repo
stringclasses
885 values
file
stringclasses
741 values
content
stringlengths
4
215k
https://github.com/Soumyo2121/Basic-Quantum-Algorithms
Soumyo2121
import qiskit from qiskit import * n = int(input("Enter the length of binry string: ")) n_q = n n_c = n qc = QuantumCircuit(n_q,n_c) for i in range(n): qc.h(i) qc.measure(i,i) qc.draw('mpl') simulator = Aer.get_backend('qasm_simulator') result = execute(qc, backend = simulator, shots = 1).result() counts = result.get_counts() print(counts)
https://github.com/Qiskit-Extensions/circuit-knitting-toolbox
Qiskit-Extensions
# This code is a Qiskit project. # (C) Copyright IBM 2023. # This code is licensed under the Apache License, Version 2.0. You may # obtain a copy of this license in the LICENSE.txt file in the root directory # of this source tree or at http://www.apache.org/licenses/LICENSE-2.0. # Any modifications or derivative works of this code must retain this # copyright notice, and modified files need to carry a notice indicating # that they have been altered from the originals. from __future__ import annotations import pytest import logging import numpy as np from qiskit import QuantumCircuit from qiskit.circuit.library import UnitaryGate from qiskit.circuit.library.standard_gates import ( RXXGate, RYYGate, RZZGate, RZXGate, XXPlusYYGate, XXMinusYYGate, CHGate, CXGate, CYGate, CZGate, CSGate, CSdgGate, CSXGate, CRXGate, CRYGate, CRZGate, CPhaseGate, ECRGate, SwapGate, iSwapGate, DCXGate, ) from qiskit.quantum_info import PauliList, random_unitary from qiskit.primitives import Estimator from qiskit_ibm_runtime import SamplerV2 from qiskit_aer import AerSimulator from qiskit_aer.primitives import Sampler from circuit_knitting.utils.simulation import ExactSampler from circuit_knitting.cutting import ( partition_problem, generate_cutting_experiments, reconstruct_expectation_values, ) from circuit_knitting.cutting.instructions import Move logger = logging.getLogger(__name__) def append_random_unitary(circuit: QuantumCircuit, qubits): circuit.unitary(random_unitary(2 ** len(qubits)), qubits) @pytest.fixture( params=[ [SwapGate()], [iSwapGate()], [DCXGate()], [CXGate()], [CYGate()], [CZGate()], [CHGate()], [ECRGate()], [CSXGate()], [CSXGate().inverse()], [CSGate()], [CSdgGate()], [RYYGate(0.0)], [RZZGate(np.pi)], [RXXGate(np.pi / 3)], [RYYGate(np.pi / 7)], [RZZGate(np.pi / 11)], [CRXGate(0.0)], [CRYGate(np.pi)], [CRZGate(np.pi / 2)], [CRXGate(np.pi / 3)], [CRYGate(np.pi / 7)], [CRZGate(np.pi / 11)], [RXXGate(np.pi / 3), CRYGate(np.pi / 7)], [CPhaseGate(np.pi / 3)], [RXXGate(np.pi / 3), CPhaseGate(np.pi / 7)], [UnitaryGate(random_unitary(2**2))], [RZXGate(np.pi / 5)], # XXPlusYYGate, XXMinusYYGate, with some combinations: # beta == 0 or not; and # within |theta| < pi or not [XXPlusYYGate(7 * np.pi / 11)], [XXPlusYYGate(17 * np.pi / 11, beta=0.4)], [XXPlusYYGate(-19 * np.pi / 11, beta=0.3)], [XXMinusYYGate(11 * np.pi / 17)], [Move()], [Move(), Move()], ] ) def example_circuit(request) -> QuantumCircuit: """Fixture for an example circuit. Except for the parametrized gates, the system can be separated according to the partition labels "AAB". """ qc = QuantumCircuit(3) cut_indices = [] for instruction in request.param: if instruction.name == "move" and len(cut_indices) % 2 == 1: # We should not entangle qubit 1 with the remainder of the system. # In fact, we're also assuming that the previous operation here was # a move. append_random_unitary(qc, [0]) append_random_unitary(qc, [1]) else: append_random_unitary(qc, [0, 1]) append_random_unitary(qc, [2]) cut_indices.append(len(qc.data)) qubits = [1, 2] if len(cut_indices) % 2 == 0: qubits.reverse() qc.append(instruction, qubits) qc.barrier() append_random_unitary(qc, [0, 1]) qc.barrier() append_random_unitary(qc, [2]) return qc def test_cutting_exact_reconstruction(example_circuit): """Test gate-cut circuit vs original circuit on statevector simulator""" qc = example_circuit observables = PauliList(["III", "IIY", "XII", "XYZ", "iZZZ", "-XZI"]) phases = np.array([(-1j) ** obs.phase for obs in observables]) observables_nophase = PauliList(["III", "IIY", "XII", "XYZ", "ZZZ", "XZI"]) estimator = Estimator() exact_expvals = ( estimator.run([qc] * len(observables), list(observables)).result().values ) subcircuits, bases, subobservables = partition_problem( qc, "AAB", observables=observables_nophase ) subexperiments, coefficients = generate_cutting_experiments( subcircuits, subobservables, num_samples=np.inf ) if np.random.randint(2): # Re-use a single sampler sampler = ExactSampler() samplers = {label: sampler for label in subcircuits.keys()} else: # One sampler per partition samplers = {label: ExactSampler() for label in subcircuits.keys()} results = { label: sampler.run(subexperiments[label]).result() for label, sampler in samplers.items() } reconstructed_expvals = reconstruct_expectation_values( results, coefficients, subobservables ) reconstructed_expvals *= phases logger.info("Max error: %f", np.max(np.abs(exact_expvals - reconstructed_expvals))) assert np.allclose(exact_expvals, reconstructed_expvals, atol=1e-8) @pytest.mark.parametrize( "sampler,is_exact_sampler", [(Sampler(), False), (SamplerV2(AerSimulator()), False), (ExactSampler(), True)], ) def test_sampler_with_identity_subobservable(sampler, is_exact_sampler): """This test ensures that the sampler works for a subcircuit with no observable measurements. Specifically, that - ``Sampler`` does not blow up (Issue #422); and - ``ExactSampler`` returns correct results This is related to https://github.com/Qiskit-Extensions/circuit-knitting-toolbox/issues/422. """ # Create a circuit to cut qc = QuantumCircuit(3) append_random_unitary(qc, [0, 1]) append_random_unitary(qc, [2]) qc.rxx(np.pi / 3, 1, 2) append_random_unitary(qc, [0, 1]) append_random_unitary(qc, [2]) # Determine expectation value using cutting observables = PauliList( ["IIZ"] ) # Without the workaround to Issue #422, this observable causes a Sampler error. subcircuits, bases, subobservables = partition_problem( qc, "AAB", observables=observables ) subexperiments, coefficients = generate_cutting_experiments( subcircuits, subobservables, num_samples=np.inf ) samplers = {label: sampler for label in subexperiments.keys()} results = { label: sampler.run(subexperiments[label]).result() for label, sampler in samplers.items() } reconstructed_expvals = reconstruct_expectation_values( results, coefficients, subobservables ) if is_exact_sampler: # Determine exact expectation values estimator = Estimator() exact_expvals = ( estimator.run([qc] * len(observables), list(observables)).result().values ) logger.info( "Max error: %f", np.max(np.abs(exact_expvals - reconstructed_expvals)) ) # Ensure both methods yielded equivalent expectation values assert np.allclose(exact_expvals, reconstructed_expvals, atol=1e-8)
https://github.com/indian-institute-of-science-qc/qiskit-aakash
indian-institute-of-science-qc
# This code is part of Qiskit. # # (C) Copyright IBM 2017, 2019. # # This code is licensed under the Apache License, Version 2.0. You may # obtain a copy of this license in the LICENSE.txt file in the root directory # of this source tree or at http://www.apache.org/licenses/LICENSE-2.0. # # Any modifications or derivative works of this code must retain this # copyright notice, and modified files need to carry a notice indicating # that they have been altered from the originals. """Tests for PTM quantum channel representation class.""" import copy import unittest import numpy as np from numpy.testing import assert_allclose from qiskit import QiskitError from qiskit.quantum_info.states import DensityMatrix from qiskit.quantum_info.operators.channel import PTM from .channel_test_case import ChannelTestCase class TestPTM(ChannelTestCase): """Tests for PTM channel representation.""" def test_init(self): """Test initialization""" mat4 = np.eye(4) / 2.0 chan = PTM(mat4) assert_allclose(chan.data, mat4) self.assertEqual(chan.dim, (2, 2)) self.assertEqual(chan.num_qubits, 1) mat16 = np.eye(16) / 4 chan = PTM(mat16) assert_allclose(chan.data, mat16) self.assertEqual(chan.dim, (4, 4)) self.assertEqual(chan.num_qubits, 2) # Wrong input or output dims should raise exception self.assertRaises(QiskitError, PTM, mat16, input_dims=2, output_dims=4) # Non multi-qubit dimensions should raise exception self.assertRaises(QiskitError, PTM, np.eye(6) / 2, input_dims=3, output_dims=2) def test_circuit_init(self): """Test initialization from a circuit.""" circuit, target = self.simple_circuit_no_measure() op = PTM(circuit) target = PTM(target) self.assertEqual(op, target) def test_circuit_init_except(self): """Test initialization from circuit with measure raises exception.""" circuit = self.simple_circuit_with_measure() self.assertRaises(QiskitError, PTM, circuit) def test_equal(self): """Test __eq__ method""" mat = self.rand_matrix(4, 4, real=True) self.assertEqual(PTM(mat), PTM(mat)) def test_copy(self): """Test copy method""" mat = np.eye(4) with self.subTest("Deep copy"): orig = PTM(mat) cpy = orig.copy() cpy._data[0, 0] = 0.0 self.assertFalse(cpy == orig) with self.subTest("Shallow copy"): orig = PTM(mat) clone = copy.copy(orig) clone._data[0, 0] = 0.0 self.assertTrue(clone == orig) def test_clone(self): """Test clone method""" mat = np.eye(4) orig = PTM(mat) clone = copy.copy(orig) clone._data[0, 0] = 0.0 self.assertTrue(clone == orig) def test_is_cptp(self): """Test is_cptp method.""" self.assertTrue(PTM(self.depol_ptm(0.25)).is_cptp()) # Non-CPTP should return false self.assertFalse(PTM(1.25 * self.ptmI - 0.25 * self.depol_ptm(1)).is_cptp()) def test_compose_except(self): """Test compose different dimension exception""" self.assertRaises(QiskitError, PTM(np.eye(4)).compose, PTM(np.eye(16))) self.assertRaises(QiskitError, PTM(np.eye(4)).compose, 2) def test_compose(self): """Test compose method.""" # Random input test state rho = DensityMatrix(self.rand_rho(2)) # UnitaryChannel evolution chan1 = PTM(self.ptmX) chan2 = PTM(self.ptmY) chan = chan1.compose(chan2) rho_targ = rho.evolve(PTM(self.ptmZ)) self.assertEqual(rho.evolve(chan), rho_targ) # 50% depolarizing channel chan1 = PTM(self.depol_ptm(0.5)) chan = chan1.compose(chan1) rho_targ = rho.evolve(PTM(self.depol_ptm(0.75))) self.assertEqual(rho.evolve(chan), rho_targ) # Compose random ptm1 = self.rand_matrix(4, 4, real=True) ptm2 = self.rand_matrix(4, 4, real=True) chan1 = PTM(ptm1, input_dims=2, output_dims=2) chan2 = PTM(ptm2, input_dims=2, output_dims=2) rho_targ = rho.evolve(chan1).evolve(chan2) chan = chan1.compose(chan2) self.assertEqual(chan.dim, (2, 2)) self.assertEqual(rho.evolve(chan), rho_targ) chan = chan1 & chan2 self.assertEqual(chan.dim, (2, 2)) self.assertEqual(rho.evolve(chan), rho_targ) def test_dot(self): """Test dot method.""" # Random input test state rho = DensityMatrix(self.rand_rho(2)) # UnitaryChannel evolution chan1 = PTM(self.ptmX) chan2 = PTM(self.ptmY) rho_targ = rho.evolve(PTM(self.ptmZ)) self.assertEqual(rho.evolve(chan2.dot(chan1)), rho_targ) self.assertEqual(rho.evolve(chan2 @ chan1), rho_targ) # Compose random ptm1 = self.rand_matrix(4, 4, real=True) ptm2 = self.rand_matrix(4, 4, real=True) chan1 = PTM(ptm1, input_dims=2, output_dims=2) chan2 = PTM(ptm2, input_dims=2, output_dims=2) rho_targ = rho.evolve(chan1).evolve(chan2) self.assertEqual(rho.evolve(chan2.dot(chan1)), rho_targ) self.assertEqual(rho.evolve(chan2 @ chan1), rho_targ) def test_compose_front(self): """Test deprecated front compose method.""" # Random input test state rho = DensityMatrix(self.rand_rho(2)) # UnitaryChannel evolution chan1 = PTM(self.ptmX) chan2 = PTM(self.ptmY) chan = chan2.compose(chan1, front=True) rho_targ = rho.evolve(PTM(self.ptmZ)) self.assertEqual(rho.evolve(chan), rho_targ) # Compose random ptm1 = self.rand_matrix(4, 4, real=True) ptm2 = self.rand_matrix(4, 4, real=True) chan1 = PTM(ptm1, input_dims=2, output_dims=2) chan2 = PTM(ptm2, input_dims=2, output_dims=2) rho_targ = rho.evolve(chan1).evolve(chan2) chan = chan2.compose(chan1, front=True) self.assertEqual(chan.dim, (2, 2)) self.assertEqual(rho.evolve(chan), rho_targ) def test_expand(self): """Test expand method.""" rho0, rho1 = np.diag([1, 0]), np.diag([0, 1]) rho_init = DensityMatrix(np.kron(rho0, rho0)) chan1 = PTM(self.ptmI) chan2 = PTM(self.ptmX) # X \otimes I chan = chan1.expand(chan2) rho_targ = DensityMatrix(np.kron(rho1, rho0)) self.assertEqual(chan.dim, (4, 4)) self.assertEqual(rho_init.evolve(chan), rho_targ) # I \otimes X chan = chan2.expand(chan1) rho_targ = DensityMatrix(np.kron(rho0, rho1)) self.assertEqual(chan.dim, (4, 4)) self.assertEqual(rho_init.evolve(chan), rho_targ) # Completely depolarizing chan_dep = PTM(self.depol_ptm(1)) chan = chan_dep.expand(chan_dep) rho_targ = DensityMatrix(np.diag([1, 1, 1, 1]) / 4) self.assertEqual(chan.dim, (4, 4)) self.assertEqual(rho_init.evolve(chan), rho_targ) def test_tensor(self): """Test tensor method.""" rho0, rho1 = np.diag([1, 0]), np.diag([0, 1]) rho_init = DensityMatrix(np.kron(rho0, rho0)) chan1 = PTM(self.ptmI) chan2 = PTM(self.ptmX) # X \otimes I chan = chan2.tensor(chan1) rho_targ = DensityMatrix(np.kron(rho1, rho0)) self.assertEqual(chan.dim, (4, 4)) self.assertEqual(rho_init.evolve(chan), rho_targ) # I \otimes X chan = chan1.tensor(chan2) rho_targ = DensityMatrix(np.kron(rho0, rho1)) self.assertEqual(chan.dim, (4, 4)) self.assertEqual(rho_init.evolve(chan), rho_targ) # Completely depolarizing chan_dep = PTM(self.depol_ptm(1)) chan = chan_dep.tensor(chan_dep) rho_targ = DensityMatrix(np.diag([1, 1, 1, 1]) / 4) self.assertEqual(chan.dim, (4, 4)) self.assertEqual(rho_init.evolve(chan), rho_targ) def test_power(self): """Test power method.""" # 10% depolarizing channel p_id = 0.9 depol = PTM(self.depol_ptm(1 - p_id)) # Compose 3 times p_id3 = p_id**3 chan3 = depol.power(3) targ3 = PTM(self.depol_ptm(1 - p_id3)) self.assertEqual(chan3, targ3) def test_add(self): """Test add method.""" mat1 = 0.5 * self.ptmI mat2 = 0.5 * self.depol_ptm(1) chan1 = PTM(mat1) chan2 = PTM(mat2) targ = PTM(mat1 + mat2) self.assertEqual(chan1._add(chan2), targ) self.assertEqual(chan1 + chan2, targ) targ = PTM(mat1 - mat2) self.assertEqual(chan1 - chan2, targ) def test_add_qargs(self): """Test add method with qargs.""" mat = self.rand_matrix(8**2, 8**2) mat0 = self.rand_matrix(4, 4) mat1 = self.rand_matrix(4, 4) op = PTM(mat) op0 = PTM(mat0) op1 = PTM(mat1) op01 = op1.tensor(op0) eye = PTM(self.ptmI) with self.subTest(msg="qargs=[0]"): value = op + op0([0]) target = op + eye.tensor(eye).tensor(op0) self.assertEqual(value, target) with self.subTest(msg="qargs=[1]"): value = op + op0([1]) target = op + eye.tensor(op0).tensor(eye) self.assertEqual(value, target) with self.subTest(msg="qargs=[2]"): value = op + op0([2]) target = op + op0.tensor(eye).tensor(eye) self.assertEqual(value, target) with self.subTest(msg="qargs=[0, 1]"): value = op + op01([0, 1]) target = op + eye.tensor(op1).tensor(op0) self.assertEqual(value, target) with self.subTest(msg="qargs=[1, 0]"): value = op + op01([1, 0]) target = op + eye.tensor(op0).tensor(op1) self.assertEqual(value, target) with self.subTest(msg="qargs=[0, 2]"): value = op + op01([0, 2]) target = op + op1.tensor(eye).tensor(op0) self.assertEqual(value, target) with self.subTest(msg="qargs=[2, 0]"): value = op + op01([2, 0]) target = op + op0.tensor(eye).tensor(op1) self.assertEqual(value, target) def test_sub_qargs(self): """Test subtract method with qargs.""" mat = self.rand_matrix(8**2, 8**2) mat0 = self.rand_matrix(4, 4) mat1 = self.rand_matrix(4, 4) op = PTM(mat) op0 = PTM(mat0) op1 = PTM(mat1) op01 = op1.tensor(op0) eye = PTM(self.ptmI) with self.subTest(msg="qargs=[0]"): value = op - op0([0]) target = op - eye.tensor(eye).tensor(op0) self.assertEqual(value, target) with self.subTest(msg="qargs=[1]"): value = op - op0([1]) target = op - eye.tensor(op0).tensor(eye) self.assertEqual(value, target) with self.subTest(msg="qargs=[2]"): value = op - op0([2]) target = op - op0.tensor(eye).tensor(eye) self.assertEqual(value, target) with self.subTest(msg="qargs=[0, 1]"): value = op - op01([0, 1]) target = op - eye.tensor(op1).tensor(op0) self.assertEqual(value, target) with self.subTest(msg="qargs=[1, 0]"): value = op - op01([1, 0]) target = op - eye.tensor(op0).tensor(op1) self.assertEqual(value, target) with self.subTest(msg="qargs=[0, 2]"): value = op - op01([0, 2]) target = op - op1.tensor(eye).tensor(op0) self.assertEqual(value, target) with self.subTest(msg="qargs=[2, 0]"): value = op - op01([2, 0]) target = op - op0.tensor(eye).tensor(op1) self.assertEqual(value, target) def test_add_except(self): """Test add method raises exceptions.""" chan1 = PTM(self.ptmI) chan2 = PTM(np.eye(16)) self.assertRaises(QiskitError, chan1._add, chan2) self.assertRaises(QiskitError, chan1._add, 5) def test_multiply(self): """Test multiply method.""" chan = PTM(self.ptmI) val = 0.5 targ = PTM(val * self.ptmI) self.assertEqual(chan._multiply(val), targ) self.assertEqual(val * chan, targ) targ = PTM(self.ptmI * val) self.assertEqual(chan * val, targ) def test_multiply_except(self): """Test multiply method raises exceptions.""" chan = PTM(self.ptmI) self.assertRaises(QiskitError, chan._multiply, "s") self.assertRaises(QiskitError, chan.