def __init__(self): self.io = None self.trajectory = None self.idle_value = 0.0 def init(self): from time import sleep debug('Conducting orderly initialization of the Example Device') sleep(1) def parse_CMD(self,cmd): def linear(start=0,end=10,step=1): from numpy import arange return list(arange(start,end,step)) try: lst = eval(cmd) except: lst = None if type(lst) is list: return {'flag':True, 'values':lst} else: return {'flag':False, 'values':[]} def set_VAL(self,value): self._VAL = value sleep(0.5) def get_VAL(self): return self._VAL VAL = property(get_VAL,set_VAL) def io_execute(self,pv_name, value): from time import sleep print(f'io_execute received: {pv_name},{value}') response = '' if pv_name == 'CMD': self.io_put(pv_name = 'ACK',value = 0) self.io_put(pv_name = 'values',value = []) reply = self.parse_CMD(value) response = ""+str(int(reply['flag'])) self.trajectory = reply['values'] if reply['flag'] == False: response += f"{'failed to eval the command'}" self.io_put(pv_name = 'values',value = reply['values']) sleep(1) self.io_put(pv_name = 'ACK',value = response) if pv_name == 'Nested_Indices': print(f'io_execute inside if pv_name == Nested_Indices: {"Nested_Indices"}') print(bytes(value)) index = eval(bytes(value))['test.server'] self.io_put(pv_name = 'ACK',value = 0) try: if self.trajectory is not None: self.VAL = self.trajectory[index] else: self.VAL = self.idle_value flag = True resp = ' ' except: resp = traceback.format_exc() print(resp) flag = False print(self.VAL) response += resp self.io_put(pv_name = 'VAL',value = self.VAL) self.io_put(pv_name = 'message',value = response) self.io_put(pv_name = 'ACK',value = 1) print('response:',reply,response) def io_put(self,pv_name, value): print(f'DeviceExample.io_put: {pv_name},{value}') if self.io is not None: if pv_name == 'VAL': self.io.io_put_queue.put({pv_name: value}) else: self.io.seq.io_put_queue.put({pv_name: value}) if __name__ is '__main__': device = DeviceExample() device.init()
true
true
f7f98b2c930d177bb959c308103dda015dce3fc8
18,784
py
Python
vnpy/trader/app/optionMaster/omEngine.py
jacksama/vnpy
0fed1d01ad527b4c083ce39dc722f5a809074b78
[ "MIT" ]
1
2021-12-28T02:46:09.000Z
2021-12-28T02:46:09.000Z
vnpy/trader/app/optionMaster/omEngine.py
gaoyangtom/vnpy
0fed1d01ad527b4c083ce39dc722f5a809074b78
[ "MIT" ]
null
null
null
vnpy/trader/app/optionMaster/omEngine.py
gaoyangtom/vnpy
0fed1d01ad527b4c083ce39dc722f5a809074b78
[ "MIT" ]
1
2021-12-28T02:46:16.000Z
2021-12-28T02:46:16.000Z
# encoding: UTF-8 from __future__ import division import json import shelve import os import traceback from collections import OrderedDict from vnpy.event import Event from vnpy.trader.vtEvent import (EVENT_TICK, EVENT_TRADE, EVENT_CONTRACT, EVENT_ORDER, EVENT_TIMER) from vnpy.trader.vtFunction import getTempPath, getJsonPath from vnpy.trader.vtObject import (VtLogData, VtSubscribeReq, VtOrderReq, VtCancelOrderReq) from vnpy.trader.vtConstant import (PRODUCT_OPTION, OPTION_CALL, OPTION_PUT, DIRECTION_LONG, DIRECTION_SHORT, OFFSET_OPEN, OFFSET_CLOSE, PRICETYPE_LIMITPRICE) from vnpy.pricing import black, bs, crr from .omBase import (OmOption, OmUnderlying, OmChain, OmPortfolio, EVENT_OM_LOG, EVENT_OM_STRATEGY, EVENT_OM_STRATEGYLOG, OM_DB_NAME) from .strategy import STRATEGY_CLASS # 定价模型字典 MODEL_DICT = {} MODEL_DICT['black'] = black MODEL_DICT['bs'] = bs MODEL_DICT['crr'] = crr ######################################################################## class OmEngine(object): """期权主引擎""" impvFileName = 'PricingImpv.vt' impvFilePath = getTempPath(impvFileName) #---------------------------------------------------------------------- def __init__(self, mainEngine, eventEngine): """Constructor""" self.mainEngine = mainEngine self.eventEngine = eventEngine self.portfolio = None self.optionContractDict = {} # symbol:contract self.strategyEngine = OmStrategyEngine(self, eventEngine) self.registerEvent() #---------------------------------------------------------------------- def registerEvent(self): """注册事件监听""" self.eventEngine.register(EVENT_CONTRACT, self.processContractEvent) #---------------------------------------------------------------------- def processTickEvent(self, event): """行情事件""" tick = event.dict_['data'] self.portfolio.newTick(tick) #---------------------------------------------------------------------- def processTradeEvent(self, event): """成交事件""" trade = event.dict_['data'] self.portfolio.newTrade(trade) #---------------------------------------------------------------------- def processContractEvent(self, event): """合约事件""" contract = event.dict_['data'] if contract.symbol and contract.productClass == PRODUCT_OPTION: self.optionContractDict[contract.symbol] = contract #---------------------------------------------------------------------- def subscribeEvent(self, symbol): """订阅对应合约的事件""" contract = self.mainEngine.getContract(symbol) if not contract: self.writeLog(u'行情订阅失败,找不到合约:%s' %symbol) return vtSymbol = contract.vtSymbol # 订阅行情 req = VtSubscribeReq() req.symbol = contract.symbol req.exchange = contract.exchange self.mainEngine.subscribe(req, contract.gatewayName) # 订阅事件 self.eventEngine.register(EVENT_TICK + vtSymbol, self.processTickEvent) self.eventEngine.register(EVENT_TRADE + vtSymbol, self.processTradeEvent) #---------------------------------------------------------------------- def initEngine(self, fileName): """初始化引擎""" if self.portfolio: return False f = file(fileName) setting = json.load(f) # 读取定价模型 model = MODEL_DICT.get(setting['model'], None) if not model: self.writeLog(u'找不到定价模型%s' %setting['model']) return # 创建标的对象 underlyingDict = OrderedDict() for underlyingSymbol in setting['underlying']: contract = self.mainEngine.getContract(underlyingSymbol) if not contract: self.writeLog(u'找不到标的物合约%s' %underlyingSymbol) continue detail = self.mainEngine.getPositionDetail(contract.vtSymbol) underlying = OmUnderlying(contract, detail) underlyingDict[underlyingSymbol] = underlying # 创建期权链对象并初始化 chainList = [] for d in setting['chain']: chainSymbol = d['chainSymbol'] r = d['r'] # 锁定标的对象 underlying = underlyingDict.get(d['underlyingSymbol'], None) if not underlying: self.writeLog(u'%s期权链的标的合约%s尚未创建,请检查配置文件' %(chainSymbol, underlyingSymbol)) continue # 创建期权对象并初始化 callDict = {} putDict = {} for symbol, contract in self.optionContractDict.items(): if contract.underlyingSymbol == d['chainSymbol']: detail = self.mainEngine.getPositionDetail(contract.vtSymbol) option = OmOption(contract, detail, underlying, model, r) if contract.optionType is OPTION_CALL: callDict[option.k] = option else: putDict[option.k] = option # 期权排序 strikeList = callDict.keys() strikeList.sort() callList = [callDict[k] for k in strikeList] putList = [putDict[k] for k in strikeList] # 创建期权链 chain = OmChain(chainSymbol, callList, putList) chainList.append(chain) # 添加标的映射关系 underlying.addChain(chain) # 创建持仓组合对象并初始化 self.portfolio = OmPortfolio(setting['name'], model, underlyingDict.values(), chainList) # 载入波动率配置 self.loadImpvSetting() # 订阅行情和事件 for underlying in underlyingDict.values(): self.subscribeEvent(underlying.vtSymbol) for chain in chainList: for option in chain.optionDict.values(): self.subscribeEvent(option.vtSymbol) # 载入成功返回 return True #---------------------------------------------------------------------- def loadImpvSetting(self): """载入波动率配置""" f = shelve.open(self.impvFilePath) for chain in self.portfolio.chainDict.values(): for option in chain.optionDict.values(): option.pricingImpv = f.get(option.symbol, 0) f.close() #---------------------------------------------------------------------- def saveImpvSetting(self): """保存波动率配置""" if not self.portfolio: return f = shelve.open(self.impvFilePath) for chain in self.portfolio.chainDict.values(): for option in chain.optionDict.values(): f[option.symbol] = option.pricingImpv f.close() #---------------------------------------------------------------------- def stop(self): """关闭函数""" self.saveImpvSetting() #---------------------------------------------------------------------- def writeLog(self, content): """发出日志 """ log = VtLogData() log.logContent = content event = Event(EVENT_OM_LOG) event.dict_['data'] = log self.eventEngine.put(event) ######################################################################## class OmStrategyEngine(object): """策略引擎""" settingFileName = 'strategy_setting.json' settingfilePath = getJsonPath(settingFileName, __file__) #---------------------------------------------------------------------- def __init__(self, omEngine, eventEngine): """Constructor""" self.omEngine = omEngine self.mainEngine = omEngine.mainEngine self.eventEngine = eventEngine self.portfolio = None self.strategyDict = {} # name: strategy self.symbolStrategyDict = {} # vtSymbol:strategy list self.orderStrategyDict= {} # vtOrderID: strategy self.registerEvent() #---------------------------------------------------------------------- def registerEvent(self): """注册事件监听""" self.eventEngine.register(EVENT_TICK, self.processTickEvent) self.eventEngine.register(EVENT_TRADE, self.processTradeEvent) self.eventEngine.register(EVENT_ORDER, self.processOrderEvent) self.eventEngine.register(EVENT_TIMER, self.processTimerEvent) #---------------------------------------------------------------------- def writeLog(self, content): """快速发出日志事件""" log = VtLogData() log.logContent = content event = Event(EVENT_OM_STRATEGYLOG) event.dict_['data'] = log self.eventEngine.put(event) #---------------------------------------------------------------------- def callStrategyFunc(self, strategy, func, params=None): """调用策略的函数,若触发异常则捕捉""" try: if params: func(params) else: func() except Exception: # 停止策略,修改状态为未初始化 strategy.trading = False strategy.inited = False # 发出日志 content = '\n'.join([u'策略%s触发异常已停止' %strategy.name, traceback.format_exc()]) self.writeLog(content) #---------------------------------------------------------------------- def processTickEvent(self, event): """处理行情事件""" tick = event.dict_['data'] l = self.symbolStrategyDict.get(tick.vtSymbol, None) if l: for strategy in l: self.callStrategyFunc(strategy, strategy.onTick, tick) #---------------------------------------------------------------------- def processTradeEvent(self, event): """处理成交事件""" trade = event.dict_['data'] strategy = self.orderStrategyDict.get(trade.vtOrderID, None) if strategy: self.callStrategyFunc(strategy, strategy.onTrade, trade) #---------------------------------------------------------------------- def processOrderEvent(self, event): """处理委托事件""" order = event.dict_['data'] strategy = self.orderStrategyDict.get(order.vtOrderID, None) if strategy: self.callStrategyFunc(strategy, strategy.onOrder, order) #---------------------------------------------------------------------- def processTimerEvent(self, event): """处理定时事件""" for strategy in self.strategyDict.values(): self.callStrategyFunc(strategy, strategy.onTimer) #---------------------------------------------------------------------- def loadSetting(self): """加载配置""" self.portfolio = self.omEngine.portfolio with open(self.settingfilePath) as f: l = json.load(f) for setting in l: self.loadStrategy(setting) #---------------------------------------------------------------------- def loadStrategy(self, setting): """加载策略""" try: name = setting['name'] className = setting['className'] except Exception: msg = traceback.format_exc() self.writeLog(u'载入策略出错:%s' %msg) return # 获取策略类 strategyClass = STRATEGY_CLASS.get(className, None) if not strategyClass: self.writeLog(u'找不到策略类:%s' %className) return # 防止策略重名 if name in self.strategyDict: self.writeLog(u'策略实例重名:%s' %name) else: # 创建策略实例 strategy = strategyClass(self, setting) self.strategyDict[name] = strategy # 保存Tick映射关系 for vtSymbol in strategy.vtSymbols: l = self.symbolStrategyDict.setdefault(vtSymbol, []) l.append(strategy) #---------------------------------------------------------------------- def initStrategy(self, name): """初始化策略""" strategy = self.strategyDict[name] self.callStrategyFunc(strategy, strategy.onInit) #---------------------------------------------------------------------- def startStrategy(self, name): """启动策略""" strategy = self.strategyDict[name] self.callStrategyFunc(strategy, strategy.onStart) #---------------------------------------------------------------------- def stopStrategy(self, name): """停止策略""" strategy = self.strategyDict[name] self.callStrategyFunc(strategy, strategy.onStop) #---------------------------------------------------------------------- def sendOrder(self, vtSymbol, direction, offset, price, volume): """发单""" contract = self.mainEngine.getContract(vtSymbol) if not contract: return '' req = VtOrderReq() req.symbol = contract.symbol req.exchange = contract.exchange req.vtSymbol = vtSymbol req.price = price req.volume = volume req.direction = direction req.offset = offset req.priceType = PRICETYPE_LIMITPRICE return self.mainEngine.sendOrder(req, contract.gatewayName) #---------------------------------------------------------------------- def cancelorder(self, vtOrderID): """撤单""" order = self.mainEngine.getOrder(vtOrderID) if not order: return req = VtCancelOrderReq() req.symbol = order.symbol req.exchange = order.exchange req.orderID = order.orderID req.symbol = order.symbol req.vtSymbol = order.vtSymbo self.mainEngine.cancelOrder(req, order.gatewayName) #---------------------------------------------------------------------- def buy(self, vtSymbol, price, volume): """开多""" return self.sendOrder(vtSymbol, DIRECTION_LONG, OFFSET_OPEN, price, volume) #---------------------------------------------------------------------- def short(self, vtSymbol, price, volume): """开空""" return self.sendOrder(vtSymbol, DIRECTION_SHORT, OFFSET_OPEN, price, volume) #---------------------------------------------------------------------- def sell(self, vtSymbol, price, volume): """平多""" return self.sendOrder(vtSymbol, DIRECTION_SHORT, OFFSET_CLOSE, price, volume) #---------------------------------------------------------------------- def cover(self, vtSymbol, price, volume): """平空""" return self.sendOrder(vtSymbol, DIRECTION_LONG, OFFSET_CLOSE, price, volume) #---------------------------------------------------------------------- def dbQuery(self, collectionName, flt): """查询数据""" return self.mainEngine.dbQuery(OM_DB_NAME, collectionName, flt) #---------------------------------------------------------------------- def dbUpdate(self, collectionName, d, flt): """更新数据""" self.mainEngine.dbUpdate(OM_DB_NAME, collectionName, d, flt, True) #---------------------------------------------------------------------- def getOption(self, vtSymbol): """获取期权信息""" return self.portfolio.optionDict.get(vtSymbol, None) #---------------------------------------------------------------------- def getUnderlying(self, vtSymbol): """获取标的信息""" return self.portfolio.underlyingDict.get(vtSymbol, None) #---------------------------------------------------------------------- def getChain(self, symbol): """获取期权链信息""" return self.portfolio.chainDict.get(symbol, None) #---------------------------------------------------------------------- def getPortfolio(self): """获取持仓组合信息""" return self.portfolio #---------------------------------------------------------------------- def putStrategyEvent(self, name): """触发策略状态变化事件(通常用于通知GUI更新)""" event = Event(EVENT_OM_STRATEGY+name) self.eventEngine.put(event) #---------------------------------------------------------------------- def setStrategyParam(self, name, key, value): """设置策略变量""" if name in self.strategyDict: strategy = self.strategyDict[name] strategy.__setattr__(key, value) self.writeLog(u'策略%s参数%s已修改为%s' %(name, key, value)) else: self.writeLog(u'策略实例不存在:' + name) return None #---------------------------------------------------------------------- def getStrategyVar(self, name): """获取策略当前的变量字典""" if name in self.strategyDict: strategy = self.strategyDict[name] varDict = OrderedDict() for key in strategy.varList: varDict[key] = strategy.__getattribute__(key) return varDict else: self.writeLog(u'策略实例不存在:' + name) return None #---------------------------------------------------------------------- def getStrategyParam(self, name): """获取策略的参数字典""" if name in self.strategyDict: strategy = self.strategyDict[name] paramDict = OrderedDict() for key in strategy.paramList: paramDict[key] = strategy.__getattribute__(key) return paramDict else: self.writeLog(u'策略实例不存在:' + name) return None #---------------------------------------------------------------------- def initAll(self): """全部初始化""" for name in self.strategyDict.keys(): self.initStrategy(name) #---------------------------------------------------------------------- def startAll(self): """全部启动""" for name in self.strategyDict.keys(): self.startStrategy(name) #---------------------------------------------------------------------- def stopAll(self): """全部停止""" for name in self.strategyDict.keys(): self.stopStrategy(name)
35.847328
96
0.458635
from __future__ import division import json import shelve import os import traceback from collections import OrderedDict from vnpy.event import Event from vnpy.trader.vtEvent import (EVENT_TICK, EVENT_TRADE, EVENT_CONTRACT, EVENT_ORDER, EVENT_TIMER) from vnpy.trader.vtFunction import getTempPath, getJsonPath from vnpy.trader.vtObject import (VtLogData, VtSubscribeReq, VtOrderReq, VtCancelOrderReq) from vnpy.trader.vtConstant import (PRODUCT_OPTION, OPTION_CALL, OPTION_PUT, DIRECTION_LONG, DIRECTION_SHORT, OFFSET_OPEN, OFFSET_CLOSE, PRICETYPE_LIMITPRICE) from vnpy.pricing import black, bs, crr from .omBase import (OmOption, OmUnderlying, OmChain, OmPortfolio, EVENT_OM_LOG, EVENT_OM_STRATEGY, EVENT_OM_STRATEGYLOG, OM_DB_NAME) from .strategy import STRATEGY_CLASS MODEL_DICT = {} MODEL_DICT['black'] = black MODEL_DICT['bs'] = bs MODEL_DICT['crr'] = crr for d in setting['chain']: chainSymbol = d['chainSymbol'] r = d['r'] underlying = underlyingDict.get(d['underlyingSymbol'], None) if not underlying: self.writeLog(u'%s期权链的标的合约%s尚未创建,请检查配置文件' %(chainSymbol, underlyingSymbol)) continue callDict = {} putDict = {} for symbol, contract in self.optionContractDict.items(): if contract.underlyingSymbol == d['chainSymbol']: detail = self.mainEngine.getPositionDetail(contract.vtSymbol) option = OmOption(contract, detail, underlying, model, r) if contract.optionType is OPTION_CALL: callDict[option.k] = option else: putDict[option.k] = option strikeList = callDict.keys() strikeList.sort() callList = [callDict[k] for k in strikeList] putList = [putDict[k] for k in strikeList] chain = OmChain(chainSymbol, callList, putList) chainList.append(chain) underlying.addChain(chain) self.portfolio = OmPortfolio(setting['name'], model, underlyingDict.values(), chainList) self.loadImpvSetting() for underlying in underlyingDict.values(): self.subscribeEvent(underlying.vtSymbol) for chain in chainList: for option in chain.optionDict.values(): self.subscribeEvent(option.vtSymbol) return True def loadImpvSetting(self): f = shelve.open(self.impvFilePath) for chain in self.portfolio.chainDict.values(): for option in chain.optionDict.values(): option.pricingImpv = f.get(option.symbol, 0) f.close() def saveImpvSetting(self): if not self.portfolio: return f = shelve.open(self.impvFilePath) for chain in self.portfolio.chainDict.values(): for option in chain.optionDict.values(): f[option.symbol] = option.pricingImpv f.close() def stop(self): self.saveImpvSetting() def writeLog(self, content): log = VtLogData() log.logContent = content event = Event(EVENT_OM_LOG) event.dict_['data'] = log self.eventEngine.put(event) olio with open(self.settingfilePath) as f: l = json.load(f) for setting in l: self.loadStrategy(setting) def loadStrategy(self, setting): try: name = setting['name'] className = setting['className'] except Exception: msg = traceback.format_exc() self.writeLog(u'载入策略出错:%s' %msg) return strategyClass = STRATEGY_CLASS.get(className, None) if not strategyClass: self.writeLog(u'找不到策略类:%s' %className) return if name in self.strategyDict: self.writeLog(u'策略实例重名:%s' %name) else: strategy = strategyClass(self, setting) self.strategyDict[name] = strategy for vtSymbol in strategy.vtSymbols: l = self.symbolStrategyDict.setdefault(vtSymbol, []) l.append(strategy) def initStrategy(self, name): strategy = self.strategyDict[name] self.callStrategyFunc(strategy, strategy.onInit) def startStrategy(self, name): strategy = self.strategyDict[name] self.callStrategyFunc(strategy, strategy.onStart) def stopStrategy(self, name): strategy = self.strategyDict[name] self.callStrategyFunc(strategy, strategy.onStop) def sendOrder(self, vtSymbol, direction, offset, price, volume): contract = self.mainEngine.getContract(vtSymbol) if not contract: return '' req = VtOrderReq() req.symbol = contract.symbol req.exchange = contract.exchange req.vtSymbol = vtSymbol req.price = price req.volume = volume req.direction = direction req.offset = offset req.priceType = PRICETYPE_LIMITPRICE return self.mainEngine.sendOrder(req, contract.gatewayName) def cancelorder(self, vtOrderID): order = self.mainEngine.getOrder(vtOrderID) if not order: return req = VtCancelOrderReq() req.symbol = order.symbol req.exchange = order.exchange req.orderID = order.orderID req.symbol = order.symbol req.vtSymbol = order.vtSymbo self.mainEngine.cancelOrder(req, order.gatewayName) def buy(self, vtSymbol, price, volume): return self.sendOrder(vtSymbol, DIRECTION_LONG, OFFSET_OPEN, price, volume) def short(self, vtSymbol, price, volume): return self.sendOrder(vtSymbol, DIRECTION_SHORT, OFFSET_OPEN, price, volume) def sell(self, vtSymbol, price, volume): return self.sendOrder(vtSymbol, DIRECTION_SHORT, OFFSET_CLOSE, price, volume) def cover(self, vtSymbol, price, volume): return self.sendOrder(vtSymbol, DIRECTION_LONG, OFFSET_CLOSE, price, volume) def dbQuery(self, collectionName, flt): return self.mainEngine.dbQuery(OM_DB_NAME, collectionName, flt) def dbUpdate(self, collectionName, d, flt): self.mainEngine.dbUpdate(OM_DB_NAME, collectionName, d, flt, True) def getOption(self, vtSymbol): return self.portfolio.optionDict.get(vtSymbol, None) def getUnderlying(self, vtSymbol): return self.portfolio.underlyingDict.get(vtSymbol, None) def getChain(self, symbol): return self.portfolio.chainDict.get(symbol, None) def getPortfolio(self): return self.portfolio def putStrategyEvent(self, name): event = Event(EVENT_OM_STRATEGY+name) self.eventEngine.put(event) def setStrategyParam(self, name, key, value): if name in self.strategyDict: strategy = self.strategyDict[name] strategy.__setattr__(key, value) self.writeLog(u'策略%s参数%s已修改为%s' %(name, key, value)) else: self.writeLog(u'策略实例不存在:' + name) return None def getStrategyVar(self, name): if name in self.strategyDict: strategy = self.strategyDict[name] varDict = OrderedDict() for key in strategy.varList: varDict[key] = strategy.__getattribute__(key) return varDict else: self.writeLog(u'策略实例不存在:' + name) return None def getStrategyParam(self, name): if name in self.strategyDict: strategy = self.strategyDict[name] paramDict = OrderedDict() for key in strategy.paramList: paramDict[key] = strategy.__getattribute__(key) return paramDict else: self.writeLog(u'策略实例不存在:' + name) return None def initAll(self): for name in self.strategyDict.keys(): self.initStrategy(name) def startAll(self): for name in self.strategyDict.keys(): self.startStrategy(name) def stopAll(self): for name in self.strategyDict.keys(): self.stopStrategy(name)
true
true
f7f98b579ef645df2a2c86f5bb7bbb28bf196c34
653
py
Python
wagtail/wagtailcore/migrations/0034_page_live_revision.py
patphongs/wagtail
32555f7a1c599c139e0f26c22907c9612af2e015
[ "BSD-3-Clause" ]
1
2019-11-06T10:51:42.000Z
2019-11-06T10:51:42.000Z
wagtail/wagtailcore/migrations/0034_page_live_revision.py
patphongs/wagtail
32555f7a1c599c139e0f26c22907c9612af2e015
[ "BSD-3-Clause" ]
null
null
null
wagtail/wagtailcore/migrations/0034_page_live_revision.py
patphongs/wagtail
32555f7a1c599c139e0f26c22907c9612af2e015
[ "BSD-3-Clause" ]
2
2017-08-08T01:39:02.000Z
2018-05-06T06:16:10.000Z
# -*- coding: utf-8 -*- # Generated by Django 1.10.4 on 2017-01-26 21:32 from __future__ import unicode_literals from django.db import migrations, models import django.db.models.deletion class Migration(migrations.Migration): dependencies = [ ('wagtailcore', '0033_remove_golive_expiry_help_text'), ] operations = [ migrations.AddField( model_name='page', name='live_revision', field=models.ForeignKey(blank=True, editable=False, null=True, on_delete=django.db.models.deletion.SET_NULL, related_name='+', to='wagtailcore.PageRevision', verbose_name='live revision'), ), ]
29.681818
200
0.679939
from __future__ import unicode_literals from django.db import migrations, models import django.db.models.deletion class Migration(migrations.Migration): dependencies = [ ('wagtailcore', '0033_remove_golive_expiry_help_text'), ] operations = [ migrations.AddField( model_name='page', name='live_revision', field=models.ForeignKey(blank=True, editable=False, null=True, on_delete=django.db.models.deletion.SET_NULL, related_name='+', to='wagtailcore.PageRevision', verbose_name='live revision'), ), ]
true
true
f7f98c856f56ffb55ddba793a6f969bdabb8eaef
18,273
py
Python
packages/galapagos_embedded/libs/lib_frontcam.py
100kimch/ros_galapagos
8f92cb93246c263b61199aef113e43cefc5f3939
[ "MIT" ]
2
2020-10-26T05:01:35.000Z
2022-02-14T10:37:17.000Z
packages/galapagos_embedded/libs/lib_frontcam.py
100kimch/ros_galapagos
8f92cb93246c263b61199aef113e43cefc5f3939
[ "MIT" ]
null
null
null
packages/galapagos_embedded/libs/lib_frontcam.py
100kimch/ros_galapagos
8f92cb93246c263b61199aef113e43cefc5f3939
[ "MIT" ]
null
null
null
import cv2 import numpy as np import rospy import matplotlib.pyplot as plt import sys from scheduler import SCHEDULER from constants import * import os import sys # * Variables # variables for matching # Initiate SIFT description detector Orb = cv2.ORB_create() # create BFMatcher object Bf = cv2.BFMatcher(cv2.NORM_HAMMING, crossCheck=True) ref_images = {} # HSV Ranges used in each state """ before lower_blue = np.array([90, 80, 0]) upper_blue = np.array([130, 255, 255]) """ lower_blue = np.array([90, 110, 100]) upper_blue = np.array([130, 200, 160]) lower_red = np.array([0, 120, 100]) upper_red = np.array([20, 180, 200]) lower_green = np.array([60, 55, 50]) upper_green = np.array([85, 255, 255]) # lower_green = np.array([65, 60, 60]) # upper_green = np.array([80, 255, 255]) value_default = 1 # * Methods def init_ref_images(): global ref_images for idx, key in enumerate(REF_IMAGE_PATH): image = cv2.imread(SCHEDULER.path + "/images/" + REF_IMAGE_PATH[key]) try: image = cv2.medianBlur(cv2.GaussianBlur(image, (11, 11), 0), 11) except cv2.error as e: rospy.logfatal("[LIB_FRONT] ref image '" + key + "' not found in constants.py!") rospy.signal_shutdown("Shutdown by fatal error.") if SCHEDULER.debug_option["show_loaded_ref_images"]: rospy.logdebug("[LIB_FRONT] {:8s} image loaded. ({})".format( key, str(SCHEDULER.path + "/" + REF_IMAGE_PATH[key]))) keypoints, descriptor = Orb.detectAndCompute(image, None) ref_images[key] = { "image": image, "keypoints": keypoints, "descriptor": descriptor } def blob_parameter(state_type): ''' blob_parameter function for making detector for some blob shapes(circle or triangle) & setting parameter of detector * Input state_type : recognition type in recognition_list (ex : 'parking') * Output blob_detector : blob detector that has parameters setted by recognition type ''' if state_type == 'traffic_light': # Setup SimpleBlobDetector parameters. params = cv2.SimpleBlobDetector_Params() params.minThreshold = 0 params.maxThreshold = 256 params.filterByArea = True params.minArea = 500 params.maxArea = 2300 params.filterByCircularity = True params.minCircularity = 0.4 params.filterByConvexity = True params.minConvexity = 0.1 params.filterByInertia = True params.minInertiaRatio = 0.01 elif state_type == 'intersection' or state_type == 'construction' or state_type == 'turnel': # Setup SimpleBlobDetector parameters. params = cv2.SimpleBlobDetector_Params() params.minThreshold = 10 params.maxThreshold = 200 params.filterByArea = True params.minArea = 500 params.filterByCircularity = True params.minCircularity = 0.1 params.filterByConvexity = False params.minConvexity = 0.1 params.filterByInertia = True params.minInertiaRatio = 0.01 else: # Setup SimpleBlobDetector parameters. params = cv2.SimpleBlobDetector_Params() params.minThreshold = 0 params.maxThreshold = 256 params.filterByArea = True params.minArea = 1000 params.maxArea = 35000 params.filterByCircularity = True params.minCircularity = 0.5 params.filterByConvexity = True params.minConvexity = 0.1 params.filterByInertia = True params.minInertiaRatio = 0.01 # Create a detector with the parameters ver = (cv2.__version__).split('.') if int(ver[0]) < 3: blob_detector = cv2.SimpleBlobDetector(params) else: blob_detector = cv2.SimpleBlobDetector_create(params) return blob_detector def blob_detecting(image, blob_detector, state_type): ''' blob_detecting function for finding center point of ROI by HSV range thresholding & detecting specific blob shape * Input image : front camera image from pi camera --> BGR image blob_detector : HSV blob detector made by blob_parameter() function * Output blob_centers : center points of blob (specific blob shape -> potential ROI center point) centers : if `blob_centers` is detected, change the type of data to pt array ''' #cv2.imshow("raw_image", image) # cv2.waitKey(1) _hsv_maxThreshold = value_default _hsv_minThreshold = value_default if state_type == 'intersection' or state_type == 'construction' or state_type == 'turnel': _hsv_maxThreshold = upper_red _hsv_minThreshold = lower_red elif state_type == 'traffic_light': _hsv_maxThreshold = upper_green _hsv_minThreshold = lower_green else: _hsv_maxThreshold = upper_blue _hsv_minThreshold = lower_blue # thresholding process rgb_image to hsv_image by HSV Threshold hsv = cv2.cvtColor(image, cv2.COLOR_BGR2HSV) # make mask and pre-image-processing : morphology (erode or dilate) kernel = np.ones((3, 3), np.uint8) mask = cv2.inRange(hsv, _hsv_minThreshold, _hsv_maxThreshold) mask = cv2.dilate(mask, kernel, iterations=5) #maks = cv2.erode(mask, kernel, iterations = 3) reversemask = 255 - mask # Detect specific blobshape and center point of blob if state_type == 'intersection' or state_type == 'turnel' or state_type == 'to_intersection': blob_centers = blob_detector.detect(mask) else: blob_centers = blob_detector.detect(reversemask) BGR_ROI = cv2.cvtColor(reversemask, cv2.COLOR_GRAY2BGR) # if IS_DEBUG_MODE == True: if SCHEDULER.debug_option["show_blob_detecting"]: print(len(blob_centers)) show_centers = cv2.drawKeypoints(reversemask, blob_centers, np.array( []), (0, 0, 255), cv2.DRAW_MATCHES_FLAGS_DRAW_RICH_KEYPOINTS) cv2.imshow('hsv', hsv) cv2.imshow('mask', mask) cv2.imshow('reverse', reversemask) cv2.imshow('result', show_centers) cv2.waitKey(0) if len(blob_centers) >= 1: centers = [] for i in blob_centers: centers.append(i.pt) return centers else: return blob_centers def signROI_detecting(image, state_type): ''' signROI_detecting function for detecting signROI using HSV range thresholding and specific blob shape detectiong, different by cases * Input image : front camera image from pi camera --> BGR image state_type : recognition type * Output signROI : sign detection result image --> BGR image True : thiere is singROI False : there is no signROI ''' # image ROI detecting using HSV range #image = cv2.GaussianBlur(image, (5, 5), 0) sign_detector = blob_parameter(state_type) sign_centers = blob_detecting(image, sign_detector, state_type) # cv2.imshow('input', image) # ! code for debugging # cv2.waitKey() # ! code for debugging # print 'test' #! code for debugging # print len(sign_centers) #! code for debugging if len(sign_centers) >= 1: xx = int(sign_centers[0][0]) yy = int(sign_centers[0][1]) # print sign_centers[0][1], sign_centers[0][0] #! code for debugging if sign_centers[0][1] - 45 < 0 or sign_centers[0][0] < 45: if sign_centers[0][0] < sign_centers[0][1]: signROI_size = int(sign_centers[0][0]) else: signROI_size = int(sign_centers[0][1]) else: signROI_size = 45 signROI = image[yy - signROI_size: yy + signROI_size, xx - signROI_size: xx + signROI_size] cv2.imshow('ROI', signROI) # ! code for debugging cv2.waitKey(1) # ! code for debugging # print("blob detected!!!!!") # print("blob detected!!!!!") # print("blob detected!!!!!") return signROI, True else: # print("blob detected failed!!!!") # print("blob detected failed!!!!") # print("blob detected failed!!!!") signROI = image return signROI, False def ORB_matching(_roi, _ref_img, _ref_keypoints, _ref_descriptor): ''' ORB_matching function for matching two input image and output is matching result * Input _roi : sign ROI image --> BGR image _ref : sign ref image --> gray image * Output matches : ORB descriptor matching result ''' global Orb global Bf # image pretreatment _roi = cv2.cvtColor(_roi, cv2.COLOR_BGR2GRAY) _roi = cv2.medianBlur(_roi, 5) # find the keypoints and descriptors with SIFT ROI_keypoints, ROI_descriptor = Orb.detectAndCompute(_roi, None) # Match descriptors. matches = Bf.match(ROI_descriptor, _ref_descriptor) # Sort them in the order of their distance. # Not use distance values yet, but can use it at thresholding matches = sorted(matches, key=lambda x: x.distance) if SCHEDULER.debug_option["show_orb_matching"] == True: print(len(matches)) # ! code for debugging matching_image = cv2.drawMatches( _roi, ROI_keypoints, _ref_img, _ref_keypoints, matches, None, flags=2) # ! code for debugging cv2.imshow('matching', matching_image) # ! code for debugging cv2.waitKey() # ! code for debugging return matches def check_if_left_or_right(image): """ Check direction where to go in intersection @Input: image - sign roi image from front pi camera image --> gray image @Output: direction where to go: ["left", "right] """ def left_or_right(_frontcam_roi): ''' left_or_right function for check direction of arrow sign * Input _frontcam_roi : sign roi image from front pi camera image --> gray image * Output direction left or right ''' _frontcam_roi = cv2.cvtColor(_frontcam_roi, cv2.COLOR_BGR2GRAY) # Threshloding --> binary image by otsu's method # cv2.imwrite('gray_frontcam_roi.png', _frontcam_roi) _frontcam_roi = cv2.GaussianBlur(_frontcam_roi, (7, 7), 0) # cv2.imwrite('gaussian_gray_frontcam_roi.png', _frontcam_roi) tmp, binary_roi = cv2.threshold( _frontcam_roi, 0, 255, cv2.THRESH_BINARY + cv2.THRESH_OTSU) #height = np.size(binary_roi, 0)/2 #width = np.size(binary_roi, 1)/2 # cutting small ROI from under center point 40 X 20 box #small_roi = binary_roi[height:height+20, width-20:width+20] # compare sum of left pixels' value and right's one sum_left = 0 sum_right = 0 ''' for j in range(20): for i in range(20): sum_left += small_roi[j, i] for i in range(20, 40): sum_right += small_roi[j, i] ''' bin_roi_H = binary_roi.shape[0] bin_roi_W = binary_roi.shape[1] for j in range(bin_roi_H // 2): for i in range(bin_roi_W // 2): sum_left += binary_roi[j + bin_roi_H // 2, i] for i in range(bin_roi_W // 2): sum_right += binary_roi[j + bin_roi_H // 2, i + binary_roi.shape[1] // 2] print("=========================================") print("sum left: ", sum_left / 255, ", sum right: ", sum_right / 255) # ! code for debugging print("==============sum printing================") # cv2.imwrite('binary_roi.png', binary_roi) # ! code for debugging # cv2.imshow('small_roi',small_roi) #! code for debugging # cv2.waitKey(0) #! code for debugging if sum_left > sum_right: print("right detected!!!!") print("right detected!!!!") print("right detected!!!!") return 'right' else: print("left detected!!!!") print("left detected!!!!") print("left detected!!!!") return 'left' def is_light_green(image): """ check the traffic_light's light image: front image return True if light is green return False if light is not green """ raw_data = np.fromstring(image.data, np.uint8) cv_img = cv2.imdecode(raw_data, cv2.IMREAD_COLOR) detector = blob_parameter('traffic_light') centers = blob_detecting(cv_img, detector, 'traffic_light') if len(centers) >= 1: return True else: return False def is_intersection(image): """ check whether the image is intersection return True if intersection return False if not intersection """ ROI_img, ROI_OX = signROI_detecting(image, 'intersection') if ROI_OX != False: # matching & thresholding result_matching = ORB_matching( ROI_img, ref_intersection, ref_intersection_keypoints, ref_intersection_descriptor) if len(result_matching) >= threshold_intersection: return True else: return False else: return False def is_parking(image): """ check whether the image is parking return True if parking return False if not parking """ ROI_img, ROI_OX = signROI_detecting(image, 'parking') if ROI_OX != False: # matching & thresholding result_matching = ORB_matching( ROI_img, ref_images["parking"]["images"], ref_images["parking"]["keypoints"], ref_images["parking"]["descriptor"]) if len(result_matching) >= threshold_parking: return True else: return False else: return False def is_construction(image): raw_data = np.fromstring(image.data, np.uint8) cv_img = cv2.imdecode(raw_data, cv2.IMREAD_COLOR) ROI_img, ROI_OX = signROI_detecting(cv_img, 'construction') if ROI_OX != False: # matching & thresholding result_matching = ORB_matching( ROI_img, ref_images["construction"]["image"], ref_images["construction"]["image"], ref_images["construction"]["descriptor"]) if SCHEDULER.debug_option["show_image_matching"]: rospy.logdebug("result matching : " + str(len(result_matching))) if len(result_matching) >= THRESHOLDS["construction"]: return True else: return False else: return False def is_tunnel(image): ROI_img, ROI_OX = signROI_detecting(image, 'tunnel') if ROI_OX != False: # matching & thresholding result_matching = ORB_matching( ROI_img, ref_images["tunnel"], ref_images["tunnel"]["keypoints"], ref_images["tunnel"]["descriptor"]) if SCHEDULER.debug_option["show_image_matching"] == True: rospy.logdebug("result matching : " + str(len(result_matching))) if len(result_matching) >= threshold_tunnel: return True else: return False else: return False def check_left_right_sign(image): """ check the sign of left or right sign return 'left' if the sign means 'left' return 'right' if the sign means 'right' return 'none' if there isn't a sign """ global threshold_lrmin global threshold_lrmax raw_data = np.fromstring(image.data, np.uint8) cv_img = cv2.imdecode(raw_data, cv2.IMREAD_COLOR) # NOTE: ROI Setting blob_ROI = cv_img[100:, :] ROI_img, ROI_OX = signROI_detecting(cv_img, 'left_or_right') if ROI_OX != False: # LEFT or RIGHT result_matching_left = ORB_matching( ROI_img, ref_images["left"]["image"], ref_images["left"]["keypoints"], ref_images["left"]["descriptor"]) result_matching_right = ORB_matching( ROI_img, ref_images["right"]["image"], ref_images["right"]["keypoints"], ref_images["right"]["descriptor"]) #print("left length: ",len(result_matching_left)) #print("right length: ",len(result_matching_right)) if len(result_matching_left) >= THRESHOLDS["left_right_min"] and \ len(result_matching_left) <= THRESHOLDS["left_right_max"] and \ len(result_matching_right) >= THRESHOLDS["left_right_min"] and \ len(result_matching_right) <= THRESHOLDS["left_right_max"]: return left_or_right(ROI_img) else: return 'none' else: return 'none' def check_sign(image): """ check what the sign means image: front image return 'intersection' if the sign means 'intersection' state return 'construction' if the sign means 'construction' state return 'parking' if the sign means 'parking' state return 'tunnel' if the sign means 'tunnel' state return 'nothing' if there is no sign """ if(is_intersection(image) == True): return 'intersection' elif(is_parking(image) == True): return 'parking' else: return 'nothing' def has_curve_in(distance, image): """ check if there is a curve in distance""" # TODO: future task return False def is_straight_in(distance, image): """ check if the way is straight in distance""" # TODO: future task return False def is_stopping_sign(image): """ check if the sign means 'stop """ # TODO: future task return False def has_crossing_line(image): """ returns true if there is a crossing line from left to right""" # TODO: future task return False # reference image & keypoints & descriptors initialize # init_ref_images() ''' from lib_frontcam import signROI_detecting import cv2 right_img = cv2.imread( "/home/kusw-004/steamcup_2020/assets/images_final/image1.png") left_img = cv2.imread( "/home/kusw-004/steamcup_2020/assets/images_final/image2.png") ref_left = cv2.imread( "/home/kusw-004/steamcup_2020/packages/galapagos_v2/libs/left.png") ref_right = cv2.imread( "/home/kusw-004/steamcup_2020/packages/galapagos_v2/libs/right.png") '''
34.347744
136
0.626224
