repo
stringclasses
885 values
file
stringclasses
741 values
content
stringlengths
4
215k
https://github.com/qiskit-community/qiskit-translations-staging
qiskit-community
import numpy as np from qiskit import QuantumCircuit # Create a Quantum Circuit acting on a quantum register of three qubits circ = QuantumCircuit(3) # Add a H gate on qubit 0, putting this qubit in superposition. circ.h(0) # Add a CX (CNOT) gate on control qubit 0 and target qubit 1, putting # the qubits in a Bell state. circ.cx(0, 1) # Add a CX (CNOT) gate on control qubit 0 and target qubit 2, putting # the qubits in a GHZ state. circ.cx(0, 2) circ.draw('mpl') from qiskit.quantum_info import Statevector # Set the intial state of the simulator to the ground state using from_int state = Statevector.from_int(0, 2**3) # Evolve the state by the quantum circuit state = state.evolve(circ) #draw using latex state.draw('latex') from qiskit.visualization import array_to_latex #Alternative way of representing in latex array_to_latex(state) state.draw('qsphere') state.draw('hinton') from qiskit.quantum_info import Operator U = Operator(circ) # Show the results U.data # Create a Quantum Circuit meas = QuantumCircuit(3, 3) meas.barrier(range(3)) # map the quantum measurement to the classical bits meas.measure(range(3), range(3)) # The Qiskit circuit object supports composition. # Here the meas has to be first and front=True (putting it before) # as compose must put a smaller circuit into a larger one. qc = meas.compose(circ, range(3), front=True) #drawing the circuit qc.draw('mpl') # Adding the transpiler to reduce the circuit to QASM instructions # supported by the backend from qiskit import transpile # Use AerSimulator from qiskit_aer import AerSimulator backend = AerSimulator() # First we have to transpile the quantum circuit # to the low-level QASM instructions used by the # backend qc_compiled = transpile(qc, backend) # Execute the circuit on the qasm simulator. # We've set the number of repeats of the circuit # to be 1024, which is the default. job_sim = backend.run(qc_compiled, shots=1024) # Grab the results from the job. result_sim = job_sim.result() counts = result_sim.get_counts(qc_compiled) print(counts) from qiskit.visualization import plot_histogram plot_histogram(counts) import qiskit.tools.jupyter %qiskit_version_table %qiskit_copyright
https://github.com/unitaryfund/mitiq
unitaryfund
# Copyright (C) Unitary Fund # # This source code is licensed under the GPL license (v3) found in the # LICENSE file in the root directory of this source tree. import random import cirq import networkx as nx import numpy as np import pennylane as qml import pytest import qiskit from pennylane.tape import QuantumTape from mitiq.benchmarks import generate_mirror_circuit from mitiq.interface.mitiq_cirq import compute_density_matrix from mitiq.pt.pt import ( CIRQ_NOISE_OP, PENNYLANE_NOISE_OP, CNOT_twirling_gates, CZ_twirling_gates, pauli_twirl_circuit, twirl_CNOT_gates, twirl_CZ_gates, ) from mitiq.utils import _equal num_qubits = 2 qubits = cirq.LineQubit.range(num_qubits) circuit = cirq.Circuit() circuit.append(cirq.CNOT(*qubits)) circuit.append(cirq.CZ(*qubits)) def amp_damp_executor(circuit: cirq.Circuit, noise: float = 0.005) -> float: return compute_density_matrix( circuit, noise_model_function=cirq.amplitude_damp, noise_level=(noise,) )[0, 0].real def test_twirl_CNOT_implements_same_unitary(): num_circuits = 1 twirled = twirl_CNOT_gates(circuit, num_circuits=num_circuits) assert len(twirled) == num_circuits original_unitary = cirq.unitary(circuit) twirled_unitary = cirq.unitary(twirled[0]) assert np.array_equal(twirled_unitary, original_unitary) or np.array_equal( -1 * twirled_unitary, original_unitary ) def test_twirl_CZ_implements_same_unitary(): num_circuits = 1 twirled = twirl_CZ_gates(circuit, num_circuits=num_circuits) assert len(twirled) == num_circuits original_unitary = cirq.unitary(circuit) twirled_unitary = cirq.unitary(twirled[0]) assert np.array_equal(twirled_unitary, original_unitary) or np.array_equal( -1 * twirled_unitary, original_unitary ) def test_CNOT_twirl_table(): a, b = cirq.LineQubit.range(2) for P, Q, R, S in CNOT_twirling_gates: circuit = cirq.Circuit( P.on(a), Q.on(b), cirq.CNOT.on(a, b), R.on(a), S.on(b), cirq.CNOT.on(a, b), ) assert np.allclose(cirq.unitary(circuit), np.eye(4)) or np.allclose( -1 * cirq.unitary(circuit), np.eye(4) ) def test_CZ_twirl_table(): a, b = cirq.LineQubit.range(2) for P, Q, R, S in CZ_twirling_gates: circuit = cirq.Circuit( P.on(a), Q.on(b), cirq.CZ.on(a, b), R.on(a), S.on(b), cirq.CZ.on(a, b), ) assert np.allclose(cirq.unitary(circuit), np.eye(4)) or np.allclose( -1 * cirq.unitary(circuit), np.eye(4) ) def test_twirl_CNOT_qiskit(): qc = qiskit.QuantumCircuit(2, 2) qc.h(0) qc.cx(0, 1) qc.measure([0, 1], [0, 1]) num_circuits = 10 twirled = twirl_CNOT_gates(qc, num_circuits=num_circuits) assert len(twirled) == num_circuits random_index = random.randint(0, 9) assert isinstance(twirled[random_index], qiskit.QuantumCircuit) def test_twirl_CNOT_increases_layer_count(): num_qubits = 3 num_layers = 10 gateset = {cirq.X: 1, cirq.Y: 1, cirq.Z: 1, cirq.H: 1, cirq.CNOT: 2} circuit = cirq.testing.random_circuit( num_qubits, num_layers, op_density=0.8, gate_domain=gateset ) num_CNOTS = sum([op.gate == cirq.CNOT for op in circuit.all_operations()]) twirled = twirl_CNOT_gates(circuit, num_circuits=1)[0] num_gates_before = len(list(circuit.all_operations())) num_gates_after = len(list(twirled.all_operations())) if num_CNOTS: assert num_gates_after > num_gates_before else: assert num_gates_after == num_gates_before def test_pauli_twirl_circuit(): num_qubits = 3 num_layers = 20 circuit, _ = generate_mirror_circuit( nlayers=num_layers, two_qubit_gate_prob=1.0, connectivity_graph=nx.complete_graph(num_qubits), ) num_circuits = 10 twirled_output = pauli_twirl_circuit(circuit, num_circuits) assert len(twirled_output) == num_circuits @pytest.mark.parametrize( "twirl_func", [pauli_twirl_circuit, twirl_CNOT_gates, twirl_CZ_gates] ) def test_no_CNOT_CZ_circuit(twirl_func): num_qubits = 2 qubits = cirq.LineQubit.range(num_qubits) circuit = cirq.Circuit() circuit.append(cirq.X.on_each(qubits)) twirled_output = twirl_func(circuit, 5) assert len(twirled_output) == 5 for i in range(5): assert _equal(circuit, twirled_output[i]) @pytest.mark.parametrize("noise_name", ["bit-flip", "depolarize"]) def test_noisy_cirq(noise_name): p = 0.01 a, b = cirq.LineQubit.range(2) circuit = cirq.Circuit(cirq.H.on(a), cirq.CNOT.on(a, b), cirq.CZ.on(a, b)) twirled_circuit = pauli_twirl_circuit( circuit, num_circuits=1, noise_name=noise_name, p=p )[0] for i, current_moment in enumerate(twirled_circuit): for op in current_moment: if op.gate in [cirq.CNOT, cirq.CZ]: for next_op in twirled_circuit[i + 1]: assert next_op.gate == CIRQ_NOISE_OP[noise_name](p=p) @pytest.mark.parametrize("noise_name", ["bit-flip", "depolarize"]) def test_noisy_pennylane(noise_name): p = 0.01 ops = [ qml.Hadamard(0), qml.CNOT((0, 1)), qml.CZ((0, 1)), ] circuit = QuantumTape(ops) twirled_circuit = pauli_twirl_circuit( circuit, num_circuits=1, noise_name=noise_name, p=p )[0] noisy_gates = ["CNOT", "CZ"] for i, op in enumerate(twirled_circuit.operations): if op.name in noisy_gates: for j in range(1, len(op.wires) + 1): assert ( type(twirled_circuit.operations[i + j]) == PENNYLANE_NOISE_OP[noise_name] )
https://github.com/ElePT/qiskit-algorithms-test
ElePT
# This code is part of Qiskit. # # (C) Copyright IBM 2023. # # This code is licensed under the Apache License, Version 2.0. You may # obtain a copy of this license in the LICENSE.txt file in the root directory # of this source tree or at http://www.apache.org/licenses/LICENSE-2.0. # # Any modifications or derivative works of this code must retain this # copyright notice, and modified files need to carry a notice indicating # that they have been altered from the originals. """Variational Quantum Imaginary Time Evolution algorithm.""" from __future__ import annotations from collections.abc import Mapping, Sequence from typing import Type, Callable import numpy as np from scipy.integrate import OdeSolver from qiskit import QuantumCircuit from qiskit.circuit import Parameter from qiskit.primitives import BaseEstimator from .solvers.ode.forward_euler_solver import ForwardEulerSolver from .variational_principles import ImaginaryVariationalPrinciple, ImaginaryMcLachlanPrinciple from .var_qte import VarQTE from ..imaginary_time_evolver import ImaginaryTimeEvolver class VarQITE(VarQTE, ImaginaryTimeEvolver): """Variational Quantum Imaginary Time Evolution algorithm. .. code-block::python import numpy as np from qiskit_algorithms import TimeEvolutionProblem, VarQITE from qiskit_algorithms.time_evolvers.variational import ImaginaryMcLachlanPrinciple from qiskit.circuit.library import EfficientSU2 from qiskit.quantum_info import SparsePauliOp, Pauli from qiskit.primitives import Estimator observable = SparsePauliOp.from_list( [ ("II", 0.2252), ("ZZ", 0.5716), ("IZ", 0.3435), ("ZI", -0.4347), ("YY", 0.091), ("XX", 0.091), ] ) ansatz = EfficientSU2(observable.num_qubits, reps=1) init_param_values = np.ones(len(ansatz.parameters)) * np.pi/2 var_principle = ImaginaryMcLachlanPrinciple() time = 1 # without evaluating auxiliary operators evolution_problem = TimeEvolutionProblem(observable, time) var_qite = VarQITE(ansatz, init_param_values, var_principle) evolution_result = var_qite.evolve(evolution_problem) # evaluating auxiliary operators aux_ops = [Pauli("XX"), Pauli("YZ")] evolution_problem = TimeEvolutionProblem(observable, time, aux_operators=aux_ops) var_qite = VarQITE(ansatz, init_param_values, var_principle, Estimator()) evolution_result = var_qite.evolve(evolution_problem) """ def __init__( self, ansatz: QuantumCircuit, initial_parameters: Mapping[Parameter, float] | Sequence[float], variational_principle: ImaginaryVariationalPrinciple | None = None, estimator: BaseEstimator | None = None, ode_solver: Type[OdeSolver] | str = ForwardEulerSolver, lse_solver: Callable[[np.ndarray, np.ndarray], np.ndarray] | None = None, num_timesteps: int | None = None, imag_part_tol: float = 1e-7, num_instability_tol: float = 1e-7, ) -> None: r""" Args: ansatz: Ansatz to be used for variational time evolution. initial_parameters: Initial parameter values for the ansatz. variational_principle: Variational Principle to be used. Defaults to ``ImaginaryMcLachlanPrinciple``. estimator: An estimator primitive used for calculating expectation values of TimeEvolutionProblem.aux_operators. ode_solver: ODE solver callable that implements a SciPy ``OdeSolver`` interface or a string indicating a valid method offered by SciPy. lse_solver: Linear system of equations solver callable. It accepts ``A`` and ``b`` to solve ``Ax=b`` and returns ``x``. If ``None``, the default ``np.linalg.lstsq`` solver is used. num_timesteps: The number of timesteps to take. If ``None``, it is automatically selected to achieve a timestep of approximately 0.01. Only relevant in case of the ``ForwardEulerSolver``. imag_part_tol: Allowed value of an imaginary part that can be neglected if no imaginary part is expected. num_instability_tol: The amount of negative value that is allowed to be rounded up to 0 for quantities that are expected to be non-negative. """ if variational_principle is None: variational_principle = ImaginaryMcLachlanPrinciple() super().__init__( ansatz, initial_parameters, variational_principle, estimator, ode_solver, lse_solver=lse_solver, num_timesteps=num_timesteps, imag_part_tol=imag_part_tol, num_instability_tol=num_instability_tol, )
https://github.com/2lambda123/Qiskit-qiskit
2lambda123
# This code is part of Qiskit. # # (C) Copyright IBM 2017, 2020. # # This code is licensed under the Apache License, Version 2.0. You may # obtain a copy of this license in the LICENSE.txt file in the root directory # of this source tree or at http://www.apache.org/licenses/LICENSE-2.0. # # Any modifications or derivative works of this code must retain this # copyright notice, and modified files need to carry a notice indicating # that they have been altered from the originals. """Piecewise-polynomially-controlled Pauli rotations.""" from __future__ import annotations from typing import List, Optional import numpy as np from qiskit.circuit import QuantumRegister, AncillaRegister, QuantumCircuit from qiskit.circuit.exceptions import CircuitError from .functional_pauli_rotations import FunctionalPauliRotations from .polynomial_pauli_rotations import PolynomialPauliRotations from .integer_comparator import IntegerComparator class PiecewisePolynomialPauliRotations(FunctionalPauliRotations): r"""Piecewise-polynomially-controlled Pauli rotations. This class implements a piecewise polynomial (not necessarily continuous) function, :math:`f(x)`, on qubit amplitudes, which is defined through breakpoints and coefficients as follows. Suppose the breakpoints :math:`(x_0, ..., x_J)` are a subset of :math:`[0, 2^n-1]`, where :math:`n` is the number of state qubits. Further on, denote the corresponding coefficients by :math:`[a_{j,1},...,a_{j,d}]`, where :math:`d` is the highest degree among all polynomials. Then :math:`f(x)` is defined as: .. math:: f(x) = \begin{cases} 0, x < x_0 \\ \sum_{i=0}^{i=d}a_{j,i}/2 x^i, x_j \leq x < x_{j+1} \end{cases} where if given the same number of breakpoints as polynomials, we implicitly assume :math:`x_{J+1} = 2^n`. .. note:: Note the :math:`1/2` factor in the coefficients of :math:`f(x)`, this is consistent with Qiskit's Pauli rotations. Examples: >>> from qiskit import QuantumCircuit >>> from qiskit.circuit.library.arithmetic.piecewise_polynomial_pauli_rotations import\ ... PiecewisePolynomialPauliRotations >>> qubits, breakpoints, coeffs = (2, [0, 2], [[0, -1.2],[-1, 1, 3]]) >>> poly_r = PiecewisePolynomialPauliRotations(num_state_qubits=qubits, ...breakpoints=breakpoints, coeffs=coeffs) >>> >>> qc = QuantumCircuit(poly_r.num_qubits) >>> qc.h(list(range(qubits))); >>> qc.append(poly_r.to_instruction(), list(range(qc.num_qubits))); >>> qc.draw() ┌───┐┌──────────┐ q_0: ┤ H ├┤0 ├ ├───┤│ │ q_1: ┤ H ├┤1 ├ └───┘│ │ q_2: ─────┤2 ├ │ pw_poly │ q_3: ─────┤3 ├ │ │ q_4: ─────┤4 ├ │ │ q_5: ─────┤5 ├ └──────────┘ References: [1]: Haener, T., Roetteler, M., & Svore, K. M. (2018). Optimizing Quantum Circuits for Arithmetic. `arXiv:1805.12445 <http://arxiv.org/abs/1805.12445>`_ [2]: Carrera Vazquez, A., Hiptmair, R., & Woerner, S. (2022). Enhancing the Quantum Linear Systems Algorithm using Richardson Extrapolation. `ACM Transactions on Quantum Computing 3, 1, Article 2 <https://doi.org/10.1145/3490631>`_ """ def __init__( self, num_state_qubits: Optional[int] = None, breakpoints: Optional[List[int]] = None, coeffs: Optional[List[List[float]]] = None, basis: str = "Y", name: str = "pw_poly", ) -> None: """ Args: num_state_qubits: The number of qubits representing the state. breakpoints: The breakpoints to define the piecewise-linear function. Defaults to ``[0]``. coeffs: The coefficients of the polynomials for different segments of the piecewise-linear function. ``coeffs[j][i]`` is the coefficient of the i-th power of x for the j-th polynomial. Defaults to linear: ``[[1]]``. basis: The type of Pauli rotation (``'X'``, ``'Y'``, ``'Z'``). name: The name of the circuit. """ # store parameters self._breakpoints = breakpoints if breakpoints is not None else [0] self._coeffs = coeffs if coeffs is not None else [[1]] # store a list of coefficients as homogeneous polynomials adding 0's where necessary self._hom_coeffs = [] self._degree = len(max(self._coeffs, key=len)) - 1 for poly in self._coeffs: self._hom_coeffs.append(poly + [0] * (self._degree + 1 - len(poly))) super().__init__(num_state_qubits=num_state_qubits, basis=basis, name=name) @property def breakpoints(self) -> List[int]: """The breakpoints of the piecewise polynomial function. The function is polynomial in the intervals ``[point_i, point_{i+1}]`` where the last point implicitly is ``2**(num_state_qubits + 1)``. Returns: The list of breakpoints. """ if ( self.num_state_qubits is not None and len(self._breakpoints) == len(self.coeffs) and self._breakpoints[-1] < 2**self.num_state_qubits ): return self._breakpoints + [2**self.num_state_qubits] return self._breakpoints @breakpoints.setter def breakpoints(self, breakpoints: List[int]) -> None: """Set the breakpoints. Args: breakpoints: The new breakpoints. """ self._invalidate() self._breakpoints = breakpoints if self.num_state_qubits and breakpoints: self._reset_registers(self.num_state_qubits) @property def coeffs(self) -> List[List[float]]: """The coefficients of the polynomials. Returns: The polynomial coefficients per interval as nested lists. """ return self._coeffs @coeffs.setter def coeffs(self, coeffs: List[List[float]]) -> None: """Set the polynomials. Args: coeffs: The new polynomials. """ self._invalidate() self._coeffs = coeffs # update the homogeneous polynomials and degree self._hom_coeffs = [] self._degree = len(max(self._coeffs, key=len)) - 1 for poly in self._coeffs: self._hom_coeffs.append(poly + [0] * (self._degree + 1 - len(poly))) if self.num_state_qubits and coeffs: self._reset_registers(self.num_state_qubits) @property def mapped_coeffs(self) -> List[List[float]]: """The coefficients mapped to the internal representation, since we only compare x>=breakpoint. Returns: The mapped coefficients. """ mapped_coeffs = [] # First polynomial mapped_coeffs.append(self._hom_coeffs[0]) for i in range(1, len(self._hom_coeffs)): mapped_coeffs.append([]) for j in range(0, self._degree + 1): mapped_coeffs[i].append(self._hom_coeffs[i][j] - self._hom_coeffs[i - 1][j]) return mapped_coeffs @property def contains_zero_breakpoint(self) -> bool | np.bool_: """Whether 0 is the first breakpoint. Returns: True, if 0 is the first breakpoint, otherwise False. """ return np.isclose(0, self.breakpoints[0]) def evaluate(self, x: float) -> float: """Classically evaluate the piecewise polynomial rotation. Args: x: Value to be evaluated at. Returns: Value of piecewise polynomial function at x. """ y = 0 for i in range(0, len(self.breakpoints)): y = y + (x >= self.breakpoints[i]) * (np.poly1d(self.mapped_coeffs[i][::-1])(x)) return y def _check_configuration(self, raise_on_failure: bool = True) -> bool: """Check if the current configuration is valid.""" valid = True if self.num_state_qubits is None: valid = False if raise_on_failure: raise AttributeError("The number of qubits has not been set.") if self.num_qubits < self.num_state_qubits + 1: valid = False if raise_on_failure: raise CircuitError( "Not enough qubits in the circuit, need at least " "{}.".format(self.num_state_qubits + 1) ) if len(self.breakpoints) != len(self.coeffs) + 1: valid = False if raise_on_failure: raise ValueError("Mismatching number of breakpoints and polynomials.") return valid def _reset_registers(self, num_state_qubits: Optional[int]) -> None: """Reset the registers.""" self.qregs = [] if num_state_qubits: qr_state = QuantumRegister(num_state_qubits) qr_target = QuantumRegister(1) self.qregs = [qr_state, qr_target] # Calculate number of ancilla qubits required num_ancillas = num_state_qubits + 1 if self.contains_zero_breakpoint: num_ancillas -= 1 if num_ancillas > 0: qr_ancilla = AncillaRegister(num_ancillas) self.add_register(qr_ancilla) def _build(self): """If not already built, build the circuit.""" if self._is_built: return super()._build() circuit = QuantumCircuit(*self.qregs, name=self.name) qr_state = circuit.qubits[: self.num_state_qubits] qr_target = [circuit.qubits[self.num_state_qubits]] # Ancilla for the comparator circuit qr_ancilla = circuit.qubits[self.num_state_qubits + 1 :] # apply comparators and controlled linear rotations for i, point in enumerate(self.breakpoints[:-1]): if i == 0 and self.contains_zero_breakpoint: # apply rotation poly_r = PolynomialPauliRotations( num_state_qubits=self.num_state_qubits, coeffs=self.mapped_coeffs[i], basis=self.basis, ) circuit.append(poly_r.to_gate(), qr_state[:] + qr_target) else: # apply Comparator comp = IntegerComparator(num_state_qubits=self.num_state_qubits, value=point) qr_state_full = qr_state[:] + [qr_ancilla[0]] # add compare qubit qr_remaining_ancilla = qr_ancilla[1:] # take remaining ancillas circuit.append( comp.to_gate(), qr_state_full[:] + qr_remaining_ancilla[: comp.num_ancillas] ) # apply controlled rotation poly_r = PolynomialPauliRotations( num_state_qubits=self.num_state_qubits, coeffs=self.mapped_coeffs[i], basis=self.basis, ) circuit.append( poly_r.to_gate().control(), [qr_ancilla[0]] + qr_state[:] + qr_target ) # uncompute comparator circuit.append( comp.to_gate().inverse(), qr_state_full[:] + qr_remaining_ancilla[: comp.num_ancillas], ) self.append(circuit.to_gate(), self.qubits)
https://github.com/qiskit-community/qiskit-translations-staging
qiskit-community
from qiskit import QuantumCircuit, transpile, schedule from qiskit.visualization.timeline import draw, IQXDebugging from qiskit.providers.fake_provider import FakeBoeblingen qc = QuantumCircuit(2) qc.h(0) qc.cx(0,1) qc = transpile(qc, FakeBoeblingen(), scheduling_method='alap', layout_method='trivial') draw(qc, style=IQXDebugging())
https://github.com/swe-train/qiskit__qiskit
swe-train
# -*- coding: utf-8 -*- # This code is part of Qiskit. # # (C) Copyright IBM 2017. # # This code is licensed under the Apache License, Version 2.0. You may # obtain a copy of this license in the LICENSE.txt file in the root directory # of this source tree or at http://www.apache.org/licenses/LICENSE-2.0. # # Any modifications or derivative works of this code must retain this # copyright notice, and modified files need to carry a notice indicating # that they have been altered from the originals. # pylint: disable=wrong-import-order """Main Qiskit public functionality.""" import pkgutil # First, check for required Python and API version from . import util # qiskit errors operator from .exceptions import QiskitError # The main qiskit operators from qiskit.circuit import ClassicalRegister from qiskit.circuit import QuantumRegister from qiskit.circuit import QuantumCircuit # pylint: disable=redefined-builtin from qiskit.tools.compiler import compile # TODO remove after 0.8 from qiskit.execute import execute # The qiskit.extensions.x imports needs to be placed here due to the # mechanism for adding gates dynamically. import qiskit.extensions import qiskit.circuit.measure import qiskit.circuit.reset # Allow extending this namespace. Please note that currently this line needs # to be placed *before* the wrapper imports or any non-import code AND *before* # importing the package you want to allow extensions for (in this case `backends`). __path__ = pkgutil.extend_path(__path__, __name__) # Please note these are global instances, not modules. from qiskit.providers.basicaer import BasicAer # Try to import the Aer provider if installed. try: from qiskit.providers.aer import Aer except ImportError: pass # Try to import the IBMQ provider if installed. try: from qiskit.providers.ibmq import IBMQ except ImportError: pass from .version import __version__ from .version import __qiskit_version__
https://github.com/PabloMartinezAngerosa/QAOA-uniform-convergence
PabloMartinezAngerosa
from tsp_qaoa import test_solution from qiskit.visualization import plot_histogram import networkx as nx import numpy as np import json import csv # Array of JSON Objects header = ['instance','p','distance', 'mean'] length_p = 3 length_instances = 2 with open('qaoa_multiple_p_distance.csv', 'w', encoding='UTF8') as f: writer = csv.writer(f) # write the header writer.writerow(header) instance_index = 0 for instance in range(length_instances): instance_index += 1 first_p = False UNIFORM_CONVERGENCE_P = [] UNIFORM_CONVERGENCE_SAMPLE = [] for p in range(length_p): p = p+1 if first_p == False: print("Vuelve a llamar a test_solution") job_2, G, UNIFORM_CONVERGENCE_SAMPLE = test_solution(p=p) first_p = True else: job_2, G, UNIFORM_CONVERGENCE_SAMPLE = test_solution(grafo=G, p=p) # Sort the JSON data based on the value of the brand key UNIFORM_CONVERGENCE_SAMPLE.sort(key=lambda x: x["mean"]) convergence_min = UNIFORM_CONVERGENCE_SAMPLE[0] UNIFORM_CONVERGENCE_P.append({ "mean":convergence_min["mean"], "probabilities": convergence_min["probabilities"] }) cauchy_function_nk = UNIFORM_CONVERGENCE_P[len(UNIFORM_CONVERGENCE_P) - 1] p_index = 0 for p_state in UNIFORM_CONVERGENCE_P: p_index += 1 print(p_index) mean = p_state["mean"] print(p_state) print(mean) distance_p_cauchy_function_nk = np.max(np.abs(cauchy_function_nk["probabilities"] - p_state["probabilities"])) writer.writerow([instance_index, p_index, distance_p_cauchy_function_nk, mean])
https://github.com/Seanaventure/HighErrorRateRouting
Seanaventure
import matplotlib.pyplot as plt import networkx as nx import qiskit import HERR from qiskit.transpiler import CouplingMap from qiskit.transpiler.passes.routing import * from qiskit import QuantumCircuit, execute, Aer, IBMQ from qiskit.dagcircuit import DAGCircuit from qiskit.converters import circuit_to_dag from qiskit.converters import dag_to_circuit from math import pi from qiskit.compiler import transpile, assemble from qiskit.providers.aer.noise import NoiseModel import qiskit.providers.aer.noise as noise from qiskit.tools.visualization import dag_drawer import random from qiskit.circuit.instruction import Instruction import time def countTwoQubitGates(transpiledCircuit): num = 0 for gate in transpiledCircuit.data: # print(type(gate[0])) if issubclass(type(gate[0]), Instruction): if gate[0].name == "cx": num += 1 return num s = '1101' n = len(s) circuit = QuantumCircuit(8, n) # Step 0 circuit.x(n) # the n+1 qubits are indexed 0...n, so the last qubit is index n circuit.barrier() # just a visual aid for now # Step 1 # range(n+1) returns [0,1,2,...,n] in Python. This covers all the qubits circuit.h(range(n+1)) circuit.barrier() # just a visual aid for now # Step 2 for ii, yesno in enumerate(reversed(s)): if yesno == '1': circuit.cx(ii, n) circuit.barrier() # just a visual aid for now # Step 3 # range(n+1) returns [0,1,2,...,n] in Python. This covers all the qubits circuit.h(range(n+1)) circuit.barrier() # just a visual aid for now # measure the qubits indexed from 0 to n-1 and store them into the classical bits indexed 0 to n- circuit.measure(range(n), range(n)) provider = IBMQ.load_account() backend = provider.get_backend('ibmq_lima') basis_gates = backend.configuration().basis_gates squareCouplingList = list() for i in range(4): for j in range(4): if i is not j: if abs(i-j) == 1: squareCouplingList.append([i, j]) squareCouplingList.append(([0, 3])) squareCouplingList.append(([3, 0])) squareCouplingMap = CouplingMap(squareCouplingList) gridCouplingList = list() for i in range(4): for j in range(4): if i is not j: if abs(i-j) == 1: gridCouplingList.append([i, j]) for i in range(4,8): for j in range(4,8): if i is not j: if abs(i-j) == 1: gridCouplingList.append([i, j]) gridCouplingList.append(([0, 4])) gridCouplingList.append(([4, 0])) gridCouplingList.append(([1, 5])) gridCouplingList.append(([5, 1])) gridCouplingList.append(([2, 6])) gridCouplingList.append(([6, 2])) gridCouplingList.append(([3, 7])) gridCouplingList.append(([7, 3])) gridCouplingMap = CouplingMap(gridCouplingList) jakatraCouplingList = [[0, 1], [1, 0], [1, 2], [2, 1], [1, 3], [3, 1], [3,5], [5,3], [4,5], [5,4], [6,5], [5,6]] jakatraCouplingMap = CouplingMap(jakatraCouplingList) circDag = circuit_to_dag(circuit) targetCouplingMap = squareCouplingMap bSwap = BasicSwap(targetCouplingMap) baseTime = time.perf_counter() bSwap.run(circDag) bSwapTime = time.perf_counter() - baseTime sabreSwap = SabreSwap(targetCouplingMap) baseTime = time.perf_counter() sabreSwap.run(circDag) sabreSwapTime = time.perf_counter() - baseTime stochasticSwap = StochasticSwap(targetCouplingMap) baseTime = time.perf_counter() stochasticSwap.run(circDag) stochasticSwapTime = time.perf_counter() - baseTime lookAheadSwap = LookaheadSwap(targetCouplingMap) baseTime = time.perf_counter() lookAheadSwap.run(circDag) lookAheadSwapTime = time.perf_counter() - baseTime for i in range(200): # Create a noise model for the simulations noise_model = noise.NoiseModel() errorRates = list() qiskitErrors = list() for i in range(len(squareCouplingList)//2): errorRates.append(random.randrange(1, 10, 1)/100.0) qiskitErrors.append(noise.depolarizing_error(errorRates[i], 2)) edges = targetCouplingMap.get_edges() uniqueEdges = set() for edge in edges: uniqueEdges.add(tuple(sorted(edge))) noiseGraph = nx.Graph() noiseGraph.add_nodes_from([0, 7]) errorIdex = 0 for edge in uniqueEdges: noise_model.add_quantum_error(qiskitErrors[errorIdex], ['cx'], edge) noiseGraph.add_edge(edge[0], edge[1], weight=1-errorRates[errorIdex]) errorIdex += 1 herr = HERR.HERR(targetCouplingMap, noiseGraph) basSwap = BasicSwap(targetCouplingMap) #print(gridCouplingMap) # Run HERR baseTime = time.perf_counter() HERRRes = herr.run(circDag) HERRSwapTime = time.perf_counter() - baseTime updatedCirc = dag_to_circuit(HERRRes) print(str(HERRSwapTime) + " " + str(bSwapTime) + " " + str(sabreSwapTime) + " " + str(stochasticSwapTime) + " " + str(lookAheadSwapTime))
https://github.com/qiskit-community/qiskit-translations-staging
qiskit-community
from qiskit import QuantumCircuit from qiskit.quantum_info import Statevector from qiskit.visualization import plot_bloch_multivector qc = QuantumCircuit(2) qc.h(0) qc.x(1) # You can reverse the order of the qubits. from qiskit.quantum_info import DensityMatrix qc = QuantumCircuit(2) qc.h([0, 1]) qc.t(1) qc.s(0) qc.cx(0,1) matrix = DensityMatrix(qc) plot_bloch_multivector(matrix, title='My Bloch Spheres', reverse_bits=True)
https://github.com/qiskit-community/qiskit-translations-staging
qiskit-community
from qiskit import QuantumCircuit from qiskit.quantum_info import Statevector from qiskit.visualization import plot_state_city qc = QuantumCircuit(2) qc.h(0) qc.cx(0,1) # plot using a Statevector state = Statevector(qc) plot_state_city(state)
https://github.com/qiskit-community/qiskit-translations-staging
qiskit-community
from qiskit.circuit.random import random_circuit circuit = random_circuit(2, 2, seed=0).decompose(reps=1) display(circuit.draw("mpl")) from qiskit.quantum_info import SparsePauliOp observable = SparsePauliOp("XZ") print(f">>> Observable: {observable.paulis}") from qiskit.primitives import Estimator estimator = Estimator() job = estimator.run(circuit, observable) print(f">>> Job ID: {job.job_id()}") print(f">>> Job Status: {job.status()}") result = job.result() print(f">>> {result}") print(f" > Expectation value: {result.values[0]}") circuit = random_circuit(2, 2, seed=1).decompose(reps=1) observable = SparsePauliOp("IY") job = estimator.run(circuit, observable) result = job.result() display(circuit.draw("mpl")) print(f">>> Observable: {observable.paulis}") print(f">>> Expectation value: {result.values[0]}") circuits = ( random_circuit(2, 2, seed=0).decompose(reps=1), random_circuit(2, 2, seed=1).decompose(reps=1), ) observables = ( SparsePauliOp("XZ"), SparsePauliOp("IY"), ) job = estimator.run(circuits, observables) result = job.result() [display(cir.draw("mpl")) for cir in circuits] print(f">>> Observables: {[obs.paulis for obs in observables]}") print(f">>> Expectation values: {result.values.tolist()}") from qiskit.circuit.library import RealAmplitudes circuit = RealAmplitudes(num_qubits=2, reps=2).decompose(reps=1) observable = SparsePauliOp("ZI") parameter_values = [0, 1, 2, 3, 4, 5] job = estimator.run(circuit, observable, parameter_values) result = job.result() display(circuit.draw("mpl")) print(f">>> Observable: {observable.paulis}") print(f">>> Parameter values: {parameter_values}") print(f">>> Expectation value: {result.values[0]}") from qiskit_ibm_runtime import QiskitRuntimeService service = QiskitRuntimeService(channel="ibm_quantum") backend = service.backend("ibmq_qasm_simulator") from qiskit.circuit.random import random_circuit from qiskit.quantum_info import SparsePauliOp circuit = random_circuit(2, 2, seed=0).decompose(reps=1) display(circuit.draw("mpl")) observable = SparsePauliOp("XZ") print(f">>> Observable: {observable.paulis}") from qiskit_ibm_runtime import Estimator estimator = Estimator(session=backend) job = estimator.run(circuit, observable) print(f">>> Job ID: {job.job_id()}") print(f">>> Job Status: {job.status()}") result = job.result() print(f">>> {result}") print(f" > Expectation value: {result.values[0]}") print(f" > Metadata: {result.metadata[0]}") from qiskit_ibm_runtime import Options options = Options(optimization_level=3, environment={"log_level": "INFO"}) from qiskit_ibm_runtime import Options options = Options() options.resilience_level = 1 options.execution.shots = 2048 estimator = Estimator(session=backend, options=options) result = estimator.run(circuit, observable).result() print(f">>> Metadata: {result.metadata[0]}") estimator = Estimator(session=backend, options=options) result = estimator.run(circuit, observable, shots=1024).result() print(f">>> Metadata: {result.metadata[0]}") from qiskit_ibm_runtime import Options # optimization_level=3 adds dynamical decoupling # resilience_level=1 adds readout error mitigation options = Options(optimization_level=3, resilience_level=1) estimator = Estimator(session=backend, options=options) result = estimator.run(circuit, observable).result() print(f">>> Expectation value: {result.values[0]}") print(f">>> Metadata: {result.metadata[0]}") from qiskit_ibm_runtime import Session, Estimator with Session(backend=backend, max_time="1h"): estimator = Estimator() result = estimator.run(circuit, observable).result() print(f">>> Expectation value from the first run: {result.values[0]}") result = estimator.run(circuit, observable).result() print(f">>> Expectation value from the second run: {result.values[0]}") from qiskit.circuit.random import random_circuit sampler_circuit = random_circuit(2, 2, seed=0).decompose(reps=1) sampler_circuit.measure_all() display(circuit.draw("mpl")) from qiskit_ibm_runtime import Session, Sampler, Estimator with Session(backend=backend): sampler = Sampler() estimator = Estimator() result = sampler.run(sampler_circuit).result() print(f">>> Quasi Distribution from the sampler job: {result.quasi_dists[0]}") result = estimator.run(circuit, observable).result() print(f">>> Expectation value from the estimator job: {result.values[0]}") from qiskit_ibm_runtime import Session, Sampler, Estimator with Session(backend=backend): sampler = Sampler() estimator = Estimator() sampler_job = sampler.run(sampler_circuit) estimator_job = estimator.run(circuit, observable) print(f">>> Quasi Distribution from the sampler job: {sampler_job.result().quasi_dists[0]}") print(f">>> Expectation value from the estimator job: {estimator_job.result().values[0]}") from qiskit_ibm_runtime import QiskitRuntimeService, Session, Sampler, Estimator, Options # 1. Initialize account service = QiskitRuntimeService(channel="ibm_quantum") # 2. Specify options, such as enabling error mitigation options = Options(resilience_level=1) # 3. Select a backend. backend = service.backend("ibmq_qasm_simulator") # 4. Create a session with Session(backend=backend): # 5. Create primitive instances sampler = Sampler(options=options) estimator = Estimator(options=options) # 6. Submit jobs sampler_job = sampler.run(sampler_circuit) estimator_job = estimator.run(circuit, observable) # 7. Get results print(f">>> Quasi Distribution from the sampler job: {sampler_job.result().quasi_dists[0]}") print(f">>> Expectation value from the estimator job: {estimator_job.result().values[0]}") import qiskit_ibm_runtime qiskit_ibm_runtime.version.get_version_info() from qiskit.tools.jupyter import * %qiskit_version_table %qiskit_copyright
https://github.com/jonasmaziero/computacao_quantica_qiskit
jonasmaziero
import numpy as np import math def Sx(j,k,d): # d = qudit dimension # j,k = identification of the Gell-Mann matrix # th = rotation angle j = j-1; k = k-1 sx = np.zeros((d,d), dtype=complex) sx[j,k] = 1 sx[k,j] = sx[j,k] return sx def Sy(j,k,d): # d = qudit dimension # j,k = identification of the Gell-Mann matrix # th = rotation angle j = j-1; k = k-1 sy = np.zeros((d,d), dtype=complex) sy[j,k] = -1j sy[k,j] = -sy[j,k] return sy def Sz(j,d): # d = qudit dimension # j = identification of the Gell-Mann matrix # th = rotation angle sz = np.zeros((d,d), dtype=complex) for k in range(0,j+1): sz[k,k] = math.sqrt(2/(j*(j+1))) if k == j: # corrige para iniciar k em 0 sz[k,k] = sz[k,k]*(-j) return sz d = 2; j = 1; k = 2; Sx(j,k,d), Sy(j,k,d), Sz(j,d) d = 3; Sx(1,2,d), Sx(1,3,d), Sx(2,3,d) d = 3; Sy(1,2,d), Sy(1,3,d), Sy(2,3,d) d = 3; Sz(1,d), Sz(2,d) 1/math.sqrt(3), -2/math.sqrt(3) def Rx(j,k,d,th): # d = qudit dimension # j,k = identification of the Gell-Mann matrix # th = rotation angle j = j-1; k = k-1 rx = np.eye(d, dtype=complex) rx[j,j] = math.cos(th/2) rx[k,k] = rx[j,j] rx[j,k] = -1j*math.sin(th/2) rx[k,j] = rx[j,k] return rx def Ry(j,k,d,th): # d = qudit dimension # j,k = identification of the Gell-Mann matrix # th = rotation angle j = j-1; k = k-1 ry = np.eye(d, dtype=complex) ry[j,j] = math.cos(th/2) ry[k,k] = ry[j,j] ry[j,k] = -math.sin(th/2) ry[k,j] = -ry[j,k] return ry def Rz(j,d,th): # d = qudit dimension # j = identification of the Gell-Mann matrix # th = rotation angle rz = np.eye(d, dtype=complex) for k in range(0,j+1): angle = (th/2)*math.sqrt(2/(j*(j+1))) if k == j: # corrige para iniciar k em 0 angle = angle*(-j) rz[k,k] = math.cos(angle) - 1j*math.sin(angle) return rz d = 2; j = 1; k = 2; th = 0; Rx(j,k,d,th), Ry(j,k,d,th), Rz(j,d,th) d = 3; j = 1; k = 2; th = 0; Rx(j,k,d,th), Ry(j,k,d,th), Rz(j,d,th)
https://github.com/shesha-raghunathan/DATE2019-qiskit-tutorial
shesha-raghunathan
#Import packages import numpy as np import matplotlib.pyplot as plt %matplotlib inline import time # import from qiskit from qiskit import QuantumCircuit, QuantumRegister, ClassicalRegister, execute, compile from qiskit.converters import qobj_to_circuits from qiskit import Aer, IBMQ from qiskit.providers.aer import noise # import tomography library import qiskit.tools.qcvv.tomography as tomo # useful additional packages from qiskit.tools.visualization import plot_state, plot_histogram from qiskit.tools.qi.qi import state_fidelity, outer from qiskit.tools.qi.qi import outer from qiskit.quantum_info import state_fidelity from qiskit.tools.monitor import job_monitor, backend_overview from qiskit.providers.ibmq import least_busy Aer.backends() # No need for credentials for running the next cells # Determine the job n = int(input("type number of qubits + enter: ")) # create a n-qubit quantum register qr = QuantumRegister(n) cr = ClassicalRegister(n) my_state = QuantumCircuit(qr, cr, name='my_state') # desired vector for a n-qubit W state desired_vector = [] qr_vector = [] n_vector = 2**n for i in range(n_vector): desired_vector.append(0) for j in range(n) : desired_vector[2**j] = 1/np.sqrt(n) # choice of the circuit building method (arbitrary or specific) print("Do you want to use the specific method?") W_state_circuit = input(" Answer by (y/n) + enter\n").upper() if (W_state_circuit == "N") : method = "arbitrary" # Initialize a n-qubit W quantum state using the arbitrary method for j in range(n) : qr_vector.append(qr[j]) my_state.initialize(desired_vector, qr_vector) else: # Quantum circuit to make a n-qubit W state using the specific method method = "specific" my_state.x(qr[n-1]) #start is |10...0> for i in range(1,n) : theta = np.arccos(np.sqrt(1/(n-i+1))) my_state.ry(-theta,qr[n-i-1]) my_state.cz(qr[n-i],qr[n-i-1]) my_state.ry(theta,qr[n-i-1]) for i in range(1,n) : my_state.cx(qr[n-i-1],qr[n-i]) # Measurement circuit measuring = QuantumCircuit(qr, cr, name='measuring') for i in range(n) : measuring.measure(qr[i] , cr[i]) test = my_state+measuring # Test circuit "my_state" : Noise free model on simulator backend_sim = Aer.get_backend('qasm_simulator') shots = 1024 job_noisefree = execute(test, backend_sim, shots=shots, max_credits=5) job_monitor(job_noisefree) noisefree_count = job_noisefree.result().get_counts(test) time_exp = time.strftime('%d/%m/%Y %H:%M:%S') print("Date (DMY):", time_exp) print(noisefree_count) plot_histogram(noisefree_count, color=['purple'], title=str(n) + '- qubit W state, noise free simulation, ' + method + " method") # QASM from test QASM_source = test.qasm() print(QASM_source) # Draw the circuit test.draw(output='mpl') # Execute state tomography using noise free quantum device simulation # obtain the final state vector backend_stvct = Aer.get_backend('statevector_simulator') job = execute(my_state, backend_stvct) my_state_psi = job.result().get_statevector(my_state) # construct state tomography set for measurement of qubits [0, ..., n-1] in the Pauli basis qubit_set = [] for i in range(0,n) : qubit_set.append(i) my_state_tomo_set = tomo.state_tomography_set(qubit_set) # default value for meas_basis ='Pauli'. # add the state tomography measurement circuits to the Quantum Program my_state_tomo_circuits = tomo.create_tomography_circuits(my_state, qr, cr, my_state_tomo_set) backend_tomo = Aer.get_backend('qasm_simulator') # for simulation # take 1024 shots for each measurement basis # note: reduce this number for larger number of qubits shots = 1024 mode = "noise free simulation" my_state_job = execute(my_state_tomo_circuits, backend_tomo, shots=shots) job_monitor(my_state_job) my_state_tomo_result = my_state_job.result() # extract tomography data from results my_state_tomo_data = tomo.tomography_data(my_state_tomo_result, my_state.name, my_state_tomo_set) # Quantum fidelity # reconstruct experimentally measured density matrix rho_fit = tomo.fit_tomography_data(my_state_tomo_data) # calculate fidelity of fitted state: time_exp = time.strftime('%d/%m/%Y %H:%M:%S') print("Date (DMY):", time_exp) print('Tomography',str(n)+'-qubit W state on', backend_tomo, ", shots:", shots, ", method:", method, ", mode:", mode) F_fit = state_fidelity(rho_fit, my_state_psi) print('Fidelity with theoretical ideal state') print('F =', F_fit) IBMQ.load_accounts() backend_overview() # you may skip running this cell if you want backend_real = least_busy(IBMQ.backends(operational=True, simulator=False)) print(backend_real) # Prepare device noise simulation (DNS) device = backend_real print("device: ", device) properties = device.properties() coupling_map = device.configuration().coupling_map prepared = False if device.name() == 'ibmq_16_melbourne' : gate_times = [ ('u1', None, 0), ('u2', None, 100), ('u3', None, 200), ('cx', [1, 0], 678), ('cx', [1, 2], 547), ('cx', [2, 3], 721), ('cx', [4, 3], 733), ('cx', [4, 10], 721), ('cx', [5, 4], 800), ('cx', [5, 6], 800), ('cx', [5, 9], 895), ('cx', [6, 8], 895), ('cx', [7, 8], 640), ('cx', [9, 8], 895), ('cx', [9, 10], 800), ('cx', [11, 10], 721), ('cx', [11, 3], 634), ('cx', [12, 2], 773), ('cx', [13, 1], 2286), ('cx', [13, 12], 1504), ('cx', [], 800) ] prepared = True elif device.name() == 'ibmqx4' : gate_times = [ ('u1', None, 0), ('u2', None, 60), ('u3', None, 120), ('cx', [1, 0], 340), ('cx', [2, 0], 424), ('cx', [2, 1], 520), ('cx', [3, 2], 620), ('cx', [3, 4], 420), ('cx', [4, 2], 920) ] prepared = True else : print("No gate times yet defined in this notebook for: ", device) if prepared : # Construct the noise model from backend properties and custom gate times noise_model = noise.device.basic_device_noise_model(properties, gate_times=gate_times) # Get the basis gates for the noise model basis_gates = noise_model.basis_gates print("noise model prepared for", device) # Execute test using device noise simulation (DNS) backend_noise = Aer.get_backend('qasm_simulator') # for simulation (DNS) shots = 1024 mode = "DNS" job_noise = execute(test, backend_noise, noise_model=noise_model, coupling_map=coupling_map, basis_gates=basis_gates) job_monitor(job_noise) print(job_noise.status) time_exp = time.strftime('%d/%m/%Y %H:%M:%S') print("Date (DMY):", time_exp) noisy_count = job_noise.result().get_counts(test) print(noisy_count) plot_histogram(noisy_count, color=['cyan'], title= str(n) + '- qubit W state, ' + mode + ': {}, '.format(device.name()) + method + " method") # Execute state tomography using device noise simulation (DNS) # obtain the final state vector backend_stvct = Aer.get_backend('statevector_simulator') job = execute(my_state, backend_stvct) my_state_psi = job.result().get_statevector(my_state) # construct state tomography set for measurement of qubits [0, ..., n-1] in the Pauli basis qubit_set = [] for i in range(0,n) : qubit_set.append(i) my_state_tomo_set = tomo.state_tomography_set(qubit_set) # default value for meas_basis ='Pauli'. # add the state tomography measurement circuits to the Quantum Program my_state_tomo_circuits = tomo.create_tomography_circuits(my_state, qr, cr, my_state_tomo_set) backend_tomo = Aer.get_backend('qasm_simulator') # for simulation # take 1024 shots for each measurement basis # note: reduce this number for larger number of qubits shots = 1024 mode = "DNS" my_state_job = execute(my_state_tomo_circuits, backend_tomo, noise_model=noise_model, coupling_map=coupling_map, basis_gates=basis_gates) job_monitor(my_state_job) my_state_tomo_result = my_state_job.result() # extract tomography data from results my_state_tomo_data = tomo.tomography_data(my_state_tomo_result, my_state.name, my_state_tomo_set) # Quantum fidelity # reconstruct experimentally measured density matrix rho_fit = tomo.fit_tomography_data(my_state_tomo_data) # calculate fidelity of fitted state: time_exp = time.strftime('%d/%m/%Y %H:%M:%S') print("Date (DMY):", time_exp) print('Tomography',str(n)+'-qubit W state on', backend_tomo, ", shots:", shots, ", method:", method, ", mode:", mode, "of", device) F_fit = state_fidelity(rho_fit, my_state_psi) print('Fidelity with theoretical ideal state') print('F =', F_fit) plt.xlabel('Number of Entangled Qubits') plt.ylabel('Quantum Fidelity') plt.axis([1.4, 6, 0, 1]) plt.grid() plt.plot([2,3,4,5], [0.788,0.734,0.628,0.542], 'mo-', label="Specific Algorithm - DNS") plt.plot([2,3,4,5], [0.773,0.682,0.386,0.148], 'cs-', label="Arbitrary Initialization - DNS") plt.legend() plt.show() # Execute test using superconducting quantum computing device (SQC) #Choose the backend #backend_noise = Aer.get_backend('qasm_simulator') # for optional test before final experiment backend_noise = device # for least busy SQC device # Execute on SQC and get counts shots = 1024 if backend_noise.name() == "qasm_simulator" : # optional test before final experiment mode = "DNS" job_noise = execute(test, backend_noise, noise_model=noise_model, coupling_map=coupling_map, basis_gates=basis_gates) else: # final experiment on real device mode = "SQC" job_noise = execute(test, backend_noise) job_monitor(job_noise) print(job_noise.status) time_exp = time.strftime('%d/%m/%Y %H:%M:%S') noisy_count = job_noise.result().get_counts(test) print(noisy_count) plot_histogram(noisy_count, color=['orange'], title= str(n) + '- qubit W state, ' + mode + ': {}, '.format(device.name()) + method + " method") # Execute state tomography on superconducting quantum computing device (SQC) # obtain the final state vector backend_stvct = Aer.get_backend('statevector_simulator') job = execute(my_state, backend_stvct) my_state_psi = job.result().get_statevector(my_state) # construct state tomography set for measurement of qubits [0, ..., n-1] in the Pauli basis qubit_set = [] for i in range(0,n) : qubit_set.append(i) my_state_tomo_set = tomo.state_tomography_set(qubit_set) # default value for meas_basis ='Pauli'. # add the state tomography measurement circuits to the Quantum Program my_state_tomo_circuits = tomo.create_tomography_circuits(my_state, qr, cr, my_state_tomo_set) #Choose the backend #backend_tomo = Aer.get_backend('qasm_simulator') # optional test before final experiment backend_tomo = device # for least busy SQC device # take 1024 shots for each measurement basis # note: reduce this number for larger number of qubits shots = 1024 # loop: 27 circuits maximum per job to avoid exceeding the allowed limit for the real device. n_circ = 3**n i_max = min(27,n_circ) my_jobs = [] index_job = -1 for i in range(0,n_circ,i_max) : circs =[] for j in range(i, i+i_max): circs.append(my_state_tomo_circuits[j]) if backend_tomo.name() == "qasm_simulator" : # optional test before final experiment mode = "DNS" my_state_job = execute(circs, backend_tomo, noise_model=noise_model, coupling_map=coupling_map, basis_gates=basis_gates) else: # final experiment on real device mode = "SQC" my_state_job = execute(circs, backend_tomo, shots=shots) my_jobs.append(my_state_job) index_job = index_job + 1 job_monitor(my_jobs[index_job], monitor_async = True) my_state_new_result = my_state_job.result() if i == 0: my_state_tomo_result = my_state_new_result else: my_state_tomo_result = my_state_tomo_result + my_state_new_result # extract tomography data from results my_state_tomo_data = tomo.tomography_data(my_state_tomo_result, my_state.name, my_state_tomo_set) # Quantum fidelity # reconstruct experimentally measured density matrix rho_fit = tomo.fit_tomography_data(my_state_tomo_data) # calculate fidelity of fitted state: time_exp = time.strftime('%d/%m/%Y %H:%M:%S') print("Date (DMY):", time_exp) print('Tomography',str(n)+'-qubit W state on', backend_tomo, ", shots:", shots, ", method:", method, ", mode:", mode, device) F_fit = state_fidelity(rho_fit, my_state_psi) print('Fidelity with theoretical ideal state') print('F =', F_fit) plt.xlabel('Number of Entangled Qubits') plt.ylabel('Quantum Fidelity') plt.axis([1.4, 6, 0, 1]) plt.grid() plt.plot([2,3,4,5], [0.812,0.735,0.592,0.457], 'ro-', label="Specific Algorithm") plt.plot([2,3,4,5], [0.838,0.539,0.144,0.060], 'bs-', label="Arbitrary Initialization") plt.legend() plt.show() # DSN vs SQC, count histograms # Shots = 1024 count_noisefree = {'010': 344, '001': 335, '100': 345} count_DNS = {'110': 42, '010': 258, '111': 9, '011': 38, '000': 76, '001': 281, '100': 286, '101': 34} count_real = {'001': 274, '000': 129, '010': 224, '011': 20, '100': 282, '111': 14, '101': 46, '110': 35} plot_histogram([count_noisefree, count_DNS, count_real], title= 'Determistic W state generation, specific algorithm, device: ibmqx4', color=['purple','cyan', 'orange'], bar_labels=False, legend = ['Noise free simulation', 'Device noise simulation','Real quantum device']) plt.xlabel('Number of Entangled Qubits') plt.ylabel('Quantum Fidelity') plt.axis([1.4, 6, 0, 1]) plt.grid() plt.plot([2,3,4,5], [0.812,0.735,0.592,0.457], 'ro-', label="Specific Algorithm - SQC") plt.plot([2,3,4,5], [0.838,0.539,0.144,0.060], 'bs-', label="Arbitrary Initialization - SQC") plt.plot([2,3,4,5], [0.788,0.734,0.628,0.542], 'mo-', label="Specific Algorithm - DNS") plt.plot([2,3,4,5], [0.773,0.682,0.386,0.148], 'cs-', label="Arbitrary Initialization - DNS") plt.legend() plt.show()
https://github.com/PacktPublishing/Quantum-Computing-in-Practice-with-Qiskit-and-IBM-Quantum-Experience
PacktPublishing
#!/usr/bin/env python3 # -*- coding: utf-8 -*- """ Created Nov 2020 @author: hassi """ print("Ch 8: How many gates do I have time for") print("---------------------------------------") # Import Qiskit and load account from qiskit import Aer, IBMQ, QuantumCircuit, execute from qiskit.providers.aer.noise import NoiseModel from qiskit.tools.visualization import plot_histogram from qiskit.tools.monitor import job_monitor from IPython.core.display import display print("Getting providers...") if not IBMQ.active_account(): IBMQ.load_account() provider = IBMQ.get_provider() def select_backend(): # Get all available and operational backends. print("Getting backends...") available_backends = provider.backends(filters=lambda b: not b.configuration().simulator and b.configuration().n_qubits > 0 and b.status().operational) # Fish out criteria to compare print("{0:20} {1:<10} {2:<10}".format("Name","#Qubits","Pending jobs")) print("{0:20} {1:<10} {2:<10}".format("----","-------","------------")) for n in range(0, len(available_backends)): backend = provider.get_backend(str(available_backends[n])) print("{0:20} {1:<10}".format(backend.name(),backend.configuration().n_qubits),backend.status().pending_jobs) select_backend=input("Select a backend:\n") backend = provider.get_backend(select_backend) return(backend) def display_information(backend,n_id,ttype): micro=10**6 qubit=0 T1=int(backend.properties().t1(qubit)*micro) T2=int(backend.properties().t2(qubit)*micro) id_len=backend.properties().gate_length("id",[0])*micro if ttype=="T1": T=T1 else: T=T2 print("\nBackend data:") print("\nBackend online since:",backend.configuration().online_date.strftime('%Y-%m-%d')) print("Qubit:",qubit) print("T1:",T1,"\u03BCs") print("T2:",T2,"\u03BCs") print("Readout error:",round(backend.properties().readout_error(qubit)*100,2),"%") print("Qubit",qubit,"Id length:",round(id_len,3),"\u03BCs") print(ttype,"-id =", round(T-n_id*id_len,2),"\u03BCs",int((100*n_id*id_len)/T),"%") return(T) def build_circuit(ttype,n_id): qc = QuantumCircuit(1,1) qc.x(0) if ttype in ["T2","t2"]: qc.h(0) for n in range(int(n_id)): qc.id(0) qc.barrier(0) if ttype in ["T2","t2"]: qc.h(0) qc.measure(0,0) return(qc) def build_noise_model(backend): print("Building noise model...") # Construct the noise model from backend noise_model = NoiseModel.from_backend(backend) return(noise_model) def execute_circuit(backend, circuit,noise_model, n_id): # Basis gates for the noise model basis_gates = noise_model.basis_gates # Coupling map coupling_map = backend.configuration().coupling_map # Execute noisy simulation on QASM simulator and get counts noisy_counts = execute(circuit, Aer.get_backend('qasm_simulator'), noise_model=noise_model, coupling_map=coupling_map, basis_gates=basis_gates).result().get_counts(circuit) return(noisy_counts) # Main def main(): # Set the time type ttype="T1" # Select the backend to simulate or run on backend=select_backend() back_sim=input("Enter Q to run on the selected backend, S to run on the simulated backend:\n") if back_sim in ["Q","q"]: sim=False else: sim=True noise_model=build_noise_model(backend) n_id=int(input("Number of id gates:\n")) t=display_information(backend,n_id,ttype) qc=build_circuit(ttype,n_id) # Print sample circuit print("\nSample 5-Id gate",ttype,"circuit:") display(build_circuit(ttype,5).draw('mpl')) # Run the circuit on a simulator job = execute(qc, backend=Aer.get_backend('qasm_simulator'), shots=8192) results = job.result() sim_counts = results.get_counts() print("\nRunning:") print("Results for simulator:",sim_counts) # Run the circuit entry={'sim':sim_counts} legend=['sim'] length=n_id while length!=0: qc=build_circuit(ttype,length) if sim: noisy_counts=execute_circuit(backend,qc,noise_model,length) else: job = execute(qc, backend=backend, shots=8192) job_monitor(job) results = job.result() noisy_counts = results.get_counts() print("Results for",length,"Id gates:",noisy_counts) entry.update({str(length):noisy_counts}) legend.append(str(length)) length=int(length/4) # Store the results in an array results_array=[] for i in legend: results_array.append(entry[i]) # Display the final results title="ID-circuits on "+str(backend)+" with "+ttype+"= "+str(t)+" \u03BCs" if sim: title+=" (Simulated)" title+=" \nOnline since: "+str(backend.configuration().online_date.strftime('%Y-%m-%d')) display(plot_histogram(results_array, legend=legend, title=title)) if __name__ == '__main__': main()
