repo
stringclasses
885 values
file
stringclasses
741 values
content
stringlengths
4
215k
https://github.com/joshy91/PythonQiskit
joshy91
import numpy as np import scipy from scipy.linalg import expm import matplotlib.pyplot as plt from mpl_toolkits.mplot3d import Axes3D from sklearn import datasets from sklearn.model_selection import train_test_split from sklearn.preprocessing import StandardScaler, MinMaxScaler from sklearn.decomposition import PCA import pandas as pd from qiskit import BasicAer from qiskit.aqua.input import ClassificationInput from qiskit.aqua import run_algorithm def Currency(training_size, test_size, n, PLOT_DATA): class_labels = [r'Buy', r'Sell', r'Hold'] training_url = "https://raw.githubusercontent.com/joshy91/PythonQiskit/master/EURUSDTrainingData.csv" training=pd.read_csv(training_url, sep=',',header=0) trainingNP = training.to_numpy() sample_train = trainingNP[:,:-2] label_train = trainingNP[:,-2] label_train[label_train == 'Buy'] = 0 label_train[label_train == 'Sell'] = 1 label_train[label_train == 'Hold'] = 2 test_url = "https://raw.githubusercontent.com/joshy91/PythonQiskit/master/EURUSDTestData.csv" test=pd.read_csv(test_url, sep=',',header=0) testNP = test.to_numpy() sample_test = testNP[:,:-2] label_test = testNP[:,-2] label_test[label_test == 'Buy'] = 0 label_test[label_test == 'Sell'] = 1 label_test[label_test == 'Hold'] = 2 # Now we standarize for gaussian around 0 with unit variance std_scale = StandardScaler().fit(sample_train) sample_train = std_scale.transform(sample_train) sample_test = std_scale.transform(sample_test) # Now reduce number of features to number of qubits pca = PCA(n_components=n).fit(sample_train) sample_train = pca.transform(sample_train) sample_test = pca.transform(sample_test) # Scale to the range (-1,+1) samples = np.append(sample_train, sample_test, axis=0) minmax_scale = MinMaxScaler((-1, 1)).fit(samples) sample_train = minmax_scale.transform(sample_train) sample_test = minmax_scale.transform(sample_test) # Pick training size number of samples from each distro training_input = {key: (sample_train[label_train == k, :])[:training_size] for k, key in enumerate(class_labels)} test_input = {key: (sample_test[label_test == k, :])[:test_size] for k, key in enumerate(class_labels)} if PLOT_DATA: for k in range(0, 3): plt.scatter(sample_train[label_train == k, 0][:training_size], sample_train[label_train == k, 1][:training_size]) plt.title("PCA dim. reduced Currency dataset") plt.show() return sample_train, training_input, test_input, class_labels n = 2 # dimension of each data point sample_Total, training_input, test_input, class_labels = Currency( training_size=80, test_size=20, n=n, PLOT_DATA=True ) temp = [test_input[k] for k in test_input] total_array = np.concatenate(temp) aqua_dict = { 'problem': {'name': 'classification', 'random_seed': 10598}, 'algorithm': { 'name': 'QSVM' }, 'feature_map': {'name': 'SecondOrderExpansion', 'depth': 2, 'entangler_map': [[0, 1]]}, 'multiclass_extension': {'name': 'AllPairs'}, 'backend': {'shots': 1024} } backend = BasicAer.get_backend('qasm_simulator') algo_input = ClassificationInput(training_input, test_input, total_array) result = run_algorithm(aqua_dict, algo_input, backend=backend) for k,v in result.items(): print("'{}' : {}".format(k, v))
https://github.com/IceKhan13/QiskitFlow
IceKhan13
import math import datetime import qiskitflow from qiskit import QuantumRegister, ClassicalRegister, QuantumCircuit def my_quantum_program(experiment_name: str = "Awesome experiment", seed: int = 42): """ Awesome docs here """ qf = qiskitflow.Experiment(experiment_name) start = datetime.datetime.now() # do some quantum coding here qreg_q = QuantumRegister(5, 'q') creg_c = ClassicalRegister(5, 'c') circuit = QuantumCircuit(qreg_q, creg_c) circuit.u3(3.141592653589793, 1.5707963267948966, 4.71238898038469, qreg_q[0]) quantum_circuit_execution_result = circuit.measure(qreg_q[0], creg_c[0]) end = datetime.datetime.now() execution_time = end - start qf.write_metric("execution time", execution_time) qf.write_parameter("somehting important", "YEAH!") qf.write_parameter("t1", 42) qf.write_parameter("version of calbiration of almaden backend", 0.0.1) qf.write_measurement("intermediate measurement", quantum_circuit_execution_result) qf.write_result({ "something here to write as results": "great!" }) if __name__ == "__main__": my_quantum_program()
https://github.com/1chooo/Quantum-Oracle
1chooo
from qiskit import QuantumCircuit, QuantumRegister qrx = QuantumRegister(3, 'x') qry = QuantumRegister(1, 'y') qc = QuantumCircuit(qrx, qry) qc.x(qry) qc.draw("mpl")
https://github.com/swe-bench/Qiskit__qiskit
swe-bench
# This code is part of Qiskit. # # (C) Copyright IBM 2020, 2023. # # This code is licensed under the Apache License, Version 2.0. You may # obtain a copy of this license in the LICENSE.txt file in the root directory # of this source tree or at http://www.apache.org/licenses/LICENSE-2.0. # # Any modifications or derivative works of this code must retain this # copyright notice, and modified files need to carry a notice indicating # that they have been altered from the originals. """VectorStateFn Class""" from typing import Dict, List, Optional, Set, Union, cast import numpy as np from qiskit import QuantumCircuit from qiskit.circuit import ParameterExpression from qiskit.opflow.list_ops.list_op import ListOp from qiskit.opflow.list_ops.summed_op import SummedOp from qiskit.opflow.list_ops.tensored_op import TensoredOp from qiskit.opflow.operator_base import OperatorBase from qiskit.opflow.state_fns.state_fn import StateFn from qiskit.quantum_info import Statevector from qiskit.utils import algorithm_globals, arithmetic from qiskit.utils.deprecation import deprecate_func class VectorStateFn(StateFn): """Deprecated: A class for state functions and measurements which are defined in vector representation, and stored using Terra's ``Statevector`` class. """ primitive: Statevector # TODO allow normalization somehow? @deprecate_func( since="0.24.0", additional_msg="For code migration guidelines, visit https://qisk.it/opflow_migration.", ) def __init__( self, primitive: Union[list, np.ndarray, Statevector] = None, coeff: Union[complex, ParameterExpression] = 1.0, is_measurement: bool = False, ) -> None: """ Args: primitive: The ``Statevector``, NumPy array, or list, which defines the behavior of the underlying function. coeff: A coefficient multiplying the state function. is_measurement: Whether the StateFn is a measurement operator """ # Lists and Numpy arrays representing statevectors are stored # in Statevector objects for easier handling. if isinstance(primitive, (np.ndarray, list)): primitive = Statevector(primitive) super().__init__(primitive, coeff=coeff, is_measurement=is_measurement) def primitive_strings(self) -> Set[str]: return {"Vector"} @property def num_qubits(self) -> int: return len(self.primitive.dims()) def add(self, other: OperatorBase) -> OperatorBase: if not self.num_qubits == other.num_qubits: raise ValueError( "Sum over statefns with different numbers of qubits, {} and {}, is not well " "defined".format(self.num_qubits, other.num_qubits) ) # Right now doesn't make sense to add a StateFn to a Measurement if isinstance(other, VectorStateFn) and self.is_measurement == other.is_measurement: # Covers Statevector and custom. return VectorStateFn( (self.coeff * self.primitive) + (other.primitive * other.coeff), is_measurement=self._is_measurement, ) return SummedOp([self, other]) def adjoint(self) -> "VectorStateFn": return VectorStateFn( self.primitive.conjugate(), coeff=self.coeff.conjugate(), is_measurement=(not self.is_measurement), ) def permute(self, permutation: List[int]) -> "VectorStateFn": new_self = self new_num_qubits = max(permutation) + 1 if self.num_qubits != len(permutation): # raise OpflowError("New index must be defined for each qubit of the operator.") pass if self.num_qubits < new_num_qubits: # pad the operator with identities new_self = self._expand_dim(new_num_qubits - self.num_qubits) qc = QuantumCircuit(new_num_qubits) # extend the permutation indices to match the size of the new matrix permutation = ( list(filter(lambda x: x not in permutation, range(new_num_qubits))) + permutation ) # decompose permutation into sequence of transpositions transpositions = arithmetic.transpositions(permutation) for trans in transpositions: qc.swap(trans[0], trans[1]) from ..primitive_ops.circuit_op import CircuitOp matrix = CircuitOp(qc).to_matrix() vector = new_self.primitive.data new_vector = cast(np.ndarray, matrix.dot(vector)) return VectorStateFn( primitive=new_vector, coeff=self.coeff, is_measurement=self.is_measurement ) def to_dict_fn(self) -> StateFn: """Creates the equivalent state function of type DictStateFn. Returns: A new DictStateFn equivalent to ``self``. """ from .dict_state_fn import DictStateFn num_qubits = self.num_qubits new_dict = {format(i, "b").zfill(num_qubits): v for i, v in enumerate(self.primitive.data)} return DictStateFn(new_dict, coeff=self.coeff, is_measurement=self.is_measurement) def _expand_dim(self, num_qubits: int) -> "VectorStateFn": primitive = np.zeros(2**num_qubits, dtype=complex) return VectorStateFn( self.primitive.tensor(primitive), coeff=self.coeff, is_measurement=self.is_measurement ) def tensor(self, other: OperatorBase) -> OperatorBase: if isinstance(other, VectorStateFn): return StateFn( self.primitive.tensor(other.primitive), coeff=self.coeff * other.coeff, is_measurement=self.is_measurement, ) return TensoredOp([self, other]) def to_density_matrix(self, massive: bool = False) -> np.ndarray: OperatorBase._check_massive("to_density_matrix", True, self.num_qubits, massive) return self.primitive.to_operator().data * self.coeff def to_matrix(self, massive: bool = False) -> np.ndarray: OperatorBase._check_massive("to_matrix", False, self.num_qubits, massive) vec = self.primitive.data * self.coeff return vec if not self.is_measurement else vec.reshape(1, -1) def to_matrix_op(self, massive: bool = False) -> OperatorBase: return self def to_circuit_op(self) -> OperatorBase: """Return ``StateFnCircuit`` corresponding to this StateFn.""" # pylint: disable=cyclic-import from .circuit_state_fn import CircuitStateFn csfn = CircuitStateFn.from_vector(self.primitive.data) * self.coeff return csfn.adjoint() if self.is_measurement else csfn def __str__(self) -> str: prim_str = str(self.primitive) if self.coeff == 1.0: return "{}({})".format( "VectorStateFn" if not self.is_measurement else "MeasurementVector", prim_str ) else: return "{}({}) * {}".format( "VectorStateFn" if not self.is_measurement else "MeasurementVector", prim_str, self.coeff, ) # pylint: disable=too-many-return-statements def eval( self, front: Optional[ Union[str, Dict[str, complex], np.ndarray, Statevector, OperatorBase] ] = None, ) -> Union[OperatorBase, complex]: if front is None: # this object is already a VectorStateFn return self if not self.is_measurement and isinstance(front, OperatorBase): raise ValueError( "Cannot compute overlap with StateFn or Operator if not Measurement. Try taking " "sf.adjoint() first to convert to measurement." ) if isinstance(front, ListOp) and front.distributive: return front.combo_fn( [self.eval(front.coeff * front_elem) for front_elem in front.oplist] ) if not isinstance(front, OperatorBase): front = StateFn(front) # pylint: disable=cyclic-import from ..operator_globals import EVAL_SIG_DIGITS from .operator_state_fn import OperatorStateFn from .circuit_state_fn import CircuitStateFn from .dict_state_fn import DictStateFn if isinstance(front, DictStateFn): return np.round( sum( v * self.primitive.data[int(b, 2)] * front.coeff for (b, v) in front.primitive.items() ) * self.coeff, decimals=EVAL_SIG_DIGITS, ) if isinstance(front, VectorStateFn): # Need to extract the element or np.array([1]) is returned. return np.round( np.dot(self.to_matrix(), front.to_matrix())[0], decimals=EVAL_SIG_DIGITS ) if isinstance(front, CircuitStateFn): # Don't reimplement logic from CircuitStateFn return np.conj(front.adjoint().eval(self.adjoint().primitive)) * self.coeff if isinstance(front, OperatorStateFn): return front.adjoint().eval(self.primitive) * self.coeff return front.adjoint().eval(self.adjoint().primitive).adjoint() * self.coeff # type: ignore def sample( self, shots: int = 1024, massive: bool = False, reverse_endianness: bool = False ) -> dict: deterministic_counts = self.primitive.probabilities_dict() # Don't need to square because probabilities_dict already does. probs = np.array(list(deterministic_counts.values())) unique, counts = np.unique( algorithm_globals.random.choice( list(deterministic_counts.keys()), size=shots, p=(probs / sum(probs)) ), return_counts=True, ) counts = dict(zip(unique, counts)) if reverse_endianness: scaled_dict = {bstr[::-1]: (prob / shots) for (bstr, prob) in counts.items()} else: scaled_dict = {bstr: (prob / shots) for (bstr, prob) in counts.items()} return dict(sorted(scaled_dict.items(), key=lambda x: x[1], reverse=True))
https://github.com/qiskit-community/qiskit-translations-staging
qiskit-community
from qiskit import QuantumRegister, ClassicalRegister, QuantumCircuit q = QuantumRegister(1) c = ClassicalRegister(1) qc = QuantumCircuit(q, c) qc.h(q) qc.measure(q, c) qc.draw(output='mpl', style={'backgroundcolor': '#EEEEEE'})
https://github.com/qiskit-community/qiskit-translations-staging
qiskit-community
from qiskit.utils import algorithm_globals from qiskit.algorithms.minimum_eigensolvers import QAOA, NumPyMinimumEigensolver from qiskit.algorithms.optimizers import COBYLA from qiskit.primitives import Sampler from qiskit_optimization.algorithms import ( MinimumEigenOptimizer, RecursiveMinimumEigenOptimizer, SolutionSample, OptimizationResultStatus, ) from qiskit_optimization import QuadraticProgram from qiskit.visualization import plot_histogram from typing import List, Tuple import numpy as np # create a QUBO qubo = QuadraticProgram() qubo.binary_var("x") qubo.binary_var("y") qubo.binary_var("z") qubo.minimize(linear=[1, -2, 3], quadratic={("x", "y"): 1, ("x", "z"): -1, ("y", "z"): 2}) print(qubo.prettyprint()) op, offset = qubo.to_ising() print("offset: {}".format(offset)) print("operator:") print(op) qp = QuadraticProgram() qp.from_ising(op, offset, linear=True) print(qp.prettyprint()) algorithm_globals.random_seed = 10598 qaoa_mes = QAOA(sampler=Sampler(), optimizer=COBYLA(), initial_point=[0.0, 0.0]) exact_mes = NumPyMinimumEigensolver() qaoa = MinimumEigenOptimizer(qaoa_mes) # using QAOA exact = MinimumEigenOptimizer(exact_mes) # using the exact classical numpy minimum eigen solver exact_result = exact.solve(qubo) print(exact_result.prettyprint()) qaoa_result = qaoa.solve(qubo) print(qaoa_result.prettyprint()) print("variable order:", [var.name for var in qaoa_result.variables]) for s in qaoa_result.samples: print(s) def get_filtered_samples( samples: List[SolutionSample], threshold: float = 0, allowed_status: Tuple[OptimizationResultStatus] = (OptimizationResultStatus.SUCCESS,), ): res = [] for s in samples: if s.status in allowed_status and s.probability > threshold: res.append(s) return res filtered_samples = get_filtered_samples( qaoa_result.samples, threshold=0.005, allowed_status=(OptimizationResultStatus.SUCCESS,) ) for s in filtered_samples: print(s) fvals = [s.fval for s in qaoa_result.samples] probabilities = [s.probability for s in qaoa_result.samples] np.mean(fvals) np.std(fvals) samples_for_plot = { " ".join(f"{qaoa_result.variables[i].name}={int(v)}" for i, v in enumerate(s.x)): s.probability for s in filtered_samples } samples_for_plot plot_histogram(samples_for_plot) rqaoa = RecursiveMinimumEigenOptimizer(qaoa, min_num_vars=1, min_num_vars_optimizer=exact) rqaoa_result = rqaoa.solve(qubo) print(rqaoa_result.prettyprint()) filtered_samples = get_filtered_samples( rqaoa_result.samples, threshold=0.005, allowed_status=(OptimizationResultStatus.SUCCESS,) ) samples_for_plot = { " ".join(f"{rqaoa_result.variables[i].name}={int(v)}" for i, v in enumerate(s.x)): s.probability for s in filtered_samples } samples_for_plot plot_histogram(samples_for_plot) import qiskit.tools.jupyter %qiskit_version_table %qiskit_copyright
https://github.com/qiskit-community/qgss-2023
qiskit-community
# required imports: from qiskit.visualization import array_to_latex from qiskit.quantum_info import Statevector, random_statevector from qiskit.quantum_info.operators import Operator, Pauli from qiskit import QuantumCircuit from qiskit.circuit.library import HGate, CXGate import numpy as np ket0 = [[1],[0]] array_to_latex(ket0) bra0 = [1,0] array_to_latex(bra0) ket1 = [[0], [1]] bra1 = [0, 1] from qc_grader.challenges.qgss_2023 import grade_lab1_ex1 grade_lab1_ex1([ket1, bra1]) sv_bra0 = Statevector(bra0) sv_bra0 sv_bra0.draw('latex') sv_eq = Statevector([1/2, 3/4, 4/5, 6/8]) sv_eq.draw('latex') sv_eq.is_valid() sv_valid = Statevector([1/2, 1/2, 1/2, 1/2]) from qc_grader.challenges.qgss_2023 import grade_lab1_ex2 grade_lab1_ex2(sv_valid) op_bra0 = Operator(bra0) op_bra0 op_ket0 = Operator(ket0) op_bra0.tensor(op_ket0) braket = np.dot(op_bra0,op_ket0) array_to_latex(braket) ketbra = np.outer(ket0,bra0) array_to_latex(ketbra) braket = np.dot(op_bra0,op_ket0) array_to_latex(braket) bra1ket0 = [0] bra0ket1 = [0] bra1ket1 = [1] ket1bra0 = [[0, 0], [1, 0]] ket0bra1 = [[0, 1], [0, 0]] ket1bra1 = [[0, 0], [0, 1]] from qc_grader.challenges.qgss_2023 import grade_lab1_ex3 grade_lab1_ex3([bra1ket0, bra0ket1, bra1ket1, ket1bra0, ket0bra1, ket1bra1]) answer = ['a'] from qc_grader.challenges.qgss_2023 import grade_lab1_ex4 grade_lab1_ex4(answer) m1 = Operator([[1,1],[0,0]]) array_to_latex(m1) m3 = Operator([[0,1],[1,0]]) array_to_latex(m3) array_to_latex(m1@ket0) m2 = Operator([[1, 0], [0, 1]]) m4 = Operator([[0, 0], [1, 1]]) from qc_grader.challenges.qgss_2023 import grade_lab1_ex5 grade_lab1_ex5([m2, m4]) cnot = CXGate() array_to_latex(cnot) m3.is_unitary() random = Operator(np.array([[ 0.50778085-0.44607116j, -0.1523741 +0.14128434j, 0.44607116+0.50778085j, -0.14128434-0.1523741j ], [ 0.16855994+0.12151822j, 0.55868196+0.38038841j, -0.12151822+0.16855994j, -0.38038841+0.55868196j], [ 0.50778085-0.44607116j, -0.1523741 +0.14128434j, -0.44607116-0.50778085j, 0.14128434+0.1523741j ], [ 0.16855994+0.12151822j, 0.55868196+0.38038841j, 0.12151822-0.16855994j, 0.38038841-0.55868196j]])) random.is_unitary() non_unitary_op = Operator(np.array([0,1,2,3])) from qc_grader.challenges.qgss_2023 import grade_lab1_ex6 grade_lab1_ex6(non_unitary_op) pauli_x = Pauli('X') array_to_latex(pauli_x) pauli_y = Pauli('Y') array_to_latex(pauli_y) pauli_z = Pauli('Z') array_to_latex(pauli_z) op_x = Operator(pauli_x) op_x op_new = np.dot(op_x,ket0) array_to_latex(op_new) result = [[0.+0.j], [-1.+0.j]] from qc_grader.challenges.qgss_2023 import grade_lab1_ex7 grade_lab1_ex7(result) hadamard = HGate() array_to_latex(hadamard) hop = Operator(hadamard) hop.is_unitary() bell = QuantumCircuit(2) bell.h(0) # apply an H gate to the circuit bell.cx(0,1) # apply a CNOT gate to the circuit bell.draw(output="mpl") bell_op = Operator(bell) array_to_latex(bell_op) ghz = QuantumCircuit(3) ############################## # add gates to your circuit here ghz.h(0) ghz.cx(0, 1) ghz.cx(1, 2) ############################## ghz.draw(output='mpl') from qc_grader.challenges.qgss_2023 import grade_lab1_ex8 grade_lab1_ex8(ghz) plus_state = Statevector.from_label("+") plus_state.draw('latex') plus_state plus_state.probabilities_dict() # run this cell multiple times to show collapsing into one state or the other res = plus_state.measure() res qc = QuantumCircuit(1,1) qc.h(0) qc.measure(0, 0) qc.draw(output="mpl") sv_bell = Statevector([np.sqrt(1/2), 0, 0, np.sqrt(1/2)]) sv_bell.draw('latex') sv_bell.probabilities_dict() sv_psi_plus = Statevector([0, np.sqrt(1/2), np.sqrt(1/2), 0]) prob_psi_plus = {'01': 0.5000000000000001, '10': 0.5000000000000001} sv_psi_minus = Statevector([0, np.sqrt(1/2), -np.sqrt(1/2), 0]) prob_psi_minus = {'01': 0.5000000000000001, '10': 0.5000000000000001} sv_phi_minus = Statevector([np.sqrt(1/2), 0, 0, -np.sqrt(1/2)]) prob_phi_minus = {'00': 0.5000000000000001, '11': 0.5000000000000001} from qc_grader.challenges.qgss_2023 import grade_lab1_ex9 grade_lab1_ex9([prob_psi_plus, prob_psi_minus, prob_phi_minus]) qft = QuantumCircuit(2) ############################## # add gates to your circuit here qft.h(1) qft.cp(np.pi/2, 0, 1) qft.h(0) qft.swap(0, 1) ############################## qft.draw(output='mpl') from qc_grader.challenges.qgss_2023 import grade_lab1_ex10 grade_lab1_ex10(qft) U = Operator(qft) array_to_latex(U)
https://github.com/wrlee7609/hybrid_quantum_gap_estimation
wrlee7609
# Ignore warning message import warnings warnings.filterwarnings("ignore") # Import python libraries import math, json import numpy as np from numpy import pi from numpy.linalg import eigvals from numpy.fft import fft, rfft from scipy.interpolate import CubicSpline from scipy.optimize import curve_fit, minimize import networkx as nx import matplotlib.pyplot as plt from matplotlib import colors # Import Qiskit libraries import qiskit import qiskit_aer.noise as noise from qiskit import QuantumCircuit, QuantumRegister, ClassicalRegister, IBMQ, Aer, transpile, execute from qiskit_aer import AerSimulator from qiskit_aer.noise import NoiseModel, depolarizing_error from qiskit.result import marginal_counts # Load IBMQ account provider = IBMQ.load_account() # Problem: Max-cut problem import networkx as nx from scipy.optimize import minimize def maxcut_obj(x, G): obj = 0 for i, j in G.edges(): if x[i] != x[j]: obj -= 1 return obj def compute_expectation(counts, G): avg = 0 sum_count = 0 for bitstring, count in counts.items(): obj = maxcut_obj(bitstring[::-1], G) avg += obj * count sum_count += count return avg/sum_count def create_qaoa_circ(G, theta): nqubits = len(G.nodes()) p = len(theta)//2 # number of alternating unitaries qc = QuantumCircuit(nqubits) beta = theta[:p] gamma = theta[p:] # initial_state for i in range(0, nqubits): qc.h(i) for irep in range(0, p): # problem unitary for pair in list(G.edges()): qc.rzz(2 * gamma[irep], pair[0], pair[1]) # mixer unitary for i in range(0, nqubits): qc.rx(2 * beta[irep], i) qc.measure_all() return qc def get_expectation(G, shots=512): backend = Aer.get_backend('qasm_simulator') backend.shots = shots def execute_circ(theta): qc = create_qaoa_circ(G, theta) counts = backend.run(qc, seed_simulator=10, nshots=512).result().get_counts() return compute_expectation(counts, G) return execute_circ G = nx.Graph() G.add_nodes_from([0, 1, 2, 3]) G.add_edges_from([(0, 1), (1, 2), (2, 3), (3, 0)]) expectation = get_expectation(G) result = minimize(expectation, [1.0, 1.0], method='Nelder-Mead', tol=1e-3) result # Problem: Rosenberg function from numpy import atleast_1d, eye, argmin, zeros, shape, squeeze, asarray, sqrt, Inf, asfarray import numpy as np from scipy.optimize import minimize def rosen(x): x = np.array(x) r = np.sum(100.0 * a * (x[1:] - x[:-1]**2.0)**2.0 + (1 - x[:-1])**2.0, axis=0) return r def callback(x): global Nfeval print(' {0:4d} {1:3.6f} {2:3.6f} {3:3.6f} {4:3.6f} {5:3.6f}'.format(Nfeval, x[0], x[1], x[2], x[3], rosen(x))) Nfeval += 1 print('{0:4s} {1:9s} {2:9s} {3:9s} {4:9s} {5:9s}'.format('Iteration', ' X1', ' X2', ' X3', ' X4', 'f(X)')) Nfeval = 1 a = 1 x0 = [1.3, 0.7, 0.9, 1.1] result = minimize(rosen, x0, method='Nelder-Mead', tol=1e-3, callback=callback) result # Problem: Transverse-field Ising model # Set up parameters Nc = 5 # number of spins: N (= 2, 3, 4, 5) g = 0.4 # dimensionless Ising coupling: J/h (= 0.2, 0.4, 0.6, 0.8) eta = 0.3 # dimensionless broadening: \eta/h (= 0.02, 0.1, 0.2, 0.3) dw = 0.25*eta # dimensionless unit of discrete frequency: \delta\omega / h L = 2*math.ceil(7.0/dw) # count of Fourier components: L Le = 100 dt = 2*pi/L/dw # dimensionless unit of discrete time: h \delta t M = 35 # Trotter depth cutoff: M shots = 1024 # count of measurement shots # Define the identity and Pauli matrices s0 = np.matrix([[1,0],[0,1]]) s1 = np.matrix([[0,1],[1,0]]) s2 = np.matrix([[0,-1j],[1j,0]]) s3 = np.matrix([[1,0],[0,-1]]) # Define the model Hamitonian Ham = np.kron(s1,s0) + np.kron(s0,s1) + g * np.kron(s3,s3) if Nc >= 3: for j in range(3,Nc+1): Ide = s0 for k in range(j-3): Ide = np.kron(Ide,s0) Ham = np.kron(Ham,s0) + np.kron(np.kron(Ide,s0),s1) + g * np.kron(np.kron(Ide,s3),s3) # Calculate the exact energy gap evals = eigvals(Ham) idx = evals.argsort()[::1] evals = evals[idx] ExactGap = evals[1] - evals[0] # set the initial guess of energy gap IniGap = 2*(1-(1-1/Nc)*g) # Define the bit string (00...0) as a reference for thr initial state s = [] for j in range (Nc): s.append('0') str1 = "" InQ = str1.join(s) # Define discrete frequencies frequency = [(j-L/2)*dw for j in range(L+1)] with open('data_frequency', 'w') as f: f.write(json.dumps(frequency)) # Define the objective function for curve fitting of the Lorentzian function def objective (x, a0, a1, a2): return a0 + a1 / ((x - a2)**2 + eta**2) # Print preliminary data print("N = %s, J/h = %.2f, M = %s" % (Nc,g,M)) print("Initial gap = %.6f" % IniGap) print("Exact gap = %.6f" % ExactGap) # Simulation type: ideal (noiseless) def InvPeak_Ideal(theta): global ExactGap, IniGap # number of alternating unitaries P = len(theta)//2 beta = theta[:P] gamma = theta[P:] # Loop for causal (i=0) and anti-causal (i=1) processes for i in range (2): # Initialize array propagator = [] # Loop for Fourier components for j in range (L): # Initialize a set of quantum/classical registers qreg = QuantumRegister(Nc, 'q') creg = ClassicalRegister(Nc, 'c') qc = QuantumCircuit(qreg, creg) # Set up the unitary for trial state for p in range (P): for n in range (Nc-1): qc.rzz(gamma[p]*pi, qreg[n], qreg[n+1]) for n in range (Nc): qc.ry(beta[p]*pi, qreg[n]) # Time evolution: Iterate Trotter steps for m in range (M): # Apply a sequence of unitary gates for time evolution for n in range (Nc): qc.rx(-2*j*(-1)**i*dt/M, qreg[n]) for n in range (Nc-1): qc.rzz(-2*g*j*(-1)**i*dt/M, qreg[n], qreg[n+1]) # Set up the inverse unitary for trial state for p in range (P): for n in range (Nc): qc.ry(-beta[P-p-1]*pi, qreg[n]) for n in range (Nc-1): qc.rzz(-gamma[P-p-1]*pi, qreg[n], qreg[n+1]) # Measure qubits qc.measure(qreg, creg) # Perform quantum simulation on the IBMQ Aer simulator simulator = Aer.get_backend('qasm_simulator') result = execute(qc, simulator, shots = shots).result() counts = result.get_counts() # Construct a time series of propagators with each component being the probability for (00...0) if InQ in counts: propagator.append(dt*np.exp(-eta*j*dt)*counts[InQ]/shots) else: propagator.append(0) # Print the end message for each step if (i==1) and (j>L-10): print(L-1-j,end="\r") # Flatten array propagator = np.ravel(propagator) # Find the many-body spectral function via discreate fast Fourier transform if i == 0: spectral_function_0r = np.real(np.fft.ifft(propagator))*L/2.0/pi spectral_function_1r = np.append(spectral_function_0r[int(L/2):L], spectral_function_0r[0:int(L/2)+1]) else: spectral_function_0a = np.real(np.fft.fft(propagator))/2.0/pi spectral_function_1a = np.append(spectral_function_0a[int(L/2):L], spectral_function_0a[0:int(L/2)+1]) # Find the many-body spectral function via discreate fast Fourier transform spectral_function_2 = [spectral_function_1r[j] + spectral_function_1a[j] for j in range(L+1)] # Truncate the lists in the range [-\eta,\eta] frequency_truncated = [frequency[j] for j in range(math.ceil(L/2-2*eta/dw),math.ceil(L/2+1+2*eta/dw))] spectral_function_truncated = [spectral_function_2[j] for j in range(math.ceil(L/2-2*eta/dw),math.ceil(L/2+1+2*eta/dw))] # Curve fitting for the Lorentzian function a2 = 0 popt, _ = curve_fit(lambda x, a0, a1: objective(x, a0, a1, a2), frequency_truncated, spectral_function_truncated) a0, a1 = popt # Subtract the zeto peak from the manu-body spectral function spectral_function = [spectral_function_2[j] - a1 / (frequency[j]**2 + eta**2) for j in range(L+1)] # Truncate the lists in the range [IniGap-\eta,IniGap+\eta] frequency_truncated = [frequency[j] for j in range(math.ceil(L/2+(IniGap-2*eta)/dw),math.ceil(L/2+1+(IniGap+2*eta)/dw))] spectral_function_truncated = [spectral_function[j] for j in range(math.ceil(L/2+(IniGap-2*eta)/dw),math.ceil(L/2+1+(IniGap+2*eta)/dw))] # Curve fitting for the Lorentzian function popt, _ = curve_fit(objective, frequency_truncated, spectral_function_truncated) a0, a1, a2 = popt return -a1/eta**2, a2, abs(a2 - ExactGap)/ExactGap, spectral_function # Define wrapper functions def InvPeak_Ideal_1(theta): obj1, obj2, obj3, obj4 = InvPeak_Ideal(theta) return obj1 def InvPeak_Ideal_2(theta): obj1, obj2, obj3, obj4 = InvPeak_Ideal(theta) return obj2 def InvPeak_Ideal_3(theta): obj1, obj2, obj3, obj4 = InvPeak_Ideal(theta) return obj3 def InvPeak_Ideal_4(theta): obj1, obj2, obj3, obj4 = InvPeak_Ideal(theta) return obj4 # Define callback function def callback (theta): global data, Nfeval, theta0 Nfeval += 1 P0 = len(theta0)//2 beta0 = theta0[:P0] gamma0 = theta0[P0:] P = len(theta)//2 beta = theta[:P] gamma = theta[P:] peak = -InvPeak_Ideal_1(theta) gap_est = InvPeak_Ideal_2(theta) gap_err = InvPeak_Ideal_3(theta) spectral_function = InvPeak_Ideal_4(theta) # Print/save data print(' {0:4d} {1:3.6f} {2:3.6f} {3:3.6f} {4:3.6f} {5:3.6f}'\ .format(Nfeval, beta[0], gamma[0], peak, gap_est, gap_err)) data.append([Nfeval, beta[0], gamma[0], peak, gap_est, gap_err]) with open('data_spectral_ideal_N%s_g%.2f_eta%.2f_M%s_beta%.2f_gamma%.2f_NM%s' % (int(Nc),g,eta,int(M),beta0[0],gamma0[0],int(Nfeval)), 'w') as f: f.write(json.dumps(spectral_function)) # Print the start message print("Simulation type: Ideal") print("Optimization method: Nelder-Mead") # Set parameters data = [] Nfeval = 0 theta0 = [0.5, 0.1] P0 = len(theta0)//2 beta0 = theta0[:P0] gamma0 = theta0[P0:] bounds = ((0,2),(0,2)) # Save data print('{0:4s} {1:9s} {2:9s} {3:9s} {4:9s} {5:9s}'\ .format('Iteration',' beta/pi','gamma/pi','height','gap_est','gap_error')) # Estimate energy gap result = minimize(InvPeak_Ideal_1, theta0, method='Nelder-Mead', tol=1e-2, bounds=bounds, callback=callback) # Save data with open('data_iteration_ideal_N%s_g%.2f_eta%.2f_M%s_beta%.2f_gamma%.2f_NM' % (int(Nc),g,eta,int(M),beta0[0],gamma0[0]), 'w') as f: f.write(json.dumps(data)) # Print the end message print(result) # Build noise model from backend calibration data backend = provider.get_backend("ibmq_manila") noise_model = NoiseModel.from_backend(backend) coupling_map = backend.configuration().coupling_map basis_gates = noise_model.basis_gates # Simulation type: Device noise model def InvPeak_Noisy(theta): global ExactGap, IniGap # number of alternating unitaries P = len(theta)//2 beta = theta[:P] gamma = theta[P:] # Loop for causal (i=0) and anti-causal (i=1) processes for i in range (2): # Print the message #print("...running") # Initialize array propagator = [] # Loop for Fourier components for j in range (L): # Initialize a set of quantum/classical registers qreg = QuantumRegister(Nc, 'q') creg = ClassicalRegister(Nc, 'c') qc = QuantumCircuit(qreg, creg) # Set up input state in QAOA for p in range (P): for n in range (Nc-1): qc.rzz(gamma[p]*pi, qreg[n], qreg[n+1]) for n in range (Nc): qc.ry(beta[p]*pi, qreg[n]) # Time evolution: Iterate Trotter steps for m in range (M): # Apply a sequence of unitary gates for time evolution for n in range (Nc): qc.rx(-2*j*(-1)**i*dt/M, qreg[n]) for n in range (Nc-1): qc.rzz(-2*g*j*(-1)**i*dt/M, qreg[n], qreg[n+1]) # Set up the state to compenstate input in QAOA for p in range (P): for n in range (Nc): qc.ry(-beta[P-p-1]*pi, qreg[n]) for n in range (Nc-1): qc.rzz(-gamma[P-p-1]*pi, qreg[n], qreg[n+1]) # Measure qubits qc.measure(qreg, creg) # Perform quantum simulation on the IBMQ Aer simulator simulator = Aer.get_backend('qasm_simulator') qc_trans = transpile(qc, backend, optimization_level = 1, initial_layout = [k for k in range(Nc)]) result = execute(qc_trans, simulator, noise_model = noise_model, coupling_map = coupling_map,\ basis_gates = basis_gates, shots = shots).result() counts = result.get_counts() # Construct a time series of propagators with each component being the probability for (00...0) if InQ in counts: propagator.append(dt*np.exp(-eta*j*dt)*counts[InQ]/shots) else: propagator.append(0) # Print the end message for each step print(j+1, end="\r") # Flatten array propagator = np.ravel(propagator) # Find the many-body spectral function via discreate fast Fourier transform if i == 0: spectral_function_0r = np.real(np.fft.ifft(propagator))*L/2.0/pi spectral_function_1r = np.append(spectral_function_0r[int(L/2):L], spectral_function_0r[0:int(L/2)+1]) else: spectral_function_0a = np.real(np.fft.fft(propagator))/2.0/pi spectral_function_1a = np.append(spectral_function_0a[int(L/2):L], spectral_function_0a[0:int(L/2)+1]) # Find the many-body spectral function via discreate fast Fourier transform spectral_function_2 = [spectral_function_1r[j] + spectral_function_1a[j] for j in range(L+1)] # Truncate the lists in the range [-\eta,\eta] frequency_truncated = [frequency[j] for j in range(math.ceil(L/2-2*eta/dw),math.ceil(L/2+1+2*eta/dw))] spectral_function_truncated = [spectral_function_2[j] for j in range(math.ceil(L/2-2*eta/dw),math.ceil(L/2+1+2*eta/dw))] # Curve fitting for the Lorentzian function a2 = 0 popt, _ = curve_fit(lambda x, a0, a1: objective(x, a0, a1, a2), frequency_truncated, spectral_function_truncated) a0, a1 = popt # Subtract the zeto peak from the manu-body spectral function spectral_function = [spectral_function_2[j] - a1 / (frequency[j]**2 + eta**2) for j in range(L+1)] # Truncate the lists in the range [IniGap-\eta,IniGap+\eta] frequency_truncated = [frequency[j] for j in range(math.ceil(L/2+(IniGap-2*eta)/dw),math.ceil(L/2+1+(IniGap+2*eta)/dw))] spectral_function_truncated = [spectral_function[j] for j in range(math.ceil(L/2+(IniGap-2*eta)/dw),math.ceil(L/2+1+(IniGap+2*eta)/dw))] # Curve fitting for the Lorentzian function popt, _ = curve_fit(objective, frequency_truncated, spectral_function_truncated) a0, a1, a2 = popt return -a1/eta**2, a2, abs(a2 - ExactGap)/ExactGap, spectral_function # Define wrapper functions def InvPeak_Noisy_1(theta): obj1, obj2, obj3, obj4 = InvPeak_Noisy(theta) return obj1 def InvPeak_Noisy_2(theta): obj1, obj2, obj3, obj4 = InvPeak_Noisy(theta) return obj2 def InvPeak_Noisy_3(theta): obj1, obj2, obj3, obj4 = InvPeak_Noisy(theta) return obj3 def InvPeak_Noisy_4(theta): obj1, obj2, obj3, obj4 = InvPeak_Noisy(theta) return obj4 # Define callback function def callback (theta): global data, Nfeval, theta0 Nfeval += 1 P0 = len(theta0)//2 beta0 = theta0[:P0] gamma0 = theta0[P0:] P = len(theta)//2 beta = theta[:P] gamma = theta[P:] peak = -InvPeak_Noisy_1(theta) gap_est = InvPeak_Noisy_2(theta) gap_err = InvPeak_Noisy_3(theta) spectral_function = InvPeak_Noisy_4(theta) # Print/save data print(' {0:4d} {1:3.6f} {2:3.6f} {3:3.6f} {4:3.6f} {5:3.6f}'\ .format(Nfeval, beta[0], gamma[0], peak, gap_est, gap_err)) data.append([Nfeval, beta[0], gamma[0], peak, gap_est, gap_err]) with open('data_spectral_noisy_N%s_g%.2f_eta%.2f_M%s_beta%.2f_gamma%.2f_NM%s' % (int(Nc),g,eta,int(M),beta0[0],gamma0[0],int(Nfeval)), 'w') as f: f.write(json.dumps(spectral_function)) # Print the start message print("Simulation type: Device noise model") print("Optimization method: Nelder-Mead") # Set parameters data = [] Nfeval = 0 theta0 = [0.5, 0.1] P0 = len(theta0)//2 beta0 = theta0[:P0] gamma0 = theta0[P0:] bounds = ((0,2),(0,2)) # Save data print('{0:4s} {1:9s} {2:9s} {3:9s} {4:9s} {5:9s}'\ .format('Iteration',' beta/pi','gamma/pi','height','gap_est','gap_error')) # Estimate energy gap result = minimize(InvPeak_Noisy_1, theta0, method='Nelder-Mead', tol=1e-2, bounds=bounds, callback=callback) # Save data with open('data_iteration_noisy_N%s_g%.2f_eta%.2f_M%s_beta%.2f_gamma%.2f_NM' % (int(Nc),g,eta,int(M),beta0[0],gamma0[0]), 'w') as f: f.write(json.dumps(data)) # Print the end message print(result)
https://github.com/ionq-samples/getting-started
ionq-samples
import json, os, requests, time from getpass import getpass # Before you begin, get your API key from https://cloud.ionq.com/settings/keys # If your API key is stored as "IONQ_API_KEY" in your local environment, this # should find it. Otherwise you'll be prompted to enter your API key manually. api_key = os.getenv('IONQ_API_KEY') or getpass('Enter your IonQ API key: ') def submit_job(headers, data): url = "https://api.ionq.co/v0.3/jobs" response = requests.post(url, headers=headers, data=data) response_json = response.json() assert response.status_code == 200, f"Error: {response_json.get('message', 'Unknown error')}" return response_json["id"] def query_job(job_id, headers): url = f"https://api.ionq.co/v0.3/jobs/{job_id}" response = requests.get(url, headers=headers) response_json = response.json() assert response.status_code == 200, f"Error: {response_json.get('message', 'Unknown error')}" return response_json["status"] def get_job_results(job_id, headers): url = f"https://api.ionq.co/v0.3/jobs/{job_id}/results" response = requests.get(url, headers=headers) response_json = response.json() assert response.status_code == 200, f"Error: {response_json.get('message', 'Unknown error')}" return response_json headers = { "Authorization": f"apiKey {api_key}", "Content-Type": "application/json", } data = { "name": "API Example Circuit", "shots": 100, "target": "simulator", "input": { "format": "ionq.circuit.v0", "gateset": "qis", "qubits": 2, "circuit": [ { "gate": "h", "target": 0 }, { "gate": "cnot", "control": 0, "target": 1 } ] } } # Now we'll send the job to our backend for processing. job_id = submit_job(headers, json.dumps(data)) # And wait for the job to be run. status = "ready" while status != "completed": time.sleep(1) # wait for 1 second before querying again status = query_job(job_id, headers) # And once the job has run, we can plot the results. results = get_job_results(job_id, headers) print(results)
https://github.com/qiskit-community/qiskit-translations-staging
qiskit-community
from qiskit import QuantumCircuit # Create a circuit with a register of three qubits circ = QuantumCircuit(3) # H gate on qubit 0, putting this qubit in a superposition of |0> + |1>. circ.h(0) # A CX (CNOT) gate on control qubit 0 and target qubit 1 generating a Bell state. circ.cx(0, 1) # CX (CNOT) gate on control qubit 0 and target qubit 2 resulting in a GHZ state. circ.cx(0, 2) # Draw the circuit circ.draw('mpl')
https://github.com/qiskit-community/qiskit-translations-staging
qiskit-community
import numpy as np # Import Qiskit from qiskit import QuantumCircuit from qiskit import Aer, transpile from qiskit.tools.visualization import plot_histogram, plot_state_city import qiskit.quantum_info as qi Aer.backends() simulator = Aer.get_backend('aer_simulator') # Create circuit circ = QuantumCircuit(2) circ.h(0) circ.cx(0, 1) circ.measure_all() # Transpile for simulator simulator = Aer.get_backend('aer_simulator') circ = transpile(circ, simulator) # Run and get counts result = simulator.run(circ).result() counts = result.get_counts(circ) plot_histogram(counts, title='Bell-State counts') # Run and get memory result = simulator.run(circ, shots=10, memory=True).result() memory = result.get_memory(circ) print(memory) # Increase shots to reduce sampling variance shots = 10000 # Stabilizer simulation method sim_stabilizer = Aer.get_backend('aer_simulator_stabilizer') job_stabilizer = sim_stabilizer.run(circ, shots=shots) counts_stabilizer = job_stabilizer.result().get_counts(0) # Statevector simulation method sim_statevector = Aer.get_backend('aer_simulator_statevector') job_statevector = sim_statevector.run(circ, shots=shots) counts_statevector = job_statevector.result().get_counts(0) # Density Matrix simulation method sim_density = Aer.get_backend('aer_simulator_density_matrix') job_density = sim_density.run(circ, shots=shots) counts_density = job_density.result().get_counts(0) # Matrix Product State simulation method sim_mps = Aer.get_backend('aer_simulator_matrix_product_state') job_mps = sim_mps.run(circ, shots=shots) counts_mps = job_mps.result().get_counts(0) plot_histogram([counts_stabilizer, counts_statevector, counts_density, counts_mps], title='Counts for different simulation methods', legend=['stabilizer', 'statevector', 'density_matrix', 'matrix_product_state']) from qiskit_aer import AerError # Initialize a GPU backend # Note that the cloud instance for tutorials does not have a GPU # so this will raise an exception. try: simulator_gpu = Aer.get_backend('aer_simulator') simulator_gpu.set_options(device='GPU') except AerError as e: print(e) # Configure a single-precision statevector simulator backend simulator = Aer.get_backend('aer_simulator_statevector') simulator.set_options(precision='single') # Run and get counts result = simulator.run(circ).result() counts = result.get_counts(circ) print(counts) # Construct quantum circuit without measure circ = QuantumCircuit(2) circ.h(0) circ.cx(0, 1) circ.save_statevector() # Transpile for simulator simulator = Aer.get_backend('aer_simulator') circ = transpile(circ, simulator) # Run and get statevector result = simulator.run(circ).result() statevector = result.get_statevector(circ) plot_state_city(statevector, title='Bell state') # Construct quantum circuit without measure circ = QuantumCircuit(2) circ.h(0) circ.cx(0, 1) circ.save_unitary() # Transpile for simulator simulator = Aer.get_backend('aer_simulator') circ = transpile(circ, simulator) # Run and get unitary result = simulator.run(circ).result() unitary = result.get_unitary(circ) print("Circuit unitary:\n", np.asarray(unitary).round(5)) # Construct quantum circuit without measure steps = 5 circ = QuantumCircuit(1) for i in range(steps): circ.save_statevector(label=f'psi_{i}') circ.rx(i * np.pi / steps, 0) circ.save_statevector(label=f'psi_{steps}') # Transpile for simulator simulator = Aer.get_backend('aer_simulator') circ = transpile(circ, simulator) # Run and get saved data result = simulator.run(circ).result() data = result.data(0) data # Generate a random statevector num_qubits = 2 psi = qi.random_statevector(2 ** num_qubits, seed=100) # Set initial state to generated statevector circ = QuantumCircuit(num_qubits) circ.set_statevector(psi) circ.save_state() # Transpile for simulator simulator = Aer.get_backend('aer_simulator') circ = transpile(circ, simulator) # Run and get saved data result = simulator.run(circ).result() result.data(0) # Use initilize instruction to set initial state circ = QuantumCircuit(num_qubits) circ.initialize(psi, range(num_qubits)) circ.save_state() # Transpile for simulator simulator = Aer.get_backend('aer_simulator') circ = transpile(circ, simulator) # Run and get result data result = simulator.run(circ).result() result.data(0) num_qubits = 2 rho = qi.random_density_matrix(2 ** num_qubits, seed=100) circ = QuantumCircuit(num_qubits) circ.set_density_matrix(rho) circ.save_state() # Transpile for simulator simulator = Aer.get_backend('aer_simulator') circ = transpile(circ, simulator) # Run and get saved data result = simulator.run(circ).result() result.data(0) # Generate a random Clifford C num_qubits = 2 stab = qi.random_clifford(num_qubits, seed=100) # Set initial state to stabilizer state C|0> circ = QuantumCircuit(num_qubits) circ.set_stabilizer(stab) circ.save_state() # Transpile for simulator simulator = Aer.get_backend('aer_simulator') circ = transpile(circ, simulator) # Run and get saved data result = simulator.run(circ).result() result.data(0) # Generate a random unitary num_qubits = 2 unitary = qi.random_unitary(2 ** num_qubits, seed=100) # Set initial state to unitary circ = QuantumCircuit(num_qubits) circ.set_unitary(unitary) circ.save_state() # Transpile for simulator simulator = Aer.get_backend('aer_simulator') circ = transpile(circ, simulator) # Run and get saved data result = simulator.run(circ).result() result.data(0) import qiskit.tools.jupyter %qiskit_version_table %qiskit_copyright
https://github.com/rodneyosodo/variational-quantum-classifier-on-heartattack
rodneyosodo
import pandas as pd import numpy as np import matplotlib.pyplot as plt import seaborn as sns import pandas_profiling as pp from sklearn.datasets import load_wine %matplotlib inline # Constants DATA_PATH = "../../Data/Raw/data.csv" CLEAN_DATA_PATH = "../../Data/Processed/winedata.csv" raw_data = load_wine() features = pd.DataFrame(data=raw_data['data'],columns=raw_data['feature_names']) data = features data['target']=raw_data['target'] data['class']=data['target'].map(lambda ind: raw_data['target_names'][ind]) data.head() data.shape data.columns print(raw_data['DESCR']) data.info() data.describe() def check_unique(df): """" Checks the unique value in each column :param df: The dataframe """ for col in df.columns: unique = df[col].unique() print("Column: {} has {} unique values\n".format(col, unique)) check_unique(data) fig = plt.figure() sns.countplot(x="target", data=data, palette="gist_rainbow_r") plt.xlabel("Heart disease (0 = have, 1 = don't)") plt.title("Target distribution") plt.show() fig.savefig("../../Output/Figures/targetdist.png", ) data = data[data['class'] != 'class_2'] data.duplicated().sum() data.drop_duplicates(inplace=True) data.drop('target', axis=1).corrwith(data['target']).plot(kind='bar', grid=True, figsize=(12, 8), title="Correlation with target") pp.ProfileReport(df=data, dark_mode=True, explorative=True) data = data[['alcohol', 'flavanoids', 'color_intensity', 'proline', 'target']] data.to_csv(CLEAN_DATA_PATH, index=False)
https://github.com/qiskit-community/qiskit-translations-staging
qiskit-community
from qiskit.circuit import Parameter from qiskit import QuantumCircuit theta = Parameter('$\\theta$') chsh_circuits_no_meas = QuantumCircuit(2) chsh_circuits_no_meas.h(0) chsh_circuits_no_meas.cx(0, 1) chsh_circuits_no_meas.ry(theta, 0) chsh_circuits_no_meas.draw('mpl') import numpy as np number_of_phases = 21 phases = np.linspace(0, 2*np.pi, number_of_phases) # Phases need to be expressed as list of lists in order to work individual_phases = [[ph] for ph in phases] from qiskit_ibm_runtime import QiskitRuntimeService service = QiskitRuntimeService() backend = "ibmq_qasm_simulator" # use the simulator from qiskit_ibm_runtime import Estimator, Session from qiskit.quantum_info import SparsePauliOp ZZ = SparsePauliOp.from_list([("ZZ", 1)]) ZX = SparsePauliOp.from_list([("ZX", 1)]) XZ = SparsePauliOp.from_list([("XZ", 1)]) XX = SparsePauliOp.from_list([("XX", 1)]) ops = [ZZ, ZX, XZ, XX] chsh_est_sim = [] # Simulator with Session(service=service, backend=backend): estimator = Estimator() for op in ops: job = estimator.run( circuits=[chsh_circuits_no_meas]*len(individual_phases), observables=[op]*len(individual_phases), parameter_values=individual_phases) est_result = job.result() chsh_est_sim.append(est_result) # <CHSH1> = <AB> - <Ab> + <aB> + <ab> chsh1_est_sim = chsh_est_sim[0].values - chsh_est_sim[1].values + chsh_est_sim[2].values + chsh_est_sim[3].values # <CHSH2> = <AB> + <Ab> - <aB> + <ab> chsh2_est_sim = chsh_est_sim[0].values + chsh_est_sim[1].values - chsh_est_sim[2].values + chsh_est_sim[3].values import matplotlib.pyplot as plt import matplotlib.ticker as tck fig, ax = plt.subplots(figsize=(10, 6)) # results from a simulator ax.plot(phases/np.pi, chsh1_est_sim, 'o-', label='CHSH1 Simulation') ax.plot(phases/np.pi, chsh2_est_sim, 'o-', label='CHSH2 Simulation') # classical bound +-2 ax.axhline(y=2, color='r', linestyle='--') ax.axhline(y=-2, color='r', linestyle='--') # quantum bound, +-2√2 ax.axhline(y=np.sqrt(2)*2, color='b', linestyle='-.') ax.axhline(y=-np.sqrt(2)*2, color='b', linestyle='-.') # set x tick labels to the unit of pi ax.xaxis.set_major_formatter(tck.FormatStrFormatter('%g $\pi$')) ax.xaxis.set_major_locator(tck.MultipleLocator(base=0.5)) # set title, labels, and legend plt.title('Violation of CHSH Inequality') plt.xlabel('Theta') plt.ylabel('CHSH witness') plt.legend() import qiskit_ibm_runtime qiskit_ibm_runtime.version.get_version_info() import qiskit.tools.jupyter %qiskit_version_table %qiskit_copyright
https://github.com/mathelatics/QGSS-2023-From-Theory-to-Implementations
mathelatics
from qiskit import * %matplotlib inline from qiskit.tools.visualization import plot_histogram qc = QuantumCircuit(3, 3) qc.draw(output='mpl') # we will teleport the state q_0 to q_2 with using q_1 qc.x(0) qc.barrier() qc.draw(output='mpl') # barrier decide that after barrier q_0 has state |1> than of |0> qc.h(1) qc.cx(1, 2) qc.draw(output='mpl') # It created an entangled state means same qubit exits on q_1 and q_2 at the same time also qc.cx(0, 1) qc.h(0) qc.draw(output='mpl') qc.barrier() qc.measure([0,1],[0,1]) qc.draw(output='mpl') # before measure all the states are entangled but to complete the teleportation process qc.barrier() qc.cx(1,2) qc.cz(0,2) qc.draw(output='mpl') # the qubit at q_0 teleported to the state q_2 # let's measure q_2 states qc.measure(2,2) simulator = Aer.get_backend('qasm_simulator') result = execute(qc, backend=simulator, shots=1024).result() counts = result.get_counts() plot_histogram(counts) print(counts) # It is used to transfer quantum information over long distances """ Question : Build a Quantum Teleportation circuit to teleport the qubit |+> or |-> """ qc = QuantumCircuit(3, 3) qc.h(0) qc.barrier() qc.draw(output='mpl')
https://github.com/qiskit-community/qiskit-translations-staging
qiskit-community
# You can set a color for all the bars. from qiskit import QuantumCircuit from qiskit.quantum_info import Statevector from qiskit.visualization import plot_state_paulivec qc = QuantumCircuit(2) qc.h(0) qc.cx(0, 1) state = Statevector(qc) plot_state_paulivec(state, color='midnightblue', title="New PauliVec plot")
https://github.com/abbarreto/qiskit3
abbarreto
https://github.com/DaisukeIto-ynu/KosakaQ
DaisukeIto-ynu
# -*- coding: utf-8 -*- # This code is part of Qiskit. # # (C) Copyright IBM 2017. # # This code is licensed under the Apache License, Version 2.0. You may # obtain a copy of this license in the LICENSE.txt file in the root directory # of this source tree or at http://www.apache.org/licenses/LICENSE-2.0. # # Any modifications or derivative works of this code must retain this # copyright notice, and modified files need to carry a notice indicating # that they have been altered from the originals. # pylint: disable=wrong-import-order """Main Qiskit public functionality.""" import pkgutil # First, check for required Python and API version from . import util # qiskit errors operator from .exceptions import QiskitError # The main qiskit operators from qiskit.circuit import ClassicalRegister from qiskit.circuit import QuantumRegister from qiskit.circuit import QuantumCircuit # pylint: disable=redefined-builtin from qiskit.tools.compiler import compile # TODO remove after 0.8 from qiskit.execute import execute # The qiskit.extensions.x imports needs to be placed here due to the # mechanism for adding gates dynamically. import qiskit.extensions import qiskit.circuit.measure import qiskit.circuit.reset # Allow extending this namespace. Please note that currently this line needs # to be placed *before* the wrapper imports or any non-import code AND *before* # importing the package you want to allow extensions for (in this case `backends`). __path__ = pkgutil.extend_path(__path__, __name__) # Please note these are global instances, not modules. from qiskit.providers.basicaer import BasicAer # Try to import the Aer provider if installed. try: from qiskit.providers.aer import Aer except ImportError: pass # Try to import the IBMQ provider if installed. try: from qiskit.providers.ibmq import IBMQ except ImportError: pass from .version import __version__ from .version import __qiskit_version__
https://github.com/2lambda123/Qiskit-qiskit
2lambda123
# This code is part of Qiskit. # # (C) Copyright IBM 2021, 2024. # # This code is licensed under the Apache License, Version 2.0. You may # obtain a copy of this license in the LICENSE.txt file in the root directory # of this source tree or at http://www.apache.org/licenses/LICENSE-2.0. # # Any modifications or derivative works of this code must retain this # copyright notice, and modified files need to carry a notice indicating # that they have been altered from the originals. """Dynamical Decoupling insertion pass.""" import itertools import numpy as np from qiskit.circuit import Gate, Delay, Reset from qiskit.circuit.library.standard_gates import IGate, UGate, U3Gate from qiskit.dagcircuit import DAGOpNode, DAGInNode from qiskit.quantum_info.operators.predicates import matrix_equal from qiskit.synthesis.one_qubit import OneQubitEulerDecomposer from qiskit.transpiler import InstructionDurations from qiskit.transpiler.passes.optimization import Optimize1qGates from qiskit.transpiler.basepasses import TransformationPass from qiskit.transpiler.exceptions import TranspilerError from qiskit.utils.deprecation import deprecate_func class DynamicalDecoupling(TransformationPass): """Dynamical decoupling insertion pass. This pass works on a scheduled, physical circuit. It scans the circuit for idle periods of time (i.e. those containing delay instructions) and inserts a DD sequence of gates in those spots. These gates amount to the identity, so do not alter the logical action of the circuit, but have the effect of mitigating decoherence in those idle periods. As a special case, the pass allows a length-1 sequence (e.g. [XGate()]). In this case the DD insertion happens only when the gate inverse can be absorbed into a neighboring gate in the circuit (so we would still be replacing Delay with something that is equivalent to the identity). This can be used, for instance, as a Hahn echo. This pass ensures that the inserted sequence preserves the circuit exactly (including global phase). .. plot:: :include-source: import numpy as np from qiskit.circuit import QuantumCircuit from qiskit.circuit.library import XGate from qiskit.transpiler import PassManager, InstructionDurations from qiskit.transpiler.passes import ALAPSchedule, DynamicalDecoupling from qiskit.visualization import timeline_drawer # Because the legacy passes do not propagate the scheduling information correctly, it is # necessary to run a no-op "re-schedule" before the output circuits can be drawn. def draw(circuit): from qiskit import transpile scheduled = transpile( circuit, optimization_level=0, instruction_durations=InstructionDurations(), scheduling_method="alap", ) return timeline_drawer(scheduled) circ = QuantumCircuit(4) circ.h(0) circ.cx(0, 1) circ.cx(1, 2) circ.cx(2, 3) circ.measure_all() durations = InstructionDurations( [("h", 0, 50), ("cx", [0, 1], 700), ("reset", None, 10), ("cx", [1, 2], 200), ("cx", [2, 3], 300), ("x", None, 50), ("measure", None, 1000)] ) # balanced X-X sequence on all qubits dd_sequence = [XGate(), XGate()] pm = PassManager([ALAPSchedule(durations), DynamicalDecoupling(durations, dd_sequence)]) circ_dd = pm.run(circ) draw(circ_dd) # Uhrig sequence on qubit 0 n = 8 dd_sequence = [XGate()] * n def uhrig_pulse_location(k): return np.sin(np.pi * (k + 1) / (2 * n + 2)) ** 2 spacing = [] for k in range(n): spacing.append(uhrig_pulse_location(k) - sum(spacing)) spacing.append(1 - sum(spacing)) pm = PassManager( [ ALAPSchedule(durations), DynamicalDecoupling(durations, dd_sequence, qubits=[0], spacing=spacing), ] ) circ_dd = pm.run(circ) draw(circ_dd) """ @deprecate_func( additional_msg=( "Instead, use :class:`~.PadDynamicalDecoupling`, which performs the same " "function but requires scheduling and alignment analysis passes to run prior to it." ), since="1.1.0", ) def __init__( self, durations, dd_sequence, qubits=None, spacing=None, skip_reset_qubits=True, target=None ): """Dynamical decoupling initializer. Args: durations (InstructionDurations): Durations of instructions to be used in scheduling. dd_sequence (list[Gate]): sequence of gates to apply in idle spots. qubits (list[int]): physical qubits on which to apply DD. If None, all qubits will undergo DD (when possible). spacing (list[float]): a list of spacings between the DD gates. The available slack will be divided according to this. The list length must be one more than the length of dd_sequence, and the elements must sum to 1. If None, a balanced spacing will be used [d/2, d, d, ..., d, d, d/2]. skip_reset_qubits (bool): if True, does not insert DD on idle periods that immediately follow initialized/reset qubits (as qubits in the ground state are less susceptile to decoherence). target (Target): The :class:`~.Target` representing the target backend, if both ``durations`` and this are specified then this argument will take precedence and ``durations`` will be ignored. """ super().__init__() self._durations = durations self._dd_sequence = dd_sequence self._qubits = qubits self._spacing = spacing self._skip_reset_qubits = skip_reset_qubits self._target = target if target is not None: self._durations = target.durations() for gate in dd_sequence: if gate.name not in target.operation_names: raise TranspilerError( f"{gate.name} in dd_sequence is not supported in the target" ) def run(self, dag): """Run the DynamicalDecoupling pass on dag. Args: dag (DAGCircuit): a scheduled DAG. Returns: DAGCircuit: equivalent circuit with delays interrupted by DD, where possible. Raises: TranspilerError: if the circuit is not mapped on physical qubits. """ if len(dag.qregs) != 1 or dag.qregs.get("q", None) is None: raise TranspilerError("DD runs on physical circuits only.") if dag.duration is None: raise TranspilerError("DD runs after circuit is scheduled.") durations = self._update_inst_durations(dag) num_pulses = len(self._dd_sequence) sequence_gphase = 0 if num_pulses != 1: if num_pulses % 2 != 0: raise TranspilerError("DD sequence must contain an even number of gates (or 1).") noop = np.eye(2) for gate in self._dd_sequence: noop = noop.dot(gate.to_matrix()) if not matrix_equal(noop, IGate().to_matrix(), ignore_phase=True): raise TranspilerError("The DD sequence does not make an identity operation.") sequence_gphase = np.angle(noop[0][0]) if self._qubits is None: self._qubits = set(range(dag.num_qubits())) else: self._qubits = set(self._qubits) if self._spacing: if sum(self._spacing) != 1 or any(a < 0 for a in self._spacing): raise TranspilerError( "The spacings must be given in terms of fractions " "of the slack period and sum to 1." ) else: # default to balanced spacing mid = 1 / num_pulses end = mid / 2 self._spacing = [end] + [mid] * (num_pulses - 1) + [end] for qarg in list(self._qubits): for gate in self._dd_sequence: if not self.__gate_supported(gate, qarg): self._qubits.discard(qarg) break index_sequence_duration_map = {} for physical_qubit in self._qubits: dd_sequence_duration = 0 for index, gate in enumerate(self._dd_sequence): gate = gate.to_mutable() self._dd_sequence[index] = gate gate.duration = durations.get(gate, physical_qubit) dd_sequence_duration += gate.duration index_sequence_duration_map[physical_qubit] = dd_sequence_duration new_dag = dag.copy_empty_like() for nd in dag.topological_op_nodes(): if not isinstance(nd.op, Delay): new_dag.apply_operation_back(nd.op, nd.qargs, nd.cargs, check=False) continue dag_qubit = nd.qargs[0] physical_qubit = dag.find_bit(dag_qubit).index if physical_qubit not in self._qubits: # skip unwanted qubits new_dag.apply_operation_back(nd.op, nd.qargs, nd.cargs, check=False) continue pred = next(dag.predecessors(nd)) succ = next(dag.successors(nd)) if self._skip_reset_qubits: # discount initial delays if isinstance(pred, DAGInNode) or isinstance(pred.op, Reset): new_dag.apply_operation_back(nd.op, nd.qargs, nd.cargs, check=False) continue dd_sequence_duration = index_sequence_duration_map[physical_qubit] slack = nd.op.duration - dd_sequence_duration if slack <= 0: # dd doesn't fit new_dag.apply_operation_back(nd.op, nd.qargs, nd.cargs, check=False) continue if num_pulses == 1: # special case of using a single gate for DD u_inv = self._dd_sequence[0].inverse().to_matrix() theta, phi, lam, phase = OneQubitEulerDecomposer().angles_and_phase(u_inv) # absorb the inverse into the successor (from left in circuit) if isinstance(succ, DAGOpNode) and isinstance(succ.op, (UGate, U3Gate)): theta_r, phi_r, lam_r = succ.op.params succ.op.params = Optimize1qGates.compose_u3( theta_r, phi_r, lam_r, theta, phi, lam ) sequence_gphase += phase # absorb the inverse into the predecessor (from right in circuit) elif isinstance(pred, DAGOpNode) and isinstance(pred.op, (UGate, U3Gate)): theta_l, phi_l, lam_l = pred.op.params pred.op.params = Optimize1qGates.compose_u3( theta, phi, lam, theta_l, phi_l, lam_l ) sequence_gphase += phase # don't do anything if there's no single-qubit gate to absorb the inverse else: new_dag.apply_operation_back(nd.op, nd.qargs, nd.cargs, check=False) continue # insert the actual DD sequence taus = [int(slack * a) for a in self._spacing] unused_slack = slack - sum(taus) # unused, due to rounding to int multiples of dt middle_index = int((len(taus) - 1) / 2) # arbitrary: redistribute to middle taus[middle_index] += unused_slack # now we add up to original delay duration for tau, gate in itertools.zip_longest(taus, self._dd_sequence): if tau > 0: new_dag.apply_operation_back(Delay(tau), [dag_qubit], check=False) if gate is not None: new_dag.apply_operation_back(gate, [dag_qubit], check=False) new_dag.global_phase = new_dag.global_phase + sequence_gphase return new_dag def _update_inst_durations(self, dag): """Update instruction durations with circuit information. If the dag contains gate calibrations and no instruction durations were provided through the target or as a standalone input, the circuit calibration durations will be used. The priority order for instruction durations is: target > standalone > circuit. """ circ_durations = InstructionDurations() if dag.calibrations: cal_durations = [] for gate, gate_cals in dag.calibrations.items(): for (qubits, parameters), schedule in gate_cals.items(): cal_durations.append((gate, qubits, parameters, schedule.duration)) circ_durations.update(cal_durations, circ_durations.dt) if self._durations is not None: circ_durations.update(self._durations, getattr(self._durations, "dt", None)) return circ_durations def __gate_supported(self, gate: Gate, qarg: int) -> bool: """A gate is supported on the qubit (qarg) or not.""" if self._target is None or self._target.instruction_supported(gate.name, qargs=(qarg,)): return True return False
https://github.com/mnp-club/Quantum_Computing_Workshop_2020
mnp-club
from qiskit import * from qiskit.tools.jupyter import * from qiskit.visualization import * import matplotlib.pyplot as plotter import numpy as np from IPython.display import display, Math, Latex %matplotlib inline # Loading your IBM Q account(s) provider = IBMQ.load_account() # The '0' state plot_bloch_vector([0,0,1]) # The '1' state plot_bloch_vector([0,0,-1]) qc1 = QuantumCircuit(2,2) # Initializing a quantum ciruit (2 qubits, 2 classical bits) # All initialized to '0' by default. qc1.draw(output='mpl') # Draws the circuit diagram qc1.x(0) # Applying X gate to the first qubit qc1.draw(output='mpl') qc1.x(1) # Applying X gate to the second qubit qc1.draw(output='mpl') # The '+' state plot_bloch_vector([1,0,0]) # The '-' state plot_bloch_vector([-1,0,0]) qc2 = QuantumCircuit(2,2) # A new quantum circuit with 2 qubits and 2 classical bits qc2.h(0) # Applying the Hadamard gate on first qubit qc2.draw(output='mpl') qc2.cx(0,1) # Applying CX gate ('control','target') qc2.draw(output='mpl') qc2.measure(0,0) # Measure first qubit and store it in first classical bit qc2.measure(1,1) # Measure second qubit and store it in second classical bit # The code below plots a histogram of the measurement result. You can copy it for further use. def run_circuit(qc): backend = Aer.get_backend('qasm_simulator') # we choose the simulator as our backend result = execute(qc, backend, shots = 2000).result() # we run the simulation counts = result.get_counts() # we get the counts return counts counts = run_circuit(qc2) print(counts) plot_histogram(counts) qc1.h(0) qc1.cx(0, 1) qc1.draw(output='mpl') qc1.measure(0,0) qc1.measure(1,1) def run_circuit(qc): backend = Aer.get_backend('qasm_simulator') result = execute(qc, backend, shots = 2000).result() counts = result.get_counts() return counts counts = run_circuit(qc1) print(counts) plot_histogram(counts) qc3 = QuantumCircuit(3,3) qc3.x(range(3)) # Setting the all qubits to '1' qc3.toffoli(0,1,2) # (control,control,target) qc3.measure(0,0) qc3.measure(1,1) qc3.measure(2,2) def run_circuit(qc3): backend = Aer.get_backend('qasm_simulator') # we choose the simulator as our backend result = execute(qc3, backend, shots = 2000).result() # we run the simulation counts = result.get_counts() # we get the counts return counts counts = run_circuit(qc3) print(counts) plot_histogram(counts) # The output should be '011' as the highest (q2) is flipped because the other two qubits were set to '1' qc4 = QuantumCircuit(2,2) #Applying the Pauli-X gate to quantum bit 0, we turn it into 1 so that the swap outcome is observable. qc4.x(0) qc4.cx(0, 1) qc4.cx(1, 0) qc4.cx(0, 1) qc4.draw(output='mpl') qc4.measure(0,0) qc4.measure(1,1) def run_circuit(qc): backend = Aer.get_backend('qasm_simulator') result = execute(qc, backend, shots = 2000).result() counts = result.get_counts() return counts counts = run_circuit(qc4) print(counts) plot_histogram(counts) qc5 = QuantumCircuit(2,2) #We turn quantum bit 1 into 1 so that we can observe the results of HZH on both 0 (from q0) and 1 (from q1). qc5.x(1) qc5.h((0, 1)) qc5.z((0, 1)) qc5.h((0, 1)) qc5.draw(output='mpl') qc5.measure(0,0) qc5.measure(1,1) def run_circuit(qc): backend = Aer.get_backend('qasm_simulator') result = execute(qc, backend, shots = 2000).result() counts = result.get_counts() return counts counts = run_circuit(qc5) print(counts) plot_histogram(counts) qc6 = QuantumCircuit(3,3) #Initializing quantum bits using gates: #q0 is initialized to 0. #q1 is initialized to 1. qc6.x(1) #q2 is initialized to the state given above. qc6.x(2) qc6.h(2) qc6.t(2) #We change q2 for the controlled swap now; we'll bring it back to the same state afterwards. qc6.tdg(2) qc6.h(2) #Controlled swap. qc6.toffoli(0, 2, 1) qc6.toffoli(1, 2, 0) qc6.toffoli(0, 2, 1) #We convert q2 back to whatever it was. qc6.h(2) qc6.t(2) qc6.draw(output='mpl') qc6.measure(0, 0) qc6.measure(1, 1) qc6.measure(2, 2) def run_circuit(qc): backend = Aer.get_backend('qasm_simulator') result = execute(qc, backend, shots = 2000).result() counts = result.get_counts() return counts counts = run_circuit(qc6) print(counts) plot_histogram(counts)