import cv2 import numpy as np import rospy import matplotlib.pyplot as plt import sys from scheduler import SCHEDULER from constants import * import os import sys Orb = cv2.ORB_create() Bf = cv2.BFMatcher(cv2.NORM_HAMMING, crossCheck=True) ref_images = {} lower_blue = np.array([90, 110, 100]) upper_blue = np.array([130, 200, 160]) lower_red = np.array([0, 120, 100]) upper_red = np.array([20, 180, 200]) lower_green = np.array([60, 55, 50]) upper_green = np.array([85, 255, 255]) value_default = 1 def init_ref_images(): global ref_images for idx, key in enumerate(REF_IMAGE_PATH): image = cv2.imread(SCHEDULER.path + "/images/" + REF_IMAGE_PATH[key]) try: image = cv2.medianBlur(cv2.GaussianBlur(image, (11, 11), 0), 11) except cv2.error as e: rospy.logfatal("[LIB_FRONT] ref image '" + key + "' not found in constants.py!") rospy.signal_shutdown("Shutdown by fatal error.") if SCHEDULER.debug_option["show_loaded_ref_images"]: rospy.logdebug("[LIB_FRONT] {:8s} image loaded. ({})".format( key, str(SCHEDULER.path + "/" + REF_IMAGE_PATH[key]))) keypoints, descriptor = Orb.detectAndCompute(image, None) ref_images[key] = { "image": image, "keypoints": keypoints, "descriptor": descriptor } def blob_parameter(state_type): if state_type == 'traffic_light': params = cv2.SimpleBlobDetector_Params() params.minThreshold = 0 params.maxThreshold = 256 params.filterByArea = True params.minArea = 500 params.maxArea = 2300 params.filterByCircularity = True params.minCircularity = 0.4 params.filterByConvexity = True params.minConvexity = 0.1 params.filterByInertia = True params.minInertiaRatio = 0.01 elif state_type == 'intersection' or state_type == 'construction' or state_type == 'turnel': params = cv2.SimpleBlobDetector_Params() params.minThreshold = 10 params.maxThreshold = 200 params.filterByArea = True params.minArea = 500 params.filterByCircularity = True params.minCircularity = 0.1 params.filterByConvexity = False params.minConvexity = 0.1 params.filterByInertia = True params.minInertiaRatio = 0.01 else: params = cv2.SimpleBlobDetector_Params() params.minThreshold = 0 params.maxThreshold = 256 params.filterByArea = True params.minArea = 1000 params.maxArea = 35000 params.filterByCircularity = True params.minCircularity = 0.5 params.filterByConvexity = True params.minConvexity = 0.1 params.filterByInertia = True params.minInertiaRatio = 0.01 ver = (cv2.__version__).split('.') if int(ver[0]) < 3: blob_detector = cv2.SimpleBlobDetector(params) else: blob_detector = cv2.SimpleBlobDetector_create(params) return blob_detector def blob_detecting(image, blob_detector, state_type): _hsv_maxThreshold = value_default _hsv_minThreshold = value_default if state_type == 'intersection' or state_type == 'construction' or state_type == 'turnel': _hsv_maxThreshold = upper_red _hsv_minThreshold = lower_red elif state_type == 'traffic_light': _hsv_maxThreshold = upper_green _hsv_minThreshold = lower_green else: _hsv_maxThreshold = upper_blue _hsv_minThreshold = lower_blue hsv = cv2.cvtColor(image, cv2.COLOR_BGR2HSV) kernel = np.ones((3, 3), np.uint8) mask = cv2.inRange(hsv, _hsv_minThreshold, _hsv_maxThreshold) mask = cv2.dilate(mask, kernel, iterations=5) reversemask = 255 - mask if state_type == 'intersection' or state_type == 'turnel' or state_type == 'to_intersection': blob_centers = blob_detector.detect(mask) else: blob_centers = blob_detector.detect(reversemask) BGR_ROI = cv2.cvtColor(reversemask, cv2.COLOR_GRAY2BGR) if SCHEDULER.debug_option["show_blob_detecting"]: print(len(blob_centers)) show_centers = cv2.drawKeypoints(reversemask, blob_centers, np.array( []), (0, 0, 255), cv2.DRAW_MATCHES_FLAGS_DRAW_RICH_KEYPOINTS) cv2.imshow('hsv', hsv) cv2.imshow('mask', mask) cv2.imshow('reverse', reversemask) cv2.imshow('result', show_centers) cv2.waitKey(0) if len(blob_centers) >= 1: centers = [] for i in blob_centers: centers.append(i.pt) return centers else: return blob_centers def signROI_detecting(image, state_type): sign_detector = blob_parameter(state_type) sign_centers = blob_detecting(image, sign_detector, state_type) yy = int(sign_centers[0][1]) ers[0][1] - 45 < 0 or sign_centers[0][0] < 45: if sign_centers[0][0] < sign_centers[0][1]: signROI_size = int(sign_centers[0][0]) else: signROI_size = int(sign_centers[0][1]) else: signROI_size = 45 signROI = image[yy - signROI_size: yy + signROI_size, xx - signROI_size: xx + signROI_size] cv2.imshow('ROI', signROI) cv2.waitKey(1) return signROI, True else: signROI = image return signROI, False def ORB_matching(_roi, _ref_img, _ref_keypoints, _ref_descriptor): global Orb global Bf _roi = cv2.cvtColor(_roi, cv2.COLOR_BGR2GRAY) _roi = cv2.medianBlur(_roi, 5) ROI_keypoints, ROI_descriptor = Orb.detectAndCompute(_roi, None) matches = Bf.match(ROI_descriptor, _ref_descriptor) matches = sorted(matches, key=lambda x: x.distance) if SCHEDULER.debug_option["show_orb_matching"] == True: print(len(matches)) matching_image = cv2.drawMatches( _roi, ROI_keypoints, _ref_img, _ref_keypoints, matches, None, flags=2) cv2.imshow('matching', matching_image) cv2.waitKey() return matches def check_if_left_or_right(image): def left_or_right(_frontcam_roi): _frontcam_roi = cv2.cvtColor(_frontcam_roi, cv2.COLOR_BGR2GRAY) # cv2.imwrite('gray_frontcam_roi.png', _frontcam_roi) _frontcam_roi = cv2.GaussianBlur(_frontcam_roi, (7, 7), 0) # cv2.imwrite('gaussian_gray_frontcam_roi.png', _frontcam_roi) tmp, binary_roi = cv2.threshold( _frontcam_roi, 0, 255, cv2.THRESH_BINARY + cv2.THRESH_OTSU) #height = np.size(binary_roi, 0)/2 #width = np.size(binary_roi, 1)/2 # cutting small ROI from under center point 40 X 20 box #small_roi = binary_roi[height:height+20, width-20:width+20] # compare sum of left pixels' value and right's one sum_left = 0 sum_right = 0 bin_roi_H = binary_roi.shape[0] bin_roi_W = binary_roi.shape[1] for j in range(bin_roi_H // 2): for i in range(bin_roi_W // 2): sum_left += binary_roi[j + bin_roi_H // 2, i] for i in range(bin_roi_W // 2): sum_right += binary_roi[j + bin_roi_H // 2, i + binary_roi.shape[1] // 2] print("=========================================") print("sum left: ", sum_left / 255, ", sum right: ", sum_right / 255) # ! code for debugging print("==============sum printing================") # cv2.imwrite('binary_roi.png', binary_roi) # ! code for debugging # cv2.imshow('small_roi',small_roi) #! code for debugging # cv2.waitKey(0) #! code for debugging if sum_left > sum_right: print("right detected!!!!") print("right detected!!!!") print("right detected!!!!") return 'right' else: print("left detected!!!!") print("left detected!!!!") print("left detected!!!!") return 'left' def is_light_green(image): raw_data = np.fromstring(image.data, np.uint8) cv_img = cv2.imdecode(raw_data, cv2.IMREAD_COLOR) detector = blob_parameter('traffic_light') centers = blob_detecting(cv_img, detector, 'traffic_light') if len(centers) >= 1: return True else: return False def is_intersection(image): ROI_img, ROI_OX = signROI_detecting(image, 'intersection') if ROI_OX != False: # matching & thresholding result_matching = ORB_matching( ROI_img, ref_intersection, ref_intersection_keypoints, ref_intersection_descriptor) if len(result_matching) >= threshold_intersection: return True else: return False else: return False def is_parking(image): ROI_img, ROI_OX = signROI_detecting(image, 'parking') if ROI_OX != False: # matching & thresholding result_matching = ORB_matching( ROI_img, ref_images["parking"]["images"], ref_images["parking"]["keypoints"], ref_images["parking"]["descriptor"]) if len(result_matching) >= threshold_parking: return True else: return False else: return False def is_construction(image): raw_data = np.fromstring(image.data, np.uint8) cv_img = cv2.imdecode(raw_data, cv2.IMREAD_COLOR) ROI_img, ROI_OX = signROI_detecting(cv_img, 'construction') if ROI_OX != False: # matching & thresholding result_matching = ORB_matching( ROI_img, ref_images["construction"]["image"], ref_images["construction"]["image"], ref_images["construction"]["descriptor"]) if SCHEDULER.debug_option["show_image_matching"]: rospy.logdebug("result matching : " + str(len(result_matching))) if len(result_matching) >= THRESHOLDS["construction"]: return True else: return False else: return False def is_tunnel(image): ROI_img, ROI_OX = signROI_detecting(image, 'tunnel') if ROI_OX != False: # matching & thresholding result_matching = ORB_matching( ROI_img, ref_images["tunnel"], ref_images["tunnel"]["keypoints"], ref_images["tunnel"]["descriptor"]) if SCHEDULER.debug_option["show_image_matching"] == True: rospy.logdebug("result matching : " + str(len(result_matching))) if len(result_matching) >= threshold_tunnel: return True else: return False else: return False def check_left_right_sign(image): global threshold_lrmin global threshold_lrmax raw_data = np.fromstring(image.data, np.uint8) cv_img = cv2.imdecode(raw_data, cv2.IMREAD_COLOR) # NOTE: ROI Setting blob_ROI = cv_img[100:, :] ROI_img, ROI_OX = signROI_detecting(cv_img, 'left_or_right') if ROI_OX != False: # LEFT or RIGHT result_matching_left = ORB_matching( ROI_img, ref_images["left"]["image"], ref_images["left"]["keypoints"], ref_images["left"]["descriptor"]) result_matching_right = ORB_matching( ROI_img, ref_images["right"]["image"], ref_images["right"]["keypoints"], ref_images["right"]["descriptor"]) #print("left length: ",len(result_matching_left)) #print("right length: ",len(result_matching_right)) if len(result_matching_left) >= THRESHOLDS["left_right_min"] and \ len(result_matching_left) <= THRESHOLDS["left_right_max"] and \ len(result_matching_right) >= THRESHOLDS["left_right_min"] and \ len(result_matching_right) <= THRESHOLDS["left_right_max"]: return left_or_right(ROI_img) else: return 'none' else: return 'none' def check_sign(image): if(is_intersection(image) == True): return 'intersection' elif(is_parking(image) == True): return 'parking' else: return 'nothing' def has_curve_in(distance, image): # TODO: future task return False def is_straight_in(distance, image): # TODO: future task return False def is_stopping_sign(image): # TODO: future task return False def has_crossing_line(image): # TODO: future task return False # reference image & keypoints & descriptors initialize # init_ref_images()
true
true
f7f98cbe22eec65b0b2524e768926b30f7b6bbdf
552
py
Python
backend/home/migrations/0001_load_initial_data.py
crowdbotics-apps/wandering-firefly-29609
bb3c8714937583d9784224e9d08f5590482595f7
[ "FTL", "AML", "RSA-MD" ]
null
null
null
backend/home/migrations/0001_load_initial_data.py
crowdbotics-apps/wandering-firefly-29609
bb3c8714937583d9784224e9d08f5590482595f7
[ "FTL", "AML", "RSA-MD" ]
56
2021-08-07T14:53:57.000Z
2022-03-06T17:22:36.000Z
backend/home/migrations/0001_load_initial_data.py
crowdbotics-apps/wandering-firefly-29609
bb3c8714937583d9784224e9d08f5590482595f7
[ "FTL", "AML", "RSA-MD" ]
null
null
null
from django.db import migrations def create_site(apps, schema_editor): Site = apps.get_model("sites", "Site") custom_domain = "wandering-firefly-29609.botics.co" site_params = { "name": "Wandering Firefly", } if custom_domain: site_params["domain"] = custom_domain Site.objects.update_or_create(defaults=site_params, id=1) class Migration(migrations.Migration): dependencies = [ ("sites", "0002_alter_domain_unique"), ] operations = [ migrations.RunPython(create_site), ]
21.230769
61
0.663043
from django.db import migrations def create_site(apps, schema_editor): Site = apps.get_model("sites", "Site") custom_domain = "wandering-firefly-29609.botics.co" site_params = { "name": "Wandering Firefly", } if custom_domain: site_params["domain"] = custom_domain Site.objects.update_or_create(defaults=site_params, id=1) class Migration(migrations.Migration): dependencies = [ ("sites", "0002_alter_domain_unique"), ] operations = [ migrations.RunPython(create_site), ]
true
true
f7f98d85a31cd0e1cf877af91144cb1b4e04fd97
17,108
py
Python
tests/base_test_class.py
valentijnscholten/django-DefectDojo
5d0b9551ee9574d01b9912399919e3eefe1e1d65
[ "BSD-3-Clause" ]
null
null
null
tests/base_test_class.py
valentijnscholten/django-DefectDojo
5d0b9551ee9574d01b9912399919e3eefe1e1d65
[ "BSD-3-Clause" ]
206
2020-04-20T16:03:18.000Z
2022-01-15T23:07:48.000Z
tests/base_test_class.py
valentijnscholten/django-DefectDojo
5d0b9551ee9574d01b9912399919e3eefe1e1d65
[ "BSD-3-Clause" ]
1
2020-12-06T15:44:44.000Z
2020-12-06T15:44:44.000Z
from selenium import webdriver from selenium.webdriver.chrome.options import Options from selenium.webdriver.common.by import By from selenium.webdriver.support import expected_conditions as EC from selenium.webdriver.support.ui import WebDriverWait from selenium.common.exceptions import NoAlertPresentException, NoSuchElementException import unittest import os import re # import time dd_driver = None dd_driver_options = None def on_exception_html_source_logger(func): def wrapper(self, *args, **kwargs): try: return func(self, *args, **kwargs) except Exception as e: print("exception occured at url:", self.driver.current_url) print("page source:", self.driver.page_source) f = open("selenium_page_source.html", "w", encoding='utf-8') f.writelines(self.driver.page_source) # time.sleep(30) raise(e) return wrapper def set_suite_settings(suite, jira=False, github=False, block_execution=False): if jira: suite.addTest(BaseTestCase('enable_jira')) else: suite.addTest(BaseTestCase('disable_jira')) if github: suite.addTest(BaseTestCase('enable_github')) else: suite.addTest(BaseTestCase('disable_github')) if block_execution: suite.addTest(BaseTestCase('enable_block_execution')) else: suite.addTest(BaseTestCase('disable_block_execution')) class BaseTestCase(unittest.TestCase): @classmethod def setUpClass(cls): # Path for automatic downloads, mapped to the media path cls.export_path = 'media' global dd_driver if not dd_driver: # setupModule and tearDownModule are not working in our scenario, so for now we use setupClass and a global variable # global variables are dirty, but in unit tests scenario's like these they are acceptable print('launching browser for: ', cls.__name__) global dd_driver_options dd_driver_options = Options() # headless means no UI, if you want to see what is happening remove headless. Adding detach will leave the window open after the test dd_driver_options.add_argument("--headless") # dd_driver_options.add_experimental_option("detach", True) # the next 2 maybe needed in some scenario's for example on WSL or other headless situations dd_driver_options.add_argument("--no-sandbox") dd_driver_options.add_argument("--disable-dev-shm-usage") dd_driver_options.add_argument("--disable-gpu") # on windows sometimes chrome can't start with certain gpu driver versions, even in headless mode # start maximized or at least with sufficient with because datatables will hide certain controls when the screen is too narrow dd_driver_options.add_argument("--window-size=1280,1024") # dd_driver_options.add_argument("--start-maximized") dd_driver_options.set_capability("acceptInsecureCerts", True) # some extra logging can be turned on if you want to query the browser javascripe console in your tests desired = webdriver.DesiredCapabilities.CHROME desired['goog:loggingPrefs'] = {'browser': 'ALL'} # set automatic downloads to test csv and excel export prefs = {"download.default_directory": cls.export_path} dd_driver_options.add_experimental_option("prefs", prefs) # change path of chromedriver according to which directory you have chromedriver. print('starting chromedriver with options: ', vars(dd_driver_options), desired) dd_driver = webdriver.Chrome(os.environ['CHROMEDRIVER'], chrome_options=dd_driver_options, desired_capabilities=desired) # best practice is only use explicit waits dd_driver.implicitly_wait(1) cls.driver = dd_driver cls.base_url = os.environ['DD_BASE_URL'] def setUp(self): self.verificationErrors = [] self.accept_next_alert = True self.accept_javascript_errors = False self.driver.execute_script("console.clear()") # clear browser console logs? def login_page(self): driver = self.driver driver.get(self.base_url + "login") driver.find_element(By.ID, "id_username").clear() driver.find_element(By.ID, "id_username").send_keys(os.environ['DD_ADMIN_USER']) driver.find_element(By.ID, "id_password").clear() driver.find_element(By.ID, "id_password").send_keys(os.environ['DD_ADMIN_PASSWORD']) driver.find_element(By.CSS_SELECTOR, "button.btn.btn-success").click() self.assertFalse(self.is_element_by_css_selector_present('.alert-danger', 'Please enter a correct username and password')) return driver def test_login(self): return self.login_page() def logout(self): driver = self.driver driver.get(self.base_url + "logout") self.assertTrue(self.is_text_present_on_page("Login")) return driver def test_logout(self): return self.logout() @on_exception_html_source_logger def delete_product_if_exists(self, name="QA Test"): driver = self.driver # Navigate to the product page self.goto_product_overview(driver) # Select the specific product to delete qa_products = driver.find_elements(By.LINK_TEXT, name) if len(qa_products) > 0: self.test_delete_product(name) @on_exception_html_source_logger def delete_finding_template_if_exists(self, name="App Vulnerable to XSS"): driver = self.driver driver.get(self.base_url + "template") # Click on `Delete Template` button templates = driver.find_elements(By.LINK_TEXT, name) if len(templates) > 0: driver.find_element(By.ID, "id_delete").click() # Click 'Yes' on Alert popup driver.switch_to.alert.accept() # used to load some page just to get started # we choose /user because it's lightweight and fast def goto_some_page(self): driver = self.driver driver.get(self.base_url + "user") return driver def goto_product_overview(self, driver): driver.get(self.base_url + "product") self.wait_for_datatable_if_content("no_products", "products_wrapper") return driver def goto_product_type_overview(self, driver): driver.get(self.base_url + "product/type") return driver def goto_component_overview(self, driver): driver.get(self.base_url + "components") return driver def goto_google_sheets_configuration_form(self, driver): # if something is terribly wrong, it may still fail, even if system_settings is disabled. # See https://github.com/DefectDojo/django-DefectDojo/issues/3742 for reference. driver.get(self.base_url + "configure_google_sheets") return driver def goto_active_engagements_overview(self, driver): driver.get(self.base_url + 'engagement/active') return driver def goto_all_engagements_overview(self, driver): driver.get(self.base_url + 'engagement/all') return driver def goto_all_engagements_by_product_overview(self, driver): return self.goto_engagements_internal(driver, 'engagements_all') def goto_engagements_internal(self, driver, rel_url): driver.get(self.base_url + rel_url) self.wait_for_datatable_if_content("no_engagements", "engagements_wrapper") return driver def goto_all_findings_list(self, driver): driver.get(self.base_url + "finding") self.wait_for_datatable_if_content("no_findings", "open_findings_wrapper") return driver def wait_for_datatable_if_content(self, no_content_id, wrapper_id): no_content = None try: no_content = self.driver.find_element(By.ID, no_content_id) except: pass if no_content is None: # wait for product_wrapper div as datatables javascript modifies the DOM on page load. WebDriverWait(self.driver, 30).until(EC.presence_of_element_located((By.ID, wrapper_id))) def is_element_by_css_selector_present(self, selector, text=None): elems = self.driver.find_elements(By.CSS_SELECTOR, selector) if len(elems) == 0: print('no elements! for: "' + selector + '": ' + text) return False if text is None: print('text is None!') return True for elem in elems: print(elem.text) if text in elem.text: # print('contains! for: ' + text) return True print('text mismatch! for: ' + text) return False def is_element_by_id_present(self, id): try: self.driver.find_element(By.ID, id) return True except NoSuchElementException: return False def is_success_message_present(self, text=None): return self.is_element_by_css_selector_present('.alert-success', text=text) def is_error_message_present(self, text=None): return self.is_element_by_css_selector_present('.alert-danger', text=text) def is_help_message_present(self, text=None): return self.is_element_by_css_selector_present('.help-block', text=text) def is_text_present_on_page(self, text): # DEBUG: couldn't find: Product type added successfully. path: //*[contains(text(),'Product type added successfully.')] # can't get this xpath to work # path = "//*[contains(text(), '" + text + "')]" # elems = self.driver.find_elements(By.XPATH, path) # if len(elems) == 0: # print("DEBUG: couldn't find: ", text, "path: ", path) body = self.driver.find_element(By.TAG_NAME, "body") return re.search(text, body.text) def element_exists_by_id(self, id): elems = self.driver.find_elements(By.ID, id) return len(elems) > 0 def change_system_setting(self, id, enable=True): print("changing system setting " + id + " enable: " + str(enable)) driver = self.driver driver.get(self.base_url + 'system_settings') is_enabled = driver.find_element(By.ID, id).is_selected() if (enable and not is_enabled) or (not enable and is_enabled): # driver.find_element(By.XPATH, '//*[@id=' + id + ']').click() driver.find_element(By.ID, id).click() # save settings driver.find_element(By.CSS_SELECTOR, "input.btn.btn-primary").click() # check if it's enabled after reload is_enabled = driver.find_element(By.ID, id).is_selected() if enable: self.assertTrue(is_enabled) if not enable: self.assertFalse(is_enabled) return is_enabled def enable_system_setting(self, id): return self.change_system_setting(id, enable=True) def disable_system_setting(self, id): return self.change_system_setting(id, enable=False) def enable_jira(self): return self.enable_system_setting('id_enable_jira') def disable_jira(self): return self.disable_system_setting('id_enable_jira') def disable_github(self): return self.disable_system_setting('id_enable_github') def enable_github(self): return self.enable_system_setting('id_enable_github') def set_block_execution(self, block_execution=True): # we set the admin user (ourselves) to have block_execution checked # this will force dedupe to happen synchronously, among other things like notifications, rules, ... print('setting block execution to: ', str(block_execution)) driver = self.driver driver.get(self.base_url + 'profile') if driver.find_element(By.ID, 'id_block_execution').is_selected() != block_execution: driver.find_element(By.XPATH, '//*[@id="id_block_execution"]').click() # save settings driver.find_element(By.CSS_SELECTOR, "input.btn.btn-primary").click() # check if it's enabled after reload self.assertTrue(driver.find_element(By.ID, 'id_block_execution').is_selected() == block_execution) return driver def enable_block_execution(self): self.set_block_execution() def disable_block_execution(self): self.set_block_execution(block_execution=False) def is_alert_present(self): try: self.driver.switch_to_alert() except NoAlertPresentException: return False return True def close_alert_and_get_its_text(self): try: alert = self.driver.switch_to_alert() alert_text = alert.text if self.accept_next_alert: alert.accept() else: alert.dismiss() return alert_text finally: self.accept_next_alert = True def assertNoConsoleErrors(self): """ Sample output for levels (i.e. errors are SEVERE) {'level': 'DEBUG', 'message': 'http://localhost:8080/product/type/4/edit 560:12 "debug"', 'source': 'console-api', 'timestamp': 1583952828410} {'level': 'INFO', 'message': 'http://localhost:8080/product/type/4/edit 561:16 "info"', 'source': 'console-api', 'timestamp': 1583952828410} {'level': 'WARNING', 'message': 'http://localhost:8080/product/type/4/edit 562:16 "warning"', 'source': 'console-api', 'timestamp': 1583952828410} {'level': 'SEVERE', 'message': 'http://localhost:8080/product/type/4/edit 563:16 "error"', 'source': 'console-api', 'timestamp': 1583952828410} """ for entry in WebdriverOnlyNewLogFacade(self.driver).get_log('browser'): """ Images are now working after https://github.com/DefectDojo/django-DefectDojo/pull/3954, but http://localhost:8080/static/dojo/img/zoom-in.cur still produces a 404 The addition of the trigger exception is due to the Report Builder tests. The addition of the innerHTML exception is due to the test for quick reports in finding_test.py """ accepted_javascript_messages = r'(zoom\-in\.cur.*)404\ \(Not\ Found\)|Uncaught TypeError: Cannot read properties of null \(reading \'trigger\'\)|Uncaught TypeError: Cannot read properties of null \(reading \'innerHTML\'\)' if (entry['level'] == 'SEVERE'): # print(self.driver.current_url) # TODO actually this seems to be the previous url # self.driver.save_screenshot("C:\\Data\\django-DefectDojo\\tests\\javascript-errors.png") # with open("C:\\Data\\django-DefectDojo\\tests\\javascript-errors.html", "w") as f: # f.write(self.driver.page_source) print(entry) print('There was a SEVERE javascript error in the console, please check all steps fromt the current test to see where it happens') print('Currently there is no reliable way to find out at which url the error happened, but it could be: .' + self.driver.current_url) if self.accept_javascript_errors: print('WARNING: skipping SEVERE javascript error because accept_javascript_errors is True!') elif re.search(accepted_javascript_messages, entry['message']): print('WARNING: skipping javascript errors related to known issues images, see https://github.com/DefectDojo/django-DefectDojo/blob/master/tests/base_test_class.py#L324') else: self.assertNotEqual(entry['level'], 'SEVERE') return True def tearDown(self): self.assertNoConsoleErrors() self.assertEqual([], self.verificationErrors) @classmethod def tearDownDriver(cls): print('tearDownDriver: ', cls.__name__) global dd_driver if dd_driver: if not dd_driver_options.experimental_options or not dd_driver_options.experimental_options.get('detach'): print('closing browser') dd_driver.quit() class WebdriverOnlyNewLogFacade(object): last_timestamp = 0 def __init__(self, webdriver): self._webdriver = webdriver def get_log(self, log_type): last_timestamp = self.last_timestamp entries = self._webdriver.get_log(log_type) filtered = [] for entry in entries: # check the logged timestamp against the # stored timestamp if entry["timestamp"] > self.last_timestamp: filtered.append(entry) # save the last timestamp only if newer # in this set of logs if entry["timestamp"] > last_timestamp: last_timestamp = entry["timestamp"] # store the very last timestamp self.last_timestamp = last_timestamp return filtered
41.026379
234
0.656886
from selenium import webdriver from selenium.webdriver.chrome.options import Options from selenium.webdriver.common.by import By from selenium.webdriver.support import expected_conditions as EC from selenium.webdriver.support.ui import WebDriverWait from selenium.common.exceptions import NoAlertPresentException, NoSuchElementException import unittest import os import re dd_driver = None dd_driver_options = None def on_exception_html_source_logger(func): def wrapper(self, *args, **kwargs): try: return func(self, *args, **kwargs) except Exception as e: print("exception occured at url:", self.driver.current_url) print("page source:", self.driver.page_source) f = open("selenium_page_source.html", "w", encoding='utf-8') f.writelines(self.driver.page_source) raise(e) return wrapper def set_suite_settings(suite, jira=False, github=False, block_execution=False): if jira: suite.addTest(BaseTestCase('enable_jira')) else: suite.addTest(BaseTestCase('disable_jira')) if github: suite.addTest(BaseTestCase('enable_github')) else: suite.addTest(BaseTestCase('disable_github')) if block_execution: suite.addTest(BaseTestCase('enable_block_execution')) else: suite.addTest(BaseTestCase('disable_block_execution')) class BaseTestCase(unittest.TestCase): @classmethod def setUpClass(cls): cls.export_path = 'media' global dd_driver if not dd_driver: print('launching browser for: ', cls.__name__) global dd_driver_options dd_driver_options = Options() # headless means no UI, if you want to see what is happening remove headless. Adding detach will leave the window open after the test dd_driver_options.add_argument("--headless") # dd_driver_options.add_experimental_option("detach", True) # the next 2 maybe needed in some scenario's for example on WSL or other headless situations dd_driver_options.add_argument("--no-sandbox") dd_driver_options.add_argument("--disable-dev-shm-usage") dd_driver_options.add_argument("--disable-gpu") # start maximized or at least with sufficient with because datatables will hide certain controls when the screen is too narrow dd_driver_options.add_argument("--window-size=1280,1024") # dd_driver_options.add_argument("--start-maximized") dd_driver_options.set_capability("acceptInsecureCerts", True) # some extra logging can be turned on if you want to query the browser javascripe console in your tests desired = webdriver.DesiredCapabilities.CHROME desired['goog:loggingPrefs'] = {'browser': 'ALL'} # set automatic downloads to test csv and excel export prefs = {"download.default_directory": cls.export_path} dd_driver_options.add_experimental_option("prefs", prefs) # change path of chromedriver according to which directory you have chromedriver. print('starting chromedriver with options: ', vars(dd_driver_options), desired) dd_driver = webdriver.Chrome(os.environ['CHROMEDRIVER'], chrome_options=dd_driver_options, desired_capabilities=desired) # best practice is only use explicit waits dd_driver.implicitly_wait(1) cls.driver = dd_driver cls.base_url = os.environ['DD_BASE_URL'] def setUp(self): self.verificationErrors = [] self.accept_next_alert = True self.accept_javascript_errors = False self.driver.execute_script("console.clear()") # clear browser console logs? def login_page(self): driver = self.driver driver.get(self.base_url + "login") driver.find_element(By.ID, "id_username").clear() driver.find_element(By.ID, "id_username").send_keys(os.environ['DD_ADMIN_USER']) driver.find_element(By.ID, "id_password").clear() driver.find_element(By.ID, "id_password").send_keys(os.environ['DD_ADMIN_PASSWORD']) driver.find_element(By.CSS_SELECTOR, "button.btn.btn-success").click() self.assertFalse(self.is_element_by_css_selector_present('.alert-danger', 'Please enter a correct username and password')) return driver def test_login(self): return self.login_page() def logout(self): driver = self.driver driver.get(self.base_url + "logout") self.assertTrue(self.is_text_present_on_page("Login")) return driver def test_logout(self): return self.logout() @on_exception_html_source_logger def delete_product_if_exists(self, name="QA Test"): driver = self.driver # Navigate to the product page self.goto_product_overview(driver) # Select the specific product to delete qa_products = driver.find_elements(By.LINK_TEXT, name) if len(qa_products) > 0: self.test_delete_product(name) @on_exception_html_source_logger def delete_finding_template_if_exists(self, name="App Vulnerable to XSS"): driver = self.driver driver.get(self.base_url + "template") # Click on `Delete Template` button templates = driver.find_elements(By.LINK_TEXT, name) if len(templates) > 0: driver.find_element(By.ID, "id_delete").click() # Click 'Yes' on Alert popup driver.switch_to.alert.accept() # used to load some page just to get started # we choose /user because it's lightweight and fast def goto_some_page(self): driver = self.driver driver.get(self.base_url + "user") return driver def goto_product_overview(self, driver): driver.get(self.base_url + "product") self.wait_for_datatable_if_content("no_products", "products_wrapper") return driver def goto_product_type_overview(self, driver): driver.get(self.base_url + "product/type") return driver def goto_component_overview(self, driver): driver.get(self.base_url + "components") return driver def goto_google_sheets_configuration_form(self, driver): driver.get(self.base_url + "configure_google_sheets") return driver def goto_active_engagements_overview(self, driver): driver.get(self.base_url + 'engagement/active') return driver def goto_all_engagements_overview(self, driver): driver.get(self.base_url + 'engagement/all') return driver def goto_all_engagements_by_product_overview(self, driver): return self.goto_engagements_internal(driver, 'engagements_all') def goto_engagements_internal(self, driver, rel_url): driver.get(self.base_url + rel_url) self.wait_for_datatable_if_content("no_engagements", "engagements_wrapper") return driver def goto_all_findings_list(self, driver): driver.get(self.base_url + "finding") self.wait_for_datatable_if_content("no_findings", "open_findings_wrapper") return driver def wait_for_datatable_if_content(self, no_content_id, wrapper_id): no_content = None try: no_content = self.driver.find_element(By.ID, no_content_id) except: pass if no_content is None: WebDriverWait(self.driver, 30).until(EC.presence_of_element_located((By.ID, wrapper_id))) def is_element_by_css_selector_present(self, selector, text=None): elems = self.driver.find_elements(By.CSS_SELECTOR, selector) if len(elems) == 0: print('no elements! for: "' + selector + '": ' + text) return False if text is None: print('text is None!') return True for elem in elems: print(elem.text) if text in elem.text: return True print('text mismatch! for: ' + text) return False def is_element_by_id_present(self, id): try: self.driver.find_element(By.ID, id) return True except NoSuchElementException: return False def is_success_message_present(self, text=None): return self.is_element_by_css_selector_present('.alert-success', text=text) def is_error_message_present(self, text=None): return self.is_element_by_css_selector_present('.alert-danger', text=text) def is_help_message_present(self, text=None): return self.is_element_by_css_selector_present('.help-block', text=text) def is_text_present_on_page(self, text): # can't get this xpath to work body = self.driver.find_element(By.TAG_NAME, "body") return re.search(text, body.text) def element_exists_by_id(self, id): elems = self.driver.find_elements(By.ID, id) return len(elems) > 0 def change_system_setting(self, id, enable=True): print("changing system setting " + id + " enable: " + str(enable)) driver = self.driver driver.get(self.base_url + 'system_settings') is_enabled = driver.find_element(By.ID, id).is_selected() if (enable and not is_enabled) or (not enable and is_enabled): # driver.find_element(By.XPATH, '//*[@id=' + id + ']').click() driver.find_element(By.ID, id).click() # save settings driver.find_element(By.CSS_SELECTOR, "input.btn.btn-primary").click() # check if it's enabled after reload is_enabled = driver.find_element(By.ID, id).is_selected() if enable: self.assertTrue(is_enabled) if not enable: self.assertFalse(is_enabled) return is_enabled def enable_system_setting(self, id): return self.change_system_setting(id, enable=True) def disable_system_setting(self, id): return self.change_system_setting(id, enable=False) def enable_jira(self): return self.enable_system_setting('id_enable_jira') def disable_jira(self): return self.disable_system_setting('id_enable_jira') def disable_github(self): return self.disable_system_setting('id_enable_github') def enable_github(self): return self.enable_system_setting('id_enable_github') def set_block_execution(self, block_execution=True): print('setting block execution to: ', str(block_execution)) driver = self.driver driver.get(self.base_url + 'profile') if driver.find_element(By.ID, 'id_block_execution').is_selected() != block_execution: driver.find_element(By.XPATH, '//*[@id="id_block_execution"]').click() driver.find_element(By.CSS_SELECTOR, "input.btn.btn-primary").click() self.assertTrue(driver.find_element(By.ID, 'id_block_execution').is_selected() == block_execution) return driver def enable_block_execution(self): self.set_block_execution() def disable_block_execution(self): self.set_block_execution(block_execution=False) def is_alert_present(self): try: self.driver.switch_to_alert() except NoAlertPresentException: return False return True def close_alert_and_get_its_text(self): try: alert = self.driver.switch_to_alert() alert_text = alert.text if self.accept_next_alert: alert.accept() else: alert.dismiss() return alert_text finally: self.accept_next_alert = True def assertNoConsoleErrors(self): for entry in WebdriverOnlyNewLogFacade(self.driver).get_log('browser'): accepted_javascript_messages = r'(zoom\-in\.cur.*)404\ \(Not\ Found\)|Uncaught TypeError: Cannot read properties of null \(reading \'trigger\'\)|Uncaught TypeError: Cannot read properties of null \(reading \'innerHTML\'\)' if (entry['level'] == 'SEVERE'): # print(self.driver.current_url) # TODO actually this seems to be the previous url # self.driver.save_screenshot("C:\\Data\\django-DefectDojo\\tests\\javascript-errors.png") # with open("C:\\Data\\django-DefectDojo\\tests\\javascript-errors.html", "w") as f: # f.write(self.driver.page_source) print(entry) print('There was a SEVERE javascript error in the console, please check all steps fromt the current test to see where it happens') print('Currently there is no reliable way to find out at which url the error happened, but it could be: .' + self.driver.current_url) if self.accept_javascript_errors: print('WARNING: skipping SEVERE javascript error because accept_javascript_errors is True!') elif re.search(accepted_javascript_messages, entry['message']): print('WARNING: skipping javascript errors related to known issues images, see https://github.com/DefectDojo/django-DefectDojo/blob/master/tests/base_test_class.py else: self.assertNotEqual(entry['level'], 'SEVERE') return True def tearDown(self): self.assertNoConsoleErrors() self.assertEqual([], self.verificationErrors) @classmethod def tearDownDriver(cls): print('tearDownDriver: ', cls.__name__) global dd_driver if dd_driver: if not dd_driver_options.experimental_options or not dd_driver_options.experimental_options.get('detach'): print('closing browser') dd_driver.quit() class WebdriverOnlyNewLogFacade(object): last_timestamp = 0 def __init__(self, webdriver): self._webdriver = webdriver def get_log(self, log_type): last_timestamp = self.last_timestamp entries = self._webdriver.get_log(log_type) filtered = [] for entry in entries: # check the logged timestamp against the # stored timestamp if entry["timestamp"] > self.last_timestamp: filtered.append(entry) # save the last timestamp only if newer # in this set of logs if entry["timestamp"] > last_timestamp: last_timestamp = entry["timestamp"] # store the very last timestamp self.last_timestamp = last_timestamp return filtered
true
true
f7f98e00acf11fa9788ce06d21ba4ee8e4f2a9aa
4,393
py
Python
modin/data_management/partitioning/remote_partition/pandas_on_python.py
zeevikal/modin
2128f80280092902c61d738d9d2ef551bc4ffaf4
[ "Apache-2.0" ]
null
null
null
modin/data_management/partitioning/remote_partition/pandas_on_python.py
zeevikal/modin
2128f80280092902c61d738d9d2ef551bc4ffaf4
[ "Apache-2.0" ]
null
null
null
modin/data_management/partitioning/remote_partition/pandas_on_python.py
zeevikal/modin
2128f80280092902c61d738d9d2ef551bc4ffaf4
[ "Apache-2.0" ]
null
null
null
import pandas from .utils import length_fn_pandas, width_fn_pandas class PandasOnPythonRemotePartition(object): """This abstract class holds the data and metadata for a single partition. The methods required for implementing this abstract class are listed in the section immediately following this. The API exposed by the children of this object is used in `BaseBlockPartitions`. Note: These objects are treated as immutable by `BaseBlockPartitions` subclasses. There is no logic for updating inplace. """ def __init__(self, data): self.data = data self.call_queue = [] def get(self): """Return the data. Note: Since this object is a simple wrapper, just return the data. Returns: The object that was `put`. """ return self.data.copy() def apply(self, func, **kwargs): """Apply some callable function to the data in this partition. Note: It is up to the implementation how kwargs are handled. They are an important part of many implementations. As of right now, they are not serialized. Args: func: The lambda to apply (may already be correctly formatted) Returns: A new `BaseRemotePartition` containing the object that has had `func` applied to it. """ self.call_queue.append((func, kwargs)) def call_queue_closure(data, call_queues): for func, kwargs in call_queues: try: data = func(data.copy(), **kwargs) except Exception as e: self.call_queue = [] raise e return data new_data = call_queue_closure(self.data, self.call_queue) self.call_queue = [] return PandasOnPythonRemotePartition(new_data) def add_to_apply_calls(self, func, **kwargs): """Add the function to the apply function call stack. This function will be executed when apply is called. It will be executed in the order inserted; apply's func operates the last and return """ self.call_queue.append((func, kwargs)) return self def to_pandas(self): """Convert the object stored in this partition to a Pandas DataFrame. Note: If the underlying object is a Pandas DataFrame, this will likely only need to call `get` Returns: A Pandas DataFrame. """ return self.data @classmethod def put(cls, obj): """A factory classmethod to format a given object. Args: obj: An object. Returns: A `RemotePartitions` object. """ return cls(obj) @classmethod def preprocess_func(cls, func): """Preprocess a function before an `apply` call. Note: This is a classmethod because the definition of how to preprocess should be class-wide. Also, we may want to use this before we deploy a preprocessed function to multiple `BaseRemotePartition` objects. Args: func: The function to preprocess. Returns: An object that can be accepted by `apply`. """ return func @classmethod def length_extraction_fn(cls): """The function to compute the length of the object in this partition. Returns: A callable function. """ return length_fn_pandas @classmethod def width_extraction_fn(cls): """The function to compute the width of the object in this partition. Returns: A callable function. """ return width_fn_pandas _length_cache = None _width_cache = None def length(self): if self._length_cache is None: self._length_cache = type(self).width_extraction_fn()(self.data) return self._length_cache def width(self): if self._width_cache is None: self._width_cache = type(self).width_extraction_fn()(self.data) return self._width_cache @classmethod def empty(cls): return cls(pandas.DataFrame())
30.506944
83
0.59094
import pandas from .utils import length_fn_pandas, width_fn_pandas class PandasOnPythonRemotePartition(object): def __init__(self, data): self.data = data self.call_queue = [] def get(self): return self.data.copy() def apply(self, func, **kwargs): self.call_queue.append((func, kwargs)) def call_queue_closure(data, call_queues): for func, kwargs in call_queues: try: data = func(data.copy(), **kwargs) except Exception as e: self.call_queue = [] raise e return data new_data = call_queue_closure(self.data, self.call_queue) self.call_queue = [] return PandasOnPythonRemotePartition(new_data) def add_to_apply_calls(self, func, **kwargs): self.call_queue.append((func, kwargs)) return self def to_pandas(self): return self.data @classmethod def put(cls, obj): return cls(obj) @classmethod def preprocess_func(cls, func): return func @classmethod def length_extraction_fn(cls): return length_fn_pandas @classmethod def width_extraction_fn(cls): return width_fn_pandas _length_cache = None _width_cache = None def length(self): if self._length_cache is None: self._length_cache = type(self).width_extraction_fn()(self.data) return self._length_cache def width(self): if self._width_cache is None: self._width_cache = type(self).width_extraction_fn()(self.data) return self._width_cache @classmethod def empty(cls): return cls(pandas.DataFrame())
true
true
f7f98e0c702db3580e71be2e696ca6c7d904a52c
1,700
py
Python
mammoth/docx/numbering_xml.py
cockcrow/python-mammoth
f05ae0c7ec6e4faee6267d3b05e3aabce3a2cbb2
[ "BSD-2-Clause" ]
1
2021-03-20T01:50:18.000Z
2021-03-20T01:50:18.000Z
mammoth/docx/numbering_xml.py
cockcrow/python-mammoth
f05ae0c7ec6e4faee6267d3b05e3aabce3a2cbb2
[ "BSD-2-Clause" ]
null
null
null
mammoth/docx/numbering_xml.py
cockcrow/python-mammoth
f05ae0c7ec6e4faee6267d3b05e3aabce3a2cbb2
[ "BSD-2-Clause" ]
null
null
null
from ..documents import numbering_level def read_numbering_xml_element(element): abstract_nums = _read_abstract_nums(element) nums = _read_nums(element, abstract_nums) return Numbering(nums) def _read_abstract_nums(element): abstract_num_elements = element.find_children("w:abstractNum") return dict(map(_read_abstract_num, abstract_num_elements)) def _read_abstract_num(element): abstract_num_id = element.attributes.get("w:abstractNumId") levels = _read_abstract_num_levels(element) return abstract_num_id, levels def _read_abstract_num_levels(element): levels = map(_read_abstract_num_level, element.find_children("w:lvl")) return dict( (level.level_index, level) for level in levels ) def _read_abstract_num_level(element): level_index = element.attributes["w:ilvl"] num_fmt = element.find_child_or_null("w:numFmt").attributes.get("w:val") is_ordered = num_fmt != "bullet" return numbering_level(level_index, is_ordered) def _read_nums(element, abstract_nums): num_elements = element.find_children("w:num") return dict( _read_num(num_element, abstract_nums) for num_element in num_elements ) def _read_num(element, abstract_nums): num_id = element.attributes.get("w:numId") abstract_num_id = element.find_child_or_null("w:abstractNumId").attributes["w:val"] return num_id, abstract_nums[abstract_num_id] class Numbering(object): def __init__(self, nums): self._nums = nums def find_level(self, num_id, level): num = self._nums.get(num_id) if num is None: return None else: return num.get(level)
28.333333
87
0.717647
from ..documents import numbering_level def read_numbering_xml_element(element): abstract_nums = _read_abstract_nums(element) nums = _read_nums(element, abstract_nums) return Numbering(nums) def _read_abstract_nums(element): abstract_num_elements = element.find_children("w:abstractNum") return dict(map(_read_abstract_num, abstract_num_elements)) def _read_abstract_num(element): abstract_num_id = element.attributes.get("w:abstractNumId") levels = _read_abstract_num_levels(element) return abstract_num_id, levels def _read_abstract_num_levels(element): levels = map(_read_abstract_num_level, element.find_children("w:lvl")) return dict( (level.level_index, level) for level in levels ) def _read_abstract_num_level(element): level_index = element.attributes["w:ilvl"] num_fmt = element.find_child_or_null("w:numFmt").attributes.get("w:val") is_ordered = num_fmt != "bullet" return numbering_level(level_index, is_ordered) def _read_nums(element, abstract_nums): num_elements = element.find_children("w:num") return dict( _read_num(num_element, abstract_nums) for num_element in num_elements ) def _read_num(element, abstract_nums): num_id = element.attributes.get("w:numId") abstract_num_id = element.find_child_or_null("w:abstractNumId").attributes["w:val"] return num_id, abstract_nums[abstract_num_id] class Numbering(object): def __init__(self, nums): self._nums = nums def find_level(self, num_id, level): num = self._nums.get(num_id) if num is None: return None else: return num.get(level)
true
true
f7f98e0f9144d9c194c8264c39056b4374ebb641
2,470
py
Python