https://github.com/MonitSharma/Qiskit-Summer-School-and-Quantum-Challenges
MonitSharma
import numpy as np # Importing standard Qiskit libraries from qiskit import QuantumCircuit, transpile, Aer, execute from qiskit.tools.jupyter import * from qiskit.visualization import * from qiskit.providers.aer import QasmSimulator backend = Aer.get_backend('statevector_simulator') qc1 = QuantumCircuit(4) # perform gate operations on individual qubits qc1.x(0) qc1.y(1) qc1.z(2) qc1.s(3) # Draw circuit qc1.draw() # Plot blochshere out1 = execute(qc1,backend).result().get_statevector() plot_bloch_multivector(out1) qc2 = QuantumCircuit(4) # initialize qubits qc2.x(range(4)) # perform gate operations on individual qubits qc2.x(0) qc2.y(1) qc2.z(2) qc2.s(3) # Draw circuit qc2.draw() # Plot blochshere out2 = execute(qc2,backend).result().get_statevector() plot_bloch_multivector(out2) qc3 = QuantumCircuit(4) # initialize qubits qc3.h(range(4)) # perform gate operations on individual qubits qc3.x(0) qc3.y(1) qc3.z(2) qc3.s(3) # Draw circuit qc3.draw() # Plot blochshere out3 = execute(qc3,backend).result().get_statevector() plot_bloch_multivector(out3) qc4 = QuantumCircuit(4) # initialize qubits qc4.x(range(4)) qc4.h(range(4)) # perform gate operations on individual qubits qc4.x(0) qc4.y(1) qc4.z(2) qc4.s(3) # Draw circuit qc4.draw() # Plot blochshere out4 = execute(qc4,backend).result().get_statevector() plot_bloch_multivector(out4) qc5 = QuantumCircuit(4) # initialize qubits qc5.h(range(4)) qc5.s(range(4)) # perform gate operations on individual qubits qc5.x(0) qc5.y(1) qc5.z(2) qc5.s(3) # Draw circuit qc5.draw() # Plot blochshere out5 = execute(qc5,backend).result().get_statevector() plot_bloch_multivector(out5) qc6 = QuantumCircuit(4) # initialize qubits qc6.x(range(4)) qc6.h(range(4)) qc6.s(range(4)) # perform gate operations on individual qubits qc6.x(0) qc6.y(1) qc6.z(2) qc6.s(3) # Draw circuit qc6.draw() # Plot blochshere out6 = execute(qc6,backend).result().get_statevector() plot_bloch_multivector(out6) import qiskit qiskit.__qiskit_version__
https://github.com/BOBO1997/osp_solutions
BOBO1997
import numpy as np import matplotlib.pyplot as plt import itertools from pprint import pprint import pickle # plt.rcParams.update({'font.size': 16}) # enlarge matplotlib fonts import time import datetime # Import qubit states Zero (|0>) and One (|1>), and Pauli operators (X, Y, Z) from qiskit.opflow import Zero, One, I, X, Y, Z from qiskit import QuantumCircuit, QuantumRegister, IBMQ, execute, transpile, Aer from qiskit.tools.monitor import job_monitor from qiskit.circuit import Parameter from qiskit.transpiler.passes import RemoveBarriers # Import QREM package from qiskit.ignis.mitigation.measurement import complete_meas_cal, CompleteMeasFitter from qiskit.ignis.mitigation import expectation_value # Import mitiq for zne import mitiq # Import state tomography modules from qiskit.ignis.verification.tomography import state_tomography_circuits from qiskit.quantum_info import state_fidelity import sys import importlib sys.path.append("./") import circuit_utils, zne_utils, tomography_utils, sgs_algorithm importlib.reload(circuit_utils) importlib.reload(zne_utils) importlib.reload(tomography_utils) importlib.reload(sgs_algorithm) from circuit_utils import * from zne_utils import * from tomography_utils import * from sgs_algorithm import * # Combine subcircuits into a single multiqubit gate representing a single trotter step num_qubits = 3 # The final time of the state evolution target_time = np.pi # Parameterize variable t to be evaluated at t=pi later dt = Parameter('t') # Convert custom quantum circuit into a gate trot_gate = trotter_gate(dt) # initial layout initial_layout = [5,3,1] # Number of trotter steps num_steps = 100 print("trotter step: ", num_steps) scale_factors = [1.0, 2.0, 3.0] # Initialize quantum circuit for 3 qubits qr = QuantumRegister(num_qubits, name="lq") qc = QuantumCircuit(qr) # Prepare initial state (remember we are only evolving 3 of the 7 qubits on jakarta qubits (q_5, q_3, q_1) corresponding to the state |110>) make_initial_state(qc, "110") # DO NOT MODIFY (|q_5,q_3,q_1> = |110>) subspace_encoder_init110(qc, targets=[0, 1, 2]) # encode trotterize(qc, trot_gate, num_steps, targets=[1, 2]) # Simulate time evolution under H_heis3 Hamiltonian subspace_decoder_init110(qc, targets=[0, 1, 2]) # decode # Evaluate simulation at target_time (t=pi) meaning each trotter step evolves pi/trotter_steps in time qc = qc.bind_parameters({dt: target_time / num_steps}) print("created qc") # Generate state tomography circuits to evaluate fidelity of simulation st_qcs = state_tomography_circuits(qc, [0, 1, 2][::-1]) #! state tomography requires === BIG ENDIAN === print("created st_qcs (length:", len(st_qcs), ")") # remove barriers st_qcs = [RemoveBarriers()(qc) for qc in st_qcs] print("removed barriers from st_qcs") # optimize circuit t3_st_qcs = transpile(st_qcs, optimization_level=3, basis_gates=["sx", "cx", "rz"]) print("created t3_st_qcs (length:", len(t3_st_qcs), ")") # zne wrapping zne_qcs = zne_wrapper(t3_st_qcs, scale_factors=scale_factors) print("created zne_qcs (length:", len(zne_qcs), ")") t3_zne_qcs = transpile(zne_qcs, optimization_level=0, basis_gates=["sx", "cx", "rz"], initial_layout=initial_layout) print("created t3_zne_qcs (length:", len(t3_zne_qcs), ")") t3_zne_qcs[-3].draw("mpl") from qiskit.test.mock import FakeJakarta backend = FakeJakarta() # backend = Aer.get_backend("qasm_simulator") # IBMQ.load_account() # provider = IBMQ.get_provider(hub='ibm-q-utokyo', group='internal', project='hirashi-jst') # provider = IBMQ.get_provider(hub='ibm-q-community', group='ibmquantumawards', project='open-science-22') # print("provider:", provider) # backend = provider.get_backend("ibmq_jakarta") shots = 1 << 13 reps = 1 # unused # Number of trotter steps print("trotter step: ", num_steps) # execute: reps = 1 job = execute(t3_zne_qcs, backend, shots=shots) # 毎回チェック: ここちゃんと変えた? print('Job ID', job.job_id()) # QREM qr = QuantumRegister(num_qubits) meas_calibs, state_labels = complete_meas_cal(qr=qr, circlabel='mcal') cal_job = execute(meas_calibs, backend=backend, shots=shots, optimization_level=3, initial_layout = initial_layout) print('Job ID', cal_job.job_id()) cal_results = cal_job.result() meas_fitter = CompleteMeasFitter(cal_results, state_labels, circlabel='mcal') mit_results = meas_fitter.filter.apply(job.result()) zne_expvals = zne_decoder(num_qubits, mit_results) target_state = (One^One^Zero).to_matrix() # DO NOT CHANGE!!! rho = expvals_to_valid_rho(num_qubits, zne_expvals) fidelity = state_fidelity(rho, target_state) print(fidelity)
https://github.com/BOBO1997/osp_solutions
BOBO1997
import numpy as np import matplotlib.pyplot as plt import itertools plt.rcParams.update({'font.size': 16}) # enlarge matplotlib fonts # Import qubit states Zero (|0>) and One (|1>), and Pauli operators (X, Y, Z) from qiskit.opflow import Zero, One, I, X, Y, Z from qiskit import QuantumCircuit, QuantumRegister, IBMQ, execute, transpile, Aer from qiskit.providers.aer import QasmSimulator from qiskit.tools.monitor import job_monitor from qiskit.circuit import Parameter # Import QREM package from qiskit.ignis.mitigation.measurement import complete_meas_cal, CompleteMeasFitter # Import mitiq for zne import mitiq # Import state tomography modules from qiskit.ignis.verification.tomography import state_tomography_circuits, StateTomographyFitter from qiskit.quantum_info import state_fidelity # Suppress warnings import warnings warnings.filterwarnings('ignore') def trotter_gate(dt, to_instruction = True): qc = QuantumCircuit(2) qc.rx(2*dt,0) qc.rz(2*dt,1) qc.h(1) qc.cx(1,0) qc.rz(-2*dt, 0) qc.rx(-2*dt, 1) qc.rz(2*dt, 1) qc.cx(1,0) qc.h(1) qc.rz(2*dt, 0) return qc.to_instruction() if to_instruction else qc trotter_gate(np.pi / 6, to_instruction=False).draw("mpl") # Combine subcircuits into a single multiqubit gate representing a single trotter step num_qubits = 3 # The final time of the state evolution target_time = np.pi # Parameterize variable t to be evaluated at t=pi later dt = Parameter('t') # Convert custom quantum circuit into a gate Trot_gate = trotter_gate(dt) # Number of trotter steps trotter_steps = 15 ### CAN BE >= 4 # Initialize quantum circuit for 3 qubits qr = QuantumRegister(7) qc = QuantumCircuit(qr) # Prepare initial state (remember we are only evolving 3 of the 7 qubits on jakarta qubits (q_5, q_3, q_1) corresponding to the state |110>) qc.x([5]) # DO NOT MODIFY (|q_5,q_3,q_1> = |110>) # Simulate time evolution under H_heis3 Hamiltonian for _ in range(trotter_steps): qc.append(Trot_gate, [qr[3], qr[5]]) qc.cx(qr[3], qr[1]) qc.cx(qr[5], qr[3]) # Evaluate simulation at target_time (t=pi) meaning each trotter step evolves pi/trotter_steps in time qc = qc.bind_parameters({dt: target_time/trotter_steps}) t3_qc = transpile(qc, optimization_level=3, basis_gates=["sx", "cx", "rz"]) t3_qc = transpile(t3_qc, optimization_level=3, basis_gates=["sx", "cx", "rz"]) # Generate state tomography circuits to evaluate fidelity of simulation st_qcs = state_tomography_circuits(t3_qc, [qr[1], qr[3], qr[5]]) # Display circuit for confirmation # st_qcs[-1].decompose().draw() # view decomposition of trotter gates st_qcs[-1].draw("mpl") # only view trotter gates from qiskit.test.mock import FakeJakarta backend = FakeJakarta() # backend = Aer.get_backend("qasm_simulator") IBMQ.load_account() # provider = IBMQ.get_provider(hub='ibm-q-utokyo', group='internal', project='hirashi-jst') provider = IBMQ.get_provider(hub='ibm-q-community', group='ibmquantumawards', project='open-science-22') print("provider:", provider) backend = provider.get_backend("ibmq_jakarta") shots = 8192 reps = 8 jobs = [] for _ in range(reps): # execute job = execute(st_qcs, backend, shots=shots) print('Job ID', job.job_id()) jobs.append(job) job_ids = \ ["624e8c85aacb9bd9c75f4da1", "624e8c894b515208aa7c6ae2", "624e8c8ba5d4eeac4977ccf3", "624e8c8ccfe45c1d4ae5a357", "624e8c8ef65d78307439029b", "624e8c9173968c1c2307b2c9", "624e8c93caa26524ecf199a9", "624e8c95aacb9b60c25f4da3"] # QREM qr = QuantumRegister(num_qubits) meas_calibs, state_labels = complete_meas_cal(qr=qr, circlabel='mcal') cal_job = execute(meas_calibs, backend=backend, shots=shots, optimization_level=3) print('Job ID', cal_job.job_id()) jobs = [] for job_id in job_ids: jobs.append(backend.retrieve_job(job_id)) cal_job_id = "624e8c97a5d4ee882477ccf4" cal_job = backend.retrieve_job(cal_job_id) qr = QuantumRegister(num_qubits) meas_calibs, state_labels = complete_meas_cal(qr=qr, circlabel='mcal') cal_results = cal_job.result() print("retrieved cal_results") meas_fitter = CompleteMeasFitter(cal_results, state_labels, circlabel='mcal') mit_results = [] for i, job in enumerate(jobs): mit_results.append( meas_fitter.filter.apply(job.result()) ) print("retrieved", i, "th results") # Compute the state tomography based on the st_qcs quantum circuits and the results from those ciricuits def state_tomo(result, st_qcs): # The expected final state; necessary to determine state tomography fidelity target_state = (One^One^Zero).to_matrix() # DO NOT MODIFY (|q_5,q_3,q_1> = |110>) # Fit state tomography results tomo_fitter = StateTomographyFitter(result, st_qcs) rho_fit = tomo_fitter.fit(method='lstsq') # Compute fidelity fid = state_fidelity(rho_fit, target_state) return fid # Compute tomography fidelities for each repetition fids = [] for result in mit_results: fid = state_tomo(result, st_qcs) fids.append(fid) print('state tomography fidelity = {:.4f} \u00B1 {:.4f}'.format(np.mean(fids), np.std(fids)))
https://github.com/Pitt-JonesLab/slam_decomposition
Pitt-JonesLab
%%capture %pip install qiskit %pip install qiskit_ibm_provider %pip install qiskit-aer # Importing standard Qiskit libraries from qiskit import QuantumRegister, ClassicalRegister, QuantumCircuit, QuantumCircuit, transpile, Aer from qiskit_ibm_provider import IBMProvider from qiskit.tools.jupyter import * from qiskit.visualization import * from qiskit.circuit.library import C3XGate # Importing matplotlib import matplotlib.pyplot as plt # Importing Numpy, Cmath and math import numpy as np import os, math, cmath from numpy import pi # Other imports from IPython.display import display, Math, Latex # Specify the path to your env file env_file_path = 'config.env' # Load environment variables from the file os.environ.update(line.strip().split('=', 1) for line in open(env_file_path) if '=' in line and not line.startswith('#')) # Load IBM Provider API KEY IBMP_API_KEY = os.environ.get('IBMP_API_KEY') # Loading your IBM Quantum account(s) IBMProvider.save_account(IBMP_API_KEY, overwrite=True) # Run the quantum circuit on a statevector simulator backend backend = Aer.get_backend('statevector_simulator') qc_b1 = QuantumCircuit(2, 2) qc_b1.h(0) qc_b1.cx(0, 1) qc_b1.draw(output='mpl', style="iqp") sv = backend.run(qc_b1).result().get_statevector() sv.draw(output='latex', prefix = "|\Phi^+\\rangle = ") qc_b2 = QuantumCircuit(2, 2) qc_b2.x(0) qc_b2.h(0) qc_b2.cx(0, 1) qc_b2.draw(output='mpl', style="iqp") sv = backend.run(qc_b2).result().get_statevector() sv.draw(output='latex', prefix = "|\Phi^-\\rangle = ") qc_b2 = QuantumCircuit(2, 2) qc_b2.h(0) qc_b2.cx(0, 1) qc_b2.z(0) qc_b2.draw(output='mpl', style="iqp") sv = backend.run(qc_b2).result().get_statevector() sv.draw(output='latex', prefix = "|\Phi^-\\rangle = ") qc_b3 = QuantumCircuit(2, 2) qc_b3.x(1) qc_b3.h(0) qc_b3.cx(0, 1) qc_b3.draw(output='mpl', style="iqp") sv = backend.run(qc_b3).result().get_statevector() sv.draw(output='latex', prefix = "|\Psi^+\\rangle = ") qc_b3 = QuantumCircuit(2, 2) qc_b3.h(0) qc_b3.cx(0, 1) qc_b3.x(0) qc_b3.draw(output='mpl', style="iqp") sv = backend.run(qc_b3).result().get_statevector() sv.draw(output='latex', prefix = "|\Psi^+\\rangle = ") qc_b4 = QuantumCircuit(2, 2) qc_b4.x(0) qc_b4.h(0) qc_b4.x(1) qc_b4.cx(0, 1) qc_b4.draw(output='mpl', style="iqp") sv = backend.run(qc_b4).result().get_statevector() sv.draw(output='latex', prefix = "|\Psi^-\\rangle = ") qc_b4 = QuantumCircuit(2, 2) qc_b4.h(0) qc_b4.cx(0, 1) qc_b4.x(0) qc_b4.z(1) qc_b4.draw(output='mpl', style="iqp") sv = backend.run(qc_b4).result().get_statevector() sv.draw(output='latex', prefix = "|\Psi^-\\rangle = ") def sv_latex_from_qc(qc, backend): sv = backend.run(qc).result().get_statevector() return sv.draw(output='latex') qc_ej2 = QuantumCircuit(4, 4) qc_ej2.x(0) sv_latex_from_qc(qc_ej2, backend) qc_ej2 = QuantumCircuit(4, 4) qc_ej2.x(1) sv_latex_from_qc(qc_ej2, backend) qc_ej2 = QuantumCircuit(4, 4) qc_ej2.x(0) qc_ej2.x(1) sv_latex_from_qc(qc_ej2, backend) qc_ej2 = QuantumCircuit(4, 4) qc_ej2.x(2) sv_latex_from_qc(qc_ej2, backend) qc_ej2 = QuantumCircuit(4, 4) qc_ej2.x(0) qc_ej2.x(2) sv_latex_from_qc(qc_ej2, backend) qc_ej2 = QuantumCircuit(4, 4) qc_ej2.x(0) qc_ej2.x(2) sv_latex_from_qc(qc_ej2, backend) qc_ej2 = QuantumCircuit(4, 4) qc_ej2.x(0) qc_ej2.x(1) qc_ej2.x(2) sv_latex_from_qc(qc_ej2, backend) qc_ej2 = QuantumCircuit(4, 4) qc_ej2.x(3) sv_latex_from_qc(qc_ej2, backend) def circuit_adder (num): if num<1 or num>8: raise ValueError("Out of range") ## El enunciado limita el sumador a los valores entre 1 y 8. Quitar esta restricción sería directo. # Definición del circuito base que vamos a construir qreg_q = QuantumRegister(4, 'q') creg_c = ClassicalRegister(1, 'c') circuit = QuantumCircuit(qreg_q, creg_c) qbit_position = 0 for element in reversed(np.binary_repr(num)): if (element=='1'): circuit.barrier() match qbit_position: case 0: # +1 circuit.append(C3XGate(), [qreg_q[0], qreg_q[1], qreg_q[2], qreg_q[3]]) circuit.ccx(qreg_q[0], qreg_q[1], qreg_q[2]) circuit.cx(qreg_q[0], qreg_q[1]) circuit.x(qreg_q[0]) case 1: # +2 circuit.ccx(qreg_q[1], qreg_q[2], qreg_q[3]) circuit.cx(qreg_q[1], qreg_q[2]) circuit.x(qreg_q[1]) case 2: # +4 circuit.cx(qreg_q[2], qreg_q[3]) circuit.x(qreg_q[2]) case 3: # +8 circuit.x(qreg_q[3]) qbit_position+=1 return circuit add_3 = circuit_adder(3) add_3.draw(output='mpl', style="iqp") qc_test_2 = QuantumCircuit(4, 4) qc_test_2.x(1) qc_test_2_plus_3 = qc_test_2.compose(add_3) qc_test_2_plus_3.draw(output='mpl', style="iqp") sv_latex_from_qc(qc_test_2_plus_3, backend) qc_test_7 = QuantumCircuit(4, 4) qc_test_7.x(0) qc_test_7.x(1) qc_test_7.x(2) qc_test_7_plus_8 = qc_test_7.compose(circuit_adder(8)) sv_latex_from_qc(qc_test_7_plus_8, backend) #qc_test_7_plus_8.draw() theta = 6.544985 phi = 2.338741 lmbda = 0 alice_1 = 0 alice_2 = 1 bob_1 = 2 qr_alice = QuantumRegister(2, 'Alice') qr_bob = QuantumRegister(1, 'Bob') cr = ClassicalRegister(3, 'c') qc_ej3 = QuantumCircuit(qr_alice, qr_bob, cr) qc_ej3.barrier(label='1') qc_ej3.u(theta, phi, lmbda, alice_1); qc_ej3.barrier(label='2') qc_ej3.h(alice_2) qc_ej3.cx(alice_2, bob_1); qc_ej3.barrier(label='3') qc_ej3.cx(alice_1, alice_2) qc_ej3.h(alice_1); qc_ej3.barrier(label='4') qc_ej3.measure([alice_1, alice_2], [alice_1, alice_2]); qc_ej3.barrier(label='5') qc_ej3.x(bob_1).c_if(alice_2, 1) qc_ej3.z(bob_1).c_if(alice_1, 1) qc_ej3.measure(bob_1, bob_1); qc_ej3.draw(output='mpl', style="iqp") result = backend.run(qc_ej3, shots=1024).result() counts = result.get_counts() plot_histogram(counts) sv_0 = np.array([1, 0]) sv_1 = np.array([0, 1]) def find_symbolic_representation(value, symbolic_constants={1/np.sqrt(2): '1/√2'}, tolerance=1e-10): """ Check if the given numerical value corresponds to a symbolic constant within a specified tolerance. Parameters: - value (float): The numerical value to check. - symbolic_constants (dict): A dictionary mapping numerical values to their symbolic representations. Defaults to {1/np.sqrt(2): '1/√2'}. - tolerance (float): Tolerance for comparing values with symbolic constants. Defaults to 1e-10. Returns: str or float: If a match is found, returns the symbolic representation as a string (prefixed with '-' if the value is negative); otherwise, returns the original value. """ for constant, symbol in symbolic_constants.items(): if np.isclose(abs(value), constant, atol=tolerance): return symbol if value >= 0 else '-' + symbol return value def array_to_dirac_notation(array, tolerance=1e-10): """ Convert a complex-valued array representing a quantum state in superposition to Dirac notation. Parameters: - array (numpy.ndarray): The complex-valued array representing the quantum state in superposition. - tolerance (float): Tolerance for considering amplitudes as negligible. Returns: str: The Dirac notation representation of the quantum state. """ # Ensure the statevector is normalized array = array / np.linalg.norm(array) # Get the number of qubits num_qubits = int(np.log2(len(array))) # Find indices where amplitude is not negligible non_zero_indices = np.where(np.abs(array) > tolerance)[0] # Generate Dirac notation terms terms = [ (find_symbolic_representation(array[i]), format(i, f"0{num_qubits}b")) for i in non_zero_indices ] # Format Dirac notation dirac_notation = " + ".join([f"{amplitude}|{binary_rep}⟩" for amplitude, binary_rep in terms]) return dirac_notation def array_to_matrix_representation(array): """ Convert a one-dimensional array to a column matrix representation. Parameters: - array (numpy.ndarray): The one-dimensional array to be converted. Returns: numpy.ndarray: The column matrix representation of the input array. """ # Replace symbolic constants with their representations matrix_representation = np.array([find_symbolic_representation(value) or value for value in array]) # Return the column matrix representation return matrix_representation.reshape((len(matrix_representation), 1)) def array_to_dirac_and_matrix_latex(array): """ Generate LaTeX code for displaying both the matrix representation and Dirac notation of a quantum state. Parameters: - array (numpy.ndarray): The complex-valued array representing the quantum state. Returns: Latex: A Latex object containing LaTeX code for displaying both representations. """ matrix_representation = array_to_matrix_representation(array) latex = "Matrix representation\n\\begin{bmatrix}\n" + \ "\\\\\n".join(map(str, matrix_representation.flatten())) + \ "\n\\end{bmatrix}\n" latex += f'Dirac Notation:\n{array_to_dirac_notation(array)}' return Latex(latex) sv_b1 = np.kron(sv_0, sv_0) array_to_dirac_and_matrix_latex(sv_b1) sv_b1 = (np.kron(sv_0, sv_0) + np.kron(sv_0, sv_1)) / np.sqrt(2) array_to_dirac_and_matrix_latex(sv_b1) sv_b1 = (np.kron(sv_0, sv_0) + np.kron(sv_1, sv_1)) / np.sqrt(2) array_to_dirac_and_matrix_latex(sv_b1) sv_b2 = np.kron(sv_0, sv_0) array_to_dirac_and_matrix_latex(sv_b2) sv_b2 = (np.kron(sv_0, sv_0) + np.kron(sv_0, sv_1)) / np.sqrt(2) array_to_dirac_and_matrix_latex(sv_b2) sv_b2 = (np.kron(sv_0, sv_0) + np.kron(sv_1, sv_1)) / np.sqrt(2) array_to_dirac_and_matrix_latex(sv_b2) sv_b2 = (np.kron(sv_0, sv_0) - np.kron(sv_1, sv_1)) / np.sqrt(2) array_to_dirac_and_matrix_latex(sv_b2) sv_b3 = np.kron(sv_0, sv_0) array_to_dirac_and_matrix_latex(sv_b3) sv_b3 = np.kron(sv_0, sv_1) array_to_dirac_and_matrix_latex(sv_b3) sv_b3 = (np.kron(sv_0, sv_0) - np.kron(sv_0, sv_1)) / np.sqrt(2) array_to_dirac_and_matrix_latex(sv_b3) sv_b3 = (np.kron(sv_0, sv_1) - np.kron(sv_1, sv_0)) / np.sqrt(2) array_to_dirac_and_matrix_latex(sv_b3) sv_b3 = (np.kron(sv_0, sv_1) + np.kron(sv_1, sv_0)) / np.sqrt(2) array_to_dirac_and_matrix_latex(sv_b3) sv_b4 = np.kron(sv_0, sv_0) array_to_dirac_and_matrix_latex(sv_b4) sv_b4 = np.kron(sv_0, sv_1) array_to_dirac_and_matrix_latex(sv_b4) sv_b4 = (np.kron(sv_0, sv_0) - np.kron(sv_0, sv_1)) / np.sqrt(2) array_to_dirac_and_matrix_latex(sv_b4) sv_b4 = (np.kron(sv_0, sv_1) - np.kron(sv_1, sv_0)) / np.sqrt(2) array_to_dirac_and_matrix_latex(sv_b4)
https://github.com/hephaex/Quantum-Computing-Awesome-List
hephaex
import cirq import random def make_quantum_teleportation_circuit(ranX, ranY): circuit = cirq.Circuit() msg, alice, bob = cirq.LineQubit.range(3) ## Bell State circuit.append([cirq.H(alice), cirq.CNOT(alice, bob)]) ## Adding random message in message qubit circuit.append([cirq.X(msg)**ranX, cirq.Y(msg)**ranY]) ## Entangling msg and Alice qubits circuit.append([cirq.CNOT(msg, alice), cirq.H(msg)]) ## Measurements circuit.append([cirq.measure(alice, msg)]) ## We use two classical bit from the bell measurement to recover the state of qubit circuit.append([cirq.CNOT(alice, bob), cirq.CZ(msg, bob)]) return msg, circuit def main(): ## Creating random variable ranX = random.random() ranY = random.random() msg, circuit = make_quantum_teleportation_circuit(ranX, ranY) ## Simulating the circuit sim = cirq.Simulator() message = sim.simulate(cirq.Circuit.from_ops([cirq.X(msg)**ranX, cirq.Y(msg)**ranY])) print("Block Spehere of Alice Qubit") b0x, b0y, b0z = cirq.bloch_vector_from_state_vector(message.final_state, 0) print("X: ", round(b0x, 4), "Y: ", round(b0y, 4), "Z: ", round(b0z, 4)) print("\n Circuit:") print(circuit) final_results = sim.simulate(circuit) print("\n Block Spehere of Bob's Qubits:") b2x, b2y, b2z = cirq.bloch_vector_from_state_vector(final_results.final_state, 2) print("X: ", round(b2x, 4), "Y: ", round(b2y, 4), "Z: ", round(b2z, 4)) if __name__ == '__main__': main()
https://github.com/dimple12M/Qiskit-Certification-Guide
dimple12M
# From IBMQ backends information we know import qiskit from qiskit import IBMQ from qiskit.providers.ibmq import least_busy from qiskit.tools.jupyter import * # IBMQ.save_account("Token needs to be provided") provider = IBMQ.load_account() %qiskit_backend_overview backend = provider.get_backend('ibmq_bogota') backend %qiskit_version_table import qiskit qiskit.__version__ qiskit.__qiskit_version__ %qiskit_job_watcher
https://github.com/qiskit-community/qiskit-translations-staging
qiskit-community
from qiskit.algorithms.optimizers import SLSQP from qiskit.circuit.library import TwoLocal num_qubits = 2 ansatz = TwoLocal(num_qubits, "ry", "cz") optimizer = SLSQP(maxiter=1000) ansatz.decompose().draw("mpl", style="iqx") from qiskit.primitives import Estimator estimator = Estimator() from qiskit.algorithms.minimum_eigensolvers import VQE vqe = VQE(estimator, ansatz, optimizer) from qiskit.quantum_info import SparsePauliOp H2_op = SparsePauliOp.from_list([ ("II", -1.052373245772859), ("IZ", 0.39793742484318045), ("ZI", -0.39793742484318045), ("ZZ", -0.01128010425623538), ("XX", 0.18093119978423156) ]) result = vqe.compute_minimum_eigenvalue(H2_op) print(result) from qiskit.algorithms.optimizers import SPSA estimator = Estimator(options={"shots": 1000}) vqe.estimator = estimator vqe.optimizer = SPSA(maxiter=100) result = vqe.compute_minimum_eigenvalue(operator=H2_op) print(result) import qiskit.tools.jupyter %qiskit_version_table %qiskit_copyright
https://github.com/we-taper/qiskit-pyzx
we-taper
from math import pi import pyzx from qiskit import QuantumCircuit, QuantumRegister, ClassicalRegister from qiskit.converters import * from circuit_translate_main import dag_to_pyzx_circuit, pyzx_circ_to_dag def optimize(c): pyzx_graph = c.to_graph() # Phase 1 pyzx.simplify.full_reduce(pyzx_graph) # Phase 2 pyzx_circuit = pyzx.extract.streaming_extract(pyzx_graph) # Phase 3 pyzx_circuit = pyzx_circuit.to_basic_gates() # Phase 4 try: # First try including the phase polynomial optimizer pyzx_circuit = pyzx.optimize.full_optimize(pyzx_circuit) except TypeError: # The phase polynomial optimizer only works on Clifford+T circuits. # Fall back to the basic optimizer pyzx_circuit = pyzx.optimize.basic_optimization(pyzx_circuit) # Phase 5 pyzx_circuit = pyzx_circuit.to_basic_gates() # Phase 6 pyzx_circuit = pyzx_circuit.split_phase_gates() return pyzx_circuit q = QuantumRegister(2, 'q') q_a = QuantumRegister(2, 'a') c = ClassicalRegister(1, 'c') circ = QuantumCircuit(q, q_a, c) # circ.rz(0.1 * pi, q[1]) # circ.cx(q[0], q[1]) # circ.measure(q[0], c[0]) # circ.measure(q[0], c[0]) # circ.measure(q[0], c[0]) # circ.rz(0.2 * pi, q[1]) # circ.cx(q[0], q[1]) # circ.rz(0.3 * pi, q[0]) # circ.x(q[0]).c_if(c, 1) # circ.rz(0.4 * pi, q[1]) # circ.cx(q[1], q[0]) # circ.h(q_a[0]) # circ.h(q_a[0]) # circ.x(q_a[0]) # circ.rx(pi, q_a[1]) # circ.ry(pi, q_a[1]) # circ.rz(0.1 * pi, q_a[1]) circ.z(q[1]) circ.cx(q[1], q[0]) # circ.measure(q[0], c[0]) circ.reset(q[0]) circ.cx(q[1], q[0]) circ.z(q[1]) print('Before circ') print(circ.qasm()) dag = circuit_to_dag(circ) ret = dag_to_pyzx_circuit(dag) print('pyzx circ (before opt)') print(ret.circuit.to_qasm()) reduced = optimize(ret.circuit) print('pyzx circ (after opt)') print(reduced.to_qasm()) dag_new = pyzx_circ_to_dag(reduced, ret) print('circ (after opt)') print(dag_to_circuit(dag_new).qasm()) # ======= # reduced = optimize(ret[0]) # for gate in reduced.gates: # if isinstance(gate, pyzx.gates.Nonunitary): # print(gate.stored_data) # print(reduced.to_qasm()) # >>>>>>> Stashed changes
https://github.com/soultanis/Quantum-Database-Search
soultanis
import grover_test as gt # Simulator-Backend # output = gt.build_and_run(3, [1]) # IBMQ-Backend output = gt.build_and_run(2, [1], real=True, online=True) print(output)
https://github.com/abbarreto/qiskit4
abbarreto
from sympy import * init_printing(use_unicode=True) %matplotlib inline p00,p01,p10,p11 = symbols('p_{00} p_{01} p_{10} p_{11}') th,ph = symbols('theta phi') Psi00 = Matrix([[cos(th)],[0],[0],[sin(th)]]) Psi01 = Matrix([[0],[sin(ph)],[cos(ph)],[0]]) Psi11 = Matrix([[0],[cos(ph)],[-sin(ph)],[0]]) Psi10 = Matrix([[-sin(th)],[0],[0],[cos(th)]]) #Psi00, Psi00.T, Psi00*Psi00.T rhoX = p00*Psi00*Psi00.T + p01*Psi01*Psi01.T + p10*Psi10*Psi10.T + p11*Psi11*Psi11.T simplify(rhoX) def kp(x,y): return KroneckerProduct(x,y) I = Matrix([[1,0],[0,1]]) Y = Matrix([[0,-1j],[1j,0]]) Y = Matrix([[0,1],[1,0]]) Z = Matrix([[1,0],[0,-1]]) cxx,cyy,czz,az,bz = symbols('c_{xx} c_{yy} c_{zz} a_{z} b_{z}') rhoX = (1/4)*(kp(I,I) + cxx*kp(X,X) + cyy*kp(Y,Y) + czz*kp(Z,Z) + az*kp(Z,I) + bz*kp(I,Z)) simplify(rhoX) th,be,ga = symbols('theta beta gamma') c00 = cos(th/2)*cos(be/2)*cos(ga/2) + sin(th/2)*sin(be/2)*sin(ga/2) c01 = cos(th/2)*cos(be/2)*sin(ga/2) - sin(th/2)*sin(be/2)*cos(ga/2) c10 = cos(th/2)*sin(be/2)*cos(ga/2) - sin(th/2)*cos(be/2)*sin(ga/2) c11 = cos(th/2)*sin(be/2)*sin(ga/2) + sin(th/2)*cos(be/2)*cos(ga/2) simplify(c00**2 + c01**2 + c10**2 + c11**2) # ok! P0 = Matrix([[1,0],[0,0]]) P1 = Matrix([[0,0],[0,1]]) def Ry(th): return cos(th/2)*I - 1j*sin(th/2)*Y def Cx_ab(): return KroneckerProduct(P0,I) + KroneckerProduct(P1,X) def Cx_ba(): return KroneckerProduct(I,P0) + KroneckerProduct(X,P1) MB = Cx_ab()*KroneckerProduct(Ry(th-ph),I)*Cx_ba()*KroneckerProduct(Ry(th+ph),I) # mudanca de base simplify(MB) from qiskit import * import numpy as np import math import qiskit nshots = 8192 IBMQ.load_account() provider = qiskit.IBMQ.get_provider(hub='ibm-q', group='open', project='main') device = provider.get_backend('ibmq_belem') simulator = Aer.get_backend('qasm_simulator') from qiskit.tools.monitor import job_monitor from qiskit.ignis.verification.tomography import state_tomography_circuits, StateTomographyFitter from qiskit.ignis.mitigation.measurement import complete_meas_cal, CompleteMeasFitter # retorna o circuito quantico que prepara um certo estado real de 1 qubit # coef = array com os 2 coeficientes reais do estado na base computacional def qc_psi_1qb_real(coef): qr = QuantumRegister(1) qc = QuantumCircuit(qr, name='psir_1qb') th = 2*math.acos(np.abs(coef[0])) qc.ry(th, qr[0]) return qc eigvals = [0.1,0.9] coef = np.sqrt(eigvals) print(coef) qc_psi_1qb_real_ = qc_psi_1qb_real(coef) qc_psi_1qb_real_.draw('mpl') from qiskit.quantum_info import Statevector sv = Statevector.from_label('0') sv sv = sv.evolve(qc_psi_1qb_real_) sv # retorna o circuito quantico que prepara um certo estado real de 2 qubits # coef = array com os 4 coeficientes reais do estado na base computacional def qc_psi_2qb_real(coef): qr = QuantumRegister(2) qc = QuantumCircuit(qr, name = 'psir_2qb') xi = 2*math.acos(math.sqrt(coef[0]**2+coef[1]**2)) coef1 = [math.sqrt(coef[0]**2+coef[1]**2),math.sqrt(1-coef[0]**2-coef[1]**2)] c_psi_1qb_real_ = qc_psi_1qb_real(coef1) qc.append(c_psi_1qb_real_, [qr[0]]) th0 = 2*math.atan(np.abs(coef[1])/np.abs(coef[0])) th1 = 2*math.atan(np.abs(coef[3])/np.abs(coef[2])) qc.x(0) qc.cry(th0, 0, 1) qc.x(0) qc.cry(th1, 0, 1) return qc eigvals = [0.1, 0.2, 0.3, 0.4] coef = np.sqrt(eigvals) print(coef) qc_psi_2qb_real_ = qc_psi_2qb_real(coef) qc_psi_2qb_real_.draw('mpl') sv = Statevector.from_label('00') sv sv = sv.evolve(qc_psi_2qb_real_) sv # note o ordenamento, o 2º qb é o 1º e o 1º é o 2º (00,10,01,11) def qc_ry(th): qr = QuantumRegister(1) qc = QuantumCircuit(qr, name = 'RY') qc.ry(th, 0) return qc # retorna o circuito quantico que prepara um certo estado real de 3 qubits # coef = array com os 8 coeficientes reais do estado na base computacional def qc_psi_3qb_real(coef): qr = QuantumRegister(3) qc = QuantumCircuit(qr, name = 'psir_3qb') d = len(coef) coef2 = np.zeros(d//2) th = np.zeros(d//2) for j in range(0,2): for k in range(0,2): coef2[int(str(j)+str(k),2)] = math.sqrt(coef[int(str(j)+str(k)+str(0),2)]**2+coef[int(str(j)+str(k)+str(1),2)]**2) c_psi_2qb_real_ = qc_psi_2qb_real(coef2) qc.append(c_psi_2qb_real_, [qr[0],qr[1]]) for j in range(0,2): for k in range(0,2): th[int(str(j)+str(k),2)] = 2*math.atan(np.abs(coef[int(str(j)+str(k)+str(1),2)])/np.abs(coef[int(str(j)+str(k)+str(0),2)])) if j == 0: qc.x(0) if k == 0: qc.x(1) qc_ry_ = qc_ry(th[int(str(j)+str(k),2)]) ccry = qc_ry_.to_gate().control(2) qc.append(ccry, [0,1,2]) if j == 0: qc.x(0) if k == 0: qc.x(1) return qc list_bin = [] for j in range(0,2**3): b = "{:03b}".format(j) list_bin.append(b) print(list_bin) eigvals = [0.01,0.1,0.04,0.2,0.05,0.3,0.18,0.12] coef = np.sqrt(eigvals) print(coef) qc_psi_3qb_real_ = qc_psi_3qb_real(coef) qc_psi_3qb_real_.draw('mpl') # odernamento: '000', '001', '010', '011', '100', '101', '110', '111' sv = Statevector.from_label('000') sv sv = sv.evolve(qc_psi_3qb_real_) sv # ordenamento aqui: 000 100 010 110 001 101 011 111 # retorna o circuito quantico que prepara um certo estado real de 4 qubits # coef = array com os 16 coeficientes reais do estado na base computacional def qc_psi_4qb_real(coef): qr = QuantumRegister(4) qc = QuantumCircuit(qr, name = 'psir_4qb') d = len(coef) coef3 = np.zeros(d//2) th = np.zeros(d//2) for j in range(0,2): for k in range(0,2): for l in range(0,2): coef3[int(str(j)+str(k)+str(l),2)] = math.sqrt(coef[int(str(j)+str(k)+str(l)+str(0),2)]**2+coef[int(str(j)+str(k)+str(l)+str(1),2)]**2) c_psi_3qb_real_ = qc_psi_3qb_real(coef3) qc.append(c_psi_3qb_real_, [qr[0],qr[1],qr[2]]) for j in range(0,2): for k in range(0,2): for l in range(0,2): th[int(str(j)+str(k)+str(l),2)] = 2*math.atan(np.abs(coef[int(str(j)+str(k)+str(l)+str(1),2)])/np.abs(coef[int(str(j)+str(k)+str(l)+str(0),2)])) if j == 0: qc.x(0) if k == 0: qc.x(1) if l == 0: qc.x(2) qc_ry_ = qc_ry(th[int(str(j)+str(k)+str(l),2)]) ccry = qc_ry_.to_gate().control(3) qc.append(ccry, [0,1,2,3]) if j == 0: qc.x(0) if k == 0: qc.x(1) if l == 0: qc.x(2) return qc list_bin = [] for j in range(0,2**4): b = "{:04b}".format(j) list_bin.append(b) print(list_bin) eigvals = np.zeros(2**4) eigvals[0] = 0.008 for j in range(1,len(eigvals)-1): eigvals[j] = eigvals[j-1]+0.005 #print(np.sum(eigvals)) eigvals[j+1] = 1 - np.sum(eigvals) #print(eigvals) #print(np.sum(eigvals)) coef = np.sqrt(eigvals) print(coef) qc_psi_4qb_real_ = qc_psi_4qb_real(coef) qc_psi_4qb_real_.draw('mpl') # '0000', '0001', '0010', '0011', '0100', '0101', '0110', '0111', '1000', '1001', '1010', '1011', '1100', '1101', '1110', '1111' sv = Statevector.from_label('0000') sv sv = sv.evolve(qc_psi_4qb_real_) sv # ordenamento aqui: 0000 1000 0100 1100 0010 1010 0110 1110 0001 1001 0101 1101 0011 1011 0111 1111 sv[1]
https://github.com/qiskit-community/qiskit-translations-staging
qiskit-community
from qiskit import QuantumCircuit, transpile from qiskit.providers.fake_provider import FakeBoeblingen backend = FakeBoeblingen() ghz = QuantumCircuit(5) ghz.h(0) ghz.cx(0,range(1,5)) circ = transpile(ghz, backend, scheduling_method="asap") circ.draw(output='mpl')
https://github.com/2lambda123/Qiskit-qiskit
2lambda123
# This code is part of Qiskit. # # (C) Copyright IBM 2022. # # This code is licensed under the Apache License, Version 2.0. You may # obtain a copy of this license in the LICENSE.txt file in the root directory # of this source tree or at http://www.apache.org/licenses/LICENSE-2.0. # # Any modifications or derivative works of this code must retain this # copyright notice, and modified files need to carry a notice indicating # that they have been altered from the originals. """Test functionality to collect, split and consolidate blocks from DAGCircuits.""" import unittest from qiskit import QuantumRegister, ClassicalRegister from qiskit.converters import ( circuit_to_dag, circuit_to_dagdependency, circuit_to_instruction, dag_to_circuit, dagdependency_to_circuit, ) from qiskit.test import QiskitTestCase from qiskit.circuit import QuantumCircuit, Measure, Clbit from qiskit.dagcircuit.collect_blocks import BlockCollector, BlockSplitter, BlockCollapser class TestCollectBlocks(QiskitTestCase): """Tests to verify correctness of collecting, splitting, and consolidating blocks from DAGCircuit and DAGDependency. Additional tests appear as a part of CollectLinearFunctions and CollectCliffords passes. """ def test_collect_gates_from_dagcircuit_1(self): """Test collecting CX gates from DAGCircuits.""" qc = QuantumCircuit(5) qc.cx(0, 1) qc.cx(0, 2) qc.z(0) qc.cx(0, 3) qc.cx(0, 4) block_collector = BlockCollector(circuit_to_dag(qc)) blocks = block_collector.collect_all_matching_blocks( lambda node: node.op.name == "cx", split_blocks=False, min_block_size=2, ) # The middle z-gate leads to two blocks of size 2 each self.assertEqual(len(blocks), 2) self.assertEqual(len(blocks[0]), 2) self.assertEqual(len(blocks[1]), 2) def test_collect_gates_from_dagcircuit_2(self): """Test collecting both CX and Z gates from DAGCircuits.""" qc = QuantumCircuit(5) qc.cx(0, 1) qc.cx(0, 2) qc.z(0) qc.cx(0, 3) qc.cx(0, 4) block_collector = BlockCollector(circuit_to_dag(qc)) blocks = block_collector.collect_all_matching_blocks( lambda node: node.op.name in ["cx", "z"], split_blocks=False, min_block_size=1, ) # All of the gates are part of a single block self.assertEqual(len(blocks), 1) self.assertEqual(len(blocks[0]), 5) def test_collect_gates_from_dagcircuit_3(self): """Test collecting CX gates from DAGCircuits.""" qc = QuantumCircuit(5) qc.cx(0, 1) qc.cx(0, 2) qc.z(0) qc.cx(1, 3) qc.cx(0, 3) qc.cx(0, 4) block_collector = BlockCollector(circuit_to_dag(qc)) blocks = block_collector.collect_all_matching_blocks( lambda node: node.op.name in ["cx"], split_blocks=False, min_block_size=1, ) # We should end up with two CX blocks: even though there is "a path # around z(0)", without commutativity analysis z(0) prevents from # including all CX-gates into the same block self.assertEqual(len(blocks), 2) def test_collect_gates_from_dagdependency_1(self): """Test collecting CX gates from DAGDependency.""" qc = QuantumCircuit(5) qc.cx(0, 1) qc.cx(0, 2) qc.z(0) qc.cx(0, 3) qc.cx(0, 4) block_collector = BlockCollector(circuit_to_dagdependency(qc)) blocks = block_collector.collect_all_matching_blocks( lambda node: node.op.name == "cx", split_blocks=False, min_block_size=1, ) # The middle z-gate commutes with CX-gates, which leads to a single block of length 4 self.assertEqual(len(blocks), 1) self.assertEqual(len(blocks[0]), 4) def test_collect_gates_from_dagdependency_2(self): """Test collecting both CX and Z gates from DAGDependency.""" qc = QuantumCircuit(5) qc.cx(0, 1) qc.cx(0, 2) qc.z(0) qc.cx(0, 3) qc.cx(0, 4) block_collector = BlockCollector(circuit_to_dagdependency(qc)) blocks = block_collector.collect_all_matching_blocks( lambda node: node.op.name in ["cx", "z"], split_blocks=False, min_block_size=1, ) # All the gates are part of a single block self.assertEqual(len(blocks), 1) self.assertEqual(len(blocks[0]), 5) def test_collect_and_split_gates_from_dagcircuit(self): """Test collecting and splitting blocks from DAGCircuit.""" qc = QuantumCircuit(6) qc.cx(0, 1) qc.cx(3, 5) qc.cx(2, 4) qc.swap(1, 0) qc.cz(5, 3) block_collector = BlockCollector(circuit_to_dag(qc)) blocks = block_collector.collect_all_matching_blocks( lambda node: True, split_blocks=False, min_block_size=1, ) # All the gates are part of a single block self.assertEqual(len(blocks), 1) self.assertEqual(len(blocks[0]), 5) # Split the first block into sub-blocks over disjoint qubit sets # We should get 3 sub-blocks split_blocks = BlockSplitter().run(blocks[0]) self.assertEqual(len(split_blocks), 3) def test_collect_and_split_gates_from_dagdependency(self): """Test collecting and splitting blocks from DAGDependecy.""" qc = QuantumCircuit(6) qc.cx(0, 1) qc.cx(3, 5) qc.cx(2, 4) qc.swap(1, 0) qc.cz(5, 3) block_collector = BlockCollector(circuit_to_dagdependency(qc)) blocks = block_collector.collect_all_matching_blocks( lambda node: True, split_blocks=False, min_block_size=1, ) # All the gates are part of a single block self.assertEqual(len(blocks), 1) self.assertEqual(len(blocks[0]), 5) # Split the first block into sub-blocks over disjoint qubit sets # We should get 3 sub-blocks split_blocks = BlockSplitter().run(blocks[0]) self.assertEqual(len(split_blocks), 3) def test_circuit_has_measure(self): """Test that block collection works properly when there is a measure in the middle of the circuit.""" qc = QuantumCircuit(2, 1) qc.cx(1, 0) qc.x(0) qc.x(1) qc.measure(0, 0) qc.x(0) qc.cx(1, 0) block_collector = BlockCollector(circuit_to_dag(qc)) blocks = block_collector.collect_all_matching_blocks( lambda node: node.op.name in ["x", "cx"], split_blocks=False, min_block_size=1, ) # measure prevents combining the two blocks self.assertEqual(len(blocks), 2) self.assertEqual(len(blocks[0]), 3) self.assertEqual(len(blocks[1]), 2) def test_circuit_has_measure_dagdependency(self): """Test that block collection works properly when there is a measure in the middle of the circuit.""" qc = QuantumCircuit(2, 1) qc.cx(1, 0) qc.x(0) qc.x(1) qc.measure(0, 0) qc.x(0) qc.cx(1, 0) block_collector = BlockCollector(circuit_to_dagdependency(qc)) blocks = block_collector.collect_all_matching_blocks( lambda node: node.op.name in ["x", "cx"], split_blocks=False, min_block_size=1, ) # measure prevents combining the two blocks self.assertEqual(len(blocks), 2) self.assertEqual(len(blocks[0]), 3) self.assertEqual(len(blocks[1]), 2) def test_circuit_has_conditional_gates(self): """Test that block collection works properly when there the circuit contains conditional gates.""" qc = QuantumCircuit(2, 1) qc.x(0) qc.x(1) qc.cx(1, 0) qc.x(1).c_if(0, 1) qc.x(0) qc.x(1) qc.cx(0, 1) # If the filter_function does not look at conditions, we should collect all # gates into the block. block_collector = BlockCollector(circuit_to_dag(qc)) blocks = block_collector.collect_all_matching_blocks( lambda node: node.op.name in ["x", "cx"], split_blocks=False, min_block_size=1, ) self.assertEqual(len(blocks), 1) self.assertEqual(len(blocks[0]), 7) # If the filter_function does look at conditions, we should not collect the middle # conditional gate (note that x(1) following the measure is collected into the first # block). block_collector = BlockCollector(circuit_to_dag(qc)) blocks = block_collector.collect_all_matching_blocks( lambda node: node.op.name in ["x", "cx"] and not getattr(node.op, "condition", None), split_blocks=False, min_block_size=1, ) self.assertEqual(len(blocks), 2) self.assertEqual(len(blocks[0]), 4) self.assertEqual(len(blocks[1]), 2) def test_circuit_has_conditional_gates_dagdependency(self): """Test that block collection works properly when there the circuit contains conditional gates.""" qc = QuantumCircuit(2, 1) qc.x(0) qc.x(1) qc.cx(1, 0) qc.x(1).c_if(0, 1) qc.x(0) qc.x(1) qc.cx(0, 1) # If the filter_function does not look at conditions, we should collect all # gates into the block. block_collector = BlockCollector(circuit_to_dagdependency(qc)) blocks = block_collector.collect_all_matching_blocks( lambda node: node.op.name in ["x", "cx"], split_blocks=False, min_block_size=1, ) self.assertEqual(len(blocks), 1) self.assertEqual(len(blocks[0]), 7) # If the filter_function does look at conditions, we should not collect the middle # conditional gate (note that x(1) following the measure is collected into the first # block). block_collector = BlockCollector(circuit_to_dag(qc)) blocks = block_collector.collect_all_matching_blocks( lambda node: node.op.name in ["x", "cx"] and not getattr(node.op, "condition", None), split_blocks=False, min_block_size=1, ) self.assertEqual(len(blocks), 2) self.assertEqual(len(blocks[0]), 4) self.assertEqual(len(blocks[1]), 2) def test_multiple_collection_methods(self): """Test that block collection allows to collect blocks using several different filter functions.""" qc = QuantumCircuit(5) qc.cx(0, 1) qc.cx(0, 2) qc.swap(1, 4) qc.swap(4, 3) qc.z(0) qc.z(1) qc.z(2) qc.z(3) qc.z(4) qc.swap(3, 4) qc.cx(0, 3) qc.cx(0, 4) block_collector = BlockCollector(circuit_to_dag(qc)) linear_blocks = block_collector.collect_all_matching_blocks( lambda node: node.op.name in ["cx", "swap"], split_blocks=False, min_block_size=1, ) cx_blocks = block_collector.collect_all_matching_blocks( lambda node: node.op.name in ["cx"], split_blocks=False, min_block_size=1, ) swapz_blocks = block_collector.collect_all_matching_blocks( lambda node: node.op.name in ["swap", "z"], split_blocks=False, min_block_size=1, ) # We should end up with two linear blocks self.assertEqual(len(linear_blocks), 2) self.assertEqual(len(linear_blocks[0]), 4) self.assertEqual(len(linear_blocks[1]), 3) # We should end up with two cx blocks self.assertEqual(len(cx_blocks), 2) self.assertEqual(len(cx_blocks[0]), 2) self.assertEqual(len(cx_blocks[1]), 2) # We should end up with one swap,z blocks self.assertEqual(len(swapz_blocks), 1) self.assertEqual(len(swapz_blocks[0]), 8) def test_min_block_size(self): """Test that the option min_block_size for collecting blocks works correctly.""" # original circuit circuit = QuantumCircuit(2) circuit.cx(0, 1) circuit.h(0) circuit.cx(0, 1) circuit.cx(1, 0) circuit.h(0) circuit.cx(0, 1) circuit.cx(1, 0) circuit.cx(0, 1) block_collector = BlockCollector(circuit_to_dag(circuit)) # When min_block_size = 1, we should obtain 3 linear blocks blocks = block_collector.collect_all_matching_blocks( lambda node: node.op.name in ["cx", "swap"], split_blocks=False, min_block_size=1, ) self.assertEqual(len(blocks), 3) # When min_block_size = 2, we should obtain 2 linear blocks blocks = block_collector.collect_all_matching_blocks( lambda node: node.op.name in ["cx", "swap"], split_blocks=False, min_block_size=2, ) self.assertEqual(len(blocks), 2) # When min_block_size = 3, we should obtain 1 linear block blocks = block_collector.collect_all_matching_blocks( lambda node: node.op.name in ["cx", "swap"], split_blocks=False, min_block_size=3, ) self.assertEqual(len(blocks), 1) # When min_block_size = 4, we should obtain no linear blocks blocks = block_collector.collect_all_matching_blocks( lambda node: node.op.name in ["cx", "swap"], split_blocks=False, min_block_size=4, ) self.assertEqual(len(blocks), 0) def test_split_blocks(self): """Test that splitting blocks of nodes into sub-blocks works correctly.""" # original circuit is linear circuit = QuantumCircuit(5) circuit.cx(0, 2) circuit.cx(1, 4) circuit.cx(2, 0) circuit.cx(0, 3) circuit.swap(3, 2) circuit.swap(4, 1) block_collector = BlockCollector(circuit_to_dag(circuit)) # If we do not split block into sub-blocks, we expect a single linear block. blocks = block_collector.collect_all_matching_blocks( lambda node: node.op.name in ["cx", "swap"], split_blocks=False, min_block_size=2, ) self.assertEqual(len(blocks), 1) # If we do split block into sub-blocks, we expect two linear blocks: # one over qubits {0, 2, 3}, and another over qubits {1, 4}. blocks = block_collector.collect_all_matching_blocks( lambda node: node.op.name in ["cx", "swap"], split_blocks=True, min_block_size=2, ) self.assertEqual(len(blocks), 2) def test_do_not_split_blocks(self): """Test that splitting blocks of nodes into sub-blocks works correctly.""" # original circuit is linear circuit = QuantumCircuit(5) circuit.cx(0, 3) circuit.cx(0, 2) circuit.cx(1, 4) circuit.swap(4, 2) block_collector = BlockCollector(circuit_to_dagdependency(circuit)) # Check that we have a single linear block blocks = block_collector.collect_all_matching_blocks( lambda node: node.op.name in ["cx", "swap"], split_blocks=True, min_block_size=1, ) self.assertEqual(len(blocks), 1) def test_collect_blocks_with_cargs(self): """Test collecting and collapsing blocks with classical bits appearing as cargs.""" qc = QuantumCircuit(3) qc.h(0) qc.h(1) qc.h(2) qc.measure_all() dag = circuit_to_dag(qc) # Collect all measure instructions blocks = BlockCollector(dag).collect_all_matching_blocks( lambda node: isinstance(node.op, Measure), split_blocks=False, min_block_size=1 ) # We should have a single block consisting of 3 measures self.assertEqual(len(blocks), 1) self.assertEqual(len(blocks[0]), 3) self.assertEqual(blocks[0][0].op, Measure()) self.assertEqual(blocks[0][1].op, Measure()) self.assertEqual(blocks[0][2].op, Measure()) def _collapse_fn(circuit): op = circuit_to_instruction(circuit) op.name = "COLLAPSED" return op # Collapse block with measures into a single "COLLAPSED" block dag = BlockCollapser(dag).collapse_to_operation(blocks, _collapse_fn) collapsed_qc = dag_to_circuit(dag) self.assertEqual(len(collapsed_qc.data), 5) self.assertEqual(collapsed_qc.data[0].operation.name, "h") self.assertEqual(collapsed_qc.data[1].operation.name, "h") self.assertEqual(collapsed_qc.data[2].operation.name, "h") self.assertEqual(collapsed_qc.data[3].operation.name, "barrier") self.assertEqual(collapsed_qc.data[4].operation.name, "COLLAPSED") self.assertEqual(collapsed_qc.data[4].operation.definition.num_qubits, 3) self.assertEqual(collapsed_qc.data[4].operation.definition.num_clbits, 3) def test_collect_blocks_with_cargs_dagdependency(self): """Test collecting and collapsing blocks with classical bits appearing as cargs, using DAGDependency.""" qc = QuantumCircuit(3) qc.h(0) qc.h(1) qc.h(2) qc.measure_all() dag = circuit_to_dagdependency(qc) # Collect all measure instructions blocks = BlockCollector(dag).collect_all_matching_blocks( lambda node: isinstance(node.op, Measure), split_blocks=False, min_block_size=1 ) # We should have a single block consisting of 3 measures self.assertEqual(len(blocks), 1) self.assertEqual(len(blocks[0]), 3) self.assertEqual(blocks[0][0].op, Measure()) self.assertEqual(blocks[0][1].op, Measure()) self.assertEqual(blocks[0][2].op, Measure()) def _collapse_fn(circuit): op = circuit_to_instruction(circuit) op.name = "COLLAPSED" return op # Collapse block with measures into a single "COLLAPSED" block dag = BlockCollapser(dag).collapse_to_operation(blocks, _collapse_fn) collapsed_qc = dagdependency_to_circuit(dag) self.assertEqual(len(collapsed_qc.data), 5) self.assertEqual(collapsed_qc.data[0].operation.name, "h") self.assertEqual(collapsed_qc.data[1].operation.name, "h") self.assertEqual(collapsed_qc.data[2].operation.name, "h") self.assertEqual(collapsed_qc.data[3].operation.name, "barrier") self.assertEqual(collapsed_qc.data[4].operation.name, "COLLAPSED") self.assertEqual(collapsed_qc.data[4].operation.definition.num_qubits, 3) self.assertEqual(collapsed_qc.data[4].operation.definition.num_clbits, 3) def test_collect_blocks_with_clbits(self): """Test collecting and collapsing blocks with classical bits appearing under condition.""" qc = QuantumCircuit(4, 3) qc.cx(0, 1).c_if(0, 1) qc.cx(2, 3) qc.cx(1, 2) qc.cx(0, 1) qc.cx(2, 3).c_if(1, 0) dag = circuit_to_dag(qc) # Collect all cx gates (including the conditional ones) blocks = BlockCollector(dag).collect_all_matching_blocks( lambda node: node.op.name == "cx", split_blocks=False, min_block_size=1 ) # We should have a single block consisting of all CX nodes self.assertEqual(len(blocks), 1) self.assertEqual(len(blocks[0]), 5) def _collapse_fn(circuit): op = circuit_to_instruction(circuit) op.name = "COLLAPSED" return op # Collapse block with measures into a single "COLLAPSED" block dag = BlockCollapser(dag).collapse_to_operation(blocks, _collapse_fn) collapsed_qc = dag_to_circuit(dag) self.assertEqual(len(collapsed_qc.data), 1) self.assertEqual(collapsed_qc.data[0].operation.name, "COLLAPSED") self.assertEqual(collapsed_qc.data[0].operation.definition.num_qubits, 4) self.assertEqual(collapsed_qc.data[0].operation.definition.num_clbits, 2) def test_collect_blocks_with_clbits_dagdependency(self): """Test collecting and collapsing blocks with classical bits appearing under conditions, using DAGDependency.""" qc = QuantumCircuit(4, 3) qc.cx(0, 1).c_if(0, 1) qc.cx(2, 3) qc.cx(1, 2) qc.cx(0, 1) qc.cx(2, 3).c_if(1, 0) dag = circuit_to_dagdependency(qc) # Collect all cx gates (including the conditional ones) blocks = BlockCollector(dag).collect_all_matching_blocks( lambda node: node.op.name == "cx", split_blocks=False, min_block_size=1 ) # We should have a single block consisting of all CX nodes self.assertEqual(len(blocks), 1) self.assertEqual(len(blocks[0]), 5) def _collapse_fn(circuit): op = circuit_to_instruction(circuit) op.name = "COLLAPSED" return op # Collapse block with measures into a single "COLLAPSED" block dag = BlockCollapser(dag).collapse_to_operation(blocks, _collapse_fn) collapsed_qc = dagdependency_to_circuit(dag) self.assertEqual(len(collapsed_qc.data), 1) self.assertEqual(collapsed_qc.data[0].operation.name, "COLLAPSED") self.assertEqual(collapsed_qc.data[0].operation.definition.num_qubits, 4) self.assertEqual(collapsed_qc.data[0].operation.definition.num_clbits, 2) def test_collect_blocks_with_clbits2(self): """Test collecting and collapsing blocks with classical bits appearing under condition.""" qreg = QuantumRegister(4, "qr") creg = ClassicalRegister(3, "cr") cbit = Clbit() qc = QuantumCircuit(qreg, creg, [cbit]) qc.cx(0, 1).c_if(creg[1], 1) qc.cx(2, 3).c_if(cbit, 0) qc.cx(1, 2) qc.cx(0, 1).c_if(creg[2], 1) dag = circuit_to_dag(qc) # Collect all cx gates (including the conditional ones) blocks = BlockCollector(dag).collect_all_matching_blocks( lambda node: node.op.name == "cx", split_blocks=False, min_block_size=1 ) # We should have a single block consisting of all CX nodes self.assertEqual(len(blocks), 1) self.assertEqual(len(blocks[0]), 4) def _collapse_fn(circuit): op = circuit_to_instruction(circuit) op.name = "COLLAPSED" return op # Collapse block with measures into a single "COLLAPSED" block dag = BlockCollapser(dag).collapse_to_operation(blocks, _collapse_fn) collapsed_qc = dag_to_circuit(dag) self.assertEqual(len(collapsed_qc.data), 1) self.assertEqual(collapsed_qc.data[0].operation.name, "COLLAPSED") self.assertEqual(collapsed_qc.data[0].operation.definition.num_qubits, 4) self.assertEqual(collapsed_qc.data[0].operation.definition.num_clbits, 3) def test_collect_blocks_with_clbits2_dagdependency(self): """Test collecting and collapsing blocks with classical bits appearing under condition, using DAGDependency.""" qreg = QuantumRegister(4, "qr") creg = ClassicalRegister(3, "cr") cbit = Clbit() qc = QuantumCircuit(qreg, creg, [cbit]) qc.cx(0, 1).c_if(creg[1], 1) qc.cx(2, 3).c_if(cbit, 0) qc.cx(1, 2) qc.cx(0, 1).c_if(creg[2], 1) dag = circuit_to_dag(qc) # Collect all cx gates (including the conditional ones) blocks = BlockCollector(dag).collect_all_matching_blocks( lambda node: node.op.name == "cx", split_blocks=False, min_block_size=1 ) # We should have a single block consisting of all CX nodes self.assertEqual(len(blocks), 1) self.assertEqual(len(blocks[0]), 4) def _collapse_fn(circuit): op = circuit_to_instruction(circuit) op.name = "COLLAPSED" return op # Collapse block with measures into a single "COLLAPSED" block dag = BlockCollapser(dag).collapse_to_operation(blocks, _collapse_fn) collapsed_qc = dag_to_circuit(dag) self.assertEqual(len(collapsed_qc.data), 1) self.assertEqual(collapsed_qc.data[0].operation.name, "COLLAPSED") self.assertEqual(collapsed_qc.data[0].operation.definition.num_qubits, 4) self.assertEqual(collapsed_qc.data[0].operation.definition.num_clbits, 3) def test_collect_blocks_with_cregs(self): """Test collecting and collapsing blocks with classical registers appearing under condition.""" qreg = QuantumRegister(4, "qr") creg = ClassicalRegister(3, "cr") creg2 = ClassicalRegister(2, "cr2") qc = QuantumCircuit(qreg, creg, creg2) qc.cx(0, 1).c_if(creg, 3) qc.cx(1, 2) qc.cx(0, 1).c_if(creg[2], 1) dag = circuit_to_dag(qc) # Collect all cx gates (including the conditional ones) blocks = BlockCollector(dag).collect_all_matching_blocks( lambda node: node.op.name == "cx", split_blocks=False, min_block_size=1 ) # We should have a single block consisting of all CX nodes self.assertEqual(len(blocks), 1) self.assertEqual(len(blocks[0]), 3) def _collapse_fn(circuit): op = circuit_to_instruction(circuit) op.name = "COLLAPSED" return op # Collapse block with measures into a single "COLLAPSED" block dag = BlockCollapser(dag).collapse_to_operation(blocks, _collapse_fn) collapsed_qc = dag_to_circuit(dag) self.assertEqual(len(collapsed_qc.data), 1) self.assertEqual(collapsed_qc.data[0].operation.name, "COLLAPSED") self.assertEqual(len(collapsed_qc.data[0].operation.definition.cregs), 1) self.assertEqual(collapsed_qc.data[0].operation.definition.num_qubits, 3) self.assertEqual(collapsed_qc.data[0].operation.definition.num_clbits, 3) def test_collect_blocks_with_cregs_dagdependency(self): """Test collecting and collapsing blocks with classical registers appearing under condition, using DAGDependency.""" qreg = QuantumRegister(4, "qr") creg = ClassicalRegister(3, "cr") creg2 = ClassicalRegister(2, "cr2") qc = QuantumCircuit(qreg, creg, creg2) qc.cx(0, 1).c_if(creg, 3) qc.cx(1, 2) qc.cx(0, 1).c_if(creg[2], 1) dag = circuit_to_dagdependency(qc) # Collect all cx gates (including the conditional ones) blocks = BlockCollector(dag).collect_all_matching_blocks( lambda node: node.op.name == "cx", split_blocks=False, min_block_size=1 ) # We should have a single block consisting of all CX nodes self.assertEqual(len(blocks), 1) self.assertEqual(len(blocks[0]), 3) def _collapse_fn(circuit): op = circuit_to_instruction(circuit) op.name = "COLLAPSED" return op # Collapse block with measures into a single "COLLAPSED" block dag = BlockCollapser(dag).collapse_to_operation(blocks, _collapse_fn) collapsed_qc = dagdependency_to_circuit(dag) self.assertEqual(len(collapsed_qc.data), 1) self.assertEqual(collapsed_qc.data[0].operation.name, "COLLAPSED") self.assertEqual(len(collapsed_qc.data[0].operation.definition.cregs), 1) self.assertEqual(collapsed_qc.data[0].operation.definition.num_qubits, 3) self.assertEqual(collapsed_qc.data[0].operation.definition.num_clbits, 3) def test_collect_blocks_backwards_dagcircuit(self): """Test collecting H gates from DAGCircuit in the forward vs. the reverse directions.""" qc = QuantumCircuit(4) qc.h(0) qc.h(1) qc.h(2) qc.h(3) qc.cx(1, 2) qc.z(0) qc.z(1) qc.z(2) qc.z(3) block_collector = BlockCollector(circuit_to_dag(qc)) # When collecting in the forward direction, there are two blocks of # single-qubit gates: the first of size 6, and the second of size 2. blocks = block_collector.collect_all_matching_blocks( lambda node: node.op.name in ["h", "z"], split_blocks=False, min_block_size=1, collect_from_back=False, ) self.assertEqual(len(blocks), 2) self.assertEqual(len(blocks[0]), 6) self.assertEqual(len(blocks[1]), 2) # When collecting in the backward direction, there are also two blocks of # single-qubit ates: but now the first is of size 2, and the second is of size 6. blocks = block_collector.collect_all_matching_blocks( lambda node: node.op.name in ["h", "z"], split_blocks=False, min_block_size=1, collect_from_back=True, ) self.assertEqual(len(blocks), 2) self.assertEqual(len(blocks[0]), 2) self.assertEqual(len(blocks[1]), 6) def test_collect_blocks_backwards_dagdependency(self): """Test collecting H gates from DAGDependency in the forward vs. the reverse directions.""" qc = QuantumCircuit(4) qc.z(0) qc.z(1) qc.z(2) qc.z(3) qc.cx(1, 2) qc.h(0) qc.h(1) qc.h(2) qc.h(3) block_collector = BlockCollector(circuit_to_dagdependency(qc)) # When collecting in the forward direction, there are two blocks of # single-qubit gates: the first of size 6, and the second of size 2. blocks = block_collector.collect_all_matching_blocks( lambda node: node.op.name in ["h", "z"], split_blocks=False, min_block_size=1, collect_from_back=False, ) self.assertEqual(len(blocks), 2) self.assertEqual(len(blocks[0]), 6) self.assertEqual(len(blocks[1]), 2) # When collecting in the backward direction, there are also two blocks of # single-qubit ates: but now the first is of size 1, and the second is of size 7 # (note that z(1) and CX(1, 2) commute). blocks = block_collector.collect_all_matching_blocks( lambda node: node.op.name in ["h", "z"], split_blocks=False, min_block_size=1, collect_from_back=True, ) self.assertEqual(len(blocks), 2) self.assertEqual(len(blocks[0]), 1) self.assertEqual(len(blocks[1]), 7) def test_split_layers_dagcircuit(self): """Test that splitting blocks of nodes into layers works correctly.""" # original circuit is linear circuit = QuantumCircuit(5) circuit.cx(0, 2) circuit.cx(1, 4) circuit.cx(2, 0) circuit.cx(0, 3) circuit.swap(3, 2) circuit.swap(4, 1) block_collector = BlockCollector(circuit_to_dag(circuit)) # If we split the gates into depth-1 layers, we expect four linear blocks: # CX(0, 2), CX(1, 4) # CX(2, 0), CX(4, 1) # CX(0, 3) # CX(3, 2) blocks = block_collector.collect_all_matching_blocks( lambda node: node.op.name in ["cx", "swap"], split_blocks=False, min_block_size=1, split_layers=True, ) self.assertEqual(len(blocks), 4) self.assertEqual(len(blocks[0]), 2) self.assertEqual(len(blocks[1]), 2) self.assertEqual(len(blocks[2]), 1) self.assertEqual(len(blocks[3]), 1) def test_split_layers_dagdependency(self): """Test that splitting blocks of nodes into layers works correctly.""" # original circuit is linear circuit = QuantumCircuit(5) circuit.cx(0, 2) circuit.cx(1, 4) circuit.cx(2, 0) circuit.cx(0, 3) circuit.swap(3, 2) circuit.swap(4, 1) block_collector = BlockCollector(circuit_to_dagdependency(circuit)) # If we split the gates into depth-1 layers, we expect four linear blocks: # CX(0, 2), CX(1, 4) # CX(2, 0), CX(4, 1) # CX(0, 3) # CX(3, 2) blocks = block_collector.collect_all_matching_blocks( lambda node: node.op.name in ["cx", "swap"], split_blocks=False, min_block_size=1, split_layers=True, ) self.assertEqual(len(blocks), 4) self.assertEqual(len(blocks[0]), 2) self.assertEqual(len(blocks[1]), 2) self.assertEqual(len(blocks[2]), 1) self.assertEqual(len(blocks[3]), 1) if __name__ == "__main__": unittest.main()
https://github.com/HuangJunye/Qiskit-for-GameDev