https://github.com/Qubit-MU/Qiskit_Fall_Fest_2023
Qubit-MU
######################################## # ENTER YOUR NAME AND WISC EMAIL HERE: # ######################################## # Name: Rochelle Li # Email: rli484@wisc.edu event = "Qiskit Fall Fest" ## Write your code below here. Delete the current information and replace it with your own ## ## Make sure to write your information between the quotation marks! name = "Rochelle Li" age = "19" school = "University of Wisconsin Madison" ## Now press the "Run" button in the toolbar above, or press Shift + Enter while you're active in this cell ## You do not need to write any code in this cell. Simply run this cell to see your information in a sentence. ## print(f'My name is {name}, I am {age} years old, and I attend {school}.') ## Run this cell to make sure your grader is setup correctly %set_env QC_GRADE_ONLY=true %set_env QC_GRADING_ENDPOINT=https://qac-grading.quantum-computing.ibm.com from qiskit import QuantumCircuit # Create quantum circuit with 3 qubits and 3 classical bits # (we'll explain why we need the classical bits later) qc = QuantumCircuit(3,3) # return a drawing of the circuit qc.draw() ## You don't need to write any new code in this cell, just run it from qiskit import QuantumCircuit qc = QuantumCircuit(3,3) # measure all the qubits qc.measure([0,1,2], [0,1,2]) qc.draw(output="mpl") from qiskit.providers.aer import AerSimulator # make a new simulator object sim = AerSimulator() job = sim.run(qc) # run the experiment result = job.result() # get the results result.get_counts() # interpret the results as a "counts" dictionary from qiskit import QuantumCircuit from qiskit.providers.aer import AerSimulator ## Write your code below here ## qc = QuantumCircuit(4,4) qc.measure([0,1,2,3], [0,1,2,3]) ## Do not modify the code under this line ## qc.draw() sim = AerSimulator() # make a new simulator object job = sim.run(qc) # run the experiment result = job.result() # get the results answer1 = result.get_counts() # Grader Cell: Run this to submit your answer from qc_grader.challenges.fall_fest23 import grade_ex1a grade_ex1a(answer1) from qiskit import QuantumCircuit qc = QuantumCircuit(2) # We start by flipping the first qubit, which is qubit 0, using an X gate qc.x(0) # Next we add an H gate on qubit 0, putting this qubit in superposition. qc.h(0) # Finally we add a CX (CNOT) gate on qubit 0 and qubit 1 # This entangles the two qubits together qc.cx(0, 1) qc.draw(output="mpl") from qiskit import QuantumCircuit qc = QuantumCircuit(2, 2) ## Write your code below here ## qc.h(0) qc.cx(0,1) ## Do not modify the code under this line ## answer2 = qc qc.draw(output="mpl") # Grader Cell: Run this to submit your answer from qc_grader.challenges.fall_fest23 import grade_ex1b grade_ex1b(answer2)
https://github.com/aryashah2k/Quantum-Computing-Collection-Of-Resources
aryashah2k
%matplotlib inline from qiskit import * from qiskit.visualization import * from qiskit.tools.monitor import * # Let's create a circuit to put a state in superposition and measure it circ = QuantumCircuit(1,1) # We use one qubit and also one classical bit for the measure result circ.h(0) #We apply the H gate circ.measure(range(1),range(1)) # We measure circ.draw(output='mpl') #We draw the circuit print(circ.qasm()) # Executing on the local simulator backend_sim = Aer.get_backend('qasm_simulator') # We choose the backend job_sim = execute(circ, backend_sim, shots=1024) # We execute the circuit, selecting the number of repetitions or 'shots' result_sim = job_sim.result() # We collect the results counts = result_sim.get_counts(circ) # We obtain the frequency of each result and we show them print(counts) plot_histogram(counts) # Execution to the get the statevector circ2 = QuantumCircuit(1,1) circ2.h(0) backend = Aer.get_backend('statevector_simulator') # We change the backend job = execute(circ2, backend) # We execute the circuit with the new simulator. Now, we do not need repetitions result = job.result() # We collect the results and access the stavector outputstate = result.get_statevector(circ2) print(outputstate) backend = Aer.get_backend('unitary_simulator') # We change the backend again job = execute(circ2, backend) # We execute the circuit result = job.result() # We collect the results and obtain the matrix unitary = result.get_unitary() print(unitary) # Connecting to the real quantum computers provider = IBMQ.load_account() # We load our account provider.backends() # We retrieve the backends to check their status for b in provider.backends(): print(b.status().to_dict()) # Executing on the IBM Q Experience simulator backend_sim = provider.get_backend('ibmq_qasm_simulator') # We choose the backend job_sim = execute(circ, backend_sim, shots=1024) # We execute the circuit, selecting the number of repetitions or 'shots' result_sim = job_sim.result() # We collect the results counts = result_sim.get_counts(circ) # We obtain the frequency of each result and we show them print(counts) plot_histogram(counts) # Executing on the quantum computer backend = provider.get_backend('ibmq_armonk') job_exp = execute(circ, backend=backend) job_monitor(job_exp) result_exp = job_exp.result() counts_exp = result_exp.get_counts(circ) plot_histogram([counts_exp,counts], legend=['Device', 'Simulator'])
https://github.com/MonitSharma/Learn-Quantum-Computing-with-Qiskit
MonitSharma
from qiskit import QuantumCircuit import numpy as np from qiskit import QuantumCircuit, assemble, Aer def deutsch_problem(seed=None): """Returns a circuit that carries out the function from Deutsch's problem. Args: seed (int): If set, then returned circuit will always be the same for the same seed. Returns: QuantumCircuit """ np.random.seed(seed) problem = QuantumCircuit(2) if np.random.randint(2): print("Function is balanced.") problem.cx(0, 1) else: print("Function is constant.") if np.random.randint(2): problem.x(1) return problem def deutsch(problem): """Implements Deutsch's algorithm. Args: function (QuantumCircuit): Deutsch function to solve. Must be a 2-qubit circuit, and either balanced, or constant. Returns: bool: True if the circuit is balanced, otherwise False. """ qc=QuantumCircuit(2,1) qc.x(1) qc.h([0,1]) qc.draw() qc.append(problem.to_gate(label='f'),[0,1]) qc.h(0) qc.measure(0,0) qc = qc.decompose('f') display(qc.draw()) sim = Aer.get_backend('aer_simulator') state = sim.run(qc).result().get_counts() # Execute the circuit and get the count state=list(state.keys())[0] ## fetch the bit from the Dictionary if state=='1': return('balanced') if state=='0': return('constant') problem=deutsch_problem() print(deutsch(problem))
https://github.com/yaelbh/qiskit-projectq-provider
yaelbh
# -*- coding: utf-8 -*- # Copyright 2018, IBM. # # This source code is licensed under the Apache License, Version 2.0 found in # the LICENSE.txt file in the root directory of this source tree. # pylint: disable=invalid-name,missing-docstring,broad-except from test.common import QiskitProjectQTestCase import unittest from qiskit import execute, QuantumCircuit, QuantumRegister, ClassicalRegister from qiskit_addon_projectq import ProjectQProvider class StatevectorSimulatorProjectQTest(QiskitProjectQTestCase): """Test ProjectQ C++ statevector simulator.""" def setUp(self): ProjectQ = ProjectQProvider() self.projectq_sim = ProjectQ.get_backend('projectq_statevector_simulator') def test_sv_simulator_projectq(self): """Test final state vector for single circuit run.""" qr = QuantumRegister(2, 'qr') cr = ClassicalRegister(2, 'cr') qc = QuantumCircuit(qr, cr) qc.h(qr[0]) qc.cx(qr[0], qr[1]) result = execute(qc, backend=self.projectq_sim).result() self.assertEqual(result.status, 'COMPLETED') actual = result.get_statevector(qc) # state is 1/sqrt(2)|00> + 1/sqrt(2)|11>, up to a global phase self.assertAlmostEqual((abs(actual[0]))**2, 1/2) self.assertAlmostEqual(abs(actual[1]), 0) self.assertAlmostEqual(abs(actual[2]), 0) self.assertAlmostEqual((abs(actual[3]))**2, 1/2) def test_qubit_order(self): """Verify Qiskit qubit ordering in state vector""" qr = QuantumRegister(2, 'qr') cr = ClassicalRegister(2, 'cr') qc = QuantumCircuit(qr, cr) qc.x(qr[0]) result = execute(qc, backend=self.projectq_sim).result() self.assertEqual(result.status, 'COMPLETED') actual = result.get_statevector(qc) # state is |01> (up to a global phase), because qubit 0 is LSB self.assertAlmostEqual(abs(actual[0]), 0) self.assertAlmostEqual((abs(actual[1]))**2, 1) self.assertAlmostEqual(abs(actual[2]), 0) self.assertAlmostEqual(abs(actual[3]), 0) if __name__ == '__main__': unittest.main()
https://github.com/qiskit-community/qiskit-translations-staging
qiskit-community
from qiskit.utils import algorithm_globals algorithm_globals.random_seed = 12345 from qiskit_machine_learning.datasets import ad_hoc_data adhoc_dimension = 2 train_features, train_labels, test_features, test_labels, adhoc_total = ad_hoc_data( training_size=20, test_size=5, n=adhoc_dimension, gap=0.3, plot_data=False, one_hot=False, include_sample_total=True, ) import matplotlib.pyplot as plt import numpy as np def plot_features(ax, features, labels, class_label, marker, face, edge, label): # A train plot ax.scatter( # x coordinate of labels where class is class_label features[np.where(labels[:] == class_label), 0], # y coordinate of labels where class is class_label features[np.where(labels[:] == class_label), 1], marker=marker, facecolors=face, edgecolors=edge, label=label, ) def plot_dataset(train_features, train_labels, test_features, test_labels, adhoc_total): plt.figure(figsize=(5, 5)) plt.ylim(0, 2 * np.pi) plt.xlim(0, 2 * np.pi) plt.imshow( np.asmatrix(adhoc_total).T, interpolation="nearest", origin="lower", cmap="RdBu", extent=[0, 2 * np.pi, 0, 2 * np.pi], ) # A train plot plot_features(plt, train_features, train_labels, 0, "s", "w", "b", "A train") # B train plot plot_features(plt, train_features, train_labels, 1, "o", "w", "r", "B train") # A test plot plot_features(plt, test_features, test_labels, 0, "s", "b", "w", "A test") # B test plot plot_features(plt, test_features, test_labels, 1, "o", "r", "w", "B test") plt.legend(bbox_to_anchor=(1.05, 1), loc="upper left", borderaxespad=0.0) plt.title("Ad hoc dataset") plt.show() plot_dataset(train_features, train_labels, test_features, test_labels, adhoc_total) from qiskit.circuit.library import ZZFeatureMap from qiskit.primitives import Sampler from qiskit.algorithms.state_fidelities import ComputeUncompute from qiskit_machine_learning.kernels import FidelityQuantumKernel adhoc_feature_map = ZZFeatureMap(feature_dimension=adhoc_dimension, reps=2, entanglement="linear") sampler = Sampler() fidelity = ComputeUncompute(sampler=sampler) adhoc_kernel = FidelityQuantumKernel(fidelity=fidelity, feature_map=adhoc_feature_map) from sklearn.svm import SVC adhoc_svc = SVC(kernel=adhoc_kernel.evaluate) adhoc_svc.fit(train_features, train_labels) adhoc_score_callable_function = adhoc_svc.score(test_features, test_labels) print(f"Callable kernel classification test score: {adhoc_score_callable_function}") adhoc_matrix_train = adhoc_kernel.evaluate(x_vec=train_features) adhoc_matrix_test = adhoc_kernel.evaluate(x_vec=test_features, y_vec=train_features) fig, axs = plt.subplots(1, 2, figsize=(10, 5)) axs[0].imshow( np.asmatrix(adhoc_matrix_train), interpolation="nearest", origin="upper", cmap="Blues" ) axs[0].set_title("Ad hoc training kernel matrix") axs[1].imshow(np.asmatrix(adhoc_matrix_test), interpolation="nearest", origin="upper", cmap="Reds") axs[1].set_title("Ad hoc testing kernel matrix") plt.show() adhoc_svc = SVC(kernel="precomputed") adhoc_svc.fit(adhoc_matrix_train, train_labels) adhoc_score_precomputed_kernel = adhoc_svc.score(adhoc_matrix_test, test_labels) print(f"Precomputed kernel classification test score: {adhoc_score_precomputed_kernel}") from qiskit_machine_learning.algorithms import QSVC qsvc = QSVC(quantum_kernel=adhoc_kernel) qsvc.fit(train_features, train_labels) qsvc_score = qsvc.score(test_features, test_labels) print(f"QSVC classification test score: {qsvc_score}") print(f"Classification Model | Accuracy Score") print(f"---------------------------------------------------------") print(f"SVC using kernel as a callable function | {adhoc_score_callable_function:10.2f}") print(f"SVC using precomputed kernel matrix | {adhoc_score_precomputed_kernel:10.2f}") print(f"QSVC | {qsvc_score:10.2f}") adhoc_dimension = 2 train_features, train_labels, test_features, test_labels, adhoc_total = ad_hoc_data( training_size=25, test_size=0, n=adhoc_dimension, gap=0.6, plot_data=False, one_hot=False, include_sample_total=True, ) plt.figure(figsize=(5, 5)) plt.ylim(0, 2 * np.pi) plt.xlim(0, 2 * np.pi) plt.imshow( np.asmatrix(adhoc_total).T, interpolation="nearest", origin="lower", cmap="RdBu", extent=[0, 2 * np.pi, 0, 2 * np.pi], ) # A label plot plot_features(plt, train_features, train_labels, 0, "s", "w", "b", "B") # B label plot plot_features(plt, train_features, train_labels, 1, "o", "w", "r", "B") plt.legend(bbox_to_anchor=(1.05, 1), loc="upper left", borderaxespad=0.0) plt.title("Ad hoc dataset for clustering") plt.show() adhoc_feature_map = ZZFeatureMap(feature_dimension=adhoc_dimension, reps=2, entanglement="linear") adhoc_kernel = FidelityQuantumKernel(feature_map=adhoc_feature_map) adhoc_matrix = adhoc_kernel.evaluate(x_vec=train_features) plt.figure(figsize=(5, 5)) plt.imshow(np.asmatrix(adhoc_matrix), interpolation="nearest", origin="upper", cmap="Greens") plt.title("Ad hoc clustering kernel matrix") plt.show() from sklearn.cluster import SpectralClustering from sklearn.metrics import normalized_mutual_info_score adhoc_spectral = SpectralClustering(2, affinity="precomputed") cluster_labels = adhoc_spectral.fit_predict(adhoc_matrix) cluster_score = normalized_mutual_info_score(cluster_labels, train_labels) print(f"Clustering score: {cluster_score}") adhoc_dimension = 2 train_features, train_labels, test_features, test_labels, adhoc_total = ad_hoc_data( training_size=25, test_size=10, n=adhoc_dimension, gap=0.6, plot_data=False, one_hot=False, include_sample_total=True, ) plot_dataset(train_features, train_labels, test_features, test_labels, adhoc_total) feature_map = ZZFeatureMap(feature_dimension=2, reps=2, entanglement="linear") qpca_kernel = FidelityQuantumKernel(fidelity=fidelity, feature_map=feature_map) matrix_train = qpca_kernel.evaluate(x_vec=train_features) matrix_test = qpca_kernel.evaluate(x_vec=test_features, y_vec=test_features) from sklearn.decomposition import KernelPCA kernel_pca_rbf = KernelPCA(n_components=2, kernel="rbf") kernel_pca_rbf.fit(train_features) train_features_rbf = kernel_pca_rbf.transform(train_features) test_features_rbf = kernel_pca_rbf.transform(test_features) kernel_pca_q = KernelPCA(n_components=2, kernel="precomputed") train_features_q = kernel_pca_q.fit_transform(matrix_train) test_features_q = kernel_pca_q.fit_transform(matrix_test) from sklearn.linear_model import LogisticRegression logistic_regression = LogisticRegression() logistic_regression.fit(train_features_q, train_labels) logistic_score = logistic_regression.score(test_features_q, test_labels) print(f"Logistic regression score: {logistic_score}") fig, (q_ax, rbf_ax) = plt.subplots(1, 2, figsize=(10, 5)) plot_features(q_ax, train_features_q, train_labels, 0, "s", "w", "b", "A train") plot_features(q_ax, train_features_q, train_labels, 1, "o", "w", "r", "B train") plot_features(q_ax, test_features_q, test_labels, 0, "s", "b", "w", "A test") plot_features(q_ax, test_features_q, test_labels, 1, "o", "r", "w", "A test") q_ax.set_ylabel("Principal component #1") q_ax.set_xlabel("Principal component #0") q_ax.set_title("Projection of training and test data\n using KPCA with Quantum Kernel") # Plotting the linear separation h = 0.01 # step size in the mesh # create a mesh to plot in x_min, x_max = train_features_q[:, 0].min() - 1, train_features_q[:, 0].max() + 1 y_min, y_max = train_features_q[:, 1].min() - 1, train_features_q[:, 1].max() + 1 xx, yy = np.meshgrid(np.arange(x_min, x_max, h), np.arange(y_min, y_max, h)) predictions = logistic_regression.predict(np.c_[xx.ravel(), yy.ravel()]) # Put the result into a color plot predictions = predictions.reshape(xx.shape) q_ax.contourf(xx, yy, predictions, cmap=plt.cm.RdBu, alpha=0.2) plot_features(rbf_ax, train_features_rbf, train_labels, 0, "s", "w", "b", "A train") plot_features(rbf_ax, train_features_rbf, train_labels, 1, "o", "w", "r", "B train") plot_features(rbf_ax, test_features_rbf, test_labels, 0, "s", "b", "w", "A test") plot_features(rbf_ax, test_features_rbf, test_labels, 1, "o", "r", "w", "A test") rbf_ax.set_ylabel("Principal component #1") rbf_ax.set_xlabel("Principal component #0") rbf_ax.set_title("Projection of training data\n using KernelPCA") plt.show() import qiskit.tools.jupyter %qiskit_version_table %qiskit_copyright
https://github.com/qiskit-community/qiskit-translations-staging
qiskit-community
from qiskit_nature.drivers.second_quantization import GaussianForcesDriver from qiskit_nature.problems.second_quantization import VibrationalStructureProblem from qiskit_nature.settings import settings settings.dict_aux_operators = True driver = GaussianForcesDriver(logfile="aux_files/CO2_freq_B3LYP_631g.log") problem = VibrationalStructureProblem(driver, num_modals=[2, 2, 3, 4], truncation_order=2) # Note: at this point, `driver.run()` has NOT been called yet. We can trigger this indirectly like so: second_q_ops = problem.second_q_ops() hamiltonian = second_q_ops["VibrationalEnergy"] print("\n".join(str(hamiltonian).splitlines()[:10] + ["..."])) from qiskit_nature.second_q.drivers import GaussianForcesDriver from qiskit_nature.second_q.problems import HarmonicBasis driver = GaussianForcesDriver(logfile="aux_files/CO2_freq_B3LYP_631g.log") basis = HarmonicBasis(num_modals=[2, 2, 3, 4]) # this is now done explicitly and already requires the basis problem = driver.run(basis=basis) problem.hamiltonian.truncation_order = 2 hamiltonian = problem.hamiltonian.second_q_op() print("\n".join(str(hamiltonian).splitlines()[:10] + ["..."])) from qiskit_nature.drivers.second_quantization import GaussianLogResult from qiskit_nature.properties.second_quantization.vibrational.bases import HarmonicBasis from qiskit_nature.settings import settings settings.dict_aux_operators = True log_result = GaussianLogResult("aux_files/CO2_freq_B3LYP_631g.log") hamiltonian = log_result.get_vibrational_energy() print(hamiltonian) hamiltonian.basis = HarmonicBasis([2, 2, 3, 4]) op = hamiltonian.second_q_ops()["VibrationalEnergy"] print("\n".join(str(op).splitlines()[:10] + ["..."])) from qiskit_nature.second_q.drivers import GaussianLogResult from qiskit_nature.second_q.formats import watson_to_problem from qiskit_nature.second_q.problems import HarmonicBasis log_result = GaussianLogResult("aux_files/CO2_freq_B3LYP_631g.log") watson = log_result.get_watson_hamiltonian() print(watson) basis = HarmonicBasis(num_modals=[2, 2, 3, 4]) problem = watson_to_problem(watson, basis) hamiltonian = problem.hamiltonian.second_q_op() print("\n".join(str(hamiltonian).splitlines()[:10] + ["..."])) from qiskit_nature.drivers.second_quantization import GaussianForcesDriver from qiskit_nature.problems.second_quantization import VibrationalStructureProblem driver = GaussianForcesDriver(logfile="aux_files/CO2_freq_B3LYP_631g.log") problem = VibrationalStructureProblem(driver, num_modals=[2, 2, 3, 4], truncation_order=2) # we trigger driver.run() implicitly like so: second_q_ops = problem.second_q_ops() hamiltonian_op = second_q_ops.pop("VibrationalEnergy") aux_ops = second_q_ops from qiskit_nature.second_q.drivers import GaussianForcesDriver from qiskit_nature.second_q.problems import HarmonicBasis driver = GaussianForcesDriver(logfile="aux_files/CO2_freq_B3LYP_631g.log") basis = HarmonicBasis(num_modals=[2, 2, 3, 4]) problem = driver.run(basis=basis) problem.hamiltonian.truncation_order = 2 hamiltonian_op, aux_ops = problem.second_q_ops() import qiskit.tools.jupyter %qiskit_version_table %qiskit_copyright
https://github.com/hephaex/Quantum-Computing-Awesome-List
hephaex
# Cell 1 import numpy as np from qiskit import Aer, QuantumCircuit, execute from qiskit.visualization import plot_histogram from IPython.display import display, Math, Latex from may4_challenge import plot_state_qsphere from may4_challenge.ex1 import minicomposer from may4_challenge.ex1 import check1, check2, check3, check4, check5, check6, check7, check8 from may4_challenge.ex1 import return_state, vec_in_braket, statevec # Cell 2 # press shift + return to run this code cell # then, click on the gate that you want to apply to your qubit # next, you have to choos # the qubit that you want to apply it to (choose '0' here) # click on clear to restart minicomposer(1, dirac=True, qsphere=True) # Cell 3 def create_circuit(): qc = QuantumCircuit(1) qc.x(0) return qc # check solution qc = create_circuit() state = statevec(qc) check1(state) plot_state_qsphere(state.data, show_state_labels=True, show_state_angles=True) # Cell 4 def create_circuit2(): qc = QuantumCircuit(1) qc.h(0) return qc qc = create_circuit2() state = statevec(qc) check2(state) plot_state_qsphere(state.data, show_state_labels=True, show_state_angles=True) # Cell 5 def create_circuit3(): qc = QuantumCircuit(1) qc.x(0) qc.h(0) return qc qc = create_circuit3() state = statevec(qc) check3(state) plot_state_qsphere(state.data, show_state_labels=True, show_state_angles=True) # Cell 6 def create_circuit4(): qc = QuantumCircuit(1) qc.x(0) qc.h(0) qc.s(0) return qc qc = create_circuit4() state = statevec(qc) check4(state) plot_state_qsphere(state.data, show_state_labels=True, show_state_angles=True) # Cell 7 # press shift + return to run this code cell # then, click on the gate that you want to apply followed by the qubit(s) that you want it to apply to # for controlled gates, the first qubit you choose is the control qubit and the second one the target qubit # click on clear to restart minicomposer(2, dirac = True, qsphere = True) # Cell 8 def create_circuit(): qc = QuantumCircuit(2) qc.h(0) qc.cx(0,1) return qc qc = create_circuit() state = statevec(qc) # determine final state after running the circuit display(Math(vec_in_braket(state.data))) check5(state) qc.draw(output='mpl') # we draw the circuit # Cell 9 def create_circuit6(): qc = QuantumCircuit(2,2) # this time, we not only want two qubits, but also # two classical bits for the measurement later qc.h(0) qc.cx(0,1) qc.y(1) return qc qc = create_circuit6() state = statevec(qc) # determine final state after running the circuit display(Math(vec_in_braket(state.data))) check6(state) qc.measure(0, 0) # we perform a measurement on qubit q_0 and store the information on the classical bit c_0 qc.measure(1, 1) # we perform a measurement on qubit q_1 and store the information on the classical bit c_1 qc.draw(output='mpl') # we draw the circuit # Cell 10 def run_circuit(qc): backend = Aer.get_backend('qasm_simulator') # we choose the simulator as our backend result = execute(qc, backend, shots = 1000).result() # we run the simulation counts = result.get_counts() # we get the counts return counts counts = run_circuit(qc) print(counts) plot_histogram(counts) # let us plot a histogram to see the possible outcomes and corresponding probabilities def run_circuit(qc): backend = Aer.get_backend('qasm_simulator') # we choose the simulator as our backend result = execute(qc, backend, shots = 1000).result() # we run the simulation counts = result.get_counts() # we get the counts return counts counts = run_circuit(qc) print(counts) check plot_histogram(counts) # let us plot a histogram to see the possible outcomes and corresponding probabilities def create_circuit6(): qc = QuantumCircuit(3,3) # this time, we not only want two qubits, but also # two classical bits for the measurement later qc.h(0) qc.cx(0,1) qc.cx(1,2) return qc qc = create_circuit6() state = statevec(qc) display(Math(vec_in_braket(state.data))) qc.measure(0, 0) # we perform a measurement on qubit q_0 and store the information on the classical bit c_0 qc.measure(1, 1) qc.measure(2,2)# we perform a measurement on qubit q_1 and store the information on the classical bit c_1 qc.draw(output='mpl') # we draw the circuit def run_circuit(qc): backend = Aer.get_backend('qasm_simulator') # we choose the simulator as our backend result = execute(qc, backend, shots = 2000).result() # we run the simulation counts = result.get_counts() # we get the counts return counts counts = run_circuit(qc) print(counts) check8(counts) plot_histogram(counts)
https://github.com/qiskit-community/qiskit-translations-staging
qiskit-community
from qiskit import QuantumCircuit from qiskit.compiler import transpile from qiskit.transpiler import PassManager circ = QuantumCircuit(3) circ.ccx(0, 1, 2) circ.draw(output='mpl') from qiskit.transpiler.passes import Unroller pass_ = Unroller(['u1', 'u2', 'u3', 'cx']) pm = PassManager(pass_) new_circ = pm.run(circ) new_circ.draw(output='mpl') from qiskit.transpiler import passes [pass_ for pass_ in dir(passes) if pass_[0].isupper()] from qiskit.transpiler import CouplingMap, Layout from qiskit.transpiler.passes import BasicSwap, LookaheadSwap, StochasticSwap coupling = [[0, 1], [1, 2], [2, 3], [3, 4], [4, 5], [5, 6]] circuit = QuantumCircuit(7) circuit.h(3) circuit.cx(0, 6) circuit.cx(6, 0) circuit.cx(0, 1) circuit.cx(3, 1) circuit.cx(3, 0) coupling_map = CouplingMap(couplinglist=coupling) bs = BasicSwap(coupling_map=coupling_map) pass_manager = PassManager(bs) basic_circ = pass_manager.run(circuit) ls = LookaheadSwap(coupling_map=coupling_map) pass_manager = PassManager(ls) lookahead_circ = pass_manager.run(circuit) ss = StochasticSwap(coupling_map=coupling_map) pass_manager = PassManager(ss) stochastic_circ = pass_manager.run(circuit) circuit.draw(output='mpl') basic_circ.draw(output='mpl') lookahead_circ.draw(output='mpl') stochastic_circ.draw(output='mpl') import math from qiskit.providers.fake_provider import FakeTokyo backend = FakeTokyo() # mimics the tokyo device in terms of coupling map and basis gates qc = QuantumCircuit(10) random_state = [ 1 / math.sqrt(4) * complex(0, 1), 1 / math.sqrt(8) * complex(1, 0), 0, 0, 0, 0, 0, 0, 1 / math.sqrt(8) * complex(1, 0), 1 / math.sqrt(8) * complex(0, 1), 0, 0, 0, 0, 1 / math.sqrt(4) * complex(1, 0), 1 / math.sqrt(8) * complex(1, 0)] qc.initialize(random_state, range(4)) qc.draw() optimized_0 = transpile(qc, backend=backend, seed_transpiler=11, optimization_level=0) print('gates = ', optimized_0.count_ops()) print('depth = ', optimized_0.depth()) optimized_1 = transpile(qc, backend=backend, seed_transpiler=11, optimization_level=1) print('gates = ', optimized_1.count_ops()) print('depth = ', optimized_1.depth()) optimized_2 = transpile(qc, backend=backend, seed_transpiler=11, optimization_level=2) print('gates = ', optimized_2.count_ops()) print('depth = ', optimized_2.depth()) optimized_3 = transpile(qc, backend=backend, seed_transpiler=11, optimization_level=3) print('gates = ', optimized_3.count_ops()) print('depth = ', optimized_3.depth()) from qiskit import QuantumRegister, ClassicalRegister, QuantumCircuit from qiskit.dagcircuit import DAGCircuit q = QuantumRegister(3, 'q') c = ClassicalRegister(3, 'c') circ = QuantumCircuit(q, c) circ.h(q[0]) circ.cx(q[0], q[1]) circ.measure(q[0], c[0]) circ.rz(0.5, q[1]).c_if(c, 2) circ.draw(output='mpl') from qiskit.converters import circuit_to_dag from qiskit.tools.visualization import dag_drawer dag = circuit_to_dag(circ) dag_drawer(dag) dag.op_nodes() node = dag.op_nodes()[3] print("node name: ", node.name) print("node op: ", node.op) print("node qargs: ", node.qargs) print("node cargs: ", node.cargs) print("node condition: ", node.op.condition) from qiskit.circuit.library import HGate dag.apply_operation_back(HGate(), qargs=[q[0]]) dag_drawer(dag) from qiskit.circuit.library import CCXGate dag.apply_operation_front(CCXGate(), qargs=[q[0], q[1], q[2]], cargs=[]) dag_drawer(dag) from qiskit.circuit.library import CHGate, U2Gate, CXGate mini_dag = DAGCircuit() p = QuantumRegister(2, "p") mini_dag.add_qreg(p) mini_dag.apply_operation_back(CHGate(), qargs=[p[1], p[0]]) mini_dag.apply_operation_back(U2Gate(0.1, 0.2), qargs=[p[1]]) # substitute the cx node with the above mini-dag cx_node = dag.op_nodes(op=CXGate).pop() dag.substitute_node_with_dag(node=cx_node, input_dag=mini_dag, wires=[p[0], p[1]]) dag_drawer(dag) from qiskit.converters import dag_to_circuit circuit = dag_to_circuit(dag) circuit.draw(output='mpl') from copy import copy from qiskit.transpiler.basepasses import TransformationPass from qiskit.transpiler import Layout from qiskit.circuit.library import SwapGate class BasicSwap(TransformationPass): """Maps (with minimum effort) a DAGCircuit onto a `coupling_map` adding swap gates.""" def __init__(self, coupling_map, initial_layout=None): """Maps a DAGCircuit onto a `coupling_map` using swap gates. Args: coupling_map (CouplingMap): Directed graph represented a coupling map. initial_layout (Layout): initial layout of qubits in mapping """ super().__init__() self.coupling_map = coupling_map self.initial_layout = initial_layout def run(self, dag): """Runs the BasicSwap pass on `dag`. Args: dag (DAGCircuit): DAG to map. Returns: DAGCircuit: A mapped DAG. Raises: TranspilerError: if the coupling map or the layout are not compatible with the DAG. """ new_dag = DAGCircuit() for qreg in dag.qregs.values(): new_dag.add_qreg(qreg) for creg in dag.cregs.values(): new_dag.add_creg(creg) if self.initial_layout is None: if self.property_set["layout"]: self.initial_layout = self.property_set["layout"] else: self.initial_layout = Layout.generate_trivial_layout(*dag.qregs.values()) if len(dag.qubits) != len(self.initial_layout): raise TranspilerError('The layout does not match the amount of qubits in the DAG') if len(self.coupling_map.physical_qubits) != len(self.initial_layout): raise TranspilerError( "Mappers require to have the layout to be the same size as the coupling map") canonical_register = dag.qregs['q'] trivial_layout = Layout.generate_trivial_layout(canonical_register) current_layout = trivial_layout.copy() for layer in dag.serial_layers(): subdag = layer['graph'] for gate in subdag.two_qubit_ops(): physical_q0 = current_layout[gate.qargs[0]] physical_q1 = current_layout[gate.qargs[1]] if self.coupling_map.distance(physical_q0, physical_q1) != 1: # Insert a new layer with the SWAP(s). swap_layer = DAGCircuit() swap_layer.add_qreg(canonical_register) path = self.coupling_map.shortest_undirected_path(physical_q0, physical_q1) for swap in range(len(path) - 2): connected_wire_1 = path[swap] connected_wire_2 = path[swap + 1] qubit_1 = current_layout[connected_wire_1] qubit_2 = current_layout[connected_wire_2] # create the swap operation swap_layer.apply_operation_back(SwapGate(), qargs=[qubit_1, qubit_2], cargs=[]) # layer insertion order = current_layout.reorder_bits(new_dag.qubits) new_dag.compose(swap_layer, qubits=order) # update current_layout for swap in range(len(path) - 2): current_layout.swap(path[swap], path[swap + 1]) order = current_layout.reorder_bits(new_dag.qubits) new_dag.compose(subdag, qubits=order) return new_dag q = QuantumRegister(7, 'q') in_circ = QuantumCircuit(q) in_circ.h(q[0]) in_circ.cx(q[0], q[4]) in_circ.cx(q[2], q[3]) in_circ.cx(q[6], q[1]) in_circ.cx(q[5], q[0]) in_circ.rz(0.1, q[2]) in_circ.cx(q[5], q[0]) from qiskit.transpiler import PassManager from qiskit.transpiler import CouplingMap from qiskit import BasicAer pm = PassManager() coupling = [[0, 1], [1, 2], [2, 3], [3, 4], [4, 5], [5, 6]] coupling_map = CouplingMap(couplinglist=coupling) pm.append([BasicSwap(coupling_map)]) out_circ = pm.run(in_circ) in_circ.draw(output='mpl') out_circ.draw(output='mpl') import logging logging.basicConfig(level='DEBUG') from qiskit.providers.fake_provider import FakeTenerife log_circ = QuantumCircuit(2, 2) log_circ.h(0) log_circ.h(1) log_circ.h(1) log_circ.x(1) log_circ.cx(0, 1) log_circ.measure([0,1], [0,1]) backend = FakeTenerife() transpile(log_circ, backend); logging.getLogger('qiskit.transpiler').setLevel('INFO') transpile(log_circ, backend); # Change log level back to DEBUG logging.getLogger('qiskit.transpiler').setLevel('DEBUG') # Transpile multiple circuits circuits = [log_circ, log_circ] transpile(circuits, backend); formatter = logging.Formatter('%(name)s - %(processName)-10s - %(levelname)s: %(message)s') handler = logging.getLogger().handlers[0] handler.setFormatter(formatter) transpile(circuits, backend); import qiskit.tools.jupyter %qiskit_version_table %qiskit_copyright
https://github.com/PacktPublishing/Quantum-Computing-in-Practice-with-Qiskit-and-IBM-Quantum-Experience
PacktPublishing
#!/usr/bin/env python3 # -*- coding: utf-8 -*- """ Created Nov 2020 @author: hassi """ from qiskit import IBMQ from qiskit.providers.ibmq import least_busy print("Ch 5: Least busy backend") print("------------------------") print("Getting provider...") if not IBMQ.active_account(): IBMQ.load_account() provider = IBMQ.get_provider() # Finding the least busy backend backend = least_busy(provider.backends(operational=True, simulator=False)) print("Least busy backend:", backend.name()) filtered_backend = least_busy(provider.backends(n_qubits=5, operational=True, simulator=False)) print("\nLeast busy 5-qubit backend:", filtered_backend.name()) from qiskit.tools.monitor import backend_overview print("\nAll backends overview:\n") backend_overview()
https://github.com/MonitSharma/Qiskit-Summer-School-and-Quantum-Challenges
MonitSharma
from qiskit import * import numpy as np from numpy import linalg as la from qiskit.tools.monitor import job_monitor import qiskit.tools.jupyter qc = QuantumCircuit(1) #### your code goes here # z measurement of qubit 0 measure_z = QuantumCircuit(1,1) measure_z.measure(0,0) # x measurement of qubit 0 measure_x = QuantumCircuit(1,1) # your code goes here # y measurement of qubit 0 measure_y = QuantumCircuit(1,1) # your code goes here shots = 2**14 # number of samples used for statistics sim = Aer.get_backend('qasm_simulator') bloch_vector_measure = [] for measure_circuit in [measure_x, measure_y, measure_z]: # run the circuit with a the selected measurement and get the number of samples that output each bit value counts = execute(qc+measure_circuit, sim, shots=shots).result().get_counts() # calculate the probabilities for each bit value probs = {} for output in ['0','1']: if output in counts: probs[output] = counts[output]/shots else: probs[output] = 0 bloch_vector_measure.append( probs['0'] - probs['1'] ) # normalizing the bloch sphere vector bloch_vector = bloch_vector_measure/la.norm(bloch_vector_measure) print('The bloch sphere coordinates are [{0:4.3f}, {1:4.3f}, {2:4.3f}]' .format(*bloch_vector)) from kaleidoscope.interactive import bloch_sphere bloch_sphere(bloch_vector, vectors_annotation=True) from qiskit.visualization import plot_bloch_vector plot_bloch_vector( bloch_vector ) # circuit for the state Tri1 Tri1 = QuantumCircuit(2) # your code goes here # circuit for the state Tri2 Tri2 = QuantumCircuit(2) # your code goes here # circuit for the state Tri3 Tri3 = QuantumCircuit(2) # your code goes here # circuit for the state Sing Sing = QuantumCircuit(2) # your code goes here # <ZZ> measure_ZZ = QuantumCircuit(2) measure_ZZ.measure_all() # <XX> measure_XX = QuantumCircuit(2) # your code goes here # <YY> measure_YY = QuantumCircuit(2) # your code goes here shots = 2**14 # number of samples used for statistics A = 1.47e-6 #unit of A is eV E_sim = [] for state_init in [Tri1,Tri2,Tri3,Sing]: Energy_meas = [] for measure_circuit in [measure_XX, measure_YY, measure_ZZ]: # run the circuit with a the selected measurement and get the number of samples that output each bit value qc = state_init+measure_circuit counts = execute(qc, sim, shots=shots).result().get_counts() # calculate the probabilities for each computational basis probs = {} for output in ['00','01', '10', '11']: if output in counts: probs[output] = counts[output]/shots else: probs[output] = 0 Energy_meas.append( probs['00'] - probs['01'] - probs['10'] + probs['11'] ) E_sim.append(A * np.sum(np.array(Energy_meas))) # Run this cell to print out your results print('Energy expection value of the state Tri1 : {:.3e} eV'.format(E_sim[0])) print('Energy expection value of the state Tri2 : {:.3e} eV'.format(E_sim[1])) print('Energy expection value of the state Tri3 : {:.3e} eV'.format(E_sim[2])) print('Energy expection value of the state Sing : {:.3e} eV'.format(E_sim[3])) # reduced plank constant in (eV) and the speed of light(cgs units) hbar, c = 4.1357e-15, 3e10 # energy difference between the triplets and singlet E_del = abs(E_sim[0] - E_sim[3]) # frequency associated with the energy difference f = E_del/hbar # convert frequency to wavelength in (cm) wavelength = c/f print('The wavelength of the radiation from the transition\ in the hyperfine structure is : {:.1f} cm'.format(wavelength)) provider = IBMQ.load_account() backend = provider.get_backend('ibmq_athens') # run this cell to get the backend information through the widget backend # assign your choice for the initial layout to the list variable `initial_layout`. initial_layout = qc_all = [state_init+measure_circuit for state_init in [Tri1,Tri2,Tri3,Sing] for measure_circuit in [measure_XX, measure_YY, measure_ZZ] ] shots = 8192 job = execute(qc_all, backend, initial_layout=initial_layout, optimization_level=3, shots=shots) print(job.job_id()) job_monitor(job) # getting the results of your job results = job.result() ## To access the results of the completed job #results = backend.retrieve_job('job_id').result() def Energy(results, shots): """Compute the energy levels of the hydrogen ground state. Parameters: results (obj): results, results from executing the circuits for measuring a hamiltonian. shots (int): shots, number of shots used for the circuit execution. Returns: Energy (list): energy values of the four different hydrogen ground states """ E = [] A = 1.47e-6 for ind_state in range(4): Energy_meas = [] for ind_comp in range(3): counts = results.get_counts(ind_state*3+ind_comp) # calculate the probabilities for each computational basis probs = {} for output in ['00','01', '10', '11']: if output in counts: probs[output] = counts[output]/shots else: probs[output] = 0 Energy_meas.append( probs['00'] - probs['01'] - probs['10'] + probs['11'] ) E.append(A * np.sum(np.array(Energy_meas))) return E E = Energy(results, shots) print('Energy expection value of the state Tri1 : {:.3e} eV'.format(E[0])) print('Energy expection value of the state Tri2 : {:.3e} eV'.format(E[1])) print('Energy expection value of the state Tri3 : {:.3e} eV'.format(E[2])) print('Energy expection value of the state Sing : {:.3e} eV'.format(E[3])) from qiskit.ignis.mitigation.measurement import * # your code to create the circuits, meas_calibs, goes here meas_calibs, state_labels = # execute meas_calibs on your choice of the backend job = execute(meas_calibs, backend, shots = shots) print(job.job_id()) job_monitor(job) cal_results = job.result() ## To access the results of the completed job #cal_results = backend.retrieve_job('job_id').result() # your code to obtain the measurement filter object, 'meas_filter', goes here results_new = meas_filter.apply(results) E_new = Energy(results_new, shots) print('Energy expection value of the state Tri1 : {:.3e} eV'.format(E_new[0])) print('Energy expection value of the state Tri2 : {:.3e} eV'.format(E_new[1])) print('Energy expection value of the state Tri3 : {:.3e} eV'.format(E_new[2])) print('Energy expection value of the state Sing : {:.3e} eV'.format(E_new[3])) # results for the energy estimation from the simulation, # execution on a quantum system without error mitigation and # with error mitigation in numpy array format Energy_exact, Energy_exp_orig, Energy_exp_new = np.array(E_sim), np.array(E), np.array(E_new) # Calculate the relative errors of the energy values without error mitigation # and assign to the numpy array variable `Err_rel_orig` of size 4 Err_rel_orig = # Calculate the relative errors of the energy values with error mitigation # and assign to the numpy array variable `Err_rel_new` of size 4 Err_rel_new = np.set_printoptions(precision=3) print('The relative errors of the energy values for four bell basis\ without measurement error mitigation : {}'.format(Err_rel_orig)) np.set_printoptions(precision=3) print('The relative errors of the energy values for four bell basis\ with measurement error mitigation : {}'.format(Err_rel_new))
https://github.com/MonitSharma/Qiskit-Summer-School-and-Quantum-Challenges
MonitSharma
#Let us begin by importing necessary libraries. from qiskit import Aer from qiskit.algorithms import VQE, QAOA, NumPyMinimumEigensolver from qiskit.algorithms.optimizers import * from qiskit.circuit.library import TwoLocal from qiskit.utils import QuantumInstance from qiskit.utils import algorithm_globals from qiskit_finance import QiskitFinanceError from qiskit_finance.applications.optimization import PortfolioOptimization from qiskit_finance.data_providers import * from qiskit_optimization.algorithms import MinimumEigenOptimizer from qiskit_optimization.applications import OptimizationApplication from qiskit_optimization.converters import QuadraticProgramToQubo import numpy as np import matplotlib.pyplot as plt %matplotlib inline import datetime import warnings from sympy.utilities.exceptions import SymPyDeprecationWarning warnings.simplefilter("ignore", SymPyDeprecationWarning) # Set parameters for assets and risk factor num_assets = 4 # set number of assets to 4 q = 0.5 # set risk factor to 0.5 budget = 2 # set budget as defined in the problem seed = 132 # set random seed # Generate time series data stocks = [("STOCK%s" % i) for i in range(num_assets)] data = RandomDataProvider(tickers=stocks, start=datetime.datetime(1955,11,5), end=datetime.datetime(1985,10,26), seed=seed) data.run() # Let's plot our finanical data for (cnt, s) in enumerate(data._tickers): plt.plot(data._data[cnt], label=s) plt.legend() plt.xticks(rotation=90) plt.xlabel('days') plt.ylabel('stock value') plt.show() #Let's calculate the expected return for our problem data mu = data.get_period_return_mean_vector() # Returns a vector containing the mean value of each asset's expected return. print(mu) # Let's plot our covariance matrix Σ(sigma) sigma = data.get_period_return_covariance_matrix() #Returns the covariance matrix of the four assets print(sigma) fig, ax = plt.subplots(1,1) im = plt.imshow(sigma, extent=[-1,1,-1,1]) x_label_list = ['stock3', 'stock2', 'stock1', 'stock0'] y_label_list = ['stock3', 'stock2', 'stock1', 'stock0'] ax.set_xticks([-0.75,-0.25,0.25,0.75]) ax.set_yticks([0.75,0.25,-0.25,-0.75]) ax.set_xticklabels(x_label_list) ax.set_yticklabels(y_label_list) plt.colorbar() plt.clim(-0.000002, 0.00001) plt.show() ############################## # Provide your code here portfolio = qp = ############################## print(qp) # Check your answer and submit using the following code from qc_grader.challenges.unimelb_2022 import grade_ex1a grade_ex1a(qp) exact_mes = NumPyMinimumEigensolver() exact_eigensolver = MinimumEigenOptimizer(exact_mes) result = exact_eigensolver.solve(qp) print(result) optimizer = SLSQP(maxiter=1000) algorithm_globals.random_seed = 1234 backend = Aer.get_backend('statevector_simulator') ############################## # Provide your code here vqe = ############################## vqe_meo = MinimumEigenOptimizer(vqe) #please do not change this code result = vqe_meo.solve(qp) #please do not change this code print(result) #please do not change this code # Check your answer and submit using the following code from qc_grader.challenges.unimelb_2022 import grade_ex1b grade_ex1b(vqe, qp) #Step 1: Let us begin by importing necessary libraries import qiskit from qiskit import Aer from qiskit.algorithms import VQE, QAOA, NumPyMinimumEigensolver from qiskit.algorithms.optimizers import * from qiskit.circuit.library import TwoLocal from qiskit.utils import QuantumInstance from qiskit.utils import algorithm_globals from qiskit_finance import QiskitFinanceError from qiskit_finance.applications.optimization import * from qiskit_finance.data_providers import * from qiskit_optimization.algorithms import MinimumEigenOptimizer from qiskit_optimization.applications import OptimizationApplication from qiskit_optimization.converters import QuadraticProgramToQubo import numpy as np import matplotlib.pyplot as plt %matplotlib inline import datetime import warnings from sympy.utilities.exceptions import SymPyDeprecationWarning warnings.simplefilter("ignore",SymPyDeprecationWarning) # Step 2. Generate time series data for four assets. # Do not change start/end dates specified to generate problem data. seed = 132 num_assets = 4 stocks = [("STOCK%s" % i) for i in range(num_assets)] data = RandomDataProvider(tickers=stocks, start=datetime.datetime(1955,11,5), end=datetime.datetime(1985,10,26), seed=seed) data.run() # Let's plot our finanical data (We are generating the same time series data as in the previous example.) for (cnt, s) in enumerate(data._tickers): plt.plot(data._data[cnt], label=s) plt.legend() plt.xticks(rotation=90) plt.xlabel('days') plt.ylabel('stock value') plt.show() # Step 3. Calculate mu and sigma for this problem mu2 = data.get_period_return_mean_vector() #Returns a vector containing the mean value of each asset. sigma2 = data.get_period_return_covariance_matrix() #Returns the covariance matrix associated with the assets. print(mu2, sigma2) # Step 4. Set parameters and constraints based on this challenge 1c ############################## # Provide your code here q2 = #Set risk factor to 0.5 budget2 = #Set budget to 3 ############################## # Step 5. Complete code to generate the portfolio instance ############################## # Provide your code here portfolio2 = qp2 = ############################## # Step 6. Now let's use QAOA to solve this problem. optimizer = SLSQP(maxiter=1000) algorithm_globals.random_seed = 1234 backend = Aer.get_backend('statevector_simulator') quantum_instance = QuantumInstance(backend=backend, seed_simulator=seed, seed_transpiler=seed) ############################## # Provide your code here qaoa = ############################## qaoa_meo = MinimumEigenOptimizer(qaoa) #please do not change this code result2 = qaoa_meo.solve(qp2) #please do not change this code print(result2) #please do not change this code # Check your answer and submit using the following code from qc_grader.challenges.unimelb_2022 import grade_ex1c grade_ex1c(qaoa, qp2)
https://github.com/swe-train/qiskit__qiskit
swe-train
# -*- coding: utf-8 -*- # This code is part of Qiskit. # # (C) Copyright IBM 2017. # # This code is licensed under the Apache License, Version 2.0. You may # obtain a copy of this license in the LICENSE.txt file in the root directory # of this source tree or at http://www.apache.org/licenses/LICENSE-2.0. # # Any modifications or derivative works of this code must retain this # copyright notice, and modified files need to carry a notice indicating # that they have been altered from the originals. # pylint: disable=wrong-import-order """Main Qiskit public functionality.""" import pkgutil # First, check for required Python and API version from . import util # qiskit errors operator from .exceptions import QiskitError # The main qiskit operators from qiskit.circuit import ClassicalRegister from qiskit.circuit import QuantumRegister from qiskit.circuit import QuantumCircuit # pylint: disable=redefined-builtin from qiskit.tools.compiler import compile # TODO remove after 0.8 from qiskit.execute import execute # The qiskit.extensions.x imports needs to be placed here due to the # mechanism for adding gates dynamically. import qiskit.extensions import qiskit.circuit.measure import qiskit.circuit.reset # Allow extending this namespace. Please note that currently this line needs # to be placed *before* the wrapper imports or any non-import code AND *before* # importing the package you want to allow extensions for (in this case `backends`). __path__ = pkgutil.extend_path(__path__, __name__) # Please note these are global instances, not modules. from qiskit.providers.basicaer import BasicAer # Try to import the Aer provider if installed. try: from qiskit.providers.aer import Aer except ImportError: pass # Try to import the IBMQ provider if installed. try: from qiskit.providers.ibmq import IBMQ except ImportError: pass from .version import __version__ from .version import __qiskit_version__
https://github.com/qiskit-community/qiskit-translations-staging
qiskit-community
from qiskit.providers.fake_provider import FakeHanoi backend = FakeHanoi() config = backend.configuration() # Basic Features print("This backend is called {0}, and is on version {1}. It has {2} qubit{3}. It " "{4} OpenPulse programs. The basis gates supported on this device are {5}." "".format(config.backend_name, config.backend_version, config.n_qubits, '' if config.n_qubits == 1 else 's', 'supports' if config.open_pulse else 'does not support', config.basis_gates)) config.dt # units of seconds config.meas_levels config.dtm config.meas_map config.drive(0) config.measure(0) config.acquire(0) props = backend.properties() def describe_qubit(qubit, properties): """Print a string describing some of reported properties of the given qubit.""" # Conversion factors from standard SI units us = 1e6 ns = 1e9 GHz = 1e-9 print("Qubit {0} has a \n" " - T1 time of {1} microseconds\n" " - T2 time of {2} microseconds\n" " - U2 gate error of {3}\n" " - U2 gate duration of {4} nanoseconds\n" " - resonant frequency of {5} GHz".format( qubit, properties.t1(qubit) * us, properties.t2(qubit) * us, properties.gate_error('sx', qubit), properties.gate_length('sx', qubit) * ns, properties.frequency(qubit) * GHz)) describe_qubit(0, props) defaults = backend.defaults() q0_freq = defaults.qubit_freq_est[0] # Hz q0_meas_freq = defaults.meas_freq_est[0] # Hz GHz = 1e-9 print("DriveChannel(0) defaults to a modulation frequency of {} GHz.".format(q0_freq * GHz)) print("MeasureChannel(0) defaults to a modulation frequency of {} GHz.".format(q0_meas_freq * GHz)) calibrations = defaults.instruction_schedule_map print(calibrations) measure_schedule = calibrations.get('measure', range(config.n_qubits)) measure_schedule.draw(backend=backend) # You can use `has` to see if an operation is defined. Ex: Does qubit 3 have an x gate defined? calibrations.has('x', 3) # Some circuit operations take parameters. U1 takes a rotation angle: calibrations.get('u1', 0, P0=3.1415) import qiskit.tools.jupyter %qiskit_version_table %qiskit_copyright
https://github.com/Qiskit/qiskit-transpiler-service
Qiskit
# -*- coding: utf-8 -*- # (C) Copyright 2024 IBM. All Rights Reserved. # # This code is licensed under the Apache License, Version 2.0. You may # obtain a copy of this license in the LICENSE.txt file in the root directory # of this source tree or at http://www.apache.org/licenses/LICENSE-2.0. # # Any modifications or derivative works of this code must retain this # copyright notice, and modified files need to carry a notice indicating # that they have been altered from the originals. """Replace each sequence of Clifford, Linear Function or Permutation gates by a single block of these types of gate.""" from functools import partial from qiskit import QuantumCircuit from qiskit.circuit import Instruction from qiskit.circuit.barrier import Barrier from qiskit.circuit.library import LinearFunction, PermutationGate from qiskit.converters import circuit_to_dag, dag_to_dagdependency, dagdependency_to_dag from qiskit.dagcircuit.dagcircuit import DAGCircuit from qiskit.quantum_info.operators import Clifford from qiskit.transpiler.basepasses import TransformationPass from qiskit.transpiler.passes.optimization.collect_and_collapse import ( CollectAndCollapse, collapse_to_operation, ) from qiskit.transpiler.passes.utils import control_flow CLIFFORD_MAX_BLOCK_SIZE = 9 LINEAR_MAX_BLOCK_SIZE = 9 PERMUTATION_MAX_BLOCK_SIZE = 12 clifford_gate_names = [ "x", "y", "z", "h", "s", "sdg", "cx", "cy", "cz", "swap", "clifford", "linear_function", "pauli", ] linear_gate_names = ["cx", "swap", "linear_function"] permutation_gate_names = ["swap"] class Flatten(TransformationPass): """Replaces all instructions that contain a circuit with their circuit""" def __init__(self, node_names): super().__init__() self.node_names = node_names def run(self, dag: DAGCircuit): for node in dag.named_nodes(*self.node_names): if ( hasattr(node.op, "params") and len(node.op.params) > 1 and isinstance(node.op.params[1], QuantumCircuit) ): dag.substitute_node_with_dag(node, circuit_to_dag(node.op.params[1])) return dag _flatten_cliffords = Flatten(("clifford", "Clifford")) _flatten_linearfunctions = Flatten(("linear_function", "Linear_function")) _flatten_permutations = Flatten(("permutation", "Permutation")) from qiskit.dagcircuit.collect_blocks import BlockCollector class GreedyBlockCollector(BlockCollector): def __init__(self, dag, max_block_size): super().__init__(dag) self.max_block_size = max_block_size def collect_matching_block(self, filter_fn): """Iteratively collects the largest block of input nodes (that is, nodes with ``_in_degree`` equal to 0) that match a given filtering function, limiting the maximum size of the block. """ current_block = [] unprocessed_pending_nodes = self._pending_nodes self._pending_nodes = [] block_qargs = set() # Iteratively process unprocessed_pending_nodes: # - any node that does not match filter_fn is added to pending_nodes # - any node that match filter_fn is added to the current_block, # and some of its successors may be moved to unprocessed_pending_nodes. while unprocessed_pending_nodes: node = unprocessed_pending_nodes.pop() if isinstance(node.op, Barrier): continue new_qargs = block_qargs.copy() for q in node.qargs: new_qargs.add(q) if filter_fn(node) and len(new_qargs) <= self.max_block_size: current_block.append(node) block_qargs = new_qargs # update the _in_degree of node's successors for suc in self._direct_succs(node): self._in_degree[suc] -= 1 if self._in_degree[suc] == 0: unprocessed_pending_nodes.append(suc) else: self._pending_nodes.append(node) return current_block class BlockChecker: def __init__(self, gates, block_class): self.gates = gates self.block_class = block_class self.current_set = set() def select(self, node): """Decides if the node should be added to the block.""" return ( node.op.name in self.gates and getattr(node.op, "condition", None) is None ) def collapse(self, circuit): """Construcs an Gate object for the block.""" self.current_set = set() return self.block_class(circuit) class CliffordInstruction(Instruction): def __init__(self, circuit): circuit = _flatten_cliffords(circuit) super().__init__( name="Clifford", num_qubits=circuit.num_qubits, num_clbits=0, params=[Clifford(circuit), circuit], ) def construct_permutation_gate(circuit): circuit = _flatten_permutations(circuit) return PermutationGate(LinearFunction(circuit).permutation_pattern()) def construct_linearfunction_gate(circuit): circuit = _flatten_linearfunctions(circuit) return LinearFunction(circuit) class RepeatedCollectAndCollapse(CollectAndCollapse): def __init__( self, block_checker: BlockChecker, do_commutative_analysis=True, split_blocks=True, min_block_size=2, max_block_size=1000, split_layers=False, collect_from_back=False, num_reps=10, ): collect_function = lambda dag: GreedyBlockCollector( dag, max_block_size ).collect_all_matching_blocks( filter_fn=block_checker.select, split_blocks=split_blocks, min_block_size=min_block_size, split_layers=split_layers, collect_from_back=collect_from_back, ) collapse_function = partial( collapse_to_operation, collapse_function=block_checker.collapse ) super().__init__( collect_function=collect_function, collapse_function=collapse_function, do_commutative_analysis=do_commutative_analysis, ) self.num_reps = num_reps @control_flow.trivial_recurse def run(self, dag): """Run the CollectLinearFunctions pass on `dag`. Args: dag (DAGCircuit): the DAG to be optimized. Returns: DAGCircuit: the optimized DAG. """ # If the option commutative_analysis is set, construct DAGDependency from the given DAGCircuit. if self.do_commutative_analysis: dag = dag_to_dagdependency(dag) for _ in range(self.num_reps): # call collect_function to collect blocks from DAG blocks = self.collect_function(dag) # call collapse_function to collapse each block in the DAG self.collapse_function(dag, blocks) # If the option commutative_analysis is set, construct back DAGCircuit from DAGDependency. if self.do_commutative_analysis: dag = dagdependency_to_dag(dag) return dag class CollectCliffords(RepeatedCollectAndCollapse): """CollectCliffords(do_commutative_analysis: bool = True, min_block_size: int = 2, max_block_size: int = CLIFFORD_MAX_BLOCK_SIZE, collect_from_back: bool = False, num_reps: int = 10) Collects Clifford blocks as `Instruction` objects and stores the original sub-circuit to compare against it after synthesis. :param do_commutative_analysis: Enable or disable commutative analysis, defaults to True :type do_commutative_analysis: bool, optional :param min_block_size: Set the minimum size for blocks generated during the collect Cliffords pass, defaults to 2. :type min_block_size: int, optional :param max_block_size: Set the maximum size for blocks generated during the collect Cliffords pass, defaults to 9. :type max_block_size: int, optional :param collect_from_back: Specify if collect blocks in reverse order or not, defaults to False. :type collect_from_back: bool, optional :param num_reps: Specify how many times to repeat the optimization process, defaults to 10. :type num_reps: int, optional """ def __init__( self, do_commutative_analysis=True, min_block_size=2, max_block_size=CLIFFORD_MAX_BLOCK_SIZE, collect_from_back=False, num_reps=10, ): super().__init__( BlockChecker( gates=clifford_gate_names, block_class=CliffordInstruction, ), do_commutative_analysis=do_commutative_analysis, split_blocks=True, min_block_size=min_block_size, max_block_size=max_block_size, split_layers=False, collect_from_back=collect_from_back, num_reps=num_reps, ) class CollectLinearFunctions(RepeatedCollectAndCollapse): """CollectLinearFunctions(do_commutative_analysis: bool = True, min_block_size: int = 4, max_block_size: int = LINEAR_MAX_BLOCK_SIZE, collect_from_back: bool = False, num_reps: int = 10) Collects blocks of `SWAP` and `CX` as `LinearFunction` objects and stores the original sub-circuit to compare against it after synthesis. :param do_commutative_analysis: Enable or disable commutative analysis, defaults to True :type do_commutative_analysis: bool, optional :param min_block_size: Set the minimum size for blocks generated during the collect linear functions pass, defaults to 4. :type min_block_size: int, optional :param max_block_size: Set the maximum size for blocks generated during the collect linear functions pass, defaults to 9. :type max_block_size: int, optional :param collect_from_back: Specify if collect blocks in reverse order or not, defaults to False. :type collect_from_back: bool, optional :param num_reps: Specify how many times to repeat the optimization process, defaults to 10. :type num_reps: int, optional """ def __init__( self, do_commutative_analysis=True, min_block_size=4, max_block_size=LINEAR_MAX_BLOCK_SIZE, collect_from_back=False, num_reps=10, ): super().__init__( BlockChecker( gates=linear_gate_names, block_class=construct_linearfunction_gate, ), do_commutative_analysis=do_commutative_analysis, split_blocks=True, min_block_size=min_block_size, max_block_size=max_block_size, split_layers=False, collect_from_back=collect_from_back, num_reps=num_reps, ) class CollectPermutations(RepeatedCollectAndCollapse): """CollectPermutations(do_commutative_analysis: bool = True, min_block_size: int = 4, max_block_size: int = PERMUTATION_MAX_BLOCK_SIZE, collect_from_back: bool = False, num_reps: int = 10) Collects blocks of `SWAP` circuits as `Permutations`. :param do_commutative_analysis: Enable or disable commutative analysis, defaults to True :type do_commutative_analysis: bool, optional :param min_block_size: Set the minimum size for blocks generated during the collect permutations pass, defaults to 4. :type min_block_size: int, optional :param max_block_size: Set the maximum size for blocks generated during the collect permutations pass, defaults to 12. :type max_block_size: int, optional :param collect_from_back: Specify if collect blocks in reverse order or not, defaults to False. :type collect_from_back: bool, optional :param num_reps: Specify how many times to repeat the optimization process, defaults to 10. :type num_reps: int, optional """ def __init__( self, do_commutative_analysis=True, min_block_size=4, max_block_size=PERMUTATION_MAX_BLOCK_SIZE, collect_from_back=False, num_reps=10, ): super().__init__( BlockChecker( gates=permutation_gate_names, block_class=construct_permutation_gate, ), do_commutative_analysis=do_commutative_analysis, split_blocks=True, min_block_size=min_block_size, max_block_size=max_block_size, split_layers=False, collect_from_back=collect_from_back, num_reps=num_reps, )
https://github.com/The-Singularity-Research/QISKit-Surface-Codes
The-Singularity-Research