Paddle_Industry_Practice_Sample_Library/Football_Action/PaddleVideo/tools/summary.py
linuxonly801/awesome-DeepLearning
b063757fa130c4d56aea5cce2e592610f1e169f9
[ "Apache-2.0" ]
883
2020-11-12T11:46:46.000Z
2022-03-31T18:27:10.000Z
tools/summary.py
arkofgalaxy/PaddleVideo
64251233c83b7eb681061b454da198a9082309a6
[ "Apache-2.0" ]
233
2020-12-09T06:04:59.000Z
2022-03-28T08:16:51.000Z
tools/summary.py
arkofgalaxy/PaddleVideo
64251233c83b7eb681061b454da198a9082309a6
[ "Apache-2.0" ]
225
2020-11-13T06:21:55.000Z
2022-03-31T05:36:11.000Z
# Copyright (c) 2020 PaddlePaddle Authors. All Rights Reserved. # # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. import argparse import os import sys import os.path as osp import paddle import paddle.nn.functional as F from paddle.jit import to_static import paddleslim __dir__ = os.path.dirname(os.path.abspath(__file__)) sys.path.append(os.path.abspath(os.path.join(__dir__, '../'))) from paddlevideo.modeling.builder import build_model from paddlevideo.utils import get_config def parse_args(): parser = argparse.ArgumentParser("PaddleVideo Summary") parser.add_argument('-c', '--config', type=str, default='configs/example.yaml', help='config file path') parser.add_argument("--img_size", type=int, default=224) parser.add_argument("--num_seg", type=int, default=8) parser.add_argument("--FLOPs", action="store_true", help="whether to print FLOPs") return parser.parse_args() def _trim(cfg, args): """ Reuse the trainging config will bring useless attribute, such as: backbone.pretrained model. Trim it here. """ model_name = cfg.model_name cfg = cfg.MODEL cfg.backbone.pretrained = "" if 'num_seg' in cfg.backbone: cfg.backbone.num_seg = args.num_seg return cfg, model_name def main(): args = parse_args() cfg, model_name = _trim(get_config(args.config, show=False), args) print(f"Building model({model_name})...") model = build_model(cfg) img_size = args.img_size num_seg = args.num_seg #NOTE: only support tsm now, will refine soon params_info = paddle.summary(model, (1, 1, num_seg, 3, img_size, img_size)) print(params_info) if args.FLOPs: flops_info = paddleslim.analysis.flops(model, [1, 1, num_seg, 3, img_size, img_size]) print(flops_info) if __name__ == "__main__": main()
30.121951
110
0.675304
import argparse import os import sys import os.path as osp import paddle import paddle.nn.functional as F from paddle.jit import to_static import paddleslim __dir__ = os.path.dirname(os.path.abspath(__file__)) sys.path.append(os.path.abspath(os.path.join(__dir__, '../'))) from paddlevideo.modeling.builder import build_model from paddlevideo.utils import get_config def parse_args(): parser = argparse.ArgumentParser("PaddleVideo Summary") parser.add_argument('-c', '--config', type=str, default='configs/example.yaml', help='config file path') parser.add_argument("--img_size", type=int, default=224) parser.add_argument("--num_seg", type=int, default=8) parser.add_argument("--FLOPs", action="store_true", help="whether to print FLOPs") return parser.parse_args() def _trim(cfg, args): model_name = cfg.model_name cfg = cfg.MODEL cfg.backbone.pretrained = "" if 'num_seg' in cfg.backbone: cfg.backbone.num_seg = args.num_seg return cfg, model_name def main(): args = parse_args() cfg, model_name = _trim(get_config(args.config, show=False), args) print(f"Building model({model_name})...") model = build_model(cfg) img_size = args.img_size num_seg = args.num_seg params_info = paddle.summary(model, (1, 1, num_seg, 3, img_size, img_size)) print(params_info) if args.FLOPs: flops_info = paddleslim.analysis.flops(model, [1, 1, num_seg, 3, img_size, img_size]) print(flops_info) if __name__ == "__main__": main()
true
true
f7f98e7de1216bce575d7173df886b1c0b423252
2,053
py
Python
build/lib/tnetwork/test/test_convert.py
Yquetzal/tnetwork
43fb2f19aeed57a8a9d9af032ee80f1c9f58516d
[ "BSD-2-Clause" ]
4
2019-02-19T07:49:06.000Z
2020-09-01T16:17:54.000Z
tnetwork/test/test_convert.py
Yquetzal/tnetwork
43fb2f19aeed57a8a9d9af032ee80f1c9f58516d
[ "BSD-2-Clause" ]
1
2019-07-13T16:16:28.000Z
2019-07-15T09:34:33.000Z
build/lib/tnetwork/test/test_convert.py
Yquetzal/tnetwork
43fb2f19aeed57a8a9d9af032ee80f1c9f58516d
[ "BSD-2-Clause" ]
3
2019-07-13T16:09:20.000Z
2022-02-08T02:23:46.000Z
import unittest import tnetwork as tn class FunctionTestCase(unittest.TestCase): def test_SN2IG2SN(self): sn = tn.graph_socioPatterns2012(format=tn.DynGraphSN) ig = sn.to_DynGraphIG() sn2 = ig.to_DynGraphSN(slices=20) self.assertEqual(sn.snapshots_timesteps(),sn2.snapshots_timesteps()) for t in sn.snapshots_timesteps(): self.assertEqual(sn.graph_at_time(t).edges(), sn2.graph_at_time(t).edges()) def test_IG2SN2IG(self): ig = tn.graph_socioPatterns2012(format=tn.DynGraphIG) sn = ig.to_DynGraphSN(slices=20) ig2 = sn.to_DynGraphIG() self.assertEqual(ig.interactions(),ig2.interactions()) def test_SN2LS2SN(self): sn = tn.graph_socioPatterns2012(format=tn.DynGraphSN) sn = sn.aggregate_sliding_window(60 * 60 * 24) ls = sn.to_DynGraphLS() sn2 = ls.to_DynGraphSN(slices=20,weighted=False) self.assertEqual(sn.snapshots_timesteps(), sn2.snapshots_timesteps()) for t in sn.snapshots_timesteps(): self.assertEqual(sn.graph_at_time(t).edges(), sn2.graph_at_time(t).edges()) def test_aggregateDay(self): dg = tn.graph_socioPatterns2012(format=tn.DynGraphSN) dgd = dg.aggregate_time_period("day") sg = dgd.to_DynGraphIG() dg2 = sg.to_DynGraphSN(60*60*24) self.assertEqual(dgd.snapshots_timesteps(),dg2.snapshots_timesteps()) for t in dgd.snapshots_timesteps(): self.assertEqual(dgd.graph_at_time(t).edges(), dg2.graph_at_time(t).edges()) def test_SN2IGaggregatePeriod(self): dg = tn.graph_socioPatterns2012(format=tn.DynGraphSN) dgd = dg.aggregate_sliding_window(60*60*24) sg = dgd.to_DynGraphIG() dg2 = sg.to_DynGraphSN(60*60*24) self.assertEqual(dgd.snapshots_timesteps(),dg2.snapshots_timesteps()) for t in dgd.snapshots_timesteps(): self.assertEqual(dgd.graph_at_time(t).edges(), dg2.graph_at_time(t).edges()) if __name__ == '__main__': unittest.main()
36.660714
88
0.67511
import unittest import tnetwork as tn class FunctionTestCase(unittest.TestCase): def test_SN2IG2SN(self): sn = tn.graph_socioPatterns2012(format=tn.DynGraphSN) ig = sn.to_DynGraphIG() sn2 = ig.to_DynGraphSN(slices=20) self.assertEqual(sn.snapshots_timesteps(),sn2.snapshots_timesteps()) for t in sn.snapshots_timesteps(): self.assertEqual(sn.graph_at_time(t).edges(), sn2.graph_at_time(t).edges()) def test_IG2SN2IG(self): ig = tn.graph_socioPatterns2012(format=tn.DynGraphIG) sn = ig.to_DynGraphSN(slices=20) ig2 = sn.to_DynGraphIG() self.assertEqual(ig.interactions(),ig2.interactions()) def test_SN2LS2SN(self): sn = tn.graph_socioPatterns2012(format=tn.DynGraphSN) sn = sn.aggregate_sliding_window(60 * 60 * 24) ls = sn.to_DynGraphLS() sn2 = ls.to_DynGraphSN(slices=20,weighted=False) self.assertEqual(sn.snapshots_timesteps(), sn2.snapshots_timesteps()) for t in sn.snapshots_timesteps(): self.assertEqual(sn.graph_at_time(t).edges(), sn2.graph_at_time(t).edges()) def test_aggregateDay(self): dg = tn.graph_socioPatterns2012(format=tn.DynGraphSN) dgd = dg.aggregate_time_period("day") sg = dgd.to_DynGraphIG() dg2 = sg.to_DynGraphSN(60*60*24) self.assertEqual(dgd.snapshots_timesteps(),dg2.snapshots_timesteps()) for t in dgd.snapshots_timesteps(): self.assertEqual(dgd.graph_at_time(t).edges(), dg2.graph_at_time(t).edges()) def test_SN2IGaggregatePeriod(self): dg = tn.graph_socioPatterns2012(format=tn.DynGraphSN) dgd = dg.aggregate_sliding_window(60*60*24) sg = dgd.to_DynGraphIG() dg2 = sg.to_DynGraphSN(60*60*24) self.assertEqual(dgd.snapshots_timesteps(),dg2.snapshots_timesteps()) for t in dgd.snapshots_timesteps(): self.assertEqual(dgd.graph_at_time(t).edges(), dg2.graph_at_time(t).edges()) if __name__ == '__main__': unittest.main()
true
true
f7f98eb70fc18671c3d0b8b711ceebc9123ebc31
598
py
Python
home/migrations/0003_blogmodel_user.py
suyogojha/Blog-Django
d75d2e021f3b66cece462dfbdf3a3405a433a254
[ "MIT" ]
null
null
null
home/migrations/0003_blogmodel_user.py
suyogojha/Blog-Django
d75d2e021f3b66cece462dfbdf3a3405a433a254
[ "MIT" ]
null
null
null
home/migrations/0003_blogmodel_user.py
suyogojha/Blog-Django
d75d2e021f3b66cece462dfbdf3a3405a433a254
[ "MIT" ]
null
null
null
# Generated by Django 3.2 on 2021-04-18 14:00 from django.conf import settings from django.db import migrations, models import django.db.models.deletion class Migration(migrations.Migration): dependencies = [ migrations.swappable_dependency(settings.AUTH_USER_MODEL), ('home', '0002_alter_blogmodel_slug'), ] operations = [ migrations.AddField( model_name='blogmodel', name='user', field=models.ForeignKey(blank=True, null=True, on_delete=django.db.models.deletion.CASCADE, to=settings.AUTH_USER_MODEL), ), ]
27.181818
133
0.67893
from django.conf import settings from django.db import migrations, models import django.db.models.deletion class Migration(migrations.Migration): dependencies = [ migrations.swappable_dependency(settings.AUTH_USER_MODEL), ('home', '0002_alter_blogmodel_slug'), ] operations = [ migrations.AddField( model_name='blogmodel', name='user', field=models.ForeignKey(blank=True, null=True, on_delete=django.db.models.deletion.CASCADE, to=settings.AUTH_USER_MODEL), ), ]
true
true
f7f98f259ed1d8115b399156659e50ec8ececc60
268
py
Python
npbench/benchmarks/polybench/covariance/covariance.py
frahlg/npbench
1bc4d9e2e22f3ca67fa2bc7f40e2e751a9c8dd26
[ "BSD-3-Clause" ]
27
2021-05-10T11:49:13.000Z
2022-03-22T18:07:19.000Z
npbench/benchmarks/polybench/covariance/covariance.py
frahlg/npbench
1bc4d9e2e22f3ca67fa2bc7f40e2e751a9c8dd26
[ "BSD-3-Clause" ]
3
2021-12-01T13:03:17.000Z
2022-03-17T10:53:00.000Z
npbench/benchmarks/polybench/covariance/covariance.py
frahlg/npbench
1bc4d9e2e22f3ca67fa2bc7f40e2e751a9c8dd26
[ "BSD-3-Clause" ]
7
2021-06-24T03:40:25.000Z
2022-01-26T09:04:33.000Z
# Copyright 2021 ETH Zurich and the NPBench authors. All rights reserved. import numpy as np def initialize(M, N, datatype=np.float64): float_n = datatype(N) data = np.fromfunction(lambda i, j: (i * j) / M, (N, M), dtype=datatype) return float_n, data
24.363636
76
0.682836
import numpy as np def initialize(M, N, datatype=np.float64): float_n = datatype(N) data = np.fromfunction(lambda i, j: (i * j) / M, (N, M), dtype=datatype) return float_n, data
true
true
f7f9902f153f6b92527da0bf1853d1044d33cd33
10,695
py
Python
estimators/neural_dual_dice.py
isabella232/dice_rl
1af2cda70e7e90302520c4576da8e5fdbdc9f261
[ "Apache-2.0" ]
85
2020-08-05T18:20:15.000Z
2022-03-23T08:44:16.000Z
estimators/neural_dual_dice.py
google-research/dice_rl
3d9f74fe43c49dfd5d0ce7405a59226a9c139381
[ "Apache-2.0" ]
7
2020-08-16T09:31:11.000Z
2021-07-15T00:41:53.000Z
estimators/neural_dual_dice.py
rajatvd/dice_rl
0e9e1a0963cb99ae3d995aa302fa19094c580d35
[ "Apache-2.0" ]
10
2020-08-16T04:24:43.000Z
2022-03-11T23:27:20.000Z
# Copyright 2020 Google LLC. # # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. from __future__ import absolute_import from __future__ import division from __future__ import print_function import numpy as np import tensorflow.compat.v2 as tf from tf_agents.specs import tensor_spec from tf_agents.policies import tf_policy from tf_agents.utils import common as tfagents_common from typing import Any, Callable, Iterable, Optional, Sequence, Tuple, Union import dice_rl.data.dataset as dataset_lib import dice_rl.utils.common as common_lib import dice_rl.estimators.estimator as estimator_lib class NeuralDualDice(object): """Policy evaluation with DualDICE.""" def __init__(self, dataset_spec, nu_network, zeta_network, nu_optimizer, zeta_optimizer, gamma: Union[float, tf.Tensor], reward_fn: Optional[Callable] = None, solve_for_state_action_ratio: bool = True, f_exponent: float = 1.5, primal_form: bool = False, num_samples: Optional[int] = None, nu_regularizer: float = 0., zeta_regularizer: float = 0.): """Initializes the solver. Args: dataset_spec: The spec of the dataset that will be given. nu_network: The nu-value network. zeta_network: The zeta-value network. nu_optimizer: The optimizer to use for nu. zeta_optimizer: The optimizer to use for zeta. gamma: The discount factor to use. reward_fn: A function that takes in an EnvStep and returns the reward for that step. If not specified, defaults to just EnvStep.reward. solve_for_state_action_ratio: Whether to solve for state-action density ratio. Defaults to True. f_exponent: Exponent p to use for f(x) = |x|^p / p. primal_form: Whether to use primal form of DualDICE, which optimizes for nu independent of zeta. This form is biased in stochastic environments. Defaults to False, which uses the saddle-point formulation of DualDICE. num_samples: Number of samples to take from policy to estimate average next nu value. If actions are discrete, this defaults to computing average explicitly. If actions are not discrete, this defaults to using a single sample. nu_regularizer: Regularization coefficient on nu network. zeta_regularizer: Regularization coefficient on zeta network. """ self._dataset_spec = dataset_spec self._nu_network = nu_network self._nu_network.create_variables() self._zeta_network = zeta_network self._zeta_network.create_variables() self._nu_optimizer = nu_optimizer self._zeta_optimizer = zeta_optimizer self._nu_regularizer = nu_regularizer self._zeta_regularizer = zeta_regularizer self._gamma = gamma if reward_fn is None: reward_fn = lambda env_step: env_step.reward self._reward_fn = reward_fn self._num_samples = num_samples self._solve_for_state_action_ratio = solve_for_state_action_ratio if (not self._solve_for_state_action_ratio and not self._dataset_spec.has_log_probability()): raise ValueError('Dataset must contain log-probability when ' 'solve_for_state_action_ratio is False.') if f_exponent <= 1: raise ValueError('Exponent for f must be greater than 1.') fstar_exponent = f_exponent / (f_exponent - 1) self._f_fn = lambda x: tf.abs(x) ** f_exponent / f_exponent self._fstar_fn = lambda x: tf.abs(x) ** fstar_exponent / fstar_exponent self._categorical_action = common_lib.is_categorical_spec( self._dataset_spec.action) if not self._categorical_action and self._num_samples is None: self._num_samples = 1 self._primal_form = primal_form self._initialize() def _initialize(self): pass def _get_value(self, network, env_step): if self._solve_for_state_action_ratio: return network((env_step.observation, env_step.action))[0] else: return network(env_step.observation)[0] def _get_average_value(self, network, env_step, policy): if self._solve_for_state_action_ratio: tfagents_step = dataset_lib.convert_to_tfagents_timestep(env_step) if self._categorical_action and self._num_samples is None: action_weights = policy.distribution( tfagents_step).action.probs_parameter() action_dtype = self._dataset_spec.action.dtype batch_size = tf.shape(action_weights)[0] num_actions = tf.shape(action_weights)[-1] actions = ( # Broadcast actions tf.ones([batch_size, 1], dtype=action_dtype) * tf.range(num_actions, dtype=action_dtype)[None, :]) else: batch_size = tf.shape(env_step.observation)[0] num_actions = self._num_samples action_weights = tf.ones([batch_size, num_actions]) / num_actions actions = tf.stack( [policy.action(tfagents_step).action for _ in range(num_actions)], axis=1) flat_actions = tf.reshape(actions, [batch_size * num_actions] + actions.shape[2:].as_list()) flat_observations = tf.reshape( tf.tile(env_step.observation[:, None, ...], [1, num_actions] + [1] * len(env_step.observation.shape[1:])), [batch_size * num_actions] + env_step.observation.shape[1:].as_list()) flat_values, _ = network((flat_observations, flat_actions)) values = tf.reshape(flat_values, [batch_size, num_actions] + flat_values.shape[1:].as_list()) return tf.reduce_sum( values * common_lib.reverse_broadcast(action_weights, values), axis=1) else: return network(env_step.observation)[0] def _orthogonal_regularization(self, network): reg = 0 for layer in network.layers: if isinstance(layer, tf.keras.layers.Dense): prod = tf.matmul(tf.transpose(layer.kernel), layer.kernel) reg += tf.reduce_sum( tf.math.square(prod * (1 - tf.eye(prod.shape[0])))) return reg def train_loss(self, initial_env_step, env_step, next_env_step, policy): nu_values = self._get_value(self._nu_network, env_step) initial_nu_values = self._get_average_value( self._nu_network, initial_env_step, policy) next_nu_values = self._get_average_value( self._nu_network, next_env_step, policy) zeta_values = self._get_value(self._zeta_network, env_step) discounts = self._gamma * next_env_step.discount policy_ratio = 1.0 if not self._solve_for_state_action_ratio: tfagents_step = dataset_lib.convert_to_tfagents_timestep(env_step) policy_log_probabilities = policy.distribution( tfagents_step).action.log_prob(env_step.action) policy_ratio = tf.exp( policy_log_probabilities - env_step.get_log_probability()) bellman_residuals = ( nu_values - common_lib.reverse_broadcast( discounts * policy_ratio, nu_values) * next_nu_values) zeta_loss = self._fstar_fn(zeta_values) - bellman_residuals * zeta_values if self._primal_form: nu_loss = (self._f_fn(bellman_residuals) - (1 - self._gamma) * initial_nu_values) else: nu_loss = -zeta_loss - (1 - self._gamma) * initial_nu_values return nu_loss, zeta_loss @tf.function def train_step(self, initial_env_step: dataset_lib.EnvStep, experience: dataset_lib.EnvStep, target_policy: tf_policy.TFPolicy): """Performs a single training step based on batch. Args: initial_env_step: A batch of initial steps. experience: A batch of transitions. Elements must have shape [batch_size, 2, ...]. target_policy: The policy whose value we want to estimate. Returns: The losses and the train op. """ env_step = tf.nest.map_structure(lambda t: t[:, 0, ...], experience) next_env_step = tf.nest.map_structure(lambda t: t[:, 1, ...], experience) with tf.GradientTape(watch_accessed_variables=False, persistent=True) as tape: tape.watch(self._nu_network.variables) tape.watch(self._zeta_network.variables) nu_loss, zeta_loss = self.train_loss( initial_env_step, env_step, next_env_step, target_policy) nu_loss += self._nu_regularizer * self._orthogonal_regularization( self._nu_network) zeta_loss += self._zeta_regularizer * self._orthogonal_regularization( self._zeta_network) nu_grads = tape.gradient(nu_loss, self._nu_network.variables) nu_grad_op = self._nu_optimizer.apply_gradients( zip(nu_grads, self._nu_network.variables)) zeta_grads = tape.gradient(zeta_loss, self._zeta_network.variables) zeta_grad_op = self._zeta_optimizer.apply_gradients( zip(zeta_grads, self._zeta_network.variables)) return (tf.reduce_mean(nu_loss), tf.reduce_mean(zeta_loss)) def estimate_average_reward(self, dataset: dataset_lib.OffpolicyDataset, target_policy: tf_policy.TFPolicy): """Estimates value (average per-step reward) of policy. Args: dataset: The dataset to sample experience from. target_policy: The policy whose value we want to estimate. Returns: Estimated average per-step reward of the target policy. """ def weight_fn(env_step): zeta = self._get_value(self._zeta_network, env_step) policy_ratio = 1.0 if not self._solve_for_state_action_ratio: tfagents_timestep = dataset_lib.convert_to_tfagents_timestep(env_step) target_log_probabilities = target_policy.distribution( tfagents_timestep).action.log_prob(env_step.action) policy_ratio = tf.exp( target_log_probabilities - env_step.get_log_probability()) return zeta * common_lib.reverse_broadcast(policy_ratio, zeta) return estimator_lib.get_fullbatch_average( dataset, limit=None, by_steps=True, reward_fn=self._reward_fn, weight_fn=weight_fn)
40.820611
80
0.692006
from __future__ import absolute_import from __future__ import division from __future__ import print_function import numpy as np import tensorflow.compat.v2 as tf from tf_agents.specs import tensor_spec from tf_agents.policies import tf_policy from tf_agents.utils import common as tfagents_common from typing import Any, Callable, Iterable, Optional, Sequence, Tuple, Union import dice_rl.data.dataset as dataset_lib import dice_rl.utils.common as common_lib import dice_rl.estimators.estimator as estimator_lib class NeuralDualDice(object): def __init__(self, dataset_spec, nu_network, zeta_network, nu_optimizer, zeta_optimizer, gamma: Union[float, tf.Tensor], reward_fn: Optional[Callable] = None, solve_for_state_action_ratio: bool = True, f_exponent: float = 1.5, primal_form: bool = False, num_samples: Optional[int] = None, nu_regularizer: float = 0., zeta_regularizer: float = 0.): self._dataset_spec = dataset_spec self._nu_network = nu_network self._nu_network.create_variables() self._zeta_network = zeta_network self._zeta_network.create_variables() self._nu_optimizer = nu_optimizer self._zeta_optimizer = zeta_optimizer self._nu_regularizer = nu_regularizer self._zeta_regularizer = zeta_regularizer self._gamma = gamma if reward_fn is None: reward_fn = lambda env_step: env_step.reward self._reward_fn = reward_fn self._num_samples = num_samples self._solve_for_state_action_ratio = solve_for_state_action_ratio if (not self._solve_for_state_action_ratio and not self._dataset_spec.has_log_probability()): raise ValueError('Dataset must contain log-probability when ' 'solve_for_state_action_ratio is False.') if f_exponent <= 1: raise ValueError('Exponent for f must be greater than 1.') fstar_exponent = f_exponent / (f_exponent - 1) self._f_fn = lambda x: tf.abs(x) ** f_exponent / f_exponent self._fstar_fn = lambda x: tf.abs(x) ** fstar_exponent / fstar_exponent self._categorical_action = common_lib.is_categorical_spec( self._dataset_spec.action) if not self._categorical_action and self._num_samples is None: self._num_samples = 1 self._primal_form = primal_form self._initialize() def _initialize(self): pass def _get_value(self, network, env_step): if self._solve_for_state_action_ratio: return network((env_step.observation, env_step.action))[0] else: return network(env_step.observation)[0] def _get_average_value(self, network, env_step, policy): if self._solve_for_state_action_ratio: tfagents_step = dataset_lib.convert_to_tfagents_timestep(env_step) if self._categorical_action and self._num_samples is None: action_weights = policy.distribution( tfagents_step).action.probs_parameter() action_dtype = self._dataset_spec.action.dtype batch_size = tf.shape(action_weights)[0] num_actions = tf.shape(action_weights)[-1] actions = ( tf.ones([batch_size, 1], dtype=action_dtype) * tf.range(num_actions, dtype=action_dtype)[None, :]) else: batch_size = tf.shape(env_step.observation)[0] num_actions = self._num_samples action_weights = tf.ones([batch_size, num_actions]) / num_actions actions = tf.stack( [policy.action(tfagents_step).action for _ in range(num_actions)], axis=1) flat_actions = tf.reshape(actions, [batch_size * num_actions] + actions.shape[2:].as_list()) flat_observations = tf.reshape( tf.tile(env_step.observation[:, None, ...], [1, num_actions] + [1] * len(env_step.observation.shape[1:])), [batch_size * num_actions] + env_step.observation.shape[1:].as_list()) flat_values, _ = network((flat_observations, flat_actions)) values = tf.reshape(flat_values, [batch_size, num_actions] + flat_values.shape[1:].as_list()) return tf.reduce_sum( values * common_lib.reverse_broadcast(action_weights, values), axis=1) else: return network(env_step.observation)[0] def _orthogonal_regularization(self, network): reg = 0 for layer in network.layers: if isinstance(layer, tf.keras.layers.Dense): prod = tf.matmul(tf.transpose(layer.kernel), layer.kernel) reg += tf.reduce_sum( tf.math.square(prod * (1 - tf.eye(prod.shape[0])))) return reg def train_loss(self, initial_env_step, env_step, next_env_step, policy): nu_values = self._get_value(self._nu_network, env_step) initial_nu_values = self._get_average_value( self._nu_network, initial_env_step, policy) next_nu_values = self._get_average_value( self._nu_network, next_env_step, policy) zeta_values = self._get_value(self._zeta_network, env_step) discounts = self._gamma * next_env_step.discount policy_ratio = 1.0 if not self._solve_for_state_action_ratio: tfagents_step = dataset_lib.convert_to_tfagents_timestep(env_step) policy_log_probabilities = policy.distribution( tfagents_step).action.log_prob(env_step.action) policy_ratio = tf.exp( policy_log_probabilities - env_step.get_log_probability()) bellman_residuals = ( nu_values - common_lib.reverse_broadcast( discounts * policy_ratio, nu_values) * next_nu_values) zeta_loss = self._fstar_fn(zeta_values) - bellman_residuals * zeta_values if self._primal_form: nu_loss = (self._f_fn(bellman_residuals) - (1 - self._gamma) * initial_nu_values) else: nu_loss = -zeta_loss - (1 - self._gamma) * initial_nu_values return nu_loss, zeta_loss @tf.function def train_step(self, initial_env_step: dataset_lib.EnvStep, experience: dataset_lib.EnvStep, target_policy: tf_policy.TFPolicy): env_step = tf.nest.map_structure(lambda t: t[:, 0, ...], experience) next_env_step = tf.nest.map_structure(lambda t: t[:, 1, ...], experience) with tf.GradientTape(watch_accessed_variables=False, persistent=True) as tape: tape.watch(self._nu_network.variables) tape.watch(self._zeta_network.variables) nu_loss, zeta_loss = self.train_loss( initial_env_step, env_step, next_env_step, target_policy) nu_loss += self._nu_regularizer * self._orthogonal_regularization( self._nu_network) zeta_loss += self._zeta_regularizer * self._orthogonal_regularization( self._zeta_network) nu_grads = tape.gradient(nu_loss, self._nu_network.variables) nu_grad_op = self._nu_optimizer.apply_gradients( zip(nu_grads, self._nu_network.variables)) zeta_grads = tape.gradient(zeta_loss, self._zeta_network.variables) zeta_grad_op = self._zeta_optimizer.apply_gradients( zip(zeta_grads, self._zeta_network.variables)) return (tf.reduce_mean(nu_loss), tf.reduce_mean(zeta_loss)) def estimate_average_reward(self, dataset: dataset_lib.OffpolicyDataset, target_policy: tf_policy.TFPolicy): def weight_fn(env_step): zeta = self._get_value(self._zeta_network, env_step) policy_ratio = 1.0 if not self._solve_for_state_action_ratio: tfagents_timestep = dataset_lib.convert_to_tfagents_timestep(env_step) target_log_probabilities = target_policy.distribution( tfagents_timestep).action.log_prob(env_step.action) policy_ratio = tf.exp( target_log_probabilities - env_step.get_log_probability()) return zeta * common_lib.reverse_broadcast(policy_ratio, zeta) return estimator_lib.get_fullbatch_average( dataset, limit=None, by_steps=True, reward_fn=self._reward_fn, weight_fn=weight_fn)
true
true
f7f9913f6080ce29d5c4c2558a99aa468982316a
5,113
py
Python
botnet/modules/baseresponder.py
admdev8/botnet-2
2fd43237e628869eb34d8e7a6747da6d71c1192c
[ "MIT" ]
69
2015-02-24T19:24:23.000Z
2022-02-23T08:04:53.000Z
botnet/modules/baseresponder.py
admdev8/botnet-2
2fd43237e628869eb34d8e7a6747da6d71c1192c
[ "MIT" ]
10
2017-06-28T21:08:29.000Z
2022-01-26T07:46:02.000Z
botnet/modules/baseresponder.py
admdev8/botnet-2
2fd43237e628869eb34d8e7a6747da6d71c1192c
[ "MIT" ]
39
2015-11-19T10:07:21.000Z
2022-03-30T10:56:24.000Z
import re from ..helpers import is_channel_name from ..message import Message from ..signals import message_out from .base import BaseModule from .mixins import ConfigMixin, MessageDispatcherMixin from .lib import parse_command class BaseResponder(ConfigMixin, MessageDispatcherMixin, BaseModule): """Inherit from this class to quickly create a module which reacts to users' messages. Example module config: "botnet": { "base_responder": { "command_prefix": "." } } """ # Don't send description of the .help command - normally each module which # is based on this class would respond to such request and flood a user with # messages. This should be set to False only in one module (by default in # module meta). Note that this parameter is a terrible workaround. The # problem is caused by the fact that modules do not have direct access to # each another, so it is not possible to query others modules for commands. # Each module has to report them separately, and in effect the same command # had to be defined in all modules. ignore_help = True # A module is expected to store the config in # config['module_config'][config_namespace][config_name] config_namespace = None config_name = None # This is the default config for this class base_default_config = { "command_prefix": "." } # Default config for the class which inherits from BaseResponder default_config = {} def __init__(self, config): super().__init__(config) self.register_default_config(self.base_default_config) self.register_default_config(self.default_config) self.register_config('botnet', 'base_responder') if self.config_namespace and self.config_name: self.register_config(self.config_namespace, self.config_name) def _get_commands_from_handlers(self, handler_prefix): """Generates a list of supported commands from defined handlers.""" commands = [] for name in dir(self): if name.startswith(handler_prefix): attr = getattr(self, name) if hasattr(attr, '__call__'): command_name = name[len(handler_prefix):] if not (self.ignore_help and command_name == 'help'): commands.append(command_name) return commands def _get_help_for_command(self, handler_prefix, name): handler = self._get_command_handler(handler_prefix, name) if not handler: return None # Header rw = 'Module %s, help for `%s`: ' % (self.__class__.__name__, name) # Docstring help_text = handler.__doc__ if help_text: rw += ' '.join(help_text.splitlines()) else: rw += 'No help available.' rw = re.sub(' +', ' ', rw) return rw def get_command_prefix(self): return self.config_get('command_prefix') def respond(self, priv_msg, text, pm=False): """Send a text in response to a message. Text will be automatically sent to a proper channel or user. priv_msg: Message object to which we are responding. text: Response text. pm: If True response will be a private message. """ # If this is supposed to be sent as a private message or was sent in # a private message to the bot respond also in private message. if pm or not is_channel_name(priv_msg.params[0]): target = priv_msg.nickname else: target = priv_msg.params[0] response = Message(command='PRIVMSG', params=[target, text]) message_out.send(self, msg=response) def get_all_commands(self): """Should return a list of strings containing all commands supported by this module. """ return self._get_commands_from_handlers(self.handler_prefix) def get_all_admin_commands(self): """Should return a list of strings containing all admin commands supported by this module. """ return self._get_commands_from_handlers(self.admin_handler_prefix) @parse_command([('command_names', '*')]) def command_help(self, msg, args): """If COMMAND is specified sends detailed help for the commands in a private message. Syntax: help [COMMAND ...] """ if len(args.command_names) > 0: # Display help for a specific command for name in args.command_names: if self.ignore_help and name == 'help': continue # get help lines = [] for prefix in [self.handler_prefix, self.admin_handler_prefix]: text = self._get_help_for_command(prefix, name) if text: lines.append(text) # send help for line in lines: self.respond(msg, line, pm=True)
36.784173
80
0.621357
import re from ..helpers import is_channel_name from ..message import Message from ..signals import message_out from .base import BaseModule from .mixins import ConfigMixin, MessageDispatcherMixin from .lib import parse_command class BaseResponder(ConfigMixin, MessageDispatcherMixin, BaseModule): # is based on this class would respond to such request and flood a user with # messages. This should be set to False only in one module (by default in # module meta). Note that this parameter is a terrible workaround. The # problem is caused by the fact that modules do not have direct access to # each another, so it is not possible to query others modules for commands. # Each module has to report them separately, and in effect the same command # had to be defined in all modules. ignore_help = True # A module is expected to store the config in # config['module_config'][config_namespace][config_name] config_namespace = None config_name = None # This is the default config for this class base_default_config = { "command_prefix": "." } # Default config for the class which inherits from BaseResponder default_config = {} def __init__(self, config): super().__init__(config) self.register_default_config(self.base_default_config) self.register_default_config(self.default_config) self.register_config('botnet', 'base_responder') if self.config_namespace and self.config_name: self.register_config(self.config_namespace, self.config_name) def _get_commands_from_handlers(self, handler_prefix): commands = [] for name in dir(self): if name.startswith(handler_prefix): attr = getattr(self, name) if hasattr(attr, '__call__'): command_name = name[len(handler_prefix):] if not (self.ignore_help and command_name == 'help'): commands.append(command_name) return commands def _get_help_for_command(self, handler_prefix, name): handler = self._get_command_handler(handler_prefix, name) if not handler: return None # Header rw = 'Module %s, help for `%s`: ' % (self.__class__.__name__, name) # Docstring help_text = handler.__doc__ if help_text: rw += ' '.join(help_text.splitlines()) else: rw += 'No help available.' rw = re.sub(' +', ' ', rw) return rw def get_command_prefix(self): return self.config_get('command_prefix') def respond(self, priv_msg, text, pm=False): # If this is supposed to be sent as a private message or was sent in # a private message to the bot respond also in private message. if pm or not is_channel_name(priv_msg.params[0]): target = priv_msg.nickname else: target = priv_msg.params[0] response = Message(command='PRIVMSG', params=[target, text]) message_out.send(self, msg=response) def get_all_commands(self): return self._get_commands_from_handlers(self.handler_prefix) def get_all_admin_commands(self): return self._get_commands_from_handlers(self.admin_handler_prefix) @parse_command([('command_names', '*')]) def command_help(self, msg, args): if len(args.command_names) > 0: # Display help for a specific command for name in args.command_names: if self.ignore_help and name == 'help': continue # get help lines = [] for prefix in [self.handler_prefix, self.admin_handler_prefix]: text = self._get_help_for_command(prefix, name) if text: lines.append(text) # send help for line in lines: self.respond(msg, line, pm=True)
true
true
f7f991602b439168bface83da9407a895bf5d90d
1,014
py
Python
model.py
eric-sentient/MIDI-reAE-chords
ac16210bbeb822cb4babb95974a4a05d527763cc
[ "MIT" ]
null
null
null
model.py
eric-sentient/MIDI-reAE-chords
ac16210bbeb822cb4babb95974a4a05d527763cc
[ "MIT" ]
null
null
null
model.py
eric-sentient/MIDI-reAE-chords
ac16210bbeb822cb4babb95974a4a05d527763cc
[ "MIT" ]
null
null
null
import pandas as pd import numpy as np import load_train from keras.models import Sequential, Model from keras.layers import Flatten, Dropout, RepeatVector, LSTM, Dense, Dropout, Embedding, Masking, Bidirectional, Layer from keras.callbacks import EarlyStopping, ModelCheckpoint def make_model(): model = Sequential() model.add(LSTM(32, input_dim=101, return_sequences=True, dropout=0.1, recurrent_dropout=0.1)) model.add(LSTM(10, activation='relu', return_sequences=False)) model.add(RepeatVector(2)) model.add(LSTM(10, activation='relu', return_sequences=True)) model.add(LSTM(32, return_sequences=True, dropout=0.1, recurrent_dropout=0.1)) # Output layer model.add(Dense(101, activation='sigmoid')) # Compile the model model.compile( optimizer='RMSprop', loss='categorical_crossentropy', metrics=['accuracy']) model.summary() return model
26
119
0.657791
import pandas as pd import numpy as np import load_train from keras.models import Sequential, Model from keras.layers import Flatten, Dropout, RepeatVector, LSTM, Dense, Dropout, Embedding, Masking, Bidirectional, Layer from keras.callbacks import EarlyStopping, ModelCheckpoint def make_model(): model = Sequential() model.add(LSTM(32, input_dim=101, return_sequences=True, dropout=0.1, recurrent_dropout=0.1)) model.add(LSTM(10, activation='relu', return_sequences=False)) model.add(RepeatVector(2)) model.add(LSTM(10, activation='relu', return_sequences=True)) model.add(LSTM(32, return_sequences=True, dropout=0.1, recurrent_dropout=0.1)) model.add(Dense(101, activation='sigmoid')) model.compile( optimizer='RMSprop', loss='categorical_crossentropy', metrics=['accuracy']) model.summary() return model
true
true
f7f991f11a49bed2aef71fe3917e5d676de18124
2,242
py
Python
visualize.py
Toroi0610/visualize_interactive
8ddc8c248902ff59f1800d2418c697ffe1e5b472
[ "MIT" ]
null
null
null
visualize.py
Toroi0610/visualize_interactive
8ddc8c248902ff59f1800d2418c697ffe1e5b472
[ "MIT" ]
null
null
null
visualize.py
Toroi0610/visualize_interactive
8ddc8c248902ff59f1800d2418c697ffe1e5b472
[ "MIT" ]
null
null
null
#!/usr/bin/env python # coding: utf-8 # In[5]: import joblib import numpy as np import matplotlib.pyplot as plt import numpy as np import matplotlib.pyplot as plt from matplotlib.widgets import Slider, Button, RadioButtons # In[6]: with open("model.pkl", "rb") as f: model = joblib.load(f) # In[7]: def pred(model, a, b, c, d): res = [] for x in np.arange(-5.0, 5.0, 0.1): for y in np.arange(-5.0, 5.0, 0.1): res.append(model.predict([[x, y, a, b, c, d]])) return np.array(res).reshape([100, 100]) # In[12]: fig, ax = plt.subplots(figsize=(12, 12)) plt.subplots_adjust(left=0.25, bottom=0.35) x = np.arange(-5, 5, 0.1) y = np.arange(-5, 5, 0.1) a = 0.2 b = 0.2 c = 0.2 d = 0.2 s = pred(model, a, b, c, d) im = plt.imshow(s) ax.margins(x=0) axcolor = 'lightgoldenrodyellow' axa = plt.axes([0.25, 0.1, 0.65, 0.03], facecolor=axcolor) axb = plt.axes([0.25, 0.15, 0.65, 0.03], facecolor=axcolor) axc = plt.axes([0.25, 0.2, 0.65, 0.03], facecolor=axcolor) axd = plt.axes([0.25, 0.25, 0.65, 0.03], facecolor=axcolor) sa = Slider(axa, 'a', 0.0, 1.0, valinit=a) sb = Slider(axb, 'b', -1.0, 1.0, valinit=b) sc = Slider(axc, 'c', 0.0, 1.0, valinit=c) sd = Slider(axd, 'd', -1.0, 1.0, valinit=d) def update(val): a = sa.val b = sb.val c = sc.val d = sd.val im.set_data(pred(model, a, b, c, d)) fig.canvas.draw_idle() # amp = samp.val # freq = sfreq.val # l.set_ydata(amp*np.sin(2*np.pi*freq*t)) # fig.canvas.draw_idle() sa.on_changed(update) sb.on_changed(update) sc.on_changed(update) sd.on_changed(update) resetax = plt.axes([0.8, 0.025, 0.1, 0.04]) button = Button(resetax, 'Reset', color=axcolor, hovercolor='0.975') def reset(event): sa.reset() sb.reset() sc.reset() sd.reset() button.on_clicked(reset) # rax = plt.axes([0.025, 0.5, 0.15, 0.15], facecolor=axcolor) # radio = RadioButtons(rax, ('red', 'blue', 'green'), active=0) # def colorfunc(label): # im.set_color(label) # fig.canvas.draw_idle() # radio.on_clicked(colorfunc) # Initialize plot with correct initial active value # colorfunc(radio.value_selected) plt.show() # In[10]: s = pred(model, 0.1, 0.1, 0, 0) # In[11]: plt.imshow(s) # In[ ]:
18.080645
68
0.609277
import joblib import numpy as np import matplotlib.pyplot as plt import numpy as np import matplotlib.pyplot as plt from matplotlib.widgets import Slider, Button, RadioButtons with open("model.pkl", "rb") as f: model = joblib.load(f) def pred(model, a, b, c, d): res = [] for x in np.arange(-5.0, 5.0, 0.1): for y in np.arange(-5.0, 5.0, 0.1): res.append(model.predict([[x, y, a, b, c, d]])) return np.array(res).reshape([100, 100]) fig, ax = plt.subplots(figsize=(12, 12)) plt.subplots_adjust(left=0.25, bottom=0.35) x = np.arange(-5, 5, 0.1) y = np.arange(-5, 5, 0.1) a = 0.2 b = 0.2 c = 0.2 d = 0.2 s = pred(model, a, b, c, d) im = plt.imshow(s) ax.margins(x=0) axcolor = 'lightgoldenrodyellow' axa = plt.axes([0.25, 0.1, 0.65, 0.03], facecolor=axcolor) axb = plt.axes([0.25, 0.15, 0.65, 0.03], facecolor=axcolor) axc = plt.axes([0.25, 0.2, 0.65, 0.03], facecolor=axcolor) axd = plt.axes([0.25, 0.25, 0.65, 0.03], facecolor=axcolor) sa = Slider(axa, 'a', 0.0, 1.0, valinit=a) sb = Slider(axb, 'b', -1.0, 1.0, valinit=b) sc = Slider(axc, 'c', 0.0, 1.0, valinit=c) sd = Slider(axd, 'd', -1.0, 1.0, valinit=d) def update(val): a = sa.val b = sb.val c = sc.val d = sd.val im.set_data(pred(model, a, b, c, d)) fig.canvas.draw_idle() sa.on_changed(update) sb.on_changed(update) sc.on_changed(update) sd.on_changed(update) resetax = plt.axes([0.8, 0.025, 0.1, 0.04]) button = Button(resetax, 'Reset', color=axcolor, hovercolor='0.975') def reset(event): sa.reset() sb.reset() sc.reset() sd.reset() button.on_clicked(reset) plt.show() s = pred(model, 0.1, 0.1, 0, 0) plt.imshow(s)
true
true
f7f992fcea49f9bec747311a0772f563c14ccfeb
66,995
py
Python
Lib/test/test_asyncio/test_unix_events.py
NihalAgarwal/cpython
e1179a5096fb12297ececd7a1c79969aa5747e28
[ "CNRI-Python-GPL-Compatible" ]
null
null
null
Lib/test/test_asyncio/test_unix_events.py
NihalAgarwal/cpython
e1179a5096fb12297ececd7a1c79969aa5747e28
[ "CNRI-Python-GPL-Compatible" ]
null
null
null
Lib/test/test_asyncio/test_unix_events.py
NihalAgarwal/cpython
e1179a5096fb12297ececd7a1c79969aa5747e28
[ "CNRI-Python-GPL-Compatible" ]
null
null
null