HuangJunye
import sys sys.path.append('/Users/kirais/Documents/GitHub/Qiskit-for-GameDev/pygame/') from qgame import CircuitGridModel, CircuitGridNode from qgame import circuit_node_types as node_types from qiskit import QuantumCircuit circuit_grid_model = CircuitGridModel(qubit_count=3, circuit_depth=6) print(circuit_grid_model) qasm_str = circuit_grid_model.create_qasm_for_circuit() print(qasm_str) circuit = QuantumCircuit.from_qasm_str(qasm_str) circuit.draw() print(CircuitGridNode(node_types.X)) circuit_grid_model.set_node(qubit_index=1,depth_index=0,circuit_grid_node=CircuitGridNode(node_types.X)) print(circuit_grid_model) qasm_str = circuit_grid_model.create_qasm_for_circuit() print(qasm_str) circuit = QuantumCircuit.from_qasm_str(qasm_str) circuit.draw() circuit_grid_model.set_node(0,1,CircuitGridNode(node_types.H)) circuit_grid_model.set_node(2,1,CircuitGridNode(node_types.H)) print(circuit_grid_model) qasm_str = circuit_grid_model.create_qasm_for_circuit() print(qasm_str) circuit = QuantumCircuit.from_qasm_str(qasm_str) circuit.draw() from qiskit import BasicAer, execute, ClassicalRegister def paddle_before_measurement(circuit, qubit_num, shot_num): backend_sv_sim = BasicAer.get_backend('statevector_simulator') job_sim = execute(circuit, backend_sv_sim, shots=shot_num) result_sim = job_sim.result() state = result_sim.get_statevector(circuit, decimals=3) probability = (state*state).real return probability probability = paddle_before_measurement(circuit, 3, 1000) print(probability) from matplotlib import pyplot as plt from matplotlib.patches import Rectangle plt.figure(figsize=(20,1)) ax = plt.gca() for i in range(8): ax.add_patch(Rectangle((i/8, 0), 1/8, 1, alpha=probability[i]+0.05, fc='k', ec='k')) # add statvector labels ax.text(0/8+1/40,-1,r"$\left|000\right\rangle$", fontsize=36) ax.text(1/8+1/40,-1,r"$\left|001\right\rangle$", fontsize=36) ax.text(2/8+1/40,-1,r"$\left|010\right\rangle$", fontsize=36) ax.text(3/8+1/40,-1,r"$\left|011\right\rangle$", fontsize=36) ax.text(4/8+1/40,-1,r"$\left|100\right\rangle$", fontsize=36) ax.text(5/8+1/40,-1,r"$\left|101\right\rangle$", fontsize=36) ax.text(6/8+1/40,-1,r"$\left|110\right\rangle$", fontsize=36) ax.text(7/8+1/40,-1,r"$\left|110\right\rangle$", fontsize=36) plt.axis('off') plt.show() from copy import deepcopy def paddle_after_measurement(circuit, qubit_num, shot_num): backend_sv_sim = BasicAer.get_backend('qasm_simulator') circuit.measure(circuit.qregs[0], circuit.cregs[0]) job_sim = execute(circuit, backend_sv_sim, shots=shot_num) result_sim = job_sim.result() counts = result_sim.get_counts(circuit) return int(list(counts.keys())[0], 2) result = paddle_after_measurement(circuit, 3, 100) print(result) from matplotlib import pyplot as plt from matplotlib.patches import Rectangle plt.figure(figsize=(20,1)) ax = plt.gca() for i in range(8): if i == result: ax.add_patch(Rectangle((i/8, 0), 1/8, 1, alpha=1, fc='k', ec='k')) else: ax.add_patch(Rectangle((i/8, 0), 1/8, 1, alpha=0, fc='k', ec='k')) # add statvector labels ax.text(0/8+1/40,-1,r"$\left|000\right\rangle$", fontsize=36) ax.text(1/8+1/40,-1,r"$\left|001\right\rangle$", fontsize=36) ax.text(2/8+1/40,-1,r"$\left|010\right\rangle$", fontsize=36) ax.text(3/8+1/40,-1,r"$\left|011\right\rangle$", fontsize=36) ax.text(4/8+1/40,-1,r"$\left|100\right\rangle$", fontsize=36) ax.text(5/8+1/40,-1,r"$\left|101\right\rangle$", fontsize=36) ax.text(6/8+1/40,-1,r"$\left|110\right\rangle$", fontsize=36) ax.text(7/8+1/40,-1,r"$\left|110\right\rangle$", fontsize=36) plt.axis('off') plt.show()
https://github.com/rodolfocarobene/SPVQE
rodolfocarobene
import itertools import warnings import numpy as np import PySimpleGUI as psg from qiskit import IBMQ, Aer from qiskit.algorithms.optimizers import ADAM, CG, COBYLA, L_BFGS_B, NFT, SPSA from qiskit.ignis.mitigation import CompleteMeasFitter from qiskit.providers.aer import QasmSimulator from qiskit.providers.aer.noise import NoiseModel from qiskit.utils import QuantumInstance from qiskit_nature.converters.second_quantization import QubitConverter from qiskit_nature.mappers.second_quantization import ParityMapper warnings.simplefilter("ignore") def get_default_opt(): print("Loading default values") values = { "molecule": "H3+", "spin": 0, "charge": 0, "basis": ["sto-6g"], "varforms": ["TwoLocal"], "backend": ["hardware"], "noise": ["None"], "shots": 2048, "correction": ["False"], "optimizer": ["SPSA"], "dist_min": 1.4, "dist_max": 3.5, "dist_delta": 11, "lagrangiana": ["True", "Series"], "lag_op": ["spin-squared"], "lag_value_num": 2, "lag_mult_num_min": 1, "lag_mult_num_max": 4, "lag_mult_num_delta": 10, "lag_value_spin2": 0, "lag_mult_spin2_min": 0.5, "lag_mult_spin2_max": 4, "lag_mult_spin2_delta": 10, "lag_value_spinz": 0, "lag_mult_spinz_min": 0.2, "lag_mult_spinz_max": 0.2, "lag_mult_spinz_delta": 0.1, "series_itermax_min": 5, "series_itermax_max": 20, "series_itermax_step": 25, "series_step_min": 0.1, "series_step_max": 1, "series_step_step": 9, "series_lamb_min": 2, "series_lamb_max": 6, "series_lamb_step": 10, } return values def get_layout(): possible_molecules = [ "H3+", "H2", "H2+", "H2*", "H2-", "H2--", "H4", "H4*", "Li2", "Li2+", "LiH", "H2O", "C2H4", "N2", "Li3+", "Na-", "HeH+", ] possible_forms = ["TwoLocal", "SO(4)", "UCCSD", "EfficientSU(2)"] possible_basis = ["sto-3g", "sto-6g"] possible_noise = ["None", "ibmq_santiago", "ibmq_bogota", "ibm_perth", "ibmq_lima"] possible_bool = ["True", "False"] possible_lag = ["True", "False", "Series", "AUGSeries"] possible_optim = ["COBYLA", "CG", "SPSA", "L_BFGS_B", "ADAM", "NFT"] possible_lag_op = ["number", "spin-squared", "spin-z", "num+spin2", "spin2+spinz", "num+spinz", "num+spin2+spinz"] possible_backend = ["statevector_simulator", "qasm_simulator", "qasm_simulator_online", "hardware", "qasm_gpu"] layout = [ [ psg.Text("Molecola"), psg.Combo(possible_molecules, default_value="H3+", size=(5, 1), key="molecule"), psg.Text("Basis"), psg.Listbox(possible_basis, default_values=["sto-6g"], select_mode="extended", size=(7, 2), key="basis"), ], [ psg.Text("Scegli forma variazionale"), psg.Listbox( possible_forms, default_values=["TwoLocal"], select_mode="extended", size=(12, 4), key="varforms" ), ], [ psg.Text("Scegli il tipo di backend"), psg.Listbox( possible_backend, default_values=["statevector_simulator"], select_mode="extended", size=(17, 4), key="backend", ), psg.Text("shots"), psg.Input(default_text=1024, size=(4, 10), key="shots"), ], [ psg.Text("Scegli l'eventuale rumore"), psg.Listbox(possible_noise, default_values=["None"], select_mode="extended", size=(14, 5), key="noise"), ], [ psg.Text("Correction"), psg.Listbox(possible_bool, default_values=["False"], select_mode="extended", size=(5, 2), key="correction"), ], [ psg.Text("Optimizer"), psg.Listbox( possible_optim, default_values=["COBYLA"], select_mode="extended", size=(8, 6), key="optimizer" ), ], [ psg.Text("Distanze: Min"), psg.Input(default_text=0.3, size=(4, 10), key="dist_min"), psg.Text(" Max"), psg.Input(default_text=3.5, size=(4, 10), key="dist_max"), psg.Text(" Delta"), psg.Input(default_text=0.1, size=(4, 10), key="dist_delta"), ], [ psg.Text("Lagrangiana"), psg.Listbox( possible_lag, default_values=["Series"], select_mode="extended", size=(10, 4), key="lagrangiana" ), ], [ psg.Text("LagSeries(itermax) MIN:"), psg.Input(default_text=10, size=(4, 10), key="series_itermax_min"), psg.Text("MAX: "), psg.Input(default_text=20, size=(4, 10), key="series_itermax_max"), psg.Text("DELTA: "), psg.Input(default_text=20, size=(4, 10), key="series_itermax_step"), ], [ psg.Text("LagSeries(step) MIN:"), psg.Input(default_text=0.2, size=(4, 10), key="series_step_min"), psg.Text("MAX: "), psg.Input(default_text=1, size=(4, 10), key="series_step_max"), psg.Text("DELTA: "), psg.Input(default_text=10, size=(4, 10), key="series_step_step"), ], [ psg.Text("LagSeries(lamb) MIN:"), psg.Input(default_text=2, size=(4, 10), key="series_lamb_min"), psg.Text("MAX: "), psg.Input(default_text=6, size=(4, 10), key="series_lamb_max"), psg.Text("DELTA: "), psg.Input(default_text=10, size=(4, 10), key="series_lamb_step"), ], [ psg.Text("Operatore"), psg.Listbox(possible_lag_op, default_values=["number"], select_mode="extended", size=(18, 7), key="lag_op"), ], [ psg.Text("NUMBER: Value"), psg.Input(default_text=2, size=(4, 10), key="lag_value_num"), psg.Text("Mult: min"), psg.Input(default_text=0.2, size=(4, 10), key="lag_mult_num_min"), psg.Text("max"), psg.Input(default_text=1, size=(4, 10), key="lag_mult_num_max"), psg.Text("delta"), psg.Input(default_text=10, size=(4, 10), key="lag_mult_num_delta"), ], [ psg.Text("SPIN-2: Value"), psg.Input(default_text=0, size=(4, 10), key="lag_value_spin2"), psg.Text("Mult: min"), psg.Input(default_text=0.2, size=(4, 10), key="lag_mult_spin2_min"), psg.Text("max"), psg.Input(default_text=1, size=(4, 10), key="lag_mult_spin2_max"), psg.Text("delta"), psg.Input(default_text=10, size=(4, 10), key="lag_mult_spin2_delta"), ], [ psg.Text("SPIN-Z: Value"), psg.Input(default_text=0, size=(4, 10), key="lag_value_spinz"), psg.Text("Mult: min"), psg.Input(default_text=0.2, size=(4, 10), key="lag_mult_spinz_min"), psg.Text("max"), psg.Input(default_text=1, size=(4, 10), key="lag_mult_spinz_max"), psg.Text("delta"), psg.Input(default_text=10, size=(4, 10), key="lag_mult_spinz_delta"), ], [psg.Button("Inizia calcolo", font=("Times New Roman", 12))], ] return layout def retrive_VQE_options(argv): if "fast" in argv: values = get_default_opt() else: layout = get_layout() win = psg.Window("Definisci opzioni per VQE", layout, resizable=True, font="Lucida", text_justification="left") e_useless, values = win.read() win.close() set_optimizers(values) set_backend_and_noise(values) lagops = set_lagrange_ops(values) if values["dist_min"] >= values["dist_max"]: values["dist_max"] = values["dist_min"] + values["dist_delta"] / 2 options = { "dist": {"min": values["dist_min"], "max": values["dist_max"], "delta": values["dist_delta"]}, "molecule": { "molecule": values["molecule"], "spin": get_spin(values["molecule"]), "charge": get_charge(values["molecule"]), "basis": values["basis"], }, "varforms": values["varforms"], "quantum_instance": values["backend"], "shots": int(values["shots"]), "optimizer": values["optimizer"], "converter": QubitConverter(mapper=ParityMapper(), two_qubit_reduction=True), "lagrange": { "active": values["lagrangiana"], "operators": lagops, }, "series": { "itermax": np.arange( int(values["series_itermax_min"]), int(values["series_itermax_max"]), int(values["series_itermax_step"]) ), "step": np.arange( float(values["series_step_min"]), float(values["series_step_max"]), float(values["series_step_step"]) ), "lamb": np.arange( float(values["series_lamb_min"]), float(values["series_lamb_max"]), float(values["series_lamb_step"]) ), }, } options = set_dist_and_geometry(options) print_chose_options(options) return options def set_ops_num_spin2(values, lagops_list): mults_num = np.arange( float(values["lag_mult_num_min"]), float(values["lag_mult_num_max"]), float(values["lag_mult_num_delta"]) ) mults_spin2 = np.arange( float(values["lag_mult_spin2_min"]), float(values["lag_mult_spin2_max"]), float(values["lag_mult_spin2_delta"]) ) for mult_num in mults_num: for mult_spin2 in mults_spin2: mult_num = np.round(mult_num, 2) mult_spin2 = np.round(mult_spin2, 2) templist = [] templist.append(("number", int(values["lag_value_num"]), mult_num)) templist.append(("spin-squared", int(values["lag_value_spin2"]), mult_spin2)) lagops_list.append(templist) def set_ops_num_spinz(values, lagops_list): mults_num = np.arange( float(values["lag_mult_num_min"]), float(values["lag_mult_num_max"]), float(values["lag_mult_num_delta"]) ) mults_spinz = np.arange( float(values["lag_mult_spinz_min"]), float(values["lag_mult_spinz_max"]), float(values["lag_mult_spinz_delta"]) ) for mult_num in mults_num: for mult_spinz in mults_spinz: mult_num = np.round(mult_num, 2) mult_spinz = np.round(mult_spinz, 2) templist = [] templist.append(("number", int(values["lag_value_num"]), mult_num)) templist.append(("spin-z", int(values["lag_value_spinz"]), mult_spinz)) lagops_list.append(templist) def set_ops_spin2_spinz(values, lagops_list): mults_spin2 = np.arange( float(values["lag_mult_spin2_min"]), float(values["lag_mult_spin2_max"]), float(values["lag_mult_spin2_delta"]) ) mults_spinz = np.arange( float(values["lag_mult_spinz_min"]), float(values["lag_mult_spinz_max"]), float(values["lag_mult_spinz_delta"]) ) for mult_spin2 in mults_spin2: for mult_spinz in mults_spinz: mult_spin2 = np.round(mult_spin2, 2) mult_spinz = np.round(mult_spinz, 2) templist = [] templist.append(("spin-squared", int(values["lag_value_spin2"]), mult_spin2)) templist.append(("spin-z", int(values["lag_value_spinz"]), mult_spinz)) lagops_list.append(templist) def set_ops_num_spin2_spinz(values, lagops_list): mults_spin2 = np.arange( float(values["lag_mult_spin2_min"]), float(values["lag_mult_spin2_max"]), float(values["lag_mult_spin2_delta"]) ) mults_num = np.arange( float(values["lag_mult_num_min"]), float(values["lag_mult_num_max"]), float(values["lag_mult_num_delta"]) ) mults_spinz = np.arange( float(values["lag_mult_spinz_min"]), float(values["lag_mult_spinz_max"]), float(values["lag_mult_spinz_delta"]) ) for mult_spin2 in mults_spin2: for mult_spinz in mults_spinz: for mult_num in mults_num: mult_spin2 = np.round(mult_spin2, 2) mult_spinz = np.round(mult_spinz, 2) mult_num = np.round(mult_num, 2) templist = [] templist.append(("spin-squared", int(values["lag_value_spin2"]), mult_spin2)) templist.append(("spin-z", int(values["lag_value_spinz"]), mult_spinz)) templist.append(("number", int(values["lag_value_num"]), mult_num)) lagops_list.append(templist) def set_ops_num(values, lagops_list, operator): mults = np.arange( float(values["lag_mult_num_min"]), float(values["lag_mult_num_max"]), float(values["lag_mult_num_delta"]) ) for mult in mults: mult = np.round(mult, 2) lagops_list.append([(operator, int(values["lag_value_num"]), mult)]) def set_ops_spin2(values, lagops_list, operator): mults = np.arange( float(values["lag_mult_spin2_min"]), float(values["lag_mult_spin2_max"]), float(values["lag_mult_spin2_delta"]) ) for mult in mults: mult = np.round(mult, 2) lagops_list.append([(operator, int(values["lag_value_spin2"]), mult)]) def set_ops_spinz(values, lagops_list, operator): mults = np.arange( float(values["lag_mult_spinz_min"]), float(values["lag_mult_spinz_max"]), float(values["lag_mult_spinz_delta"]) ) for mult in mults: mult = np.round(mult, 2) lagops_list.append([(operator, int(values["lag_value_spinz"]), mult)]) def set_lagrange_ops(values): if float(values["lag_mult_num_min"]) >= float(values["lag_mult_num_max"]): values["lag_mult_num_max"] = float(values["lag_mult_num_min"]) + float(values["lag_mult_num_delta"]) / 2 if float(values["lag_mult_spin2_min"]) >= float(values["lag_mult_spin2_max"]): values["lag_mult_spin2_max"] = float(values["lag_mult_spin2_min"]) + float(values["lag_mult_spin2_delta"]) / 2 if float(values["lag_mult_spinz_min"]) >= float(values["lag_mult_spinz_max"]): values["lag_mult_spinz_max"] = float(values["lag_mult_spinz_min"]) + float(values["lag_mult_spinz_delta"]) / 2 if values["lagrangiana"] == ["False"]: lagops_list = [[("dummy", 0, 0)]] else: lagops_list = [] for operator in values["lag_op"]: if operator == "number": set_ops_num(values, lagops_list, operator) elif operator == "spin-squared": set_ops_spin2(values, lagops_list, operator) elif operator == "spin-z": set_ops_spinz(values, lagops_list, operator) elif operator == "num+spin2": set_ops_num_spin2(values, lagops_list) elif operator == "num+spinz": set_ops_num_spinz(values, lagops_list) elif operator == "spin2+spinz": set_ops_spin2_spinz(values, lagops_list) elif operator == "num+spin2+spinz": set_ops_num_spin2_spinz(values, lagops_list) return lagops_list def print_chose_options(options): quantum_instance_name = [] for ist in options["quantum_instance"]: quantum_instance_name.append(ist[1]) optimizers_name = [] for opt in options["optimizer"]: optimizers_name.append(opt[1]) print("OPZIONI SCELTE") print("mol_type: ", options["molecule"]["molecule"]) print("charge: ", options["molecule"]["charge"]) print("spin: ", options["molecule"]["spin"]) print("dist: ", options["dists"]) print("basis: ", options["molecule"]["basis"]) print("varforms: ", options["varforms"]) print("instances: ", quantum_instance_name) print("optimizer: ", optimizers_name) if options["lagrange"]["active"][0] != "False": print( "lagrange: ", "\n\tactive: ", options["lagrange"]["active"], "\n\toperator: ", options["lagrange"]["operators"], ) print( "series: ", "\n\titermax: ", options["series"]["itermax"], "\n\tstep: ", options["series"]["step"], "\n\tlamb: ", options["series"]["lamb"], ) def set_optimizers(values): optimizers = [] for opt in values["optimizer"]: if opt == "CG": optimizers.append((CG(maxiter=50), "CG")) elif opt == "COBYLA": optimizers.append((COBYLA(), "COBYLA")) elif opt == "ADAM": optimizers.append((ADAM(maxiter=100), "ADAM")) elif opt == "L_BFGS_B": optimizers.append((L_BFGS_B(maxiter=100), "LBFGSB")) elif opt == "SPSA": optimizers.append((SPSA(maxiter=500), "SPSA")) elif opt == "NFT": optimizers.append((NFT(maxiter=200), "NFT")) values["optimizer"] = optimizers def set_backend_and_noise(values): quantum_instance_list = [] provider = IBMQ.load_account() iteratore = list(itertools.product(values["backend"], values["noise"], values["correction"])) for backend, noise, corr in iteratore: if backend == "statevector_simulator": quantum_instance = QuantumInstance(Aer.get_backend("statevector_simulator")) noise = "None" elif backend == "qasm_simulator": quantum_instance = QuantumInstance( backend=QasmSimulator(), shots=int(values["shots"]) # Aer.get_backend('qasm_simulator'), ) elif backend == "qasm_gpu": quantum_instance = QuantumInstance( backend=Aer.get_backend("qasm_simulator"), backend_options={"method": "statevector_gpu"}, shots=int(values["shots"]), ) elif backend == "qasm_simulator_online": quantum_instance = QuantumInstance( backend=provider.backend.ibmq_qasm_simulator, # provider.get_backend('ibmq_qasm_simulator'), #QasmSimulator(method='statevector'), shots=int(values["shots"]), ) elif backend == "hardware": mybackend = provider.get_backend("ibmq_bogota") # just dummy, for hardware quantum_instance = mybackend if backend == "qasm_simulator" and noise != "None": device = provider.get_backend(noise) coupling_map = device.configuration().coupling_map noise_model = NoiseModel.from_backend(device) quantum_instance.coupling_map = coupling_map quantum_instance.noise_model = noise_model name = backend + "_" + noise if backend == "qasm_simulator" and noise != "None" and corr == "True": quantum_instance.measurement_error_mitigation_cls = CompleteMeasFitter quantum_instance.measurement_error_mitigation_shots = 1000 name += "_corrected" quantum_instance_list.append((quantum_instance, name)) values["backend"] = quantum_instance_list def set_dist_and_geometry(options): minimo = float(options["dist"]["min"]) massimo = float(options["dist"]["max"]) delta = float(options["dist"]["delta"]) dist = np.arange(minimo, massimo, delta) options["dists"] = dist geometries = [] mol_type = options["molecule"]["molecule"] if mol_type == "H3+": alt = np.sqrt(dist**2 - (dist / 2) ** 2, dtype="float64") for i, single_dist in enumerate(dist): geom = "H .0 .0 .0; H .0 .0 " + str(single_dist) geom += "; H .0 " + str(alt[i]) + " " + str(single_dist / 2) geometries.append(geom) elif mol_type == "Na-": geometries.append("Na .0 .0 .0") elif mol_type == "HeH+": for i, single_dist in enumerate(dist): geom = "He .0 .0 .0; H .0 .0 " + str(single_dist) geometries.append(geom) elif mol_type == "Li3+": alt = np.sqrt(dist**2 - (dist / 2) ** 2, dtype="float64") for i, single_dist in enumerate(dist): geom = "Li .0 .0 .0; Li .0 .0 " + str(single_dist) geom += "; Li .0 " + str(alt[i]) + " " + str(single_dist / 2) geometries.append(geom) elif mol_type == "C2H4": bot_alt = np.sin(180 - 121.3) * 1.087 fixed_dist = np.cos(180 - 121.3) * 1.087 for i, single_dist in enumerate(dist): top_alt = np.sin(180 - 121.3) * single_dist geom1 = "H " + str(-fixed_dist) + " " + str(top_alt) + " 0.0; " geom2 = "H " + str(-fixed_dist) + " " + str(-bot_alt) + " 0.0; " geom3 = "C 0.0 0.0 0.0; C " + str(single_dist) + " 0.0 0.0; " geom4 = "H " + str(fixed_dist) + " " + str(top_alt) + " 0.0; " geom5 = "H " + str(fixed_dist) + " " + str(-bot_alt) + " 0.0" geom = geom1 + geom2 + geom3 + geom4 + geom5 geometries.append(geom) elif "H2O" in mol_type: for single_dist in dist: alt = single_dist * np.cos(0.25) lung = single_dist * np.sin(0.25) + 0.9584 geom = "H .0 .0 .0; O .0 .0 0.9584; H .0 " + str(alt) + " " + str(lung) geometries.append(geom) elif "H2" in mol_type: for single_dist in dist: geom = "H .0 .0 .0; H .0 .0 " + str(single_dist) geometries.append(geom) elif "N2" in mol_type: for single_dist in dist: geom = "N .0 .0 .0; N .0 .0 " + str(single_dist) geometries.append(geom) elif "H4" in mol_type: for single_dist in dist: geom = "H .0 .0 .0; H .0 .0 " + str(single_dist) geom += "; H .0 .0 " + str(2 * single_dist) + "; H .0 .0 " + str(3 * single_dist) geometries.append(geom) elif "Li2" in mol_type: for single_dist in dist: geom = "Li .0 .0 .0; Li .0 .0 " + str(single_dist) geometries.append(geom) elif "LiH" in mol_type: for single_dist in dist: geom = "Li .0 .0 .0; H .0 .0 " + str(single_dist) geometries.append(geom) options["geometries"] = geometries return options def get_spin(mol_opt): mol_type = mol_opt if mol_type == "H3+": spin = 0 if mol_type == "Li3+": spin = 0 elif mol_type == "H2": spin = 0 elif mol_type == "H2*": spin = 2 elif mol_type == "H2+": spin = 1 elif mol_type == "H2-": spin = 1 elif mol_type == "H2--": spin = 0 elif mol_type == "H4": spin = 0 elif mol_type == "H4*": spin = 2 elif mol_type == "Li2": spin = 0 elif mol_type == "Li2+": spin = 1 elif mol_type == "H2O": spin = 0 elif mol_type == "LiH": spin = 0 elif mol_type == "C2H4": spin = 0 elif mol_type == "N2": spin = 0 elif mol_type == "Na-": spin = 0 elif mol_type == "HeH+": spin = 0 return spin def get_charge(mol_opt): mol_type = mol_opt if mol_type == "H3+": charge = 1 if mol_type == "Li3+": charge = 1 elif mol_type == "H2": charge = 0 elif mol_type == "H2*": charge = 0 elif mol_type == "H2+": charge = 1 elif mol_type == "H2-": charge = -1 elif mol_type == "H2--": charge = -2 elif mol_type == "H4": charge = 0 elif mol_type == "H4*": charge = 0 elif mol_type == "Li2": charge = 0 elif mol_type == "Li2+": charge = 1 elif mol_type == "LiH": charge = 0 elif mol_type == "H2O": charge = 0 elif mol_type == "C2H4": charge = 0 elif mol_type == "N2": charge = 0 elif mol_type == "Na-": charge = -1 elif mol_type == "HeH+": charge = 1 return charge
https://github.com/1chooo/Quantum-Oracle
1chooo
# %% [markdown] # # 第1章原始程式碼 # %% #Program 1.1 The first quantum program from qiskit import QuantumCircuit print("Hello, Qubit!") qc = QuantumCircuit(1,1) qc.measure([0], [0]) print("This is a quantum circuit of 1 qubit and 1 bit:") qc.draw('mpl') # %% #Program 1.2 Design a quantum circuit with 5 qubits and 3 classical bits from qiskit import QuantumCircuit print("This is a quantum circuit of 5 qubits and 2 bits:") qc = QuantumCircuit(5, 2) qc.measure([1,3], [0,1]) qc.draw('mpl') # %% #Program 1.3 Name and label quantum bits and classical bits from qiskit import QuantumRegister,ClassicalRegister,QuantumCircuit qrx = QuantumRegister(3,'x') qry = QuantumRegister(2,'y') qrz = QuantumRegister(1,'z') cr = ClassicalRegister(4,'c') qc = QuantumCircuit(qrx,qry,qrz,cr) qc.measure([qrx[1],qrx[2]], [cr[0],cr[1]]) qc.measure([4,5], [2,3]) qc.draw('mpl') # %% #Program 1.4 Transpile and execute quantum circuit on simulator from qiskit import QuantumCircuit, transpile, execute from qiskit.providers.aer import AerSimulator sim = AerSimulator() qc = QuantumCircuit(1, 1) qc.measure([0], [0]) print(qc) cqc = transpile(qc, sim) job=execute(cqc, backend=sim, shots=1000) result = job.result() counts = result.get_counts(qc) print("Total counts for qubit states are:",counts) # %% #Program 1.5 Execute quantum circuit (program) on simulator from qiskit import QuantumCircuit, execute from qiskit.providers.aer import AerSimulator sim = AerSimulator() qc = QuantumCircuit(1, 1) qc.measure([0], [0]) print(qc) job=execute(qc, backend=sim, shots=1000) result = job.result() counts = result.get_counts(qc) print("Total counts for qubit states are:",counts) # %% #Program 1.6 Execute quantum circuit (program) on least busy quantum computer from qiskit import QuantumCircuit, IBMQ, execute from qiskit.providers.ibmq import least_busy from qiskit.tools.monitor import job_monitor qc = QuantumCircuit(1, 1) qc.measure([0], [0]) print(qc) IBMQ.save_account('your_token',overwrite=True) IBMQ.load_account() provider=IBMQ.get_provider(group='open') print(provider) qcomp = least_busy(provider.backends(simulator=False)) print("The least busy quantum computer is:",qcomp) job=execute(qc, backend=qcomp, shots=1000) job_monitor(job) result = job.result() counts = result.get_counts(qc) print("Total counts for qubit states are:",counts) # %% #Program 1.7 Execute quantum circuit (program) on proper quantum computer from qiskit import QuantumCircuit, IBMQ, execute from qiskit.tools.monitor import job_monitor qc = QuantumCircuit(1, 1) qc.measure([0], [0]) print(qc) #IBMQ.save_account('......',overwrite=True) #IBMQ.load_account() provider = IBMQ.get_provider(group='open') qcomp = provider.get_backend('ibmq_lima') job=execute(qc, backend=qcomp, shots=1000) job_monitor(job) result = job.result() counts = result.get_counts(qc) print("Total counts for qubit states are:",counts)
https://github.com/aryashah2k/Quantum-Computing-Collection-Of-Resources
aryashah2k
# import all necessary objects and methods for quantum circuits from qiskit import QuantumRegister, ClassicalRegister, QuantumCircuit, execute, Aer # define a quantum register with a single qubit q = QuantumRegister(1,"q") # define a classical register with a single bit c = ClassicalRegister(1,"c") # define a quantum circuit qc = QuantumCircuit(q,c) # apply the first Hadamard qc.h(q[0]) # the first measurement qc.measure(q,c) # apply the second Hadamard if the measurement outcome is 0 qc.h(q[0]).c_if(c,0) # the second measurement qc.measure(q[0],c) # draw the circuit qc.draw(output="mpl") job = execute(qc,Aer.get_backend('qasm_simulator'),shots=1000) counts = job.result().get_counts(qc) print(counts) # import all necessary objects and methods for quantum circuits from qiskit import QuantumRegister, ClassicalRegister, QuantumCircuit, execute, Aer # # your code is here # # import all necessary objects and methods for quantum circuits from qiskit import QuantumRegister, ClassicalRegister, QuantumCircuit, execute, Aer # define a quantum register with a single qubit q = QuantumRegister(1) # define a classical register with a single bit c = ClassicalRegister(1,"c") # define a quantum circuit qc = QuantumCircuit(q,c) # start in state |1> qc.x(q[0]) # apply the first Hadamard qc.h(q[0]) # the first measurement qc.measure(q,c) # apply the second Hadamard if the measurement outcome is 1 qc.h(q[0]).c_if(c,1) # the second measurement qc.measure(q[0],c) # draw the circuit qc.draw(output="mpl") # execute the circuit 1000 times in the local simulator job = execute(qc,Aer.get_backend('qasm_simulator'),shots=1000) counts = job.result().get_counts(qc) print(counts) # import all necessary objects and methods for quantum circuits from qiskit import QuantumRegister, ClassicalRegister, QuantumCircuit, execute, Aer # # your code is here # # import all necessary objects and methods for quantum circuits from qiskit import QuantumRegister, ClassicalRegister, QuantumCircuit, execute, Aer # define a quantum register with a single qubit q = QuantumRegister(1) # define a classical register with a single bit c = ClassicalRegister(1,"c") # define a quantum circuit qc = QuantumCircuit(q,c) for i in range(3): qc.h(q[0]).c_if(c,0) qc.measure(q,c) # draw the circuit qc.draw(output="mpl") # execute the circuit 1000 times in the local simulator job = execute(qc,Aer.get_backend('qasm_simulator'),shots=1000) counts = job.result().get_counts(qc) print(counts) # import all necessary objects and methods for quantum circuits from qiskit import QuantumRegister, ClassicalRegister, QuantumCircuit, execute, Aer # import randrange for random choices from random import randrange # # your code is here # # import all necessary objects and methods for quantum circuits from qiskit import QuantumRegister, ClassicalRegister, QuantumCircuit, execute, Aer # import randrange for random choices from random import randrange # define a quantum register with a single qubit q = QuantumRegister(1) # define a classical register with a single bit c = ClassicalRegister(1,"c") # define a quantum circuit qc = QuantumCircuit(q,c) shot = 10000 observe = [0,0] qc.h(q[0]) qc.measure(q,c) observe = [shot/2,shot/2] for i in range(4): x = randrange(2) if x==0: observe[0] = observe[0] / 2 observe[1] = observe[1] + observe[0] else: observe[1] = observe[1] / 2 observe[0] = observe[0] + observe[1] qc.h(q[0]).c_if(c,x) qc.measure(q,c) # draw the circuit qc.draw(output="mpl") print('0:',round(observe[0]),'1:',round(observe[1])) # execute the circuit 10000 times in the local simulator job = execute(qc,Aer.get_backend('qasm_simulator'),shots=shot) counts = job.result().get_counts(qc) print(counts)
https://github.com/qiskit-community/qiskit-translations-staging
qiskit-community
from qiskit import QuantumRegister, ClassicalRegister, QuantumCircuit q = QuantumRegister(1) c = ClassicalRegister(1) qc = QuantumCircuit(q, c) qc.h(q) qc.measure(q, c) qc.draw(output='mpl', style={'backgroundcolor': '#EEEEEE'})
https://github.com/swe-bench/Qiskit__qiskit
swe-bench
# This code is part of Qiskit. # # (C) Copyright IBM 2017, 2020 # # This code is licensed under the Apache License, Version 2.0. You may # obtain a copy of this license in the LICENSE.txt file in the root directory # of this source tree or at http://www.apache.org/licenses/LICENSE-2.0. # # Any modifications or derivative works of this code must retain this # copyright notice, and modified files need to carry a notice indicating # that they have been altered from the originals. """Quick program to test the quantum information states modules.""" import unittest import numpy as np from qiskit import QiskitError from qiskit.test import QiskitTestCase from qiskit.quantum_info.states import DensityMatrix, Statevector from qiskit.quantum_info import state_fidelity from qiskit.quantum_info import purity from qiskit.quantum_info import entropy from qiskit.quantum_info import concurrence from qiskit.quantum_info import entanglement_of_formation from qiskit.quantum_info import mutual_information from qiskit.quantum_info.states import shannon_entropy from qiskit.quantum_info import negativity class TestStateMeasures(QiskitTestCase): """Tests state measure functions""" def test_state_fidelity_statevector(self): """Test state_fidelity function for statevector inputs""" psi1 = [0.70710678118654746, 0, 0, 0.70710678118654746] psi2 = [0.0, 0.70710678118654746, 0.70710678118654746, 0.0] self.assertAlmostEqual(state_fidelity(psi1, psi1), 1.0, places=7, msg="vector-vector input") self.assertAlmostEqual(state_fidelity(psi2, psi2), 1.0, places=7, msg="vector-vector input") self.assertAlmostEqual(state_fidelity(psi1, psi2), 0.0, places=7, msg="vector-vector input") psi1 = Statevector([0.70710678118654746, 0, 0, 0.70710678118654746]) psi2 = Statevector([0.0, 0.70710678118654746, 0.70710678118654746, 0.0]) self.assertAlmostEqual(state_fidelity(psi1, psi1), 1.0, places=7, msg="vector-vector input") self.assertAlmostEqual(state_fidelity(psi2, psi2), 1.0, places=7, msg="vector-vector input") self.assertAlmostEqual(state_fidelity(psi1, psi2), 0.0, places=7, msg="vector-vector input") psi1 = Statevector([1, 0, 0, 1]) # invalid state psi2 = Statevector([1, 0, 0, 0]) self.assertRaises(QiskitError, state_fidelity, psi1, psi2) self.assertRaises(QiskitError, state_fidelity, psi1, psi2, validate=True) self.assertEqual(state_fidelity(psi1, psi2, validate=False), 1) def test_state_fidelity_density_matrix(self): """Test state_fidelity function for density matrix inputs""" rho1 = [[0.5, 0, 0, 0.5], [0, 0, 0, 0], [0, 0, 0, 0], [0.5, 0, 0, 0.5]] mix = [[0.25, 0, 0, 0], [0, 0.25, 0, 0], [0, 0, 0.25, 0], [0, 0, 0, 0.25]] self.assertAlmostEqual(state_fidelity(rho1, rho1), 1.0, places=7, msg="matrix-matrix input") self.assertAlmostEqual(state_fidelity(mix, mix), 1.0, places=7, msg="matrix-matrix input") self.assertAlmostEqual(state_fidelity(rho1, mix), 0.25, places=7, msg="matrix-matrix input") rho1 = DensityMatrix(rho1) mix = DensityMatrix(mix) self.assertAlmostEqual(state_fidelity(rho1, rho1), 1.0, places=7, msg="matrix-matrix input") self.assertAlmostEqual(state_fidelity(mix, mix), 1.0, places=7, msg="matrix-matrix input") self.assertAlmostEqual(state_fidelity(rho1, mix), 0.25, places=7, msg="matrix-matrix input") rho1 = DensityMatrix([1, 0, 0, 0]) mix = DensityMatrix(np.diag([1, 0, 0, 1])) self.assertRaises(QiskitError, state_fidelity, rho1, mix) self.assertRaises(QiskitError, state_fidelity, rho1, mix, validate=True) self.assertEqual(state_fidelity(rho1, mix, validate=False), 1) def test_state_fidelity_mixed(self): """Test state_fidelity function for statevector and density matrix inputs""" psi1 = Statevector([0.70710678118654746, 0, 0, 0.70710678118654746]) rho1 = DensityMatrix([[0.5, 0, 0, 0.5], [0, 0, 0, 0], [0, 0, 0, 0], [0.5, 0, 0, 0.5]]) mix = DensityMatrix([[0.25, 0, 0, 0], [0, 0.25, 0, 0], [0, 0, 0.25, 0], [0, 0, 0, 0.25]]) self.assertAlmostEqual(state_fidelity(psi1, rho1), 1.0, places=7, msg="vector-matrix input") self.assertAlmostEqual(state_fidelity(psi1, mix), 0.25, places=7, msg="vector-matrix input") self.assertAlmostEqual(state_fidelity(rho1, psi1), 1.0, places=7, msg="matrix-vector input") def test_purity_statevector(self): """Test purity function on statevector inputs""" psi = Statevector([1, 0, 0, 0]) self.assertEqual(purity(psi), 1) self.assertEqual(purity(psi, validate=True), 1) self.assertEqual(purity(psi, validate=False), 1) psi = [0.70710678118654746, 0.70710678118654746] self.assertAlmostEqual(purity(psi), 1) self.assertAlmostEqual(purity(psi, validate=True), 1) self.assertAlmostEqual(purity(psi, validate=False), 1) psi = np.array([0.5, 0.5j, -0.5j, -0.5]) self.assertAlmostEqual(purity(psi), 1) self.assertAlmostEqual(purity(psi, validate=True), 1) self.assertAlmostEqual(purity(psi, validate=False), 1) psi = Statevector([1, 0, 0, 1]) self.assertRaises(QiskitError, purity, psi) self.assertRaises(QiskitError, purity, psi, validate=True) self.assertEqual(purity(psi, validate=False), 4) def test_purity_density_matrix(self): """Test purity function on density matrix inputs""" rho = DensityMatrix(np.diag([1, 0, 0, 0])) self.assertEqual(purity(rho), 1) self.assertEqual(purity(rho, validate=True), 1) self.assertEqual(purity(rho, validate=False), 1) rho = np.diag([0.25, 0.25, 0.25, 0.25]) self.assertEqual(purity(rho), 0.25) self.assertEqual(purity(rho, validate=True), 0.25) self.assertEqual(purity(rho, validate=False), 0.25) rho = [[0.5, 0, 0, 0.5], [0, 0, 0, 0], [0, 0, 0, 0], [0.5, 0, 0, 0.5]] self.assertEqual(purity(rho), 1) self.assertEqual(purity(rho, validate=True), 1) self.assertEqual(purity(rho, validate=False), 1) rho = np.diag([1, 0, 0, 1]) self.assertRaises(QiskitError, purity, rho) self.assertRaises(QiskitError, purity, rho, validate=True) self.assertEqual(purity(rho, validate=False), 2) def test_purity_equivalence(self): """Test purity is same for equivalent inputs""" for alpha, beta in [ (0, 0), (0, 0.25), (0.25, 0), (0.33, 0.33), (0.5, 0.5), (0.75, 0.25), (0, 0.75), ]: psi = Statevector([alpha, beta, 0, 1j * np.sqrt(1 - alpha**2 - beta**2)]) rho = DensityMatrix(psi) self.assertAlmostEqual(purity(psi), purity(rho)) def test_entropy_statevector(self): """Test entropy function on statevector inputs""" test_psis = [ [1, 0], [0, 1, 0, 0], [0.5, 0.5, 0.5, 0.5], [0.5, 0.5j, -0.5j, 0.5], [0.70710678118654746, 0, 0, -0.70710678118654746j], [0.70710678118654746] + (14 * [0]) + [0.70710678118654746j], ] for psi_ls in test_psis: self.assertEqual(entropy(psi_ls), 0) self.assertEqual(entropy(np.array(psi_ls)), 0) def test_entropy_density_matrix(self): """Test entropy function on density matrix inputs""" # Density matrix input rhos = [DensityMatrix(np.diag([0.5] + (n * [0]) + [0.5])) for n in range(1, 5)] for rho in rhos: self.assertAlmostEqual(entropy(rho), 1) self.assertAlmostEqual(entropy(rho, base=2), 1) self.assertAlmostEqual(entropy(rho, base=np.e), -1 * np.log(0.5)) # Array input for prob in [0.001, 0.3, 0.7, 0.999]: rho = np.diag([prob, 1 - prob]) self.assertAlmostEqual(entropy(rho), shannon_entropy([prob, 1 - prob])) self.assertAlmostEqual( entropy(rho, base=np.e), shannon_entropy([prob, 1 - prob], base=np.e) ) self.assertAlmostEqual(entropy(rho, base=2), shannon_entropy([prob, 1 - prob], base=2)) # List input rho = [[0.5, 0], [0, 0.5]] self.assertAlmostEqual(entropy(rho), 1) def test_entropy_equivalence(self): """Test entropy is same for equivalent inputs""" for alpha, beta in [ (0, 0), (0, 0.25), (0.25, 0), (0.33, 0.33), (0.5, 0.5), (0.75, 0.25), (0, 0.75), ]: psi = Statevector([alpha, beta, 0, 1j * np.sqrt(1 - alpha**2 - beta**2)]) rho = DensityMatrix(psi) self.assertAlmostEqual(entropy(psi), entropy(rho)) def test_concurrence_statevector(self): """Test concurrence function on statevector inputs""" # Statevector input psi = Statevector([0.70710678118654746, 0, 0, -0.70710678118654746j]) self.assertAlmostEqual(concurrence(psi), 1) # List input psi = [1, 0, 0, 0] self.assertAlmostEqual(concurrence(psi), 0) # Array input psi = np.array([0.5, 0.5, 0.5, 0.5]) self.assertAlmostEqual(concurrence(psi), 0) # Larger than 2 qubit input psi_ls = [0.70710678118654746] + (14 * [0]) + [0.70710678118654746j] psi = Statevector(psi_ls, dims=(2, 8)) self.assertAlmostEqual(concurrence(psi), 1) psi = Statevector(psi_ls, dims=(4, 4)) self.assertAlmostEqual(concurrence(psi), 1) psi = Statevector(psi_ls, dims=(8, 2)) self.assertAlmostEqual(concurrence(psi), 1) def test_concurrence_density_matrix(self): """Test concurrence function on density matrix inputs""" # Density matrix input rho1 = DensityMatrix([[0.5, 0, 0, 0.5], [0, 0, 0, 0], [0, 0, 0, 0], [0.5, 0, 0, 0.5]]) rho2 = DensityMatrix([[0, 0, 0, 0], [0, 0.5, -0.5j, 0], [0, 0.5j, 0.5, 0], [0, 0, 0, 0]]) self.assertAlmostEqual(concurrence(rho1), 1) self.assertAlmostEqual(concurrence(rho2), 1) self.assertAlmostEqual(concurrence(0.5 * rho1 + 0.5 * rho2), 0) self.assertAlmostEqual(concurrence(0.75 * rho1 + 0.25 * rho2), 0.5) # List input rho = [[0.5, 0.5, 0, 0], [0.5, 0.5, 0, 0], [0, 0, 0, 0], [0, 0, 0, 0]] self.assertEqual(concurrence(rho), 0) # Array input rho = np.diag([0.25, 0.25, 0.25, 0.25]) self.assertEqual(concurrence(rho), 0) def test_concurrence_equivalence(self): """Test concurrence is same for equivalent inputs""" for alpha, beta in [ (0, 0), (0, 0.25), (0.25, 0), (0.33, 0.33), (0.5, 0.5), (0.75, 0.25), (0, 0.75), ]: psi = Statevector([alpha, beta, 0, 1j * np.sqrt(1 - alpha**2 - beta**2)]) rho = DensityMatrix(psi) self.assertAlmostEqual(concurrence(psi), concurrence(rho)) def test_entanglement_of_formation_statevector(self): """Test entanglement of formation function on statevector inputs""" # Statevector input psi = Statevector([0.70710678118654746, 0, 0, -0.70710678118654746j]) self.assertAlmostEqual(entanglement_of_formation(psi), 1) # List input psi = [1, 0, 0, 0] self.assertAlmostEqual(entanglement_of_formation(psi), 0) # Array input psi = np.array([0.5, 0.5, 0.5, 0.5]) self.assertAlmostEqual(entanglement_of_formation(psi), 0) # Larger than 2 qubit input psi_ls = [0.70710678118654746] + (14 * [0]) + [0.70710678118654746j] psi = Statevector(psi_ls, dims=(2, 8)) self.assertAlmostEqual(entanglement_of_formation(psi), 1) psi = Statevector(psi_ls, dims=(4, 4)) self.assertAlmostEqual(entanglement_of_formation(psi), 1) psi = Statevector(psi_ls, dims=(8, 2)) self.assertAlmostEqual(entanglement_of_formation(psi), 1) def test_entanglement_of_formation_density_matrix(self): """Test entanglement of formation function on density matrix inputs""" # Density matrix input rho1 = DensityMatrix([[0.5, 0, 0, 0.5], [0, 0, 0, 0], [0, 0, 0, 0], [0.5, 0, 0, 0.5]]) rho2 = DensityMatrix([[0, 0, 0, 0], [0, 0.5, -0.5j, 0], [0, 0.5j, 0.5, 0], [0, 0, 0, 0]]) self.assertAlmostEqual(entanglement_of_formation(rho1), 1) self.assertAlmostEqual(entanglement_of_formation(rho2), 1) self.assertAlmostEqual(entanglement_of_formation(0.5 * rho1 + 0.5 * rho2), 0) self.assertAlmostEqual( entanglement_of_formation(0.75 * rho1 + 0.25 * rho2), 0.35457890266527003 ) # List input rho = [[0.5, 0.5, 0, 0], [0.5, 0.5, 0, 0], [0, 0, 0, 0], [0, 0, 0, 0]] self.assertEqual(entanglement_of_formation(rho), 0) # Array input rho = np.diag([0.25, 0.25, 0.25, 0.25]) self.assertEqual(entanglement_of_formation(rho), 0) def test_entanglement_of_formation_equivalence(self): """Test entanglement of formation is same for equivalent inputs""" for alpha, beta in [ (0, 0), (0, 0.25), (0.25, 0), (0.33, 0.33), (0.5, 0.5), (0.75, 0.25), (0, 0.75), ]: psi = Statevector([alpha, beta, 0, 1j * np.sqrt(1 - alpha**2 - beta**2)]) rho = DensityMatrix(psi) self.assertAlmostEqual(entanglement_of_formation(psi), entanglement_of_formation(rho)) def test_mutual_information_statevector(self): """Test mutual_information function on statevector inputs""" # Statevector input psi = Statevector([0.70710678118654746, 0, 0, -0.70710678118654746j]) self.assertAlmostEqual(mutual_information(psi), 2) # List input psi = [1, 0, 0, 0] self.assertAlmostEqual(mutual_information(psi), 0) # Array input psi = np.array([0.5, 0.5, 0.5, 0.5]) self.assertAlmostEqual(mutual_information(psi), 0) # Larger than 2 qubit input psi_ls = [0.70710678118654746] + (14 * [0]) + [0.70710678118654746j] psi = Statevector(psi_ls, dims=(2, 8)) self.assertAlmostEqual(mutual_information(psi), 2) psi = Statevector(psi_ls, dims=(4, 4)) self.assertAlmostEqual(mutual_information(psi), 2) psi = Statevector(psi_ls, dims=(8, 2)) self.assertAlmostEqual(mutual_information(psi), 2) def test_mutual_information_density_matrix(self): """Test mutual_information function on density matrix inputs""" # Density matrix input rho1 = DensityMatrix([[0.5, 0, 0, 0.5], [0, 0, 0, 0], [0, 0, 0, 0], [0.5, 0, 0, 0.5]]) rho2 = DensityMatrix([[0, 0, 0, 0], [0, 0.5, -0.5j, 0], [0, 0.5j, 0.5, 0], [0, 0, 0, 0]]) self.assertAlmostEqual(mutual_information(rho1), 2) self.assertAlmostEqual(mutual_information(rho2), 2) # List input rho = [[0.5, 0.5, 0, 0], [0.5, 0.5, 0, 0], [0, 0, 0, 0], [0, 0, 0, 0]] self.assertEqual(mutual_information(rho), 0) # Array input rho = np.diag([0.25, 0.25, 0.25, 0.25]) self.assertEqual(mutual_information(rho), 0) def test_mutual_information_equivalence(self): """Test mutual_information is same for equivalent inputs""" for alpha, beta in [ (0, 0), (0, 0.25), (0.25, 0), (0.33, 0.33), (0.5, 0.5), (0.75, 0.25), (0, 0.75), ]: psi = Statevector([alpha, beta, 0, 1j * np.sqrt(1 - alpha**2 - beta**2)]) rho = DensityMatrix(psi) self.assertAlmostEqual(mutual_information(psi), mutual_information(rho)) def test_negativity_statevector(self): """Test negativity function on statevector inputs""" # Constructing separable quantum statevector state = Statevector([1 / np.sqrt(2), 1 / np.sqrt(2), 0, 0]) negv = negativity(state, [0]) self.assertAlmostEqual(negv, 0, places=7) # Constructing entangled quantum statevector state = Statevector([0, 1 / np.sqrt(2), -1 / np.sqrt(2), 0]) negv = negativity(state, [1]) self.assertAlmostEqual(negv, 0.5, places=7) def test_negativity_density_matrix(self): """Test negativity function on density matrix inputs""" # Constructing separable quantum state rho = DensityMatrix.from_label("10+") negv = negativity(rho, [0, 1]) self.assertAlmostEqual(negv, 0, places=7) negv = negativity(rho, [0, 2]) self.assertAlmostEqual(negv, 0, places=7) # Constructing entangled quantum state rho = DensityMatrix([[0, 0, 0, 0], [0, 0.5, -0.5, 0], [0, -0.5, 0.5, 0], [0, 0, 0, 0]]) negv = negativity(rho, [0]) self.assertAlmostEqual(negv, 0.5, places=7) negv = negativity(rho, [1]) self.assertAlmostEqual(negv, 0.5, places=7) if __name__ == "__main__": unittest.main()
https://github.com/magn5452/QiskitQaoa
magn5452
from matplotlib import pyplot as plt from qiskit import QuantumCircuit, Aer, assemble from qiskit.extensions import HamiltonianGate from qiskit.providers import aer from qiskit.providers.aer import StatevectorSimulator from qiskit.quantum_info import Operator from qiskit.visualization import plot_histogram from VehicleRouting.standard.concretization.CircuitPlotter import MPLCircuitPlotter circuit = QuantumCircuit(4) circuit.h(0) circuit.h(1) circuit.h(2) circuit.h(3) circuit.measure_all() circuit_plotter = MPLCircuitPlotter() circuit_plotter.plot(circuit) backend = StatevectorSimulator(precision='single') backend.shots = 2 ** 8 counts = backend.run(circuit).result().get_counts() plt.show()
https://github.com/hugoecarl/TSP-Problem-Study
hugoecarl
import math import matplotlib.pyplot as plt %matplotlib inline class TSP: def __init__(self): self.flat_mat = flat_mat self.n = 0 self.melhor_dist = 1e11 self.pontos = [] self.melhores_pontos = [] def busca_exaustiva(self, flat_mat, n, ite): if ite == n: dist = 0 for j in range(1, n): dist += flat_mat[self.pontos[j-1] * n + self.pontos[j]] dist += flat_mat[self.pontos[n-1] * n + self.pontos[0]] if dist < self.melhor_dist: self.melhor_dist = dist self.melhores_pontos = self.pontos[:] return for i in range(n): if self.pontos[i] == -1: self.pontos[i] = ite self.busca_exaustiva(flat_mat, n, ite + 1) self.pontos[i] = -1 def dist_mat(self): x = [] y = [] flat_mat = [] #matriz 1 dimensao contendo todas as distancias possiveis entre os pontos para facilitar cálculo. while True: try: temp = input("Digite a coordenada x y: ").split() x.append(float(temp[0])) y.append(float(temp[1])) except: break for i in range(len(x)): for j in range(len(y)): flat_mat.append(math.sqrt((x[i] - x[j])**2 + (y[i] - y[j])**2)) return flat_mat, x, y def get_results(self): self.flat_mat, x, _ = self.dist_mat() self.n = len(x) self.pontos = [-1]*self.n self.pontos[0] = 0 self.busca_exaustiva(self.flat_mat, self.n, 1) return self.melhor_dist, self.melhores_pontos Tsp = TSP() distancia, pontos = Tsp.get_results() print("Melhor distancia encontrada: ", distancia) print("Melhor caminho encontrado: ", pontos) #plota gráfico def connectpoints(x,y,p1,p2): x1, x2 = x[p1], x[p2] y1, y2 = y[p1], y[p2] plt.plot([x1,x2],[y1,y2],'ro-') for i in range(1, len(pontos)): connectpoints(x,y,pontos[i-1],pontos[i]) connectpoints(x,y,pontos[len(x)-1],pontos[0]) plt.title("Percurso") plt.show() %%time %%cmd python TSP.py < in-1.txt type out-1.txt python TSP.py < in-2.txt type out-2.txt python TSP.py < in-3.txt type out-3.txt python TSP.py < in-4.txt type out-4.txt from qiskit import IBMQ import numpy as np #IBMQ.save_account('seu-tokenIBMQ-para-rodar-localmente') IBMQ.load_account() from qiskit import Aer from qiskit.tools.visualization import plot_histogram from qiskit.circuit.library import TwoLocal from qiskit.optimization.applications.ising import max_cut, tsp from qiskit.aqua.algorithms import VQE, NumPyMinimumEigensolver from qiskit.aqua.components.optimizers import SPSA from qiskit.aqua import aqua_globals from qiskit.aqua import QuantumInstance from qiskit.optimization.applications.ising.common import sample_most_likely from qiskit.optimization.algorithms import MinimumEigenOptimizer from qiskit.optimization.problems import QuadraticProgram import logging from qiskit.aqua import set_qiskit_aqua_logging #Preparando os dados segundo os imputs do usuario para serem resolvidos pelo qiskit max 4 pontos por limitação de qubits coord = [] flat_mat, x, y = TSP().dist_mat() dist_mat = np.array(flat_mat).reshape(len(x),len(x)) for i, j in zip(x, y): coord.append([i,j]) ins = tsp.TspData('TSP_Q', dim=len(x), coord=np.array(coord), w=dist_mat) qubitOp, offset = tsp.get_operator(ins) print('Offset:', offset) print('Ising Hamiltonian:') print(qubitOp.print_details()) #Usando o numpyMinimumEigensolver como o solver do problema para resolver de forma quantica ee = NumPyMinimumEigensolver(qubitOp) result = ee.run() print('energy:', result.eigenvalue.real) print('tsp objective:', result.eigenvalue.real + offset) x_Q = sample_most_likely(result.eigenstate) print('feasible:', tsp.tsp_feasible(x_Q)) z = tsp.get_tsp_solution(x_Q) print('solution:', z) print('solution objective:', tsp.tsp_value(z, ins.w)) for i in range(1, len(z)): connectpoints(x,y,z[i-1],z[i]) connectpoints(x,y,z[len(x)-1],z[0]) plt.title("Percurso") plt.show() #instanciando o simulador ou o computador real importante lembrar que nao ira funcionar para mais de 4 pontos pelo numero de qubits disponibilizados pela IBM que sao apenas 16 para o simulador qasm e 15 para a maquina quantica provider = IBMQ.get_provider(hub = 'ibm-q') device = provider.get_backend('ibmq_16_melbourne') aqua_globals.random_seed = np.random.default_rng(123) seed = 10598 backend = Aer.get_backend('qasm_simulator') #descomentar essa linha caso queira rodar na maquina real #backend = device quantum_instance = QuantumInstance(backend, seed_simulator=seed, seed_transpiler=seed) #rodando no simulador quantico spsa = SPSA(maxiter=10) ry = TwoLocal(qubitOp.num_qubits, 'ry', 'cz', reps=5, entanglement='linear') vqe = VQE(qubitOp, ry, spsa, quantum_instance=quantum_instance) result = vqe.run(quantum_instance) print('energy:', result.eigenvalue.real) print('time:', result.optimizer_time) x = sample_most_likely(result.eigenstate) print('feasible:', tsp.tsp_feasible(x_Q)) z = tsp.get_tsp_solution(x_Q) print('solution:', z) print('solution objective:', tsp.tsp_value(z, ins.w))