from collections import Counter from typing import Tuple, List from networkx import MultiGraph from networkx import nx from networkx.algorithms import bipartite from sympy.combinatorics import Permutation import matplotlib.pyplot as plt # from SurfaceCodes.utilites import permlist_to_tuple class SurfaceCodeGraph(MultiGraph): def __init__(self, sigma: Tuple[Tuple[int]], alpha: Tuple[Tuple[int]]): super().__init__() self.sigma = sigma # should include singletons corresponding to fixed points self.alpha = alpha # should include singletons corresponding to fixed points f = self.compute_phi() self.phi = self.permlist_to_tuple(f) self.build_node_info() # print dictionary for [sigma, alpha, phi] self.node_dict = self.sigma_dict, self.alpha_dict, self.phi_dict self.node_info = ["sigma:", self.sigma_dict, "alpha:", self.alpha_dict, "phi:", self.phi_dict] self.code_graph = nx.MultiGraph() # Create black nodes for each cycle in sigma along with white nodes # representing "half edges" around the black nodes for cycle in self.sigma: self.code_graph.add_node(cycle, bipartite=1) for node in cycle: self.code_graph.add_node(node, bipartite=0) self.code_graph.add_edge(cycle, node) # Create black nodes for each cycle in phi along with white nodes # representing "half edges" around the black nodes for cycle in self.phi: self.code_graph.add_node(cycle, bipartite=1) for node in cycle: self.code_graph.add_edge(cycle, node) # Create nodes for each cycle in alpha then # glue the nodes corresponding to a the pairs for pair in self.alpha: self.code_graph.add_node(pair) self.code_graph = nx.contracted_nodes(self.code_graph, pair[0], pair[1], self_loops=True) # Now contract pair with pair[0] to make sure edges (white nodes) are labeled # by the pairs in alpha to keep track of the gluing from the previous step self.code_graph = nx.contracted_nodes(self.code_graph, pair, pair[0], self_loops=True) # Define the white and black nodes. White correspond to edges labeled by # cycles in alpha. Black correspond to nodes labeled by cycles in sigma # (vertices) and phi (faces) self.black_nodes, self.white_nodes = bipartite.sets(self.code_graph) def permlist_to_tuple(self, perms): """ convert list of lists to tuple of tuples in order to have two level iterables that are hashable for the dictionaries used later """ return tuple(tuple(perm) for perm in perms) def compute_phi(self): """compute the list of lists full cyclic form of phi (faces of dessin [sigma, alpha, phi])""" s = Permutation(self.sigma) a = Permutation(self.alpha) f = ~(a * s) f = f.full_cyclic_form # prints permutation as a list of lists including all singletons (fixed points) return f def build_node_info(self): count = -1 self.sigma_dict = dict() for count, cycle in enumerate(self.sigma): self.sigma_dict[cycle] = count self.phi_dict = dict() for count, cycle in enumerate(self.phi, start=count + 1): self.phi_dict[cycle] = count self.alpha_dict = dict() for count, pair in enumerate(self.alpha, start=count + 1): self.alpha_dict[pair] = count return tuple([self.sigma_dict, self.alpha_dict, self.phi_dict]) def boundary_1(self, edge): """ compute boundary of a single edge given by a white node (cycle in alpha) """ boundary1 = [node for node in self.code_graph.neighbors(edge) if node in self.sigma_dict] return boundary1 def del_1(self, edges: List[Tuple[int]]): """ boundary of a list of edges, i.e. an arbitrary 1-chain over Z/2Z """ boundary_list = [self.boundary_1(edge) for edge in edges] a = Counter([y for x in boundary_list for y in x]) boundary_list = [x[0] for x in a.items() if x[1] % 2 == 1] return boundary_list def boundary_2(self, face): """ compute boundary of a single face """ boundary = self.code_graph.neighbors(face) return boundary def del_2(self, faces: List[Tuple[int]]): """ boundary of a list of faces, i.e. an arbitrary 2-chain over Z/2Z """ boundary_list = [self.boundary_2(face) for face in faces] a = Counter([y for x in boundary_list for y in x]) boundary_list = [x[0] for x in a.items() if x[1] % 2 == 1] return boundary_list def coboundary_1(self, star): """ compute coboundary of a single star """ coboundary = self.code_graph.neighbors(star) return coboundary def delta_1(self, stars: List[Tuple[int]]): """ coboundary of a list of stars, i.e. an arbitrary 0-cochain over Z/2Z """ coboundary_list = [self.coboundary_1(star) for star in stars] a = Counter([y for x in coboundary_list for y in x]) coboundary_list = [x[0] for x in a.items() if x[1] % 2 == 1] return coboundary_list def coboundary_2(self, edge): """ compute coboundary of a single edge given by a white node (cycle in alpha) """ coboundary2 = [node for node in self.code_graph.neighbors(edge) if node in self.phi_dict] return coboundary2 def delta_2(self, edges: List[Tuple[int]]): """ coboundary of a list of edges, i.e. an arbitrary 1-cochain over Z/2Z given by a list of cycles in alpha """ coboundary_list = [self.coboundary_2(edge) for edge in edges] a = Counter([y for x in coboundary_list for y in x]) coboundary_list = [x[0] for x in a.items() if x[1] % 2 == 1] return coboundary_list def euler_characteristic(self): """ Compute the Euler characteristic of the surface in which the graph is embedded """ chi = len(self.phi) - len(self.alpha) + len(self.sigma) return (chi) def genus(self): """ Compute the genus of the surface in which the graph is embedded """ g = int(-(len(self.phi) - len(self.alpha) + len(self.sigma) - 2) / 2) return (g) def draw(self, node_type='', layout = ''): """ Draw graph with vertices, edges, and faces labeled by colored nodes and their integer indices corresponding to the qubit indices for the surface code """ if not node_type in ['cycles', 'dict']: raise ValueError('node_type can be "cycles" or "dict"') if layout == 'spring': pos=nx.spring_layout(self.code_graph) if layout == 'spectral': pos=nx.spectral_layout(self.code_graph) if layout == 'planar': pos=nx.planar_layout(self.code_graph) if layout == 'shell': pos=nx.shell_layout(self.code_graph) if layout == 'circular': pos=nx.circular_layout(self.code_graph) if layout == 'spiral': pos=nx.spiral_layout(self.code_graph) if layout == 'random': pos=nx.random_layout(self.code_graph) # white nodes nx.draw_networkx_nodes(self.code_graph, pos, nodelist=list(self.alpha), node_color='c', node_size=500, alpha=0.3) # vertex nodes nx.draw_networkx_nodes(self.code_graph, pos, nodelist=list(self.sigma), node_color='b', node_size=500, alpha=0.6) # face nodes nx.draw_networkx_nodes(self.code_graph, pos, nodelist=list(self.phi), node_color='r', node_size=500, alpha=0.6) # edges nx.draw_networkx_edges(self.code_graph, pos, width=1.0, alpha=0.5) labels={} if node_type == 'cycles': ''' label nodes the cycles of sigma, alpha, and phi ''' for node in self.alpha_dict: # stuff = self.alpha_dict[node] labels[node]=f'$e$({node})' for node in self.sigma_dict: # something = self.sigma_dict[node] labels[node]=f'$v$({node})' for node in self.phi_dict: # something2 = self.phi_dict[node] labels[node]=f'$f$({node})' nx.draw_networkx_labels(self.code_graph, pos, labels, font_size=12) if node_type == 'dict': ''' label nodes with v, e, f and indices given by node_dict corresponding to qubit indices of surface code ''' for node in self.alpha_dict: # stuff = self.alpha_dict[node] labels[node]=f'$e$({self.alpha_dict[node]})' for node in self.sigma_dict: # something = self.sigma_dict[node] labels[node]=f'$v$({self.sigma_dict[node]})' for node in self.phi_dict: # something2 = self.phi_dict[node] labels[node]=f'$f$({self.phi_dict[node]})' nx.draw_networkx_labels(self.code_graph, pos, labels, font_size=12) # plt.axis('off') # plt.savefig("labels_and_colors.png") # save as png plt.show() # display sigma = ((0,1,2),(3,4,5),(6,7)) alpha = ((0,3),(1,6),(2,4),(5,7)) SCG = SurfaceCodeGraph(sigma, alpha) SCG SCG.draw('cycles', 'spring') SCG.phi SCG.node_info SCG.code_graph.nodes bipartite.sets(SCG.code_graph) SCG.white_nodes SCG.black_nodes SCG.draw('dict', 'spring') SCG.euler_characteristic() SCG.genus() SCG.del_2([(1,3,7)]) SCG.del_2([(0, 4), (1,3,7)]) SCG.delta_1([(0,1,2)]) SCG.delta_1([(0,1,2), (3,4,5)]) SCG.boundary_1((0,3)) SCG.boundary_1((1,6)) SCG.del_1([(0,3), (1,6)]) SCG.coboundary_2((0,3)) SCG.coboundary_2((1,6)) SCG.delta_2([(0,3), (1,6)]) from typing import Tuple from qiskit.circuit import QuantumCircuit, QuantumRegister, ClassicalRegister # from SurfaceCodes.surface_code_class import SurfaceCodeGraph # from SurfaceCodes.utilites import permlist_to_tuple class SurfaceCodeCircuit(QuantumCircuit): def __init__(self, sigma: Tuple[Tuple[int]], alpha: Tuple[Tuple[int]]): super().__init__() self.sigma = sigma self.alpha = alpha self.scgraph = SurfaceCodeGraph(self.sigma, self.alpha) ''' Compute the permutation corresponding to phi and create a 'surface code circuit' based on a (multi)graph 'surface_code_graph' given by sigma, alpha, and phi Create quantum and classical registers based on the number of nodes in G ''' # f = self.scgraph.compute_phi() self.phi = self.scgraph.phi self.qr = QuantumRegister(len(self.scgraph.code_graph.nodes)) self.cr = ClassicalRegister(len(self.scgraph.code_graph.nodes)) self.circ = QuantumCircuit(self.qr, self.cr) self.node_info = self.scgraph.node_dict self.sigma_dict, self.alpha_dict, self.phi_dict = self.node_info for cycle in self.sigma: self.circ.h(self.sigma_dict[cycle]) for cycle in self.phi: self.circ.h(self.phi_dict[cycle]) def x_measurement(self, qubit: int, cbit: int): """Measure 'qubit' in the X-basis, and store the result in 'cbit' :param qubit, cbit: :return None """ # circuit.measure = measure # fix a bug in qiskit.circuit.measure self.circ.h(qubit) self.circ.measure(qubit, cbit) self.circ.h(qubit) def star_syndrome_measure(self, vertex: Tuple[int]): """ Applies CX gates to surrounding qubits of a star then measures star qubit in X-basis :param vertex: :return: self.circ, self.scgraph, self.node_info """ for node in self.scgraph.code_graph.neighbors(vertex): self.circ.cx(self.sigma_dict[vertex], self.alpha_dict[node]) self.circ.barrier() self.x_measurement(self.sigma_dict[vertex], self.sigma_dict[vertex]) self.circ.barrier() return self.circ, self.scgraph, self.node_info def face_syndrome_measure(self, vertex: Tuple[int]): """ Applies CZ gates to surrounding qubits of a face then measures face qubit in X-basis :param vertex: :return: """ for node in self.scgraph.code_graph.neighbors(vertex): self.circ.cz(self.phi_dict[vertex], self.alpha_dict[node]) self.circ.barrier() self.x_measurement(self.phi_dict[vertex], self.phi_dict[vertex]) self.circ.barrier() return self.circ, self.scgraph, self.node_info def product_Z(self, faces): """ Pauli product Z operator for arbitrary 2-chain boundary """ boundary_nodes = self.scgraph.del_2(faces) for node in boundary_nodes: self.circ.z(self.alpha_dict[node]) def product_X(self, stars): """ Pauli product X operator for arbitrary 0-cochain coboundary """ coboundary_nodes = self.scgraph.delta_1(stars) for node in coboundary_nodes: self.circ.x(self.alpha_dict[node]) def draw_graph(self, node_type='', layout = ''): if layout == 'spring': pos=nx.spring_layout(self.scgraph.code_graph) if layout == 'spectral': pos=nx.spectral_layout(self.scgraph.code_graph) if layout == 'planar': pos=nx.planar_layout(self.scgraph.code_graph) if layout == 'shell': pos=nx.shell_layout(self.scgraph.code_graph) if layout == 'circular': pos=nx.circular_layout(self.scgraph.code_graph) if layout == 'spiral': pos=nx.spiral_layout(self.scgraph.code_graph) if layout == 'random': pos=nx.random_layout(self.scgraph.code_graph) if node_type == 'cycles': self.scgraph.draw('cycles', layout) if node_type == 'dict': self.scgraph.draw('dict', layout) SCC = SurfaceCodeCircuit(sigma, alpha) SCC.circ.draw('mpl') nx.draw(SCC.scgraph.code_graph, with_labels = True) SCC.draw_graph('cycles', 'spring') SCC.draw_graph('dict', 'spring') SCC.node_info SCC.sigma SCC.alpha SCC.phi SCC.scgraph.code_graph.nodes SCC.star_syndrome_measure(((0,1,2))) SCC.circ.draw('mpl') SCC.face_syndrome_measure(((2, 6, 5))) SCC.circ.draw('mpl') SCC.product_Z([(0, 4), (2, 6, 5)]) SCC.circ.draw('mpl') SCC.product_X([(3, 4, 5), (6, 7)]) SCC.circ.draw('mpl') sigma = ((0,1),(2,3,4),(5,6,7),(8,9),(10,11,12),(13,14,15,16),(17,18,19,20),(21,22,23),(24,25,26),(27,28,29,30),(31,32,33,34),(35,36,37),(38,39),(40,41,42),(43,44,45),(46,47)) alpha = ((0,2),(1,10),(3,5),(4,14),(6,8),(7,18),(9,22),(11,13),(12,24),(15,17),(16,28),(19,21),(20,32),(23,36),(25,27),(26,38),(29,31),(30,41),(33,35),(34,44),(37,47),(39,40),(42,43),(45,46)) SCG = SurfaceCodeGraph(sigma, alpha) SCG.genus() SCG.draw('dict', 'planar') SCG.draw('dict', 'spectral') len(SCG.code_graph.nodes()) len(SCG.sigma) len(SCG.alpha) len(SCG.phi) SCG.phi SCG.code_graph.nodes() SCG.code_graph.remove_node((0, 10, 24, 38, 40, 43, 46, 37, 23, 9, 6, 3)) len(SCG.code_graph.nodes()) nx.draw_spectral(SCG.code_graph, with_labels = False) G = nx.Graph() pos = dict() for x in range(7): for y in range(7): G.add_node((x,y)) pos[(x,y)] = (x,y) if x>0: G.add_edge((x-1,y),(x,y)) if y>0: G.add_edge((x,y),(x,y-1)) nx.draw(G, pos=pos, with_labels = True) nx.is_isomorphic(SCG.code_graph, G) G1, G2 = SCG.code_graph, G GM = nx.isomorphism.GraphMatcher(G1,G2) GM.is_isomorphic() GM.mapping node_color = {(x[0], x[1]): 1-((x[0]+x[1])%2)/2 for x in G.nodes()} for y in range(1,7,2): for z in range(1,7,2): node_color[(y,z)] = .2 node_color = [node_color[x] for x in sorted(node_color.keys())] nx.draw(G, pos = pos, node_color = node_color)
https://github.com/matheusmtta/Quantum-Computing
matheusmtta
import matplotlib.pyplot as plt %matplotlib inline import numpy as np from qiskit import * from qiskit.tools.visualization import plot_histogram from IPython.display import display, Math, Latex from qiskit.visualization import plot_state_qsphere def BuildBell(x, y): U = QuantumCircuit(2) U.h(0) U.cx(0, 1) if x == 1: U.cz(0, 1) if y == 1: U.x(1) U = U.to_gate() U.name = 'Build Bell' #ctl_U = U.control() make it a controlled gate return U backend = BasicAer.get_backend('statevector_simulator') n = 2 #bell state 00 [x, y] = [0, 0] b00 = QuantumCircuit(n, n) b00.append(BuildBell(x, y), range(n)) #bell state 01 [x, y] = [0, 1] b01 = QuantumCircuit(n, n) b01.append(BuildBell(x, y), range(n)) #bell state 10 [x, y] = [1, 0] b10 = QuantumCircuit(n, n) b10.append(BuildBell(x, y), range(n)) #bell state 11 [x, y] = [1, 1] b11 = QuantumCircuit(n, n) b11.append(BuildBell(x, y), range(n)) bqs00 = execute(b00, backend).result() bqs01 = execute(b01, backend).result() bqs10 = execute(b10, backend).result() bqs11 = execute(b11, backend).result() #GENERAL CIRCUIT b_00 bxy = QuantumCircuit(n, n) bxy.h(0) bxy.cx(0, 1) bxy.measure(range(n), range(n)) backend = BasicAer.get_backend('qasm_simulator') atp = 1024 res = execute(bxy, backend=backend, shots=atp).result() ans = res.get_counts() bxy.draw('mpl') plot_histogram(ans) plot_state_qsphere(bqs00.get_statevector(b00)) #bell state 00 qsphere plot_state_qsphere(bqs01.get_statevector(b01)) #bell state 01 qsphere plot_state_qsphere(bqs10.get_statevector(b10)) #bell state 10 qsphere plot_state_qsphere(bqs11.get_statevector(b11)) #bell state 11 qsphere
https://github.com/lkcoredo/qiskitWorkshop
lkcoredo
import qiskit qiskit.__qiskit_version__ from qiskit import IBMQ IBMQ.save_account('86ae6d9e149ed5f78869fe4c6ba5b9b42419053fed9e1c0f731d63d6c7b416c9812292cc69fd2cf108e4096a6c3e20f5d7366d48de2ac650fc599d86acaa526c') IBMQ.load_account() from qiskit import * qr = QuantumRegister(2) cr = ClassicalRegister(2) circuit = QuantumCircuit(qr, cr) circuit = QuantumCircuit(qr, cr) circuit.draw() circuit.h(qr[0]) circuit.draw(output= 'mpl') circuit.cx(qr[0], qr[1]) circuit.draw(output= 'mpl') circuit.measure(qr, cr) circuit.draw(output= 'mpl') simulator = Aer.get_backend("qasm_simulator") execute(circuit, backend = simulator) result = execute(circuit, backend = simulator).result() from qiskit.tools.visualization import plot_histogram plot_histogram(result.get_counts(circuit)) IBMQ.load_account() provider = IBMQ.get_provider(hub='ibm-q', group='open', project='main') provider.backends() qcomp = provider.get_backend('ibmq_santiago') job = execute(circuit, backend=qcomp) from qiskit.tools.monitor import job_monitor job_monitor(job) result = job.result() plot_histogram(result.get_count(circuit))
https://github.com/qiskit-community/qiskit-translations-staging
qiskit-community
from qiskit import QuantumRegister, ClassicalRegister, QuantumCircuit q = QuantumRegister(1) c = ClassicalRegister(1) qc = QuantumCircuit(q, c) qc.h(q) qc.measure(q, c) qc.draw(output='mpl', style={'backgroundcolor': '#EEEEEE'})
https://github.com/mentesniker/Quantum-error-mitigation
mentesniker
from qiskit import QuantumCircuit, QuantumRegister, Aer, execute, ClassicalRegister from qiskit.ignis.verification.topological_codes import RepetitionCode from qiskit.ignis.verification.topological_codes import lookuptable_decoding from qiskit.ignis.verification.topological_codes import GraphDecoder from qiskit.providers.aer.noise import NoiseModel from qiskit.providers.aer.noise.errors import pauli_error, depolarizing_error from qiskit.ignis.mitigation.measurement import (complete_meas_cal,CompleteMeasFitter) from qiskit.visualization import plot_histogram import random backend = Aer.get_backend('qasm_simulator') #These two functions were taken from https://stackoverflow.com/questions/10237926/convert-string-to-list-of-bits-and-viceversa def tobits(s): result = [] for c in s: bits = bin(ord(c))[2:] bits = '00000000'[len(bits):] + bits result.extend([int(b) for b in bits]) return ''.join([str(x) for x in result]) def frombits(bits): chars = [] for b in range(int(len(bits) / 8)): byte = bits[b*8:(b+1)*8] chars.append(chr(int(''.join([str(bit) for bit in byte]), 2))) return ''.join(chars) def get_noise(circuit,probability,qubits): random_number = random.uniform(0, 1) if(random_number <= probability): qubit = random.randint(0,len(qubits)-1) circuit.x(qubit) return circuit def codificate(bitString): qubits = list() for i in range(len(bitString)): mycircuit = QuantumCircuit(1,1) if(bitString[i] == "1"): mycircuit.x(0) qubits.append(mycircuit) return qubits m0 = tobits("I like dogs") qubits = codificate(m0) measurements = list() for i in range(len(qubits)): qubit = qubits[i] qubit.measure(0,0) result = execute(qubit, backend, shots=1, memory=True).result() measurements.append(int(result.get_memory()[0])) print(frombits(measurements)) m0 = tobits("I like dogs") qubits = codificate(m0) measurements = list() for i in range(len(qubits)): qubit = qubits[i] qubit = get_noise(qubit,0.2,range(qubit.num_qubits)) qubit.measure(0,0) result = execute(qubit, backend, shots=1, memory=True).result() measurements.append(int(result.get_memory()[0])) print(frombits(measurements)) for i in range(len(qubits)): cb = QuantumRegister(1,'code_qubit') lq = QuantumRegister(4,'ancilla_qubit') sb = ClassicalRegister(2,'syndrome_bit') out = ClassicalRegister(1,'output_bit') mycircuit = QuantumCircuit(cb,lq,sb,out) if(m0[i] == "1"): mycircuit.x(0) mycircuit.cx(0,1) mycircuit.cx(1,2) mycircuit = get_noise(mycircuit,0.2,range(3)) mycircuit.cx(0,3) mycircuit.cx(1,3) mycircuit.cx(0,4) mycircuit.cx(2,4) mycircuit.measure(3,0) mycircuit.measure(4,1) qubits[i] = mycircuit measurements = list() raw_bits = list() for i in range(len(qubits)): qubit = qubits[i] qubit.measure(0,2) result = execute(qubit, backend, shots=1, memory=True).result() bits = result.get_memory()[0] raw_bits.append(int(bits[0])) for i in range(len(qubits)): qubit = qubits[i] result = execute(qubit, backend, shots=1, memory=True).result() bits = result.get_memory()[0] if(bits[2] == '1' and bits[3] == '0'): qubit.x(2) if(bits[2] == '0' and bits[3] == '1'): qubit.x(1) if(bits[2] == '1' and bits[3] == '1'): qubit.x(0) qubit.measure(0,2) result = execute(qubit, backend, shots=1, memory=True).result() bits = result.get_memory()[0] measurements.append(int(bits[0])) print("without error correction the string was: " + frombits(raw_bits)) print("with error correction the string was: " + frombits(measurements))
https://github.com/qiskit-community/qiskit-translations-staging
qiskit-community
from qiskit import QuantumCircuit qc = QuantumCircuit(1, 1) qc.h(0) qc.measure(0,0) qc.x(0).c_if(0, 0) qc.draw(output='mpl') from qiskit import QuantumRegister, ClassicalRegister q = QuantumRegister(3, 'q') c = ClassicalRegister(3, 'c') qc = QuantumCircuit(q, c) qc.h([0, 1, 2]) qc.barrier() qc.measure(q, c) qc.draw('mpl') print(bin(3)) print(bin(7)) qc.x(2).c_if(c, 3) # for the 011 case qc.x(2).c_if(c, 7) # for the 111 case qc.draw(output='mpl') nq = 2 m = 2 q = QuantumRegister(nq, 'q') c = ClassicalRegister(m, 'c') qc_S = QuantumCircuit(q,c) qc_S.h(0) qc_S.x(1) qc_S.draw('mpl') from math import pi cu_circ = QuantumCircuit(2) cu_circ.cp(pi/2, 0, 1) cu_circ.draw('mpl') for _ in range(2 ** (m - 1)): qc_S.cp(pi/2, 0, 1) qc_S.draw('mpl') def x_measurement(qc, qubit, cbit): """Measure 'qubit' in the X-basis, and store the result in 'cbit'""" qc.h(qubit) qc.measure(qubit, cbit) x_measurement(qc_S, q[0], c[0]) qc_S.draw('mpl') qc_S.reset(0) qc_S.h(0) qc_S.draw('mpl') qc_S.p(-pi/2, 0).c_if(c, 1) qc_S.draw('mpl') ## 2^t c-U operations (with t=m-2) for _ in range(2 ** (m - 2)): qc_S.cp(pi/2, 0, 1) x_measurement(qc_S, q[0], c[1]) qc_S.draw('mpl') import matplotlib.pyplot as plt from qiskit.tools.visualization import plot_histogram from qiskit_aer.primitives import Sampler sampler = Sampler() job = sampler.run(qc_S) result = job.result() dist0 = result.quasi_dists[0] key_new = [str(key/2**m) for key in list(dist0.keys())] dist1 = dict(zip(key_new, dist0.values())) fig, ax = plt.subplots(1,2) plot_histogram(dist0, ax=ax[0]) plot_histogram(dist1, ax=ax[1]) plt.tight_layout() nq = 3 # number of qubits m = 3 # number of classical bits q = QuantumRegister(nq,'q') c = ClassicalRegister(m,'c') qc = QuantumCircuit(q,c) qc.h(0) qc.x([1, 2]) qc.draw('mpl') cu_circ = QuantumCircuit(nq) cu_circ.mcp(pi/4, [0, 1], 2) cu_circ.draw('mpl') for _ in range(2 ** (m - 1)): qc.mcp(pi/4, [0, 1], 2) qc.draw('mpl') x_measurement(qc, q[0], c[0]) qc.draw('mpl') qc.reset(0) qc.h(0) qc.draw('mpl') qc.p(-pi/2, 0).c_if(c, 1) qc.draw('mpl') for _ in range(2 ** (m - 2)): qc.mcp(pi/4, [0, 1], 2) x_measurement(qc, q[0], c[1]) qc.draw('mpl') # initialization of qubit q0 qc.reset(0) qc.h(0) # phase correction qc.p(-pi/4, 0).c_if(c, 1) qc.p(-pi/2, 0).c_if(c, 2) qc.p(-3*pi/2, 0).c_if(c, 3) # c-U operations for _ in range(2 ** (m - 3)): qc.mcp(pi/4, [0, 1], 2) # X measurement qc.h(0) qc.measure(0, 2) qc.draw('mpl') result = sampler.run(qc).result() dist0 = result.quasi_dists[0] key_new = [str(key/2**m) for key in list(dist0.keys())] dist1 = dict(zip(key_new, dist0.values())) fig, ax = plt.subplots(1,2) plot_histogram(dist0, ax=ax[0]) plot_histogram(dist1, ax=ax[1]) plt.tight_layout() import qiskit.tools.jupyter %qiskit_version_table %qiskit_copyright
https://github.com/qiskit-community/qiskit-translations-staging
qiskit-community
from qiskit import QuantumCircuit, transpile, schedule from qiskit.visualization.pulse_v2 import draw, IQXSimple from qiskit.providers.fake_provider import FakeBoeblingen qc = QuantumCircuit(2) qc.h(0) qc.cx(0, 1) qc.measure_all() qc = transpile(qc, FakeBoeblingen(), layout_method='trivial') sched = schedule(qc, FakeBoeblingen()) draw(sched, style=IQXSimple(), backend=FakeBoeblingen())
https://github.com/GIRISHBELANI/QC_Benchmarks_using_dm-simulator
GIRISHBELANI
""" Shor's Factoring Algorithm Benchmark - Qiskit """ import sys sys.path[1:1] = ["_common", "_common/qiskit", "shors/_common", "quantum-fourier-transform/qiskit"] sys.path[1:1] = ["../../_common", "../../_common/qiskit", "../../shors/_common", "../../quantum-fourier-transform/qiskit"] from qiskit import QuantumCircuit, QuantumRegister, ClassicalRegister import math from math import gcd from fractions import Fraction import time import random import numpy as np np.random.seed(0) import execute as ex import metrics as metrics from qft_benchmark import inv_qft_gate from qft_benchmark import qft_gate import copy from utils import getAngles, getAngle, modinv, generate_numbers, choose_random_base, determine_factors verbose = True ############### Circuit Definition # Creation of the circuit that performs addition by a in Fourier Space # Can also be used for subtraction by setting the parameter inv to a value different from 0 def phiADD(num_qubits, a): qc = QuantumCircuit(num_qubits, name="\u03C6ADD") angle = getAngles(a, num_qubits) for i in range(0, num_qubits): # addition qc.u1(angle[i], i) global PHIADD_ if PHIADD_ == None or num_qubits <= 3: if num_qubits < 4: PHIADD_ = qc return qc # Single controlled version of the phiADD circuit def cphiADD(num_qubits, a): phiadd_gate = phiADD(num_qubits, a).to_gate() cphiadd_gate = phiadd_gate.control(1) return cphiadd_gate # Doubly controlled version of the phiADD circuit def ccphiADD(num_qubits, a): phiadd_gate = phiADD(num_qubits, a).to_gate() ccphiadd_gate = phiadd_gate.control(2) return ccphiadd_gate # Circuit that implements doubly controlled modular addition by a (num qubits should be bit count for number N) def ccphiADDmodN(num_qubits, a, N): qr_ctl = QuantumRegister(2) qr_main = QuantumRegister(num_qubits + 1) qr_ancilla = QuantumRegister(1) qc = QuantumCircuit(qr_ctl, qr_main, qr_ancilla, name="cc\u03C6ADDmodN") # Generate relevant gates for circuit ccphiadda_gate = ccphiADD(num_qubits + 1, a) ccphiadda_inv_gate = ccphiADD(num_qubits + 1, a).inverse() phiaddN_inv_gate = phiADD(num_qubits + 1, N).inverse() cphiaddN_gate = cphiADD(num_qubits + 1, N) # Create relevant temporary qubit lists ctl_main_qubits = [i for i in qr_ctl]; ctl_main_qubits.extend([i for i in qr_main]) anc_main_qubits = [qr_ancilla[0]]; anc_main_qubits.extend([i for i in qr_main]) # Create circuit qc.append(ccphiadda_gate, ctl_main_qubits) qc.append(phiaddN_inv_gate, qr_main) qc.append(inv_qft_gate(num_qubits + 1), qr_main) qc.cx(qr_main[-1], qr_ancilla[0]) qc.append(qft_gate(num_qubits + 1), qr_main) qc.append(cphiaddN_gate, anc_main_qubits) qc.append(ccphiadda_inv_gate, ctl_main_qubits) qc.append(inv_qft_gate(num_qubits + 1), qr_main) qc.x(qr_main[-1]) qc.cx(qr_main[-1], qr_ancilla[0]) qc.x(qr_main[-1]) qc.append(qft_gate(num_qubits + 1), qr_main) qc.append(ccphiadda_gate, ctl_main_qubits) global CCPHIADDMODN_ if CCPHIADDMODN_ == None or num_qubits <= 2: if num_qubits < 3: CCPHIADDMODN_ = qc return qc # Circuit that implements the inverse of doubly controlled modular addition by a def ccphiADDmodN_inv(num_qubits, a, N): cchpiAddmodN_circ = ccphiADDmodN(num_qubits, a, N) cchpiAddmodN_inv_circ = cchpiAddmodN_circ.inverse() return cchpiAddmodN_inv_circ # Creates circuit that implements single controlled modular multiplication by a. n represents the number of bits # needed to represent the integer number N def cMULTamodN(n, a, N): qr_ctl = QuantumRegister(1) qr_x = QuantumRegister(n) qr_main = QuantumRegister(n + 1) qr_ancilla = QuantumRegister(1) qc = QuantumCircuit(qr_ctl, qr_x, qr_main, qr_ancilla, name="cMULTamodN") # quantum Fourier transform only on auxillary qubits qc.append(qft_gate(n + 1), qr_main) for i in range(n): ccphiADDmodN_gate = ccphiADDmodN(n, (2 ** i) * a % N, N) # Create relevant temporary qubit list qubits = [qr_ctl[0]]; qubits.extend([qr_x[i]]) qubits.extend([i for i in qr_main]); qubits.extend([qr_ancilla[0]]) qc.append(ccphiADDmodN_gate, qubits) # inverse quantum Fourier transform only on auxillary qubits qc.append(inv_qft_gate(n + 1), qr_main) global CMULTAMODN_ if CMULTAMODN_ == None or n <= 2: if n < 3: CMULTAMODN_ = qc return qc # Creates circuit that implements single controlled Ua gate. n represents the number of bits # needed to represent the integer number N def controlled_Ua(n, a, exponent, N): qr_ctl = QuantumRegister(1) qr_x = QuantumRegister(n) qr_main = QuantumRegister(n) qr_ancilla = QuantumRegister(2) qc = QuantumCircuit(qr_ctl, qr_x, qr_main, qr_ancilla, name=f"C-U^{a}^{exponent}") # Generate Gates a_inv = modinv(a ** exponent, N) cMULTamodN_gate = cMULTamodN(n, a ** exponent, N) cMULTamodN_inv_gate = cMULTamodN(n, a_inv, N).inverse() # Create relevant temporary qubit list qubits = [i for i in qr_ctl]; qubits.extend([i for i in qr_x]); qubits.extend([i for i in qr_main]) qubits.extend([i for i in qr_ancilla]) qc.append(cMULTamodN_gate, qubits) for i in range(n): qc.cswap(qr_ctl, qr_x[i], qr_main[i]) qc.append(cMULTamodN_inv_gate, qubits) global CUA_ if CUA_ == None or n <= 2: if n < 3: CUA_ = qc return qc # Execute Shor's Order Finding Algorithm given a 'number' to factor, # the 'base' of exponentiation, and the number of qubits required 'input_size' def ShorsAlgorithm(number, base, method, verbose=verbose): # Create count of qubits to use to represent the number to factor # NOTE: this should match the number of bits required to represent (number) n = int(math.ceil(math.log(number, 2))) # this will hold the 2n measurement results measurements = [0] * (2 * n) # Standard Shors Algorithm if method == 1: num_qubits = 4 * n + 2 if verbose: print( f"... running Shors to factor number [ {number} ] with base={base} using num_qubits={n}") # Create a circuit and allocate necessary qubits qr_up = QuantumRegister(2 * n) # Register for sequential QFT qr_down = QuantumRegister(n) # Register for multiplications qr_aux = QuantumRegister(n + 2) # Register for addition and multiplication cr_data = ClassicalRegister(2 * n) # Register for measured values of QFT qc = QuantumCircuit(qr_up, qr_down, qr_aux, cr_data, name="main") # Initialize down register to 1 and up register to superposition state qc.h(qr_up) qc.x(qr_down[0]) qc.barrier() # Apply Multiplication Gates for exponentiation for i in range(2 * n): cUa_gate = controlled_Ua(n, int(base), 2 ** i, number) # Create relevant temporary qubit list qubits = [qr_up[i]]; qubits.extend([i for i in qr_down]); qubits.extend([i for i in qr_aux]) qc.append(cUa_gate, qubits) qc.barrier() i = 0 while i < ((qr_up.size - 1) / 2): qc.swap(qr_up[i], qr_up[2 * n - 1 - i]) i = i + 1 qc.append(inv_qft_gate(2 * n), qr_up) # Measure up register qc.measure(qr_up, cr_data) elif method == 2: # Create a circuit and allocate necessary qubits num_qubits = 2 * n + 3 if verbose: print(f"... running Shors to factor number [ {number} ] with base={base} using num_qubits={n}") qr_up = QuantumRegister(1) # Single qubit for sequential QFT qr_down = QuantumRegister(n) # Register for multiplications qr_aux = QuantumRegister(n + 2) # Register for addition and multiplication cr_data = ClassicalRegister(2 * n) # Register for measured values of QFT cr_aux = ClassicalRegister(1) # Register to reset the state of the up register based on previous measurements qc = QuantumCircuit(qr_down, qr_up, qr_aux, cr_data, cr_aux, name="main") # Initialize down register to 1 qc.x(qr_down[0]) # perform modular exponentiation 2*n times for k in range(2 * n): # one iteration of 1-qubit QPE # Reset the top qubit to 0 if the previous measurement was 1 qc.x(qr_up).c_if(cr_aux, 1) qc.h(qr_up) cUa_gate = controlled_Ua(n, base ** (2 ** (2 * n - 1 - k)), number) qc.append(cUa_gate, [qr_up[0], qr_down, qr_aux]) # perform inverse QFT --> Rotations conditioned on previous outcomes for i in range(2 ** k): qc.u1(getAngle(i, k), qr_up[0]).c_if(cr_data, i) qc.h(qr_up) qc.measure(qr_up[0], cr_data[k]) qc.measure(qr_up[0], cr_aux[0]) global QC_, QFT_ if QC_ == None or n <= 2: if n < 3: QC_ = qc if QFT_ == None or n <= 2: if n < 3: QFT_ = qft_gate(n + 1) # turn the measured values into a number in [0,1) by summing their binary values ma = [(measurements[2 * n - 1 - i]*1. / (1 << (i + 1))) for i in range(2 * n)] y = sum(ma) y = 0.833 # continued fraction expansion to get denominator (the period?) r = Fraction(y).limit_denominator(number - 1).denominator f = Fraction(y).limit_denominator(number - 1) if verbose: print(f" ... y = {y} fraction = {f.numerator} / {f.denominator} r = {f.denominator}") # return the (potential) period return r # DEVNOTE: need to resolve this; currently not using the standard 'execute module' # measure and flush are taken care of in other methods; do not add here return qc # Execute Shor's Factoring Algorithm given a 'number' to factor, # the 'base' of exponentiation, and the number of qubits required 'input_size' # Filter function, which defines the gate set for the first optimization # (don't decompose QFTs and iQFTs to make cancellation easier) ''' def high_level_gates(eng, cmd): g = cmd.gate if g == QFT or get_inverse(g) == QFT or g == Swap: return True if isinstance(g, BasicMathGate): #return False return True print("***************** should never get here !") if isinstance(g, AddConstant): return True elif isinstance(g, AddConstantModN): return True return False return eng.next_engine.is_available(cmd) ''' # Attempt to execute Shor's Algorithm to find factors, up to a max number of tries # Returns number of failures, 0 if success def attempt_factoring(input_size, number, verbose): max_tries = 5 trials = 0 failures = 0 while trials < max_tries: trials += 1 # choose a base at random base = choose_random_base(number) if base == 0: break # execute the algorithm which determines the period given this base r = ShorsAlgorithm(input_size, number, base, verbose=verbose) # try to determine the factors from the period 'r' f1, f2 = determine_factors(r, base, number) # Success! if these are the factors and both are greater than 1 if (f1 * f2) == number and f1 > 1 and f2 > 1: if verbose: print(f" ==> Factors found :-) : {f1} * {f2} = {number}") break else: failures += 1 if verbose: print(f" ==> Bad luck: Found {f1} and {f2} which are not the factors") print(f" ... trying again ...") return failures ############### Circuit end # Print analyzed results # Analyze and print measured results # Expected result is always the secret_int, so fidelity calc is simple def analyze_and_print_result(qc, result, num_qubits, marked_item, num_shots): if verbose: print(f"For marked item {marked_item} measured: {result}") key = format(marked_item, f"0{num_qubits}b")[::-1] fidelity = result[key] return fidelity # Define custom result handler def execution_handler(result, num_qubits, number, num_shots): # determine fidelity of result set num_qubits = int(num_qubits) fidelity = analyze_and_print_result(result, num_qubits - 1, int(number), num_shots) metrics.store_metric(num_qubits, number, 'fidelity', fidelity) #################### Benchmark Loop # Execute program with default parameters def run(min_qubits=5, max_circuits=3, max_qubits=10, num_shots=100, verbose=verbose, interactive=False, backend_id='qasm_simulator', provider_backend=None, hub="ibm-q", group="open", project="main"): print("Shor's Factoring Algorithm Benchmark - Qiskit") # Generate array of numbers to factor numbers = generate_numbers() min_qubits = max(min_qubits, 5) # need min of 5 max_qubits = max(max_qubits, min_qubits) # max must be >= min max_qubits = min(max_qubits, len(numbers)) # max cannot exceed available numbers # Initialize metrics module metrics.init_metrics() # Initialize execution module using the execution result handler above and specified backend_id ex.init_execution(execution_handler) ex.set_execution_target(backend_id, provider_backend=provider_backend, hub=hub, group=group, project=project) if interactive: do_interactive_test(verbose=verbose) return; # Execute Benchmark Program N times for multiple circuit sizes # Accumulate metrics asynchronously as circuits complete for num_qubits in range(min_qubits, max_qubits + 1): input_size = num_qubits - 1 # determine number of circuits to execute for this group num_circuits = min(2 ** (input_size), max_circuits) print( f"************\nExecuting [{num_circuits}] circuits with num_qubits = {num_qubits}, input_size = {input_size}") ##print(f"... choices at {input_size} = {numbers[input_size]}") # determine array of numbers to factor numbers_to_factor = np.random.choice(numbers[input_size], num_circuits, False) ##print(f"... numbers = {numbers_to_factor}") # Number of times the factoring attempts failed for each qubit size failures = 0 # loop over all of the numbers to factor for number in numbers_to_factor: # convert from np form (created by np.random) number = int(number) # create the circuit for given qubit size and secret string, store time metric ts = time.time() # not currently used # n_iterations = int(np.pi * np.sqrt(2 ** input_size) / 4) # attempt to execute Shor's Algorithm to find factors failures += attempt_factoring(input_size, number, verbose) metrics.store_metric(num_qubits, number, 'create_time', time.time() - ts) metrics.store_metric(num_qubits, number, 'exec_time', time.time() - ts) # submit circuit for execution on target (simulator, cloud simulator, or hardware) # ex.submit_circuit(eng, qureg, num_qubits, number, num_shots) # Report how many factoring failures occurred if failures > 0: print(f"*** Factoring attempts failed {failures} times!") # execute all circuits for this group, aggregate and report metrics when complete # ex.execute_circuits() metrics.aggregate_metrics_for_group(num_qubits) metrics.report_metrics_for_group(num_qubits) # Alternatively, execute all circuits, aggregate and report metrics # ex.execute_circuits() # metrics.aggregate_metrics_for_group(num_qubits) # metrics.report_metrics_for_group(num_qubits) # print the last circuit created # print(qc) # Plot metrics for all circuit sizes metrics.plot_metrics("Benchmark Results - Shor's Factoring Algorithm - Qiskit") # For interactive_shors_factoring testing def do_interactive_test(verbose): done = False while not done: s = input('\nEnter the number to factor: ') if len(s) < 1: break number = int(s) print(f"Factoring number = {number}\n") input_size = int(math.ceil(math.log(number, 2))) # attempt to execute Shor's Algorithm to find factors failures = attempt_factoring(input_size, number, verbose) # Report how many factoring failures occurred if failures > 0: print(f"*** Factoring attempts failed {failures} times!") print("... exiting") # if main, execute method if __name__ == '__main__': run() # max_qubits = 6, max_circuits = 5, num_shots=100)
https://github.com/Pitt-JonesLab/clonk_transpilation
Pitt-JonesLab
from src.clonk.backend_utils.topology_visualization import pretty_print from src.clonk.backend_utils.mock_backends import FakeModular pb = FakeModular(module_size=5, children=4, total_levels=2) pretty_print(pb) from qiskit.quantum_info.random import random_unitary from qiskit import QuantumCircuit from src.clonk.utils.riswap_gates.riswap import RiSwapGate from src.clonk.utils.transpiler_passes.weyl_decompose import RootiSwapWeylDecomposition from qiskit.transpiler.passes import CountOps from qiskit.transpiler import PassManager from tqdm import tqdm N = 2000 basis_gate = RiSwapGate(0.5) pm0 = PassManager() pm0.append(RootiSwapWeylDecomposition(basis_gate=basis_gate)) pm0.append(CountOps()) res = 0 for _ in tqdm(range(N)): qc = QuantumCircuit(2) qc.append(random_unitary(dims=4), [0, 1]) pm0.run(qc) res += pm0.property_set["count_ops"]["riswap"] print("Haar score:", res / N) from src.clonk.benchmark_suite.backend_suite_v3 import simple_backends_v3 print([backend.label for backend in simple_backends_v3]) from src.clonk.benchmark_suite.circuit_suite import circuits q_size = 4 circuits["QAOA_Vanilla"].circuit_lambda(q_size).decompose().draw() """Example:""" from src.clonk.benchmark_suite.main_plotting import benchmark, plot_wrap for circuit_gen in circuits.values(): benchmark( backends=simple_backends_v3, circuit_generator=circuit_gen, q_range=[4, 6, 8, 12, 14, 16], continuously_save=1, overwrite=0, # NOTE: turn this to 1 if you want to scrap the saved data and recollect a new batch repeat=1, ) # NOTE when plotting use motivation = 1 to plot SWAP counts, and motivation = 0 to plot gate durations plot_wrap(simple_backends_v3, circuits.keys(), motivation=True, plot_average=True) """Fig 4""" from src.clonk.benchmark_suite.backend_suite_v2 import motivation_backends for circuit_gen in circuits.values(): benchmark( backends=motivation_backends, circuit_generator=circuit_gen, q_range=motivation_backends[0].q_range, continuously_save=True, overwrite=False, repeat=1, ) plot_wrap(motivation_backends, circuits.keys(), motivation=True, plot_average=True) """Fig 10""" from src.clonk.benchmark_suite.backend_suite_v2 import small_results_backends for circuit_gen in circuits.values(): benchmark( backends=small_results_backends, circuit_generator=circuit_gen, q_range=small_results_backends[0].q_range, continuously_save=True, overwrite=False, repeat=1, ) plot_wrap(small_results_backends, circuits.keys(), motivation=True, plot_average=True) # """Fig 12""" from src.clonk.benchmark_suite.backend_suite_v2 import results_backends for circuit_gen in circuits.values(): benchmark( backends=results_backends, circuit_generator=circuit_gen, q_range=results_backends[0].q_range, continuously_save=True, overwrite=False, repeat=1, ) plot_wrap(results_backends, circuits.keys(), motivation=True, plot_average=True) """Fig 13""" from src.clonk.benchmark_suite.backend_suite_v2 import small_results_part2_backends for circuit_gen in circuits.values(): benchmark( backends=small_results_part2_backends, circuit_generator=circuit_gen, q_range=small_results_part2_backends[0].q_range, continuously_save=True, overwrite=False, repeat=1, ) plot_wrap( small_results_part2_backends, circuits.keys(), motivation=False, plot_average=True ) """Fig 14""" plot_wrap(results_backends, circuits.keys(), motivation=False, plot_average=True) from src.clonk.benchmark_suite.backend_suite_v2 import small_results_part2_backendsv2 from qiskit.converters import circuit_to_dag import numpy as np ignore = ["u"] for circuit_gen in circuits.values(): # [circuits['Quantum_Volume']]: print(circuit_gen.label) qc = circuit_gen.circuit_lambda(16) for backend in small_results_part2_backendsv2: print(backend.label) c = backend.pass_manager.run(qc) # transpile :) d = circuit_to_dag(c) w = d.qubits # if use wires error bc returns classical bits qubit_wire_counts = np.zeros(20) for i, wi in enumerate(w): for node in d.nodes_on_wire(wi, only_ops=True): if node.name in ignore: continue # count the 2Q ops if node.name in ["cx", "fSim", "riswap"]: qubit_wire_counts[i] += 1 # print(qubit_wire_counts) print(sum(qubit_wire_counts)) from src.clonk.benchmark_suite.nuop_script import create_plot2, collect_random2q_data N = 20 base_fidelity_list = [0.97, 0.98, 1 - 10e-3, 1 - 5e-3, 1 - 10e-4, 1] filename = f"src/clonk/benchmark_suite/data-archive2/data1_random.h5" # NOTE preloaded, change name of file to recollect gate_error, decomp_error, fidelity_error = collect_random2q_data( 1 - 10e-3, N=N, mode="random", fn=filename ) create_plot2(gate_error, decomp_error, fidelity_error, plot_bool=0, fn=filename); create_plot2(gate_error, decomp_error, fidelity_error, plot_bool=1, fn=filename);
https://github.com/carstenblank/dc-qiskit-algorithms
carstenblank
# Copyright 2018 Carsten Blank # # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. import unittest import logging import qiskit from ddt import ddt, data as test_data, unpack from qiskit import QuantumCircuit, QuantumRegister, ClassicalRegister from qiskit_aer.backends.aerbackend import AerBackend import dc_qiskit_algorithms.DraperAdder logging.basicConfig(format=logging.BASIC_FORMAT, level='INFO') log = logging.getLogger('test_DraperAdder') @ddt class DraperAdderTwoBitTest(unittest.TestCase): @test_data( (0, 0, None), (0, 1, None), (0, 2, None), (0, 3, None), (1, 0, None), (1, 1, None), (1, 2, None), (1, 3, None), (2, 0, None), (2, 1, None), (2, 2, None), (2, 3, None), (3, 0, None), (3, 1, None), (3, 2, None), (3, 3, None), (0, 0, 2), (0, 1, 2), (0, 2, 2), (0, 3, 2), (1, 0, 2), (1, 1, 2), (1, 2, 2), (1, 3, 2), (2, 0, 2), (2, 1, 2), (2, 2, 2), (2, 3, 2), (3, 0, 2), (3, 1, 2), (3, 2, 2), (3, 3, 2), (7, 0, None), (7, 1, None), (7, 2, None), (7, 3, None), (7, 4, None), (7, 5, None), (7, 6, None), (7, 7, None) ) # @test_data((7, 1, None), (7, 2, None), (7, 3, None)) @unpack def test_two_bit_adder(self, a, b, length): log.info("Testing 'DraperAdder' with a=%d(%s), b=%d(%s).", a, "{0:b}".format(a), b, "{0:b}".format(b)) length = dc_qiskit_algorithms.DraperAdderGate.compute_length(a, b, length) qubit_a = QuantumRegister(length, "a") qubit_b = QuantumRegister(length, "b") readout_a = ClassicalRegister(length, "c_a") readout_b = ClassicalRegister(length, "c_b") qc = QuantumCircuit(qubit_a, qubit_b, readout_a, readout_b, name="draper adder") qc.add_draper(a, b, list(qubit_a) + list(qubit_b), length) qc.measure(qubit_a, readout_a) qc.measure(qubit_b, readout_b) backend = qiskit.Aer.get_backend('qasm_simulator') # type: AerBackend job = qiskit.execute(qc, backend, shots=8192) counts = job.result().get_counts() result_list = [{'b': k[::-1].split(' ')[1], 'a': k[::-1].split(' ')[0], 'counts': v} for k, v in counts.items()] log.info(result_list) self.assertEqual(len(result_list), 1) data = result_list[0] # type: dict self.assertEqual(int(data['b'], 2), b, "Register b must be unchanged!") self.assertEqual(int(data['a'], 2), (a + b) % 2**length, "Addition must be correctly performed!") if __name__ == '__main__': unittest.main(verbosity=2)
https://github.com/Alice-Bob-SW/emulation-examples
Alice-Bob-SW
import math import random import numpy as np import qrisp import qiskit from qrisp.interface import VirtualQiskitBackend from qiskit_alice_bob_provider.local.provider import AliceBobLocalProvider provider = AliceBobLocalProvider() backend = provider.get_backend("EMU:40Q:LOGICAL_TARGET") vrtl_qasm_sim = VirtualQiskitBackend(backend) def is_prime(n): if n <= 1: return False elif n <= 3: return True elif n % 2 == 0 or n % 3 == 0: return False i = 5 while i * i <= n: if n % i == 0 or n % (i + 2) == 0: return False i += 6 return True def find_period_classical(g, N): # returns the period of g in Z_N e = 1 while pow(g, e, N) != 1: e = e + 1 return e def classical_Shor(N): # returns the factors of N by using Shor's algorithm # with a classical brute-force period finding routine if N % 2 == 0: return (2, N // 2) if is_prime(N): return (1, N) while True: a = random.randint(2, N - 1) if math.gcd(a, N) != 1: return sorted([math.gcd(a, N), N // math.gcd(a, N)]) r = find_period_classical(a, N) if r % 2 == 0: x = pow(a, r // 2, N) p = math.gcd(x - 1, N) q = math.gcd(x + 1, N) if p != 1 and p != N: return sorted([p, N // p]) if q != 1 and q != N: return sorted([q, N // q]) classical_Shor(15) from sympy import continued_fraction_convergents, continued_fraction_iterator, Rational def get_r_candidates(approx): rationals = continued_fraction_convergents( continued_fraction_iterator(Rational(approx)) ) return [rat.q for rat in rationals] def get_phase_candidates(a, N): qg = qrisp.QuantumModulus(N) qg[:] = 1 qpe_res = qrisp.QuantumFloat(2 * qg.size + 1, exponent=-(2 * qg.size + 1)) qrisp.h(qpe_res) x = a for i in range(len(qpe_res)): with qrisp.control(qpe_res[i]): qg *= x x = (x * x) % N qrisp.QFT(qpe_res, inv=True) qiskit_qc = qpe_res.qs.compile().to_qiskit() # Compile the circuit to qiskit for technical limitations # of the qrisp framework. cr = qiskit.ClassicalRegister(len(qpe_res)) qiskit_qc.add_register(cr) qiskit_qc.measure(range(len(qg), len(qpe_res) + len(qg)), range(len(cr))) results = qiskit.execute(qiskit_qc, backend=backend, shots=5).result().get_counts() return results def binary_to_float(binaries): # Convert binary string to floating-point decimal results = [] for binary in binaries: decimal = 0 for i, bit in enumerate(binary): if bit == "1": decimal += 2 ** -(i + 1) results.append(decimal) return results def quantum_shor(a, N): meas_res = get_phase_candidates(a, N) r_candidates = sum( [get_r_candidates(approx) for approx in binary_to_float(meas_res.keys())], [] ) for cand in sorted(set(r_candidates)): if (a**cand) % N == 1: r = cand break else: raise Exception( "Could not find the right candidate for the period. Please try resampling." ) if r % 2: raise Exception( "Found an odd period for the given base. Please retry with another value of a." ) p = np.gcd(a ** (r // 2) + 1, N) q = int(N / p) if p > q: return (q, p) return (p, q) a = 2 N = 15 # WARNING: The code below takes approximatively 10 minutes to run quantum_shor(a, N) from qiskit_alice_bob_provider.processor.logical_cat import ( _logical_bit_flip_error, _logical_phase_flip_error, ) def logical_error_rate(distance, average_nb_photons, kappa_1, kappa_2): # Returns the logical error rate for the given parameters. return _logical_bit_flip_error( d=distance, nbar=average_nb_photons ) + _logical_phase_flip_error( d=distance, nbar=average_nb_photons, k1=kappa_1, k2=kappa_2 ) def error_rate_upper_bound(V, success_rate): if success_rate <= 0 or success_rate > 1: raise Exception("The success rate should be between 0 and 1") return 1 - np.exp(np.log(success_rate) / V) a = 2 N = 15 qg = qrisp.QuantumModulus(N) qg[:] = 1 qpe_res = qrisp.QuantumFloat(2 * qg.size + 1, exponent=-(2 * qg.size + 1)) qrisp.h(qpe_res) x = a for i in range(len(qpe_res)): with qrisp.control(qpe_res[i]): qg *= x x = (x * x) % N qrisp.QFT(qpe_res, inv=True) # Parameters of the `EMU:40Q:LOGICAL_TARGET` backend distance = 15 n_qubits = 40 kappa_1 = 100 kappa_2 = 1e7 average_nb_photons = 19 qc_qiskit_TARGET = qpe_res.qs.compile().to_qiskit() print("Circuit width before transpilation:", qc_qiskit_TARGET.width()) print("Circuit depth before transpilation:", qc_qiskit_TARGET.depth()) qc_qiskit_transpiled_TARGET = qiskit.transpile(qc_qiskit_TARGET, backend=backend) print("Circuit width after transpilation:", qc_qiskit_transpiled_TARGET.width()) print("Circuit depth after transpilation:", qc_qiskit_transpiled_TARGET.depth()) q_volume_TARGET = qc_qiskit_transpiled_TARGET.depth() * (qc_qiskit_transpiled_TARGET.width()) #width * depth of the circuit print('Quantum volume of the transpiled circuit:', q_volume_TARGET) erub_TARGET = error_rate_upper_bound(q_volume_TARGET, 0.5) print('Error rate upper bound:', f"{erub_TARGET:.3e}") ler_TARGET = logical_error_rate(distance,average_nb_photons,kappa_1,kappa_2) print('Backend logical error rate:', f"{ler_TARGET:.3e}") backend = provider.get_backend("EMU:15Q:LOGICAL_EARLY") # Parameters of the `EMU:15Q:LOGICAL_EARLY` backend distance = 13 n_qubits = 15 kappa_1 = 100 kappa_2 = 100000 average_nb_photons = 7 qc_qiskit_EARLY = qpe_res.qs.compile().to_qiskit() print("Circuit width before transpilation:", qc_qiskit_EARLY.width()) print("Circuit depth before transpilation:", qc_qiskit_EARLY.depth()) qc_qiskit_transpiled_EARLY = qiskit.transpile(qc_qiskit_EARLY, backend=backend) print("Circuit width after transpilation:", qc_qiskit_transpiled_EARLY.width()) print("Circuit depth after transpilation:", qc_qiskit_transpiled_EARLY.depth()) q_volume_EARLY = qc_qiskit_transpiled_EARLY.depth() * (qc_qiskit_transpiled_EARLY.width()) #width * depth of the circuit print('Quantum volume of the transpiled circuit:', q_volume_EARLY) erub_EARLY = error_rate_upper_bound(q_volume_EARLY, 0.5) print('Error rate upper bound:', f"{erub_EARLY:.3e}") ler_EARLY = logical_error_rate(distance,average_nb_photons,kappa_1,kappa_2) print('Backend logical error rate:', f"{ler_EARLY:.3e}") # WARNING: The code below takes approximatively 30 minutes to run" for _ in range(10): print(quantum_shor(a,N)) import pandas as pd data = [ [ qc_qiskit_transpiled_EARLY.width(), qc_qiskit_transpiled_EARLY.depth(), q_volume_EARLY, f"{ler_EARLY:.3e}", f"{erub_EARLY:.3e}", ], [ qc_qiskit_transpiled_TARGET.width(), qc_qiskit_transpiled_TARGET.depth(), q_volume_TARGET, f"{ler_TARGET:.3e}", f"{erub_TARGET:.3e}", ], ] pd.DataFrame( data, columns=["Width", "Depth", "Volume", "Logical Error Rate", "Upper bound"], index=["EMU:40Q:LOGICAL_TARGET", "EMU:15Q:LOGICAL_EARLY"], )
https://github.com/qiskit-community/qiskit-translations-staging
qiskit-community
import numpy as np from qiskit import QuantumCircuit from qiskit.providers.fake_provider import FakeVigoV2 backend = FakeVigoV2() qc = QuantumCircuit(2, 1) qc.h(0) qc.x(1) qc.cp(np.pi/4, 0, 1) qc.h(0) qc.measure([0], [0]) qc.draw(output='mpl')
https://github.com/swe-train/qiskit__qiskit
swe-train
# This code is part of Qiskit. # # (C) Copyright IBM 2020. # # This code is licensed under the Apache License, Version 2.0. You may # obtain a copy of this license in the LICENSE.txt file in the root directory # of this source tree or at http://www.apache.org/licenses/LICENSE-2.0. # # Any modifications or derivative works of this code must retain this # copyright notice, and modified files need to carry a notice indicating # that they have been altered from the originals. """Test for the converter dag dependency to circuit and circuit to dag dependency.""" import unittest from qiskit.converters.dagdependency_to_circuit import dagdependency_to_circuit from qiskit.converters.circuit_to_dagdependency import circuit_to_dagdependency from qiskit import QuantumRegister, ClassicalRegister, QuantumCircuit from qiskit.test import QiskitTestCase class TestCircuitToDagCanonical(QiskitTestCase): """Test QuantumCircuit to DAGDependency.""" def test_circuit_and_dag_canonical(self): """Check convert to dag dependency and back""" qr = QuantumRegister(3) cr = ClassicalRegister(3) circuit_in = QuantumCircuit(qr, cr) circuit_in.h(qr[0]) circuit_in.h(qr[1]) circuit_in.measure(qr[0], cr[0]) circuit_in.measure(qr[1], cr[1]) circuit_in.x(qr[0]).c_if(cr, 0x3) circuit_in.measure(qr[0], cr[0]) circuit_in.measure(qr[1], cr[1]) circuit_in.measure(qr[2], cr[2]) dag_dependency = circuit_to_dagdependency(circuit_in) circuit_out = dagdependency_to_circuit(dag_dependency) self.assertEqual(circuit_out, circuit_in) def test_circuit_and_dag_canonical2(self): """Check convert to dag dependency and back also when the option ``create_preds_and_succs`` is False.""" qr = QuantumRegister(3) cr = ClassicalRegister(3) circuit_in = QuantumCircuit(qr, cr) circuit_in.h(qr[0]) circuit_in.h(qr[1]) circuit_in.measure(qr[0], cr[0]) circuit_in.measure(qr[1], cr[1]) circuit_in.x(qr[0]).c_if(cr, 0x3) circuit_in.measure(qr[0], cr[0]) circuit_in.measure(qr[1], cr[1]) circuit_in.measure(qr[2], cr[2]) dag_dependency = circuit_to_dagdependency(circuit_in, create_preds_and_succs=False) circuit_out = dagdependency_to_circuit(dag_dependency) self.assertEqual(circuit_out, circuit_in) def test_calibrations(self): """Test that calibrations are properly copied over.""" circuit_in = QuantumCircuit(1) circuit_in.add_calibration("h", [0], None) self.assertEqual(len(circuit_in.calibrations), 1) dag_dependency = circuit_to_dagdependency(circuit_in) self.assertEqual(len(dag_dependency.calibrations), 1) circuit_out = dagdependency_to_circuit(dag_dependency) self.assertEqual(len(circuit_out.calibrations), 1) def test_metadata(self): """Test circuit metadata is preservered through conversion.""" meta_dict = {"experiment_id": "1234", "execution_number": 4} qr = QuantumRegister(2) circuit_in = QuantumCircuit(qr, metadata=meta_dict) circuit_in.h(qr[0]) circuit_in.cx(qr[0], qr[1]) circuit_in.measure_all() dag_dependency = circuit_to_dagdependency(circuit_in) self.assertEqual(dag_dependency.metadata, meta_dict) circuit_out = dagdependency_to_circuit(dag_dependency) self.assertEqual(circuit_out.metadata, meta_dict) if __name__ == "__main__": unittest.main(verbosity=2)
https://github.com/ColibrITD-SAS/mpqp
ColibrITD-SAS
from mpqp import QCircuit from mpqp.gates import * circuit = QCircuit([H(0), CNOT(0,1), Ry(2.6, 0), Ry(-0.87, 1)]) print(circuit) from mpqp.measures import Observable, ExpectationMeasure import numpy as np from mpqp.tools.maths import is_hermitian matrix = np.array([[4, 2, 3, 8], [2, -3, 1, 0], [3, 1, -1, 5], [8, 0, 5, 2]]) is_hermitian(matrix) obs = Observable(matrix) circuit.add(ExpectationMeasure([0,1], observable=obs, shots=0)) from mpqp.execution import run, ATOSDevice, IBMDevice result = run(circuit, ATOSDevice.MYQLM_PYLINALG) print(result) print(result.expectation_value) circuit = circuit.without_measurements() circuit.add(ExpectationMeasure([0,1], observable=obs, shots=2000)) results = run(circuit, [ATOSDevice.MYQLM_PYLINALG, IBMDevice.AER_SIMULATOR]) print(results) from mpqp.measures import I, X, Y, Z ps_1 = I@Z - 3 * X@Y print(f"{ps_1=}") ps_2 = I@Z + 2.555555555*Y@I + X@Z - X@Z print("ps_2 =",repr(ps_2)) print(" =",repr(ps_2.simplify())) print(" ~=",repr(ps_2.round(1))) print(" ~=",ps_2) ps_2 = ps_2.round(1).simplify() print(f"""Addition: ({ps_1}) + ({ps_2}) = {ps_1 + ps_2} Subtraction: ({ps_1}) - ({ps_2}) = {ps_1 - ps_2} Scalar product: 2 * ({ps_1}) = {2 * ps_1} Scalar division: ({ps_2}) / 3 ~= {ps_2 / 3} Tensor product: ({ps_1}) @ Z = {ps_1@Z} ({ps_1}) @ ({ps_2}) = {ps_1@ps_2}""") obs1 = Observable(ps_1) print("`obs` created with matrix:") print("matrix:") print(obs.matrix) print("Pauli string:") print(obs.pauli_string) print("\n\n`obs1` created with Pauli string:") print("Pauli string:") print(obs1.pauli_string) print("matrix:") print(obs1.matrix) circuit = circuit.without_measurements() circuit.add(ExpectationMeasure([0, 1], observable=obs1, shots=1000)) results = run( circuit, [ ATOSDevice.MYQLM_PYLINALG, IBMDevice.AER_SIMULATOR, ATOSDevice.MYQLM_CLINALG, ], ) print(results)
https://github.com/Manish-Sudhir/QiskitCheck
Manish-Sudhir
import warnings from qiskit import QuantumRegister, ClassicalRegister from qiskit import QuantumCircuit, execute, Aer, transpile, IBMQ, assemble from qiskit.tools.monitor import job_monitor from qiskit.circuit.library import QFT from qiskit.visualization import plot_bloch_multivector, plot_histogram, array_to_latex warnings.filterwarnings("ignore", category=DeprecationWarning) import numpy as np import pandas as pd import math from math import sqrt from qiskit.quantum_info import Statevector, random_statevector from qiskit.circuit.random import random_circuit from scipy.stats import chi2_contingency, ttest_ind, chisquare import unittest import hypothesis.strategies as st from hypothesis import given, settings pi = np.pi def measure_z(circuit, qubit_indexes): cBitIndex = 0 for index in qubit_indexes: circuit.measure(index, cBitIndex) cBitIndex+=1 return circuit def measure_x(circuit, qubitIndexes): cBitIndex = 0 for index in qubitIndexes: circuit.h(index) circuit.measure(index, cBitIndex) cBitIndex+=1 return circuit def measure_y(circuit, qubit_indexes): cBitIndex = 0 for index in qubit_indexes: circuit.sdg(index) circuit.h(index) circuit.measure(index, cBitIndex) cBitIndex+=1 return circuit def flip_endian(dict): newdict = {} for key in list(dict): newdict[key[::-1]] = dict.pop(key) return newdict def set_measure_x(circuit, n): for num in range(n): circuit.h(num) def set_measure_y(circuit, n): for num in range(n): circuit.sdg(num) circuit.h(num) def qft_rotations(circuit, n): #if qubit amount is 0, then do nothing and return if n == 0: #set it to measure the x axis set_measure_x(qc, 2) qc.measure_all() return circuit n -= 1 circuit.h(n) for qubit in range(n): circuit.cp(pi/2**(n-qubit), qubit, n) return qft_rotations(circuit, n) backend = Aer.get_backend('aer_simulator') qc = QuantumCircuit(2) qc.x(0) circ = qft_rotations(qc,2)#call the recursive qft method print(circ) #set it to measure the x axis set_measure_x(qc, 2) job = execute(qc, backend, shots=100000)#run the circuit 1000000 times print(flip_endian(job.result().get_counts()))#return the result counts def assertEntangled(backend,qc,qubits_to_assert,measurements_to_make,alpha = 0.05): # makes sure qubits_to_assert is a list if (not isinstance(qubits_to_assert, list)): qubits_to_assert = [qubits_to_assert] ## classical register must be of same length as amount of qubits to assert ## if there is no classical register add them according to length of qubit list if (qc.num_clbits == 0): qc.add_register(ClassicalRegister(len(qubits_to_assert))) elif (len(qubits_to_assert) != 2): raise ValueError("QuantumCircuit classical register must be of length 2") zQuantumCircuit = measure_z(qc, qubits_to_assert) zJob = execute(zQuantumCircuit, backend, shots=measurements_to_make, memory=True) zMemory = zJob.result().get_memory() q1=[] q2=[] qubitDict = dict.fromkeys(['qubit1','qubit2']) qubitDict = {'qubit1': qubits_to_assert[0],'qubit2':qubits_to_assert[1]} print("new dict", qubitDict) classicalQubitIndex = 1 for qubit in qubitDict.keys(): print("this qubit:",qubit) for measurement in zMemory: # print("this measurement", measurement) if (measurement[2-classicalQubitIndex] == '0'): # print("measure: ",measurement[2-classicalQubitIndex],"also: qubittoassert0",qubits_to_assert[0],"and qubittoassert1: ",qubits_to_assert[1]) if(qubit=='qubit1'): q1.append(measurement[2-classicalQubitIndex]) # print("Added to q1 for measure0:", measurement[2-classicalQubitIndex]) else: q2.append(measurement[2-classicalQubitIndex]) # print("Added to q2 for measure0:", measurement[2-classicalQubitIndex]) else: # print("measureOTHER: ",measurement[2-classicalQubitIndex], "also: qubittoassert0",qubits_to_assert[0],"and qubittoassert1: ",qubits_to_assert[1]) if(qubit=='qubit1'): q1.append(measurement[2-classicalQubitIndex]) # print("Added to q1 for measure1:", measurement[2-classicalQubitIndex]) else: q2.append(measurement[2-classicalQubitIndex]) # print("Added to q2 for measure1:", measurement[2-classicalQubitIndex]) classicalQubitIndex+=1 measDict = dict.fromkeys(['qubit1','qubit2']) measDict = {'qubit1': q1,'qubit2':q2} measDf1 = pd.DataFrame.from_dict(measDict,orient='index') measDf12=measDf1.transpose() print(measDf12) ct = pd.crosstab(measDf12.qubit1,measDf12.qubit2) chiVal, pVal, dOfFreedom, exp = chi2_contingency(ct) print("chi square value: ",chiVal,"p value: ",pVal,"expected values: ",exp) if(pVal>alpha): raise(AssertionError("states are not entangled")) else: print("states are entangled") backend = Aer.get_backend('aer_simulator') qr = QuantumRegister(2) cr=ClassicalRegister(2) qc3 = QuantumCircuit(qr,cr) # qc3.x(1) qc3.x(0) qc3.h(0) qc3.cnot(0,1) # qc3.rx(np.pi/2,qr[0]) qc3.p(10*2*math.pi/100, 0) # qc3.p(0.5*2*math.pi/100, 1) # print(qc3) assertEntangled(backend,qc3,[0,1],2000,0.05) # circuit = QuantumCircuit(2) # circuit.initialize([0, 1/np.sqrt(2), -1.j/np.sqrt(2), 0], circuit.qubits) # assertEntangled(backend,circuit,[0,1],10,0.05) def getDf(qc,qubits_to_assert,measurements_to_make,backend): ## classical register must be of same length as amount of qubits to assert ## if there is no classical register add them according to length of qubit list if (qc.num_clbits == 0): qc.add_register(ClassicalRegister(len(qubits_to_assert))) elif (len(qubits_to_assert) != 2): raise ValueError("QuantumCircuit classical register must be of length 2") ## divide measurements to make by 3 as we need to run measurements twice, one for x and one for y measurements_to_make = measurements_to_make // 3 yQuantumCircuit = measure_y(qc.copy(), qubits_to_assert) xQuantumCircuit = measure_x(qc.copy(), qubits_to_assert) zQuantumCircuit = measure_z(qc, qubits_to_assert) yJob = execute(yQuantumCircuit, backend, shots=measurements_to_make, memory=True) yMemory = yJob.result().get_memory() yCounts = yJob.result().get_counts() ## get x axis results xJob = execute(xQuantumCircuit, backend, shots=measurements_to_make, memory=True) xMemory = xJob.result().get_memory() xCounts = xJob.result().get_counts() ## get z axis results zJob = execute(zQuantumCircuit, backend, shots=measurements_to_make, memory=True) zMemory = zJob.result().get_memory() zCounts = zJob.result().get_counts() resDf = pd.DataFrame(columns=['0','1','+','i','-','-i']) classical_qubit_index = 1 for qubit in qubits_to_assert: zero_amount, one_amount, plus_amount, i_amount, minus_amount, minus_i_amount = 0,0,0,0,0,0 for experiment in xCounts: if (experiment[2-classical_qubit_index] == '0'): plus_amount += xCounts[experiment] else: minus_amount += xCounts[experiment] for experiment in yCounts: if (experiment[2-classical_qubit_index] == '0'): i_amount += yCounts[experiment] else: minus_i_amount += yCounts[experiment] for experiment in zCounts: if (experiment[2-classical_qubit_index] == '0'): zero_amount += zCounts[experiment] else: one_amount += zCounts[experiment] df = {'0':zero_amount, '1':one_amount, '+':plus_amount, 'i':i_amount, '-':minus_amount,'-i':minus_i_amount} resDf = resDf.append(df, ignore_index = True) classical_qubit_index+=1 resDf['+'] = resDf['+'].astype(int) resDf['i'] = resDf['i'].astype(int) resDf['-'] = resDf['-'].astype(int) resDf['-i'] = resDf['-i'].astype(int) resDf['0'] = resDf['0'].astype(int) resDf['1'] = resDf['1'].astype(int) return resDf # Completed but more testing required ## assert that qubits are equal def assertEqual(backend, quantumCircuit, qubits_to_assert, measurements_to_make, alpha): ## needs to make at least 2 measurements, one for x axis, one for y axis ## realistically we need more for any statistical significance if (measurements_to_make < 2): raise ValueError("Must make at least 2 measurements") # makes sure qubits_to_assert is a list if (not isinstance(qubits_to_assert, list)): qubits_to_assert = [qubits_to_assert] # Get Df is a function I made to return a dataframe containing measurements for each each qubit across all axes and I use 5 such different measurements for my dataset resDf1 = getDf(quantumCircuit,qubits_to_assert,measurements_to_make,backend) resDf2 = getDf(quantumCircuit,qubits_to_assert,measurements_to_make,backend) resDf3 = getDf(quantumCircuit,qubits_to_assert,measurements_to_make,backend) resDf4 = getDf(quantumCircuit,qubits_to_assert,measurements_to_make,backend) resDf5 = getDf(quantumCircuit,qubits_to_assert,measurements_to_make,backend) q1Vals = [] q2Vals = [] q1Vals.extend([resDf1.at[0,'1'],resDf1.at[0,'-'],resDf1.at[0,'-i'], resDf2.at[0,'1'],resDf2.at[0,'-'],resDf2.at[0,'-i'], resDf3.at[0,'1'],resDf3.at[0,'-'],resDf3.at[0,'-i'], resDf4.at[0,'1'],resDf4.at[0,'-'],resDf4.at[0,'-i'], resDf5.at[0,'1'],resDf5.at[0,'-'],resDf5.at[0,'-i']]) print(q1Vals) q2Vals.extend([resDf1.at[1,'1'],resDf1.at[1,'-'],resDf1.at[1,'-i'], resDf2.at[1,'1'],resDf2.at[1,'-'],resDf2.at[1,'-i'],resDf3.at[1,'1'],resDf3.at[1,'-'],resDf3.at[1,'-i'],resDf4.at[1,'1'],resDf4.at[1,'-'],resDf4.at[1,'-i'],resDf5.at[1,'1'],resDf5.at[1,'-'],resDf5.at[1,'-i'] ]) print(q2Vals) tTest, pValue = ttest_ind(q1Vals, q2Vals, alternative = 'two-sided') # Apply t test print("stat: ",tTest, "pValue: ", pValue) if pValue > alpha: print("The two qubits are equal (fail to reject null hypothesis) ") else: print("There is a significant difference between the two qubits (reject null hypothesis)") qc = QuantumCircuit(2) backend = Aer.get_backend('aer_simulator') # qc.initialize([0, 1/np.sqrt(2), -1.j/np.sqrt(2), 0], qc.qubits) qc.h(0) # qc.cnot(0,1) qc.x(1) qc.p(0.5*2*math.pi/100, 1) # qc.h(1) # qc.p(10*2*math.pi/100, 0) # qc.p(20*2*math.pi/100, 1) # assertEqual(backend, qc, [0,1], 300000, 0.05) # assertEqual(backend, qc, [0,0], 300000, 0.05) # Complete needs to be checked # Assertion to check if expected probability of viewing a particular qubitstate is to its actual probaility # Qubitchoice is an optional argument that if passed will only compare the expected probabilty with the probability of observing # that particular qubit (first or second) in the desired qubitState for the qc def assertProbability(qc, qubitState :str, expectedProbability, qubitChoice=None): sv = Statevector.from_label("00") # Creates a statevector with states 00 evl = sv.evolve(qc) # Passes the qc into the statevector in order to evolve # Performs a check to observe if qubitChoice has been passed or not if(qubitChoice!=None): probs = evl.probabilities_dict([qubitChoice]) # If passed we will get the probabilities for that particular qubit else: probs = evl.probabilities_dict() probsRound = {key: round(values,2) for key,values in probs.items()} # rounds off the probabilities in the dictionary # Loops over the prob dictionary with rounded values for key,value in probsRound.items(): if(key==qubitState): if(value==expectedProbability): print("Expected Probability present") return True else: raise(AssertionError("Probability not present")) raise(AssertionError("Probability not present or Desired state has no probability")) qc = QuantumCircuit(2) qc.h(0) assertProbability(qc,"0",1,1) print("------") assertProbability(qc,"00",0.5) circuit = QuantumCircuit(2) circuit.initialize([1, 0], 0) circuit.initialize(random_statevector(2).data, 1) print("another",circuit.global_phase) # print(circuit) qasm_circuit = circuit.decompose().decompose().decompose() print(type(qasm_circuit)) print("here",qasm_circuit._global_phase) qc = QuantumCircuit(2) initial_state = qc.initialize(random_statevector(2).data, 0) initial_state1 = qc.initialize(random_statevector(2).data, 1) # print(qc) qasm_circuit1 = qc.decompose().decompose().decompose() print(qasm_circuit1) import random def generateQC(theta_range,phi_range,lam_range): # make sure theta phi and lamba are all in lists # make sure they have size of 2 lists = [theta_range,phi_range,lam_range] for i in lists: if (not isinstance(i, list)): i = [i] if len(i)!=2: raise ValueError("Range has to be two") qc = QuantumCircuit(2) for i in range(2): theta=random.randint(theta_range[0],theta_range[1]) phi=random.randint(phi_range[0],phi_range[1]) lam=random.randint(lam_range[0],lam_range[1]) qc.u(theta,phi,lam,i) return qc # In Qsharp qubit initialisation was perfromed as such: # { q : Qubit (36 ,72) (0 ,360) }; first = generateQC([36,72],[0,360],[0,360]) # QUBITS TO ASSERT PROBLEM HOW WILL I KNOW IF QUBIT IS 0 OR 1 print(first) class property: def __init__(self,backend,theta_range,phi_range,lam_range,which_assertion,measurements_to_make,alpha,experiments,noOfTests): self.backend = backend self.theta_range = theta_range self.phi_range = phi_range self.lam_range = lam_range # self.predicate = predicate self.which_assertion = which_assertion self.measurements_to_make = measurements_to_make self.alpha = alpha self.experiments = experiments self.noOfTests = noOfTests def generateQC(self): # make sure theta phi and lamba are all in lists # make sure they have size of 2 lists = [self.theta_range,self.phi_range,self.lam_range] for i in lists: if (not isinstance(i, list)): i = [i] if len(i)!=2: raise ValueError("Range has to be two") qc = QuantumCircuit(2) for i in range(2): theta=random.randint(self.theta_range[0],self.theta_range[1]) phi=random.randint(self.phi_range[0],self.phi_range[1]) lam=random.randint(self.lam_range[0],self.lam_range[1]) qc.u(theta,phi,lam,i) return qc def run(self, qcToTest): # assertEntangled(backend,qc3,[1,0],2000,0.05) # assertEqual(backend, qc, [0,1], 300000, 3, 0.05) # qcToTest = generateQC(theta_range) # if(which_assertion=assertEntangled) return self.which_assertion(backend,qcToTest,[0,1], self.measurements_to_make,self.experiments,self.alpha) # number_of_test_cases = 7 # number_of_measurements = 2000 # number_of_experiments = 20 # for tc in range(testcases):, testcases # qc = new qc() # for e in range(experiment):, experiments # AssertEntangles(qc), measurements done here def check(self): for j in range(self.noOfTests): qcToTest = generateQC(self.theta_range,self.phi_range,self.lam_range) initial_state = qcToTest.copy() # final_state = # print(qcToTest) # for i in range(self.experiments): try: self.run(qcToTest) except AssertionError: raise AssertionError("Property failed after run", self.noOfTests * j) pbt = property(backend,[36,72],[0,360],[0,360],assertEntangled,2000,0.05,10,3) pbt.check() pbt2 = property(backend,[36,72],[0,360],[0,360],assertEqual,2000,0.05,10,3) pbt2.check() #pass created qubits into whichever function #then pass that into assertions class property: def __init__(self,backend,theta_range,phi_range,lam_range,which_assertion,measurements_to_make,alpha,experiments,noOfTests): self.backend = backend self.theta_range = theta_range self.phi_range = phi_range self.lam_range = lam_range # self.predicate = predicate self.which_assertion = which_assertion self.measurements_to_make = measurements_to_make self.alpha = alpha self.experiments = experiments self.noOfTests = noOfTests def generateQC(self): # make sure theta phi and lamba are all in lists # make sure they have size of 2 lists = [self.theta_range,self.phi_range,self.lam_range] for i in lists: if (not isinstance(i, list)): i = [i] if len(i)!=2: raise ValueError("Range has to be two") qc = QuantumCircuit(2) for i in range(2): theta=random.randint(self.theta_range[0],self.theta_range[1]) phi=random.randint(self.phi_range[0],self.phi_range[1]) lam=random.randint(self.lam_range[0],self.lam_range[1]) qc.u(theta,phi,lam,i) return qc def run(self, qcToTest): # assertEntangled(backend,qc3,[1,0],2000,0.05) # assertEqual(backend, qc, [0,1], 300000, 3, 0.05) # qcToTest = generateQC(theta_range) # if(which_assertion=assertEntangled) return self.which_assertion(backend,qcToTest,[0,0], self.measurements_to_make,self.experiments,self.alpha) # number_of_test_cases = 7 # number_of_measurements = 2000 # number_of_experiments = 20 # for tc in range(testcases):, testcases # qc = new qc() # for e in range(experiment):, experiments # AssertEntangles(qc), measurements done here def check(self): for j in range(self.noOfTests): qcToTest = generateQC(self.theta_range,self.phi_range,self.lam_range) # print(qcToTest) # for i in range(self.experiments): try: self.run(qcToTest) except AssertionError: raise AssertionError("Property failed after run", self.noOfTests * j) pbt = property(backend,[36,72],[0,360],[0,360],assertEntangled,2000,0.05,10,3) pbt.check() pbt2 = property(backend,[36,72],[0,360],[0,360],assertEqual,2000,0.05,10,3) pbt2.check() #pass created qubits into whichever function #then pass that into assertions def assertEntangled(backend,qc,qubits_to_assert,measurements_to_make,experiments,alpha = 0.05): # makes sure qubits_to_assert is a list if (not isinstance(qubits_to_assert, list)): qubits_to_assert = [qubits_to_assert] ## classical register must be of same length as amount of qubits to assert ## if there is no classical register add them according to length of qubit list if (qc.num_clbits == 0): qc.add_register(ClassicalRegister(len(qubits_to_assert))) elif (len(qubits_to_assert) != 2): raise ValueError("QuantumCircuit classical register must be of length 2") q1=[] q2=[] for i in range (experiments): zQuantumCircuit = measure_z(qc, qubits_to_assert) zJob = execute(zQuantumCircuit, backend, shots=measurements_to_make, memory=True) zMemory = zJob.result().get_memory() qubitDict = dict.fromkeys(['qubit1','qubit2']) qubitDict = {'qubit1': qubits_to_assert[0],'qubit2':qubits_to_assert[1]} # print("new dict", qubitDict) classicalQubitIndex = 1 for qubit in qubitDict.keys(): # print("this qubit:",qubit) for measurement in zMemory: # print("this measurement", measurement) if (measurement[2-classicalQubitIndex] == '0'): # print("measure: ",measurement[2-classicalQubitIndex],"also: qubittoassert0",qubits_to_assert[0],"and qubittoassert1: ",qubits_to_assert[1]) if(qubit=='qubit1'): q1.append(measurement[2-classicalQubitIndex]) # print("Added to q1 for measure0:", measurement[2-classicalQubitIndex]) else: q2.append(measurement[2-classicalQubitIndex]) # print("Added to q2 for measure0:", measurement[2-classicalQubitIndex]) else: # print("measureOTHER: ",measurement[2-classicalQubitIndex], "also: qubittoassert0",qubits_to_assert[0],"and qubittoassert1: ",qubits_to_assert[1]) if(qubit=='qubit1'): q1.append(measurement[2-classicalQubitIndex]) # print("Added to q1 for measure1:", measurement[2-classicalQubitIndex]) else: q2.append(measurement[2-classicalQubitIndex]) # print("Added to q2 for measure1:", measurement[2-classicalQubitIndex]) classicalQubitIndex+=1 measDict = dict.fromkeys(['qubit1','qubit2']) measDict = {'qubit1': q1,'qubit2':q2} measDf1 = pd.DataFrame.from_dict(measDict,orient='index') measDf12=measDf1.transpose() print(measDf12) # print(measDf12) ct = pd.crosstab(measDf12.qubit1,measDf12.qubit2) chiVal, pVal, dOfFreedom, exp = chi2_contingency(ct) print("chi square value: ",chiVal,"p value: ",pVal,"expected values: ",exp) if(pVal>alpha): raise(AssertionError("states are not entangled")) else: print("states are entangled") backend = Aer.get_backend('aer_simulator') qr = QuantumRegister(2) cr=ClassicalRegister(2) qc3 = QuantumCircuit(qr,cr) # qc3.x(1) qc3.x(0) qc3.h(0) qc3.cnot(0,1) # qc3.rx(np.pi/2,qr[0]) qc3.p(10*2*math.pi/100, 0) # qc3.p(0.5*2*math.pi/100, 1) # print(qc3) qc4 = QuantumCircuit(2) qc4.u(64,343,57,0) qc4.u(65,43,226,1) qc1 = QuantumCircuit(2) qc1.x(0) qc1.x(1) circ = qft_rotations(qc1,2) print(circ) assertEntangled(backend,circ,[1,1],2000,1,0.05) # Completed but more testing required ## assert that qubits are equal def assertEqual(backend, quantumCircuit, qubits_to_assert, measurements_to_make, experiments, alpha): ## needs to make at least 2 measurements, one for x axis, one for y axis ## realistically we need more for any statistical significance if (measurements_to_make < 2): raise ValueError("Must make at least 2 measurements") # makes sure qubits_to_assert is a list if (not isinstance(qubits_to_assert, list)): qubits_to_assert = [qubits_to_assert] q1Vals = [] q2Vals = [] # Get Df is a function I made to return a dataframe containing measurements for each each qubit across all axes and I use 5 such different measurements for my dataset for i in range(experiments): resDf1 = getDf(quantumCircuit,qubits_to_assert,measurements_to_make,backend) q1Vals.extend([resDf1.at[0,'1'],resDf1.at[0,'-'],resDf1.at[0,'-i']]) q2Vals.extend([resDf1.at[1,'1'],resDf1.at[1,'-'],resDf1.at[1,'-i']]) print(q1Vals) print(q2Vals) tTest, pValue = ttest_ind(q1Vals, q2Vals, alternative = 'two-sided') # Apply t test print("stat: ",tTest, "pValue: ", pValue) if pValue > alpha: print("The two qubits are equal (fail to reject null hypothesis) ") else: print("There is a significant difference between the two qubits (reject null hypothesis)") qc = QuantumCircuit(2) backend = Aer.get_backend('aer_simulator') # qc.initialize([0, 1/np.sqrt(2), -1.j/np.sqrt(2), 0], qc.qubits) qc.h(0) # qc.cnot(0,1) qc.x(1) # qc.p(0.5*2*math.pi/100, 1) # qc.h(1) # qc.p(10*2*math.pi/100, 0) # qc.p(20*2*math.pi/100, 1) # assertEqual(backend, qc, [0,1], 300000, 3, 0.05) # assertEqual(backend, qc, [0,0], 300000, 0.05) qc1 = QuantumCircuit(2) # qc1.x(0) qc1.h(0) qc1.cnot(0,1) # circ = qft_rotations(qc1,2) assertEqual(backend, qc, [0,1], 300000, 10, 0.05) # assertEntangled(backend,circ,[1,0],3000,10,0.05) # Completed but more testing required ## assert that qubits are equal def assertEqual(backend, quantumCircuit, qubits_to_assert, measurements_to_make, experiments, alpha): ## needs to make at least 2 measurements, one for x axis, one for y axis ## realistically we need more for any statistical significance if (measurements_to_make < 2): raise ValueError("Must make at least 2 measurements") # makes sure qubits_to_assert is a list if (not isinstance(qubits_to_assert, list)): qubits_to_assert = [qubits_to_assert] q1Vals = [] q2Vals = [] # Get Df is a function I made to return a dataframe containing measurements for each each qubit across all axes and I use 5 such different measurements for my dataset for i in range(experiments): # resDf1 = getDf(quantumCircuit,qubits_to_assert,measurements_to_make,backend) # q1Vals.extend([resDf1.at[0,'1'],resDf1.at[0,'-'],resDf1.at[0,'-i']]) # q2Vals.extend([resDf1.at[1,'1'],resDf1.at[1,'-'],resDf1.at[1,'-i']]) zQuantumCircuit = measure_z(quantumCircuit,qubits_to_assert) zJob = execute(zQuantumCircuit, backend, shots=measurements_to_make, memory=True) # zMemory = zJob.result().get_memory() zCounts = zJob.result().get_counts() # print(i,zCounts) # for k,v in zCounts.items(): # print(i,k,v) # if(i==0): # q1Vals.extend([v]) # else: # q2Vals.extend([v]) resDf = pd.DataFrame(columns=['0','1']) classical_qubit_index = 1 for qubit in qubits_to_assert: zero_amount, one_amount = 0,0 for experiment in zCounts: if (experiment[2-classical_qubit_index] == '0'): zero_amount += zCounts[experiment] else: one_amount += zCounts[experiment] # print(i,"0:",zero_amount) # print(i,"1:",one_amount) df = {'0':zero_amount, '1':one_amount} resDf = resDf.append(df, ignore_index = True) classical_qubit_index+=1 resDf['0'] = resDf['0'].astype(int) resDf['1'] = resDf['1'].astype(int) q1Vals.extend([resDf.at[0,'1']/measurements_to_make]) q2Vals.extend([resDf.at[1,'1']/measurements_to_make]) # print("here",q1Vals) # print("here",q2Vals) equalTest(q1Vals,q2Vals,alpha) def equalTest(q1Vals,q2Vals,alpha): # q1Vals.extend([resDf.at[0,'1'],resDf.at[0,'0']]) # q2Vals.extend([resDf1.at[1,'1'],resDf1.at[1,'-'],resDf1.at[1,'-i']]) # q2Vals.extend([resDf.at[1,'1'],resDf.at[1,'0']]) print("q1",q1Vals) print("q2",q2Vals) tTest, pValue = ttest_ind(q1Vals, q2Vals, alternative = 'two-sided') # Apply t test print("stat: ",tTest, "pValue: ", pValue) if pValue > alpha: print("The two qubits are equal (fail to reject null hypothesis) ") else: print("There is a significant difference between the two qubits (reject null hypothesis)") qc = QuantumCircuit(2,2) backend = Aer.get_backend('aer_simulator') # qc.initialize([0, 1/np.sqrt(2), -1.j/np.sqrt(2), 0], qc.qubits) qc.h(0) qc.x(1) qc.h(1) # qc.cnot(0,1) # qc.x(1) qc.p(0.5*2*math.pi/100, 1) # qc.h(1) # qc.p(10*2*math.pi/100, 0) # qc.p(20*2*math.pi/100, 1) # assertEqual(backend, qc, [0,1], 300000, 3, 0.05) # assertEqual(backend, qc, [0,0], 300000, 0.05) qc1 = QuantumCircuit(2) # qc1.x(0) qc1.x(0) qc1.cnot(0,1) # circ = qft_rotations(qc1,2) assertEqual(backend, qc, [0,1], 300000, 30, 0.05) # assertEntangled(backend,circ,[1,0],3000,10,0.05)