__rmul__, "s") self.assertRaises(QiskitError, chan._multiply, chan) self.assertRaises(QiskitError, chan.__rmul__, chan) def test_negate(self): """Test negate method""" chan = PTM(self.ptmI) targ = PTM(-self.ptmI) self.assertEqual(-chan, targ) if __name__ == "__main__": unittest.main()
https://github.com/BOBO1997/osp_solutions
BOBO1997
import numpy as np import matplotlib.pyplot as plt import itertools from pprint import pprint import pickle import time import datetime # Import qubit states Zero (|0>) and One (|1>), and Pauli operators (X, Y, Z) from qiskit.opflow import Zero, One, I, X, Y, Z from qiskit import QuantumCircuit, QuantumRegister, IBMQ, execute, transpile, Aer from qiskit.tools.monitor import job_monitor from qiskit.circuit import Parameter from qiskit.transpiler.passes import RemoveBarriers # Import QREM package from qiskit.ignis.mitigation.measurement import complete_meas_cal, CompleteMeasFitter from qiskit.ignis.mitigation import expectation_value # Import mitiq for zne import mitiq # Import state tomography modules from qiskit.ignis.verification.tomography import state_tomography_circuits from qiskit.quantum_info import state_fidelity import sys import importlib sys.path.append("../utils/") import circuit_utils, zne_utils, tomography_utils, sgs_algorithm importlib.reload(circuit_utils) importlib.reload(zne_utils) importlib.reload(tomography_utils) importlib.reload(sgs_algorithm) from circuit_utils import * from zne_utils import * from tomography_utils import * from sgs_algorithm import * # Combine subcircuits into a single multiqubit gate representing a single trotter step num_qubits = 3 # The final time of the state evolution target_time = np.pi # Parameterize variable t to be evaluated at t=pi later dt = Parameter('t') # Convert custom quantum circuit into a gate trot_gate = trotter_gate(dt) # initial layout initial_layout = [5,3,1] # Number of trotter steps num_steps = 100 print("trotter step: ", num_steps) scale_factors = [1.0, 2.0, 3.0] # Initialize quantum circuit for 3 qubits qr = QuantumRegister(num_qubits, name="q") qc = QuantumCircuit(qr) # Prepare initial state (remember we are only evolving 3 of the 7 qubits on jakarta qubits (q_5, q_3, q_1) corresponding to the state |110>) make_initial_state(qc, "110") # DO NOT MODIFY (|q_5,q_3,q_1> = |110>) subspace_encoder_init110(qc, targets=[0, 1, 2]) # encode trotterize(qc, trot_gate, num_steps, targets=[1, 2]) # Simulate time evolution under H_heis3 Hamiltonian subspace_decoder_init110(qc, targets=[0, 1, 2]) # decode # Evaluate simulation at target_time (t=pi) meaning each trotter step evolves pi/trotter_steps in time qc = qc.bind_parameters({dt: target_time / num_steps}) print("created qc") # Generate state tomography circuits to evaluate fidelity of simulation st_qcs = state_tomography_circuits(qc, [0, 1, 2][::-1]) #! state tomography requires === BIG ENDIAN === print("created st_qcs (length:", len(st_qcs), ")") # remove barriers st_qcs = [RemoveBarriers()(qc) for qc in st_qcs] print("removed barriers from st_qcs") # optimize circuit t3_st_qcs = transpile(st_qcs, optimization_level=3, basis_gates=["sx", "cx", "rz"]) t3_st_qcs = transpile(t3_st_qcs, optimization_level=3, basis_gates=["sx", "cx", "rz"]) print("created t3_st_qcs (length:", len(t3_st_qcs), ")") # zne wrapping zne_qcs = zne_wrapper(t3_st_qcs, scale_factors = scale_factors, pt = True) # Pauli Twirling print("created zne_qcs (length:", len(zne_qcs), ")") # optimization_level must be 0 # feed initial_layout here to see the picture of the circuits before casting the job t3_zne_qcs = transpile(zne_qcs, optimization_level=0, basis_gates=["sx", "cx", "rz"], initial_layout=initial_layout) print("created t3_zne_qcs (length:", len(t3_zne_qcs), ")") t3_zne_qcs[-3].draw("mpl") # from qiskit.test.mock import FakeJakarta # backend = FakeJakarta() # backend = Aer.get_backend("qasm_simulator") IBMQ.load_account() provider = IBMQ.get_provider(hub='ibm-q-community', group='ibmquantumawards', project='open-science-22') print("provider:", provider) backend = provider.get_backend("ibmq_jakarta") print(str(backend)) shots = 1 << 13 reps = 8 # unused jobs = [] for _ in range(reps): #! CHECK: run t3_zne_qcs, with optimization_level = 0 and straightforward initial_layout job = execute(t3_zne_qcs, backend, shots=shots, optimization_level=0) print('Job ID', job.job_id()) jobs.append(job) # QREM qr = QuantumRegister(num_qubits, name="calq") meas_calibs, state_labels = complete_meas_cal(qr=qr, circlabel='mcal') # we have to feed initial_layout to calibration matrix cal_job = execute(meas_calibs, backend=backend, shots=shots, optimization_level=3, initial_layout = initial_layout) print('Job ID', cal_job.job_id()) meas_calibs[0].draw("mpl") dt_now = datetime.datetime.now() print(dt_now) filename = "job_ids_" + str(backend) + "_100step_" + dt_now.strftime('%Y%m%d_%H%M%S') + "_.pkl" print(filename) with open("jobs_" + str(backend) + "_100step_" + dt_now.strftime('%Y%m%d_%H%M%S') + "_.pkl", "wb") as f: pickle.dump({"jobs": jobs, "cal_job": cal_job}, f) with open(filename, "wb") as f: pickle.dump({"job_ids": [job.job_id() for job in jobs], "cal_job_id": cal_job.job_id()}, f) with open("properties_" + str(backend) + "_" + dt_now.strftime('%Y%m%d_%H%M%S') + "_.pkl", "wb") as f: pickle.dump(backend.properties(), f) filename = "job_ids_ibmq_jakarta_100step_20220413_030821_.pkl" # change here with open(filename, "rb") as f: job_ids_dict = pickle.load(f) job_ids = job_ids_dict["job_ids"] cal_job_id = job_ids_dict["cal_job_id"] retrieved_jobs = [] for job_id in job_ids: retrieved_jobs.append(backend.retrieve_job(job_id)) retrieved_cal_job = backend.retrieve_job(cal_job_id) cal_results = retrieved_cal_job.result() meas_fitter = CompleteMeasFitter(cal_results, state_labels, circlabel='mcal') target_state = (One^One^Zero).to_matrix() # DO NOT CHANGE!!! fids = [] for job in retrieved_jobs: mit_results = meas_fitter.filter.apply(job.result()) zne_expvals = zne_decoder(num_qubits, mit_results, scale_factors = scale_factors) rho = expvals_to_valid_rho(num_qubits, zne_expvals) fid = state_fidelity(rho, target_state) fids.append(fid) print('state tomography fidelity = {:.4f} \u00B1 {:.4f}'.format(np.mean(fids), np.std(fids))) import qiskit.tools.jupyter %qiskit_version_table
https://github.com/2lambda123/Qiskit-qiskit
2lambda123
# This code is part of Qiskit. # # (C) Copyright IBM 2017, 2023. # # This code is licensed under the Apache License, Version 2.0. You may # obtain a copy of this license in the LICENSE.txt file in the root directory # of this source tree or at http://www.apache.org/licenses/LICENSE-2.0. # # Any modifications or derivative works of this code must retain this # copyright notice, and modified files need to carry a notice indicating # that they have been altered from the originals. """Contains functions used by the basic provider simulators. """ from __future__ import annotations from string import ascii_uppercase, ascii_lowercase import numpy as np import qiskit.circuit.library.standard_gates as gates from qiskit.exceptions import QiskitError # Single qubit gates supported by ``single_gate_params``. SINGLE_QUBIT_GATES = { "U": gates.UGate, "u": gates.UGate, "u1": gates.U1Gate, "u2": gates.U2Gate, "u3": gates.U3Gate, "h": gates.HGate, "p": gates.PhaseGate, "s": gates.SGate, "sdg": gates.SdgGate, "sx": gates.SXGate, "sxdg": gates.SXdgGate, "t": gates.TGate, "tdg": gates.TdgGate, "x": gates.XGate, "y": gates.YGate, "z": gates.ZGate, "id": gates.IGate, "i": gates.IGate, "r": gates.RGate, "rx": gates.RXGate, "ry": gates.RYGate, "rz": gates.RZGate, } def single_gate_matrix(gate: str, params: list[float] | None = None) -> np.ndarray: """Get the matrix for a single qubit. Args: gate: the single qubit gate name params: the operation parameters op['params'] Returns: array: A numpy array representing the matrix Raises: QiskitError: If a gate outside the supported set is passed in for the ``Gate`` argument. """ if params is None: params = [] if gate in SINGLE_QUBIT_GATES: gc = SINGLE_QUBIT_GATES[gate] else: raise QiskitError("Gate is not a valid basis gate for this simulator: %s" % gate) return gc(*params).to_matrix() # Two qubit gates WITHOUT parameters: name -> matrix TWO_QUBIT_GATES = { "CX": gates.CXGate().to_matrix(), "cx": gates.CXGate().to_matrix(), "ecr": gates.ECRGate().to_matrix(), "cy": gates.CYGate().to_matrix(), "cz": gates.CZGate().to_matrix(), "swap": gates.SwapGate().to_matrix(), "iswap": gates.iSwapGate().to_matrix(), "ch": gates.CHGate().to_matrix(), "cs": gates.CSGate().to_matrix(), "csdg": gates.CSdgGate().to_matrix(), "csx": gates.CSXGate().to_matrix(), "dcx": gates.DCXGate().to_matrix(), } # Two qubit gates WITH parameters: name -> class TWO_QUBIT_GATES_WITH_PARAMETERS = { "cp": gates.CPhaseGate, "crx": gates.CRXGate, "cry": gates.CRYGate, "crz": gates.CRZGate, "cu": gates.CUGate, "cu1": gates.CU1Gate, "cu3": gates.CU3Gate, "rxx": gates.RXXGate, "ryy": gates.RYYGate, "rzz": gates.RZZGate, "rzx": gates.RZXGate, "xx_minus_yy": gates.XXMinusYYGate, "xx_plus_yy": gates.XXPlusYYGate, } # Three qubit gates: name -> matrix THREE_QUBIT_GATES = { "ccx": gates.CCXGate().to_matrix(), "ccz": gates.CCZGate().to_matrix(), "rccx": gates.RCCXGate().to_matrix(), "cswap": gates.CSwapGate().to_matrix(), } def einsum_matmul_index(gate_indices: list[int], number_of_qubits: int) -> str: """Return the index string for Numpy.einsum matrix-matrix multiplication. The returned indices are to perform a matrix multiplication A.B where the matrix A is an M-qubit matrix, matrix B is an N-qubit matrix, and M <= N, and identity matrices are implied on the subsystems where A has no support on B. Args: gate_indices (list[int]): the indices of the right matrix subsystems to contract with the left matrix. number_of_qubits (int): the total number of qubits for the right matrix. Returns: str: An indices string for the Numpy.einsum function. """ mat_l, mat_r, tens_lin, tens_lout = _einsum_matmul_index_helper(gate_indices, number_of_qubits) # Right indices for the N-qubit input and output tensor tens_r = ascii_uppercase[:number_of_qubits] # Combine indices into matrix multiplication string format # for numpy.einsum function return f"{mat_l}{mat_r}, {tens_lin}{tens_r}->{tens_lout}{tens_r}" def einsum_vecmul_index(gate_indices: list[int], number_of_qubits: int) -> str: """Return the index string for Numpy.einsum matrix-vector multiplication. The returned indices are to perform a matrix multiplication A.v where the matrix A is an M-qubit matrix, vector v is an N-qubit vector, and M <= N, and identity matrices are implied on the subsystems where A has no support on v. Args: gate_indices (list[int]): the indices of the right matrix subsystems to contract with the left matrix. number_of_qubits (int): the total number of qubits for the right matrix. Returns: str: An indices string for the Numpy.einsum function. """ mat_l, mat_r, tens_lin, tens_lout = _einsum_matmul_index_helper(gate_indices, number_of_qubits) # Combine indices into matrix multiplication string format # for numpy.einsum function return f"{mat_l}{mat_r}, {tens_lin}->{tens_lout}" def _einsum_matmul_index_helper( gate_indices: list[int], number_of_qubits: int ) -> tuple[str, str, str, str]: """Return the index string for Numpy.einsum matrix multiplication. The returned indices are to perform a matrix multiplication A.v where the matrix A is an M-qubit matrix, matrix v is an N-qubit vector, and M <= N, and identity matrices are implied on the subsystems where A has no support on v. Args: gate_indices (list[int]): the indices of the right matrix subsystems to contract with the left matrix. number_of_qubits (int): the total number of qubits for the right matrix. Returns: tuple: (mat_left, mat_right, tens_in, tens_out) of index strings for that may be combined into a Numpy.einsum function string. Raises: QiskitError: if the total number of qubits plus the number of contracted indices is greater than 26. """ # Since we use ASCII alphabet for einsum index labels we are limited # to 26 total free left (lowercase) and 26 right (uppercase) indexes. # The rank of the contracted tensor reduces this as we need to use that # many characters for the contracted indices if len(gate_indices) + number_of_qubits > 26: raise QiskitError("Total number of free indexes limited to 26") # Indices for N-qubit input tensor tens_in = ascii_lowercase[:number_of_qubits] # Indices for the N-qubit output tensor tens_out = list(tens_in) # Left and right indices for the M-qubit multiplying tensor mat_left = "" mat_right = "" # Update left indices for mat and output for pos, idx in enumerate(reversed(gate_indices)): mat_left += ascii_lowercase[-1 - pos] mat_right += tens_in[-1 - idx] tens_out[-1 - idx] = ascii_lowercase[-1 - pos] tens_out = "".join(tens_out) # Combine indices into matrix multiplication string format # for numpy.einsum function return mat_left, mat_right, tens_in, tens_out
https://github.com/qiskit-community/qiskit-translations-staging
qiskit-community