https://github.com/2lambda123/Qiskit-qiskit
2lambda123
# This code is part of Qiskit. # # (C) Copyright IBM 2017, 2019. # # This code is licensed under the Apache License, Version 2.0. You may # obtain a copy of this license in the LICENSE.txt file in the root directory # of this source tree or at http://www.apache.org/licenses/LICENSE-2.0. # # Any modifications or derivative works of this code must retain this # copyright notice, and modified files need to carry a notice indicating # that they have been altered from the originals. """UnitaryGate tests""" import json import numpy from numpy.testing import assert_allclose import qiskit from qiskit.extensions.unitary import UnitaryGate from qiskit.test import QiskitTestCase from qiskit import QuantumRegister, ClassicalRegister, QuantumCircuit from qiskit.transpiler import PassManager from qiskit.converters import circuit_to_dag, dag_to_circuit from qiskit.quantum_info.random import random_unitary from qiskit.quantum_info.operators import Operator from qiskit.transpiler.passes import CXCancellation class TestUnitaryGate(QiskitTestCase): """Tests for the Unitary class.""" def test_set_matrix(self): """Test instantiation""" try: UnitaryGate([[0, 1], [1, 0]]) # pylint: disable=broad-except except Exception as err: self.fail(f"unexpected exception in init of Unitary: {err}") def test_set_matrix_raises(self): """test non-unitary""" try: UnitaryGate([[1, 1], [1, 0]]) # pylint: disable=broad-except except Exception: pass else: self.fail("setting Unitary with non-unitary did not raise") def test_set_init_with_unitary(self): """test instantiation of new unitary with another one (copy)""" uni1 = UnitaryGate([[0, 1], [1, 0]]) uni2 = UnitaryGate(uni1) self.assertEqual(uni1, uni2) self.assertFalse(uni1 is uni2) def test_conjugate(self): """test conjugate""" ymat = numpy.array([[0, -1j], [1j, 0]]) uni = UnitaryGate([[0, 1j], [-1j, 0]]) self.assertTrue(numpy.array_equal(uni.conjugate().to_matrix(), ymat)) def test_adjoint(self): """test adjoint operation""" uni = UnitaryGate([[0, 1j], [-1j, 0]]) self.assertTrue(numpy.array_equal(uni.adjoint().to_matrix(), uni.to_matrix())) class TestUnitaryCircuit(QiskitTestCase): """Matrix gate circuit tests.""" def test_1q_unitary(self): """test 1 qubit unitary matrix""" qr = QuantumRegister(1) cr = ClassicalRegister(1) qc = QuantumCircuit(qr, cr) matrix = numpy.array([[1, 0], [0, 1]]) qc.x(qr[0]) qc.append(UnitaryGate(matrix), [qr[0]]) # test of qasm output self.log.info(qc.qasm()) # test of text drawer self.log.info(qc) dag = circuit_to_dag(qc) dag_nodes = dag.named_nodes("unitary") self.assertTrue(len(dag_nodes) == 1) dnode = dag_nodes[0] self.assertIsInstance(dnode.op, UnitaryGate) self.assertEqual(dnode.qargs, (qr[0],)) assert_allclose(dnode.op.to_matrix(), matrix) def test_2q_unitary(self): """test 2 qubit unitary matrix""" qr = QuantumRegister(2) cr = ClassicalRegister(2) qc = QuantumCircuit(qr, cr) sigmax = numpy.array([[0, 1], [1, 0]]) sigmay = numpy.array([[0, -1j], [1j, 0]]) matrix = numpy.kron(sigmax, sigmay) qc.x(qr[0]) uni2q = UnitaryGate(matrix) qc.append(uni2q, [qr[0], qr[1]]) passman = PassManager() passman.append(CXCancellation()) qc2 = passman.run(qc) # test of qasm output self.log.info(qc2.qasm()) # test of text drawer self.log.info(qc2) dag = circuit_to_dag(qc) nodes = dag.two_qubit_ops() self.assertEqual(len(nodes), 1) dnode = nodes[0] self.assertIsInstance(dnode.op, UnitaryGate) self.assertEqual(dnode.qargs, (qr[0], qr[1])) assert_allclose(dnode.op.to_matrix(), matrix) qc3 = dag_to_circuit(dag) self.assertEqual(qc2, qc3) def test_3q_unitary(self): """test 3 qubit unitary matrix on non-consecutive bits""" qr = QuantumRegister(4) qc = QuantumCircuit(qr) sigmax = numpy.array([[0, 1], [1, 0]]) sigmay = numpy.array([[0, -1j], [1j, 0]]) matrix = numpy.kron(sigmay, numpy.kron(sigmax, sigmay)) qc.x(qr[0]) uni3q = UnitaryGate(matrix) qc.append(uni3q, [qr[0], qr[1], qr[3]]) qc.cx(qr[3], qr[2]) # test of text drawer self.log.info(qc) dag = circuit_to_dag(qc) nodes = dag.multi_qubit_ops() self.assertEqual(len(nodes), 1) dnode = nodes[0] self.assertIsInstance(dnode.op, UnitaryGate) self.assertEqual(dnode.qargs, (qr[0], qr[1], qr[3])) assert_allclose(dnode.op.to_matrix(), matrix) def test_1q_unitary_int_qargs(self): """test single qubit unitary matrix with 'int' and 'list of ints' qubits argument""" sigmax = numpy.array([[0, 1], [1, 0]]) sigmaz = numpy.array([[1, 0], [0, -1]]) # new syntax qr = QuantumRegister(2) qc = QuantumCircuit(qr) qc.unitary(sigmax, 0) qc.unitary(sigmax, qr[1]) qc.unitary(sigmaz, [0, 1]) # expected circuit qc_target = QuantumCircuit(qr) qc_target.append(UnitaryGate(sigmax), [0]) qc_target.append(UnitaryGate(sigmax), [qr[1]]) qc_target.append(UnitaryGate(sigmaz), [[0, 1]]) self.assertEqual(qc, qc_target) def test_qobj_with_unitary_matrix(self): """test qobj output with unitary matrix""" qr = QuantumRegister(4) qc = QuantumCircuit(qr) sigmax = numpy.array([[0, 1], [1, 0]]) sigmay = numpy.array([[0, -1j], [1j, 0]]) matrix = numpy.kron(sigmay, numpy.kron(sigmax, sigmay)) qc.rx(numpy.pi / 4, qr[0]) uni = UnitaryGate(matrix) qc.append(uni, [qr[0], qr[1], qr[3]]) qc.cx(qr[3], qr[2]) qobj = qiskit.compiler.assemble(qc) instr = qobj.experiments[0].instructions[1] self.assertEqual(instr.name, "unitary") assert_allclose(numpy.array(instr.params[0]).astype(numpy.complex64), matrix) # check conversion to dict qobj_dict = qobj.to_dict() class NumpyEncoder(json.JSONEncoder): """Class for encoding json str with complex and numpy arrays.""" def default(self, obj): if isinstance(obj, numpy.ndarray): return obj.tolist() if isinstance(obj, complex): return (obj.real, obj.imag) return json.JSONEncoder.default(self, obj) # check json serialization self.assertTrue(isinstance(json.dumps(qobj_dict, cls=NumpyEncoder), str)) def test_labeled_unitary(self): """test qobj output with unitary matrix""" qr = QuantumRegister(4) qc = QuantumCircuit(qr) sigmax = numpy.array([[0, 1], [1, 0]]) sigmay = numpy.array([[0, -1j], [1j, 0]]) matrix = numpy.kron(sigmax, sigmay) uni = UnitaryGate(matrix, label="xy") qc.append(uni, [qr[0], qr[1]]) qobj = qiskit.compiler.assemble(qc) instr = qobj.experiments[0].instructions[0] self.assertEqual(instr.name, "unitary") self.assertEqual(instr.label, "xy") def test_qasm_unitary_only_one_def(self): """test that a custom unitary can be converted to qasm and the definition is only written once""" qr = QuantumRegister(2, "q0") cr = ClassicalRegister(1, "c0") qc = QuantumCircuit(qr, cr) matrix = numpy.array([[1, 0], [0, 1]]) unitary_gate = UnitaryGate(matrix) qc.x(qr[0]) qc.append(unitary_gate, [qr[0]]) qc.append(unitary_gate, [qr[1]]) expected_qasm = ( "OPENQASM 2.0;\n" 'include "qelib1.inc";\n' "gate unitary q0 { u(0,0,0) q0; }\n" "qreg q0[2];\ncreg c0[1];\n" "x q0[0];\n" "unitary q0[0];\n" "unitary q0[1];\n" ) self.assertEqual(expected_qasm, qc.qasm()) def test_qasm_unitary_twice(self): """test that a custom unitary can be converted to qasm and that if the qasm is called twice it is the same every time""" qr = QuantumRegister(2, "q0") cr = ClassicalRegister(1, "c0") qc = QuantumCircuit(qr, cr) matrix = numpy.array([[1, 0], [0, 1]]) unitary_gate = UnitaryGate(matrix) qc.x(qr[0]) qc.append(unitary_gate, [qr[0]]) qc.append(unitary_gate, [qr[1]]) expected_qasm = ( "OPENQASM 2.0;\n" 'include "qelib1.inc";\n' "gate unitary q0 { u(0,0,0) q0; }\n" "qreg q0[2];\ncreg c0[1];\n" "x q0[0];\n" "unitary q0[0];\n" "unitary q0[1];\n" ) self.assertEqual(expected_qasm, qc.qasm()) self.assertEqual(expected_qasm, qc.qasm()) def test_qasm_2q_unitary(self): """test that a 2 qubit custom unitary can be converted to qasm""" qr = QuantumRegister(2, "q0") cr = ClassicalRegister(1, "c0") qc = QuantumCircuit(qr, cr) matrix = numpy.asarray([[0, 0, 0, 1], [0, 0, 1, 0], [0, 1, 0, 0], [1, 0, 0, 0]]) unitary_gate = UnitaryGate(matrix) qc.x(qr[0]) qc.append(unitary_gate, [qr[0], qr[1]]) qc.append(unitary_gate, [qr[1], qr[0]]) expected_qasm = ( "OPENQASM 2.0;\n" 'include "qelib1.inc";\n' "gate unitary q0,q1 { u(pi,-pi/2,pi/2) q0; u(pi,pi/2,-pi/2) q1; }\n" "qreg q0[2];\n" "creg c0[1];\n" "x q0[0];\n" "unitary q0[0],q0[1];\n" "unitary q0[1],q0[0];\n" ) self.assertEqual(expected_qasm, qc.qasm()) def test_qasm_unitary_noop(self): """Test that an identity unitary can be converted to OpenQASM 2""" qc = QuantumCircuit(QuantumRegister(3, "q0")) qc.unitary(numpy.eye(8), qc.qubits) expected_qasm = ( "OPENQASM 2.0;\n" 'include "qelib1.inc";\n' "gate unitary q0,q1,q2 { }\n" "qreg q0[3];\n" "unitary q0[0],q0[1],q0[2];\n" ) self.assertEqual(expected_qasm, qc.qasm()) def test_unitary_decomposition(self): """Test decomposition for unitary gates over 2 qubits.""" qc = QuantumCircuit(3) qc.unitary(random_unitary(8, seed=42), [0, 1, 2]) self.assertTrue(Operator(qc).equiv(Operator(qc.decompose()))) def test_unitary_decomposition_via_definition(self): """Test decomposition for 1Q unitary via definition.""" mat = numpy.array([[0, 1], [1, 0]]) self.assertTrue(numpy.allclose(Operator(UnitaryGate(mat).definition).data, mat)) def test_unitary_decomposition_via_definition_2q(self): """Test decomposition for 2Q unitary via definition.""" mat = numpy.array([[0, 0, 1, 0], [0, 0, 0, -1], [1, 0, 0, 0], [0, -1, 0, 0]]) self.assertTrue(numpy.allclose(Operator(UnitaryGate(mat).definition).data, mat)) def test_unitary_control(self): """Test parameters of controlled - unitary.""" mat = numpy.array([[0, 1], [1, 0]]) gate = UnitaryGate(mat).control() self.assertTrue(numpy.allclose(gate.params, mat)) self.assertTrue(numpy.allclose(gate.base_gate.params, mat))
https://github.com/sarthag/Quantum-Algos-using-Qiskit
sarthag
from qiskit import * from qiskit.visualization import plot_bloch_multivector, plot_bloch_vector, plot_histogram from qiskit.compiler import transpile, assemble from qiskit.tools.monitor import job_monitor from qiskit.providers.ibmq import least_busy import matplotlib import numpy as np %pylab inline qc = QuantumCircuit(4,3) qc.x(3) qc.h(range(3)) reps = 1 for count in range(3): for i in range (reps): qc.cp(pi/4, count, 3) reps *= 2 qc.barrier() qc.draw('mpl') def inv_qft(qc, n): for qubit in range (n//2): qc.swap(qubit, n-qubit-1) for j in range(n): for m in range(j): qc.cp(-pi/(2*(j-m)), m, j) qc.h(j) inv_qft(qc, 3) qc.barrier() qc.measure(range(3), range(3)) qc.draw('mpl') qasm_sim = Aer.get_backend('qasm_simulator') shots = 1 qobj = assemble(qc, qasm_sim) results = qasm_sim.run(qobj).result() counts = results.get_counts() plot_histogram(counts) IBMQ.load_account() provider = IBMQ.get_provider(hub='ibm-q') provider.backends() backend = least_busy(provider.backends(filters=lambda x: x.configuration().n_qubits >= 4 and not x.configuration().simulator and x.status().operational==True)) print("least busy backend: ", backend) # Run our circuit on the least busy backend. Monitor the execution of the job in the queue from qiskit.tools.monitor import job_monitor shots = 1024 transpiled_circuit = transpile(qc, backend) qobj = assemble(transpiled_circuit, shots=shots) job = backend.run(qobj) job_monitor(job, interval=2) results = job.result() answer = results.get_counts() plot_histogram(answer)
https://github.com/qiskit-community/qiskit-translations-staging
qiskit-community
from qiskit_aer.utils import approximate_quantum_error, approximate_noise_model import numpy as np # Import Aer QuantumError functions that will be used from qiskit_aer.noise import amplitude_damping_error, reset_error, pauli_error from qiskit.quantum_info import Kraus gamma = 0.23 error = amplitude_damping_error(gamma) results = approximate_quantum_error(error, operator_string="reset") print(results) p = (1 + gamma - np.sqrt(1 - gamma)) / 2 q = 0 print("") print("Expected results:") print("P(0) = {}".format(1-(p+q))) print("P(1) = {}".format(p)) print("P(2) = {}".format(q)) gamma = 0.23 K0 = np.array([[1,0],[0,np.sqrt(1-gamma)]]) K1 = np.array([[0,np.sqrt(gamma)],[0,0]]) results = approximate_quantum_error(Kraus([K0, K1]), operator_string="reset") print(results) reset_to_0 = Kraus([np.array([[1,0],[0,0]]), np.array([[0,1],[0,0]])]) reset_to_1 = Kraus([np.array([[0,0],[1,0]]), np.array([[0,0],[0,1]])]) reset_kraus = [reset_to_0, reset_to_1] gamma = 0.23 error = amplitude_damping_error(gamma) results = approximate_quantum_error(error, operator_list=reset_kraus) print(results) import qiskit.tools.jupyter %qiskit_version_table %qiskit_copyright
https://github.com/qiskit-community/qiskit-translations-staging
qiskit-community
import matplotlib.pyplot as plt from qiskit import QuantumCircuit, transpile from qiskit.providers.fake_provider import FakeAuckland backend = FakeAuckland() ghz = QuantumCircuit(15) ghz.h(0) ghz.cx(0, range(1, 15)) depths = [] for _ in range(100): depths.append( transpile( ghz, backend, layout_method='trivial' # Fixed layout mapped in circuit order ).depth() ) plt.figure(figsize=(8, 6)) plt.hist(depths, align='left', color='#AC557C') plt.xlabel('Depth', fontsize=14) plt.ylabel('Counts', fontsize=14);
https://github.com/apcarrik/qiskit-dev
apcarrik
import numpy as np from qiskit import * from matplotlib import pyplot ### Opaque Gates from qiskit.circuit import Gate my_gate = Gate(name='my_gate', num_qubits=2, params=[]) qr = QuantumRegister(3, 'q') circ = QuantumCircuit(qr) circ.append(my_gate, [qr[0], qr[1]]) circ.append(my_gate, [qr[1], qr[2]]) circ.draw('mpl') pyplot.show() ### Composite Gates # build a sub-circuit sub_q = QuantumRegister(2) sub_circ = QuantumCircuit(sub_q, name="sub_circ") sub_circ.h(sub_q[0]) sub_circ.crz(1, sub_q[0], sub_q[1]) sub_circ.barrier() sub_circ.id(sub_q[1]) sub_circ.u(1,2,-2, sub_q[0]) # convert to a gate and stick it into an arbitrary place in the bigger circuit sub_inst = sub_circ.to_instruction() qr = QuantumRegister(3, 'q') circ = QuantumCircuit(qr) circ.h(qr[0]) circ.cx(qr[0], qr[1]) circ.cx(qr[1], qr[2]) circ.append(sub_inst, [qr[1], qr[2]]) circ.draw('mpl') pyplot.show() # decompose sub-circuit decomposed_circ = circ.decompose() decomposed_circ.draw('mpl') pyplot.show() ### Parameterized Circuits from qiskit.circuit import Parameter theta = Parameter('θ') n=5 qc = QuantumCircuit(n,1) qc.h(0) for i in range(n-1): qc.cx(i, i+1) qc.barrier() qc.rz(theta, range(5)) qc.barrier() for i in reversed(range(n-1)): qc.cx(i, i+1) qc.h(0) qc.measure(0,0) qc.draw('mpl') pyplot.show() print(qc.parameters) # binding parameters import numpy as np theta_range = np.linspace(0, 2*np.pi, 128) circuits = [qc.bind_parameters({theta: theta_val}) for theta_val in theta_range] circuits[-1].draw('mpl') # Last of 128 circuits pyplot.show() job = execute(qc, backend=BasicAer.get_backend('qasm_simulator'), parameter_binds=[{theta: theta_val} for theta_val in theta_range] ) counts = job.result().get_counts() print(len(counts)) # plot oscillation in qubit 0 as theta value changes fig = pyplot.figure(figsize=(8,6)) ax = fig.add_subplot(111) ax.plot(theta_range, list(map(lambda c: c.get('0', 0), counts)), '.-', label='0') ax.plot(theta_range, list(map(lambda c: c.get('1', 0), counts)), '.-', label='1') ax.set_xticks([i * np.pi / 2 for i in range(5)]) ax.set_xticklabels(['0', r'$\frac{\pi}{2}$', r'$\pi$', r'$\frac{3\pi}{2}$', r'$2\pi$'], fontsize = 14) ax.set_xlabel('θ', fontsize=14) ax.set_ylabel('Counts', fontsize=14) ax.legend(fontsize=14) pyplot.show() ### Reducing Compilation Cost import time from itertools import combinations from qiskit.compiler import assemble from qiskit.test.mock import FakeVigo # start with compiling over bound circuits start = time.time() qcs = [] theta_range = np.linspace(0, 2*np.pi, 32) for n in theta_range: qc = QuantumCircuit(5) for k in range(8): for i,j in combinations(range(5),2): qc.cx(i,j) qc.rz(n, range(5)) for i,j in combinations(range(5), 2): qc.cx(i,j) qcs.append(qc) compiled_circuits = transpile(qcs, backend=FakeVigo()) qobj = assemble(compiled_circuits, backend=FakeVigo()) end = time.time() print('Time compiling over set of bound circuits: ', end-start, 's') # now, compile over parametrized circuits, then bind start = time.time() qc = QuantumCircuit(5) theta = Parameter('theta') for k in range(8): for i,j in combinations(range(5), 2): qc.cx(i,j) qc.rz(theta, range(5)) for i,j in combinations(range(5), 2): qc.cx(i,j) transpiled_qc = transpile(qc, backend = FakeVigo()) qobj = assemble([transpiled_qc.bind_parameters({theta: n}) for n in theta_range], backend=FakeVigo()) end = time.time() print('Time compiling over parameterized circuit, then binding: ', end-start, 's') ### Composition # Parameterized circuits can be composed like standard quantum circuits, but # the parameter names in each circuit must be unique across all circuits, unless # the circuits use the same parameter phi = Parameter('phi') sub_circ1 = QuantumCircuit(2, name='sc_1') sub_circ1.rz(phi, 0) sub_circ1.rx(phi, 1) sub_circ2 = QuantumCircuit(2, name='sc_2') sub_circ2.rz(phi, 0) sub_circ2.rx(phi, 1) qc = QuantumCircuit(4) qr = qc.qregs[0] qc.append(sub_circ1.to_instruction(), [qr[0], qr[1]]) qc.append(sub_circ2.to_instruction(), [qr[0], qr[1]]) qc.append(sub_circ2.to_instruction(), [qr[2], qr[3]]) print(qc.draw()) # The following raises an error: "QiskitError: 'Name conflict on adding parameter: phi'" # phi2 = Parameter('phi') # qc.u(0.1, phi2, 0.3, 0) # To insert a subcircuit under a different parameterization, the to_instruction method accepts an # optional argument (parameter_map) which, when present, will generate instructions with the source parameter # replaced by a new parameter. p = Parameter('p') qc = QuantumCircuit(3, name='oracle') qc.rz(p, 0) qc.cx(0,1) qc.rz(p,1) qc.cx(1, 2) qc.rz(p, 2) theta = Parameter('theta') phi = Parameter('phi') gamma = Parameter('gamma') qr = QuantumRegister(9) larger_qc = QuantumCircuit(qr) larger_qc.append(qc.to_instruction({p: theta}), qr[0:3]) larger_qc.append(qc.to_instruction({p: phi}), qr[3:6]) larger_qc.append(qc.to_instruction({p: gamma}), qr[6:9]) print(larger_qc.draw()) print(larger_qc.decompose().draw())
https://github.com/BOBO1997/osp_solutions
BOBO1997
import numpy as np import matplotlib.pyplot as plt import itertools from pprint import pprint import pickle import time import datetime # Import qubit states Zero (|0>) and One (|1>), and Pauli operators (X, Y, Z) from qiskit.opflow import Zero, One, I, X, Y, Z from qiskit import QuantumCircuit, QuantumRegister, IBMQ, execute, transpile, Aer from qiskit.tools.monitor import job_monitor from qiskit.circuit import Parameter from qiskit.transpiler.passes import RemoveBarriers # Import QREM package from qiskit.ignis.mitigation.measurement import complete_meas_cal, CompleteMeasFitter from qiskit.ignis.mitigation import expectation_value # Import mitiq for zne import mitiq # Import state tomography modules from qiskit.ignis.verification.tomography import state_tomography_circuits from qiskit.quantum_info import state_fidelity import sys import importlib sys.path.append("../utils/") import circuit_utils, zne_utils, tomography_utils, sgs_algorithm importlib.reload(circuit_utils) importlib.reload(zne_utils) importlib.reload(tomography_utils) importlib.reload(sgs_algorithm) from circuit_utils import * from zne_utils import * from tomography_utils import * from sgs_algorithm import * # Combine subcircuits into a single multiqubit gate representing a single trotter step num_qubits = 3 # The final time of the state evolution target_time = np.pi # Parameterize variable t to be evaluated at t=pi later dt = Parameter('t') # Convert custom quantum circuit into a gate trot_gate = trotter_gate(dt) # initial layout initial_layout = [5,3,1] # Number of trotter steps num_steps = 100 print("trotter step: ", num_steps) scale_factors = [1.0, 2.0, 3.0] # Initialize quantum circuit for 3 qubits qr = QuantumRegister(num_qubits, name="q") qc = QuantumCircuit(qr) # Prepare initial state (remember we are only evolving 3 of the 7 qubits on jakarta qubits (q_5, q_3, q_1) corresponding to the state |110>) make_initial_state(qc, "110") # DO NOT MODIFY (|q_5,q_3,q_1> = |110>) subspace_encoder_init110(qc, targets=[0, 1, 2]) # encode trotterize(qc, trot_gate, num_steps, targets=[1, 2]) # Simulate time evolution under H_heis3 Hamiltonian subspace_decoder_init110(qc, targets=[0, 1, 2]) # decode # Evaluate simulation at target_time (t=pi) meaning each trotter step evolves pi/trotter_steps in time qc = qc.bind_parameters({dt: target_time / num_steps}) print("created qc") # Generate state tomography circuits to evaluate fidelity of simulation st_qcs = state_tomography_circuits(qc, [0, 1, 2][::-1]) #! state tomography requires === BIG ENDIAN === print("created st_qcs (length:", len(st_qcs), ")") # remove barriers st_qcs = [RemoveBarriers()(qc) for qc in st_qcs] print("removed barriers from st_qcs") # optimize circuit t3_st_qcs = transpile(st_qcs, optimization_level=3, basis_gates=["sx", "cx", "rz"]) t3_st_qcs = transpile(t3_st_qcs, optimization_level=3, basis_gates=["sx", "cx", "rz"]) print("created t3_st_qcs (length:", len(t3_st_qcs), ")") # zne wrapping zne_qcs = zne_wrapper(t3_st_qcs, scale_factors = scale_factors, pt = True) # Pauli Twirling print("created zne_qcs (length:", len(zne_qcs), ")") # optimization_level must be 0 # feed initial_layout here to see the picture of the circuits before casting the job t3_zne_qcs = transpile(zne_qcs, optimization_level=0, basis_gates=["sx", "cx", "rz"], initial_layout=initial_layout) print("created t3_zne_qcs (length:", len(t3_zne_qcs), ")") t3_zne_qcs[-3].draw("mpl") from qiskit.test.mock import FakeJakarta backend = FakeJakarta() # backend = Aer.get_backend("qasm_simulator") # IBMQ.load_account() # provider = IBMQ.get_provider(hub='ibm-q-community', group='ibmquantumawards', project='open-science-22') # print("provider:", provider) # backend = provider.get_backend("ibmq_jakarta") print(str(backend)) shots = 1 << 13 reps = 8 # unused jobs = [] for _ in range(reps): #! CHECK: run t3_zne_qcs, with optimization_level = 0 and straightforward initial_layout job = execute(t3_zne_qcs, backend, shots=shots, optimization_level=0) print('Job ID', job.job_id()) jobs.append(job) # QREM qr = QuantumRegister(num_qubits, name="calq") meas_calibs, state_labels = complete_meas_cal(qr=qr, circlabel='mcal') # we have to feed initial_layout to calibration matrix cal_job = execute(meas_calibs, backend=backend, shots=shots, optimization_level=3, initial_layout = initial_layout) print('Job ID', cal_job.job_id()) meas_calibs[0].draw("mpl") dt_now = datetime.datetime.now() print(dt_now) filename = "job_ids_" + str(backend) + "_100step_" + dt_now.strftime('%Y%m%d_%H%M%S') + "_.pkl" print(filename) # with open("jobs_" + str(backend) + "_100step_" + dt_now.strftime('%Y%m%d_%H%M%S') + "_.pkl", "wb") as f: # pickle.dump({"jobs": jobs, "cal_job": cal_job}, f) # with open(filename, "wb") as f: # pickle.dump({"job_ids": [job.job_id() for job in jobs], "cal_job_id": cal_job.job_id()}, f) # with open("properties_" + str(backend) + "_" + dt_now.strftime('%Y%m%d_%H%M%S') + "_.pkl", "wb") as f: # pickle.dump(backend.properties(), f) retrieved_jobs = jobs retrieved_cal_job = cal_job cal_results = retrieved_cal_job.result() meas_fitter = CompleteMeasFitter(cal_results, state_labels, circlabel='mcal') target_state = (One^One^Zero).to_matrix() # DO NOT CHANGE!!! fids = [] for job in retrieved_jobs: mit_results = meas_fitter.filter.apply(job.result()) zne_expvals = zne_decoder(num_qubits, mit_results, scale_factors = scale_factors) rho = expvals_to_valid_rho(num_qubits, zne_expvals) fid = state_fidelity(rho, target_state) fids.append(fid) print('state tomography fidelity = {:.4f} \u00B1 {:.4f}'.format(np.mean(fids), np.std(fids)))
https://github.com/OJB-Quantum/Qiskit-Metal-to-Litho
OJB-Quantum
import numpy as np import qiskit_metal as metal from qiskit_metal import designs, draw, MetalGUI, Dict, open_docs #design.overwrite_enabled = True #design.chips.main #design.chips.main.size.size_x = '11mm' #design.chips.main.size.size_y = '9mm' # To launch the qiskit metal GUI,use the method MetalGUI. design = designs.DesignPlanar() gui = MetalGUI(design) gui.screenshot() %metal_heading Connecting QPins with coplanar waveguides (CPWs) from qiskit_metal.qlibrary.qubits.transmon_pocket import TransmonPocket # Allow running the same cell here multiple times to overwrite changes design.overwrite_enabled = True ## Custom options for all the transmons options = dict( # Some options we want to modify from the deafults # (see below for defaults) pad_width = '425 um', pocket_height = '650um', # Adding 4 connectors (see below for defaults) connection_pads=dict( a = dict(loc_W=+1,loc_H=+1), b = dict(loc_W=-1,loc_H=+1, pad_height='30um'), c = dict(loc_W=+1,loc_H=-1, pad_width='200um'), d = dict(loc_W=-1,loc_H=-1, pad_height='50um') ) ) ## Create 4 transmons q1 = TransmonPocket(design, 'Q1', options = dict( pos_x='+2.55mm', pos_y='+0.0mm', **options)) q2 = TransmonPocket(design, 'Q2', options = dict( pos_x='+0.0mm', pos_y='-0.9mm', orientation = '90', **options)) q3 = TransmonPocket(design, 'Q3', options = dict( pos_x='-2.55mm', pos_y='+0.0mm', **options)) q4 = TransmonPocket(design, 'Q4', options = dict( pos_x='+0.0mm', pos_y='+0.9mm', orientation = '90', **options)) ## Rebuild the design gui.rebuild() gui.autoscale() gui.toggle_docks(True) gui.screenshot() # Import the basic cpw QComponent from the QLibrary. It is a class called RouteMeander. We can see its default options using RouteMeander.get_template_options(design) from qiskit_metal.qlibrary.tlines.meandered import RouteMeander RouteMeander.get_template_options(design) options = Dict( meander=Dict( lead_start='0.1mm', lead_end='0.1mm', asymmetry='0 um') ) def connect(component_name: str, component1: str, pin1: str, component2: str, pin2: str, length: str, asymmetry='0 um', flip=False): """Connect two pins with a CPW.""" myoptions = Dict( pin_inputs=Dict( start_pin=Dict( component=component1, pin=pin1), end_pin=Dict( component=component2, pin=pin2)), lead=Dict( start_straight='0.13mm' ), total_length=length, fillet = '90um') myoptions.update(options) myoptions.meander.asymmetry = asymmetry myoptions.meander.lead_direction_inverted = 'true' if flip else 'false' return RouteMeander(design, component_name, myoptions) asym = 150 cpw1 = connect('cpw1', 'Q1', 'd', 'Q2', 'c', '6.0 mm', f'+{asym}um') cpw2 = connect('cpw2', 'Q3', 'c', 'Q2', 'a', '6.1 mm', f'-{asym}um', flip=True) cpw3 = connect('cpw3', 'Q3', 'a', 'Q4', 'b', '6.0 mm', f'+{asym}um') cpw4 = connect('cpw4', 'Q1', 'b', 'Q4', 'd', '6.1 mm', f'-{asym}um', flip=True) gui.rebuild() gui.autoscale() gui.toggle_docks(True) gui.highlight_components(['Q1','Q2','Q3','Q4','cpw1','cpw2','cpw3','cpw4']) gui.screenshot() design.components.keys() # We can access the created CPW from the design too. design.components.cpw2 # The design can have variables, which can be used in the component options. design.variables.cpw_width = '10um' design.variables.cpw_gap = '6um' gui.rebuild() # Ex: we can all qubit pads using the variables. cpw1.options.lead.end_straight = '100um' cpw2.options.lead.end_straight = '100um' cpw3.options.lead.end_straight = '100um' cpw4.options.lead.end_straight = '100um' # Set variables in the design design.variables.pad_width = '450 um' design.variables.cpw_width = '25 um' design.variables.cpw_gap = '12 um' # Assign variables to component options q1.options.pad_width = 'pad_width' q2.options.pad_width = 'pad_width' q3.options.pad_width = 'pad_width' q4.options.pad_width = 'pad_width' # Rebuild all compoinent and refresh the gui gui.rebuild() gui.autoscale() gui.screenshot() %metal_heading Render to GDS gds = design.renderers.gds gds.options.path_filename gds.options.path_filename = '../resources/Fake_Junctions.GDS' q1.options gds.options.path_filename = "../resources/Fake_Junctions.GDS" # Not sure what's going on here, however the GDS file is downloadable from the Qiskit Metal GUI. design.renderers.gds.export_to_gds("4-Transmon_design.gds") # Basic and crazy shapes. # See their source code to see how to get started on a few simple examples. from qiskit_metal.qlibrary.sample_shapes.n_square_spiral import NSquareSpiral # print(NSquareSpiral.get_template_options(design)) ops = { 'n': '10', 'width': '5um', 'radius': '100um', 'gap': '22um', 'pos_x': '0.65mm', 'pos_y': '2.2mm', 'orientation': '0', 'subtract': 'False'} NSquareSpiral(design, 'spiral', ops) NSquareSpiral(design, 'spiral_cut', {**ops, **dict(subtract=True, width='22um', gap='10um')}) gui.rebuild() # To see source, try ??NSquareSpiral. Go to the actual source file and edit it, copy it, or edit it in the GUI using the Edit Source button. from qiskit_metal.qlibrary.tlines.straight_path import RouteStraight # CpwStraightLine.get_template_options(design) myoptions = Dict( pin_inputs=Dict( start_pin=Dict( component='Q4', pin='c'), end_pin=Dict( component='spiral', pin='spiralPin')) ) RouteStraight(design, 'cpw_s1', myoptions); gui.rebuild() qcomponents = ['spiral', 'cpw_s1'] gui.highlight_components(qcomponents) gui.zoom_on_components(qcomponents) gui.screenshot() # N-Gon version. Orientation is in degrees. from qiskit_metal.qlibrary.sample_shapes.n_gon import NGon # display(NGon.get_template_options(design)) ops = { 'n': '6', 'radius': '250um', 'pos_x': '-0.85mm', 'pos_y': '2.0mm', 'orientation': '0', 'subtract': 'False', 'helper': 'False', 'chip': 'main', 'layer': '1'} NGon(design, 'ngon', ops) NGon(design, 'ngon_negative', {**ops, **dict(subtract=True, radius='350um')}) gui.rebuild() gui.zoom_on_components(['ngon_negative']) gui.screenshot() # Generate a circle with certain radius. from qiskit_metal.qlibrary.sample_shapes.circle_raster import CircleRaster display(CircleRaster.get_template_options(design)) ops = { 'radius': '10um', 'pos_x': '-1.5mm', 'pos_y': '2mm', 'resolution': '16', 'cap_style': 'round', 'subtract': 'False', 'helper': 'False', 'chip': 'main', 'layer': '1'} CircleRaster(design, 'CircleRaster', ops) gui.rebuild() gui.zoom_on_components(['CircleRaster']) gui.screenshot() # Generate a hollow rectangle. Orientation is in degrees. from qiskit_metal.qlibrary.sample_shapes.rectangle_hollow import RectangleHollow display(RectangleHollow.get_template_options(design)) ops = { 'width': '500um', 'height': '300um', 'pos_x': '-2.3mm', 'pos_y': '2mm', 'orientation': '0', 'subtract': 'False', 'helper': 'False', 'chip': 'main', 'layer': '1', 'inner': { 'width': '250um', 'height': '100um', 'offset_x': '40um', 'offset_y': '-20um', 'orientation': '15'}} RectangleHollow(design, 'RectangleHollow', ops) gui.rebuild() gui.zoom_on_components(['RectangleHollow']) gui.screenshot() gui.autoscale() gui.screenshot() # Return the boundry box of the geometry, for example: q1.qgeometry_bounds(). # The function returns a tuple containing (minx, miny, maxx, maxy) bound values for the bounds of the component as a whole. for name, qcomponent in design.components.items(): print(f"{name:10s} : {qcomponent.qgeometry_bounds()}") # We can get all the QGeometry of a QComponent. There are several kinds, such as path and poly. Let us look at all the polygons used to create qubit q1. q1.qgeometry_table('poly') q1.qgeometry_table('path') q1.qgeometry_table('junction') # Use this code to close the Qiskit Metal GUI. gui.main_window.close()
https://github.com/MiChaelinzo/Quantum-time-travel
MiChaelinzo
from qiskit import QuantumCircuit from qiskit.circuit.library import ZZFeatureMap from qiskit.ml.datasets import ad_hoc_data from qiskit.circuit.library import TwoLocal from qiskit.aqua import QuantumInstance from qiskit.aqua.algorithms import QSVM # Prepare data (example using ad hoc dataset) feature_dim = 2 sample_total, training_input, test_input, class_labels = ad_hoc_data( training_size=20, test_size=10, n=feature_dim, gap=0.3, plot_data=False ) # Feature map and ansatz feature_map = ZZFeatureMap(feature_dimension=feature_dim, reps=2) ansatz = TwoLocal(feature_dim, ['ry', 'rz'], 'cz', reps=2) # QSVM setup qsvm = QSVM(feature_map, ansatz, training_input, test_input, class_labels) # Run QSVM (using a simulator backend) backend = Aer.get_backend('qasm_simulator') quantum_instance = QuantumInstance(backend, shots=1024) result = qsvm.run(quantum_instance) # Analyze results (example: prediction accuracy) print(f'Testing accuracy: {result["testing_accuracy"]}')
https://github.com/swe-train/qiskit__qiskit
swe-train
#!/usr/bin/env python3 # This code is part of Qiskit. # # (C) Copyright IBM 2021 # # This code is licensed under the Apache License, Version 2.0. You may # obtain a copy of this license in the LICENSE.txt file in the root directory # of this source tree or at http://www.apache.org/licenses/LICENSE-2.0. # # Any modifications or derivative works of this code must retain this # copyright notice, and modified files need to carry a notice indicating # that they have been altered from the originals. """Utility to check that slow imports are not used in the default path.""" import subprocess import sys # This is not unused: importing it sets up sys.modules import qiskit # pylint: disable=unused-import def _main(): optional_imports = [ "networkx", "sympy", "pydot", "pygments", "ipywidgets", "scipy.stats", "matplotlib", "qiskit.providers.aer", "qiskit.providers.ibmq", "qiskit.ignis", "qiskit.aqua", "docplex", ] modules_imported = [] for mod in optional_imports: if mod in sys.modules: modules_imported.append(mod) if not modules_imported: sys.exit(0) res = subprocess.run( [sys.executable, "-X", "importtime", "-c", "import qiskit"], capture_output=True, encoding="utf8", check=True, ) import_tree = [ x.split("|")[-1] for x in res.stderr.split("\n") if "RuntimeWarning" not in x or "warnings.warn" not in x ] indent = -1 matched_module = None for module in import_tree: line_indent = len(module) - len(module.lstrip()) module_name = module.strip() if module_name in modules_imported: if indent > 0: continue indent = line_indent matched_module = module_name if indent > 0: if line_indent < indent: print(f"ERROR: {matched_module} is imported via {module_name}") indent = -1 matched_module = None sys.exit(len(modules_imported)) if __name__ == "__main__": _main()
https://github.com/jonasmaziero/computacao_quantica_qiskit
jonasmaziero
import numpy as np def cnot_matrix_ab(d): cn = np.zeros((d**2,d**2),dtype=int) for p in range(0,d): # d^2 elementos não nulos for q in range(0,d): cn[p*d+(p+q)%d,p*d+q] = 1 return cn d=2; cn = cnot_matrix_ab(d); print(cn) d=3; cn = cnot_matrix_ab(d); print(cn) d=4; cn = cnot_matrix_ab(d); print(cn) import numpy as np def cnot_matrix(d, ctr): cn = np.zeros((d**2,d**2),dtype=int) if ctr == 'a': for p in range(0,d): for q in range(0,d): cn[p*d+(p+q)%d,p*d+q] = 1 elif ctr == 'b': for p in range(0,d): for q in range(0,d): cn[((q+p)%d)*d+q,p*d+q] = 1 return cn d=2; print(cnot_matrix(d, 'b')) # ok! d=3; print(cnot_matrix(d, 'b')) def den2dec(local,d): # local = list with the local computational base state values # d = individual qudit dimension N = len(local) j = 0 for k in range(0,N): j += local[k]*d**(N-1-k) return j # value of the global computational basis index # example: 3 qutrits d = 3; N = 3 local = [0,0,0] for j0 in range(0,3): for j1 in range(0,3): for j2 in range(0,3): local = [j0,j1,j2] j = den2dec(local,d) print('j0 j1 j2 =',j0,j1,j2,', j =',j) def dec2den(j,N,d): den = [0 for k in range(0,N)] jv = j for k in range(0,N): if jv >= d**(N-1-k): den[k] = jv//(d**(N-1-k)) jv = jv - den[k]*d**(N-1-k) return den N = 3; d = 3 for j in range(0,d**N): print('j=',j,', den=', dec2den(j,N,d)) def dec2den_opt(j,N,d): # optmized version den = [0 for k in range(0,N)] if j < d: den[N-1] = j; return den rem = [] # list for the remainders k = j while k >= d: rem.append(k%d) k = k//d rem.append(k%d) for j in range(0,len(rem)): den[N-1-j] = rem[j] return den N = 3; d = 3 for j in range(0,d**N): print('j=',j,', den=', dec2den_opt(j,N,d)) def cnot_qudits(d,N,t,c): # d = qudit dimension; N = No. of qudits; t = target qudit (0,...,N-1); c = control qudit (0,...,N-1) D = d**N; cnot = np.zeros((D,D), dtype=int) # set all d^2N elements to 0 for k in range (0,d**N): localr = dec2den_opt(k,N,d) # sequence os values for the local basis locall = localr.copy() # copy the right list to the left list locall[t] = (localr[t]+localr[c])%d globall = den2dec(locall,d) cnot[globall,k] = 1 return cnot d=2; N=2; t=1; c=0; cnot = cnot_qudits(d,N,t,c); print(cnot) # ok! d=2; N=2; t=0; c=1; cnot = cnot_qudits(d,N,t,c); print(cnot) # ok! d=3; N=2; t=1; c=0; cnot = cnot_qudits(d,N,t,c); print(cnot) # ok! d=2; N=3; t=2; c=0; cnot = cnot_qudits(d,N,t,c); print(cnot) # ok from sympy import init_printing, Matrix init_printing(use_unicode=True) from sympy.physics.quantum import TensorProduct def tp(x,y): return TensorProduct(x,y) s1 = Matrix([[0,1],[1,0]]); s0 = Matrix([[1,0],[0,1]]); P0 = Matrix([[1,0],[0,0]]); P1 = Matrix([[0,0],[0,1]]) cnot03 = tp(tp(P0,s0),s0) + tp(tp(P1,s0),s1); cnot03 d=3; N=3; t=1; c=0; cnot = cnot_qudits(d,N,t,c); print(cnot) # ok
https://github.com/swe-bench/Qiskit__qiskit
swe-bench
# -*- coding: utf-8 -*- # This code is part of Qiskit. # # (C) Copyright IBM 2017. # # This code is licensed under the Apache License, Version 2.0. You may # obtain a copy of this license in the LICENSE.txt file in the root directory # of this source tree or at http://www.apache.org/licenses/LICENSE-2.0. # # Any modifications or derivative works of this code must retain this # copyright notice, and modified files need to carry a notice indicating # that they have been altered from the originals. # pylint: disable=wrong-import-order """Main Qiskit public functionality.""" import pkgutil # First, check for required Python and API version from . import util # qiskit errors operator from .exceptions import QiskitError # The main qiskit operators from qiskit.circuit import ClassicalRegister from qiskit.circuit import QuantumRegister from qiskit.circuit import QuantumCircuit # pylint: disable=redefined-builtin from qiskit.tools.compiler import compile # TODO remove after 0.8 from qiskit.execute import execute # The qiskit.extensions.x imports needs to be placed here due to the # mechanism for adding gates dynamically. import qiskit.extensions import qiskit.circuit.measure import qiskit.circuit.reset # Allow extending this namespace. Please note that currently this line needs # to be placed *before* the wrapper imports or any non-import code AND *before* # importing the package you want to allow extensions for (in this case `backends`). __path__ = pkgutil.extend_path(__path__, __name__) # Please note these are global instances, not modules. from qiskit.providers.basicaer import BasicAer # Try to import the Aer provider if installed. try: from qiskit.providers.aer import Aer except ImportError: pass # Try to import the IBMQ provider if installed. try: from qiskit.providers.ibmq import IBMQ except ImportError: pass from .version import __version__ from .version import __qiskit_version__
https://github.com/qiskit-community/qiskit-translations-staging
qiskit-community
from qiskit import QuantumCircuit ghz = QuantumCircuit(5) ghz.h(0) ghz.cx(0,range(1,5)) ghz.draw(output='mpl')
https://github.com/SaashaJoshi/IBM-Qiskit-Summer-School-2020
SaashaJoshi
!pip install -U -r grading_tools/requirements.txt from IPython.display import clear_output clear_output() # our backend is the Pulse Simulator from resources import helper from qiskit.providers.aer import PulseSimulator backend_sim = PulseSimulator() # sample duration for pulse instructions dt = 1e-9 # create the model duffing_model = helper.get_transmon(dt) # get qubit frequency from Duffing model qubit_lo_freq = duffing_model.hamiltonian.get_qubit_lo_from_drift() import numpy as np # visualization tools import matplotlib.pyplot as plt plt.style.use('dark_background') # unit conversion factors -> all backend properties returned in SI (Hz, sec, etc) GHz = 1.0e9 # Gigahertz MHz = 1.0e6 # Megahertz kHz = 1.0e3 # kilohertz us = 1.0e-6 # microseconds ns = 1.0e-9 # nanoseconds from qiskit import pulse from qiskit.pulse import Play, Acquire from qiskit.pulse.pulse_lib import GaussianSquare # qubit to be used throughout the notebook qubit = 0 ### Collect the necessary channels drive_chan = pulse.DriveChannel(qubit) meas_chan = pulse.MeasureChannel(qubit) acq_chan = pulse.AcquireChannel(qubit) # Construct a measurement schedule and add it to an InstructionScheduleMap meas_samples = 1200 meas_pulse = GaussianSquare(duration=meas_samples, amp=0.025, sigma=4, width=1150) measure_sched = Play(meas_pulse, meas_chan) | Acquire(meas_samples, acq_chan, pulse.MemorySlot(qubit)) inst_map = pulse.InstructionScheduleMap() inst_map.add('measure', [qubit], measure_sched) # save the measurement/acquire pulse for later measure = inst_map.get('measure', qubits=[qubit]) from qiskit.pulse import pulse_lib def build_rabi_pulse_schedule(drive_duration, drive_amp, drive_sigma): ### create a Rabi schedule (already done) ### create a Gaussian Rabi pulse using pulse_lib ### play Rabi pulse on the Rabi schedule and return rabi_schedule = pulse.Schedule(name='rabi_experiment') ### WRITE YOUR CODE BETWEEN THESE LINES - START rabi_pulse = pulse_lib.gaussian(duration=drive_duration, amp=drive_amp, sigma=drive_sigma) rabi_schedule = pulse.Schedule() rabi_schedule += Play(rabi_pulse, drive_chan) ### WRITE YOUR CODE BETWEEN THESE LINES - END # add measurement to rabi_schedule # << indicates time shift the beginning to the start of the schedule rabi_schedule += measure << rabi_schedule.duration return rabi_schedule # Gaussian pulse parameters, with varying amplitude drive_duration = 128 num_rabi_points = 41 drive_amps = np.linspace(0, 0.9, num_rabi_points) drive_sigma = 16 # now vary the amplitude for each drive amp rabi_schedules = [] for drive_amp in drive_amps: rabi_schedules.append(build_rabi_pulse_schedule(drive_duration, drive_amp, drive_sigma)) rabi_schedules[-1].draw() # assemble the schedules into a Qobj from qiskit import assemble rabi_qobj = assemble(**helper.get_params('rabi', globals())) answer1a = rabi_qobj # run the simulation rabi_result = backend_sim.run(rabi_qobj, duffing_model).result() # retrieve the data from the experiment rabi_values = helper.get_values_from_result(rabi_result, qubit) fit_params, y_fit = helper.fit_sinusoid(drive_amps, rabi_values, [1, 0, 0.5, 0]) plt.scatter(drive_amps, rabi_values, color='white') plt.plot(drive_amps, y_fit, color='red') drive_period = fit_params[2] # get period of rabi oscillation plt.axvline(0, color='red', linestyle='--') plt.axvline(drive_period/2, color='red', linestyle='--') plt.xlabel("Drive amp [a.u.]", fontsize=15) plt.ylabel("Measured signal [a.u.]", fontsize=15) plt.show() print("Pi pulse amplitude is %f"%float(drive_period/2)) # x_90 is a concise way to say pi_over_2; i.e., an X rotation of 90 degrees x90_pulse = pulse_lib.gaussian(duration=drive_duration, amp=drive_period/4, sigma=drive_sigma, name='x90_pulse') # Ramsey experiment parameters time_max_us = 0.4 time_step_us = 0.0035 times_us = np.arange(0.1, time_max_us, time_step_us) # Convert to units of dt delay_times_dt = times_us * us / dt def build_ramsey_pulse_schedule(delay): ### create a Ramsey pulse schedule (already done) ### play an x90 pulse on the drive channel ### play another x90 pulse after delay ### add measurement pulse to schedule ramsey_schedule = pulse.Schedule(name='ramsey_experiment') ### HINT: include delay by adding it to the duration of the schedule ### round delay to nearest integer with int(delay) ### WRITE YOUR CODE BETWEEN THESE LINES - START ramsey_schedule = pulse.Schedule() ramsey_schedule += Play(x90_pulse, drive_chan) ramsey_schedule += Play(x90_pulse, drive_chan) << ramsey_schedule.duration + int(delay) ramsey_schedule += measure << ramsey_schedule.duration ### WRITE YOUR CODE BETWEEN THESE LINES - END return ramsey_schedule # create schedules for Ramsey experiment ramsey_schedules = [] for delay in delay_times_dt: ramsey_schedules.append(build_ramsey_pulse_schedule(delay)) ramsey_schedules[-1].draw() # assemble the schedules into a Qobj # the helper will drive the pulses off-resonantly by an unknown value ramsey_qobj = assemble(**helper.get_params('ramsey', globals())) answer1b = ramsey_qobj # run the simulation ramsey_result = backend_sim.run(ramsey_qobj, duffing_model).result() # retrieve the data from the experiment ramsey_values = helper.get_values_from_result(ramsey_result, qubit) # off-resonance component fit_params, y_fit = helper.fit_sinusoid(times_us, ramsey_values, [1, 0.7, 0.1, 0.25]) _, _, ramsey_period_us, _, = fit_params del_f_MHz = 1/ramsey_period_us # freq is MHz since times in us plt.scatter(times_us, np.real(ramsey_values), color='white') plt.plot(times_us, y_fit, color='red', label=f"df = {del_f_MHz:.6f} MHz") plt.xlim(np.min(times_us), np.max(times_us)) plt.xlabel('Delay between X90 pulses [$\mu$s]', fontsize=15) plt.ylabel('Measured Signal [a.u.]', fontsize=15) plt.title('Ramsey Experiment', fontsize=15) plt.legend(loc=3) plt.show() print("Drive is off-resonant by %f MHz"%float(del_f_MHz)) name = 'Saasha Joshi' email = 'saashajoshi08@gmail.com' from grading_tools import grade grade(answer1a, name, email, 'lab6', 'ex1a') grade(answer1b, name, email, 'lab6', 'ex1b') from IPython.display import display, Javascript;display(Javascript('IPython.notebook.save_checkpoint();')); from grading_tools import send_code;send_code('ex1.ipynb')
https://github.com/qiskit-community/qiskit-jku-provider
qiskit-community
# This code is part of Qiskit. # # (C) Copyright IBM 2021. # # This code is licensed under the Apache License, Version 2.0. You may # obtain a copy of this license in the LICENSE.txt file in the root directory # of this source tree or at http://www.apache.org/licenses/LICENSE-2.0. # # Any modifications or derivative works of this code must retain this # copyright notice, and modified files need to carry a notice indicating # that they have been altered from the originals. """ pauli common functions """ import logging import numpy as np from qiskit import QuantumCircuit, QuantumRegister from qiskit.algorithms import AlgorithmError from qiskit.circuit import Parameter, ParameterExpression from qiskit.qasm import pi from qiskit.quantum_info import Pauli # pylint: disable=unused-import logger = logging.getLogger(__name__) # pylint: disable=too-many-arguments,too-many-branches,too-many-locals def pauli_measurement(circuit, pauli, qreg, creg, barrier=False): """ Add the proper post-rotation gate on the circuit. Args: circuit (QuantumCircuit): the circuit to be modified. pauli (Pauli): the pauli will be added. qreg (QuantumRegister): the quantum register associated with the circuit. creg (ClassicalRegister): the classical register associated with the circuit. barrier (bool, optional): whether or not add barrier before measurement. Returns: QuantumCircuit: the original circuit object with post-rotation gate """ num_qubits = pauli.num_qubits for qubit_idx in range(num_qubits): if pauli.x[qubit_idx]: if pauli.z[qubit_idx]: # Measure Y circuit.sdg(qreg[qubit_idx]) # sdg circuit.h(qreg[qubit_idx]) # h else: # Measure X circuit.h(qreg[qubit_idx]) # h if barrier: circuit.barrier(qreg[qubit_idx]) circuit.measure(qreg[qubit_idx], creg[qubit_idx]) return circuit def measure_pauli_z(data, pauli): """ Appropriate post-rotations on the state are assumed. Args: data (dict): a dictionary of the form data = {'00000': 10} ({str: int}) pauli (Pauli): a Pauli object Returns: float: Expected value of paulis given data """ observable = 0.0 num_shots = sum(data.values()) p_z_or_x = np.logical_or(pauli.z, pauli.x) for key, value in data.items(): bitstr = np.asarray(list(key))[::-1].astype(int).astype(bool) # pylint: disable=no-member sign = -1.0 if np.logical_xor.reduce(np.logical_and(bitstr, p_z_or_x)) else 1.0 observable += sign * value observable /= num_shots return observable def covariance(data, pauli_1, pauli_2, avg_1, avg_2): """ Compute the covariance matrix element between two Paulis, given the measurement outcome. Appropriate post-rotations on the state are assumed. Args: data (dict): a dictionary of the form data = {'00000': 10} ({str:int}) pauli_1 (Pauli): a Pauli class member pauli_2 (Pauli): a Pauli class member avg_1 (float): expectation value of pauli_1 on `data` avg_2 (float): expectation value of pauli_2 on `data` Returns: float: the element of the covariance matrix between two Paulis """ cov = 0.0 num_shots = sum(data.values()) if num_shots == 1: return cov p1_z_or_x = np.logical_or(pauli_1.z, pauli_1.x) p2_z_or_x = np.logical_or(pauli_2.z, pauli_2.x) for key, value in data.items(): bitstr = np.asarray(list(key))[::-1].astype(int).astype(bool) # pylint: disable=no-member sign_1 = ( -1.0 if np.logical_xor.reduce(np.logical_and(bitstr, p1_z_or_x)) else 1.0 ) sign_2 = ( -1.0 if np.logical_xor.reduce(np.logical_and(bitstr, p2_z_or_x)) else 1.0 ) cov += (sign_1 - avg_1) * (sign_2 - avg_2) * value cov /= num_shots - 1 return cov # pylint: disable=invalid-name def suzuki_expansion_slice_pauli_list(pauli_list, lam_coef, expansion_order): """ Compute the list of pauli terms for a single slice of the suzuki expansion following the paper https://arxiv.org/pdf/quant-ph/0508139.pdf. Args: pauli_list (list[list[complex, Pauli]]): The slice's weighted Pauli list for the suzuki expansion lam_coef (float): The parameter lambda as defined in said paper, adjusted for the evolution time and the number of time slices expansion_order (int): The order for suzuki expansion Returns: list: slice pauli list """ if expansion_order == 1: half = [[lam_coef / 2 * c, p] for c, p in pauli_list] res = half + list(reversed(half)) else: p_k = (4 - 4 ** (1 / (2 * expansion_order - 1))) ** -1 side_base = suzuki_expansion_slice_pauli_list( pauli_list, lam_coef * p_k, expansion_order - 1 ) side = side_base * 2 middle = suzuki_expansion_slice_pauli_list( pauli_list, lam_coef * (1 - 4 * p_k), expansion_order - 1 ) res = side + middle + side return res def check_commutativity(op_1, op_2, anti=False): """ Check the (anti-)commutativity between two operators. Args: op_1 (WeightedPauliOperator): operator op_2 (WeightedPauliOperator): operator anti (bool): if True, check anti-commutativity, otherwise check commutativity. Returns: bool: whether or not two operators are commuted or anti-commuted. """ com = op_1 * op_2 - op_2 * op_1 if not anti else op_1 * op_2 + op_2 * op_1 com.simplify() return bool(com.is_empty()) # pylint: disable=too-many-statements def evolution_instruction( pauli_list, evo_time, num_time_slices, controlled=False, power=1, use_basis_gates=True, shallow_slicing=False, barrier=False, ): """ Construct the evolution circuit according to the supplied specification. Args: pauli_list (list([[complex, Pauli]])): The list of pauli terms corresponding to a single time slice to be evolved evo_time (Union(complex, float, Parameter, ParameterExpression)): The evolution time num_time_slices (int): The number of time slices for the expansion controlled (bool, optional): Controlled circuit or not power (int, optional): The power to which the unitary operator is to be raised use_basis_gates (bool, optional): boolean flag for indicating only using basis gates when building circuit. shallow_slicing (bool, optional): boolean flag for indicating using shallow qc.data reference repetition for slicing barrier (bool, optional): whether or not add barrier for every slice Returns: Instruction: The Instruction corresponding to specified evolution. Raises: AlgorithmError: power must be an integer and greater or equal to 1 ValueError: Unrecognized pauli """ if not isinstance(power, int) or power < 1: raise AlgorithmError("power must be an integer and greater or equal to 1.") state_registers = QuantumRegister(pauli_list[0][1].num_qubits) if controlled: inst_name = f"Controlled-Evolution^{power}" ancillary_registers = QuantumRegister(1) qc_slice = QuantumCircuit(state_registers, ancillary_registers, name=inst_name) else: inst_name = f"Evolution^{power}" qc_slice = QuantumCircuit(state_registers, name=inst_name) # for each pauli [IXYZ]+, record the list of qubit pairs needing CX's cnot_qubit_pairs = [None] * len(pauli_list) # for each pauli [IXYZ]+, record the highest index of the nontrivial pauli gate (X,Y, or Z) top_xyz_pauli_indices = [-1] * len(pauli_list) for pauli_idx, pauli in enumerate(reversed(pauli_list)): n_qubits = pauli[1].num_qubits # changes bases if necessary nontrivial_pauli_indices = [] for qubit_idx in range(n_qubits): # pauli I if not pauli[1].z[qubit_idx] and not pauli[1].x[qubit_idx]: continue if cnot_qubit_pairs[pauli_idx] is None: nontrivial_pauli_indices.append(qubit_idx) if pauli[1].x[qubit_idx]: # pauli X if not pauli[1].z[qubit_idx]: if use_basis_gates: qc_slice.h(state_registers[qubit_idx]) else: qc_slice.h(state_registers[qubit_idx]) # pauli Y elif pauli[1].z[qubit_idx]: if use_basis_gates: qc_slice.u(pi / 2, -pi / 2, pi / 2, state_registers[qubit_idx]) else: qc_slice.rx(pi / 2, state_registers[qubit_idx]) # pauli Z elif pauli[1].z[qubit_idx] and not pauli[1].x[qubit_idx]: pass else: raise ValueError(f"Unrecognized pauli: {pauli[1]}") if nontrivial_pauli_indices: top_xyz_pauli_indices[pauli_idx] = nontrivial_pauli_indices[-1] # insert lhs cnot gates if cnot_qubit_pairs[pauli_idx] is None: cnot_qubit_pairs[pauli_idx] = list( zip( sorted(nontrivial_pauli_indices)[:-1], sorted(nontrivial_pauli_indices)[1:], ) ) for pair in cnot_qubit_pairs[pauli_idx]: qc_slice.cx(state_registers[pair[0]], state_registers[pair[1]]) # insert Rz gate if top_xyz_pauli_indices[pauli_idx] >= 0: # Because Parameter does not support complexity number operation; thus, we do # the following tricks to generate parameterized instruction. # We assume the coefficient in the pauli is always real. and can not do imaginary time # evolution if isinstance(evo_time, (Parameter, ParameterExpression)): lam = 2.0 * pauli[0] / num_time_slices lam = lam.real if lam.imag == 0 else lam lam = lam * evo_time else: lam = (2.0 * pauli[0] * evo_time / num_time_slices).real if not controlled: if use_basis_gates: qc_slice.p(lam, state_registers[top_xyz_pauli_indices[pauli_idx]]) else: qc_slice.rz(lam, state_registers[top_xyz_pauli_indices[pauli_idx]]) else: if use_basis_gates: qc_slice.p( lam / 2, state_registers[top_xyz_pauli_indices[pauli_idx]] ) qc_slice.cx( ancillary_registers[0], state_registers[top_xyz_pauli_indices[pauli_idx]], ) qc_slice.p( -lam / 2, state_registers[top_xyz_pauli_indices[pauli_idx]] ) qc_slice.cx( ancillary_registers[0], state_registers[top_xyz_pauli_indices[pauli_idx]], ) else: qc_slice.crz( lam, ancillary_registers[0], state_registers[top_xyz_pauli_indices[pauli_idx]], ) # insert rhs cnot gates for pair in reversed(cnot_qubit_pairs[pauli_idx]): qc_slice.cx(state_registers[pair[0]], state_registers[pair[1]]) # revert bases if necessary for qubit_idx in range(n_qubits): if pauli[1].x[qubit_idx]: # pauli X if not pauli[1].z[qubit_idx]: if use_basis_gates: qc_slice.h(state_registers[qubit_idx]) else: qc_slice.h(state_registers[qubit_idx]) # pauli Y elif pauli[1].z[qubit_idx]: if use_basis_gates: qc_slice.u(-pi / 2, -pi / 2, pi / 2, state_registers[qubit_idx]) else: qc_slice.rx(-pi / 2, state_registers[qubit_idx]) # repeat the slice if shallow_slicing: logger.info( "Under shallow slicing mode, the qc.data reference is repeated shallowly. " "Thus, changing gates of one slice of the output circuit might affect " "other slices." ) if barrier: qc_slice.barrier(state_registers) qc_slice.data *= num_time_slices * power qc = qc_slice else: qc = QuantumCircuit(*qc_slice.qregs, name=inst_name) for _ in range(num_time_slices * power): qc.append(qc_slice, qc.qubits) if barrier: qc.barrier(state_registers) return qc.to_instruction()
https://github.com/2lambda123/Qiskit-qiskit