"""Tests for unix_events.py.""" import collections import contextlib import errno import io import os import pathlib import signal import socket import stat import sys import tempfile import threading import unittest from unittest import mock from test import support if sys.platform == 'win32': raise unittest.SkipTest('UNIX only') import asyncio from asyncio import log from asyncio import base_events from asyncio import events from asyncio import unix_events from test.test_asyncio import utils as test_utils MOCK_ANY = mock.ANY def tearDownModule(): asyncio.set_event_loop_policy(None) def close_pipe_transport(transport): # Don't call transport.close() because the event loop and the selector # are mocked if transport._pipe is None: return transport._pipe.close() transport._pipe = None @unittest.skipUnless(signal, 'Signals are not supported') class SelectorEventLoopSignalTests(test_utils.TestCase): def setUp(self): super().setUp() self.loop = asyncio.SelectorEventLoop() self.set_event_loop(self.loop) def test_check_signal(self): self.assertRaises( TypeError, self.loop._check_signal, '1') self.assertRaises( ValueError, self.loop._check_signal, signal.NSIG + 1) def test_handle_signal_no_handler(self): self.loop._handle_signal(signal.NSIG + 1) def test_handle_signal_cancelled_handler(self): h = asyncio.Handle(mock.Mock(), (), loop=mock.Mock()) h.cancel() self.loop._signal_handlers[signal.NSIG + 1] = h self.loop.remove_signal_handler = mock.Mock() self.loop._handle_signal(signal.NSIG + 1) self.loop.remove_signal_handler.assert_called_with(signal.NSIG + 1) @mock.patch('asyncio.unix_events.signal') def test_add_signal_handler_setup_error(self, m_signal): m_signal.NSIG = signal.NSIG m_signal.valid_signals = signal.valid_signals m_signal.set_wakeup_fd.side_effect = ValueError self.assertRaises( RuntimeError, self.loop.add_signal_handler, signal.SIGINT, lambda: True) @mock.patch('asyncio.unix_events.signal') def test_add_signal_handler_coroutine_error(self, m_signal): m_signal.NSIG = signal.NSIG async def simple_coroutine(): pass # callback must not be a coroutine function coro_func = simple_coroutine coro_obj = coro_func() self.addCleanup(coro_obj.close) for func in (coro_func, coro_obj): self.assertRaisesRegex( TypeError, 'coroutines cannot be used with add_signal_handler', self.loop.add_signal_handler, signal.SIGINT, func) @mock.patch('asyncio.unix_events.signal') def test_add_signal_handler(self, m_signal): m_signal.NSIG = signal.NSIG m_signal.valid_signals = signal.valid_signals cb = lambda: True self.loop.add_signal_handler(signal.SIGHUP, cb) h = self.loop._signal_handlers.get(signal.SIGHUP) self.assertIsInstance(h, asyncio.Handle) self.assertEqual(h._callback, cb) @mock.patch('asyncio.unix_events.signal') def test_add_signal_handler_install_error(self, m_signal): m_signal.NSIG = signal.NSIG m_signal.valid_signals = signal.valid_signals def set_wakeup_fd(fd): if fd == -1: raise ValueError() m_signal.set_wakeup_fd = set_wakeup_fd class Err(OSError): errno = errno.EFAULT m_signal.signal.side_effect = Err self.assertRaises( Err, self.loop.add_signal_handler, signal.SIGINT, lambda: True) @mock.patch('asyncio.unix_events.signal') @mock.patch('asyncio.base_events.logger') def test_add_signal_handler_install_error2(self, m_logging, m_signal): m_signal.NSIG = signal.NSIG m_signal.valid_signals = signal.valid_signals class Err(OSError): errno = errno.EINVAL m_signal.signal.side_effect = Err self.loop._signal_handlers[signal.SIGHUP] = lambda: True self.assertRaises( RuntimeError, self.loop.add_signal_handler, signal.SIGINT, lambda: True) self.assertFalse(m_logging.info.called) self.assertEqual(1, m_signal.set_wakeup_fd.call_count) @mock.patch('asyncio.unix_events.signal') @mock.patch('asyncio.base_events.logger') def test_add_signal_handler_install_error3(self, m_logging, m_signal): class Err(OSError): errno = errno.EINVAL m_signal.signal.side_effect = Err m_signal.NSIG = signal.NSIG m_signal.valid_signals = signal.valid_signals self.assertRaises( RuntimeError, self.loop.add_signal_handler, signal.SIGINT, lambda: True) self.assertFalse(m_logging.info.called) self.assertEqual(2, m_signal.set_wakeup_fd.call_count) @mock.patch('asyncio.unix_events.signal') def test_remove_signal_handler(self, m_signal): m_signal.NSIG = signal.NSIG m_signal.valid_signals = signal.valid_signals self.loop.add_signal_handler(signal.SIGHUP, lambda: True) self.assertTrue( self.loop.remove_signal_handler(signal.SIGHUP)) self.assertTrue(m_signal.set_wakeup_fd.called) self.assertTrue(m_signal.signal.called) self.assertEqual( (signal.SIGHUP, m_signal.SIG_DFL), m_signal.signal.call_args[0]) @mock.patch('asyncio.unix_events.signal') def test_remove_signal_handler_2(self, m_signal): m_signal.NSIG = signal.NSIG m_signal.SIGINT = signal.SIGINT m_signal.valid_signals = signal.valid_signals self.loop.add_signal_handler(signal.SIGINT, lambda: True) self.loop._signal_handlers[signal.SIGHUP] = object() m_signal.set_wakeup_fd.reset_mock() self.assertTrue( self.loop.remove_signal_handler(signal.SIGINT)) self.assertFalse(m_signal.set_wakeup_fd.called) self.assertTrue(m_signal.signal.called) self.assertEqual( (signal.SIGINT, m_signal.default_int_handler), m_signal.signal.call_args[0]) @mock.patch('asyncio.unix_events.signal') @mock.patch('asyncio.base_events.logger') def test_remove_signal_handler_cleanup_error(self, m_logging, m_signal): m_signal.NSIG = signal.NSIG m_signal.valid_signals = signal.valid_signals self.loop.add_signal_handler(signal.SIGHUP, lambda: True) m_signal.set_wakeup_fd.side_effect = ValueError self.loop.remove_signal_handler(signal.SIGHUP) self.assertTrue(m_logging.info) @mock.patch('asyncio.unix_events.signal') def test_remove_signal_handler_error(self, m_signal): m_signal.NSIG = signal.NSIG m_signal.valid_signals = signal.valid_signals self.loop.add_signal_handler(signal.SIGHUP, lambda: True) m_signal.signal.side_effect = OSError self.assertRaises( OSError, self.loop.remove_signal_handler, signal.SIGHUP) @mock.patch('asyncio.unix_events.signal') def test_remove_signal_handler_error2(self, m_signal): m_signal.NSIG = signal.NSIG m_signal.valid_signals = signal.valid_signals self.loop.add_signal_handler(signal.SIGHUP, lambda: True) class Err(OSError): errno = errno.EINVAL m_signal.signal.side_effect = Err self.assertRaises( RuntimeError, self.loop.remove_signal_handler, signal.SIGHUP) @mock.patch('asyncio.unix_events.signal') def test_close(self, m_signal): m_signal.NSIG = signal.NSIG m_signal.valid_signals = signal.valid_signals self.loop.add_signal_handler(signal.SIGHUP, lambda: True) self.loop.add_signal_handler(signal.SIGCHLD, lambda: True) self.assertEqual(len(self.loop._signal_handlers), 2) m_signal.set_wakeup_fd.reset_mock() self.loop.close() self.assertEqual(len(self.loop._signal_handlers), 0) m_signal.set_wakeup_fd.assert_called_once_with(-1) @mock.patch('asyncio.unix_events.sys') @mock.patch('asyncio.unix_events.signal') def test_close_on_finalizing(self, m_signal, m_sys): m_signal.NSIG = signal.NSIG m_signal.valid_signals = signal.valid_signals self.loop.add_signal_handler(signal.SIGHUP, lambda: True) self.assertEqual(len(self.loop._signal_handlers), 1) m_sys.is_finalizing.return_value = True m_signal.signal.reset_mock() with self.assertWarnsRegex(ResourceWarning, "skipping signal handlers removal"): self.loop.close() self.assertEqual(len(self.loop._signal_handlers), 0) self.assertFalse(m_signal.signal.called) @unittest.skipUnless(hasattr(socket, 'AF_UNIX'), 'UNIX Sockets are not supported') class SelectorEventLoopUnixSocketTests(test_utils.TestCase): def setUp(self): super().setUp() self.loop = asyncio.SelectorEventLoop() self.set_event_loop(self.loop) @support.skip_unless_bind_unix_socket def test_create_unix_server_existing_path_sock(self): with test_utils.unix_socket_path() as path: sock = socket.socket(socket.AF_UNIX) sock.bind(path) sock.listen(1) sock.close() coro = self.loop.create_unix_server(lambda: None, path) srv = self.loop.run_until_complete(coro) srv.close() self.loop.run_until_complete(srv.wait_closed()) @support.skip_unless_bind_unix_socket def test_create_unix_server_pathlib(self): with test_utils.unix_socket_path() as path: path = pathlib.Path(path) srv_coro = self.loop.create_unix_server(lambda: None, path) srv = self.loop.run_until_complete(srv_coro) srv.close() self.loop.run_until_complete(srv.wait_closed()) def test_create_unix_connection_pathlib(self): with test_utils.unix_socket_path() as path: path = pathlib.Path(path) coro = self.loop.create_unix_connection(lambda: None, path) with self.assertRaises(FileNotFoundError): # If pathlib.Path wasn't supported, the exception would be # different. self.loop.run_until_complete(coro) def test_create_unix_server_existing_path_nonsock(self): with tempfile.NamedTemporaryFile() as file: coro = self.loop.create_unix_server(lambda: None, file.name) with self.assertRaisesRegex(OSError, 'Address.*is already in use'): self.loop.run_until_complete(coro) def test_create_unix_server_ssl_bool(self): coro = self.loop.create_unix_server(lambda: None, path='spam', ssl=True) with self.assertRaisesRegex(TypeError, 'ssl argument must be an SSLContext'): self.loop.run_until_complete(coro) def test_create_unix_server_nopath_nosock(self): coro = self.loop.create_unix_server(lambda: None, path=None) with self.assertRaisesRegex(ValueError, 'path was not specified, and no sock'): self.loop.run_until_complete(coro) def test_create_unix_server_path_inetsock(self): sock = socket.socket() with sock: coro = self.loop.create_unix_server(lambda: None, path=None, sock=sock) with self.assertRaisesRegex(ValueError, 'A UNIX Domain Stream.*was expected'): self.loop.run_until_complete(coro) def test_create_unix_server_path_dgram(self): sock = socket.socket(socket.AF_UNIX, socket.SOCK_DGRAM) with sock: coro = self.loop.create_unix_server(lambda: None, path=None, sock=sock) with self.assertRaisesRegex(ValueError, 'A UNIX Domain Stream.*was expected'): self.loop.run_until_complete(coro) @unittest.skipUnless(hasattr(socket, 'SOCK_NONBLOCK'), 'no socket.SOCK_NONBLOCK (linux only)') @support.skip_unless_bind_unix_socket def test_create_unix_server_path_stream_bittype(self): sock = socket.socket( socket.AF_UNIX, socket.SOCK_STREAM | socket.SOCK_NONBLOCK) with tempfile.NamedTemporaryFile() as file: fn = file.name try: with sock: sock.bind(fn) coro = self.loop.create_unix_server(lambda: None, path=None, sock=sock) srv = self.loop.run_until_complete(coro) srv.close() self.loop.run_until_complete(srv.wait_closed()) finally: os.unlink(fn) def test_create_unix_server_ssl_timeout_with_plain_sock(self): coro = self.loop.create_unix_server(lambda: None, path='spam', ssl_handshake_timeout=1) with self.assertRaisesRegex( ValueError, 'ssl_handshake_timeout is only meaningful with ssl'): self.loop.run_until_complete(coro) def test_create_unix_connection_path_inetsock(self): sock = socket.socket() with sock: coro = self.loop.create_unix_connection(lambda: None, sock=sock) with self.assertRaisesRegex(ValueError, 'A UNIX Domain Stream.*was expected'): self.loop.run_until_complete(coro) @mock.patch('asyncio.unix_events.socket') def test_create_unix_server_bind_error(self, m_socket): # Ensure that the socket is closed on any bind error sock = mock.Mock() m_socket.socket.return_value = sock sock.bind.side_effect = OSError coro = self.loop.create_unix_server(lambda: None, path="/test") with self.assertRaises(OSError): self.loop.run_until_complete(coro) self.assertTrue(sock.close.called) sock.bind.side_effect = MemoryError coro = self.loop.create_unix_server(lambda: None, path="/test") with self.assertRaises(MemoryError): self.loop.run_until_complete(coro) self.assertTrue(sock.close.called) def test_create_unix_connection_path_sock(self): coro = self.loop.create_unix_connection( lambda: None, os.devnull, sock=object()) with self.assertRaisesRegex(ValueError, 'path and sock can not be'): self.loop.run_until_complete(coro) def test_create_unix_connection_nopath_nosock(self): coro = self.loop.create_unix_connection( lambda: None, None) with self.assertRaisesRegex(ValueError, 'no path and sock were specified'): self.loop.run_until_complete(coro) def test_create_unix_connection_nossl_serverhost(self): coro = self.loop.create_unix_connection( lambda: None, os.devnull, server_hostname='spam') with self.assertRaisesRegex(ValueError, 'server_hostname is only meaningful'): self.loop.run_until_complete(coro) def test_create_unix_connection_ssl_noserverhost(self): coro = self.loop.create_unix_connection( lambda: None, os.devnull, ssl=True) with self.assertRaisesRegex( ValueError, 'you have to pass server_hostname when using ssl'): self.loop.run_until_complete(coro) def test_create_unix_connection_ssl_timeout_with_plain_sock(self): coro = self.loop.create_unix_connection(lambda: None, path='spam', ssl_handshake_timeout=1) with self.assertRaisesRegex( ValueError, 'ssl_handshake_timeout is only meaningful with ssl'): self.loop.run_until_complete(coro) @unittest.skipUnless(hasattr(os, 'sendfile'), 'sendfile is not supported') class SelectorEventLoopUnixSockSendfileTests(test_utils.TestCase): DATA = b"12345abcde" * 16 * 1024 # 160 KiB class MyProto(asyncio.Protocol): def __init__(self, loop): self.started = False self.closed = False self.data = bytearray() self.fut = loop.create_future() self.transport = None self._ready = loop.create_future() def connection_made(self, transport): self.started = True self.transport = transport self._ready.set_result(None) def data_received(self, data): self.data.extend(data) def connection_lost(self, exc): self.closed = True self.fut.set_result(None) async def wait_closed(self): await self.fut @classmethod def setUpClass(cls): with open(support.TESTFN, 'wb') as fp: fp.write(cls.DATA) super().setUpClass() @classmethod def tearDownClass(cls): support.unlink(support.TESTFN) super().tearDownClass() def setUp(self): self.loop = asyncio.new_event_loop() self.set_event_loop(self.loop) self.file = open(support.TESTFN, 'rb') self.addCleanup(self.file.close) super().setUp() def make_socket(self, cleanup=True): sock = socket.socket(socket.AF_INET, socket.SOCK_STREAM) sock.setblocking(False) sock.setsockopt(socket.SOL_SOCKET, socket.SO_SNDBUF, 1024) sock.setsockopt(socket.SOL_SOCKET, socket.SO_RCVBUF, 1024) if cleanup: self.addCleanup(sock.close) return sock def run_loop(self, coro): return self.loop.run_until_complete(coro) def prepare(self): sock = self.make_socket() proto = self.MyProto(self.loop) port = support.find_unused_port() srv_sock = self.make_socket(cleanup=False) srv_sock.bind((support.HOST, port)) server = self.run_loop(self.loop.create_server( lambda: proto, sock=srv_sock)) self.run_loop(self.loop.sock_connect(sock, (support.HOST, port))) self.run_loop(proto._ready) def cleanup(): proto.transport.close() self.run_loop(proto.wait_closed()) server.close() self.run_loop(server.wait_closed()) self.addCleanup(cleanup) return sock, proto def test_sock_sendfile_not_available(self): sock, proto = self.prepare() with mock.patch('asyncio.unix_events.os', spec=[]): with self.assertRaisesRegex(asyncio.SendfileNotAvailableError, "os[.]sendfile[(][)] is not available"): self.run_loop(self.loop._sock_sendfile_native(sock, self.file, 0, None)) self.assertEqual(self.file.tell(), 0) def test_sock_sendfile_not_a_file(self): sock, proto = self.prepare() f = object() with self.assertRaisesRegex(asyncio.SendfileNotAvailableError, "not a regular file"): self.run_loop(self.loop._sock_sendfile_native(sock, f, 0, None)) self.assertEqual(self.file.tell(), 0) def test_sock_sendfile_iobuffer(self): sock, proto = self.prepare() f = io.BytesIO() with self.assertRaisesRegex(asyncio.SendfileNotAvailableError, "not a regular file"): self.run_loop(self.loop._sock_sendfile_native(sock, f, 0, None)) self.assertEqual(self.file.tell(), 0) def test_sock_sendfile_not_regular_file(self): sock, proto = self.prepare() f = mock.Mock() f.fileno.return_value = -1 with self.assertRaisesRegex(asyncio.SendfileNotAvailableError, "not a regular file"): self.run_loop(self.loop._sock_sendfile_native(sock, f, 0, None)) self.assertEqual(self.file.tell(), 0) def test_sock_sendfile_cancel1(self): sock, proto = self.prepare() fut = self.loop.create_future() fileno = self.file.fileno() self.loop._sock_sendfile_native_impl(fut, None, sock, fileno, 0, None, len(self.DATA), 0) fut.cancel() with contextlib.suppress(asyncio.CancelledError): self.run_loop(fut) with self.assertRaises(KeyError): self.loop._selector.get_key(sock) def test_sock_sendfile_cancel2(self): sock, proto = self.prepare() fut = self.loop.create_future() fileno = self.file.fileno() self.loop._sock_sendfile_native_impl(fut, None, sock, fileno, 0, None, len(self.DATA), 0) fut.cancel() self.loop._sock_sendfile_native_impl(fut, sock.fileno(), sock, fileno, 0, None, len(self.DATA), 0) with self.assertRaises(KeyError): self.loop._selector.get_key(sock) def test_sock_sendfile_blocking_error(self): sock, proto = self.prepare() fileno = self.file.fileno() fut = mock.Mock() fut.cancelled.return_value = False with mock.patch('os.sendfile', side_effect=BlockingIOError()): self.loop._sock_sendfile_native_impl(fut, None, sock, fileno, 0, None, len(self.DATA), 0) key = self.loop._selector.get_key(sock) self.assertIsNotNone(key) fut.add_done_callback.assert_called_once_with(mock.ANY) def test_sock_sendfile_os_error_first_call(self): sock, proto = self.prepare() fileno = self.file.fileno() fut = self.loop.create_future() with mock.patch('os.sendfile', side_effect=OSError()): self.loop._sock_sendfile_native_impl(fut, None, sock, fileno, 0, None, len(self.DATA), 0) with self.assertRaises(KeyError): self.loop._selector.get_key(sock) exc = fut.exception() self.assertIsInstance(exc, asyncio.SendfileNotAvailableError) self.assertEqual(0, self.file.tell()) def test_sock_sendfile_os_error_next_call(self): sock, proto = self.prepare() fileno = self.file.fileno() fut = self.loop.create_future() err = OSError() with mock.patch('os.sendfile', side_effect=err): self.loop._sock_sendfile_native_impl(fut, sock.fileno(), sock, fileno, 1000, None, len(self.DATA), 1000) with self.assertRaises(KeyError): self.loop._selector.get_key(sock) exc = fut.exception() self.assertIs(exc, err) self.assertEqual(1000, self.file.tell()) def test_sock_sendfile_exception(self): sock, proto = self.prepare() fileno = self.file.fileno() fut = self.loop.create_future() err = asyncio.SendfileNotAvailableError() with mock.patch('os.sendfile', side_effect=err): self.loop._sock_sendfile_native_impl(fut, sock.fileno(), sock, fileno, 1000, None, len(self.DATA), 1000) with self.assertRaises(KeyError): self.loop._selector.get_key(sock) exc = fut.exception() self.assertIs(exc, err) self.assertEqual(1000, self.file.tell()) class UnixReadPipeTransportTests(test_utils.TestCase): def setUp(self): super().setUp() self.loop = self.new_test_loop() self.protocol = test_utils.make_test_protocol(asyncio.Protocol) self.pipe = mock.Mock(spec_set=io.RawIOBase) self.pipe.fileno.return_value = 5 blocking_patcher = mock.patch('os.set_blocking') blocking_patcher.start() self.addCleanup(blocking_patcher.stop) fstat_patcher = mock.patch('os.fstat') m_fstat = fstat_patcher.start() st = mock.Mock() st.st_mode = stat.S_IFIFO m_fstat.return_value = st self.addCleanup(fstat_patcher.stop) def read_pipe_transport(self, waiter=None): transport = unix_events._UnixReadPipeTransport(self.loop, self.pipe, self.protocol, waiter=waiter) self.addCleanup(close_pipe_transport, transport) return transport def test_ctor(self): waiter = asyncio.Future(loop=self.loop) tr = self.read_pipe_transport(waiter=waiter) self.loop.run_until_complete(waiter) self.protocol.connection_made.assert_called_with(tr) self.loop.assert_reader(5, tr._read_ready) self.assertIsNone(waiter.result()) @mock.patch('os.read') def test__read_ready(self, m_read): tr = self.read_pipe_transport() m_read.return_value = b'data' tr._read_ready() m_read.assert_called_with(5, tr.max_size) self.protocol.data_received.assert_called_with(b'data') @mock.patch('os.read') def test__read_ready_eof(self, m_read): tr = self.read_pipe_transport() m_read.return_value = b'' tr._read_ready() m_read.assert_called_with(5, tr.max_size) self.assertFalse(self.loop.readers) test_utils.run_briefly(self.loop) self.protocol.eof_received.assert_called_with() self.protocol.connection_lost.assert_called_with(None) @mock.patch('os.read') def test__read_ready_blocked(self, m_read): tr = self.read_pipe_transport() m_read.side_effect = BlockingIOError tr._read_ready() m_read.assert_called_with(5, tr.max_size) test_utils.run_briefly(self.loop) self.assertFalse(self.protocol.data_received.called) @mock.patch('asyncio.log.logger.error') @mock.patch('os.read') def test__read_ready_error(self, m_read, m_logexc): tr = self.read_pipe_transport() err = OSError() m_read.side_effect = err tr._close = mock.Mock() tr._read_ready() m_read.assert_called_with(5, tr.max_size) tr._close.assert_called_with(err) m_logexc.assert_called_with( test_utils.MockPattern( 'Fatal read error on pipe transport' '\nprotocol:.*\ntransport:.*'), exc_info=(OSError, MOCK_ANY, MOCK_ANY)) @mock.patch('os.read') def test_pause_reading(self, m_read): tr = self.read_pipe_transport() m = mock.Mock() self.loop.add_reader(5, m) tr.pause_reading() self.assertFalse(self.loop.readers) @mock.patch('os.read') def test_resume_reading(self, m_read): tr = self.read_pipe_transport() tr.resume_reading() self.loop.assert_reader(5, tr._read_ready) @mock.patch('os.read') def test_close(self, m_read): tr = self.read_pipe_transport() tr._close = mock.Mock() tr.close() tr._close.assert_called_with(None) @mock.patch('os.read') def test_close_already_closing(self, m_read): tr = self.read_pipe_transport() tr._closing = True tr._close = mock.Mock() tr.close() self.assertFalse(tr._close.called) @mock.patch('os.read') def test__close(self, m_read): tr = self.read_pipe_transport() err = object() tr._close(err) self.assertTrue(tr.is_closing()) self.assertFalse(self.loop.readers) test_utils.run_briefly(self.loop) self.protocol.connection_lost.assert_called_with(err) def test__call_connection_lost(self): tr = self.read_pipe_transport() self.assertIsNotNone(tr._protocol) self.assertIsNotNone(tr._loop) err = None tr._call_connection_lost(err) self.protocol.connection_lost.assert_called_with(err) self.pipe.close.assert_called_with() self.assertIsNone(tr._protocol) self.assertIsNone(tr._loop) def test__call_connection_lost_with_err(self): tr = self.read_pipe_transport() self.assertIsNotNone(tr._protocol) self.assertIsNotNone(tr._loop) err = OSError() tr._call_connection_lost(err) self.protocol.connection_lost.assert_called_with(err) self.pipe.close.assert_called_with() self.assertIsNone(tr._protocol) self.assertIsNone(tr._loop) class UnixWritePipeTransportTests(test_utils.TestCase): def setUp(self): super().setUp() self.loop = self.new_test_loop() self.protocol = test_utils.make_test_protocol(asyncio.BaseProtocol) self.pipe = mock.Mock(spec_set=io.RawIOBase) self.pipe.fileno.return_value = 5 blocking_patcher = mock.patch('os.set_blocking') blocking_patcher.start() self.addCleanup(blocking_patcher.stop) fstat_patcher = mock.patch('os.fstat') m_fstat = fstat_patcher.start() st = mock.Mock() st.st_mode = stat.S_IFSOCK m_fstat.return_value = st self.addCleanup(fstat_patcher.stop) def write_pipe_transport(self, waiter=None): transport = unix_events._UnixWritePipeTransport(self.loop, self.pipe, self.protocol, waiter=waiter) self.addCleanup(close_pipe_transport, transport) return transport def test_ctor(self): waiter = asyncio.Future(loop=self.loop) tr = self.write_pipe_transport(waiter=waiter) self.loop.run_until_complete(waiter) self.protocol.connection_made.assert_called_with(tr) self.loop.assert_reader(5, tr._read_ready) self.assertEqual(None, waiter.result()) def test_can_write_eof(self): tr = self.write_pipe_transport() self.assertTrue(tr.can_write_eof()) @mock.patch('os.write') def test_write(self, m_write): tr = self.write_pipe_transport() m_write.return_value = 4 tr.write(b'data') m_write.assert_called_with(5, b'data') self.assertFalse(self.loop.writers) self.assertEqual(bytearray(), tr._buffer) @mock.patch('os.write') def test_write_no_data(self, m_write): tr = self.write_pipe_transport() tr.write(b'') self.assertFalse(m_write.called) self.assertFalse(self.loop.writers) self.assertEqual(bytearray(b''), tr._buffer) @mock.patch('os.write') def test_write_partial(self, m_write): tr = self.write_pipe_transport() m_write.return_value = 2 tr.write(b'data') self.loop.assert_writer(5, tr._write_ready) self.assertEqual(bytearray(b'ta'), tr._buffer) @mock.patch('os.write') def test_write_buffer(self, m_write): tr = self.write_pipe_transport() self.loop.add_writer(5, tr._write_ready) tr._buffer = bytearray(b'previous') tr.write(b'data') self.assertFalse(m_write.called) self.loop.assert_writer(5, tr._write_ready) self.assertEqual(bytearray(b'previousdata'), tr._buffer) @mock.patch('os.write') def test_write_again(self, m_write): tr = self.write_pipe_transport() m_write.side_effect = BlockingIOError() tr.write(b'data') m_write.assert_called_with(5, bytearray(b'data')) self.loop.assert_writer(5, tr._write_ready) self.assertEqual(bytearray(b'data'), tr._buffer) @mock.patch('asyncio.unix_events.logger') @mock.patch('os.write') def test_write_err(self, m_write, m_log): tr = self.write_pipe_transport() err = OSError() m_write.side_effect = err tr._fatal_error = mock.Mock() tr.write(b'data') m_write.assert_called_with(5, b'data') self.assertFalse(self.loop.writers) self.assertEqual(bytearray(), tr._buffer) tr._fatal_error.assert_called_with( err, 'Fatal write error on pipe transport') self.assertEqual(1, tr._conn_lost) tr.write(b'data') self.assertEqual(2, tr._conn_lost) tr.write(b'data') tr.write(b'data') tr.write(b'data') tr.write(b'data') # This is a bit overspecified. :-( m_log.warning.assert_called_with( 'pipe closed by peer or os.write(pipe, data) raised exception.') tr.close() @mock.patch('os.write') def test_write_close(self, m_write): tr = self.write_pipe_transport() tr._read_ready() # pipe was closed by peer tr.write(b'data') self.assertEqual(tr._conn_lost, 1) tr.write(b'data') self.assertEqual(tr._conn_lost, 2) def test__read_ready(self): tr = self.write_pipe_transport() tr._read_ready() self.assertFalse(self.loop.readers) self.assertFalse(self.loop.writers) self.assertTrue(tr.is_closing()) test_utils.run_briefly(self.loop) self.protocol.connection_lost.assert_called_with(None) @mock.patch('os.write') def test__write_ready(self, m_write): tr = self.write_pipe_transport() self.loop.add_writer(5, tr._write_ready) tr._buffer = bytearray(b'data') m_write.return_value = 4 tr._write_ready() self.assertFalse(self.loop.writers) self.assertEqual(bytearray(), tr._buffer) @mock.patch('os.write') def test__write_ready_partial(self, m_write): tr = self.write_pipe_transport() self.loop.add_writer(5, tr._write_ready) tr._buffer = bytearray(b'data') m_write.return_value = 3 tr._write_ready() self.loop.assert_writer(5, tr._write_ready) self.assertEqual(bytearray(b'a'), tr._buffer) @mock.patch('os.write') def test__write_ready_again(self, m_write): tr = self.write_pipe_transport() self.loop.add_writer(5, tr._write_ready) tr._buffer = bytearray(b'data') m_write.side_effect = BlockingIOError() tr._write_ready() m_write.assert_called_with(5, bytearray(b'data')) self.loop.assert_writer(5, tr._write_ready) self.assertEqual(bytearray(b'data'), tr._buffer) @mock.patch('os.write') def test__write_ready_empty(self, m_write): tr = self.write_pipe_transport() self.loop.add_writer(5, tr._write_ready) tr._buffer = bytearray(b'data') m_write.return_value = 0 tr._write_ready() m_write.assert_called_with(5, bytearray(b'data')) self.loop.assert_writer(5, tr._write_ready) self.assertEqual(bytearray(b'data'), tr._buffer) @mock.patch('asyncio.log.logger.error') @mock.patch('os.write') def test__write_ready_err(self, m_write, m_logexc): tr = self.write_pipe_transport() self.loop.add_writer(5, tr._write_ready) tr._buffer = bytearray(b'data') m_write.side_effect = err = OSError() tr._write_ready() self.assertFalse(self.loop.writers) self.assertFalse(self.loop.readers) self.assertEqual(bytearray(), tr._buffer) self.assertTrue(tr.is_closing()) m_logexc.assert_not_called() self.assertEqual(1, tr._conn_lost) test_utils.run_briefly(self.loop) self.protocol.connection_lost.assert_called_with(err) @mock.patch('os.write') def test__write_ready_closing(self, m_write): tr = self.write_pipe_transport() self.loop.add_writer(5, tr._write_ready) tr._closing = True tr._buffer = bytearray(b'data') m_write.return_value = 4 tr._write_ready() self.assertFalse(self.loop.writers) self.assertFalse(self.loop.readers) self.assertEqual(bytearray(), tr._buffer) self.protocol.connection_lost.assert_called_with(None) self.pipe.close.assert_called_with() @mock.patch('os.write') def test_abort(self, m_write): tr = self.write_pipe_transport() self.loop.add_writer(5, tr._write_ready) self.loop.add_reader(5, tr._read_ready) tr._buffer = [b'da', b'ta'] tr.abort() self.assertFalse(m_write.called) self.assertFalse(self.loop.readers) self.assertFalse(self.loop.writers) self.assertEqual([], tr._buffer) self.assertTrue(tr.is_closing()) test_utils.run_briefly(self.loop) self.protocol.connection_lost.assert_called_with(None) def test__call_connection_lost(self): tr = self.write_pipe_transport() self.assertIsNotNone(tr._protocol) self.assertIsNotNone(tr._loop) err = None tr._call_connection_lost(err) self.protocol.connection_lost.assert_called_with(err) self.pipe.close.assert_called_with() self.assertIsNone(tr._protocol) self.assertIsNone(tr._loop) def test__call_connection_lost_with_err(self): tr = self.write_pipe_transport() self.assertIsNotNone(tr._protocol) self.assertIsNotNone(tr._loop) err = OSError() tr._call_connection_lost(err) self.protocol.connection_lost.assert_called_with(err) self.pipe.close.assert_called_with() self.assertIsNone(tr._protocol) self.assertIsNone(tr._loop) def test_close(self): tr = self.write_pipe_transport() tr.write_eof = mock.Mock() tr.close() tr.write_eof.assert_called_with() # closing the transport twice must not fail tr.close() def test_close_closing(self): tr = self.write_pipe_transport() tr.write_eof = mock.Mock() tr._closing = True tr.close() self.assertFalse(tr.write_eof.called) def test_write_eof(self): tr = self.write_pipe_transport() tr.write_eof() self.assertTrue(tr.is_closing()) self.assertFalse(self.loop.readers) test_utils.run_briefly(self.loop) self.protocol.connection_lost.assert_called_with(None) def test_write_eof_pending(self): tr = self.write_pipe_transport() tr._buffer = [b'data'] tr.write_eof() self.assertTrue(tr.is_closing()) self.assertFalse(self.protocol.connection_lost.called) class AbstractChildWatcherTests(unittest.TestCase): def test_not_implemented(self): f = mock.Mock() watcher = asyncio.AbstractChildWatcher() self.assertRaises( NotImplementedError, watcher.add_child_handler, f, f) self.assertRaises( NotImplementedError, watcher.remove_child_handler, f) self.assertRaises( NotImplementedError, watcher.attach_loop, f) self.assertRaises( NotImplementedError, watcher.close) self.assertRaises( NotImplementedError, watcher.is_active) self.assertRaises( NotImplementedError, watcher.__enter__) self.assertRaises( NotImplementedError, watcher.__exit__, f, f, f) class BaseChildWatcherTests(unittest.TestCase): def test_not_implemented(self): f = mock.Mock() watcher = unix_events.BaseChildWatcher() self.assertRaises( NotImplementedError, watcher._do_waitpid, f) WaitPidMocks = collections.namedtuple("WaitPidMocks", ("waitpid", "WIFEXITED", "WIFSIGNALED", "WEXITSTATUS", "WTERMSIG", )) class ChildWatcherTestsMixin: ignore_warnings = mock.patch.object(log.logger, "warning") def setUp(self): super().setUp() self.loop = self.new_test_loop() self.running = False self.zombies = {} with mock.patch.object( self.loop, "add_signal_handler") as self.m_add_signal_handler: self.watcher = self.create_watcher() self.watcher.attach_loop(self.loop) def waitpid(self, pid, flags): if isinstance(self.watcher, asyncio.SafeChildWatcher) or pid != -1: self.assertGreater(pid, 0) try: if pid < 0: return self.zombies.popitem() else: return pid, self.zombies.pop(pid) except KeyError: pass if self.running: return 0, 0 else: raise ChildProcessError() def add_zombie(self, pid, returncode): self.zombies[pid] = returncode + 32768 def WIFEXITED(self, status): return status >= 32768 def WIFSIGNALED(self, status): return 32700 < status < 32768 def WEXITSTATUS(self, status): self.assertTrue(self.WIFEXITED(status)) return status - 32768 def WTERMSIG(self, status): self.assertTrue(self.WIFSIGNALED(status)) return 32768 - status def test_create_watcher(self): self.m_add_signal_handler.assert_called_once_with( signal.SIGCHLD, self.watcher._sig_chld) def waitpid_mocks(func): def wrapped_func(self): def patch(target, wrapper): return mock.patch(target, wraps=wrapper, new_callable=mock.Mock) with patch('os.WTERMSIG', self.WTERMSIG) as m_WTERMSIG, \ patch('os.WEXITSTATUS', self.WEXITSTATUS) as m_WEXITSTATUS, \ patch('os.WIFSIGNALED', self.WIFSIGNALED) as m_WIFSIGNALED, \ patch('os.WIFEXITED', self.WIFEXITED) as m_WIFEXITED, \ patch('os.waitpid', self.waitpid) as m_waitpid: func(self, WaitPidMocks(m_waitpid, m_WIFEXITED, m_WIFSIGNALED, m_WEXITSTATUS, m_WTERMSIG, )) return wrapped_func @waitpid_mocks def test_sigchld(self, m): # register a child callback = mock.Mock() with self.watcher: self.running = True self.watcher.add_child_handler(42, callback, 9, 10, 14) self.assertFalse(callback.called) self.assertFalse(m.WIFEXITED.called) self.assertFalse(m.WIFSIGNALED.called) self.assertFalse(m.WEXITSTATUS.called) self.assertFalse(m.WTERMSIG.called) # child is running self.watcher._sig_chld() self.assertFalse(callback.called) self.assertFalse(m.WIFEXITED.called) self.assertFalse(m.WIFSIGNALED.called) self.assertFalse(m.WEXITSTATUS.called) self.assertFalse(m.WTERMSIG.called) # child terminates (returncode 12) self.running = False self.add_zombie(42, 12) self.watcher._sig_chld() self.assertTrue(m.WIFEXITED.called) self.assertTrue(m.WEXITSTATUS.called) self.assertFalse(m.WTERMSIG.called) callback.assert_called_once_with(42, 12, 9, 10, 14) m.WIFSIGNALED.reset_mock() m.WIFEXITED.reset_mock() m.WEXITSTATUS.reset_mock() callback.reset_mock() # ensure that the child is effectively reaped self.add_zombie(42, 13) with self.ignore_warnings: self.watcher._sig_chld() self.assertFalse(callback.called) self.assertFalse(m.WTERMSIG.called) m.WIFSIGNALED.reset_mock() m.WIFEXITED.reset_mock() m.WEXITSTATUS.reset_mock() # sigchld called again self.zombies.clear() self.watcher._sig_chld() self.assertFalse(callback.called) self.assertFalse(m.WIFEXITED.called) self.assertFalse(m.WIFSIGNALED.called) self.assertFalse(m.WEXITSTATUS.called) self.assertFalse(m.WTERMSIG.called) @waitpid_mocks def test_sigchld_two_children(self, m): callback1 = mock.Mock() callback2 = mock.Mock() # register child 1 with self.watcher: self.running = True self.watcher.add_child_handler(43, callback1, 7, 8) self.assertFalse(callback1.called) self.assertFalse(callback2.called) self.assertFalse(m.WIFEXITED.called) self.assertFalse(m.WIFSIGNALED.called) self.assertFalse(m.WEXITSTATUS.called) self.assertFalse(m.WTERMSIG.called) # register child 2 with self.watcher: self.watcher.add_child_handler(44, callback2, 147, 18) self.assertFalse(callback1.called) self.assertFalse(callback2.called) self.assertFalse(m.WIFEXITED.called) self.assertFalse(m.WIFSIGNALED.called) self.assertFalse(m.WEXITSTATUS.called) self.assertFalse(m.WTERMSIG.called) # children are running self.watcher._sig_chld() self.assertFalse(callback1.called) self.assertFalse(callback2.called) self.assertFalse(m.WIFEXITED.called) self.assertFalse(m.WIFSIGNALED.called) self.assertFalse(m.WEXITSTATUS.called) self.assertFalse(m.WTERMSIG.called) # child 1 terminates (signal 3) self.add_zombie(43, -3) self.watcher._sig_chld() callback1.assert_called_once_with(43, -3, 7, 8) self.assertFalse(callback2.called) self.assertTrue(m.WIFSIGNALED.called) self.assertFalse(m.WEXITSTATUS.called) self.assertTrue(m.WTERMSIG.called) m.WIFSIGNALED.reset_mock() m.WIFEXITED.reset_mock() m.WTERMSIG.reset_mock() callback1.reset_mock() # child 2 still running self.watcher._sig_chld() self.assertFalse(callback1.called) self.assertFalse(callback2.called) self.assertFalse(m.WIFEXITED.called) self.assertFalse(m.WIFSIGNALED.called) self.assertFalse(m.WEXITSTATUS.called) self.assertFalse(m.WTERMSIG.called) # child 2 terminates (code 108) self.add_zombie(44, 108) self.running = False self.watcher._sig_chld() callback2.assert_called_once_with(44, 108, 147, 18) self.assertFalse(callback1.called) self.assertTrue(m.WIFEXITED.called) self.assertTrue(m.WEXITSTATUS.called) self.assertFalse(m.WTERMSIG.called) m.WIFSIGNALED.reset_mock() m.WIFEXITED.reset_mock() m.WEXITSTATUS.reset_mock() callback2.reset_mock() # ensure that the children are effectively reaped self.add_zombie(43, 14) self.add_zombie(44, 15) with self.ignore_warnings: self.watcher._sig_chld() self.assertFalse(callback1.called) self.assertFalse(callback2.called) self.assertFalse(m.WTERMSIG.called) m.WIFSIGNALED.reset_mock() m.WIFEXITED.reset_mock() m.WEXITSTATUS.reset_mock() # sigchld called again self.zombies.clear() self.watcher._sig_chld() self.assertFalse(callback1.called) self.assertFalse(callback2.called) self.assertFalse(m.WIFEXITED.called) self.assertFalse(m.WIFSIGNALED.called) self.assertFalse(m.WEXITSTATUS.called) self.assertFalse(m.WTERMSIG.called) @waitpid_mocks def test_sigchld_two_children_terminating_together(self, m): callback1 = mock.Mock() callback2 = mock.Mock() # register child 1 with self.watcher: self.running = True self.watcher.add_child_handler(45, callback1, 17, 8) self.assertFalse(callback1.called) self.assertFalse(callback2.called) self.assertFalse(m.WIFEXITED.called) self.assertFalse(m.WIFSIGNALED.called) self.assertFalse(m.WEXITSTATUS.called) self.assertFalse(m.WTERMSIG.called) # register child 2 with self.watcher: self.watcher.add_child_handler(46, callback2, 1147, 18) self.assertFalse(callback1.called) self.assertFalse(callback2.called) self.assertFalse(m.WIFEXITED.called) self.assertFalse(m.WIFSIGNALED.called) self.assertFalse(m.WEXITSTATUS.called) self.assertFalse(m.WTERMSIG.called) # children are running self.watcher._sig_chld() self.assertFalse(callback1.called) self.assertFalse(callback2.called) self.assertFalse(m.WIFEXITED.called) self.assertFalse(m.WIFSIGNALED.called) self.assertFalse(m.WEXITSTATUS.called) self.assertFalse(m.WTERMSIG.called) # child 1 terminates (code 78) # child 2 terminates (signal 5) self.add_zombie(45, 78) self.add_zombie(46, -5) self.running = False self.watcher._sig_chld() callback1.assert_called_once_with(45, 78, 17, 8) callback2.assert_called_once_with(46, -5, 1147, 18) self.assertTrue(m.WIFSIGNALED.called) self.assertTrue(m.WIFEXITED.called) self.assertTrue(m.WEXITSTATUS.called) self.assertTrue(m.WTERMSIG.called) m.WIFSIGNALED.reset_mock() m.WIFEXITED.reset_mock() m.WTERMSIG.reset_mock() m.WEXITSTATUS.reset_mock() callback1.reset_mock() callback2.reset_mock() # ensure that the children are effectively reaped self.add_zombie(45, 14) self.add_zombie(46, 15) with self.ignore_warnings: self.watcher._sig_chld() self.assertFalse(callback1.called) self.assertFalse(callback2.called) self.assertFalse(m.WTERMSIG.called) @waitpid_mocks def test_sigchld_race_condition(self, m): # register a child callback = mock.Mock() with self.watcher: # child terminates before being registered self.add_zombie(50, 4) self.watcher._sig_chld() self.watcher.add_child_handler(50, callback, 1, 12) callback.assert_called_once_with(50, 4, 1, 12) callback.reset_mock() # ensure that the child is effectively reaped self.add_zombie(50, -1) with self.ignore_warnings: self.watcher._sig_chld() self.assertFalse(callback.called) @waitpid_mocks def test_sigchld_replace_handler(self, m): callback1 = mock.Mock() callback2 = mock.Mock() # register a child with self.watcher: self.running = True self.watcher.add_child_handler(51, callback1, 19) self.assertFalse(callback1.called) self.assertFalse(callback2.called) self.assertFalse(m.WIFEXITED.called) self.assertFalse(m.WIFSIGNALED.called) self.assertFalse(m.WEXITSTATUS.called) self.assertFalse(m.WTERMSIG.called) # register the same child again with self.watcher: self.watcher.add_child_handler(51, callback2, 21) self.assertFalse(callback1.called) self.assertFalse(callback2.called) self.assertFalse(m.WIFEXITED.called) self.assertFalse(m.WIFSIGNALED.called) self.assertFalse(m.WEXITSTATUS.called) self.assertFalse(m.WTERMSIG.called) # child terminates (signal 8) self.running = False self.add_zombie(51, -8) self.watcher._sig_chld() callback2.assert_called_once_with(51, -8, 21) self.assertFalse(callback1.called) self.assertTrue(m.WIFSIGNALED.called) self.assertFalse(m.WEXITSTATUS.called) self.assertTrue(m.WTERMSIG.called) m.WIFSIGNALED.reset_mock() m.WIFEXITED.reset_mock() m.WTERMSIG.reset_mock() callback2.reset_mock() # ensure that the child is effectively reaped self.add_zombie(51, 13) with self.ignore_warnings: self.watcher._sig_chld() self.assertFalse(callback1.called) self.assertFalse(callback2.called) self.assertFalse(m.WTERMSIG.called) @waitpid_mocks def test_sigchld_remove_handler(self, m): callback = mock.Mock() # register a child with self.watcher: self.running = True self.watcher.add_child_handler(52, callback, 1984) self.assertFalse(callback.called) self.assertFalse(m.WIFEXITED.called) self.assertFalse(m.WIFSIGNALED.called) self.assertFalse(m.WEXITSTATUS.called) self.assertFalse(m.WTERMSIG.called) # unregister the child self.watcher.remove_child_handler(52) self.assertFalse(callback.called) self.assertFalse(m.WIFEXITED.called) self.assertFalse(m.WIFSIGNALED.called) self.assertFalse(m.WEXITSTATUS.called) self.assertFalse(m.WTERMSIG.called) # child terminates (code 99) self.running = False self.add_zombie(52, 99) with self.ignore_warnings: self.watcher._sig_chld() self.assertFalse(callback.called) @waitpid_mocks def test_sigchld_unknown_status(self, m): callback = mock.Mock() # register a child with self.watcher: self.running = True self.watcher.add_child_handler(53, callback, -19) self.assertFalse(callback.called) self.assertFalse(m.WIFEXITED.called) self.assertFalse(m.WIFSIGNALED.called) self.assertFalse(m.WEXITSTATUS.called) self.assertFalse(m.WTERMSIG.called) # terminate with unknown status self.zombies[53] = 1178 self.running = False self.watcher._sig_chld() callback.assert_called_once_with(53, 1178, -19) self.assertTrue(m.WIFEXITED.called) self.assertTrue(m.WIFSIGNALED.called) self.assertFalse(m.WEXITSTATUS.called) self.assertFalse(m.WTERMSIG.called) callback.reset_mock() m.WIFEXITED.reset_mock() m.WIFSIGNALED.reset_mock() # ensure that the child is effectively reaped self.add_zombie(53, 101) with self.ignore_warnings: self.watcher._sig_chld() self.assertFalse(callback.called) @waitpid_mocks def test_remove_child_handler(self, m): callback1 = mock.Mock() callback2 = mock.Mock() callback3 = mock.Mock() # register children with self.watcher: self.running = True self.watcher.add_child_handler(54, callback1, 1) self.watcher.add_child_handler(55, callback2, 2) self.watcher.add_child_handler(56, callback3, 3) # remove child handler 1 self.assertTrue(self.watcher.remove_child_handler(54)) # remove child handler 2 multiple times self.assertTrue(self.watcher.remove_child_handler(55)) self.assertFalse(self.watcher.remove_child_handler(55)) self.assertFalse(self.watcher.remove_child_handler(55)) # all children terminate self.add_zombie(54, 0) self.add_zombie(55, 1) self.add_zombie(56, 2) self.running = False with self.ignore_warnings: self.watcher._sig_chld() self.assertFalse(callback1.called) self.assertFalse(callback2.called) callback3.assert_called_once_with(56, 2, 3) @waitpid_mocks def test_sigchld_unhandled_exception(self, m): callback = mock.Mock() # register a child with self.watcher: self.running = True self.watcher.add_child_handler(57, callback) # raise an exception m.waitpid.side_effect = ValueError with mock.patch.object(log.logger, 'error') as m_error: self.assertEqual(self.watcher._sig_chld(), None) self.assertTrue(m_error.called) @waitpid_mocks def test_sigchld_child_reaped_elsewhere(self, m): # register a child callback = mock.Mock() with self.watcher: self.running = True self.watcher.add_child_handler(58, callback) self.assertFalse(callback.called) self.assertFalse(m.WIFEXITED.called) self.assertFalse(m.WIFSIGNALED.called) self.assertFalse(m.WEXITSTATUS.called) self.assertFalse(m.WTERMSIG.called) # child terminates self.running = False self.add_zombie(58, 4) # waitpid is called elsewhere os.waitpid(58, os.WNOHANG) m.waitpid.reset_mock() # sigchld with self.ignore_warnings: self.watcher._sig_chld() if isinstance(self.watcher, asyncio.FastChildWatcher): # here the FastChildWatche enters a deadlock # (there is no way to prevent it) self.assertFalse(callback.called) else: callback.assert_called_once_with(58, 255) @waitpid_mocks def test_sigchld_unknown_pid_during_registration(self, m): # register two children callback1 = mock.Mock() callback2 = mock.Mock() with self.ignore_warnings, self.watcher: self.running = True # child 1 terminates self.add_zombie(591, 7) # an unknown child terminates self.add_zombie(593, 17) self.watcher._sig_chld() self.watcher.add_child_handler(591, callback1) self.watcher.add_child_handler(592, callback2) callback1.assert_called_once_with(591, 7) self.assertFalse(callback2.called) @waitpid_mocks def test_set_loop(self, m): # register a child callback = mock.Mock() with self.watcher: self.running = True self.watcher.add_child_handler(60, callback) # attach a new loop old_loop = self.loop self.loop = self.new_test_loop() patch = mock.patch.object with patch(old_loop, "remove_signal_handler") as m_old_remove, \ patch(self.loop, "add_signal_handler") as m_new_add: self.watcher.attach_loop(self.loop) m_old_remove.assert_called_once_with( signal.SIGCHLD) m_new_add.assert_called_once_with( signal.SIGCHLD, self.watcher._sig_chld) # child terminates self.running = False self.add_zombie(60, 9) self.watcher._sig_chld() callback.assert_called_once_with(60, 9) @waitpid_mocks def test_set_loop_race_condition(self, m): # register 3 children callback1 = mock.Mock() callback2 = mock.Mock() callback3 = mock.Mock() with self.watcher: self.running = True self.watcher.add_child_handler(61, callback1) self.watcher.add_child_handler(62, callback2) self.watcher.add_child_handler(622, callback3) # detach the loop old_loop = self.loop self.loop = None with mock.patch.object( old_loop, "remove_signal_handler") as m_remove_signal_handler: with self.assertWarnsRegex( RuntimeWarning, 'A loop is being detached'): self.watcher.attach_loop(None) m_remove_signal_handler.assert_called_once_with( signal.SIGCHLD) # child 1 & 2 terminate self.add_zombie(61, 11) self.add_zombie(62, -5) # SIGCHLD was not caught self.assertFalse(callback1.called) self.assertFalse(callback2.called) self.assertFalse(callback3.called) # attach a new loop self.loop = self.new_test_loop() with mock.patch.object( self.loop, "add_signal_handler") as m_add_signal_handler: self.watcher.attach_loop(self.loop) m_add_signal_handler.assert_called_once_with( signal.SIGCHLD, self.watcher._sig_chld) callback1.assert_called_once_with(61, 11) # race condition! callback2.assert_called_once_with(62, -5) # race condition! self.assertFalse(callback3.called) callback1.reset_mock() callback2.reset_mock() # child 3 terminates self.running = False self.add_zombie(622, 19) self.watcher._sig_chld() self.assertFalse(callback1.called) self.assertFalse(callback2.called) callback3.assert_called_once_with(622, 19) @waitpid_mocks def test_close(self, m): # register two children callback1 = mock.Mock() with self.watcher: self.running = True # child 1 terminates self.add_zombie(63, 9) # other child terminates self.add_zombie(65, 18) self.watcher._sig_chld() self.watcher.add_child_handler(63, callback1) self.watcher.add_child_handler(64, callback1) self.assertEqual(len(self.watcher._callbacks), 1) if isinstance(self.watcher, asyncio.FastChildWatcher): self.assertEqual(len(self.watcher._zombies), 1) with mock.patch.object( self.loop, "remove_signal_handler") as m_remove_signal_handler: self.watcher.close() m_remove_signal_handler.assert_called_once_with( signal.SIGCHLD) self.assertFalse(self.watcher._callbacks) if isinstance(self.watcher, asyncio.FastChildWatcher): self.assertFalse(self.watcher._zombies) class SafeChildWatcherTests (ChildWatcherTestsMixin, test_utils.TestCase): def create_watcher(self): return asyncio.SafeChildWatcher() class FastChildWatcherTests (ChildWatcherTestsMixin, test_utils.TestCase): def create_watcher(self): return asyncio.FastChildWatcher() class PolicyTests(unittest.TestCase): def create_policy(self): return asyncio.DefaultEventLoopPolicy() def test_get_default_child_watcher(self): policy = self.create_policy() self.assertIsNone(policy._watcher) watcher = policy.get_child_watcher() self.assertIsInstance(watcher, asyncio.ThreadedChildWatcher) self.assertIs(policy._watcher, watcher) self.assertIs(watcher, policy.get_child_watcher()) def test_get_child_watcher_after_set(self): policy = self.create_policy() watcher = asyncio.FastChildWatcher() policy.set_child_watcher(watcher) self.assertIs(policy._watcher, watcher) self.assertIs(watcher, policy.get_child_watcher()) def test_get_child_watcher_thread(self): def f(): policy.set_event_loop(policy.new_event_loop()) self.assertIsInstance(policy.get_event_loop(), asyncio.AbstractEventLoop) watcher = policy.get_child_watcher() self.assertIsInstance(watcher, asyncio.SafeChildWatcher) self.assertIsNone(watcher._loop) policy.get_event_loop().close() policy = self.create_policy() th = threading.Thread(target=f) th.start() th.join() def test_child_watcher_replace_mainloop_existing(self): policy = self.create_policy() loop = policy.get_event_loop() # Explicitly setup SafeChildWatcher, # default ThreadedChildWatcher has no _loop property watcher = asyncio.SafeChildWatcher() policy.set_child_watcher(watcher) watcher.attach_loop(loop) self.assertIs(watcher._loop, loop) new_loop = policy.new_event_loop() policy.set_event_loop(new_loop) self.assertIs(watcher._loop, new_loop) policy.set_event_loop(None) self.assertIs(watcher._loop, None) loop.close() new_loop.close() class TestFunctional(unittest.TestCase): def setUp(self): self.loop = asyncio.new_event_loop() asyncio.set_event_loop(self.loop) def tearDown(self): self.loop.close() asyncio.set_event_loop(None) def test_add_reader_invalid_argument(self): def assert_raises(): return self.assertRaisesRegex(ValueError, r'Invalid file object') cb = lambda: None with assert_raises(): self.loop.add_reader(object(), cb) with assert_raises(): self.loop.add_writer(object(), cb) with assert_raises(): self.loop.remove_reader(object()) with assert_raises(): self.loop.remove_writer(object()) def test_add_reader_or_writer_transport_fd(self): def assert_raises(): return self.assertRaisesRegex( RuntimeError, r'File descriptor .* is used by transport') async def runner(): tr, pr = await self.loop.create_connection( lambda: asyncio.Protocol(), sock=rsock) try: cb = lambda: None with assert_raises(): self.loop.add_reader(rsock, cb) with assert_raises(): self.loop.add_reader(rsock.fileno(), cb) with assert_raises(): self.loop.remove_reader(rsock) with assert_raises(): self.loop.remove_reader(rsock.fileno()) with assert_raises(): self.loop.add_writer(rsock, cb) with assert_raises(): self.loop.add_writer(rsock.fileno(), cb) with assert_raises(): self.loop.remove_writer(rsock) with assert_raises(): self.loop.remove_writer(rsock.fileno()) finally: tr.close() rsock, wsock = socket.socketpair() try: self.loop.run_until_complete(runner()) finally: rsock.close() wsock.close() if __name__ == '__main__': unittest.main()