import numpy as np from qiskit import QuantumRegister, ClassicalRegister, QuantumCircuit from qiskit.circuit.library import QFT def create_qpe_circuit(theta, num_qubits): '''Creates a QPE circuit given theta and num_qubits.''' # Step 1: Create a circuit with two quantum registers and one classical register. first = QuantumRegister(size=num_qubits, name='first') # the first register for phase estimation second = QuantumRegister(size=1, name='second') # the second register for storing eigenvector |psi> classical = ClassicalRegister(size=num_qubits, name='readout') # classical register for readout qpe_circuit = QuantumCircuit(first, second, classical) # Step 2: Initialize the qubits. # All qubits are initialized in |0> by default, no extra code is needed to initialize the first register. qpe_circuit.x(second) # Initialize the second register with state |psi>, which is |1> in this example. # Step 3: Create superposition in the first register. qpe_circuit.barrier() # Add barriers to separate each step of the algorithm for better visualization. qpe_circuit.h(first) # Step 4: Apply a controlled-U^(2^j) black box. qpe_circuit.barrier() for j in range(num_qubits): qpe_circuit.cp(theta*2*np.pi*(2**j), j, num_qubits) # Theta doesn't contain the 2 pi factor. # Step 5: Apply an inverse QFT to the first register. qpe_circuit.barrier() qpe_circuit.compose(QFT(num_qubits, inverse=True), inplace=True) # Step 6: Measure the first register. qpe_circuit.barrier() qpe_circuit.measure(first, classical) return qpe_circuit num_qubits = 4 qpe_circuit_fixed_phase = create_qpe_circuit(1/2, num_qubits) # Create a QPE circuit with fixed theta=1/2. qpe_circuit_fixed_phase.draw('mpl') from qiskit.circuit import Parameter theta = Parameter('theta') # Create a parameter `theta` whose values can be assigned later. qpe_circuit_parameterized = create_qpe_circuit(theta, num_qubits) qpe_circuit_parameterized.draw('mpl') number_of_phases = 21 phases = np.linspace(0, 2, number_of_phases) individual_phases = [[ph] for ph in phases] # Phases need to be expressed as a list of lists. from qiskit_ibm_runtime import QiskitRuntimeService service = QiskitRuntimeService() backend = "ibmq_qasm_simulator" # use the simulator from qiskit_ibm_runtime import Sampler, Session with Session(service=service, backend=backend): results = Sampler().run( [qpe_circuit_parameterized]*len(individual_phases), parameter_values=individual_phases ).result() from qiskit.tools.visualization import plot_histogram idx = 6 plot_histogram(results.quasi_dists[idx].binary_probabilities(), legend=[f'$\\theta$={phases[idx]:.3f}']) def most_likely_bitstring(results_dict): '''Finds the most likely outcome bit string from a result dictionary.''' return max(results_dict, key=results_dict.get) def find_neighbors(bitstring): '''Finds the neighbors of a bit string. Example: For bit string '1010', this function returns ('1001', '1011') ''' if bitstring == len(bitstring)*'0': neighbor_left = len(bitstring)*'1' else: neighbor_left = format((int(bitstring,2)-1), '0%sb'%len(bitstring)) if bitstring == len(bitstring)*'1': neighbor_right = len(bitstring)*'0' else: neighbor_right = format((int(bitstring,2)+1), '0%sb'%len(bitstring)) return (neighbor_left, neighbor_right) def estimate_phase(results_dict): '''Estimates the phase from a result dictionary of a QPE circuit.''' # Find the most likely outcome bit string N1 and its neighbors. num_1_key = most_likely_bitstring(results_dict) neighbor_left, neighbor_right = find_neighbors(num_1_key) # Get probabilities of N1 and its neighbors. num_1_prob = results_dict.get(num_1_key) neighbor_left_prob = results_dict.get(neighbor_left) neighbor_right_prob = results_dict.get(neighbor_right) # Find the second most likely outcome N2 and its probability P2 among the neighbors. if neighbor_left_prob is None: # neighbor_left doesn't exist if neighbor_right_prob is None: # both neighbors don't exist, N2 is N1 num_2_key = num_1_key num_2_prob = num_1_prob else: # If only neighbor_left doesn't exist, N2 is neighbor_right. num_2_key = neighbor_right num_2_prob = neighbor_right_prob elif neighbor_right_prob is None: # If only neighbor_right doesn't exist, N2 is neighbor_left. num_2_key = neighbor_left num_2_prob = neighbor_left_prob elif neighbor_left_prob > neighbor_right_prob: # Both neighbors exist and neighbor_left has higher probability, so N2 is neighbor_left. num_2_key = neighbor_left num_2_prob = neighbor_left_prob else: # Both neighbors exist and neighbor_right has higher probability, so N2 is neighor_right. num_2_key = neighbor_right num_2_prob = neighbor_right_prob # Calculate the estimated phases for N1 and N2. num_qubits = len(num_1_key) num_1_phase = (int(num_1_key, 2) / 2**num_qubits) num_2_phase = (int(num_2_key, 2) / 2**num_qubits) # Calculate the weighted average phase from N1 and N2. phase_estimated = (num_1_phase * num_1_prob + num_2_phase * num_2_prob) / (num_1_prob + num_2_prob) return phase_estimated qpe_solutions = [] for idx, result_dict in enumerate(results.quasi_dists): qpe_solutions.append(estimate_phase(result_dict.binary_probabilities())) ideal_solutions = np.append( phases[:(number_of_phases-1)//2], # first period np.subtract(phases[(number_of_phases-1)//2:-1], 1) # second period ) ideal_solutions = np.append(ideal_solutions, np.subtract(phases[-1], 2)) # starting point of the third period import matplotlib.pyplot as plt fig = plt.figure(figsize=(10, 6)) plt.plot(phases, ideal_solutions, '--', label='Ideal solutions') plt.plot(phases, qpe_solutions, 'o', label='QPE solutions') plt.title('Quantum Phase Estimation Algorithm') plt.xlabel('Input Phase') plt.ylabel('Output Phase') plt.legend() import qiskit_ibm_runtime qiskit_ibm_runtime.version.get_version_info() import qiskit.tools.jupyter %qiskit_version_table %qiskit_copyright
https://github.com/hamburgerguy/Quantum-Algorithm-Implementations
hamburgerguy
"""Qiskit code for running Simon's algorithm on quantum hardware for 2 qubits and b = '11' """ # importing Qiskit from qiskit import IBMQ, BasicAer from qiskit.providers.ibmq import least_busy from qiskit import QuantumCircuit, execute # import basic plot tools from qiskit.visualization import plot_histogram from qiskit_textbook.tools import simon_oracle #set b equal to '11' b = '11' #1) initialize qubits n = 2 simon_circuit_2 = QuantumCircuit(n*2, n) #2) Apply Hadamard gates before querying the oracle simon_circuit_2.h(range(n)) #3) Query oracle simon_circuit_2 += simon_oracle(b) #5) Apply Hadamard gates to the input register simon_circuit_2.h(range(n)) #3) and 6) Measure qubits simon_circuit_2.measure(range(n), range(n)) # Load saved IBMQ accounts and get the least busy backend device IBMQ.load_account() provider = IBMQ.get_provider(hub='ibm-q') backend = least_busy(provider.backends(filters=lambda x: x.configuration().n_qubits >= n and not x.configuration().simulator and x.status().operational==True)) print("least busy backend: ", backend) # Execute and monitor the job from qiskit.tools.monitor import job_monitor shots = 1024 job = execute(simon_circuit_2, backend=backend, shots=shots, optimization_level=3) job_monitor(job, interval = 2) # Get results and plot counts device_counts = job.result().get_counts() plot_histogram(device_counts) #additionally, function for calculating dot product of results def bdotz(b, z): accum = 0 for i in range(len(b)): accum += int(b[i]) * int(z[i]) return (accum % 2) print('b = ' + b) for z in device_counts: print( '{}.{} = {} (mod 2) ({:.1f}%)'.format(b, z, bdotz(b,z), device_counts[z]*100/shots)) #the most significant results are those for which b dot z=0(mod 2). '''b = 11 11.00 = 0 (mod 2) (45.0%) 11.01 = 1 (mod 2) (6.2%) 11.10 = 1 (mod 2) (6.4%) 11.11 = 0 (mod 2) (42.4%)'''
https://github.com/qiskit-community/qiskit-translations-staging
qiskit-community
from qiskit import QuantumCircuit from qiskit.transpiler.passes import RemoveBarriers circuit = QuantumCircuit(1) circuit.x(0) circuit.barrier() circuit.h(0) circuit = RemoveBarriers()(circuit) circuit.draw('mpl')
https://github.com/ctuning/ck-qiskit
ctuning
# This code is part of Qiskit. # # (C) Copyright IBM 2017. # # This code is licensed under the Apache License, Version 2.0. You may # obtain a copy of this license in the LICENSE.txt file in the root directory # of this source tree or at http://www.apache.org/licenses/LICENSE-2.0. # # Any modifications or derivative works of this code must retain this # copyright notice, and modified files need to carry a notice indicating # that they have been altered from the originals. """ Quantum teleportation example. Note: if you have only cloned the Qiskit repository but not used `pip install`, the examples only work from the root directory. """ from qiskit import QuantumRegister, ClassicalRegister, QuantumCircuit from qiskit import BasicAer from qiskit import execute ############################################################### # Set the backend name and coupling map. ############################################################### coupling_map = [[0, 1], [0, 2], [1, 2], [3, 2], [3, 4], [4, 2]] backend = BasicAer.get_backend("qasm_simulator") ############################################################### # Make a quantum program for quantum teleportation. ############################################################### q = QuantumRegister(3, "q") c0 = ClassicalRegister(1, "c0") c1 = ClassicalRegister(1, "c1") c2 = ClassicalRegister(1, "c2") qc = QuantumCircuit(q, c0, c1, c2, name="teleport") # Prepare an initial state qc.u(0.3, 0.2, 0.1, q[0]) # Prepare a Bell pair qc.h(q[1]) qc.cx(q[1], q[2]) # Barrier following state preparation qc.barrier(q) # Measure in the Bell basis qc.cx(q[0], q[1]) qc.h(q[0]) qc.measure(q[0], c0[0]) qc.measure(q[1], c1[0]) # Apply a correction qc.barrier(q) qc.z(q[2]).c_if(c0, 1) qc.x(q[2]).c_if(c1, 1) qc.measure(q[2], c2[0]) ############################################################### # Execute. # Experiment does not support feedback, so we use the simulator ############################################################### # First version: not mapped initial_layout = {q[0]: 0, q[1]: 1, q[2]: 2} job = execute(qc, backend=backend, coupling_map=None, shots=1024, initial_layout=initial_layout) result = job.result() print(result.get_counts(qc)) # Second version: mapped to 2x8 array coupling graph job = execute( qc, backend=backend, coupling_map=coupling_map, shots=1024, initial_layout=initial_layout ) result = job.result() print(result.get_counts(qc)) # Both versions should give the same distribution
https://github.com/Tojarieh97/VQE
Tojarieh97
%load_ext autoreload %autoreload 2 import nbimporter from typing import Dict, Tuple, List import numpy as np from tqdm import tqdm QUBITS_NUM = 4 N = 2**QUBITS_NUM NUM_SHOTS = 1024 NUM_ITERATIONS = 100 CIRCUIT_DEPTH = 3 PARAMS_NUM = 2*QUBITS_NUM*(CIRCUIT_DEPTH+1) from qiskit import Aer from qiskit.utils import QuantumInstance, algorithm_globals seed = 50 algorithm_globals.random_seed = seed simulator_backend = Aer.get_backend('qasm_simulator') from scipy.optimize import minimize from linear_entangelment_and_full_entangelment_ansatz_circuits import * def get_ansatz_state(thetas, ansatz_entangelment, input_state): if ansatz_entangelment=="full": return get_full_entangelment_ansatz(QUBITS_NUM, thetas, input_state) if ansatz_entangelment=="linear": return get_linear_entangelment_ansatz(QUBITS_NUM, thetas, input_state) def transfrom_hamiltonian_into_pauli_strings(hamiltonian) -> List: pauli_operators = hamiltonian.to_pauli_op().settings['oplist'] pauli_coeffs = list(map(lambda pauli_operator: pauli_operator.coeff, pauli_operators)) pauli_strings = list(map(lambda pauli_operator: pauli_operator.primitive, pauli_operators)) return pauli_coeffs, pauli_strings from qiskit.circuit.library.standard_gates import HGate, SGate from qiskit import QuantumCircuit, ClassicalRegister, QuantumRegister reducing_to_pauli_z_mapping = { 'I': 'I', 'Z': 'Z', 'X': 'Z', 'Y': 'Z' } def reduce_pauli_matrixes_into_sigma_z(pauli_string) -> str: reduced_pauli_string = "" for matrix_index in range(QUBITS_NUM): pauli_matrix = str(pauli_string[matrix_index]) reduced_pauli_matrix = reducing_to_pauli_z_mapping[pauli_matrix] reduced_pauli_string = reduced_pauli_matrix + reduced_pauli_string return reduced_pauli_string def add_layer_of_gates_for_reducing_paulis_to_sigma_z(pauli_string, quantum_circuit): quantum_registers = QuantumRegister(QUBITS_NUM, name="qubit") additional_circuit_layer = QuantumCircuit(quantum_registers) for quantum_register_index, pauli_matrix in enumerate(pauli_string): if pauli_matrix == "X": additional_circuit_layer.append(HGate(), [quantum_registers[quantum_register_index]]) if pauli_string == "Y": additional_circuit_layer.append(HGate(), [quantum_registers[quantum_register_index]]) additional_circuit_layer.append(SGate(), [quantum_registers[quantum_register_index]]) extended_quantum_circuit = quantum_circuit.compose(additional_circuit_layer) return extended_quantum_circuit def get_probability_distribution(counts: Dict) -> Dict: proba_distribution = {state: (count / NUM_SHOTS) for state, count in counts.items()} return proba_distribution def calculate_probabilities_of_measurments_in_computational_basis(quantum_state_circuit) -> Dict: quantum_state_circuit.measure_all() transpiled_quantum_state_circuit = transpile(quantum_state_circuit, simulator_backend) Qobj = assemble(transpiled_quantum_state_circuit) result = simulator_backend.run(Qobj).result() counts = result.get_counts(quantum_state_circuit) return get_probability_distribution(counts) def sort_probas_dict_by_qubits_string_keys(proba_distribution: Dict) -> Dict: return dict(sorted(proba_distribution.items())) def reset_power_of_minus_1(power_of_minus_1): power_of_minus_1 = 0 return power_of_minus_1 def convert_pauli_string_into_str(pauli_string) -> str: return str(pauli_string) def calculate_expectation_value_of_pauli_string_by_measurments_probas(pauli_string, ansatz_circuit): pauli_string_expectation_value = 0 power_of_minus_1 = 0 pauli_string_str = convert_pauli_string_into_str(pauli_string) extended_ansatz_circuit = add_layer_of_gates_for_reducing_paulis_to_sigma_z(pauli_string_str, ansatz_circuit) probas_distribution = calculate_probabilities_of_measurments_in_computational_basis(extended_ansatz_circuit) reduced_pauli_string = reduce_pauli_matrixes_into_sigma_z(pauli_string) sorted_probas_distribuition = sort_probas_dict_by_qubits_string_keys(probas_distribution) for qubits_string, proba in sorted_probas_distribuition.items(): for string_index in range(QUBITS_NUM): if(str(qubits_string[string_index])=="1" and str(reduced_pauli_string[string_index])=="Z"): power_of_minus_1 += 1 pauli_string_expectation_value += pow(-1, power_of_minus_1)*proba power_of_minus_1 = reset_power_of_minus_1(power_of_minus_1) return pauli_string_expectation_value def get_expectation_value(ansatz_circuit, pauli_coeffs, pauli_strings): total_expection_value = 0 for pauli_coeff, pauli_string in tqdm(zip(pauli_coeffs, pauli_strings)): total_expection_value += pauli_coeff*calculate_expectation_value_of_pauli_string_by_measurments_probas( pauli_string, ansatz_circuit) return total_expection_value from qiskit import assemble, transpile def