2lambda123
# This code is part of Qiskit. # # (C) Copyright IBM 2017, 2019. # # This code is licensed under the Apache License, Version 2.0. You may # obtain a copy of this license in the LICENSE.txt file in the root directory # of this source tree or at http://www.apache.org/licenses/LICENSE-2.0. # # Any modifications or derivative works of this code must retain this # copyright notice, and modified files need to carry a notice indicating # that they have been altered from the originals. """Tests PassManagerConfig""" from qiskit import QuantumRegister from qiskit.providers.backend import Backend from qiskit.test import QiskitTestCase from qiskit.providers.fake_provider import FakeMelbourne, FakeArmonk, FakeHanoi, FakeHanoiV2 from qiskit.providers.basicaer import QasmSimulatorPy from qiskit.transpiler.coupling import CouplingMap from qiskit.transpiler.passmanager_config import PassManagerConfig class TestPassManagerConfig(QiskitTestCase): """Test PassManagerConfig.from_backend().""" def test_config_from_backend(self): """Test from_backend() with a valid backend. `FakeHanoi` is used in this testcase. This backend has `defaults` attribute that contains an instruction schedule map. """ backend = FakeHanoi() config = PassManagerConfig.from_backend(backend) self.assertEqual(config.basis_gates, backend.configuration().basis_gates) self.assertEqual(config.inst_map, backend.defaults().instruction_schedule_map) self.assertEqual( str(config.coupling_map), str(CouplingMap(backend.configuration().coupling_map)) ) def test_config_from_backend_v2(self): """Test from_backend() with a BackendV2 instance.""" backend = FakeHanoiV2() config = PassManagerConfig.from_backend(backend) self.assertEqual(config.basis_gates, backend.operation_names) self.assertEqual(config.inst_map, backend.instruction_schedule_map) self.assertEqual(config.coupling_map.get_edges(), backend.coupling_map.get_edges()) def test_invalid_backend(self): """Test from_backend() with an invalid backend.""" with self.assertRaises(AttributeError): PassManagerConfig.from_backend(Backend()) def test_from_backend_and_user(self): """Test from_backend() with a backend and user options. `FakeMelbourne` is used in this testcase. This backend does not have `defaults` attribute and thus not provide an instruction schedule map. """ qr = QuantumRegister(4, "qr") initial_layout = [None, qr[0], qr[1], qr[2], None, qr[3]] backend = FakeMelbourne() config = PassManagerConfig.from_backend( backend, basis_gates=["user_gate"], initial_layout=initial_layout ) self.assertEqual(config.basis_gates, ["user_gate"]) self.assertNotEqual(config.basis_gates, backend.configuration().basis_gates) self.assertIsNone(config.inst_map) self.assertEqual( str(config.coupling_map), str(CouplingMap(backend.configuration().coupling_map)) ) self.assertEqual(config.initial_layout, initial_layout) def test_from_backendv1_inst_map_is_none(self): """Test that from_backend() works with backend that has defaults defined as None.""" backend = FakeHanoi() backend.defaults = lambda: None config = PassManagerConfig.from_backend(backend) self.assertIsInstance(config, PassManagerConfig) self.assertIsNone(config.inst_map) def test_simulator_backend_v1(self): """Test that from_backend() works with backendv1 simulator.""" backend = QasmSimulatorPy() config = PassManagerConfig.from_backend(backend) self.assertIsInstance(config, PassManagerConfig) self.assertIsNone(config.inst_map) self.assertIsNone(config.coupling_map) def test_invalid_user_option(self): """Test from_backend() with an invalid user option.""" with self.assertRaises(TypeError): PassManagerConfig.from_backend(FakeMelbourne(), invalid_option=None) def test_str(self): """Test string output.""" pm_config = PassManagerConfig.from_backend(FakeArmonk()) # For testing remove instruction schedule map it's str output is non-deterministic # based on hash seed pm_config.inst_map = None str_out = str(pm_config) expected = """Pass Manager Config: initial_layout: None basis_gates: ['id', 'rz', 'sx', 'x'] inst_map: None coupling_map: None layout_method: None routing_method: None translation_method: None scheduling_method: None instruction_durations: id(0,): 7.111111111111111e-08 s rz(0,): 0.0 s sx(0,): 7.111111111111111e-08 s x(0,): 7.111111111111111e-08 s measure(0,): 4.977777777777777e-06 s backend_properties: {'backend_name': 'ibmq_armonk', 'backend_version': '2.4.3', 'gates': [{'gate': 'id', 'name': 'id0', 'parameters': [{'date': datetime.datetime(2021, 3, 15, 0, 38, 15, tzinfo=tzoffset(None, -14400)), 'name': 'gate_error', 'unit': '', 'value': 0.00019769550670970334}, {'date': datetime.datetime(2021, 3, 15, 0, 40, 24, tzinfo=tzoffset(None, -14400)), 'name': 'gate_length', 'unit': 'ns', 'value': 71.11111111111111}], 'qubits': [0]}, {'gate': 'rz', 'name': 'rz0', 'parameters': [{'date': datetime.datetime(2021, 3, 15, 0, 40, 24, tzinfo=tzoffset(None, -14400)), 'name': 'gate_error', 'unit': '', 'value': 0}, {'date': datetime.datetime(2021, 3, 15, 0, 40, 24, tzinfo=tzoffset(None, -14400)), 'name': 'gate_length', 'unit': 'ns', 'value': 0}], 'qubits': [0]}, {'gate': 'sx', 'name': 'sx0', 'parameters': [{'date': datetime.datetime(2021, 3, 15, 0, 38, 15, tzinfo=tzoffset(None, -14400)), 'name': 'gate_error', 'unit': '', 'value': 0.00019769550670970334}, {'date': datetime.datetime(2021, 3, 15, 0, 40, 24, tzinfo=tzoffset(None, -14400)), 'name': 'gate_length', 'unit': 'ns', 'value': 71.11111111111111}], 'qubits': [0]}, {'gate': 'x', 'name': 'x0', 'parameters': [{'date': datetime.datetime(2021, 3, 15, 0, 38, 15, tzinfo=tzoffset(None, -14400)), 'name': 'gate_error', 'unit': '', 'value': 0.00019769550670970334}, {'date': datetime.datetime(2021, 3, 15, 0, 40, 24, tzinfo=tzoffset(None, -14400)), 'name': 'gate_length', 'unit': 'ns', 'value': 71.11111111111111}], 'qubits': [0]}], 'general': [], 'last_update_date': datetime.datetime(2021, 3, 15, 0, 40, 24, tzinfo=tzoffset(None, -14400)), 'qubits': [[{'date': datetime.datetime(2021, 3, 15, 0, 36, 17, tzinfo=tzoffset(None, -14400)), 'name': 'T1', 'unit': 'us', 'value': 182.6611165336624}, {'date': datetime.datetime(2021, 3, 14, 0, 33, 45, tzinfo=tzoffset(None, -18000)), 'name': 'T2', 'unit': 'us', 'value': 237.8589220110257}, {'date': datetime.datetime(2021, 3, 15, 0, 40, 24, tzinfo=tzoffset(None, -14400)), 'name': 'frequency', 'unit': 'GHz', 'value': 4.971852852405576}, {'date': datetime.datetime(2021, 3, 15, 0, 40, 24, tzinfo=tzoffset(None, -14400)), 'name': 'anharmonicity', 'unit': 'GHz', 'value': -0.34719293148282626}, {'date': datetime.datetime(2021, 3, 15, 0, 35, 20, tzinfo=tzoffset(None, -14400)), 'name': 'readout_error', 'unit': '', 'value': 0.02400000000000002}, {'date': datetime.datetime(2021, 3, 15, 0, 35, 20, tzinfo=tzoffset(None, -14400)), 'name': 'prob_meas0_prep1', 'unit': '', 'value': 0.0234}, {'date': datetime.datetime(2021, 3, 15, 0, 35, 20, tzinfo=tzoffset(None, -14400)), 'name': 'prob_meas1_prep0', 'unit': '', 'value': 0.024599999999999955}, {'date': datetime.datetime(2021, 3, 15, 0, 35, 20, tzinfo=tzoffset(None, -14400)), 'name': 'readout_length', 'unit': 'ns', 'value': 4977.777777777777}]]} approximation_degree: None seed_transpiler: None timing_constraints: None unitary_synthesis_method: default unitary_synthesis_plugin_config: None target: None """ self.assertEqual(str_out, expected)
https://github.com/ronitd2002/IBM-Quantum-challenge-2024
ronitd2002
from qiskit import QuantumCircuit # Create a new circuit with a single qubit qc = QuantumCircuit(1) # Add a Not gate to qubit 0 qc.x(0) # Return a drawing of the circuit using MatPlotLib ("mpl"). This is the # last line of the cell, so the drawing appears in the cell output. qc.draw("mpl") ### CHECK QISKIT VERSION import qiskit qiskit.__version__ ### CHECK OTHER DEPENDENCIES %pip show pylatexenc matplotlib qc_grader #qc-grader should be 0.18.8 (or higher) ### Imports from qiskit import QuantumCircuit from qiskit.quantum_info import SparsePauliOp from qiskit_ibm_runtime import EstimatorV2 as Estimator from qiskit_aer import AerSimulator import matplotlib.pyplot as plt from qc_grader.challenges.iqc_2024 import grade_lab0_ex1 # Create a new circuit with two qubits qc = QuantumCircuit(2) # Add a Hadamard gate to qubit 0 qc.h(0) # Perform a CNOT gate on qubit 1, controlled by qubit 0 qc.cx(0, 1) # Return a drawing of the circuit using MatPlotLib ("mpl"). This is the # last line of the cell, so the drawing appears in the cell output. qc.draw("mpl") # The ZZ applies a Z operator on qubit 0, and a Z operator on qubit 1 ZZ = SparsePauliOp('ZZ') # The ZI applies a Z operator on qubit 0, and an Identity operator on qubit 1 ZI = SparsePauliOp('ZI') # The IX applies an Identity operator on qubit 0, and an X operator on qubit 1 IX = SparsePauliOp('IX') ### Write your code below here ### IZ = SparsePauliOp('IZ') XX = SparsePauliOp('XX') XI = SparsePauliOp('XI') ### Follow the same naming convention we used above ## Don't change any code past this line, but remember to run the cell. observables = [IZ, IX, ZI, XI, ZZ, XX] # Submit your answer using following code grade_lab0_ex1(observables) # Set up the Estimator estimator = Estimator(backend=AerSimulator()) # Submit the circuit to Estimator pub = (qc, observables) job = estimator.run(pubs=[pub]) # Collect the data data = ['IZ', 'IX', 'ZI', 'XI', 'ZZ', 'XX'] values = job.result()[0].data.evs # Set up our graph container = plt.plot(data, values, '-o') # Label each axis plt.xlabel('Observables') plt.ylabel('Values') # Draw the final graph plt.show() container = plt.bar(data, values, width=0.8) plt.xlabel('Observables') plt.ylabel('Values') plt.show()
https://github.com/maryrbarros2/QuantumAlgorithms_Qiskit
maryrbarros2
# Do the necessary imports import numpy as np from qiskit import QuantumCircuit, QuantumRegister, ClassicalRegister, execute, BasicAer, IBMQ from qiskit.visualization import plot_histogram, plot_bloch_multivector ### Creating 3 qubit and 2 classical bits in each separate register qr = QuantumRegister(3) crz = ClassicalRegister(1) crx = ClassicalRegister(1) teleportation_circuit = QuantumCircuit(qr, crz, crx) ### A third party eve helps to create an entangled state def create_bell_pair(qc, a, b): qc.h(a) qc.cx(a, b) create_bell_pair(teleportation_circuit, 1, 2) teleportation_circuit.draw() def alice_gates(qc, a, b): qc.cx(a, b) qc.h(a) teleportation_circuit.barrier() alice_gates(teleportation_circuit, 0, 1) teleportation_circuit.draw() def measure_and_send(qc, a, b): qc.barrier() qc.measure(a,0) qc.measure(b,1) teleportation_circuit.barrier() measure_and_send(teleportation_circuit, 0, 1) teleportation_circuit.draw() def bob_gates(qc, qubit, crz, crx): qc.x(qubit).c_if(crx, 1) qc.z(qubit).c_if(crz, 1) teleportation_circuit.barrier() bob_gates(teleportation_circuit, 2, crz, crx) teleportation_circuit.draw() from qiskit.extensions import Initialize import math qc = QuantumCircuit(1) initial_state = [0,1] init_gate = Initialize(initial_state) # qc.append(initialize_qubit, [0]) qr = QuantumRegister(3) # Protocol uses 3 qubits crz = ClassicalRegister(1) # and 2 classical registers crx = ClassicalRegister(1) qc = QuantumCircuit(qr, crz, crx) # First, let's initialise Alice's q0 qc.append(init_gate, [0]) qc.barrier() # Now begins the teleportation protocol create_bell_pair(qc, 1, 2) qc.barrier() # Send q1 to Alice and q2 to Bob alice_gates(qc, 0, 1) # Alice then sends her classical bits to Bob measure_and_send(qc, 0, 1) # Bob decodes qubits bob_gates(qc, 2, crz, crx) qc.draw() backend = BasicAer.get_backend('statevector_simulator') out_vector = execute(qc, backend).result().get_statevector() plot_bloch_multivector(out_vector) inverse_init_gate = init_gate.gates_to_uncompute() qc.append(inverse_init_gate, [2]) qc.draw() cr_result = ClassicalRegister(1) qc.add_register(cr_result) qc.measure(2,2) qc.draw() backend = BasicAer.get_backend('qasm_simulator') counts = execute(qc, backend, shots=1024).result().get_counts() plot_histogram(counts) def bob_gates(qc, a, b, c): qc.cz(a, c) qc.cx(b, c) qc = QuantumCircuit(3,1) # First, let's initialise Alice's q0 qc.append(init_gate, [0]) qc.barrier() # Now begins the teleportation protocol create_bell_pair(qc, 1, 2) qc.barrier() # Send q1 to Alice and q2 to Bob alice_gates(qc, 0, 1) qc.barrier() # Alice sends classical bits to Bob bob_gates(qc, 0, 1, 2) # We undo the initialisation process qc.append(inverse_init_gate, [2]) # See the results, we only care about the state of qubit 2 qc.measure(2,0) # View the results: qc.draw() from qiskit import IBMQ IBMQ.save_account('### IMB TOKEN ') IBMQ.load_account() provider = IBMQ.get_provider(hub='ibm-q') provider.backends() from qiskit.providers.ibmq import least_busy backend = least_busy(provider.backends(filters=lambda b: b.configuration().n_qubits >= 3 and not b.configuration().simulator and b.status().operational==True)) job_exp = execute(qc, backend=backend, shots=8192) exp_result = job_exp.result() exp_measurement_result = exp_result.get_counts(qc) print(exp_measurement_result) plot_histogram(exp_measurement_result) error_rate_percent = sum([exp_measurement_result[result] for result in exp_measurement_result.keys() if result[0]=='1']) \ * 100./ sum(list(exp_measurement_result.values())) print("The experimental error rate : ", error_rate_percent, "%")
https://github.com/AlphaMiyaL/Qiskit-Quantum-Journey
AlphaMiyaL
#imports import matplotlib.pyplot as plt import numpy as np from qiskit import * from qiskit.providers.ibmq import least_busy from qiskit.quantum_info import Statevector from qiskit.visualization import plot_histogram from qiskit.tools.monitor import job_monitor clause_list = [[0,1], [0,2], [1,3], [2,3]] def XOR(qc, a, b, output): qc.cx(a, output) qc.cx(b, output) # We will use separate registers to name the bits in_qubits = QuantumRegister(2, name='input') out_qubit = QuantumRegister(1, name='output') qc = QuantumCircuit(in_qubits, out_qubit) XOR(qc, in_qubits[0], in_qubits[1], out_qubit) qc.draw() # Create separate registers to name bits var_qubits = QuantumRegister(4, name='v') # variable bits clause_qubits = QuantumRegister(4, name='c') # bits to store clause-checks # Create quantum circuit qc = QuantumCircuit(var_qubits, clause_qubits) # Use XOR gate to check each clause i = 0 for clause in clause_list: XOR(qc, clause[0], clause[1], clause_qubits[i]) i += 1 qc.draw() # Create separate registers to name bits var_qubits = QuantumRegister(4, name='v') clause_qubits = QuantumRegister(4, name='c') output_qubit = QuantumRegister(1, name='out') qc = QuantumCircuit(var_qubits, clause_qubits, output_qubit) # Compute clauses i = 0 for clause in clause_list: XOR(qc, clause[0], clause[1], clause_qubits[i]) i += 1 # Flip 'output' bit if all clauses are satisfied qc.mct(clause_qubits, output_qubit) qc.draw() var_qubits = QuantumRegister(4, name='v') clause_qubits = QuantumRegister(4, name='c') output_qubit = QuantumRegister(1, name='out') cbits = ClassicalRegister(4, name='cbits') qc = QuantumCircuit(var_qubits, clause_qubits, output_qubit, cbits) def diffuser(nqubits): qc = QuantumCircuit(nqubits) # Apply transformation |s> -> |00..0> (H-gates) for qubit in range(nqubits): qc.h(qubit) # Apply transformation |00..0> -> |11..1> (X-gates) for qubit in range(nqubits): qc.x(qubit) # Do multi-controlled-Z gate qc.h(nqubits-1) qc.mct(list(range(nqubits-1)), nqubits-1) # multi-controlled-toffoli qc.h(nqubits-1) # Apply transformation |11..1> -> |00..0> for qubit in range(nqubits): qc.x(qubit) # Apply transformation |00..0> -> |s> for qubit in range(nqubits): qc.h(qubit) # We will return the diffuser as a gate U_s = qc.to_gate() U_s.name = "U$_s$" return U_s def sudoku_oracle(qc, clause_list, clause_qubits): # Compute clauses i = 0 for clause in clause_list: XOR(qc, clause[0], clause[1], clause_qubits[i]) i += 1 # Flip 'output' bit if all clauses are satisfied qc.mct(clause_qubits, output_qubit) # Uncompute clauses to reset clause-checking bits to 0 i = 0 for clause in clause_list: XOR(qc, clause[0], clause[1], clause_qubits[i]) i += 1 sudoku_oracle(qc, clause_list, clause_qubits) qc.draw() var_qubits = QuantumRegister(4, name='v') clause_qubits = QuantumRegister(4, name='c') output_qubit = QuantumRegister(1, name='out') cbits = ClassicalRegister(4, name='cbits') qc = QuantumCircuit(var_qubits, clause_qubits, output_qubit, cbits) # Initialize 'out0' in state |-> qc.initialize([1, -1]/np.sqrt(2), output_qubit) # Initialize qubits in state |s> qc.h(var_qubits) qc.barrier() # for visual separation ## First Iteration # Apply our oracle sudoku_oracle(qc, clause_list, clause_qubits) qc.barrier() # for visual separation # Apply our diffuser qc.append(diffuser(4), [0,1,2,3]) ## Second Iteration sudoku_oracle(qc, clause_list, clause_qubits) qc.barrier() # for visual separation # Apply our diffuser qc.append(diffuser(4), [0,1,2,3]) # Measure the variable qubits qc.measure(var_qubits, cbits) qc.draw(fold=-1) # Simulate and plot results backend = Aer.get_backend('aer_simulator') #provider = IBMQ.load_account() #backend = provider.get_backend('ibm_oslo') job = execute(qc, backend=backend, shots=1024) print("job id:", job.job_id()) job_monitor(job) result = job.result() plot_histogram(result.get_counts())
https://github.com/qiskit-community/qiskit-translations-staging
qiskit-community
from qiskit_optimization import QuadraticProgram problem = QuadraticProgram("sample") problem.binary_var("x") problem.binary_var("y") problem.maximize(linear={"x": 1, "y": -2}) print(problem.prettyprint()) from qiskit.algorithms import NumPyMinimumEigensolver from qiskit_optimization.algorithms import MinimumEigenOptimizer mes = NumPyMinimumEigensolver() meo = MinimumEigenOptimizer(min_eigen_solver=mes) result = meo.solve(problem) print(result) from qiskit.algorithms.minimum_eigensolvers import NumPyMinimumEigensolver from qiskit_optimization.algorithms import MinimumEigenOptimizer mes = NumPyMinimumEigensolver() meo = MinimumEigenOptimizer(min_eigen_solver=mes) result = meo.solve(problem) print(result) from qiskit import BasicAer from qiskit.algorithms import QAOA from qiskit.algorithms.optimizers import COBYLA from qiskit.utils import QuantumInstance from qiskit_optimization.algorithms import MinimumEigenOptimizer backend = BasicAer.get_backend("qasm_simulator") shots = 1000 qins = QuantumInstance(backend=backend, shots=shots) mes = QAOA(optimizer=COBYLA(), quantum_instance=qins) meo = MinimumEigenOptimizer(min_eigen_solver=mes) result = meo.solve(problem) print(result) from qiskit.algorithms.minimum_eigensolvers import QAOA from qiskit.algorithms.optimizers import COBYLA from qiskit.primitives import Sampler from qiskit_optimization.algorithms import MinimumEigenOptimizer shots = 1000 mes = QAOA(sampler=Sampler(), optimizer=COBYLA()) meo = MinimumEigenOptimizer(min_eigen_solver=mes) result = meo.solve(problem) print(result) from qiskit import BasicAer from qiskit.algorithms import VQE from qiskit.algorithms.optimizers import COBYLA from qiskit.circuit.library import RealAmplitudes from qiskit.utils import QuantumInstance from qiskit_optimization.algorithms import MinimumEigenOptimizer backend = BasicAer.get_backend("qasm_simulator") shots = 1000 qins = QuantumInstance(backend=backend, shots=shots) mes = VQE(ansatz=RealAmplitudes(), optimizer=COBYLA(), quantum_instance=qins) meo = MinimumEigenOptimizer(min_eigen_solver=mes) result = meo.solve(problem) print(result) from qiskit.algorithms.minimum_eigensolvers import SamplingVQE from qiskit.algorithms.optimizers import COBYLA from qiskit.circuit.library import RealAmplitudes from qiskit.primitives import Sampler from qiskit_optimization.algorithms import MinimumEigenOptimizer mes = SamplingVQE(sampler=Sampler(), ansatz=RealAmplitudes(), optimizer=COBYLA()) meo = MinimumEigenOptimizer(min_eigen_solver=mes) result = meo.solve(problem) print(result) from qiskit.algorithms.minimum_eigensolvers import VQE from qiskit.algorithms.optimizers import COBYLA from qiskit.circuit.library import RealAmplitudes from qiskit.primitives import Estimator from qiskit_optimization.algorithms import MinimumEigenOptimizer mes = VQE(estimator=Estimator(), ansatz=RealAmplitudes(), optimizer=COBYLA()) try: meo = MinimumEigenOptimizer(min_eigen_solver=mes) except TypeError as ex: print(ex) from qiskit import BasicAer from qiskit.algorithms import QAOA from qiskit.algorithms.optimizers import COBYLA from qiskit.utils import QuantumInstance from qiskit_optimization.algorithms import WarmStartQAOAOptimizer, SlsqpOptimizer backend = BasicAer.get_backend("qasm_simulator") shots = 1000 qins = QuantumInstance(backend=backend, shots=shots) qaoa = QAOA(optimizer=COBYLA(), quantum_instance=qins) optimizer = WarmStartQAOAOptimizer( pre_solver=SlsqpOptimizer(), relax_for_pre_solver=True, qaoa=qaoa, epsilon=0.25 ) result = optimizer.solve(problem) print(result) from qiskit.algorithms.minimum_eigensolvers import QAOA from qiskit.algorithms.optimizers import COBYLA from qiskit.primitives import Sampler from qiskit_optimization.algorithms import WarmStartQAOAOptimizer, SlsqpOptimizer qaoa = QAOA(sampler=Sampler(), optimizer=COBYLA()) optimizer = WarmStartQAOAOptimizer( pre_solver=SlsqpOptimizer(), relax_for_pre_solver=True, qaoa=qaoa, epsilon=0.25 ) result = optimizer.solve(problem) print(result) from qiskit import BasicAer from qiskit.algorithms.optimizers import COBYLA from qiskit.utils import QuantumInstance from qiskit_optimization.algorithms import GroverOptimizer backend = BasicAer.get_backend("qasm_simulator") shots = 1000 qins = QuantumInstance(backend=backend, shots=shots) optimizer = GroverOptimizer(num_value_qubits=3, num_iterations=3, quantum_instance=qins) result = optimizer.solve(problem) print(result) from qiskit.algorithms.optimizers import COBYLA from qiskit.primitives import Sampler from qiskit_optimization.algorithms import GroverOptimizer optimizer = GroverOptimizer(num_value_qubits=3, num_iterations=3, sampler=Sampler()) result = optimizer.solve(problem) print(result) from qiskit import BasicAer from qiskit.algorithms.optimizers import COBYLA from qiskit.utils import QuantumInstance from qiskit.primitives import Sampler from qiskit_optimization.algorithms import GroverOptimizer backend = BasicAer.get_backend("qasm_simulator") shots = 1000 qins = QuantumInstance(backend=backend, shots=shots) try: optimizer = GroverOptimizer( num_value_qubits=3, num_iterations=3, quantum_instance=qins, sampler=Sampler() ) # raises an error because both quantum_instance and sampler are set. except ValueError as ex: print(ex) import qiskit.tools.jupyter %qiskit_version_table %qiskit_copyright
https://github.com/deveshq/QC-with-qiskit
deveshq
#initialization import matplotlib.pyplot as plt import numpy as np import math # importing Qiskit from qiskit import IBMQ, Aer, transpile, assemble from qiskit import QuantumCircuit, ClassicalRegister, QuantumRegister # import basic plot tools from qiskit.visualization import plot_histogram qpe = QuantumCircuit(4, 3) qpe.x(3) #Apply Hadamard gate for qubit in range(3): qpe.h(qubit) qpe.draw() repetitions = 1 for counting_qubit in range(3): for i in range(repetitions): qpe.cp(math.pi/4, counting_qubit, 3); # This is CU # we use 2*pi*(1/theta) repetitions *= 2 qpe.draw() def qft_dagger(qc, n): """n-qubit QFTdagger the first n qubits in circ""" # Don't forget the Swaps! for qubit in range(n//2): qc.swap(qubit, n-qubit-1) for j in range(n): for m in range(j): qc.cp(-math.pi/float(2**(j-m)), m, j) qc.h(j) qpe.barrier() # Apply inverse QFT qft_dagger(qpe, 3) # Measure qpe.barrier() for n in range(3): qpe.measure(n,n) qpe.draw() aer_sim = Aer.get_backend('aer_simulator') shots = 2048 t_qpe = transpile(qpe, aer_sim) qobj = assemble(t_qpe, shots=shots) results = aer_sim.run(qobj).result() answer = results.get_counts() plot_histogram(answer) # Create and set up circuit qpe2 = QuantumCircuit(4, 3) # Apply H-Gates to counting qubits: for qubit in range(3): qpe2.h(qubit) # Prepare our eigenstate |psi>: qpe2.x(3) # Do the controlled-U operations: angle = 2*math.pi/3 repetitions = 1 for counting_qubit in range(3): for i in range(repetitions): qpe2.cp(angle, counting_qubit, 3); repetitions *= 2 # Do the inverse QFT: qft_dagger(qpe2, 3) # Measure of course! for n in range(3): qpe2.measure(n,n) qpe2.draw() # Let's see the results! aer_sim = Aer.get_backend('aer_simulator') shots = 4096 t_qpe2 = transpile(qpe2, aer_sim) qobj = assemble(t_qpe2, shots=shots) results = aer_sim.run(qobj).result() answer = results.get_counts() plot_histogram(answer) # Create and set up circuit qpe3 = QuantumCircuit(6, 5) # Apply H-Gates to counting qubits: for qubit in range(5): qpe3.h(qubit) # Prepare our eigenstate |psi>: qpe3.x(5) # Do the controlled-U operations: angle = 2*math.pi/3 repetitions = 1 for counting_qubit in range(5): for i in range(repetitions): qpe3.cp(angle, counting_qubit, 5); repetitions *= 2 # Do the inverse QFT: qft_dagger(qpe3, 5) # Measure of course! qpe3.barrier() for n in range(5): qpe3.measure(n,n) qpe3.draw() # Let's see the results! aer_sim = Aer.get_backend('aer_simulator') shots = 4096 t_qpe3 = transpile(qpe3, aer_sim) qobj = assemble(t_qpe3, shots=shots) results = aer_sim.run(qobj).result() answer = results.get_counts() plot_histogram(answer)
https://github.com/qiskit-community/qiskit-translations-staging
qiskit-community
from qiskit import QuantumRegister, ClassicalRegister, QuantumCircuit q = QuantumRegister(1) c = ClassicalRegister(1) qc = QuantumCircuit(q, c) qc.h(q) qc.measure(q, c) qc.draw(output='mpl', style={'backgroundcolor': '#EEEEEE'})
https://github.com/qiskit-community/qiskit-translations-staging
qiskit-community
#General imports import numpy as np #Operator Imports from qiskit.opflow import Z, X, I, StateFn, CircuitStateFn, SummedOp from qiskit.opflow.gradients import Gradient, NaturalGradient, QFI, Hessian #Circuit imports from qiskit.circuit import QuantumCircuit, QuantumRegister, Parameter, ParameterVector, ParameterExpression from qiskit.circuit.library import EfficientSU2 # Instantiate the quantum state a = Parameter('a') b = Parameter('b') q = QuantumRegister(1) qc = QuantumCircuit(q) qc.h(q) qc.rz(a, q[0]) qc.rx(b, q[0]) # Instantiate the Hamiltonian observable H = (2 * X) + Z # Combine the Hamiltonian observable and the state op = ~StateFn(H) @ CircuitStateFn(primitive=qc, coeff=1.) # Print the operator corresponding to the expectation value print(op) params = [a, b] # Define the values to be assigned to the parameters value_dict = {a: np.pi / 4, b: np.pi} # Convert the operator and the gradient target params into the respective operator grad = Gradient().convert(operator = op, params = params) # Print the operator corresponding to the Gradient print(grad) # Assign the parameters and evaluate the gradient grad_result = grad.assign_parameters(value_dict).eval() print('Gradient', grad_result) # Define the Hamiltonian with fixed coefficients H = 0.5 * X - 1 * Z # Define the parameters w.r.t. we want to compute the gradients params = [a, b] # Define the values to be assigned to the parameters value_dict = { a: np.pi / 4, b: np.pi} # Combine the Hamiltonian observable and the state into an expectation value operator op = ~StateFn(H) @ CircuitStateFn(primitive=qc, coeff=1.) print(op) # Convert the expectation value into an operator corresponding to the gradient w.r.t. the state parameters using # the parameter shift method. state_grad = Gradient(grad_method='param_shift').convert(operator=op, params=params) # Print the operator corresponding to the gradient print(state_grad) # Assign the parameters and evaluate the gradient state_grad_result = state_grad.assign_parameters(value_dict).eval() print('State gradient computed with parameter shift', state_grad_result) # Convert the expectation value into an operator corresponding to the gradient w.r.t. the state parameter using # the linear combination of unitaries method. state_grad = Gradient(grad_method='lin_comb').convert(operator=op, params=params) # Print the operator corresponding to the gradient print(state_grad) # Assign the parameters and evaluate the gradient state_grad_result = state_grad.assign_parameters(value_dict).eval() print('State gradient computed with the linear combination method', state_grad_result) # Convert the expectation value into an operator corresponding to the gradient w.r.t. the state parameter using # the finite difference method. state_grad = Gradient(grad_method='fin_diff').convert(operator=op, params=params) # Print the operator corresponding to the gradient print(state_grad) # Assign the parameters and evaluate the gradient state_grad_result = state_grad.assign_parameters(value_dict).eval() print('State gradient computed with finite difference', state_grad_result) # Besides the method to compute the circuit gradients resp. QFI, a regularization method can be chosen: # `ridge` or `lasso` with automatic parameter search or `perturb_diag_elements` or `perturb_diag` # which perturb the diagonal elements of the QFI. nat_grad = NaturalGradient(grad_method='lin_comb', qfi_method='lin_comb_full', regularization='ridge').convert( operator=op, params=params) # Assign the parameters and evaluate the gradient nat_grad_result = nat_grad.assign_parameters(value_dict).eval() print('Natural gradient computed with linear combination of unitaries', nat_grad_result) # Instantiate the Hamiltonian observable H = X # Instantiate the quantum state with two parameters a = Parameter('a') b = Parameter('b') q = QuantumRegister(1) qc = QuantumCircuit(q) qc.h(q) qc.rz(a, q[0]) qc.rx(b, q[0]) # Combine the Hamiltonian observable and the state op = ~StateFn(H) @ CircuitStateFn(primitive=qc, coeff=1.) # Convert the operator and the hessian target coefficients into the respective operator hessian = Hessian().convert(operator = op, params = [a, b]) # Define the values to be assigned to the parameters value_dict = {a: np.pi / 4, b: np.pi/4} # Assign the parameters and evaluate the Hessian w.r.t. the Hamiltonian coefficients hessian_result = hessian.assign_parameters(value_dict).eval() print('Hessian \n', np.real(np.array(hessian_result))) # Define parameters params = [a, b] # Get the operator object representing the Hessian state_hess = Hessian(hess_method='param_shift').convert(operator=op, params=params) # Assign the parameters and evaluate the Hessian hessian_result = state_hess.assign_parameters(value_dict).eval() print('Hessian computed using the parameter shift method\n', (np.array(hessian_result))) # Get the operator object representing the Hessian state_hess = Hessian(hess_method='lin_comb').convert(operator=op, params=params) # Assign the parameters and evaluate the Hessian hessian_result = state_hess.assign_parameters(value_dict).eval() print('Hessian computed using the linear combination of unitaries method\n', (np.array(hessian_result))) # Get the operator object representing the Hessian using finite difference state_hess = Hessian(hess_method='fin_diff').convert(operator=op, params=params) # Assign the parameters and evaluate the Hessian hessian_result = state_hess.assign_parameters(value_dict).eval() print('Hessian computed with finite difference\n', (np.array(hessian_result))) # Wrap the quantum circuit into a CircuitStateFn state = CircuitStateFn(primitive=qc, coeff=1.) # Convert the state and the parameters into the operator object that represents the QFI qfi = QFI(qfi_method='lin_comb_full').convert(operator=state, params=params) # Define the values for which the QFI is to be computed values_dict = {a: np.pi / 4, b: 0.1} # Assign the parameters and evaluate the QFI qfi_result = qfi.assign_parameters(values_dict).eval() print('full QFI \n', np.real(np.array(qfi_result))) # Convert the state and the parameters into the operator object that represents the QFI # and set the approximation to 'block_diagonal' qfi = QFI('overlap_block_diag').convert(operator=state, params=params) # Assign the parameters and evaluate the QFI qfi_result = qfi.assign_parameters(values_dict).eval() print('Block-diagonal QFI \n', np.real(np.array(qfi_result))) # Convert the state and the parameters into the operator object that represents the QFI # and set the approximation to 'diagonal' qfi = QFI('overlap_diag').convert(operator=state, params=params) # Assign the parameters and evaluate the QFI qfi_result = qfi.assign_parameters(values_dict).eval() print('Diagonal QFI \n', np.real(np.array(qfi_result))) # Execution Imports from qiskit import Aer from qiskit.utils import QuantumInstance # Algorithm Imports from qiskit.algorithms import VQE from qiskit.algorithms.optimizers import CG from qiskit.opflow import I, X, Z from qiskit.circuit import QuantumCircuit, ParameterVector from scipy.optimize import minimize # Instantiate the system Hamiltonian h2_hamiltonian = -1.05 * (I ^ I) + 0.39 * (I ^ Z) - 0.39 * (Z ^ I) - 0.01 * (Z ^ Z) + 0.18 * (X ^ X) # This is the target energy h2_energy = -1.85727503 # Define the Ansatz wavefunction = QuantumCircuit(2) params = ParameterVector('theta', length=8) it = iter(params) wavefunction.ry(next(it), 0) wavefunction.ry(next(it), 1) wavefunction.rz(next(it), 0) wavefunction.rz(next(it), 1) wavefunction.cx(0, 1) wavefunction.ry(next(it), 0) wavefunction.ry(next(it), 1) wavefunction.rz(next(it), 0) wavefunction.rz(next(it), 1) # Define the expectation value corresponding to the energy op = ~StateFn(h2_hamiltonian) @ StateFn(wavefunction) grad = Gradient(grad_method='lin_comb') qi_sv = QuantumInstance(Aer.get_backend('aer_simulator_statevector'), shots=1, seed_simulator=2, seed_transpiler=2) #Conjugate Gradient algorithm optimizer = CG(maxiter=50) # Gradient callable vqe = VQE(wavefunction, optimizer=optimizer, gradient=grad, quantum_instance=qi_sv) result = vqe.compute_minimum_eigenvalue(h2_hamiltonian) print('Result:', result.optimal_value, 'Reference:', h2_energy) import qiskit.tools.jupyter %qiskit_version_table %qiskit_copyright
https://github.com/Bikramaditya0154/Quantum-Simulation-of-the-ground-states-of-Li-and-Li-2-using-Variational-Quantum-EIgensolver
Bikramaditya0154
from qiskit import Aer from qiskit_nature.drivers import UnitsType, Molecule from qiskit_nature.drivers.second_quantization import ( ElectronicStructureDriverType, ElectronicStructureMoleculeDriver, ) from qiskit_nature.problems.second_quantization import ElectronicStructureProblem from qiskit_nature.converters.second_quantization import QubitConverter from qiskit_nature.mappers.second_quantization import JordanWignerMapper molecule = Molecule( geometry=[["Li", [0.0, 0.0, 0.0]]], charge=2, multiplicity=2 ) driver = ElectronicStructureMoleculeDriver( molecule, basis="sto3g", driver_type=ElectronicStructureDriverType.PYSCF ) es_problem = ElectronicStructureProblem(driver) qubit_converter = QubitConverter(JordanWignerMapper()) from qiskit.providers.aer import StatevectorSimulator from qiskit import Aer from qiskit.utils import QuantumInstance from qiskit_nature.algorithms import VQEUCCFactory quantum_instance = QuantumInstance(backend=Aer.get_backend("aer_simulator_statevector")) vqe_solver = VQEUCCFactory(quantum_instance=quantum_instance) from qiskit.algorithms import VQE from qiskit.circuit.library import TwoLocal tl_circuit = TwoLocal( rotation_blocks=["h", "rx"], entanglement_blocks="cz", entanglement="full", reps=2, parameter_prefix="y", ) another_solver = VQE( ansatz=tl_circuit, quantum_instance=QuantumInstance(Aer.get_backend("aer_simulator_statevector")), ) from qiskit_nature.algorithms import GroundStateEigensolver calc = GroundStateEigensolver(qubit_converter, vqe_solver) res = calc.solve(es_problem) print(res)
https://github.com/qiskit-community/qiskit-translations-staging
qiskit-community
# You can show the phase of each state and use # degrees instead of radians from qiskit.quantum_info import DensityMatrix import numpy as np from qiskit import QuantumCircuit from qiskit.visualization import plot_state_qsphere qc = QuantumCircuit(2) qc.h([0, 1]) qc.cz(0,1) qc.ry(np.pi/3, 0) qc.rx(np.pi/5, 1) qc.z(1) matrix = DensityMatrix(qc) plot_state_qsphere(matrix, show_state_phases = True, use_degrees = True)
https://github.com/qiskit-community/qiskit-translations-staging
qiskit-community
# Create circuit to test transpiler on from qiskit import QuantumCircuit from qiskit.circuit.library import GroverOperator, Diagonal oracle = Diagonal([1]*7 + [-1]) qc = QuantumCircuit(3) qc.h([0,1,2]) qc = qc.compose(GroverOperator(oracle)) # Use Statevector object to calculate the ideal output from qiskit.quantum_info import Statevector ideal_distribution = Statevector.from_instruction(qc).probabilities_dict() from qiskit.visualization import plot_histogram plot_histogram(ideal_distribution) from qiskit_ibm_runtime import QiskitRuntimeService service = QiskitRuntimeService() backend = service.backend('ibm_algiers') # Need to add measurements to the circuit qc.measure_all() from qiskit import transpile circuits = [] for optimization_level in [0, 3]: t_qc = transpile(qc, backend, optimization_level=optimization_level, seed_transpiler=0) print(f'CNOTs (optimization_level={optimization_level}): ', t_qc.count_ops()['cx']) circuits.append(t_qc) from qiskit.transpiler import PassManager, InstructionDurations from qiskit.transpiler.passes import ASAPSchedule, DynamicalDecoupling from qiskit.circuit.library import XGate # Get gate durations so the transpiler knows how long each operation takes durations = InstructionDurations.from_backend(backend) # This is the sequence we'll apply to idling qubits dd_sequence = [XGate(), XGate()] # Run scheduling and dynamic decoupling passes on circuit pm = PassManager([ASAPSchedule(durations), DynamicalDecoupling(durations, dd_sequence)] ) circ_dd = pm.run(circuits[1]) # Add this new circuit to our list circuits.append(circ_dd) from qiskit_ibm_runtime import Sampler, Session with Session(service=service, backend=backend): sampler = Sampler() job = sampler.run( circuits=circuits, # sample all three circuits skip_transpilation=True, shots=8000) result = job.result() from qiskit.visualization import plot_histogram binary_prob = [quasi_dist.binary_probabilities() for quasi_dist in result.quasi_dists] plot_histogram(binary_prob+[ideal_distribution], bar_labels=False, legend=['optimization_level=0', 'optimization_level=3', 'optimization_level=3 + dd', 'ideal distribution']) from qiskit.quantum_info import hellinger_fidelity for counts in result.quasi_dists: print( f"{hellinger_fidelity(counts.binary_probabilities(), ideal_distribution):.3f}" ) import qiskit_ibm_runtime qiskit_ibm_runtime.version.get_version_info() from qiskit.tools.jupyter import * %qiskit_version_table %qiskit_copyright
https://github.com/qiskit-community/qiskit-pocket-guide
qiskit-community
from qiskit import BasicAer print(BasicAer.backends()) from qiskit import QuantumCircuit,BasicAer,transpile qc = QuantumCircuit(2) qc.h(0) qc.cx(0, 1) qc.measure_all() backend = BasicAer.get_backend("qasm_simulator") tqc = transpile(qc, backend) job = backend.run(tqc, shots=1000) result = job.result() counts = result.get_counts(tqc) print(counts) from qiskit import QuantumCircuit,BasicAer,transpile qc = QuantumCircuit(2) qc.h(0) qc.cx(0, 1) backend = BasicAer.get_backend("statevector_simulator") tqc = transpile(qc, backend) job = backend.run(tqc) result = job.result() statevector = result.get_statevector(tqc, 4) print(statevector) from qiskit import QuantumCircuit,BasicAer,transpile qc = QuantumCircuit(2) qc.h(0) qc.cx(0, 1) backend = BasicAer.get_backend("unitary_simulator") tqc = transpile(qc, backend) job = backend.run(tqc) result = job.result() unitary = result.get_unitary(tqc, 4) print(unitary)
https://github.com/aryashah2k/Quantum-Computing-Collection-Of-Resources
aryashah2k
# This is a comment # A comment is used for explanations/descriptions/etc. # Comments do not affect the programs # let's define an integer variable named a a = 5 # let's print its value print(a) # let's define three integer variables named a, b, and c a = 2 b = 4 c = a + b # summation of a and b # let's print their values together print(a,b,c) # a single space will automatically appear in between # let's print their values in reverse order print(c,b,a) # let's print their summation and multiplication print(a+b+c,a*b*c) # let's define variables with string/text values hw = "hello world" # we can use double quotes hqw = 'hello quantum world' # we can use single quotes # let's print them print(hw) print(hqw) # let's print them together by inserting another string in between print(hw,"and",hqw) # let's concatenate a few strings d = "Hello " + 'World' + " but " + 'Quantum ' + "World" # let's print the result print(d) # let's print numeric and string values together print("a =",a,", b =",b,", a+b =",a+b) # let's subtract two numbers d = a-b print(a,b,d) # let's divide two numbers d = a/b print(a,b,d) # let's divide integers over integers # the result is always an integer (with possible integer remainder) d = 33 // 6 print(d) # reminder/mod operator r = 33 % 6 # 33 mod 6 = 3 # or when 33 is divided by 6 over integers, the reminder is 3 # 33 = 5 * 6 + 3 # let's print the result print(r) # Booleen variables t = True f = False # let's print their values print(t,f) # print their negations print(not t) print("the negation of",t,"is",not t) print(not f) print("the negation of",f,"is",not f) # define a float variable d = -3.4444 # let's print its value and its square print(d, d * d) e = (23*13) - (11 * 15) print(e) # we can use more than one variable # left is the variable for the left part of the expression # we start with the multiplication inside the parentheses left = 34*11 # we continue with the substruction inside the parentheses # we reuse the variable named left left = 123 - left # we reuse left again for the multiplication with -3 left = -3 * left # right is the variable for the right part of the expression # we use the same idea here right = 23 * 15 right = 5 + right right = 4 * right # at the end, we use left for the result left = left + right # let's print the result print(left) # # your solution is here # n1,n2,n3 = 3,-4,6 print(n1,n2,n3) r1 = (2 * n1 + 3 * n2)*2 - 5 *n3 print(r1) # # your solution is here # n1,n2,n3 = 3,-4,6 up = (n1-n2) * (n2-n3) down = (n3-n1) * (n3+1) result = up/down print (result) # # your solution is here # N = "Arya" S = "Shah" print("hello from the quantum world to",N,S)
https://github.com/matteoacrossi/oqs-jupyterbook
matteoacrossi
# Imports import numpy as np from qiskit import QuantumRegister, QuantumCircuit, Aer, execute from qiskit.ignis.verification.tomography import state_tomography_circuits, StateTomographyFitter import matplotlib.pyplot as plt from qiskit.quantum_info import partial_trace from qiskit.quantum_info.states import DensityMatrix def depolarizing_channel(q, p, system, ancillae): """Returns a QuantumCircuit implementing depolarizing channel on q[system] Args: q (QuantumRegister): the register to use for the circuit p (float): the probability for the channel between 0 and 1 system (int): index of the system qubit ancillae (list): list of indices for the ancillary qubits Returns: A QuantumCircuit object """ dc = QuantumCircuit(q) # theta = 1/2 * np.arccos(1-2*p) # dc.ry(theta, q[ancillae[0]]) dc.ry(theta, q[ancillae[1]]) dc.ry(theta, q[ancillae[2]]) dc.cx(q[ancillae[0]], q[system]) dc.cy(q[ancillae[1]], q[system]) dc.cz(q[ancillae[2]], q[system]) return dc # We create the quantum circuit q = QuantumRegister(5, name='q') # Index of the system qubit system = 2 # Indices of the ancillary qubits ancillae = [1, 3, 4] # Prepare the qubit in a state that has coherence and different populations prepare_state = QuantumCircuit(q) prepare_state.u(np.pi/4, np.pi/4, 0, q[system]) # For example, let's consider 10 equally spaced values of p p_values = np.linspace(0, 1, 10) # Here we will create a list of results for each different value of p tomography_circuits = [] for p in p_values: circ = prepare_state + depolarizing_channel(q, p, system, ancillae) tomography_circuits.append(state_tomography_circuits(circ, q[system])) tomography_results = [] for tomo_circ in tomography_circuits: job = execute(tomo_circ, Aer.get_backend('qasm_simulator'), shots=8192) tomography_results.append(job.result()) tomo_rhos = np.zeros((2,2,len(p_values)), dtype=complex) for (i, p) in enumerate(p_values): tomo_fitter = StateTomographyFitter(tomography_results[i], tomography_circuits[i]) tomo_rhos[:,:,i] = tomo_fitter.fit() # Simulated results plt.plot(p_values, np.real(tomo_rhos[0,1,:]),"C0*", label='Re $\\rho_{01}$') plt.plot(p_values, np.imag(tomo_rhos[0,1,:]),"C1*", label='Im $\\rho_{01}$') plt.plot(p_values, np.real(tomo_rhos[0,0,:]),"C2x", label='$\\rho_{00}$') plt.plot(p_values, np.real(tomo_rhos[1,1,:]),"C3x", label='$\\rho_{11}$') # Theoretical prediction # We obtain the density operator of the initial state rho0 = partial_trace(DensityMatrix.from_instruction(prepare_state), [0, 1, 3, 4]).data plt.plot(p_values, np.real(rho0[0,1])*(1-p_values), "C0", linewidth=.5) plt.plot(p_values, np.imag(rho0[0,1])*(1-p_values), "C1", linewidth=.5) plt.plot(p_values, 0.5*p_values + np.real(rho0[0,0])*(1-p_values), "C2", linewidth=.5) plt.plot(p_values, 0.5*p_values + np.real(rho0[1,1])*(1-p_values), "C3", linewidth=.5) plt.xlabel('p') plt.ylabel('$\\rho_{xx}$') plt.legend(); plt.title("SIMULATION Depol. channel. Full tomo. $|\\psi_0\\rangle = U_3(\\pi/4,\\pi/4,0)|0\\rangle$");
https://github.com/Pitt-JonesLab/slam_decomposition
Pitt-JonesLab
import logging logger = logging.getLogger() logger.setLevel(logging.INFO) import numpy as np # %matplotlib widget from qiskit import transpile from qiskit import QuantumCircuit from qiskit.circuit.random import random_circuit from slam.utils.transpiler_pass.weyl_decompose import ( RootiSwapWeylDecomposition as decomposer, ) from qiskit.transpiler.passes import ( Collect2qBlocks, ConsolidateBlocks, Unroll3qOrMore, Optimize1qGates, ) from slam.utils.gates.custom_gates import RiSwapGate from qiskit.circuit.library import CXGate from qiskit.converters import circuit_to_dag from qiskit.transpiler.basepasses import TransformationPass from qiskit.quantum_info import Operator from slam.basis import MixedOrderBasisCircuitTemplate from slam.utils.polytopes.polytope_wrap import monodromy_range_from_target from slam.utils.gates.family_extend import recursive_sibling_check from slam.utils.gates.bare_candidates import get_group_name from slam.utils.gates.duraton_scaling import cost_scaling, atomic_cost_scaling from slam.utils.gates.winner_selection import pick_winner from qiskit.transpiler.basepasses import AnalysisPass from qiskit.transpiler.passes import CountOps from qiskit.dagcircuit import DAGOpNode, DAGCircuit from qiskit.transpiler import PassManager from itertools import product from slam.utils.circuit_suite import benchmark_lambdas # load square-lattice coupling map or all-to-all from qiskit.transpiler import CouplingMap coupling_map = CouplingMap.from_grid(8, 8) coupling_map = CouplingMap.from_grid(3, 3) # coupling_map = CouplingMap.from_full(16) # load qiskit transpiler with pass for coupling map induce_swaps = lambda qc: transpile(qc, coupling_map=coupling_map, optimization_level=3) qc = benchmark_lambdas[3](9) # turn off logging logger.setLevel(logging.ERROR) qc = induce_swaps(qc) # turn back on logging logger.setLevel(logging.INFO) duration_1q = 0.1 benchmark_lambdas[3](9).draw("mpl") from slam.utils.transpiler_pass.speed_limit_pass import ( pass_manager_basic, pass_manager_slam, pass_manager_optimized_sqiswap, ) qc.draw("mpl") qc = QuantumCircuit(2) qc.cx(0, 1) qc.swap(0, 1) qc.barrier() qc.cx(1, 0) # qc.swap(0,1) # qc.h(1) # qc.crz(np.pi/2, 0, 1) # qc.h(0) from weylchamber import c1c2c3 print(c1c2c3(Operator(qc).data)) qc.draw(output="mpl") qc.draw("mpl") pm = pass_manager_basic(gate="sqiswap", duration_1q=duration_1q) transp1 = pm.run(qc) # transp1.draw(output='mpl') print(0.1 * 247 + 0.5 * 246) print(0.1 * 5 + 1.9 * 45 + 1.3 * 56) pm = pass_manager_optimized_sqiswap(duration_1q=duration_1q, speed_method="linear") transp1 = pm.run(qc) # transp1.draw(output='mpl') method = ["linear", "mid", "squared", "hardware"][0] strategy = ["basic_overall", "lambda_weight", "basic_smush", "lambda_smush"][3] use_fam = 0 pm = pass_manager_slam( strategy=strategy, family_extension=use_fam, speed_method=method, duration_1q=duration_1q, coupling_map=coupling_map, ) transp0 = pm.run(qc) transp0.draw(output="mpl")
https://github.com/jlapeyre/Qurt.jl
jlapeyre
from qiskit import QuantumRegister, QuantumCircuit from qiskit.circuit import Clbit, Qubit from qiskit.transpiler import PassManager from qiskit.transpiler.passes import CXCancellation from qiskit.dagcircuit import DAGCircuit import qiskit.dagcircuit from qiskit.circuit import QuantumCircuit, Qubit from qiskit.converters import circuit_to_dag import rustworkx as rx def make_cnot_circuit(): nq = 2 qc = QuantumCircuit(nq) (n1, n2, n3) = (4, 5, 3) for _ in range(n1): qc.cx(0, 1) for _ in range(n2): qc.cx(1, 0) for _ in range(n3): qc.cx(0, 1) return qc def cancel_cnots(qc): pass_manager = PassManager() pass_manager.append(CXCancellation()) out_circuit = pass_manager.run(qc) return out_circuit def make_and_cancel(): qc = make_cnot_circuit() cancel_cnots(qc)
https://github.com/DaisukeIto-ynu/KosakaQ
DaisukeIto-ynu
# -*- coding: utf-8 -*- # This code is part of Qiskit. # # (C) Copyright IBM 2017. # # This code is licensed under the Apache License, Version 2.0. You may # obtain a copy of this license in the LICENSE.txt file in the root directory # of this source tree or at http://www.apache.org/licenses/LICENSE-2.0. # # Any modifications or derivative works of this code must retain this # copyright notice, and modified files need to carry a notice indicating # that they have been altered from the originals. # pylint: disable=wrong-import-order """Main Qiskit public functionality.""" import pkgutil # First, check for required Python and API version from . import util # qiskit errors operator from .exceptions import QiskitError # The main qiskit operators from qiskit.circuit import ClassicalRegister from qiskit.circuit import QuantumRegister from qiskit.circuit import QuantumCircuit # pylint: disable=redefined-builtin from qiskit.tools.compiler import compile # TODO remove after 0.8 from qiskit.execute import execute # The qiskit.extensions.x imports needs to be placed here due to the # mechanism for adding gates dynamically. import qiskit.extensions import qiskit.circuit.measure import qiskit.circuit.reset # Allow extending this namespace. Please note that currently this line needs # to be placed *before* the wrapper imports or any non-import code AND *before* # importing the package you want to allow extensions for (in this case `backends`). __path__ = pkgutil.extend_path(__path__, __name__) # Please note these are global instances, not modules. from qiskit.providers.basicaer import BasicAer # Try to import the Aer provider if installed. try: from qiskit.providers.aer import Aer except ImportError: pass # Try to import the IBMQ provider if installed. try: from qiskit.providers.ibmq import IBMQ except ImportError: pass from .version import __version__ from .version import __qiskit_version__
https://github.com/jonasmaziero/computacao_quantica_qiskit
jonasmaziero
import numpy as np import math def Sx(j,k,d): # d = qudit dimension # j,k = identification of the Gell-Mann matrix # th = rotation angle j = j-1; k = k-1 sx = np.zeros((d,d), dtype=complex) sx[j,k] = 1 sx[k,j] = sx[j,k] return sx def Sy(j,k,d): # d = qudit dimension # j,k = identification of the Gell-Mann matrix # th = rotation angle j = j-1; k = k-1 sy = np.zeros((d,d), dtype=complex) sy[j,k] = -1j sy[k,j] = -sy[j,k] return sy def Sz(j,d): # d = qudit dimension # j = identification of the Gell-Mann matrix # th = rotation angle sz = np.zeros((d,d), dtype=complex) for k in range(0,j+1): sz[k,k] = math.sqrt(2/(j*(j+1))) if k == j: # corrige para iniciar k em 0 sz[k,k] = sz[k,k]*(-j) return sz d = 2; j = 1; k = 2; Sx(j,k,d), Sy(j,k,d), Sz(j,d) d = 3; Sx(1,2,d), Sx(1,3,d), Sx(2,3,d) d = 3; Sy(1,2,d), Sy(1,3,d), Sy(2,3,d) d = 3; Sz(1,d), Sz(2,d) 1/math.sqrt(3), -2/math.sqrt(3) def Rx(j,k,d,th): # d = qudit dimension # j,k = identification of the Gell-Mann matrix # th = rotation angle j = j-1; k = k-1 rx = np.eye(d, dtype=complex) rx[j,j] = math.cos(th/2) rx[k,k] = rx[j,j] rx[j,k] = -1j*math.sin(th/2) rx[k,j] = rx[j,k] return rx def Ry(j,k,d,th): # d = qudit dimension # j,k = identification of the Gell-Mann matrix # th = rotation angle j = j-1; k = k-1 ry = np.eye(d, dtype=complex) ry[j,j] = math.cos(th/2) ry[k,k] = ry[j,j] ry[j,k] = -math.sin(th/2) ry[k,j] = -ry[j,k] return ry def Rz(j,d,th): # d = qudit dimension # j = identification of the Gell-Mann matrix # th = rotation angle rz = np.eye(d, dtype=complex) for k in range(0,j+1): angle = (th/2)*math.sqrt(2/(j*(j+1))) if k == j: # corrige para iniciar k em 0 angle = angle*(-j) rz[k,k] = math.cos(angle) - 1j*math.sin(angle) return rz d = 2; j = 1; k = 2; th = 0; Rx(j,k,d,th), Ry(j,k,d,th), Rz(j,d,th) d = 3; j = 1; k = 2; th = 0; Rx(j,k,d,th), Ry(j,k,d,th), Rz(j,d,th)
https://github.com/drobiu/quantum-project
drobiu
import numpy as np from qiskit import QuantumRegister, QuantumCircuit, ClassicalRegister from src.logic.find_color_positions import FCP from src.util.util import run_qc secret_string = [3, 2, 2, 0] print("Input string:", secret_string) print("\nPerforming FUC\n") colors = np.zeros(4) for i in secret_string: colors[i] = 1 results = [] colors = list(colors) print("FCP result:", colors) print("\nPerforming FCP\n") if not np.array_equal(np.array(colors), np.ones_like(colors)): zero = colors.index(0) for i in range(4): if colors[i] == 0: results.append(np.zeros(4)) print("Color", i, ": -") continue qy = QuantumRegister(8, name='qy') y = QuantumRegister(4, name='y') s = QuantumRegister(3) c = ClassicalRegister(4) qc = QuantumCircuit(y, qy, s, c) qc = FCP(qc, y, qy, s, secret_string, c=i, d=zero) qc.measure(y[:], c[::-1]) result = run_qc(qc, with_QI=False, verbose=False) curr_result = list(result.get_counts(qc).keys()) assert len(curr_result) == 1 print("Color", i, ":", curr_result[0]) results.append(list(map(int, str(curr_result[0])))) result_string = np.zeros(4) for i in range(4): for j, n in enumerate(results[i]): if n == 1: result_string[j] = i print(result_string)
https://github.com/18520339/uts-quantum-computing
18520339