34.515714
80
0.624345
import collections import contextlib import errno import io import os import pathlib import signal import socket import stat import sys import tempfile import threading import unittest from unittest import mock from test import support if sys.platform == 'win32': raise unittest.SkipTest('UNIX only') import asyncio from asyncio import log from asyncio import base_events from asyncio import events from asyncio import unix_events from test.test_asyncio import utils as test_utils MOCK_ANY = mock.ANY def tearDownModule(): asyncio.set_event_loop_policy(None) def close_pipe_transport(transport): # are mocked if transport._pipe is None: return transport._pipe.close() transport._pipe = None @unittest.skipUnless(signal, 'Signals are not supported') class SelectorEventLoopSignalTests(test_utils.TestCase): def setUp(self): super().setUp() self.loop = asyncio.SelectorEventLoop() self.set_event_loop(self.loop) def test_check_signal(self): self.assertRaises( TypeError, self.loop._check_signal, '1') self.assertRaises( ValueError, self.loop._check_signal, signal.NSIG + 1) def test_handle_signal_no_handler(self): self.loop._handle_signal(signal.NSIG + 1) def test_handle_signal_cancelled_handler(self): h = asyncio.Handle(mock.Mock(), (), loop=mock.Mock()) h.cancel() self.loop._signal_handlers[signal.NSIG + 1] = h self.loop.remove_signal_handler = mock.Mock() self.loop._handle_signal(signal.NSIG + 1) self.loop.remove_signal_handler.assert_called_with(signal.NSIG + 1) @mock.patch('asyncio.unix_events.signal') def test_add_signal_handler_setup_error(self, m_signal): m_signal.NSIG = signal.NSIG m_signal.valid_signals = signal.valid_signals m_signal.set_wakeup_fd.side_effect = ValueError self.assertRaises( RuntimeError, self.loop.add_signal_handler, signal.SIGINT, lambda: True) @mock.patch('asyncio.unix_events.signal') def test_add_signal_handler_coroutine_error(self, m_signal): m_signal.NSIG = signal.NSIG async def simple_coroutine(): pass # callback must not be a coroutine function coro_func = simple_coroutine coro_obj = coro_func() self.addCleanup(coro_obj.close) for func in (coro_func, coro_obj): self.assertRaisesRegex( TypeError, 'coroutines cannot be used with add_signal_handler', self.loop.add_signal_handler, signal.SIGINT, func) @mock.patch('asyncio.unix_events.signal') def test_add_signal_handler(self, m_signal): m_signal.NSIG = signal.NSIG m_signal.valid_signals = signal.valid_signals cb = lambda: True self.loop.add_signal_handler(signal.SIGHUP, cb) h = self.loop._signal_handlers.get(signal.SIGHUP) self.assertIsInstance(h, asyncio.Handle) self.assertEqual(h._callback, cb) @mock.patch('asyncio.unix_events.signal') def test_add_signal_handler_install_error(self, m_signal): m_signal.NSIG = signal.NSIG m_signal.valid_signals = signal.valid_signals def set_wakeup_fd(fd): if fd == -1: raise ValueError() m_signal.set_wakeup_fd = set_wakeup_fd class Err(OSError): errno = errno.EFAULT m_signal.signal.side_effect = Err self.assertRaises( Err, self.loop.add_signal_handler, signal.SIGINT, lambda: True) @mock.patch('asyncio.unix_events.signal') @mock.patch('asyncio.base_events.logger') def test_add_signal_handler_install_error2(self, m_logging, m_signal): m_signal.NSIG = signal.NSIG m_signal.valid_signals = signal.valid_signals class Err(OSError): errno = errno.EINVAL m_signal.signal.side_effect = Err self.loop._signal_handlers[signal.SIGHUP] = lambda: True self.assertRaises( RuntimeError, self.loop.add_signal_handler, signal.SIGINT, lambda: True) self.assertFalse(m_logging.info.called) self.assertEqual(1, m_signal.set_wakeup_fd.call_count) @mock.patch('asyncio.unix_events.signal') @mock.patch('asyncio.base_events.logger') def test_add_signal_handler_install_error3(self, m_logging, m_signal): class Err(OSError): errno = errno.EINVAL m_signal.signal.side_effect = Err m_signal.NSIG = signal.NSIG m_signal.valid_signals = signal.valid_signals self.assertRaises( RuntimeError, self.loop.add_signal_handler, signal.SIGINT, lambda: True) self.assertFalse(m_logging.info.called) self.assertEqual(2, m_signal.set_wakeup_fd.call_count) @mock.patch('asyncio.unix_events.signal') def test_remove_signal_handler(self, m_signal): m_signal.NSIG = signal.NSIG m_signal.valid_signals = signal.valid_signals self.loop.add_signal_handler(signal.SIGHUP, lambda: True) self.assertTrue( self.loop.remove_signal_handler(signal.SIGHUP)) self.assertTrue(m_signal.set_wakeup_fd.called) self.assertTrue(m_signal.signal.called) self.assertEqual( (signal.SIGHUP, m_signal.SIG_DFL), m_signal.signal.call_args[0]) @mock.patch('asyncio.unix_events.signal') def test_remove_signal_handler_2(self, m_signal): m_signal.NSIG = signal.NSIG m_signal.SIGINT = signal.SIGINT m_signal.valid_signals = signal.valid_signals self.loop.add_signal_handler(signal.SIGINT, lambda: True) self.loop._signal_handlers[signal.SIGHUP] = object() m_signal.set_wakeup_fd.reset_mock() self.assertTrue( self.loop.remove_signal_handler(signal.SIGINT)) self.assertFalse(m_signal.set_wakeup_fd.called) self.assertTrue(m_signal.signal.called) self.assertEqual( (signal.SIGINT, m_signal.default_int_handler), m_signal.signal.call_args[0]) @mock.patch('asyncio.unix_events.signal') @mock.patch('asyncio.base_events.logger') def test_remove_signal_handler_cleanup_error(self, m_logging, m_signal): m_signal.NSIG = signal.NSIG m_signal.valid_signals = signal.valid_signals self.loop.add_signal_handler(signal.SIGHUP, lambda: True) m_signal.set_wakeup_fd.side_effect = ValueError self.loop.remove_signal_handler(signal.SIGHUP) self.assertTrue(m_logging.info) @mock.patch('asyncio.unix_events.signal') def test_remove_signal_handler_error(self, m_signal): m_signal.NSIG = signal.NSIG m_signal.valid_signals = signal.valid_signals self.loop.add_signal_handler(signal.SIGHUP, lambda: True) m_signal.signal.side_effect = OSError self.assertRaises( OSError, self.loop.remove_signal_handler, signal.SIGHUP) @mock.patch('asyncio.unix_events.signal') def test_remove_signal_handler_error2(self, m_signal): m_signal.NSIG = signal.NSIG m_signal.valid_signals = signal.valid_signals self.loop.add_signal_handler(signal.SIGHUP, lambda: True) class Err(OSError): errno = errno.EINVAL m_signal.signal.side_effect = Err self.assertRaises( RuntimeError, self.loop.remove_signal_handler, signal.SIGHUP) @mock.patch('asyncio.unix_events.signal') def test_close(self, m_signal): m_signal.NSIG = signal.NSIG m_signal.valid_signals = signal.valid_signals self.loop.add_signal_handler(signal.SIGHUP, lambda: True) self.loop.add_signal_handler(signal.SIGCHLD, lambda: True) self.assertEqual(len(self.loop._signal_handlers), 2) m_signal.set_wakeup_fd.reset_mock() self.loop.close() self.assertEqual(len(self.loop._signal_handlers), 0) m_signal.set_wakeup_fd.assert_called_once_with(-1) @mock.patch('asyncio.unix_events.sys') @mock.patch('asyncio.unix_events.signal') def test_close_on_finalizing(self, m_signal, m_sys): m_signal.NSIG = signal.NSIG m_signal.valid_signals = signal.valid_signals self.loop.add_signal_handler(signal.SIGHUP, lambda: True) self.assertEqual(len(self.loop._signal_handlers), 1) m_sys.is_finalizing.return_value = True m_signal.signal.reset_mock() with self.assertWarnsRegex(ResourceWarning, "skipping signal handlers removal"): self.loop.close() self.assertEqual(len(self.loop._signal_handlers), 0) self.assertFalse(m_signal.signal.called) @unittest.skipUnless(hasattr(socket, 'AF_UNIX'), 'UNIX Sockets are not supported') class SelectorEventLoopUnixSocketTests(test_utils.TestCase): def setUp(self): super().setUp() self.loop = asyncio.SelectorEventLoop() self.set_event_loop(self.loop) @support.skip_unless_bind_unix_socket def test_create_unix_server_existing_path_sock(self): with test_utils.unix_socket_path() as path: sock = socket.socket(socket.AF_UNIX) sock.bind(path) sock.listen(1) sock.close() coro = self.loop.create_unix_server(lambda: None, path) srv = self.loop.run_until_complete(coro) srv.close() self.loop.run_until_complete(srv.wait_closed()) @support.skip_unless_bind_unix_socket def test_create_unix_server_pathlib(self): with test_utils.unix_socket_path() as path: path = pathlib.Path(path) srv_coro = self.loop.create_unix_server(lambda: None, path) srv = self.loop.run_until_complete(srv_coro) srv.close() self.loop.run_until_complete(srv.wait_closed()) def test_create_unix_connection_pathlib(self): with test_utils.unix_socket_path() as path: path = pathlib.Path(path) coro = self.loop.create_unix_connection(lambda: None, path) with self.assertRaises(FileNotFoundError): # If pathlib.Path wasn't supported, the exception would be self.loop.run_until_complete(coro) def test_create_unix_server_existing_path_nonsock(self): with tempfile.NamedTemporaryFile() as file: coro = self.loop.create_unix_server(lambda: None, file.name) with self.assertRaisesRegex(OSError, 'Address.*is already in use'): self.loop.run_until_complete(coro) def test_create_unix_server_ssl_bool(self): coro = self.loop.create_unix_server(lambda: None, path='spam', ssl=True) with self.assertRaisesRegex(TypeError, 'ssl argument must be an SSLContext'): self.loop.run_until_complete(coro) def test_create_unix_server_nopath_nosock(self): coro = self.loop.create_unix_server(lambda: None, path=None) with self.assertRaisesRegex(ValueError, 'path was not specified, and no sock'): self.loop.run_until_complete(coro) def test_create_unix_server_path_inetsock(self): sock = socket.socket() with sock: coro = self.loop.create_unix_server(lambda: None, path=None, sock=sock) with self.assertRaisesRegex(ValueError, 'A UNIX Domain Stream.*was expected'): self.loop.run_until_complete(coro) def test_create_unix_server_path_dgram(self): sock = socket.socket(socket.AF_UNIX, socket.SOCK_DGRAM) with sock: coro = self.loop.create_unix_server(lambda: None, path=None, sock=sock) with self.assertRaisesRegex(ValueError, 'A UNIX Domain Stream.*was expected'): self.loop.run_until_complete(coro) @unittest.skipUnless(hasattr(socket, 'SOCK_NONBLOCK'), 'no socket.SOCK_NONBLOCK (linux only)') @support.skip_unless_bind_unix_socket def test_create_unix_server_path_stream_bittype(self): sock = socket.socket( socket.AF_UNIX, socket.SOCK_STREAM | socket.SOCK_NONBLOCK) with tempfile.NamedTemporaryFile() as file: fn = file.name try: with sock: sock.bind(fn) coro = self.loop.create_unix_server(lambda: None, path=None, sock=sock) srv = self.loop.run_until_complete(coro) srv.close() self.loop.run_until_complete(srv.wait_closed()) finally: os.unlink(fn) def test_create_unix_server_ssl_timeout_with_plain_sock(self): coro = self.loop.create_unix_server(lambda: None, path='spam', ssl_handshake_timeout=1) with self.assertRaisesRegex( ValueError, 'ssl_handshake_timeout is only meaningful with ssl'): self.loop.run_until_complete(coro) def test_create_unix_connection_path_inetsock(self): sock = socket.socket() with sock: coro = self.loop.create_unix_connection(lambda: None, sock=sock) with self.assertRaisesRegex(ValueError, 'A UNIX Domain Stream.*was expected'): self.loop.run_until_complete(coro) @mock.patch('asyncio.unix_events.socket') def test_create_unix_server_bind_error(self, m_socket): sock = mock.Mock() m_socket.socket.return_value = sock sock.bind.side_effect = OSError coro = self.loop.create_unix_server(lambda: None, path="/test") with self.assertRaises(OSError): self.loop.run_until_complete(coro) self.assertTrue(sock.close.called) sock.bind.side_effect = MemoryError coro = self.loop.create_unix_server(lambda: None, path="/test") with self.assertRaises(MemoryError): self.loop.run_until_complete(coro) self.assertTrue(sock.close.called) def test_create_unix_connection_path_sock(self): coro = self.loop.create_unix_connection( lambda: None, os.devnull, sock=object()) with self.assertRaisesRegex(ValueError, 'path and sock can not be'): self.loop.run_until_complete(coro) def test_create_unix_connection_nopath_nosock(self): coro = self.loop.create_unix_connection( lambda: None, None) with self.assertRaisesRegex(ValueError, 'no path and sock were specified'): self.loop.run_until_complete(coro) def test_create_unix_connection_nossl_serverhost(self): coro = self.loop.create_unix_connection( lambda: None, os.devnull, server_hostname='spam') with self.assertRaisesRegex(ValueError, 'server_hostname is only meaningful'): self.loop.run_until_complete(coro) def test_create_unix_connection_ssl_noserverhost(self): coro = self.loop.create_unix_connection( lambda: None, os.devnull, ssl=True) with self.assertRaisesRegex( ValueError, 'you have to pass server_hostname when using ssl'): self.loop.run_until_complete(coro) def test_create_unix_connection_ssl_timeout_with_plain_sock(self): coro = self.loop.create_unix_connection(lambda: None, path='spam', ssl_handshake_timeout=1) with self.assertRaisesRegex( ValueError, 'ssl_handshake_timeout is only meaningful with ssl'): self.loop.run_until_complete(coro) @unittest.skipUnless(hasattr(os, 'sendfile'), 'sendfile is not supported') class SelectorEventLoopUnixSockSendfileTests(test_utils.TestCase): DATA = b"12345abcde" * 16 * 1024 class MyProto(asyncio.Protocol): def __init__(self, loop): self.started = False self.closed = False self.data = bytearray() self.fut = loop.create_future() self.transport = None self._ready = loop.create_future() def connection_made(self, transport): self.started = True self.transport = transport self._ready.set_result(None) def data_received(self, data): self.data.extend(data) def connection_lost(self, exc): self.closed = True self.fut.set_result(None) async def wait_closed(self): await self.fut @classmethod def setUpClass(cls): with open(support.TESTFN, 'wb') as fp: fp.write(cls.DATA) super().setUpClass() @classmethod def tearDownClass(cls): support.unlink(support.TESTFN) super().tearDownClass() def setUp(self): self.loop = asyncio.new_event_loop() self.set_event_loop(self.loop) self.file = open(support.TESTFN, 'rb') self.addCleanup(self.file.close) super().setUp() def make_socket(self, cleanup=True): sock = socket.socket(socket.AF_INET, socket.SOCK_STREAM) sock.setblocking(False) sock.setsockopt(socket.SOL_SOCKET, socket.SO_SNDBUF, 1024) sock.setsockopt(socket.SOL_SOCKET, socket.SO_RCVBUF, 1024) if cleanup: self.addCleanup(sock.close) return sock def run_loop(self, coro): return self.loop.run_until_complete(coro) def prepare(self): sock = self.make_socket() proto = self.MyProto(self.loop) port = support.find_unused_port() srv_sock = self.make_socket(cleanup=False) srv_sock.bind((support.HOST, port)) server = self.run_loop(self.loop.create_server( lambda: proto, sock=srv_sock)) self.run_loop(self.loop.sock_connect(sock, (support.HOST, port))) self.run_loop(proto._ready) def cleanup(): proto.transport.close() self.run_loop(proto.wait_closed()) server.close() self.run_loop(server.wait_closed()) self.addCleanup(cleanup) return sock, proto def test_sock_sendfile_not_available(self): sock, proto = self.prepare() with mock.patch('asyncio.unix_events.os', spec=[]): with self.assertRaisesRegex(asyncio.SendfileNotAvailableError, "os[.]sendfile[(][)] is not available"): self.run_loop(self.loop._sock_sendfile_native(sock, self.file, 0, None)) self.assertEqual(self.file.tell(), 0) def test_sock_sendfile_not_a_file(self): sock, proto = self.prepare() f = object() with self.assertRaisesRegex(asyncio.SendfileNotAvailableError, "not a regular file"): self.run_loop(self.loop._sock_sendfile_native(sock, f, 0, None)) self.assertEqual(self.file.tell(), 0) def test_sock_sendfile_iobuffer(self): sock, proto = self.prepare() f = io.BytesIO() with self.assertRaisesRegex(asyncio.SendfileNotAvailableError, "not a regular file"): self.run_loop(self.loop._sock_sendfile_native(sock, f, 0, None)) self.assertEqual(self.file.tell(), 0) def test_sock_sendfile_not_regular_file(self): sock, proto = self.prepare() f = mock.Mock() f.fileno.return_value = -1 with self.assertRaisesRegex(asyncio.SendfileNotAvailableError, "not a regular file"): self.run_loop(self.loop._sock_sendfile_native(sock, f, 0, None)) self.assertEqual(self.file.tell(), 0) def test_sock_sendfile_cancel1(self): sock, proto = self.prepare() fut = self.loop.create_future() fileno = self.file.fileno() self.loop._sock_sendfile_native_impl(fut, None, sock, fileno, 0, None, len(self.DATA), 0) fut.cancel() with contextlib.suppress(asyncio.CancelledError): self.run_loop(fut) with self.assertRaises(KeyError): self.loop._selector.get_key(sock) def test_sock_sendfile_cancel2(self): sock, proto = self.prepare() fut = self.loop.create_future() fileno = self.file.fileno() self.loop._sock_sendfile_native_impl(fut, None, sock, fileno, 0, None, len(self.DATA), 0) fut.cancel() self.loop._sock_sendfile_native_impl(fut, sock.fileno(), sock, fileno, 0, None, len(self.DATA), 0) with self.assertRaises(KeyError): self.loop._selector.get_key(sock) def test_sock_sendfile_blocking_error(self): sock, proto = self.prepare() fileno = self.file.fileno() fut = mock.Mock() fut.cancelled.return_value = False with mock.patch('os.sendfile', side_effect=BlockingIOError()): self.loop._sock_sendfile_native_impl(fut, None, sock, fileno, 0, None, len(self.DATA), 0) key = self.loop._selector.get_key(sock) self.assertIsNotNone(key) fut.add_done_callback.assert_called_once_with(mock.ANY) def test_sock_sendfile_os_error_first_call(self): sock, proto = self.prepare() fileno = self.file.fileno() fut = self.loop.create_future() with mock.patch('os.sendfile', side_effect=OSError()): self.loop._sock_sendfile_native_impl(fut, None, sock, fileno, 0, None, len(self.DATA), 0) with self.assertRaises(KeyError): self.loop._selector.get_key(sock) exc = fut.exception() self.assertIsInstance(exc, asyncio.SendfileNotAvailableError) self.assertEqual(0, self.file.tell()) def test_sock_sendfile_os_error_next_call(self): sock, proto = self.prepare() fileno = self.file.fileno() fut = self.loop.create_future() err = OSError() with mock.patch('os.sendfile', side_effect=err): self.loop._sock_sendfile_native_impl(fut, sock.fileno(), sock, fileno, 1000, None, len(self.DATA), 1000) with self.assertRaises(KeyError): self.loop._selector.get_key(sock) exc = fut.exception() self.assertIs(exc, err) self.assertEqual(1000, self.file.tell()) def test_sock_sendfile_exception(self): sock, proto = self.prepare() fileno = self.file.fileno() fut = self.loop.create_future() err = asyncio.SendfileNotAvailableError() with mock.patch('os.sendfile', side_effect=err): self.loop._sock_sendfile_native_impl(fut, sock.fileno(), sock, fileno, 1000, None, len(self.DATA), 1000) with self.assertRaises(KeyError): self.loop._selector.get_key(sock) exc = fut.exception() self.assertIs(exc, err) self.assertEqual(1000, self.file.tell()) class UnixReadPipeTransportTests(test_utils.TestCase): def setUp(self): super().setUp() self.loop = self.new_test_loop() self.protocol = test_utils.make_test_protocol(asyncio.Protocol) self.pipe = mock.Mock(spec_set=io.RawIOBase) self.pipe.fileno.return_value = 5 blocking_patcher = mock.patch('os.set_blocking') blocking_patcher.start() self.addCleanup(blocking_patcher.stop) fstat_patcher = mock.patch('os.fstat') m_fstat = fstat_patcher.start() st = mock.Mock() st.st_mode = stat.S_IFIFO m_fstat.return_value = st self.addCleanup(fstat_patcher.stop) def read_pipe_transport(self, waiter=None): transport = unix_events._UnixReadPipeTransport(self.loop, self.pipe, self.protocol, waiter=waiter) self.addCleanup(close_pipe_transport, transport) return transport def test_ctor(self): waiter = asyncio.Future(loop=self.loop) tr = self.read_pipe_transport(waiter=waiter) self.loop.run_until_complete(waiter) self.protocol.connection_made.assert_called_with(tr) self.loop.assert_reader(5, tr._read_ready) self.assertIsNone(waiter.result()) @mock.patch('os.read') def test__read_ready(self, m_read): tr = self.read_pipe_transport() m_read.return_value = b'data' tr._read_ready() m_read.assert_called_with(5, tr.max_size) self.protocol.data_received.assert_called_with(b'data') @mock.patch('os.read') def test__read_ready_eof(self, m_read): tr = self.read_pipe_transport() m_read.return_value = b'' tr._read_ready() m_read.assert_called_with(5, tr.max_size) self.assertFalse(self.loop.readers) test_utils.run_briefly(self.loop) self.protocol.eof_received.assert_called_with() self.protocol.connection_lost.assert_called_with(None) @mock.patch('os.read') def test__read_ready_blocked(self, m_read): tr = self.read_pipe_transport() m_read.side_effect = BlockingIOError tr._read_ready() m_read.assert_called_with(5, tr.max_size) test_utils.run_briefly(self.loop) self.assertFalse(self.protocol.data_received.called) @mock.patch('asyncio.log.logger.error') @mock.patch('os.read') def test__read_ready_error(self, m_read, m_logexc): tr = self.read_pipe_transport() err = OSError() m_read.side_effect = err tr._close = mock.Mock() tr._read_ready() m_read.assert_called_with(5, tr.max_size) tr._close.assert_called_with(err) m_logexc.assert_called_with( test_utils.MockPattern( 'Fatal read error on pipe transport' '\nprotocol:.*\ntransport:.*'), exc_info=(OSError, MOCK_ANY, MOCK_ANY)) @mock.patch('os.read') def test_pause_reading(self, m_read): tr = self.read_pipe_transport() m = mock.Mock() self.loop.add_reader(5, m) tr.pause_reading() self.assertFalse(self.loop.readers) @mock.patch('os.read') def test_resume_reading(self, m_read): tr = self.read_pipe_transport() tr.resume_reading() self.loop.assert_reader(5, tr._read_ready) @mock.patch('os.read') def test_close(self, m_read): tr = self.read_pipe_transport() tr._close = mock.Mock() tr.close() tr._close.assert_called_with(None) @mock.patch('os.read') def test_close_already_closing(self, m_read): tr = self.read_pipe_transport() tr._closing = True tr._close = mock.Mock() tr.close() self.assertFalse(tr._close.called) @mock.patch('os.read') def test__close(self, m_read): tr = self.read_pipe_transport() err = object() tr._close(err) self.assertTrue(tr.is_closing()) self.assertFalse(self.loop.readers) test_utils.run_briefly(self.loop) self.protocol.connection_lost.assert_called_with(err) def test__call_connection_lost(self): tr = self.read_pipe_transport() self.assertIsNotNone(tr._protocol) self.assertIsNotNone(tr._loop) err = None tr._call_connection_lost(err) self.protocol.connection_lost.assert_called_with(err) self.pipe.close.assert_called_with() self.assertIsNone(tr._protocol) self.assertIsNone(tr._loop) def test__call_connection_lost_with_err(self): tr = self.read_pipe_transport() self.assertIsNotNone(tr._protocol) self.assertIsNotNone(tr._loop) err = OSError() tr._call_connection_lost(err) self.protocol.connection_lost.assert_called_with(err) self.pipe.close.assert_called_with() self.assertIsNone(tr._protocol) self.assertIsNone(tr._loop) class UnixWritePipeTransportTests(test_utils.TestCase): def setUp(self): super().setUp() self.loop = self.new_test_loop() self.protocol = test_utils.make_test_protocol(asyncio.BaseProtocol) self.pipe = mock.Mock(spec_set=io.RawIOBase) self.pipe.fileno.return_value = 5 blocking_patcher = mock.patch('os.set_blocking') blocking_patcher.start() self.addCleanup(blocking_patcher.stop) fstat_patcher = mock.patch('os.fstat') m_fstat = fstat_patcher.start() st = mock.Mock() st.st_mode = stat.S_IFSOCK m_fstat.return_value = st self.addCleanup(fstat_patcher.stop) def write_pipe_transport(self, waiter=None): transport = unix_events._UnixWritePipeTransport(self.loop, self.pipe, self.protocol, waiter=waiter) self.addCleanup(close_pipe_transport, transport) return transport def test_ctor(self): waiter = asyncio.Future(loop=self.loop) tr = self.write_pipe_transport(waiter=waiter) self.loop.run_until_complete(waiter) self.protocol.connection_made.assert_called_with(tr) self.loop.assert_reader(5, tr._read_ready) self.assertEqual(None, waiter.result()) def test_can_write_eof(self): tr = self.write_pipe_transport() self.assertTrue(tr.can_write_eof()) @mock.patch('os.write') def test_write(self, m_write): tr = self.write_pipe_transport() m_write.return_value = 4 tr.write(b'data') m_write.assert_called_with(5, b'data') self.assertFalse(self.loop.writers) self.assertEqual(bytearray(), tr._buffer) @mock.patch('os.write') def test_write_no_data(self, m_write): tr = self.write_pipe_transport() tr.write(b'') self.assertFalse(m_write.called) self.assertFalse(self.loop.writers) self.assertEqual(bytearray(b''), tr._buffer) @mock.patch('os.write') def test_write_partial(self, m_write): tr = self.write_pipe_transport() m_write.return_value = 2 tr.write(b'data') self.loop.assert_writer(5, tr._write_ready) self.assertEqual(bytearray(b'ta'), tr._buffer) @mock.patch('os.write') def test_write_buffer(self, m_write): tr = self.write_pipe_transport() self.loop.add_writer(5, tr._write_ready) tr._buffer = bytearray(b'previous') tr.write(b'data') self.assertFalse(m_write.called) self.loop.assert_writer(5, tr._write_ready) self.assertEqual(bytearray(b'previousdata'), tr._buffer) @mock.patch('os.write') def test_write_again(self, m_write): tr = self.write_pipe_transport() m_write.side_effect = BlockingIOError() tr.write(b'data') m_write.assert_called_with(5, bytearray(b'data')) self.loop.assert_writer(5, tr._write_ready) self.assertEqual(bytearray(b'data'), tr._buffer) @mock.patch('asyncio.unix_events.logger') @mock.patch('os.write') def test_write_err(self, m_write, m_log): tr = self.write_pipe_transport() err = OSError() m_write.side_effect = err tr._fatal_error = mock.Mock() tr.write(b'data') m_write.assert_called_with(5, b'data') self.assertFalse(self.loop.writers) self.assertEqual(bytearray(), tr._buffer) tr._fatal_error.assert_called_with( err, 'Fatal write error on pipe transport') self.assertEqual(1, tr._conn_lost) tr.write(b'data') self.assertEqual(2, tr._conn_lost) tr.write(b'data') tr.write(b'data') tr.write(b'data') tr.write(b'data') m_log.warning.assert_called_with( 'pipe closed by peer or os.write(pipe, data) raised exception.') tr.close() @mock.patch('os.write') def test_write_close(self, m_write): tr = self.write_pipe_transport() tr._read_ready() tr.write(b'data') self.assertEqual(tr._conn_lost, 1) tr.write(b'data') self.assertEqual(tr._conn_lost, 2) def test__read_ready(self): tr = self.write_pipe_transport() tr._read_ready() self.assertFalse(self.loop.readers) self.assertFalse(self.loop.writers) self.assertTrue(tr.is_closing()) test_utils.run_briefly(self.loop) self.protocol.connection_lost.assert_called_with(None) @mock.patch('os.write') def test__write_ready(self, m_write): tr = self.write_pipe_transport() self.loop.add_writer(5, tr._write_ready) tr._buffer = bytearray(b'data') m_write.return_value = 4 tr._write_ready() self.assertFalse(self.loop.writers) self.assertEqual(bytearray(), tr._buffer) @mock.patch('os.write') def test__write_ready_partial(self, m_write): tr = self.write_pipe_transport() self.loop.add_writer(5, tr._write_ready) tr._buffer = bytearray(b'data') m_write.return_value = 3 tr._write_ready() self.loop.assert_writer(5, tr._write_ready) self.assertEqual(bytearray(b'a'), tr._buffer) @mock.patch('os.write') def test__write_ready_again(self, m_write): tr = self.write_pipe_transport() self.loop.add_writer(5, tr._write_ready) tr._buffer = bytearray(b'data') m_write.side_effect = BlockingIOError() tr._write_ready() m_write.assert_called_with(5, bytearray(b'data')) self.loop.assert_writer(5, tr._write_ready) self.assertEqual(bytearray(b'data'), tr._buffer) @mock.patch('os.write') def test__write_ready_empty(self, m_write): tr = self.write_pipe_transport() self.loop.add_writer(5, tr._write_ready) tr._buffer = bytearray(b'data') m_write.return_value = 0 tr._write_ready() m_write.assert_called_with(5, bytearray(b'data')) self.loop.assert_writer(5, tr._write_ready) self.assertEqual(bytearray(b'data'), tr._buffer) @mock.patch('asyncio.log.logger.error') @mock.patch('os.write') def test__write_ready_err(self, m_write, m_logexc): tr = self.write_pipe_transport() self.loop.add_writer(5, tr._write_ready) tr._buffer = bytearray(b'data') m_write.side_effect = err = OSError() tr._write_ready() self.assertFalse(self.loop.writers) self.assertFalse(self.loop.readers) self.assertEqual(bytearray(), tr._buffer) self.assertTrue(tr.is_closing()) m_logexc.assert_not_called() self.assertEqual(1, tr._conn_lost) test_utils.run_briefly(self.loop) self.protocol.connection_lost.assert_called_with(err) @mock.patch('os.write') def test__write_ready_closing(self, m_write): tr = self.write_pipe_transport() self.loop.add_writer(5, tr._write_ready) tr._closing = True tr._buffer = bytearray(b'data') m_write.return_value = 4 tr._write_ready() self.assertFalse(self.loop.writers) self.assertFalse(self.loop.readers) self.assertEqual(bytearray(), tr._buffer) self.protocol.connection_lost.assert_called_with(None) self.pipe.close.assert_called_with() @mock.patch('os.write') def test_abort(self, m_write): tr = self.write_pipe_transport() self.loop.add_writer(5, tr._write_ready) self.loop.add_reader(5, tr._read_ready) tr._buffer = [b'da', b'ta'] tr.abort() self.assertFalse(m_write.called) self.assertFalse(self.loop.readers) self.assertFalse(self.loop.writers) self.assertEqual([], tr._buffer) self.assertTrue(tr.is_closing()) test_utils.run_briefly(self.loop) self.protocol.connection_lost.assert_called_with(None) def test__call_connection_lost(self): tr = self.write_pipe_transport() self.assertIsNotNone(tr._protocol) self.assertIsNotNone(tr._loop) err = None tr._call_connection_lost(err) self.protocol.connection_lost.assert_called_with(err) self.pipe.close.assert_called_with() self.assertIsNone(tr._protocol) self.assertIsNone(tr._loop) def test__call_connection_lost_with_err(self): tr = self.write_pipe_transport() self.assertIsNotNone(tr._protocol) self.assertIsNotNone(tr._loop) err = OSError() tr._call_connection_lost(err) self.protocol.connection_lost.assert_called_with(err) self.pipe.close.assert_called_with() self.assertIsNone(tr._protocol) self.assertIsNone(tr._loop) def test_close(self): tr = self.write_pipe_transport() tr.write_eof = mock.Mock() tr.close() tr.write_eof.assert_called_with() tr.close() def test_close_closing(self): tr = self.write_pipe_transport() tr.write_eof = mock.Mock() tr._closing = True tr.close() self.assertFalse(tr.write_eof.called) def test_write_eof(self): tr = self.write_pipe_transport() tr.write_eof() self.assertTrue(tr.is_closing()) self.assertFalse(self.loop.readers) test_utils.run_briefly(self.loop) self.protocol.connection_lost.assert_called_with(None) def test_write_eof_pending(self): tr = self.write_pipe_transport() tr._buffer = [b'data'] tr.write_eof() self.assertTrue(tr.is_closing()) self.assertFalse(self.protocol.connection_lost.called) class AbstractChildWatcherTests(unittest.TestCase): def test_not_implemented(self): f = mock.Mock() watcher = asyncio.AbstractChildWatcher() self.assertRaises( NotImplementedError, watcher.add_child_handler, f, f) self.assertRaises( NotImplementedError, watcher.remove_child_handler, f) self.assertRaises( NotImplementedError, watcher.attach_loop, f) self.assertRaises( NotImplementedError, watcher.close) self.assertRaises( NotImplementedError, watcher.is_active) self.assertRaises( NotImplementedError, watcher.__enter__) self.assertRaises( NotImplementedError, watcher.__exit__, f, f, f) class BaseChildWatcherTests(unittest.TestCase): def test_not_implemented(self): f = mock.Mock() watcher = unix_events.BaseChildWatcher() self.assertRaises( NotImplementedError, watcher._do_waitpid, f) WaitPidMocks = collections.namedtuple("WaitPidMocks", ("waitpid", "WIFEXITED", "WIFSIGNALED", "WEXITSTATUS", "WTERMSIG", )) class ChildWatcherTestsMixin: ignore_warnings = mock.patch.object(log.logger, "warning") def setUp(self): super().setUp() self.loop = self.new_test_loop() self.running = False self.zombies = {} with mock.patch.object( self.loop, "add_signal_handler") as self.m_add_signal_handler: self.watcher = self.create_watcher() self.watcher.attach_loop(self.loop) def waitpid(self, pid, flags): if isinstance(self.watcher, asyncio.SafeChildWatcher) or pid != -1: self.assertGreater(pid, 0) try: if pid < 0: return self.zombies.popitem() else: return pid, self.zombies.pop(pid) except KeyError: pass if self.running: return 0, 0 else: raise ChildProcessError() def add_zombie(self, pid, returncode): self.zombies[pid] = returncode + 32768 def WIFEXITED(self, status): return status >= 32768 def WIFSIGNALED(self, status): return 32700 < status < 32768 def WEXITSTATUS(self, status): self.assertTrue(self.WIFEXITED(status)) return status - 32768 def WTERMSIG(self, status): self.assertTrue(self.WIFSIGNALED(status)) return 32768 - status def test_create_watcher(self): self.m_add_signal_handler.assert_called_once_with( signal.SIGCHLD, self.watcher._sig_chld) def waitpid_mocks(func): def wrapped_func(self): def patch(target, wrapper): return mock.patch(target, wraps=wrapper, new_callable=mock.Mock) with patch('os.WTERMSIG', self.WTERMSIG) as m_WTERMSIG, \ patch('os.WEXITSTATUS', self.WEXITSTATUS) as m_WEXITSTATUS, \ patch('os.WIFSIGNALED', self.WIFSIGNALED) as m_WIFSIGNALED, \ patch('os.WIFEXITED', self.WIFEXITED) as m_WIFEXITED, \ patch('os.waitpid', self.waitpid) as m_waitpid: func(self, WaitPidMocks(m_waitpid, m_WIFEXITED, m_WIFSIGNALED, m_WEXITSTATUS, m_WTERMSIG, )) return wrapped_func @waitpid_mocks def test_sigchld(self, m): callback = mock.Mock() with self.watcher: self.running = True self.watcher.add_child_handler(42, callback, 9, 10, 14) self.assertFalse(callback.called) self.assertFalse(m.WIFEXITED.called) self.assertFalse(m.WIFSIGNALED.called) self.assertFalse(m.WEXITSTATUS.called) self.assertFalse(m.WTERMSIG.called) self.watcher._sig_chld() self.assertFalse(callback.called) self.assertFalse(m.WIFEXITED.called) self.assertFalse(m.WIFSIGNALED.called) self.assertFalse(m.WEXITSTATUS.called) self.assertFalse(m.WTERMSIG.called) self.running = False self.add_zombie(42, 12) self.watcher._sig_chld() self.assertTrue(m.WIFEXITED.called) self.assertTrue(m.WEXITSTATUS.called) self.assertFalse(m.WTERMSIG.called) callback.assert_called_once_with(42, 12, 9, 10, 14) m.WIFSIGNALED.reset_mock() m.WIFEXITED.reset_mock() m.WEXITSTATUS.reset_mock() callback.reset_mock() self.add_zombie(42, 13) with self.ignore_warnings: self.watcher._sig_chld() self.assertFalse(callback.called) self.assertFalse(m.WTERMSIG.called) m.WIFSIGNALED.reset_mock() m.WIFEXITED.reset_mock() m.WEXITSTATUS.reset_mock() self.zombies.clear() self.watcher._sig_chld() self.assertFalse(callback.called) self.assertFalse(m.WIFEXITED.called) self.assertFalse(m.WIFSIGNALED.called) self.assertFalse(m.WEXITSTATUS.called) self.assertFalse(m.WTERMSIG.called) @waitpid_mocks def test_sigchld_two_children(self, m): callback1 = mock.Mock() callback2 = mock.Mock() with self.watcher: self.running = True self.watcher.add_child_handler(43, callback1, 7, 8) self.assertFalse(callback1.called) self.assertFalse(callback2.called) self.assertFalse(m.WIFEXITED.called) self.assertFalse(m.WIFSIGNALED.called) self.assertFalse(m.WEXITSTATUS.called) self.assertFalse(m.WTERMSIG.called) with self.watcher: self.watcher.add_child_handler(44, callback2, 147, 18) self.assertFalse(callback1.called) self.assertFalse(callback2.called) self.assertFalse(m.WIFEXITED.called) self.assertFalse(m.WIFSIGNALED.called) self.assertFalse(m.WEXITSTATUS.called) self.assertFalse(m.WTERMSIG.called) self.watcher._sig_chld() self.assertFalse(callback1.called) self.assertFalse(callback2.called) self.assertFalse(m.WIFEXITED.called) self.assertFalse(m.WIFSIGNALED.called) self.assertFalse(m.WEXITSTATUS.called) self.assertFalse(m.WTERMSIG.called) self.add_zombie(43, -3) self.watcher._sig_chld() callback1.assert_called_once_with(43, -3, 7, 8) self.assertFalse(callback2.called) self.assertTrue(m.WIFSIGNALED.called) self.assertFalse(m.WEXITSTATUS.called) self.assertTrue(m.WTERMSIG.called) m.WIFSIGNALED.reset_mock() m.WIFEXITED.reset_mock() m.WTERMSIG.reset_mock() callback1.reset_mock() self.watcher._sig_chld() self.assertFalse(callback1.called) self.assertFalse(callback2.called) self.assertFalse(m.WIFEXITED.called) self.assertFalse(m.WIFSIGNALED.called) self.assertFalse(m.WEXITSTATUS.called) self.assertFalse(m.WTERMSIG.called) self.add_zombie(44, 108) self.running = False self.watcher._sig_chld() callback2.assert_called_once_with(44, 108, 147, 18) self.assertFalse(callback1.called) self.assertTrue(m.WIFEXITED.called) self.assertTrue(m.WEXITSTATUS.called) self.assertFalse(m.WTERMSIG.called) m.WIFSIGNALED.reset_mock() m.WIFEXITED.reset_mock() m.WEXITSTATUS.reset_mock() callback2.reset_mock() self.add_zombie(43, 14) self.add_zombie(44, 15) with self.ignore_warnings: self.watcher._sig_chld() self.assertFalse(callback1.called) self.assertFalse(callback2.called) self.assertFalse(m.WTERMSIG.called) m.WIFSIGNALED.reset_mock() m.WIFEXITED.reset_mock() m.WEXITSTATUS.reset_mock() self.zombies.clear() self.watcher._sig_chld() self.assertFalse(callback1.called) self.assertFalse(callback2.called) self.assertFalse(m.WIFEXITED.called) self.assertFalse(m.WIFSIGNALED.called) self.assertFalse(m.WEXITSTATUS.called) self.assertFalse(m.WTERMSIG.called) @waitpid_mocks def test_sigchld_two_children_terminating_together(self, m): callback1 = mock.Mock() callback2 = mock.Mock() with self.watcher: self.running = True self.watcher.add_child_handler(45, callback1, 17, 8) self.assertFalse(callback1.called) self.assertFalse(callback2.called) self.assertFalse(m.WIFEXITED.called) self.assertFalse(m.WIFSIGNALED.called) self.assertFalse(m.WEXITSTATUS.called) self.assertFalse(m.WTERMSIG.called) with self.watcher: self.watcher.add_child_handler(46, callback2, 1147, 18) self.assertFalse(callback1.called) self.assertFalse(callback2.called) self.assertFalse(m.WIFEXITED.called) self.assertFalse(m.WIFSIGNALED.called) self.assertFalse(m.WEXITSTATUS.called) self.assertFalse(m.WTERMSIG.called) self.watcher._sig_chld() self.assertFalse(callback1.called) self.assertFalse(callback2.called) self.assertFalse(m.WIFEXITED.called) self.assertFalse(m.WIFSIGNALED.called) self.assertFalse(m.WEXITSTATUS.called) self.assertFalse(m.WTERMSIG.called) self.add_zombie(45, 78) self.add_zombie(46, -5) self.running = False self.watcher._sig_chld() callback1.assert_called_once_with(45, 78, 17, 8) callback2.assert_called_once_with(46, -5, 1147, 18) self.assertTrue(m.WIFSIGNALED.called) self.assertTrue(m.WIFEXITED.called) self.assertTrue(m.WEXITSTATUS.called) self.assertTrue(m.WTERMSIG.called) m.WIFSIGNALED.reset_mock() m.WIFEXITED.reset_mock() m.WTERMSIG.reset_mock() m.WEXITSTATUS.reset_mock() callback1.reset_mock() callback2.reset_mock() self.add_zombie(45, 14) self.add_zombie(46, 15) with self.ignore_warnings: self.watcher._sig_chld() self.assertFalse(callback1.called) self.assertFalse(callback2.called) self.assertFalse(m.WTERMSIG.called) @waitpid_mocks def test_sigchld_race_condition(self, m): callback = mock.Mock() with self.watcher: self.add_zombie(50, 4) self.watcher._sig_chld() self.watcher.add_child_handler(50, callback, 1, 12) callback.assert_called_once_with(50, 4, 1, 12) callback.reset_mock() self.add_zombie(50, -1) with self.ignore_warnings: self.watcher._sig_chld() self.assertFalse(callback.called) @waitpid_mocks def test_sigchld_replace_handler(self, m): callback1 = mock.Mock() callback2 = mock.Mock() with self.watcher: self.running = True self.watcher.add_child_handler(51, callback1, 19) self.assertFalse(callback1.called) self.assertFalse(callback2.called) self.assertFalse(m.WIFEXITED.called) self.assertFalse(m.WIFSIGNALED.called) self.assertFalse(m.WEXITSTATUS.called) self.assertFalse(m.WTERMSIG.called) with self.watcher: self.watcher.add_child_handler(51, callback2, 