cost_function(thetas, hamiltonian, ansatz_entangelment): initial_eigenvector = np.identity(N)[0] pauli_coeffs, pauli_strings = transfrom_hamiltonian_into_pauli_strings(hamiltonian) ansatz_state = get_ansatz_state(thetas, ansatz_entangelment, initial_eigenvector) L = get_expectation_value(ansatz_state, pauli_coeffs, pauli_strings) insert_approximated_energy_to_list_of_all_approximated_energies(L) return L def get_optimal_thetas_of_ansatz_circuit_for_hamiltonian(hamiltonian, ansatz_entangelment): initial_thetas = np.random.uniform(low=0, high=2*np.pi, size=PARAMS_NUM) optimizer_result = minimize(cost_function, x0=initial_thetas, args=(hamiltonian, ansatz_entangelment), method="CG", options={"maxiter":NUM_ITERATIONS, "disp": True}) optimal_thetas = optimizer_result.x return optimal_thetas def get_approximated_eigenvalue_of_hamiltonian(hamiltonian, ansatz_entangelment): optimal_thetas = get_optimal_thetas_of_ansatz_circuit_for_hamiltonian(hamiltonian, ansatz_entangelment) print(optimal_thetas) initial_eigenvector = np.identity(N)[0] optimal_ansatz_state = get_ansatz_state(optimal_thetas, ansatz_entangelment, initial_eigenvector) pauli_coeffs, pauli_strings = transfrom_hamiltonian_into_pauli_strings(hamiltonian) approximated_eigenvalue = get_expectation_value(optimal_ansatz_state, pauli_coeffs, pauli_strings) return approximated_eigenvalue from numpy import linalg as LA def get_approximation_error(exact_eigenvalue, approximated_eigenvalue): return abs(abs(exact_eigenvalue)-abs(approximated_eigenvalue))/abs(exact_eigenvalue) def get_minimum_exact_eigenvalue_of_hamiltonian(hamiltonian): eigen_values = LA.eigvals(hamiltonian.to_matrix()) print(sorted(eigen_values)) return min(sorted(eigen_values)) def compare_exact_and_approximated_eigenvalue(hamiltonian, approximated_eigenvalue): exact_eigenvalue = get_minimum_exact_eigenvalue_of_hamiltonian(hamiltonian) print("Exact Eigenvalue:") print(exact_eigenvalue) print("\nApproximated Eigenvalue:") print(approximated_eigenvalue) print("\nApproximation Error") print(get_approximation_error(exact_eigenvalue, approximated_eigenvalue)) plot_convergence_of_optimization_process(approximated_energies, exact_eigenvalue, margin=3) approximated_energies = [] def insert_approximated_energy_to_list_of_all_approximated_energies(energy): approximated_energies.append(energy) import matplotlib.pyplot as plt def plot_convergence_of_optimization_process(approximated_energies, exact_eigenvalue, margin): plt.title("convergence of optimization process to the exact eigenvalue") plt.margins(0, margin) plt.plot(approximated_energies[-NUM_ITERATIONS:]) plt.axhline(y = exact_eigenvalue, color = 'r', linestyle = '-') plt.grid() plt.xlabel("# of iterations") plt.ylabel("Energy") def plot_fidelity(): plt.plot(LiH_approximated_energies) plt.xlabel("# of iterations") plt.ylabel("Energy") from qiskit.opflow import X, Z, I, H, Y LiH_molecule_4_qubits = -7.49894690201071*(I^I^I^I) + \ -0.0029329964409502266*(X^X^Y^Y) + \ 0.0029329964409502266*(X^Y^Y^X) + \ 0.01291078027311749*(X^Z^X^I) + \ -0.0013743761078958677*(X^Z^X^Z) + \ 0.011536413200774975*(X^I^X^I) + \ 0.0029329964409502266*(Y^X^X^Y) + \ -0.0029329964409502266*(Y^Y^X^X) + \ 0.01291078027311749*(Y^Z^Y^I) + \ -0.0013743761078958677*(Y^Z^Y^Z) + \ 0.011536413200774975*(Y^I^Y^I) + \ 0.16199475388004184*(Z^I^I^I) + \ 0.011536413200774975*(Z^X^Z^X) + \ 0.011536413200774975*(Z^Y^Z^Y) + \ 0.12444770133137588*(Z^Z^I^I) + \ 0.054130445793298836*(Z^I^Z^I) + \ 0.05706344223424907*(Z^I^I^Z) + \ 0.012910780273117487*(I^X^Z^X) + \ -0.0013743761078958677*(I^X^I^X) + \ 0.012910780273117487*(I^Y^Z^Y) + \ -0.0013743761078958677*(I^Y^I^Y) + \ 0.16199475388004186*(I^Z^I^I) + \ 0.05706344223424907*(I^Z^Z^I) + \ 0.054130445793298836*(I^Z^I^Z) + \ -0.013243698330265966*(I^I^Z^I) + \ 0.08479609543670981*(I^I^Z^Z) + \ -0.013243698330265952*(I^I^I^Z) %%time LiH_approximated_eigenvalue = get_approximated_eigenvalue_of_hamiltonian(LiH_molecule_4_qubits, "linear") compare_exact_and_approximated_eigenvalue(LiH_molecule_4_qubits, LiH_approximated_eigenvalue) %%time LiH_approximated_eigenvalue = get_approximated_eigenvalue_of_hamiltonian(LiH_molecule_4_qubits, "full") compare_exact_and_approximated_eigenvalue(LiH_molecule_4_qubits, LiH_approximated_eigenvalue) H2_molecule_Hamiltonian_4_qubits = -0.8105479805373279 * (I^I^I^I) \ + 0.1721839326191554 * (I^I^I^Z) \ - 0.22575349222402372 * (I^I^Z^I) \ + 0.17218393261915543 * (I^Z^I^I) \ - 0.2257534922240237 * (Z^I^I^I) \ + 0.12091263261776627 * (I^I^Z^Z) \ + 0.16892753870087907 * (I^Z^I^Z) \ + 0.045232799946057826 * (Y^Y^Y^Y) \ + 0.045232799946057826 * (X^X^Y^Y) \ + 0.045232799946057826 * (Y^Y^X^X) \ + 0.045232799946057826 * (X^X^X^X) \ + 0.1661454325638241 * (Z^I^I^Z) \ + 0.1661454325638241 * (I^Z^Z^I) \ + 0.17464343068300453 * (Z^I^Z^I) \ + 0.12091263261776627 * (Z^Z^I^I) %%time H2_approximated_eigenvalue = get_approximated_eigenvalue_of_hamiltonian(H2_molecule_Hamiltonian_4_qubits, "linear") compare_exact_and_approximated_eigenvalue(H2_molecule_Hamiltonian_4_qubits, H2_approximated_eigenvalue) %%time H2_approximated_eigenvalue = get_approximated_eigenvalue_of_hamiltonian(H2_molecule_Hamiltonian_4_qubits, "full") compare_exact_and_approximated_eigenvalue(H2_molecule_Hamiltonian_4_qubits, H2_approximated_eigenvalue) transverse_ising_4_qubits = 0.0 * (I^I^I^I) \ + 0.8398088405253477 * (X^I^I^I) \ + 0.7989496312070936 * (I^X^I^I) \ + 0.38189710487113193 * (Z^Z^I^I) \ + 0.057753122422666725 * (I^I^X^I) \ + 0.5633292636970458 * (Z^I^Z^I) \ + 0.3152740621483513 * (I^Z^Z^I) \ + 0.07209487981989715 * (I^I^I^X) \ + 0.17892334004292654 * (Z^I^I^Z) \ + 0.2273896497668042 * (I^Z^I^Z) \ + 0.09762902934216211 * (I^I^Z^Z) %%time TI_approximated_eigenvalue = get_approximated_eigenvalue_of_hamiltonian(transverse_ising_4_qubits, "linear") compare_exact_and_approximated_eigenvalue(transverse_ising_4_qubits, TI_approximated_eigenvalue) %%time TI_approximated_eigenvalue = get_approximated_eigenvalue_of_hamiltonian(transverse_ising_4_qubits, "full") compare_exact_and_approximated_eigenvalue(transverse_ising_4_qubits, TI_approximated_eigenvalue) QUBITS_NUM = 3 N = 2**QUBITS_NUM NUM_SHOTS = 1024 NUM_ITERATIONS = 1000 CIRCUIT_DEPTH = 3 PARAMS_NUM = 2*QUBITS_NUM*(CIRCUIT_DEPTH+1) from qiskit.opflow import X, Z, I transverse_ising_3_qubits = 0.0 * (I^I^I) \ + 0.012764169333459807 * (X^I^I) \ + 0.7691573729160869 * (I^X^I) \ + 0.398094746026449 * (Z^Z^I) \ + 0.15250261906586637 * (I^I^X) \ + 0.2094051920882264 * (Z^I^Z) \ + 0.5131291860752999 * (I^Z^Z) %%time TI_approximated_eigenvalue = get_approximated_eigenvalue_of_hamiltonian(transverse_ising_3_qubits, "linear") compare_exact_and_approximated_eigenvalue(transverse_ising_3_qubits, TI_approximated_eigenvalue) %%time TI_approximated_eigenvalue = get_approximated_eigenvalue_of_hamiltonian(transverse_ising_3_qubits, "full") compare_exact_and_approximated_eigenvalue(transverse_ising_3_qubits, TI_approximated_eigenvalue) QUBITS_NUM = 2 N = 2**QUBITS_NUM NUM_SHOTS = 1024 NUM_ITERATIONS = 1000 CIRCUIT_DEPTH = 3 PARAMS_NUM = 2*QUBITS_NUM*(CIRCUIT_DEPTH+1) transverse_ising_2_qubits = 0.13755727363376802 * (I^X) \ + 0.43305656297810435 * (X^I) \ + 0.8538597608997253 * (Z^Z) %%time TI_approximated_eigenvalue = get_approximated_eigenvalue_of_hamiltonian(transverse_ising_2_qubits, "linear") compare_exact_and_approximated_eigenvalue(transverse_ising_2_qubits, TI_approximated_eigenvalue) %%time TI_approximated_eigenvalue = get_approximated_eigenvalue_of_hamiltonian(transverse_ising_2_qubits, "full") compare_exact_and_approximated_eigenvalue(transverse_ising_2_qubits, TI_approximated_eigenvalue) from qiskit.opflow import X, Z, I H2_molecule_Hamiltonian_2_qubits = -0.5053051899926562*(I^I) + \ -0.3277380754984016*(Z^I) + \ 0.15567463610622564*(Z^Z) + \ -0.3277380754984016*(I^Z) %%time H2_approximated_eigenvalue = get_approximated_eigenvalue_of_hamiltonian(H2_molecule_Hamiltonian_2_qubits, "linear") compare_exact_and_approximated_eigenvalue(H2_molecule_Hamiltonian_2_qubits, H2_approximated_eigenvalue) %%time H2_approximated_eigenvalue = get_approximated_eigenvalue_of_hamiltonian(H2_molecule_Hamiltonian_2_qubits, "full") compare_exact_and_approximated_eigenvalue(H2_molecule_Hamiltonian_2_qubits, H2_approximated_eigenvalue)
https://github.com/rubenandrebarreiro/ibm-qiskit-global-summer-school-2023
rubenandrebarreiro
# import the quantum circuit and the quantum register # from the IBM's Qiskit library from qiskit import QuantumCircuit, QuantumRegister # import the Sparse Pauli operator from # the IBM's Qiskit quantum information module from qiskit.quantum_info import SparsePauliOp # defome the function to generate a Sparse Pauli operator # for the Heisenberg's Hamiltonian def heisenberg_hamiltonian( length: int, jx: float = 1.0, jy: float = 0.0, jz: float = 0.0 ) -> SparsePauliOp: # create an empty list for the terms terms = [] # for each index ranged for the number of qubits on # the Heisenberg's Hamiltonian for i in range( ( length - 1 ) ): # if it is pretended to append a XX operator term to # the Heisenberg's Hamiltonian operator if jx: # append a XX operator term to # the Heisenberg's Hamiltonian operator terms.append( ( "XX", [i, i + 1], jx ) ) # if it is pretended to append a YY operator term to # the Heisenberg's Hamiltonian operator if jy: # append a YY operator term to # the Heisenberg's Hamiltonian operator terms.append( ( "YY", [i, i + 1], jy ) ) # if it is pretended to append a ZZ operator term to # the Heisenberg's Hamiltonian operator if jz: # append a ZZ operator term to # the Heisenberg's Hamiltonian operator terms.append( ( "ZZ", [i, i + 1], jz ) ) # return the Sparse Pauli operator # for the Heisenberg's Hamiltonian return SparsePauliOp.from_sparse_list(terms, num_qubits=length) # define a function to generate the quantum circuit for the state preparation def state_prep_circuit( num_qubits: int, layers: int = 1 ) -> QuantumCircuit: # create a quantum register with the number of qubits pretended qubits = QuantumRegister(num_qubits, name="q") # create a quantum circuit with the quantum register defined before circuit = QuantumCircuit(qubits) # apply a Hadamard gate to # the quantum circuit, on all the qubits circuit.h(qubits) # for each layer of the quantum circuit for _ in range(layers): # for each 2n-th qubit for i in range(0, ( num_qubits - 1 ), 2): # apply a CX/CNOT gate to # the quantum circuit, # with control on the current qubit # and target on the next qubit circuit.cx( qubits[i], qubits[ ( i + 1 ) ] ) # apply a RY (Rotation-Y) gate to # the quantum circuit, on the 1st qubit, # with the theta angle equal to 0.1 # on all the qubits circuit.ry( 0.1, qubits ) # for each (2n + 1)-th qubit for i in range(1, ( num_qubits - 1 ), 2): # apply a CX/CNOT gate to # the quantum circuit, # with control on the current qubit # and target on the next qubit circuit.cx( qubits[i], qubits[ ( i + 1 ) ] ) # apply a RY (Rotation-Y) gate to # the quantum circuit, on the 1st qubit, # with the theta angle equal to 0.1 # on all the qubits circuit.ry(0.1, qubits) # return the quantum circuit for the state preparation return circuit # define the number of qubits for # the Heisenberg's Hamiltonian operator and # for the state preparation quantum circuit length = 5 # create the Heisenberg's Hamiltonian operator # for the number of qubits defined before hamiltonian = heisenberg_hamiltonian( length, 1.0, 1.0 ) # create the state preparation quantum circuit # for the number of qubits defined before circuit = state_prep_circuit( length, layers=2 ) # print the Heisenberg's Hamiltonian operator print(hamiltonian) # draw the quantum circuit implementing # a state preparation circuit.draw("mpl") # import estimator from IBM's Qiskit # Aer primitives module from qiskit_aer.primitives import Estimator # create an Estimator object with approximation estimator = Estimator( approximation=True ) # create a job for the quantum circuit implementing # the Heisenberg's Hamiltonian, running the Estimator job = estimator.run( circuit, hamiltonian, shots=None ) # retrieve the results of the job ran by # the Estimator created before, # that was ran on the quantum circuit # implementing the Heisenberg's Hamiltonian result = job.result() # retrieve the exact expectation value (energy) # from the results of the job ran by # the Estimator created before, # that was ran on the quantum circuit # implementing the Heisenberg's Hamiltonian exact_value = result.values[0] # print the exact expectation value (energy) # from the results of the job ran by # the Estimator created before, # that was ran on the quantum circuit # implementing the Heisenberg's Hamiltonian print( f"Exact energy: {exact_value}" ) # import the IBM's Qiskit Runtime Service # from the Qiskit IBM's Runtime from qiskit_ibm_runtime import QiskitRuntimeService # define the hub for the IBM's Qiskit # Runtime Service hub = "ibm-q-internal" # define the group for the IBM's Qiskit # Runtime Service group = "deployed" # define the project for the IBM's Qiskit # Runtime Service project = "default" # create an IBM's Qiskit Runtime Service service = QiskitRuntimeService(instance=f"{hub}/{group}/{project}") # import the estimator, options and session # for quantum simulations from the Qiskit IBM Runtime module from qiskit_ibm_runtime import Estimator, Options, Session # import the coupling map from # the IBM's Qiskit Transpiler module from qiskit.transpiler import CouplingMap # define the backend to run the quantum simulation # to run in the backend, using the IBM's Qiskit Runtime backend = service.get_backend("simulator_statevector") # set the options for the quantum simulation # to run in the backend, using the IBM's Qiskit Runtime simulator = { "basis_gates": ["id", "rz", "sx", "cx", "reset"], "coupling_map": list(CouplingMap.from_line(length + 1)), } # define the number of shots for the quantum simulation # to run in the backend, using the IBM's Qiskit Runtime shots = 10000 # import the built-in math module import math # define the options for the quantum simulation # to run in the backend, using the IBM's Qiskit Runtime, # with a resilience level of 0 (zero) options = Options( simulator=simulator, resilience_level=0, ) # within the context of a session of the IBM's Qiskit Runtime with Session( service=service, backend=backend ): # create an estimator object with the options defined before estimator = Estimator(options=options) # create a job for the quantum circuit implementing # the Heisenberg's Hamiltonian, running the Estimator job = estimator.run( circuit, hamiltonian, shots=shots ) # retrieve the results of the job ran by # the Estimator created before, # that was ran on the quantum circuit # implementing the Heisenberg's Hamiltonian result = job.result() # retrieve the values of the results of # the job ran by the Estimator created before, # that was ran on the quantum circuit # implementing the Heisenberg's Hamiltonian experiment_value = result.values[0] # compute the error as the distance between # the experiment value and the exact value error = abs(experiment_value - exact_value) # retrieve the variance from the results of # the job ran by the Estimator created