from IPython.display import YouTubeVideo YouTubeVideo('BYKc2RnQMqo', width=858, height=540) !pip install qiskit --quiet !pip install qiskit-aer --quiet !pip install pylatexenc --quiet # @markdown ### **1. Import `Qiskit` and essential packages** { display-mode: "form" } from qiskit import QuantumCircuit, transpile, assemble from qiskit.circuit.library import QFT from qiskit_aer import AerSimulator from fractions import Fraction import random import sympy import math # @markdown ### **2. Controlled Modular Multiplication for $U(x) = a^x mod N$** { display-mode: "form" } class CtrlMultCircuit(QuantumCircuit): def __init__(self, a, binary_power, N): super().__init__(N.bit_length()) self.a = a self.power = 2 ** binary_power # Convert binary to decimal self.N = N self.name = f'{self.a}^{self.power} mod {self.N}' self._create_circuit() def _create_circuit(self): for dec_power in range(self.power): a_exp = self.a ** dec_power % self.N for i in range(self.num_qubits): if a_exp >> i & 1: self.x(i) for j in range(i + 1, self.num_qubits): if a_exp >> j & 1: self.swap(i, j) # @markdown ### **3. Quantum Phase Estimation with `Modular Exponentiation` and `Quantum Fourier Transform` to find period $r$** { display-mode: "form" } # @markdown ![](https://reneroliveira.github.io/quantum-shors-algorithm/images/shor_circuit.png) class QPECircuit(QuantumCircuit): def __init__(self, a, N): super().__init__(2 * N.bit_length(), N.bit_length()) self.a = a self.N = N self._create_circuit() def _modular_exponentiation(self): for qbit_idx in range(self.num_qubits // 2): self.append( CtrlMultCircuit(self.a, qbit_idx, self.N).to_gate().control(), [qbit_idx] + list(range(self.num_qubits // 2, 2 * self.num_qubits // 2)) ) def _create_circuit(self): self.h(range(self.num_qubits // 2)) # Apply Hadamard gates to the first n qubits self.x(self.num_qubits - 1) self.barrier() self._modular_exponentiation() # Apply controlled modular exponentiation self.barrier() self.append( QFT(self.num_qubits // 2, inverse=True), range(self.num_qubits // 2) # Apply inverse QFT to the first n qubits ) def collapse(self, simulator): self.measure(range(self.num_qubits // 2), range(self.num_qubits // 2)) transpiled_circuit = transpile(self, simulator) self.collapse_result = simulator.run(transpiled_circuit, memory=True).result() return self.collapse_result # @markdown ### **4. Completed Shor's Algorithm for Integer Factorization** { display-mode: "form" } class ShorAlgorithm: def __init__(self, N, max_attempts=-1, random_coprime_only=False, simulator=None): self.N = N self.simulator = simulator self.max_attempts = max_attempts # -1 for all possible values of a self.random_coprime_only = random_coprime_only # True to select only coprime values of a and N def execute(self): is_N_invalid = self._is_N_invalid() if is_N_invalid: return is_N_invalid # Only coprime values remain if random_coprime_only is enabled, # Otherwise select a random integer in [2, N) as initial guess a_values = [a for a in range(2, self.N) if not self.random_coprime_only or (math.gcd(a, self.N) == 1)] print(f'[INFO] {len(a_values)} possible values of a: {a_values}') self.max_attempts = len(a_values) if self.max_attempts <= -1 else min(self.max_attempts, len(a_values)) attempts_count = 0 while attempts_count < self.max_attempts: print(f'\n===== Attempt {attempts_count + 1}/{self.max_attempts} =====') attempts_count += 1 self.chosen_a = random.choice(a_values) self.r = 1 print(f'[START] Chosen base a: {self.chosen_a}') if not self.random_coprime_only: gcd = math.gcd(self.chosen_a, self.N) if gcd != 1: print(f'=> {self.chosen_a} and {self.N} share common factor: {self.N} = {gcd} * {self.N // gcd}') return gcd, self.N // gcd print(f'>>> {self.chosen_a} and {self.N} are coprime => Perform Quantum Phase Estimation to find {self.chosen_a}^r - 1 = 0 (MOD {self.N})') if not self._quantum_period_finding(): a_values.remove(self.chosen_a) self.r = self.chosen_a = self.qpe_circuit = None continue factors = self._classical_postprocess() if factors: return factors a_values.remove(self.chosen_a) self.r = self.chosen_a = self.qpe_circuit = None print(f'[FAIL] No non-trivial factors found after {self.max_attempts} attempts.') def _is_N_invalid(self): if self.N <= 3: print('[ERR] N must be > 3') return 1, self.N if self.N % 2 == 0: print(f'=> {self.N} is an even number: {self.N} = 2 * {self.N // 2}') return 2, self.N // 2 if sympy.isprime(self.N): print(f'=> {self.N} is a prime number: {self.N} = 1 * {self.N}') return 1, self.N max_exponent = int(math.log2(self.N)) # Start with a large exponent and reduce for k in range(max_exponent, 1, -1): p = round(self.N ** (1 / k)) if p ** k == self.N: print(f'=> {self.N} is a power of prime: {self.N} = {p}^{k}') return p, k return False def _quantum_period_finding(self): while self.chosen_a ** self.r % self.N != 1: # QPE + continued fractions may find wrong r self.qpe_circuit = QPECircuit(self.chosen_a, self.N) # Find phase s/r result = self.qpe_circuit.collapse(self.simulator) state_bin = result.get_memory()[0] state_dec = int(state_bin, 2) # Convert to decimal bits_count = 2 ** (self.N.bit_length() - 1) phase = state_dec / bits_count # Continued fraction to find r self.r = Fraction(phase).limit_denominator(self.N).denominator # Get fraction that most closely approximates phase if self.r > self.N or self.r == 1: # Safety check to avoid infinite loops print(f'[ERR] Invalid period found: r = {self.r} => Retry with different a.') return False print(f'>>> Output State: |{state_bin}⟩ = {state_dec} (dec) => Phase = {state_dec} / {bits_count} = {phase:.3f}') return True def _classical_postprocess(self): # Classical postprocessing to find factors from the period print(f'>>> Found r = {self.r} => a^{{r/2}} ± 1 = {self.chosen_a:.0f}^{self.r/2:.0f} ± 1') if self.r % 2 != 0: print(f'[ERR] r = {self.r} is odd => Retry with different a.') return None int1, int2 = self.chosen_a ** (self.r // 2) - 1, self.chosen_a ** (self.r // 2) + 1 if int1 % self.N == 0 or int2 % self.N == 0: print(f'[ERR] {self.chosen_a}^{self.r/2:.0f} ± 1 is a multiple of {self.N} => Retry with different a.') return None factor1, factor2 = math.gcd(int1, self.N), math.gcd(int2, self.N) if factor1 not in [1, self.N] and factor2 not in [1, self.N]: # Check to see if factor is non-trivial print(f'[DONE] Successfully found non-trivial factors: {self.N} = {factor1} * {factor2}') return factor1, factor2 print(f'[FAIL] Trivial factors found: [1, {self.N}] => Retry with different a.') return None # @markdown ### **5. Run the Factorization** { display-mode: "form" } number_to_factor = 21 # @param {type:"slider", min: 15, max: 55, step: 1} max_attempts = -1 # @param {type:"slider", min:-1, max:100, step:10} random_coprime_only = False # @param {type:"boolean"} # @markdown ***Note**: `max_attempts` will be limited to number of available values. shor = ShorAlgorithm(number_to_factor, max_attempts, random_coprime_only, AerSimulator()) factors = shor.execute() try: display(shor.qpe_circuit.draw(output='mpl', fold=-1)) except Exception: pass
https://github.com/intrinsicvardhan/QuantumComputingAlgos
intrinsicvardhan
# Do the necessary imports import numpy as np from qiskit import QuantumCircuit, QuantumRegister, ClassicalRegister from qiskit import IBMQ, Aer, transpile, assemble from qiskit.visualization import plot_histogram, plot_bloch_multivector, array_to_latex from qiskit.extensions import Initialize from qiskit.ignis.verification import marginal_counts from qiskit.quantum_info import random_statevector # Loading your IBM Quantum account(s) provider = IBMQ.load_account() ## SETUP # Protocol uses 3 qubits and 2 classical bits in 2 different registers qr = QuantumRegister(3, name="q") # Protocol uses 3 qubits crz = ClassicalRegister(1, name="crz") # and 2 classical bits crx = ClassicalRegister(1, name="crx") # in 2 different registers teleportation_circuit = QuantumCircuit(qr, crz, crx) def create_bell_pair(qc, a, b): qc.h(a) qc.cx(a,b) qr = QuantumRegister(3, name="q") crz, crx = ClassicalRegister(1, name="crz"), ClassicalRegister(1, name="crx") teleportation_circuit = QuantumCircuit(qr, crz, crx) create_bell_pair(teleportation_circuit, 1, 2) teleportation_circuit.draw() def alice_gates(qc, psi, a): qc.cx(psi, a) qc.h(psi) qr = QuantumRegister(3, name="q") crz, crx = ClassicalRegister(1, name="crz"), ClassicalRegister(1, name="crx") teleportation_circuit = QuantumCircuit(qr, crz, crx) ## STEP 1 create_bell_pair(teleportation_circuit, 1, 2) ## STEP 2 teleportation_circuit.barrier() # Use barrier to separate steps alice_gates(teleportation_circuit, 0, 1) teleportation_circuit.draw() def measure_and_send(qc, a, b): """Measures qubits a & b and 'sends' the results to Bob""" qc.barrier() qc.measure(a,0) qc.measure(b,1) qr = QuantumRegister(3, name="q") crz, crx = ClassicalRegister(1, name="crz"), ClassicalRegister(1, name="crx") teleportation_circuit = QuantumCircuit(qr, crz, crx) create_bell_pair(teleportation_circuit, 1, 2) teleportation_circuit.barrier() # Use barrier to separate steps alice_gates(teleportation_circuit, 0, 1) measure_and_send(teleportation_circuit, 0 ,1) teleportation_circuit.draw() def bob_gates(qc, qubit, crz, crx): qc.x(qubit).c_if(crx, 1) # Apply gates if the registers qc.z(qubit).c_if(crz, 1) # are in the state '1' qr = QuantumRegister(3, name="q") crz, crx = ClassicalRegister(1, name="crz"), ClassicalRegister(1, name="crx") teleportation_circuit = QuantumCircuit(qr, crz, crx) ## STEP 1 create_bell_pair(teleportation_circuit, 1, 2) ## STEP 2 teleportation_circuit.barrier() # Use barrier to separate steps alice_gates(teleportation_circuit, 0, 1) ## STEP 3 measure_and_send(teleportation_circuit, 0, 1) ## STEP 4 teleportation_circuit.barrier() # Use barrier to separate steps bob_gates(teleportation_circuit, 2, crz, crx) teleportation_circuit.draw() # Create random 1-qubit state psi = random_statevector(2) # Display it nicely display(array_to_latex(psi, prefix="|\\psi\\rangle =")) # Show it on a Bloch sphere plot_bloch_multivector(psi) init_gate = Initialize(psi) init_gate.label = "init" ## SETUP qr = QuantumRegister(3, name="q") # Protocol uses 3 qubits crz = ClassicalRegister(1, name="crz") # and 2 classical registers crx = ClassicalRegister(1, name="crx") qc = QuantumCircuit(qr, crz, crx) ## STEP 0 # First, let's initialize Alice's q0 qc.append(init_gate, [0]) qc.barrier() ## STEP 1 # Now begins the teleportation protocol create_bell_pair(qc, 1, 2) qc.barrier() ## STEP 2 # Send q1 to Alice and q2 to Bob alice_gates(qc, 0, 1) ## STEP 3 # Alice then sends her classical bits to Bob measure_and_send(qc, 0, 1) ## STEP 4 # Bob decodes qubits bob_gates(qc, 2, crz, crx) # Display the circuit qc.draw() sim = Aer.get_backend('aer_simulator') qc.save_statevector() out_vector = sim.run(qc).result().get_statevector() plot_bloch_multivector(out_vector)
https://github.com/qiskit-community/qiskit-translations-staging
qiskit-community
import numpy as np from qiskit import QuantumCircuit from qiskit.providers.fake_provider import FakeVigoV2 backend = FakeVigoV2() qc = QuantumCircuit(2, 1) qc.h(0) qc.x(1) qc.cp(np.pi/4, 0, 1) qc.h(0) qc.measure([0], [0]) qc.draw(output='mpl')
https://github.com/2lambda123/Qiskit-qiskit
2lambda123
# This code is part of Qiskit. # # (C) Copyright IBM 2022. # # This code is licensed under the Apache License, Version 2.0. You may # obtain a copy of this license in the LICENSE.txt file in the root directory # of this source tree or at http://www.apache.org/licenses/LICENSE-2.0. # # Any modifications or derivative works of this code must retain this # copyright notice, and modified files need to carry a notice indicating # that they have been altered from the originals. """A swap strategy pass for blocks of commuting gates.""" from __future__ import annotations from collections import defaultdict from qiskit.circuit import Gate, QuantumCircuit, Qubit from qiskit.converters import circuit_to_dag from qiskit.dagcircuit import DAGCircuit, DAGOpNode from qiskit.transpiler import TransformationPass, Layout, TranspilerError from qiskit.transpiler.passes.routing.commuting_2q_gate_routing.swap_strategy import SwapStrategy from qiskit.transpiler.passes.routing.commuting_2q_gate_routing.commuting_2q_block import ( Commuting2qBlock, ) class Commuting2qGateRouter(TransformationPass): """A class to swap route one or more commuting gates to the coupling map. This pass routes blocks of commuting two-qubit gates encapsulated as :class:`.Commuting2qBlock` instructions. This pass will not apply to other instructions. The mapping to the coupling map is done using swap strategies, see :class:`.SwapStrategy`. The swap strategy should suit the problem and the coupling map. This transpiler pass should ideally be executed before the quantum circuit is enlarged with any idle ancilla qubits. Otherwise we may swap qubits outside of the portion of the chip we want to use. Therefore, the swap strategy and its associated coupling map do not represent physical qubits. Instead, they represent an intermediate mapping that corresponds to the physical qubits once the initial layout is applied. The example below shows how to map a four qubit :class:`.PauliEvolutionGate` to qubits 0, 1, 3, and 4 of the five qubit device with the coupling map .. parsed-literal:: 0 -- 1 -- 2 | 3 | 4 To do this we use a line swap strategy for qubits 0, 1, 3, and 4 defined it in terms of virtual qubits 0, 1, 2, and 3. .. code-block:: python from qiskit import QuantumCircuit from qiskit.opflow import PauliSumOp from qiskit.circuit.library import PauliEvolutionGate from qiskit.transpiler import Layout, CouplingMap, PassManager from qiskit.transpiler.passes import FullAncillaAllocation from qiskit.transpiler.passes import EnlargeWithAncilla from qiskit.transpiler.passes import ApplyLayout from qiskit.transpiler.passes import SetLayout from qiskit.transpiler.passes.routing.commuting_2q_gate_routing import ( SwapStrategy, FindCommutingPauliEvolutions, Commuting2qGateRouter, ) # Define the circuit on virtual qubits op = PauliSumOp.from_list([("IZZI", 1), ("ZIIZ", 2), ("ZIZI", 3)]) circ = QuantumCircuit(4) circ.append(PauliEvolutionGate(op, 1), range(4)) # Define the swap strategy on qubits before the initial_layout is applied. swap_strat = SwapStrategy.from_line([0, 1, 2, 3]) # Chose qubits 0, 1, 3, and 4 from the backend coupling map shown above. backend_cmap = CouplingMap(couplinglist=[(0, 1), (1, 2), (1, 3), (3, 4)]) initial_layout = Layout.from_intlist([0, 1, 3, 4], *circ.qregs) pm_pre = PassManager( [ FindCommutingPauliEvolutions(), Commuting2qGateRouter(swap_strat), SetLayout(initial_layout), FullAncillaAllocation(backend_cmap), EnlargeWithAncilla(), ApplyLayout(), ] ) # Insert swap gates, map to initial_layout and finally enlarge with ancilla. pm_pre.run(circ).draw("mpl") This pass manager relies on the ``current_layout`` which corresponds to the qubit layout as swap gates are applied. The pass will traverse all nodes in the dag. If a node should be routed using a swap strategy then it will be decomposed into sub-instructions with swap layers in between and the ``current_layout`` will be modified. Nodes that should not be routed using swap strategies will be added back to the dag taking the ``current_layout`` into account. """ def __init__( self, swap_strategy: SwapStrategy | None = None, edge_coloring: dict[tuple[int, int], int] | None = None, ) -> None: r""" Args: swap_strategy: An instance of a :class:`.SwapStrategy` that holds the swap layers that are used, and the order in which to apply them, to map the instruction to the hardware. If this field is not given if should be contained in the property set of the pass. This allows other passes to determine the most appropriate swap strategy at run-time. edge_coloring: An optional edge coloring of the coupling map (I.e. no two edges that share a node have the same color). If the edge coloring is given then the commuting gates that can be simultaneously applied given the current qubit permutation are grouped according to the edge coloring and applied according to this edge coloring. Here, a color is an int which is used as the index to define and access the groups of commuting gates that can be applied simultaneously. If the edge coloring is not given then the sets will be built-up using a greedy algorithm. The edge coloring is useful to position gates such as ``RZZGate``\s next to swap gates to exploit CX cancellations. """ super().__init__() self._swap_strategy = swap_strategy self._bit_indices: dict[Qubit, int] | None = None self._edge_coloring = edge_coloring def run(self, dag: DAGCircuit) -> DAGCircuit: """Run the pass by decomposing the nodes it applies on. Args: dag: The dag to which we will add swaps. Returns: A dag where swaps have been added for the intended gate type. Raises: TranspilerError: If the swap strategy was not given at init time and there is no swap strategy in the property set. TranspilerError: If the quantum circuit contains more than one qubit register. TranspilerError: If there are qubits that are not contained in the quantum register. """ if self._swap_strategy is None: swap_strategy = self.property_set["swap_strategy"] if swap_strategy is None: raise TranspilerError("No swap strategy given at init or in the property set.") else: swap_strategy = self._swap_strategy if len(dag.qregs) != 1: raise TranspilerError( f"{self.__class__.__name__} runs on circuits with one quantum register." ) if len(dag.qubits) != next(iter(dag.qregs.values())).size: raise TranspilerError("Circuit has qubits not contained in the qubit register.") new_dag = dag.copy_empty_like() current_layout = Layout.generate_trivial_layout(*dag.qregs.values()) # Used to keep track of nodes that do not decompose using swap strategies. accumulator = new_dag.copy_empty_like() for node in dag.topological_op_nodes(): if isinstance(node.op, Commuting2qBlock): # Check that the swap strategy creates enough connectivity for the node. self._check_edges(dag, node, swap_strategy) # Compose any accumulated non-swap strategy gates to the dag accumulator = self._compose_non_swap_nodes(accumulator, current_layout, new_dag) # Decompose the swap-strategy node and add to the dag. new_dag.compose(self.swap_decompose(dag, node, current_layout, swap_strategy)) else: accumulator.apply_operation_back(node.op, node.qargs, node.cargs) self._compose_non_swap_nodes(accumulator, current_layout, new_dag) return new_dag def _compose_non_swap_nodes( self, accumulator: DAGCircuit, layout: Layout, new_dag: DAGCircuit ) -> DAGCircuit: """Add all the non-swap strategy nodes that we have accumulated up to now. This method also resets the node accumulator to an empty dag. Args: layout: The current layout that keeps track of the swaps. new_dag: The new dag that we are building up. accumulator: A DAG to keep track of nodes that do not decompose using swap strategies. Returns: A new accumulator with the same registers as ``new_dag``. """ # Add all the non-swap strategy nodes that we have accumulated up to now. order = layout.reorder_bits(new_dag.qubits) order_bits: list[int | None] = [None] * len(layout) for idx, val in enumerate(order): order_bits[val] = idx new_dag.compose(accumulator, qubits=order_bits) # Re-initialize the node accumulator return new_dag.copy_empty_like() def _position_in_cmap(self, dag: DAGCircuit, j: int, k: int, layout: Layout) -> tuple[int, ...]: """A helper function to track the movement of virtual qubits through the swaps. Args: j: The index of decision variable j (i.e. virtual qubit). k: The index of decision variable k (i.e. virtual qubit). layout: The current layout that takes into account previous swap gates. Returns: The position in the coupling map of the virtual qubits j and k as a tuple. """ bit0 = dag.find_bit(layout.get_physical_bits()[j]).index bit1 = dag.find_bit(layout.get_physical_bits()[k]).index return bit0, bit1 def _build_sub_layers( self, current_layer: dict[tuple[int, int], Gate] ) -> list[dict[tuple[int, int], Gate]]: """A helper method to build-up sets of gates to simultaneously apply. This is done with an edge coloring if the ``edge_coloring`` init argument was given or with a greedy algorithm if not. With an edge coloring all gates on edges with the same color will be applied simultaneously. These sublayers are applied in the order of their color, which is an int, in increasing color order. Args: current_layer: All gates in the current layer can be applied given the qubit ordering of the current layout. However, not all gates in the current layer can be applied simultaneously. This function creates sub-layers by building up sub-layers of gates. All gates in a sub-layer can simultaneously be applied given the coupling map and current qubit configuration. Returns: A list of gate dicts that can be applied. The gates a position 0 are applied first. A gate dict has the qubit tuple as key and the gate to apply as value. """ if self._edge_coloring is not None: return self._edge_coloring_build_sub_layers(current_layer) else: return self._greedy_build_sub_layers(current_layer) def _edge_coloring_build_sub_layers( self, current_layer: dict[tuple[int, int], Gate] ) -> list[dict[tuple[int, int], Gate]]: """The edge coloring method of building sub-layers of commuting gates.""" sub_layers: list[dict[tuple[int, int], Gate]] = [ {} for _ in set(self._edge_coloring.values()) ] for edge, gate in current_layer.items(): color = self._edge_coloring[edge] sub_layers[color][edge] = gate return sub_layers @staticmethod def _greedy_build_sub_layers( current_layer: dict[tuple[int, int], Gate] ) -> list[dict[tuple[int, int], Gate]]: """The greedy method of building sub-layers of commuting gates.""" sub_layers = [] while len(current_layer) > 0: current_sub_layer, remaining_gates = {}, {} blocked_vertices: set[tuple] = set() for edge, evo_gate in current_layer.items(): if blocked_vertices.isdisjoint(edge): current_sub_layer[edge] = evo_gate # A vertex becomes blocked once a gate is applied to it. blocked_vertices = blocked_vertices.union(edge) else: remaining_gates[edge] = evo_gate current_layer = remaining_gates sub_layers.append(current_sub_layer) return sub_layers def swap_decompose( self, dag: DAGCircuit, node: DAGOpNode, current_layout: Layout, swap_strategy: SwapStrategy ) -> DAGCircuit: """Take an instance of :class:`.Commuting2qBlock` and map it to the coupling map. The mapping is done with the swap strategy. Args: dag: The dag which contains the :class:`.Commuting2qBlock` we route. node: A node whose operation is a :class:`.Commuting2qBlock`. current_layout: The layout before the swaps are applied. This function will modify the layout so that subsequent gates can be properly composed on the dag. swap_strategy: The swap strategy used to decompose the node. Returns: A dag that is compatible with the coupling map where swap gates have been added to map the gates in the :class:`.Commuting2qBlock` to the hardware. """ trivial_layout = Layout.generate_trivial_layout(*dag.qregs.values()) gate_layers = self._make_op_layers(dag, node.op, current_layout, swap_strategy) # Iterate over and apply gate layers max_distance = max(gate_layers.keys()) circuit_with_swap = QuantumCircuit(len(dag.qubits)) for i in range(max_distance + 1): # Get current layer and replace the problem indices j,k by the corresponding # positions in the coupling map. The current layer corresponds # to all the gates that can be applied at the ith swap layer. current_layer = {} for (j, k), local_gate in gate_layers.get(i, {}).items(): current_layer[self._position_in_cmap(dag, j, k, current_layout)] = local_gate # Not all gates that are applied at the ith swap layer can be applied at the same # time. We therefore greedily build sub-layers. sub_layers = self._build_sub_layers(current_layer) # Apply sub-layers for sublayer in sub_layers: for edge, local_gate in sublayer.items(): circuit_with_swap.append(local_gate, edge) # Apply SWAP gates if i < max_distance: for swap in swap_strategy.swap_layer(i): (j, k) = [trivial_layout.get_physical_bits()[vertex] for vertex in swap] circuit_with_swap.swap(j, k) current_layout.swap(j, k) return circuit_to_dag(circuit_with_swap) def _make_op_layers( self, dag: DAGCircuit, op: Commuting2qBlock, layout: Layout, swap_strategy: SwapStrategy ) -> dict[int, dict[tuple, Gate]]: """Creates layers of two-qubit gates based on the distance in the swap strategy.""" gate_layers: dict[int, dict[tuple, Gate]] = defaultdict(dict) for node in op.node_block: edge = (dag.find_bit(node.qargs[0]).index, dag.find_bit(node.qargs[1]).index) bit0 = layout.get_virtual_bits()[dag.qubits[edge[0]]] bit1 = layout.get_virtual_bits()[dag.qubits[edge[1]]] distance = swap_strategy.distance_matrix[bit0, bit1] gate_layers[distance][edge] = node.op return gate_layers def _check_edges(self, dag: DAGCircuit, node: DAGOpNode, swap_strategy: SwapStrategy): """Check if the swap strategy can create the required connectivity. Args: node: The dag node for which to check if the swap strategy provides enough connectivity. swap_strategy: The swap strategy that is being used. Raises: TranspilerError: If there is an edge that the swap strategy cannot accommodate and if the pass has been configured to raise on such issues. """ required_edges = set() for sub_node in node.op: edge = (dag.find_bit(sub_node.qargs[0]).index, dag.find_bit(sub_node.qargs[1]).index) required_edges.add(edge) # Check that the swap strategy supports all required edges if not required_edges.issubset(swap_strategy.possible_edges): raise TranspilerError( f"{swap_strategy} cannot implement all edges in {required_edges}." )
https://github.com/acfilok96/Quantum-Computation
acfilok96
import qiskit print(qiskit.__version__) from qiskit.aqua.algorithms import Shor from qiskit.aqua import QuantumInstance import numpy as np from qiskit import QuantumCircuit, Aer, execute from qiskit.tools.visualization import plot_histogram backend = Aer.get_backend('qasm_simulator') quantum_instance = QuantumInstance(backend=backend, shots=1024) my_shor = Shor(N=2189,a=4,quantum_instance=quantum_instance) Shor.run(my_shor)
https://github.com/jdanielescanez/quantum-solver
jdanielescanez
import unittest import sys import os sys.path.append(os.path.dirname(os.path.realpath(__file__)) + '/../src') from bb84.participant import Participant from bb84.sender import Sender from bb84.receiver import Receiver from qiskit import Aer ALICE = 'Alice' BOB = 'Bob' EXAMPLE_LIST_1 = [1, 0, 0, 1, 0, 1, 1] EXAMPLE_LIST_2 = [1, 1, 0, 0, 0, 1, 0] ORIGINAL_BITS_SIZE = len(EXAMPLE_LIST_1) INDEX_SHARED_KEY = 2 def is_lambda(x): return callable(x) and x.__name__ == '<lambda>' class BB84EntitiesTests(unittest.TestCase): def setUp(self): self.sender = Sender(ALICE, ORIGINAL_BITS_SIZE) self.receiver = Receiver(BOB, ORIGINAL_BITS_SIZE) @unittest.expectedFailure def test_participant(self): _ = Participant('Participant', ORIGINAL_BITS_SIZE) def test_name(self): self.assertEqual(self.sender.name, ALICE) self.assertEqual(self.receiver.name, BOB) def test_original_bits_size(self): self.assertEqual(self.sender.original_bits_size, ORIGINAL_BITS_SIZE) self.assertEqual(self.receiver.original_bits_size, ORIGINAL_BITS_SIZE) def test_setter_values(self): self.sender.set_values(EXAMPLE_LIST_1) self.receiver.set_values(EXAMPLE_LIST_1) self.assertEqual(self.sender.values, EXAMPLE_LIST_1) self.assertEqual(self.receiver.values, EXAMPLE_LIST_1) def test_set_random_values(self): self.sender.set_values() self.receiver.set_values() self.assertTrue(isinstance(self.sender.values, list) and \ len(self.sender.values) == ORIGINAL_BITS_SIZE) self.assertTrue(isinstance(self.receiver.values, list) and \ len(self.receiver.values) == ORIGINAL_BITS_SIZE) def test_show_values(self): self.assertTrue(self.sender.show_values is not None) self.assertTrue(self.receiver.show_values is not None) def test_setter_axes(self): self.sender.set_axes(EXAMPLE_LIST_1) self.receiver.set_axes(EXAMPLE_LIST_1) self.assertEqual(self.sender.axes, EXAMPLE_LIST_1) self.assertEqual(self.receiver.axes, EXAMPLE_LIST_1) def test_set_random_axes(self): self.sender.set_axes() self.receiver.set_axes() self.assertTrue(isinstance(self.sender.axes, list) and \ len(self.sender.axes) == ORIGINAL_BITS_SIZE) self.assertTrue(isinstance(self.receiver.axes, list) and \ len(self.receiver.axes) == ORIGINAL_BITS_SIZE) def test_show_axes(self): self.assertTrue(self.sender.show_axes is not None) self.assertTrue(self.receiver.show_axes is not None) def test_remove_garbage(self): self.sender.set_values(EXAMPLE_LIST_1) self.receiver.set_values(EXAMPLE_LIST_2) self.sender.set_axes(EXAMPLE_LIST_1) self.receiver.set_axes(EXAMPLE_LIST_2) self.sender.remove_garbage(EXAMPLE_LIST_2) self.receiver.remove_garbage(EXAMPLE_LIST_1) def test_check_key(self): self.test_remove_garbage() shared_key = self.receiver.key[:INDEX_SHARED_KEY] self.assertTrue(self.sender.check_key(shared_key)) def test_confirm_key(self): self.test_check_key() shared_key = self.receiver.key[:INDEX_SHARED_KEY] self.sender.confirm_key(len(shared_key)) def test_is_safe_key(self): self.test_confirm_key() self.assertTrue(self.sender.is_safe_key) def test_show_key(self): self.test_is_safe_key() self.assertTrue(self.sender.show_key is not None) def test_generate_otp(self): self.test_is_safe_key() self.sender.generate_otp(ORIGINAL_BITS_SIZE) self.assertTrue(isinstance(self.sender.otp, list)) def test_show_otp(self): self.test_generate_otp() self.assertTrue(self.sender.show_otp is not None) def test_xor_otp_message(self): self.test_generate_otp() msg = 'qwertyuiopasdfghjklñzxcvbnm012345789QWERTYUIOPASDFGHJKLÑZXCVBNM,._-' encoded_msg = self.sender.xor_otp_message(msg) decoded_msg = self.sender.xor_otp_message(encoded_msg) self.assertEqual(decoded_msg, msg) def test_encode_quantum_message(self): self.test_set_random_axes() self.test_set_random_values() self.msg = self.sender.encode_quantum_message() for i, qc in enumerate(self.msg): for gate in qc.data: if gate[0].name == 'x': self.assertTrue(self.sender.values[i] == 1) if gate[0].name == 'h': self.assertTrue(self.sender.axes[i] == 1) def test_decode_quantum_message(self): self.test_encode_quantum_message() backend = Aer.get_backend('aer_simulator') self.msg = self.receiver.decode_quantum_message(self.msg, 1, backend) for i in self.receiver.axes: if self.receiver.axes[i] == self.sender.axes[i]: self.assertEqual(self.receiver.values[i], self.sender.values[i]) if __name__ == '__main__': unittest.main()
https://github.com/MonitSharma/Learn-Quantum-Computing-with-Qiskit
MonitSharma
from qiskit.circuit import QuantumCircuit from qiskit_aer import AerSimulator from qiskit.visualization import plot_histogram def decimal_to_binary(decimal): binary = "" if decimal == 0: return "0" while decimal > 0: binary = str(decimal % 2) + binary decimal //= 2 return binary # Example usage decimal_number = 42 binary_number = decimal_to_binary(decimal_number) print(f"The binary representation of {decimal_number} is: {binary_number}") def binary_to_decimal(binary): decimal = 0 power = len(binary) - 1 for digit in binary: decimal += int(digit) * (2 ** power) power -= 1 return decimal # Example usage binary_number = "101010" decimal_number = binary_to_decimal(binary_number) print(f"The decimal representation of {binary_number} is: {decimal_number}") qcirc = QuantumCircuit(8) qcirc.measure_all() qcirc.draw() qcirc.draw('mpl') from qiskit.primitives import Sampler, Estimator, BackendEstimator, BackendSampler backend = AerSimulator() # decide the backend on which to run the circuit sampler = BackendSampler(backend) # create a sampler object sampler2 = Sampler() result = sampler.run(qcirc).result() # run the circuit and save the results result print("Counts",result.quasi_dists[0]) plot_histogram(result.quasi_dists[0]) qcirc = QuantumCircuit(1) # only a single qubit quantum circuit qcirc.draw('mpl') # let's visualize the circuit qcirc.initialize([1,0]) qcirc.draw('mpl') qcirc.measure_all() # applying the measurement qcirc.draw('mpl') result = sampler.run(qcirc).result() counts = result.quasi_dists[0] counts plot_histogram(counts) result = sampler.run(qcirc, shots = 2000).result() counts = result.quasi_dists[0] counts plot_histogram(counts) from qiskit import QuantumRegister, ClassicalRegister qr = QuantumRegister(1,'q0') # you can specifically name the qubit q0 cr = ClassicalRegister(1,'c0') qc = QuantumCircuit(qr, cr) # combine the quantum and classical register qc.initialize([1,0],0) qc.measure(0,0) # apply the measurement as operator qc.draw('mpl') result = sampler.run(qc, shots = 2000).result() counts = result.quasi_dists[0] counts plot_histogram(counts)
https://github.com/swe-bench/Qiskit__qiskit
swe-bench
# This code is part of Qiskit. # # (C) Copyright IBM 2022, 2023. # # This code is licensed under the Apache License, Version 2.0. You may # obtain a copy of this license in the LICENSE.txt file in the root directory # of this source tree or at http://www.apache.org/licenses/LICENSE-2.0. # # Any modifications or derivative works of this code must retain this # copyright notice, and modified files need to carry a notice indicating # that they have been altered from the originals. """Test the QAOA algorithm with opflow.""" import unittest from test.python.algorithms import QiskitAlgorithmsTestCase from functools import partial import numpy as np from scipy.optimize import minimize as scipy_minimize from ddt import ddt, idata, unpack import rustworkx as rx from qiskit import QuantumCircuit from qiskit_algorithms.minimum_eigensolvers import QAOA from qiskit_algorithms.optimizers import COBYLA, NELDER_MEAD from qiskit.circuit import Parameter from qiskit.opflow import PauliSumOp from qiskit.quantum_info import Pauli from qiskit.result import QuasiDistribution from qiskit.primitives import Sampler from qiskit.utils import algorithm_globals I = PauliSumOp.from_list([("I", 1)]) X = PauliSumOp.from_list([("X", 1)]) W1 = np.array([[0, 1, 0, 1], [1, 0, 1, 0], [0, 1, 0, 1], [1, 0, 1, 0]]) P1 = 1 M1 = (I ^ I ^ I ^ X) + (I ^ I ^ X ^ I) + (I ^ X ^ I ^ I) + (X ^ I ^ I ^ I) S1 = {"0101", "1010"} W2 = np.array( [ [0.0, 8.0, -9.0, 0.0], [8.0, 0.0, 7.0, 9.0], [-9.0, 7.0, 0.0, -8.0], [0.0, 9.0, -8.0, 0.0], ] ) P2 = 1 M2 = None S2 = {"1011", "0100"} CUSTOM_SUPERPOSITION = [1 / np.sqrt(15)] * 15 + [0] @ddt class TestQAOA(QiskitAlgorithmsTestCase): """Test QAOA with MaxCut.""" def setUp(self): super().setUp() self.seed = 10598 algorithm_globals.random_seed = self.seed self.sampler = Sampler() @idata( [ [W1, P1, M1, S1], [W2, P2, M2, S2], ] ) @unpack def test_qaoa(self, w, reps, mixer, solutions): """QAOA test""" self.log.debug("Testing %s-step QAOA with MaxCut on graph\n%s", reps, w) qubit_op, _ = self._get_operator(w) qaoa = QAOA(self.sampler, COBYLA(), reps=reps, mixer=mixer) with self.assertWarns(DeprecationWarning): result = qaoa.compute_minimum_eigenvalue(operator=qubit_op) x = self._sample_most_likely(result.eigenstate) graph_solution = self._get_graph_solution(x) self.assertIn(graph_solution, solutions) @idata( [ [W1, P1, S1], [W2, P2, S2], ] ) @unpack def test_qaoa_qc_mixer(self, w, prob, solutions): """QAOA test with a mixer as a parameterized circuit""" self.log.debug( "Testing %s-step QAOA with MaxCut on graph with a mixer as a parameterized circuit\n%s", prob, w, ) optimizer = COBYLA() qubit_op, _ = self._get_operator(w) num_qubits = qubit_op.num_qubits mixer = QuantumCircuit(num_qubits) theta = Parameter("θ") mixer.rx(theta, range(num_qubits)) qaoa = QAOA(self.sampler, optimizer, reps=prob, mixer=mixer) with self.assertWarns(DeprecationWarning): result = qaoa.compute_minimum_eigenvalue(operator=qubit_op) x = self._sample_most_likely(result.eigenstate) graph_solution = self._get_graph_solution(x) self.assertIn(graph_solution, solutions) def test_qaoa_qc_mixer_many_parameters(self): """QAOA test with a mixer as a parameterized circuit with the num of parameters > 1.""" optimizer = COBYLA() qubit_op, _ = self._get_operator(W1) num_qubits = qubit_op.num_qubits mixer = QuantumCircuit(num_qubits) for i in range(num_qubits): theta = Parameter("θ" + str(i)) mixer.rx(theta, range(num_qubits)) qaoa = QAOA(self.sampler, optimizer, reps=2, mixer=mixer) with self.assertWarns(DeprecationWarning): result = qaoa.compute_minimum_eigenvalue(operator=qubit_op) x = self._sample_most_likely(result.eigenstate) self.log.debug(x) graph_solution = self._get_graph_solution(x) self.assertIn(graph_solution, S1) def test_qaoa_qc_mixer_no_parameters(self): """QAOA test with a mixer as a parameterized circuit with zero parameters.""" qubit_op, _ = self._get_operator(W1) num_qubits = qubit_op.num_qubits mixer = QuantumCircuit(num_qubits) # just arbitrary circuit mixer.rx(np.pi / 2, range(num_qubits)) qaoa = QAOA(self.sampler, COBYLA(), reps=1, mixer=mixer) with self.assertWarns(DeprecationWarning): result = qaoa.compute_minimum_eigenvalue(operator=qubit_op) # we just assert that we get a result, it is not meaningful. self.assertIsNotNone(result.eigenstate) def test_change_operator_size(self): """QAOA change operator size test""" qubit_op, _ = self._get_operator( np.array([[0, 1, 0, 1], [1, 0, 1, 0], [0, 1, 0, 1], [1, 0, 1, 0]]) ) qaoa = QAOA(self.sampler, COBYLA(), reps=1) with self.assertWarns(DeprecationWarning): result = qaoa.compute_minimum_eigenvalue(operator=qubit_op) x = self._sample_most_likely(result.eigenstate) graph_solution = self._get_graph_solution(x) with self.subTest(msg="QAOA 4x4"): self.assertIn(graph_solution, {"0101", "1010"}) qubit_op, _ = self._get_operator( np.array( [ [0, 1, 0, 1, 0, 1], [1, 0, 1, 0, 1, 0], [0, 1, 0, 1, 0, 1], [1, 0, 1, 0, 1, 0], [0, 1, 0, 1, 0, 1], [1, 0, 1, 0, 1, 0], ] ) ) with self.assertWarns(DeprecationWarning): result = qaoa.compute_minimum_eigenvalue(operator=qubit_op) x = self._sample_most_likely(result.eigenstate) graph_solution = self._get_graph_solution(x) with self.subTest(msg="QAOA 6x6"): self.assertIn(graph_solution, {"010101", "101010"}) @idata([[W2, S2, None], [W2, S2, [0.0, 0.0]], [W2, S2, [1.0, 0.8]]]) @unpack def test_qaoa_initial_point(self, w, solutions, init_pt): """Check first parameter value used is initial point as expected""" qubit_op, _ = self._get_operator(w) first_pt = [] def cb_callback(eval_count, parameters, mean, metadata): nonlocal first_pt if eval_count == 1: first_pt = list(parameters) qaoa = QAOA( self.sampler, COBYLA(), initial_point=init_pt, callback=cb_callback, ) with self.assertWarns(DeprecationWarning): result = qaoa.compute_minimum_eigenvalue(operator=qubit_op) x = self._sample_most_likely(result.eigenstate) graph_solution = self._get_graph_solution(x) with self.subTest("Initial Point"): # If None the preferred random initial point of QAOA variational form if init_pt is None: self.assertLess(result.eigenvalue, -0.97) else: self.assertListEqual(init_pt, first_pt) with self.subTest("Solution"): self.assertIn(graph_solution, solutions) def test_qaoa_random_initial_point(self): """QAOA random initial point""" w = rx.adjacency_matrix( rx.undirected_gnp_random_graph(5, 0.5, seed=algorithm_globals.random_seed) ) qubit_op, _ = self._get_operator(w) qaoa = QAOA(self.sampler, NELDER_MEAD(disp=True), reps=2) with self.assertWarns(DeprecationWarning): result = qaoa.compute_minimum_eigenvalue(operator=qubit_op) self.assertLess(result.eigenvalue, -0.97) def test_optimizer_scipy_callable(self): """Test passing a SciPy optimizer directly as callable.""" w = rx.adjacency_matrix( rx.undirected_gnp_random_graph(5, 0.5, seed=algorithm_globals.random_seed) ) qubit_op, _ = self._get_operator(w) qaoa = QAOA( self.sampler, partial(scipy_minimize, method="Nelder-Mead", options={"maxiter": 2}), ) with self.assertWarns(DeprecationWarning): result = qaoa.compute_minimum_eigenvalue(qubit_op) self.assertEqual(result.cost_function_evals, 5) def _get_operator(self, weight_matrix): """Generate Hamiltonian for the max-cut problem of a graph. Args: weight_matrix (numpy.ndarray) : adjacency matrix. Returns: PauliSumOp: operator for the Hamiltonian float: a constant shift for the obj function. """ num_nodes = weight_matrix.shape[0] pauli_list = [] shift = 0 for i in range(num_nodes): for j in range(i): if weight_matrix[i, j] != 0: x_p = np.zeros(num_nodes, dtype=bool) z_p = np.zeros(num_nodes, dtype=bool) z_p[i] = True z_p[j] = True pauli_list.append([0.5 * weight_matrix[i, j], Pauli((z_p, x_p))]) shift -= 0.5 * weight_matrix[i, j] opflow_list = [(pauli[1].to_label(), pauli[0]) for pauli in pauli_list] with self.assertWarns(DeprecationWarning): return PauliSumOp.from_list(opflow_list), shift def _get_graph_solution(self, x: np.ndarray) -> str: """Get graph solution from binary string. Args: x : binary string as numpy array. Returns: a graph solution as string. """ return "".join([str(int(i)) for i in 1 - x]) def _sample_most_likely(self, state_vector: QuasiDistribution) -> np.ndarray: """Compute the most likely binary string from state vector. Args: state_vector: Quasi-distribution. Returns: Binary string as numpy.ndarray of ints. """ values = list(state_vector.values()) n = int(np.log2(len(values))) k = np.argmax(np.abs(values)) x = np.zeros(n) for i in range(n): x[i] = k % 2 k >>= 1 return x if __name__ == "__main__": unittest.main()
https://github.com/qiskit-community/qiskit-translations-staging
qiskit-community
from qiskit import QuantumCircuit qc = QuantumCircuit(2, 2) qc.h(0) qc.cx(0, 1) qc.measure([0, 1], [0, 1]) qc.draw('mpl')
https://github.com/qiskit-community/qiskit-translations-staging
qiskit-community
from qiskit import QuantumCircuit, transpile, schedule from qiskit.visualization.timeline import draw, IQXSimple from qiskit.providers.fake_provider import FakeBoeblingen qc = QuantumCircuit(2) qc.h(0) qc.cx(0,1) qc = transpile(qc, FakeBoeblingen(), scheduling_method='alap', layout_method='trivial') draw(qc, style=IQXSimple())
https://github.com/MartenSkogh/QiskitVQEWrapper
MartenSkogh
import sys import numpy as np import scipy as sp import re from copy import deepcopy from pprint import pprint from timeit import default_timer as timer from enum import Enum from qiskit import Aer from qiskit.aqua import QuantumInstance from qiskit.aqua.operators import Z2Symmetries from qiskit.aqua.algorithms.minimum_eigen_solvers import VQE from qiskit.aqua.algorithms import ExactEigensolver from qiskit.aqua.components.optimizers import SLSQP, L_BFGS_B, COBYLA, SPSA from qiskit.chemistry.core import Hamiltonian, TransformationType, QubitMappingType from qiskit.chemistry.drivers import PySCFDriver, GaussianDriver, UnitsType, HFMethodType from qiskit.chemistry.components.variational_forms import UCCSD from qiskit.chemistry.components.initial_states import HartreeFock class DriverType(Enum): """ DriverType Enum """ PYSCF = 'PySCF' GAUSSIAN = 'Gaussian' class VQEWrapper(): def __init__(self): ### MOLECULE ### # These things need to be set before running self.molecule_string = None # You can make a pretty educated guess for these two self.spin = None self.charge = None self.qmolecule = None ### CHEMISTRY DRIVER ### #Basis has to be in a format accepted by Gaussian (sto-3g, 6-31g) self.basis = 'sto-3g' self.chem_driver = DriverType.GAUSSIAN self.hf_method = HFMethodType.UHF self.length_unit = UnitsType.ANGSTROM self.gaussian_checkfile = '' self.driver = None self.core = None ### HAMILTONIAN ### self.transformation = TransformationType.FULL self.qubit_mapping = QubitMappingType.JORDAN_WIGNER self.two_qubit_reduction = False self.freeze_core = True self.orbital_reduction = [] self.qubit_op = None self.aux_ops = None self.initial_point = None self.optimizer = SLSQP(maxiter=5000) self.ansatz = 'UCCSD' self.excitation_type = 'sd' self.num_time_slices = 1 self.shallow_circuit_concat = False self.vqe_algo = None self.var_form = None self.vqe_callback = None self.vqe_time = None ### BACKEND CONFIG ### #Choose the backend (use Aer instead of BasicAer) self.simulator = 'statevector_simulator' self.shots = 1024 self.seed_simulator = None self.seed_transpiler = None self.noise_model = None self.measurement_error_mitigation_cls = None self.backend_options = {} def opt_str(self): match = re.search(r'optimizers.[A-z]+.(.+) object', str(self.optimizer)) opt_str = match.group(1) return opt_str def gaussian_config(self): #Format properties to a string fitting the gaussian input format if self.gaussian_checkfile != '': chk = f'%Chk={self.gaussian_checkfile}\n' else: chk = '' gaussian_config = chk + f'# {self.hf_method.value}/{self.basis} scf(conventional)\n\nMolecule\n\n{self.charge} {self.spin+1}\n' gaussian_config = gaussian_config + self.molecule_string.replace('; ','\n') + '\n\n' return gaussian_config def initiate(self): self.init_backend() self.init_driver() self.init_core() self.init_ops() self.init_init_state() self.init_var_form() self.init_vqe() def init_driver(self): if self.chem_driver.value == 'PySCF': if self.hf_method == HFMethodType.RHF and self.spin % 2 == 0: print(f'WARNING: Restricted Hartree-Fock (RHF) cannot handle unpaired electrons!') print(f'Switching to Unrestricted Hartree-Fock!') self.chem_driver = HFMethodType.UHF self.driver = PySCFDriver(atom=self.molecule_string, unit=self.length_unit, charge=self.charge, spin=self.spin, hf_method=self.hf_method, basis=self.basis) elif self.chem_driver.value == 'Gaussian': self.driver = GaussianDriver(config=self.gaussian_config()) self.qmolecule = self.driver.run() def init_backend(self): self.backend = Aer.get_backend(self.simulator) self.quantum_instance = QuantumInstance(backend=self.backend, shots=self.shots, seed_simulator = self.seed_simulator, seed_transpiler = self.seed_transpiler, noise_model = self.noise_model, measurement_error_mitigation_cls = self.measurement_error_mitigation_cls, backend_options = self.backend_options) def init_core(self): self.core = Hamiltonian(transformation=self.transformation, qubit_mapping=self.qubit_mapping, two_qubit_reduction=self.two_qubit_reduction, freeze_core=self.freeze_core, orbital_reduction=self.orbital_reduction) def init_ops(self): self.qubit_op, self.aux_ops = self.core.run(self.qmolecule) #Initial state def init_init_state(self): self.init_state = HartreeFock(num_orbitals=self.core._molecule_info['num_orbitals'], qubit_mapping=self.core._qubit_mapping, two_qubit_reduction=self.core._two_qubit_reduction, num_particles=self.core._molecule_info['num_particles']) #Set up VQE def init_vqe(self): self.vqe_algo = VQE(self.qubit_op, self.var_form, self.optimizer, initial_point=self.initial_point, callback=self.vqe_callback) def init_var_form(self): if self.ansatz.upper() == 'UCCSD': # UCCSD Ansatz self.var_form = UCCSD(num_orbitals=self.core._molecule_info['num_orbitals'], num_particles=self.core._molecule_info['num_particles'], initial_state=self.init_state, qubit_mapping=self.core._qubit_mapping, two_qubit_reduction=self.core._two_qubit_reduction, num_time_slices=self.num_time_slices, excitation_type=self.excitation_type, shallow_circuit_concat=self.shallow_circuit_concat) else: if self.var_form is None: raise ValueError('No variational form specified!') def print_config(self): print(f'\n\n=== MOLECULAR INFORMATION ===') print(f'* Molecule string: {self.molecule_string}') print(f'* Charge: {self.charge}') print(f'* Spin (2S): {self.spin}') print(f'* Basis set: {self.basis}') print(f'* Num orbitals: {self.qmolecule.num_orbitals}') print(f'* Lenght Unit: {self.length_unit}') print(f'* HF method: {self.hf_method}') print(f'\n\n=== HAMILTONIAN INFORMATION ===') print(f'* Transformation type: {self.transformation}') print(f'* Qubit mapping: {self.qubit_mapping}') print(f'* Two qubit reduction: {self.two_qubit_reduction}') print(f'* Freeze core: {self.freeze_core}') print(f'* Orbital reduction: {self.orbital_reduction}') print(f'\n\n=== CHEMISTRY DRIVER INFORMATION ===') print(f'* Not yet implemented!') print(f'\n\n=== BACKEND INFORMATION ===') print(f'* Not yet implemented!') def run_vqe(self): #Run the algorithm vqe_start = timer() self.vqe_result = self.vqe_algo.run(self.quantum_instance) self.vqe_time = timer() - vqe_start #Get the results result = self.core.process_algorithm_result(self.vqe_result) return result
https://github.com/swe-train/qiskit__qiskit
swe-train
# This code is part of Qiskit. # # (C) Copyright IBM 2017, 2018. # # This code is licensed under the Apache License, Version 2.0. You may # obtain a copy of this license in the LICENSE.txt file in the root directory # of this source tree or at http://www.apache.org/licenses/LICENSE-2.0. # # Any modifications or derivative works of this code must retain this # copyright notice, and modified files need to carry a notice indicating # that they have been altered from the originals. from qiskit import QuantumCircuit from qiskit.transpiler import PassManager from qiskit.transpiler.passes import CommutationAnalysis, CommutativeCancellation circuit = QuantumCircuit(5) # Quantum Instantaneous Polynomial Time example circuit.cx(0, 1) circuit.cx(2, 1) circuit.cx(4, 3) circuit.cx(2, 3) circuit.z(0) circuit.z(4) circuit.cx(0, 1) circuit.cx(2, 1) circuit.cx(4, 3) circuit.cx(2, 3) circuit.cx(3, 2) print(circuit) pm = PassManager() pm.append([CommutationAnalysis(), CommutativeCancellation()]) new_circuit = pm.run(circuit) print(new_circuit)
https://github.com/qiskit-community/qiskit-translations-staging
qiskit-community
from qiskit import QuantumRegister, ClassicalRegister, QuantumCircuit from qiskit.dagcircuit import DAGCircuit from qiskit.converters import circuit_to_dag from qiskit.visualization import dag_drawer q = QuantumRegister(3, 'q') c = ClassicalRegister(3, 'c') circ = QuantumCircuit(q, c) circ.h(q[0]) circ.cx(q[0], q[1]) circ.measure(q[0], c[0]) circ.rz(0.5, q[1]).c_if(c, 2) dag = circuit_to_dag(circ) dag_drawer(dag)
https://github.com/jonasmaziero/computacao_quantica_qiskit
jonasmaziero
%run init.ipynb from qiskit import * nshots = 8192 qiskit.IBMQ.load_account() provider = qiskit.IBMQ.get_provider(hub = 'ibm-q-research-2', group = 'federal-uni-sant-1', project = 'main') simulator = Aer.get_backend('qasm_simulator') device = provider.get_backend('ibmq_lima') from qiskit.tools.visualization import plot_histogram from qiskit.ignis.verification.tomography import state_tomography_circuits, StateTomographyFitter from qiskit.tools.monitor import job_monitor, backend_overview, backend_monitor def qc_ent_dist(): qc = QuantumCircuit(2, name = 'E dist') qc.h([0]); qc.cx(0, 1) return qc qc_ent_dist_ = qc_ent_dist(); qc_ent_dist_.draw(output = 'mpl') def qc_bb_cb(): qc = QuantumCircuit(2, name = 'BB->CB') qc.cx(0,1); qc.h(0) return qc qc_bb_cb_ = qc_bb_cb(); qc_bb_cb_.draw(output = 'mpl') def qc_teleport(th, ph, lb): qc = QuantumCircuit(3) qc_ent_dist_ = qc_ent_dist(); qc.append(qc_ent_dist_, [1, 2]) # distribuição de emaranhamento qc.barrier() qc.u(th, ph, lb, [0]) # Preparação do estado a ser teletransportado qc.barrier() qc_bb_cb_ = qc_bb_cb(); qc.append(qc_bb_cb_, [0, 1]) # Base de Bell para base computacional qc.barrier() qc.cx(1, 2); qc.cz(0, 2) # infor clássica + unitária de Bob return qc qc_teleport_ = qc_teleport(0.1, 0.5, 0); qc_teleport_.decompose().draw(output = 'mpl') import numpy as np import math th, ph, lb = 0, 0, 0; rho_teo = np.array([[math.cos(th/2)**2, (math.cos(ph)+1j*math.sin(ph))*math.sin(th/2)*math.cos(th/2)], [(math.cos(ph)+1j*math.sin(ph))*math.sin(th/2)*math.cos(th/2), math.sin(th/2)**2]]) qc_teleport_ = qc_teleport(0.1, 0.5, 0) qstc = state_tomography_circuits(qc_teleport_, [2]) # simulação job = qiskit.execute(qstc, Aer.get_backend('qasm_simulator'), shots = nshots) qstf = StateTomographyFitter(job.result(), qstc) rho_sim = qstf.fit(method='lstsq') print('rho_teo = ', rho_teo) print('rho_sim = ', rho_sim) # experimento job = qiskit.execute(qstc, backend = device, shots = nshots) job_monitor(job) qstf = StateTomographyFitter(job.result(), qstc) rho_exp = qstf.fit(method = 'lstsq') print('rho_exp = ', rho_exp) F = qiskit.quantum_info.state_fidelity(rho_teo, rho_exp); print('F = ', F) # variar th em cos(th/2)|0>+exp(i*ph)sin(th/2)|1>
https://github.com/qiskit-community/qiskit-translations-staging
qiskit-community
from qiskit import QuantumCircuit, ClassicalRegister, QuantumRegister, execute, assemble, Aer from qiskit.tools.visualization import plot_histogram from math import pi import matplotlib.pyplot as plt q = QuantumRegister(1,'q') c = ClassicalRegister(1,'c') qc = QuantumCircuit(q, c) qc.h(0) qc.measure(0,0) qc.x(0).c_if(c, 0) qc.draw(output='mpl') q = QuantumRegister(3,'q') c = ClassicalRegister(3,'c') qc = QuantumCircuit(q, c) qc.h(q[0]) qc.h(q[1]) qc.h(q[2]) qc.barrier() qc.measure(q,c) qc.draw('mpl') print(bin(3)) print(bin(7)) q = QuantumRegister(3,'q') c = ClassicalRegister(3,'c') qc = QuantumCircuit(q, c) qc.h(0) qc.h(1) qc.h(2) qc.barrier() qc.measure(q,c) qc.x(2).c_if(c, 3) # for the 011 case qc.x(2).c_if(c, 7) # for the 111 case qc.draw(output='mpl') nq = 2 m = 2 q = QuantumRegister(nq,'q') c = ClassicalRegister(m,'c') qc_S = QuantumCircuit(q,c) qc_S.h(0) qc_S.x(1) qc_S.draw('mpl') cu_circ = QuantumCircuit(2) cu_circ.cp(pi/2,0,1) cu_circ.draw('mpl') for _ in range(2**(m-1)): qc_S.cp(pi/2,0,1) qc_S.draw('mpl') def x_measurement(qc, qubit, cbit): """Measure 'qubit' in the X-basis, and store the result in 'cbit'""" qc.h(qubit) qc.measure(qubit, cbit) x_measurement(qc_S, q[0], c[0]) qc_S.draw('mpl') qc_S.reset(0) qc_S.h(0) qc_S.draw('mpl') qc_S.p(-pi/2,0).c_if(c,1) qc_S.draw('mpl') ## 2^t c-U operations (with t=m-2) for _ in range(2**(m-2)): qc_S.cp(pi/2,0,1) x_measurement(qc_S, q[0], c[1]) qc_S.draw('mpl') sim = Aer.get_backend('qasm_simulator') count0 = execute(qc_S, sim).result().get_counts() key_new = [str(int(key,2)/2**m) for key in list(count0.keys())] count1 = dict(zip(key_new, count0.values())) fig, ax = plt.subplots(1,2) plot_histogram(count0, ax=ax[0]) plot_histogram(count1, ax=ax[1]) plt.tight_layout() nq = 3 # number of qubits m = 3 # number of classical bits q = QuantumRegister(nq,'q') c = ClassicalRegister(m,'c') qc = QuantumCircuit(q,c) qc.h(0) qc.x([1,2]) qc.draw('mpl') cu_circ = QuantumCircuit(nq) cu_circ.mcp(pi/4,[0,1],2) cu_circ.draw('mpl') for _ in range(2**(m-1)): qc.mcp(pi/4,[0,1],2) qc.draw('mpl') x_measurement(qc, q[0], c[0]) qc.draw('mpl') qc.reset(0) qc.h(0) qc.draw('mpl') qc.p(-pi/2,0).c_if(c,1) qc.draw('mpl') for _ in range(2**(m-2)): qc.mcp(pi/4,[0,1],2) x_measurement(qc, q[0], c[1]) qc.draw('mpl') # initialization of qubit q0 qc.reset(0) qc.h(0) # phase correction qc.p(-pi/4,0).c_if(c,1) qc.p(-pi/2,0).c_if(c,2) qc.p(-3*pi/4,0).c_if(c,3) # c-U operations for _ in range(2**(m-3)): qc.mcp(pi/4,[0,1],2) # X measurement qc.h(0) qc.measure(0,2) qc.draw('mpl') count0 = execute(qc, sim).result().get_counts() key_new = [str(int(key,2)/2**m) for key in list(count0.keys())] count1 = dict(zip(key_new, count0.values())) fig, ax = plt.subplots(1,2) plot_histogram(count0, ax=ax[0]) plot_histogram(count1, ax=ax[1]) fig.tight_layout() import qiskit.tools.jupyter %qiskit_version_table %qiskit_copyright
https://github.com/qiskit-community/qiskit-cold-atom
qiskit-community