21) self.assertFalse(callback1.called) self.assertFalse(callback2.called) self.assertFalse(m.WIFEXITED.called) self.assertFalse(m.WIFSIGNALED.called) self.assertFalse(m.WEXITSTATUS.called) self.assertFalse(m.WTERMSIG.called) self.running = False self.add_zombie(51, -8) self.watcher._sig_chld() callback2.assert_called_once_with(51, -8, 21) self.assertFalse(callback1.called) self.assertTrue(m.WIFSIGNALED.called) self.assertFalse(m.WEXITSTATUS.called) self.assertTrue(m.WTERMSIG.called) m.WIFSIGNALED.reset_mock() m.WIFEXITED.reset_mock() m.WTERMSIG.reset_mock() callback2.reset_mock() self.add_zombie(51, 13) with self.ignore_warnings: self.watcher._sig_chld() self.assertFalse(callback1.called) self.assertFalse(callback2.called) self.assertFalse(m.WTERMSIG.called) @waitpid_mocks def test_sigchld_remove_handler(self, m): callback = mock.Mock() with self.watcher: self.running = True self.watcher.add_child_handler(52, callback, 1984) self.assertFalse(callback.called) self.assertFalse(m.WIFEXITED.called) self.assertFalse(m.WIFSIGNALED.called) self.assertFalse(m.WEXITSTATUS.called) self.assertFalse(m.WTERMSIG.called) self.watcher.remove_child_handler(52) self.assertFalse(callback.called) self.assertFalse(m.WIFEXITED.called) self.assertFalse(m.WIFSIGNALED.called) self.assertFalse(m.WEXITSTATUS.called) self.assertFalse(m.WTERMSIG.called) self.running = False self.add_zombie(52, 99) with self.ignore_warnings: self.watcher._sig_chld() self.assertFalse(callback.called) @waitpid_mocks def test_sigchld_unknown_status(self, m): callback = mock.Mock() with self.watcher: self.running = True self.watcher.add_child_handler(53, callback, -19) self.assertFalse(callback.called) self.assertFalse(m.WIFEXITED.called) self.assertFalse(m.WIFSIGNALED.called) self.assertFalse(m.WEXITSTATUS.called) self.assertFalse(m.WTERMSIG.called) self.zombies[53] = 1178 self.running = False self.watcher._sig_chld() callback.assert_called_once_with(53, 1178, -19) self.assertTrue(m.WIFEXITED.called) self.assertTrue(m.WIFSIGNALED.called) self.assertFalse(m.WEXITSTATUS.called) self.assertFalse(m.WTERMSIG.called) callback.reset_mock() m.WIFEXITED.reset_mock() m.WIFSIGNALED.reset_mock() self.add_zombie(53, 101) with self.ignore_warnings: self.watcher._sig_chld() self.assertFalse(callback.called) @waitpid_mocks def test_remove_child_handler(self, m): callback1 = mock.Mock() callback2 = mock.Mock() callback3 = mock.Mock() with self.watcher: self.running = True self.watcher.add_child_handler(54, callback1, 1) self.watcher.add_child_handler(55, callback2, 2) self.watcher.add_child_handler(56, callback3, 3) self.assertTrue(self.watcher.remove_child_handler(54)) self.assertTrue(self.watcher.remove_child_handler(55)) self.assertFalse(self.watcher.remove_child_handler(55)) self.assertFalse(self.watcher.remove_child_handler(55)) self.add_zombie(54, 0) self.add_zombie(55, 1) self.add_zombie(56, 2) self.running = False with self.ignore_warnings: self.watcher._sig_chld() self.assertFalse(callback1.called) self.assertFalse(callback2.called) callback3.assert_called_once_with(56, 2, 3) @waitpid_mocks def test_sigchld_unhandled_exception(self, m): callback = mock.Mock() with self.watcher: self.running = True self.watcher.add_child_handler(57, callback) m.waitpid.side_effect = ValueError with mock.patch.object(log.logger, 'error') as m_error: self.assertEqual(self.watcher._sig_chld(), None) self.assertTrue(m_error.called) @waitpid_mocks def test_sigchld_child_reaped_elsewhere(self, m): callback = mock.Mock() with self.watcher: self.running = True self.watcher.add_child_handler(58, callback) self.assertFalse(callback.called) self.assertFalse(m.WIFEXITED.called) self.assertFalse(m.WIFSIGNALED.called) self.assertFalse(m.WEXITSTATUS.called) self.assertFalse(m.WTERMSIG.called) self.running = False self.add_zombie(58, 4) os.waitpid(58, os.WNOHANG) m.waitpid.reset_mock() with self.ignore_warnings: self.watcher._sig_chld() if isinstance(self.watcher, asyncio.FastChildWatcher): self.assertFalse(callback.called) else: callback.assert_called_once_with(58, 255) @waitpid_mocks def test_sigchld_unknown_pid_during_registration(self, m): callback1 = mock.Mock() callback2 = mock.Mock() with self.ignore_warnings, self.watcher: self.running = True self.add_zombie(591, 7) self.add_zombie(593, 17) self.watcher._sig_chld() self.watcher.add_child_handler(591, callback1) self.watcher.add_child_handler(592, callback2) callback1.assert_called_once_with(591, 7) self.assertFalse(callback2.called) @waitpid_mocks def test_set_loop(self, m): callback = mock.Mock() with self.watcher: self.running = True self.watcher.add_child_handler(60, callback) old_loop = self.loop self.loop = self.new_test_loop() patch = mock.patch.object with patch(old_loop, "remove_signal_handler") as m_old_remove, \ patch(self.loop, "add_signal_handler") as m_new_add: self.watcher.attach_loop(self.loop) m_old_remove.assert_called_once_with( signal.SIGCHLD) m_new_add.assert_called_once_with( signal.SIGCHLD, self.watcher._sig_chld) self.running = False self.add_zombie(60, 9) self.watcher._sig_chld() callback.assert_called_once_with(60, 9) @waitpid_mocks def test_set_loop_race_condition(self, m): callback1 = mock.Mock() callback2 = mock.Mock() callback3 = mock.Mock() with self.watcher: self.running = True self.watcher.add_child_handler(61, callback1) self.watcher.add_child_handler(62, callback2) self.watcher.add_child_handler(622, callback3) old_loop = self.loop self.loop = None with mock.patch.object( old_loop, "remove_signal_handler") as m_remove_signal_handler: with self.assertWarnsRegex( RuntimeWarning, 'A loop is being detached'): self.watcher.attach_loop(None) m_remove_signal_handler.assert_called_once_with( signal.SIGCHLD) self.add_zombie(61, 11) self.add_zombie(62, -5) self.assertFalse(callback1.called) self.assertFalse(callback2.called) self.assertFalse(callback3.called) self.loop = self.new_test_loop() with mock.patch.object( self.loop, "add_signal_handler") as m_add_signal_handler: self.watcher.attach_loop(self.loop) m_add_signal_handler.assert_called_once_with( signal.SIGCHLD, self.watcher._sig_chld) callback1.assert_called_once_with(61, 11) callback2.assert_called_once_with(62, -5) self.assertFalse(callback3.called) callback1.reset_mock() callback2.reset_mock() self.running = False self.add_zombie(622, 19) self.watcher._sig_chld() self.assertFalse(callback1.called) self.assertFalse(callback2.called) callback3.assert_called_once_with(622, 19) @waitpid_mocks def test_close(self, m): callback1 = mock.Mock() with self.watcher: self.running = True self.add_zombie(63, 9) self.add_zombie(65, 18) self.watcher._sig_chld() self.watcher.add_child_handler(63, callback1) self.watcher.add_child_handler(64, callback1) self.assertEqual(len(self.watcher._callbacks), 1) if isinstance(self.watcher, asyncio.FastChildWatcher): self.assertEqual(len(self.watcher._zombies), 1) with mock.patch.object( self.loop, "remove_signal_handler") as m_remove_signal_handler: self.watcher.close() m_remove_signal_handler.assert_called_once_with( signal.SIGCHLD) self.assertFalse(self.watcher._callbacks) if isinstance(self.watcher, asyncio.FastChildWatcher): self.assertFalse(self.watcher._zombies) class SafeChildWatcherTests (ChildWatcherTestsMixin, test_utils.TestCase): def create_watcher(self): return asyncio.SafeChildWatcher() class FastChildWatcherTests (ChildWatcherTestsMixin, test_utils.TestCase): def create_watcher(self): return asyncio.FastChildWatcher() class PolicyTests(unittest.TestCase): def create_policy(self): return asyncio.DefaultEventLoopPolicy() def test_get_default_child_watcher(self): policy = self.create_policy() self.assertIsNone(policy._watcher) watcher = policy.get_child_watcher() self.assertIsInstance(watcher, asyncio.ThreadedChildWatcher) self.assertIs(policy._watcher, watcher) self.assertIs(watcher, policy.get_child_watcher()) def test_get_child_watcher_after_set(self): policy = self.create_policy() watcher = asyncio.FastChildWatcher() policy.set_child_watcher(watcher) self.assertIs(policy._watcher, watcher) self.assertIs(watcher, policy.get_child_watcher()) def test_get_child_watcher_thread(self): def f(): policy.set_event_loop(policy.new_event_loop()) self.assertIsInstance(policy.get_event_loop(), asyncio.AbstractEventLoop) watcher = policy.get_child_watcher() self.assertIsInstance(watcher, asyncio.SafeChildWatcher) self.assertIsNone(watcher._loop) policy.get_event_loop().close() policy = self.create_policy() th = threading.Thread(target=f) th.start() th.join() def test_child_watcher_replace_mainloop_existing(self): policy = self.create_policy() loop = policy.get_event_loop() watcher = asyncio.SafeChildWatcher() policy.set_child_watcher(watcher) watcher.attach_loop(loop) self.assertIs(watcher._loop, loop) new_loop = policy.new_event_loop() policy.set_event_loop(new_loop) self.assertIs(watcher._loop, new_loop) policy.set_event_loop(None) self.assertIs(watcher._loop, None) loop.close() new_loop.close() class TestFunctional(unittest.TestCase): def setUp(self): self.loop = asyncio.new_event_loop() asyncio.set_event_loop(self.loop) def tearDown(self): self.loop.close() asyncio.set_event_loop(None) def test_add_reader_invalid_argument(self): def assert_raises(): return self.assertRaisesRegex(ValueError, r'Invalid file object') cb = lambda: None with assert_raises(): self.loop.add_reader(object(), cb) with assert_raises(): self.loop.add_writer(object(), cb) with assert_raises(): self.loop.remove_reader(object()) with assert_raises(): self.loop.remove_writer(object()) def test_add_reader_or_writer_transport_fd(self): def assert_raises(): return self.assertRaisesRegex( RuntimeError, r'File descriptor .* is used by transport') async def runner(): tr, pr = await self.loop.create_connection( lambda: asyncio.Protocol(), sock=rsock) try: cb = lambda: None with assert_raises(): self.loop.add_reader(rsock, cb) with assert_raises(): self.loop.add_reader(rsock.fileno(), cb) with assert_raises(): self.loop.remove_reader(rsock) with assert_raises(): self.loop.remove_reader(rsock.fileno()) with assert_raises(): self.loop.add_writer(rsock, cb) with assert_raises(): self.loop.add_writer(rsock.fileno(), cb) with assert_raises(): self.loop.remove_writer(rsock) with assert_raises(): self.loop.remove_writer(rsock.fileno()) finally: tr.close() rsock, wsock = socket.socketpair() try: self.loop.run_until_complete(runner()) finally: rsock.close() wsock.close() if __name__ == '__main__': unittest.main()
true
true
f7f994ba76665067e1ccbdba2cef4940b951dc04
2,370
py
Python
BurpExtensions/modules/webcommon.py
afollett/mywebappscripts
83dc8984cd4d4216578aee506278a2e6e9473ce9
[ "MIT" ]
129
2015-02-05T04:45:54.000Z
2021-11-27T06:54:17.000Z
BurpExtensions/modules/webcommon.py
YarboJanks/mywebappscripts
83dc8984cd4d4216578aee506278a2e6e9473ce9
[ "MIT" ]
1
2016-03-21T09:22:34.000Z
2016-03-21T10:57:36.000Z
BurpExtensions/modules/webcommon.py
YarboJanks/mywebappscripts
83dc8984cd4d4216578aee506278a2e6e9473ce9
[ "MIT" ]
60
2015-02-20T15:49:46.000Z
2021-03-01T01:44:04.000Z
import re def get_host_header_from_request(self,requestInfo): t1 = requestInfo.getHeaders() header_name='Host:' regex=re.compile('^.*%s.*'%header_name,re.IGNORECASE) for i in t1: #Search for the Host header m1=regex.match(i) #Extract and store the Host header if m1: t2=i.split(': ') return t2 def extract_directory(self,callbacks,url): t0=url.split('/') if len(t0) > 1: t0.pop(-1) i=0 t1='' while i<len(t0): t1=t1+'/'+t0[i] i+=1 return t1[1:] def extract_urls(self,callbacks,url): t0=url.split('/') i=0 t1='' while i<len(t0): t1=t1+'/'+t0[i] i+=1 return t1[1:] def get_referer_header_from_request(self,requestInfo): t1 = requestInfo.getHeaders() header_name='Referer:' regex=re.compile('^.*%s.*'%header_name,re.IGNORECASE) for i in t1: #Search for the Referer header m1=regex.match(i) #Extract and store the Referer header if m1: t2=i.split(': ') return t2 def get_setcookie_from_header(self,responseInfo): t1 = responseInfo.getHeaders() header_name='Set-Cookie:' #Search for the Set Cookie header regex=re.compile('^.*%s.*'%header_name,re.IGNORECASE) for i in t1: m1=regex.match(i) #Extract and store the Set Cookie header if m1: t2=i.split(': ') return t2 def get_response_code_from_headers(self,responseInfo): t1 = responseInfo.getHeaders() return t1 def get_location_from_headers(self,responseInfo): t1 = responseInfo.getHeaders() header_name='Location:' #Search for the Location header regex=re.compile('^.*%s.*'%header_name,re.IGNORECASE) for i in t1: m1=regex.match(i) #Extract and store the Location header if m1: t2=i.split(': ') return t2 def get_response_body(self,response_byte_array,responseInfo): responseBody=response_byte_array[responseInfo.getBodyOffset():] return responseBody def get_banner_from_response(self,responseInfo): t1 = responseInfo.getHeaders() #header_name='Server:' header_name=['Server:','X-AspNet-Version:','X-AspNetMvc-Version:','X-Powered-By:','X-Requested-With:','X-UA-Compatible:','Via:'] for h1 in header_name: regex=re.compile('^.*%s.*'%h1,re.IGNORECASE) for i in t1: #Search for the Server header m1=regex.match(i) #Extract and store the Server header if m1: return i
23.009709
130
0.666245
import re def get_host_header_from_request(self,requestInfo): t1 = requestInfo.getHeaders() header_name='Host:' regex=re.compile('^.*%s.*'%header_name,re.IGNORECASE) for i in t1: m1=regex.match(i) if m1: t2=i.split(': ') return t2 def extract_directory(self,callbacks,url): t0=url.split('/') if len(t0) > 1: t0.pop(-1) i=0 t1='' while i<len(t0): t1=t1+'/'+t0[i] i+=1 return t1[1:] def extract_urls(self,callbacks,url): t0=url.split('/') i=0 t1='' while i<len(t0): t1=t1+'/'+t0[i] i+=1 return t1[1:] def get_referer_header_from_request(self,requestInfo): t1 = requestInfo.getHeaders() header_name='Referer:' regex=re.compile('^.*%s.*'%header_name,re.IGNORECASE) for i in t1: m1=regex.match(i) if m1: t2=i.split(': ') return t2 def get_setcookie_from_header(self,responseInfo): t1 = responseInfo.getHeaders() header_name='Set-Cookie:' regex=re.compile('^.*%s.*'%header_name,re.IGNORECASE) for i in t1: m1=regex.match(i) if m1: t2=i.split(': ') return t2 def get_response_code_from_headers(self,responseInfo): t1 = responseInfo.getHeaders() return t1 def get_location_from_headers(self,responseInfo): t1 = responseInfo.getHeaders() header_name='Location:' regex=re.compile('^.*%s.*'%header_name,re.IGNORECASE) for i in t1: m1=regex.match(i) if m1: t2=i.split(': ') return t2 def get_response_body(self,response_byte_array,responseInfo): responseBody=response_byte_array[responseInfo.getBodyOffset():] return responseBody def get_banner_from_response(self,responseInfo): t1 = responseInfo.getHeaders() header_name=['Server:','X-AspNet-Version:','X-AspNetMvc-Version:','X-Powered-By:','X-Requested-With:','X-UA-Compatible:','Via:'] for h1 in header_name: regex=re.compile('^.*%s.*'%h1,re.IGNORECASE) for i in t1: m1=regex.match(i) if m1: return i
true
true
f7f9951a302081ac98159ad5fbfd7f3467802a8a
3,222
py
Python
phigaro/misc/vis.py
bobeobibo/phigaro
342a3454bb5324426b25feb4a4d1f640b58bf8f8
[ "MIT" ]
31
2019-03-06T14:33:37.000Z
2022-03-08T07:16:07.000Z
phigaro/misc/vis.py
bobeobibo/phigaro
342a3454bb5324426b25feb4a4d1f640b58bf8f8
[ "MIT" ]
27
2019-05-17T05:06:58.000Z
2022-03-27T00:38:56.000Z
phigaro/misc/vis.py
bobeobibo/phigaro
342a3454bb5324426b25feb4a4d1f640b58bf8f8
[ "MIT" ]
12
2017-08-23T12:48:38.000Z
2021-06-24T00:57:22.000Z
import numpy as np from plotly import tools from plotly.graph_objs import Bar import plotly.offline as py from phigaro.finder.v2 import calc_scores def _make_coords_colors(data_len, real_phage_coords): colors = np.zeros(data_len) for begin, end in real_phage_coords: for i in range(begin, end + 1): colors[i] = 1 return colors def plot_scores(scores, title, real_phage_coords=None): indices = np.arange(len(scores)) colors = None if real_phage_coords is not None: colors = _make_coords_colors(len(scores), real_phage_coords) data = Bar( x=indices, y=scores + 0.1, name=title, marker=dict(color=colors,) ) return data def plot_phage(phage, title): ind = np.arange(len(phage)) int_phage = [c + 0.1 for c in phage] data = Bar(x=ind, y=int_phage, marker=dict(color='black',), name=title) return data def _make_rects(coords, ymin, ymax, fillcolor, opacity): return [ dict( type='rect', xref='x', yref='y', x0=x_begin, y0=ymin, x1=x_end, y1=ymax, fillcolor=fillcolor, opacity=opacity, line={'width': 0}, ) for (x_begin, x_end) in coords ] def plot_scores_and_phage( phage, window_len, score_func=None, scan_func=None, real_phage_coords=None ): score_func = score_func or score_tri fig = tools.make_subplots(rows=2, cols=1, shared_xaxes=True) title = 'Scores: window: {}'.format(window_len) scores = np.array(calc_scores(phage, window_len, score_func)) ranges = [] if scan_func is not None: ranges = scan_func(scores) score_fig = plot_scores(scores, title, real_phage_coords=None) phage_fig = plot_phage(phage, 'Phage') fig.append_trace(score_fig, 1, 1) fig.append_trace(phage_fig, 2, 1) ymax = window_len / 2 if real_phage_coords is not None or ranges: fig['layout'].update( dict( shapes=_make_rects(ranges, ymax, 'rgb(50, 171, 96)', 0.5) + _make_rects(real_phage_coords or [], ymax, '#ff0000', 0.5) ) ) py.iplot(fig) def plot_scores_and_phage2( phage, scores, found_phage_coords, real_phage_coords=None, filename='filename', ): # real_phage_coords = real_phage_coords or [] fig = tools.make_subplots(rows=2, cols=1, shared_xaxes=True) title = 'Scores' score_fig = plot_scores(scores, title, real_phage_coords=None) phage_fig = plot_phage(phage, 'Phage') fig.append_trace(score_fig, 1, 1) fig.append_trace(phage_fig, 2, 1) ymax = max(scores) # print(len(real_phage_coords), len(found_phage_coords)) if (len(real_phage_coords) + len(found_phage_coords)) != 0: # print('got real coords') fig['layout'].update( dict( shapes=_make_rects( found_phage_coords, ymax * 0.5, ymax * 0.75, '#0000ff', 0.5 ) + _make_rects( real_phage_coords, ymax * 0.75, ymax, '#aaaa00', 0.5 ) ) ) py.plot(fig, filename=filename + '.html')
27.305085
79
0.606145
import numpy as np from plotly import tools from plotly.graph_objs import Bar import plotly.offline as py from phigaro.finder.v2 import calc_scores def _make_coords_colors(data_len, real_phage_coords): colors = np.zeros(data_len) for begin, end in real_phage_coords: for i in range(begin, end + 1): colors[i] = 1 return colors def plot_scores(scores, title, real_phage_coords=None): indices = np.arange(len(scores)) colors = None if real_phage_coords is not None: colors = _make_coords_colors(len(scores), real_phage_coords) data = Bar( x=indices, y=scores + 0.1, name=title, marker=dict(color=colors,) ) return data def plot_phage(phage, title): ind = np.arange(len(phage)) int_phage = [c + 0.1 for c in phage] data = Bar(x=ind, y=int_phage, marker=dict(color='black',), name=title) return data def _make_rects(coords, ymin, ymax, fillcolor, opacity): return [ dict( type='rect', xref='x', yref='y', x0=x_begin, y0=ymin, x1=x_end, y1=ymax, fillcolor=fillcolor, opacity=opacity, line={'width': 0}, ) for (x_begin, x_end) in coords ] def plot_scores_and_phage( phage, window_len, score_func=None, scan_func=None, real_phage_coords=None ): score_func = score_func or score_tri fig = tools.make_subplots(rows=2, cols=1, shared_xaxes=True) title = 'Scores: window: {}'.format(window_len) scores = np.array(calc_scores(phage, window_len, score_func)) ranges = [] if scan_func is not None: ranges = scan_func(scores) score_fig = plot_scores(scores, title, real_phage_coords=None) phage_fig = plot_phage(phage, 'Phage') fig.append_trace(score_fig, 1, 1) fig.append_trace(phage_fig, 2, 1) ymax = window_len / 2 if real_phage_coords is not None or ranges: fig['layout'].update( dict( shapes=_make_rects(ranges, ymax, 'rgb(50, 171, 96)', 0.5) + _make_rects(real_phage_coords or [], ymax, '#ff0000', 0.5) ) ) py.iplot(fig) def plot_scores_and_phage2( phage, scores, found_phage_coords, real_phage_coords=None, filename='filename', ): fig = tools.make_subplots(rows=2, cols=1, shared_xaxes=True) title = 'Scores' score_fig = plot_scores(scores, title, real_phage_coords=None) phage_fig = plot_phage(phage, 'Phage') fig.append_trace(score_fig, 1, 1) fig.append_trace(phage_fig, 2, 1) ymax = max(scores) if (len(real_phage_coords) + len(found_phage_coords)) != 0: fig['layout'].update( dict( shapes=_make_rects( found_phage_coords, ymax * 0.5, ymax * 0.75, '#0000ff', 0.5 ) + _make_rects( real_phage_coords, ymax * 0.75, ymax, '#aaaa00', 0.5 ) ) ) py.plot(fig, filename=filename + '.html')
true
true
f7f9953808294f5b02d2ec4faf583a807d423e7a
4,693
py
Python
grr/lib/flows/cron/filestore_stats.py
theGreenJedi/grr
d9e11e304dc299d49c76b7fdf6fdbfcd4b8eec39
[ "Apache-2.0" ]
null
null
null
grr/lib/flows/cron/filestore_stats.py
theGreenJedi/grr
d9e11e304dc299d49c76b7fdf6fdbfcd4b8eec39
[ "Apache-2.0" ]
null
null
null
grr/lib/flows/cron/filestore_stats.py
theGreenJedi/grr
d9e11e304dc299d49c76b7fdf6fdbfcd4b8eec39
[ "Apache-2.0" ]
null
null
null
#!/usr/bin/env python """Filestore stats crons.""" from grr.lib import aff4 from grr.lib import flow from grr.lib import rdfvalue from grr.lib import stats as stats_lib from grr.lib import utils from grr.lib.aff4_objects import cronjobs from grr.lib.aff4_objects import stats as aff4_stats # pylint: enable=unused-import class ClassCounter(object): """Populates a stats.Graph with counts of each object class.""" def __init__(self, attribute, title): self.attribute = attribute self.value_dict = {} self.graph = self.attribute(title=title) def ProcessFile(self, fd): classname = fd.__class__.__name__ self.value_dict[classname] = self.value_dict.get(classname, 0) + 1 def Save(self, fd): for classname, count in self.value_dict.items(): self.graph.Append(label=classname, y_value=count) fd.Set(self.attribute, self.graph) class ClassFileSizeCounter(ClassCounter): """Count total filesize by classtype.""" GB = 1024 * 1024 * 1024 def ProcessFile(self, fd): classname = fd.__class__.__name__ self.value_dict[classname] = self.value_dict.get(classname, 0) + fd.Get(fd.Schema.SIZE) def Save(self, fd): for classname, count in self.value_dict.items(): self.graph.Append(label=classname, y_value=count / float(self.GB)) fd.Set(self.attribute, self.graph) class GraphDistribution(stats_lib.Distribution): """Abstract class for building histograms.""" _bins = [] def __init__(self, attribute, title): self.attribute = attribute self.graph = self.attribute(title=title) super(GraphDistribution, self).__init__(bins=self._bins) def ProcessFile(self, fd): raise NotImplementedError() def Save(self, fd): for x, y in sorted(self.bins_heights.items()): if x >= 0: self.graph.Append(x_value=int(x), y_value=y) fd.Set(self.attribute, self.graph) class FileSizeHistogram(GraphDistribution): """Graph filesize.""" _bins = [0, 2, 50, 100, 1e3, 10e3, 100e3, 500e3, 1e6, 5e6, 10e6, 50e6, 100e6, 500e6, 1e9, 5e9, 10e9] def ProcessFile(self, fd): self.Record(fd.Get(fd.Schema.SIZE)) class ClientCountHistogram(GraphDistribution): """Graph the number of files that are found on 0, 1, 5...etc clients.""" _bins = [0, 1, 5, 10, 20, 50, 100] def ProcessFile(self, fd): # The same file can be in multiple locations on the one client so we use a # set to kill the dups. clients = set() for urn in fd.Query("aff4:/C"): client, _ = urn.Split(2) clients.add(client) self.Record(len(clients)) class FilestoreStatsCronFlow(cronjobs.SystemCronFlow): """Build statistics about the filestore.""" frequency = rdfvalue.Duration("1w") lifetime = rdfvalue.Duration("1d") HASH_PATH = "aff4:/files/hash/generic/sha256" FILESTORE_STATS_URN = rdfvalue.RDFURN("aff4:/stats/FileStoreStats") OPEN_FILES_LIMIT = 500 def _CreateConsumers(self): self.consumers = [ClassCounter(self.stats.Schema.FILESTORE_FILETYPES, "Number of files in the filestore by type"), ClassFileSizeCounter( self.stats.Schema.FILESTORE_FILETYPES_SIZE, "Total filesize (GB) files in the filestore by type"), FileSizeHistogram( self.stats.Schema.FILESTORE_FILESIZE_HISTOGRAM, "Filesize distribution in bytes"), ClientCountHistogram( self.stats.Schema.FILESTORE_CLIENTCOUNT_HISTOGRAM, "Number of files found on X clients")] @flow.StateHandler() def Start(self): """Retrieve all the clients for the AbstractClientStatsCollectors.""" self.stats = aff4.FACTORY.Create(self.FILESTORE_STATS_URN, aff4_stats.FilestoreStats, mode="w", token=self.token) self._CreateConsumers() hashes = list(aff4.FACTORY.Open(self.HASH_PATH, token=self.token).ListChildren()) try: for urns in utils.Grouper(hashes, self.OPEN_FILES_LIMIT): for fd in aff4.FACTORY.MultiOpen(urns, mode="r", token=self.token, age=aff4.NEWEST_TIME): for consumer in self.consumers: consumer.ProcessFile(fd) self.HeartBeat() finally: for consumer in self.consumers: consumer.Save(self.stats) self.stats.Close()
32.365517
80
0.622843
from grr.lib import aff4 from grr.lib import flow from grr.lib import rdfvalue from grr.lib import stats as stats_lib from grr.lib import utils from grr.lib.aff4_objects import cronjobs from grr.lib.aff4_objects import stats as aff4_stats class ClassCounter(object): def __init__(self, attribute, title): self.attribute = attribute self.value_dict = {} self.graph = self.attribute(title=title) def ProcessFile(self, fd): classname = fd.__class__.__name__ self.value_dict[classname] = self.value_dict.get(classname, 0) + 1 def Save(self, fd): for classname, count in self.value_dict.items(): self.graph.Append(label=classname, y_value=count) fd.Set(self.attribute, self.graph) class ClassFileSizeCounter(ClassCounter): GB = 1024 * 1024 * 1024 def ProcessFile(self, fd): classname = fd.__class__.__name__ self.value_dict[classname] = self.value_dict.get(classname, 0) + fd.Get(fd.Schema.SIZE) def Save(self, fd): for classname, count in self.value_dict.items(): self.graph.Append(label=classname, y_value=count / float(self.GB)) fd.Set(self.attribute, self.graph) class GraphDistribution(stats_lib.Distribution): _bins = [] def __init__(self, attribute, title): self.attribute = attribute self.graph = self.attribute(title=title) super(GraphDistribution, self).__init__(bins=self._bins) def ProcessFile(self, fd): raise NotImplementedError() def Save(self, fd): for x, y in sorted(self.bins_heights.items()): if x >= 0: self.graph.Append(x_value=int(x), y_value=y) fd.Set(self.attribute, self.graph) class FileSizeHistogram(GraphDistribution): _bins = [0, 2, 50, 100, 1e3, 10e3, 100e3, 500e3, 1e6, 5e6, 10e6, 50e6, 100e6, 500e6, 1e9, 5e9, 10e9] def ProcessFile(self, fd): self.Record(fd.Get(fd.Schema.SIZE)) class ClientCountHistogram(GraphDistribution): _bins = [0, 1, 5, 10, 20, 50, 100] def ProcessFile(self, fd): clients = set() for urn in fd.Query("aff4:/C"): client, _ = urn.Split(2) clients.add(client) self.Record(len(clients)) class FilestoreStatsCronFlow(cronjobs.SystemCronFlow): frequency = rdfvalue.Duration("1w") lifetime = rdfvalue.Duration("1d") HASH_PATH = "aff4:/files/hash/generic/sha256" FILESTORE_STATS_URN = rdfvalue.RDFURN("aff4:/stats/FileStoreStats") OPEN_FILES_LIMIT = 500 def _CreateConsumers(self): self.consumers = [ClassCounter(self.stats.Schema.FILESTORE_FILETYPES, "Number of files in the filestore by type"), ClassFileSizeCounter( self.stats.Schema.FILESTORE_FILETYPES_SIZE, "Total filesize (GB) files in the filestore by type"), FileSizeHistogram( self.stats.Schema.FILESTORE_FILESIZE_HISTOGRAM, "Filesize distribution in bytes"), ClientCountHistogram( self.stats.Schema.FILESTORE_CLIENTCOUNT_HISTOGRAM, "Number of files found on X clients")] @flow.StateHandler() def Start(self): self.stats = aff4.FACTORY.Create(self.FILESTORE_STATS_URN, aff4_stats.FilestoreStats, mode="w", token=self.token) self._CreateConsumers() hashes = list(aff4.FACTORY.Open(self.HASH_PATH, token=self.token).ListChildren()) try: for urns in utils.Grouper(hashes, self.OPEN_FILES_LIMIT): for fd in aff4.FACTORY.MultiOpen(urns, mode="r", token=self.token, age=aff4.NEWEST_TIME): for consumer in self.consumers: consumer.ProcessFile(fd) self.HeartBeat() finally: for consumer in self.consumers: consumer.Save(self.stats) self.stats.Close()
true
true
f7f9967e6e3514f8f4b1ce4db5f80834c49af67c
2,806
py
Python
SimpleGP/tests/test_egp.py
mgraffg/simplegp
7e4639e3ac76571a4e67669cad6e8e775b3fc345
[ "Apache-2.0" ]
2
2015-03-18T17:26:20.000Z
2019-03-18T17:28:16.000Z
SimpleGP/tests/test_egp.py
mgraffg/simplegp
7e4639e3ac76571a4e67669cad6e8e775b3fc345
[ "Apache-2.0" ]
1
2015-04-19T17:02:49.000Z
2015-07-21T18:48:34.000Z
SimpleGP/tests/test_egp.py
mgraffg/simplegp
7e4639e3ac76571a4e67669cad6e8e775b3fc345
[ "Apache-2.0" ]
null
null
null
# Copyright 2013 Mario Graff Guerrero # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # http://www.apache.org/licenses/LICENSE-2.0 # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. import numpy as np from SimpleGP import EGPS, SparseArray class TestSGPS(object): def __init__(self): x = np.linspace(-10, 10, 100) pol = np.array([0.2, -0.3, 0.2]) self._pol = pol X = np.vstack((x**2, x, np.ones(x.shape[0]))) self._y = (X.T * pol).sum(axis=1) self._x = x[:, np.newaxis] def test_EGPS(self): gp = EGPS(generations=3).fit(self._x, self._y, test=self._x, test_y=self._y) assert isinstance(gp.early_stopping[-1], SparseArray) def test_EGPS_wo_st(self): gp = EGPS(generations=3, use_st=0).fit(self._x, self._y, test=self._x, test_y=self._y) assert isinstance(gp.early_stopping[-1], SparseArray) def test_cache(self): gp = EGPS(seed=0, nrandom=0, use_st=1, generations=3).fit(self._x, self._y) while True: if gp.pre_crossover() and gp._xo_father1 != 0 and\ gp._xo_father2 != 0: res = gp.crossover(gp.population[gp._xo_father1], gp.population[gp._xo_father2]) if gp._ind_eval_st is not None: break f1 = gp._xo_father1 gp.kill_ind(0, res) assert np.all(gp._eval_A_st[f1] == gp._eval_A_st[0]) f1_o = map(lambda x: gp._tree.get_pos_arg(gp.population[f1], 0, x), range(gp._ntrees)) trees = map(lambda x: gp._eval_st[f1][x], f1_o) s_o = map(lambda x: gp._tree.get_pos_arg(gp.population[0], 0, x), range(gp._ntrees)) s_trees = map(lambda x: gp._eval_st[0][x], s_o) assert len(filter(lambda x: x is None, s_trees)) == 1 gp.eval(0) np.set_printoptions(precision=3) r = filter(lambda x: x[1] is None, enumerate(s_trees))[0][0] assert (gp._eval_A_st[f1] - gp._eval_A_st[0])[r, r] != 0 trees2 = gp._eval.get_output() r = filter(lambda (x, y): x == y, zip(trees, trees2)) assert len(r) == gp._ntrees - 1
41.264706
75
0.561654
import numpy as np from SimpleGP import EGPS, SparseArray class TestSGPS(object): def __init__(self): x = np.linspace(-10, 10, 100) pol = np.array([0.2, -0.3, 0.2]) self._pol = pol X = np.vstack((x**2, x, np.ones(x.shape[0]))) self._y = (X.T * pol).sum(axis=1) self._x = x[:, np.newaxis] def test_EGPS(self): gp = EGPS(generations=3).fit(self._x, self._y, test=self._x, test_y=self._y) assert isinstance(gp.early_stopping[-1], SparseArray) def test_EGPS_wo_st(self): gp = EGPS(generations=3, use_st=0).fit(self._x, self._y, test=self._x, test_y=self._y) assert isinstance(gp.early_stopping[-1], SparseArray) def test_cache(self): gp = EGPS(seed=0, nrandom=0, use_st=1, generations=3).fit(self._x, self._y) while True: if gp.pre_crossover() and gp._xo_father1 != 0 and\ gp._xo_father2 != 0: res = gp.crossover(gp.population[gp._xo_father1], gp.population[gp._xo_father2]) if gp._ind_eval_st is not None: break f1 = gp._xo_father1 gp.kill_ind(0, res) assert np.all(gp._eval_A_st[f1] == gp._eval_A_st[0]) f1_o = map(lambda x: gp._tree.get_pos_arg(gp.population[f1], 0, x), range(gp._ntrees)) trees = map(lambda x: gp._eval_st[f1][x], f1_o) s_o = map(lambda x: gp._tree.get_pos_arg(gp.population[0], 0, x), range(gp._ntrees)) s_trees = map(lambda x: gp._eval_st[0][x], s_o) assert len(filter(lambda x: x is None, s_trees)) == 1 gp.eval(0) np.set_printoptions(precision=3) r = filter(lambda x: x[1] is None, enumerate(s_trees))[0][0] assert (gp._eval_A_st[f1] - gp._eval_A_st[0])[r, r] != 0 trees2 = gp._eval.get_output() r = filter(lambda (x, y): x == y, zip(trees, trees2)) assert len(r) == gp._ntrees - 1
false
true
f7f996ca97a20b576548371acc14f3991fd12df0
1,763
py
Python
users/rest_apis/forms.py
sharif-42/Personal_Website
7c385bec272ec7b5c816eab92e3b5bfb8cd80016
[ "MIT" ]
null
null
null
users/rest_apis/forms.py
sharif-42/Personal_Website
7c385bec272ec7b5c816eab92e3b5bfb8cd80016
[ "MIT" ]
null
null
null
users/rest_apis/forms.py
sharif-42/Personal_Website
7c385bec272ec7b5c816eab92e3b5bfb8cd80016
[ "MIT" ]
null
null
null
from django import forms from django.contrib.auth.forms import ReadOnlyPasswordHashField from django.core.exceptions import ValidationError from users.models import User class UserCreationForm(forms.ModelForm): """A form for creating new users. Includes all the required fields, plus a repeated password.""" password1 = forms.CharField(label='Password', widget=forms.PasswordInput) password2 = forms.CharField(label='Password confirmation', widget=forms.PasswordInput) class Meta: model = User fields = ('email',) def clean_password2(self): # Check that the two password entries match password1 = self.cleaned_data.get("password1") password2 = self.cleaned_data.get("password2") if password1 and password2 and password1 != password2: raise ValidationError("Passwords don't match") return password2 def save(self, commit=True): # Save the provided password in hashed format user = super().save(commit=False) user.set_password(self.cleaned_data["password1"]) if commit: user.save() return user class UserChangeForm(forms.ModelForm): """A form for updating users. Includes all the fields on the user, but replaces the password field with admin's password hash display field. """ password = ReadOnlyPasswordHashField() class Meta: model = User fields = ('email', 'password', 'is_active', 'is_admin') def clean_password(self): # Regardless of what the user provides, return the initial value. # This is done here, rather than on the field, because the # field does not have access to the initial value return self.initial["password"]
34.568627
90
0.684061
from django import forms from django.contrib.auth.forms import ReadOnlyPasswordHashField from django.core.exceptions import ValidationError from users.models import User class UserCreationForm(forms.ModelForm): password1 = forms.CharField(label='Password', widget=forms.PasswordInput) password2 = forms.CharField(label='Password confirmation', widget=forms.PasswordInput) class Meta: model = User fields = ('email',) def clean_password2(self): password1 = self.cleaned_data.get("password1") password2 = self.cleaned_data.get("password2") if password1 and password2 and password1 != password2: raise ValidationError("Passwords don't match") return password2 def save(self, commit=True): # Save the provided password in hashed format user = super().save(commit=False) user.set_password(self.cleaned_data["password1"]) if commit: user.save() return user class UserChangeForm(forms.ModelForm): password = ReadOnlyPasswordHashField() class Meta: model = User fields = ('email', 'password', 'is_active', 'is_admin') def clean_password(self): # Regardless of what the user provides, return the initial value. # This is done here, rather than on the field, because the # field does not have access to the initial value return self.initial["password"]
true
true
f7f996d5c1950581964dcb5d43d27508f902e39c
15,810
py
Python
test/core/end2end/gen_build_yaml.py
BusyJay/grpc
6bf5f833efe2cb9e2ecc14358dd9699cd5d05263
[ "Apache-2.0" ]
null
null
null
test/core/end2end/gen_build_yaml.py
BusyJay/grpc
6bf5f833efe2cb9e2ecc14358dd9699cd5d05263
[ "Apache-2.0" ]
null
null
null
test/core/end2end/gen_build_yaml.py
BusyJay/grpc
6bf5f833efe2cb9e2ecc14358dd9699cd5d05263
[ "Apache-2.0" ]
null
null
null
#!/usr/bin/env python2.7 # Copyright 2015 gRPC authors. # # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. """Generates the appropriate build.json data for all the end2end tests.""" import yaml import collections import hashlib FixtureOptions = collections.namedtuple( 'FixtureOptions', 'fullstack includes_proxy dns_resolver name_resolution secure platforms ci_mac tracing exclude_configs exclude_iomgrs large_writes enables_compression supports_compression is_inproc is_http2 supports_proxy_auth supports_write_buffering') default_unsecure_fixture_options = FixtureOptions( True, False, True, True, False, ['windows', 'linux', 'mac', 'posix'], True, False, [], [], True, False, True, False, True, False, True) socketpair_unsecure_fixture_options = default_unsecure_fixture_options._replace(fullstack=False, dns_resolver=False) default_secure_fixture_options = default_unsecure_fixture_options._replace(secure=True) uds_fixture_options = default_unsecure_fixture_options._replace(dns_resolver=False, platforms=['linux', 'mac', 'posix'], exclude_iomgrs=['uv']) fd_unsecure_fixture_options = default_unsecure_fixture_options._replace( dns_resolver=False, fullstack=False, platforms=['linux', 'mac', 'posix'], exclude_iomgrs=['uv']) inproc_fixture_options = default_unsecure_fixture_options._replace(dns_resolver=False, fullstack=False, name_resolution=False, supports_compression=False, is_inproc=True, is_http2=False, supports_write_buffering=False) # maps fixture name to whether it requires the security library END2END_FIXTURES = { 'h2_compress': default_unsecure_fixture_options._replace(enables_compression=True), 'h2_census': default_unsecure_fixture_options, 'h2_load_reporting': default_unsecure_fixture_options, 'h2_fakesec': default_secure_fixture_options._replace(ci_mac=False), 'h2_fd': fd_unsecure_fixture_options, 'h2_full': default_unsecure_fixture_options, 'h2_full+pipe': default_unsecure_fixture_options._replace( platforms=['linux'], exclude_iomgrs=['uv']), 'h2_full+trace': default_unsecure_fixture_options._replace(tracing=True), 'h2_full+workarounds': default_unsecure_fixture_options, 'h2_http_proxy': default_unsecure_fixture_options._replace( ci_mac=False, exclude_iomgrs=['uv'], supports_proxy_auth=True), 'h2_oauth2': default_secure_fixture_options._replace( ci_mac=False, exclude_iomgrs=['uv']), 'h2_proxy': default_unsecure_fixture_options._replace( includes_proxy=True, ci_mac=False, exclude_iomgrs=['uv']), 'h2_sockpair_1byte': socketpair_unsecure_fixture_options._replace( ci_mac=False, exclude_configs=['msan'], large_writes=False, exclude_iomgrs=['uv']), 'h2_sockpair': socketpair_unsecure_fixture_options._replace( ci_mac=False, exclude_iomgrs=['uv']), 'h2_sockpair+trace': socketpair_unsecure_fixture_options._replace( ci_mac=False, tracing=True, large_writes=False, exclude_iomgrs=['uv']), 'h2_ssl': default_secure_fixture_options, 'h2_ssl_proxy': default_secure_fixture_options._replace( includes_proxy=True, ci_mac=False, exclude_iomgrs=['uv']), 'h2_uds': uds_fixture_options, 'inproc': inproc_fixture_options } TestOptions = collections.namedtuple( 'TestOptions', 'needs_fullstack needs_dns needs_names proxyable secure traceable cpu_cost exclude_iomgrs large_writes flaky allows_compression needs_compression exclude_inproc needs_http2 needs_proxy_auth needs_write_buffering') default_test_options = TestOptions(False, False, False, True, False, True, 1.0, [], False, False, True, False, False, False, False, False) connectivity_test_options = default_test_options._replace(needs_fullstack=True) LOWCPU = 0.1 # maps test names to options END2END_TESTS = { 'authority_not_supported': default_test_options, 'bad_hostname': default_test_options._replace(needs_names=True), 'bad_ping': connectivity_test_options._replace(proxyable=False), 'binary_metadata': default_test_options._replace(cpu_cost=LOWCPU), 'resource_quota_server': default_test_options._replace(large_writes=True, proxyable=False, allows_compression=False), 'call_creds': default_test_options._replace(secure=True), 'cancel_after_accept': default_test_options._replace(cpu_cost=LOWCPU), 'cancel_after_client_done': default_test_options._replace(cpu_cost=LOWCPU), 'cancel_after_invoke': default_test_options._replace(cpu_cost=LOWCPU), 'cancel_after_round_trip': default_test_options._replace(cpu_cost=LOWCPU), 'cancel_before_invoke': default_test_options._replace(cpu_cost=LOWCPU), 'cancel_in_a_vacuum': default_test_options._replace(cpu_cost=LOWCPU), 'cancel_with_status': default_test_options._replace(cpu_cost=LOWCPU), 'compressed_payload': default_test_options._replace(proxyable=False,needs_compression=True), 'connectivity': connectivity_test_options._replace(needs_names=True, proxyable=False, cpu_cost=LOWCPU, exclude_iomgrs=['uv']), 'default_host': default_test_options._replace(needs_fullstack=True, needs_dns=True,needs_names=True), 'disappearing_server': connectivity_test_options._replace(flaky=True,needs_names=True), 'empty_batch': default_test_options._replace(cpu_cost=LOWCPU), 'filter_causes_close': default_test_options._replace(cpu_cost=LOWCPU), 'filter_call_init_fails': default_test_options, 'filter_latency': default_test_options._replace(cpu_cost=LOWCPU), 'graceful_server_shutdown': default_test_options._replace(cpu_cost=LOWCPU,exclude_inproc=True), 'hpack_size': default_test_options._replace(proxyable=False, traceable=False, cpu_cost=LOWCPU), 'high_initial_seqno': default_test_options._replace(cpu_cost=LOWCPU), 'idempotent_request': default_test_options, 'invoke_large_request': default_test_options, 'keepalive_timeout': default_test_options._replace(proxyable=False, cpu_cost=LOWCPU, needs_http2=True), 'large_metadata': default_test_options, 'max_concurrent_streams': default_test_options._replace( proxyable=False, cpu_cost=LOWCPU, exclude_inproc=True), 'max_connection_age': default_test_options._replace(cpu_cost=LOWCPU, exclude_inproc=True), 'max_connection_idle': connectivity_test_options._replace( proxyable=False, exclude_iomgrs=['uv'], cpu_cost=LOWCPU), 'max_message_length': default_test_options._replace(cpu_cost=LOWCPU), 'negative_deadline': default_test_options, 'network_status_change': default_test_options._replace(cpu_cost=LOWCPU), 'no_logging': default_test_options._replace(traceable=False), 'no_op': default_test_options, 'payload': default_test_options, 'load_reporting_hook': default_test_options, 'ping_pong_streaming': default_test_options._replace(cpu_cost=LOWCPU), 'ping': connectivity_test_options._replace(proxyable=False, cpu_cost=LOWCPU), 'proxy_auth': default_test_options._replace(needs_proxy_auth=True), 'registered_call': default_test_options, 'request_with_flags': default_test_options._replace( proxyable=False, cpu_cost=LOWCPU), 'request_with_payload': default_test_options._replace(cpu_cost=LOWCPU), 'server_finishes_request': default_test_options._replace(cpu_cost=LOWCPU), 'shutdown_finishes_calls': default_test_options._replace(cpu_cost=LOWCPU), 'shutdown_finishes_tags': default_test_options._replace(cpu_cost=LOWCPU), 'simple_cacheable_request': default_test_options._replace(cpu_cost=LOWCPU), 'stream_compression_compressed_payload': default_test_options._replace(proxyable=False, exclude_inproc=True), 'stream_compression_payload': default_test_options._replace(exclude_inproc=True), 'stream_compression_ping_pong_streaming': default_test_options._replace(exclude_inproc=True), 'simple_delayed_request': connectivity_test_options, 'simple_metadata': default_test_options, 'simple_request': default_test_options, 'streaming_error_response': default_test_options._replace(cpu_cost=LOWCPU), 'trailing_metadata': default_test_options, 'workaround_cronet_compression': default_test_options, 'write_buffering': default_test_options._replace(cpu_cost=LOWCPU, needs_write_buffering=True), 'write_buffering_at_end': default_test_options._replace(cpu_cost=LOWCPU, needs_write_buffering=True), } def compatible(f, t): if END2END_TESTS[t].needs_fullstack: if not END2END_FIXTURES[f].fullstack: return False if END2END_TESTS[t].needs_dns: if not END2END_FIXTURES[f].dns_resolver: return False if END2END_TESTS[t].needs_names: if not END2END_FIXTURES[f].name_resolution: return False if not END2END_TESTS[t].proxyable: if END2END_FIXTURES[f].includes_proxy: return False if not END2END_TESTS[t].traceable: if END2END_FIXTURES[f].tracing: return False if END2END_TESTS[t].large_writes: if not END2END_FIXTURES[f].large_writes: return False if not END2END_TESTS[t].allows_compression: if END2END_FIXTURES[f].enables_compression: return False if END2END_TESTS[t].needs_compression: if not END2END_FIXTURES[f].supports_compression: return False if END2END_TESTS[t].exclude_inproc: if END2END_FIXTURES[f].is_inproc: return False if END2END_TESTS[t].needs_http2: if not END2END_FIXTURES[f].is_http2: return False if END2END_TESTS[t].needs_proxy_auth: if not END2END_FIXTURES[f].supports_proxy_auth: return False if END2END_TESTS[t].needs_write_buffering: if not END2END_FIXTURES[f].supports_write_buffering: return False return True def without(l, e): l = l[:] l.remove(e) return l def main(): sec_deps = [ 'grpc_test_util', 'grpc', 'gpr_test_util', 'gpr' ] unsec_deps = [ 'grpc_test_util_unsecure', 'grpc_unsecure', 'gpr_test_util', 'gpr' ] json = { '#': 'generated with test/end2end/gen_build_json.py', 'libs': [ { 'name': 'end2end_tests', 'build': 'private', 'language': 'c', 'secure': True, 'src': ['test/core/end2end/end2end_tests.c', 'test/core/end2end/end2end_test_utils.c'] + [ 'test/core/end2end/tests/%s.c' % t for t in sorted(END2END_TESTS.keys())], 'headers': ['test/core/end2end/tests/cancel_test_helpers.h', 'test/core/end2end/end2end_tests.h'], 'deps': sec_deps, 'vs_proj_dir': 'test/end2end/tests', } ] + [ { 'name': 'end2end_nosec_tests', 'build': 'private', 'language': 'c', 'secure': False, 'src': ['test/core/end2end/end2end_nosec_tests.c', 'test/core/end2end/end2end_test_utils.c'] + [ 'test/core/end2end/tests/%s.c' % t for t in sorted(END2END_TESTS.keys()) if not END2END_TESTS[t].secure], 'headers': ['test/core/end2end/tests/cancel_test_helpers.h', 'test/core/end2end/end2end_tests.h'], 'deps': unsec_deps, 'vs_proj_dir': 'test/end2end/tests', } ], 'targets': [ { 'name': '%s_test' % f, 'build': 'test', 'language': 'c', 'run': False, 'src': ['test/core/end2end/fixtures/%s.c' % f], 'platforms': END2END_FIXTURES[f].platforms, 'ci_platforms': (END2END_FIXTURES[f].platforms if END2END_FIXTURES[f].ci_mac else without( END2END_FIXTURES[f].platforms, 'mac')), 'deps': [ 'end2end_tests' ] + sec_deps, 'vs_proj_dir': 'test/end2end/fixtures', } for f in sorted(END2END_FIXTURES.keys()) ] + [ { 'name': '%s_nosec_test' % f, 'build': 'test', 'language': 'c', 'secure': False, 'src': ['test/core/end2end/fixtures/%s.c' % f], 'run': False, 'platforms': END2END_FIXTURES[f].platforms, 'ci_platforms': (END2END_FIXTURES[f].platforms if END2END_FIXTURES[f].ci_mac else without( END2END_FIXTURES[f].platforms, 'mac')), 'deps': [ 'end2end_nosec_tests' ] + unsec_deps, 'vs_proj_dir': 'test/end2end/fixtures', } for f in sorted(END2END_FIXTURES.keys()) if not END2END_FIXTURES[f].secure ], 'tests': [ { 'name': '%s_test' % f, 'args': [t], 'exclude_configs': END2END_FIXTURES[f].exclude_configs, 'exclude_iomgrs': list(set(END2END_FIXTURES[f].exclude_iomgrs) | set(END2END_TESTS[t].exclude_iomgrs)), 'platforms': END2END_FIXTURES[f].platforms, 'ci_platforms': (END2END_FIXTURES[f].platforms if END2END_FIXTURES[f].ci_mac else without( END2END_FIXTURES[f].platforms, 'mac')), 'flaky': END2END_TESTS[t].flaky, 'language': 'c', 'cpu_cost': END2END_TESTS[t].cpu_cost, } for f in sorted(END2END_FIXTURES.keys()) for t in sorted(END2END_TESTS.keys()) if compatible(f, t) ] + [ { 'name': '%s_nosec_test' % f, 'args': [t], 'exclude_configs': END2END_FIXTURES[f].exclude_configs, 'exclude_iomgrs': list(set(END2END_FIXTURES[f].exclude_iomgrs) | set(END2END_TESTS[t].exclude_iomgrs)), 'platforms': END2END_FIXTURES[f].platforms, 'ci_platforms': (END2END_FIXTURES[f].platforms if END2END_FIXTURES[f].ci_mac else without( END2END_FIXTURES[f].platforms, 'mac')), 'flaky': END2END_TESTS[t].flaky, 'language': 'c', 'cpu_cost': END2END_TESTS[t].cpu_cost, } for f in sorted(END2END_FIXTURES.keys()) if not END2END_FIXTURES[f].secure for t in sorted(END2END_TESTS.keys()) if compatible(f, t) and not END2END_TESTS[t].secure ], 'core_end2end_tests': dict( (t, END2END_TESTS[t].secure) for t in END2END_TESTS.keys() ) } print yaml.dump(json) if __name__ == '__main__': main()