before, # that was ran on the quantum circuit # implementing the Heisenberg's Hamiltonian variance = result.metadata[0]["variance"] # compute the standard deviation of the results of # the job ran by the Estimator created before, # that was ran on the quantum circuit # implementing the Heisenberg's Hamiltonian std = math.sqrt( variance / shots ) # print the statistics for the estimated energy, # the energy error, the variance, and the standard error print(f"Estimated energy: {experiment_value}") print(f"Energy error: {error}") print(f"Variance: {variance}") print(f"Standard error: {std}") # import the noise model and the readout error # from the IBM's Qiskit Aer Noise module from qiskit_aer.noise import NoiseModel, ReadoutError # create a noise model noise_model = NoiseModel() ##### your code here ##### # create the measurement miss-assignments and # correct measurement probabilities # create the measurement miss-assignment # probabilities for the 1st qubit, # for the erroneous measurement outcomes qubit0_p0_given1 = 0.2 qubit0_p1_given0 = 0.5 # create the correct measurement # probabilities for the 1st qubit qubit0_p0_given0 = (1 - qubit0_p0_given1) qubit0_p1_given1 = (1 - qubit0_p1_given0) # create the measurement miss-assignment # probabilities for the remaining qubits k_i, # for the erroneous measurement outcomes qubitk_p0_given1 = 0.02 qubitk_p1_given0 = 0.05 # create the correct measurement # probabilities for the remaining qubits k_i qubitk_p0_given0 = (1 - qubitk_p0_given1) qubitk_p1_given1 = (1 - qubitk_p1_given0) # create the readout error objects # create a readout error for the 1st qubit readout_error_qubit0 = ReadoutError( [ [ qubit0_p0_given0, qubit0_p0_given1 ], [ qubit0_p1_given0, qubit0_p1_given1 ] ] ) # ceeate a readout error for the remaining qubits k_i readout_error_qubitk = ReadoutError( [ [ qubitk_p0_given0, qubitk_p0_given1 ], [ qubitk_p1_given0, qubitk_p1_given1 ] ] ) # add a readout error to the noise model for the 1st qubit noise_model.add_readout_error( readout_error_qubit0, [0] ) # for each of the remaining qubits k_i # note: recall that even though our circuit acts on 5 qubits, # we will initialize a simulator with 6 qubits in order to # later demonstrate the potential effects of qubit choice for k in range( 1, ( length + 1 ) ): # add a readout error to the noise model # for the remaining qubits k_i noise_model.add_readout_error( readout_error_qubitk, [k] ) # print the noise model created before print(noise_model) # submit your answer # import the grader for the exercise 1 of the lab 5 from qc_grader.challenges.qgss_2023 import grade_lab5_ex1 # grade the exercise 1 of the lab 5 grade_lab5_ex1(noise_model) # define the options for the quantum simulation # to run in the backend, using the IBM's Qiskit Runtime, # considering the noise model defined before, # and a resilience level of 0 (zero) options = Options( simulator=dict( noise_model=noise_model, **simulator ), resilience_level=0, transpilation=dict( initial_layout=list( range(length) ) ), ) # within the context of a session of the IBM's Qiskit Runtime with Session( service=service, backend=backend ): # create an estimator object with the options defined before estimator = Estimator(options=options) # create a job for the quantum circuit implementing # the Heisenberg's Hamiltonian, running the Estimator job = estimator.run( circuit, hamiltonian, shots=shots ) # retrieve the results of the job ran by # the Estimator created before, # that was ran on the quantum circuit # implementing the Heisenberg's Hamiltonian result = job.result() # retrieve the values of the results of # the job ran by the Estimator created before, # that was ran on the quantum circuit # implementing the Heisenberg's Hamiltonian experiment_value = result.values[0] # compute the error as the distance between # the experiment value and the exact value error = abs(experiment_value - exact_value) # retrieve the variance from the results of # the job ran by the Estimator created before, # that was ran on the quantum circuit # implementing the Heisenberg's Hamiltonian variance = result.metadata[0]["variance"] # compute the standard deviation of the results of # the job ran by the Estimator created before, # that was ran on the quantum circuit # implementing the Heisenberg's Hamiltonian std = math.sqrt( variance / shots ) # print the statistics for the estimated energy, # the energy error, the variance, and the standard error print(f"Estimated energy: {experiment_value}") print(f"Energy error: {error}") print(f"Variance: {variance}") print(f"Standard error: {std}") # define the options for the quantum simulation # to run in the backend, using the IBM's Qiskit Runtime, # considering the noise model defined before, # and a resilience level of 0 (zero), # but this time, with a layout where # the 1st qubit is not considered options = Options( simulator=dict( noise_model=noise_model, **simulator ), resilience_level=0, transpilation=dict( initial_layout=list( range(1, ( length + 1 ) ) ) ), ) # within the context of a session of the IBM's Qiskit Runtime with Session( service=service, backend=backend ): # create an estimator object with the options defined before estimator = Estimator(options=options) # create a job for the quantum circuit implementing # the Heisenberg's Hamiltonian, running the Estimator job = estimator.run( circuit, hamiltonian, shots=shots ) # retrieve the results of the job ran by # the Estimator created before, # that was ran on the quantum circuit # implementing the Heisenberg's Hamiltonian result = job.result() # retrieve the values of the results of # the job ran by the Estimator created before, # that was ran on the quantum circuit # implementing the Heisenberg's Hamiltonian experiment_value = result.values[0] # compute the error as the distance between # the experiment value and the exact value error = abs(experiment_value - exact_value) # retrieve the variance from the results of # the job ran by the Estimator created before, # that was ran on the quantum circuit # implementing the Heisenberg's Hamiltonian variance = result.metadata[0]["variance"] # compute the standard deviation of the results of # the job ran by the Estimator created before, # that was ran on the quantum circuit # implementing the Heisenberg's Hamiltonian std = math.sqrt( variance / shots ) # print the statistics for the estimated energy, # the energy error, the variance, and the standard error print(f"Estimated energy: {experiment_value}") print(f"Energy error: {error}") print(f"Variance: {variance}") print(f"Standard error: {std}") # define the options for the quantum simulation # to run in the backend, using the IBM's Qiskit Runtime, # considering the noise model defined before, # and a resilience level of 1 (one), # but this time, with a layout where # the 1st qubit is not considered options = Options( simulator=dict( noise_model=noise_model, **simulator ), resilience_level=1, transpilation=dict( initial_layout=list( range( 1, ( length + 1 ) ) ) ), ) # within the context of a session of the IBM's Qiskit Runtime with Session( service=service, backend=backend ): # create an estimator object with the options defined before estimator = Estimator(options=options) # create a job for the quantum circuit implementing # the Heisenberg's Hamiltonian, running the Estimator job = estimator.run( circuit, hamiltonian, shots=shots ) # retrieve the results of the job ran by # the Estimator created before, # that was ran on the quantum circuit # implementing the Heisenberg's Hamiltonian result = job.result() # retrieve the values of the results of # the job ran by the Estimator created before, # that was ran on the quantum circuit # implementing the Heisenberg's Hamiltonian experiment_value = result.values[0] # compute the error as the distance between # the experiment value and the exact value error = abs(experiment_value - exact_value) # retrieve the variance from the results of # the job ran by the Estimator created before, # that was ran on the quantum circuit # implementing the Heisenberg's Hamiltonian variance = result.metadata[0]["variance"] # compute the standard deviation of the results of # the job ran by the Estimator created before, # that was ran on the quantum circuit # implementing the Heisenberg's Hamiltonian std = math.sqrt( variance / shots ) # print the statistics for the estimated energy, # the energy error, the variance, and the standard error print(f"Estimated energy: {experiment_value}") print(f"Energy error: {error}") print(f"Variance: {variance}") print(f"Standard error: {std}") # define the variable for # the new number of shots new_shots: int ##### your code here ##### # define the new number of shots new_shots = 20000 # submit your answer # import the grader for the exercise 2 of the lab 5 from qc_grader.challenges.qgss_2023 import grade_lab5_ex2 # grade the exercise 2 of the lab 5 grade_lab5_ex2(new_shots) # import the noise model and the depolarizing error # from the IBM's Qiskit Aer Noise module from qiskit_aer.noise import depolarizing_error # creata a noise model noise_model = NoiseModel() ##### your code here ##### # create the depolarizaation probability depolarization_prob = 0.01 # create the depolarization error objects # create a two-qubit depolarization error for two qubits depolarizing_error_two_quits = depolarizing_error( depolarization_prob, 2 ) # add the two-qubit depolarization error after each CNOT/CX gate noise_model.add_all_qubit_quantum_error( depolarizing_error_two_quits, ['cx'] ) # print the noise model created before print(noise_model) # submit your answer # import the grader for the exercise 3 of the lab 5 from qc_grader.challenges.qgss_2023 import grade_lab5_ex3 # grade the exercise 3 of the lab 5 grade_lab5_ex3(noise_model) # define the options for the quantum simulation # to run in the backend, using the IBM's Qiskit Runtime, # with a resilience level of 1 (one) options = Options( simulator=dict( noise_model=noise_model, **simulator ), resilience_level=1, ) # within the context of a session of the IBM's Qiskit Runtime with Session( service=service, backend=backend ): # create an estimator object with the options defined before estimator = Estimator(options=options) # create a job for the quantum circuit implementing # the Heisenberg's Hamiltonian, running the Estimator job = estimator.run( circuit, hamiltonian, shots=shots ) # retrieve the results of the job ran by # the Estimator created before, # that was ran on the quantum circuit # implementing the Heisenberg's Hamiltonian result = job.result() # retrieve the values of the results of # the job ran by the Estimator created before, # that was ran on the quantum circuit # implementing the Heisenberg's Hamiltonian experiment_value = result.values[0] # compute the error as the distance between # the experiment value and the exact value error = abs(experiment_value - exact_value) # retrieve the variance from the results of # the job ran by the Estimator created before, # that was ran on the quantum circuit # implementing the Heisenberg's Hamiltonian variance = result.metadata[0]["variance"] # compute the standard deviation of the results of # the job ran by the Estimator created before, # that was ran on the quantum circuit # implementing the Heisenberg's Hamiltonian std = math.sqrt( variance / shots ) # print the statistics for the estimated energy, # the energy error, the variance, and the standard error print(f"Estimated energy: {experiment_value}") print(f"Energy error: {error}") print(f"Variance: {variance}") print(f"Standard error: {std}") # define the options for the quantum simulation # to run in the backend, using the IBM's Qiskit Runtime, # with a resilience level of 2 (two) options = Options( simulator=dict( noise_model=noise_model, **simulator ), resilience_level=2, ) # within the context of a session of the IBM's Qiskit Runtime with Session( service=service, backend=backend ): # create an estimator object with the options defined before estimator = Estimator(options=options) # create a job for the quantum circuit implementing # the Heisenberg's Hamiltonian, running the Estimator job = estimator.run( circuit, hamiltonian, shots=shots ) # retrieve the results of the job ran by # the Estimator created before, # that was ran on the quantum circuit # implementing the Heisenberg's Hamiltonian result = job.result() # retrieve the values of the results of # the job ran by the Estimator created before, # that was ran on the quantum circuit # implementing the Heisenberg's Hamiltonian experiment_value = result.values[0] # compute the error as the distance between # the experiment value and the exact value error = abs(experiment_value - exact_value) # retrieve the variances of the results of # the job ran by the Estimator created before, # that was ran on the quantum circuit # implementing the Heisenberg's Hamiltonian, # applying Zero-Noise Extrapolation with Noise Amplification variances = result.metadata[0]["zne"]["noise_amplification"]["variance"] # print the statistics for the estimated energy, # the energy error, and the variances print(f"Estimated energy: {experiment_value}") print(f"Energy error: {error}") print(f"Variances: {variances}") # import Pauli error from # the IBM's Qiskit Aer Noise module from qiskit_aer.noise import pauli_error # create a noise model noise_model = NoiseModel() ##### your code here ##### # create the Pauli error probability pauli_error_prob = 0.1 # create the Pauli error objects # create a bit flip error for a qubit bit_flip_error = pauli_error( [ ( "X", pauli_error_prob ), ( "I", ( 1 - pauli_error_prob ) ) ] ) # add a bit flip error for a qubit, # after each Pauli-X, Pauli-Y, Pauli-Z, and Hadamard gate noise_model.add_all_qubit_quantum_error( bit_flip_error, ["x", "y", "z", "h"] ) # print the noise model created before print(noise_model) # define the options for the quantum simulation # to run in the backend, using the IBM's Qiskit Runtime, # with a resilience level of 0 (zero) options = Options( simulator=dict( noise_model=noise_model, **simulator ), resilience_level=0, ) # within the context of a session of the IBM's Qiskit Runtime with Session( service=service, backend=backend ): # create an estimator object with the options defined before estimator = Estimator(options=options) # create a job for the quantum circuit implementing # the Heisenberg's Hamiltonian, running the Estimator job = estimator.run( circuit, hamiltonian, shots=shots ) # retrieve the results of the job ran by # the Estimator created before, # that was ran on the quantum circuit # implementing the Heisenberg's Hamiltonian result = job.result() # retrieve the values of the results of # the job ran by the Estimator created before, # that was ran on the quantum circuit # implementing the Heisenberg's Hamiltonian experiment_value = result.values[0] # compute the error as the distance between # the experiment value and the exact value error = abs(experiment_value - exact_value) # retrieve the variance from the results of # the job ran by the Estimator created before, # that was ran on the quantum circuit # implementing the Heisenberg's Hamiltonian