https://github.com/shantomborah/Quantum-Algorithms
shantomborah
import random import numpy as np import matplotlib.pyplot as plt from qiskit import QuantumCircuit, Aer, execute from qiskit.circuit import ParameterVector from qiskit.quantum_info import state_fidelity from qiskit.quantum_info import Statevector, DensityMatrix, Operator class Compressor: def __init__(self, ensemble, block_size): # Initialize parameters self.ensemble = ensemble self.n = block_size self.m = block_size self.theta = ParameterVector('theta', length=block_size) self.phi = ParameterVector('phi', length=block_size) # Initialize density matrix properties self.rho = np.zeros((2, 2)) self.s0 = np.array([0, 0]) self.s1 = np.array([0, 0]) self.entropy = 1 self.initialize_density_matrix() self.noise = ParameterVector('noise', length=self.m) # Build subcircuits self.ns_ckt = QuantumCircuit(self.n, name='$Noise$') self.source = QuantumCircuit(self.n, name='$Src$') self.tx_ckt = QuantumCircuit(self.n, name='$Tx$') self.rx_ckt = QuantumCircuit(self.n, name='$Rx$') self.initialize_subcircuits() def initialize_density_matrix(self): # Evaluate density matrix and list of states for key in self.ensemble.keys(): theta = key[0] phi = key[1] state = np.array([np.cos(theta/2), np.sin(theta/2) * np.exp(phi*complex(1, 0))]) self.rho = self.rho + self.ensemble[key] * np.outer(state, state) # Evaluate spectrum self.rho: np.ndarray v, w = np.linalg.eig(self.rho) s0 = Statevector(w[:, 0]) s1 = Statevector(w[:, 1]) self.rho = DensityMatrix(self.rho) # Evaluate entropy and typical basis if state_fidelity(s0, self.rho) > state_fidelity(s1, self.rho): self.s0 = s0 self.s1 = s1 else: self.s0 = s1 self.s1 = s0 self.entropy = -np.real(sum([p * np.log2(p) for p in v])) self.m = int(np.ceil(self.entropy * self.n)) def initialize_subcircuits(self): # Build source self.source.reset(range(self.n)) for i in range(self.n): self.source.ry(self.theta[i], i) self.source.rz(self.phi[i], i) # Build typical basis change operator U = Operator(np.column_stack((self.s0.data, self.s1.data))).adjoint() for i in range(self.n): self.tx_ckt.unitary(U, [i], label='$Basis$') # Build permutation operator data = list(range(2 ** self.n)) data = [("{0:0" + str(self.n) + "b}").format(i) for i in data] data = sorted(data, key=lambda x: x.count('1')) data = [int(x, 2) for x in data] V = np.zeros((2 ** self.n, 2 ** self.n)) for i in range(2 ** self.n): V[i, data[i]] = 1 self.tx_ckt.unitary(V, list(range(self.n)), label='$Perm$') # Build bit flip noisy channel for i in range(self.m): self.ns_ckt.u3(self.noise[i], 0, self.noise[i], i) # Build receiver self.rx_ckt.reset(range(self.m, self.n)) self.rx_ckt.append(self.tx_ckt.to_gate().inverse(), list(range(self.n))) def simulate(self, num_shots=1, bit_flip_prob=0.0): # Get backend and circuit simulator = Aer.get_backend('statevector_simulator') circ = self.source + self.tx_ckt + self.ns_ckt + self.rx_ckt fid_list = [] for i in range(num_shots): # Acquire parameters states = random.choices(list(self.ensemble.keys()), self.ensemble.values(), k=self.n) noise = random.choices([0, np.pi], [1-bit_flip_prob, bit_flip_prob], k=self.m) theta = [p[0] for p in states] phi = [p[1] for p in states] circ1 = self.source.bind_parameters({self.theta: theta, self.phi: phi}) circ2 = circ.bind_parameters({self.theta: theta, self.phi: phi, self.noise: noise}) # Simulate ini_state = execute(circ1, simulator).result().get_statevector() fin_state = execute(circ2, simulator).result().get_statevector() fid_list.append(state_fidelity(ini_state, fin_state)) # Return results return fid_list def visualize(self): # Draw components self.source.draw('mpl', reverse_bits=True).suptitle('Source Circuit') self.tx_ckt.draw('mpl', reverse_bits=True).suptitle('Tx Circuit') self.rx_ckt.draw('mpl', reverse_bits=True).suptitle('Rx Circuit') (self.source + self.tx_ckt + self.ns_ckt + self.rx_ckt).draw('mpl', reverse_bits=True).suptitle('Full Circuit') plt.show() if __name__ == '__main__': ensemble = {(0, 0): 0.5, (np.pi/2, 0): 0.5} com = Compressor(ensemble, 3) com.visualize() fid1 = com.simulate(num_shots=100) fid2 = com.simulate(num_shots=100, bit_flip_prob=0.1) print('Noiseless System Fidelity: ', np.mean(fid1)) print('Noisy (p = 0.1) System Fidelity: ', np.mean(fid2))
https://github.com/qiskit-community/qiskit-translations-staging
qiskit-community
from qiskit import QuantumCircuit, execute from qiskit.providers.fake_provider import FakeVigoV2 from qiskit.visualization import plot_gate_map backend = FakeVigoV2() plot_gate_map(backend)
https://github.com/alejomonbar/Quantum-Supply-Chain-Manager
alejomonbar
%load_ext autoreload %autoreload 2 #!pip install pennylane #improt pennylane dependnecies import pennylane as qml from pennylane import numpy as np from pennylane.optimize import NesterovMomentumOptimizer from sklearn.preprocessing import StandardScaler # load the csv files import pandas as pd # plot the historical acc and cost import matplotlib.pyplot as plt import seaborn as sns from IPython.display import clear_output clear_output(wait=False) import os data_train = pd.read_csv("dataset/fair_train.csv") X_train,y_train = data_train[data_train.columns[:16]].values, data_train[data_train.columns[16]].values data_test = pd.read_csv("dataset/classic_test.csv") X_test,y_test = data_test[data_test.columns[:16]].values, data_test[data_test.columns[16]].values (X_train.shape, y_train.shape),(X_test.shape, y_test.shape) scale = StandardScaler() scale.fit(X_train) X_train = scale.transform(X_train) X_test = scale.transform(X_test) dev = qml.device("default.qubit", wires=4) def layer_1(W): qml.RY(W[0], wires=0) qml.RY(W[1], wires=1) qml.RY(W[2], wires=2) qml.RY(W[3], wires=3) qml.Hadamard(wires=0) qml.Hadamard(wires=1) qml.Hadamard(wires=2) qml.Hadamard(wires=3) qml.RZ(W[4], wires=0) qml.RZ(W[5], wires=1) qml.RZ(W[6], wires=2) qml.RZ(W[7], wires=3) qml.CNOT(wires=[1,0]) qml.RY(W[8], wires=1) qml.CNOT(wires=[2,0]) qml.RY(W[9], wires=2) qml.CNOT(wires=[3,0]) qml.RY(W[10], wires=3) qml.CNOT(wires=[2,1]) qml.RY(W[11], wires=2) qml.CNOT(wires=[3,1]) qml.RY(W[12], wires=3) # qml.Hadamard(wires=0) # qml.Hadamard(wires=1) # qml.Hadamard(wires=2) # qml.Hadamard(wires=3) #qml.CNOT(wires=[1,0]) #qml.CNOT(wires=[2,0]) #qml.CNOT(wires=[3,0]) def block(weights, wires): qml.CNOT(wires=[wires[0],wires[1]]) qml.RY(weights[0], wires=wires[0]) qml.RY(weights[1], wires=wires[1]) n_wires = 4 n_block_wires = 2 n_params_block = 2 n_blocks = qml.MPS.get_n_blocks(range(n_wires),n_block_wires) n_blocks @qml.qnode(dev) def circuit(weights, x): #statepreparation(x) qml.AmplitudeEmbedding(x, wires=[0,1,2,3],normalize=True,pad_with=True) #for i in range(4): #qml.Hadamard(wires=i) #qml.RY(x[i], wires=i) #qml.Hadamard(wires=i) #qml.RX(x[i+4], wires=i) #qml.RX(x[i+8], wires=i) #qml.CNOT(wires=[0,1]) #qml.CNOT(wires=[1,2]) #qml.CNOT(wires=[2,3]) #qml.CNOT(wires=[3,0]) #qml.CNOT(wires=[4,0]) #qml.CNOT(wires=[0,1]) #qml.CNOT(wires=[1,2]) #qml.CNOT(wires=[2,3]) #qml.CNOT(wires=[3,0]) for w in weights: #layer_1(w[:13]) #layer_2(w[12:21]) #layer_2(w[16:24]) #layer_3(w[21:]) qml.MPS(range(n_wires),n_block_wires,block, n_params_block, w) #print(w) #print(x) return qml.expval(qml.PauliZ(3)) def variational_classifier(weights, bias, x): return circuit(weights, x) + bias def square_loss(labels, predictions): loss = 0 for l, p in zip(labels, predictions): loss = loss + (l - p) ** 2 loss = loss / len(labels) return loss def accuracy(labels, predictions): loss = 0 for l, p in zip(labels, predictions): if abs(l - p) < 1e-5: loss = loss + 1 loss = loss / len(labels) return loss def cost(weights, bias, X, Y): #print(1) predictions = [variational_classifier(weights, bias, x) for x in X] return square_loss(Y, predictions) np.random.seed(0) num_layers = 1 weights_init = 2*np.pi * np.random.randn(num_layers,3, 2, requires_grad=True) bias_init = np.array(0.0, requires_grad=True) print(weights_init, bias_init) print(qml.draw(circuit,expansion_strategy='device',wire_order=[0,1,2,3,4,5,6,7])(weights_init,np.asarray(X_train[0]))) for i in weights_init: print(i[0]) y_train = np.where(y_train < 1, -1, y_train) y_test = np.where(y_test < 1, -1, y_test) from sklearn.utils import shuffle X,y = shuffle(X_train, y_train, random_state=0) from sklearn.model_selection import train_test_split opt = NesterovMomentumOptimizer(0.4) batch_size = 32 num_data = len(y_train) num_train = 0.9 # train the variational classifier weights = weights_init bias = bias_init print() cost_g = [] acc_train = [] acc_test = [] plt.show() for it in range(50): X_train_70, X_test_30, y_train_70, y_test_30 =train_test_split(np.asarray(X), np.asarray(y), train_size=num_train, test_size=1.0-num_train, shuffle=True) # Update the weights by one optimizer step batch_index = np.random.randint(0, len(X_train_70), (batch_size,)) feats_train_batch = X_train_70[batch_index] Y_train_batch = y_train_70[batch_index] weights, bias, _, _ = opt.step(cost, weights, bias, feats_train_batch, Y_train_batch) # Compute predictions on train and validation set predictions_train = [np.sign(variational_classifier(weights, bias, f)) for f in X_train_70] predictions_val = [np.sign(variational_classifier(weights, bias, f)) for f in X_test_30] # Compute accuracy on train and validation set acc_tra = accuracy(y_train_70, predictions_train) acc_val = accuracy(y_test_30, predictions_val) cost_train = cost(weights, bias,X_train, y_train) cost_g.append(cost_train) acc_train.append(acc_tra) acc_test.append(acc_val) clear_output(wait=True) plt.plot(cost_g,label='cost') plt.plot(acc_train,label='acc_train') plt.plot(acc_test,label='acc_test') plt.legend(['cost','acc_train','acc_test']) plt.show() print( "Iter: {:5d} | Cost: {:0.7f} | Acc train: {:0.7f} | Acc validation: {:0.7f} " "".format(it + 1, cost_train, acc_tra, acc_val) ) print(weights) x_test = [] for x in X_test.tolist(): if sum(x) == 0: x[0]=1 x_test.append( x/ np.linalg.norm(x)) x_test[0] y_pred = [np.sign(variational_classifier(weights, bias, f)) for f in x_test] y_test_pred = [] for i in y_pred: if i < 0: y_test_pred.append(-1) else: y_test_pred.append(1) from sklearn.metrics import confusion_matrix, roc_curve, auc from sklearn.preprocessing import StandardScaler # demonstration of calculating metrics for a neural network model using sklearn from sklearn.metrics import accuracy_score from sklearn.metrics import precision_score from sklearn.metrics import recall_score from sklearn.metrics import f1_score from sklearn.metrics import cohen_kappa_score from sklearn.metrics import roc_auc_score accuracy = accuracy_score(y_test, y_test_pred) print('Accuracy: %f' % accuracy) # precision tp / (tp + fp) precision = precision_score(y_test, y_test_pred) print('Precision: %f' % precision) # recall: tp / (tp + fn) recall = recall_score(y_test, y_test_pred) print('Recall: %f' % recall) # f1: 2 tp / (2 tp + fp + fn) f1 = f1_score(y_test, y_test_pred) print('F1 score: %f' % f1) # kappa kappa = cohen_kappa_score(y_test, y_test_pred) print('Cohens kappa: %f' % kappa) # ROC AUC auc = roc_auc_score(y_test, y_test_pred) print('ROC AUC: %f' % auc) # confusion matrix test_matrix = confusion_matrix(y_test, y_test_pred) print(test_matrix) ax = sns.heatmap(test_matrix, annot=True, cmap='Blues', fmt='g') ax.set_title('Seaborn Confusion Matrix with labels\n\n'); ax.set_xlabel('\nPredicted Values') ax.set_ylabel('Actual Values '); ax.xaxis.set_ticklabels(['0','1']) ax.yaxis.set_ticklabels(['0','1']) ## Display the visualization of the Confusion Matrix. plt.show() y_pred_1 = [int(i) for i in y_pred ] y_pred_1 = ["{}\n".format(i) for i in y_pred_1] with open(r'mps_1_layers_std.csv', 'w') as fp: fp.writelines(y_pred_1)
https://github.com/acfilok96/Quantum-Computation
acfilok96
import qiskit from qiskit import * print(qiskit.__version__) %matplotlib inline from qiskit.tools.visualization import plot_histogram def find_secret_number(secter_number): # Using Bernstein Vazirani Algorithm secret_number = str(secter_number) circuit = QuantumCircuit(len(secret_number)+1, len(secret_number)) circuit.h(range(len(secret_number))) circuit.x(len(secret_number)) circuit.h(len(secret_number)) circuit.barrier() for position,value in enumerate(reversed(secret_number)): if value == '1': circuit.cx(position, len(secret_number)) circuit.barrier() circuit.h(range(len(secret_number))) circuit.barrier() circuit.measure(range(len(secret_number)), range(len(secret_number))) circuit.barrier() # circuit.draw(output='mpl') simulator = Aer.get_backend('qasm_simulator') job = execute(circuit, backend=simulator, shots=1) result = job.result() counts = result.get_counts() # print(counts) return circuit, counts secret_number = int(input("enter number: ")) circuit, number = find_secret_number(secret_number) print('required number: ', number) circuit.draw(output='mpl')
https://github.com/qiskit-community/qiskit-translations-staging
qiskit-community
import matplotlib.pyplot as plt from qiskit import QuantumCircuit, transpile from qiskit.providers.fake_provider import FakeAuckland backend = FakeAuckland() ghz = QuantumCircuit(15) ghz.h(0) ghz.cx(0, range(1, 15)) ghz.draw(output='mpl')
https://github.com/dkp-quantum/Tutorials
dkp-quantum
# Install packages #!pip install numpy #!pip install matplotlib #!pip install qiskit #!pip install qiskit[visualization] #!pip install qiskit[optimization] #!pip install qiskit_machine_learning # Load packages ## General tools import numpy as np import matplotlib.pyplot as plt from math import pi ## Qiskit Circuit Functions from qiskit import * from qiskit.quantum_info import * from qiskit.visualization import * # install the latest released version of PennyLane !pip install pennylane from pennylane import numpy as np import matplotlib.pyplot as plt from math import pi import pennylane as qml # Setup the device using qml.device() ## Assigning the device and defining the measurement of the circuit dev = qml.device(name = 'default.qubit', wires = 2) @qml.qnode(dev) def circuit(): return qml.expval(qml.PauliZ(0) @ qml.PauliZ(1)) drawer = qml.draw(circuit, show_all_wires=True) print(drawer()) # Setup the device using qml.device() ## Assigning names to each wires dev = qml.device(name = 'default.qubit', wires = ['a', 'b']) @qml.qnode(dev) def circuit(x): return qml.expval(qml.PauliZ('a') @ qml.PauliZ('b')) drawer = qml.draw(circuit, show_all_wires=True) print(drawer(0.5)) # Setup the device using qml.device() ## Assigning the number of shots shots_list = [5, 10, 1000] # number of shots for each batches dev = qml.device("default.qubit", wires=2, shots=shots_list) @qml.qnode(dev) def circuit(x): qml.RX(x, wires=0) qml.CNOT(wires=[0, 1]) return qml.expval(qml.PauliZ(0) @ qml.PauliX(1)), qml.expval(qml.PauliZ(0)) drawer = qml.draw(circuit, show_all_wires=True) print(drawer(x = 0.5)) ## The result of the execution of the circuit. circuit(0.5) dev = qml.device('default.qubit', wires=['aux', 'q1', 'q2']) # Quntum function def my_quantum_function(x, y): qml.RZ(x, wires='q1') qml.CNOT(wires=['aux' ,'q1']) qml.RY(y, wires='q2') return qml.expval(qml.PauliZ('q2')) circuit = qml.QNode(my_quantum_function, dev) circuit(x = np.pi/4, y = 0.7) # Plot the circuit print(qml.draw(circuit)(np.pi/4, 0.7)) # Plot the circuit with matplotlib.pyplot library import matplotlib.pyplot as plt fig, ax = qml.draw_mpl(circuit)(x = np.pi/4, y = 0.7) plt.show() # Measurement 1) Sampling result from each shots dev = qml.device("default.qubit", wires=2, shots=1000) @qml.qnode(dev) def circuit(): qml.Hadamard(wires=0) qml.CNOT(wires=[0, 1]) return qml.sample(qml.PauliZ(0)), qml.sample(qml.PauliZ(1)) fig, ax = qml.draw_mpl(circuit)() plt.show() result_sample = circuit() # Print out the dimension of the result print(result_sample.shape) # Let's look at the result result_sample # Measurement 2) Sampling result from each shots dev = qml.device("default.qubit", wires=2, shots=1000) @qml.qnode(dev) def circuit(): qml.Hadamard(wires=0) qml.CNOT(wires=[0, 1]) return qml.probs(wires=[0, 1]) fig, ax = qml.draw_mpl(circuit)() plt.show() result_prob = circuit() # Print out the dimension of the result print(result_prob.shape) # Let's look at the result result_prob # Measurement 3) Sampling result from each shots dev = qml.device("default.qubit", wires=3, shots=1000) @qml.qnode(dev) def my_quantum_function(x, y): qml.RZ(x, wires=0) qml.CNOT(wires=[0, 1]) qml.RY(y, wires=1) qml.CNOT(wires=[0, 2]) return qml.expval(qml.PauliZ(0) @ qml.Identity(1) @qml.PauliX(2)) fig, ax = qml.draw_mpl(my_quantum_function)(x = pi/2, y = pi/3) plt.show() result_tensor = my_quantum_function(x = pi/2, y = pi/3) # Let's look at the result result_tensor import pennylane as qml from pennylane import numpy as np from pennylane.optimize import NesterovMomentumOptimizer dev = qml.device("default.qubit", wires=4) def layer(W): qml.Rot(W[0, 0], W[0, 1], W[0, 2], wires=0) qml.Rot(W[1, 0], W[1, 1], W[1, 2], wires=1) qml.Rot(W[2, 0], W[2, 1], W[2, 2], wires=2) qml.Rot(W[3, 0], W[3, 1], W[3, 2], wires=3) qml.CNOT(wires=[0, 1]) qml.CNOT(wires=[1, 2]) qml.CNOT(wires=[2, 3]) qml.CNOT(wires=[3, 0]) def statepreparation(x): qml.BasisState(x, wires=[0, 1, 2, 3]) @qml.qnode(dev) def circuit(weights, x): statepreparation(x) for W in weights: layer(W) return qml.expval(qml.PauliZ(0)) def variational_classifier(weights, bias, x): return circuit(weights, x) + bias def square_loss(labels, predictions): loss = 0 for l, p in zip(labels, predictions): loss = loss + (l - p) ** 2 loss = loss / len(labels) return loss def accuracy(labels, predictions): loss = 0 for l, p in zip(labels, predictions): if abs(l - p) < 1e-5: loss = loss + 1 loss = loss / len(labels) return loss def cost(weights, bias, X, Y): predictions = [variational_classifier(weights, bias, x) for x in X] return square_loss(Y, predictions) from pennylane import numpy as np data = np.array([[0., 0., 0., 0., 0], [0., 0., 0., 1., 1], [0., 0., 1., 0., 1], [0., 0., 1., 1., 0], [0., 1., 0., 0., 1], [0., 1., 0., 1., 0], [0., 1., 1., 0., 0], [0., 1., 1., 1., 1], [1., 0., 0., 0., 1], [1., 0., 0., 1., 0], [1., 0., 1., 0., 0], [1., 0., 1., 1., 1], [1., 1., 0., 0., 0], [1., 1., 0., 1., 1], [1., 1., 1., 0., 1], [1., 1., 1., 1., 0]]) X = np.array(data[:, :-1], requires_grad=False) Y = np.array(data[:, -1], requires_grad=False) Y = Y * 2 - np.ones(len(Y)) # shift label from {0, 1} to {-1, 1} for i in range(5): print("X = {}, Y = {: d}".format(X[i], int(Y[i]))) print("...") np.random.seed(0) num_qubits = 4 num_layers = 2 weights_init = 0.01 * np.random.randn(num_layers, num_qubits, 3, requires_grad=True) bias_init = np.array(0.0, requires_grad=True) print(weights_init, bias_init) opt = NesterovMomentumOptimizer(0.5) batch_size = 5 weights = weights_init bias = bias_init iter_num = 10 for it in range(iter_num): # Update the weights by one optimizer step batch_index = np.random.randint(0, len(X), (batch_size,)) X_batch = X[batch_index] Y_batch = Y[batch_index] weights, bias, _, _ = opt.step(cost, weights, bias, X_batch, Y_batch) # Compute accuracy predictions = [np.sign(variational_classifier(weights, bias, x)) for x in X] acc = accuracy(Y, predictions) print( "Iter: {:5d} | Cost: {:0.7f} | Accuracy: {:0.7f} ".format( it + 1, cost(weights, bias, X, Y), acc ) ) dev = qml.device("default.qubit", wires=2) def get_angles(x): beta0 = 2 * np.arcsin(np.sqrt(x[1] ** 2) / np.sqrt(x[0] ** 2 + x[1] ** 2 + 1e-12)) beta1 = 2 * np.arcsin(np.sqrt(x[3] ** 2) / np.sqrt(x[2] ** 2 + x[3] ** 2 + 1e-12)) beta2 = 2 * np.arcsin( np.sqrt(x[2] ** 2 + x[3] ** 2) / np.sqrt(x[0] ** 2 + x[1] ** 2 + x[2] ** 2 + x[3] ** 2) ) return np.array([beta2, -beta1 / 2, beta1 / 2, -beta0 / 2, beta0 / 2]) def statepreparation(a): qml.RY(a[0], wires=0) qml.CNOT(wires=[0, 1]) qml.RY(a[1], wires=1) qml.CNOT(wires=[0, 1]) qml.RY(a[2], wires=1) qml.PauliX(wires=0) qml.CNOT(wires=[0, 1]) qml.RY(a[3], wires=1) qml.CNOT(wires=[0, 1]) qml.RY(a[4], wires=1) qml.PauliX(wires=0) x = np.array([0.53896774, 0.79503606, 0.27826503, 0.0], requires_grad=False) ang = get_angles(x) @qml.qnode(dev) def test(angles): statepreparation(angles) return qml.expval(qml.PauliZ(0)) test(ang) print("x : ", x) print("angles : ", ang) print("amplitude vector: ", np.real(dev.state)) def layer(W): qml.Rot(W[0, 0], W[0, 1], W[0, 2], wires=0) qml.Rot(W[1, 0], W[1, 1], W[1, 2], wires=1) qml.CNOT(wires=[0, 1]) @qml.qnode(dev) def circuit(weights, angles): statepreparation(angles) for W in weights: layer(W) return qml.expval(qml.PauliZ(0)) def variational_classifier(weights, bias, angles): return circuit(weights, angles) + bias def cost(weights, bias, features, labels): predictions = [variational_classifier(weights, bias, f) for f in features] return square_loss(labels, predictions) # !pip install pandas # !pip install sklearn from sklearn.datasets import load_iris import pandas as pd import numpy as np # visualization package import matplotlib.pyplot as plt import seaborn as sns iris = load_iris() # sample data load #print(iris) # pring out data with variable types and its description print(iris.DESCR) # Description of the dataset # feature_names(x variables) 와 target(y variable)을 잘 나타내도록 data frame 생성 df = pd.DataFrame(data=iris.data, columns=iris.feature_names) df['target'] = iris.target # 숫자형으로 기록된 target(y variable) - (0.0, 1.0, 2.0)을 문자값으로 변환 df['target'] = df['target'].map({0:"setosa", 1:"versicolor", 2:"virginica"}) print(df) sns.pairplot(df, hue="target", height=3) plt.show() from pennylane import numpy as np data = np.loadtxt("iris_classes1and2_scaled.txt") X = data[:, 0:2] print("First X sample (original) :", X[0]) # pad the vectors to size 2^2 with constant values padding = 0.3 * np.ones((len(X), 1)) X_pad = np.c_[np.c_[X, padding], np.zeros((len(X), 1))] print("First X sample (padded) :", X_pad[0]) # normalize each input normalization = np.sqrt(np.sum(X_pad ** 2, -1)) X_norm = (X_pad.T / normalization).T print("First X sample (normalized):", X_norm[0]) # angles for state preparation are new features features = np.array([get_angles(x) for x in X_norm], requires_grad=False) print("First features sample :", features[0]) Y = data[:, -1] import matplotlib.pyplot as plt plt.figure() plt.scatter(X[:, 0][Y == 1], X[:, 1][Y == 1], c="b", marker="o", edgecolors="k") plt.scatter(X[:, 0][Y == -1], X[:, 1][Y == -1], c="r", marker="o", edgecolors="k") plt.title("Original data") plt.show() plt.figure() dim1 = 0 dim2 = 1 plt.scatter( X_norm[:, dim1][Y == 1], X_norm[:, dim2][Y == 1], c="b", marker="o", edgecolors="k" ) plt.scatter( X_norm[:, dim1][Y == -1], X_norm[:, dim2][Y == -1], c="r", marker="o", edgecolors="k" ) plt.title("Padded and normalised data (dims {} and {})".format(dim1, dim2)) plt.show() plt.figure() dim1 = 0 dim2 = 3 plt.scatter( features[:, dim1][Y == 1], features[:, dim2][Y == 1], c="b", marker="o", edgecolors="k" ) plt.scatter( features[:, dim1][Y == -1], features[:, dim2][Y == -1], c="r", marker="o", edgecolors="k" ) plt.title("Feature vectors (dims {} and {})".format(dim1, dim2)) plt.show() np.random.seed(0) num_data = len(Y) num_train = int(0.75 * num_data) index = np.random.permutation(range(num_data)) feats_train = features[index[:num_train]] Y_train = Y[index[:num_train]] feats_val = features[index[num_train:]] Y_val = Y[index[num_train:]] # We need these later for plotting X_train = X[index[:num_train]] X_val = X[index[num_train:]] num_qubits = 2 num_layers = 6 weights_init = 0.01 * np.random.randn(num_layers, num_qubits, 3, requires_grad=True) bias_init = np.array(0.0, requires_grad=True) opt = NesterovMomentumOptimizer(0.01) batch_size = 50 # train the variational classifier weights = weights_init bias = bias_init Iter_num = 25 for it in range(Iter_num): # Update the weights by one optimizer step batch_index = np.random.randint(0, num_train, (batch_size,)) feats_train_batch = feats_train[batch_index] Y_train_batch = Y_train[batch_index] weights, bias, _, _ = opt.step(cost, weights, bias, feats_train_batch, Y_train_batch) # Compute predictions on train and validation set predictions_train = [np.sign(variational_classifier(weights, bias, f)) for f in feats_train] predictions_val = [np.sign(variational_classifier(weights, bias, f)) for f in feats_val] # Compute accuracy on train and validation set acc_train = accuracy(Y_train, predictions_train) acc_val = accuracy(Y_val, predictions_val) print( "Iter: {:5d} | Cost: {:0.7f} | Acc train: {:0.7f} | Acc validation: {:0.7f} " "".format(it + 1, cost(weights, bias, features, Y), acc_train, acc_val) ) plt.figure(figsize=(12,9)) cm = plt.cm.RdBu # make data for decision regions xx, yy = np.meshgrid(np.linspace(0.0, 1.5, 20), np.linspace(0.0, 1.5, 20)) X_grid = [np.array([x, y]) for x, y in zip(xx.flatten(), yy.flatten())] # preprocess grid points like data inputs above padding = 0.3 * np.ones((len(X_grid), 1)) X_grid = np.c_[np.c_[X_grid, padding], np.zeros((len(X_grid), 1))] # pad each input normalization = np.sqrt(np.sum(X_grid ** 2, -1)) X_grid = (X_grid.T / normalization).T # normalize each input features_grid = np.array( [get_angles(x) for x in X_grid] ) # angles for state preparation are new features predictions_grid = [variational_classifier(weights, bias, f) for f in features_grid] Z = np.reshape(predictions_grid, xx.shape) # plot decision regions cnt = plt.contourf( xx, yy, Z, levels=np.arange(-1, 1.1, 0.1), cmap=cm, alpha=0.8, extend="both" ) plt.contour( xx, yy, Z, levels=[0.0], colors=("black",), linestyles=("--",), linewidths=(0.8,) ) plt.colorbar(cnt, ticks=[-1, 0, 1]) # plot data plt.scatter( X_train[:, 0][Y_train == 1], X_train[:, 1][Y_train == 1], c="b", marker="o", edgecolors="k", label="class 1 train", ) plt.scatter( X_val[:, 0][Y_val == 1], X_val[:, 1][Y_val == 1], c="b", marker="^", edgecolors="k", label="class 1 validation", ) plt.scatter( X_train[:, 0][Y_train == -1], X_train[:, 1][Y_train == -1], c="r", marker="o", edgecolors="k", label="class -1 train", ) plt.scatter( X_val[:, 0][Y_val == -1], X_val[:, 1][Y_val == -1], c="r", marker="^", edgecolors="k", label="class -1 validation", ) plt.legend() plt.show() # Install packages # !pip install tensorflow # Loading packages import pennylane as qml from pennylane import numpy as np from pennylane.templates import RandomLayers import tensorflow as tf from tensorflow import keras import matplotlib.pyplot as plt n_epochs = 30 # Number of optimization epochs n_layers = 1 # Number of random layers n_train = 50 # Size of the train dataset n_test = 30 # Size of the test dataset # SAVE_PATH = "quanvolution/" # Data saving folder. Here we don't need to make saving path. PREPROCESS = True # If False, skip quantum processing and load data from SAVE_PATH np.random.seed(0) # Seed for NumPy random number generator tf.random.set_seed(0) # Seed for TensorFlow random number generator # Assigning MNIST data into train / test data mnist_dataset = keras.datasets.mnist (train_images, train_labels), (test_images, test_labels) = mnist_dataset.load_data() # Reduce dataset size ## Previouslys, we set the number of train / test data in setting the hyper-parameters. train_images = train_images[:n_train] train_labels = train_labels[:n_train] test_images = test_images[:n_test] test_labels = test_labels[:n_test] # Normalize pixel values within 0 and 1. ## We are modifying the data values between 0 and 1. train_images = train_images / 255 test_images = test_images / 255 # Add extra dimension for convolution channels train_images = np.array(train_images[..., tf.newaxis], requires_grad=False) test_images = np.array(test_images[..., tf.newaxis], requires_grad=False) # Setup the device using qml.device() dev = qml.device("default.qubit", wires=4) # Random circuit parameters using in rotation-Y gate rand_params = np.random.uniform(high=2 * np.pi, size=(n_layers, 4)) @qml.qnode(dev) def circuit(phi): # Encoding of 4 classical input values for j in range(4): qml.RY(np.pi * phi[j], wires=j) # Random quantum circuit RandomLayers(rand_params, wires=list(range(4))) # Measurement producing 4 classical output values return [qml.expval(qml.PauliZ(j)) for j in range(4)] ## Assigning phi_value to plot the circuit phi_value = [0,0,0,0] ## Plotting the quantum circuit fig, ax = qml.draw_mpl(circuit)(phi_value) plt.show() def quanv(image): """Convolves the input image with many applications of the same quantum circuit.""" out = np.zeros((14, 14, 4)) # Loop over the coordinates of the top-left pixel of 2X2 squares for j in range(0, 28, 2): for k in range(0, 28, 2): # Process a squared 2x2 region of the image with a quantum circuit q_results = circuit( [ image[j, k, 0], image[j, k + 1, 0], image[j + 1, k, 0], image[j + 1, k + 1, 0] ] ) # Assign expectation values to different channels of the output pixel (j/2, k/2) for c in range(4): out[j // 2, k // 2, c] = q_results[c] return out if PREPROCESS == True: q_train_images = [] print("Quantum pre-processing of train images:") for idx, img in enumerate(train_images): print("{}/{} ".format(idx + 1, n_train), end="\r") q_train_images.append(quanv(img)) q_train_images = np.asarray(q_train_images) q_test_images = [] print("\nQuantum pre-processing of test images:") for idx, img in enumerate(test_images): print("{}/{} ".format(idx + 1, n_test), end="\r") q_test_images.append(quanv(img)) q_test_images = np.asarray(q_test_images) # # Save pre-processed images # np.save(SAVE_PATH + "q_train_images.npy", q_train_images) # np.save(SAVE_PATH + "q_test_images.npy", q_test_images) # # Load pre-processed images # q_train_images = np.load(SAVE_PATH + "q_train_images.npy") # q_test_images = np.load(SAVE_PATH + "q_test_images.npy") n_samples = 4 n_channels = 4 fig, axes = plt.subplots(1 + n_channels, n_samples, figsize=(10, 10)) for k in range(n_samples): axes[0, 0].set_ylabel("Input") if k != 0: axes[0, k].yaxis.set_visible(False) axes[0, k].imshow(train_images[k, :, :, 0], cmap="gray") # Plot all output channels for c in range(n_channels): axes[c + 1, 0].set_ylabel("Output [ch. {}]".format(c)) if k != 0: axes[c, k].yaxis.set_visible(False) axes[c + 1, k].imshow(q_train_images[k, :, :, c], cmap="gray") plt.tight_layout() plt.show() def MyModel(): """Initializes and returns a custom Keras model which is ready to be trained.""" model = keras.models.Sequential([ keras.layers.Flatten(), keras.layers.Dense(10, activation="softmax") ]) model.compile( optimizer='adam', loss="sparse_categorical_crossentropy", metrics=["accuracy"], ) return model q_model = MyModel() q_history = q_model.fit( q_train_images, train_labels, validation_data=(q_test_images, test_labels), batch_size=4, epochs=n_epochs, verbose=2, ) c_model = MyModel() c_history = c_model.fit( train_images, train_labels, validation_data=(test_images, test_labels), batch_size=4, epochs=n_epochs, verbose=2, ) import matplotlib.pyplot as plt plt.style.use("seaborn") fig, (ax1, ax2) = plt.subplots(2, 1, figsize=(6, 9)) ax1.plot(q_history.history["val_accuracy"], "-ob", label="With quantum layer") ax1.plot(c_history.history["val_accuracy"], "-og", label="Without quantum layer") ax1.set_ylabel("Accuracy") ax1.set_ylim([0, 1]) ax1.set_xlabel("Epoch") ax1.legend() ax2.plot(q_history.history["val_loss"], "-ob", label="With quantum layer") ax2.plot(c_history.history["val_loss"], "-og", label="Without quantum layer") ax2.set_ylabel("Loss") ax2.set_ylim(top=2.5) ax2.set_xlabel("Epoch") ax2.legend() plt.tight_layout() plt.show()
https://github.com/AnshDabkara/Qiskit_Algorithm
AnshDabkara
from qiskit import IBMQ, Aer from qiskit.providers.ibmq import least_busy from qiskit import QuantumCircuit, transpile, assemble from qiskit.tools.monitor import job_monitor import matplotlib as mpl import numpy as np # import basic plot tools from qiskit.visualization import plot_histogram # length of the n-bit string n = 4 constant_oracle = QuantumCircuit(n+1) constant_oracle.clear() output = np.random.randint(2) # random no. 0/1 as output if output == 1: constant_oracle.x(n) balance_oracle = QuantumCircuit(n+1) balance_oracle.clear() b_str = "1000" # implementing x-gates for i in range(len(b_str)): if b_str[i] == '1': balance_oracle.x(i) balance_oracle.barrier() # implementing cnot gates for qubit in range(n): balance_oracle.cx(qubit, n) balance_oracle.barrier() balance_oracle.draw() # implemneting x-gates for i in range (len(b_str)): if b_str[i] == '1': balance_oracle.x(i) balance_oracle.barrier() dj_circuit = QuantumCircuit(n+1, n) # Apply H-gates for qubit in range(n): dj_circuit.h(qubit) # Put qubit in state |-> dj_circuit.x(n) dj_circuit.h(n) # Add oracle dj_circuit = dj_circuit.compose(constant_oracle) # Repeat H-gates for qubit in range(n): dj_circuit.h(qubit) dj_circuit.barrier() # Measure for i in range(n): dj_circuit.measure(i, i) dj_circuit.draw('mpl') aer_sim = Aer.get_backend('aer_simulator') #Local Simulator shots = 1024 #No. of times the circuit is running qobj = assemble(dj_circuit, shots = shots) results = aer_sim.run(qobj).result() counts = results.get_counts() plot_histogram(counts)
https://github.com/acfilok96/Quantum-Computation
acfilok96
from qiskit import * qr = QuantumRegister(2) cr = ClassicalRegister(2) circuit = QuantumCircuit(qr, cr) %matplotlib inline circuit.draw() circuit.h(qr[0]) circuit.draw(output = 'mpl') circuit.cx(qr[0], qr[1]) circuit.draw(output='mpl') circuit.measure(qr, cr) circuit.draw(output='mpl') simulator = Aer.get_backend('qasm_simulator') execute(circuit, backend=simulator) result = execute(circuit, backend=simulator).result() from qiskit.tools.visualization import plot_histogram plot_histogram(result.get_counts(circuit)) # plot_histogram provider = IBMQ.get_provider('ibm-q') backend = provider.get_backend('ibmq_16_melbourne') job =execute(circuit, backend= backend) from qiskit.tools.monitor import job_monitor job_monitor(job) result = job.result() plot_histogram(result.get_counts(circuit))
https://github.com/qiskit-community/qiskit-translations-staging
qiskit-community
from qiskit import QuantumCircuit, transpile from qiskit.visualization import plot_circuit_layout from qiskit.providers.fake_provider import FakeVigo backend = FakeVigo() ghz = QuantumCircuit(3, 3) ghz.h(0) ghz.cx(0,range(1,3)) ghz.barrier() ghz.measure(range(3), range(3)) new_circ_lv3 = transpile(ghz, backend=backend, optimization_level=3) plot_circuit_layout(new_circ_lv3, backend)
https://github.com/TheGupta2012/QPE-Algorithms
TheGupta2012
resolutions = [i for i in range(10, 55, 5)] resolutions from qiskit import IBMQ from qiskit import QuantumCircuit, execute, transpile, Aer from qiskit.extensions import UnitaryGate, Initialize from qiskit.quantum_info import Statevector from qiskit.tools.visualization import plot_bloch_vector from qiskit.tools.visualization import plot_histogram, plot_bloch_multivector import numpy as np from time import sleep import sys sys.path.append("../..") import os from scipy.stats import unitary_group import matplotlib.pyplot as plt %matplotlib inline # IBMQ.load_account() # provider = IBMQ.get_provider(hub='ibm-q-education') # santiago = provider.get_backend('ibmq_santiago') # casablanca = provider.get_backend('ibmq_casablanca') # bogota = provider.get_backend('ibmq_bogota') sim = Aer.get_backend('qasm_simulator') # athens = provider.get_backend('ibmq_athens') from Modules.normal_SPEA import SPEA from Modules.changed_SPEA import global_max_SPEA def generate_plots(unitary_size, costs, errors, overlaps, algorithm): import random colors = ['red', 'brown', 'cyan', 'green', 'grey', 'blue', 'purple', 'black', 'orange'] c1, c2, c3 = random.sample(colors, 3) # plot os.makedirs("Experiment_1/"+str(unitary_size) + "_qubit(random)/", exist_ok=True) # plot 1 fig = plt.figure(figsize=(13, 6)) ax1 = fig.add_subplot(1, 2, 1) ax1.set_title(str(unitary_size)+" qubit "+algorithm + " Cost v/s Max iters", fontsize=16) ax1.set_xlabel("Number of Resolutions ", fontsize=15) ax1.set_ylabel("Metrics Returned for unitary ", fontsize=15) ax1.plot(resolutions, costs, label='Costs of Unitary', marker='o', color=c1, alpha=0.7) ax1.plot(resolutions, overlaps, label='Average overlap from nearest eigenvector', marker='s', color=c2, alpha=0.6) ax1.legend(loc='best') ax1.grid() # plot 2 ax2 = fig.add_subplot(1, 2, 2) ax2.set_title(str(unitary_size)+" qubit "+algorithm + " % error v/s Max iters", fontsize=16) ax2.set_xlabel("Number of resolutions ", fontsize=15) ax2.set_ylabel("% error for nearest eigenvalue", fontsize=15) ax2.plot(resolutions, errors, label='Average error from nearest eigenvalue', marker='o', color=c3, alpha=0.6) ax2.legend(loc='best') ax2.grid() # save axure fig.savefig("Experiment_1/"+str(unitary_size)+"_qubit(random)/" + algorithm+" Algorithm (alternate).JPG", dpi=200) def get_results(eig_vals, eig_vect, bases, basis_indices, unitary, algorithm, experiments): '''Return the results of running the algorithm for this particular unitary matrix''' costs_g = [] errors_g = [] max_overlaps_g = [] # find how the cost converges with increasing iterations for reso in resolutions: costs = [] errors = [] overlaps = [] i = 0 # run the experiments ... while len(costs) < experiments: if algorithm == 'original': spea = SPEA(unitary, resolution=reso, error=3, max_iters=10) else: spea = global_max_SPEA( unitary, resolution=reso, error=3, max_iters=10) result = spea.get_eigen_pair( progress=False, backend=sim, algo='alternate', basis=bases[i], basis_ind=basis_indices[i], randomize=False,shots = 2**12) # if result['cost'] < 0.65: # continue # increment the basis index i+=1 # in exp 1 -> basis[0], in exp 2 -> basis[1] and so on.... # find the costs costs.append(result['cost']) theta = result['theta'] res_state = result['state'] # find the abs difference in this theta with the closest eigenvalue # and append that to the errors ... min_error = 1e5 for e in eig_vals: error = abs(e - theta) if error < min_error: min_error = error perc_error = ((error)/e)*100 errors.append(perc_error) # find overlaps max_overlap = -1 for k in eig_vect: dot = np.linalg.norm(np.dot(k, res_state.conjugate().T))**2 max_overlap = max(max_overlap, dot) overlaps.append(max_overlap) print("Result with", reso, " resolutions :") print("AVG. COST :", np.average(costs), "AVG. ERROR :", np.average(errors)) # append the average result of your algorithm ... costs_g.append(np.average(costs)) errors_g.append(np.average(errors)) max_overlaps_g.append(np.average(overlaps)) return costs_g, errors_g, max_overlaps_g unit_2 = unitary_group.rvs(4) unit_2 eig_vals2, eig_vect2 = np.linalg.eig(unit_2) eig_vals2 = np.angle(eig_vals2) e = [] for k in eig_vals2: if k < 0: v = (k + 2*np.pi)/(2*np.pi) else: v = (k)/(2*np.pi) e.append(v) eig_vals2 = np.array(e) print("Eigenstates :", eig_vect2) print("Eigenvalues :", eig_vals2) bases2 , basis_indices2 = [], [] for _ in range(4): sample = unitary_group.rvs(4) basis = [] for k in sample: basis.append(np.array(k, dtype=complex)) ind = np.random.choice(range(4)) bases2.append(basis) basis_indices2.append(ind) print("Basis set :",bases2) print("Basis indices :",basis_indices2) costs_2qubit_b, errors_eig_2qubit_b, max_overlaps_2qubit_b = get_results( eig_vals2, eig_vect2, bases2, basis_indices2, unit_2, 'original', 4) generate_plots(2, costs_2qubit_b, errors_eig_2qubit_b, max_overlaps_2qubit_b, "Original") costs_2qubit_c, errors_eig_2qubit_c, max_overlaps_2qubit_c = get_results( eig_vals2, eig_vect2, bases2, basis_indices2, unit_2, 'modified', 4) generate_plots(2, costs_2qubit_c, errors_eig_2qubit_c, max_overlaps_2qubit_c, "Modified") unit_3 = unitary_group.rvs(8) unit_3 eig_vals3, eig_vect3 = np.linalg.eig(unit_3) eig_vals3 = np.angle(eig_vals3) e = [] for k in eig_vals3: if k < 0: v = (k + 2*np.pi)/(2*np.pi) else: v = (k)/(2*np.pi) e.append(v) eig_vals3 = np.array(e) print("Eigenstates :", eig_vect3) print("Eigenvalues :", eig_vals3) bases3 , basis_indices3 = [], [] for _ in range(4): sample = unitary_group.rvs(8) basis = [] for k in sample: basis.append(np.array(k, dtype=complex)) ind = np.random.choice(range(8)) bases3.append(basis) basis_indices3.append(ind) print("Basis indices :",basis_indices3) costs_3qubit_b, errors_eig_3qubit_b, max_overlaps_3qubit_b = get_results( eig_vals3, eig_vect3, bases3, basis_indices3, unit_3, 'original', 4) generate_plots(3, costs_3qubit_b, errors_eig_3qubit_b, max_overlaps_3qubit_b, "Original") costs_3qubit_c, errors_eig_3qubit_c, max_overlaps_3qubit_c = get_results( eig_vals3, eig_vect3, bases3, basis_indices3, unit_3, 'modified', 4) generate_plots(3, costs_3qubit_c, errors_eig_3qubit_c, max_overlaps_3qubit_c, "Modified") unit_4 = unitary_group.rvs(16) # unit_4 eig_vals4, eig_vect4 = np.linalg.eig(unit_4) eig_vals4 = np.angle(eig_vals4) e = [] for k in eig_vals4: if k < 0: v = (k + 2*np.pi)/(2*np.pi) else: v = (k)/(2*np.pi) e.append(v) eig_vals4 = np.array(e) print("Eigenstates :", eig_vect4) print("Eigenvalues :", eig_vals4) bases4 , basis_indices4 = [], [] for _ in range(4): sample = unitary_group.rvs(16) basis = [] for k in sample: basis.append(np.array(k, dtype=complex)) ind = np.random.choice(range(16)) bases4.append(basis) basis_indices4.append(ind) print("Basis indices :",basis_indices4) costs_4qubit_b, errors_eig_4qubit_b, max_overlaps_4qubit_b = get_results( eig_vals4, eig_vect4, bases4, basis_indices4, unit_4, 'original', 4) generate_plots(4, costs_4qubit_b, errors_eig_4qubit_b, max_overlaps_4qubit_b, "Original") costs_4qubit_c, errors_eig_4qubit_c, max_overlaps_4qubit_c = get_results( eig_vals4, eig_vect4, bases4, basis_indices4, unit_4, 'modified', 4) generate_plots(4, costs_4qubit_c, errors_eig_4qubit_c,max_overlaps_4qubit_c, "Modified")
https://github.com/mrvee-qC-bee/SCQC23
mrvee-qC-bee
# Importing standard Qiskit libraries from qiskit import QuantumCircuit, transpile from qiskit.tools.jupyter import * from qiskit.visualization import * from ibm_quantum_widgets import * from qiskit.quantum_info import Statevector from qiskit_aer import AerSimulator # qiskit-ibmq-provider has been deprecated. # Please see the Migration Guides in https://ibm.biz/provider_migration_guide for more detail. from qiskit_ibm_runtime import QiskitRuntimeService, Sampler, Estimator, Session, Options # Loading your IBM Quantum account(s) service = QiskitRuntimeService(channel="ibm_quantum") # Invoke a primitive inside a session. For more details see https://qiskit.org/documentation/partners/qiskit_ibm_runtime/tutorials.html # with Session(backend=service.backend("ibmq_qasm_simulator")): # result = Sampler().run(circuits).result() import math #may be helpful coords = [] # Put your code here in this format: [radius, theta, phi] plot_bloch_vector(coords, coord_type='spherical') qc = QuantumCircuit(1) # Add your code here sv = Statevector(qc) plot_bloch_multivector(sv) # You will already have defined 'qc' in the code cell above. Use that circuit for this exercise. backend = # Choose your backend - this should be the Aer Simulator! job = # Run your circuit through a job result = # Get the result from the job counts = # Get the counts dictionary from the result plot_histogram(counts)
https://github.com/Ilan-Bondarevsky/qiskit_algorithm
Ilan-Bondarevsky
import sys import os current_dir = os.getcwd() sys.path.append(current_dir) from quantum_circuit import QuantumCircuit # import qiskit.providers.fake_provider from qiskit.transpiler import CouplingMap import qiskit_ibm_runtime.fake_provider from Backend.backend import Backend class FakeBackend(Backend): def __init__(self, backend_name : str) -> None: self.backend = FakeBackend.get_ibm_fake_backend(backend_name=backend_name) @staticmethod def get_ibm_fake_backend_name_list() -> list[str]: ibm_dir = dir(qiskit_ibm_runtime.fake_provider) return [val for val in ibm_dir if '__' not in val and 'Fake' in val] @staticmethod def get_ibm_fake_backend(backend_name : str): try: return getattr(qiskit_ibm_runtime.fake_provider, backend_name)() except: pass fake_backend_name = FakeBackend.get_ibm_fake_backend_name_list() for backend in fake_backend_name: backend = FakeBackend.get_ibm_fake_backend(backend) if backend is not None: try: if backend.name == backend_name: return backend except: pass return None @staticmethod def get_ibm_fake_backend_names_with_limit(min_qubit : int = 1, max_qubit: int = float('inf')) -> list[str]: limited_backend = [] fake_backend_name = FakeBackend.get_ibm_fake_backend_name_list() for backend in fake_backend_name: backend = FakeBackend.get_ibm_fake_backend(backend) if backend is not None: try: num_qubit = backend.num_qubits if num_qubit >= min_qubit and num_qubit <= max_qubit: limited_backend.append(backend.name) except: pass return limited_backend if __name__ == "__main__": print(FakeBackend.get_ibm_fake_backend_name_list()) backend = FakeBackend('fake_auckland') qc = QuantumCircuit(2) qc.x(0) qc.h(1) qc.measure_all() print(qc.draw()) job = backend.run(qc) print(job.result()) qc_transpile = backend.traspile_qiskit(qc)[0] print(qc_transpile.draw()) job = backend.run(qc_transpile) print(job.result())
https://github.com/pbark/qiskit_tutorials
pbark
# import common packages import numpy as np import matplotlib.pyplot as plt from qiskit import Aer, IBMQ, QuantumRegister from qiskit.providers.ibmq import least_busy from qiskit.providers.aer import noise # lib from Qiskit Aqua from qiskit.aqua import Operator, QuantumInstance from qiskit.aqua.algorithms import VQE, ExactEigensolver from qiskit.aqua.components.optimizers import COBYLA, SPSA, L_BFGS_B from qiskit.aqua.components.variational_forms import RY, RYRZ, SwapRZ # lib from Qiskit Aqua Chemistry from qiskit.chemistry import QiskitChemistry from qiskit.chemistry import FermionicOperator from qiskit.chemistry.drivers import PySCFDriver, UnitsType from qiskit.chemistry.aqua_extensions.components.variational_forms import UCCSD from qiskit.chemistry.aqua_extensions.components.initial_states import HartreeFock # setup qiskit.chemistry logging import logging from qiskit.chemistry import set_qiskit_chemistry_logging # function that allows us to create multiple figures in single notebook cell def show_figure(fig): dummy_fig = plt.figure() new_dummy_fig_manager = dummy_fig.canvas.manager new_dummy_fig_manager.canvas.figure = fig fig.set_canvas(new_dummy_fig_manager.canvas) set_qiskit_chemistry_logging(logging.INFO) # choose among DEBUG, INFO, WARNING, ERROR, CRITICAL and NOTSET driver = PySCFDriver(atom='H .0 .0 .0; H .0 .0 1.6', unit=UnitsType.ANGSTROM, charge=0, spin=0, basis='sto3g') molecule = driver.run() nuclear_repulsion_energy = molecule.nuclear_repulsion_energy num_particles = molecule.num_alpha + molecule.num_beta num_spin_orbitals = molecule.num_orbitals * 2 print("HF energy: {}".format(molecule.hf_energy - molecule.nuclear_repulsion_energy)) print("# of electrons: {}".format(num_particles)) print("# of spin orbitals: {}".format(num_spin_orbitals)) print("Contents of molecule object: \n{}".format(sorted(molecule.__dir__()))) # get the integrals from molecule object h1 = molecule.one_body_integrals h2 = molecule.two_body_integrals # create a fermionic operator ferOp = FermionicOperator(h1=h1, h2=h2) map_type = 'parity' # 'jordan_wigner', 'parity', 'bravyi_kitaev', 'bksf' # if 'parity' mapping is selected, reduce the number of qubits (-2 qubits) qubit_reduction = True if map_type == 'parity' else False qubitOp = ferOp.mapping(map_type=map_type, threshold=10**-10) # paulis with coefs below threshold are not considered qubitOp = qubitOp.two_qubit_reduced_operator(num_particles) if qubit_reduction else qubitOp qubitOp.chop(10**-10) # cut out the pauli strings with prefacator smaller then print(qubitOp) qubitOp.paulis # to see all the contents of given class # qubitOp.__dir__() # one can group the Paulis # qubitOp.to_grouped_paulis() # qubitOp.paulis for pauli in qubitOp.paulis: print(pauli[0],str(pauli[1])) max_iter = 200 # maximum number of iterations # optimizer = COBYLA(maxiter=max_iter) # optimizer = SPSA(maxiter=max_iter) optimizer = L_BFGS_B(maxiter=max_iter) HF_state = HartreeFock(qubitOp.num_qubits, num_spin_orbitals, num_particles, map_type, qubit_reduction) HF_state_vec = HF_state.construct_circuit(mode='vector') # we can use qiskit's vizualisation module to plot the state from qiskit.visualization import plot_state_city plot_state_city(HF_state_vec) # you might want to visualise on the Bloch sphere for a non-superposition state from qiskit.visualization import plot_state_city, plot_bloch_multivector plot_bloch_multivector(HF_state_vec) var_form_uccsd = UCCSD(qubitOp.num_qubits, depth=1, num_orbitals=num_spin_orbitals, num_particles=num_particles, active_occupied=None, active_unoccupied=None, # you could modify the active space here initial_state=HF_state, qubit_mapping=map_type, two_qubit_reduction=qubit_reduction, num_time_slices=1) var_form_swaprz = SwapRZ(qubitOp.num_qubits, depth=1, initial_state=HF_state) var_form_ryrz = RYRZ(qubitOp.num_qubits, depth=1, initial_state=HF_state) # var_form_ry = RY(qubitOp.num_qubits, depth=1, # initial_state=HF_state) simultation_type = 'state_vector'# qasm, qasm_cloud, real_device, state_vector if simultation_type == 'qasm': sv_mode = False qasm_simulator = Aer.get_backend('qasm_simulator') # qasm_simulator, ibmq_qasm_simulator # uncomment this and put your token from the IBMQ website. #IBMQ.save_account('Your IBMQ API-token', overwrite=True) IBMQ.load_accounts() # connect with your token to IBMQ provider = IBMQ.get_provider(hub='ibm-q', group='open', project='main') print(provider.backends()) # lists available backends # set the noise model device = provider.get_backend('ibmq_16_melbourne') # ibmq_16_melbourne properties = device.properties() coupling_map = device.configuration().coupling_map noise_model = noise.device.basic_device_noise_model(properties) basis_gates = noise_model.basis_gates shots = 8192 # choose the maximal number of shots (8192 is max on the ibmq_qasm_simulator) num_qubits = qubitOp.num_qubits # run on qasm_simulator quantum_instance = QuantumInstance(qasm_simulator, shots=shots, basis_gates=basis_gates, coupling_map=coupling_map, noise_model=noise_model) # all the details of noise model print(noise_model.to_dict()) elif simultation_type == 'qasm_cloud': sv_mode = False # uncomment this and put your token from the IBMQ website. #IBMQ.save_account('Your IBMQ API-token', overwrite=True) IBMQ.load_accounts() # connect with your token to IBMQ provider = IBMQ.get_provider(hub='ibm-q', group='open', project='main') print(provider.backends()) # lists available backends qasm_simulator_cloud = provider.get_backend('ibmq_qasm_simulator') # ibmq_16_melbourne , ibmq_qasm_simulator # set the qasm cloud simulator shots = 8192 quantum_instance = QuantumInstance(qasm_simulator_cloud, shots=shots) elif simultation_type == 'real_device': sv_mode = False # uncomment this and put your token from the IBMQ website. #IBMQ.save_account('Your IBMQ API-token', overwrite=True) IBMQ.load_accounts() # connect with your token to IBMQ provider = IBMQ.get_provider(hub='ibm-q', group='open', project='main') print(provider.backends()) # lists available backends # set the noise model device = provider.get_backend('ibmq_16_melbourne') # ibmq_16_melbourne # run on qasm_simulator shots = 8192 quantum_instance = QuantumInstance(device, shots=shots) elif simultation_type == 'state_vector': sv_mode = True num_qubits = qubitOp.num_qubits sv_simulator = Aer.get_backend('statevector_simulator') quantum_instance = QuantumInstance(sv_simulator) else: raise Exception('Please select for simultation_type == qasm, qasm_cloud, real_device, state_vector') vqe_uccsd = VQE(qubitOp, var_form_uccsd, optimizer) vqe_ryrz = VQE(qubitOp, var_form_ryrz, optimizer) vqe_swaprz = VQE(qubitOp, var_form_swaprz, optimizer) for pauli in qubitOp.paulis: print('Circuit for:', pauli[1]) circuit_uccsd = vqe_uccsd.construct_circuit(statevector_mode=sv_mode, parameter=np.ones(var_form_uccsd._num_parameters)) for i in range(len(circuit_uccsd)): fig = circuit_uccsd[i].draw(output='mpl') show_figure(fig) fig.show() circuit_swaprz = vqe_swaprz.construct_circuit(statevector_mode=sv_mode, parameter=np.ones(var_form_swaprz._num_parameters)) circuit_swaprz[1].draw(output='mpl') circuit_ryrz = vqe_ryrz.construct_circuit(statevector_mode=sv_mode, parameter=np.ones(var_form_ryrz._num_parameters)) circuit_ryrz[1].draw(output='mpl') results = vqe_uccsd.run(quantum_instance) print('The computed ground state energy is: {:.12f}'.format(results['eigvals'][0])) print('The total ground state energy is: {:.12f}'.format(results['eigvals'][0] + nuclear_repulsion_energy)) print("Parameters: {}".format(results['opt_params'])) evolution_time = 100 # how many time steps num_time_slices = 4 # number of Trotter steps qr = QuantumRegister(num_qubits,'q') initial_circuit = HF_state.construct_circuit(mode='circuit') evolution_circuit = qubitOp.evolve(state_in=initial_circuit, evo_time=evolution_time, evo_mode='circuit',num_time_slices=num_time_slices, expansion_mode='trotter') evolution_circuit.draw(output='mpl') max_time=evolution_time statevector_of_t = np.zeros([max_time,2*num_qubits]) for evo_t in range(max_time): evolution_circuit = qubitOp.evolve(state_in=initial_circuit, evo_time=evo_t, evo_mode='circuit',num_time_slices=num_time_slices, expansion_mode='trotter') result = quantum_instance.execute(evolution_circuit) statevector_of_t[evo_t,:] = np.asarray(result.get_statevector(evolution_circuit)) time_min = 0 time_max = 4 for i in range(time_min, time_max): fig = plot_state_city(statevector_of_t[i,:]) show_figure(fig) fig.show() # First, we use classical eigendecomposition to get ground state energy (including nuclear repulsion energy) as reference. qiskit_chemistry_dict = { 'driver': {'name': 'HDF5'}, 'HDF5': {'hdf5_input': 'H2/H2_equilibrium_0.735_sto-3g.hdf5'}, 'operator': {'name':'hamiltonian', 'qubit_mapping': 'parity', 'two_qubit_reduction': True}, 'algorithm': {'name': 'ExactEigensolver'} } solver = QiskitChemistry() result_classical = solver.run(qiskit_chemistry_dict) # Second, we use variational quantum eigensolver (VQE) qiskit_chemistry_dict['algorithm']['name'] = 'VQE' qiskit_chemistry_dict['optimizer'] = {'name': 'SPSA', 'max_trials': 350} qiskit_chemistry_dict['variational_form'] = {'name': 'RYRZ', 'depth': 3, 'entanglement':'full'} backend = Aer.get_backend('statevector_simulator') solver = QiskitChemistry() result = solver.run(qiskit_chemistry_dict, backend=backend) # We print out the results print('Ground state energy (classical): {:.12f}'.format(result_classical['energy'])) print('Ground state energy (quantum) : {:.12f}'.format(result['energy'])) print("====================================================") # You can also print out other info in the field 'printable' for line in result['printable']: print(line) molecule='H2' maxiter = 10 # increase to allow optimizer to converge, set low to test mol_distances = np.arange(0.2, 3.1, 0.2) mol_distances_vqe = np.arange(0.2, 3.1,1) # Exact eigensolver qiskit_chemistry_dict_ee = { 'driver': {'name': 'HDF5'}, 'HDF5': {'hdf5_input': ''}, 'operator': {'name':'hamiltonian', 'qubit_mapping': 'parity', 'two_qubit_reduction': True}, 'algorithm': {'name': 'ExactEigensolver'} } # choose which backend want to use # backend = Aer.get_backend('qasm_simulator') backend = Aer.get_backend('statevector_simulator') # VQE qiskit_chemistry_dict_vqe = { 'driver': {'name': 'HDF5'}, 'HDF5': {'hdf5_input': ''}, 'operator': {'name':'hamiltonian', 'qubit_mapping': 'parity', 'two_qubit_reduction': True}, 'algorithm': {'name': 'VQE'}, 'optimizer': {'name': 'L_BFGS_B', 'maxiter': maxiter}, # or SPSA, max_trials=200 'variational_form': {'name': 'RY', 'depth': 1, 'entanglement':'full'}, # RYRZ, UCCSD (delete entanglement field) 'backend': {'shots': 1024} } algos = ['ExactEigensolver', 'VQE'] energy = np.zeros((len(algos), len(mol_distances))) energy_vqe = np.zeros((len(algos), len(mol_distances_vqe))) # Run the algos for j, algo in enumerate([qiskit_chemistry_dict_ee, qiskit_chemistry_dict_vqe]): algo_name = algo['algorithm']['name'] print("Using {}".format(algo_name)) if algo_name == 'VQE': for i, dis in enumerate(mol_distances_vqe): print("Processing atomic distance: {:1.1f} Angstrom".format(dis), end='\r') algo['HDF5']['hdf5_input'] = "{}/{:1.1f}_sto-3g.hdf5".format(molecule, dis) result = solver.run(algo, backend=backend if algo_name == 'VQE' else None) energy_vqe[j][i] = result['energy'] else: for i, dis in enumerate(mol_distances): print("Processing atomic distance: {:1.1f} Angstrom".format(dis), end='\r') algo['HDF5']['hdf5_input'] = "{}/{:1.1f}_sto-3g.hdf5".format(molecule, dis) result = solver.run(algo, backend=backend if algo_name == 'VQE' else None) energy[j][i] = result['energy'] for i, algo in enumerate(algos): if algo == 'VQE': plt.plot(mol_distances_vqe, energy_vqe[i], label=algo, linestyle='', marker='x') else: plt.plot(mol_distances, energy[i], label=algo) plt.xlabel('Atomic distance (Angstrom)') plt.ylabel('Energy [Ha]') plt.legend() plt.show() mol_distances_errors = [] energy_errors = [] for i, pts_vqe in enumerate(mol_distances_vqe): for j, pts in enumerate(mol_distances): # find the entries with same bond distances if pts_vqe == pts: mol_distances_errors.append(pts) energy_errors.append(abs(energy[0][j]-energy_vqe[1][i])) # plot the errors print('Errors |Exact - VQE|:\n',energy_errors) plt.plot(mol_distances_errors, energy_errors, label='Errors(Exact-VQE)', linestyle='', marker='x') # chemical accuracy of 1 mHa plt.hlines(0.001, 0, 3, colors='k', label='Chemical Accuracy') plt.legend() plt.show() import qiskit.tools.jupyter %qiskit_version_table %qiskit_copyright
https://github.com/Z-928/Bugs4Q
Z-928
from qiskit import * qc = QuantumCircuit(2) qc.h(i) qc.crz (PI/4, 0, 1)