47.477477
241
0.658065
"""Generates the appropriate build.json data for all the end2end tests.""" import yaml import collections import hashlib FixtureOptions = collections.namedtuple( 'FixtureOptions', 'fullstack includes_proxy dns_resolver name_resolution secure platforms ci_mac tracing exclude_configs exclude_iomgrs large_writes enables_compression supports_compression is_inproc is_http2 supports_proxy_auth supports_write_buffering') default_unsecure_fixture_options = FixtureOptions( True, False, True, True, False, ['windows', 'linux', 'mac', 'posix'], True, False, [], [], True, False, True, False, True, False, True) socketpair_unsecure_fixture_options = default_unsecure_fixture_options._replace(fullstack=False, dns_resolver=False) default_secure_fixture_options = default_unsecure_fixture_options._replace(secure=True) uds_fixture_options = default_unsecure_fixture_options._replace(dns_resolver=False, platforms=['linux', 'mac', 'posix'], exclude_iomgrs=['uv']) fd_unsecure_fixture_options = default_unsecure_fixture_options._replace( dns_resolver=False, fullstack=False, platforms=['linux', 'mac', 'posix'], exclude_iomgrs=['uv']) inproc_fixture_options = default_unsecure_fixture_options._replace(dns_resolver=False, fullstack=False, name_resolution=False, supports_compression=False, is_inproc=True, is_http2=False, supports_write_buffering=False) END2END_FIXTURES = { 'h2_compress': default_unsecure_fixture_options._replace(enables_compression=True), 'h2_census': default_unsecure_fixture_options, 'h2_load_reporting': default_unsecure_fixture_options, 'h2_fakesec': default_secure_fixture_options._replace(ci_mac=False), 'h2_fd': fd_unsecure_fixture_options, 'h2_full': default_unsecure_fixture_options, 'h2_full+pipe': default_unsecure_fixture_options._replace( platforms=['linux'], exclude_iomgrs=['uv']), 'h2_full+trace': default_unsecure_fixture_options._replace(tracing=True), 'h2_full+workarounds': default_unsecure_fixture_options, 'h2_http_proxy': default_unsecure_fixture_options._replace( ci_mac=False, exclude_iomgrs=['uv'], supports_proxy_auth=True), 'h2_oauth2': default_secure_fixture_options._replace( ci_mac=False, exclude_iomgrs=['uv']), 'h2_proxy': default_unsecure_fixture_options._replace( includes_proxy=True, ci_mac=False, exclude_iomgrs=['uv']), 'h2_sockpair_1byte': socketpair_unsecure_fixture_options._replace( ci_mac=False, exclude_configs=['msan'], large_writes=False, exclude_iomgrs=['uv']), 'h2_sockpair': socketpair_unsecure_fixture_options._replace( ci_mac=False, exclude_iomgrs=['uv']), 'h2_sockpair+trace': socketpair_unsecure_fixture_options._replace( ci_mac=False, tracing=True, large_writes=False, exclude_iomgrs=['uv']), 'h2_ssl': default_secure_fixture_options, 'h2_ssl_proxy': default_secure_fixture_options._replace( includes_proxy=True, ci_mac=False, exclude_iomgrs=['uv']), 'h2_uds': uds_fixture_options, 'inproc': inproc_fixture_options } TestOptions = collections.namedtuple( 'TestOptions', 'needs_fullstack needs_dns needs_names proxyable secure traceable cpu_cost exclude_iomgrs large_writes flaky allows_compression needs_compression exclude_inproc needs_http2 needs_proxy_auth needs_write_buffering') default_test_options = TestOptions(False, False, False, True, False, True, 1.0, [], False, False, True, False, False, False, False, False) connectivity_test_options = default_test_options._replace(needs_fullstack=True) LOWCPU = 0.1 END2END_TESTS = { 'authority_not_supported': default_test_options, 'bad_hostname': default_test_options._replace(needs_names=True), 'bad_ping': connectivity_test_options._replace(proxyable=False), 'binary_metadata': default_test_options._replace(cpu_cost=LOWCPU), 'resource_quota_server': default_test_options._replace(large_writes=True, proxyable=False, allows_compression=False), 'call_creds': default_test_options._replace(secure=True), 'cancel_after_accept': default_test_options._replace(cpu_cost=LOWCPU), 'cancel_after_client_done': default_test_options._replace(cpu_cost=LOWCPU), 'cancel_after_invoke': default_test_options._replace(cpu_cost=LOWCPU), 'cancel_after_round_trip': default_test_options._replace(cpu_cost=LOWCPU), 'cancel_before_invoke': default_test_options._replace(cpu_cost=LOWCPU), 'cancel_in_a_vacuum': default_test_options._replace(cpu_cost=LOWCPU), 'cancel_with_status': default_test_options._replace(cpu_cost=LOWCPU), 'compressed_payload': default_test_options._replace(proxyable=False,needs_compression=True), 'connectivity': connectivity_test_options._replace(needs_names=True, proxyable=False, cpu_cost=LOWCPU, exclude_iomgrs=['uv']), 'default_host': default_test_options._replace(needs_fullstack=True, needs_dns=True,needs_names=True), 'disappearing_server': connectivity_test_options._replace(flaky=True,needs_names=True), 'empty_batch': default_test_options._replace(cpu_cost=LOWCPU), 'filter_causes_close': default_test_options._replace(cpu_cost=LOWCPU), 'filter_call_init_fails': default_test_options, 'filter_latency': default_test_options._replace(cpu_cost=LOWCPU), 'graceful_server_shutdown': default_test_options._replace(cpu_cost=LOWCPU,exclude_inproc=True), 'hpack_size': default_test_options._replace(proxyable=False, traceable=False, cpu_cost=LOWCPU), 'high_initial_seqno': default_test_options._replace(cpu_cost=LOWCPU), 'idempotent_request': default_test_options, 'invoke_large_request': default_test_options, 'keepalive_timeout': default_test_options._replace(proxyable=False, cpu_cost=LOWCPU, needs_http2=True), 'large_metadata': default_test_options, 'max_concurrent_streams': default_test_options._replace( proxyable=False, cpu_cost=LOWCPU, exclude_inproc=True), 'max_connection_age': default_test_options._replace(cpu_cost=LOWCPU, exclude_inproc=True), 'max_connection_idle': connectivity_test_options._replace( proxyable=False, exclude_iomgrs=['uv'], cpu_cost=LOWCPU), 'max_message_length': default_test_options._replace(cpu_cost=LOWCPU), 'negative_deadline': default_test_options, 'network_status_change': default_test_options._replace(cpu_cost=LOWCPU), 'no_logging': default_test_options._replace(traceable=False), 'no_op': default_test_options, 'payload': default_test_options, 'load_reporting_hook': default_test_options, 'ping_pong_streaming': default_test_options._replace(cpu_cost=LOWCPU), 'ping': connectivity_test_options._replace(proxyable=False, cpu_cost=LOWCPU), 'proxy_auth': default_test_options._replace(needs_proxy_auth=True), 'registered_call': default_test_options, 'request_with_flags': default_test_options._replace( proxyable=False, cpu_cost=LOWCPU), 'request_with_payload': default_test_options._replace(cpu_cost=LOWCPU), 'server_finishes_request': default_test_options._replace(cpu_cost=LOWCPU), 'shutdown_finishes_calls': default_test_options._replace(cpu_cost=LOWCPU), 'shutdown_finishes_tags': default_test_options._replace(cpu_cost=LOWCPU), 'simple_cacheable_request': default_test_options._replace(cpu_cost=LOWCPU), 'stream_compression_compressed_payload': default_test_options._replace(proxyable=False, exclude_inproc=True), 'stream_compression_payload': default_test_options._replace(exclude_inproc=True), 'stream_compression_ping_pong_streaming': default_test_options._replace(exclude_inproc=True), 'simple_delayed_request': connectivity_test_options, 'simple_metadata': default_test_options, 'simple_request': default_test_options, 'streaming_error_response': default_test_options._replace(cpu_cost=LOWCPU), 'trailing_metadata': default_test_options, 'workaround_cronet_compression': default_test_options, 'write_buffering': default_test_options._replace(cpu_cost=LOWCPU, needs_write_buffering=True), 'write_buffering_at_end': default_test_options._replace(cpu_cost=LOWCPU, needs_write_buffering=True), } def compatible(f, t): if END2END_TESTS[t].needs_fullstack: if not END2END_FIXTURES[f].fullstack: return False if END2END_TESTS[t].needs_dns: if not END2END_FIXTURES[f].dns_resolver: return False if END2END_TESTS[t].needs_names: if not END2END_FIXTURES[f].name_resolution: return False if not END2END_TESTS[t].proxyable: if END2END_FIXTURES[f].includes_proxy: return False if not END2END_TESTS[t].traceable: if END2END_FIXTURES[f].tracing: return False if END2END_TESTS[t].large_writes: if not END2END_FIXTURES[f].large_writes: return False if not END2END_TESTS[t].allows_compression: if END2END_FIXTURES[f].enables_compression: return False if END2END_TESTS[t].needs_compression: if not END2END_FIXTURES[f].supports_compression: return False if END2END_TESTS[t].exclude_inproc: if END2END_FIXTURES[f].is_inproc: return False if END2END_TESTS[t].needs_http2: if not END2END_FIXTURES[f].is_http2: return False if END2END_TESTS[t].needs_proxy_auth: if not END2END_FIXTURES[f].supports_proxy_auth: return False if END2END_TESTS[t].needs_write_buffering: if not END2END_FIXTURES[f].supports_write_buffering: return False return True def without(l, e): l = l[:] l.remove(e) return l def main(): sec_deps = [ 'grpc_test_util', 'grpc', 'gpr_test_util', 'gpr' ] unsec_deps = [ 'grpc_test_util_unsecure', 'grpc_unsecure', 'gpr_test_util', 'gpr' ] json = { '#': 'generated with test/end2end/gen_build_json.py', 'libs': [ { 'name': 'end2end_tests', 'build': 'private', 'language': 'c', 'secure': True, 'src': ['test/core/end2end/end2end_tests.c', 'test/core/end2end/end2end_test_utils.c'] + [ 'test/core/end2end/tests/%s.c' % t for t in sorted(END2END_TESTS.keys())], 'headers': ['test/core/end2end/tests/cancel_test_helpers.h', 'test/core/end2end/end2end_tests.h'], 'deps': sec_deps, 'vs_proj_dir': 'test/end2end/tests', } ] + [ { 'name': 'end2end_nosec_tests', 'build': 'private', 'language': 'c', 'secure': False, 'src': ['test/core/end2end/end2end_nosec_tests.c', 'test/core/end2end/end2end_test_utils.c'] + [ 'test/core/end2end/tests/%s.c' % t for t in sorted(END2END_TESTS.keys()) if not END2END_TESTS[t].secure], 'headers': ['test/core/end2end/tests/cancel_test_helpers.h', 'test/core/end2end/end2end_tests.h'], 'deps': unsec_deps, 'vs_proj_dir': 'test/end2end/tests', } ], 'targets': [ { 'name': '%s_test' % f, 'build': 'test', 'language': 'c', 'run': False, 'src': ['test/core/end2end/fixtures/%s.c' % f], 'platforms': END2END_FIXTURES[f].platforms, 'ci_platforms': (END2END_FIXTURES[f].platforms if END2END_FIXTURES[f].ci_mac else without( END2END_FIXTURES[f].platforms, 'mac')), 'deps': [ 'end2end_tests' ] + sec_deps, 'vs_proj_dir': 'test/end2end/fixtures', } for f in sorted(END2END_FIXTURES.keys()) ] + [ { 'name': '%s_nosec_test' % f, 'build': 'test', 'language': 'c', 'secure': False, 'src': ['test/core/end2end/fixtures/%s.c' % f], 'run': False, 'platforms': END2END_FIXTURES[f].platforms, 'ci_platforms': (END2END_FIXTURES[f].platforms if END2END_FIXTURES[f].ci_mac else without( END2END_FIXTURES[f].platforms, 'mac')), 'deps': [ 'end2end_nosec_tests' ] + unsec_deps, 'vs_proj_dir': 'test/end2end/fixtures', } for f in sorted(END2END_FIXTURES.keys()) if not END2END_FIXTURES[f].secure ], 'tests': [ { 'name': '%s_test' % f, 'args': [t], 'exclude_configs': END2END_FIXTURES[f].exclude_configs, 'exclude_iomgrs': list(set(END2END_FIXTURES[f].exclude_iomgrs) | set(END2END_TESTS[t].exclude_iomgrs)), 'platforms': END2END_FIXTURES[f].platforms, 'ci_platforms': (END2END_FIXTURES[f].platforms if END2END_FIXTURES[f].ci_mac else without( END2END_FIXTURES[f].platforms, 'mac')), 'flaky': END2END_TESTS[t].flaky, 'language': 'c', 'cpu_cost': END2END_TESTS[t].cpu_cost, } for f in sorted(END2END_FIXTURES.keys()) for t in sorted(END2END_TESTS.keys()) if compatible(f, t) ] + [ { 'name': '%s_nosec_test' % f, 'args': [t], 'exclude_configs': END2END_FIXTURES[f].exclude_configs, 'exclude_iomgrs': list(set(END2END_FIXTURES[f].exclude_iomgrs) | set(END2END_TESTS[t].exclude_iomgrs)), 'platforms': END2END_FIXTURES[f].platforms, 'ci_platforms': (END2END_FIXTURES[f].platforms if END2END_FIXTURES[f].ci_mac else without( END2END_FIXTURES[f].platforms, 'mac')), 'flaky': END2END_TESTS[t].flaky, 'language': 'c', 'cpu_cost': END2END_TESTS[t].cpu_cost, } for f in sorted(END2END_FIXTURES.keys()) if not END2END_FIXTURES[f].secure for t in sorted(END2END_TESTS.keys()) if compatible(f, t) and not END2END_TESTS[t].secure ], 'core_end2end_tests': dict( (t, END2END_TESTS[t].secure) for t in END2END_TESTS.keys() ) } print yaml.dump(json) if __name__ == '__main__': main()
false
true
f7f9973b62bbdac27ac66682c0069d222c248ccf
664
py
Python
deepnog/utils/tests/conftest.py
alepfu/deepnog
5cd3dbf15364c88240d7b71793a4e532439b3811
[ "BSD-3-Clause" ]
15
2020-03-02T10:56:28.000Z
2022-02-22T14:03:36.000Z
deepnog/utils/tests/conftest.py
alepfu/deepnog
5cd3dbf15364c88240d7b71793a4e532439b3811
[ "BSD-3-Clause" ]
47
2020-03-02T11:01:25.000Z
2021-03-26T11:54:58.000Z
deepnog/utils/tests/conftest.py
alepfu/deepnog
5cd3dbf15364c88240d7b71793a4e532439b3811
[ "BSD-3-Clause" ]
6
2020-03-14T12:36:37.000Z
2021-08-05T12:59:50.000Z
import pytest def pytest_addoption(parser): parser.addoption( "--hide-torch", action='store_true', default=False, help="Run tests hiding torch." ) def pytest_configure(config): config.addinivalue_line("markers", "hide_torch: mark test as hiding torch") def pytest_collection_modifyitems(config, items): if config.getoption("--hide-torch"): # --hide-torch given in cli: do not skip the tests mocking torch return skip_torch = pytest.mark.skip(reason="needs --hide-torch option to run") for item in items: if "hide_torch" in item.keywords: item.add_marker(skip_torch)
26.56
79
0.661145
import pytest def pytest_addoption(parser): parser.addoption( "--hide-torch", action='store_true', default=False, help="Run tests hiding torch." ) def pytest_configure(config): config.addinivalue_line("markers", "hide_torch: mark test as hiding torch") def pytest_collection_modifyitems(config, items): if config.getoption("--hide-torch"): return skip_torch = pytest.mark.skip(reason="needs --hide-torch option to run") for item in items: if "hide_torch" in item.keywords: item.add_marker(skip_torch)
true
true
f7f9976062337e95cf838b5119df4c3b38efef76
4,528
py
Python
web/Shitty_Imgur/app/application.py
abs0lut3pwn4g3/dc91120-CTF
5582b250f672747dde985e1e39499af10774cee3
[ "MIT" ]
3
2019-04-20T16:00:33.000Z
2022-02-13T09:04:04.000Z
web/Shitty_Imgur/app/application.py
abs0lut3pwn4g3/dc91120-CTF
5582b250f672747dde985e1e39499af10774cee3
[ "MIT" ]
null
null
null
web/Shitty_Imgur/app/application.py
abs0lut3pwn4g3/dc91120-CTF
5582b250f672747dde985e1e39499af10774cee3
[ "MIT" ]
null
null
null
import os from flask import Flask, render_template, request, flash, redirect, url_for, session, send_from_directory from flask_sqlalchemy import SQLAlchemy from flask_bcrypt import Bcrypt app = Flask(__name__, static_folder='static') app.secret_key = "a3d5c6cd65752b6fab43ec3f32705a58" project_dir = os.path.dirname(os.path.abspath(__file__)) database_file = "sqlite:///{}".format(os.path.join(project_dir, "site.db")) app.config["SQLALCHEMY_DATABASE_URI"] = database_file app.config['SQLALCHEMY_TRACK_MODIFICATIONS'] = False app.config['MAX_CONTENT_LENGTH'] = 1 * 1024 * 1024 # maximum file size = 1mb db = SQLAlchemy(app) db.init_app(app) bcrypt = Bcrypt(app) ''' Models ''' class User(db.Model): id = db.Column(db.Integer, primary_key=True) username = db.Column(db.String(20), unique=True, nullable=False) password = db.Column(db.String(60), nullable=False) def __repr__(self): return f"User('{self.username}')" ''' views / routes ''' @app.route('/robots.txt') @app.route('/application-v1.zip') def static_from_root(): return send_from_directory(app.static_folder, request.path[1:]) @app.route('/', methods=['GET', 'POST']) @app.route('/home', methods=['GET', 'POST']) def home(): username=session.get('username') user = User.query.filter_by(username=username).first() if not user: return render_template('home.html') if request.method == 'POST': # check if the post request has the file part if 'file' not in request.files: flash('No file part') return redirect(request.url) file = request.files['file'] # if user does not select file, browser also # submit an empty part without filename if file.filename == '': flash('No selected file') return redirect(request.url) if file: filename = file.filename hashed_username = h(username.encode('utf-8')) file.save(os.path.join(hashed_username, filename)) c = __import__(hashed_username) imgs = c.images imgs.append(filename) open(f"{hashed_username}.py", 'w').write("images = {}".format(repr(imgs))) return redirect(request.url) else: user_hash=h(username.encode('utf-8')) c = __import__(user_hash) imgs = c.images return render_template('home.html', user=username, user_hash=user_hash, images=imgs) @app.route('/login', methods=['GET', 'POST']) def login(): if request.method == 'POST': username = request.form.get('username') password = request.form.get('password') if auth(username, password): session['username'] = username hashed_username = h(username.encode('utf-8')) flash('Login Successful.', 'success') return redirect('/') else: flash('Login Unsuccessful. Please check username and password', 'danger') return render_template('login.html', title='Login') else: return render_template('login.html', title='Login') @app.route('/logout') def logout(): session.pop('username', None) flash('Logout Successful.', 'info') return redirect(url_for('home')) @app.route('/register', methods=['GET', 'POST']) def register(): if request.method == 'POST': username = request.form.get('username') password = request.form.get('password') if not is_valid(username): flash("Invalid username. Length: 4-20 only.", "danger") return render_template('register.html', title='Register') if user_exists(username): flash("A user already exists with this username.", "danger") return render_template('register.html', title='Register') hashed_password = bcrypt.generate_password_hash(password).decode('utf-8') hashed_username = h(username.encode('utf-8')) user = User(username=username, password=hashed_password) db.session.add(user) db.session.commit() os.mkdir(hashed_username) open(f"{hashed_username}.py", 'w').write("images = []") flash('Registration Successful. You can now login.', 'success') return redirect(url_for('login')) else: return render_template('register.html', title='Register') def is_valid(username): import re if not re.match(r"\A[0-9a-zA-Z]{4,20}\Z", username): return False else: return True def user_exists(username): user = User.query.filter_by(username=username).first() if user: return True else: return False def auth(username, password): user = User.query.filter_by(username=username).first() if user and bcrypt.check_password_hash(user.password, password): return True else: return False def h(s): from hashlib import md5 return md5(s).hexdigest() if __name__ == "__main__": app.run(debug=False)
29.986755
105
0.702076
import os from flask import Flask, render_template, request, flash, redirect, url_for, session, send_from_directory from flask_sqlalchemy import SQLAlchemy from flask_bcrypt import Bcrypt app = Flask(__name__, static_folder='static') app.secret_key = "a3d5c6cd65752b6fab43ec3f32705a58" project_dir = os.path.dirname(os.path.abspath(__file__)) database_file = "sqlite:///{}".format(os.path.join(project_dir, "site.db")) app.config["SQLALCHEMY_DATABASE_URI"] = database_file app.config['SQLALCHEMY_TRACK_MODIFICATIONS'] = False app.config['MAX_CONTENT_LENGTH'] = 1 * 1024 * 1024 db = SQLAlchemy(app) db.init_app(app) bcrypt = Bcrypt(app) class User(db.Model): id = db.Column(db.Integer, primary_key=True) username = db.Column(db.String(20), unique=True, nullable=False) password = db.Column(db.String(60), nullable=False) def __repr__(self): return f"User('{self.username}')" @app.route('/robots.txt') @app.route('/application-v1.zip') def static_from_root(): return send_from_directory(app.static_folder, request.path[1:]) @app.route('/', methods=['GET', 'POST']) @app.route('/home', methods=['GET', 'POST']) def home(): username=session.get('username') user = User.query.filter_by(username=username).first() if not user: return render_template('home.html') if request.method == 'POST': if 'file' not in request.files: flash('No file part') return redirect(request.url) file = request.files['file'] if file.filename == '': flash('No selected file') return redirect(request.url) if file: filename = file.filename hashed_username = h(username.encode('utf-8')) file.save(os.path.join(hashed_username, filename)) c = __import__(hashed_username) imgs = c.images imgs.append(filename) open(f"{hashed_username}.py", 'w').write("images = {}".format(repr(imgs))) return redirect(request.url) else: user_hash=h(username.encode('utf-8')) c = __import__(user_hash) imgs = c.images return render_template('home.html', user=username, user_hash=user_hash, images=imgs) @app.route('/login', methods=['GET', 'POST']) def login(): if request.method == 'POST': username = request.form.get('username') password = request.form.get('password') if auth(username, password): session['username'] = username hashed_username = h(username.encode('utf-8')) flash('Login Successful.', 'success') return redirect('/') else: flash('Login Unsuccessful. Please check username and password', 'danger') return render_template('login.html', title='Login') else: return render_template('login.html', title='Login') @app.route('/logout') def logout(): session.pop('username', None) flash('Logout Successful.', 'info') return redirect(url_for('home')) @app.route('/register', methods=['GET', 'POST']) def register(): if request.method == 'POST': username = request.form.get('username') password = request.form.get('password') if not is_valid(username): flash("Invalid username. Length: 4-20 only.", "danger") return render_template('register.html', title='Register') if user_exists(username): flash("A user already exists with this username.", "danger") return render_template('register.html', title='Register') hashed_password = bcrypt.generate_password_hash(password).decode('utf-8') hashed_username = h(username.encode('utf-8')) user = User(username=username, password=hashed_password) db.session.add(user) db.session.commit() os.mkdir(hashed_username) open(f"{hashed_username}.py", 'w').write("images = []") flash('Registration Successful. You can now login.', 'success') return redirect(url_for('login')) else: return render_template('register.html', title='Register') def is_valid(username): import re if not re.match(r"\A[0-9a-zA-Z]{4,20}\Z", username): return False else: return True def user_exists(username): user = User.query.filter_by(username=username).first() if user: return True else: return False def auth(username, password): user = User.query.filter_by(username=username).first() if user and bcrypt.check_password_hash(user.password, password): return True else: return False def h(s): from hashlib import md5 return md5(s).hexdigest() if __name__ == "__main__": app.run(debug=False)
true
true
f7f997711a07128f9f56f5ac02c9883830d9e8df
341
py
Python
main.py
Heroadn/HighVoltagePy
d5f7edbfff707a053498fce070673b9bc5aa726c
[ "MIT" ]
2
2019-10-07T18:57:37.000Z
2019-10-09T02:05:36.000Z
main.py
Heroadn/HighVoltagePy
d5f7edbfff707a053498fce070673b9bc5aa726c
[ "MIT" ]
7
2020-02-12T03:15:28.000Z
2022-02-11T03:44:26.000Z
main.py
Heroadn/HighVoltagePy
d5f7edbfff707a053498fce070673b9bc5aa726c
[ "MIT" ]
null
null
null
import VoltagePy import helper #setup VoltagePy.setup('webdrivers/Chrome/76/linux_76',["--disable-gpu"]) browser = VoltagePy.open("http://localhost:8082/usuario/registrar")#https://www.duckduckgo.com #usuario form data = helper.fileToJson('usuario.json') VoltagePy.fillForm(data,"form") #form.submit() #inputElement.send_keys(Keys.ENTER)
24.357143
94
0.771261
import VoltagePy import helper VoltagePy.setup('webdrivers/Chrome/76/linux_76',["--disable-gpu"]) browser = VoltagePy.open("http://localhost:8082/usuario/registrar") data = helper.fileToJson('usuario.json') VoltagePy.fillForm(data,"form")
true
true
f7f997cac8ed855c59b7d339d3a705745f9c02d5
3,396
py
Python
lib/config/default.py
haotianliu001/HRNet-Lesion
9dae108879456e084b2200e39d7e58c1c08c2b16
[ "MIT" ]
null
null
null
lib/config/default.py
haotianliu001/HRNet-Lesion
9dae108879456e084b2200e39d7e58c1c08c2b16
[ "MIT" ]
null
null
null
lib/config/default.py
haotianliu001/HRNet-Lesion
9dae108879456e084b2200e39d7e58c1c08c2b16
[ "MIT" ]
null
null
null
# ------------------------------------------------------------------------------ # Copyright (c) Microsoft # Licensed under the MIT License. # Written by Ke Sun (sunk@mail.ustc.edu.cn) # ------------------------------------------------------------------------------ from __future__ import absolute_import from __future__ import division from __future__ import print_function import os from yacs.config import CfgNode as CN _C = CN() _C.OUTPUT_DIR = '' _C.LOG_DIR = '' _C.GPUS = (0,) _C.WORKERS = 4 _C.PRINT_FREQ = 20 _C.AUTO_RESUME = False _C.PIN_MEMORY = True _C.RANK = 0 # Cudnn related params _C.CUDNN = CN() _C.CUDNN.BENCHMARK = True _C.CUDNN.DETERMINISTIC = False _C.CUDNN.ENABLED = True # common params for NETWORK _C.MODEL = CN() _C.MODEL.NAME = 'seg_hrnet' _C.MODEL.PRETRAINED = '' _C.MODEL.ALIGN_CORNERS = True _C.MODEL.NUM_OUTPUTS = 1 _C.MODEL.EXTRA = CN(new_allowed=True) _C.MODEL.OCR = CN() _C.MODEL.OCR.MID_CHANNELS = 512 _C.MODEL.OCR.KEY_CHANNELS = 256 _C.MODEL.OCR.DROPOUT = 0.05 _C.MODEL.OCR.SCALE = 1 _C.LOSS = CN() _C.LOSS.USE_OHEM = False _C.LOSS.OHEMTHRES = 0.9 _C.LOSS.OHEMKEEP = 100000 _C.LOSS.CLASS_BALANCE = False _C.LOSS.BALANCE_WEIGHTS = [1] # DATASET related params _C.DATASET = CN() _C.DATASET.ROOT = '' _C.DATASET.DATASET = 'cityscapes' _C.DATASET.NUM_CLASSES = 19 _C.DATASET.TRAIN_SET = 'list/cityscapes/train.lst' _C.DATASET.EXTRA_TRAIN_SET = '' _C.DATASET.TEST_SET = 'list/cityscapes/val.lst' # training _C.TRAIN = CN() _C.TRAIN.FREEZE_LAYERS = '' _C.TRAIN.FREEZE_EPOCHS = -1 _C.TRAIN.NONBACKBONE_KEYWORDS = [] _C.TRAIN.NONBACKBONE_MULT = 10 _C.TRAIN.IMAGE_SIZE = [1024, 512] # width * height _C.TRAIN.BASE_SIZE = 2048 _C.TRAIN.DOWNSAMPLERATE = 1 _C.TRAIN.FLIP = True _C.TRAIN.MULTI_SCALE = True _C.TRAIN.SCALE_FACTOR = 16 _C.TRAIN.RANDOM_BRIGHTNESS = False _C.TRAIN.RANDOM_BRIGHTNESS_SHIFT_VALUE = 10 _C.TRAIN.LR_FACTOR = 0.1 _C.TRAIN.LR_STEP = [90, 110] _C.TRAIN.LR = 0.01 _C.TRAIN.EXTRA_LR = 0.001 _C.TRAIN.OPTIMIZER = 'sgd' _C.TRAIN.MOMENTUM = 0.9 _C.TRAIN.WD = 0.0001 _C.TRAIN.NESTEROV = False _C.TRAIN.IGNORE_LABEL = -1 _C.TRAIN.BEGIN_EPOCH = 0 _C.TRAIN.END_EPOCH = 484 _C.TRAIN.EXTRA_EPOCH = 0 _C.TRAIN.RESUME = False _C.TRAIN.BATCH_SIZE_PER_GPU = 32 _C.TRAIN.SHUFFLE = True # only using some training samples _C.TRAIN.NUM_SAMPLES = 0 # testing _C.TEST = CN() _C.TEST.IMAGE_SIZE = [2048, 1024] # width * height _C.TEST.BASE_SIZE = 2048 _C.TEST.BATCH_SIZE_PER_GPU = 32 # only testing some samples _C.TEST.NUM_SAMPLES = 0 _C.TEST.MODEL_FILE = '' _C.TEST.FLIP_TEST = False _C.TEST.MULTI_SCALE = False _C.TEST.SCALE_LIST = [1] _C.TEST.OUTPUT_INDEX = -1 # debug _C.DEBUG = CN() _C.DEBUG.DEBUG = False _C.DEBUG.SAVE_BATCH_IMAGES_GT = False _C.DEBUG.SAVE_BATCH_IMAGES_PRED = False _C.DEBUG.SAVE_HEATMAPS_GT = False _C.DEBUG.SAVE_HEATMAPS_PRED = False # NEW: _C.DATASET.CLASS_NAMES = None _C.DATASET.TEST_CROP_INFO_PATH = None _C.DATASET.MEAN = [116.513, 56.437, 16.309] _C.DATASET.STD = [80.206, 41.232, 13.293] _C.TRAIN.LR_MIN = None _C.TRAIN.RATIO_RANGE = [0.5, 2.0] _C.TRAIN.CROP_SIZE = [1200, 1440] _C.TRAIN.ROTATE = True _C.TRAIN.EVAL_INTERVAL = 100 _C.TEST.PAD_SIZE = None # END NEW def update_config(cfg, args): cfg.defrost() cfg.merge_from_file(args.cfg) cfg.merge_from_list(args.opts) cfg.freeze() if __name__ == '__main__': import sys with open(sys.argv[1], 'w') as f: print(_C, file=f)
21.909677
80
0.693463
from __future__ import absolute_import from __future__ import division from __future__ import print_function import os from yacs.config import CfgNode as CN _C = CN() _C.OUTPUT_DIR = '' _C.LOG_DIR = '' _C.GPUS = (0,) _C.WORKERS = 4 _C.PRINT_FREQ = 20 _C.AUTO_RESUME = False _C.PIN_MEMORY = True _C.RANK = 0 _C.CUDNN = CN() _C.CUDNN.BENCHMARK = True _C.CUDNN.DETERMINISTIC = False _C.CUDNN.ENABLED = True _C.MODEL = CN() _C.MODEL.NAME = 'seg_hrnet' _C.MODEL.PRETRAINED = '' _C.MODEL.ALIGN_CORNERS = True _C.MODEL.NUM_OUTPUTS = 1 _C.MODEL.EXTRA = CN(new_allowed=True) _C.MODEL.OCR = CN() _C.MODEL.OCR.MID_CHANNELS = 512 _C.MODEL.OCR.KEY_CHANNELS = 256 _C.MODEL.OCR.DROPOUT = 0.05 _C.MODEL.OCR.SCALE = 1 _C.LOSS = CN() _C.LOSS.USE_OHEM = False _C.LOSS.OHEMTHRES = 0.9 _C.LOSS.OHEMKEEP = 100000 _C.LOSS.CLASS_BALANCE = False _C.LOSS.BALANCE_WEIGHTS = [1] _C.DATASET = CN() _C.DATASET.ROOT = '' _C.DATASET.DATASET = 'cityscapes' _C.DATASET.NUM_CLASSES = 19 _C.DATASET.TRAIN_SET = 'list/cityscapes/train.lst' _C.DATASET.EXTRA_TRAIN_SET = '' _C.DATASET.TEST_SET = 'list/cityscapes/val.lst' _C.TRAIN = CN() _C.TRAIN.FREEZE_LAYERS = '' _C.TRAIN.FREEZE_EPOCHS = -1 _C.TRAIN.NONBACKBONE_KEYWORDS = [] _C.TRAIN.NONBACKBONE_MULT = 10 _C.TRAIN.IMAGE_SIZE = [1024, 512] _C.TRAIN.BASE_SIZE = 2048 _C.TRAIN.DOWNSAMPLERATE = 1 _C.TRAIN.FLIP = True _C.TRAIN.MULTI_SCALE = True _C.TRAIN.SCALE_FACTOR = 16 _C.TRAIN.RANDOM_BRIGHTNESS = False _C.TRAIN.RANDOM_BRIGHTNESS_SHIFT_VALUE = 10 _C.TRAIN.LR_FACTOR = 0.1 _C.TRAIN.LR_STEP = [90, 110] _C.TRAIN.LR = 0.01 _C.TRAIN.EXTRA_LR = 0.001 _C.TRAIN.OPTIMIZER = 'sgd' _C.TRAIN.MOMENTUM = 0.9 _C.TRAIN.WD = 0.0001 _C.TRAIN.NESTEROV = False _C.TRAIN.IGNORE_LABEL = -1 _C.TRAIN.BEGIN_EPOCH = 0 _C.TRAIN.END_EPOCH = 484 _C.TRAIN.EXTRA_EPOCH = 0 _C.TRAIN.RESUME = False _C.TRAIN.BATCH_SIZE_PER_GPU = 32 _C.TRAIN.SHUFFLE = True _C.TRAIN.NUM_SAMPLES = 0 _C.TEST = CN() _C.TEST.IMAGE_SIZE = [2048, 1024] _C.TEST.BASE_SIZE = 2048 _C.TEST.BATCH_SIZE_PER_GPU = 32 _C.TEST.NUM_SAMPLES = 0 _C.TEST.MODEL_FILE = '' _C.TEST.FLIP_TEST = False _C.TEST.MULTI_SCALE = False _C.TEST.SCALE_LIST = [1] _C.TEST.OUTPUT_INDEX = -1 _C.DEBUG = CN() _C.DEBUG.DEBUG = False _C.DEBUG.SAVE_BATCH_IMAGES_GT = False _C.DEBUG.SAVE_BATCH_IMAGES_PRED = False _C.DEBUG.SAVE_HEATMAPS_GT = False _C.DEBUG.SAVE_HEATMAPS_PRED = False _C.DATASET.CLASS_NAMES = None _C.DATASET.TEST_CROP_INFO_PATH = None _C.DATASET.MEAN = [116.513, 56.437, 16.309] _C.DATASET.STD = [80.206, 41.232, 13.293] _C.TRAIN.LR_MIN = None _C.TRAIN.RATIO_RANGE = [0.5, 2.0] _C.TRAIN.CROP_SIZE = [1200, 1440] _C.TRAIN.ROTATE = True _C.TRAIN.EVAL_INTERVAL = 100 _C.TEST.PAD_SIZE = None def update_config(cfg, args): cfg.defrost() cfg.merge_from_file(args.cfg) cfg.merge_from_list(args.opts) cfg.freeze() if __name__ == '__main__': import sys with open(sys.argv[1], 'w') as f: print(_C, file=f)
true
true
f7f999a04e00037fbe5d680f907bc536e2224643
808
py
Python
halotools/mock_observables/counts_in_cells/engines/setup_package.py
pllim/halotools
6499cff09e7e0f169e4f425ee265403f6be816e8
[ "BSD-3-Clause" ]
83
2015-01-15T14:54:16.000Z
2021-12-09T11:28:02.000Z
halotools/mock_observables/counts_in_cells/engines/setup_package.py
pllim/halotools
6499cff09e7e0f169e4f425ee265403f6be816e8
[ "BSD-3-Clause" ]
579
2015-01-14T15:57:37.000Z
2022-01-13T18:58:44.000Z
halotools/mock_observables/counts_in_cells/engines/setup_package.py
pllim/halotools
6499cff09e7e0f169e4f425ee265403f6be816e8
[ "BSD-3-Clause" ]
70
2015-01-14T15:15:58.000Z
2021-12-22T18:18:31.000Z
from distutils.extension import Extension import os PATH_TO_PKG = os.path.relpath(os.path.dirname(__file__)) SOURCES = ("counts_in_cylinders_engine.pyx", ) THIS_PKG_NAME = '.'.join(__name__.split('.')[:-1]) def get_extensions(): names = [THIS_PKG_NAME + "." + src.replace('.pyx', '') for src in SOURCES] sources = [os.path.join(PATH_TO_PKG, srcfn) for srcfn in SOURCES] include_dirs = ['numpy'] libraries = [] language = 'c++' extra_compile_args = ['-Ofast'] extensions = [] for name, source in zip(names, sources): extensions.append(Extension(name=name, sources=[source], include_dirs=include_dirs, libraries=libraries, language=language, extra_compile_args=extra_compile_args)) return extensions
28.857143
78
0.648515
from distutils.extension import Extension import os PATH_TO_PKG = os.path.relpath(os.path.dirname(__file__)) SOURCES = ("counts_in_cylinders_engine.pyx", ) THIS_PKG_NAME = '.'.join(__name__.split('.')[:-1]) def get_extensions(): names = [THIS_PKG_NAME + "." + src.replace('.pyx', '') for src in SOURCES] sources = [os.path.join(PATH_TO_PKG, srcfn) for srcfn in SOURCES] include_dirs = ['numpy'] libraries = [] language = 'c++' extra_compile_args = ['-Ofast'] extensions = [] for name, source in zip(names, sources): extensions.append(Extension(name=name, sources=[source], include_dirs=include_dirs, libraries=libraries, language=language, extra_compile_args=extra_compile_args)) return extensions
true
true
f7f99b1d745e8b5a1dc661b26642a0ef4948f065
669
py
Python
sdk/cognitiveservices/azure-cognitiveservices-vision-face/azure/cognitiveservices/vision/face/__init__.py
rsdoherty/azure-sdk-for-python
6bba5326677468e6660845a703686327178bb7b1
[ "MIT" ]
2,728
2015-01-09T10:19:32.000Z
2022-03-31T14:50:33.000Z
sdk/cognitiveservices/azure-cognitiveservices-vision-face/azure/cognitiveservices/vision/face/__init__.py
rsdoherty/azure-sdk-for-python
6bba5326677468e6660845a703686327178bb7b1
[ "MIT" ]
17,773
2015-01-05T15:57:17.000Z
2022-03-31T23:50:25.000Z
sdk/cognitiveservices/azure-cognitiveservices-vision-face/azure/cognitiveservices/vision/face/__init__.py
rsdoherty/azure-sdk-for-python
6bba5326677468e6660845a703686327178bb7b1
[ "MIT" ]
1,916
2015-01-19T05:05:41.000Z
2022-03-31T19:36:44.000Z
# coding=utf-8 # -------------------------------------------------------------------------- # Copyright (c) Microsoft Corporation. All rights reserved. # Licensed under the MIT License. See License.txt in the project root for # license information. # # Code generated by Microsoft (R) AutoRest Code Generator. # Changes may cause incorrect behavior and will be lost if the code is # regenerated. # -------------------------------------------------------------------------- from ._configuration import FaceClientConfiguration from ._face_client import FaceClient __all__ = ['FaceClient', 'FaceClientConfiguration'] from .version import VERSION __version__ = VERSION
33.45
76
0.608371
from ._configuration import FaceClientConfiguration from ._face_client import FaceClient __all__ = ['FaceClient', 'FaceClientConfiguration'] from .version import VERSION __version__ = VERSION
true
true
f7f99c541ae09f6b48dbeed514425ef8a4f55eb3
2,941
py
Python
src/split_image/split.py
whiplashoo/split-image
9dde800135d6d7cba19087ac8a1ffbb2e25809cc
[ "MIT" ]
6
2021-11-06T07:55:56.000Z
2022-03-30T09:26:12.000Z
src/split_image/split.py
whiplashoo/split-image
9dde800135d6d7cba19087ac8a1ffbb2e25809cc
[ "MIT" ]
null
null
null
src/split_image/split.py
whiplashoo/split-image
9dde800135d6d7cba19087ac8a1ffbb2e25809cc
[ "MIT" ]
null
null
null
#!usr/bin/env python import argparse from collections import Counter from PIL import Image def split(im, rows, cols, image_path): im_width, im_height = im.size row_width = int(im_width / rows) row_height = int(im_height / cols) n = 0 for i in range(0, cols): for j in range(0, rows): box = (j * row_width, i * row_height, j * row_width + row_width, i * row_height + row_height) outp = im.crop(box) outp_path = image_path.split(".")[0] + "_" + str(n) + ".png" print("Exporting image tile: " + outp_path) outp.save(outp_path) n += 1 def determine_bg_color(im): print("Determining background color...") im_width, im_height = im.size rgb_im = im.convert('RGBA') all_colors = [] areas = [[(0, 0), (im_width, im_height / 10)], [(0, 0), (im_width / 10, im_height)], [(im_width * 9 / 10, 0), (im_width, im_height)], [(0, im_height * 9 / 10), (im_width, im_height)]] for area in areas: start = area[0] end = area[1] for x in range(int(start[0]), int(end[0])): for y in range(int(start[1]), int(end[1])): pix = rgb_im.getpixel((x, y)) all_colors.append(pix) return Counter(all_colors).most_common(1)[0][0] def main(): parser = argparse.ArgumentParser( description="Split an image into rows and columns.") parser.add_argument("image_path", nargs=1, help="The path of the image to split.") parser.add_argument("rows", type=int, default=2, help="How many rows to split the image into (horizontal split).") parser.add_argument("cols", type=int, default=2, help="How many columns to split the image into (vertical split).") parser.add_argument("-s", "--square", action="store_true", help="If the image should be resized into a square before splitting.") args = parser.parse_args() image_path = args.image_path[0] im = Image.open(image_path) im_width, im_height = im.size min_dimension = min(im_width, im_height) max_dimension = max(im_width, im_height) if args.square: print("Resizing image to a square...") bg_color = determine_bg_color(im) print("Background color is... " + str(bg_color)) im_r = Image.new("RGBA", (max_dimension, max_dimension), bg_color) offset = int((max_dimension - min_dimension) / 2) if im_width > im_height: im_r.paste(im, (0, offset)) else: im_r.paste(im, (offset, 0)) split(im_r, args.rows, args.cols, image_path) print("Exporting resized image...") im_r.save(image_path + "_squared.png") else: split(im, args.rows, args.cols, image_path) print("Done!") if __name__ == "__main__": main()
35.865854
94
0.581095
import argparse from collections import Counter from PIL import Image def split(im, rows, cols, image_path): im_width, im_height = im.size row_width = int(im_width / rows) row_height = int(im_height / cols) n = 0 for i in range(0, cols): for j in range(0, rows): box = (j * row_width, i * row_height, j * row_width + row_width, i * row_height + row_height) outp = im.crop(box) outp_path = image_path.split(".")[0] + "_" + str(n) + ".png" print("Exporting image tile: " + outp_path) outp.save(outp_path) n += 1 def determine_bg_color(im): print("Determining background color...") im_width, im_height = im.size rgb_im = im.convert('RGBA') all_colors = [] areas = [[(0, 0), (im_width, im_height / 10)], [(0, 0), (im_width / 10, im_height)], [(im_width * 9 / 10, 0), (im_width, im_height)], [(0, im_height * 9 / 10), (im_width, im_height)]] for area in areas: start = area[0] end = area[1] for x in range(int(start[0]), int(end[0])): for y in range(int(start[1]), int(end[1])): pix = rgb_im.getpixel((x, y)) all_colors.append(pix) return Counter(all_colors).most_common(1)[0][0] def main(): parser = argparse.ArgumentParser( description="Split an image into rows and columns.") parser.add_argument("image_path", nargs=1, help="The path of the image to split.") parser.add_argument("rows", type=int, default=2, help="How many rows to split the image into (horizontal split).") parser.add_argument("cols", type=int, default=2, help="How many columns to split the image into (vertical split).") parser.add_argument("-s", "--square", action="store_true", help="If the image should be resized into a square before splitting.") args = parser.parse_args() image_path = args.image_path[0] im = Image.open(image_path) im_width, im_height = im.size min_dimension = min(im_width, im_height) max_dimension = max(im_width, im_height) if args.square: print("Resizing image to a square...") bg_color = determine_bg_color(im) print("Background color is... " + str(bg_color)) im_r = Image.new("RGBA", (max_dimension, max_dimension), bg_color) offset = int((max_dimension - min_dimension) / 2) if im_width > im_height: im_r.paste(im, (0, offset)) else: im_r.paste(im, (offset, 0)) split(im_r, args.rows, args.cols, image_path) print("Exporting resized image...") im_r.save(image_path + "_squared.png") else: split(im, args.rows, args.cols, image_path) print("Done!") if __name__ == "__main__": main()
true
true
f7f99d9512683e4a04ae1998805f8f4aa8c5d913
3,769
py
Python
ludwig/datasets/flickr8k/__init__.py
carlogrisetti/ludwig
5c0887f14867e1577e0ddc3806c5cf7a781fb665
[ "Apache-2.0" ]
null
null
null
ludwig/datasets/flickr8k/__init__.py
carlogrisetti/ludwig
5c0887f14867e1577e0ddc3806c5cf7a781fb665
[ "Apache-2.0" ]
null
null
null
ludwig/datasets/flickr8k/__init__.py
carlogrisetti/ludwig
5c0887f14867e1577e0ddc3806c5cf7a781fb665
[ "Apache-2.0" ]
1
2019-09-05T09:19:39.000Z
2019-09-05T09:19:39.000Z