variance = result.metadata[0]["variance"] # compute the standard deviation of the results of # the job ran by the Estimator created before, # that was ran on the quantum circuit # implementing the Heisenberg's Hamiltonian std = math.sqrt( variance / shots ) # print the statistics for the estimated energy, # the energy error, the variance, and the standard error print(f"Estimated energy: {experiment_value}") print(f"Energy error: {error}") print(f"Variance: {variance}") print(f"Standard error: {std}") # define the options for the quantum simulation # to run in the backend, using the IBM's Qiskit Runtime, # with a resilience level of 1 (one) options = Options( simulator=dict(noise_model=noise_model, **simulator), resilience_level=1, ) # within the context of a session of the IBM's Qiskit Runtime with Session( service=service, backend=backend ): # create an estimator object with the options defined before estimator = Estimator(options=options) # create a job for the quantum circuit implementing # the Heisenberg's Hamiltonian, running the Estimator job = estimator.run( circuit, hamiltonian, shots=shots ) # retrieve the results of the job ran by # the Estimator created before, # that was ran on the quantum circuit # implementing the Heisenberg's Hamiltonian result = job.result() # retrieve the values of the results of # the job ran by the Estimator created before, # that was ran on the quantum circuit # implementing the Heisenberg's Hamiltonian experiment_value = result.values[0] # compute the error as the distance between # the experiment value and the exact value error = abs(experiment_value - exact_value) # retrieve the variance from the results of # the job ran by the Estimator created before, # that was ran on the quantum circuit # implementing the Heisenberg's Hamiltonian variance = result.metadata[0]["variance"] # compute the standard deviation of the results of # the job ran by the Estimator created before, # that was ran on the quantum circuit # implementing the Heisenberg's Hamiltonian std = math.sqrt( variance / shots ) # print the statistics for the estimated energy, # the energy error, the variance, and the standard error print(f"Estimated energy: {experiment_value}") print(f"Energy error: {error}") print(f"Variance: {variance}") print(f"Standard error: {std}") # define the options for the quantum simulation # to run in the backend, using the IBM's Qiskit Runtime, # with a resilience level of 2 (two) options = Options( simulator=dict(noise_model=noise_model, **simulator), resilience_level=2, ) # within the context of a session of the IBM's Qiskit Runtime with Session( service=service, backend=backend ): # create an estimator object with the options defined before estimator = Estimator(options=options) # create a job for the quantum circuit implementing # the Heisenberg's Hamiltonian, running the Estimator job = estimator.run( circuit, hamiltonian, shots=shots ) # retrieve the results of the job ran by # the Estimator created before, # that was ran on the quantum circuit # implementing the Heisenberg's Hamiltonian result = job.result() # retrieve the values of the results of # the job ran by the Estimator created before, # that was ran on the quantum circuit # implementing the Heisenberg's Hamiltonian experiment_value = result.values[0] # compute the error as the distance between # the experiment value and the exact value error = abs(experiment_value - exact_value) # retrieve the variances of the results of # the job ran by the Estimator created before, # that was ran on the quantum circuit # implementing the Heisenberg's Hamiltonian, # applying Zero-Noise Extrapolation with Noise Amplification variances = result.metadata[0]["zne"]["noise_amplification"]["variance"] # print the statistics for the estimated energy, # the energy error, and the variances print(f"Estimated energy: {experiment_value}") print(f"Energy error: {error}") print(f"Variances: {variances}") # import Pauli error from # the IBM's Qiskit Aer Noise module from qiskit_aer.noise import pauli_error # create a noise model noise_model = NoiseModel() ##### your code here ##### # create the Pauli error probability pauli_error_prob = 0.1 # create the Pauli error objects # create a phase flip error for a qubit phase_flip_error = pauli_error( [ ( "Z", pauli_error_prob ), ( "I", ( 1 - pauli_error_prob ) ) ] ) # add a phase flip error for a qubit, # after each Pauli-X, Pauli-Y, Pauli-Z, and Hadamard gate noise_model.add_all_qubit_quantum_error( phase_flip_error, ["x", "y", "z", "h"] ) # print the noise model created before print(noise_model) # define the options for the quantum simulation # to run in the backend, using the IBM's Qiskit Runtime, # with a resilience level of 0 (zero) options = Options( simulator=dict( noise_model=noise_model, **simulator ), resilience_level=0, ) # within the context of a session of the IBM's Qiskit Runtime with Session( service=service, backend=backend ): # create an estimator object with the options defined before estimator = Estimator(options=options) # create a job for the quantum circuit implementing # the Heisenberg's Hamiltonian, running the Estimator job = estimator.run( circuit, hamiltonian, shots=shots ) # retrieve the results of the job ran by # the Estimator created before, # that was ran on the quantum circuit # implementing the Heisenberg's Hamiltonian result = job.result() # retrieve the values of the results of # the job ran by the Estimator created before, # that was ran on the quantum circuit # implementing the Heisenberg's Hamiltonian experiment_value = result.values[0] # compute the error as the distance between # the experiment value and the exact value error = abs(experiment_value - exact_value) # retrieve the variance from the results of # the job ran by the Estimator created before, # that was ran on the quantum circuit # implementing the Heisenberg's Hamiltonian variance = result.metadata[0]["variance"] # compute the standard deviation of the results of # the job ran by the Estimator created before, # that was ran on the quantum circuit # implementing the Heisenberg's Hamiltonian std = math.sqrt( variance / shots ) # print the statistics for the estimated energy, # the energy error, the variance, and the standard error print(f"Estimated energy: {experiment_value}") print(f"Energy error: {error}") print(f"Variance: {variance}") print(f"Standard error: {std}") # define the options for the quantum simulation # to run in the backend, using the IBM's Qiskit Runtime, # with a resilience level of 1 (one) options = Options( simulator=dict( noise_model=noise_model, **simulator ), resilience_level=1, ) # within the context of a session of the IBM's Qiskit Runtime with Session( service=service, backend=backend ): # create an estimator object with the options defined before estimator = Estimator(options=options) # create a job for the quantum circuit implementing # the Heisenberg's Hamiltonian, running the Estimator job = estimator.run( circuit, hamiltonian, shots=shots ) # retrieve the results of the job ran by # the Estimator created before, # that was ran on the quantum circuit # implementing the Heisenberg's Hamiltonian result = job.result() # retrieve the values of the results of # the job ran by the Estimator created before, # that was ran on the quantum circuit # implementing the Heisenberg's Hamiltonian experiment_value = result.values[0] # compute the error as the distance between # the experiment value and the exact value error = abs(experiment_value - exact_value) # retrieve the variance from the results of # the job ran by the Estimator created before, # that was ran on the quantum circuit # implementing the Heisenberg's Hamiltonian variance = result.metadata[0]["variance"] # compute the standard deviation of the results of # the job ran by the Estimator created before, # that was ran on the quantum circuit # implementing the Heisenberg's Hamiltonian std = math.sqrt( variance / shots ) # print the statistics for the estimated energy, # the energy error, the variance, and the standard error print(f"Estimated energy: {experiment_value}") print(f"Energy error: {error}") print(f"Variance: {variance}") print(f"Standard error: {std}") # define the options for the quantum simulation # to run in the backend, using the IBM's Qiskit Runtime, # with a resilience level of 2 (two) options = Options( simulator=dict(noise_model=noise_model, **simulator), resilience_level=2, ) # within the context of a session of the IBM's Qiskit Runtime with Session( service=service, backend=backend ): # create an estimator object with the options defined before estimator = Estimator(options=options) # create a job for the quantum circuit implementing # the Heisenberg's Hamiltonian, running the Estimator job = estimator.run( circuit, hamiltonian, shots=shots ) # retrieve the results of the job ran by # the Estimator created before, # that was ran on the quantum circuit # implementing the Heisenberg's Hamiltonian result = job.result() # retrieve the values of the results of # the job ran by the Estimator created before, # that was ran on the quantum circuit # implementing the Heisenberg's Hamiltonian experiment_value = result.values[0] # compute the error as the distance between # the experiment value and the exact value error = abs(experiment_value - exact_value) # retrieve the variances of the results of # the job ran by the Estimator created before, # that was ran on the quantum circuit # implementing the Heisenberg's Hamiltonian, # applying Zero-Noise Extrapolation with Noise Amplification variances = result.metadata[0]["zne"]["noise_amplification"]["variance"] # print the statistics for the estimated energy, # the energy error, and the variances print(f"Estimated energy: {experiment_value}") print(f"Energy error: {error}") print(f"Variances: {variances}") # import Reset error from # the IBM's Qiskit Aer Noise module from qiskit_aer.noise import reset_error # create a noise model noise_model = NoiseModel() ##### your code here ##### # create the Reset error probabilities reset_0_prob = 0.2 reset_1_prob = 0.33 # create the Reset error objects # create a Reset error for a qubit reset_0_1_error = reset_error( reset_0_prob, reset_1_prob ) # add a Reset error for a qubit, # after each Pauli-X, Pauli-Y, Pauli-Z, and Hadamard gate noise_model.add_all_qubit_quantum_error( reset_0_1_error, ["x", "y", "z", "h"] ) # print the noise model created before print(noise_model) # define the options for the quantum simulation # to run in the backend, using the IBM's Qiskit Runtime, # with a resilience level of 0 (zero) options = Options( simulator=dict( noise_model=noise_model, **simulator ), resilience_level=0, ) # within the context of a session of the IBM's Qiskit Runtime with Session( service=service, backend=backend ): # create an estimator object with the options defined before estimator = Estimator(options=options) # create a job for the quantum circuit implementing # the Heisenberg's Hamiltonian, running the Estimator job = estimator.run( circuit, hamiltonian, shots=shots ) # retrieve the results of the job ran by # the Estimator created before, # that was ran on the quantum circuit # implementing the Heisenberg's Hamiltonian result = job.result() # retrieve the values of the results of # the job ran by the Estimator created before, # that was ran on the quantum circuit # implementing the Heisenberg's Hamiltonian experiment_value = result.values[0] # compute the error as the distance between # the experiment value and the exact value error = abs(experiment_value - exact_value) # retrieve the variance from the results of # the job ran by the Estimator created before, # that was ran on the quantum circuit # implementing the Heisenberg's Hamiltonian variance = result.metadata[0]["variance"] # compute the standard deviation of the results of # the job ran by the Estimator created before, # that was ran on the quantum circuit # implementing the Heisenberg's Hamiltonian std = math.sqrt( variance / shots ) # print the statistics for the estimated energy, # the energy error, the variance, and the standard error print(f"Estimated energy: {experiment_value}") print(f"Energy error: {error}") print(f"Variance: {variance}") print(f"Standard error: {std}") # define the options for the quantum simulation # to run in the backend, using the IBM's Qiskit Runtime, # with a resilience level of 1 (one) options = Options( simulator=dict( noise_model=noise_model, **simulator ), resilience_level=1, ) # within the context of a session of the IBM's Qiskit Runtime with Session( service=service, backend=backend ): # create an estimator object with the options defined before estimator = Estimator(options=options) # create a job for the quantum circuit implementing # the Heisenberg's Hamiltonian, running the Estimator job = estimator.run( circuit, hamiltonian, shots=shots ) # retrieve the results of the job ran by # the Estimator created before, # that was ran on the quantum circuit # implementing the Heisenberg's Hamiltonian result = job.result() # retrieve the values of the results of # the job ran by the Estimator created before, # that was ran on the quantum circuit # implementing the Heisenberg's Hamiltonian experiment_value = result.values[0] # compute the error as the distance between # the experiment value and the exact value error = abs(experiment_value - exact_value) # retrieve the variance from the results of # the job ran by the Estimator created before, # that was ran on the quantum circuit # implementing the Heisenberg's Hamiltonian variance = result.metadata[0]["variance"] # compute the standard deviation of the results of # the job ran by the Estimator created before, # that was ran on the quantum circuit # implementing the Heisenberg's Hamiltonian std = math.sqrt( variance / shots ) # print the statistics for the estimated energy, # the energy error, the variance, and the standard error print(f"Estimated energy: {experiment_value}") print(f"Energy error: {error}") print(f"Variance: {variance}") print(f"Standard error: {std}") # define the options for the quantum simulation # to run in the backend, using the IBM's Qiskit Runtime, # with a resilience level of 2 (two) options = Options( simulator=dict(noise_model=noise_model, **simulator), resilience_level=2, ) # within the context of a session of the IBM's Qiskit Runtime with Session( service=service, backend=backend ): # create an estimator object with the options defined before estimator = Estimator(options=options) # create a job for the quantum circuit implementing # the Heisenberg's Hamiltonian, running the Estimator job = estimator.run( circuit, hamiltonian, shots=shots ) # retrieve the results of the job ran by # the Estimator created before, # that was ran on the quantum circuit # implementing the Heisenberg's Hamiltonian result = job.result() # retrieve the values of the results of # the job ran by the Estimator created before, # that was ran on the quantum circuit # implementing the Heisenberg's Hamiltonian experiment_value = result.values[0] # compute the error as the distance between # the experiment value and the exact value error = abs(experiment_value - exact_value) # retrieve the variances of the results of # the job ran by the Estimator created before, # that was ran on the quantum circuit # implementing the Heisenberg's Hamiltonian, # applying Zero-Noise Extrapolation with Noise Amplification variances = result.metadata[0]["zne"]["noise_amplification"]["variance"] # print the statistics for the estimated energy, # the energy error, and the variances print(f"Estimated energy: {experiment_value}") print(f"Energy error: {error}") print(f"Variances: {variances}") # import the IBM's Qiskit Jupyter Tools import qiskit.tools.jupyter # show the table of the IBM's Qiskit version %qiskit_version_table
https://github.com/qiskit-community/qiskit-translations-staging