https://github.com/GIRISHBELANI/QC_Benchmarks_using_dm-simulator
GIRISHBELANI
""" This file allows to test the various QFT implemented. The user must specify: 1) The number of qubits it wants the QFT to be implemented on 2) The kind of QFT want to implement, among the options: -> Normal QFT with SWAP gates at the end -> Normal QFT without SWAP gates at the end -> Inverse QFT with SWAP gates at the end -> Inverse QFT without SWAP gates at the end The user must can also specify, in the main function, the input quantum state. By default is a maximal superposition state This file uses as simulator the local simulator 'statevector_simulator' because this simulator saves the quantum state at the end of the circuit, which is exactly the goal of the test file. This simulator supports sufficient qubits to the size of the QFTs that are going to be used in Shor's Algorithm because the IBM simulator only supports up to 32 qubits """ """ Imports from qiskit""" from qiskit import QuantumCircuit, ClassicalRegister, QuantumRegister from qiskit import execute, IBMQ, BasicAer """ Imports to Python functions """ import time """ Local Imports """ from qfunctions import create_QFT, create_inverse_QFT """ Function to properly print the final state of the simulation """ """ This is only possible in this way because the program uses the statevector_simulator """ def show_good_coef(results, n): i=0 max = pow(2,n) if max > 100: max = 100 """ Iterate to all possible states """ while i<max: binary = bin(i)[2:].zfill(n) number = results.item(i) number = round(number.real, 3) + round(number.imag, 3) * 1j """ Print the respective component of the state if it has a non-zero coefficient """ if number!=0: print('|{}>'.format(binary),number) i=i+1 """ Main program """ if __name__ == '__main__': """ Select how many qubits want to apply the QFT on """ n = int(input('\nPlease select how many qubits want to apply the QFT on: ')) """ Select the kind of QFT to apply using the variable what_to_test: what_to_test = 0: Apply normal QFT with the SWAP gates at the end what_to_test = 1: Apply normal QFT without the SWAP gates at the end what_to_test = 2: Apply inverse QFT with the SWAP gates at the end what_to_test = 3: Apply inverse QFT without the SWAP gates at the end """ print('\nSelect the kind of QFT to apply:') print('Select 0 to apply normal QFT with the SWAP gates at the end') print('Select 1 to apply normal QFT without the SWAP gates at the end') print('Select 2 to apply inverse QFT with the SWAP gates at the end') print('Select 3 to apply inverse QFT without the SWAP gates at the end\n') what_to_test = int(input('Select your option: ')) if what_to_test<0 or what_to_test>3: print('Please select one of the options') exit() print('\nTotal number of qubits used: {0}\n'.format(n)) print('Please check source file to change input quantum state. By default is a maximal superposition state with |+> in every qubit.\n') ts = time.time() """ Create quantum and classical registers """ quantum_reg = QuantumRegister(n) classic_reg = ClassicalRegister(n) """ Create Quantum Circuit """ circuit = QuantumCircuit(quantum_reg, classic_reg) """ Create the input state desired Please change this as you like, by default we put H gates in every qubit, initializing with a maximimal superposition state """ #circuit.h(quantum_reg) """ Test the right QFT according to the variable specified before""" if what_to_test == 0: create_QFT(circuit,quantum_reg,n,1) elif what_to_test == 1: create_QFT(circuit,quantum_reg,n,0) elif what_to_test == 2: create_inverse_QFT(circuit,quantum_reg,n,1) elif what_to_test == 3: create_inverse_QFT(circuit,quantum_reg,n,0) else: print('Noting to implement, exiting program') exit() """ show results of circuit creation """ create_time = round(time.time()-ts, 3) if n < 8: print(circuit) print(f"... circuit creation time = {create_time}") ts = time.time() """ Simulate the created Quantum Circuit """ simulation = execute(circuit, backend=BasicAer.get_backend('statevector_simulator'),shots=1) """ Get the results of the simulation in proper structure """ sim_result=simulation.result() """ Get the statevector of the final quantum state """ outputstate = sim_result.get_statevector(circuit, decimals=3) """ show execution time """ exec_time = round(time.time()-ts, 3) print(f"... circuit execute time = {exec_time}") """ Print final quantum state to user """ print('The final state after applying the QFT is:\n') show_good_coef(outputstate,n)
https://github.com/zeynepCankara/Introduction-Quantum-Programming
zeynepCankara
# let's print all numbers between 0 and 9 for i in range(10): print(i) # range(n) represents the list of all numbers from 0 to n-1 # i is the variable to take the values in the range(n) iteratively: 0, 1, ..., 9 in our example # let's write the same code in two lines for i in range(10): # do not forget to use colon print(i) # the second line is indented # this means that the command in the second line will be executed inside the for-loop # any other code executed inside the for-loop must be intented in the same way #my_code_inside_for-loop_2 will come here #my_code_inside_for-loop_3 will come here #my_code_inside_for-loop_4 will come here # now I am out of the scope of for-loop #my_code_outside_for-loop_1 will come here #my_code_outside_for-loop_2 will come here # let's calculate the summation 1+2+...+10 by using a for-loop # we use variable total for the total summation total = 0 for i in range(11): # do not forget to use colon total = total + i # total is increased by i in each iteration # alternatively, the same assignment can shortly be written as total += i similarly to languages C, C++, Java, etc. # now I am out of the scope of for-loop # let's print the latest value of total print(total) # let's calculate the summation 10+12+14+...+44 # we create a list having all numbers in the summation # for this purpose, this time we will use three parameters in range total = 0 for j in range(10,45,2): # the range is defined between 10 and 44, and the value of j will be increased by 2 after each iteration total += j # let's use the shortened version of total = total + j print(total) # let's calculate the summation 1+2+4+8+16+...+256 # remark that 256 = 2*2*...*2 (8 times) total = 0 current_number = 1 # this value will be multiplied by 2 after each iteration for k in range(9): total = total + current_number # current_number is 1 at the beginning, and its value will be doubled after each iteration current_number = 2 * current_number # let's double the value of the current_number for the next iteration # short version of the same assignment: current_number *= 2 as in the languages C, C++, Java, etc. # now I am out of the scope of for-loop # let's print the latest value of total print(total) # instead of a range, we can directly use a list for i in [1,10,100,1000,10000]: print(i) # instead of [...], we can also use (...) # but this time it is a tuple, not a list (keep in your mind that the values in a tuple cannot be changed) for i in (1,10,100,1000,10000): print(i) # let's create a range between 10 and 91 that contains the multiples of 7 for j in range(14,92,7): # 14 is the first multiple of 7 greater than or equal to 10 # 91 should be in the range, and so we write 92 print(j) # let's create a range between 11 and 22 for i in range(11,23): print(i) # we can also use variables in range n = 5 for j in range(n,2*n): print(j) # we will print all numbers in {n,n+1,n+2,...,2n-1} # we can use a list of strings for name in ("Asja","Balvis","Fyodor"): print("Hello",name,":-)") # any range can be converted to a list L1 = list(range(10)) print(L1) L2 = list(range(55,200,11)) print(L2) # # your solution is here # # # your solution is here # # let's calculate the summation 1+2+4+8+...+256 by using a while-loop total = 0 i = 1 #while condition(s): # your_code1 # your_code2 # your_code3 while i < 257: # this loop iterates as long as i is less than 257 total = total + i i = i * 2 # i is doubled in each iteration, and so soon it will be greater than 256 print(total) # remember that we calculated this summation as 511 before L = [0,1,2,3,4,5,11] # this is a list containing 7 integer values i = 0 while i in L: # this loop will be iterated as long as i is in L print(i) i = i + 1 # the value of i iteratively increased, and so soon it will hit a value not in the list L # the loop is terminated after i is set to 6, because 6 is not in L # let's use negation in the condition of while-loop L = [10] # this list has a single element i = 0 while i not in L: # this loop will be iterated as long as i is not equal to 10 print(i) i = i+1 # the value of i will hit 10 after ten iterations # let's rewrite the same loop by using a direct inequality i = 0 while i != 10: # "!=" is used for "not equal to" operator print(i) i=i+1 # let's rewrite the same loop by using negation of equality i = 0 while not (i == 10): # "==" is used for "equal to" operator print(i) i=i+1 # while-loop seems having more fun :-) # but we should be more careful when writing the condition(s)! # summation and n is zero at the beginning S = 0 n = 0 while S < 1000: # this loop will stop after S exceeds 999 (S = 1000 or S > 1000) n = n +1 S = S + n # let's print n and S print("n =",n," S =",S) # three examples for the operator "less than or equal to" #print (4 <= 5) #print (5 <= 5) #print (6 <= 5) # you may comment out the above three lines and see the results by running this cell # # your solution is here # # this is the code for including function randrange into our program from random import randrange # randrange(n) picks a number from the list [0,1,2,...,n-1] randomly #r = randrange(100) #print(r) # # your solution is here # # here is a schematic example for double nested loops #for i in range(10): # your_code1 # your_code2 # while j != 7: # your_code_3 # your_code_4 # # your solution is here #
https://github.com/qiskit-community/qiskit-translations-staging
qiskit-community
from qiskit_nature.second_q.drivers import PySCFDriver from qiskit_nature.second_q.problems import ElectronicBasis driver = PySCFDriver() driver.run_pyscf() ao_problem = driver.to_problem(basis=ElectronicBasis.AO) print(ao_problem.basis) ao_hamil = ao_problem.hamiltonian print(ao_hamil.electronic_integrals.alpha) from qiskit_nature.second_q.formats.qcschema_translator import get_ao_to_mo_from_qcschema qcschema = driver.to_qcschema() basis_transformer = get_ao_to_mo_from_qcschema(qcschema) print(basis_transformer.initial_basis) print(basis_transformer.final_basis) mo_problem = basis_transformer.transform(ao_problem) print(mo_problem.basis) mo_hamil = mo_problem.hamiltonian print(mo_hamil.electronic_integrals.alpha) import numpy as np from qiskit_nature.second_q.operators import ElectronicIntegrals from qiskit_nature.second_q.problems import ElectronicBasis from qiskit_nature.second_q.transformers import BasisTransformer ao2mo_alpha = np.random.random((2, 2)) ao2mo_beta = np.random.random((2, 2)) basis_transformer = BasisTransformer( ElectronicBasis.AO, ElectronicBasis.MO, ElectronicIntegrals.from_raw_integrals(ao2mo_alpha, h1_b=ao2mo_beta), ) from qiskit_nature.second_q.drivers import PySCFDriver driver = PySCFDriver(atom="Li 0 0 0; H 0 0 1.5") full_problem = driver.run() print(full_problem.molecule) print(full_problem.num_particles) print(full_problem.num_spatial_orbitals) from qiskit_nature.second_q.transformers import FreezeCoreTransformer fc_transformer = FreezeCoreTransformer() fc_problem = fc_transformer.transform(full_problem) print(fc_problem.num_particles) print(fc_problem.num_spatial_orbitals) print(fc_problem.hamiltonian.constants) fc_transformer = FreezeCoreTransformer(remove_orbitals=[4, 5]) fc_problem = fc_transformer.transform(full_problem) print(fc_problem.num_particles) print(fc_problem.num_spatial_orbitals) from qiskit_nature.second_q.drivers import PySCFDriver driver = PySCFDriver(atom="Li 0 0 0; H 0 0 1.5") full_problem = driver.run() print(full_problem.num_particles) print(full_problem.num_spatial_orbitals) from qiskit_nature.second_q.transformers import ActiveSpaceTransformer as_transformer = ActiveSpaceTransformer(2, 2) as_problem = as_transformer.transform(full_problem) print(as_problem.num_particles) print(as_problem.num_spatial_orbitals) print(as_problem.hamiltonian.electronic_integrals.alpha) as_transformer = ActiveSpaceTransformer(2, 2, active_orbitals=[0, 4]) as_problem = as_transformer.transform(full_problem) print(as_problem.num_particles) print(as_problem.num_spatial_orbitals) print(as_problem.hamiltonian.electronic_integrals.alpha) import qiskit.tools.jupyter %qiskit_version_table %qiskit_copyright
https://github.com/jaykomarraju/Quantum-Optimization-for-Solar-Farm
jaykomarraju
import numpy as np import networkx as nx from qiskit import Aer from qiskit.algorithms import QAOA, NumPyMinimumEigensolver from qiskit.algorithms.optimizers import COBYLA from qiskit.utils import QuantumInstance from qiskit_optimization import QuadraticProgram from qiskit_optimization.algorithms import MinimumEigenOptimizer num_time_slots = 24 # Define the QUBO problem qubo = QuadraticProgram() # Add binary variables for charging (c) and discharging (d) states for t in range(num_time_slots): qubo.binary_var(f'c_{t}') qubo.binary_var(f'd_{t}') # Define the objective function # (In practice, you need to calculate Jij and hi based on the solar farm data) Jij = np.random.rand(num_time_slots, num_time_slots) * 0.5 hi_c = -1 + np.random.rand(num_time_slots) hi_d = 1 - np.random.rand(num_time_slots) # Set linear and quadratic terms of the objective function linear_terms = {} quadratic_terms = {} for t in range(num_time_slots): linear_terms[f'c_{t}'] = hi_c[t] linear_terms[f'd_{t}'] = hi_d[t] for s in range(num_time_slots): if t != s: quadratic_terms[(f'c_{t}', f'c_{s}')] = Jij[t, s] quadratic_terms[(f'd_{t}', f'd_{s}')] = Jij[t, s] qubo.minimize(linear=linear_terms, quadratic=quadratic_terms) # Set up the quantum instance backend = Aer.get_backend('qasm_simulator') quantum_instance = QuantumInstance(backend, seed_simulator=42, seed_transpiler=42, shots=10000) # Set up the QAOA algorithm and optimizer optimizer = COBYLA(maxiter=500) qaoa = QAOA(optimizer=optimizer, reps=5, quantum_instance=quantum_instance) # Set up the minimum eigen optimizer min_eig_optimizer = MinimumEigenOptimizer(qaoa) # Solve the problem result = min_eig_optimizer.solve(qubo) print("QAOA result:", result) # Solve the problem using a classical solver (NumPyMinimumEigensolver) exact_solver = MinimumEigenOptimizer(NumPyMinimumEigensolver()) exact_result = exact_solver.solve(qubo) print("Classical result:", exact_result)
https://github.com/Alice-Bob-SW/qiskit-alice-bob-provider
Alice-Bob-SW
from typing import Iterator, List, Set, Tuple import numpy as np import pytest from qiskit import QuantumCircuit, execute from qiskit_aer.backends import AerSimulator from qiskit_aer.noise import NoiseModel, pauli_error from qiskit_alice_bob_provider.local.backend import ProcessorSimulator from qiskit_alice_bob_provider.local.job import ProcessorSimulationJob from qiskit_alice_bob_provider.processor.description import ( AppliedInstruction, InstructionProperties, ProcessorDescription, ) from qiskit_alice_bob_provider.processor.interpolated_cat import ( InterpolatedCatProcessor, ) from qiskit_alice_bob_provider.processor.serialization.model import ( SerializedProcessor, ) from qiskit_alice_bob_provider.processor.utils import pauli_errors_to_chi from .processor_fixture import ( LargeSimpleProcessor, OneQubitProcessor, SimpleAllToAllProcessor, SimpleProcessor, ) def gen_circuits() -> Iterator[Tuple[str, QuantumCircuit, Set[str]]]: circ = QuantumCircuit(2, 2) circ.initialize('0', 0) circ.initialize('+', 1) circ.x(0) circ.cx(0, 1) circ.measure(0, 0) circ.measure_x(1, 1) yield ('everything_circuit', circ, {'11'}) @pytest.mark.parametrize( ['tup', 'backend'], ( (tup, backend) for tup in gen_circuits() for backend in [ ProcessorSimulator(SimpleProcessor()), ProcessorSimulator( SimpleAllToAllProcessor(), translation_stage_plugin='sk_synthesis', ), ] ), ) def test_circuit( tup: Tuple[str, QuantumCircuit, Set[str]], backend: ProcessorSimulator ) -> None: _, circ, expected_keys = tup # backend = ProcessorSimulator(SimpleProcessor()) job: ProcessorSimulationJob = execute(circ, backend) result = job.result() try: assert result.get_counts().keys() == expected_keys except AssertionError: print('==== Original circuit ====') print(circ) print('==== Scheduled circuit ====') print(job.circuits()[0]) print('==== Noisy circuit ====') print(job.noisy_circuits()[0]) raise def test_multiple_experiments() -> None: circ1 = QuantumCircuit(1, 1) circ1.x(0) circ1.measure(0, 0) circ2 = QuantumCircuit(1, 1) circ2.initialize('+') circ2.measure_x(0, 0) backend = ProcessorSimulator(SimpleProcessor()) job: ProcessorSimulationJob = execute([circ1, circ2], backend) result = job.result() assert len(result.get_counts()) == 2 def test_non_default_shots() -> None: circ = QuantumCircuit(1, 1) circ.x(0) circ.measure(0, 0) shots = 5 backend = ProcessorSimulator(SimpleProcessor()) job: ProcessorSimulationJob = execute(circ, backend, shots=shots) result = job.result() assert sum(result.get_counts().values()) == shots class _CXProcessor(ProcessorDescription): clock_cycle = 1 def all_instructions(self) -> Iterator[InstructionProperties]: for i in range(2): yield InstructionProperties(name='p0', params=[], qubits=(i,)) yield InstructionProperties(name='mz', params=[], qubits=(i,)) yield InstructionProperties(name='cx', params=[], qubits=(0, 1)) yield InstructionProperties(name='cx', params=[], qubits=(1, 0)) def apply_instruction( self, name: str, qubits: Tuple[int, ...], params: List[float] ) -> AppliedInstruction: if name == 'cx': return AppliedInstruction( duration=self.clock_cycle, quantum_errors=pauli_errors_to_chi({'IX': 1.0}), readout_errors=None, ) return AppliedInstruction( duration=self.clock_cycle, quantum_errors=None, readout_errors=None, ) def gen_circuits_ordering() -> Iterator[Tuple[str, QuantumCircuit]]: circ = QuantumCircuit(2, 2) circ.cx(0, 1) circ.measure(0, 0) circ.measure(1, 1) yield ('01_circuit', circ) circ = QuantumCircuit(2, 2) circ.cx(1, 0) circ.measure(0, 0) circ.measure(1, 1) yield ('10_circuit', circ) @pytest.mark.parametrize('tup', gen_circuits_ordering()) def test_qubit_ordering(tup: Tuple[str, QuantumCircuit]) -> None: _, circ = tup aer = AerSimulator() nm = NoiseModel() nm.add_all_qubit_quantum_error(pauli_error([('IX', 1.0)]), 'cx') aer_counts = execute(circ, aer, noise_model=nm).result().get_counts() backend = ProcessorSimulator(_CXProcessor()) proc_counts = execute(circ, backend).result().get_counts() try: assert aer_counts == proc_counts except AssertionError: print(circ) def test_interpolated_cat() -> None: with open( 'tests/processor/serialization/data/all_types.json', encoding='utf-8', ) as f: ser = SerializedProcessor.model_validate_json(f.read()) proc = InterpolatedCatProcessor(ser, alpha=np.sqrt(5)) backend = ProcessorSimulator(proc) circ = QuantumCircuit(2, 2) circ.initialize('+', 0) circ.initialize('0', 1) circ.x(0) circ.delay(800, 0, unit='s') circ.y(0) circ.rz(1.57, 0) circ.cx(0, 1) circ.measure_x(0, 0) circ.measure(0, 1) job = execute(circ, backend) assert isinstance(job, ProcessorSimulationJob) noisy_circ = job.noisy_circuits()[0] assert len(noisy_circ.get_instructions('p0_error')) == 1 assert len(noisy_circ.get_instructions('p+_error')) == 1 assert len(noisy_circ.get_instructions('mx_error')) == 1 assert len(noisy_circ.get_instructions('x_error')) == 1 assert len(noisy_circ.get_instructions('y_error')) == 0 assert len(noisy_circ.get_instructions('rz_error')) == 1 assert len(noisy_circ.get_instructions('cx_error')) == 1 assert len(noisy_circ.get_instructions('mx_error')) == 1 assert len(noisy_circ.get_instructions('mz_error')) == 1 assert len(noisy_circ.get_instructions('delay')) == 1 # The next lines test that we can simulate without errors job.result().get_counts() def test_no_delay() -> None: """This test makes sure that quantum errors get inserted even when there are no delay in the circuit after scheduling.""" backend = ProcessorSimulator(OneQubitProcessor()) circ = QuantumCircuit(1, 1) circ.initialize('+') circ.measure_x(0, 0) assert execute(circ, backend, shots=1).result().get_counts() == {'1': 1} class _ConditioningProcessor(ProcessorDescription): def __init__(self, clock_cycle: float = 1): self.clock_cycle = clock_cycle self.n_qubits = 2 def all_instructions(self) -> Iterator[InstructionProperties]: yield InstructionProperties(name='p+', params=[], qubits=None) yield InstructionProperties(name='p-', params=[], qubits=None) yield InstructionProperties(name='mx', params=[], qubits=None) yield InstructionProperties(name='x', params=[], qubits=None) def apply_instruction( self, name: str, qubits: Tuple[int, ...], params: List[float] ) -> AppliedInstruction: if name == 'mx': return AppliedInstruction( duration=1e4, quantum_errors=None, readout_errors=None, ) elif name in {'p+', 'p-'}: return AppliedInstruction( duration=1e2, quantum_errors=None, readout_errors=None, ) elif name == 'x': return AppliedInstruction( duration=1e3, quantum_errors=pauli_errors_to_chi({'Z': 1.0}), readout_errors=None, ) raise NotImplementedError() def test_conditional_instruction() -> None: # Noiseless backend, except the X gate that has a 100% Z-flip error backend = ProcessorSimulator(_ConditioningProcessor()) circ = QuantumCircuit(2, 2) circ.initialize('++') circ.measure_x(0, 0) circ.x(1).c_if(0, 0) circ.measure_x(1, 1) assert execute(circ, backend, shots=1).result().get_counts() == {'10': 1} circ = QuantumCircuit(2, 2) circ.initialize('+-') circ.measure_x(0, 0) circ.x(1).c_if(0, 0) circ.measure_x(1, 1) job = execute(circ, backend, shots=1) assert job.result().get_counts() == {'01': 1} def test_large_processor() -> None: """A processor with more qubits (40 here) than accepted by AerSimulator (29 on my machine, this is based on system memory) would fail. A fix was implemented in local/backend.py""" backend = ProcessorSimulator(LargeSimpleProcessor()) circ = QuantumCircuit(1, 1) circ.initialize('0') circ.delay(1, 0, unit='s') circ.measure(0, 0) execute(circ, backend)
https://github.com/msramalho/Teach-Me-Quantum
msramalho
import qiskit from qiskit import IBMQ # requires qiskit version >= 0.6 IBMQ.save_account("MY_TOKEN") IBMQ.load_accounts() for backend in IBMQ.backends(): print(backend) backend_0 = IBMQ.backends()[0] # retrieve the Backend at index 0 print(backend_0.configuration()) print("Go check its specification at %s" % backend_0.configuration()["url"])
https://github.com/indian-institute-of-science-qc/qiskit-aakash
indian-institute-of-science-qc
# This code is part of Qiskit. # # (C) Copyright IBM 2017, 2019. # # This code is licensed under the Apache License, Version 2.0. You may # obtain a copy of this license in the LICENSE.txt file in the root directory # of this source tree or at http://www.apache.org/licenses/LICENSE-2.0. # # Any modifications or derivative works of this code must retain this # copyright notice, and modified files need to carry a notice indicating # that they have been altered from the originals. """Assembler Test.""" import unittest import io from logging import StreamHandler, getLogger import sys import copy import numpy as np from qiskit import pulse from qiskit.circuit import Instruction, Gate, Parameter, ParameterVector from qiskit.circuit import QuantumRegister, ClassicalRegister, QuantumCircuit from qiskit.compiler.assembler import assemble from qiskit.exceptions import QiskitError from qiskit.pulse import Schedule, Acquire, Play from qiskit.pulse.channels import MemorySlot, AcquireChannel, DriveChannel, MeasureChannel from qiskit.pulse.configuration import Kernel, Discriminator from qiskit.pulse.library import gaussian from qiskit.qobj import QasmQobj, PulseQobj from qiskit.qobj.utils import MeasLevel, MeasReturnType from qiskit.pulse.macros import measure from qiskit.test import QiskitTestCase from qiskit.providers.fake_provider import ( FakeOpenPulse2Q, FakeOpenPulse3Q, FakeYorktown, FakeHanoi, ) class RxGate(Gate): """Used to test custom gate assembly. Useful for testing pulse gates with parameters, as well. Note: Parallel maps (e.g., in assemble_circuits) pickle their input, so circuit features have to be defined top level. """ def __init__(self, theta): super().__init__("rxtheta", 1, [theta]) class TestCircuitAssembler(QiskitTestCase): """Tests for assembling circuits to qobj.""" def setUp(self): super().setUp() qr = QuantumRegister(2, name="q") cr = ClassicalRegister(2, name="c") self.circ = QuantumCircuit(qr, cr, name="circ") self.circ.h(qr[0]) self.circ.cx(qr[0], qr[1]) self.circ.measure(qr, cr) self.backend = FakeYorktown() self.backend_config = self.backend.configuration() self.num_qubits = self.backend_config.n_qubits # lo test values self.default_qubit_lo_freq = [5e9 for _ in range(self.num_qubits)] self.default_meas_lo_freq = [6.7e9 for _ in range(self.num_qubits)] self.user_lo_config_dict = { pulse.DriveChannel(0): 5.55e9, pulse.MeasureChannel(0): 6.64e9, pulse.DriveChannel(3): 4.91e9, pulse.MeasureChannel(4): 6.1e9, } self.user_lo_config = pulse.LoConfig(self.user_lo_config_dict) def test_assemble_single_circuit(self): """Test assembling a single circuit.""" qobj = assemble(self.circ, shots=2000, memory=True) self.assertIsInstance(qobj, QasmQobj) self.assertEqual(qobj.config.shots, 2000) self.assertEqual(qobj.config.memory, True) self.assertEqual(len(qobj.experiments), 1) self.assertEqual(qobj.experiments[0].instructions[1].name, "cx") def test_assemble_multiple_circuits(self): """Test assembling multiple circuits, all should have the same config.""" qr0 = QuantumRegister(2, name="q0") qc0 = ClassicalRegister(2, name="c0") circ0 = QuantumCircuit(qr0, qc0, name="circ0") circ0.h(qr0[0]) circ0.cx(qr0[0], qr0[1]) circ0.measure(qr0, qc0) qr1 = QuantumRegister(3, name="q1") qc1 = ClassicalRegister(3, name="c1") circ1 = QuantumCircuit(qr1, qc1, name="circ0") circ1.h(qr1[0]) circ1.cx(qr1[0], qr1[1]) circ1.cx(qr1[0], qr1[2]) circ1.measure(qr1, qc1) qobj = assemble([circ0, circ1], shots=100, memory=False, seed_simulator=6) self.assertIsInstance(qobj, QasmQobj) self.assertEqual(qobj.config.seed_simulator, 6) self.assertEqual(len(qobj.experiments), 2) self.assertEqual(qobj.experiments[1].config.n_qubits, 3) self.assertEqual(len(qobj.experiments), 2) self.assertEqual(len(qobj.experiments[1].instructions), 6) def test_assemble_no_run_config(self): """Test assembling with no run_config, relying on default.""" qobj = assemble(self.circ) self.assertIsInstance(qobj, QasmQobj) self.assertEqual(qobj.config.shots, 1024) def test_shots_greater_than_max_shots(self): """Test assembling with shots greater than max shots""" self.assertRaises(QiskitError, assemble, self.backend, shots=1024000) def test_shots_not_of_type_int(self): """Test assembling with shots having type other than int""" self.assertRaises(QiskitError, assemble, self.backend, shots="1024") def test_shots_of_type_numpy_int64(self): """Test assembling with shots having type numpy.int64""" qobj = assemble(self.circ, shots=np.int64(2048)) self.assertEqual(qobj.config.shots, 2048) def test_default_shots_greater_than_max_shots(self): """Test assembling with default shots greater than max shots""" self.backend_config.max_shots = 5 qobj = assemble(self.circ, self.backend) self.assertIsInstance(qobj, QasmQobj) self.assertEqual(qobj.config.shots, 5) def test_assemble_initialize(self): """Test assembling a circuit with an initialize.""" q = QuantumRegister(2, name="q") circ = QuantumCircuit(q, name="circ") circ.initialize([1 / np.sqrt(2), 0, 0, 1 / np.sqrt(2)], q[:]) qobj = assemble(circ) self.assertIsInstance(qobj, QasmQobj) self.assertEqual(qobj.experiments[0].instructions[0].name, "initialize") np.testing.assert_almost_equal( qobj.experiments[0].instructions[0].params, [0.7071067811865, 0, 0, 0.707106781186] ) def test_assemble_meas_level_meas_return(self): """Test assembling a circuit schedule with `meas_level`.""" qobj = assemble(self.circ, meas_level=1, meas_return="single") self.assertIsInstance(qobj, QasmQobj) self.assertEqual(qobj.config.meas_level, 1) self.assertEqual(qobj.config.meas_return, "single") # no meas_level set qobj = assemble(self.circ) self.assertIsInstance(qobj, QasmQobj) self.assertEqual(qobj.config.meas_level, 2) self.assertEqual(hasattr(qobj.config, "meas_return"), False) def test_assemble_backend_rep_delays(self): """Check that rep_delay is properly set from backend values.""" rep_delay_range = [2.5e-3, 4.5e-3] # sec default_rep_delay = 3.0e-3 setattr(self.backend_config, "rep_delay_range", rep_delay_range) setattr(self.backend_config, "default_rep_delay", default_rep_delay) # dynamic rep rates off setattr(self.backend_config, "dynamic_reprate_enabled", False) qobj = assemble(self.circ, self.backend) self.assertEqual(hasattr(qobj.config, "rep_delay"), False) # dynamic rep rates on setattr(self.backend_config, "dynamic_reprate_enabled", True) qobj = assemble(self.circ, self.backend) self.assertEqual(qobj.config.rep_delay, default_rep_delay * 1e6) def test_assemble_user_rep_time_delay(self): """Check that user runtime config rep_delay works.""" # set custom rep_delay in runtime config rep_delay = 2.2e-6 rep_delay_range = [0, 3e-6] # sec setattr(self.backend_config, "rep_delay_range", rep_delay_range) # dynamic rep rates off (no default so shouldn't be in qobj config) setattr(self.backend_config, "dynamic_reprate_enabled", False) qobj = assemble(self.circ, self.backend, rep_delay=rep_delay) self.assertEqual(hasattr(qobj.config, "rep_delay"), False) # turn on dynamic rep rates, rep_delay should be set setattr(self.backend_config, "dynamic_reprate_enabled", True) qobj = assemble(self.circ, self.backend, rep_delay=rep_delay) self.assertEqual(qobj.config.rep_delay, 2.2) # test ``rep_delay=0`` qobj = assemble(self.circ, self.backend, rep_delay=0) self.assertEqual(qobj.config.rep_delay, 0) # use ``rep_delay`` outside of ``rep_delay_range``` rep_delay_large = 5.0e-6 with self.assertRaises(QiskitError): assemble(self.circ, self.backend, rep_delay=rep_delay_large) def test_assemble_opaque_inst(self): """Test opaque instruction is assembled as-is""" opaque_inst = Instruction(name="my_inst", num_qubits=4, num_clbits=2, params=[0.5, 0.4]) q = QuantumRegister(6, name="q") c = ClassicalRegister(4, name="c") circ = QuantumCircuit(q, c, name="circ") circ.append(opaque_inst, [q[0], q[2], q[5], q[3]], [c[3], c[0]]) qobj = assemble(circ) self.assertIsInstance(qobj, QasmQobj) self.assertEqual(len(qobj.experiments[0].instructions), 1) self.assertEqual(qobj.experiments[0].instructions[0].name, "my_inst") self.assertEqual(qobj.experiments[0].instructions[0].qubits, [0, 2, 5, 3]) self.assertEqual(qobj.experiments[0].instructions[0].memory, [3, 0]) self.assertEqual(qobj.experiments[0].instructions[0].params, [0.5, 0.4]) def test_assemble_unroll_parametervector(self): """Verfiy that assemble unrolls parametervectors ref #5467""" pv1 = ParameterVector("pv1", 3) pv2 = ParameterVector("pv2", 3) qc = QuantumCircuit(2, 2) for i in range(3): qc.rx(pv1[i], 0) qc.ry(pv2[i], 1) qc.barrier() qc.measure([0, 1], [0, 1]) qc.bind_parameters({pv1: [0.1, 0.2, 0.3], pv2: [0.4, 0.5, 0.6]}) qobj = assemble(qc, parameter_binds=[{pv1: [0.1, 0.2, 0.3], pv2: [0.4, 0.5, 0.6]}]) self.assertIsInstance(qobj, QasmQobj) self.assertEqual(qobj.experiments[0].instructions[0].params[0], 0.100000000000000) self.assertEqual(qobj.experiments[0].instructions[1].params[0], 0.400000000000000) self.assertEqual(qobj.experiments[0].instructions[2].params[0], 0.200000000000000) self.assertEqual(qobj.experiments[0].instructions[3].params[0], 0.500000000000000) self.assertEqual(qobj.experiments[0].instructions[4].params[0], 0.300000000000000) self.assertEqual(qobj.experiments[0].instructions[5].params[0], 0.600000000000000) def test_measure_to_registers_when_conditionals(self): """Verify assemble_circuits maps all measure ops on to a register slot for a circuit containing conditionals.""" qr = QuantumRegister(2) cr1 = ClassicalRegister(1) cr2 = ClassicalRegister(2) qc = QuantumCircuit(qr, cr1, cr2) qc.measure(qr[0], cr1) # Measure not required for a later conditional qc.measure(qr[1], cr2[1]) # Measure required for a later conditional qc.h(qr[1]).c_if(cr2, 3) qobj = assemble(qc) first_measure, second_measure = ( op for op in qobj.experiments[0].instructions if op.name == "measure" ) self.assertTrue(hasattr(first_measure, "register")) self.assertEqual(first_measure.register, first_measure.memory) self.assertTrue(hasattr(second_measure, "register")) self.assertEqual(second_measure.register, second_measure.memory) def test_convert_to_bfunc_plus_conditional(self): """Verify assemble_circuits converts conditionals from QASM to Qobj.""" qr = QuantumRegister(1) cr = ClassicalRegister(1) qc = QuantumCircuit(qr, cr) qc.h(qr[0]).c_if(cr, 1) qobj = assemble(qc) bfunc_op, h_op = qobj.experiments[0].instructions self.assertEqual(bfunc_op.name, "bfunc") self.assertEqual(bfunc_op.mask, "0x1") self.assertEqual(bfunc_op.val, "0x1") self.assertEqual(bfunc_op.relation, "==") self.assertTrue(hasattr(h_op, "conditional")) self.assertEqual(bfunc_op.register, h_op.conditional) def test_convert_to_bfunc_plus_conditional_onebit(self): """Verify assemble_circuits converts single bit conditionals from QASM to Qobj.""" qr = QuantumRegister(1) cr = ClassicalRegister(3) qc = QuantumCircuit(qr, cr) qc.h(qr[0]).c_if(cr[2], 1) qobj = assemble(qc) inst_set = qobj.experiments[0].instructions [bfunc_op, h_op] = inst_set self.assertEqual(len(inst_set), 2) self.assertEqual(bfunc_op.name, "bfunc") self.assertEqual(bfunc_op.mask, "0x4") self.assertEqual(bfunc_op.val, "0x4") self.assertEqual(bfunc_op.relation, "==") self.assertTrue(hasattr(h_op, "conditional")) self.assertEqual(bfunc_op.register, h_op.conditional) def test_resize_value_to_register(self): """Verify assemble_circuits converts the value provided on the classical creg to its mapped location on the device register.""" qr = QuantumRegister(1) cr1 = ClassicalRegister(2) cr2 = ClassicalRegister(2) cr3 = ClassicalRegister(1) qc = QuantumCircuit(qr, cr1, cr2, cr3) qc.h(qr[0]).c_if(cr2, 2) qobj = assemble(qc) bfunc_op, h_op = qobj.experiments[0].instructions self.assertEqual(bfunc_op.name, "bfunc") self.assertEqual(bfunc_op.mask, "0xC") self.assertEqual(bfunc_op.val, "0x8") self.assertEqual(bfunc_op.relation, "==") self.assertTrue(hasattr(h_op, "conditional")) self.assertEqual(bfunc_op.register, h_op.conditional) def test_assemble_circuits_raises_for_bind_circuit_mismatch(self): """Verify assemble_circuits raises error for parameterized circuits without matching binds.""" qr = QuantumRegister(2) x = Parameter("x") y = Parameter("y") full_bound_circ = QuantumCircuit(qr) full_param_circ = QuantumCircuit(qr) partial_param_circ = QuantumCircuit(qr) partial_param_circ.p(x, qr[0]) full_param_circ.p(x, qr[0]) full_param_circ.p(y, qr[1]) partial_bind_args = {"parameter_binds": [{x: 1}, {x: 0}]} full_bind_args = {"parameter_binds": [{x: 1, y: 1}, {x: 0, y: 0}]} inconsistent_bind_args = {"parameter_binds": [{x: 1}, {x: 0, y: 0}]} # Raise when parameters passed for non-parametric circuit self.assertRaises(QiskitError, assemble, full_bound_circ, **partial_bind_args) # Raise when no parameters passed for parametric circuit self.assertRaises(QiskitError, assemble, partial_param_circ) self.assertRaises(QiskitError, assemble, full_param_circ) # Raise when circuit has more parameters than run_config self.assertRaises(QiskitError, assemble, full_param_circ, **partial_bind_args) # Raise when not all circuits have all parameters self.assertRaises( QiskitError, assemble, [full_param_circ, partial_param_circ], **full_bind_args ) # Raise when not all binds have all circuit params self.assertRaises(QiskitError, assemble, full_param_circ, **inconsistent_bind_args) def test_assemble_circuits_rases_for_bind_mismatch_over_expressions(self): """Verify assemble_circuits raises for invalid binds for circuit including ParameterExpressions. """ qr = QuantumRegister(1) x = Parameter("x") y = Parameter("y") expr_circ = QuantumCircuit(qr) expr_circ.p(x + y, qr[0]) partial_bind_args = {"parameter_binds": [{x: 1}, {x: 0}]} # Raise when no parameters passed for parametric circuit self.assertRaises(QiskitError, assemble, expr_circ) # Raise when circuit has more parameters than run_config self.assertRaises(QiskitError, assemble, expr_circ, **partial_bind_args) def test_assemble_circuits_binds_parameters(self): """Verify assemble_circuits applies parameter bindings and output circuits are bound.""" qr = QuantumRegister(1) qc1 = QuantumCircuit(qr) qc2 = QuantumCircuit(qr) qc3 = QuantumCircuit(qr) x = Parameter("x") y = Parameter("y") sum_ = x + y product_ = x * y qc1.u(x, y, 0, qr[0]) qc2.rz(x, qr[0]) qc2.rz(y, qr[0]) qc3.u(sum_, product_, 0, qr[0]) bind_args = {"parameter_binds": [{x: 0, y: 0}, {x: 1, y: 0}, {x: 1, y: 1}]} qobj = assemble([qc1, qc2, qc3], **bind_args) self.assertEqual(len(qobj.experiments), 9) self.assertEqual( [len(expt.instructions) for expt in qobj.experiments], [1, 1, 1, 2, 2, 2, 1, 1, 1] ) def _qobj_inst_params(expt_no, inst_no): expt = qobj.experiments[expt_no] inst = expt.instructions[inst_no] return [float(p) for p in inst.params] self.assertEqual(_qobj_inst_params(0, 0), [0, 0, 0]) self.assertEqual(_qobj_inst_params(1, 0), [1, 0, 0]) self.assertEqual(_qobj_inst_params(2, 0), [1, 1, 0]) self.assertEqual(_qobj_inst_params(3, 0), [0]) self.assertEqual(_qobj_inst_params(3, 1), [0]) self.assertEqual(_qobj_inst_params(4, 0), [1]) self.assertEqual(_qobj_inst_params(4, 1), [0]) self.assertEqual(_qobj_inst_params(5, 0), [1]) self.assertEqual(_qobj_inst_params(5, 1), [1]) self.assertEqual(_qobj_inst_params(6, 0), [0, 0, 0]) self.assertEqual(_qobj_inst_params(7, 0), [1, 0, 0]) self.assertEqual(_qobj_inst_params(8, 0), [2, 1, 0]) def test_init_qubits_default(self): """Check that the init_qubits=None assemble option is passed on to the qobj.""" qobj = assemble(self.circ) self.assertEqual(qobj.config.init_qubits, True) def test_init_qubits_true(self): """Check that the init_qubits=True assemble option is passed on to the qobj.""" qobj = assemble(self.circ, init_qubits=True) self.assertEqual(qobj.config.init_qubits, True) def test_init_qubits_false(self): """Check that the init_qubits=False assemble option is passed on to the qobj.""" qobj = assemble(self.circ, init_qubits=False) self.assertEqual(qobj.config.init_qubits, False) def test_circuit_with_global_phase(self): """Test that global phase for a circuit is handled correctly.""" circ = QuantumCircuit(2) circ.h(0) circ.cx(0, 1) circ.measure_all() circ.global_phase = 0.3 * np.pi qobj = assemble([circ, self.circ]) self.assertEqual(getattr(qobj.experiments[1].header, "global_phase"), 0) self.assertEqual(getattr(qobj.experiments[0].header, "global_phase"), 0.3 * np.pi) def test_circuit_global_phase_gate_definitions(self): """Test circuit with global phase on gate definitions.""" class TestGate(Gate): """dummy gate""" def __init__(self): super().__init__("test_gate", 1, []) def _define(self): circ_def = QuantumCircuit(1) circ_def.x(0) circ_def.global_phase = np.pi self._definition = circ_def gate = TestGate() circ = QuantumCircuit(1) circ.append(gate, [0]) qobj = assemble([circ]) self.assertEqual(getattr(qobj.experiments[0].header, "global_phase"), 0) circ.global_phase = np.pi / 2 qobj = assemble([circ]) self.assertEqual(getattr(qobj.experiments[0].header, "global_phase"), np.pi / 2) def test_pulse_gates_single_circ(self): """Test that we can add calibrations to circuits.""" theta = Parameter("theta") circ = QuantumCircuit(2) circ.h(0) circ.append(RxGate(3.14), [0]) circ.append(RxGate(theta), [1]) circ = circ.assign_parameters({theta: 3.14}) with pulse.build() as custom_h_schedule: pulse.play(pulse.library.Drag(50, 0.15, 4, 2), pulse.DriveChannel(0)) with pulse.build() as x180: pulse.play(pulse.library.Gaussian(50, 0.2, 5), pulse.DriveChannel(1)) circ.add_calibration("h", [0], custom_h_schedule) circ.add_calibration(RxGate(3.14), [0], x180) circ.add_calibration(RxGate(3.14), [1], x180) qobj = assemble(circ, FakeOpenPulse2Q()) # Only one circuit, so everything is stored at the job level cals = qobj.config.calibrations lib = qobj.config.pulse_library self.assertFalse(hasattr(qobj.experiments[0].config, "calibrations")) self.assertEqual([gate.name == "rxtheta" for gate in cals.gates].count(True), 2) self.assertEqual([gate.name == "h" for gate in cals.gates].count(True), 1) self.assertEqual(len(lib), 2) self.assertTrue(all(len(item.samples) == 50 for item in lib)) def test_pulse_gates_with_parameteric_pulses(self): """Test that pulse gates are assembled efficiently for backends that enable parametric pulses. """ with pulse.build() as custom_h_schedule: pulse.play(pulse.library.Drag(50, 0.15, 4, 2), pulse.DriveChannel(0)) circ = QuantumCircuit(2) circ.h(0) circ.add_calibration("h", [0], custom_h_schedule) backend = FakeOpenPulse2Q() backend.configuration().parametric_pulses = ["drag"] qobj = assemble(circ, backend) self.assertFalse(hasattr(qobj.config, "pulse_library")) self.assertTrue(hasattr(qobj.config, "calibrations")) def test_pulse_gates_multiple_circuits(self): """Test one circuit with cals and another without.""" with pulse.build() as dummy_sched: pulse.play(pulse.library.Drag(50, 0.15, 4, 2), pulse.DriveChannel(0)) circ = QuantumCircuit(2) circ.h(0) circ.append(RxGate(3.14), [1]) circ.add_calibration("h", [0], dummy_sched) circ.add_calibration(RxGate(3.14), [1], dummy_sched) circ2 = QuantumCircuit(2) circ2.h(0) qobj = assemble([circ, circ2], FakeOpenPulse2Q()) self.assertEqual(len(qobj.config.pulse_library), 1) self.assertEqual(len(qobj.experiments[0].config.calibrations.gates), 2) self.assertFalse(hasattr(qobj.config, "calibrations")) self.assertFalse(hasattr(qobj.experiments[1].config, "calibrations")) def test_pulse_gates_common_cals(self): """Test that common calibrations are added at the top level.""" with pulse.build() as dummy_sched: pulse.play(pulse.library.Drag(50, 0.15, 4, 2), pulse.DriveChannel(0)) circ = QuantumCircuit(2) circ.h(0) circ.append(RxGate(3.14), [1]) circ.add_calibration("h", [0], dummy_sched) circ.add_calibration(RxGate(3.14), [1], dummy_sched) circ2 = QuantumCircuit(2) circ2.h(0) circ2.add_calibration(RxGate(3.14), [1], dummy_sched) qobj = assemble([circ, circ2], FakeOpenPulse2Q()) # Identical pulses are only added once self.assertEqual(len(qobj.config.pulse_library), 1) # Identical calibrations are only added once self.assertEqual(qobj.config.calibrations.gates[0].name, "rxtheta") self.assertEqual(qobj.config.calibrations.gates[0].params, [3.14]) self.assertEqual(qobj.config.calibrations.gates[0].qubits, [1]) self.assertEqual(len(qobj.experiments[0].config.calibrations.gates), 1) self.assertFalse(hasattr(qobj.experiments[1].config, "calibrations")) def test_assemble_adds_circuit_metadata_to_experiment_header(self): """Verify that any circuit metadata is added to the exeriment header.""" circ = QuantumCircuit(2, metadata={"experiment_type": "gst", "execution_number": "1234"}) qobj = assemble(circ, shots=100, memory=False, seed_simulator=6) self.assertEqual( qobj.experiments[0].header.metadata, {"experiment_type": "gst", "execution_number": "1234"}, ) def test_pulse_gates_delay_only(self): """Test that a single delay gate is translated to an instruction.""" circ = QuantumCircuit(2) circ.append(Gate("test", 1, []), [0]) test_sched = pulse.Delay(64, DriveChannel(0)) + pulse.Delay(160, DriveChannel(0)) circ.add_calibration("test", [0], test_sched) qobj = assemble(circ, FakeOpenPulse2Q()) self.assertEqual(len(qobj.config.calibrations.gates[0].instructions), 2) self.assertEqual( qobj.config.calibrations.gates[0].instructions[1].to_dict(), {"name": "delay", "t0": 64, "ch": "d0", "duration": 160}, ) def test_job_qubit_meas_los_no_range(self): """Test that adding job qubit/meas lo freq lists are assembled into the qobj.config, w/ out any lo range.""" qobj = assemble( self.circ, backend=self.backend, qubit_lo_freq=self.default_qubit_lo_freq, meas_lo_freq=self.default_meas_lo_freq, ) # convert to ghz qubit_lo_freq_ghz = [freq / 1e9 for freq in self.default_qubit_lo_freq] meas_lo_freq_ghz = [freq / 1e9 for freq in self.default_meas_lo_freq] self.assertEqual(qobj.config.qubit_lo_freq, qubit_lo_freq_ghz) self.assertEqual(qobj.config.meas_lo_freq, meas_lo_freq_ghz) def test_job_lo_errors(self): """Test that job lo's are checked against the lo ranges and that errors are thrown if either quantity has an incorrect length or type.""" qubit_lo_range = [[freq - 5e6, freq + 5e6] for freq in self.default_qubit_lo_freq] meas_lo_range = [[freq - 5e6, freq + 5e6] for freq in self.default_meas_lo_freq] # lo range not a nested list with self.assertRaises(QiskitError): assemble( self.circ, backend=self.backend, qubit_lo_freq=self.default_qubit_lo_freq, meas_lo_freq=self.default_meas_lo_freq, qubit_lo_range=[4.995e9 for i in range(self.num_qubits)], meas_lo_range=meas_lo_range, ) # qubit lo range inner list not 2d with self.assertRaises(QiskitError): assemble( self.circ, backend=self.backend, qubit_lo_freq=self.default_qubit_lo_freq, meas_lo_freq=self.default_meas_lo_freq, qubit_lo_range=qubit_lo_range, meas_lo_range=[[6.695e9] for i in range(self.num_qubits)], ) # meas lo range inner list not 2d with self.assertRaises(QiskitError): assemble( self.circ, backend=self.backend, qubit_lo_freq=self.default_qubit_lo_freq, meas_lo_freq=self.default_meas_lo_freq, qubit_lo_range=qubit_lo_range, meas_lo_range=[[6.695e9] for i in range(self.num_qubits)], ) # qubit lo out of range with self.assertRaises(QiskitError): assemble( self.circ, backend=self.backend, qubit_lo_freq=self.default_qubit_lo_freq, meas_lo_freq=self.default_meas_lo_freq, qubit_lo_range=[[5.005e9, 5.010e9] for i in range(self.num_qubits)], meas_lo_range=meas_lo_range, ) # meas lo out of range with self.assertRaises(QiskitError): assemble( self.circ, backend=self.backend, qubit_lo_freq=self.default_qubit_lo_freq, meas_lo_freq=self.default_meas_lo_freq, qubit_lo_range=qubit_lo_range, meas_lo_range=[[6.705e9, 6.710e9] for i in range(self.num_qubits)], ) def test_job_qubit_meas_los_w_range(self): """Test that adding job qubit/meas lo freq lists are assembled into the qobj.config, w/ lo ranges input. Verify that lo ranges do not enter into the config.""" qubit_lo_range = [[freq - 5e6, freq + 5e6] for freq in self.default_qubit_lo_freq] meas_lo_range = [[freq - 5e6, freq + 5e6] for freq in self.default_meas_lo_freq] qobj = assemble( self.circ, backend=self.backend, qubit_lo_freq=self.default_qubit_lo_freq, meas_lo_freq=self.default_meas_lo_freq, qubit_lo_range=qubit_lo_range, meas_lo_range=meas_lo_range, ) # convert to ghz qubit_lo_freq_ghz = [freq / 1e9 for freq in self.default_qubit_lo_freq] meas_lo_freq_ghz = [freq / 1e9 for freq in self.default_meas_lo_freq] self.assertEqual(qobj.config.qubit_lo_freq, qubit_lo_freq_ghz) self.assertEqual(qobj.config.meas_lo_freq, meas_lo_freq_ghz) self.assertNotIn("qubit_lo_range", qobj.config.to_dict()) self.assertNotIn("meas_lo_range", qobj.config.to_dict()) def test_assemble_single_circ_single_lo_config(self): """Test assembling a single circuit, with a single experiment level lo config.""" qobj = assemble( self.circ, self.backend, qubit_lo_freq=self.default_qubit_lo_freq, meas_lo_freq=self.default_meas_lo_freq, schedule_los=self.user_lo_config, ) self.assertListEqual(qobj.config.qubit_lo_freq, [5.55, 5, 5, 4.91, 5]) self.assertListEqual(qobj.config.meas_lo_freq, [6.64, 6.7, 6.7, 6.7, 6.1]) self.assertEqual(len(qobj.experiments), 1) def test_assemble_single_circ_single_lo_config_dict(self): """Test assembling a single circuit, with a single experiment level lo config supplied as dictionary.""" qobj = assemble( self.circ, self.backend, qubit_lo_freq=self.default_qubit_lo_freq, meas_lo_freq=self.default_meas_lo_freq, schedule_los=self.user_lo_config_dict, ) self.assertListEqual(qobj.config.qubit_lo_freq, [5.55, 5, 5, 4.91, 5]) self.assertListEqual(qobj.config.meas_lo_freq, [6.64, 6.7, 6.7, 6.7, 6.1]) self.assertEqual(len(qobj.experiments), 1) def test_assemble_single_circ_multi_lo_config(self): """Test assembling a single circuit, with multiple experiment level lo configs (frequency sweep). """ user_lo_config_dict2 = { pulse.DriveChannel(1): 5.55e9, pulse.MeasureChannel(1): 6.64e9, pulse.DriveChannel(4): 4.91e9, pulse.MeasureChannel(3): 6.1e9, } user_lo_config2 = pulse.LoConfig(user_lo_config_dict2) qobj = assemble( self.circ, self.backend, qubit_lo_freq=self.default_qubit_lo_freq, meas_lo_freq=self.default_meas_lo_freq, schedule_los=[self.user_lo_config, user_lo_config2], ) qubit_lo_freq_ghz = [freq / 1e9 for freq in self.default_qubit_lo_freq] meas_lo_freq_ghz = [freq / 1e9 for freq in self.default_meas_lo_freq] self.assertListEqual(qobj.config.qubit_lo_freq, qubit_lo_freq_ghz) self.assertListEqual(qobj.config.meas_lo_freq, meas_lo_freq_ghz) self.assertEqual(len(qobj.experiments), 2) # experiment 0 los self.assertEqual(qobj.experiments[0].config.qubit_lo_freq, [5.55, 5, 5, 4.91, 5]) self.assertEqual(qobj.experiments[0].config.meas_lo_freq, [6.64, 6.7, 6.7, 6.7, 6.1]) # experiment 1 los self.assertEqual(qobj.experiments[1].config.qubit_lo_freq, [5, 5.55, 5, 5, 4.91]) self.assertEqual(qobj.experiments[1].config.meas_lo_freq, [6.7, 6.64, 6.7, 6.1, 6.7]) def test_assemble_multi_circ_multi_lo_config(self): """Test assembling circuits, with the same number of experiment level lo configs (n:n setup).""" user_lo_config_dict2 = { pulse.DriveChannel(1): 5.55e9, pulse.MeasureChannel(1): 6.64e9, pulse.DriveChannel(4): 4.91e9, pulse.MeasureChannel(3): 6.1e9, } user_lo_config2 = pulse.LoConfig(user_lo_config_dict2) qobj = assemble( [self.circ, self.circ], self.backend, qubit_lo_freq=self.default_qubit_lo_freq, meas_lo_freq=self.default_meas_lo_freq, schedule_los=[self.user_lo_config, user_lo_config2], ) qubit_lo_freq_ghz = [freq / 1e9 for freq in self.default_qubit_lo_freq] meas_lo_freq_ghz = [freq / 1e9 for freq in self.default_meas_lo_freq] self.assertListEqual(qobj.config.qubit_lo_freq, qubit_lo_freq_ghz) self.assertListEqual(qobj.config.meas_lo_freq, meas_lo_freq_ghz) self.assertEqual(len(qobj.experiments), 2) # experiment 0 los self.assertEqual(qobj.experiments[0].config.qubit_lo_freq, [5.55, 5, 5, 4.91, 5]) self.assertEqual(qobj.experiments[0].config.meas_lo_freq, [6.64, 6.7, 6.7, 6.7, 6.1]) # experiment 1 los self.assertEqual(qobj.experiments[1].config.qubit_lo_freq, [5, 5.55, 5, 5, 4.91]) self.assertEqual(qobj.experiments[1].config.meas_lo_freq, [6.7, 6.64, 6.7, 6.1, 6.7]) def test_assemble_multi_circ_single_lo_config(self): """Test assembling multiple circuits, with a single experiment level lo config (should override job level).""" qobj = assemble( [self.circ, self.circ], self.backend, qubit_lo_freq=self.default_qubit_lo_freq, meas_lo_freq=self.default_meas_lo_freq, schedule_los=self.user_lo_config, ) self.assertListEqual(qobj.config.qubit_lo_freq, [5.55, 5, 5, 4.91, 5]) self.assertListEqual(qobj.config.meas_lo_freq, [6.64, 6.7, 6.7, 6.7, 6.1]) self.assertEqual(len(qobj.experiments), 2) def test_assemble_multi_circ_wrong_number_of_multi_lo_configs(self): """Test assembling circuits, with a different number of experiment level lo configs (n:m setup). """ with self.assertRaises(QiskitError): assemble( [self.circ, self.circ, self.circ], self.backend, qubit_lo_freq=self.default_qubit_lo_freq, meas_lo_freq=self.default_meas_lo_freq, schedule_los=[self.user_lo_config, self.user_lo_config], ) def test_assemble_circ_lo_config_errors(self): """Test that lo config errors are raised properly if experiment level los are provided and some are missing or if default values are not provided. Also check that experiment level lo range is validated.""" # no defaults, but have drive/meas experiment level los for each qubit (no error) full_lo_config_dict = { pulse.DriveChannel(0): 4.85e9, pulse.DriveChannel(1): 4.9e9, pulse.DriveChannel(2): 4.95e9, pulse.DriveChannel(3): 5e9, pulse.DriveChannel(4): 5.05e9, pulse.MeasureChannel(0): 6.8e9, pulse.MeasureChannel(1): 6.85e9, pulse.MeasureChannel(2): 6.9e9, pulse.MeasureChannel(3): 6.95e9, pulse.MeasureChannel(4): 7e9, } qobj = assemble(self.circ, self.backend, schedule_los=full_lo_config_dict) self.assertListEqual(qobj.config.qubit_lo_freq, [4.85, 4.9, 4.95, 5, 5.05]) self.assertListEqual(qobj.config.meas_lo_freq, [6.8, 6.85, 6.9, 6.95, 7]) self.assertEqual(len(qobj.experiments), 1) # no defaults and missing experiment level drive lo raises missing_drive_lo_config_dict = copy.deepcopy(full_lo_config_dict) missing_drive_lo_config_dict.pop(pulse.DriveChannel(0)) with self.assertRaises(QiskitError): qobj = assemble(self.circ, self.backend, schedule_los=missing_drive_lo_config_dict) # no defaults and missing experiment level meas lo raises missing_meas_lo_config_dict = copy.deepcopy(full_lo_config_dict) missing_meas_lo_config_dict.pop(pulse.MeasureChannel(0)) with self.assertRaises(QiskitError): qobj = assemble(self.circ, self.backend, schedule_los=missing_meas_lo_config_dict) # verify lo ranges are checked at experiment level lo_values = list(full_lo_config_dict.values()) qubit_lo_range = [[freq - 5e6, freq + 5e6] for freq in lo_values[:5]] meas_lo_range = [[freq - 5e6, freq + 5e6] for freq in lo_values[5:]] # out of range drive lo full_lo_config_dict[pulse.DriveChannel(0)] -= 5.5e6 with self.assertRaises(QiskitError): qobj = assemble( self.circ, self.backend, qubit_lo_range=qubit_lo_range, schedule_los=full_lo_config_dict, ) full_lo_config_dict[pulse.DriveChannel(0)] += 5.5e6 # reset drive value # out of range meas lo full_lo_config_dict[pulse.MeasureChannel(0)] += 5.5e6 with self.assertRaises(QiskitError): qobj = assemble( self.circ, self.backend, meas_lo_range=meas_lo_range, schedule_los=full_lo_config_dict, ) class TestPulseAssembler(QiskitTestCase): """Tests for assembling schedules to qobj.""" def setUp(self): super().setUp() self.backend = FakeOpenPulse2Q() self.backend_config = self.backend.configuration() test_pulse = pulse.Waveform( samples=np.array([0.02739068, 0.05, 0.05, 0.05, 0.02739068], dtype=np.complex128), name="pulse0", ) self.schedule = pulse.Schedule(name="fake_experiment") self.schedule = self.schedule.insert(0, Play(test_pulse, self.backend_config.drive(0))) for i in range(self.backend_config.n_qubits): self.schedule = self.schedule.insert( 5, Acquire(5, self.backend_config.acquire(i), MemorySlot(i)) ) self.user_lo_config_dict = {self.backend_config.drive(0): 4.91e9} self.user_lo_config = pulse.LoConfig(self.user_lo_config_dict) self.default_qubit_lo_freq = [4.9e9, 5.0e9] self.default_meas_lo_freq = [6.5e9, 6.6e9] self.config = {"meas_level": 1, "memory_slot_size": 100, "meas_return": "avg"} self.header = {"backend_name": "FakeOpenPulse2Q", "backend_version": "0.0.0"} def test_assemble_adds_schedule_metadata_to_experiment_header(self): """Verify that any circuit metadata is added to the exeriment header.""" self.schedule.metadata = {"experiment_type": "gst", "execution_number": "1234"} qobj = assemble( self.schedule, shots=100, qubit_lo_freq=self.default_qubit_lo_freq, meas_lo_freq=self.default_meas_lo_freq, schedule_los=[], ) self.assertEqual( qobj.experiments[0].header.metadata, {"experiment_type": "gst", "execution_number": "1234"}, ) def test_assemble_sample_pulse(self): """Test that the pulse lib and qobj instruction can be paired up.""" schedule = pulse.Schedule() schedule += pulse.Play( pulse.Waveform([0.1] * 16, name="test0"), pulse.DriveChannel(0), name="test1" ) schedule += pulse.Play( pulse.Waveform([0.1] * 16, name="test1"), pulse.DriveChannel(0), name="test2" ) schedule += pulse.Play( pulse.Waveform([0.5] * 16, name="test0"), pulse.DriveChannel(0), name="test1" ) qobj = assemble( schedule, qobj_header=self.header, qubit_lo_freq=self.default_qubit_lo_freq, meas_lo_freq=self.default_meas_lo_freq, schedule_los=[], **self.config, ) test_dict = qobj.to_dict() experiment = test_dict["experiments"][0] inst0_name = experiment["instructions"][0]["name"] inst1_name = experiment["instructions"][1]["name"] inst2_name = experiment["instructions"][2]["name"] pulses = {} for item in test_dict["config"]["pulse_library"]: pulses[item["name"]] = item["samples"] self.assertTrue(all(name in pulses for name in [inst0_name, inst1_name, inst2_name])) # Their pulses are the same self.assertEqual(inst0_name, inst1_name) self.assertTrue(np.allclose(pulses[inst0_name], [0.1] * 16)) self.assertTrue(np.allclose(pulses[inst2_name], [0.5] * 16)) def test_assemble_single_schedule_without_lo_config(self): """Test assembling a single schedule, no lo config.""" qobj = assemble( self.schedule, qobj_header=self.header, qubit_lo_freq=self.default_qubit_lo_freq, meas_lo_freq=self.default_meas_lo_freq, schedule_los=[], **self.config, ) test_dict = qobj.to_dict() self.assertListEqual(test_dict["config"]["qubit_lo_freq"], [4.9, 5.0]) self.assertEqual(len(test_dict["experiments"]), 1) self.assertEqual(len(test_dict["experiments"][0]["instructions"]), 2) def test_assemble_multi_schedules_without_lo_config(self): """Test assembling schedules, no lo config.""" qobj = assemble( [self.schedule, self.schedule], qobj_header=self.header, qubit_lo_freq=self.default_qubit_lo_freq, meas_lo_freq=self.default_meas_lo_freq, **self.config, ) test_dict = qobj.to_dict() self.assertListEqual(test_dict["config"]["qubit_lo_freq"], [4.9, 5.0]) self.assertEqual(len(test_dict["experiments"]), 2) self.assertEqual(len(test_dict["experiments"][0]["instructions"]), 2) def test_assemble_single_schedule_with_lo_config(self): """Test assembling a single schedule, with a single lo config.""" qobj = assemble( self.schedule, qobj_header=self.header, qubit_lo_freq=self.default_qubit_lo_freq, meas_lo_freq=self.default_meas_lo_freq, schedule_los=self.user_lo_config, **self.config, ) test_dict = qobj.to_dict() self.assertListEqual(test_dict["config"]["qubit_lo_freq"], [4.91, 5.0]) self.assertEqual(len(test_dict["experiments"]), 1) self.assertEqual(len(test_dict["experiments"][0]["instructions"]), 2) def test_assemble_single_schedule_with_lo_config_dict(self): """Test assembling a single schedule, with a single lo config supplied as dictionary.""" qobj = assemble( self.schedule, qobj_header=self.header, qubit_lo_freq=self.default_qubit_lo_freq, meas_lo_freq=self.default_meas_lo_freq, schedule_los=self.user_lo_config_dict, **self.config, ) test_dict = qobj.to_dict() self.assertListEqual(test_dict["config"]["qubit_lo_freq"], [4.91, 5.0]) self.assertEqual(len(test_dict["experiments"]), 1) self.assertEqual(len(test_dict["experiments"][0]["instructions"]), 2) def test_assemble_single_schedule_with_multi_lo_configs(self): """Test assembling a single schedule, with multiple lo configs (frequency sweep).""" qobj = assemble( self.schedule, qobj_header=self.header, qubit_lo_freq=self.default_qubit_lo_freq, meas_lo_freq=self.default_meas_lo_freq, schedule_los=[self.user_lo_config, self.user_lo_config], **self.config, ) test_dict = qobj.to_dict() self.assertListEqual(test_dict["config"]["qubit_lo_freq"], [4.9, 5.0]) self.assertEqual(len(test_dict["experiments"]), 2) self.assertEqual(len(test_dict["experiments"][0]["instructions"]), 2) self.assertDictEqual(test_dict["experiments"][0]["config"], {"qubit_lo_freq": [4.91, 5.0]}) def test_assemble_multi_schedules_with_multi_lo_configs(self): """Test assembling schedules, with the same number of lo configs (n:n setup).""" qobj = assemble( [self.schedule, self.schedule], qobj_header=self.header, qubit_lo_freq=self.default_qubit_lo_freq, meas_lo_freq=self.default_meas_lo_freq, schedule_los=[self.user_lo_config, self.user_lo_config], **self.config, ) test_dict = qobj.to_dict() self.assertListEqual(test_dict["config"]["qubit_lo_freq"], [4.9, 5.0]) self.assertEqual(len(test_dict["experiments"]), 2) self.assertEqual(len(test_dict["experiments"][0]["instructions"]), 2) self.assertDictEqual(test_dict["experiments"][0]["config"], {"qubit_lo_freq": [4.91, 5.0]}) def test_assemble_multi_schedules_with_wrong_number_of_multi_lo_configs(self): """Test assembling schedules, with a different number of lo configs (n:m setup).""" with self.assertRaises(QiskitError): assemble( [self.schedule, self.schedule, self.schedule], qobj_header=self.header, qubit_lo_freq=self.default_qubit_lo_freq, meas_lo_freq=self.default_meas_lo_freq, schedule_los=[self.user_lo_config, self.user_lo_config], **self.config, ) def test_assemble_meas_map(self): """Test assembling a single schedule, no lo config.""" schedule = Schedule(name="fake_experiment") schedule = schedule.insert(5, Acquire(5, AcquireChannel(0), MemorySlot(0))) schedule = schedule.insert(5, Acquire(5, AcquireChannel(1), MemorySlot(1))) qobj = assemble( schedule, qubit_lo_freq=self.default_qubit_lo_freq, meas_lo_freq=self.default_meas_lo_freq, meas_map=[[0], [1]], ) self.assertIsInstance(qobj, PulseQobj) qobj = assemble( schedule, qubit_lo_freq=self.default_qubit_lo_freq, meas_lo_freq=self.default_meas_lo_freq, meas_map=[[0, 1, 2]], ) self.assertIsInstance(qobj, PulseQobj) def test_assemble_memory_slots(self): """Test assembling a schedule and inferring number of memoryslots.""" n_memoryslots = 10 # single acquisition schedule = Acquire( 5, self.backend_config.acquire(0), mem_slot=pulse.MemorySlot(n_memoryslots - 1) ) qobj = assemble( schedule, qubit_lo_freq=self.default_qubit_lo_freq, meas_lo_freq=self.default_meas_lo_freq, meas_map=[[0], [1]], ) self.assertEqual(qobj.config.memory_slots, n_memoryslots) # this should be in experimental header as well self.assertEqual(qobj.experiments[0].header.memory_slots, n_memoryslots) # multiple acquisition schedule = Acquire( 5, self.backend_config.acquire(0), mem_slot=pulse.MemorySlot(n_memoryslots - 1) ) schedule = schedule.insert( 10, Acquire( 5, self.backend_config.acquire(0), mem_slot=pulse.MemorySlot(n_memoryslots - 1) ), ) qobj = assemble( schedule, qubit_lo_freq=self.default_qubit_lo_freq, meas_lo_freq=self.default_meas_lo_freq, meas_map=[[0], [1]], ) self.assertEqual(qobj.config.memory_slots, n_memoryslots) # this should be in experimental header as well self.assertEqual(qobj.experiments[0].header.memory_slots, n_memoryslots) def test_assemble_memory_slots_for_schedules(self): """Test assembling schedules with different memory slots.""" n_memoryslots = [10, 5, 7] schedules = [] for n_memoryslot in n_memoryslots: schedule = Acquire( 5, self.backend_config.acquire(0), mem_slot=pulse.MemorySlot(n_memoryslot - 1) ) schedules.append(schedule) qobj = assemble( schedules, qubit_lo_freq=self.default_qubit_lo_freq, meas_lo_freq=self.default_meas_lo_freq, meas_map=[[0], [1]], ) self.assertEqual(qobj.config.memory_slots, max(n_memoryslots)) self.assertEqual(qobj.experiments[0].header.memory_slots, n_memoryslots[0]) self.assertEqual(qobj.experiments[1].header.memory_slots, n_memoryslots[1]) self.assertEqual(qobj.experiments[2].header.memory_slots, n_memoryslots[2]) def test_pulse_name_conflicts(self): """Test that pulse name conflicts can be resolved.""" name_conflict_pulse = pulse.Waveform( samples=np.array([0.02, 0.05, 0.05, 0.05, 0.02], dtype=np.complex128), name="pulse0" ) self.schedule = self.schedule.insert( 1, Play(name_conflict_pulse, self.backend_config.drive(1)) ) qobj = assemble( self.schedule, qobj_header=self.header, qubit_lo_freq=self.default_qubit_lo_freq, meas_lo_freq=self.default_meas_lo_freq, schedule_los=[], **self.config, ) self.assertNotEqual(qobj.config.pulse_library[0].name, qobj.config.pulse_library[1].name) def test_pulse_name_conflicts_in_other_schedule(self): """Test two pulses with the same name in different schedule can be resolved.""" backend = FakeHanoi() defaults = backend.defaults() schedules = [] ch_d0 = pulse.DriveChannel(0) for amp in (0.1, 0.2): sched = Schedule() sched += Play(gaussian(duration=100, amp=amp, sigma=30, name="my_pulse"), ch_d0) sched += measure(qubits=[0], backend=backend) << 100 schedules.append(sched) qobj = assemble( schedules, qubit_lo_freq=defaults.qubit_freq_est, meas_lo_freq=defaults.meas_freq_est ) # two user pulses and one measurement pulse should be contained self.assertEqual(len(qobj.config.pulse_library), 3) def test_assemble_with_delay(self): """Test that delay instruction is not ignored in assembly.""" delay_schedule = pulse.Delay(10, self.backend_config.drive(0)) delay_schedule += self.schedule delay_qobj = assemble(delay_schedule, self.backend) self.assertEqual(delay_qobj.experiments[0].instructions[0].name, "delay") self.assertEqual(delay_qobj.experiments[0].instructions[0].duration, 10) self.assertEqual(delay_qobj.experiments[0].instructions[0].t0, 0) def test_delay_removed_on_acq_ch(self): """Test that delay instructions on acquire channels are skipped on assembly with times shifted properly. """ delay0 = pulse.Delay(5, self.backend_config.acquire(0)) delay1 = pulse.Delay(7, self.backend_config.acquire(1)) sched0 = delay0 sched0 += self.schedule # includes ``Acquire`` instr sched0 += delay1 sched1 = self.schedule # includes ``Acquire`` instr sched1 += delay0 sched1 += delay1 sched2 = delay0 sched2 += delay1 sched2 += self.schedule # includes ``Acquire`` instr delay_qobj = assemble([sched0, sched1, sched2], self.backend) # check that no delay instrs occur on acquire channels is_acq_delay = False for exp in delay_qobj.experiments: for instr in exp.instructions: if instr.name == "delay" and "a" in instr.ch: is_acq_delay = True self.assertFalse(is_acq_delay) # check that acquire instr are shifted from ``t0=5`` as needed self.assertEqual(delay_qobj.experiments[0].instructions[1].t0, 10) self.assertEqual(delay_qobj.experiments[0].instructions[1].name, "acquire") self.assertEqual(delay_qobj.experiments[1].instructions[1].t0, 5) self.assertEqual(delay_qobj.experiments[1].instructions[1].name, "acquire") self.assertEqual(delay_qobj.experiments[2].instructions[1].t0, 12) self.assertEqual(delay_qobj.experiments[2].instructions[1].name, "acquire") def test_assemble_schedule_enum(self): """Test assembling a schedule with enum input values to assemble.""" qobj = assemble( self.schedule, qobj_header=self.header, qubit_lo_freq=self.default_qubit_lo_freq, meas_lo_freq=self.default_meas_lo_freq, schedule_los=[], meas_level=MeasLevel.CLASSIFIED, meas_return=MeasReturnType.AVERAGE, ) test_dict = qobj.to_dict() self.assertEqual(test_dict["config"]["meas_return"], "avg") self.assertEqual(test_dict["config"]["meas_level"], 2) def test_assemble_parametric(self): """Test that parametric pulses can be assembled properly into a PulseQobj.""" amp = [0.5, 0.6, 1, 0.2] angle = [np.pi / 2, 0.6, 0, 0] sched = pulse.Schedule(name="test_parametric") sched += Play( pulse.Gaussian(duration=25, sigma=4, amp=amp[0], angle=angle[0]), DriveChannel(0) ) sched += Play( pulse.Drag(duration=25, amp=amp[1], angle=angle[1], sigma=7.8, beta=4), DriveChannel(1) ) sched += Play(pulse.Constant(duration=25, amp=amp[2], angle=angle[2]), DriveChannel(2)) sched += ( Play( pulse.GaussianSquare(duration=150, amp=amp[3], angle=angle[3], sigma=8, width=140), MeasureChannel(0), ) << sched.duration ) backend = FakeOpenPulse3Q() backend.configuration().parametric_pulses = [ "gaussian", "drag", "gaussian_square", "constant", ] qobj = assemble(sched, backend) self.assertEqual(qobj.config.pulse_library, []) qobj_insts = qobj.experiments[0].instructions self.assertTrue(all(inst.name == "parametric_pulse" for inst in qobj_insts)) self.assertEqual(qobj_insts[0].pulse_shape, "gaussian") self.assertEqual(qobj_insts[1].pulse_shape, "drag") self.assertEqual(qobj_insts[2].pulse_shape, "constant") self.assertEqual(qobj_insts[3].pulse_shape, "gaussian_square") self.assertDictEqual( qobj_insts[0].parameters, {"duration": 25, "sigma": 4, "amp": amp[0] * np.exp(1j * angle[0])}, ) self.assertDictEqual( qobj_insts[1].parameters, {"duration": 25, "sigma": 7.8, "amp": amp[1] * np.exp(1j * angle[1]), "beta": 4}, ) self.assertDictEqual( qobj_insts[2].parameters, {"duration": 25, "amp": amp[2] * np.exp(1j * angle[2])} ) self.assertDictEqual( qobj_insts[3].parameters, {"duration": 150, "sigma": 8, "amp": amp[3] * np.exp(1j * angle[3]), "width": 140}, ) self.assertEqual( qobj.to_dict()["experiments"][0]["instructions"][0]["parameters"]["amp"], amp[0] * np.exp(1j * angle[0]), ) def test_assemble_parametric_unsupported(self): """Test that parametric pulses are translated to Waveform if they're not supported by the backend during assemble time. """ sched = pulse.Schedule(name="test_parametric_to_sample_pulse") sched += Play( pulse.Drag(duration=25, amp=0.5, angle=-0.3, sigma=7.8, beta=4), DriveChannel(1) ) sched += Play(pulse.Constant(duration=25, amp=1), DriveChannel(2)) backend = FakeOpenPulse3Q() backend.configuration().parametric_pulses = ["something_extra"] qobj = assemble(sched, backend) self.assertNotEqual(qobj.config.pulse_library, []) qobj_insts = qobj.experiments[0].instructions self.assertFalse(hasattr(qobj_insts[0], "pulse_shape")) def test_assemble_parametric_pulse_kwarg_with_backend_setting(self): """Test that parametric pulses respect the kwarg over backend""" backend = FakeHanoi() qc = QuantumCircuit(1, 1) qc.x(0) qc.measure(0, 0) with pulse.build(backend, name="x") as x_q0: pulse.play(pulse.Gaussian(duration=128, amp=0.1, sigma=16), pulse.drive_channel(0)) qc.add_calibration("x", (0,), x_q0) qobj = assemble(qc, backend, parametric_pulses=["gaussian"]) self.assertEqual(qobj.config.parametric_pulses, ["gaussian"]) def test_assemble_parametric_pulse_kwarg_empty_list_with_backend_setting(self): """Test that parametric pulses respect the kwarg as empty list over backend""" backend = FakeHanoi() qc = QuantumCircuit(1, 1) qc.x(0) qc.measure(0, 0) with pulse.build(backend, name="x") as x_q0: pulse.play(pulse.Gaussian(duration=128, amp=0.1, sigma=16), pulse.drive_channel(0)) qc.add_calibration("x", (0,), x_q0) qobj = assemble(qc, backend, parametric_pulses=[]) self.assertEqual(qobj.config.parametric_pulses, []) def test_init_qubits_default(self): """Check that the init_qubits=None assemble option is passed on to the qobj.""" qobj = assemble(self.schedule, self.backend) self.assertEqual(qobj.config.init_qubits, True) def test_init_qubits_true(self): """Check that the init_qubits=True assemble option is passed on to the qobj.""" qobj = assemble(self.schedule, self.backend, init_qubits=True) self.assertEqual(qobj.config.init_qubits, True) def test_init_qubits_false(self): """Check that the init_qubits=False assemble option is passed on to the qobj.""" qobj = assemble(self.schedule, self.backend, init_qubits=False) self.assertEqual(qobj.config.init_qubits, False) def test_assemble_backend_rep_times_delays(self): """Check that rep_time and rep_delay are properly set from backend values.""" # use first entry from allowed backend values rep_times = [2.0, 3.0, 4.0] # sec rep_delay_range = [2.5e-3, 4.5e-3] default_rep_delay = 3.0e-3 self.backend_config.rep_times = rep_times setattr(self.backend_config, "rep_delay_range", rep_delay_range) setattr(self.backend_config, "default_rep_delay", default_rep_delay) # dynamic rep rates off qobj = assemble(self.schedule, self.backend) self.assertEqual(qobj.config.rep_time, int(rep_times[0] * 1e6)) self.assertEqual(hasattr(qobj.config, "rep_delay"), False) # dynamic rep rates on setattr(self.backend_config, "dynamic_reprate_enabled", True) # RuntimeWarning bc ``rep_time`` is specified`` when dynamic rep rates not enabled with self.assertWarns(RuntimeWarning): qobj = assemble(self.schedule, self.backend) self.assertEqual(qobj.config.rep_time, int(rep_times[0] * 1e6)) self.assertEqual(qobj.config.rep_delay, default_rep_delay * 1e6) def test_assemble_user_rep_time_delay(self): """Check that user runtime config rep_time and rep_delay work.""" # set custom rep_time and rep_delay in runtime config rep_time = 200.0e-6 rep_delay = 2.5e-6 self.config["rep_time"] = rep_time self.config["rep_delay"] = rep_delay # dynamic rep rates off # RuntimeWarning bc using ``rep_delay`` when dynamic rep rates off with self.assertWarns(RuntimeWarning): qobj = assemble(self.schedule, self.backend, **self.config) self.assertEqual(qobj.config.rep_time, int(rep_time * 1e6)) self.assertEqual(hasattr(qobj.config, "rep_delay"), False) # now remove rep_delay and enable dynamic rep rates # RuntimeWarning bc using ``rep_time`` when dynamic rep rates are enabled del self.config["rep_delay"] setattr(self.backend_config, "dynamic_reprate_enabled", True) with self.assertWarns(RuntimeWarning): qobj = assemble(self.schedule, self.backend, **self.config) self.assertEqual(qobj.config.rep_time, int(rep_time * 1e6)) self.assertEqual(hasattr(qobj.config, "rep_delay"), False) # use ``default_rep_delay`` # ``rep_time`` comes from allowed backend rep_times rep_times = [0.5, 1.0, 1.5] # sec self.backend_config.rep_times = rep_times setattr(self.backend_config, "rep_delay_range", [0, 3.0e-6]) setattr(self.backend_config, "default_rep_delay", 2.2e-6) del self.config["rep_time"] qobj = assemble(self.schedule, self.backend, **self.config) self.assertEqual(qobj.config.rep_time, int(rep_times[0] * 1e6)) self.assertEqual(qobj.config.rep_delay, 2.2) # use qobj ``default_rep_delay`` self.config["rep_delay"] = 1.5e-6 qobj = assemble(self.schedule, self.backend, **self.config) self.assertEqual(qobj.config.rep_time, int(rep_times[0] * 1e6)) self.assertEqual(qobj.config.rep_delay, 1.5) # use ``rep_delay`` outside of ``rep_delay_range self.config["rep_delay"] = 5.0e-6 with self.assertRaises(QiskitError): assemble(self.schedule, self.backend, **self.config) def test_assemble_with_individual_discriminators(self): """Test that assembly works with individual discriminators.""" disc_one = Discriminator("disc_one", test_params=True) disc_two = Discriminator("disc_two", test_params=False) schedule = Schedule() schedule = schedule.append( Acquire(5, AcquireChannel(0), MemorySlot(0), discriminator=disc_one), ) schedule = schedule.append( Acquire(5, AcquireChannel(1), MemorySlot(1), discriminator=disc_two), ) qobj = assemble( schedule, qubit_lo_freq=self.default_qubit_lo_freq, meas_lo_freq=self.default_meas_lo_freq, meas_map=[[0, 1]], ) qobj_discriminators = qobj.experiments[0].instructions[0].discriminators self.assertEqual(len(qobj_discriminators), 2) self.assertEqual(qobj_discriminators[0].name, "disc_one") self.assertEqual(qobj_discriminators[0].params["test_params"], True) self.assertEqual(qobj_discriminators[1].name, "disc_two") self.assertEqual(qobj_discriminators[1].params["test_params"], False) def test_assemble_with_single_discriminators(self): """Test that assembly works with both a single discriminator.""" disc_one = Discriminator("disc_one", test_params=True) schedule = Schedule() schedule = schedule.append( Acquire(5, AcquireChannel(0), MemorySlot(0), discriminator=disc_one), ) schedule = schedule.append( Acquire(5, AcquireChannel(1), MemorySlot(1)), ) qobj = assemble( schedule, qubit_lo_freq=self.default_qubit_lo_freq, meas_lo_freq=self.default_meas_lo_freq, meas_map=[[0, 1]], ) qobj_discriminators = qobj.experiments[0].instructions[0].discriminators self.assertEqual(len(qobj_discriminators), 1) self.assertEqual(qobj_discriminators[0].name, "disc_one") self.assertEqual(qobj_discriminators[0].params["test_params"], True) def test_assemble_with_unequal_discriminators(self): """Test that assembly works with incorrect number of discriminators for number of qubits.""" disc_one = Discriminator("disc_one", test_params=True) disc_two = Discriminator("disc_two", test_params=False) schedule = Schedule() schedule += Acquire(5, AcquireChannel(0), MemorySlot(0), discriminator=disc_one) schedule += Acquire(5, AcquireChannel(1), MemorySlot(1), discriminator=disc_two) schedule += Acquire(5, AcquireChannel(2), MemorySlot(2)) with self.assertRaises(QiskitError): assemble( schedule, qubit_lo_freq=self.default_qubit_lo_freq, meas_lo_freq=self.default_meas_lo_freq, meas_map=[[0, 1, 2]], ) def test_assemble_with_individual_kernels(self): """Test that assembly works with individual kernels.""" disc_one = Kernel("disc_one", test_params=True) disc_two = Kernel("disc_two", test_params=False) schedule = Schedule() schedule = schedule.append( Acquire(5, AcquireChannel(0), MemorySlot(0), kernel=disc_one), ) schedule = schedule.append( Acquire(5, AcquireChannel(1), MemorySlot(1), kernel=disc_two), ) qobj = assemble( schedule, qubit_lo_freq=self.default_qubit_lo_freq, meas_lo_freq=self.default_meas_lo_freq, meas_map=[[0, 1]], ) qobj_kernels = qobj.experiments[0].instructions[0].kernels self.assertEqual(len(qobj_kernels), 2) self.assertEqual(qobj_kernels[0].name, "disc_one") self.assertEqual(qobj_kernels[0].params["test_params"], True) self.assertEqual(qobj_kernels[1].name, "disc_two") self.assertEqual(qobj_kernels[1].params["test_params"], False) def test_assemble_with_single_kernels(self): """Test that assembly works with both a single kernel.""" disc_one = Kernel("disc_one", test_params=True) schedule = Schedule() schedule = schedule.append( Acquire(5, AcquireChannel(0), MemorySlot(0), kernel=disc_one), ) schedule = schedule.append( Acquire(5, AcquireChannel(1), MemorySlot(1)), ) qobj = assemble( schedule, qubit_lo_freq=self.default_qubit_lo_freq, meas_lo_freq=self.default_meas_lo_freq, meas_map=[[0, 1]], ) qobj_kernels = qobj.experiments[0].instructions[0].kernels self.assertEqual(len(qobj_kernels), 1) self.assertEqual(qobj_kernels[0].name, "disc_one") self.assertEqual(qobj_kernels[0].params["test_params"], True) def test_assemble_with_unequal_kernels(self): """Test that assembly works with incorrect number of discriminators for number of qubits.""" disc_one = Kernel("disc_one", test_params=True) disc_two = Kernel("disc_two", test_params=False) schedule = Schedule() schedule += Acquire(5, AcquireChannel(0), MemorySlot(0), kernel=disc_one) schedule += Acquire(5, AcquireChannel(1), MemorySlot(1), kernel=disc_two) schedule += Acquire(5, AcquireChannel(2), MemorySlot(2)) with self.assertRaises(QiskitError): assemble( schedule, qubit_lo_freq=self.default_qubit_lo_freq, meas_lo_freq=self.default_meas_lo_freq, meas_map=[[0, 1, 2]], ) def test_assemble_single_instruction(self): """Test assembling schedules, no lo config.""" inst = pulse.Play(pulse.Constant(100, 1.0), pulse.DriveChannel(0)) self.assertIsInstance(assemble(inst, self.backend), PulseQobj) def test_assemble_overlapping_time(self): """Test that assembly errors when qubits are measured in overlapping time.""" schedule = Schedule() schedule = schedule.append( Acquire(5, AcquireChannel(0), MemorySlot(0)), ) schedule = schedule.append( Acquire(5, AcquireChannel(1), MemorySlot(1)) << 1, ) with self.assertRaises(QiskitError): assemble( schedule, qubit_lo_freq=self.default_qubit_lo_freq, meas_lo_freq=self.default_meas_lo_freq, meas_map=[[0, 1]], ) def test_assemble_meas_map_vs_insts(self): """Test that assembly errors when the qubits are measured in overlapping time and qubits are not in the first meas_map list.""" schedule = Schedule() schedule += Acquire(5, AcquireChannel(0), MemorySlot(0)) schedule += Acquire(5, AcquireChannel(1), MemorySlot(1)) schedule += Acquire(5, AcquireChannel(2), MemorySlot(2)) << 2 schedule += Acquire(5, AcquireChannel(3), MemorySlot(3)) << 2 with self.assertRaises(QiskitError): assemble( schedule, qubit_lo_freq=self.default_qubit_lo_freq, meas_lo_freq=self.default_meas_lo_freq, meas_map=[[0], [1, 2], [3]], ) def test_assemble_non_overlapping_time_single_meas_map(self): """Test that assembly works when qubits are measured in non-overlapping time within the same measurement map list.""" schedule = Schedule() schedule = schedule.append( Acquire(5, AcquireChannel(0), MemorySlot(0)), ) schedule = schedule.append( Acquire(5, AcquireChannel(1), MemorySlot(1)) << 5, ) qobj = assemble( schedule, qubit_lo_freq=self.default_qubit_lo_freq, meas_lo_freq=self.default_meas_lo_freq, meas_map=[[0, 1]], ) self.assertIsInstance(qobj, PulseQobj) def test_assemble_disjoint_time(self): """Test that assembly works when qubits are in disjoint meas map sets.""" schedule = Schedule() schedule = schedule.append( Acquire(5, AcquireChannel(0), MemorySlot(0)), ) schedule = schedule.append( Acquire(5, AcquireChannel(1), MemorySlot(1)) << 1, ) qobj = assemble( schedule, qubit_lo_freq=self.default_qubit_lo_freq, meas_lo_freq=self.default_meas_lo_freq, meas_map=[[0, 2], [1, 3]], ) self.assertIsInstance(qobj, PulseQobj) def test_assemble_valid_qubits(self): """Test that assembly works when qubits that are in the measurement map is measured.""" schedule = Schedule() schedule = schedule.append( Acquire(5, AcquireChannel(1), MemorySlot(1)), ) schedule = schedule.append( Acquire(5, AcquireChannel(2), MemorySlot(2)), ) schedule = schedule.append( Acquire(5, AcquireChannel(3), MemorySlot(3)), ) qobj = assemble( schedule, qubit_lo_freq=self.default_qubit_lo_freq, meas_lo_freq=self.default_meas_lo_freq, meas_map=[[0, 1, 2], [3]], ) self.assertIsInstance(qobj, PulseQobj) class TestPulseAssemblerMissingKwargs(QiskitTestCase): """Verify that errors are raised in case backend is not provided and kwargs are missing.""" def setUp(self): super().setUp() self.schedule = pulse.Schedule(name="fake_experiment") self.backend = FakeOpenPulse2Q() self.config = self.backend.configuration() self.defaults = self.backend.defaults() self.qubit_lo_freq = list(self.defaults.qubit_freq_est) self.meas_lo_freq = list(self.defaults.meas_freq_est) self.qubit_lo_range = self.config.qubit_lo_range self.meas_lo_range = self.config.meas_lo_range self.schedule_los = { pulse.DriveChannel(0): self.qubit_lo_freq[0], pulse.DriveChannel(1): self.qubit_lo_freq[1], pulse.MeasureChannel(0): self.meas_lo_freq[0], pulse.MeasureChannel(1): self.meas_lo_freq[1], } self.meas_map = self.config.meas_map self.memory_slots = self.config.n_qubits # default rep_time and rep_delay self.rep_time = self.config.rep_times[0] self.rep_delay = None def test_defaults(self): """Test defaults work.""" qobj = assemble( self.schedule, qubit_lo_freq=self.qubit_lo_freq, meas_lo_freq=self.meas_lo_freq, qubit_lo_range=self.qubit_lo_range, meas_lo_range=self.meas_lo_range, schedule_los=self.schedule_los, meas_map=self.meas_map, memory_slots=self.memory_slots, rep_time=self.rep_time, rep_delay=self.rep_delay, ) self.assertIsInstance(qobj, PulseQobj) def test_missing_qubit_lo_freq(self): """Test error raised if qubit_lo_freq missing.""" with self.assertRaises(QiskitError): assemble( self.schedule, qubit_lo_freq=None, meas_lo_freq=self.meas_lo_freq, qubit_lo_range=self.qubit_lo_range, meas_lo_range=self.meas_lo_range, meas_map=self.meas_map, memory_slots=self.memory_slots, rep_time=self.rep_time, rep_delay=self.rep_delay, ) def test_missing_meas_lo_freq(self): """Test error raised if meas_lo_freq missing.""" with self.assertRaises(QiskitError): assemble( self.schedule, qubit_lo_freq=self.qubit_lo_freq, meas_lo_freq=None, qubit_lo_range=self.qubit_lo_range, meas_lo_range=self.meas_lo_range, meas_map=self.meas_map, memory_slots=self.memory_slots, rep_time=self.rep_time, rep_delay=self.rep_delay, ) def test_missing_memory_slots(self): """Test error is not raised if memory_slots are missing.""" qobj = assemble( self.schedule, qubit_lo_freq=self.qubit_lo_freq, meas_lo_freq=self.meas_lo_freq, qubit_lo_range=self.qubit_lo_range, meas_lo_range=self.meas_lo_range, schedule_los=self.schedule_los, meas_map=self.meas_map, memory_slots=None, rep_time=self.rep_time, rep_delay=self.rep_delay, ) self.assertIsInstance(qobj, PulseQobj) def test_missing_rep_time_and_delay(self): """Test qobj is valid if rep_time and rep_delay are missing.""" qobj = assemble( self.schedule, qubit_lo_freq=self.qubit_lo_freq, meas_lo_freq=self.meas_lo_freq, qubit_lo_range=self.qubit_lo_range, meas_lo_range=self.meas_lo_range, schedule_los=self.schedule_los, meas_map=self.meas_map, memory_slots=None, rep_time=None, rep_delay=None, ) self.assertEqual(hasattr(qobj, "rep_time"), False) self.assertEqual(hasattr(qobj, "rep_delay"), False) def test_missing_meas_map(self): """Test that assembly still works if meas_map is missing.""" qobj = assemble( self.schedule, qubit_lo_freq=self.qubit_lo_freq, meas_lo_freq=self.meas_lo_freq, qubit_lo_range=self.qubit_lo_range, meas_lo_range=self.meas_lo_range, schedule_los=self.schedule_los, meas_map=None, memory_slots=self.memory_slots, rep_time=self.rep_time, rep_delay=self.rep_delay, ) self.assertIsInstance(qobj, PulseQobj) def test_missing_lo_ranges(self): """Test that assembly still works if lo_ranges are missing.""" qobj = assemble( self.schedule, qubit_lo_freq=self.qubit_lo_freq, meas_lo_freq=self.meas_lo_freq, qubit_lo_range=None, meas_lo_range=None, schedule_los=self.schedule_los, meas_map=self.meas_map, memory_slots=self.memory_slots, rep_time=self.rep_time, rep_delay=self.rep_delay, ) self.assertIsInstance(qobj, PulseQobj) def test_unsupported_meas_level(self): """Test that assembly raises an error if meas_level is not supported""" backend = FakeOpenPulse2Q() backend.configuration().meas_levels = [1, 2] with self.assertRaises(QiskitError): assemble( self.schedule, backend, qubit_lo_freq=self.qubit_lo_freq, meas_lo_freq=self.meas_lo_freq, qubit_lo_range=self.qubit_lo_range, meas_lo_range=self.meas_lo_range, schedule_los=self.schedule_los, meas_level=0, meas_map=self.meas_map, memory_slots=self.memory_slots, rep_time=self.rep_time, rep_delay=self.rep_delay, ) def test_single_and_deprecated_acquire_styles(self): """Test that acquires are identically combined with Acquires that take a single channel.""" backend = FakeOpenPulse2Q() new_style_schedule = Schedule() acq_dur = 1200 for i in range(2): new_style_schedule += Acquire(acq_dur, AcquireChannel(i), MemorySlot(i)) deprecated_style_schedule = Schedule() for i in range(2): deprecated_style_schedule += Acquire(1200, AcquireChannel(i), MemorySlot(i)) # The Qobj IDs will be different n_qobj = assemble(new_style_schedule, backend) n_qobj.qobj_id = None n_qobj.experiments[0].header.name = None d_qobj = assemble(deprecated_style_schedule, backend) d_qobj.qobj_id = None d_qobj.experiments[0].header.name = None self.assertEqual(n_qobj, d_qobj) assembled_acquire = n_qobj.experiments[0].instructions[0] self.assertEqual(assembled_acquire.qubits, [0, 1]) self.assertEqual(assembled_acquire.memory_slot, [0, 1]) class StreamHandlerRaiseException(StreamHandler): """Handler class that will raise an exception on formatting errors.""" def handleError(self, record): raise sys.exc_info() class TestLogAssembler(QiskitTestCase): """Testing the log_assembly option.""" def setUp(self): super().setUp() logger = getLogger() self.addCleanup(logger.setLevel, logger.level) logger.setLevel("DEBUG") self.output = io.StringIO() logger.addHandler(StreamHandlerRaiseException(self.output)) self.circuit = QuantumCircuit(QuantumRegister(1)) def assertAssembleLog(self, log_msg): """Runs assemble and checks for logs containing specified message""" assemble(self.circuit, shots=2000, memory=True) self.output.seek(0) # Filter unrelated log lines output_lines = self.output.readlines() assembly_log_lines = [x for x in output_lines if log_msg in x] self.assertTrue(len(assembly_log_lines) == 1) def test_assembly_log_time(self): """Check Total Assembly Time is logged""" self.assertAssembleLog("Total Assembly Time") if __name__ == "__main__": unittest.main(verbosity=2)
https://github.com/swe-bench/Qiskit__qiskit
swe-bench
# This code is part of Qiskit. # # (C) Copyright IBM 2021. # # This code is licensed under the Apache License, Version 2.0. You may # obtain a copy of this license in the LICENSE.txt file in the root directory # of this source tree or at http://www.apache.org/licenses/LICENSE-2.0. # # Any modifications or derivative works of this code must retain this # copyright notice, and modified files need to carry a notice indicating # that they have been altered from the originals. """Transpiler pulse gate pass testing.""" import ddt from qiskit import pulse, circuit, transpile from qiskit.providers.fake_provider import FakeAthens, FakeAthensV2 from qiskit.quantum_info.random import random_unitary from qiskit.test import QiskitTestCase @ddt.ddt class TestPulseGate(QiskitTestCase): """Integration test of pulse gate pass with custom backend.""" def setUp(self): super().setUp() self.sched_param = circuit.Parameter("P0") with pulse.build(name="sx_q0") as custom_sx_q0: pulse.play(pulse.Constant(100, 0.1), pulse.DriveChannel(0)) self.custom_sx_q0 = custom_sx_q0 with pulse.build(name="sx_q1") as custom_sx_q1: pulse.play(pulse.Constant(100, 0.2), pulse.DriveChannel(1)) self.custom_sx_q1 = custom_sx_q1 with pulse.build(name="cx_q01") as custom_cx_q01: pulse.play(pulse.Constant(100, 0.4), pulse.ControlChannel(0)) self.custom_cx_q01 = custom_cx_q01 with pulse.build(name="my_gate_q0") as my_gate_q0: pulse.shift_phase(self.sched_param, pulse.DriveChannel(0)) pulse.play(pulse.Constant(120, 0.1), pulse.DriveChannel(0)) self.my_gate_q0 = my_gate_q0 with pulse.build(name="my_gate_q1") as my_gate_q1: pulse.shift_phase(self.sched_param, pulse.DriveChannel(1)) pulse.play(pulse.Constant(120, 0.2), pulse.DriveChannel(1)) self.my_gate_q1 = my_gate_q1 def test_transpile_with_bare_backend(self): """Test transpile without custom calibrations.""" backend = FakeAthens() qc = circuit.QuantumCircuit(2) qc.sx(0) qc.x(0) qc.rz(0, 0) qc.sx(1) qc.measure_all() transpiled_qc = transpile(qc, backend, initial_layout=[0, 1]) ref_calibration = {} self.assertDictEqual(transpiled_qc.calibrations, ref_calibration) def test_transpile_with_backend_target(self): """Test transpile without custom calibrations from target.""" backend = FakeAthensV2() target = backend.target qc = circuit.QuantumCircuit(2) qc.sx(0) qc.x(0) qc.rz(0, 0) qc.sx(1) qc.measure_all() transpiled_qc = transpile(qc, initial_layout=[0, 1], target=target) ref_calibration = {} self.assertDictEqual(transpiled_qc.calibrations, ref_calibration) def test_transpile_with_custom_basis_gate(self): """Test transpile with custom calibrations.""" backend = FakeAthens() backend.defaults().instruction_schedule_map.add("sx", (0,), self.custom_sx_q0) backend.defaults().instruction_schedule_map.add("sx", (1,), self.custom_sx_q1) qc = circuit.QuantumCircuit(2) qc.sx(0) qc.x(0) qc.rz(0, 0) qc.sx(1) qc.measure_all() transpiled_qc = transpile(qc, backend, initial_layout=[0, 1]) ref_calibration = { "sx": { ((0,), ()): self.custom_sx_q0, ((1,), ()): self.custom_sx_q1, } } self.assertDictEqual(transpiled_qc.calibrations, ref_calibration) def test_transpile_with_custom_basis_gate_in_target(self): """Test transpile with custom calibrations.""" backend = FakeAthensV2() target = backend.target target["sx"][(0,)].calibration = self.custom_sx_q0 target["sx"][(1,)].calibration = self.custom_sx_q1 qc = circuit.QuantumCircuit(2) qc.sx(0) qc.x(0) qc.rz(0, 0) qc.sx(1) qc.measure_all() transpiled_qc = transpile(qc, initial_layout=[0, 1], target=target) ref_calibration = { "sx": { ((0,), ()): self.custom_sx_q0, ((1,), ()): self.custom_sx_q1, } } self.assertDictEqual(transpiled_qc.calibrations, ref_calibration) def test_transpile_with_instmap(self): """Test providing instruction schedule map.""" instmap = FakeAthens().defaults().instruction_schedule_map instmap.add("sx", (0,), self.custom_sx_q0) instmap.add("sx", (1,), self.custom_sx_q1) # Inst map is renewed backend = FakeAthens() qc = circuit.QuantumCircuit(2) qc.sx(0) qc.x(0) qc.rz(0, 0) qc.sx(1) qc.measure_all() transpiled_qc = transpile(qc, backend, inst_map=instmap, initial_layout=[0, 1]) ref_calibration = { "sx": { ((0,), ()): self.custom_sx_q0, ((1,), ()): self.custom_sx_q1, } } self.assertDictEqual(transpiled_qc.calibrations, ref_calibration) def test_transpile_with_custom_gate(self): """Test providing non-basis gate.""" backend = FakeAthens() backend.defaults().instruction_schedule_map.add( "my_gate", (0,), self.my_gate_q0, arguments=["P0"] ) backend.defaults().instruction_schedule_map.add( "my_gate", (1,), self.my_gate_q1, arguments=["P0"] ) qc = circuit.QuantumCircuit(2) qc.append(circuit.Gate("my_gate", 1, [1.0]), [0]) qc.append(circuit.Gate("my_gate", 1, [2.0]), [1]) transpiled_qc = transpile(qc, backend, basis_gates=["my_gate"], initial_layout=[0, 1]) my_gate_q0_1_0 = self.my_gate_q0.assign_parameters({self.sched_param: 1.0}, inplace=False) my_gate_q1_2_0 = self.my_gate_q1.assign_parameters({self.sched_param: 2.0}, inplace=False) ref_calibration = { "my_gate": { ((0,), (1.0,)): my_gate_q0_1_0, ((1,), (2.0,)): my_gate_q1_2_0, } } self.assertDictEqual(transpiled_qc.calibrations, ref_calibration) def test_transpile_with_parameterized_custom_gate(self): """Test providing non-basis gate, which is kept parameterized throughout transpile.""" backend = FakeAthens() backend.defaults().instruction_schedule_map.add( "my_gate", (0,), self.my_gate_q0, arguments=["P0"] ) param = circuit.Parameter("new_P0") qc = circuit.QuantumCircuit(1) qc.append(circuit.Gate("my_gate", 1, [param]), [0]) transpiled_qc = transpile(qc, backend, basis_gates=["my_gate"], initial_layout=[0]) my_gate_q0_p = self.my_gate_q0.assign_parameters({self.sched_param: param}, inplace=False) ref_calibration = { "my_gate": { ((0,), (param,)): my_gate_q0_p, } } self.assertDictEqual(transpiled_qc.calibrations, ref_calibration) def test_transpile_with_multiple_circuits(self): """Test transpile with multiple circuits with custom gate.""" backend = FakeAthens() backend.defaults().instruction_schedule_map.add( "my_gate", (0,), self.my_gate_q0, arguments=["P0"] ) params = [0.0, 1.0, 2.0, 3.0] circs = [] for param in params: qc = circuit.QuantumCircuit(1) qc.append(circuit.Gate("my_gate", 1, [param]), [0]) circs.append(qc) transpiled_qcs = transpile(circs, backend, basis_gates=["my_gate"], initial_layout=[0]) for param, transpiled_qc in zip(params, transpiled_qcs): my_gate_q0_x = self.my_gate_q0.assign_parameters( {self.sched_param: param}, inplace=False ) ref_calibration = {"my_gate": {((0,), (param,)): my_gate_q0_x}} self.assertDictEqual(transpiled_qc.calibrations, ref_calibration) def test_multiple_instructions_with_different_parameters(self): """Test adding many instruction with different parameter binding.""" backend = FakeAthens() backend.defaults().instruction_schedule_map.add( "my_gate", (0,), self.my_gate_q0, arguments=["P0"] ) qc = circuit.QuantumCircuit(1) qc.append(circuit.Gate("my_gate", 1, [1.0]), [0]) qc.append(circuit.Gate("my_gate", 1, [2.0]), [0]) qc.append(circuit.Gate("my_gate", 1, [3.0]), [0]) transpiled_qc = transpile(qc, backend, basis_gates=["my_gate"], initial_layout=[0]) my_gate_q0_1_0 = self.my_gate_q0.assign_parameters({self.sched_param: 1.0}, inplace=False) my_gate_q0_2_0 = self.my_gate_q0.assign_parameters({self.sched_param: 2.0}, inplace=False) my_gate_q0_3_0 = self.my_gate_q0.assign_parameters({self.sched_param: 3.0}, inplace=False) ref_calibration = { "my_gate": { ((0,), (1.0,)): my_gate_q0_1_0, ((0,), (2.0,)): my_gate_q0_2_0, ((0,), (3.0,)): my_gate_q0_3_0, } } self.assertDictEqual(transpiled_qc.calibrations, ref_calibration) def test_transpile_with_different_qubit(self): """Test transpile with qubit without custom gate.""" backend = FakeAthens() backend.defaults().instruction_schedule_map.add("sx", (0,), self.custom_sx_q0) qc = circuit.QuantumCircuit(1) qc.sx(0) qc.measure_all() transpiled_qc = transpile(qc, backend, initial_layout=[3]) self.assertDictEqual(transpiled_qc.calibrations, {}) @ddt.data(0, 1, 2, 3) def test_transpile_with_both_instmap_and_empty_target(self, opt_level): """Test when instmap and target are both provided and only instmap contains custom schedules. Test case from Qiskit/qiskit-terra/#9489 """ instmap = FakeAthens().defaults().instruction_schedule_map instmap.add("sx", (0,), self.custom_sx_q0) instmap.add("sx", (1,), self.custom_sx_q1) instmap.add("cx", (0, 1), self.custom_cx_q01) # This doesn't have custom schedule definition target = FakeAthensV2().target qc = circuit.QuantumCircuit(2) qc.append(random_unitary(4, seed=123), [0, 1]) qc.measure_all() transpiled_qc = transpile( qc, optimization_level=opt_level, basis_gates=["sx", "rz", "x", "cx"], inst_map=instmap, target=target, initial_layout=[0, 1], ) ref_calibration = { "sx": { ((0,), ()): self.custom_sx_q0, ((1,), ()): self.custom_sx_q1, }, "cx": { ((0, 1), ()): self.custom_cx_q01, }, } self.assertDictEqual(transpiled_qc.calibrations, ref_calibration) @ddt.data(0, 1, 2, 3) def test_transpile_with_instmap_with_v2backend(self, opt_level): """Test when instmap is provided with V2 backend. Test case from Qiskit/qiskit-terra/#9489 """ instmap = FakeAthens().defaults().instruction_schedule_map instmap.add("sx", (0,), self.custom_sx_q0) instmap.add("sx", (1,), self.custom_sx_q1) instmap.add("cx", (0, 1), self.custom_cx_q01) qc = circuit.QuantumCircuit(2) qc.append(random_unitary(4, seed=123), [0, 1]) qc.measure_all() transpiled_qc = transpile( qc, FakeAthensV2(), optimization_level=opt_level, inst_map=instmap, initial_layout=[0, 1], ) ref_calibration = { "sx": { ((0,), ()): self.custom_sx_q0, ((1,), ()): self.custom_sx_q1, }, "cx": { ((0, 1), ()): self.custom_cx_q01, }, } self.assertDictEqual(transpiled_qc.calibrations, ref_calibration) @ddt.data(0, 1, 2, 3) def test_transpile_with_instmap_with_v2backend_with_custom_gate(self, opt_level): """Test when instmap is provided with V2 backend. In this test case, instmap contains a custom gate which doesn't belong to Qiskit standard gate. Target must define a custom gete on the fly to reflect user-provided instmap. Test case from Qiskit/qiskit-terra/#9489 """ with pulse.build(name="custom") as rabi12: pulse.play(pulse.Constant(100, 0.4), pulse.DriveChannel(0)) instmap = FakeAthens().defaults().instruction_schedule_map instmap.add("rabi12", (0,), rabi12) gate = circuit.Gate("rabi12", 1, []) qc = circuit.QuantumCircuit(1) qc.append(gate, [0]) qc.measure_all() transpiled_qc = transpile( qc, FakeAthensV2(), optimization_level=opt_level, inst_map=instmap, initial_layout=[0], ) ref_calibration = { "rabi12": { ((0,), ()): rabi12, } } self.assertDictEqual(transpiled_qc.calibrations, ref_calibration) def test_transpile_with_instmap_not_mutate_backend(self): """Do not override default backend target when transpile with inst map. Providing an instmap for the transpile arguments may override target, which might be pulled from the provided backend instance. This should not override the source object since the same backend may be used for future transpile without intention of instruction overriding. """ backend = FakeAthensV2() original_sx0 = backend.target["sx"][(0,)].calibration instmap = FakeAthens().defaults().instruction_schedule_map instmap.add("sx", (0,), self.custom_sx_q0) qc = circuit.QuantumCircuit(1) qc.sx(0) qc.measure_all() transpiled_qc = transpile( qc, FakeAthensV2(), inst_map=instmap, initial_layout=[0], ) self.assertTrue(transpiled_qc.has_calibration_for(transpiled_qc.data[0])) self.assertEqual( backend.target["sx"][(0,)].calibration, original_sx0, )
https://github.com/swe-bench/Qiskit__qiskit
swe-bench
# -*- coding: utf-8 -*- # This code is part of Qiskit. # # (C) Copyright IBM 2018, 2019. # # This code is licensed under the Apache License, Version 2.0. You may # obtain a copy of this license in the LICENSE.txt file in the root directory # of this source tree or at http://www.apache.org/licenses/LICENSE-2.0. # # Any modifications or derivative works of this code must retain this # copyright notice, and modified files need to carry a notice indicating # that they have been altered from the originals. """ The Amplitude Estimation Algorithm. """ import logging from collections import OrderedDict import numpy as np from qiskit import ClassicalRegister from qiskit.aqua import AquaError from qiskit.aqua import Pluggable, PluggableType, get_pluggable_class from qiskit.aqua.algorithms import QuantumAlgorithm from qiskit.aqua.circuits import PhaseEstimationCircuit from qiskit.aqua.components.iqfts import Standard from .q_factory import QFactory logger = logging.getLogger(__name__) class AmplitudeEstimation(QuantumAlgorithm): """ The Amplitude Estimation algorithm. """ CONFIGURATION = { 'name': 'AmplitudeEstimation', 'description': 'Amplitude Estimation Algorithm', 'input_schema': { '$schema': 'http://json-schema.org/schema#', 'id': 'AmplitudeEstimation_schema', 'type': 'object', 'properties': { 'num_eval_qubits': { 'type': 'integer', 'default': 5, 'minimum': 1 } }, 'additionalProperties': False }, 'problems': ['uncertainty'], 'depends': [ { 'pluggable_type': 'uncertainty_problem', 'default': { 'name': 'EuropeanCallDelta' } }, { 'pluggable_type': 'iqft', 'default': { 'name': 'STANDARD', } }, ], } def __init__(self, num_eval_qubits, a_factory, i_objective=None, q_factory=None, iqft=None): """ Constructor. Args: num_eval_qubits (int): number of evaluation qubits a_factory (CircuitFactory): the CircuitFactory subclass object representing the problem unitary q_factory (CircuitFactory): the CircuitFactory subclass object representing an amplitude estimation sample (based on a_factory) iqft (IQFT): the Inverse Quantum Fourier Transform pluggable component, defaults to using a standard iqft when None """ self.validate(locals()) super().__init__() # get/construct A/Q operator self.a_factory = a_factory if q_factory is None: if i_objective is None: i_objective = self.a_factory.num_target_qubits - 1 self.q_factory = QFactory(a_factory, i_objective) else: self.q_factory = q_factory # get parameters self._m = num_eval_qubits self._M = 2 ** num_eval_qubits # determine number of ancillas self._num_ancillas = self.q_factory.required_ancillas_controlled() self._num_qubits = self.a_factory.num_target_qubits + self._m + self._num_ancillas if iqft is None: iqft = Standard(self._m) self._iqft = iqft self._circuit = None self._ret = {} @classmethod def init_params(cls, params, algo_input): """ Initialize via parameters dictionary and algorithm input instance Args: params: parameters dictionary algo_input: Input instance """ if algo_input is not None: raise AquaError("Input instance not supported.") ae_params = params.get(Pluggable.SECTION_KEY_ALGORITHM) num_eval_qubits = ae_params.get('num_eval_qubits') # Set up uncertainty problem. The params can include an uncertainty model # type dependent on the uncertainty problem and is this its responsibility # to create for itself from the complete params set that is passed to it. uncertainty_problem_params = params.get(Pluggable.SECTION_KEY_UNCERTAINTY_PROBLEM) uncertainty_problem = get_pluggable_class( PluggableType.UNCERTAINTY_PROBLEM, uncertainty_problem_params['name']).init_params(params) # Set up iqft, we need to add num qubits to params which is our num_ancillae bits here iqft_params = params.get(Pluggable.SECTION_KEY_IQFT) iqft_params['num_qubits'] = num_eval_qubits iqft = get_pluggable_class(PluggableType.IQFT, iqft_params['name']).init_params(params) return cls(num_eval_qubits, uncertainty_problem, q_factory=None, iqft=iqft) def construct_circuit(self, measurement=False): """ Construct the Amplitude Estimation quantum circuit. Args: measurement (bool): Boolean flag to indicate if measurement should be included in the circuit. Returns: the QuantumCircuit object for the constructed circuit """ pec = PhaseEstimationCircuit( iqft=self._iqft, num_ancillae=self._m, state_in_circuit_factory=self.a_factory, unitary_circuit_factory=self.q_factory ) self._circuit = pec.construct_circuit(measurement=measurement) return self._circuit def _evaluate_statevector_results(self, probabilities): # map measured results to estimates y_probabilities = OrderedDict() for i, probability in enumerate(probabilities): b = "{0:b}".format(i).rjust(self._num_qubits, '0')[::-1] y = int(b[:self._m], 2) y_probabilities[y] = y_probabilities.get(y, 0) + probability a_probabilities = OrderedDict() for y, probability in y_probabilities.items(): if y >= int(self._M / 2): y = self._M - y a = np.power(np.sin(y * np.pi / 2 ** self._m), 2) a_probabilities[a] = a_probabilities.get(a, 0) + probability return a_probabilities, y_probabilities def _run(self): if self._quantum_instance.is_statevector: self.construct_circuit(measurement=False) # run circuit on statevector simlator ret = self._quantum_instance.execute(self._circuit) state_vector = np.asarray([ret.get_statevector(self._circuit)]) self._ret['statevector'] = state_vector # get state probabilities state_probabilities = np.real(state_vector.conj() * state_vector)[0] # evaluate results a_probabilities, y_probabilities = self._evaluate_statevector_results(state_probabilities) else: # run circuit on QASM simulator self.construct_circuit(measurement=True) ret = self._quantum_instance.execute(self._circuit) # get counts self._ret['counts'] = ret.get_counts() # construct probabilities y_probabilities = {} a_probabilities = {} shots = sum(ret.get_counts().values()) for state, counts in ret.get_counts().items(): y = int(state.replace(' ', '')[:self._m][::-1], 2) p = counts / shots y_probabilities[y] = p a = np.power(np.sin(y * np.pi / 2 ** self._m), 2) a_probabilities[a] = a_probabilities.get(a, 0.0) + p # construct a_items and y_items a_items = [(a, p) for (a, p) in a_probabilities.items() if p > 1e-6] y_items = [(y, p) for (y, p) in y_probabilities.items() if p > 1e-6] a_items = sorted(a_items) y_items = sorted(y_items) self._ret['a_items'] = a_items self._ret['y_items'] = y_items # map estimated values to original range and extract probabilities self._ret['mapped_values'] = [self.a_factory.value_to_estimation(a_item[0]) for a_item in self._ret['a_items']] self._ret['values'] = [a_item[0] for a_item in self._ret['a_items']] self._ret['y_values'] = [y_item[0] for y_item in y_items] self._ret['probabilities'] = [a_item[1] for a_item in self._ret['a_items']] self._ret['mapped_items'] = [(self._ret['mapped_values'][i], self._ret['probabilities'][i]) for i in range(len(self._ret['mapped_values']))] # determine most likely estimator self._ret['estimation'] = None self._ret['max_probability'] = 0 for val, prob in self._ret['mapped_items']: if prob > self._ret['max_probability']: self._ret['max_probability'] = prob self._ret['estimation'] = val return self._ret
https://github.com/GIRISHBELANI/QC_Benchmarks_using_dm-simulator
GIRISHBELANI
""" Amplitude Estimation Benchmark Program via Phase Estimation - QSim """ import copy import sys import time import numpy as np from qiskit import QuantumCircuit, QuantumRegister, ClassicalRegister sys.path[1:1] = ["_common", "_common/qsim", "quantum-fourier-transform/qsim"] sys.path[1:1] = ["../../_common", "../../_common/qsim", "../../quantum-fourier-transform/qsim"] import execute as ex import metrics as metrics from qft_benchmark import inv_qft_gate from execute import BenchmarkResult # Benchmark Name benchmark_name = "Amplitude Estimation" np.random.seed(0) verbose = False # saved subcircuits circuits for printing A_ = None Q_ = None cQ_ = None QC_ = None QFTI_ = None ############### Circuit Definition def AmplitudeEstimation(num_state_qubits, num_counting_qubits, a, psi_zero=None, psi_one=None): num_qubits = num_state_qubits + 1 + num_counting_qubits qr_state = QuantumRegister(num_state_qubits+1) qr_counting = QuantumRegister(num_counting_qubits) cr = ClassicalRegister(num_counting_qubits) qc = QuantumCircuit(qr_counting, qr_state, cr, name=f"qae-{num_qubits}-{a}") # create the Amplitude Generator circuit A = A_gen(num_state_qubits, a, psi_zero, psi_one) # create the Quantum Operator circuit and a controlled version of it cQ, Q = Ctrl_Q(num_state_qubits, A) # save small example subcircuits for visualization global A_, Q_, cQ_, QFTI_ if (cQ_ and Q_) == None or num_state_qubits <= 6: if num_state_qubits < 9: cQ_ = cQ; Q_ = Q; A_ = A if QFTI_ == None or num_qubits <= 5: if num_qubits < 9: QFTI_ = inv_qft_gate(num_counting_qubits) # Prepare state from A, and counting qubits with H transform qc.append(A, [qr_state[i] for i in range(num_state_qubits+1)]) for i in range(num_counting_qubits): qc.h(qr_counting[i]) repeat = 1 for j in reversed(range(num_counting_qubits)): for _ in range(repeat): qc.append(cQ, [qr_counting[j]] + [qr_state[l] for l in range(num_state_qubits+1)]) repeat *= 2 qc.barrier() # inverse quantum Fourier transform only on counting qubits qc.append(inv_qft_gate(num_counting_qubits), qr_counting) qc.barrier() # measure counting qubits qc.measure([qr_counting[m] for m in range(num_counting_qubits)], list(range(num_counting_qubits))) # save smaller circuit example for display global QC_ if QC_ == None or num_qubits <= 5: if num_qubits < 9: QC_ = qc return qc # Construct A operator that takes |0>_{n+1} to sqrt(1-a) |psi_0>|0> + sqrt(a) |psi_1>|1> def A_gen(num_state_qubits, a, psi_zero=None, psi_one=None): if psi_zero==None: psi_zero = '0'*num_state_qubits if psi_one==None: psi_one = '1'*num_state_qubits theta = 2 * np.arcsin(np.sqrt(a)) # Let the objective be qubit index n; state is on qubits 0 through n-1 qc_A = QuantumCircuit(num_state_qubits+1, name=f"A") # takes state to |0>_{n} (sqrt(1-a) |0> + sqrt(a) |1>) qc_A.ry(theta, num_state_qubits) # takes state to sqrt(1-a) |psi_0>|0> + sqrt(a) |0>_{n}|1> qc_A.x(num_state_qubits) for i in range(num_state_qubits): if psi_zero[i]=='1': qc_A.cnot(num_state_qubits,i) qc_A.x(num_state_qubits) # takes state to sqrt(1-a) |psi_0>|0> + sqrt(a) |psi_1>|1> for i in range(num_state_qubits): if psi_one[i]=='1': qc_A.cnot(num_state_qubits,i) return qc_A # Construct the grover-like operator and a controlled version of it def Ctrl_Q(num_state_qubits, A_circ): # index n is the objective qubit, and indexes 0 through n-1 are state qubits qc = QuantumCircuit(num_state_qubits+1, name=f"Q") temp_A = copy.copy(A_circ) A_gate = temp_A.to_gate() A_gate_inv = temp_A.inverse().to_gate() ### Each cycle in Q applies in order: -S_chi, A_circ_inverse, S_0, A_circ # -S_chi qc.x(num_state_qubits) qc.z(num_state_qubits) qc.x(num_state_qubits) # A_circ_inverse qc.append(A_gate_inv, [i for i in range(num_state_qubits+1)]) # S_0 for i in range(num_state_qubits+1): qc.x(i) qc.h(num_state_qubits) qc.mcx([x for x in range(num_state_qubits)], num_state_qubits) qc.h(num_state_qubits) for i in range(num_state_qubits+1): qc.x(i) # A_circ qc.append(A_gate, [i for i in range(num_state_qubits+1)]) # Create a gate out of the Q operator qc.to_gate(label='Q') # and also a controlled version of it Ctrl_Q_ = qc.control(1) # and return both return Ctrl_Q_, qc # Analyze and print measured results # Expected result is always the secret_int (which encodes alpha), so fidelity calc is simple def analyze_and_print_result(qc, result, num_counting_qubits, s_int, num_shots): if result.backend_name == 'dm_simulator': benchmark_result = BenchmarkResult(result, num_shots) probs = benchmark_result.get_probs(num_shots) # get results as measured probability else: probs = result.get_counts(qc) # get results as measured counts # calculate expected output histogram a = a_from_s_int(s_int, num_counting_qubits) correct_dist = a_to_bitstring(a, num_counting_qubits) # print("correct_dist ====== ", correct_dist) # generate thermal_dist for polarization calculation thermal_dist = metrics.uniform_dist(num_counting_qubits) # print("thermal_dist ====== ", thermal_dist) # convert probs, expectation, and thermal_dist to app form for visibility # app form of correct distribution is measuring amplitude a 100% of the time app_counts = bitstring_to_a(probs, num_counting_qubits) app_correct_dist = {a: 1.0} app_thermal_dist = bitstring_to_a(thermal_dist, num_counting_qubits) # print("app_counts ====== ", app_counts) # print("app_correct_dist ====== ", app_correct_dist) # print("app_thermal_dist ====== ", app_thermal_dist) if verbose: print(f"For amplitude {a}, expected: {correct_dist} measured: {probs}") print(f" ... For amplitude {a} thermal_dist: {thermal_dist}") print(f"For amplitude {a}, app expected: {app_correct_dist} measured: {app_counts}") print(f" ... For amplitude {a} app_thermal_dist: {app_thermal_dist}") # use polarization fidelity with rescaling fidelity = metrics.polarization_fidelity(probs, correct_dist, thermal_dist) #fidelity = metrics.polarization_fidelity(app_counts, app_correct_dist, app_thermal_dist) # print("fidelity ====== ", fidelity) hf_fidelity = metrics.hellinger_fidelity_with_expected(probs, correct_dist) if verbose: print(f" ... fidelity: {fidelity} hf_fidelity: {hf_fidelity}") return probs, fidelity def a_to_bitstring(a, num_counting_qubits): m = num_counting_qubits # solution 1 num1 = round(np.arcsin(np.sqrt(a)) / np.pi * 2**m) num2 = round((np.pi - np.arcsin(np.sqrt(a))) / np.pi * 2**m) if num1 != num2 and num2 < 2**m and num1 < 2**m: counts = {format(num1, "0"+str(m)+"b"): 0.5, format(num2, "0"+str(m)+"b"): 0.5} else: counts = {format(num1, "0"+str(m)+"b"): 1} return counts def bitstring_to_a(counts, num_counting_qubits): est_counts = {} m = num_counting_qubits precision = int(num_counting_qubits / (np.log2(10))) + 2 for key in counts.keys(): r = counts[key] num = int(key,2) / (2**m) a_est = round((np.sin(np.pi * num) )** 2, precision) if a_est not in est_counts.keys(): est_counts[a_est] = 0 est_counts[a_est] += r return est_counts def a_from_s_int(s_int, num_counting_qubits): theta = s_int * np.pi / (2**num_counting_qubits) precision = int(num_counting_qubits / (np.log2(10))) + 2 a = round(np.sin(theta)**2, precision) return a ################ Benchmark Loop # Because circuit size grows significantly with num_qubits # limit the max_qubits here ... MAX_QUBITS=8 # Execute program with default parameters def run(min_qubits=4, max_qubits=7, skip_qubits=1, max_circuits=3, num_shots=100, #for dm-simulator min_qubits=4 because it requires to measure atleast 2 qubits num_state_qubits=1, # default, not exposed to users backend_id='dm_simulator', provider_backend=None, #hub="ibm-q", group="open", project="main", exec_options=None, context=None): print(f"{benchmark_name} Benchmark Program - QSim") # Clamp the maximum number of qubits if max_qubits > MAX_QUBITS: print(f"INFO: {benchmark_name} benchmark is limited to a maximum of {MAX_QUBITS} qubits.") max_qubits = MAX_QUBITS # validate parameters (smallest circuit is 3 qubits) num_state_qubits = max(1, num_state_qubits) if max_qubits < num_state_qubits + 2: print(f"ERROR: AE Benchmark needs at least {num_state_qubits + 2} qubits to run") return min_qubits = max(max(4, min_qubits), num_state_qubits + 2) # min_qubit=4 for AE using dm-simulator skip_qubits = max(1, skip_qubits) #print(f"min, max, state = {min_qubits} {max_qubits} {num_state_qubits}") # create context identifier if context is None: context = f"{benchmark_name} Benchmark" ########## # Initialize metrics module metrics.init_metrics() # Define custom result handler def execution_handler(qc, result, num_qubits, s_int, num_shots): # determine fidelity of result set num_counting_qubits = int(num_qubits) - num_state_qubits - 1 counts, fidelity = analyze_and_print_result(qc, result, num_counting_qubits, int(s_int), num_shots) metrics.store_metric(num_qubits, s_int, 'fidelity', fidelity) # Initialize execution module using the execution result handler above and specified backend_id ex.init_execution(execution_handler) ex.set_execution_target(backend_id, provider_backend=provider_backend, # hub=hub, group=group, project=project, exec_options=exec_options, context=context) ########## # Execute Benchmark Program N times for multiple circuit sizes # Accumulate metrics asynchronously as circuits complete for num_qubits in range(min_qubits, max_qubits + 1, skip_qubits): # reset random seed np.random.seed(0) # as circuit width grows, the number of counting qubits is increased num_counting_qubits = num_qubits - num_state_qubits - 1 # determine number of circuits to execute for this group num_circuits = min(2 ** (num_counting_qubits), max_circuits) print(f"************\nExecuting [{num_circuits}] circuits with num_qubits = {num_qubits}") if verbose: print(f" with num_state_qubits = {num_state_qubits} num_counting_qubits = {num_counting_qubits}") # determine range of secret strings to loop over if 2**(num_counting_qubits) <= max_circuits: s_range = list(range(num_circuits)) else: s_range = np.random.choice(2**(num_counting_qubits), num_circuits, False) # loop over limited # of secret strings for this for s_int in s_range: # create the circuit for given qubit size and secret string, store time metric ts = time.time() a_ = a_from_s_int(s_int, num_counting_qubits) # print("a_ ===== ", int(a_)) qc = AmplitudeEstimation(num_state_qubits, num_counting_qubits, a_).reverse_bits() print(qc) metrics.store_metric(num_qubits, s_int, 'create_time', time.time() - ts) # collapse the 3 sub-circuit levels used in this benchmark (for qiskit) qc2 = qc.decompose().decompose().decompose() # submit circuit for execution on target (simulator, cloud simulator, or hardware) ex.submit_circuit(qc2, num_qubits, s_int, num_shots) # Wait for some active circuits to complete; report metrics when groups complete ex.throttle_execution(metrics.finalize_group) # Wait for all active circuits to complete; report metrics when groups complete ex.finalize_execution(metrics.finalize_group) ########## # print a sample circuit print("Sample Circuit:"); print(QC_ if QC_ != None else " ... too large!") print("\nControlled Quantum Operator 'cQ' ="); print(cQ_ if cQ_ != None else " ... too large!") print("\nQuantum Operator 'Q' ="); print(Q_ if Q_ != None else " ... too large!") print("\nAmplitude Generator 'A' ="); print(A_ if A_ != None else " ... too large!") print("\nInverse QFT Circuit ="); print(QFTI_ if QC_ != None else " ... too large!") # Plot metrics for all circuit sizes metrics.plot_metrics(f"Benchmark Results - {benchmark_name} - QSim") # if main, execute method if __name__ == '__main__': run()
https://github.com/ohadlev77/sat-circuits-engine
ohadlev77
# (1) Run this cell for obtaining the suitable Grover's operator for the defined satisfiability problem from sat_circuits_engine import SATInterface # Defining constraints and varibales in a high-level fashion high_level_constraints_string = ( "(x0 != x1)," \ "(x3 != x4)," \ "(x1 != x3)," \ "(x3 != x5)," \ "(x5 != x6)," \ "(x0 != x2)," \ "(x1 != x6)," \ "(x4 != x6)" ) high_level_vars = {"x0": 1, "x1": 1, "x2": 1, "x3": 2, "x4": 1, "x5": 1, "x6": 1} # Initialization of the interface, `save_data=True` for exporting data into a dedicated directory demo_1 = SATInterface( high_level_constraints_string=high_level_constraints_string, high_level_vars=high_level_vars, name="demo_1", save_data=True ) # `obtain_grover_operator()` returns a dictionary of the form: `{ # 'operator': QC_OBJ, # 'decomposed_operator': QC_OBJ, # 'transpiled_operator': QC_OBJ, # 'high_level_to_bit_indexes_map': MAP_OBJ # }`. # Transpilation is done according to the `transpile_kwargs` arg, which by default is set to: # {'basis_gates': ['u', 'cx'], 'optimization_level': 3}. grover_operator_data = demo_1.obtain_grover_operator( transpile_kwargs={'basis_gates': ['u', 'cx'], 'optimization_level': 3} ) demo_1.save_display_grover_operator(grover_operator_data, display=True) # (2) Run this cell for obtaining the overall SAT circuit: # A `QuantumCircuit` object that solves the satisfiability problem, ready for execution on a backend. from qiskit_aer import AerSimulator # The number of iterations over Grover's iterator (= operator + diffuser) depends on the number of solutions. # If the number of solutions is known, it is best to provide it. # If the number of solutions is unknown, `solutions_num=-1` will initiate an classical # iterative stochastic process that looks for an adequate number of iterations for the problem. # Needless to mention, this process add some computational overheads. # `solutions_num=-2` will generate a dynamic circuit to overcome the need for providing the number of solutions. # NOTE - this is a BETA feature which is currently under development. For now it failes # to scale and works properly only for small circuits (~ < 15 qubits). overall_circuit_data = demo_1.obtain_overall_sat_circuit( grover_operator=grover_operator_data['operator'], solutions_num=6, backend=AerSimulator() ) demo_1.save_display_overall_circuit(overall_circuit_data, display=True) # (3) Run this cell for executing the overall SAT circuit and obtaining the results. results_data = demo_1.run_overall_sat_circuit( circuit=overall_circuit_data['circuit'], backend=AerSimulator(), shots=300 ) demo_1.save_display_results(results_data, display=True) # (1) Run this cell to obtain Grover's operator for the defined constraints from sat_circuits_engine import SATInterface # Initialization of the interface, `save_data=False` = not saving and exporting data demo_2 = SATInterface( constraints_string="([4][3][2] == [0]),([2] == [3]),([3] == [4]),([0] != [1]),([8][7] == [3][2])", num_input_qubits=9, name="demo_2", save_data=False ) # Obtaining Grover's operator objects grover_operator_data = demo_2.obtain_grover_operator( transpile_kwargs={'basis_gates': ['u', 'cx'], 'optimization_level': 3} ) operator = grover_operator_data['operator'] decomposed_operator = grover_operator_data['decomposed_operator'] transpiled_operator = grover_operator_data['transpiled_operator'] # Displaying results print("The high level operator circuit diagram:") display(operator.draw('mpl', fold=-1)) print("The decomposed operator circuit diagram:") display(decomposed_operator.draw('mpl', fold=-1)) print(f"Gates count in the transpiled operator: {transpiled_operator.count_ops()}") # Run this cell to initiate an interactive user interface from sat_circuits_engine import SATInterface SATInterface() # (1) Run this cell for obtaining the suitable Grover's operator for the defined satisfiability problem from sat_circuits_engine import SATInterface # Defining constraints and varibales in a high-level fashion high_level_constraints_string = ( "(x0 != x1)," \ "(x2 + 2 != x3)," \ "(x3 != x4)," \ "(x3 != x1)," \ "(x5 != x6)," \ "(x0 != x2)," \ "(x1 != x5)," \ "(x4 != x6)," \ "(x3 == 2)," \ "(x2 + x4 + x3 == 3)" ) high_level_vars = {"x0": 1, "x1": 1, "x2": 1, "x3": 2, "x4": 1, "x5": 1, "x6": 1} # Initialization of the interface, `save_data=True` for exporting data into a dedicated directory benchmark_demo = SATInterface( high_level_constraints_string=high_level_constraints_string, high_level_vars=high_level_vars, name="benchmark_demo", save_data=True ) grover_operator_data = benchmark_demo.obtain_grover_operator( transpile_kwargs={'basis_gates': ['u', 'cx'], 'optimization_level': 3} ) benchmark_demo.save_display_grover_operator(grover_operator_data, display=True) # (2) Run this cell for obtaining the overall SAT circuit: # a `QuantumCircuit` object that solves the satisfiability problem, ready for execution on a backend. from qiskit_aer import AerSimulator overall_circuit_data = benchmark_demo.obtain_overall_sat_circuit( grover_operator=grover_operator_data['operator'], solutions_num=1, backend=AerSimulator() ) benchmark_demo.save_display_overall_circuit(overall_circuit_data, display=True) # (3) Run this cell for executing the overall SAT circuit and obtaining the results. # WARNING: this specific circuit is heavy for a classical computer to simualte, it might take a while. results_data = benchmark_demo.run_overall_sat_circuit( circuit=overall_circuit_data['circuit'], backend=AerSimulator(), shots=50 ) benchmark_demo.save_display_results(results_data, display=True) from sat_circuits_engine import SATInterface SATInterface()
https://github.com/swe-bench/Qiskit__qiskit
swe-bench
# This code is part of Qiskit. # # (C) Copyright IBM 2020, 2023. # # This code is licensed under the Apache License, Version 2.0. You may # obtain a copy of this license in the LICENSE.txt file in the root directory # of this source tree or at http://www.apache.org/licenses/LICENSE-2.0. # # Any modifications or derivative works of this code must retain this # copyright notice, and modified files need to carry a notice indicating # that they have been altered from the originals. """CircuitStateFn Class""" from typing import Dict, List, Optional, Set, Union, cast import numpy as np from qiskit import BasicAer, ClassicalRegister, QuantumCircuit, transpile from qiskit.circuit import Instruction, ParameterExpression from qiskit.circuit.exceptions import CircuitError from qiskit.circuit.library import IGate, StatePreparation from qiskit.opflow.exceptions import OpflowError from qiskit.opflow.list_ops.composed_op import ComposedOp from qiskit.opflow.list_ops.list_op import ListOp from qiskit.opflow.list_ops.summed_op import SummedOp from qiskit.opflow.list_ops.tensored_op import TensoredOp from qiskit.opflow.operator_base import OperatorBase from qiskit.opflow.primitive_ops.circuit_op import CircuitOp from qiskit.opflow.primitive_ops.matrix_op import MatrixOp from qiskit.opflow.primitive_ops.pauli_op import PauliOp from qiskit.opflow.state_fns.state_fn import StateFn from qiskit.opflow.state_fns.vector_state_fn import VectorStateFn from qiskit.quantum_info import Statevector from qiskit.utils.deprecation import deprecate_func class CircuitStateFn(StateFn): r""" Deprecated: A class for state functions and measurements which are defined by the action of a QuantumCircuit starting from \|0⟩, and stored using Terra's ``QuantumCircuit`` class. """ primitive: QuantumCircuit # TODO allow normalization somehow? @deprecate_func( since="0.24.0", additional_msg="For code migration guidelines, visit https://qisk.it/opflow_migration.", ) def __init__( self, primitive: Union[QuantumCircuit, Instruction] = None, coeff: Union[complex, ParameterExpression] = 1.0, is_measurement: bool = False, from_operator: bool = False, ) -> None: """ Args: primitive: The ``QuantumCircuit`` (or ``Instruction``, which will be converted) which defines the behavior of the underlying function. coeff: A coefficient multiplying the state function. is_measurement: Whether the StateFn is a measurement operator. from_operator: if True the StateFn is derived from OperatorStateFn. (Default: False) Raises: TypeError: Unsupported primitive, or primitive has ClassicalRegisters. """ if isinstance(primitive, Instruction): qc = QuantumCircuit(primitive.num_qubits) qc.append(primitive, qargs=range(primitive.num_qubits)) primitive = qc if not isinstance(primitive, QuantumCircuit): raise TypeError( "CircuitStateFn can only be instantiated " "with QuantumCircuit, not {}".format(type(primitive)) ) if len(primitive.clbits) != 0: raise TypeError("CircuitOp does not support QuantumCircuits with ClassicalRegisters.") super().__init__(primitive, coeff=coeff, is_measurement=is_measurement) self.from_operator = from_operator @staticmethod def from_dict(density_dict: dict) -> "CircuitStateFn": """Construct the CircuitStateFn from a dict mapping strings to probability densities. Args: density_dict: The dict representing the desired state. Returns: The CircuitStateFn created from the dict. """ # If the dict is sparse (elements <= qubits), don't go # building a statevector to pass to Qiskit's # initializer, just create a sum. if len(density_dict) <= len(list(density_dict.keys())[0]): statefn_circuits = [] for bstr, prob in density_dict.items(): qc = QuantumCircuit(len(bstr)) # NOTE: Reversing endianness!! for (index, bit) in enumerate(reversed(bstr)): if bit == "1": qc.x(index) sf_circuit = CircuitStateFn(qc, coeff=prob) statefn_circuits += [sf_circuit] if len(statefn_circuits) == 1: return statefn_circuits[0] else: return cast(CircuitStateFn, SummedOp(cast(List[OperatorBase], statefn_circuits))) else: sf_dict = StateFn(density_dict) return CircuitStateFn.from_vector(sf_dict.to_matrix()) @staticmethod def from_vector(statevector: np.ndarray) -> "CircuitStateFn": """Construct the CircuitStateFn from a vector representing the statevector. Args: statevector: The statevector representing the desired state. Returns: The CircuitStateFn created from the vector. """ normalization_coeff = np.linalg.norm(statevector) normalized_sv = statevector / normalization_coeff return CircuitStateFn(StatePreparation(normalized_sv), coeff=normalization_coeff) def primitive_strings(self) -> Set[str]: return {"QuantumCircuit"} @property def settings(self) -> Dict: """Return settings.""" data = super().settings data["from_operator"] = self.from_operator return data @property def num_qubits(self) -> int: return self.primitive.num_qubits def add(self, other: OperatorBase) -> OperatorBase: if not self.num_qubits == other.num_qubits: raise ValueError( "Sum over operators with different numbers of qubits, " "{} and {}, is not well " "defined".format(self.num_qubits, other.num_qubits) ) if isinstance(other, CircuitStateFn) and self.primitive == other.primitive: return CircuitStateFn(self.primitive, coeff=self.coeff + other.coeff) # Covers all else. return SummedOp([self, other]) def adjoint(self) -> "CircuitStateFn": try: inverse = self.primitive.inverse() except CircuitError as missing_inverse: raise OpflowError( "Failed to take the inverse of the underlying circuit, the circuit " "is likely not unitary and can therefore not be inverted." ) from missing_inverse return CircuitStateFn( inverse, coeff=self.coeff.conjugate(), is_measurement=(not self.is_measurement) ) def compose( self, other: OperatorBase, permutation: Optional[List[int]] = None, front: bool = False ) -> OperatorBase: if not self.is_measurement and not front: raise ValueError( "Composition with a Statefunctions in the first operand is not defined." ) new_self, other = self._expand_shorter_operator_and_permute(other, permutation) new_self.from_operator = self.from_operator if front: return other.compose(new_self) if isinstance(other, (PauliOp, CircuitOp, MatrixOp)): op_circuit_self = CircuitOp(self.primitive) # Avoid reimplementing compose logic composed_op_circs = cast(CircuitOp, op_circuit_self.compose(other.to_circuit_op())) # Returning CircuitStateFn return CircuitStateFn( composed_op_circs.primitive, is_measurement=self.is_measurement, coeff=self.coeff * other.coeff, from_operator=self.from_operator, ) if isinstance(other, CircuitStateFn) and self.is_measurement: # pylint: disable=cyclic-import from ..operator_globals import Zero return self.compose(CircuitOp(other.primitive)).compose( (Zero ^ self.num_qubits) * other.coeff ) return ComposedOp([new_self, other]) def tensor(self, other: OperatorBase) -> Union["CircuitStateFn", TensoredOp]: r""" Return tensor product between self and other, overloaded by ``^``. Note: You must be conscious of Qiskit's big-endian bit printing convention. Meaning, Plus.tensor(Zero) produces a \|+⟩ on qubit 0 and a \|0⟩ on qubit 1, or \|+⟩⨂\|0⟩, but would produce a QuantumCircuit like: \|0⟩-- \|+⟩-- Because Terra prints circuits and results with qubit 0 at the end of the string or circuit. Args: other: The ``OperatorBase`` to tensor product with self. Returns: An ``OperatorBase`` equivalent to the tensor product of self and other. """ if isinstance(other, CircuitStateFn) and other.is_measurement == self.is_measurement: # Avoid reimplementing tensor, just use CircuitOp's c_op_self = CircuitOp(self.primitive, self.coeff) c_op_other = CircuitOp(other.primitive, other.coeff) c_op = c_op_self.tensor(c_op_other) if isinstance(c_op, CircuitOp): return CircuitStateFn( primitive=c_op.primitive, coeff=c_op.coeff, is_measurement=self.is_measurement, ) return TensoredOp([self, other]) def to_density_matrix(self, massive: bool = False) -> np.ndarray: """ Return numpy matrix of density operator, warn if more than 16 qubits to force the user to set massive=True if they want such a large matrix. Generally big methods like this should require the use of a converter, but in this case a convenience method for quick hacking and access to classical tools is appropriate. """ OperatorBase._check_massive("to_density_matrix", True, self.num_qubits, massive) # Rely on VectorStateFn's logic here. return VectorStateFn(self.to_matrix(massive=massive) * self.coeff).to_density_matrix() def to_matrix(self, massive: bool = False) -> np.ndarray: OperatorBase._check_massive("to_matrix", False, self.num_qubits, massive) # Need to adjoint to get forward statevector and then reverse if self.is_measurement: return np.conj(self.adjoint().to_matrix(massive=massive)) qc = self.to_circuit(meas=False) statevector_backend = BasicAer.get_backend("statevector_simulator") transpiled = transpile(qc, statevector_backend, optimization_level=0) statevector = statevector_backend.run(transpiled).result().get_statevector() from ..operator_globals import EVAL_SIG_DIGITS return np.round(statevector * self.coeff, decimals=EVAL_SIG_DIGITS) def __str__(self) -> str: qc = cast(CircuitStateFn, self.reduce()).to_circuit() prim_str = str(qc.draw(output="text")) if self.coeff == 1.0: return "{}(\n{}\n)".format( "CircuitStateFn" if not self.is_measurement else "CircuitMeasurement", prim_str ) else: return "{}(\n{}\n) * {}".format( "CircuitStateFn" if not self.is_measurement else "CircuitMeasurement", prim_str, self.coeff, ) def assign_parameters(self, param_dict: dict) -> Union["CircuitStateFn", ListOp]: param_value = self.coeff qc = self.primitive if isinstance(self.coeff, ParameterExpression) or self.primitive.parameters: unrolled_dict = self._unroll_param_dict(param_dict) if isinstance(unrolled_dict, list): return ListOp([self.assign_parameters(param_dict) for param_dict in unrolled_dict]) if isinstance(self.coeff, ParameterExpression) and self.coeff.parameters <= set( unrolled_dict.keys() ): param_instersection = set(unrolled_dict.keys()) & self.coeff.parameters binds = {param: unrolled_dict[param] for param in param_instersection} param_value = float(self.coeff.bind(binds)) # & is set intersection, check if any parameters in unrolled are present in circuit # This is different from bind_parameters in Terra because they check for set equality if set(unrolled_dict.keys()) & self.primitive.parameters: # Only bind the params found in the circuit param_instersection = set(unrolled_dict.keys()) & self.primitive.parameters binds = {param: unrolled_dict[param] for param in param_instersection} qc = self.to_circuit().assign_parameters(binds) return self.__class__(qc, coeff=param_value, is_measurement=self.is_measurement) def eval( self, front: Optional[ Union[str, Dict[str, complex], np.ndarray, OperatorBase, Statevector] ] = None, ) -> Union[OperatorBase, complex]: if front is None: vector_state_fn = self.to_matrix_op().eval() return vector_state_fn if not self.is_measurement and isinstance(front, OperatorBase): raise ValueError( "Cannot compute overlap with StateFn or Operator if not Measurement. Try taking " "sf.adjoint() first to convert to measurement." ) if isinstance(front, ListOp) and front.distributive: return front.combo_fn( [self.eval(front.coeff * front_elem) for front_elem in front.oplist] ) # Composable with circuit if isinstance(front, (PauliOp, CircuitOp, MatrixOp, CircuitStateFn)): new_front = self.compose(front) return new_front.eval() return self.to_matrix_op().eval(front) def to_circuit(self, meas: bool = False) -> QuantumCircuit: """Return QuantumCircuit representing StateFn""" if meas: meas_qc = self.primitive.copy() meas_qc.add_register(ClassicalRegister(self.num_qubits)) meas_qc.measure(qubit=range(self.num_qubits), cbit=range(self.num_qubits)) return meas_qc else: return self.primitive def to_circuit_op(self) -> OperatorBase: """Return ``StateFnCircuit`` corresponding to this StateFn.""" return self def to_instruction(self): """Return Instruction corresponding to primitive.""" return self.primitive.to_instruction() # TODO specify backend? def sample( self, shots: int = 1024, massive: bool = False, reverse_endianness: bool = False ) -> dict: """ Sample the state function as a normalized probability distribution. Returns dict of bitstrings in order of probability, with values being probability. """ OperatorBase._check_massive("sample", False, self.num_qubits, massive) qc = self.to_circuit(meas=True) qasm_backend = BasicAer.get_backend("qasm_simulator") transpiled = transpile(qc, qasm_backend, optimization_level=0) counts = qasm_backend.run(transpiled, shots=shots).result().get_counts() if reverse_endianness: scaled_dict = {bstr[::-1]: (prob / shots) for (bstr, prob) in counts.items()} else: scaled_dict = {bstr: (prob / shots) for (bstr, prob) in counts.items()} return dict(sorted(scaled_dict.items(), key=lambda x: x[1], reverse=True)) # Warning - modifying primitive!! def reduce(self) -> "CircuitStateFn": if self.primitive.data is not None: # Need to do this from the end because we're deleting items! for i in reversed(range(len(self.primitive.data))): gate = self.primitive.data[i].operation # Check if Identity or empty instruction (need to check that type is exactly # Instruction because some gates have lazy gate.definition population) # pylint: disable=unidiomatic-typecheck if isinstance(gate, IGate) or ( type(gate) == Instruction and gate.definition.data == [] ): del self.primitive.data[i] return self def _expand_dim(self, num_qubits: int) -> "CircuitStateFn": # this is equivalent to self.tensor(identity_operator), but optimized for better performance # just like in tensor method, qiskit endianness is reversed here return self.permute(list(range(num_qubits, num_qubits + self.num_qubits))) def permute(self, permutation: List[int]) -> "CircuitStateFn": r""" Permute the qubits of the circuit. Args: permutation: A list defining where each qubit should be permuted. The qubit at index j of the circuit should be permuted to position permutation[j]. Returns: A new CircuitStateFn containing the permuted circuit. """ new_qc = QuantumCircuit(max(permutation) + 1).compose(self.primitive, qubits=permutation) return CircuitStateFn(new_qc, coeff=self.coeff, is_measurement=self.is_measurement)
https://github.com/matteoacrossi/oqs-jupyterbook