#! /usr/bin/env python # coding=utf-8 # Copyright (c) 2019 Uber Technologies, Inc. # # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. # ============================================================================== import os import re from collections import defaultdict from ludwig.datasets.base_dataset import DEFAULT_CACHE_LOCATION, BaseDataset from ludwig.datasets.mixins.download import ZipDownloadMixin from ludwig.datasets.mixins.load import CSVLoadMixin from ludwig.utils.fs_utils import makedirs, rename def load(cache_dir=DEFAULT_CACHE_LOCATION, split=False): dataset = Flickr8k(cache_dir=cache_dir) return dataset.load(split=split) class Flickr8k(CSVLoadMixin, ZipDownloadMixin, BaseDataset): """The Flickr8k dataset. This pulls in an array of mixins for different types of functionality which belongs in the workflow for ingesting and transforming training data into a destination dataframe that can fit into Ludwig's training API. """ def __init__(self, cache_dir=DEFAULT_CACHE_LOCATION): super().__init__(dataset_name="flickr8k", cache_dir=cache_dir) def process_downloaded_dataset(self): makedirs(self.processed_temp_path, exist_ok=True) # create a dictionary matching image_path --> list of captions image_to_caption = defaultdict(list) with open( f"{self.raw_dataset_path}/Flickr8k.token.txt", "r" ) as captions_file: image_to_caption = defaultdict(list) for line in captions_file: line = line.split("#") # the regex is to format the string to fit properly in a csv line[1] = line[1].strip("\n01234.\t ") line[1] = re.sub('\"', '\"\"', line[1]) line[1] = '\"' + line[1] + '\"' image_to_caption[line[0]].append(line[1]) # create csv file with 7 columns: image_path, 5 captions, and split with open( os.path.join(self.processed_temp_path, self.csv_filename), 'w' ) as output_file: output_file.write('image_path,caption0,caption1,caption2,') output_file.write('caption3,caption4,split\n') splits = ["train", "dev", "test"] for i in range(len(splits)): split = splits[i] with open( f"{self.raw_dataset_path}/Flickr_8k.{split}Images.txt", "r" ) as split_file: for image_name in split_file: image_name = image_name.strip('\n') if image_name in image_to_caption: output_file.write('{},{},{},{},{},{},{}\n'.format( # Note: image folder is named Flicker8k_Dataset "{}/Flicker8k_Dataset/{}".format( self.raw_dataset_path, image_name ), *image_to_caption[image_name], i )) # Note: csv is stored in /processed while images are stored in /raw rename(self.processed_temp_path, self.processed_dataset_path)
43.321839
97
0.597241
import os import re from collections import defaultdict from ludwig.datasets.base_dataset import DEFAULT_CACHE_LOCATION, BaseDataset from ludwig.datasets.mixins.download import ZipDownloadMixin from ludwig.datasets.mixins.load import CSVLoadMixin from ludwig.utils.fs_utils import makedirs, rename def load(cache_dir=DEFAULT_CACHE_LOCATION, split=False): dataset = Flickr8k(cache_dir=cache_dir) return dataset.load(split=split) class Flickr8k(CSVLoadMixin, ZipDownloadMixin, BaseDataset): def __init__(self, cache_dir=DEFAULT_CACHE_LOCATION): super().__init__(dataset_name="flickr8k", cache_dir=cache_dir) def process_downloaded_dataset(self): makedirs(self.processed_temp_path, exist_ok=True) image_to_caption = defaultdict(list) with open( f"{self.raw_dataset_path}/Flickr8k.token.txt", "r" ) as captions_file: image_to_caption = defaultdict(list) for line in captions_file: line = line.split("#") line[1] = line[1].strip("\n01234.\t ") line[1] = re.sub('\"', '\"\"', line[1]) line[1] = '\"' + line[1] + '\"' image_to_caption[line[0]].append(line[1]) # create csv file with 7 columns: image_path, 5 captions, and split with open( os.path.join(self.processed_temp_path, self.csv_filename), 'w' ) as output_file: output_file.write('image_path,caption0,caption1,caption2,') output_file.write('caption3,caption4,split\n') splits = ["train", "dev", "test"] for i in range(len(splits)): split = splits[i] with open( f"{self.raw_dataset_path}/Flickr_8k.{split}Images.txt", "r" ) as split_file: for image_name in split_file: image_name = image_name.strip('\n') if image_name in image_to_caption: output_file.write('{},{},{},{},{},{},{}\n'.format( # Note: image folder is named Flicker8k_Dataset "{}/Flicker8k_Dataset/{}".format( self.raw_dataset_path, image_name ), *image_to_caption[image_name], i )) # Note: csv is stored in /processed while images are stored in /raw rename(self.processed_temp_path, self.processed_dataset_path)
true
true
f7f99e7d47f0196f9f61d42e699a57a7aa5e4ba3
3,675
py
Python
relation_rcnn/test.py
super-wcg/Relation-Network-for-Object-Detection
f91ef685b8d713b2a88fb5300222b1932e7ddd64
[ "MIT" ]
null
null
null
relation_rcnn/test.py
super-wcg/Relation-Network-for-Object-Detection
f91ef685b8d713b2a88fb5300222b1932e7ddd64
[ "MIT" ]
null
null
null
relation_rcnn/test.py
super-wcg/Relation-Network-for-Object-Detection
f91ef685b8d713b2a88fb5300222b1932e7ddd64
[ "MIT" ]
null
null
null
# -------------------------------------------------------- # Relation Networks for Object Detection # Copyright (c) 2017 Microsoft # Licensed under The MIT License [see LICENSE for details] # Modified by Jiayuan Gu, Dazhi Cheng, Yuwen Xiong # -------------------------------------------------------- # Based on: # MX-RCNN # Copyright (c) 2016 by Contributors # Licence under The Apache 2.0 License # https://github.com/ijkguo/mx-rcnn/ # -------------------------------------------------------- import _init_paths import argparse import os import sys import time import logging from config.config import config, update_config def parse_args(): parser = argparse.ArgumentParser(description='Test a Faster R-CNN network') # general parser.add_argument('--cfg', help='experiment configure file name', required=True, type=str) args, rest = parser.parse_known_args() update_config(args.cfg) # rcnn parser.add_argument('--vis', help='turn on visualization', action='store_true') parser.add_argument('--ignore_cache', help='ignore cached results boxes', action='store_true') parser.add_argument('--thresh', help='valid detection threshold', default=1e-3, type=float) parser.add_argument('--shuffle', help='shuffle data on visualization', action='store_true') parser.add_argument('--test_epoch', help='the epoch model to be test', default=config.TEST.test_epoch, type=int) # nms parser.add_argument('--nms', help='params for nms or softnms', default=config.TEST.NMS, type=float) parser.add_argument('--softnms', help='whether to enable softnms', default=config.TEST.SOFTNMS, action='store_true') parser.add_argument('--naive_nms', help='whether to enable naive nms', default=False, action='store_true') parser.add_argument('--first_n', help='first_n for learn nms or nms', default=config.TEST.FIRST_N, type=int) parser.add_argument('--merge', help='merge method for learn nms', default=config.TEST.MERGE_METHOD, type=int) parser.add_argument('--debug', help='whether to enable debug mode', default=False, action='store_true') # dataset parser.add_argument('--test_set', help='which set to be tested', default=config.dataset.test_image_set, type=str) args, rest = parser.parse_known_args() # update config config.TEST.test_epoch = args.test_epoch config.TEST.NMS = args.nms config.TEST.SOFTNMS = args.softnms and (not args.naive_nms) config.TEST.FIRST_N = args.first_n config.TEST.MERGE_METHOD = args.merge config.dataset.test_image_set = args.test_set #print(args.test_set) return args args = parse_args() curr_path = os.path.abspath(os.path.dirname(__file__)) sys.path.insert(0, os.path.join(curr_path, '../external/mxnet', config.MXNET_VERSION)) import mxnet as mx import numpy as np from function.test_rcnn import test_rcnn from utils.create_logger import create_logger def main(): ctx = [mx.gpu(int(i)) for i in config.gpus.split(',')] print args np.random.seed(0) mx.random.seed(0) logger, final_output_path = create_logger(config.output_path, args.cfg, config.dataset.test_image_set) print(config.dataset.dataset) test_rcnn(config, config.dataset.dataset, config.dataset.test_image_set, config.dataset.root_path, config.dataset.dataset_path, ctx, os.path.join(final_output_path, '..', '_'.join([iset for iset in config.dataset.image_set.split('+')]), config.TRAIN.model_prefix), config.TEST.test_epoch, args.vis, args.ignore_cache, args.shuffle, config.TEST.HAS_RPN, config.dataset.proposal, args.thresh, logger=logger, output_path=final_output_path) if __name__ == '__main__': main()
44.277108
174
0.698776
import _init_paths import argparse import os import sys import time import logging from config.config import config, update_config def parse_args(): parser = argparse.ArgumentParser(description='Test a Faster R-CNN network') parser.add_argument('--cfg', help='experiment configure file name', required=True, type=str) args, rest = parser.parse_known_args() update_config(args.cfg) parser.add_argument('--vis', help='turn on visualization', action='store_true') parser.add_argument('--ignore_cache', help='ignore cached results boxes', action='store_true') parser.add_argument('--thresh', help='valid detection threshold', default=1e-3, type=float) parser.add_argument('--shuffle', help='shuffle data on visualization', action='store_true') parser.add_argument('--test_epoch', help='the epoch model to be test', default=config.TEST.test_epoch, type=int) parser.add_argument('--nms', help='params for nms or softnms', default=config.TEST.NMS, type=float) parser.add_argument('--softnms', help='whether to enable softnms', default=config.TEST.SOFTNMS, action='store_true') parser.add_argument('--naive_nms', help='whether to enable naive nms', default=False, action='store_true') parser.add_argument('--first_n', help='first_n for learn nms or nms', default=config.TEST.FIRST_N, type=int) parser.add_argument('--merge', help='merge method for learn nms', default=config.TEST.MERGE_METHOD, type=int) parser.add_argument('--debug', help='whether to enable debug mode', default=False, action='store_true') parser.add_argument('--test_set', help='which set to be tested', default=config.dataset.test_image_set, type=str) args, rest = parser.parse_known_args() config.TEST.test_epoch = args.test_epoch config.TEST.NMS = args.nms config.TEST.SOFTNMS = args.softnms and (not args.naive_nms) config.TEST.FIRST_N = args.first_n config.TEST.MERGE_METHOD = args.merge config.dataset.test_image_set = args.test_set return args args = parse_args() curr_path = os.path.abspath(os.path.dirname(__file__)) sys.path.insert(0, os.path.join(curr_path, '../external/mxnet', config.MXNET_VERSION)) import mxnet as mx import numpy as np from function.test_rcnn import test_rcnn from utils.create_logger import create_logger def main(): ctx = [mx.gpu(int(i)) for i in config.gpus.split(',')] print args np.random.seed(0) mx.random.seed(0) logger, final_output_path = create_logger(config.output_path, args.cfg, config.dataset.test_image_set) print(config.dataset.dataset) test_rcnn(config, config.dataset.dataset, config.dataset.test_image_set, config.dataset.root_path, config.dataset.dataset_path, ctx, os.path.join(final_output_path, '..', '_'.join([iset for iset in config.dataset.image_set.split('+')]), config.TRAIN.model_prefix), config.TEST.test_epoch, args.vis, args.ignore_cache, args.shuffle, config.TEST.HAS_RPN, config.dataset.proposal, args.thresh, logger=logger, output_path=final_output_path) if __name__ == '__main__': main()
false
true
f7f99f15967abee3be0eb8f1392685b53540e401
3,984
py
Python
configs/body/2d_kpt_sview_rgb_img/topdown_heatmap/coco/shufflenetv1_coco_256x192.py
jlgzb/mmpose
0ecf06e3580f141f6ab44645768a0d6d8ba48383
[ "Apache-2.0" ]
4
2021-10-02T08:21:43.000Z
2021-11-01T07:25:24.000Z
configs/body/2d_kpt_sview_rgb_img/topdown_heatmap/coco/shufflenetv1_coco_256x192.py
jlgzb/mmpose
0ecf06e3580f141f6ab44645768a0d6d8ba48383
[ "Apache-2.0" ]
null
null
null
configs/body/2d_kpt_sview_rgb_img/topdown_heatmap/coco/shufflenetv1_coco_256x192.py
jlgzb/mmpose
0ecf06e3580f141f6ab44645768a0d6d8ba48383
[ "Apache-2.0" ]
1
2021-06-22T06:41:45.000Z
2021-06-22T06:41:45.000Z
log_level = 'INFO' load_from = None resume_from = None dist_params = dict(backend='nccl') workflow = [('train', 1)] checkpoint_config = dict(interval=10) evaluation = dict(interval=10, metric='mAP', save_best='AP') optimizer = dict( type='Adam', lr=5e-4, ) optimizer_config = dict(grad_clip=None) # learning policy lr_config = dict( policy='step', warmup='linear', warmup_iters=500, warmup_ratio=0.001, step=[170, 200]) total_epochs = 210 log_config = dict( interval=50, hooks=[ dict(type='TextLoggerHook'), # dict(type='TensorboardLoggerHook') ]) channel_cfg = dict( num_output_channels=17, dataset_joints=17, dataset_channel=[ [0, 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16], ], inference_channel=[ 0, 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16 ]) # model settings model = dict( type='TopDown', pretrained='mmcls://shufflenet_v1', backbone=dict(type='ShuffleNetV1', groups=3), keypoint_head=dict( type='TopdownHeatmapSimpleHead', in_channels=960, out_channels=channel_cfg['num_output_channels'], loss_keypoint=dict(type='JointsMSELoss', use_target_weight=True)), train_cfg=dict(), test_cfg=dict( flip_test=True, post_process='default', shift_heatmap=True, modulate_kernel=11)) data_cfg = dict( image_size=[192, 256], heatmap_size=[48, 64], num_output_channels=channel_cfg['num_output_channels'], num_joints=channel_cfg['dataset_joints'], dataset_channel=channel_cfg['dataset_channel'], inference_channel=channel_cfg['inference_channel'], soft_nms=False, nms_thr=1.0, oks_thr=0.9, vis_thr=0.2, use_gt_bbox=False, det_bbox_thr=0.0, bbox_file='data/coco/person_detection_results/' 'COCO_val2017_detections_AP_H_56_person.json', ) train_pipeline = [ dict(type='LoadImageFromFile'), dict(type='TopDownRandomFlip', flip_prob=0.5), dict( type='TopDownHalfBodyTransform', num_joints_half_body=8, prob_half_body=0.3), dict( type='TopDownGetRandomScaleRotation', rot_factor=40, scale_factor=0.5), dict(type='TopDownAffine'), dict(type='ToTensor'), dict( type='NormalizeTensor', mean=[0.485, 0.456, 0.406], std=[0.229, 0.224, 0.225]), dict(type='TopDownGenerateTarget', sigma=2), dict( type='Collect', keys=['img', 'target', 'target_weight'], meta_keys=[ 'image_file', 'joints_3d', 'joints_3d_visible', 'center', 'scale', 'rotation', 'bbox_score', 'flip_pairs' ]), ] val_pipeline = [ dict(type='LoadImageFromFile'), dict(type='TopDownAffine'), dict(type='ToTensor'), dict( type='NormalizeTensor', mean=[0.485, 0.456, 0.406], std=[0.229, 0.224, 0.225]), dict( type='Collect', keys=['img'], meta_keys=[ 'image_file', 'center', 'scale', 'rotation', 'bbox_score', 'flip_pairs' ]), ] test_pipeline = val_pipeline data_root = 'data/coco' data = dict( samples_per_gpu=64, workers_per_gpu=2, val_dataloader=dict(samples_per_gpu=32), test_dataloader=dict(samples_per_gpu=32), train=dict( type='TopDownCocoDataset', ann_file=f'{data_root}/annotations/person_keypoints_train2017.json', img_prefix=f'{data_root}/train2017/', data_cfg=data_cfg, pipeline=train_pipeline), val=dict( type='TopDownCocoDataset', ann_file=f'{data_root}/annotations/person_keypoints_val2017.json', img_prefix=f'{data_root}/val2017/', data_cfg=data_cfg, pipeline=val_pipeline), test=dict( type='TopDownCocoDataset', ann_file=f'{data_root}/annotations/person_keypoints_val2017.json', img_prefix=f'{data_root}/val2017/', data_cfg=data_cfg, pipeline=val_pipeline), )
28.056338
79
0.632028
log_level = 'INFO' load_from = None resume_from = None dist_params = dict(backend='nccl') workflow = [('train', 1)] checkpoint_config = dict(interval=10) evaluation = dict(interval=10, metric='mAP', save_best='AP') optimizer = dict( type='Adam', lr=5e-4, ) optimizer_config = dict(grad_clip=None) lr_config = dict( policy='step', warmup='linear', warmup_iters=500, warmup_ratio=0.001, step=[170, 200]) total_epochs = 210 log_config = dict( interval=50, hooks=[ dict(type='TextLoggerHook'), ]) channel_cfg = dict( num_output_channels=17, dataset_joints=17, dataset_channel=[ [0, 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16], ], inference_channel=[ 0, 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16 ]) model = dict( type='TopDown', pretrained='mmcls://shufflenet_v1', backbone=dict(type='ShuffleNetV1', groups=3), keypoint_head=dict( type='TopdownHeatmapSimpleHead', in_channels=960, out_channels=channel_cfg['num_output_channels'], loss_keypoint=dict(type='JointsMSELoss', use_target_weight=True)), train_cfg=dict(), test_cfg=dict( flip_test=True, post_process='default', shift_heatmap=True, modulate_kernel=11)) data_cfg = dict( image_size=[192, 256], heatmap_size=[48, 64], num_output_channels=channel_cfg['num_output_channels'], num_joints=channel_cfg['dataset_joints'], dataset_channel=channel_cfg['dataset_channel'], inference_channel=channel_cfg['inference_channel'], soft_nms=False, nms_thr=1.0, oks_thr=0.9, vis_thr=0.2, use_gt_bbox=False, det_bbox_thr=0.0, bbox_file='data/coco/person_detection_results/' 'COCO_val2017_detections_AP_H_56_person.json', ) train_pipeline = [ dict(type='LoadImageFromFile'), dict(type='TopDownRandomFlip', flip_prob=0.5), dict( type='TopDownHalfBodyTransform', num_joints_half_body=8, prob_half_body=0.3), dict( type='TopDownGetRandomScaleRotation', rot_factor=40, scale_factor=0.5), dict(type='TopDownAffine'), dict(type='ToTensor'), dict( type='NormalizeTensor', mean=[0.485, 0.456, 0.406], std=[0.229, 0.224, 0.225]), dict(type='TopDownGenerateTarget', sigma=2), dict( type='Collect', keys=['img', 'target', 'target_weight'], meta_keys=[ 'image_file', 'joints_3d', 'joints_3d_visible', 'center', 'scale', 'rotation', 'bbox_score', 'flip_pairs' ]), ] val_pipeline = [ dict(type='LoadImageFromFile'), dict(type='TopDownAffine'), dict(type='ToTensor'), dict( type='NormalizeTensor', mean=[0.485, 0.456, 0.406], std=[0.229, 0.224, 0.225]), dict( type='Collect', keys=['img'], meta_keys=[ 'image_file', 'center', 'scale', 'rotation', 'bbox_score', 'flip_pairs' ]), ] test_pipeline = val_pipeline data_root = 'data/coco' data = dict( samples_per_gpu=64, workers_per_gpu=2, val_dataloader=dict(samples_per_gpu=32), test_dataloader=dict(samples_per_gpu=32), train=dict( type='TopDownCocoDataset', ann_file=f'{data_root}/annotations/person_keypoints_train2017.json', img_prefix=f'{data_root}/train2017/', data_cfg=data_cfg, pipeline=train_pipeline), val=dict( type='TopDownCocoDataset', ann_file=f'{data_root}/annotations/person_keypoints_val2017.json', img_prefix=f'{data_root}/val2017/', data_cfg=data_cfg, pipeline=val_pipeline), test=dict( type='TopDownCocoDataset', ann_file=f'{data_root}/annotations/person_keypoints_val2017.json', img_prefix=f'{data_root}/val2017/', data_cfg=data_cfg, pipeline=val_pipeline), )
true
true
f7f9a1a87e35653efaa2f39e5ea3d37157bf7df7
968
py
Python
code/deep/adarnn/base/loss/mutual_info.py
jiaruonan/transferlearning
0360ba0b09df6c1033d466ddc65f0c870187331e
[ "MIT" ]
9,657
2017-05-01T03:29:35.000Z
2022-03-31T21:25:30.000Z
code/deep/adarnn/base/loss/mutual_info.py
xiaohuihui-com/transferlearning
17583db86db19709ff483a24590f0d5b88e25fe5
[ "MIT" ]
262
2017-09-16T09:33:02.000Z
2022-03-30T05:08:45.000Z
code/deep/adarnn/base/loss/mutual_info.py
xiaohuihui-com/transferlearning
17583db86db19709ff483a24590f0d5b88e25fe5
[ "MIT" ]
3,273
2017-05-01T06:28:31.000Z
2022-03-31T09:57:48.000Z
import torch import torch.nn as nn import torch.nn.functional as F class Mine_estimator(nn.Module): def __init__(self, input_dim=2048, hidden_dim=512): super(Mine_estimator, self).__init__() self.mine_model = Mine(input_dim, hidden_dim) def forward(self, X, Y): Y_shffle = Y[torch.randperm(len(Y))] loss_joint = self.mine_model(X, Y) loss_marginal = self.mine_model(X, Y_shffle) ret = torch.mean(loss_joint) - \ torch.log(torch.mean(torch.exp(loss_marginal))) loss = -ret return loss class Mine(nn.Module): def __init__(self, input_dim=2048, hidden_dim=512): super(Mine, self).__init__() self.fc1_x = nn.Linear(input_dim, hidden_dim) self.fc1_y = nn.Linear(input_dim, hidden_dim) self.fc2 = nn.Linear(hidden_dim, 1) def forward(self, x, y): h1 = F.leaky_relu(self.fc1_x(x)+self.fc1_y(y)) h2 = self.fc2(h1) return h2
32.266667
59
0.636364
import torch import torch.nn as nn import torch.nn.functional as F class Mine_estimator(nn.Module): def __init__(self, input_dim=2048, hidden_dim=512): super(Mine_estimator, self).__init__() self.mine_model = Mine(input_dim, hidden_dim) def forward(self, X, Y): Y_shffle = Y[torch.randperm(len(Y))] loss_joint = self.mine_model(X, Y) loss_marginal = self.mine_model(X, Y_shffle) ret = torch.mean(loss_joint) - \ torch.log(torch.mean(torch.exp(loss_marginal))) loss = -ret return loss class Mine(nn.Module): def __init__(self, input_dim=2048, hidden_dim=512): super(Mine, self).__init__() self.fc1_x = nn.Linear(input_dim, hidden_dim) self.fc1_y = nn.Linear(input_dim, hidden_dim) self.fc2 = nn.Linear(hidden_dim, 1) def forward(self, x, y): h1 = F.leaky_relu(self.fc1_x(x)+self.fc1_y(y)) h2 = self.fc2(h1) return h2
true
true
f7f9a2c7ab062c209125ef4e457b4996dc74124d
1,519
py
Python
AdnReport/test/test_Adn_Report_dialog.py
METIS-GEO/plugins
1673f22dec90aafd7eef61842f01e6b8e0de833e
[ "MIT" ]
null
null
null
AdnReport/test/test_Adn_Report_dialog.py
METIS-GEO/plugins
1673f22dec90aafd7eef61842f01e6b8e0de833e
[ "MIT" ]
null
null
null
AdnReport/test/test_Adn_Report_dialog.py
METIS-GEO/plugins
1673f22dec90aafd7eef61842f01e6b8e0de833e
[ "MIT" ]
null
null
null
# coding=utf-8 """Dialog test. .. note:: This program is free software; you can redistribute it and/or modify it under the terms of the GNU General Public License as published by the Free Software Foundation; either version 2 of the License, or (at your option) any later version. """ __author__ = 'g.bruel@metis-reseaux.fr' __date__ = '2018-01-08' __copyright__ = 'Copyright 2018, gbruel/metis' import unittest from PyQt4.QtGui import QDialogButtonBox, QDialog from Adn_Report_dialog import AdnReportDialog from utilities import get_qgis_app QGIS_APP = get_qgis_app() class AdnReportDialogTest(unittest.TestCase): """Test dialog works.""" def setUp(self): """Runs before each test.""" self.dialog = AdnReportDialog(None) def tearDown(self): """Runs after each test.""" self.dialog = None def test_dialog_ok(self): """Test we can click OK.""" button = self.dialog.button_box.button(QDialogButtonBox.Ok) button.click() result = self.dialog.result() self.assertEqual(result, QDialog.Accepted) def test_dialog_cancel(self): """Test we can click cancel.""" button = self.dialog.button_box.button(QDialogButtonBox.Cancel) button.click() result = self.dialog.result() self.assertEqual(result, QDialog.Rejected) if __name__ == "__main__": suite = unittest.makeSuite(AdnReportDialogTest) runner = unittest.TextTestRunner(verbosity=2) runner.run(suite)
27.125
78
0.687294
__author__ = 'g.bruel@metis-reseaux.fr' __date__ = '2018-01-08' __copyright__ = 'Copyright 2018, gbruel/metis' import unittest from PyQt4.QtGui import QDialogButtonBox, QDialog from Adn_Report_dialog import AdnReportDialog from utilities import get_qgis_app QGIS_APP = get_qgis_app() class AdnReportDialogTest(unittest.TestCase): def setUp(self): self.dialog = AdnReportDialog(None) def tearDown(self): self.dialog = None def test_dialog_ok(self): button = self.dialog.button_box.button(QDialogButtonBox.Ok) button.click() result = self.dialog.result() self.assertEqual(result, QDialog.Accepted) def test_dialog_cancel(self): button = self.dialog.button_box.button(QDialogButtonBox.Cancel) button.click() result = self.dialog.result() self.assertEqual(result, QDialog.Rejected) if __name__ == "__main__": suite = unittest.makeSuite(AdnReportDialogTest) runner = unittest.TextTestRunner(verbosity=2) runner.run(suite)
true
true
f7f9a2d690b276c094aee2a450d85ba36d107780
3,409
py
Python
test/strandtest.py
edbgon/rpipin
99f3023288dbb08b5f8530ba5f23bdc5802ac427
[ "MIT" ]
null
null
null
test/strandtest.py
edbgon/rpipin
99f3023288dbb08b5f8530ba5f23bdc5802ac427
[ "MIT" ]
null
null
null
test/strandtest.py
edbgon/rpipin
99f3023288dbb08b5f8530ba5f23bdc5802ac427
[ "MIT" ]
null
null
null
# NeoPixel library strandtest example # Author: Tony DiCola (tony@tonydicola.com) # # Direct port of the Arduino NeoPixel library strandtest example. Showcases # various animations on a strip of NeoPixels. import time from neopixel import * # LED strip configuration: LED_COUNT = 10 # Number of LED pixels. LED_PIN = 18 # GPIO pin connected to the pixels (must support PWM!). LED_FREQ_HZ = 800000 # LED signal frequency in hertz (usually 800khz) LED_DMA = 5 # DMA channel to use for generating signal (try 5) LED_BRIGHTNESS = 128 # Set to 0 for darkest and 255 for brightest LED_INVERT = False # True to invert the signal (when using NPN transistor level shift) # Define functions which animate LEDs in various ways. def colorWipe(strip, color, wait_ms=50): """Wipe color across display a pixel at a time.""" for i in range(strip.numPixels()): strip.setPixelColor(i, color) strip.show() time.sleep(wait_ms/1000.0) def theaterChase(strip, color, wait_ms=50, iterations=10): """Movie theater light style chaser animation.""" for j in range(iterations): for q in range(3): for i in range(0, strip.numPixels(), 3): strip.setPixelColor(i+q, color) strip.show() time.sleep(wait_ms/1000.0) for i in range(0, strip.numPixels(), 3): strip.setPixelColor(i+q, 0) def wheel(pos): """Generate rainbow colors across 0-255 positions.""" pos = int(pos) if pos < 85: return Color(pos * 3, 255 - pos * 3, 0) elif pos < 170: pos -= 85 return Color(255 - pos * 3, 0, pos * 3) else: pos -= 170 return Color(0, pos * 3, 255 - pos * 3) def rainbow(strip, wait_ms=20, iterations=1): """Draw rainbow that fades across all pixels at once.""" for j in range(256*iterations): for i in range(strip.numPixels()): strip.setPixelColor(i, wheel((i+j) & 255)) strip.show() time.sleep(wait_ms/1000.0) def rainbowCycle(strip, wait_ms=20, iterations=5): """Draw rainbow that uniformly distributes itself across all pixels.""" for j in range(256*iterations): for i in range(strip.numPixels()): strip.setPixelColor(i, int(wheel(((i * 256 / strip.numPixels())) + j) & 255)) strip.show() time.sleep(wait_ms/1000.0) def theaterChaseRainbow(strip, wait_ms=50): """Rainbow movie theater light style chaser animation.""" for j in range(256): for q in range(3): for i in range(0, strip.numPixels(), 3): strip.setPixelColor(i+q, wheel((i+j) % 255)) strip.show() time.sleep(wait_ms/1000.0) for i in range(0, strip.numPixels(), 3): strip.setPixelColor(i+q, 0) # Main program logic follows: if __name__ == '__main__': # Create NeoPixel object with appropriate configuration. strip = Adafruit_NeoPixel(LED_COUNT, LED_PIN, LED_FREQ_HZ, LED_DMA, LED_INVERT, LED_BRIGHTNESS) # Intialize the library (must be called once before other functions). strip.begin() print ('Press Ctrl-C to quit.') while True: # Color wipe animations. colorWipe(strip, Color(255, 0, 0)) # Red wipe colorWipe(strip, Color(0, 255, 0)) # Blue wipe colorWipe(strip, Color(0, 0, 255)) # Green wipe # Theater chase animations. theaterChase(strip, Color(127, 127, 127)) # White theater chase theaterChase(strip, Color(127, 0, 0)) # Red theater chase theaterChase(strip, Color( 0, 0, 127)) # Blue theater chase # Rainbow animations. rainbow(strip) rainbowCycle(strip) theaterChaseRainbow(strip)
34.09
96
0.692285
import time from neopixel import * LED_COUNT = 10 LED_PIN = 18 LED_FREQ_HZ = 800000 LED_DMA = 5 LED_BRIGHTNESS = 128 LED_INVERT = False def colorWipe(strip, color, wait_ms=50): for i in range(strip.numPixels()): strip.setPixelColor(i, color) strip.show() time.sleep(wait_ms/1000.0) def theaterChase(strip, color, wait_ms=50, iterations=10): for j in range(iterations): for q in range(3): for i in range(0, strip.numPixels(), 3): strip.setPixelColor(i+q, color) strip.show() time.sleep(wait_ms/1000.0) for i in range(0, strip.numPixels(), 3): strip.setPixelColor(i+q, 0) def wheel(pos): pos = int(pos) if pos < 85: return Color(pos * 3, 255 - pos * 3, 0) elif pos < 170: pos -= 85 return Color(255 - pos * 3, 0, pos * 3) else: pos -= 170 return Color(0, pos * 3, 255 - pos * 3) def rainbow(strip, wait_ms=20, iterations=1): for j in range(256*iterations): for i in range(strip.numPixels()): strip.setPixelColor(i, wheel((i+j) & 255)) strip.show() time.sleep(wait_ms/1000.0) def rainbowCycle(strip, wait_ms=20, iterations=5): for j in range(256*iterations): for i in range(strip.numPixels()): strip.setPixelColor(i, int(wheel(((i * 256 / strip.numPixels())) + j) & 255)) strip.show() time.sleep(wait_ms/1000.0) def theaterChaseRainbow(strip, wait_ms=50): for j in range(256): for q in range(3): for i in range(0, strip.numPixels(), 3): strip.setPixelColor(i+q, wheel((i+j) % 255)) strip.show() time.sleep(wait_ms/1000.0) for i in range(0, strip.numPixels(), 3): strip.setPixelColor(i+q, 0) if __name__ == '__main__': strip = Adafruit_NeoPixel(LED_COUNT, LED_PIN, LED_FREQ_HZ, LED_DMA, LED_INVERT, LED_BRIGHTNESS) strip.begin() print ('Press Ctrl-C to quit.') while True: colorWipe(strip, Color(255, 0, 0)) colorWipe(strip, Color(0, 255, 0)) colorWipe(strip, Color(0, 0, 255)) theaterChase(strip, Color(127, 127, 127)) theaterChase(strip, Color(127, 0, 0)) theaterChase(strip, Color( 0, 0, 127)) rainbow(strip) rainbowCycle(strip) theaterChaseRainbow(strip)
true
true
f7f9a373d9eccad91b95aeb1cb2578c3cbbdf211
6,516
py
Python
euca2ools/commands/euimage/installpackedimage.py
vasiliykochergin/euca2ools
23781599a9da28dcc582cffd1df7a7e3f8ce8ba0
[ "BSD-2-Clause" ]
null
null
null
euca2ools/commands/euimage/installpackedimage.py
vasiliykochergin/euca2ools
23781599a9da28dcc582cffd1df7a7e3f8ce8ba0
[ "BSD-2-Clause" ]
null
null
null
euca2ools/commands/euimage/installpackedimage.py
vasiliykochergin/euca2ools
23781599a9da28dcc582cffd1df7a7e3f8ce8ba0
[ "BSD-2-Clause" ]
null
null
null
# Copyright 2014-2015 Eucalyptus Systems, Inc. # # Redistribution and use of this software in source and binary forms, # with or without modification, are permitted provided that the following # conditions are met: # # Redistributions of source code must retain the above copyright notice, # this list of conditions and the following disclaimer. # # Redistributions in binary form must reproduce the above copyright # notice, this list of conditions and the following disclaimer in the # documentation and/or other materials provided with the distribution. # # THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS # "AS IS" AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT # LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR # A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT # OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, # SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT # LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, # DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY # THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT # (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE # OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. import argparse import hashlib import tempfile from requestbuilder import Arg from requestbuilder.auth.aws import QueryHmacV2Auth from requestbuilder.mixins import FileTransferProgressBarMixin, TabifyingMixin import euca2ools from euca2ools.commands.ec2 import EC2 from euca2ools.commands.euimage.pack import ImagePack from euca2ools.commands.s3 import S3Request class InstallPackedImage(S3Request, FileTransferProgressBarMixin, TabifyingMixin): DESCRIPTION = '***TECH PREVIEW***\n\nInstall a packed image into the cloud' ARGS = [Arg('pack_filename', metavar='FILE', help='the pack to install (required)'), Arg('--profile', help='''which of the image's profiles to install (default: "default")'''), # Upload stuff (for bundle pieces or imported disk image pieces) Arg('-b', '--bucket', metavar='BUCKET[/PREFIX]', help='bucket to upload the image to (required)'), Arg('--location', help='''location constraint of the destination bucket (default: inferred from s3-location-constraint in configuration, or otherwise none'''), # Bundle stuff Arg('--privatekey', metavar='FILE', help='''file containing your private key to sign the bundle's manifest with. This private key will also be required to unbundle the bundle in the future. (instance-store only)'''), Arg('--cert', metavar='FILE', help='''file containing your X.509 certificate (instance-store only)'''), Arg('--ec2cert', metavar='FILE', help='''file containing the cloud's X.509 certificate (instance-store only)'''), Arg('--user', metavar='ACCOUNT', help='your account ID (instance-store only)'), # Registration stuff Arg('--kernel', metavar='IMAGE', help='''ID of the kernel image to associate with this machine image (paravirtual only)'''), Arg('--ramdisk', metavar='IMAGE', help='''ID of the ramdisk image to associate with this machine image (paravirtual only)'''), Arg('--ec2-url', help='compute service endpoint URL'), Arg('--ec2-auth', help=argparse.SUPPRESS), Arg('--ec2-service', help=argparse.SUPPRESS)] def configure(self): S3Request.configure(self) if not self.args.get('ec2_service'): self.args['ec2_service'] = EC2.from_other( self.service, url=self.args.get('ec2_url')) if not self.args.get('ec2_auth'): self.args['ec2_auth'] = QueryHmacV2Auth.from_other(self.auth) if not self.args.get('profile'): self.args['profile'] = 'default' def main(self): services = {'s3': {'service': self.service, 'auth': self.auth}, 'ec2': {'service': self.args['ec2_service'], 'auth': self.args['ec2_auth']}} unpacked_image = tempfile.TemporaryFile() with ImagePack.open(self.args['pack_filename']) as pack: if self.args['profile'] not in pack.image_md.profiles: raise ValueError( 'no such profile: "{0}" (choose from {1})'.format( self.args['profile'], ', '.join(pack.image_md.profiles.keys()))) with pack.open_image() as image: # We could technically hand the image file object # directly to the installation process and calculate # checksums on fly, but that would mean we error out # only after everything finishes and force people to # clean up after if the checksum happens to be bad. # We thus do this in two steps instead. digest = hashlib.sha256() bytes_written = 0 pbar = self.get_progressbar(label='Decompressing', maxval=pack.pack_md.image_size) pbar.start() while True: chunk = image.read(euca2ools.BUFSIZE) if not chunk: break digest.update(chunk) unpacked_image.write(chunk) bytes_written += len(chunk) pbar.update(bytes_written) pbar.finish() if digest.hexdigest() != pack.pack_md.image_sha256sum: raise RuntimeError('image appears to be corrupt ' '(expected SHA256: {0}, actual: {1})', pack.pack_md.image_sha256sum, digest.hexdigest()) unpacked_image.seek(0) image_id = pack.image_md.install_profile( self.args['profile'], services, unpacked_image, pack.pack_md.image_size, self.args) unpacked_image.close() return image_id def print_result(self, image_id): print self.tabify(('IMAGE', image_id))
50.123077
79
0.610344
import argparse import hashlib import tempfile from requestbuilder import Arg from requestbuilder.auth.aws import QueryHmacV2Auth from requestbuilder.mixins import FileTransferProgressBarMixin, TabifyingMixin import euca2ools from euca2ools.commands.ec2 import EC2 from euca2ools.commands.euimage.pack import ImagePack from euca2ools.commands.s3 import S3Request class InstallPackedImage(S3Request, FileTransferProgressBarMixin, TabifyingMixin): DESCRIPTION = '***TECH PREVIEW***\n\nInstall a packed image into the cloud' ARGS = [Arg('pack_filename', metavar='FILE', help='the pack to install (required)'), Arg('--profile', help='''which of the image's profiles to install (default: "default")'''), # Upload stuff (for bundle pieces or imported disk image pieces) Arg('-b', '--bucket', metavar='BUCKET[/PREFIX]', help='bucket to upload the image to (required)'), Arg('--location', help='''location constraint of the destination bucket (default: inferred from s3-location-constraint in configuration, or otherwise none'''), # Bundle stuff Arg('--privatekey', metavar='FILE', help='''file containing your private key to sign the bundle's manifest with. This private key will also be required to unbundle the bundle in the future. (instance-store only)'''), Arg('--cert', metavar='FILE', help='''file containing your X.509 certificate (instance-store only)'''), Arg('--ec2cert', metavar='FILE', help='''file containing the cloud's X.509 certificate (instance-store only)'''), Arg('--user', metavar='ACCOUNT', help='your account ID (instance-store only)'), # Registration stuff Arg('--kernel', metavar='IMAGE', help='''ID of the kernel image to associate with this machine image (paravirtual only)'''), Arg('--ramdisk', metavar='IMAGE', help='''ID of the ramdisk image to associate with this machine image (paravirtual only)'''), Arg('--ec2-url', help='compute service endpoint URL'), Arg('--ec2-auth', help=argparse.SUPPRESS), Arg('--ec2-service', help=argparse.SUPPRESS)] def configure(self): S3Request.configure(self) if not self.args.get('ec2_service'): self.args['ec2_service'] = EC2.from_other( self.service, url=self.args.get('ec2_url')) if not self.args.get('ec2_auth'): self.args['ec2_auth'] = QueryHmacV2Auth.from_other(self.auth) if not self.args.get('profile'): self.args['profile'] = 'default' def main(self): services = {'s3': {'service': self.service, 'auth': self.auth}, 'ec2': {'service': self.args['ec2_service'], 'auth': self.args['ec2_auth']}} unpacked_image = tempfile.TemporaryFile() with ImagePack.open(self.args['pack_filename']) as pack: if self.args['profile'] not in pack.image_md.profiles: raise ValueError( 'no such profile: "{0}" (choose from {1})'.format( self.args['profile'], ', '.join(pack.image_md.profiles.keys()))) with pack.open_image() as image: # We could technically hand the image file object # directly to the installation process and calculate # checksums on fly, but that would mean we error out # only after everything finishes and force people to # clean up after if the checksum happens to be bad. # We thus do this in two steps instead. digest = hashlib.sha256() bytes_written = 0 pbar = self.get_progressbar(label='Decompressing', maxval=pack.pack_md.image_size) pbar.start() while True: chunk = image.read(euca2ools.BUFSIZE) if not chunk: break digest.update(chunk) unpacked_image.write(chunk) bytes_written += len(chunk) pbar.update(bytes_written) pbar.finish() if digest.hexdigest() != pack.pack_md.image_sha256sum: raise RuntimeError('image appears to be corrupt ' '(expected SHA256: {0}, actual: {1})', pack.pack_md.image_sha256sum, digest.hexdigest()) unpacked_image.seek(0) image_id = pack.image_md.install_profile( self.args['profile'], services, unpacked_image, pack.pack_md.image_size, self.args) unpacked_image.close() return image_id def print_result(self, image_id): print self.tabify(('IMAGE', image_id))
false
true
f7f9a38e0cf2bdd2a6ecda9998ccb93f100e3316
3,799
py
Python
gluon/tests/test_languages.py
himelpdas/biddrive
786e0fc58d8c0afeef0bcad9125b0d98eaabc709
[ "BSD-3-Clause" ]
97
2015-01-17T09:41:57.000Z
2022-03-15T11:39:03.000Z
webui/gluon/tests/test_languages.py
pouyana/teireader
ac0a92d8b2e570eae1c0a03fd35a7b281eccd250
[ "MIT" ]
26
2015-01-02T13:35:48.000Z
2015-06-10T14:39:07.000Z
webui/gluon/tests/test_languages.py
pouyana/teireader
ac0a92d8b2e570eae1c0a03fd35a7b281eccd250
[ "MIT" ]
35
2015-01-25T04:48:37.000Z
2021-01-29T20:32:26.000Z
#!/usr/bin/env python # -*- coding: utf-8 -*- """ Unit tests for gluon.languages """ import sys import os import unittest import tempfile import threading import logging def fix_sys_path(): """ logic to have always the correct sys.path '', web2py/gluon, web2py/site-packages, web2py/ ... """ def add_path_first(path): sys.path = [path] + [p for p in sys.path if ( not p == path and not p == (path + '/'))] path = os.path.dirname(os.path.abspath(__file__)) if not os.path.isfile(os.path.join(path,'web2py.py')): i = 0 while i<10: i += 1 if os.path.exists(os.path.join(path,'web2py.py')): break path = os.path.abspath(os.path.join(path, '..')) paths = [path, os.path.abspath(os.path.join(path, 'site-packages')), os.path.abspath(os.path.join(path, 'gluon')), ''] [add_path_first(path) for path in paths] fix_sys_path() import languages from storage import Storage try: import multiprocessing def read_write(args): (filename, iterations) = args for i in range(0, iterations): content = languages.read_dict(filename) if not len(content): return False languages.write_dict(filename, content) return True class TestLanguagesParallel(unittest.TestCase): def setUp(self): self.filename = tempfile.mktemp() contents = dict() for i in range(1000): contents["key%d" % i] = "value%d" % i languages.write_dict(self.filename, contents) languages.read_dict(self.filename) def tearDown(self): try: os.remove(self.filename) except: pass def test_reads_and_writes(self): readwriters = 10 pool = multiprocessing.Pool(processes=readwriters) results = pool.map(read_write, [[self.filename, 10]] * readwriters) for result in results: self.assertTrue(result) class TestTranslations(unittest.TestCase): def setUp(self): if os.path.isdir('gluon'): self.langpath = 'applications/welcome/languages' else: self.langpath = os.path.realpath( '../../applications/welcome/languages') self.http_accept_language = 'en' def tearDown(self): pass def test_plain(self): T = languages.translator(self.langpath, self.http_accept_language) self.assertEqual(str(T('Hello World')), 'Hello World') self.assertEqual(str(T('Hello World## comment')), 'Hello World') self.assertEqual(str(T('%s %%{shop}', 1)), '1 shop') self.assertEqual(str(T('%s %%{shop}', 2)), '2 shops') self.assertEqual(str(T('%s %%{shop[0]}', 1)), '1 shop') self.assertEqual(str(T('%s %%{shop[0]}', 2)), '2 shops') self.assertEqual(str(T('%s %%{quark[0]}', 1)), '1 quark') self.assertEqual(str(T('%s %%{quark[0]}', 2)), '2 quarks') self.assertEqual(str(T.M('**Hello World**')), '<strong>Hello World</strong>') T.force('it') self.assertEqual(str(T('Hello World')), 'Salve Mondo') except ImportError: logging.warning("Skipped test case, no multiprocessing module.") if __name__ == '__main__': unittest.main()
30.637097
79
0.515662
import sys import os import unittest import tempfile import threading import logging def fix_sys_path(): def add_path_first(path): sys.path = [path] + [p for p in sys.path if ( not p == path and not p == (path + '/'))] path = os.path.dirname(os.path.abspath(__file__)) if not os.path.isfile(os.path.join(path,'web2py.py')): i = 0 while i<10: i += 1 if os.path.exists(os.path.join(path,'web2py.py')): break path = os.path.abspath(os.path.join(path, '..')) paths = [path, os.path.abspath(os.path.join(path, 'site-packages')), os.path.abspath(os.path.join(path, 'gluon')), ''] [add_path_first(path) for path in paths] fix_sys_path() import languages from storage import Storage try: import multiprocessing def read_write(args): (filename, iterations) = args for i in range(0, iterations): content = languages.read_dict(filename) if not len(content): return False languages.write_dict(filename, content) return True class TestLanguagesParallel(unittest.TestCase): def setUp(self): self.filename = tempfile.mktemp() contents = dict() for i in range(1000): contents["key%d" % i] = "value%d" % i languages.write_dict(self.filename, contents) languages.read_dict(self.filename) def tearDown(self): try: os.remove(self.filename) except: pass def test_reads_and_writes(self): readwriters = 10 pool = multiprocessing.Pool(processes=readwriters) results = pool.map(read_write, [[self.filename, 10]] * readwriters) for result in results: self.assertTrue(result) class TestTranslations(unittest.TestCase): def setUp(self): if os.path.isdir('gluon'): self.langpath = 'applications/welcome/languages' else: self.langpath = os.path.realpath( '../../applications/welcome/languages') self.http_accept_language = 'en' def tearDown(self): pass def test_plain(self): T = languages.translator(self.langpath, self.http_accept_language) self.assertEqual(str(T('Hello World')), 'Hello World') self.assertEqual(str(T('Hello World## comment')), 'Hello World') self.assertEqual(str(T('%s %%{shop}', 1)), '1 shop') self.assertEqual(str(T('%s %%{shop}', 2)), '2 shops') self.assertEqual(str(T('%s %%{shop[0]}', 1)), '1 shop') self.assertEqual(str(T('%s %%{shop[0]}', 2)), '2 shops') self.assertEqual(str(T('%s %%{quark[0]}', 1)), '1 quark') self.assertEqual(str(T('%s %%{quark[0]}', 2)), '2 quarks') self.assertEqual(str(T.M('**Hello World**')), '<strong>Hello World</strong>') T.force('it') self.assertEqual(str(T('Hello World')), 'Salve Mondo') except ImportError: logging.warning("Skipped test case, no multiprocessing module.") if __name__ == '__main__': unittest.main()
true
true