qiskit-community
# You can set a color for all the bars. from qiskit import QuantumCircuit from qiskit.quantum_info import Statevector from qiskit.visualization import plot_state_paulivec qc = QuantumCircuit(2) qc.h(0) qc.cx(0, 1) state = Statevector(qc) plot_state_paulivec(state, color='midnightblue', title="New PauliVec plot")
https://github.com/qclib/qclib
qclib
# Copyright 2021 qclib project. # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # http://www.apache.org/licenses/LICENSE-2.0 # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. """ https://arxiv.org/abs/quant-ph/0407010 https://arxiv.org/abs/2108.10182 """ import numpy as np from qiskit import QuantumCircuit, QuantumRegister from qclib.gates.initialize import Initialize from qclib.state_preparation.util.state_tree_preparation import ( Amplitude, state_decomposition, ) from qclib.state_preparation.util.angle_tree_preparation import create_angles_tree from qclib.state_preparation.util.tree_register import add_register from qclib.state_preparation.util.tree_walk import top_down class TopDownInitialize(Initialize): """ Top-down state preparation https://arxiv.org/abs/quant-ph/0407010 https://arxiv.org/abs/2108.10182 This class implements a state preparation gate. """ def __init__(self, params, label=None, opt_params=None): """ Parameters ---------- params: list of complex A unit vector representing a quantum state. Values are amplitudes. opt_params: {'global_phase': global_phase, 'lib': lib} global_phase: bool If ``True``, corrects the global phase. Default value is ``True``. lib: str Library to be used. Default value is ``'qclib'``. """ self._name = "top-down" self._get_num_qubits(params) if opt_params is None: self.global_phase = True self.lib = "qclib" else: if opt_params.get("global_phase") is None: self.global_phase = True else: self.global_phase = opt_params.get("global_phase") if opt_params.get("lib") is None: self.lib = "qclib" else: self.lib = opt_params.get("lib") if label is None: label = "TDSP" super().__init__(self._name, self.num_qubits, params, label=label) def _define(self): self.definition = self._define_initialize() def _define_initialize(self): if self.lib == "qiskit": reg = QuantumRegister(self.num_qubits) circuit = QuantumCircuit(reg) # pylint: disable=maybe-no-member circuit.initialize(self.params) return circuit data = [Amplitude(i, a) for i, a in enumerate(self.params)] state_tree = state_decomposition(self.num_qubits, data) angle_tree = create_angles_tree(state_tree) circuit = QuantumCircuit() add_register(circuit, angle_tree, 0) top_down(angle_tree, circuit, 0) if self.global_phase: circuit.global_phase += sum(np.angle(self.params)) / len(self.params) return circuit @staticmethod def initialize(q_circuit, state, qubits=None, opt_params=None): """ Appends a TopDownInitialize gate into the q_circuit """ if qubits is None: q_circuit.append( TopDownInitialize(state, opt_params=opt_params), q_circuit.qubits ) else: q_circuit.append(TopDownInitialize(state, opt_params=opt_params), qubits)
https://github.com/qiskit-community/qiskit-translations-staging
qiskit-community
import numpy as np from qiskit import QuantumRegister, ClassicalRegister, QuantumCircuit from qiskit.circuit.library import QFT def create_qpe_circuit(theta, num_qubits): '''Creates a QPE circuit given theta and num_qubits.''' # Step 1: Create a circuit with two quantum registers and one classical register. first = QuantumRegister(size=num_qubits, name='first') # the first register for phase estimation second = QuantumRegister(size=1, name='second') # the second register for storing eigenvector |psi> classical = ClassicalRegister(size=num_qubits, name='readout') # classical register for readout qpe_circuit = QuantumCircuit(first, second, classical) # Step 2: Initialize the qubits. # All qubits are initialized in |0> by default, no extra code is needed to initialize the first register. qpe_circuit.x(second) # Initialize the second register with state |psi>, which is |1> in this example. # Step 3: Create superposition in the first register. qpe_circuit.barrier() # Add barriers to separate each step of the algorithm for better visualization. qpe_circuit.h(first) # Step 4: Apply a controlled-U^(2^j) black box. qpe_circuit.barrier() for j in range(num_qubits): qpe_circuit.cp(theta*2*np.pi*(2**j), j, num_qubits) # Theta doesn't contain the 2 pi factor. # Step 5: Apply an inverse QFT to the first register. qpe_circuit.barrier() qpe_circuit.compose(QFT(num_qubits, inverse=True), inplace=True) # Step 6: Measure the first register. qpe_circuit.barrier() qpe_circuit.measure(first, classical) return qpe_circuit num_qubits = 4 qpe_circuit_fixed_phase = create_qpe_circuit(1/2, num_qubits) # Create a QPE circuit with fixed theta=1/2. qpe_circuit_fixed_phase.draw('mpl') from qiskit.circuit import Parameter theta = Parameter('theta') # Create a parameter `theta` whose values can be assigned later. qpe_circuit_parameterized = create_qpe_circuit(theta, num_qubits) qpe_circuit_parameterized.draw('mpl') number_of_phases = 21 phases = np.linspace(0, 2, number_of_phases) individual_phases = [[ph] for ph in phases] # Phases need to be expressed as a list of lists. from qiskit_ibm_runtime import QiskitRuntimeService service = QiskitRuntimeService() backend = "ibmq_qasm_simulator" # use the simulator from qiskit_ibm_runtime import Sampler, Session with Session(service=service, backend=backend): results = Sampler().run( [qpe_circuit_parameterized]*len(individual_phases), parameter_values=individual_phases ).result() from qiskit.tools.visualization import plot_histogram idx = 6 plot_histogram(results.quasi_dists[idx].binary_probabilities(), legend=[f'$\\theta$={phases[idx]:.3f}']) def most_likely_bitstring(results_dict): '''Finds the most likely outcome bit string from a result dictionary.''' return max(results_dict, key=results_dict.get) def find_neighbors(bitstring): '''Finds the neighbors of a bit string. Example: For bit string '1010', this function returns ('1001', '1011') ''' if bitstring == len(bitstring)*'0': neighbor_left = len(bitstring)*'1' else: neighbor_left = format((int(bitstring,2)-1), '0%sb'%len(bitstring)) if bitstring == len(bitstring)*'1': neighbor_right = len(bitstring)*'0' else: neighbor_right = format((int(bitstring,2)+1), '0%sb'%len(bitstring)) return (neighbor_left, neighbor_right) def estimate_phase(results_dict): '''Estimates the phase from a result dictionary of a QPE circuit.''' # Find the most likely outcome bit string N1 and its neighbors. num_1_key = most_likely_bitstring(results_dict) neighbor_left, neighbor_right = find_neighbors(num_1_key) # Get probabilities of N1 and its neighbors. num_1_prob = results_dict.get(num_1_key) neighbor_left_prob = results_dict.get(neighbor_left) neighbor_right_prob = results_dict.get(neighbor_right) # Find the second most likely outcome N2 and its probability P2 among the neighbors. if neighbor_left_prob is None: # neighbor_left doesn't exist if neighbor_right_prob is None: # both neighbors don't exist, N2 is N1 num_2_key = num_1_key num_2_prob = num_1_prob else: # If only neighbor_left doesn't exist, N2 is neighbor_right. num_2_key = neighbor_right num_2_prob = neighbor_right_prob elif neighbor_right_prob is None: # If only neighbor_right doesn't exist, N2 is neighbor_left. num_2_key = neighbor_left num_2_prob = neighbor_left_prob elif neighbor_left_prob > neighbor_right_prob: # Both neighbors exist and neighbor_left has higher probability, so N2 is neighbor_left. num_2_key = neighbor_left num_2_prob = neighbor_left_prob else: # Both neighbors exist and neighbor_right has higher probability, so N2 is neighor_right. num_2_key = neighbor_right num_2_prob = neighbor_right_prob # Calculate the estimated phases for N1 and N2. num_qubits = len(num_1_key) num_1_phase = (int(num_1_key, 2) / 2**num_qubits) num_2_phase = (int(num_2_key, 2) / 2**num_qubits) # Calculate the weighted average phase from N1 and N2. phase_estimated = (num_1_phase * num_1_prob + num_2_phase * num_2_prob) / (num_1_prob + num_2_prob) return phase_estimated qpe_solutions = [] for idx, result_dict in enumerate(results.quasi_dists): qpe_solutions.append(estimate_phase(result_dict.binary_probabilities())) ideal_solutions = np.append( phases[:(number_of_phases-1)//2], # first period np.subtract(phases[(number_of_phases-1)//2:-1], 1) # second period ) ideal_solutions = np.append(ideal_solutions, np.subtract(phases[-1], 2)) # starting point of the third period import matplotlib.pyplot as plt fig = plt.figure(figsize=(10, 6)) plt.plot(phases, ideal_solutions, '--', label='Ideal solutions') plt.plot(phases, qpe_solutions, 'o', label='QPE solutions') plt.title('Quantum Phase Estimation Algorithm') plt.xlabel('Input Phase') plt.ylabel('Output Phase') plt.legend() import qiskit_ibm_runtime qiskit_ibm_runtime.version.get_version_info() import qiskit.tools.jupyter %qiskit_version_table %qiskit_copyright
https://github.com/jonasmaziero/computacao_quantica_qiskit
jonasmaziero
%run init.ipynb from qiskit import * nshots = 8192 IBMQ.load_account() provider= qiskit.IBMQ.get_provider(hub='ibm-q-research-2',group='federal-uni-sant-1',project='main') device = provider.get_backend('ibmq_lima') simulator = Aer.get_backend('qasm_simulator') from qiskit.visualization import plot_histogram from qiskit.tools.monitor import job_monitor from qiskit.quantum_info import state_fidelity def qc_qft(n): qr = QuantumRegister(n); qc = QuantumCircuit(qr, name = 'QFT') for l in range(0, n): qc.h(qr[l]) if l < n-1: for q in range(l+1, n): lb = 2*math.pi*2**(-q+l-1) qc.cp(lb, qr[q], qr[l]) #qc.barrier() #qc.barrier() if n%2 == 0: ul = n//2 else: ul = (n-1)//2 for p in range(0, ul): qc.swap(p, n-1-p) return qc n = 4; qc_qft_ = qc_qft(n); qc_qft_.draw(output='mpl') def qc_iqft(n): qr = QuantumRegister(n); qc = QuantumCircuit(qr, name = 'IQFT') if n%2 == 0: ul = n//2 else: ul = (n-1)//2 for p in range(ul-1, -1, -1): qc.swap(p, n-1-p) #qc.barrier() for l in range(n-1, -1, -1): if l < n-1: for q in range(n-1, l+1-1, -1): lb = -2*math.pi*2**(-q+l-1)#; print(lb) qc.cp(lb, qr[q], qr[l]) qc.h(qr[l]) #qc.barrier() return qc n = 4; qc_iqft_ = qc_iqft(n); qc_iqft_.draw(output='mpl') #x0 = 1 + 0*1j; x1 = 0 + 0*1j # estado |0> #x0 = 0 + 0*1j; x1 = 1 + 0*1j # estado |1> x0 = 1/math.sqrt(2) + 0*1j; x1 = 1/math.sqrt(2) + 0*1j # estado |+> mx0 = math.sqrt(x0.real**2 + x0.imag**2) if x0.real != 0: ph0 = math.atan(x0.imag/x0.real) elif x0.real == 0 and x0.imag != 0: ph0 = math.pi/2 elif x0.real == 0 and x0.imag == 0: ph0 = 0 mx1 = math.sqrt(x1.real**2 + x1.imag**2) if x1.real != 0: ph1 = math.atan(x1.imag/x1.real) elif x1.real == 0 and x1.imag != 0: ph1 = math.pi/2 elif x1.real == 0 and x1.imag == 0: ph1 = 0 print('|x0|=',mx0,', ph0=', ph0,', |x1|=', mx1,', ph1=', ph1) th = 2*math.acos(mx1); ph = ph1-ph0+math.pi; lb = ph0-math.pi print('th=',th,', ph=', ph,', lb=', lb) n = 1 qr = QuantumRegister(n); qc = QuantumCircuit(qr) qc.x(qr[0]); qc.u(th, ph, lb, qr[0]); qc.barrier() qc_qft_ = qc_qft(n); qft = qc_qft_.to_gate(); qc.append(qft, [0]) qc.draw(output='mpl') svsimulator = Aer.get_backend('statevector_simulator') job = execute(qc, backend = svsimulator, shots = 1, memory = True) print(job.result().get_statevector(qc)) def tfc(x): # classical discrete Fourier transform d = len(x) y = np.zeros(d, dtype = complex) for k in range(0, d): for j in range(0, d): y[k] += x[j]*(math.cos(2*math.pi*j*k/d) + 1j*math.sin(2*math.pi*j*k/d)) return y/math.sqrt(d) d = 4; x = np.zeros(d, dtype = complex); #x = [1/2, 1/2, 1/2, 1/2] x = [-1/2, -1/2, 1/2, 1/2] y = tfc(x); print(y) n = 2 qr = QuantumRegister(n); qc = QuantumCircuit(qr) #qc.h([0,1]); qc.barrier() # ok qc.x([0]); qc.h([0,1]); qc.barrier() # ok a menos de uma fase global de pi qc_qft_ = qc_qft(n); qft = qc_qft_.to_gate(); qc.append(qft, [0,1]) qc.draw(output='mpl') svsimulator = Aer.get_backend('statevector_simulator') job = execute(qc, backend = svsimulator, shots = 1, memory = True) print(job.result().get_statevector(qc)) # para >1 qubit tem a questao da ordem da bc d = 4; x = np.zeros(d, dtype = complex); x = [math.sqrt(1/6), math.sqrt(1/6), math.sqrt(2/3), 0] y = tfc(x); print(y) n = 3 qr = QuantumRegister(n); cr = ClassicalRegister(n); qc = QuantumCircuit(qr, cr) qc.x([0,2]); qc.barrier() qc_qft_ = qc_qft(n); qft = qc_qft_.to_gate(); qc.append(qft, [0,1,2]); qc.barrier() qc_iqft_ = qc_iqft(n); iqft = qc_iqft_.to_gate(); qc.append(iqft, [0,1,2]); qc.barrier() qc.measure([0,1,2],[0,1,2]) qc.draw(output='mpl') job_sim = execute(qc, backend = simulator, shots = nshots) job_exp = execute(qc, backend = device, shots = nshots) job_monitor(job_exp) plot_histogram([job_sim.result().get_counts(), job_exp.result().get_counts()], legend = ['sim', 'exp'])
https://github.com/kaelynj/Qiskit-HubbardModel
kaelynj
my_list = [1,3,6,8,2,7,5,7,9,2,16,4] def my_oracle(my_input): winner = 9 response = False if winner == my_input: response = True return response for index, number in enumerate(my_list): if (my_oracle(number) == True): print("Winner winner chicken dinner! at index = %i"%index) print("%i times the Oracle was called"%(index+1)) break from qiskit import * import matplotlib.pyplot as plt import numpy as np # create the oracle quantum circuit oracle = QuantumCircuit(2, name='oracle') oracle.cz(0,1) # apply the Controlled-Z gate or CZ gate oracle.to_gate() # make oracle into its own gate oracle.draw() backend = Aer.get_backend('statevector_simulator') grover_circuit = QuantumCircuit(2,2) # 2 qubits, 2 classical registers grover_circuit.h([0,1]) # apply hadamard gate on both qubits 0 and 1 to prepare superposition state discussed in description.md grover_circuit.append(oracle, [0,1]) # append oracle to be able to query each state at same time grover_circuit.draw() job = execute(grover_circuit, backend) result = job.result() sv = result.get_statevector() np.around(sv, 2) reflection = QuantumCircuit(2, name='reflection') reflection.h([0,1]) # apply hadamard gate on all qubits to bring them back to '00' state from the original 's' state reflection.z([0,1]) # apply Z gate on both qubits reflection.cz(0,1) # controlled-z gate reflection.h([0,1]) # transform back with hadamard on both qubits reflection.to_gate() reflection.draw() backend = Aer.get_backend('qasm_simulator') grover_circuit = QuantumCircuit(2,2) grover_circuit.h([0,1]) grover_circuit.append(oracle, [0,1]) grover_circuit.append(reflection, [0,1]) grover_circuit.measure([0,1], [0,1]) grover_circuit.draw() job = execute(grover_circuit, backend, shots=1) result = job.result() result.get_counts()