# This code is part of Qiskit. # # (C) Copyright IBM 2021. # # This code is licensed under the Apache License, Version 2.0. You may # obtain a copy of this license in the LICENSE.txt file in the root directory # of this source tree or at http://www.apache.org/licenses/LICENSE-2.0. # # Any modifications or derivative works of this code must retain this # copyright notice, and modified files need to carry a notice indicating # that they have been altered from the originals. """Fermionic circuit solver tests.""" import numpy as np from qiskit import QuantumCircuit from qiskit.test import QiskitTestCase from qiskit_nature.second_q.operators import FermionicOp, SpinOp from qiskit_cold_atom.fermions.fermion_circuit_solver import ( FermionCircuitSolver, FermionicBasis, ) from qiskit_cold_atom.fermions.fermion_gate_library import Hop from qiskit_cold_atom.exceptions import QiskitColdAtomError # Black import needed to decorate the quantum circuit with spin gates. import qiskit_cold_atom.spins # pylint: disable=unused-import class TestFermionCircuitSolver(QiskitTestCase): """class to test the FermionCircuitSolver class.""" def setUp(self): super().setUp() # Setup two solvers with different number of fermionic species self.solver1 = FermionCircuitSolver() self.solver2 = FermionCircuitSolver(num_species=2) def test_basis_setter(self): """test max. dimension of the basis""" self.solver1.max_dimension = 500 with self.assertRaises(QiskitColdAtomError): self.solver1.basis = FermionicBasis(sites=12, n_particles=6) def test_preprocess_circuit(self): """test the preprocessing of the circuit""" circ = QuantumCircuit(4, 4) circ.fload([0, 2]) circ.fhop([0.5], [0, 1, 2, 3]) with self.subTest("spin conserving circuit"): self.solver2.preprocess_circuit(circ) self.assertEqual(self.solver2._dim, 4) with self.subTest("non spin conserving circuit"): self.solver1.preprocess_circuit(circ) self.assertEqual(self.solver1._dim, 6) def test_get_initial_state(self): """test initialization of the state for the simulation""" circ = QuantumCircuit(4, 4) circ.fload([0, 3]) self.solver2.preprocess_circuit(circ) init_state = self.solver2.get_initial_state(circ) target = np.array([0, 0, 1, 0]) self.assertTrue(np.all(init_state.toarray().T == target)) def test_embed_operator(self): """test embedding of an operator""" fer_op = FermionicOp({"+_0 -_1": 1.0}) spin_op = SpinOp({"X_0 Y_1": 1}) num_wires = 4 qargs = [1, 3] qargs_wrong = [0, 1, 3] with self.subTest("check operator type"): with self.assertRaises(QiskitColdAtomError): self.solver1._embed_operator(spin_op, num_wires, qargs) with self.subTest("check operator wiring"): with self.assertRaises(QiskitColdAtomError): self.solver1._embed_operator(fer_op, num_wires, qargs_wrong) with self.subTest("operator embedding"): embedded_op = self.solver1._embed_operator(fer_op, num_wires, qargs) target_op = FermionicOp({"+_1 -_3": 1.0}, num_spin_orbitals=4) self.assertTrue(embedded_op.simplify() == target_op.simplify()) def test_conservation_checks(self): """test the checks for conservation of spin-species.""" with self.subTest("check operator type"): circ = QuantumCircuit(4, 4) circ.fhop([0.5], [0, 1, 2, 3]) circ.rlx(0.5, 0) # apply gate with a SpinOp generator with self.assertRaises(QiskitColdAtomError): self.solver1._check_conservations(circ) with self.subTest("check compatibility with number of species"): circ = QuantumCircuit(5, 5) circ.fhop([0.5], [0, 1, 2, 3]) self.assertTrue(self.solver1._check_conservations(circ) == (True, True)) with self.assertRaises(QiskitColdAtomError): self.solver2._check_conservations(circ) with self.subTest("spin conserved"): circ = QuantumCircuit(4, 4) circ.fload([0, 3]) circ.fhop([0.5], [0, 1, 2, 3]) self.assertTrue(self.solver2._check_conservations(circ) == (True, True)) with self.subTest("spin not conserved"): circ = QuantumCircuit(4, 4) circ.fload([0, 3]) circ.fhop([0.5], [0, 1, 2, 3]) circ.frx(0.3, [0, 2]) # non spin-conserving gate self.assertTrue(self.solver2._check_conservations(circ) == (True, False)) def test_operator_to_mat(self): """test matrix representation of fermionic gates""" with self.subTest("check operator type"): spin_op = SpinOp({"X_0 Y_1": 1.0}) with self.assertRaises(QiskitColdAtomError): self.solver1.operator_to_mat(spin_op) circ = QuantumCircuit(4, 4) circ.fload([0, 3]) circ.fhop([0.5], [0, 1, 2, 3]) with self.subTest("check dimensionality of operator"): self.solver2.preprocess_circuit(circ) fer_op_wrong = FermionicOp({"+_0 -_1": 1.0}, num_spin_orbitals=3) fer_op_correct = FermionicOp({"+_0 -_1": 1.0}, num_spin_orbitals=4) with self.assertRaises(QiskitColdAtomError): self.solver2.operator_to_mat(fer_op_wrong) self.solver2.operator_to_mat(fer_op_correct) with self.subTest("test matrix representation"): self.solver2.preprocess_circuit(circ) target = np.array( [ [0.0, -0.5, -0.5, 0.0], [-0.5, 0.0, 0.0, -0.5], [-0.5, 0.0, 0.0, -0.5], [0.0, -0.5, -0.5, 0.0], ] ) test_op = self.solver2.operator_to_mat(Hop(num_modes=4, j=[0.5]).generator) self.assertTrue(np.all(test_op.toarray() == target)) def test_draw_shots(self): """test drawing of the shots from a measurement distribution""" circ = QuantumCircuit(4, 4) circ.fload([0, 3]) circ.fhop([0.5], [0, 1, 2, 3]) self.solver2.preprocess_circuit(circ) with self.subTest("check missing shot number"): # error because the number of shots is not specified with self.assertRaises(QiskitColdAtomError): self.solver2.draw_shots(np.ones(4) / 4) self.solver2.shots = 5 with self.subTest("check match of dimensions"): # error because there is a mismatch in the dimension with self.assertRaises(QiskitColdAtomError): self.solver2.draw_shots(np.ones(3) / 3) with self.subTest("formatting of measurement outcomes"): self.solver2.seed = 40 outcomes = self.solver2.draw_shots(np.ones(4) / 4) self.assertEqual(outcomes, ["0110", "0101", "1010", "0110", "0110"]) def test_to_operators(self): """test the to_operators method inherited form BaseCircuitSolver""" test_circ = QuantumCircuit(4, 4) test_circ.fload([0, 3]) test_circ.fhop([0.5], [0, 1, 2, 3]) test_circ.fint(1.0, [0, 1, 2, 3]) test_circ.measure_all() with self.subTest("test ignore barriers"): self.solver1.ignore_barriers = False with self.assertRaises(NotImplementedError): self.solver1.to_operators(test_circ) self.solver1.ignore_barriers = True with self.subTest("check for gate generators"): qubit_circ = QuantumCircuit(1) qubit_circ.h(0) with self.assertRaises(QiskitColdAtomError): self.solver1.to_operators(qubit_circ) with self.subTest("gate after previous measurement instruction"): meas_circ = QuantumCircuit(4, 4) meas_circ.measure_all() meas_circ.fhop([0.5], [0, 1, 2, 3]) with self.assertRaises(QiskitColdAtomError): self.solver1.to_operators(meas_circ) with self.subTest("check returned operators"): operators = self.solver1.to_operators(test_circ) target_ops = [ FermionicOp( { "+_0 -_1": -0.5, "-_0 +_1": 0.5, "+_2 -_3": -0.5, "-_2 +_3": 0.5, }, num_spin_orbitals=4, ), FermionicOp({"+_0 -_0 +_2 -_2": 1, "+_1 -_1 +_3 -_3": 1}, num_spin_orbitals=4), ] for op, target in zip(operators, target_ops): self.assertTrue(op == target) def test_call_method(self): """test the call method inherited form BaseCircuitSolver that simulates a circuit""" test_circ = QuantumCircuit(4) test_circ.fload([0, 3]) test_circ.fhop([np.pi / 4], [0, 1, 2, 3]) test_circ.fint(np.pi, [0, 1, 2, 3]) with self.subTest("running the circuit"): self.solver2.shots = 5 self.solver2.seed = 40 simulation = self.solver2(test_circ) self.assertEqual(simulation["memory"], ["0110", "0101", "1010", "0110", "0110"]) self.assertEqual(simulation["counts"], {"1010": 1, "0110": 3, "0101": 1}) self.assertTrue( np.allclose(simulation["statevector"], np.array([-0.5j, -0.5, 0.5, -0.5j])) ) self.assertTrue( np.allclose( simulation["unitary"], np.array( [ [-0.5, -0.5j, -0.5j, 0.5], [0.5j, 0.5, -0.5, 0.5j], [0.5j, -0.5, 0.5, 0.5j], [0.5, -0.5j, -0.5j, -0.5], ] ), ) ) with self.subTest("check for maximum dimension"): self.solver2.max_dimension = 3 with self.assertRaises(QiskitColdAtomError): simulation = self.solver2(test_circ) self.solver2.max_dimension = 100 with self.subTest("check if shots are specified"): self.solver2.shots = None simulation = self.solver2(test_circ) self.assertEqual(simulation["memory"], []) self.assertEqual(simulation["counts"], {})
https://github.com/mathelatics/QGSS-2023-From-Theory-to-Implementations
mathelatics
from IPython.display import IFrame IFrame(src="http://www.youtube.com/embed/mMwovHK2NrE", width=1920/2, height=1080/2) from qiskit import * circuit = QuantumCircuit(3,3) # QUBIT ORDERING # q0 = State |psi> that we want to teleport # q1 = Alice's half of the Bell pair # q2 = Bob's half of the Bell pair, the destination of the teleportation # ======================== # Step 0: Create the state to be teleported in qubit 0 circuit.x(0) # qubit 0 is now in state |1>, and this is the state that we want to teleport circuit.barrier() # just a visual aid # ======================== # Step 1: create an entangled Bell pair between Alice and Bob (qubits 1 and 2) circuit.h(1) circuit.cx(1,2) circuit.barrier() # just a visual aid # ======================== # Step 2: Alice applies a series of operations # between the state to teleport (qubit 0) and her half of the Bell pair (qubit 1) circuit.cx(0,1) circuit.h(0) circuit.barrier() # just a visual aid # ======================== # Step 3: Alice measures both qubits 0 and 1 circuit.measure([0, 1], [0, 1]) # results stored in classical bits 0 and 1, respectively circuit.barrier() # just a visual aid # ======================== # Step 4: Now that Alice has measured the two qubits, their states have collapsed to 0 and 1. # Bob can do operations conditioned on these qubits to his half of the Bell pair # Note that while we're conditioning Bob's operation on the collapsed qubits 0 and 1, we can # do teleportation over long distances by transmitting the classical information in classical bits 0 and 1 circuit.cx(1, 2) circuit.cz(0, 2) # Step 5: Done! Measure Bob's qubit to find out what state it is in circuit.measure([2], [2]) %matplotlib inline circuit.draw(output='mpl') simulator = Aer.get_backend('qasm_simulator') result = execute(circuit, backend=simulator, shots=1024).result() from qiskit.visualization import plot_histogram plot_histogram(result.get_counts(circuit)) def create_state_psi(theta): # Create a state along the x axis on the x-y plane and then rotate it by angle theta around the z-axis # theta = 0 => state is exactly along x # theta = pi/2 => state is exactly along y create_circuit = QuantumCircuit(1, name='create_state_psi') create_circuit.h(0) create_circuit.rz(theta, 0) return create_circuit def create_Bell_pair(): create_Bell_circuit = QuantumCircuit(2, name='create_Bell_pair') create_Bell_circuit.h(0) create_Bell_circuit.cx(0,1) return create_Bell_circuit def teleportation_Alice(): teleportation_Alice_circuit = QuantumCircuit(2, name='teleportation_Alice') teleportation_Alice_circuit.cx(0,1) teleportation_Alice_circuit.h(0) return teleportation_Alice_circuit def Alice_measure(): Alice_measure_circuit = QuantumCircuit(2, 2, name='Alice_measure') Alice_measure_circuit.measure([0,1], [0,1]) return Alice_measure_circuit def teleportation_Bob(): teleportation_Bob_circuit = QuantumCircuit(3, name='teleportation_Bob') teleportation_Bob_circuit.cx(1,2) teleportation_Bob_circuit.cz(0,2) return teleportation_Bob_circuit def build_circuit(theta): circuit = QuantumCircuit(3, 3) # Step 0: create the state to teleport circuit.append(create_state_psi(theta).to_instruction(), [0]) circuit.barrier() # Step 1: create the Bell pair between Alice and Bob's qubits circuit.append(create_Bell_pair().to_instruction(), [1,2]) circuit.barrier() # Step 2: Alice applies a series of operations circuit.append(teleportation_Alice().to_instruction(), [0,1]) circuit.barrier() # Step 3: Alice measures her two qubits circuit.append(Alice_measure().to_instruction(), [0,1], [0,1]) circuit.barrier() # Step 4: Bob applies operations to his qubit depending on Alice's measurement outcomes circuit.append(teleportation_Bob().to_instruction(), [0,1,2]) circuit.barrier() # Step 5: Done. Now measure Bob's qubit to be sure that teleportation was successful circuit.h(2) # note that the Hadamard gate here ensures that we measure in the Hadamard basis instead of z basis circuit.measure([0,1,2], [0,1,2]) return circuit circuit = build_circuit(0.01) circuit.draw(output='mpl') circuit.decompose().draw(output='mpl') simulator = Aer.get_backend('qasm_simulator') result = execute(circuit, backend=simulator, shots=1024).result() counts = result.get_counts(circuit) print(counts) num_c2_zero = sum(counts[c2c1c0] for c2c1c0 in counts if c2c1c0[0] == '0') import numpy as np thetas = np.arange(0, 4*np.pi, np.pi/16) simulator = Aer.get_backend('qasm_simulator') percent_ones = [] for theta in thetas: circuit = build_circuit(theta) result = execute(circuit, backend=simulator, shots=1024).result() counts = result.get_counts(circuit) num_c2_ones = sum(counts[c2c1c0] for c2c1c0 in counts if c2c1c0[0] == '1') percent_ones.append(num_c2_ones*100./1024) import matplotlib.pyplot as plotter plotter.plot(thetas, percent_ones) plotter.xlabel('Initial angle, theta (radians)') plotter.ylabel('Percentage of 1 counts') plotter.show() # build circuits thetas = np.arange(0, 4*np.pi, np.pi/16) circuits = [] for theta in thetas: circuit = build_circuit(theta) circuits.append(circuit) # load account IBMQ.load_account() provider = IBMQ.get_provider(hub='ibm-q') qcomp = provider.get_backend('ibmq_16_melbourne') # run the job on the backend qcomp job = execute(circuits, backend=qcomp, shots=512, initial_layout=[6,8,7]) print(job.job_id()) from qiskit.tools.monitor import job_monitor job_monitor(job) simresult = execute(circuits, backend=simulator, shots=512).result() result = job.result() percent_ones = [] for circuit in circuits: thiscircuit_counts = result.get_counts(circuit) num_c2_ones = sum(thiscircuit_counts[c2c1c0] for c2c1c0 in thiscircuit_counts if c2c1c0[0] == '1') percent_ones.append(num_c2_ones*100./512) percent_ones_sim = [] for circuit in circuits: thiscircuit_counts = simresult.get_counts(circuit) num_c2_ones = sum(thiscircuit_counts[c2c1c0] for c2c1c0 in thiscircuit_counts if c2c1c0[0] == '1') percent_ones_sim.append(num_c2_ones*100./512) plotter.plot(thetas, percent_ones, 'r.', label='Real device') plotter.plot(thetas, percent_ones_sim, 'k', label='Simulator') plotter.xlabel('Initial angle, theta (radians)') plotter.ylabel('Percentage of 1 counts') plotter.legend() plotter.show() thetas = np.arange(0, 4*np.pi, np.pi/16) circuits_classicalcontrol = [] for theta in thetas: cr1 = ClassicalRegister(1) cr2 = ClassicalRegister(1) cr3 = ClassicalRegister(1) qr = QuantumRegister(3) circuit = QuantumCircuit(qr, cr1, cr2, cr3) # ======================== # Step 0: Create the state to be teleported in qubit 0 circuit.h(0) circuit.rz(theta, 0) circuit.barrier() # ======================== # Step 1: create an entangled Bell pair between Alice and Bob (qubits 1 and 2) circuit.h(1) circuit.cx(1,2) circuit.barrier() # ======================== # Step 2: Alice applies a series of operations # between the state to teleport (qubit 0) and her half of the Bell pair (qubit 1) circuit.cx(0,1) circuit.h(0) circuit.barrier() # ======================== # Step 3: Alice measures both qubits 0 and 1 circuit.measure([0, 1], [0, 1]) # results stored in classical bits 0 and 1, respectively circuit.barrier() # ======================== # Step 4: Now that Alice has measured the two qubits, their states have collapsed to 0 and 1. # Use the classical bits from Alice's measurements to do operations on Bob's half of the Bell pair circuit.x(2).c_if(cr2, 1) circuit.z(2).c_if(cr1, 1) circuit.barrier() # Step 5: Done! Measure Bob's qubit in the Hadamard basis to find out what state it is in circuit.h(2) circuit.measure([2], [2]) circuits_classicalcontrol.append(circuit) circuits_classicalcontrol[0].draw() simulator = Aer.get_backend('qasm_simulator') simresult_classicalcontrol = execute(circuits_classicalcontrol, backend=simulator, shots=512).result() percent_ones_sim = [] for ii in range(len((circuits))): thiscircuit_counts = simresult_classicalcontrol.get_counts(ii) num_c2_ones = sum(thiscircuit_counts[c2c1c0] for c2c1c0 in thiscircuit_counts if c2c1c0[0] == '1') percent_ones_sim.append(num_c2_ones*100./512) plotter.plot(thetas, percent_ones_sim, 'k', label='Simulator') plotter.xlabel('Initial angle, theta (radians)') plotter.ylabel('Percentage of 1 counts') plotter.legend() plotter.show() qiskit.__qiskit_version__ import qiskit.tools.jupyter %qiskit_copyright
https://github.com/rigetti/qiskit-rigetti
rigetti
############################################################################## # Copyright 2021 Rigetti Computing # # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. ############################################################################## from typing import Iterable, Optional, Any, Union, List, cast, Tuple from uuid import uuid4 from pyquil import get_qc from pyquil.api import QuantumComputer, QCSClient from qiskit import QuantumCircuit, ClassicalRegister from qiskit.circuit import Measure, CircuitInstruction, Clbit from qiskit.providers import BackendV1, Options, Provider from qiskit.providers.models import QasmBackendConfiguration from qiskit.transpiler import CouplingMap from ._qcs_job import RigettiQCSJob def _prepare_readouts(circuit: QuantumCircuit) -> None: """ Errors if measuring into more than one readout. If only measuring one, ensures its name is 'ro'. Mutates the input circuit. """ measures: List[CircuitInstruction] = [d for d in circuit.data if isinstance(d[0], Measure)] readout_names: List[str] = list({clbit.register.name for m in measures for clbit in m.clbits}) num_readouts = len(readout_names) if num_readouts == 0: raise RuntimeError("Circuit has no measurements") if num_readouts > 1: readout_names.sort() raise RuntimeError( f"Multiple readout registers are unsupported on QCSBackend; found {', '.join(readout_names)}" ) orig_readout_name = readout_names[0] if orig_readout_name == "ro": return for i, reg in enumerate(circuit.cregs): if reg.name != orig_readout_name: continue # rename register to "ro" ro_reg = ClassicalRegister(size=reg.size, name="ro") circuit.cregs[i] = ro_reg def map_ro_reg(clbits: Iterable[Clbit]) -> List[Clbit]: return [Clbit(ro_reg, clbit.index) for clbit in clbits if clbit.register.name == orig_readout_name] circuit._clbits = map_ro_reg(circuit.clbits) circuit._clbit_indices = { Clbit(ro_reg, clbit.index): loc._replace(registers=[ro_reg]) for clbit, loc in circuit._clbit_indices.items() if clbit.register.name == orig_readout_name } for instruction in circuit._data: instruction.clbits = map_ro_reg(instruction.clbits) break def _prepare_circuit(circuit: QuantumCircuit) -> QuantumCircuit: """ Returns a prepared copy of the circuit for execution on the QCS Backend. """ circuit = circuit.copy() _prepare_readouts(circuit) return circuit class GetQuantumProcessorException(Exception): pass class RigettiQCSBackend(BackendV1): """ Class for representing a Rigetti backend, which may target a real QPU or a simulator. """ def __init__( self, *, compiler_timeout: float, execution_timeout: float, client_configuration: QCSClient, backend_configuration: QasmBackendConfiguration, provider: Optional[Provider], auto_set_coupling_map: bool = True, qc: Optional[QuantumComputer] = None, **fields: Any, ) -> None: """ Args: execution_timeout: Time limit for execution requests, in seconds. compiler_timeout: Time limit for compiler requests, in seconds. client_configuration: QCS client configuration. backend_configuration: Backend configuration. provider: Parent provider. qc: The `QuantumComputer` this backend represents to Qiskit. auto_set_coupling_map: When `True`, this will set the `QasmBackendConfiguration` `coupling_map` based on the `QuantumComputer` topology if the existing `coupling_map` is empty. fields: Keyword arguments for the values to use to override the default options. """ super().__init__(backend_configuration, provider, **fields) self._compiler_timeout = compiler_timeout self._execution_timeout = execution_timeout self._client_configuration = client_configuration self._qc = qc self._auto_set_coupling_map = auto_set_coupling_map @classmethod def _default_options(cls) -> Options: return Options(shots=None) @property def qc(self) -> QuantumComputer: self._load_qc_if_necessary() return cast(QuantumComputer, self._qc) @property def coupling_map(self) -> CouplingMap: self._set_coupling_map_based_on_qc_topology_if_necessary() return CouplingMap(self.configuration().coupling_map) def _load_qc_if_necessary(self) -> None: configuration: QasmBackendConfiguration = self.configuration() if self._qc is None: try: self._qc = get_qc( configuration.backend_name, compiler_timeout=self._compiler_timeout, execution_timeout=self._execution_timeout, client_configuration=self._client_configuration, ) except Exception as e: raise GetQuantumProcessorException( f"failed to retrieve quantum processor {configuration.backend_name}" ) from e def _set_coupling_map_based_on_qc_topology_if_necessary(self) -> None: configuration: QasmBackendConfiguration = self.configuration() if not configuration.coupling_map and self._auto_set_coupling_map: configuration.coupling_map = get_coupling_map_from_qc_topology(self.qc) def run( self, run_input: Union[QuantumCircuit, List[QuantumCircuit]], **options: Any, ) -> RigettiQCSJob: """ Run the quantum circuit(s) using this backend. Args: run_input: Either a single :class:`QuantumCircuit` to run or a list of them to run in parallel. **options: Execution options to forward to :class:`RigettiQCSJob`. Returns: RigettiQCSJob: The job that has been started. Wait for it by calling :func:`RigettiQCSJob.result` """ if not isinstance(run_input, list): run_input = [run_input] bindings = options.get("parameter_binds") or [] if len(bindings) > 0: run_input = [circuit.bind_parameters(binding) for circuit in run_input for binding in bindings] run_input = [_prepare_circuit(circuit) for circuit in run_input] self._set_coupling_map_based_on_qc_topology_if_necessary() return RigettiQCSJob( job_id=str(uuid4()), circuits=run_input, options=options, qc=self.qc, backend=self, configuration=self.configuration(), ) def get_coupling_map_from_qc_topology(qc: QuantumComputer) -> List[Tuple[int, int]]: return cast(List[Tuple[int, int]], qc.quantum_processor.qubit_topology().to_directed().edges())
https://github.com/qiskit-community/qiskit-translations-staging
qiskit-community
import matplotlib.pyplot as plt from qiskit import QuantumCircuit, transpile from qiskit.providers.fake_provider import FakeAuckland backend = FakeAuckland() ghz = QuantumCircuit(15) ghz.h(0) ghz.cx(0, range(1, 15)) depths = [] for _ in range(100): depths.append( transpile( ghz, backend, layout_method='trivial' # Fixed layout mapped in circuit order ).depth() ) plt.figure(figsize=(8, 6)) plt.hist(depths, align='left', color='#AC557C') plt.xlabel('Depth', fontsize=14) plt.ylabel('Counts', fontsize=14);
https://github.com/qiskit-community/qiskit-translations-staging
qiskit-community
import random from qiskit.quantum_info import Statevector secret = random.randint(0,7) # the owner is randomly picked secret_string = format(secret, '03b') # format the owner in 3-bit string oracle = Statevector.from_label(secret_string) # let the oracle know the owner from qiskit.algorithms import AmplificationProblem problem = AmplificationProblem(oracle, is_good_state=secret_string) from qiskit.algorithms import Grover grover_circuits = [] for iteration in range(1,3): grover = Grover(iterations=iteration) circuit = grover.construct_circuit(problem) circuit.measure_all() grover_circuits.append(circuit) # Grover's circuit with 1 iteration grover_circuits[0].draw() # Grover's circuit with 2 iterations grover_circuits[1].draw() from qiskit_ibm_runtime import QiskitRuntimeService service = QiskitRuntimeService() backend = "ibmq_qasm_simulator" # use the simulator from qiskit_ibm_runtime import Sampler, Session with Session(service=service, backend=backend): sampler = Sampler() job = sampler.run(circuits=grover_circuits, shots=1000) result = job.result() print(result) from qiskit.tools.visualization import plot_histogram # Extract bit string with highest probability from results as the answer result_dict = result.quasi_dists[1].binary_probabilities() answer = max(result_dict, key=result_dict.get) print(f"As you can see, the quantum computer returned '{answer}' as the answer with highest probability.\n" "And the results with 2 iterations have higher probability than the results with 1 iteration." ) # Plot the results plot_histogram(result.quasi_dists, legend=['1 iteration', '2 iterations']) # Print the results and the correct answer. print(f"Quantum answer: {answer}") print(f"Correct answer: {secret_string}") print('Success!' if answer == secret_string else 'Failure!') import qiskit_ibm_runtime qiskit_ibm_runtime.version.get_version_info() import qiskit.tools.jupyter %qiskit_version_table %qiskit_copyright
https://github.com/shesha-raghunathan/DATE2019-qiskit-tutorial
shesha-raghunathan
# Import the QuantumProgram and our configuration import math from pprint import pprint from qiskit import QuantumProgram import Qconfig qp = QuantumProgram() # quantum register for the first circuit q1 = qp.create_quantum_register('q1', 4) c1 = qp.create_classical_register('c1', 4) # quantum register for the second circuit q2 = qp.create_quantum_register('q2', 2) c2 = qp.create_classical_register('c2', 2) # making the first circuits qc1 = qp.create_circuit('GHZ', [q1], [c1]) qc2 = qp.create_circuit('superposition', [q2], [c2]) qc1.h(q1[0]) qc1.cx(q1[0], q1[1]) qc1.cx(q1[1], q1[2]) qc1.cx(q1[2], q1[3]) for i in range(4): qc1.measure(q1[i], c1[i]) # making the second circuits qc2.h(q2) for i in range(2): qc2.measure(q2[i], c2[i]) # printing the circuits print(qp.get_qasm('GHZ')) print(qp.get_qasm('superposition')) qobj = qp.compile(['GHZ','superposition'], backend='local_qasm_simulator') qp.get_execution_list(qobj) qp.get_execution_list(qobj, verbose=True) qp.get_compiled_configuration(qobj, 'GHZ', ) print(qp.get_compiled_qasm(qobj, 'GHZ')) # Coupling map coupling_map = {0: [1, 2, 3]} # Place the qubits on a triangle in the bow-tie initial_layout={("q1", 0): ("q", 0), ("q1", 1): ("q", 1), ("q1", 2): ("q", 2), ("q1", 3): ("q", 3)} qobj = qp.compile(['GHZ'], backend='local_qasm_simulator', coupling_map=coupling_map, initial_layout=initial_layout) print(qp.get_compiled_qasm(qobj,'GHZ')) # Define methods for making QFT circuits def input_state(circ, q, n): """n-qubit input state for QFT that produces output 1.""" for j in range(n): circ.h(q[j]) circ.u1(math.pi/float(2**(j)), q[j]).inverse() def qft(circ, q, n): """n-qubit QFT on q in circ.""" for j in range(n): for k in range(j): circ.cu1(math.pi/float(2**(j-k)), q[j], q[k]) circ.h(q[j]) qp = QuantumProgram() q = qp.create_quantum_register("q", 3) c = qp.create_classical_register("c", 3) qft3 = qp.create_circuit("qft3", [q], [c]) input_state(qft3, q, 3) qft(qft3, q, 3) for i in range(3): qft3.measure(q[i], c[i]) print(qft3.qasm()) result = qp.execute(["qft3"], backend="local_qasm_simulator", shots=1024) result.get_counts("qft3") print(result.get_ran_qasm("qft3")) # Coupling map for ibmqx2 "bowtie" coupling_map = {0: [1, 2], 1: [2], 2: [], 3: [2, 4], 4: [2]} # Place the qubits on a triangle in the bow-tie initial_layout={("q", 0): ("q", 2), ("q", 1): ("q", 3), ("q", 2): ("q", 4)} result2 = qp.execute(["qft3"], backend="local_qasm_simulator", coupling_map=coupling_map, initial_layout=initial_layout) result2.get_counts("qft3") print(result2.get_ran_qasm("qft3")) # Place the qubits on a linear segment of the ibmqx3 coupling_map = {0: [1], 1: [2], 2: [3], 3: [14], 4: [3, 5], 6: [7, 11], 7: [10], 8: [7], 9: [8, 10], 11: [10], 12: [5, 11, 13], 13: [4, 14], 15: [0, 14]} initial_layout={("q", 0): ("q", 0), ("q", 1): ("q", 1), ("q", 2): ("q", 2)} result3 = qp.execute(["qft3"], backend="local_qasm_simulator", coupling_map=coupling_map, initial_layout=initial_layout) result3.get_counts("qft3") print(result3.get_ran_qasm("qft3"))
https://github.com/arthurfaria/Qiskit_certificate_prep
arthurfaria
import numpy as np from qiskit import QuantumCircuit, assemble, Aer, execute, BasicAer from qiskit.visualization import * from qiskit.quantum_info import Statevector, random_statevector from qiskit.tools.jupyter import * from qiskit.extensions import Initialize bell_0 = QuantumCircuit(2,2) bell_0.h(0) bell_0.cx(0,1) bell_0.draw('latex') #we define the basis sv = Statevector.from_label("00") #we evolve this initial state through our circuit sv_bell_0 = sv.evolve(bell_0) sv_bell_0.draw('latex') bell_1 = QuantumCircuit(2,2) bell_1.h(0) bell_1.cx(0,1) bell_1.z(1) #mpl = matplotlib #latex_source also possible, but really hard to see what is going on bell_1.draw('mpl') sv_bell_1 = sv.evolve(bell_1) sv_bell_1.draw('latex_source') bell_2 = QuantumCircuit(2,2) bell_2.h(0) bell_2.x(1) bell_2.cx(0,1) bell_2.draw('text') sv_bell_2 = sv.evolve(bell_2) sv_bell_2.draw('text') #text by default bell_3 = QuantumCircuit(2,2) bell_3.h(0) bell_3.x(1) bell_3.cx(0,1) bell_3.z(1) bell_3.draw() #text by default sv_bell_3 = sv.evolve(bell_3) sv_bell_3.draw() ghz = QuantumCircuit(3) ghz.h(0) ghz.cx(0,1) ghz.cx(1,2) ghz.draw('mpl') ### drawing the statevector sv_ghz= Statevector.from_label("000") state_ghz = sv_ghz.evolve(ghz) state_ghz.draw('latex') plot_state_qsphere(bell_1) plot_state_hinton(bell_1) plot_state_paulivec(bell_3) plot_state_city(bell_2) plot_bloch_multivector(bell_2) # It is not a separable state!! ex_sep_state = QuantumCircuit(2) ex_sep_state.h(0) ex_sep_state.h(1) ex_sv = Statevector.from_label("00") ex_state = ex_sv.evolve(ex_sep_state) plot_bloch_multivector(ex_state) plot_bloch_vector([0.7,0.5,1]) #here for [x,y,z]; x=Tr[Xρ] and similar for y and z ###Part1: circuit part qc = QuantumCircuit(3) qc.h(0) qc.cx(0,1) qc.cx(1,2) #it saves the current simulator quantum state as a statevector. qc.save_statevector() ###Parts 2 and 3 using Aer_simulator qobj = assemble(qc) backend1 = Aer.get_backend('aer_simulator') ###Parts 4 and 5 result = backend1.run(qobj).result() sv_qc0 = result.get_statevector() sv_qc0.draw('latex') sv_qc0.draw('qsphere') ######## PART2: statevetor_simulator ###Part1: circuit part qc1 = QuantumCircuit(3) qc1.h(0) qc1.cx(0,1) qc1.cx(1,2) ### backend part backend2 = BasicAer.get_backend('statevector_simulator') ### result part # by default shots = 1024 job = execute(qc1, backend2, shots=1024) result = job.result() #finally, we get the statevector from the result sv_qc1 = result.get_statevector(qc1) sv_qc1.draw('qsphere') plot_state_city(sv_qc1) N = 1/np.sqrt(3) desired_state = [N,np.sqrt(1-N**2)] #adding it to a circuit qc_custom0 = QuantumCircuit(1) qc_custom0.initialize(desired_state,0) #as simple as this! qc_custom0.draw('mpl') meas = QuantumCircuit(1,1) meas.measure(0,0) #we add, through the composite function, the measurement to the custom state qc_custom = meas.compose(qc_custom0, front=True) qc_custom.draw('mpl') #To get histograms, we use qasm_simulator. #We will see this in the notebook qasm_simulator_and_visualization.ipynb backend_qasm = BasicAer.get_backend('qasm_simulator') job0 = execute(qc_custom, backend_qasm, shots=1000) counts = job0.result().get_counts() plot_histogram(counts) # random_statevector of dimension 2 psi = random_statevector(2) #Initialize qubits in a specific state. init_gate = Initialize(psi) # defining a name to the state. By default is |psi\rangle init_gate.label = "initial state" qc_random = QuantumCircuit(1) # random state for the first qibit qc_random.append(init_gate, [0]) qc_random.draw('mpl') qc_random.measure_all() qc_random.draw('mpl') job1 = execute(qc_random, backend_qasm, shots=1000) counts1 = job1.result().get_counts() plot_histogram(counts1) decomp = qc_custom0.decompose() decomp.draw('mpl')
https://github.com/jonasmaziero/computacao_quantica_qiskit_sbf_2023
jonasmaziero
from sympy import Matrix, sqrt, init_printing; init_printing(use_unicode=True) ket0 = Matrix([[1],[0]]); ket1 = Matrix([[0],[1]]); from sympy.physics.quantum import TensorProduct as tp ket00 = tp(ket0,ket0); ket01 = tp(ket0,ket1); ket10 = tp(ket1,ket0); ket11 = tp(ket1,ket1) Psim = (ket01-ket10)/sqrt(2); Psim.T X = Matrix([[0,1],[1,0]]); Z = Matrix([[1,0],[0,-1]]); (tp(Z,Z)*Psim).T, (tp(X,X)*Psim).T A1 = Z; A2 = X; B1 = (Z+X)/sqrt(2); B2 = (Z-X)/sqrt(2); O = tp(A1,B1)+tp(A1,B2)+tp(A2,B1)-tp(A2,B2) O, sqrt(2)*(tp(Z,Z)+tp(X,X)) from qiskit import QuantumCircuit def qc_Psim(): # função que cria o circuito quantico para preparar o estado de Bell |Psi-> qc = QuantumCircuit(2, name=r'$|\Psi_-\rangle$') qc.x([0,1]) qc.h(0) qc.cx(0,1) #qc.z(0) #qc.x(1) return qc qc_Psim_ = qc_Psim() qc_Psim_.draw('mpl') import qiskit from qiskit.quantum_info import Statevector qc_Psim_ = qc_Psim() state = Statevector(qc_Psim_) qiskit.visualization.plot_state_city(state) from sympy import Matrix Psim = Matrix([[0],[1],[-1],[0]])/sqrt(2) #Psim from sympy.physics.quantum.dagger import Dagger rho_Psim = Psim*Dagger(Psim) rho_Psim qc = QuantumCircuit(2,2) qc_Psim_ = qc_Psim() qc.append(qc_Psim_,[0,1]) qc.measure([0,1],[0,1]) qc.draw('mpl') from qiskit import Aer, execute simulator = Aer.get_backend('qasm_simulator') nshots = 2**13 job = execute(qc, backend=simulator, shots=nshots) counts = job.result().get_counts() p00=0; p01=0; p10=0; p11=0 for j in (0,2): for k in (0,2): if '00' in counts: p00 = counts['00']/nshots if '01' in counts: p01 = counts['01']/nshots if '10' in counts: p10 = counts['10']/nshots if '11' in counts: p11 = counts['11']/nshots ZZ_avg = (p00+p11)-(p01+p10) ZZ_avg qc = QuantumCircuit(2,2) qc_Psim_ = qc_Psim() qc.append(qc_Psim_,[0,1]) qc.h([0,1]) qc.measure([0,1],[0,1]) qc.draw('mpl') from qiskit import Aer simulator = Aer.get_backend('qasm_simulator') nshots = 2**13 job = execute(qc, backend=simulator, shots=nshots) counts = job.result().get_counts() p00=0; p01=0; p10=0; p11=0 for j in (0,2): for k in (0,2): if '00' in counts: p00 = counts['00']/nshots if '01' in counts: p01 = counts['01']/nshots if '10' in counts: p10 = counts['10']/nshots if '11' in counts: p11 = counts['11']/nshots XX_avg = (p00+p11)-(p01+p10) XX_avg O_avg = sqrt(2)*(ZZ_avg + XX_avg) O_avg, float(O_avg) import qiskit qiskit.IBMQ.save_account('5a0140fc106f9f8ae43104d5751baf65c726195f8b45b1f42e161f0182b5fe79ca6dbb1405159301e1e44d40d680223ea572d9b8737205bfa6f90485f1f88123', overwrite = True) qiskit.IBMQ.load_account() provider = qiskit.IBMQ.get_provider(hub='ibm-q', group='open', project='main') device = provider.get_backend('ibm_nairobi') qc = QuantumCircuit(2,2); qc_Psim_ = qc_Psim(); qc.append(qc_Psim_,[0,1]); qc.measure([0,1],[0,1]) job = execute(qc, backend = device, shots = nshots); print(job.job_id()) device = provider.get_backend('ibm_nairobi'); job = device.retrieve_job('cmfbdw78vz2g008daj90') counts = job.result().get_counts() p00=0; p01=0; p10=0; p11=0 for j in (0,2): for k in (0,2): if '00' in counts: p00 = counts['00']/nshots if '01' in counts: p01 = counts['01']/nshots if '10' in counts: p10 = counts['10']/nshots if '11' in counts: p11 = counts['11']/nshots ZZ_avg_exp = (p00+p11)-(p01+p10); ZZ_avg_exp device = provider.get_backend('ibm_nairobi') qc = QuantumCircuit(2,2); qc_Psim_ = qc_Psim(); qc.append(qc_Psim_,[0,1]); qc.h([0,1]); qc.measure([0,1],[0,1]) job = execute(qc, backend = device, shots = nshots); jobid = job.job_id() print(jobid) device = provider.get_backend('ibm_nairobi'); job = device.retrieve_job('cmfbekafysfg008t2y4g') counts = job.result().get_counts() p00=0; p01=0; p10=0; p11=0 for j in (0,2): for k in (0,2): if '00' in counts: p00 = counts['00']/nshots if '01' in counts: p01 = counts['01']/nshots if '10' in counts: p10 = counts['10']/nshots if '11' in counts: p11 = counts['11']/nshots XX_avg_exp = (p00+p11)-(p01+p10); XX_avg_exp O_avg_exp = sqrt(2.)*(ZZ_avg_exp + XX_avg_exp) O_avg_exp import numpy as np import math th_max = math.pi/2; npt = 100; dth = th_max/npt; th = np.arange(0,th_max+dth,dth) Oteo = -math.sqrt(2)*(1+np.sin(th)) Odl = -2*np.ones(len(th)) from matplotlib import pyplot as plt plt.plot(th, Oteo, label = r'$\langle O\rangle_{\Psi}^{teo}$') plt.plot(th, Odl, label = 'LHV limit') plt.xlabel(r'$\theta$') plt.legend(); plt.show() # circuito quântico para preparação do estado Psi def qc_Psi(th): qc = QuantumCircuit(2) qc.u(th,0,0, 0) qc.cx(0,1) qc.z(0) qc.x(1) return qc import math th = math.pi/4 qc_Psi_ = qc_Psi(th) qc_Psi_.draw('mpl') # função para calcular as médias tipo <A\otimes B>, com A,B=+1,-1, dadas as probabilidades def ABavg(result, nshots): avg = 0 if '00' in result: avg += result['00'] if '01' in result: avg -= result['01'] if '10' in result: avg -= result['10'] if '11' in result: avg += result['11'] return avg/nshots # = (N(00)-N(01)-N(10)+N(11))/nshots th_max = math.pi/2; npe = 5; dth = th_max/npe; th = np.arange(0,th_max+dth,dth) Osim = np.zeros(len(th)) from qiskit import Aer, execute simulator = Aer.get_backend('qasm_simulator') nshots = 2**13 for j in range(0,len(th)): # mede ZZ qc = QuantumCircuit(2,2) qc_Psi_ = qc_Psi(th[j]); qc.append(qc_Psi_, [0,1]) qc.measure([0,1],[0,1]) job = execute(qc, backend=simulator, shots=nshots) result = job.result().get_counts() ZZavg = ABavg(result, nshots) # mede XX qc = QuantumCircuit(2,2) qc_Psi_ = qc_Psi(th[j]); qc.append(qc_Psi_, [0,1]) qc.h([0,1]) qc.measure([0,1],[0,1]) job = execute(qc, backend=simulator, shots=nshots) result = job.result().get_counts() XXavg = ABavg(result, nshots) # média de O Osim[j] = math.sqrt(2)*(ZZavg + XXavg) Osim import numpy as np; import math th_max = math.pi/2; dtht = th_max/npt; tht = np.arange(0,th_max+dtht,dtht) Oteo = -math.sqrt(2)*(1+np.sin(tht)); Odl = -2*np.ones(len(tht)) dth = th_max/npe; th = np.arange(0,th_max+dth,dth) from matplotlib import pyplot as plt plt.plot(tht, Oteo, label = r'$\langle O\rangle_{\Psi}^{teo}$') plt.plot(tht, Odl, label = 'LHV limit') plt.plot(th, Osim, '*', label = r'$\langle O\rangle_{\Psi}^{sim}$') plt.xlabel(r'$\theta$') plt.legend(); plt.show() import qiskit qiskit.IBMQ.save_account('45b1db3a3c2ecae609e6c98184250919ccd31c9ea24100440abe0821fe6312c2b05a67239806c5b0020754eb3072f924547adb621e1e3931200aee13583a776f', overwrite = True) qiskit.IBMQ.load_account() provider = qiskit.IBMQ.get_provider(hub='ibm-q', group='open', project='main') th_max = math.pi/2; dth = th_max/npe; th = np.arange(0,th_max+dth,dth) device = provider.get_backend('ibm_nairobi') nshots = 2**13 jobs_ids_ZZ = []; jobs_ids_XX = [] for j in range(0,len(th)): # mede ZZ qc = QuantumCircuit(2,2); qc_Psi_ = qc_Psi(th[j]); qc.append(qc_Psi_, [0,1]); qc.measure([0,1],[0,1]) job = execute(qc, backend=device, shots=nshots) print('ZZ',job.job_id()); jobs_ids_ZZ.append(job.job_id()) # mede XX qc = QuantumCircuit(2,2); qc_Psi_ = qc_Psi(th[j]); qc.append(qc_Psi_, [0,1]); qc.h([0,1]); qc.measure([0,1],[0,1]) job = execute(qc, backend=device, shots=nshots) print('XX',job.job_id()); jobs_ids_XX.append(job.job_id()) f = open("jobs_ids_ZZ.txt", "w"); f.write(str(jobs_ids_ZZ)); f.close() f = open("jobs_ids_XX.txt", "w"); f.write(str(jobs_ids_XX)); f.close() f = open("jobs_ids_ZZ.txt","r") list_ids_ZZ = f.read().replace("'","").replace(" ","").replace("[","").replace("]","").split(",") f.close() f = open("jobs_ids_XX.txt","r") list_ids_XX = f.read().replace("'","").replace(" ","").replace("[","").replace("]","").split(",") f.close() th_max = math.pi/2; dth = th_max/npe; th = np.arange(0,th_max+dth,dth) Oexp = np.zeros(len(th)) for j in range(0,len(th)): # média de ZZ job = device.retrieve_job(list_ids_ZZ[j]) result = job.result().get_counts() ZZavg = ABavg(result, nshots) # média de XX job = device.retrieve_job(list_ids_XX[j]) result = job.result().get_counts() XXavg = ABavg(result, nshots) # média de O Oexp[j] = math.sqrt(2)*(ZZavg + XXavg) Oexp import numpy as np; import math th_max = math.pi/2; dtht = th_max/npt; tht = np.arange(0,th_max+dtht,dtht) Oteo = -math.sqrt(2)*(1+np.sin(tht)); Odl = -2*np.ones(len(tht)) dth = th_max/npe; th = np.arange(0,th_max+dth,dth) from matplotlib import pyplot as plt plt.plot(tht, Oteo, label = r'$\langle O\rangle_{\Psi}^{teo}$') plt.plot(tht, Odl, label = 'LHV limit') plt.plot(th, Osim, '*', label = r'$\langle O\rangle_{\Psi}^{sim}$') plt.plot(th, Oexp, '*', label = r'$\langle O\rangle_{\Psi}^{exp}$') plt.xlabel(r'$\theta$'); plt.legend(); plt.show() def f_Oavg(O,psi): from sympy.physics.quantum.dagger import Dagger return Dagger(psi)*O*psi from sympy import Matrix, symbols, cos, sin, sqrt, simplify from sympy.physics.quantum import TensorProduct as tp Psim = Matrix([[0],[1],[-1],[0]])/sqrt(2) X = Matrix([[0,1],[1,0]]) Z = Matrix([[1,0],[0,-1]]) th = symbols('theta') A1B1 = tp(Z,cos(th)*Z+sin(th)*X) A1B1avg = f_Oavg(A1B1,Psim) A1B2 = tp(Z,(Z-X)/sqrt(2)) A1B2avg = f_Oavg(A1B2,Psim) A2B1 = tp(X,cos(th)*Z+sin(th)*X) A2B1avg = f_Oavg(A2B1,Psim) A2B2 = tp(X,(Z-X)/sqrt(2)) A2B2avg = f_Oavg(A2B2,Psim) Oavg = A1B1avg + A1B2avg + A2B1avg - A2B2avg A1B1avg, A1B2avg, A2B1avg, A2B2avg, simplify(Oavg) import numpy as np; import math th_max = math.pi/4; npt = 100; dth = th_max/npt; tht = np.arange(-th_max,th_max+dth,dth) Oteo = -math.sqrt(2)*(1+np.sin(tht+math.pi/4)) Odl = -2*np.ones(len(tht)) from matplotlib import pyplot as plt plt.plot(tht, Oteo, label = r'$\langle O\rangle_{\Psi}^{teo}$') plt.plot(tht, Odl, label = 'LHV limit') plt.xlabel(r'$\theta$') plt.legend(); plt.show() th_max = math.pi/4; npe = 4; dth = 2*th_max/npe; th = np.arange(-th_max,th_max+dth,dth); Osim = np.zeros(len(th)) from qiskit import *; simulator = Aer.get_backend('qasm_simulator'); nshots = 2**13 for j in range(0,len(th)): # mede <A1B1> qc = QuantumCircuit(2,2); qc_Psim_ = qc_Psim(); qc.append(qc_Psim_, [0,1]); qc.u(th[j],0,math.pi, 1); qc.measure([0,1],[0,1]) job = execute(qc, backend=simulator, shots=nshots); result = job.result().get_counts(); A1B1avg = ABavg(result, nshots) # mede <A1B2> qc = QuantumCircuit(2,2); qc_Psim_ = qc_Psim(); qc.append(qc_Psim_, [0,1]); qc.u(-math.pi/4,0,math.pi, 1); qc.measure([0,1],[0,1]) job = execute(qc, backend=simulator, shots=nshots); result = job.result().get_counts(); A1B2avg = ABavg(result, nshots) # mede <A2B1> qc = QuantumCircuit(2,2); qc_Psim_ = qc_Psim(); qc.append(qc_Psim_, [0,1]); qc.h(0); qc.u(th[j],0,math.pi, 1); qc.measure([0,1],[0,1]) job = execute(qc, backend=simulator, shots=nshots); result = job.result().get_counts(); A2B1avg = ABavg(result, nshots) # mede <A2B2> qc = QuantumCircuit(2,2); qc_Psim_ = qc_Psim(); qc.append(qc_Psim_, [0,1]); qc.h(0); qc.u(-math.pi/4,0,math.pi, 1); qc.measure([0,1],[0,1]) job = execute(qc, backend=simulator, shots=nshots); result = job.result().get_counts(); A2B2avg = ABavg(result, nshots) # média de O Osim[j] = A1B1avg + A1B2avg + A2B1avg - A2B2avg Osim import numpy as np; import math th_max = math.pi/4; dtht = 2*th_max/npt; tht = np.arange(-th_max,th_max+dtht,dtht) Oteo = -math.sqrt(2)*(1+np.sin(tht+math.pi/4)); Odl = -2*np.ones(len(tht)) dth = 2*th_max/npe; th = np.arange(-th_max,th_max+dth,dth) from matplotlib import pyplot as plt plt.plot(tht, Oteo, label = r'$\langle O\rangle_{\Psi}^{teo}$') plt.plot(tht, Odl, label = 'LHV limit') plt.plot(th, Osim, '*', label = r'$\langle O\rangle_{\Psi}^{sim}$') plt.xlabel(r'$\theta$') plt.legend(); plt.show() import qiskit qiskit.IBMQ.save_account('45b1db3a3c2ecae609e6c98184250919ccd31c9ea24100440abe0821fe6312c2b05a67239806c5b0020754eb3072f924547adb621e1e3931200aee13583a776f', overwrite = True) qiskit.IBMQ.load_account() #provider = qiskit.IBMQ.get_provider(hub='ibm-q', group='open', project='main') provider = qiskit.IBMQ.get_provider(hub='ibm-q-research-2', group='federal-uni-sant-1', project='main') th_max = math.pi/4; npe = 4; dth = 2*th_max/npe; th = np.arange(-th_max,th_max+dth,dth) from qiskit import *; device = provider.get_backend('ibm_nairobi'); nshots = 2**13 jobs_ids_A1B1 = []; jobs_ids_A1B2 = []; jobs_ids_A2B1 = []; jobs_ids_A2B2 = [] for j in range(0,len(th)): # mede <A1B1> qc = QuantumCircuit(2,2); qc_Psim_ = qc_Psim(); qc.append(qc_Psim_, [0,1]); qc.u(th[j],0,math.pi, 1) qc.measure([0,1],[0,1]) job = execute(qc, backend=device, shots=nshots); print('A1B1:',job.job_id()); jobs_ids_A1B1.append(job.job_id()) # mede <A1B2> qc = QuantumCircuit(2,2); qc_Psim_ = qc_Psim(); qc.append(qc_Psim_, [0,1]); qc.u(-math.pi/4,0,math.pi, 1) qc.measure([0,1],[0,1]) job = execute(qc, backend=device, shots=nshots); print('A1B2:',job.job_id()); jobs_ids_A1B2.append(job.job_id()) # mede <A2B1> qc = QuantumCircuit(2,2); qc_Psim_ = qc_Psim(); qc.append(qc_Psim_, [0,1]); qc.h(0); qc.u(th[j],0,math.pi, 1) qc.measure([0,1],[0,1]) job = execute(qc, backend=device, shots=nshots); print('A2B1:',job.job_id()); jobs_ids_A2B1.append(job.job_id()) # mede <A2B2> qc = QuantumCircuit(2,2); qc_Psim_ = qc_Psim(); qc.append(qc_Psim_, [0,1]); qc.h(0); qc.u(-math.pi/4,0,math.pi, 1) qc.measure([0,1],[0,1]) job = execute(qc, backend=device, shots=nshots); print('A2B2:',job.job_id()); jobs_ids_A2B2.append(job.job_id()) f = open("jobs_ids_A1B1.txt", "w"); f.write(str(jobs_ids_A1B1)); f.close() f = open("jobs_ids_A1B2.txt", "w"); f.write(str(jobs_ids_A1B2)); f.close() f = open("jobs_ids_A2B1.txt", "w"); f.write(str(jobs_ids_A2B1)); f.close() f = open("jobs_ids_A2B2.txt", "w"); f.write(str(jobs_ids_A2B2)); f.close() device = provider.get_backend('ibm_nairobi') f = open("jobs_ids_A1B1.txt","r") list_ids_A1B1 = f.read().replace("'","").replace(" ","").replace("[","").replace("]","").split(","); f.close() f = open("jobs_ids_A1B2.txt","r") list_ids_A1B2 = f.read().replace("'","").replace(" ","").replace("[","").replace("]","").split(","); f.close() f = open("jobs_ids_A2B1.txt","r") list_ids_A2B1 = f.read().replace("'","").replace(" ","").replace("[","").replace("]","").split(","); f.close() f = open("jobs_ids_A2B2.txt","r") list_ids_A2B2 = f.read().replace("'","").replace(" ","").replace("[","").replace("]","").split(","); f.close() th_max = math.pi/4; dth = 2*th_max/npe; th = np.arange(-th_max,th_max+dth,dth); Oexp = np.zeros(len(th)) for j in range(0,len(th)): # média de A1B1 job = device.retrieve_job(list_ids_A1B1[j]); result = job.result().get_counts(); A1B1avg = ABavg(result, nshots) # média de A1B2 job = device.retrieve_job(list_ids_A1B2[j]); result = job.result().get_counts(); A1B2avg = ABavg(result, nshots) # média de A2B1 job = device.retrieve_job(list_ids_A2B1[j]); result = job.result().get_counts(); A2B1avg = ABavg(result, nshots) # média de A2B2 job = device.retrieve_job(list_ids_A2B2[j]); result = job.result().get_counts(); A2B2avg = ABavg(result, nshots) # média de O Oexp[j] = A1B1avg + A1B2avg + A2B1avg - A2B2avg Oexp import numpy as np; import math th_max = math.pi/4; dtht = 2*th_max/npt; tht = np.arange(-th_max,th_max+dtht,dtht) Oteo = -math.sqrt(2)*(1+np.sin(tht+math.pi/4)); Odl = -2*np.ones(len(tht)) dth = 2*th_max/npe; th = np.arange(-th_max,th_max+dth,dth) from matplotlib import pyplot as plt plt.plot(tht, Oteo, label = r'$\langle O\rangle_{\Psi}^{teo}$') plt.plot(tht, Odl, label = 'LHV limit') plt.plot(th, Osim, '*', label = r'$\langle O\rangle_{\Psi}^{sim}$') plt.plot(th, Oexp, '*', label = r'$\langle O\rangle_{\Psi}^{exp}$') plt.xlabel(r'$\theta$'); plt.legend(); plt.show()
https://github.com/PabloMartinezAngerosa/QAOA-uniform-convergence
PabloMartinezAngerosa
from tsp_qaoa import test_solution from qiskit.visualization import plot_histogram import networkx as nx import numpy as np import json import csv # Array of JSON Objects header = ['instance','p','distance', 'mean'] length_p = 3 length_instances = 2 with open('qaoa_multiple_p_distance.csv', 'w', encoding='UTF8') as f: writer = csv.writer(f) # write the header writer.writerow(header) instance_index = 0 for instance in range(length_instances): instance_index += 1 first_p = False UNIFORM_CONVERGENCE_P = [] UNIFORM_CONVERGENCE_SAMPLE = [] for p in range(length_p): p = p+1 if first_p == False: print("Vuelve a llamar a test_solution") job_2, G, UNIFORM_CONVERGENCE_SAMPLE = test_solution(p=p) first_p = True else: job_2, G, UNIFORM_CONVERGENCE_SAMPLE = test_solution(grafo=G, p=p) # Sort the JSON data based on the value of the brand key UNIFORM_CONVERGENCE_SAMPLE.sort(key=lambda x: x["mean"]) convergence_min = UNIFORM_CONVERGENCE_SAMPLE[0] UNIFORM_CONVERGENCE_P.append({ "mean":convergence_min["mean"], "probabilities": convergence_min["probabilities"] }) cauchy_function_nk = UNIFORM_CONVERGENCE_P[len(UNIFORM_CONVERGENCE_P) - 1] p_index = 0 for p_state in UNIFORM_CONVERGENCE_P: p_index += 1 print(p_index) mean = p_state["mean"] print(p_state) print(mean) distance_p_cauchy_function_nk = np.max(np.abs(cauchy_function_nk["probabilities"] - p_state["probabilities"])) writer.writerow([instance_index, p_index, distance_p_cauchy_function_nk, mean])
https://github.com/shesha-raghunathan/DATE2019-qiskit-tutorial
shesha-raghunathan
from qiskit import ClassicalRegister, QuantumRegister from qiskit import QuantumCircuit, execute from qiskit.tools.visualization import plot_histogram # set up registers and program qr = QuantumRegister(16) cr = ClassicalRegister(16) qc = QuantumCircuit(qr, cr) # rightmost eight (qu)bits have ')' = 00101001 qc.x(qr[0]) qc.x(qr[3]) qc.x(qr[5]) # second eight (qu)bits have superposition of # '8' = 00111000 # ';' = 00111011 # these differ only on the rightmost two bits qc.h(qr[9]) # create superposition on 9 qc.cx(qr[9],qr[8]) # spread it to 8 with a CNOT qc.x(qr[11]) qc.x(qr[12]) qc.x(qr[13]) # measure for j in range(16): qc.measure(qr[j], cr[j]) from qiskit import register, available_backends, get_backend #import Qconfig and set APIToken and API url try: import sys sys.path.append("../") # go to parent dir import Qconfig qx_config = { "APItoken": Qconfig.APItoken, "url": Qconfig.config['url']} except Exception as e: print(e) qx_config = { "APItoken":"YOUR_TOKEN_HERE", "url":"https://quantumexperience.ng.bluemix.net/api"} #set api register(qx_config['APItoken'], qx_config['url']) backend = "ibmq_qasm_simulator" shots_sim = 128 job_sim = execute(qc, backend, shots=shots_sim) stats_sim = job_sim.result().get_counts() plot_histogram(stats_sim) import matplotlib.pyplot as plt %matplotlib inline plt.rc('font', family='monospace') def plot_smiley (stats, shots): for bitString in stats: char = chr(int( bitString[0:8] ,2)) # get string of the leftmost 8 bits and convert to an ASCII character char += chr(int( bitString[8:16] ,2)) # do the same for string of rightmost 8 bits, and add it to the previous character prob = stats[bitString] / shots # fraction of shots for which this result occurred # create plot with all characters on top of each other with alpha given by how often it turned up in the output plt.annotate( char, (0.5,0.5), va="center", ha="center", color = (0,0,0, prob ), size = 300) if (prob>0.05): # list prob and char for the dominant results (occurred for more than 5% of shots) print(str(prob)+"\t"+char) plt.axis('off') plt.show() plot_smiley(stats_sim, shots_sim) backends = available_backends() backend = get_backend('ibmqx5') print('Status of ibmqx5:',backend.status) if backend.status["operational"] is True: print("\nThe device is operational, so we'll submit the job.") shots_device = 1000 job_device = execute(qc, backend, shots=shots_device) stats_device = job_device.result().get_counts() else: print("\nThe device is not operational. Try again later.") plot_smiley(stats_device, shots_device)
https://github.com/BOBO1997/osp_solutions
BOBO1997
import numpy as np import matplotlib.pyplot as plt from pprint import pprint import pickle import time import datetime # Import qubit states Zero (|0>) and One (|1>), and Pauli operators (X, Y, Z) from qiskit.opflow import Zero, One from qiskit import QuantumCircuit, QuantumRegister, IBMQ, execute, transpile, Aer from qiskit.tools.monitor import job_monitor from qiskit.circuit import Parameter from qiskit.transpiler.passes import RemoveBarriers # Import QREM package from qiskit.ignis.mitigation.measurement import complete_meas_cal, CompleteMeasFitter from qiskit.ignis.mitigation import expectation_value # Import mitiq for zne # unused for this file import mitiq # Import state tomography modules from qiskit.ignis.verification.tomography import state_tomography_circuits, StateTomographyFitter from qiskit.quantum_info import state_fidelity import sys import importlib sys.path.append("../../solutions/utils/") import circuit_utils, zne_utils, tomography_utils importlib.reload(circuit_utils) importlib.reload(zne_utils) # unused for this file importlib.reload(tomography_utils) # unused for this file from circuit_utils import * from zne_utils import zne_wrapper, zne_decoder from tomography_utils import expvals_to_valid_rho from qiskit.test.mock import FakeJakarta backend = FakeJakarta() # backend = Aer.get_backend("qasm_simulator") num_qubits = 3 # The final time of the state evolution target_time = np.pi # Parameterize variable t to be evaluated at t=pi later dt = Parameter('t') # Convert custom quantum circuit into a gate trot_gate = trotter_gate(dt) # initial layout initial_layout = [5,3,1] # Number of trotter steps num_steps_list = [1,2,3,4,5,6,7,8,9,10,20,30,40,50,60,70,80,90,100] print("trotter step list: ", num_steps_list) scale_factors = [1.0, 2.0, 3.0] # unused for this file shots = 1 << 13 reps = 8 # unused target_state = (One^One^Zero).to_matrix() # DO NOT CHANGE!!! # QREM qr = QuantumRegister(num_qubits, name="calq") meas_calibs, state_labels = complete_meas_cal(qr=qr, circlabel='mcal') # we have to feed initial_layout to calibration matrix cal_job = execute(meas_calibs, backend=backend, shots=shots, optimization_level=3, initial_layout = initial_layout) print('Job ID', cal_job.job_id()) retrieved_cal_job = cal_job cal_results = retrieved_cal_job.result() meas_fitter = CompleteMeasFitter(cal_results, state_labels, circlabel='mcal') zne_fid_list = [] zne_stddev_list = [] for num_steps in num_steps_list: print("trotter steps: ", num_steps) t1 = time.perf_counter() # Initialize quantum circuit for 3 qubits qr = QuantumRegister(num_qubits, name="q") qc = QuantumCircuit(qr) # Prepare initial state (remember we are only evolving 3 of the 7 qubits on jakarta qubits (q_5, q_3, q_1) corresponding to the state |110>) make_initial_state(qc, "110") # DO NOT MODIFY (|q_5,q_3,q_1> = |110>) subspace_encoder_init110(qc, targets=[0, 1, 2]) # encode trotterize(qc, trot_gate, num_steps, targets=[1, 2]) # Simulate time evolution under H_heis3 Hamiltonian subspace_decoder(qc, targets=[0, 1, 2]) # decode # Evaluate simulation at target_time (t=pi) meaning each trotter step evolves pi/trotter_steps in time qc = qc.bind_parameters({dt: target_time / num_steps}) print("created qc") # Generate state tomography circuits to evaluate fidelity of simulation st_qcs = state_tomography_circuits(qc, [0, 1, 2][::-1]) #! state tomography requires === BIG ENDIAN === print("created st_qcs (length:", len(st_qcs), ")") # remove barriers st_qcs = [RemoveBarriers()(qc) for qc in st_qcs] print("removed barriers from st_qcs") # optimize circuit t3_st_qcs = transpile(st_qcs, optimization_level=3, basis_gates=["sx", "cx", "rz"]) t3_st_qcs = transpile(t3_st_qcs, optimization_level=3, basis_gates=["sx", "cx", "rz"]) print("created t3_st_qcs (length:", len(t3_st_qcs), ")") # zne wrapping zne_qcs = t3_st_qcs zne_qcs = zne_wrapper(t3_st_qcs, scale_factors = scale_factors, pt = False) print("created zne_qcs (length:", len(zne_qcs), ")") # optimization_level must be 0 # feed initial_layout here to see the picture of the circuits before casting the job t3_zne_qcs = transpile(zne_qcs, optimization_level=0, basis_gates=["sx", "cx", "rz"], initial_layout=initial_layout) print("created t3_zne_qcs (length:", len(t3_zne_qcs), ")") jobs = [] for _ in range(reps): #! CHECK: run t3_zne_qcs, with optimization_level = 0 and straightforward initial_layout job = execute(t3_zne_qcs, backend, shots=shots, optimization_level=0) print('Job ID', job.job_id()) jobs.append(job) retrieved_jobs = jobs zne_fids = [] for job in retrieved_jobs: raw_results = job.result() mit_results = meas_fitter.filter.apply(raw_results) zne_expvals = zne_decoder(num_qubits, mit_results, scale_factors = scale_factors) zne_rho = expvals_to_valid_rho(num_qubits, zne_expvals) zne_fid = state_fidelity(zne_rho, target_state) zne_fids.append(zne_fid) zne_fid_list.append(np.mean(zne_fids)) zne_stddev_list.append(np.std(zne_fids)) t2 = time.perf_counter() print('zne state tomography fidelity = {:.4f} \u00B1 {:.4f}'.format(np.mean(zne_fids), np.std(zne_fids))) print("time:", t2 - t1) print() with open("e2d1_zne.pkl", "wb") as f: pickle.dump({"num_steps_list": num_steps_list, "fid": zne_fid_list, "stddev": zne_stddev_list}, f) import qiskit.tools.jupyter %qiskit_version_table plt.plot(num_steps_list, zne_fid_list)