matteoacrossi
from qiskit import QuantumRegister, ClassicalRegister, QuantumCircuit import numpy as np ########################################### # Amplitude damping channel on IBMQ_VIGO # ########################################### # Quantum register q = QuantumRegister(5, name='q') # Quantum circuit ad = QuantumCircuit(q) # Amplitude damping channel acting on system qubit ## Qubit identification system = 1 environment = 2 # Define rotation angle theta = 0.0 # Construct circuit ad.x(q[system]) # Notice the extra factor 2 due to how qiskit defines the unitary angles ad.cu(theta, 0.0, 0.0, 0.0, q[system], q[environment]) ad.cx(q[environment], q[system]) # Draw circuit ad.draw(output='mpl') def c1(R,t): """Returns the coherence factor in the amplitude damping channel Args: R (float): value of R = \gamma_0/\lambda t (float): value of the time variable Returns: A float number """ def amplitude_damping_channel(q, c, sys, env, R, t): """Returns a QuantumCircuit implementing the amplitude damping channel on the system qubit Args: q (QuantumRegister): the register to use for the circuit c (ClassicalRegister): the register to use for the measurement of the system qubit sys (int): index for the system qubit env (int): index for the environment qubit R (float): value of R = \gamma_0/\lambda t (float): value of the time variable Returns: A QuantumCircuit object """ ####################################### # Amplitude damping channel # # with non-M. witness on IBMQ_VIGO # ####################################### # Quantum and classical register q = QuantumRegister(5, name='q') c = ClassicalRegister(2, name='c') # Quantum circuit ad = QuantumCircuit(q, c) # Amplitude damping channel acting on system qubit # with non-Markovianity witness ## Qubit identification system = 1 environment = 2 ancilla = 3 # Define rotation angle theta = 0.0 # Construct circuit ## Bell state between system and ancilla ad.h(q[system]) ad.cx(q[system], q[ancilla]) ## Channel acting on system qubit ad.cu3(theta, 0.0, 0.0, q[system], q[environment]) ad.cx(q[environment], q[system]) ## Local measurement for the witness ### Choose observable observable = 'YY' ### Change to the corresponding basis if observable == 'XX': ad.h(q[system]) ad.h(q[ancilla]) elif observable == 'YY': ad.sdg(q[system]) ad.h(q[system]) ad.sdg(q[ancilla]) ad.h(q[ancilla]) ### Measure ad.measure(q[system], c[0]) ad.measure(q[ancilla], c[1]) # Draw circuit ad.draw(output='mpl') def amplitude_damping_channel_witness(q, c, sys, env, anc, observable, R, t): """Returns a QuantumCircuit implementing the amplitude damping channel on the system qubit with non-Markovianity witness Args: q (QuantumRegister): the register to use for the circuit c (ClassicalRegister): the register to use for the measurement of the system and ancilla qubits sys (int): index for the system qubit env (int): index for the environment qubit anc (int): index for the ancillary qubit observable (str): the observable to be measured. Possible values "XX", "YY", "ZZ" R (float): value of R = \gamma_0/\lambda t (float): value of the time variable Returns: A QuantumCircuit object """
https://github.com/BOBO1997/osp_solutions
BOBO1997
import numpy as np import matplotlib.pyplot as plt import itertools from pprint import pprint import pickle import time import datetime # Import qubit states Zero (|0>) and One (|1>), and Pauli operators (X, Y, Z) from qiskit.opflow import Zero, One, I, X, Y, Z from qiskit import QuantumCircuit, QuantumRegister, IBMQ, execute, transpile, Aer from qiskit.tools.monitor import job_monitor from qiskit.circuit import Parameter from qiskit.transpiler.passes import RemoveBarriers # Import QREM package from qiskit.ignis.mitigation.measurement import complete_meas_cal, CompleteMeasFitter from qiskit.ignis.mitigation import expectation_value # Import mitiq for zne import mitiq # Import state tomography modules from qiskit.ignis.verification.tomography import state_tomography_circuits from qiskit.quantum_info import state_fidelity import sys import importlib sys.path.append("../utils/") import circuit_utils, zne_utils, tomography_utils, sgs_algorithm importlib.reload(circuit_utils) importlib.reload(zne_utils) importlib.reload(tomography_utils) importlib.reload(sgs_algorithm) from circuit_utils import * from zne_utils import * from tomography_utils import * from sgs_algorithm import * # Combine subcircuits into a single multiqubit gate representing a single trotter step num_qubits = 3 # The final time of the state evolution target_time = np.pi # Parameterize variable t to be evaluated at t=pi later dt = Parameter('t') # Convert custom quantum circuit into a gate trot_gate = trotter_gate(dt) # initial layout initial_layout = [5,3,1] # Number of trotter steps num_steps = 100 print("trotter step: ", num_steps) scale_factors = [1.0, 2.0, 3.0] # Initialize quantum circuit for 3 qubits qr = QuantumRegister(num_qubits, name="q") qc = QuantumCircuit(qr) # Prepare initial state (remember we are only evolving 3 of the 7 qubits on jakarta qubits (q_5, q_3, q_1) corresponding to the state |110>) make_initial_state(qc, "110") # DO NOT MODIFY (|q_5,q_3,q_1> = |110>) subspace_encoder_init110(qc, targets=[0, 1, 2]) # encode trotterize(qc, trot_gate, num_steps, targets=[1, 2]) # Simulate time evolution under H_heis3 Hamiltonian subspace_decoder_init110(qc, targets=[0, 1, 2]) # decode # Evaluate simulation at target_time (t=pi) meaning each trotter step evolves pi/trotter_steps in time qc = qc.bind_parameters({dt: target_time / num_steps}) print("created qc") # Generate state tomography circuits to evaluate fidelity of simulation st_qcs = state_tomography_circuits(qc, [0, 1, 2][::-1]) #! state tomography requires === BIG ENDIAN === print("created st_qcs (length:", len(st_qcs), ")") # remove barriers st_qcs = [RemoveBarriers()(qc) for qc in st_qcs] print("removed barriers from st_qcs") # optimize circuit t3_st_qcs = transpile(st_qcs, optimization_level=3, basis_gates=["sx", "cx", "rz"]) t3_st_qcs = transpile(t3_st_qcs, optimization_level=3, basis_gates=["sx", "cx", "rz"]) print("created t3_st_qcs (length:", len(t3_st_qcs), ")") # zne wrapping zne_qcs = zne_wrapper(t3_st_qcs, scale_factors = scale_factors, pt = True) # Pauli Twirling print("created zne_qcs (length:", len(zne_qcs), ")") # optimization_level must be 0 # feed initial_layout here to see the picture of the circuits before casting the job t3_zne_qcs = transpile(zne_qcs, optimization_level=0, basis_gates=["sx", "cx", "rz"], initial_layout=initial_layout) print("created t3_zne_qcs (length:", len(t3_zne_qcs), ")") t3_zne_qcs[-3].draw("mpl") from qiskit.test.mock import FakeJakarta backend = FakeJakarta() # backend = Aer.get_backend("qasm_simulator") # IBMQ.load_account() # provider = IBMQ.get_provider(hub='ibm-q-community', group='ibmquantumawards', project='open-science-22') # print("provider:", provider) # backend = provider.get_backend("ibmq_jakarta") print(str(backend)) shots = 1 << 13 reps = 8 # unused jobs = [] for _ in range(reps): #! CHECK: run t3_zne_qcs, with optimization_level = 0 and straightforward initial_layout job = execute(t3_zne_qcs, backend, shots=shots, optimization_level=0) print('Job ID', job.job_id()) jobs.append(job) # QREM qr = QuantumRegister(num_qubits, name="calq") meas_calibs, state_labels = complete_meas_cal(qr=qr, circlabel='mcal') # we have to feed initial_layout to calibration matrix cal_job = execute(meas_calibs, backend=backend, shots=shots, optimization_level=3, initial_layout = initial_layout) print('Job ID', cal_job.job_id()) meas_calibs[0].draw("mpl") dt_now = datetime.datetime.now() print(dt_now) filename = "job_ids_" + str(backend) + "_100step_" + dt_now.strftime('%Y%m%d_%H%M%S') + "_.pkl" print(filename) # with open("jobs_" + str(backend) + "_100step_" + dt_now.strftime('%Y%m%d_%H%M%S') + "_.pkl", "wb") as f: # pickle.dump({"jobs": jobs, "cal_job": cal_job}, f) # with open(filename, "wb") as f: # pickle.dump({"job_ids": [job.job_id() for job in jobs], "cal_job_id": cal_job.job_id()}, f) # with open("properties_" + str(backend) + "_" + dt_now.strftime('%Y%m%d_%H%M%S') + "_.pkl", "wb") as f: # pickle.dump(backend.properties(), f) retrieved_jobs = jobs retrieved_cal_job = cal_job cal_results = retrieved_cal_job.result() meas_fitter = CompleteMeasFitter(cal_results, state_labels, circlabel='mcal') target_state = (One^One^Zero).to_matrix() # DO NOT CHANGE!!! fids = [] for job in retrieved_jobs: mit_results = meas_fitter.filter.apply(job.result()) zne_expvals = zne_decoder(num_qubits, mit_results, scale_factors = scale_factors) rho = expvals_to_valid_rho(num_qubits, zne_expvals) fid = state_fidelity(rho, target_state) fids.append(fid) print('state tomography fidelity = {:.4f} \u00B1 {:.4f}'.format(np.mean(fids), np.std(fids)))
https://github.com/qiskit-community/qiskit-translations-staging
qiskit-community
from qiskit_optimization.algorithms import MinimumEigenOptimizer from qiskit.utils import algorithm_globals from qiskit.algorithms.minimum_eigensolvers import QAOA, NumPyMinimumEigensolver from qiskit.algorithms.optimizers import COBYLA from qiskit.primitives import Sampler from qiskit_optimization.applications.vertex_cover import VertexCover import networkx as nx seed = 123 algorithm_globals.random_seed = seed graph = nx.random_regular_graph(d=3, n=6, seed=seed) pos = nx.spring_layout(graph, seed=seed) prob = VertexCover(graph) prob.draw(pos=pos) qp = prob.to_quadratic_program() print(qp.prettyprint()) # Numpy Eigensolver meo = MinimumEigenOptimizer(min_eigen_solver=NumPyMinimumEigensolver()) result = meo.solve(qp) print(result.prettyprint()) print("\nsolution:", prob.interpret(result)) prob.draw(result, pos=pos) # QAOA meo = MinimumEigenOptimizer(min_eigen_solver=QAOA(reps=1, sampler=Sampler(), optimizer=COBYLA())) result = meo.solve(qp) print(result.prettyprint()) print("\nsolution:", prob.interpret(result)) print("\ntime:", result.min_eigen_solver_result.optimizer_time) prob.draw(result, pos=pos) from qiskit_optimization.applications import Knapsack prob = Knapsack(values=[3, 4, 5, 6, 7], weights=[2, 3, 4, 5, 6], max_weight=10) qp = prob.to_quadratic_program() print(qp.prettyprint()) # Numpy Eigensolver meo = MinimumEigenOptimizer(min_eigen_solver=NumPyMinimumEigensolver()) result = meo.solve(qp) print(result.prettyprint()) print("\nsolution:", prob.interpret(result)) # QAOA meo = MinimumEigenOptimizer(min_eigen_solver=QAOA(reps=1, sampler=Sampler(), optimizer=COBYLA())) result = meo.solve(qp) print(result.prettyprint()) print("\nsolution:", prob.interpret(result)) print("\ntime:", result.min_eigen_solver_result.optimizer_time) from qiskit_optimization.converters import QuadraticProgramToQubo # the same knapsack problem instance as in the previous section prob = Knapsack(values=[3, 4, 5, 6, 7], weights=[2, 3, 4, 5, 6], max_weight=10) qp = prob.to_quadratic_program() print(qp.prettyprint()) # intermediate QUBO form of the optimization problem conv = QuadraticProgramToQubo() qubo = conv.convert(qp) print(qubo.prettyprint()) # qubit Hamiltonian and offset op, offset = qubo.to_ising() print(f"num qubits: {op.num_qubits}, offset: {offset}\n") print(op) import qiskit.tools.jupyter %qiskit_version_table %qiskit_copyright
https://github.com/shesha-raghunathan/DATE2019-qiskit-tutorial
shesha-raghunathan
def digit_sum(n): num_str = str(n) sum = 0 for i in range(0, len(num_str)): sum += int(num_str[i]) return sum # CZ (Controlled-Z) # control qubit: q0 # target qubit: q1 def CZ(qp,q0,q1): qp.h(q1) qp.cx(q0,q1) qp.h(q1) # f-SWAP # taking into account the one-directionality of CNOT gates in the available devices def fSWAP(qp,q0,q1): qp.cx(q0,q1) qp.h(q0) qp.h(q1) qp.cx(q0,q1) qp.h(q0) qp.h(q1) qp.cx(q0,q1) CZ(qp,q0,q1) # CH (Controlled-Haddamard) # control qubit: q1 # target qubit: q0 def CH2(qp,q0,q1): qp.sdg(q0) qp.h(q0) qp.tdg(q0) qp.h(q0) qp.h(q1) qp.cx(q0,q1) qp.h(q0) qp.h(q1) qp.t(q0) qp.h(q0) qp.s(q0) # Fourier transform gates def F2(qp,q0,q1): qp.cx(q0,q1) CH2(qp,q0,q1) qp.cx(q0,q1) CZ(qp,q0,q1) def F0(qp,q0,q1): F2(qp,q0,q1) def F1(qp,q0,q1): F2(qp,q0,q1) qp.sdg(q0) from math import pi # ROTATIONAL GATES def RZ(qp,th,q0): qp.u1(-th,q0) def RY(qp,th,q0): qp.u3(th,0.,0.,q0) def RX(qp,th,q0): qp.u3(th,0.,pi,q0) # CRX (Controlled-RX) # control qubit: q0 # target qubit: q1 def CRX(qp,th,q0,q1): RZ(qp,pi/2.0,q1) RY(qp,th/2.0,q1) qp.cx(q0,q1) RY(qp,-th/2.0,q1) qp.cx(q0,q1) RZ(qp,-pi/2.0,q1) # Bogoliubov B_1 def B(qp,thk,q0,q1): qp.x(q1) qp.cx(q1,q0) CRX(qp,thk,q0,q1) qp.cx(q1,q0) qp.x(q1) # This circuit can be implemented in ibmqx5 using qubits (q0,q1,q2,q3)=(6,7,11,10) # It can also be implemented between other qubits or in ibqmx2 and ibqmx4 using fermionic SWAPS # For instance, the lines commented correspond to the implementations: # ibmqx2 (q0,q1,q2,q3)=(4,2,0,1) # ibmqx4 (q0,q1,q2,q3)=(3,2,1,0) def Udisg(qc,lam,q0,q1,q2,q3): k=1 n=4 th1=-np.arccos((lam-np.cos(2*pi*k/n))/np.sqrt((lam-np.cos(2*pi*k/n))**2+np.sin(2*pi*k/n)**2)) B(Udis,th1,q0,q1) F1(Udis,q0,q1) F0(Udis,q2,q3) #fSWAP(Udis,q2,q1) # for ibmqx2 #fSWAP(Udis,q1,q2) # for ibmqx4 F0(Udis,q0,q2) F0(Udis,q1,q3) #fSWAP(Udis,q2,q1) # for ibmqx2 #fSWAP(Udis,q1,q2) # for ibmqx4 def Initial(qc,lam,q0,q1,q2,q3): if lam <1: qc.x(q3) def Ising(qc,ini,udis,mes,lam,q0,q1,q2,q3,c0,c1,c2,c3): Initial(ini,lam,q0,q1,q2,q3) Udisg(udis,lam,q0,q1,q2,q3) mes.measure(q0,c0) mes.measure(q1,c1) mes.measure(q2,c2) mes.measure(q3,c3) qc.add_circuit("Ising",ini+udis+mes) #import sys #sys.path.append("../../") # importing the QISKit from qiskit import QuantumCircuit,QuantumProgram #import Qconfig # useful additional packages import matplotlib.pyplot as plt %matplotlib inline import numpy as np from scipy import linalg as la # Simulator shots = 1024 backend ='ibmqx_qasm_simulator' coupling_map = None mag_sim = [] for i in range(8): Isex = QuantumProgram() q = Isex.create_quantum_register("q",4) c = Isex.create_classical_register("c", 4) Udis = Isex.create_circuit("Udis", [q], [c]) ini = Isex.create_circuit("ini",[q],[c]) mes = Isex.create_circuit("mes",[q],[c]) lam=i*0.25 Ising(Isex,ini,Udis,mes,lam,q[0],q[1],q[2],q[3],c[0],c[1],c[2],c[3]) # Isex.set_api(Qconfig.APItoken, Qconfig.config["url"]) # set the APIToken and API url result = Isex.execute(["Ising"], backend=backend, coupling_map=coupling_map, shots=shots,timeout=240000) res=result.get_counts("Ising") r1=list(res.keys()) r2=list(res.values()) M=0 for j in range(0,len(r1)): M=M+(4-2*digit_sum(r1[j]))*r2[j]/shots #print("$\lambda$: ",lam,", $<\sigma_{z}>$: ",M/4) mag_sim.append(M/4) # Real device shots = 1024 #backend ='ibmqx5' max_credits = 5 mag=[] for i in range(8): Isex = QuantumProgram() q = Isex.create_quantum_register("q",12) c = Isex.create_classical_register("c", 4) Udis = Isex.create_circuit("Udis", [q], [c]) ini = Isex.create_circuit("ini",[q],[c]) mes = Isex.create_circuit("mes",[q],[c]) lam=i*0.25 Ising(Isex,ini,Udis,mes,lam,q[6],q[7],q[11],q[10],c[0],c[1],c[2],c[3]) # Isex.set_api(Qconfig.APItoken, Qconfig.config["url"]) # set the APIToken and API url result = Isex.execute(["Ising"], backend=backend, max_credits=max_credits, wait=10, shots=shots,timeout=240000) res=result.get_counts("Ising") r1=list(res.keys()) r2=list(res.values()) M=0 for j in range(0,len(r1)): M=M+(4-2*digit_sum(r1[j]))*r2[j]/shots #print("$\lambda$: ",lam,", $<\sigma_{z}>$: ",M/4) mag.append(M/4) # As it is a system of only 4 particles, we can easily compute the exact result def exact(lam): if lam <1: return lam/(2*np.sqrt(1+lam**2)) if lam >1: return 1/2+lam/(2*np.sqrt(1+lam**2)) return None vexact = np.vectorize(exact) l=np.arange(0.0,2.0,0.01) l1=np.arange(0.0,2.0,0.25) plt.figure(figsize=(9,5)) plt.plot(l,vexact(l),'k',label='exact') plt.plot(l1, mag_sim, 'bo',label='simulation') plt.plot(l1, mag, 'r*',label='ibmqx5') plt.xlabel('$\lambda$') plt.ylabel('$<\sigma_{z}>$') plt.legend() plt.title('Magnetization of the ground state of n=4 Ising spin chain') plt.show() #This was the result when the real device is used: def Initial_time(qc,t,lam,q0,q1,q2,q3): qc.u3(np.arccos(lam/np.sqrt(1+lam**2)),pi/2.+4*t*np.sqrt(1+lam**2),0.,q0) qc.cx(q0,q1) def Ising_time(qc,ini,udis,mes,lam,t,q0,q1,q2,q3,c0,c1,c2,c3): Initial_time(ini,t,lam,q0,q1,q2,q3) Udisg(udis,lam,q0,q1,q2,q3) mes.measure(q0,c0) mes.measure(q1,c1) mes.measure(q2,c2) mes.measure(q3,c3) qc.add_circuit("Ising_time",ini+udis+mes) #Simulation shots = 1024 backend = 'ibmqx_qasm_simulator' coupling_map = None # We compute the time evolution for lambda=0.5,0.9 and 1.8 nlam=3 magt_sim=[[] for _ in range(nlam)] lam0=[0.5,0.9,1.8] for j in range(nlam): lam=lam0[j] for i in range(9): Isex_time = QuantumProgram() q = Isex_time.create_quantum_register("q",4) c = Isex_time.create_classical_register("c", 4) Udis = Isex_time.create_circuit("Udis", [q], [c]) ini = Isex_time.create_circuit("ini",[q],[c]) mes = Isex_time.create_circuit("mes",[q],[c]) t=i*0.25 Ising_time(Isex_time,ini,Udis,mes,lam,t,q[0],q[1],q[2],q[3],c[0],c[1],c[2],c[3]) Isex_time.set_api(Qconfig.APItoken, Qconfig.config["url"]) result = Isex_time.execute(["Ising_time"], backend=backend, coupling_map=coupling_map, shots=shots,timeout=240000) res=result.get_counts("Ising_time") r1=list(res.keys()) r2=list(res.values()) M=0 for k in range(0,len(r1)): M=M+(4-2*digit_sum(r1[k]))*r2[k]/shots magt_sim[j].append(M/4) shots = 1024 backend = 'ibmqx5' max_credits = 5 # We compute the time evolution for lambda=0.5,0.9 and 1.8 nlam=3 magt=[[] for _ in range(nlam)] lam0=[0.5,0.9,1.8] for j in range(nlam): lam=lam0[j] for i in range(9): Isex_time = QuantumProgram() q = Isex_time.create_quantum_register("q",12) c = Isex_time.create_classical_register("c", 4) Udis = Isex_time.create_circuit("Udis", [q], [c]) ini = Isex_time.create_circuit("ini",[q],[c]) mes = Isex_time.create_circuit("mes",[q],[c]) t=i*0.25 Ising_time(Isex_time,ini,Udis,mes,lam,t,q[6],q[7],q[11],q[10],c[0],c[1],c[2],c[3]) Isex_time.set_api(Qconfig.APItoken, Qconfig.config["url"]) result = Isex_time.execute(["Ising_time"], backend=backend, max_credits=max_credits, wait=10, shots=shots,timeout=240000) res=result.get_counts("Ising_time") r1=list(res.keys()) r2=list(res.values()) M=0 for k in range(0,len(r1)): M=M+(4-2*digit_sum(r1[k]))*r2[k]/shots magt[j].append(M/4) def exact_time(lam,tt): Mt=(1 + 2*lam**2 + np.cos(4*tt*np.sqrt(1 + lam**2)))/(2 + 2*lam**2) return Mt vexact_t = np.vectorize(exact_time) t=np.arange(0.0,2.0,0.01) tt=np.arange(0.0,2.25,0.25) plt.figure(figsize=(10,5)) plt.plot(t,vexact_t(0.5,t),'b',label='$\lambda=0.5$') plt.plot(t,vexact_t(0.9,t),'r',label='$\lambda=0.9$') plt.plot(t,vexact_t(1.8,t),'g',label='$\lambda=1.8$') #plt.plot(tt, magt_sim[0], 'bo',label='simulation') #plt.plot(tt, magt_sim[1], 'ro') #plt.plot(tt, magt_sim[2], 'go') plt.plot(tt, magt[0], 'b*',label='ibmqx5') plt.plot(tt, magt[1], 'r*') plt.plot(tt, magt[2], 'g*') plt.plot(tt, magt[0], 'b--') plt.plot(tt, magt[1], 'r--') plt.plot(tt, magt[2], 'g--') plt.xlabel('time') plt.ylabel('$<\sigma_{z}>$') plt.legend() plt.title('Time evolution |↑↑↑↑> state') plt.show() plt.figure(figsize=(13,3)) plt.subplot(1,3,1) plt.plot(t,vexact_t(0.5,t),'b',label='$\lambda=0.5$') plt.plot(tt, magt[0], 'b*',label='ibmqx5') plt.plot(tt, magt[0], 'b--',label='ibmqx5') plt.xlabel('time') plt.ylabel('$<\sigma_{z}>$') plt.title('$\lambda=0.5$') plt.subplot(132) plt.plot(t,vexact_t(0.9,t),'r',label='$\lambda=0.9$') plt.plot(tt, magt[1], 'r*',label='ibmqx5') plt.plot(tt, magt[1], 'r--',label='ibmqx5') plt.xlabel('time') plt.ylabel('$<\sigma_{z}>$') plt.title('$\lambda=0.9$') plt.subplot(133) plt.plot(t,vexact_t(1.8,t),'g',label='$\lambda=1.8$') plt.plot(tt, magt[2], 'g*',label='ibmqx5') plt.plot(tt, magt[2], 'g--',label='ibmqx5') plt.xlabel('time') plt.ylabel('$<\sigma_{z}>$') plt.title('$\lambda=1.8$') plt.tight_layout() plt.show()
https://github.com/jdanielescanez/quantum-solver
jdanielescanez
#!/usr/bin/env python3 # -*- coding: utf-8 -*- """ Created on Tue Sep 19 19:13:26 2023 @author: abdullahalshihry """ #!/usr/bin/env python3 # -*- coding: utf-8 -*- """ Created on Mon Sep 18 19:15:12 2023 @author: abdullahalshihry """ import qiskit as qs import qiskit.visualization as qv import random import qiskit.circuit as qf def Deutsch_Jozsa(circuit): qr = qs.QuantumRegister(5,'q') cr = qs.ClassicalRegister(4,'c') qc = qs.QuantumCircuit(qr,cr) qc.x(qr[4]) qc.barrier(range(5)) qc.h(qr[0]) qc.h(qr[1]) qc.h(qr[2]) qc.h(qr[3]) qc.h(qr[4]) qc.barrier(range(5)) qc = qc.compose(circuit) qc.barrier(range(5)) qc.h(qr[0]) qc.h(qr[1]) qc.h(qr[2]) qc.h(qr[3]) qc.barrier(range(5)) qc.measure(0,0) qc.measure(1,1) qc.measure(2,2) qc.measure(3,3) job1 = qs.execute(qc, qs.Aer.get_backend('aer_simulator'), shots = 1024) output1 = job1.result().get_counts() print(output1) qc.draw('mpl') def Oracle(): qr = qs.QuantumRegister(5,'q') cr = qs.ClassicalRegister(4,'c') qc = qs.QuantumCircuit(qr,cr) qq = qs.QuantumCircuit(5,name='Uf') v = random.randint(1, 2) if v == 1: qc.cx(0,4) qc.cx(1,4) qc.cx(2,4) qc.cx(3,4) print('Balanced (1)') elif v == 2: qq.i(qr[0]) qq.i(qr[1]) qq.i(qr[2]) qq.i(qr[3]) print('Constant (0)') qq =qq.to_gate() qc.append(qq,[0,1,2,3,4]) return qc Deutsch_Jozsa(Oracle())
https://github.com/usamisaori/qLipschitz
usamisaori
from sklearn import datasets import pennylane as qml import numpy as np from pennylane.optimize import AdamOptimizer import matplotlib.pyplot as plt X_train, Y_train = datasets.make_circles(n_samples=200, noise=0.09, factor=0.4) X_test, Y_test = datasets.make_circles(n_samples=50, noise=0.09, factor=0.4) print('Training Data:') print(X_train[:10]) print('\nTraining Label:') print(Y_train[:10]) plt.scatter(X_train[:, 0], X_train[:, 1], c=Y_train) plt.show() print(f'Total datas: {len(X_train)}') print(f'labels: {list(set(Y_train))}') print(f'label 0 datas: {len(list(filter(lambda x: x==0, Y_train)))}') print(f'label 1 datas: {len(list(filter(lambda x: x==1, Y_train)))}') Z_train = (X_train[:, 0] ** 2 + X_train[:, 1] ** 2) ** 0.5 temp = np.zeros((X_train.shape[0], len(X_train[0]) + 1)) temp[:, :-1] = X_train temp[:, -1] = Z_train X_train2 = temp Z_test = (X_test[:, 0] ** 2 + X_test[:, 1] ** 2) ** 0.5 temp = np.zeros((X_test.shape[0], len(X_test[0]) + 1)) temp[:, :-1] = X_test temp[:, -1] = Z_test X_test2 = temp print('Solved Training Data:') print(X_train2[:10]) def plot3D(X, Y): fig = plt.figure(figsize=(10, 10)) ax = fig.add_subplot(111, projection='3d') ax.scatter( X[:, 0], X[:, 1], X[:, 2], zdir='z', s=30, c=Y, depthshade=True ) plt.show() plot3D(X_train2, Y_train) print(f'Total datas: {len(X_train2)}') print(f'labels: {list(set(Y_train))}') print(f'label 0 datas: {len(list(filter(lambda x: x==0, Y_train)))}') print(f'label 1 datas: {len(list(filter(lambda x: x==1, Y_train)))}') qubits_num = 3 layers_num = 2 dev = qml.device("default.qubit", wires=qubits_num) class VQC: def __init__(self): # 3 => U3(theta, phi, lambda) self.params = (0.05 * np.random.randn(layers_num, qubits_num, 3)) params = [-1.18991246e-01, -8.69694713e-01, 1.43722811e-03] self.params = [ [params, [ 3.47641545e+00, -4.73632073e-02, 1.97135609e+00], [ 1.95775707e+00, -1.12139160e-02, -6.21796144e-03]], [params, [ 3.47641545e+00, -4.73632073e-02, 1.97135609e+00], [ 1.95775707e+00, -1.12139160e-02, -6.21796144e-03]], ] self.params = [ [-0.09117728, -1.11137259, -1.33992893, -1.49234722, -1.64223525, -1.63931865, -1.75914568, -1.78395664, -1.64893105], (0.05 * np.random.randn(1, 9))[0] ] self.bestparams = self.params self.bestcost = 10 self.opt = AdamOptimizer(0.1) self.weights = [] self.costs = [] self.accuracies = [] def fit(self, X_train, Y_train, epoch=300): batch_size = 20 for turn in range(epoch): # Update the weights by one optimizer step batch_index = np.random.randint(0, len(X_train), (batch_size,)) X_train_batch = X_train[batch_index] Y_train_batch = Y_train[batch_index] self.params = self.opt.step(lambda v: cost(v, X_train_batch, Y_train_batch), self.params) cost_now = cost(self.params, X_train, Y_train) acc_now = accuracy(self.params, X_train, Y_train) if cost_now < self.bestcost: self.bestcost = cost_now self.bestparams = self.params self.weights.append(self.params) self.costs.append(cost_now) self.accuracies.append(acc_now) print( "Turn: {:5d} | Cost: {:0.7f} | Accuracy: {:0.2f}% ".format( turn + 1, cost_now, acc_now * 100 )) def score(self, X_test, Y_test): predictions = [ predict(self.bestparams, data) for data in X_test ] acc = accuracy(self.bestparams, X_test, Y_test) print("FINAL ACCURACY: {:0.2f}%".format(acc * 100)) @qml.qnode(dev) def circuit(params, data): angles = [ i * np.pi for i in data ] for i in range(qubits_num): qml.RX(angles[i], wires=i) qml.Rot( *params[0, i], wires=i ) qml.CZ(wires=[1, 0]) qml.CZ(wires=[1, 2]) qml.CZ(wires=[0, 2]) for i in range(qubits_num): qml.Rot( *params[1, i], wires=i ) # PauliZ measure => 1 -> |0> while -1 -> |1> return qml.expval(qml.PauliZ(0)), qml.expval(qml.PauliZ(1)), qml.expval(qml.PauliZ(2)) import qiskit import numpy as np from qiskit import QuantumCircuit from qiskit import Aer, execute unitary_backend = Aer.get_backend('unitary_simulator') qasm_backend = Aer.get_backend('qasm_simulator') def predict(params, data): qcircuit = QuantumCircuit(3, 3) qubits = qcircuit.qubits for i, d in enumerate(data): qcircuit.rx(d * np.pi, qubits[i]) for i in range(qubits_num): qcircuit.u3(*params[0][i], qubits[i]) qcircuit.cz(qubits[0], qubits[1]) qcircuit.cz(qubits[1], qubits[2]) qcircuit.cz(qubits[0], qubits[2]) for i in range(qubits_num): qcircuit.u3(*params[1][i], qubits[i]) # the measurement qcircuit.measure([0, 1, 2], [0, 1, 2]) # job execution shots = 1000 job_sim = execute(qcircuit, qasm_backend, shots=shots) result_sim = job_sim.result() counts = result_sim.get_counts(qcircuit) p1 = (counts.get('100', 0) + counts.get('111', 0) + counts.get('101', 0) + counts.get('110',0)) / shots if p1 > 0.5: return 1 else: return 0 def cost(weights, datas, labels): loss = 0 for i, data in enumerate(datas): # like [-1, 1, 1] measured = circuit(weights, data) p = measured[0] if labels[i] == 0: loss += (1 - p) ** 2 else: loss += (-1 - p) ** 2 return loss / len(datas) def accuracy(weights, datas, labels): predictions = [ predict(weights, data) for data in datas ] acc = 0 for i, p in enumerate(predictions): if p == labels[i]: acc += 1 return acc / len(predictions) vqc = VQC() vqc = VQC() vqc.fit(X_train2, Y_train, epoch=50) vqc.bestparams = [[[-1.18991246e-01, -8.69694713e-01, 1.43722811e-03], [ 3.47641545e+00, -4.73632073e-02, 1.97135609e+00], [ 1.95775707e+00, -1.12139160e-02, -6.21796144e-03]], [[ 2.02460380e-02, -2.25797547e+00, 5.14234265e-03], [-1.71552299e-02, 2.46283604e-03, -1.03805722e-02], [-2.37244982e-03, -3.35799404e-03, 6.10191152e-03]]] print(cost(vqc.bestparams, X_train2, Y_train)) print(cost(vqc.bestparams, X_test2, Y_test)) vqc.score(X_test2, Y_test) def createCircuit(params, data): qcircuit = QuantumCircuit(3, 3) qubits = qcircuit.qubits for i, d in enumerate(data): qcircuit.rx(d * np.pi, qubits[i]) for i in range(qubits_num): qcircuit.u3(*params[0][i], qubits[i]) qcircuit.cz(qubits[0], qubits[1]) qcircuit.cz(qubits[1], qubits[2]) qcircuit.cz(qubits[0], qubits[2]) for i in range(qubits_num): qcircuit.u3(*params[1][i], qubits[i]) return qcircuit qcircuit = createCircuit(vqc.bestparams, X_train2[0]) qcircuit.draw(output='mpl') def measure(qcircuit, label): # the measurement qcircuit.measure([0, 1, 2], [0, 1, 2]) # job execution shots = 1000 job_sim = execute(qcircuit, qasm_backend, shots=shots) result_sim = job_sim.result() counts = result_sim.get_counts(qcircuit) print(f'simulation results: \n{counts}') p1 = (counts.get('100', 0) + counts.get('111', 0) + counts.get('101', 0) + counts.get('110',0)) / shots print(f'p1: {p1}') print(f'Expected label: {label}') example = [0, 30, 35, 70] for index in example: qcircuit = createCircuit(vqc.bestparams, X_train2[index]) measure(qcircuit, Y_train[index]) print() # origin data plt.scatter(X_train2[:, 0], X_train2[:, 1], c=Y_train) plt.show() predictions = [ predict(vqc.bestparams, data) for data in X_test2 ] Y_ = [ Y_test[i] if Y_test[i] == predictions[i] else 2 for i in range(len(Y_test)) ] plt.scatter(X_test2[:, 0], X_test2[:, 1], c=Y_) plt.show() print(X_train2[9]) print(Y_train[9]) print(X_train2[7]) print(Y_train[7]) params = [[[-1.18991246e-01, -8.69694713e-01, 1.43722811e-03], [ 3.47641545e+00, -4.73632073e-02, 1.97135609e+00], [ 1.95775707e+00, -1.12139160e-02, -6.21796144e-03]], [[ 2.02460380e-02, -2.25797547e+00, 5.14234265e-03], [-1.71552299e-02, 2.46283604e-03, -1.03805722e-02], [-2.37244982e-03, -3.35799404e-03, 6.10191152e-03]]] params = [[ [1.571, 1.571, 1.571],[1.571, 1.571, 1.571],[1.571, 1.571, 1.571], ],[ [1.571, 1.571, 1.571],[1.571, 1.571, 1.571],[1.571, 1.571, 1.571], ]] def getCircuits(a, b): circuit0 = QuantumCircuit(3, 3) qubits = circuit0.qubits for i, d in enumerate(X_train2[a]): circuit0.rx(d * np.pi, qubits[i]) for i in range(qubits_num): circuit0.u3(*params[0][i], qubits[i]) circuit1 = QuantumCircuit(3, 3) qubits = circuit1.qubits for i, d in enumerate(X_train2[b]): circuit1.rx(d * np.pi, qubits[i]) for i in range(qubits_num): circuit1.u3(*params[0][i], qubits[i]) return circuit0, circuit1 circuit0, circuit1 = getCircuits(12, 60) circuit0.draw(output='mpl') circuit1.draw(output='mpl') from scipy.linalg import sqrtm def D(rou, sigma): A = rou - sigma A_ = sqrtm( np.dot( A.conj().T, A ) ) return 0.5 * np.linalg.norm( np.trace(A_) ) from qiskit.quantum_info import DensityMatrix, Statevector def getDensityMatrix(circuit): return DensityMatrix(circuit).data def getStatevector(circuit): return Statevector(circuit).data print(X_train2[3]) print(Y_train[3]) print(X_train2[15]) print(Y_train[15]) circuit0, circuit1 = getCircuits(3,15) matrix_0 = getDensityMatrix(circuit0) matrix_1 = getDensityMatrix(circuit1) print(D(matrix_0, matrix_1)) def params_loss(params, data1, data2, label1, label2): circuit1 = QuantumCircuit(3, 3) qubits = circuit1.qubits for i, d in enumerate(data1): circuit1.rx(d * np.pi, qubits[i]) for i in range(qubits_num): circuit1.u3(*params[i*3: (i+1)*3], qubits[i]) circuit2 = QuantumCircuit(3, 3) qubits = circuit2.qubits for i, d in enumerate(data1): circuit1.rx(d * np.pi, qubits[i]) for i in range(qubits_num): circuit1.u3(*params[i*3: (i+1)*3], qubits[i]) matrix_1 = getDensityMatrix(circuit1) matrix_2 = getDensityMatrix(circuit2) d = D(matrix_1, matrix_2) if label1 == label2: return d ** 2 else: return (1 - d) ** 2 print(Y_train[10:30]) def train_params(datas, labels): params = (0.01 * np.random.randn(1, 9))[0] length = len(params) momentum, s = 0, 0 alpha = 0.1 belta1 = 0.9; belta2 = 0.999 e = 1e-8 for epoch in range(40): loss_origin = 0 derivates = np.zeros(len(params)) for t in range(10): a, b = t, t + 10 loss_origin += params_loss(params, datas[a], datas[b], labels[a], labels[b]) for i in range(len(params)): params[i] += 0.01 loss = 0 for t in range(10): a, b = t, t + 10 loss += params_loss(params, datas[a], datas[b], labels[a], labels[b]) derivates[i] = (loss - loss_origin) / 0.01 grad = derivates # Adam Optimizer momentum = belta1 * momentum + (1 - belta1) * grad s = belta2 * s + (1 - belta2) * (grad ** 2) m_ = momentum / (1 - belta1 ** t) s_ = s / (1 - belta2 ** t) # update parameters params = params - alpha * (m_ / ( s_ ** 0.5 + e )) return loss_origin, params train_params(X_train2[10:50], Y_train[10:50])
https://github.com/MonitSharma/Learn-Quantum-Computing-with-Qiskit
MonitSharma
from qiskit import QuantumCircuit from qiskit.circuit import Parameter theta = Parameter('theta') qc = QuantumCircuit(3) qc.cx(0,2) qc.cx(0,1) qc.rx(theta,0) qc.cx(0,1) qc.cx(0,2) qc.draw('mpl') qc = QuantumCircuit(3) qc.h(0) qc.h(1) qc.h(2) qc.cx(0,2) qc.cx(0,1) qc.rx(theta,0) qc.cx(0,1) qc.cx(0,2) qc.h(2) qc.h(1) qc.h(0) qc.draw('mpl')
https://github.com/qiskit-community/qiskit-translations-staging
qiskit-community
import numpy as np from qiskit import QuantumCircuit from qiskit.providers.fake_provider import FakeVigoV2 backend = FakeVigoV2() qc = QuantumCircuit(2, 1) qc.h(0) qc.x(1) qc.cp(np.pi/4, 0, 1) qc.h(0) qc.measure([0], [0]) qc.draw(output='mpl')
https://github.com/qiskit-community/qiskit-translations-staging
qiskit-community
from qiskit import QuantumCircuit, transpile, schedule from qiskit.visualization.timeline import draw, IQXDebugging from qiskit.providers.fake_provider import FakeBoeblingen qc = QuantumCircuit(2) qc.h(0) qc.cx(0,1) qc = transpile(qc, FakeBoeblingen(), scheduling_method='alap', layout_method='trivial') draw(qc, style=IQXDebugging())
https://github.com/zeynepCankara/Introduction-Quantum-Programming
zeynepCankara
from matplotlib.pyplot import bar labels = [] L = [] for i in range(8): labels = labels + [i+1] L = L + [1] # visualize the values of elements in the list bar(labels,L) # # 1st step - query # # flip the sign of the marked element L[3] = -1 * L[3] # visualize the values of elements in the list bar(labels,L) # # 1st step - inversion # # summation of all values sum = 0 for i in range(len(L)): sum += L[i] # mean of all values mean = sum / len(L) # reflection over the mean for i in range(len(L)): value = L[i] new_value = mean - (L[i]-mean) L[i] = new_value # visualize the values of elements in the list bar(labels,L) # # 2nd step - query # # flip the sign of the marked element L[3] = -1 * L[3] # visualize the values of elements in the list bar(labels,L) # # 2nd step - inversion # # summation of all values sum = 0 for i in range(len(L)): sum += L[i] # mean of all values mean = sum / len(L) # reflection over mean for i in range(len(L)): value = L[i] new_value = mean - (L[i]-mean) L[i] = new_value # visualize the values of elements in the list bar(labels,L) for i in range(3): # flip the sign of the marked element L[3] = -1 * L[3] # summation of all values sum = 0 for i in range(len(L)): sum += L[i] # mean of all values mean = sum / len(L) # reflection over mean for i in range(len(L)): value = L[i] new_value = mean - (L[i]-mean) L[i] = new_value # visualize the values of elements in the list bar(labels,L) from matplotlib.pyplot import bar labels = [] L = [] for i in range(16): labels = labels + [i+1] L = L + [1] for i in range(20): print((i+1),"th iteration:") # flip the sign of the marked element L[11] = -1 * L[11] # print after query phase print(L[11]) # summation of all values sum = 0 for i in range(len(L)): sum += L[i] # mean of all values mean = sum / len(L) # reflection over mean for i in range(len(L)): value = L[i] new_value = mean - (L[i]-mean) L[i] = new_value # print after inversion phase print(L[11]) print() N = 8 marked = 1 L = [] for i in range(N): L = L + [1/(N**0.5)] # print the elements of a given list with a given precision def print_list(L,precision): output = "" for i in range(len(L)): output = output + str(round(L[i],precision))+" " print(output) print_list(L,3) for i in range(10): print((i+1),"th iteration:") # flip the sign of the marked element L[marked] = -1 * L[marked] # print after query phase print_list(L,3) # summation of all values sum = 0 for i in range(len(L)): sum += L[i] # mean of all values mean = sum / len(L) print("mean = ",round(mean,3)) # reflection over mean for i in range(len(L)): value = L[i] new_value = mean - (L[i]-mean) L[i] = new_value # calculate the length of the list length_of_list = 0 for j in range(len(L)): length_of_list += L[j]*L[j] print("length of list is",round(length_of_list,3)) # print after inversion phase print_list(L,3) print() N = 16 marked_elements = [0,2,9] L = [] for i in range(N): L = L + [1/(N**0.5)] # print the elements of a given list with a given precision def print_list(L,precision): output = "" for i in range(len(L)): output = output + str(round(L[i],precision))+" " print(output) print_list(L,3) for i in range(10): print((i+1),"th iteration:") # flip the sign of the marked element for marked in marked_elements: L[marked] = -1 * L[marked] # print after query phase print_list(L,3) # summation of all values sum = 0 for i in range(len(L)): sum += L[i] # mean of all values mean = sum / len(L) # reflection over mean for i in range(len(L)): value = L[i] new_value = mean - (L[i]-mean) L[i] = new_value # calculate the length of the list length_of_list = 0 for j in range(len(L)): length_of_list += L[j]*L[j] print("length of list is",round(length_of_list,3)) # print after inversion phase print_list(L,3) print() N = 16 marked_elements = range(12) L = [] for i in range(N): L = L + [1/(N**0.5)] # print the elements of a given list with a given precision def print_list(L,precision): output = "" for i in range(len(L)): output = output + str(round(L[i],precision))+" " print(output) print_list(L,3) for i in range(10): print((i+1),"th iteration:") # flip the sign of the marked element for marked in marked_elements: L[marked] = -1 * L[marked] # print after query phase print_list(L,3) # summation of all values sum = 0 for i in range(len(L)): sum += L[i] # mean of all values mean = sum / len(L) # reflection over mean for i in range(len(L)): value = L[i] new_value = mean - (L[i]-mean) L[i] = new_value # calculate the length of the list length_of_list = 0 for j in range(len(L)): length_of_list += L[j]*L[j] print("length of list is",round(length_of_list,3)) # print after inversion phase print_list(L,3) print()
https://github.com/swe-bench/Qiskit__qiskit
swe-bench
# This code is part of Qiskit. # # (C) Copyright IBM 2020. # # This code is licensed under the Apache License, Version 2.0. You may # obtain a copy of this license in the LICENSE.txt file in the root directory # of this source tree or at http://www.apache.org/licenses/LICENSE-2.0. # # Any modifications or derivative works of this code must retain this # copyright notice, and modified files need to carry a notice indicating # that they have been altered from the originals. """Tests ClassicalFunction as a gate.""" import unittest from qiskit.test import QiskitTestCase from qiskit import QuantumCircuit from qiskit.circuit.library.standard_gates import XGate from qiskit.utils.optionals import HAS_TWEEDLEDUM if HAS_TWEEDLEDUM: from . import examples from qiskit.circuit.classicalfunction import classical_function as compile_classical_function @unittest.skipUnless(HAS_TWEEDLEDUM, "Tweedledum is required for these tests.") class TestOracleDecomposition(QiskitTestCase): """Tests ClassicalFunction.decomposition.""" def test_grover_oracle(self): """grover_oracle.decomposition""" oracle = compile_classical_function(examples.grover_oracle) quantum_circuit = QuantumCircuit(5) quantum_circuit.append(oracle, [2, 1, 0, 3, 4]) expected = QuantumCircuit(5) expected.append(XGate().control(4, ctrl_state="1010"), [2, 1, 0, 3, 4]) self.assertEqual(quantum_circuit.decompose(), expected)
https://github.com/BP-2/SimonsAlgorithm
BP-2
# importing Qiskit from qiskit import Aer from qiskit.providers.aer import AerSimulator from qiskit.providers.ibmq import least_busy from qiskit import * # import basic plot tools from qiskit.visualization import plot_histogram from qiskit_textbook.tools import simon_oracle from IPython.display import display # This will be our bitstring key b = input("input the bitstring key") n = len(b) #this is because we need double bits to act as both registers simon_circuit = QuantumCircuit(n*2, n) # Apply Hadamard gates before querying the oracle simon_circuit.h(range(n)) # Apply barrier for visual separation simon_circuit.barrier() arr = [] counter = 0 while counter < n*2: arr.append(counter) counter += 1 print (arr) #append the black box to the circuit simon_circuit.append(simon_oracle(b), arr) # Apply barrier for visual separation simon_circuit.barrier() # Apply Hadamard gates to the input register simon_circuit.h(range(n)) # Measure qubits simon_circuit.measure(range(n), range(n)) display(simon_circuit.draw()) # use local simulator sim = Aer.get_backend('qasm_simulator') result = execute(simon_circuit, backend = sim, shots = 1024).result() counts = result.get_counts() print(counts) display(plot_histogram(counts))
https://github.com/jonasmaziero/computacao_quantica_qiskit
jonasmaziero
def dec2den(j,N,d): den = [0 for k in range(0,N)] jv = j for k in range(0,N): if jv >= d**(N-1-k): den[k] = jv//(d**(N-1-k)) jv = jv - den[k]*d**(N-1-k) return den def den2dec(local,d): # local = list with the local computational base state values # d = individual qudit dimension N = len(local) j = 0 for k in range(0,N): j += local[k]*d**(N-1-k) return j # value of the global computational basis index def dec2den_opt(j,N,d): # optimized version den = [0 for k in range(0,N)] if j < d: den[N-1] = j; return den rem = [] # list for the remainder k = j while k >= d: rem.append(k%d) k = k//d rem.append(k%d) for j in range(0,len(rem)): den[N-1-j] = rem[j] return den import numpy as np def swap_qudits(d,N,t,c): # d = qudit dimension; N = No. of qudits; t = target qudit (0,...,N-1); c = control qudit (0,...,N-1) D = d**N; swap = np.zeros((D,D), dtype=int) # set all d^2N elements to 0 for k in range (0,d**N): localr = dec2den_opt(k,N,d) # sequence of values for the local basis #locall = [0 for k in range(0,N)] #for s in range(0,N): # locall[s] = localr[s] locall = localr.copy() #rt = localr[t]; locall[c] = localr[t] #rc = localr[c]; locall[t] = localr[c] globall = den2dec(locall,d) swap[globall,k] = 1 return swap d=2; N=2; t=0; c=1; print(swap_qudits(d,N,t,c)) # ok d=3; N=2; t=0; c=1; print(swap_qudits(d,N,t,c)) # ok d=2; N=3; t=0; c=2; print(swap_qudits(d,N,t,c)) # ok
https://github.com/qclib/qclib
qclib
# Copyright 2021 qclib project. # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # http://www.apache.org/licenses/LICENSE-2.0 # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. """ Quadratic-depth Multicontrolled Special Unitary """ from typing import Union, List from qiskit import QuantumCircuit, QuantumRegister from qiskit.circuit import Qubit from qiskit.circuit import Gate from numpy import sqrt, outer from numpy.linalg import eig from .mcx import LinearMcx from .util import check_u2 # pylint: disable=protected-access class Qdmcu(Gate): """ Quandratic Depth Multi-Controlled Unitary ----------------------------------------- Implements gate decomposition of a munticontrolled operator in U(2) according to Theorem 4 of Iten et al. (2016) arXiv:1501.06911. """ def __init__( self, unitary, num_controls, ctrl_state: str=None ): """ Parameters ---------- unitary : numpy.ndarray 2 x 2 unitary matrix controls : Either qiskit.QuantumRegister or list of qiskit.Qubit containing the qubits to be used as control gates. target : qiskit.Qubit on wich the unitary operation is to be applied ctrl_state : String of binary digits describing the basis state used as control """ check_u2(unitary) self.unitary = unitary self.controls = QuantumRegister(num_controls) self.target = QuantumRegister(1) self.num_qubits = num_controls + 1 self.ctrl_state = ctrl_state super().__init__("qdmcu", self.num_qubits, [], "qdmcu") def _define(self): self.definition = QuantumCircuit(self.controls, self.target) num_ctrl = len(self.controls) if num_ctrl == 1: u_gate = QuantumCircuit(1) u_gate.unitary(self.unitary, 0) self.definition.append( u_gate.control( num_ctrl_qubits=num_ctrl, ctrl_state=self.ctrl_state ), [*self.controls, self.target] ) else: if self.ctrl_state is None: self.ctrl_state = '1' * num_ctrl # Notice that `ctrl_state`` is reversed with respect to `controls``. v_op = Qdmcu.custom_sqrtm(self.unitary) v_gate = QuantumCircuit(1, name="V") v_gate.unitary(v_op, 0) v_gate_dag = QuantumCircuit(1, name="V^dag") v_gate_dag.unitary(v_op.T.conj(), 0) linear_mcx_gate = LinearMcx( num_controls=num_ctrl-1, ctrl_state=self.ctrl_state[1:], action_only=True ).definition self.definition.append( v_gate.control(1, ctrl_state=self.ctrl_state[:1]), [self.controls[-1], self.target] ) self.definition.append( linear_mcx_gate, [*self.controls[:-1], self.controls[-1], self.target] ) self.definition.append( v_gate_dag.control(1, ctrl_state=self.ctrl_state[:1]), [self.controls[-1], self.target] ) self.definition.append( linear_mcx_gate.inverse(), [*self.controls[:-1], self.controls[-1], self.target] ) self.qdmcu( self.definition, v_op, self.controls[:-1], self.target, self.ctrl_state[1:] ) @staticmethod def custom_sqrtm(unitary): eig_vals, eig_vecs = eig(unitary) first_eig = sqrt(eig_vals[0]) * outer(eig_vecs[:, 0], eig_vecs[:, 0].conj()) second_eig = sqrt(eig_vals[1]) * outer(eig_vecs[:, 1], eig_vecs[:, 1].conj()) return first_eig + second_eig @staticmethod def qdmcu( circuit, unitary, controls: Union[QuantumRegister, List[Qubit]], target: Qubit, ctrl_state: str=None ): circuit.append( Qdmcu(unitary, len(controls), ctrl_state=ctrl_state), [*controls, target] )
https://github.com/qiskit-community/qiskit-translations-staging
qiskit-community
import matplotlib.pyplot as plt from scipy.interpolate import griddata %matplotlib inline import numpy as np from qiskit import QuantumRegister, QuantumCircuit, AncillaRegister, transpile from qiskit.circuit.library import IntegerComparator, WeightedAdder, LinearAmplitudeFunction from qiskit.algorithms import IterativeAmplitudeEstimation, EstimationProblem from qiskit_aer.primitives import Sampler from qiskit_finance.circuit.library import LogNormalDistribution # number of qubits per dimension to represent the uncertainty num_uncertainty_qubits = 2 # parameters for considered random distribution S = 2.0 # initial spot price vol = 0.4 # volatility of 40% r = 0.05 # annual interest rate of 4% T = 40 / 365 # 40 days to maturity # resulting parameters for log-normal distribution mu = (r - 0.5 * vol**2) * T + np.log(S) sigma = vol * np.sqrt(T) mean = np.exp(mu + sigma**2 / 2) variance = (np.exp(sigma**2) - 1) * np.exp(2 * mu + sigma**2) stddev = np.sqrt(variance) # lowest and highest value considered for the spot price; in between, an equidistant discretization is considered. low = np.maximum(0, mean - 3 * stddev) high = mean + 3 * stddev # map to higher dimensional distribution # for simplicity assuming dimensions are independent and identically distributed) dimension = 2 num_qubits = [num_uncertainty_qubits] * dimension low = low * np.ones(dimension) high = high * np.ones(dimension) mu = mu * np.ones(dimension) cov = sigma**2 * np.eye(dimension) # construct circuit u = LogNormalDistribution(num_qubits=num_qubits, mu=mu, sigma=cov, bounds=(list(zip(low, high)))) # plot PDF of uncertainty model x = [v[0] for v in u.values] y = [v[1] for v in u.values] z = u.probabilities # z = map(float, z) # z = list(map(float, z)) resolution = np.array([2**n for n in num_qubits]) * 1j grid_x, grid_y = np.mgrid[min(x) : max(x) : resolution[0], min(y) : max(y) : resolution[1]] grid_z = griddata((x, y), z, (grid_x, grid_y)) plt.figure(figsize=(10, 8)) ax = plt.axes(projection="3d") ax.plot_surface(grid_x, grid_y, grid_z, cmap=plt.cm.Spectral) ax.set_xlabel("Spot Price $S_1$ (\$)", size=15) ax.set_ylabel("Spot Price $S_2$ (\$)", size=15) ax.set_zlabel("Probability (\%)", size=15) plt.show() # determine number of qubits required to represent total loss weights = [] for n in num_qubits: for i in range(n): weights += [2**i] # create aggregation circuit agg = WeightedAdder(sum(num_qubits), weights) n_s = agg.num_sum_qubits n_aux = agg.num_qubits - n_s - agg.num_state_qubits # number of additional qubits # set the strike price (should be within the low and the high value of the uncertainty) strike_price_1 = 3 strike_price_2 = 4 # set the barrier threshold barrier = 2.5 # map strike prices and barrier threshold from [low, high] to {0, ..., 2^n-1} max_value = 2**n_s - 1 low_ = low[0] high_ = high[0] mapped_strike_price_1 = ( (strike_price_1 - dimension * low_) / (high_ - low_) * (2**num_uncertainty_qubits - 1) ) mapped_strike_price_2 = ( (strike_price_2 - dimension * low_) / (high_ - low_) * (2**num_uncertainty_qubits - 1) ) mapped_barrier = (barrier - low) / (high - low) * (2**num_uncertainty_qubits - 1) # condition and condition result conditions = [] barrier_thresholds = [2] * dimension n_aux_conditions = 0 for i in range(dimension): # target dimension of random distribution and corresponding condition (which is required to be True) comparator = IntegerComparator(num_qubits[i], mapped_barrier[i] + 1, geq=False) n_aux_conditions = max(n_aux_conditions, comparator.num_ancillas) conditions += [comparator] # set the approximation scaling for the payoff function c_approx = 0.25 # setup piecewise linear objective fcuntion breakpoints = [0, mapped_strike_price_1, mapped_strike_price_2] slopes = [0, 1, 0] offsets = [0, 0, mapped_strike_price_2 - mapped_strike_price_1] f_min = 0 f_max = mapped_strike_price_2 - mapped_strike_price_1 objective = LinearAmplitudeFunction( n_s, slopes, offsets, domain=(0, max_value), image=(f_min, f_max), rescaling_factor=c_approx, breakpoints=breakpoints, ) # define overall multivariate problem qr_state = QuantumRegister(u.num_qubits, "state") # to load the probability distribution qr_obj = QuantumRegister(1, "obj") # to encode the function values ar_sum = AncillaRegister(n_s, "sum") # number of qubits used to encode the sum ar_cond = AncillaRegister(len(conditions) + 1, "conditions") ar = AncillaRegister( max(n_aux, n_aux_conditions, objective.num_ancillas), "work" ) # additional qubits objective_index = u.num_qubits # define the circuit asian_barrier_spread = QuantumCircuit(qr_state, qr_obj, ar_cond, ar_sum, ar) # load the probability distribution asian_barrier_spread.append(u, qr_state) # apply the conditions for i, cond in enumerate(conditions): state_qubits = qr_state[(num_uncertainty_qubits * i) : (num_uncertainty_qubits * (i + 1))] asian_barrier_spread.append(cond, state_qubits + [ar_cond[i]] + ar[: cond.num_ancillas]) # aggregate the conditions on a single qubit asian_barrier_spread.mcx(ar_cond[:-1], ar_cond[-1]) # apply the aggregation function controlled on the condition asian_barrier_spread.append(agg.control(), [ar_cond[-1]] + qr_state[:] + ar_sum[:] + ar[:n_aux]) # apply the payoff function asian_barrier_spread.append(objective, ar_sum[:] + qr_obj[:] + ar[: objective.num_ancillas]) # uncompute the aggregation asian_barrier_spread.append( agg.inverse().control(), [ar_cond[-1]] + qr_state[:] + ar_sum[:] + ar[:n_aux] ) # uncompute the conditions asian_barrier_spread.mcx(ar_cond[:-1], ar_cond[-1]) for j, cond in enumerate(reversed(conditions)): i = len(conditions) - j - 1 state_qubits = qr_state[(num_uncertainty_qubits * i) : (num_uncertainty_qubits * (i + 1))] asian_barrier_spread.append( cond.inverse(), state_qubits + [ar_cond[i]] + ar[: cond.num_ancillas] ) print(asian_barrier_spread.draw()) print("objective qubit index", objective_index) # plot exact payoff function plt.figure(figsize=(7, 5)) x = np.linspace(sum(low), sum(high)) y = (x <= 5) * np.minimum(np.maximum(0, x - strike_price_1), strike_price_2 - strike_price_1) plt.plot(x, y, "r-") plt.grid() plt.title("Payoff Function (for $S_1 = S_2$)", size=15) plt.xlabel("Sum of Spot Prices ($S_1 + S_2)$", size=15) plt.ylabel("Payoff", size=15) plt.xticks(size=15, rotation=90) plt.yticks(size=15) plt.show() # plot contour of payoff function with respect to both time steps, including barrier plt.figure(figsize=(7, 5)) z = np.zeros((17, 17)) x = np.linspace(low[0], high[0], 17) y = np.linspace(low[1], high[1], 17) for i, x_ in enumerate(x): for j, y_ in enumerate(y): z[i, j] = np.minimum( np.maximum(0, x_ + y_ - strike_price_1), strike_price_2 - strike_price_1 ) if x_ > barrier or y_ > barrier: z[i, j] = 0 plt.title("Payoff Function", size=15) plt.contourf(x, y, z) plt.colorbar() plt.xlabel("Spot Price $S_1$", size=15) plt.ylabel("Spot Price $S_2$", size=15) plt.xticks(size=15) plt.yticks(size=15) plt.show() # evaluate exact expected value sum_values = np.sum(u.values, axis=1) payoff = np.minimum(np.maximum(sum_values - strike_price_1, 0), strike_price_2 - strike_price_1) leq_barrier = [np.max(v) <= barrier for v in u.values] exact_value = np.dot(u.probabilities[leq_barrier], payoff[leq_barrier]) print("exact expected value:\t%.4f" % exact_value) num_state_qubits = asian_barrier_spread.num_qubits - asian_barrier_spread.num_ancillas print("state qubits: ", num_state_qubits) transpiled = transpile(asian_barrier_spread, basis_gates=["u", "cx"]) print("circuit width:", transpiled.width()) print("circuit depth:", transpiled.depth()) asian_barrier_spread_measure = asian_barrier_spread.measure_all(inplace=False) sampler = Sampler() job = sampler.run(asian_barrier_spread_measure) # evaluate the result value = 0 probabilities = job.result().quasi_dists[0].binary_probabilities() for i, prob in probabilities.items(): if prob > 1e-4 and i[-num_state_qubits:][0] == "1": value += prob # map value to original range mapped_value = objective.post_processing(value) / (2**num_uncertainty_qubits - 1) * (high_ - low_) print("Exact Operator Value: %.4f" % value) print("Mapped Operator value: %.4f" % mapped_value) print("Exact Expected Payoff: %.4f" % exact_value) # set target precision and confidence level epsilon = 0.01 alpha = 0.05 problem = EstimationProblem( state_preparation=asian_barrier_spread, objective_qubits=[objective_index], post_processing=objective.post_processing, ) # construct amplitude estimation ae = IterativeAmplitudeEstimation(epsilon, alpha=alpha, sampler=Sampler(run_options={"shots": 100})) result = ae.estimate(problem) conf_int = ( np.array(result.confidence_interval_processed) / (2**num_uncertainty_qubits - 1) * (high_ - low_) ) print("Exact value: \t%.4f" % exact_value) print( "Estimated value:\t%.4f" % (result.estimation_processed / (2**num_uncertainty_qubits - 1) * (high_ - low_)) ) print("Confidence interval: \t[%.4f, %.4f]" % tuple(conf_int)) import qiskit.tools.jupyter %qiskit_version_table %qiskit_copyright
https://github.com/ACDuriez/Ising-VQE
ACDuriez