https://github.com/qiskit-community/qiskit-translations-staging
qiskit-community
from qiskit import QuantumCircuit from qiskit.quantum_info import Statevector from qiskit.visualization import plot_state_city qc = QuantumCircuit(2) qc.h(0) qc.cx(0,1) # plot using a Statevector state = Statevector(qc) plot_state_city(state)
https://github.com/swe-train/qiskit__qiskit
swe-train
# This code is part of Qiskit. # # (C) Copyright IBM 2019. # # This code is licensed under the Apache License, Version 2.0. You may # obtain a copy of this license in the LICENSE.txt file in the root directory # of this source tree or at http://www.apache.org/licenses/LICENSE-2.0. # # Any modifications or derivative works of this code must retain this # copyright notice, and modified files need to carry a notice indicating # that they have been altered from the originals. """Test cases for the pulse Schedule transforms.""" import unittest from typing import List, Set import numpy as np from qiskit import pulse from qiskit.pulse import ( Play, Delay, Acquire, Schedule, Waveform, Drag, Gaussian, GaussianSquare, Constant, ) from qiskit.pulse import transforms, instructions from qiskit.pulse.channels import ( MemorySlot, DriveChannel, AcquireChannel, RegisterSlot, SnapshotChannel, ) from qiskit.pulse.instructions import directives from qiskit.test import QiskitTestCase from qiskit.providers.fake_provider import FakeOpenPulse2Q class TestAlignMeasures(QiskitTestCase): """Test the helper function which aligns acquires.""" def setUp(self): super().setUp() self.backend = FakeOpenPulse2Q() self.config = self.backend.configuration() self.inst_map = self.backend.defaults().instruction_schedule_map self.short_pulse = pulse.Waveform( samples=np.array([0.02739068], dtype=np.complex128), name="p0" ) def test_align_measures(self): """Test that one acquire is delayed to match the time of the later acquire.""" sched = pulse.Schedule(name="fake_experiment") sched.insert(0, Play(self.short_pulse, self.config.drive(0)), inplace=True) sched.insert(1, Acquire(5, self.config.acquire(0), MemorySlot(0)), inplace=True) sched.insert(10, Acquire(5, self.config.acquire(1), MemorySlot(1)), inplace=True) sched.insert(10, Play(self.short_pulse, self.config.measure(0)), inplace=True) sched.insert(11, Play(self.short_pulse, self.config.measure(0)), inplace=True) sched.insert(10, Play(self.short_pulse, self.config.measure(1)), inplace=True) aligned = transforms.align_measures([sched])[0] self.assertEqual(aligned.name, "fake_experiment") ref = pulse.Schedule(name="fake_experiment") ref.insert(0, Play(self.short_pulse, self.config.drive(0)), inplace=True) ref.insert(10, Acquire(5, self.config.acquire(0), MemorySlot(0)), inplace=True) ref.insert(10, Acquire(5, self.config.acquire(1), MemorySlot(1)), inplace=True) ref.insert(19, Play(self.short_pulse, self.config.measure(0)), inplace=True) ref.insert(20, Play(self.short_pulse, self.config.measure(0)), inplace=True) ref.insert(10, Play(self.short_pulse, self.config.measure(1)), inplace=True) self.assertEqual(aligned, ref) aligned = transforms.align_measures([sched], self.inst_map, align_time=20)[0] ref = pulse.Schedule(name="fake_experiment") ref.insert(10, Play(self.short_pulse, self.config.drive(0)), inplace=True) ref.insert(20, Acquire(5, self.config.acquire(0), MemorySlot(0)), inplace=True) ref.insert(20, Acquire(5, self.config.acquire(1), MemorySlot(1)), inplace=True) ref.insert(29, Play(self.short_pulse, self.config.measure(0)), inplace=True) ref.insert(30, Play(self.short_pulse, self.config.measure(0)), inplace=True) ref.insert(20, Play(self.short_pulse, self.config.measure(1)), inplace=True) self.assertEqual(aligned, ref) def test_align_post_u3(self): """Test that acquires are scheduled no sooner than the duration of the longest X gate.""" sched = pulse.Schedule(name="fake_experiment") sched = sched.insert(0, Play(self.short_pulse, self.config.drive(0))) sched = sched.insert(1, Acquire(5, self.config.acquire(0), MemorySlot(0))) sched = transforms.align_measures([sched], self.inst_map)[0] for time, inst in sched.instructions: if isinstance(inst, Acquire): self.assertEqual(time, 4) sched = transforms.align_measures([sched], self.inst_map, max_calibration_duration=10)[0] for time, inst in sched.instructions: if isinstance(inst, Acquire): self.assertEqual(time, 10) def test_multi_acquire(self): """Test that the last acquire is aligned to if multiple acquires occur on the same channel.""" sched = pulse.Schedule() sched.insert(0, Play(self.short_pulse, self.config.drive(0)), inplace=True) sched.insert(4, Acquire(5, self.config.acquire(0), MemorySlot(0)), inplace=True) sched.insert(20, Acquire(5, self.config.acquire(1), MemorySlot(1)), inplace=True) sched.insert(10, Acquire(5, self.config.acquire(0), MemorySlot(0)), inplace=True) aligned = transforms.align_measures([sched], self.inst_map) ref = pulse.Schedule() ref.insert(0, Play(self.short_pulse, self.config.drive(0)), inplace=True) ref.insert(20, Acquire(5, self.config.acquire(0), MemorySlot(0)), inplace=True) ref.insert(20, Acquire(5, self.config.acquire(1), MemorySlot(1)), inplace=True) ref.insert(26, Acquire(5, self.config.acquire(0), MemorySlot(0)), inplace=True) self.assertEqual(aligned[0], ref) def test_multiple_acquires(self): """Test that multiple acquires are also aligned.""" sched = pulse.Schedule(name="fake_experiment") sched.insert(0, Acquire(5, self.config.acquire(0), MemorySlot(0)), inplace=True) sched.insert(5, Acquire(5, self.config.acquire(0), MemorySlot(0)), inplace=True) sched.insert(10, Acquire(5, self.config.acquire(1), MemorySlot(1)), inplace=True) ref = pulse.Schedule() ref.insert(10, Acquire(5, self.config.acquire(0), MemorySlot(0)), inplace=True) ref.insert(15, Acquire(5, self.config.acquire(0), MemorySlot(0)), inplace=True) ref.insert(10, Acquire(5, self.config.acquire(1), MemorySlot(1)), inplace=True) aligned = transforms.align_measures([sched], self.inst_map)[0] self.assertEqual(aligned, ref) def test_align_across_schedules(self): """Test that acquires are aligned together across multiple schedules.""" sched1 = pulse.Schedule(name="fake_experiment") sched1 = sched1.insert(0, Play(self.short_pulse, self.config.drive(0))) sched1 = sched1.insert(10, Acquire(5, self.config.acquire(0), MemorySlot(0))) sched2 = pulse.Schedule(name="fake_experiment") sched2 = sched2.insert(3, Play(self.short_pulse, self.config.drive(0))) sched2 = sched2.insert(25, Acquire(5, self.config.acquire(0), MemorySlot(0))) schedules = transforms.align_measures([sched1, sched2], self.inst_map) for time, inst in schedules[0].instructions: if isinstance(inst, Acquire): self.assertEqual(time, 25) for time, inst in schedules[0].instructions: if isinstance(inst, Acquire): self.assertEqual(time, 25) def test_align_all(self): """Test alignment of all instructions in a schedule.""" sched0 = pulse.Schedule() sched0.insert(0, Play(self.short_pulse, self.config.drive(0)), inplace=True) sched0.insert(10, Acquire(5, self.config.acquire(0), MemorySlot(0)), inplace=True) sched1 = pulse.Schedule() sched1.insert(25, Play(self.short_pulse, self.config.drive(0)), inplace=True) sched1.insert(25, Acquire(5, self.config.acquire(0), MemorySlot(0)), inplace=True) all_aligned = transforms.align_measures([sched0, sched1], self.inst_map, align_all=True) ref1_aligned = pulse.Schedule() ref1_aligned.insert(15, Play(self.short_pulse, self.config.drive(0)), inplace=True) ref1_aligned.insert(25, Acquire(5, self.config.acquire(0), MemorySlot(0)), inplace=True) self.assertEqual(all_aligned[0], ref1_aligned) self.assertEqual(all_aligned[1], sched1) ref1_not_aligned = pulse.Schedule() ref1_not_aligned.insert(0, Play(self.short_pulse, self.config.drive(0)), inplace=True) ref1_not_aligned.insert(25, Acquire(5, self.config.acquire(0), MemorySlot(0)), inplace=True) all_not_aligned = transforms.align_measures( [sched0, sched1], self.inst_map, align_all=False, ) self.assertEqual(all_not_aligned[0], ref1_not_aligned) self.assertEqual(all_not_aligned[1], sched1) def test_measurement_at_zero(self): """Test that acquire at t=0 works.""" sched1 = pulse.Schedule(name="fake_experiment") sched1 = sched1.insert(0, Play(self.short_pulse, self.config.drive(0))) sched1 = sched1.insert(0, Acquire(5, self.config.acquire(0), MemorySlot(0))) sched2 = pulse.Schedule(name="fake_experiment") sched2 = sched2.insert(0, Play(self.short_pulse, self.config.drive(0))) sched2 = sched2.insert(0, Acquire(5, self.config.acquire(0), MemorySlot(0))) schedules = transforms.align_measures([sched1, sched2], max_calibration_duration=0) for time, inst in schedules[0].instructions: if isinstance(inst, Acquire): self.assertEqual(time, 0) for time, inst in schedules[0].instructions: if isinstance(inst, Acquire): self.assertEqual(time, 0) class TestAddImplicitAcquires(QiskitTestCase): """Test the helper function which makes implicit acquires explicit.""" def setUp(self): super().setUp() self.backend = FakeOpenPulse2Q() self.config = self.backend.configuration() self.short_pulse = pulse.Waveform( samples=np.array([0.02739068], dtype=np.complex128), name="p0" ) sched = pulse.Schedule(name="fake_experiment") sched = sched.insert(0, Play(self.short_pulse, self.config.drive(0))) sched = sched.insert(5, Acquire(5, self.config.acquire(0), MemorySlot(0))) sched = sched.insert(5, Acquire(5, self.config.acquire(1), MemorySlot(1))) self.sched = sched def test_add_implicit(self): """Test that implicit acquires are made explicit according to the meas map.""" sched = transforms.add_implicit_acquires(self.sched, [[0, 1]]) acquired_qubits = set() for _, inst in sched.instructions: if isinstance(inst, Acquire): acquired_qubits.add(inst.acquire.index) self.assertEqual(acquired_qubits, {0, 1}) def test_add_across_meas_map_sublists(self): """Test that implicit acquires in separate meas map sublists are all added.""" sched = transforms.add_implicit_acquires(self.sched, [[0, 2], [1, 3]]) acquired_qubits = set() for _, inst in sched.instructions: if isinstance(inst, Acquire): acquired_qubits.add(inst.acquire.index) self.assertEqual(acquired_qubits, {0, 1, 2, 3}) def test_dont_add_all(self): """Test that acquires aren't added if no qubits in the sublist aren't being acquired.""" sched = transforms.add_implicit_acquires(self.sched, [[4, 5], [0, 2], [1, 3]]) acquired_qubits = set() for _, inst in sched.instructions: if isinstance(inst, Acquire): acquired_qubits.add(inst.acquire.index) self.assertEqual(acquired_qubits, {0, 1, 2, 3}) def test_multiple_acquires(self): """Test for multiple acquires.""" sched = pulse.Schedule() acq_q0 = pulse.Acquire(1200, AcquireChannel(0), MemorySlot(0)) sched += acq_q0 sched += acq_q0 << sched.duration sched = transforms.add_implicit_acquires(sched, meas_map=[[0]]) self.assertEqual(sched.instructions, ((0, acq_q0), (2400, acq_q0))) class TestPad(QiskitTestCase): """Test padding of schedule with delays.""" def test_padding_empty_schedule(self): """Test padding of empty schedule.""" self.assertEqual(pulse.Schedule(), transforms.pad(pulse.Schedule())) def test_padding_schedule(self): """Test padding schedule.""" delay = 10 sched = ( Delay(delay, DriveChannel(0)).shift(10) + Delay(delay, DriveChannel(0)).shift(10) + Delay(delay, DriveChannel(1)).shift(10) ) ref_sched = ( sched # pylint: disable=unsupported-binary-operation | Delay(delay, DriveChannel(0)) | Delay(delay, DriveChannel(0)).shift(20) | Delay(delay, DriveChannel(1)) | Delay( # pylint: disable=unsupported-binary-operation 2 * delay, DriveChannel(1) ).shift(20) ) self.assertEqual(transforms.pad(sched), ref_sched) def test_padding_schedule_inverse_order(self): """Test padding schedule is insensitive to order in which commands were added. This test is the same as `test_adding_schedule` but the order by channel in which commands were added to the schedule to be padded has been reversed. """ delay = 10 sched = ( Delay(delay, DriveChannel(1)).shift(10) + Delay(delay, DriveChannel(0)).shift(10) + Delay(delay, DriveChannel(0)).shift(10) ) ref_sched = ( sched # pylint: disable=unsupported-binary-operation | Delay(delay, DriveChannel(0)) | Delay(delay, DriveChannel(0)).shift(20) | Delay(delay, DriveChannel(1)) | Delay( # pylint: disable=unsupported-binary-operation 2 * delay, DriveChannel(1) ).shift(20) ) self.assertEqual(transforms.pad(sched), ref_sched) def test_padding_until_less(self): """Test padding until time that is less than schedule duration.""" delay = 10 sched = Delay(delay, DriveChannel(0)).shift(10) + Delay(delay, DriveChannel(1)) ref_sched = sched | Delay(delay, DriveChannel(0)) | Delay(5, DriveChannel(1)).shift(10) self.assertEqual(transforms.pad(sched, until=15), ref_sched) def test_padding_until_greater(self): """Test padding until time that is greater than schedule duration.""" delay = 10 sched = Delay(delay, DriveChannel(0)).shift(10) + Delay(delay, DriveChannel(1)) ref_sched = ( sched # pylint: disable=unsupported-binary-operation | Delay(delay, DriveChannel(0)) | Delay(30, DriveChannel(0)).shift(20) | Delay(40, DriveChannel(1)).shift(10) # pylint: disable=unsupported-binary-operation ) self.assertEqual(transforms.pad(sched, until=50), ref_sched) def test_padding_supplied_channels(self): """Test padding of only specified channels.""" delay = 10 sched = Delay(delay, DriveChannel(0)).shift(10) + Delay(delay, DriveChannel(1)) ref_sched = sched | Delay(delay, DriveChannel(0)) | Delay(2 * delay, DriveChannel(2)) channels = [DriveChannel(0), DriveChannel(2)] self.assertEqual(transforms.pad(sched, channels=channels), ref_sched) def test_padding_less_than_sched_duration(self): """Test that the until arg is respected even for less than the input schedule duration.""" delay = 10 sched = Delay(delay, DriveChannel(0)) + Delay(delay, DriveChannel(0)).shift(20) ref_sched = sched | pulse.Delay(5, DriveChannel(0)).shift(10) self.assertEqual(transforms.pad(sched, until=15), ref_sched) def test_padding_prepended_delay(self): """Test that there is delay before the first instruction.""" delay = 10 sched = Delay(delay, DriveChannel(0)).shift(10) + Delay(delay, DriveChannel(0)) ref_sched = ( Delay(delay, DriveChannel(0)) + Delay(delay, DriveChannel(0)) + Delay(delay, DriveChannel(0)) ) self.assertEqual(transforms.pad(sched, until=30, inplace=True), ref_sched) def test_pad_no_delay_on_classical_io_channels(self): """Test padding does not apply to classical IO channels.""" delay = 10 sched = ( Delay(delay, MemorySlot(0)).shift(20) + Delay(delay, RegisterSlot(0)).shift(10) + Delay(delay, SnapshotChannel()) ) ref_sched = ( Delay(delay, MemorySlot(0)).shift(20) + Delay(delay, RegisterSlot(0)).shift(10) + Delay(delay, SnapshotChannel()) ) self.assertEqual(transforms.pad(sched, until=15), ref_sched) def get_pulse_ids(schedules: List[Schedule]) -> Set[int]: """Returns ids of pulses used in Schedules.""" ids = set() for schedule in schedules: for _, inst in schedule.instructions: ids.add(inst.pulse.id) return ids class TestCompressTransform(QiskitTestCase): """Compress function test.""" def test_with_duplicates(self): """Test compression of schedule.""" schedule = Schedule() drive_channel = DriveChannel(0) schedule += Play(Waveform([0.0, 0.1]), drive_channel) schedule += Play(Waveform([0.0, 0.1]), drive_channel) compressed_schedule = transforms.compress_pulses([schedule]) original_pulse_ids = get_pulse_ids([schedule]) compressed_pulse_ids = get_pulse_ids(compressed_schedule) self.assertEqual(len(compressed_pulse_ids), 1) self.assertEqual(len(original_pulse_ids), 2) self.assertTrue(next(iter(compressed_pulse_ids)) in original_pulse_ids) def test_sample_pulse_with_clipping(self): """Test sample pulses with clipping.""" schedule = Schedule() drive_channel = DriveChannel(0) schedule += Play(Waveform([0.0, 1.0]), drive_channel) schedule += Play(Waveform([0.0, 1.001], epsilon=1e-3), drive_channel) schedule += Play(Waveform([0.0, 1.0000000001]), drive_channel) compressed_schedule = transforms.compress_pulses([schedule]) original_pulse_ids = get_pulse_ids([schedule]) compressed_pulse_ids = get_pulse_ids(compressed_schedule) self.assertEqual(len(compressed_pulse_ids), 1) self.assertEqual(len(original_pulse_ids), 3) self.assertTrue(next(iter(compressed_pulse_ids)) in original_pulse_ids) def test_no_duplicates(self): """Test with no pulse duplicates.""" schedule = Schedule() drive_channel = DriveChannel(0) schedule += Play(Waveform([0.0, 1.0]), drive_channel) schedule += Play(Waveform([0.0, 0.9]), drive_channel) schedule += Play(Waveform([0.0, 0.3]), drive_channel) compressed_schedule = transforms.compress_pulses([schedule]) original_pulse_ids = get_pulse_ids([schedule]) compressed_pulse_ids = get_pulse_ids(compressed_schedule) self.assertEqual(len(original_pulse_ids), len(compressed_pulse_ids)) def test_parametric_pulses_with_duplicates(self): """Test with parametric pulses.""" schedule = Schedule() drive_channel = DriveChannel(0) schedule += Play(Gaussian(duration=25, sigma=4, amp=0.5, angle=np.pi / 2), drive_channel) schedule += Play(Gaussian(duration=25, sigma=4, amp=0.5, angle=np.pi / 2), drive_channel) schedule += Play(GaussianSquare(duration=150, amp=0.2, sigma=8, width=140), drive_channel) schedule += Play(GaussianSquare(duration=150, amp=0.2, sigma=8, width=140), drive_channel) schedule += Play(Constant(duration=150, amp=0.5, angle=0.7), drive_channel) schedule += Play(Constant(duration=150, amp=0.5, angle=0.7), drive_channel) schedule += Play(Drag(duration=25, amp=0.4, angle=-0.3, sigma=7.8, beta=4), drive_channel) schedule += Play(Drag(duration=25, amp=0.4, angle=-0.3, sigma=7.8, beta=4), drive_channel) compressed_schedule = transforms.compress_pulses([schedule]) original_pulse_ids = get_pulse_ids([schedule]) compressed_pulse_ids = get_pulse_ids(compressed_schedule) self.assertEqual(len(original_pulse_ids), 8) self.assertEqual(len(compressed_pulse_ids), 4) def test_parametric_pulses_with_no_duplicates(self): """Test parametric pulses with no duplicates.""" schedule = Schedule() drive_channel = DriveChannel(0) schedule += Play(Gaussian(duration=25, sigma=4, amp=0.5, angle=np.pi / 2), drive_channel) schedule += Play(Gaussian(duration=25, sigma=4, amp=0.49, angle=np.pi / 2), drive_channel) schedule += Play(GaussianSquare(duration=150, amp=0.2, sigma=8, width=140), drive_channel) schedule += Play(GaussianSquare(duration=150, amp=0.19, sigma=8, width=140), drive_channel) schedule += Play(Constant(duration=150, amp=0.5, angle=0.3), drive_channel) schedule += Play(Constant(duration=150, amp=0.51, angle=0.3), drive_channel) schedule += Play(Drag(duration=25, amp=0.5, angle=0.5, sigma=7.8, beta=4), drive_channel) schedule += Play(Drag(duration=25, amp=0.5, angle=0.51, sigma=7.8, beta=4), drive_channel) compressed_schedule = transforms.compress_pulses([schedule]) original_pulse_ids = get_pulse_ids([schedule]) compressed_pulse_ids = get_pulse_ids(compressed_schedule) self.assertEqual(len(original_pulse_ids), len(compressed_pulse_ids)) def test_with_different_channels(self): """Test with different channels.""" schedule = Schedule() schedule += Play(Waveform([0.0, 0.1]), DriveChannel(0)) schedule += Play(Waveform([0.0, 0.1]), DriveChannel(1)) compressed_schedule = transforms.compress_pulses([schedule]) original_pulse_ids = get_pulse_ids([schedule]) compressed_pulse_ids = get_pulse_ids(compressed_schedule) self.assertEqual(len(original_pulse_ids), 2) self.assertEqual(len(compressed_pulse_ids), 1) def test_sample_pulses_with_tolerance(self): """Test sample pulses with tolerance.""" schedule = Schedule() schedule += Play(Waveform([0.0, 0.1001], epsilon=1e-3), DriveChannel(0)) schedule += Play(Waveform([0.0, 0.1], epsilon=1e-3), DriveChannel(1)) compressed_schedule = transforms.compress_pulses([schedule]) original_pulse_ids = get_pulse_ids([schedule]) compressed_pulse_ids = get_pulse_ids(compressed_schedule) self.assertEqual(len(original_pulse_ids), 2) self.assertEqual(len(compressed_pulse_ids), 1) def test_multiple_schedules(self): """Test multiple schedules.""" schedules = [] for _ in range(2): schedule = Schedule() drive_channel = DriveChannel(0) schedule += Play(Waveform([0.0, 0.1]), drive_channel) schedule += Play(Waveform([0.0, 0.1]), drive_channel) schedule += Play(Waveform([0.0, 0.2]), drive_channel) schedules.append(schedule) compressed_schedule = transforms.compress_pulses(schedules) original_pulse_ids = get_pulse_ids(schedules) compressed_pulse_ids = get_pulse_ids(compressed_schedule) self.assertEqual(len(original_pulse_ids), 6) self.assertEqual(len(compressed_pulse_ids), 2) class TestAlignSequential(QiskitTestCase): """Test sequential alignment transform.""" def test_align_sequential(self): """Test sequential alignment without a barrier.""" context = transforms.AlignSequential() d0 = pulse.DriveChannel(0) d1 = pulse.DriveChannel(1) schedule = pulse.Schedule() schedule.insert(1, instructions.Delay(3, d0), inplace=True) schedule.insert(4, instructions.Delay(5, d1), inplace=True) schedule.insert(12, instructions.Delay(7, d0), inplace=True) schedule = context.align(schedule) reference = pulse.Schedule() # d0 reference.insert(0, instructions.Delay(3, d0), inplace=True) reference.insert(8, instructions.Delay(7, d0), inplace=True) # d1 reference.insert(3, instructions.Delay(5, d1), inplace=True) self.assertEqual(schedule, reference) def test_align_sequential_with_barrier(self): """Test sequential alignment with a barrier.""" context = transforms.AlignSequential() d0 = pulse.DriveChannel(0) d1 = pulse.DriveChannel(1) schedule = pulse.Schedule() schedule.insert(1, instructions.Delay(3, d0), inplace=True) schedule.append(directives.RelativeBarrier(d0, d1), inplace=True) schedule.insert(4, instructions.Delay(5, d1), inplace=True) schedule.insert(12, instructions.Delay(7, d0), inplace=True) schedule = context.align(schedule) reference = pulse.Schedule() reference.insert(0, instructions.Delay(3, d0), inplace=True) reference.insert(3, directives.RelativeBarrier(d0, d1), inplace=True) reference.insert(3, instructions.Delay(5, d1), inplace=True) reference.insert(8, instructions.Delay(7, d0), inplace=True) self.assertEqual(schedule, reference) class TestAlignLeft(QiskitTestCase): """Test left alignment transform.""" def test_align_left(self): """Test left alignment without a barrier.""" context = transforms.AlignLeft() d0 = pulse.DriveChannel(0) d1 = pulse.DriveChannel(1) d2 = pulse.DriveChannel(2) schedule = pulse.Schedule() schedule.insert(1, instructions.Delay(3, d0), inplace=True) schedule.insert(17, instructions.Delay(11, d2), inplace=True) sched_grouped = pulse.Schedule() sched_grouped += instructions.Delay(5, d1) sched_grouped += instructions.Delay(7, d0) schedule.append(sched_grouped, inplace=True) schedule = context.align(schedule) reference = pulse.Schedule() # d0 reference.insert(0, instructions.Delay(3, d0), inplace=True) reference.insert(3, instructions.Delay(7, d0), inplace=True) # d1 reference.insert(3, instructions.Delay(5, d1), inplace=True) # d2 reference.insert(0, instructions.Delay(11, d2), inplace=True) self.assertEqual(schedule, reference) def test_align_left_with_barrier(self): """Test left alignment with a barrier.""" context = transforms.AlignLeft() d0 = pulse.DriveChannel(0) d1 = pulse.DriveChannel(1) d2 = pulse.DriveChannel(2) schedule = pulse.Schedule() schedule.insert(1, instructions.Delay(3, d0), inplace=True) schedule.append(directives.RelativeBarrier(d0, d1, d2), inplace=True) schedule.insert(17, instructions.Delay(11, d2), inplace=True) sched_grouped = pulse.Schedule() sched_grouped += instructions.Delay(5, d1) sched_grouped += instructions.Delay(7, d0) schedule.append(sched_grouped, inplace=True) schedule = transforms.remove_directives(context.align(schedule)) reference = pulse.Schedule() # d0 reference.insert(0, instructions.Delay(3, d0), inplace=True) reference.insert(3, instructions.Delay(7, d0), inplace=True) # d1 reference = reference.insert(3, instructions.Delay(5, d1)) # d2 reference = reference.insert(3, instructions.Delay(11, d2)) self.assertEqual(schedule, reference) class TestAlignRight(QiskitTestCase): """Test right alignment transform.""" def test_align_right(self): """Test right alignment without a barrier.""" context = transforms.AlignRight() d0 = pulse.DriveChannel(0) d1 = pulse.DriveChannel(1) d2 = pulse.DriveChannel(2) schedule = pulse.Schedule() schedule.insert(1, instructions.Delay(3, d0), inplace=True) schedule.insert(17, instructions.Delay(11, d2), inplace=True) sched_grouped = pulse.Schedule() sched_grouped.insert(2, instructions.Delay(5, d1), inplace=True) sched_grouped += instructions.Delay(7, d0) schedule.append(sched_grouped, inplace=True) schedule = context.align(schedule) reference = pulse.Schedule() # d0 reference.insert(1, instructions.Delay(3, d0), inplace=True) reference.insert(4, instructions.Delay(7, d0), inplace=True) # d1 reference.insert(6, instructions.Delay(5, d1), inplace=True) # d2 reference.insert(0, instructions.Delay(11, d2), inplace=True) self.assertEqual(schedule, reference) def test_align_right_with_barrier(self): """Test right alignment with a barrier.""" context = transforms.AlignRight() d0 = pulse.DriveChannel(0) d1 = pulse.DriveChannel(1) d2 = pulse.DriveChannel(2) schedule = pulse.Schedule() schedule.insert(1, instructions.Delay(3, d0), inplace=True) schedule.append(directives.RelativeBarrier(d0, d1, d2), inplace=True) schedule.insert(17, instructions.Delay(11, d2), inplace=True) sched_grouped = pulse.Schedule() sched_grouped.insert(2, instructions.Delay(5, d1), inplace=True) sched_grouped += instructions.Delay(7, d0) schedule.append(sched_grouped, inplace=True) schedule = transforms.remove_directives(context.align(schedule)) reference = pulse.Schedule() # d0 reference.insert(0, instructions.Delay(3, d0), inplace=True) reference.insert(7, instructions.Delay(7, d0), inplace=True) # d1 reference.insert(9, instructions.Delay(5, d1), inplace=True) # d2 reference.insert(3, instructions.Delay(11, d2), inplace=True) self.assertEqual(schedule, reference) class TestAlignEquispaced(QiskitTestCase): """Test equispaced alignment transform.""" def test_equispaced_with_short_duration(self): """Test equispaced context with duration shorter than the schedule duration.""" context = transforms.AlignEquispaced(duration=20) d0 = pulse.DriveChannel(0) schedule = pulse.Schedule() for _ in range(3): schedule.append(Delay(10, d0), inplace=True) schedule = context.align(schedule) reference = pulse.Schedule() reference.insert(0, Delay(10, d0), inplace=True) reference.insert(10, Delay(10, d0), inplace=True) reference.insert(20, Delay(10, d0), inplace=True) self.assertEqual(schedule, reference) def test_equispaced_with_longer_duration(self): """Test equispaced context with duration longer than the schedule duration.""" context = transforms.AlignEquispaced(duration=50) d0 = pulse.DriveChannel(0) schedule = pulse.Schedule() for _ in range(3): schedule.append(Delay(10, d0), inplace=True) schedule = context.align(schedule) reference = pulse.Schedule() reference.insert(0, Delay(10, d0), inplace=True) reference.insert(20, Delay(10, d0), inplace=True) reference.insert(40, Delay(10, d0), inplace=True) self.assertEqual(schedule, reference) def test_equispaced_with_multiple_channels_short_duration(self): """Test equispaced context with multiple channels and duration shorter than the total duration.""" context = transforms.AlignEquispaced(duration=20) d0 = pulse.DriveChannel(0) d1 = pulse.DriveChannel(1) schedule = pulse.Schedule() schedule.append(Delay(10, d0), inplace=True) schedule.append(Delay(20, d1), inplace=True) schedule = context.align(schedule) reference = pulse.Schedule() reference.insert(0, Delay(10, d0), inplace=True) reference.insert(0, Delay(20, d1), inplace=True) self.assertEqual(schedule, reference) def test_equispaced_with_multiple_channels_longer_duration(self): """Test equispaced context with multiple channels and duration longer than the total duration.""" context = transforms.AlignEquispaced(duration=30) d0 = pulse.DriveChannel(0) d1 = pulse.DriveChannel(1) schedule = pulse.Schedule() schedule.append(Delay(10, d0), inplace=True) schedule.append(Delay(20, d1), inplace=True) schedule = context.align(schedule) reference = pulse.Schedule() reference.insert(0, Delay(10, d0), inplace=True) reference.insert(10, Delay(20, d1), inplace=True) self.assertEqual(schedule, reference) class TestAlignFunc(QiskitTestCase): """Test callback alignment transform.""" @staticmethod def _position(ind): """Returns 0.25, 0.5, 0.75 for ind = 1, 2, 3.""" return ind / (3 + 1) def test_numerical_with_short_duration(self): """Test numerical alignment context with duration shorter than the schedule duration.""" context = transforms.AlignFunc(duration=20, func=self._position) d0 = pulse.DriveChannel(0) schedule = pulse.Schedule() for _ in range(3): schedule.append(Delay(10, d0), inplace=True) schedule = context.align(schedule) reference = pulse.Schedule() reference.insert(0, Delay(10, d0), inplace=True) reference.insert(10, Delay(10, d0), inplace=True) reference.insert(20, Delay(10, d0), inplace=True) self.assertEqual(schedule, reference) def test_numerical_with_longer_duration(self): """Test numerical alignment context with duration longer than the schedule duration.""" context = transforms.AlignFunc(duration=80, func=self._position) d0 = pulse.DriveChannel(0) schedule = pulse.Schedule() for _ in range(3): schedule.append(Delay(10, d0), inplace=True) schedule = context.align(schedule) reference = pulse.Schedule() reference.insert(15, Delay(10, d0), inplace=True) reference.insert(35, Delay(10, d0), inplace=True) reference.insert(55, Delay(10, d0), inplace=True) self.assertEqual(schedule, reference) class TestFlatten(QiskitTestCase): """Test flattening transform.""" def test_flatten(self): """Test the flatten transform.""" context_left = transforms.AlignLeft() d0 = pulse.DriveChannel(0) d1 = pulse.DriveChannel(1) schedule = pulse.Schedule() schedule += instructions.Delay(3, d0) grouped = pulse.Schedule() grouped += instructions.Delay(5, d1) grouped += instructions.Delay(7, d0) # include a grouped schedule grouped = schedule + grouped # flatten the schedule inline internal groups flattened = transforms.flatten(grouped) # align all the instructions to the left after flattening flattened = context_left.align(flattened) grouped = context_left.align(grouped) reference = pulse.Schedule() # d0 reference.insert(0, instructions.Delay(3, d0), inplace=True) reference.insert(3, instructions.Delay(7, d0), inplace=True) # d1 reference.insert(0, instructions.Delay(5, d1), inplace=True) self.assertEqual(flattened, reference) self.assertNotEqual(grouped, reference) class _TestDirective(directives.Directive): """Pulse ``RelativeBarrier`` directive.""" def __init__(self, *channels): """Test directive""" super().__init__(operands=tuple(channels)) @property def channels(self): return self.operands class TestRemoveDirectives(QiskitTestCase): """Test removing of directives.""" def test_remove_directives(self): """Test that all directives are removed.""" d0 = pulse.DriveChannel(0) d1 = pulse.DriveChannel(1) schedule = pulse.Schedule() schedule += _TestDirective(d0, d1) schedule += instructions.Delay(3, d0) schedule += _TestDirective(d0, d1) schedule = transforms.remove_directives(schedule) reference = pulse.Schedule() # d0 reference += instructions.Delay(3, d0) self.assertEqual(schedule, reference) class TestRemoveTrivialBarriers(QiskitTestCase): """Test scheduling transforms.""" def test_remove_trivial_barriers(self): """Test that trivial barriers are properly removed.""" schedule = pulse.Schedule() schedule += directives.RelativeBarrier() schedule += directives.RelativeBarrier(pulse.DriveChannel(0)) schedule += directives.RelativeBarrier(pulse.DriveChannel(0), pulse.DriveChannel(1)) schedule = transforms.remove_trivial_barriers(schedule) reference = pulse.Schedule() reference += directives.RelativeBarrier(pulse.DriveChannel(0), pulse.DriveChannel(1)) self.assertEqual(schedule, reference) class TestRemoveSubroutines(QiskitTestCase): """Test removing of subroutines.""" def test_remove_subroutines(self): """Test that nested subroutiens are removed.""" d0 = pulse.DriveChannel(0) nested_routine = pulse.Schedule() nested_routine.insert(10, pulse.Delay(10, d0), inplace=True) subroutine = pulse.Schedule() subroutine.insert(0, pulse.Delay(20, d0), inplace=True) with self.assertWarns(DeprecationWarning): subroutine.insert(20, pulse.instructions.Call(nested_routine), inplace=True) subroutine.insert(50, pulse.Delay(10, d0), inplace=True) main_program = pulse.Schedule() main_program.insert(0, pulse.Delay(10, d0), inplace=True) with self.assertWarns(DeprecationWarning): main_program.insert(30, pulse.instructions.Call(subroutine), inplace=True) target = transforms.inline_subroutines(main_program) reference = pulse.Schedule() reference.insert(0, pulse.Delay(10, d0), inplace=True) reference.insert(30, pulse.Delay(20, d0), inplace=True) reference.insert(60, pulse.Delay(10, d0), inplace=True) reference.insert(80, pulse.Delay(10, d0), inplace=True) self.assertEqual(target, reference) def test_call_in_nested_schedule(self): """Test that subroutines in nested schedule.""" d0 = pulse.DriveChannel(0) subroutine = pulse.Schedule() subroutine.insert(10, pulse.Delay(10, d0), inplace=True) nested_sched = pulse.Schedule() with self.assertWarns(DeprecationWarning): nested_sched.insert(0, pulse.instructions.Call(subroutine), inplace=True) main_sched = pulse.Schedule() main_sched.insert(0, nested_sched, inplace=True) target = transforms.inline_subroutines(main_sched) # no call instruction reference_nested = pulse.Schedule() reference_nested.insert(0, subroutine, inplace=True) reference = pulse.Schedule() reference.insert(0, reference_nested, inplace=True) self.assertEqual(target, reference) def test_call_in_nested_block(self): """Test that subroutines in nested schedule.""" d0 = pulse.DriveChannel(0) subroutine = pulse.ScheduleBlock() subroutine.append(pulse.Delay(10, d0), inplace=True) nested_block = pulse.ScheduleBlock() with self.assertWarns(DeprecationWarning): nested_block.append(pulse.instructions.Call(subroutine), inplace=True) main_block = pulse.ScheduleBlock() main_block.append(nested_block, inplace=True) target = transforms.inline_subroutines(main_block) # no call instruction reference_nested = pulse.ScheduleBlock() reference_nested.append(subroutine, inplace=True) reference = pulse.ScheduleBlock() reference.append(reference_nested, inplace=True) self.assertEqual(target, reference) if __name__ == "__main__": unittest.main()
https://github.com/biswaroopmukherjee/Quantum-Waddle
biswaroopmukherjee
import numpy as np import time import networkx as nx import matplotlib.pyplot as plt import random from qiskit import (QuantumCircuit, QuantumRegister, ClassicalRegister, execute, Aer) %matplotlib inline from qiskit import IBMQ from qiskit.tools.monitor import job_monitor IBMQ.load_account() IBMQ.providers() provider = IBMQ.get_provider(group='open') def counts_to_prob_1d(counts): # Convert histogram counts to probability vector of size 1 x 2^n states = list(counts.keys()) state_counts = list(counts.values()) nshots = sum(state_counts) # Convert binary to integer index, reversing order as consistent w qiskit convention states_x = [int(s[::-1],2) for s in states] # Create array of probability values probabilities = np.zeros(2**n) probabilities[states_x] = state_counts probabilities /= nshots return probabilities def increment_gate(circuit, qpos, qcoin): n = len(qpos) for i in range(n): circuit.mct([qcoin[0]]+qpos[i+1:], qpos[i], None, mode='noancilla') def decrement_gate(circuit, qpos, qcoin): n = len(qpos) circuit.x(qcoin[0]) for i in range(n): if i+1 < n: circuit.x(qpos[i+1:]) circuit.mct([qcoin[0]]+qpos[i+1:], qpos[i], None, mode='noancilla') if i+1 < n: circuit.x(qpos[i+1:]) def step(circuit, qpos, qcoin,cpos,simulatorType): circuit.h(qcoin) circuit.barrier() increment_gate(circuit, qpos, qcoin) circuit.barrier() decrement_gate(circuit, qpos, qcoin) circuit.barrier() if simulatorType == 'classical': circuit.measure(qpos,cpos) def run(steps,simulatorType): # steps = number of quantum walks steps # simulatorType = 'sim', 'quantum' or 'classical' if simulatorType == 'sim': simulator = Aer.get_backend('qasm_simulator') elif simulatorType == 'quantum': simulator = provider.get_backend('ibmq_5_yorktown') elif simulatorType == 'classical': simulator = Aer.get_backend('qasm_simulator') else: simulator = Aer.get_backend('qasm_simulator') qpos = QuantumRegister(n,'qc') qcoin = QuantumRegister(1,'qanc') cpos = ClassicalRegister(n,'cr') circuit = QuantumCircuit(qpos, qcoin, cpos) for i in range(steps): step(circuit, qpos, qcoin,cpos, simulatorType) # # Map the quantum measurement to the classical bits circuit.measure(qpos,cpos) # # Execute the circuit on the qasm simulator job = execute(circuit, simulator, shots=1000) # # monitor job job_monitor(job) # # Grab results from the job result = job.result() # # Returns counts counts = result.get_counts(circuit) return counts seed = 12 random.seed(seed) np.random.seed(seed) def plotCircleGraph(names,propabilities,color=[0,0,1]): G = nx.Graph() colorarray = [] # generate array of colors numProp = len(propabilities) for idx in range(numProp): colorarray.append(color+[0.5*propabilities[idx]]) # generate graph for idx in range(numProp-1): G.add_edge(idx, idx+1) # add last edge G.add_edge(0,numProp-1) # label nodes labels = {} for idx in range(numProp): labels[idx] = names[idx] nx.draw(G, pos=nx.circular_layout(G), node_color=colorarray, cmap=plt.cm.Blues, node_size=3000, edge_color='k', ) pos=nx.circular_layout(G) labels = nx.draw_networkx_labels(G,pos,labels,font_size=16, bbox=dict(facecolor='w', alpha=1, edgecolor='w') ) # run and plot 1D walk steps = 3 n=2 for i in range(steps+1): #run classical random walk countsClassical = run(i,'classical') propClassical = counts_to_prob_1d(countsClassical) #run quantum simulation countsSim = run(i,'sim') propSim = counts_to_prob_1d(countsSim) #run the real thing countsQuantum = run(i,'quantum') propQuantum = counts_to_prob_1d(countsQuantum) names = [] formatLabel = '{0:0'+str(n)+'b}' for idx in range(2**n): names.append('|' + formatLabel.format(idx) +'>') #plotting f, axs = plt.subplots(2,3,figsize=(13,8)) margin=0.4 f.subplots_adjust(margin, margin, 1.-margin, 1.-margin) axs[0,0].set_title('classical random walk', fontsize=14) plt.sca(axs[0,0]) plotCircleGraph(names,propClassical,color=[1,0,0]) plt.sca(axs[1,0]) plt.bar(names,propClassical,edgecolor='black', color=[1,0,0,.4], lw=2) plt.ylim(0,1) plt.xticks(rotation=45) axs[0,1].set_title('simulated quantum walk', fontsize=14) plt.sca(axs[0,1]) plotCircleGraph(names,propSim,color=[0.3,1,0]) plt.sca(axs[1,1]) plt.bar(names,propSim,edgecolor='black', color=[0.3,1,0,.4], lw=2) plt.ylim(0,1) plt.xticks(rotation=45) axs[0,2].set_title('IBM quantum walk', fontsize=14) plt.sca(axs[0,2]) plotCircleGraph(names,propQuantum,color=[0.1,0.3,1]) plt.sca(axs[1,2]) plt.bar(names,propQuantum,edgecolor='black', color=[0.1,0.3,1,.4], lw=2) plt.ylim(0,1) plt.xticks(rotation=45) plt.tight_layout() plt.show()
https://github.com/qiskit-community/community.qiskit.org
qiskit-community
from qiskit import QuantumRegister, ClassicalRegister, QuantumCircuit, Aer, execute def NOT(input): q = QuantumRegister(1) # a qubit in which to encode the inout c = ClassicalRegister(1) # a bit to store the output qc = QuantumCircuit(q, c) # this is where the quantum program goes # We encode '0' as the qubit state |0⟩, and '1' as |1⟩ # Since the qubit is initially |0⟩, we don't need to do anything for an input of '0' # For an input of '1', we do an x to rotate the |0⟩ to |1⟩ if input=='1': # qc.x( q[0] ) # Now we've encoded the input, we can do a NOT on it using x qc.x( q[0] ) # Finally, we extract the |0⟩/|1⟩ output of the qubit and encode it in the bit c[0] qc.measure( q[0], c[0] ) # We'll run the program on a simulator backend = Aer.get_backend('qasm_simulator') # Since the output will be deterministic, we can use just a single shot to get it job = execute(qc,backend,shots=1,memory=True) output = job.result().get_memory()[0] return output def XOR(input1,input2): q = QuantumRegister(2) # a qubit in which to encode the inout c = ClassicalRegister(1) # a bit to store the output qc = QuantumCircuit(q, c) # this is where the quantum program goes if input1=='1': qc.x( q[0] ) if input2=='1': qc.x( q[1] ) qc.cx(q[0],q[1]) # just needs a cnot qc.measure(q[1],c[0]) # output from qubit 1 is measured # We'll run the program on a simulator backend = Aer.get_backend('qasm_simulator') # Since the output will be deterministic, we can use just a single shot to get it job = execute(qc,backend,shots=1,memory=True) output = job.result().get_memory()[0] return output def AND(input1,input2): q = QuantumRegister(3) # a qubit in which to encode the inout c = ClassicalRegister(1) # a bit to store the output qc = QuantumCircuit(q, c) # this is where the quantum program goes if input1=='1': qc.x( q[0] ) if input2=='1': qc.x( q[1] ) qc.ccx(q[0],q[1],q[2]) # just needs a ccx controlled on qubits 0 and 1 and targeted on 2 qc.measure(q[2],c[0]) # output from qubit 2 is measured # We'll run the program on a simulator backend = Aer.get_backend('qasm_simulator') # Since the output will be deterministic, we can use just a single shot to get it job = execute(qc,backend,shots=1,memory=True) output = job.result().get_memory()[0] return output def NAND(input1,input2): q = QuantumRegister(3) # a qubit in which to encode the inout c = ClassicalRegister(1) # a bit to store the output qc = QuantumCircuit(q, c) # this is where the quantum program goes if input1=='1': qc.x( q[0] ) if input2=='1': qc.x( q[1] ) # can be done with an AND followed by a NOT qc.ccx(q[0],q[1],q[2]) # the AND just needs a ccx controlled on qubits 0 and 1 and targeted on 2 qc.x(q[2]) # the NOT is done to the qubit containing the output qc.measure(q[2],c[0]) # output from qubit 2 is measured # We'll run the program on a simulator backend = Aer.get_backend('qasm_simulator') # Since the output will be deterministic, we can use just a single shot to get it job = execute(qc,backend,shots=1,memory=True) output = job.result().get_memory()[0] return output def OR(input1,input2): q = QuantumRegister(3) # a qubit in which to encode the inout c = ClassicalRegister(1) # a bit to store the output qc = QuantumCircuit(q, c) # this is where the quantum program goes if input1=='1': qc.x( q[0] ) if input2=='1': qc.x( q[1] ) # can be done with NOTs on the inputs and output of an AND qc.x(q[0]) qc.x(q[1]) qc.ccx(q[0],q[1],q[2]) # the AND just needs a ccx controlled on qubits 0 and 1 and targeted on 2 qc.x(q[2]) # the NOT is done to the qubit containing the output qc.measure(q[2],c[0]) # output from qubit 2 is measured # We'll run the program on a simulator backend = Aer.get_backend('qasm_simulator') # Since the output will be deterministic, we can use just a single shot to get it job = execute(qc,backend,shots=1,memory=True) output = job.result().get_memory()[0] return output print('\nResults for the NOT gate') for input in ['0','1']: print(' NOT with input',input,'gives output',NOT(input)) print('\nResults for the XOR gate') for input1 in ['0','1']: for input2 in ['0','1']: print(' NOT with inputs',input1,input2,'gives output',XOR(input1,input2)) print('\nResults for the AND gate') for input1 in ['0','1']: for input2 in ['0','1']: print(' NOT with inputs',input1,input2,'gives output',AND(input1,input2)) print('\nResults for the NAND gate') for input1 in ['0','1']: for input2 in ['0','1']: print(' NOT with inputs',input1,input2,'gives output',NAND(input1,input2)) print('\nResults for the OR gate') for input1 in ['0','1']: for input2 in ['0','1']: print(' NOT with inputs',input1,input2,'gives output',OR(input1,input2))
https://github.com/qiskit-community/qiskit-translations-staging
qiskit-community
from qiskit import QuantumCircuit, transpile, schedule from qiskit.visualization.timeline import draw, IQXDebugging from qiskit.providers.fake_provider import FakeBoeblingen qc = QuantumCircuit(2) qc.h(0) qc.cx(0,1) qc = transpile(qc, FakeBoeblingen(), scheduling_method='alap', layout_method='trivial') draw(qc, style=IQXDebugging())
https://github.com/2lambda123/Qiskit-qiskit
2lambda123
# This code is part of Qiskit. # # (C) Copyright IBM 2022. # # This code is licensed under the Apache License, Version 2.0. You may # obtain a copy of this license in the LICENSE.txt file in the root directory # of this source tree or at http://www.apache.org/licenses/LICENSE-2.0. # # Any modifications or derivative works of this code must retain this # copyright notice, and modified files need to carry a notice indicating # that they have been altered from the originals. """ Tests for Layer1Q implementation. """ import unittest from random import randint import test.python.transpiler.aqc.fast_gradient.utils_for_testing as tut import numpy as np import qiskit.transpiler.synthesis.aqc.fast_gradient.layer as lr from qiskit.transpiler.synthesis.aqc.fast_gradient.pmatrix import PMatrix from qiskit.test import QiskitTestCase class TestLayer1q(QiskitTestCase): """ Tests for Layer1Q class. """ max_num_qubits = 5 # maximum number of qubits in tests num_repeats = 50 # number of repetitions in tests def setUp(self): super().setUp() np.random.seed(0x0696969) def test_layer1q_matrix(self): """ Tests: (1) the correctness of Layer2Q matrix construction; (2) matrix multiplication interleaved with permutations. """ mat_kind = "complex" eps = 100.0 * np.finfo(float).eps max_rel_err = 0.0 for n in range(2, self.max_num_qubits + 1): dim = 2**n iden = tut.eye_int(n) for k in range(n): m_mat = tut.rand_matrix(dim=dim, kind=mat_kind) t_mat, g_mat = tut.make_test_matrices2x2(n=n, k=k, kind=mat_kind) lmat = lr.Layer1Q(num_qubits=n, k=k, g2x2=g_mat) g2, perm, inv_perm = lmat.get_attr() self.assertTrue(m_mat.dtype == t_mat.dtype == g_mat.dtype == g2.dtype) self.assertTrue(np.all(g_mat == g2)) self.assertTrue(np.all(iden[perm].T == iden[inv_perm])) g_mat = np.kron(tut.eye_int(n - 1), g_mat) # T == P^t @ G @ P. err = tut.relative_error(t_mat, iden[perm].T @ g_mat @ iden[perm]) self.assertLess(err, eps, "err = {:0.16f}".format(err)) max_rel_err = max(max_rel_err, err) # Multiplication by permutation matrix of the left can be # replaced by row permutations. tm = t_mat @ m_mat err1 = tut.relative_error(iden[perm].T @ g_mat @ m_mat[perm], tm) err2 = tut.relative_error((g_mat @ m_mat[perm])[inv_perm], tm) # Multiplication by permutation matrix of the right can be # replaced by column permutations. mt = m_mat @ t_mat err3 = tut.relative_error(m_mat @ iden[perm].T @ g_mat @ iden[perm], mt) err4 = tut.relative_error((m_mat[:, perm] @ g_mat)[:, inv_perm], mt) self.assertTrue( err1 < eps and err2 < eps and err3 < eps and err4 < eps, "err1 = {:f}, err2 = {:f}, " "err3 = {:f}, err4 = {:f}".format(err1, err2, err3, err4), ) max_rel_err = max(max_rel_err, err1, err2, err3, err4) def test_pmatrix_class(self): """ Test the class PMatrix. """ _eps = 100.0 * np.finfo(float).eps mat_kind = "complex" max_rel_err = 0.0 for n in range(2, self.max_num_qubits + 1): dim = 2**n tmp1 = np.ndarray((dim, dim), dtype=np.cfloat) tmp2 = tmp1.copy() for _ in range(self.num_repeats): k0 = randint(0, n - 1) k1 = randint(0, n - 1) k2 = randint(0, n - 1) k3 = randint(0, n - 1) k4 = randint(0, n - 1) t0, g0 = tut.make_test_matrices2x2(n=n, k=k0, kind=mat_kind) t1, g1 = tut.make_test_matrices2x2(n=n, k=k1, kind=mat_kind) t2, g2 = tut.make_test_matrices2x2(n=n, k=k2, kind=mat_kind) t3, g3 = tut.make_test_matrices2x2(n=n, k=k3, kind=mat_kind) t4, g4 = tut.make_test_matrices2x2(n=n, k=k4, kind=mat_kind) c0 = lr.Layer1Q(num_qubits=n, k=k0, g2x2=g0) c1 = lr.Layer1Q(num_qubits=n, k=k1, g2x2=g1) c2 = lr.Layer1Q(num_qubits=n, k=k2, g2x2=g2) c3 = lr.Layer1Q(num_qubits=n, k=k3, g2x2=g3) c4 = lr.Layer1Q(num_qubits=n, k=k4, g2x2=g4) m_mat = tut.rand_matrix(dim=dim, kind=mat_kind) ttmtt = t0 @ t1 @ m_mat @ np.conj(t2).T @ np.conj(t3).T pmat = PMatrix(n) pmat.set_matrix(m_mat) pmat.mul_left_q1(layer=c1, temp_mat=tmp1) pmat.mul_left_q1(layer=c0, temp_mat=tmp1) pmat.mul_right_q1(layer=c2, temp_mat=tmp1, dagger=True) pmat.mul_right_q1(layer=c3, temp_mat=tmp1, dagger=True) alt_ttmtt = pmat.finalize(temp_mat=tmp1) err1 = tut.relative_error(alt_ttmtt, ttmtt) self.assertLess(err1, _eps, "relative error: {:f}".format(err1)) prod = np.cfloat(np.trace(ttmtt @ t4)) alt_prod = pmat.product_q1(layer=c4, tmp1=tmp1, tmp2=tmp2) err2 = abs(alt_prod - prod) / abs(prod) self.assertLess(err2, _eps, "relative error: {:f}".format(err2)) max_rel_err = max(max_rel_err, err1, err2) if __name__ == "__main__": unittest.main()
https://github.com/Spintronic6889/Introduction-of-Quantum-walk-its-application-on-search-and-decision-making
Spintronic6889
!python --version !pip install qiskit !pip install pylatexenc from qiskit import QuantumRegister, ClassicalRegister, QuantumCircuit, execute, Aer from qiskit.visualization import plot_histogram import matplotlib.pyplot as plt from qiskit.visualization import plot_state_city %matplotlib inline import matplotlib as mpl from random import randrange import numpy as np import networkx as nx import random import math from qiskit.tools.monitor import job_monitor from random import randrange pose=[] for i in range(400): pose.append([]) #print(pose) #pose[-1]=1 #print(pose[-1]) pose[0]=200 for k in range(200): rand = randrange(0,2) if rand==0: #print(rand) pose[k+1]=pose[k]+1 if rand==1: pose[k+1]=pose[k]-1 #print(pose) yc=[] for e in range(400): yc.append([]) for q in range(400): yc[q]=0 for h in range(400): if pose[h]==q: yc[q]=yc[q]+1 #print((yc)) #print(len(yc)) xc = np.arange(0, 400, 1) plt.plot(yc) plt.xlim(150, 250) class quantom_walk: def __init__(self): self.__n=2 self.__steps=1 self.__theta=0 self.__phi=0 self.__qtype=1 self.__shot=5000 def main_qw(self,n,steps,qtype,theta,phi): self.__qpos = QuantumRegister(n,'qpos') self.__qcoin = QuantumRegister(1,'qcoin') self.__cpos = ClassicalRegister(n,'cr') self.__QC = QuantumCircuit(self.__qpos, self.__qcoin) if qtype==2: self.__QC.x(self.__qcoin[0]) if qtype==3: self.__QC.u(theta, phi, 0, self.__qcoin[0]) for i in range(steps): self.__QC.h(self.__qcoin[0]) self.__QC.barrier() for i in range(n): self.__QC.mct([self.__qcoin[0]]+self.__qpos[i+1:], self.__qpos[i], None, mode='noancilla') self.__QC.barrier() self.__QC.x(self.__qcoin[0]) for i in range(n): if i+1 < n: self.__QC.x(self.__qpos[i+1:]) self.__QC.mct([self.__qcoin[0]]+self.__qpos[i+1:], self.__qpos[i], None, mode='noancilla') if i+1 < n: self.__QC.x(self.__qpos[i+1:]) self.__QC.barrier() a=n/2 p=math.floor(a) for k in range(n): if(k<p): self.__QC.swap(self.__qpos[n-1-k],self.__qpos[k]) def displayh(self): display(self.__QC.draw(output="mpl")) def histagramh(self,shot): self.__QC.measure_all() job = execute(self.__QC,Aer.get_backend('aer_simulator'),shots=5000) counts = job.result().get_counts(self.__QC) return counts def spacevectorh(self): backend = Aer.get_backend('statevector_simulator') job = execute(self.__QC, backend) result = job.result() outputstate = result.get_statevector(self.__QC, decimals=3) print(outputstate) def plotcityh(self): backend = Aer.get_backend('statevector_simulator') job = execute(self.__QC, backend) result = job.result() outputstate = result.get_statevector(self.__QC, decimals=3) from qiskit.visualization import plot_state_city plot_state_city(outputstate) return outputstate def unitaryh(self): backend = Aer.get_backend('unitary_simulator') job = execute(self.__QC, backend) result = job.result() yy=result.get_unitary(self.__QC, decimals=3) print(yy) def IBMQh(self): from qiskit import IBMQ IBMQ.save_account('d1441affe8622903745ae099f50bce72c21036f85b14600d18195c977b9efcdee621dd4a981b92d8028c03c4dc1860c82d70f501d345023471402f4f8dad0181',overwrite=True) provider = IBMQ.load_account() device = provider.get_backend('ibmq_quito') #we use ibmq_16_melbourne quantum device job = execute(self.__QC, backend = device) #we pass our circuit and backend as usual from qiskit.tools.monitor import job_monitor job_monitor(job) #to see our status in queue result = job.result() counts= result.get_counts(self.__QC) return counts def instructionset(self): print(self.__QC.qasm()) qw = quantom_walk() qw.main_qw(4,4,1,1.5,4) #qw.instructionset() #qw.displayh() #plot_histogram(qw.histagramh(3000), figsize=(20, 5), color=None, number_to_keep=None, sort='asc', target_string=None, legend=None, bar_labels=True, title=None, ax=None) #qw.histagramh(3000) #qw.spacevectorh() #qw.unitaryh() #qw.plotcityh() #plot_state_city(qw.plotcityh(), figsize=(20, 10)) #plot_histogram(qw.IBMQh(), figsize=(5, 2), color=None, number_to_keep=None, sort='asc', target_string=None, legend=None, bar_labels=True, title=None, ax=None, filename=None) #qw.IBMQh() qw = quantom_walk() qw.main_qw(2,2,3,1.5,1.5) qw.displayh() qw.main_qw(6,25,1,1.5,4) plot_histogram(qw.histagramh(3000), figsize=(20, 5), color=None, number_to_keep=None, sort='asc', target_string=None, legend=None, bar_labels=True, title=None, ax=None) qw.main_qw(3,4,1,1.5,4) qw.spacevectorh() qw.main_qw(3,15,1,1.5,4) plot_state_city(qw.plotcityh(), figsize=(20, 10)) qw.main_qw(2,3,1,1.5,4) qw.unitaryh() qw.main_qw(3,2,1,1.5,4) qw.instructionset() qw.main_qw(2,1,1,1.5,4) plot_histogram(qw.IBMQh(), figsize=(5, 2), color=None, number_to_keep=None, sort='asc', target_string=None, legend=None, bar_labels=True, title=None, ax=None, filename=None) #hadamrad...qtype=1 qw = quantom_walk() qw.main_qw(3,32,1,0,0) plot_histogram(qw.histagramh(3000), figsize=(20, 5), color=None, number_to_keep=None, sort='asc', target_string=None, legend=None, bar_labels=True, title=None, ax=None) #optimized ugate applied...qtype=3 qw = quantom_walk() qw.main_qw(3,32,3,1.57,1.57) plot_histogram(qw.histagramh(3000), figsize=(20, 5), color=None, number_to_keep=None, sort='asc', target_string=None, legend=None, bar_labels=True, title=None, ax=None)