import numpy as np import networkx as nx import matplotlib.pyplot as plt from tqdm import tqdm from scipy.optimize import minimize from dataclasses import dataclass from qiskit.providers.fake_provider import FakeManila,FakeQuito,FakeLima,FakeKolkata,FakeNairobi from qiskit.transpiler import CouplingMap from qiskit.circuit import QuantumCircuit,ParameterVector,Parameter from qiskit.circuit.library import EfficientSU2 from qiskit.quantum_info import SparsePauliOp #from qiskit.opflow import PauliSumOp from qiskit.primitives import Estimator,Sampler,BackendEstimator from qiskit.algorithms.minimum_eigensolvers import VQE from qiskit.algorithms.minimum_eigensolvers import NumPyMinimumEigensolver from qiskit.algorithms.optimizers import SLSQP,COBYLA,L_BFGS_B,QNSPSA,SPSA from qiskit_aer.noise import NoiseModel from qiskit_ibm_runtime import Session,Options,QiskitRuntimeService from qiskit_ibm_runtime import Estimator as IBM_Estimator from qiskit_ibm_runtime import Sampler as IBM_Sampler from qiskit_aer.primitives import Estimator as AerEstimator J = 1 h = 0.5 n_qubits = 4 def get_line_graph(n_qubits): """This function creates a linear lattice with open boundary conditions for a given number of qubits""" graph_line = nx.Graph() graph_line.add_nodes_from(range(n_qubits)) edge_list = [] for i in graph_line.nodes: if i < n_qubits-1: edge_list.append((i,i+1)) # Generate graph from the list of edges graph_line.add_edges_from(edge_list) return graph_line graph = get_line_graph(n_qubits) nx.draw_networkx(graph) #plotting the graph def get_h_op(graph,J=1.,hx=0.5,hz=0.,ap=0.): """Creates a general Ising hamiltonian for given values of the coupling, transverse field, longitudinal field and antiparallel field Args: graph: networkx graph of the lattice J: uniform coupling between first neighbors hx: transverse field parameter hz: longitudinal field parameter ap: antiparallel field at the boundaries""" num_qubits = len(graph.nodes()) sparse_list = [] # Uniform Z and X fields for qubit in graph.nodes(): # X field coeff = ('X',[qubit],-1*hx) sparse_list.append(coeff) # Z field coeff = ('Z',[qubit],-1*hz) sparse_list.append(coeff) # Anti-paralel field at the borders coeff = ('Z',[0],ap) #this is the positive field (order reversed) sparse_list.append(coeff) coeff = ('Z',[num_qubits-1],-1*ap) sparse_list.append(coeff) #Interaction field (ZZ) for i,j in graph.edges(): coeff = ('ZZ',[i,j],-1*J) sparse_list.append(coeff) hamiltonian = SparsePauliOp.from_sparse_list(sparse_list,num_qubits=num_qubits).simplify() return hamiltonian def get_kk_op(graph): """Creates the number of kinks operator""" sparse_list = [] for i,j in graph.edges(): coeff = ('II',[i,j],0.5) sparse_list.append(coeff) coeff = ('ZZ',[i,j],-0.5) sparse_list.append(coeff) kk_op = SparsePauliOp.from_sparse_list(sparse_list,num_qubits=len(graph.nodes)) return kk_op # We show the Hamiltonian with the crittical boundary field as well as # the number of kinks print(get_h_op(graph,J,h,ap=np.sqrt(1-h))) print(get_kk_op(graph)) exact_steps = 70 g_i = 0. g_f = 1.6 exact_g_values = np.linspace(g_i,g_f,exact_steps) def get_numpy_results(graph,J,h,g_values): """Returns the exact values of the energy and number of kinks for a given lattice, coupling, transverse field and values of the boundary field""" n_qubits = len(graph.nodes()) numpy_solver = NumPyMinimumEigensolver() E_values = [] kk_values = [] kk_op = get_kk_op(graph) #getting the (g-independent) number of kinks operator for g in g_values: h_op = get_h_op(graph,J,h,ap=g) #getting the hamiltonian operator for each g value result = numpy_solver.compute_minimum_eigenvalue(operator=h_op,aux_operators=[kk_op]) E_values.append(result.eigenvalue) kk_values.append(np.real(result.aux_operators_evaluated[0][0])) return E_values,kk_values exact_E,exact_kk = get_numpy_results(graph,J,h,exact_g_values) # getting the exact energy and number of kinks #Plotting f,ax = plt.subplots() plt.plot(exact_g_values,exact_E) plt.xlabel('boundary field') plt.ylabel('groundstate energy') inset_ax = f.add_axes([0.25, 0.3, 0.27, 0.27])# [left, bottom, width, height] inset_ax.plot(exact_g_values,exact_kk) inset_ax.set_ylabel('$<N_k>$') inset_ax.set_xlabel('boundary field') inset_ax.axvline(x=np.sqrt(1-h), color='red', linestyle='dashed') #indicating the critical boundary field plt.show() #Initialize runtime service = QiskitRuntimeService( channel='ibm_quantum', instance='ibm-q/open/main', token='your_token' ) backend = service.backend("ibmq_qasm_simulator") shots = 2**14 # shots for noisy simulations def get_ansatz_hva(graph, theta_list): """Creates the hamiltonian variaitonal ansatz for a given lattice graph and list of parameters. The parameters list must have a lenght of 3*n_layers, and must have a form (coupling_i,transverse_i,boundary_i) Args: graph: lattice graph theta_list: list of parameters """ n_qubits = len(graph.nodes()) n_layers = len(theta_list)//3 qc = QuantumCircuit(n_qubits) even_edges = [edge for edge in graph.edges() if edge[0]%2==0] odd_edges = [edge for edge in graph.edges() if edge[0]%2!=0] # initial_state qc.h(range(n_qubits)) for layer_index in range(n_layers): # Coupling term for pair in even_edges: qc.rzz(2 * theta_list[3*layer_index],pair[0],pair[1]) for pair in odd_edges: qc.rzz(2 * theta_list[3*layer_index],pair[0],pair[1]) # boundary field term qc.rz(2 *theta_list[3*layer_index+2],0) qc.rz(-2 * theta_list[3*layer_index+2], n_qubits-1) # transverse field term qc.rx(2 * theta_list[3*layer_index+1], range(n_qubits)) return qc layers_hva = 4 theta_list_hva = ParameterVector('θ',3*layers_hva) ansatz_hva = get_ansatz_hva(graph,theta_list_hva) ansatz_hva.draw('mpl',style='iqx') def get_ansatz_hea(graph,theta_list): """Creates the hardware efficient ansatz for a given lattice graph and list of parameters. The parameters list must have a lenght of 2*n_qubits_n_layers Args: graph: lattice graph theta_list: list of parameters """ nqubits = len(graph.nodes()) n_layers = len(theta_list)//(2*nqubits) assert len(theta_list)==2*n_qubits*n_layers, "The list of parameters does not have the correct size" qc = QuantumCircuit(nqubits) even_edges = [edge for edge in graph.edges() if edge[0]%2==0] odd_edges = [edge for edge in graph.edges() if edge[0]%2!=0] reversed_edges = [edge for edge in graph.edges()][::-1] for layer_index in range(n_layers): for qubit in range(nqubits): qc.ry(theta_list[2*(nqubits)*layer_index+qubit], qubit) # for pair in reversed_edges: # qc.cnot(pair[0],pair[1]) for pair in even_edges: qc.cnot(pair[0],pair[1]) for pair in odd_edges: qc.cnot(pair[0],pair[1]) for qubit in range(nqubits): qc.ry(theta_list[nqubits+2*(nqubits)*layer_index+qubit], qubit) return qc def get_ansatz_hea_ZNE(graph,theta_list): """Creates the folded version of hardware efficient ansatz for a given lattice graph and list of parameters. The parameters list must have a lenght of 2*n_qubits_n_layers. Used in the ZNE error mitigation protocol Args: graph: lattice graph theta_list: list of parameters """ nqubits = len(graph.nodes()) n_layers = len(theta_list)//(2*nqubits) assert len(theta_list)==2*n_qubits*n_layers, "The list of parameters does not have the correct size" qc = QuantumCircuit(nqubits) even_edges = [edge for edge in graph.edges() if edge[0]%2==0] odd_edges = [edge for edge in graph.edges() if edge[0]%2!=0] reversed_edges = [edge for edge in graph.edges()][::-1] for layer_index in range(n_layers): for qubit in range(nqubits): qc.ry(theta_list[2*(nqubits)*layer_index+qubit], qubit) # for pair in reversed_edges: # qc.cnot(pair[0],pair[1]) #folding even edges for pair in even_edges: qc.cnot(pair[0],pair[1]) qc.barrier() for pair in even_edges: qc.cnot(pair[0],pair[1]) qc.barrier() for pair in even_edges: qc.cnot(pair[0],pair[1]) qc.barrier() #folding odd edges for pair in odd_edges: qc.cnot(pair[0],pair[1]) qc.barrier() for pair in odd_edges: qc.cnot(pair[0],pair[1]) qc.barrier() for pair in odd_edges: qc.cnot(pair[0],pair[1]) qc.barrier() for qubit in range(nqubits): qc.ry(theta_list[nqubits+2*(nqubits)*layer_index+qubit], qubit) return qc # Here we define and show the circuit for the HEA layers_hea = 1 theta_list = ParameterVector('t',2*n_qubits*layers_hea) # The list of parameters must ansatz_hea = get_ansatz_hea(graph,theta_list) ansatz_hea.draw('mpl', style="iqx") # Here is the folded version of the HEA ansatz for the ZNE ansatz_hea = get_ansatz_hea_ZNE(graph,theta_list) ansatz_hea.draw('mpl', style="iqx") def get_estimator(session, server='qasm', shots=2**14, device=FakeKolkata(), options_rtm=Options(), seed=170): """Defines an estimator. Set 'qasm' for noiseless, 'noisy' for backend estimator and 'rtm' for the runtime estimator""" if server =='qasm': estimator = Estimator(options={'shots':shots,'seed':seed}) elif server == 'noisy': estimator = BackendEstimator(device,options={'shots':shots,'seed':seed}) elif server == 'rtm': estimator = IBM_Estimator(session=session,options=options_rtm) return estimator def get_extrapolation(value_k1,value_k2,extrap='lin'): """Returns the exponential extrapolation given the values for k=1 and k=2 noise factors""" k_values = [1.,2.] if extrap =='lin': y_values = [value_k1,value_k2] # Fit a linear regression model (polynomial of degree 1) coefficients = np.polyfit(k_values, y_values, 1) # The coefficients represent the slope (m) and y-intercept (b) of the line slope, intercept = coefficients extrapolation = intercept if extrap == 'exp': y_values = [np.abs(value_k1/value_k2),1.] ln_y = np.log(y_values) # Fit a linear regression model (polynomial of degree 1) coefficients_exp = np.polyfit(k_values, ln_y, 1) # The coefficients represent the slope (m) and y-intercept (b) of the line slope_exp, intercept_exp = coefficients_exp extrapolation = np.exp(intercept_exp)*value_k2 return extrapolation def vqe_opt_scipy(graph, service, backend, g=0.7071067811865476, h=0.5, ansatz_str='hea', layers=1, optimizer='SLSQP', maxiter=50, ftol=0., reps=1, zne=False, extrap='exp', shots=None, server='qasm', device=FakeNairobi(), options=Options()): """Runs the vqe for the Ising model with boundary fields for a single value of the boundary field, using the scipy optimization function. It gives data for the convergence of the optimization, which is the logs for each sampling, the mean and standart deviation of these samplings, and also the number of function evaluations Args: graph: networkx lattice graph service: service for runtime backend: backend for runtime (can include quantum backends) g: value of the boundary field h: value of the transverse field ansatz_str: choice of ansatz, 'hea' for HEA and 'hva' for HVA layers: number of layers for the ansatz optimizer: optimization algorithm, as string for scipy maxiter: maximum iterations for the optimization ftol: tolerance for convergence, for scipy reps: (int) number of initial parameters samplings zne: (bool) zne option extrap: type of extrapolation shots: number of shots, set to None for statevector simulations server: 'qasm' for noiseless, 'noisy' for aer, 'rtm' for runtime device: noise model for noisy simulations options: Options() class for runtime """ n_qubits = len(graph.nodes()) if ansatz_str == 'hea': theta_list = ParameterVector('θ',2*n_qubits*layers) ansatz = get_ansatz_hea(graph,theta_list) ansatz_k2 = get_ansatz_hea_ZNE(graph,theta_list) elif ansatz_str == 'hva': theta_list = ParameterVector('θ',3*layers) ansatz = get_ansatz_hva(graph,theta_list) ansatz_k2 = get_ansatz_hva(graph,theta_list) cost_operator = get_h_op(graph,hx=h,ap=g) #Defining Hamiltonian # Now we set the cost function, with no mitigation, linear or exp extrapolation if zne == False: def cost_function_vqe(theta): job = estimator.run(ansatz, cost_operator, theta) values = job.result().values[0] return values if zne == True: def cost_function_vqe(theta): job = estimator.run([ansatz,ansatz_k2], 2*[cost_operator], 2*[theta]) value_k1 = job.result().values[0] value_k2 = job.result().values[1] extrapolation = get_extrapolation(value_k1=value_k1,value_k2=value_k2,extrap=extrap) return extrapolation log_list = [] nfev_list = [] with Session(service=service,backend=backend) as session: estimator = get_estimator(server=server, shots=shots, device=device, session=session, options_rtm=options) for i in tqdm(range(reps)): random_point = np.random.random(ansatz.num_parameters) iter_list = [] result_sample = minimize(cost_function_vqe, x0=random_point, method=optimizer, callback=lambda xk: iter_list.append(list(xk)), options={'maxiter':maxiter,'disp':False,'ftol':ftol}) iters = len(iter_list) energy_list = estimator.run(iters*[ansatz],iters*[cost_operator],iter_list).result().values nfev_list.append(int(result_sample.nfev)) log_list.append(list(energy_list)) session.close() max_length = max(len(sublist) for sublist in log_list) # Finding the length of the largest list for sublist in log_list: if len(sublist) < max_length: last_element = sublist[-1] # Extracting the last element sublist.extend([last_element] * (max_length - len(sublist))) # Filling with the last element mean_list = [] std_list = [] for i in range(len(log_list[0])): values_list = [l[i] for l in log_list] mean_list.append(np.mean(values_list)) std_list.append(np.std(values_list)) return log_list,mean_list,std_list,nfev_list g_mag = 0.2 g_knk = 1.2 E_mag = NumPyMinimumEigensolver().compute_minimum_eigenvalue(get_h_op(graph,ap=g_mag)).eigenvalue E_knk = NumPyMinimumEigensolver().compute_minimum_eigenvalue(get_h_op(graph,ap=g_knk)).eigenvalue reps = 5 # we define the number of initial parameters samplings logs_hva_mag,avgs_hva_mag,stds_hva_mag,nfevs_hva_mag = vqe_opt_scipy(graph=graph, service=service, backend=backend, server='qasm', g=g_mag, layers=layers_hva, ansatz_str='hva', reps=reps, maxiter=300, shots=None, ftol=1e-16) avgs_list = avgs_hva_mag stds_list = stds_hva_mag g_value = g_mag exact_energy = E_mag #Plots x_values = np.arange(len(avgs_list)) f, ax = plt.subplots() plt.plot(avgs_list) # Calculating upper and lower bounds for the confidence interval upper_bound = np.array(avgs_list) + 3 * np.array(stds_list) # 3 sigmas lower_bound = np.array(avgs_list) - 3 * np.array(stds_list) # 3 sigmas plt.fill_between(x_values, lower_bound, upper_bound, color='skyblue', alpha=0.4) plt.axhline(y=exact_energy, color="tab:red", ls="--", label="exact") plt.xlim((0,40)) x_lim = 60 # plt.xlim(0,60) plt.xlabel("iteration") plt.ylabel("cost function") plt.title(f"VQE optimization g = {np.round(g_value,3)} {reps} samplings") inset_ax = f.add_axes([0.6,0.6,0.25,0.25]) # [left, bottom, width, height] inset_ax.plot([(exact_energy-avg)/exact_energy for avg in avgs_list]) inset_ax.set_yscale('log') y_ticks = [10**i for i in range(-0, -10, -1)] # Change the range to suit your needs inset_ax.set_yticks(y_ticks) inset_ax.set_xlabel("iteration") inset_ax.set_ylabel("relative error") plt.show() logs_hva_knk,avgs_hva_knk,stds_hva_knk,nfevs_hva_knk = vqe_opt_scipy(graph=graph, service=service, backend=backend, server='qasm', g=g_knk, layers=layers_hva, ansatz_str='hva', reps=reps, maxiter=300, shots=None, ftol=1e-16) avgs_list = avgs_hva_knk stds_list = stds_hva_knk g_value = g_knk exact_energy = E_knk #Plots x_values = np.arange(len(avgs_list)) f, ax = plt.subplots() plt.plot(avgs_list) # Calculating upper and lower bounds for the confidence interval upper_bound = np.array(avgs_list) + 3 * np.array(stds_list) # 3 sigmas lower_bound = np.array(avgs_list) - 3 * np.array(stds_list) # 3 sigmas plt.fill_between(x_values, lower_bound, upper_bound, color='skyblue', alpha=0.4) plt.axhline(y=exact_energy, color="tab:red", ls="--", label="exact") plt.xlim((0,40)) x_lim = 60 # plt.xlim(0,60) plt.xlabel("iteration") plt.ylabel("cost function") plt.title(f"VQE optimization g = {np.round(g_value,3)} {reps} samplings") inset_ax = f.add_axes([0.6,0.6,0.25,0.25]) # [left, bottom, width, height] inset_ax.plot([(exact_energy-avg)/exact_energy for avg in avgs_list]) inset_ax.set_yscale('log') y_ticks = [10**i for i in range(-0, -10, -1)] # Change the range to suit your needs inset_ax.set_yticks(y_ticks) inset_ax.set_xlabel("iteration") inset_ax.set_ylabel("relative error") plt.show() # Here we define a different callback which is suited for the SPSA implementation of qiskit intermediate_info = { 'nfev': [], 'parameters': [], 'energy': [], 'step_size': [], 'step_sucesss': [] } def callback(nfev, parameters, energy, step_size,step_sucess): intermediate_info['nfev'].append(nfev) intermediate_info['parameters'].append(parameters) intermediate_info['energy'].append(energy) intermediate_info['step_size'].append(step_size) intermediate_info['step_sucess'].append(step_sucess) @dataclass class VQELog: values: list parameters: list def update(self, count, parameters, mean, step_size, step_sucess): self.values.append(mean) self.parameters.append(parameters) print(f"Running circuit {count}", end="\r", flush=True) # Here is the main function def vqe_critical_spsa(graph, service, backend, device=FakeKolkata(), g=0.7071067811865476, layers=1, server='qasm', learning_rate=0.07, perturbation=0.1, maxiter=200, hx=0.5, options=Options(), zne=False, extrap='exp', reps=1, shots=2**14, ansatz_str='hea'): """Runs the vqe for the Ising model with boundary fields for a single value of the boundary field, using the scipy optimization function. It gives data for the convergence of the optimization, which is the logs for each sampling, the mean and standart deviation of these samplings, and also the number of function evaluations Args: graph: networkx lattice graph service: service for runtime backend: backend for runtime (can include quantum backends) g: value of the boundary field h: value of the transverse field ansatz_str: choice of ansatz, 'hea' for HEA and 'hva' for HVA layers: number of layers for the ansatz maxiter: maximum iterations for the optimization learning_rate: learning rate for the SPSA optimizer perturbation: perturbation for the SPSA optimizer reps: (int) number of initial parameters samplings zne: (bool) zne option extrap: type of extrapolation shots: number of shots, set to None for statevector simulations server: 'qasm' for noiseless, 'noisy' for aer, 'rtm' for runtime device: noise model for noisy simulations options: Options() class for runtime """ n_qubits = len(graph.nodes()) if ansatz_str == 'hea': theta_list = ParameterVector('θ',2*n_qubits*layers) ansatz = get_ansatz_hea(graph,theta_list) ansatz_k2 = get_ansatz_hea_ZNE(graph,theta_list) elif ansatz_str == 'hva': theta_list = ParameterVector('θ',3*layers) ansatz = get_ansatz_hva(graph,theta_list) ansatz_k2 = get_ansatz_hva(graph,theta_list) cost_operator = get_h_op(graph,hx=hx,ap=g) #Defining Hamiltonian # Now we set the cost function, with no mitigation, linear or exp extrapolation if zne == False: def cost_function_vqe(theta): job = estimator.run(ansatz, cost_operator, theta) values = job.result().values[0] return values if zne == True: def cost_function_vqe(theta): job = estimator.run([ansatz,ansatz_k2], 2*[cost_operator], 2*[theta]) value_k1 = job.result().values[0] value_k2 = job.result().values[1] return get_extrapolation(value_k1=value_k1,value_k2=value_k2,extrap=extrap) log_list = [] nfev_list = [] with Session(service=service,backend=backend) as session: # estimator = BackendEstimator(FakeNairobiV2(),options={'shots':shots}) estimator = get_estimator(server=server, shots=shots, device=device, session=session, options_rtm=options) for i in tqdm(range(reps)): log = VQELog([], []) spsa = SPSA(maxiter=maxiter, trust_region=True, learning_rate=learning_rate, perturbation=perturbation, callback=log.update) random_point = np.random.random(ansatz.num_parameters) result_sample = spsa.minimize(cost_function_vqe,x0=random_point) log_list.append(log) nfev_list.append(result_sample.nfev) session.close() max_length = max(len(sublist.values) for sublist in log_list) # Finding the length of the largest list for sublist in log_list: if len(sublist.values) < max_length: last_element = sublist[-1] # Extracting the last element sublist = list(sublist)[:].extend([last_element] * (max_length - len(sublist))) # Filling with the last element mean_list = [] std_list = [] for i in range(len(log_list[0].values)): values_list = [log.values[i] for log in log_list] mean_list.append(np.mean(values_list)) std_list.append(np.std(values_list)) return log_list,mean_list,std_list,nfev_list logs_hea_noisy_mag,avgs_hea_noisy_mag,stds_hea_noisy_mag,nfevs_hea_noisy_mag = vqe_critical_spsa(graph=graph, service=service, backend=backend, device=FakeKolkata(), g=g_mag, server='noisy', layers=1, maxiter=170, ansatz_str='hea', reps=5, zne=False, shots = shots ) avgs_list = avgs_hea_noisy_mag stds_list = stds_hea_noisy_mag g_value = g_mag exact_energy = E_mag #Plots x_values = np.arange(len(avgs_list)) f, ax = plt.subplots() plt.plot(avgs_list) # Calculating upper and lower bounds for the confidence interval upper_bound = np.array(avgs_list) + 3 * np.array(stds_list) # 3 sigmas lower_bound = np.array(avgs_list) - 3 * np.array(stds_list) # 3 sigmas plt.fill_between(x_values, lower_bound, upper_bound, color='skyblue', alpha=0.4) plt.axhline(y=exact_energy, color="tab:red", ls="--", label="exact") plt.xlabel("iteration") plt.ylabel("cost function") plt.title(f"VQE optimization noisy g = {np.round(g_value,3)} {reps} samplings") inset_ax = f.add_axes([0.6,0.6,0.25,0.25]) # [left, bottom, width, height] inset_ax.plot([(exact_energy-avg)/exact_energy for avg in avgs_list]) inset_ax.set_yscale('log') y_ticks = [10**i for i in range(-0, -3, -1)] # Change the range to suit your needs inset_ax.set_yticks(y_ticks) inset_ax.set_xlabel("iteration") inset_ax.set_ylabel("relative error") plt.show() reps = 3 logs_hea_zne_mag,avgs_hea_zne_mag,stds_hea_zne_mag,nfevs_hea_zne_mag = vqe_critical_spsa(graph=graph, service=service, backend=backend, device=FakeKolkata(), g=g_mag, server='noisy', layers=1, maxiter=170, ansatz_str='hea', reps=reps, zne=True, extrap='exp', shots=shots ) avgs_list = avgs_hea_zne_mag stds_list = stds_hea_zne_mag g_value = g_mag exact_energy = E_mag #Plots x_values = np.arange(len(avgs_list)) f, ax = plt.subplots() plt.plot(avgs_list) # Calculating upper and lower bounds for the confidence interval upper_bound = np.array(avgs_list) + 3 * np.array(stds_list) # 3 sigmas lower_bound = np.array(avgs_list) - 3 * np.array(stds_list) # 3 sigmas plt.fill_between(x_values, lower_bound, upper_bound, color='skyblue', alpha=0.4) plt.axhline(y=exact_energy, color="tab:red", ls="--", label="exact") x_lim = 60 # plt.xlim(0,60) plt.xlabel("iteration") plt.ylabel("cost function") plt.title(f"VQE optimization mitigated g = {np.round(g_value,3)} {reps} samplings") inset_ax = f.add_axes([0.6,0.6,0.25,0.25]) # [left, bottom, width, height] inset_ax.plot([(exact_energy-avg)/exact_energy for avg in avgs_list]) inset_ax.set_yscale('log') y_ticks = [10**i for i in range(-0, -3, -1)] # Change the range to suit your needs inset_ax.set_yticks(y_ticks) inset_ax.set_xlabel("iteration") inset_ax.set_ylabel("relative error") plt.show() logs_hea_noisy_knk,avgs_hea_noisy_knk,stds_hea_noisy_knk,nfevs_hea_noisy_knk = vqe_critical_spsa(graph=graph, service=service, backend=backend, device=FakeKolkata(), g=g_knk, server='noisy', layers=1, maxiter=170, ansatz_str='hea', reps=reps, zne=False, shots=shots ) avgs_list = avgs_hea_noisy_knk stds_list = stds_hea_noisy_knk g_value = g_knk exact_energy = E_knk #Plots x_values = np.arange(len(avgs_list)) f, ax = plt.subplots() plt.plot(avgs_list) # Calculating upper and lower bounds for the confidence interval upper_bound = np.array(avgs_list) + 3 * np.array(stds_list) # 3 sigmas lower_bound = np.array(avgs_list) - 3 * np.array(stds_list) # 3 sigmas plt.fill_between(x_values, lower_bound, upper_bound, color='skyblue', alpha=0.4) plt.axhline(y=exact_energy, color="tab:red", ls="--", label="exact") x_lim = 60 # plt.xlim(0,60) plt.xlabel("iteration") plt.ylabel("cost function") plt.title(f"VQE optimization noisy g = {np.round(g_value,3)} {reps} samplings") inset_ax = f.add_axes([0.6,0.6,0.25,0.25]) # [left, bottom, width, height] inset_ax.plot([(exact_energy-avg)/exact_energy for avg in avgs_list]) inset_ax.set_yscale('log') y_ticks = [10**i for i in range(-0, -3, -1)] # Change the range to suit your needs inset_ax.set_yticks(y_ticks) inset_ax.set_xlabel("iteration") inset_ax.set_ylabel("relative error") plt.show() reps = 3 logs_hea_zne_knk,avgs_hea_zne_knk,stds_hea_zne_knk,nfevs_hea_zne_knk = vqe_critical_spsa(graph=graph, service=service, backend=backend, device=FakeKolkata(), g=g_knk, server='noisy', layers=1, maxiter=170, ansatz_str='hea', reps=reps, zne=True, extrap='exp', shots=shots ) avgs_list = avgs_hea_zne_knk stds_list = stds_hea_zne_knk g_value = g_knk exact_energy = E_knk #Plots x_values = np.arange(len(avgs_list)) f, ax = plt.subplots() plt.plot(avgs_list) # Calculating upper and lower bounds for the confidence interval upper_bound = np.array(avgs_list) + 3 * np.array(stds_list) # 3 sigmas lower_bound = np.array(avgs_list) - 3 * np.array(stds_list) # 3 sigmas plt.fill_between(x_values, lower_bound, upper_bound, color='skyblue', alpha=0.4) plt.axhline(y=exact_energy, color="tab:red", ls="--", label="exact") # plt.xlim(0,60) plt.xlabel("iteration") plt.ylabel("cost function") plt.title(f"VQE optimization mitigated g = {np.round(g_value,3)} {reps} samplings") inset_ax = f.add_axes([0.6,0.6,0.25,0.25]) # [left, bottom, width, height] inset_ax.plot([(exact_energy-avg)/exact_energy for avg in avgs_list]) inset_ax.set_yscale('log') y_ticks = [10**i for i in range(-0, -3, -1)] # Change the range to suit your needs inset_ax.set_yticks(y_ticks) inset_ax.set_xlabel("iteration") inset_ax.set_ylabel("relative error") plt.show() def vqe_phase_diagram(graph, g_values, optimizer, init_optimizer, service, backend, server='qasm', device=FakeNairobi(), angles_dict = {}, layers=1, hx=0.5, options=Options(), zne=False, extrap='exp', init_reps=1, shots=2**14, ansatz_str='hea'): """Runs the vqe to simulate the antiparallel model in the hardware efficient ansatz for different values of the antiparallel field. Returns the list of energies as well as a dictionary with the optimal angles for each value of the boundary field. Args: graph: networkx lattice graph g_values: list of values for the boundary field angles_dict: dictionary of angles optimizer: qiskit optimizer class init_optimizer: optimizer for the first point layers: layers for the ansatz service: service for runtime backend: backend for runtime (can include quantum backends) h: value of the transverse field ansatz_str: choice of ansatz, 'hea' for HEA and 'hva' for HVA reps: number of initial parameters samplings for the first point zne: (bool) zne option extrap: type of extrapolation shots: number of shots, set to None for statevector simulations server: 'qasm' for noiseless, 'noisy' for aer, 'rtm' for runtime device: noise model for noisy simulations options: Options() class for runtime """ n_qubits = len(graph.nodes()) if ansatz_str == 'hea': theta_list = ParameterVector('θ',2*n_qubits*layers) ansatz = get_ansatz_hea(graph,theta_list) ansatz_k2 = get_ansatz_hea_ZNE(graph,theta_list) elif ansatz_str == 'hva': theta_list = ParameterVector('θ',3*layers) ansatz = get_ansatz_hva(graph,theta_list) ansatz_k2 = get_ansatz_hva(graph,theta_list) E_values = [] rev_g_values = g_values[::-1] for i,g in enumerate(tqdm(rev_g_values)): cost_operator = get_h_op(graph,hx=hx,ap=g) #Defining Hamiltonian # Now we set the cost function, with no mitigation, linear or exp extrapolation if zne == False: def cost_function_vqe(theta): job = estimator.run(ansatz, cost_operator, theta) values = job.result().values[0] return values if zne == True: def cost_function_vqe(theta): job = estimator.run([ansatz,ansatz_k2], 2*[cost_operator], 2*[theta]) value_k1 = job.result().values[0] value_k2 = job.result().values[1] return get_extrapolation(value_k1=value_k1,value_k2=value_k2,extrap=extrap) if i == 0: sample = 0. for j in range(init_reps): #Performs sampling of initial parameters for the first point initial_point = np.random.uniform(0., 2*np.pi, size=ansatz.num_parameters) with Session(service=service,backend=backend) as session: estimator = get_estimator(server=server, shots=shots, device=device, session=session, options_rtm=options) result_sample = init_optimizer.minimize(fun=cost_function_vqe, x0=initial_point) session.close() if result_sample.fun < sample: sample = result_sample.fun result = result_sample initial_point = result.x else: with Session(service=service,backend=backend) as session: estimator = get_estimator(server=server, shots=shots, device=device, session=session, options_rtm=options) result = optimizer.minimize(fun=cost_function_vqe, x0=initial_point) session.close() E_values.append(result.fun) #optimal angles storage angles = list(result.x) angles_dict[str(round(g,5))] = angles return E_values,angles_dict def vqe_optimal(graph, service, backend, angles_opt, server='qasm', device=FakeNairobi(), layers=1, hx=0.5, options=Options(), zne=False, extrap='lin', shots=2**14, ansatz_str='hea'): """ Receives the optimal parameters for each value of the boundary field and runs the circuits to compute the energy as well as the number of kinks Args: graph: networkx lattice graph g_values: list of values for the boundary field angles_opt: dictionary of optimal angles service: service for runtime backend: backend for runtime (can include quantum backends) h: value of the transverse field ansatz_str: choice of ansatz, 'hea' for HEA and 'hva' for HVA layers: layers for the ansatz reps: number of initial parameters samplings for the first point zne: (bool) zne option extrap: type of extrapolation shots: number of shots, set to None for statevector simulations server: 'qasm' for noiseless, 'noisy' for aer, 'rtm' for runtime device: noise model for noisy simulations options: Options() class for runtime Returns: The values of the energy, number of kinks, and the associated values of g to facilitate plotting """ n_qubits = len(graph.nodes()) g_values = [float(k) for k in angles_opt.keys()] n_points = len(g_values) # Setting the ansatz if ansatz_str == 'hea': theta_list = ParameterVector('θ',2*n_qubits*layers) ansatz = get_ansatz_hea(graph,theta_list) ansatz_k2 = get_ansatz_hea_ZNE(graph,theta_list) elif ansatz_str == 'hva': theta_list = ParameterVector('θ',3*layers) ansatz = get_ansatz_hva(graph,theta_list) ansatz_k2 = get_ansatz_hva(graph,theta_list) # Getting the list of angles and hamiltonians angles_list = [] h_list = [] g_list = [] kk_op = get_kk_op(graph) E_values = [] kk_values = [] for g_str,angles in angles_opt.items(): g = float(g_str) g_list.append(g) h_list.append(get_h_op(graph,hx=hx,ap=g)) angles_list.append(angles) with Session(service=service,backend=backend) as session: estimator = get_estimator(server=server, shots=shots, device=device, session=session, options_rtm=options) result_h = estimator.run(n_points*[ansatz],h_list,angles_list).result() result_kk = estimator.run(n_points*[ansatz],n_points*[kk_op],angles_list).result() if zne == False: E_values = list(result_h.values) kk_values = list(result_kk.values) else: result_h_k2 = estimator.run(n_points*[ansatz_k2],h_list,angles_list).result() result_kk_k2 = estimator.run(n_points*[ansatz_k2],n_points*[kk_op],angles_list).result() for i in range(n_points): E_values.append(get_extrapolation(result_h.values[i],result_h_k2.values[i],extrap)) kk_values.append(get_extrapolation(result_kk.values[i],result_kk_k2.values[i],extrap)) session.close() return E_values,kk_values,g_list # We define the range of values of g used for the VQE implentation g_values = np.linspace(g_i,g_f,25) init_reps = 5 slsqp = SLSQP(150) init_slsqp = SLSQP(150) # We consider more iterations for the first point E_hva,angles_hva = vqe_phase_diagram(graph=graph, g_values=g_values, ansatz_str='hva', backend=backend, layers=layers_hva, optimizer=slsqp, init_optimizer=init_slsqp, service=service, server='qasm', shots=None, init_reps=init_reps) # Now we run the circuits one last time with the optimal parameters E_hva,kk_hva,g_hva = vqe_optimal(graph=graph, service=service, server='qasm', angles_opt=angles_hva, ansatz_str='hva', layers=layers_hva, backend=backend) #Plotting f,ax = plt.subplots() #plt.plot(g_values,E_3,'ro') plt.plot(exact_g_values,exact_E,label='exact') plt.plot(g_hva,E_hva,'ro',label='VQE') plt.xlabel('boundary field') plt.ylabel('groundstate energy') plt.legend() inset_ax = f.add_axes([0.24, 0.22, 0.3, 0.3]) # [left, bottom, width, height] plt.plot(exact_g_values,exact_kk) plt.plot(g_hva,kk_hva,'ro',markersize=4) inset_ax.set_xlabel('boundary field') inset_ax.set_ylabel("$<N_k>$") plt.show() init_reps = 2 spsa = SPSA(maxiter=300,trust_region=True,learning_rate=0.07,perturbation=0.1) init_spsa = SPSA(maxiter=300,trust_region=True,learning_rate=0.07,perturbation=0.1) # We consider more iterations for the first point # To perform the whole optimization using ZNE, just set zne = True # This step took 207 minutes to run on my machine E_hea_noisy,angles_hea_noisy = vqe_phase_diagram(graph=graph, g_values=g_values, ansatz_str='hea', backend=backend, layers=layers_hea, optimizer=spsa, init_optimizer=init_spsa, service=service, server='noisy', device=FakeKolkata(), zne=False, shots=shots, init_reps=init_reps) # Now we run the circuits one last time with the optimal parameters E_opt_hea_noisy,kk_opt_hea_noisy,g_hea = vqe_optimal(graph=graph, service=service, server='noisy', angles_opt=angles_hea_noisy, device=FakeKolkata(), ansatz_str='hea', layers=layers_hea, zne=False, backend=backend, shots=shots) #Plotting f,ax = plt.subplots() #plt.plot(g_values,E_3,'ro') plt.plot(exact_g_values,exact_E,label='exact') plt.plot(g_hea,E_opt_hea_noisy,'o',label='noisy') plt.xlabel('boundary field') plt.ylabel('groundstate energy') plt.legend() inset_ax = f.add_axes([0.24, 0.22, 0.3, 0.3]) # [left, bottom, width, height] plt.plot(exact_g_values,exact_kk) plt.plot(g_hea,kk_opt_hea_noisy,'o',markersize=4) inset_ax.set_xlabel('boundary field') inset_ax.set_ylabel("$<N_k>$") plt.show() # Now we run the circuits now using ZNE E_opt_hea_mitigated,kk_opt_hea_mitigated,g_hea = vqe_optimal(graph=graph, service=service, server='noisy', angles_opt=angles_hea_noisy, device=FakeKolkata(), ansatz_str='hea', layers=layers_hea, zne=True, extrap='exp', backend=backend, shots=shots) #Plotting f,ax = plt.subplots() #plt.plot(g_values,E_3,'ro') plt.plot(exact_g_values,exact_E,label='exact') plt.plot(g_hea,E_opt_hea_noisy,'o',label='noisy') plt.plot(g_hea,E_opt_hea_mitigated,'o',label='mitigated') plt.xlabel('boundary field') plt.ylabel('groundstate energy') plt.legend() inset_ax = f.add_axes([0.24, 0.22, 0.3, 0.3]) # [left, bottom, width, height] plt.plot(exact_g_values,exact_kk) plt.plot(g_hea,kk_opt_hea_noisy,'o',markersize=4) plt.plot(g_hea,kk_opt_hea_mitigated,'o',markersize=4) inset_ax.set_xlabel('boundary field') inset_ax.set_ylabel("$<N_k>$") plt.show() # First we get the optimal parameters with statevector simulations E_hea_noiseless,angles_hea_noiseless = vqe_phase_diagram(graph=graph, g_values=g_values, ansatz_str='hea', backend=backend, layers=layers_hea, optimizer=spsa, init_optimizer=init_spsa, service=service, server='qasm', shots=None, init_reps=init_reps) # Setting options for runtime # Noisy options fake_device = FakeKolkata() noise_model = NoiseModel.from_backend(fake_device) options_noisy = Options() options_noisy.execution.shots = shots options_noisy.simulator = { "noise_model": noise_model, "basis_gates": fake_device.configuration().basis_gates, "coupling_map": fake_device.configuration().coupling_map, "seed_simulator": 42 } options_noisy.optimization_level = 3 # no optimization options_noisy.resilience_level = 0 # M3 for Sampler and T-REx for Estimator # Mitigated options options_mitigated = Options() options_mitigated.execution.shots = shots options_mitigated.simulator = { "noise_model": noise_model, "basis_gates": fake_device.configuration().basis_gates, "coupling_map": fake_device.configuration().coupling_map } # Set number of shots, optimization_level and resilience_level options_mitigated.optimization_level = 3 options_mitigated.resilience_level = 1 # setting T-REX # Now we run the circuits in runtime with the optimal parameters # To run on runtime we set server = 'rtm' # First we run the unmitigated results E_opt_hea_noisy_rtm,kk_opt_hea_noisy_rtm,g_hea = vqe_optimal(graph=graph, service=service, server='rtm', options = options_noisy, angles_opt=angles_hea_noiseless, ansatz_str='hea', layers=layers_hea, zne=False, extrap='exp', backend=backend, shots=shots) # Now we run using ZNE and ZNE+T-REX # ZNE E_opt_hea_mitigated1_rtm,kk_opt_hea_mitigated1_rtm,g_hea = vqe_optimal(graph=graph, service=service, server='rtm', options = options_noisy, angles_opt=angles_hea_noiseless, ansatz_str='hea', layers=layers_hea, zne=True, extrap='exp', backend=backend, shots=shots) # ZNE + T-REX E_opt_hea_mitigated2_rtm,kk_opt_hea_mitigated2_rtm,g_hea = vqe_optimal(graph=graph, service=service, server='rtm', options = options_mitigated, angles_opt=angles_hea_noiseless, ansatz_str='hea', layers=layers_hea, zne=True, extrap='exp', backend=backend, shots=shots) #Plotting f,ax = plt.subplots() #plt.plot(g_values,E_3,'ro') plt.plot(exact_g_values,exact_E,label='exact') plt.plot(g_hea,E_opt_hea_noisy_rtm,'o',label='noisy') plt.plot(g_hea,E_opt_hea_mitigated1_rtm,'o',label='ZNE') plt.plot(g_hea,E_opt_hea_mitigated2_rtm,'o',label='ZNE+T-REX') plt.xlabel('boundary field') plt.ylabel('groundstate energy') plt.legend() inset_ax = f.add_axes([0.24, 0.22, 0.3, 0.3]) # [left, bottom, width, height] plt.plot(exact_g_values,exact_kk) plt.plot(g_hea,kk_opt_hea_noisy_rtm,'o',markersize=4) plt.plot(g_hea,kk_opt_hea_mitigated1_rtm,'o',markersize=4) plt.plot(g_hea,kk_opt_hea_mitigated2_rtm,'o',markersize=4) inset_ax.set_xlabel('boundary field') inset_ax.set_ylabel("$<N_k>$") plt.show()
https://github.com/zapata-engineering/orquestra-qiskit
zapata-engineering
################################################################################ # © Copyright 2021-2022 Zapata Computing Inc. ################################################################################ import hashlib from typing import Dict, Iterable, List, NamedTuple, Sequence, Tuple, Union import numpy as np import qiskit import sympy from orquestra.quantum.circuits import ( _builtin_gates, _circuit, _gates, _operations, _wavefunction_operations, ) from orquestra.quantum.circuits.symbolic.sympy_expressions import ( SYMPY_DIALECT, expression_from_sympy, ) from orquestra.quantum.circuits.symbolic.translations import translate_expression from ._qiskit_expressions import QISKIT_DIALECT, expression_from_qiskit QiskitTriplet = Tuple[ qiskit.circuit.Instruction, List[qiskit.circuit.Qubit], List[qiskit.circuit.Clbit] ] def _import_qiskit_qubit(qubit: qiskit.circuit.Qubit) -> int: return qubit._index def _qiskit_expr_from_orquestra(expr): intermediate = expression_from_sympy(expr) return translate_expression(intermediate, QISKIT_DIALECT) def _orquestra_expr_from_qiskit(expr): intermediate = expression_from_qiskit(expr) return translate_expression(intermediate, SYMPY_DIALECT) ORQUESTRA_QISKIT_GATE_MAP = { _builtin_gates.X: qiskit.circuit.library.XGate, _builtin_gates.Y: qiskit.circuit.library.YGate, _builtin_gates.Z: qiskit.circuit.library.ZGate, _builtin_gates.S: qiskit.circuit.library.SGate, _builtin_gates.SX: qiskit.circuit.library.SXGate, _builtin_gates.T: qiskit.circuit.library.TGate, _builtin_gates.H: qiskit.circuit.library.HGate, _builtin_gates.I: qiskit.circuit.library.IGate, _builtin_gates.CNOT: qiskit.circuit.library.CXGate, _builtin_gates.CZ: qiskit.circuit.library.CZGate, _builtin_gates.SWAP: qiskit.circuit.library.SwapGate, _builtin_gates.ISWAP: qiskit.circuit.library.iSwapGate, _builtin_gates.RX: qiskit.circuit.library.RXGate, _builtin_gates.RY: qiskit.circuit.library.RYGate, _builtin_gates.RZ: qiskit.circuit.library.RZGate, _builtin_gates.PHASE: qiskit.circuit.library.PhaseGate, _builtin_gates.CPHASE: qiskit.circuit.library.CPhaseGate, _builtin_gates.XX: qiskit.circuit.library.RXXGate, _builtin_gates.YY: qiskit.circuit.library.RYYGate, _builtin_gates.ZZ: qiskit.circuit.library.RZZGate, _builtin_gates.U3: qiskit.circuit.library.U3Gate, _builtin_gates.Delay: qiskit.circuit.Delay, } def _make_gate_instance(gate_ref, gate_params) -> _gates.Gate: """Returns a gate instance that's applicable to qubits. For non-parametric gate refs like X, returns just the `X` For parametric gate factories like `RX`, returns the produced gate, like `RX(0.2)` """ if _gates.gate_is_parametric(gate_ref, gate_params): return gate_ref(*gate_params) else: return gate_ref def _make_controlled_gate_prototype(wrapped_gate_ref, num_control_qubits=1): def _factory(*gate_params): return _gates.ControlledGate( _make_gate_instance(wrapped_gate_ref, gate_params), num_control_qubits ) return _factory QISKIT_ORQUESTRA_GATE_MAP = { **{q_cls: z_ref for z_ref, q_cls in ORQUESTRA_QISKIT_GATE_MAP.items()}, qiskit.extensions.SXdgGate: _builtin_gates.SX.dagger, qiskit.extensions.SdgGate: _builtin_gates.S.dagger, qiskit.extensions.TdgGate: _builtin_gates.T.dagger, qiskit.circuit.library.CSwapGate: _builtin_gates.SWAP.controlled(1), qiskit.circuit.library.CRXGate: _make_controlled_gate_prototype(_builtin_gates.RX), qiskit.circuit.library.CRYGate: _make_controlled_gate_prototype(_builtin_gates.RY), qiskit.circuit.library.CRZGate: _make_controlled_gate_prototype(_builtin_gates.RZ), } def export_to_qiskit(circuit: _circuit.Circuit) -> qiskit.QuantumCircuit: q_circuit = qiskit.QuantumCircuit(circuit.n_qubits) q_register = qiskit.circuit.QuantumRegister(circuit.n_qubits, "q") gate_op_only_circuit = _circuit.Circuit( [op for op in circuit.operations if isinstance(op, _gates.GateOperation)] ) custom_names = { gate_def.gate_name for gate_def in gate_op_only_circuit.collect_custom_gate_definitions() } q_triplets = [] for gate_op in circuit.operations: if isinstance(gate_op, _gates.GateOperation): q_triplet = _export_gate_to_qiskit( gate_op.gate, applied_qubit_indices=gate_op.qubit_indices, q_register=q_register, custom_names=custom_names, ) elif isinstance(gate_op, _wavefunction_operations.ResetOperation): q_triplet = ( qiskit.circuit.library.Reset(), [q_register[gate_op.qubit_indices[0]]], [], ) q_triplets.append(q_triplet) for q_gate, q_qubits, q_clbits in q_triplets: q_circuit.append(q_gate, q_qubits, q_clbits) return q_circuit def _export_gate_to_qiskit(gate, applied_qubit_indices, q_register, custom_names): try: return _export_gate_via_mapping( gate, applied_qubit_indices, q_register, custom_names ) except ValueError: pass try: return _export_dagger_gate( gate, applied_qubit_indices, q_register, custom_names ) except ValueError: pass try: return _export_controlled_gate( gate, applied_qubit_indices, q_register, custom_names ) except ValueError: pass try: return _export_custom_gate( gate, applied_qubit_indices, q_register, custom_names ) except ValueError: pass raise NotImplementedError(f"Exporting gate {gate} to Qiskit is unsupported") def _export_gate_via_mapping(gate, applied_qubit_indices, q_register, custom_names): try: qiskit_cls = ORQUESTRA_QISKIT_GATE_MAP[ _builtin_gates.builtin_gate_by_name(gate.name) ] except KeyError: raise ValueError(f"Can't export gate {gate} to Qiskit via mapping") qiskit_params = [_qiskit_expr_from_orquestra(param) for param in gate.params] qiskit_qubits = [q_register[index] for index in applied_qubit_indices] return qiskit_cls(*qiskit_params), qiskit_qubits, [] def _export_dagger_gate( gate: _gates.Dagger, applied_qubit_indices, q_register, custom_names, ): if not isinstance(gate, _gates.Dagger): # Raising an exception here is redundant to the type hint, but it allows us # to handle exporting all gates in the same way, regardless of type raise ValueError(f"Can't export gate {gate} as a dagger gate") target_gate, qiskit_qubits, qiskit_clbits = _export_gate_to_qiskit( gate.wrapped_gate, applied_qubit_indices=applied_qubit_indices, q_register=q_register, custom_names=custom_names, ) return target_gate.inverse(), qiskit_qubits, qiskit_clbits def _export_controlled_gate( gate: _gates.ControlledGate, applied_qubit_indices, q_register, custom_names, ): if not isinstance(gate, _gates.ControlledGate): # Raising an exception here is redundant to the type hint, but it allows us # to handle exporting all gates in the same way, regardless of type raise ValueError(f"Can't export gate {gate} as a controlled gate") target_indices = applied_qubit_indices[gate.num_control_qubits :] target_gate, _, _ = _export_gate_to_qiskit( gate.wrapped_gate, applied_qubit_indices=target_indices, q_register=q_register, custom_names=custom_names, ) controlled_gate = target_gate.control(gate.num_control_qubits) qiskit_qubits = [q_register[index] for index in applied_qubit_indices] return controlled_gate, qiskit_qubits, [] def _export_custom_gate( gate: _gates.MatrixFactoryGate, applied_qubit_indices, q_register, custom_names, ): if gate.name not in custom_names: raise ValueError( f"Can't export gate {gate} as a custom gate, the circuit is missing its " "definition" ) if gate.params: raise ValueError( f"Can't export parametrized gate {gate}, Qiskit doesn't support " "parametrized custom gates" ) # At that time of writing it Qiskit doesn't support parametrized gates defined with # a symbolic matrix. # See https://github.com/Qiskit/qiskit-terra/issues/4751 for more info. qiskit_qubits = [q_register[index] for index in applied_qubit_indices] qiskit_matrix = np.array(gate.matrix) return ( qiskit.extensions.UnitaryGate(qiskit_matrix, label=gate.name), qiskit_qubits, [], ) class AnonGateOperation(NamedTuple): gate_name: str matrix: sympy.Matrix qubit_indices: Tuple[int, ...] ImportedOperation = Union[_operations.Operation, AnonGateOperation] def _apply_custom_gate( anon_op: AnonGateOperation, custom_defs_map: Dict[str, _gates.CustomGateDefinition] ) -> _gates.GateOperation: gate_def = custom_defs_map[anon_op.gate_name] # Qiskit doesn't support custom gates with parametrized matrices # so we can assume empty params list. gate_params: Tuple[sympy.Symbol, ...] = tuple() gate = gate_def(*gate_params) return gate(*anon_op.qubit_indices) def import_from_qiskit(circuit: qiskit.QuantumCircuit) -> _circuit.Circuit: q_ops = [_import_qiskit_triplet(triplet) for triplet in circuit.data] anon_ops = [op for op in q_ops if isinstance(op, AnonGateOperation)] # Qiskit doesn't support custom gates with parametrized matrices # so we can assume empty params list. params_ordering: Tuple[sympy.Symbol, ...] = tuple() custom_defs = { anon_op.gate_name: _gates.CustomGateDefinition( gate_name=anon_op.gate_name, matrix=anon_op.matrix, params_ordering=params_ordering, ) for anon_op in anon_ops } imported_ops = [ _apply_custom_gate(op, custom_defs) if isinstance(op, AnonGateOperation) else op for op in q_ops ] return _circuit.Circuit( operations=imported_ops, n_qubits=circuit.num_qubits, ) def _import_qiskit_triplet(qiskit_triplet: QiskitTriplet) -> ImportedOperation: qiskit_op, qiskit_qubits, _ = qiskit_triplet return _import_qiskit_op(qiskit_op, qiskit_qubits) def _import_qiskit_op(qiskit_op, qiskit_qubits) -> ImportedOperation: # We always wanna try importing via mapping to handle complex gate structures # represented by a single class, like CNOT (Control + X) or CSwap (Control + Swap). try: return _import_qiskit_op_via_mapping(qiskit_op, qiskit_qubits) except ValueError: pass try: return _import_controlled_qiskit_op(qiskit_op, qiskit_qubits) except ValueError: pass try: return _import_custom_qiskit_gate(qiskit_op, qiskit_qubits) except AttributeError: raise ValueError(f"Conversion of {qiskit_op.name} from Qiskit is unsupported.") def _import_qiskit_op_via_mapping( qiskit_gate: qiskit.circuit.Instruction, qiskit_qubits: Iterable[qiskit.circuit.Qubit], ) -> _operations.Operation: qubit_indices = [_import_qiskit_qubit(qubit) for qubit in qiskit_qubits] if isinstance(qiskit_gate, qiskit.circuit.library.Reset): return _wavefunction_operations.ResetOperation(qubit_indices[0]) try: gate_ref = QISKIT_ORQUESTRA_GATE_MAP[type(qiskit_gate)] except KeyError: raise ValueError(f"Conversion of {qiskit_gate} from Qiskit is unsupported.") # values to consider: # - gate matrix parameters (only parametric gates) # - gate application indices (all gates) orquestra_params = [ _orquestra_expr_from_qiskit(param) for param in qiskit_gate.params ] gate = _make_gate_instance(gate_ref, orquestra_params) return _gates.GateOperation(gate=gate, qubit_indices=tuple(qubit_indices)) def _import_controlled_qiskit_op( qiskit_gate: qiskit.circuit.ControlledGate, qiskit_qubits: Sequence[qiskit.circuit.Qubit], ) -> _gates.GateOperation: if not isinstance(qiskit_gate, qiskit.circuit.ControlledGate): # Raising an exception here is redundant to the type hint, but it allows us # to handle exporting all gates in the same way, regardless of type raise ValueError(f"Can't import gate {qiskit_gate} as a controlled gate") wrapped_qubits = qiskit_qubits[qiskit_gate.num_ctrl_qubits :] wrapped_op = _import_qiskit_op(qiskit_gate.base_gate, wrapped_qubits) qubit_indices = map(_import_qiskit_qubit, qiskit_qubits) if isinstance(wrapped_op, _gates.GateOperation): return wrapped_op.gate.controlled(qiskit_gate.num_ctrl_qubits)(*qubit_indices) else: raise NotImplementedError( "Importing of controlled anonymous gates not yet supported." ) def _hash_hex(bytes_): return hashlib.sha256(bytes_).hexdigest() def _custom_qiskit_gate_name(gate_label: str, gate_name: str, matrix: np.ndarray): matrix_hash = _hash_hex(matrix.tobytes()) target_name = gate_label or gate_name return f"{target_name}.{matrix_hash}" def _import_custom_qiskit_gate( qiskit_op: qiskit.circuit.Gate, qiskit_qubits: Iterable[qiskit.circuit.Qubit] ) -> AnonGateOperation: value_matrix = qiskit_op.to_matrix() return AnonGateOperation( gate_name=_custom_qiskit_gate_name( qiskit_op.label, qiskit_op.name, value_matrix ), matrix=sympy.Matrix(value_matrix), qubit_indices=tuple(_import_qiskit_qubit(qubit) for qubit in qiskit_qubits), )
https://github.com/Quantum-Ducks/QuBayes
Quantum-Ducks
# These are versions of some of our important functions # that were duplicates or non-generalized forms that I # am retiring to here in case something goes wrong import pandas as pd import numpy as np def get_probabilities_2state_sys(states): num_total = np.shape(states)[0] * np.shape(states)[1] num_ones = np.shape(np.where(states == 1))[1] num_zeros = num_total - num_ones prob_one = num_ones/num_total prob_zero = num_zeros/num_total assert round(prob_one+prob_zero, 3) == 1. return prob_one, prob_zero def get_conditional_probability_2parent_2state(Astates, Bstates, Cstates): #I'm in progress of generalizing this in probabilities.ipynb, but feel free to pick up where I left off """A and B are parent nodes. C is child node""" num111, num101, num011, num001, num110, num100, num010, num000 = 0, 0, 0, 0, 0, 0, 0, 0 num11, num01, num10, num00 = 0,0,0,0 #Add up cases where C=1 indC_one_row = np.where(Cstates == 1)[0] #index of row with a 1 indC_one_col = np.where(Cstates == 1)[1] #index of corresponding coln with a 1 for i in range(len(indC_one_col)): # loop through all times C=1 A = Astates.iloc[indC_one_row[i], indC_one_col[i]] B = Bstates.iloc[indC_one_row[i], indC_one_col[i]] if A == 1: if B == 1: num111 += 1 #C=1, B=1, A=1 num11 += 1 #B=1, A=1 elif B == 0: num101 += 1 #C=1, B=0, A=1 num01 += 1 #B=0, A=1 elif A == 0: if B == 1: num110 += 1 #C=1, B=1, A=0 num10 += 1 #B=1, A=0 elif B == 0: num100 += 1 #C=1, B=0, A=0 num00 += 1 #B=0, A=0 # Add up states where C=0 indC_zero_row = np.where(Cstates == 0)[0] indC_zero_col = np.where(Cstates == 0)[1] for i in range(len(indC_zero_col)): # loop through all times C=0 A = Astates.iloc[indC_zero_row[i], indC_zero_col[i]] B = Bstates.iloc[indC_zero_row[i], indC_zero_col[i]] if A == 1: if B == 1: num011 += 1 #C=0, B=1, A=1 num11 += 1 #B=1, A=1 elif B == 0: num001 += 1 #C=0, B=0, A=1 num01 += 1 #B=0, A=1 elif A == 0: if B == 1: num010 += 1 #C=0, B=1, A=0 num10 += 1 #B=1, A=0 elif B == 0: num000 += 1 #C=0, B=0, A=0 num00 += 1 #B=0, A=0 # Calculate conditional probabilities num_total = np.shape(Astates)[0] * np.shape(Astates)[1] """The variable names are in the order CBA (cases, testing, stay at home). """ P111 = num111/num11 P101 = num101/num01 P110 = num110/num10 P100 = num100/num00 P011 = num011/num11 P001 = num001/num01 P010 = num010/num10 P000 = num000/num00 states = np.array(['0|00','1|00','0|01','1|01','0|10','1|10','0|11','1|11']) #I believe this is the order Matt was talking about with top to bottom, left to right in the table from the paper conditional_probabilities = np.array([P000,P100,P001,P101,P010,P110,P011,P111]) #in this order, the first two, second two, etc. should each add to 1 as pairs (columns in the paper's table) # Make graph for circuit input ProbA1, ProbA0 = get_probabilities_2state_sys(Astates) ProbB1, ProbB0 = get_probabilities_2state_sys(Bstates) graph = { 'StayAtHome': ([], [ProbA0, ProbA1]), # P(A = 0), P(A = 1) 'Testing': ([], [ProbB0, ProbB1]), #P(B = 0), P(B = 1) #P(C=0|A=0,B=0), P(C=1|A=0,B=0), P(C=0|A=0,B=1), P(C=1|A=0,B=1), P(C=0|A=1,B=0), P(C=1|A=1,B=0), P(C=0|A=1,B=1), P(C=1|A=1,B=1) 'Cases': (['StayAtHome','Testing'], [P000, P100, P010, P110, P001, P101, P011, P111]) } return states, conditional_probabilities, graph def Margies_marginal_probabilities(ntwk_results): #a combined version of this with Ella's is kept in the real code #ntwk_results: dict, counts resulting from network run (should have 2^n entries) #marg_probs: array of length n, marginal probabilities that each qubit is 0, #from most significant to least significant n = len(list(ntwk_results.keys())[0]) prob = np.zeros(n) total = sum(ntwk_results.values()) for i in range(n): for key in ntwk_results: if int(key[i]) == 0: prob[i] += ntwk_results[key] prob[i] = prob[i]/total return prob def Ella_3qubit_marginal_probabilities(pstates_dict): # Works for 3 qubits only C0, B0, A0, numtot = 0, 0, 0, 0 for key in pstates_dict: Cstate=key[0] Bstate=key[1] Astate=key[2] numtot += pstates_dict[key] if Cstate == '0': C0 += pstates_dict[key] if Bstate == '0': B0 += pstates_dict[key] if Astate == '0': A0 += pstates_dict[key] ProbC0 = C0/numtot ProbB0 = B0/numtot ProbA0 = A0/numtot return ProbC0, ProbB0, ProbA0 def Ella_marginal_probabilities_general(pstates_dict): """Works for n qubits""" n = len(list(pstates_dict.keys())[0]) #number of qubits in state Probs = np.empty(n) numZeros, numtot = np.zeros(n), 0 for key in pstates_dict: numtot += pstates_dict[key] for i in range(n): #print(i) state=key[i] if state == '0': numZeros[i] += pstates_dict[key] for i in range(n): Probs[i] = numZeros[i]/numtot return Probs # Test the marginal prob functions with some simulated output from our 3 qubit run! #pick the function to use (comment others out) funct = Ella_marginal_probabilities_general #funct = Ella_3qubit_marginal_probabilities #funct = Margies_marginal_probabilities result1 = {'000': 2783, '001': 1240, '100': 603, '111': 815, '110': 294, '010': 1712, '101': 485, '011': 260} print(funct(result1)) def get_lesser_model_states(): statedataStayHome = {'MarHome' : data['MarHome'], 'AprHome' : data['AprHome'], 'MayHome' : data['MayHome'], 'JunHome' : data['JunHome']} statesStayHome = pd.DataFrame(data=statedataStayHome) statedataTests = {'MarTest' : data['MarTest'], 'AprTest' : data['AprTest'], 'MayTest' : data['MayTest'], 'JunTest' : data['JunTest']} statesTests = pd.DataFrame(data=statedataTests) statedataCases = {'MarCases' : data['MarCases'], 'AprCases' : data['AprCases'], 'MayCases' : data['MayCases'], 'JunCases' : data['JunCases']} statesCases = pd.DataFrame(data=statedataCases) # 0 = increasing. 1 = flat or decreasing return statesStayHome, statesTests, statesCases data = pd.read_csv('data/lesser_model_data.csv') Astates, Bstates, Cstates = get_lesser_model_states() print(get_conditional_probability_2parent_2state(Astates, Bstates, Cstates)) """ # ALTERNATE SECTION OF GENERALIZED CONDITIONAL PROBABILITY CODE TO CONSIDER SHORTENING BY LIKE 3 LINES def f(c, *ps): for key in keys: num_c, tot_c = 0, 0 n = len(c) for i in range(n): all_ps = all([ps[j][i] == key[j] for j in range(len(ps))]) if all_ps: tot_c += 1 if c[i] == thing before |: num_c += 1 """ def generate_cond_keys_old(s_0, s_i): ############################################## #THIS FUNCTION WILL GENERATE A LIST OF STRINGS TO USE AS KEYS FOR CONDITIONAL PROBABILITIES ### INPUT ### # s_0 int number of states of the child node # s_i list number of states for each parent node, from most to least significant ### OUTPUT ### # list of strings to use as keys for conditional probabilities (included commas in case there is ever an >11-state node!) ############################################## ranges = [range(0, elem) for elem in list([s_0])+list(s_i)] enumed = product(*ranges) cond_keys = [] for enum in enumed: enum = list(enum) parent_str = ",".join(str(x) for x in enum[1:]) cond_keys.append("%s|%s"%(str(enum[0]), parent_str)) return cond_keys
https://github.com/LauraGentini/QRL
LauraGentini
__author__ = 'QRL_team' from qiskit import * from qiskit.circuit.library import GroverOperator from qiskit.quantum_info import Statevector import numpy as np from math import ceil class GroverMazeLearner: """ Inits a quantum QLearner object for given environment. Environment must be discrete and of "maze type", with the last state as the goal """ def __init__(self, env): self.env = env # gym.make("FrozenLake-v0", is_slippery=False) # state and action spaces dims self.obs_dim = self.env.observation_space.n self.acts_dim = self.env.action_space.n # dim of qubits register needed to encode all actions self.acts_reg_dim = ceil(np.log2(self.acts_dim)) # optimal number of steps in original Grover's algorithm self.max_grover_steps = int(round( np.pi / (4 * np.arcsin(1. / np.sqrt(2 ** self.acts_reg_dim))) - 0.5)) # quality values self.state_vals = np.zeros(self.obs_dim) # grover steps taken self.grover_steps = np.zeros((self.obs_dim, self.acts_dim), dtype=int) # boolean flags to signal maximum amplitude amplification reached self.grover_steps_flag = np.zeros((self.obs_dim, self.acts_dim), dtype=bool) # learner hyperparms (eps still not used) self.hyperparams = {'k': -1, 'alpha': 0.05, 'gamma': 0.99, 'eps': 0.01, 'max_epochs': 1000, 'max_steps': 100 , 'graphics': True} # current state self.state = self.env.reset() # current action self.action = 0 # list of grover oracles self.grover_ops = self._init_grover_ops() # list of state-action circuits self.acts_circs = self._init_acts_circs() # qiskit simulator self.SIM = Aer.get_backend('qasm_simulator') def set_hyperparams(self, hyperdict): """ Set learner's hyperparameters :param hyperdict: a dict with same keys as self's :return: """ self.hyperparams = hyperdict def _init_acts_circs(self): """ Inits state-action circuits :return: list of qiskit circuits, initialized in full superposition """ circs = [QuantumCircuit(self.acts_reg_dim, name='|as_{}>'.format(i)) for i in range(self.obs_dim)] for c in circs: c.h(list(range(self.acts_reg_dim))) return circs def _update_statevals(self, reward, new_state): """ Bellman equation for state values update :param reward: instantaneous reward received by the agent :param new_state: state reached upon taking previous action :return: """ self.state_vals[self.state] += self.hyperparams['alpha']*(reward + self.hyperparams['gamma']*self.state_vals[new_state] - self.state_vals[self.state]) def _eval_grover_steps(self, reward, new_state): """ Choose how many grover step to take based on instantaneous reward and value of new state :param reward: the instantaneous reward received by the agent :param new_state: the new state visited by the agent :return: number of grover steps to be taken, if it exceeds the theoretical optimal number the latter is returned instead """ steps_num = int(self.hyperparams['k']*(reward + self.state_vals[new_state])) return min(steps_num, self.max_grover_steps) def _init_grover_ops(self): """ Inits grover oracles for the actions set :return: a list of qiskit instructions ready to be appended to circuit """ states_binars = [format(i, '0{}b'.format(self.acts_reg_dim)) for i in range(self.acts_dim)] targ_states = [Statevector.from_label(s) for s in states_binars] grops = [GroverOperator(oracle=ts) for ts in targ_states] return [g.to_instruction() for g in grops] def _run_grover(self): """ DEPRECATED :return: """ # deploy grover ops on acts_circs gsteps = self.grover_steps[self.state, self.action] circ = self.acts_circs[self.state] op = self.grover_ops[self.action] for _ in range(gsteps): circ.append(op, list(range(self.acts_reg_dim))) self.acts_circs[self.state] = circ def _run_grover_bool(self): """ Update state-action circuits based on evaluated steps :return: """ flag = self.grover_steps_flag[self.state, :] gsteps = self.grover_steps[self.state, self.action] circ = self.acts_circs[self.state] op = self.grover_ops[self.action] if not flag.any(): for _ in range(gsteps): circ.append(op, list(range(self.acts_reg_dim))) if gsteps >= self.max_grover_steps and not flag.any(): self.grover_steps_flag[self.state, self.action] = True self.acts_circs[self.state] = circ def _take_action(self): """ Measures the state-action circuit corresponding to current state and decides next action :return: action to be taken, int """ circ = self.acts_circs[self.state] circ_tomeasure = circ.copy() circ_tomeasure.measure_all() # circ_tomeasure = transpile(circ_tomeasure) # print(circ.draw()) job = execute(circ_tomeasure, backend=self.SIM, shots=1) result = job.result() counts = result.get_counts() action = int((list(counts.keys()))[0], 2) return action def train(self): """ groverize and measure action qstate -> take corresp action obtain: newstate, reward, terminationflag update stateval, grover_steps for epoch in epochs until max_epochs is reached :return: dictionary of trajectories """ traj_dict = {} # set initial max_steps optimal_steps = self.hyperparams['max_steps'] for epoch in range(self.hyperparams['max_epochs']): if epoch % 10 == 0: print("Processing epoch {} ...".format(epoch)) # reset env self.state = self.env.reset() # init list for traj traj = [self.state] if self.hyperparams['graphics']: self.env.render() for step in range(optimal_steps): print('Taking step {0}/{1}'.format(step, optimal_steps), end='\r') # print('STATE: ', self.state) # Select action self.action = self._take_action() # take action new_state, reward, done, _ = self.env.step(self.action) if new_state == self.state: reward -= 10 done = True if new_state == self.obs_dim - 1: reward += 99 # update optimal traj len optimal_steps = step + 1 elif not done: reward -= 1 # print('REWARD: ', reward) # update statevals and grover steps self._update_statevals(reward, new_state) self.grover_steps[self.state, self.action] = self._eval_grover_steps(reward, new_state) # amplify amplitudes with grover # self._run_grover() self._run_grover_bool() # render if curious if self.hyperparams['graphics']: self.env.render() # save transition traj.append(new_state) # quit epoch if done if done: break # move to new state self.state = new_state # print('STATE_VALS: ', self.state_vals) # print('GROVER_STEPS: ', self.grover_steps) traj_dict['epoch_{}'.format(epoch)] = traj # return trajectories return traj_dict
https://github.com/AmirhoseynpowAsghari/Qiskit-Tutorials
AmirhoseynpowAsghari
!pip install qutip import numpy as np from qutip import * # Define the system parameters omega = 1.0 # Frequency of the external potential interaction_strength = 0.5 # Strength of the interaction time_points = np.linspace(0, 10, 1000) # Time points for simulation # Define the Hamiltonian for the system H0 = omega * tensor(sigmax(), identity(2)) # External potential Hint = interaction_strength * (tensor(sigmax(), sigmax()) + tensor(sigmay(), sigmay())) # Interaction term H = H0 + Hint # Total Hamiltonian # Define the initial state of the system psi0 = tensor(basis(2, 0), basis(2, 1)) # Example initial state: |0⟩⨂|1⟩ # Simulate the time evolution of the system result = mesolve(H, psi0, time_points, [], []) # Extract the desired state from the result list states = result.states # Calculate the concurrence at each time point concurrence = [concurrence(state) for state in states] # Plot the concurrence as a function of time import matplotlib.pyplot as plt plt.plot(time_points, concurrence) plt.xlabel('Time') plt.ylabel('Concurrence') plt.title('Effect of External Potential on Concurrence') plt.show()
https://github.com/qiskit-community/qiskit-translations-staging
qiskit-community
from qiskit import QuantumRegister, ClassicalRegister, QuantumCircuit qr = QuantumRegister(3, 'q') anc = QuantumRegister(1, 'ancilla') cr = ClassicalRegister(3, 'c') qc = QuantumCircuit(qr, anc, cr) qc.x(anc[0]) qc.h(anc[0]) qc.h(qr[0:3]) qc.cx(qr[0:3], anc[0]) qc.h(qr[0:3]) qc.barrier(qr) qc.measure(qr, cr) qc.draw('mpl')
https://github.com/maheshwaripranav/Qiskit-Fall-Fest-Kolkata-Hackathon
maheshwaripranav
import qiskit import numpy as np import math import random import pandas as pd from qiskit import IBMQ IBMQ.save_account('3ccb2d17a0f19c3ce64cf44b3e1c90d3369ea562672f7315624ee8d92bb4350e10b643e3b2af92eef73c029e051518c2a833fb0ffa2e600b2c6c65ed5dd29d40') IBMQ.load_account() from qiskit import * import math as m import time from copy import deepcopy from qiskit import QuantumRegister, QuantumCircuit, ClassicalRegister, Aer from qiskit.quantum_info import state_fidelity #simulators S_simulator = Aer.backends(name = 'statevector_simulator')[0] M_simulator = Aer.backends(name = 'qasm_simulator')[0] U_simulator = Aer.backends(name = 'unitary_simulator')[0] #provider = IBMQ.get_provider(hub = 'ibm-q-research') csv_url = 'https://archive.ics.uci.edu/ml/machine-learning-databases/iris/iris.data' # using the attribute information as the column names col_names = ['Sepal_Length','Sepal_Width','Petal_Length','Petal_Width','Class'] iris = pd.read_csv(csv_url, names = col_names) #amplitude encoding # total amplitudes to be encoded = features*total_instances = 600 # total computatuional basis states available = 2**10 = 1024 # redundant states = 1024 - 600 = 424 features = 4 total_instances = 150 num_qubits = int(math.log(features*total_instances,2)) +1 redundant_basis_states = 2**num_qubits - features*total_instances redundant_basis_states_list = list(np.zeros(redundant_basis_states,dtype = int)) q = QuantumRegister(num_qubits) qc = QuantumCircuit(q) Vector = [] for i in range(total_instances): vector = [iris['Sepal_Length'][i],iris['Sepal_Width'][i],iris['Petal_Length'][i],iris['Petal_Length'][i] ] #Vector = list(np.concatenate(vector)) Vector.append(vector) #Vector = Vector.append(redundant_basis_states_list) final_state = list(np.concatenate(Vector)) Final_state = final_state + redundant_basis_states_list normalized_state = (Final_state / np.linalg.norm(Final_state)) qc.initialize(normalized_state) qc.draw('mpl') # the corresponding state contains all 600 amplitudes # angle encoding Vector circuit = QuantumCircuit(features, 4) for j in range(total_instances): for i in range(features): circuit.ry(Vector[j][i],i) #qc.ry(Vector[i],i) circuit.measure(range(4), range(4)) circuit.draw('mpl') backend_sim = Aer.get_backend('qasm_simulator') job_sim = backend_sim.run(circuit, shots=1024) result_sim = job_sim.result() counts = result_sim.get_counts() counts
https://github.com/qiskit-community/qiskit-translations-staging
qiskit-community
from qiskit import QuantumCircuit, QuantumRegister, ClassicalRegister from qiskit.circuit.quantumcircuitdata import CircuitInstruction from qiskit.circuit import Measure from qiskit.circuit.library import HGate, CXGate qr = QuantumRegister(2) cr = ClassicalRegister(2) instructions = [ CircuitInstruction(HGate(), [qr[0]], []), CircuitInstruction(CXGate(), [qr[0], qr[1]], []), CircuitInstruction(Measure(), [qr[0]], [cr[0]]), CircuitInstruction(Measure(), [qr[1]], [cr[1]]), ] circuit = QuantumCircuit.from_instructions(instructions) circuit.draw("mpl")
https://github.com/zeynepCankara/Introduction-Quantum-Programming
zeynepCankara
# import all necessary objects and methods for quantum circuits from qiskit import QuantumRegister, ClassicalRegister, QuantumCircuit, execute, Aer # import randrange for random choices from random import randrange n = 5 m = 4 states_of_qubits = [] # we trace the state of each qubit also by ourselves qreg1 = QuantumRegister(n) # quantum register with n qubits creg1 = ClassicalRegister(n) # classical register with n bits mycircuit1 = QuantumCircuit(qreg1,creg1) # quantum circuit with quantum and classical registers # set each qubit to |1> for i in range(n): mycircuit1.x(qreg1[i]) # apply x-gate (NOT operator) states_of_qubits.append(1) # the state of each qubit is set to 1 # randomly pick m pairs of qubits for i in range(m): controller_qubit = randrange(n) target_qubit = randrange(n) # controller and target qubits should be different while controller_qubit == target_qubit: # if they are the same, we pick the target_qubit again target_qubit = randrange(n) # print our picked qubits print("the indices of the controller and target qubits are",controller_qubit,target_qubit) # apply cx-gate (CNOT operator) mycircuit1.cx(qreg1[controller_qubit],qreg1[target_qubit]) # we also trace the results if states_of_qubits[controller_qubit] == 1: # if the value of the controller qubit is 1, states_of_qubits[target_qubit] = 1 - states_of_qubits[target_qubit] # then flips the value of the target qubit # remark that 1-x gives the negation of x # measure the quantum register mycircuit1.measure(qreg1,creg1) print("Everything looks fine, let's continue ...") # draw the circuit mycircuit1.draw(output='mpl') # re-execute this cell if you DO NOT see the circuit diagram # execute the circuit 100 times in the local simulator job = execute(mycircuit1,Aer.get_backend('qasm_simulator'),shots=100) counts = job.result().get_counts(mycircuit1) # print the reverse of the outcome for outcome in counts: reverse_outcome = '' for i in outcome: reverse_outcome = i + reverse_outcome print(reverse_outcome,"is observed",counts[outcome],"times") # the states of the qubits should be as follows based on our own calculation print(states_of_qubits) # import all necessary objects and methods for quantum circuits from qiskit import QuantumRegister, ClassicalRegister, QuantumCircuit, execute, Aer all_inputs=['00','01','10','11'] for input in all_inputs: qreg2 = QuantumRegister(2) # quantum register with 2 qubits creg2 = ClassicalRegister(2) # classical register with 2 bits mycircuit2 = QuantumCircuit(qreg2,creg2) # quantum circuit with quantum and classical registers #initialize the inputs if input[0]=='1': mycircuit2.x(qreg2[0]) # set the state of the first qubit to |1> if input[1]=='1': mycircuit2.x(qreg2[1]) # set the state of the second qubit to |1> # apply h-gate to both qubits mycircuit2.h(qreg2[0]) mycircuit2.h(qreg2[1]) # apply cx(first-qubit,second-qubit) mycircuit2.cx(qreg2[0],qreg2[1]) # apply h-gate to both qubits mycircuit2.h(qreg2[0]) mycircuit2.h(qreg2[1]) # measure both qubits mycircuit2.measure(qreg2,creg2) # execute the circuit 100 times in the local simulator job = execute(mycircuit2,Aer.get_backend('qasm_simulator'),shots=100) counts = job.result().get_counts(mycircuit2) for outcome in counts: # print the reverse of the outcomes reverse_outcome = '' for i in outcome: reverse_outcome = i + reverse_outcome print("our input is",input,": ",reverse_outcome,"is observed",counts[outcome],"times") # import all necessary objects and methods for quantum circuits from qiskit import QuantumRegister, ClassicalRegister, QuantumCircuit, execute, Aer all_inputs=['00','01','10','11'] for input in all_inputs: qreg3 = QuantumRegister(2) # quantum register with 2 qubits creg3 = ClassicalRegister(2) # classical register with 2 bits mycircuit3 = QuantumCircuit(qreg3,creg3) # quantum circuit with quantum and classical registers #initialize the inputs if input[0]=='1': mycircuit3.x(qreg3[0]) # set the value of the first qubit to |1> if input[1]=='1': mycircuit3.x(qreg3[1]) # set the value of the second qubit to |1> # apply cx(first-qubit,second-qubit) mycircuit3.cx(qreg3[0],qreg3[1]) # apply cx(second-qubit,first-qubit) mycircuit3.cx(qreg3[1],qreg3[0]) # apply cx(first-qubit,second-qubit) mycircuit3.cx(qreg3[0],qreg3[1]) mycircuit3.measure(qreg3,creg3) # execute the circuit 100 times in the local simulator job = execute(mycircuit3,Aer.get_backend('qasm_simulator'),shots=100) counts = job.result().get_counts(mycircuit3) for outcome in counts: # print the reverse of the outcomes reverse_outcome = '' for i in outcome: reverse_outcome = i + reverse_outcome print("our input is",input,": ",reverse_outcome,"is observed",counts[outcome],"times")
https://github.com/JessicaJohnBritto/Quantum-Computing-and-Information
JessicaJohnBritto
# Importing Packages import matplotlib.pyplot as plt import numpy as np from qiskit import IBMQ, Aer from qiskit.providers.ibmq import least_busy from qiskit import QuantumCircuit, ClassicalRegister, QuantumRegister, transpile, assemble from qiskit.visualization import plot_histogram # Input Secret Number s = input("Input the secret number:\n") n=len(s) qc = QuantumCircuit(n+1, n) # Putting states in superposition qc.x(n) for i in range(n+1): qc.h(i) qc.barrier() # Apply the inner-product oracle s=s[::-1] # reverse s to fit qiskit's qubit ordering print(s) for k in range(n): if s[k] == '1': qc.cx(k, n) qc.barrier() # Measuring for m in range(n): qc.h(m) qc.barrier() for b in range(n): qc.measure(b,b) qc.draw(output="mpl") # Simulating on local simulator aer_sim = Aer.get_backend('aer_simulator') shots = 1024 qobj = assemble(qc) results = aer_sim.run(qobj).result() count = results.get_counts() plot_histogram(count)
https://github.com/qiskit-community/qiskit-translations-staging
qiskit-community
from qiskit_nature.second_q.drivers import GaussianForcesDriver # if you ran Gaussian elsewhere and already have the output file driver = GaussianForcesDriver(logfile="aux_files/CO2_freq_B3LYP_631g.log") # if you want to run the Gaussian job from Qiskit # driver = GaussianForcesDriver( # ['#p B3LYP/6-31g Freq=(Anharm) Int=Ultrafine SCF=VeryTight', # '', # 'CO2 geometry optimization B3LYP/6-31g', # '', # '0 1', # 'C -0.848629 2.067624 0.160992', # 'O 0.098816 2.655801 -0.159738', # 'O -1.796073 1.479446 0.481721', # '', # '' from qiskit_nature.second_q.problems import HarmonicBasis basis = HarmonicBasis([2, 2, 2, 2]) from qiskit_nature.second_q.problems import VibrationalStructureProblem from qiskit_nature.second_q.mappers import DirectMapper vibrational_problem = driver.run(basis=basis) vibrational_problem.hamiltonian.truncation_order = 2 main_op, aux_ops = vibrational_problem.second_q_ops() print(main_op) qubit_mapper = DirectMapper() qubit_op = qubit_mapper.map(main_op) print(qubit_op) basis = HarmonicBasis([3, 3, 3, 3]) vibrational_problem = driver.run(basis=basis) vibrational_problem.hamiltonian.truncation_order = 2 main_op, aux_ops = vibrational_problem.second_q_ops() qubit_mapper = DirectMapper() qubit_op = qubit_mapper.map(main_op) print(qubit_op) # for simplicity, we will use the smaller basis again vibrational_problem = driver.run(basis=HarmonicBasis([2, 2, 2, 2])) vibrational_problem.hamiltonian.truncation_order = 2 from qiskit.algorithms.minimum_eigensolvers import NumPyMinimumEigensolver from qiskit_nature.second_q.algorithms import GroundStateEigensolver solver = GroundStateEigensolver( qubit_mapper, NumPyMinimumEigensolver(filter_criterion=vibrational_problem.get_default_filter_criterion()), ) result = solver.solve(vibrational_problem) print(result) import qiskit.tools.jupyter %qiskit_version_table %qiskit_copyright