https://github.com/SanNare/qiskit-notebooks
SanNare
from qiskit import * qr = QuantumRegister(2) cr = ClassicalRegister(2) circuit = QuantumCircuit(qr,cr) %matplotlib inline circuit.draw(output = 'mpl') circuit.h(qr[0]) circuit.cx(qr[0],qr[1]) circuit.draw(output = 'mpl') circuit.measure(qr,cr) circuit.draw(output = 'mpl') simulator = Aer.get_backend('qasm_simulator') result = execute(circuit,backend = simulator).result() from qiskit.tools.visualization import plot_histogram plot_histogram(result.get_counts(circuit)) IBMQ.load_account() provider = IBMQ.get_provider('ibm-q') qcomp = provider.get_backend('ibmq_16_melbourne') job = execute(circuit,backend = qcomp) from qiskit.tools.monitor import job_monitor job_monitor(job) result = job.result() plot_histogram(result.get_counts(circuit))
https://github.com/mentesniker/Quantum-Cryptography
mentesniker
from qiskit import QuantumCircuit from qiskit import BasicAer from qiskit import execute def encryption(qc, initialString, pk): for bit in range(0,len(initialString)): if(initialString[bit] == '1'): qc.x(bit) if(pk[2*bit] == '1'): qc.z(bit) if(pk[2*bit+1] == '1'): qc.x(bit) return qc def decryption(qc, lenCypher, pk): for bit in range(0,lenCypher): if(pk[2*bit] == '1'): qc.z(bit) if(pk[2*bit+1] == '1'): qc.x(bit) return qc def generate_random_key(length,backend): pk = '' for i in range(0,2*length): qc = QuantumCircuit(1,1) qc.h(0) qc.measure(0,0) counts = execute(qc, backend=backend, shots=1).result().get_counts(qc) pk += list(counts.keys())[0] return pk def run_circuit(qc,backend): job = execute(qc, backend, shots=100) result = job.result() return result.get_counts(qc) initialString = '0110' pk = generate_random_key(len(initialString),backend) encrypt = QuantumCircuit(len(initialString),len(initialString)) backend = BasicAer.get_backend('qasm_simulator') encryption(encrypt,initialString,pk) encrypt.barrier() encrypt.measure([0,1,2,3],[0,1,2,3]) print("the encrypted string is: " + str(run_circuit(encrypt,backend))) encrypt.barrier() decryption(encrypt,len(encrypt.qubits),pk) encrypt.barrier() encrypt.measure([0,1,2,3],[0,1,2,3]) print("the original string is: " + str(run_circuit(encrypt,backend))) encrypt.draw()
https://github.com/riachakraborty/Algorithms-
riachakraborty
# useful additional packages #%% import numpy as np import matplotlib.pyplot as plt import matplotlib as mpl %matplotlib inline # importing Qiskit from qiskit import Aer, IBMQ from qiskit import QuantumCircuit, ClassicalRegister, QuantumRegister from qiskit import execute, compile #from qiskit.tools.monitor import job_monitor, backend_monitor, backend_overview backend = Aer.get_backend('statevector_simulator') # import basic plot tools from qiskit.tools.visualization import plot_histogram # Load our saved IBMQ accounts IBMQ.load_accounts() n = 12 # the length of the first register for querying the oracle # Choose a type of oracle at random. With probability half it is constant, # and with the same probability it is balanced oracleType, oracleValue = np.random.randint(2), np.random.randint(2) if oracleType == 0: print("The oracle returns a constant value ", oracleValue) else: print("The oracle returns a balanced function") a = np.random.randint(1,2**n) # this is a hidden parameter for balanced oracle. # Creating registers # n qubits for querying the oracle and one qubit for storing the answer qr = QuantumRegister(n+1) #all qubits are initialized to zero # for recording the measurement on the first register cr = ClassicalRegister(n) circuitName = "DeutschJozsa" djCircuit = QuantumCircuit(qr, cr) # Create the superposition of all input queries in the first register by applying the Hadamard gate to each qubit. for i in range(n): djCircuit.h(qr[i]) # Flip the second register and apply the Hadamard gate. djCircuit.x(qr[n]) djCircuit.h(qr[n]) # Apply barrier to mark the beginning of the oracle djCircuit.barrier() if oracleType == 0:#If the oracleType is "0", the oracle returns oracleValue for all input. if oracleValue == 1: djCircuit.x(qr[n]) else: djCircuit.iden(qr[n]) else: # Otherwise, it returns the inner product of the input with a (non-zero bitstring) for i in range(n): if (a & (1 << i)): djCircuit.cx(qr[i], qr[n]) # Apply barrier to mark the end of the oracle djCircuit.barrier() # Apply Hadamard gates after querying the oracle for i in range(n): djCircuit.h(qr[i]) # Measurement djCircuit.barrier() for i in range(n): djCircuit.measure(qr[i], cr[i]) #draw the circuit #djCircuit.draw(output='mpl') backend = Aer.get_backend('qasm_simulator') shots = 1000 job = execute(djCircuit, backend=backend, shots=shots) results = job.result() answer = results.get_counts() plot_histogram(answer)
https://github.com/jdanielescanez/quantum-solver
jdanielescanez
#!/usr/bin/env python3 # Author: Daniel Escanez-Exposito from abc import ABC, abstractmethod from qiskit import QuantumCircuit from qiskit.circuit.library import YGate, ZGate from qiskit.circuit.gate import Gate import qiskit.quantum_info as qi from numpy.random import randint import numpy as np from math import ceil ## An abstract class of a participant entity in the Six-State implementation ## @see https://qiskit.org/textbook/ch-algorithms/quantum-key-distribution.html class Participant(ABC): ## Constructor @abstractmethod def __init__(self, name='', original_bits_size=0): ## The name of the participant self.name = name ## The original size of the message self.original_bits_size = original_bits_size ## The values of the participant self.values = None ## The axes of the participant self.axes = None ## The key of the participant self.key = None ## If the key is determined safe self.is_safe_key = False ## The otp of the participant self.otp = None ## The gate measuring z and y axes self.set_hy() ## Values setter def set_values(self, values=None): if values == None: self.values = list(randint(2, size=self.original_bits_size)) else: self.values = values ## Axes setter def set_axes(self, axes=None): if axes == None: self.axes = list(randint(3, size=self.original_bits_size)) else: self.axes = axes ## Print values def show_values(self): print('\n' + self.name, 'Values:') print(self.values) ## Print axes def show_axes(self): print('\n' + self.name, 'Axes:') print(self.axes) ## Print key def show_key(self): print('\n' + self.name, 'Key:') print(self.key) ## Print otp def show_otp(self): print('\n' + self.name, 'OTP:') print(self.otp) ## Remove the values of the qubits that were measured on the wrong axis def remove_garbage(self, another_axes): self.key = [] for i in range(self.original_bits_size): if self.axes[i] == another_axes[i]: self.key.append(self.values[i]) ## Check if the shared key is equal to the current key def check_key(self, shared_key): return shared_key == self.key[:len(shared_key)] ## Use the rest of the key and validate it def confirm_key(self, shared_size): self.key = self.key[shared_size:] self.is_safe_key = True ## Generate an One-Time Pad def generate_otp(self, n_bits): self.otp = [] for i in range(ceil(len(self.key) / n_bits)): bits_string = ''.join(map(str, self.key[i * n_bits: (i + 1) * n_bits])) self.otp.append(int(bits_string, 2)) ## Performs an XOR operation between the message and the One-Time Pad def xor_otp_message(self, message): final_message = '' CHR_LIMIT = 1114112 if len(self.otp) > 0: for i, char in enumerate(message): final_message += chr((ord(char) ^ self.otp[i % len(self.otp)]) % CHR_LIMIT) return final_message ## New gate setter def set_hy(self): hy_op = qi.Operator(1/np.sqrt(2)*(YGate().to_matrix() + ZGate().to_matrix())) hy_gate = QuantumCircuit(1) hy_gate.unitary(hy_op, [0], label='h_y') self.hy = hy_gate.to_gate()
https://github.com/qiskit-community/qiskit-translations-staging
qiskit-community
from qiskit import QuantumCircuit top = QuantumCircuit(1) top.x(0); bottom = QuantumCircuit(2) bottom.cry(0.2, 0, 1); tensored = bottom.tensor(top) tensored.draw('mpl')
https://github.com/lynnlangit/learning-quantum
lynnlangit
try: import cirq except ImportError: print("installing cirq...") %pip install --quiet cirq print("installed cirq.") import cirq # One Qubit q = cirq.NamedQubit("a") # Create a Circuit A and NOT the qubit, then measure circuit = cirq.Circuit(cirq.X(q), cirq.measure(q, key='measured value') ) print("Circuit A:") print(circuit) print() # Simulate the circuit 10 times simulator = cirq.Simulator() result = simulator.run(circuit, repetitions=10) print("Results of Circuit A:") print(result) # Two Qubits q0,q1 = cirq.LineQubit.range(2) # Create a Circuit B and NOT the qubit, use a controlled-X gate on the qubits, then measure ops = cirq.X(q0), cirq.CNOT(q0,q1),cirq.measure(q0, key='m'),cirq.measure(q1, key='n') circuit1 = cirq.Circuit(ops ) print("Circuit B:") print(circuit1) print() simulator = cirq.Simulator() result = simulator.run(circuit1, repetitions=10) print("Results of Circuit B:") print(result) qubit = cirq.NamedQubit("a") # Create a circuit which puts a qubit into superposition using H, then measure circuit = cirq.Circuit(cirq.H(qubit), cirq.measure(qubit, key='m') ) print("Circuit C:") print(circuit) # Simulate the circuit 10 times simulator = cirq.Simulator() result = simulator.run(circuit, repetitions=10) print("Results:") print(result) import matplotlib.pyplot as plt qubit = cirq.NamedQubit("a") # Create a circuit which puts a qubit into superposition using H, then measure ops = [cirq.H(qubit), cirq.measure(qubit, key='m')] circuit = cirq.Circuit(ops) print("Circuit C:") print(circuit) # Simulate the circuit 100 times, plot results result = cirq.Simulator().run(circuit, repetitions=100) _ = cirq.vis.plot_state_histogram(result, plt.subplot()) a = cirq.NamedQubit("a") b = cirq.NamedQubit("b") c = cirq.NamedQubit("c") # Create a circuit which puts qubits into superposition using H, # Then entangle two qubits, then measure ops = [cirq.H(a), cirq.H(b), cirq.CNOT(b,c), cirq.H(b),cirq.measure(b)] circuit = cirq.Circuit(ops) print("Circuit D:\n") print(circuit) # Simulate the circuit 100 times, plot results result = cirq.Simulator().run(circuit, repetitions=100) _ = cirq.vis.plot_state_histogram(result, plt.subplot())
https://github.com/rmlarose/qcbq
rmlarose
#!pip install qiskit # Include the necessary imports for this program import numpy as np from qiskit import QuantumCircuit, ClassicalRegister, QuantumRegister from qiskit import execute # Create a Quantum Register with 3 qubits qr = QuantumRegister(3) # Create a Quantum Circuit from the quantum register. Because we're going to use # the statevector_simulator, we won't measure the circuit or need classical registers. circ = QuantumCircuit(qr) # Place an X gate on the 2nd and 3rd wires. The topmost wire is index 0. circ.x(qr[1]) circ.x(qr[2]) # Draw the circuit circ.draw(output='mpl') # Use the BasicAer statevector_simulator backend from qiskit import BasicAer backend_sv_sim = BasicAer.get_backend('statevector_simulator') # Execute the circuit on the state vector simulator job_sim = execute(circ, backend_sv_sim) # Grab the results from the job. result_sim = job_sim.result() # Obtain the state vector for the quantum circuit quantum_state = result_sim.get_statevector(circ, decimals=3) # Output the quantum state vector in a manner that contains a comma-delimited string. quantum_state # Plot the state vector on a Q-sphere from qiskit.tools.visualization import plot_state_qsphere plot_state_qsphere(quantum_state) # Create a Classical Register with 3 bits cr = ClassicalRegister(3) # Create the measurement portion of a quantum circuit meas_circ = QuantumCircuit(qr, cr) # Create a barrier that separates the gates from the measurements meas_circ.barrier(qr) # Measure the qubits into the classical registers meas_circ.measure(qr, cr) # Add the measument circuit to the original circuit complete_circuit = circ + meas_circ # Draw the new circuit complete_circuit.draw(output='mpl') # Use the BasicAer qasm_simulator backend from qiskit import BasicAer backend_sim = BasicAer.get_backend('qasm_simulator') # Execute the circuit on the qasm simulator, running it 1000 times. job_sim = execute(complete_circuit, backend_sim, shots=1000) # Grab the results from the job. result_sim = job_sim.result() # Print the counts, which are contained in a Python dictionary counts = result_sim.get_counts(complete_circuit) print(counts) # Plot the results on a histogram from qiskit.tools.visualization import plot_histogram plot_histogram(counts) # Include the necessary imports for this program # Create a Quantum Register with 3 qubits # Create a Quantum Circuit from the quantum register. Because we're going to use # the statevector_simulator, we won't measure the circuit or need classical registers. # Place Hadamard gate on each of the wires. # Draw the circuit # Use the BasicAer statevector_simulator backend # Execute the circuit on the state vector simulator # Grab the results from the job. # Obtain the state vector for the quantum circuit # Output the quantum state vector in a manner that contains a comma-delimited string. # Plot the state vector on a Q-sphere # Create a Classical Register with 3 bits # Create the measurement portion of a quantum circuit # Create a barrier that separates the gates from the measurements # Measure the qubits into the classical registers # Add the measument circuit to the original circuit # Draw the new circuit # Use the BasicAer qasm_simulator backend # Execute the circuit on the qasm simulator, running it 1000 times. # Grab the results from the job. # Print the counts, which are contained in a Python dictionary # Plot the results on a histogram
https://github.com/usamisaori/quantum-expressibility-entangling-capability
usamisaori
import sys sys.path.append('../') from circuits import sampleCircuitA, sampleCircuitB1, sampleCircuitB2,\ sampleCircuitB3, sampleCircuitC, sampleCircuitD, sampleCircuitE,\ sampleCircuitF from entanglement import Ent import warnings warnings.filterwarnings('ignore') labels = [ 'Circuit A', 'Circuit B1', 'Circuit B2', 'Circuit B3', 'Circuit C', 'Circuit D', 'Circuit E', 'Circuit F' ] samplers = [ sampleCircuitA, sampleCircuitB1, sampleCircuitB2, sampleCircuitB3, sampleCircuitC, sampleCircuitD, sampleCircuitE, sampleCircuitF ] q = 4 for layer in range(1, 4): print(f'qubtis: {q}') print('-' * 25) for (label, sampler) in zip(labels, samplers): expr = Ent(sampler, layer=layer, epoch=3000) print(f'{label}(layer={layer}): {expr}') print()
https://github.com/swe-train/qiskit__qiskit
swe-train
# This code is part of Qiskit. # # (C) Copyright IBM 2017, 2019. # # This code is licensed under the Apache License, Version 2.0. You may # obtain a copy of this license in the LICENSE.txt file in the root directory # of this source tree or at http://www.apache.org/licenses/LICENSE-2.0. # # Any modifications or derivative works of this code must retain this # copyright notice, and modified files need to carry a notice indicating # that they have been altered from the originals. """Tests for quantum channel representation transformations.""" import unittest import numpy as np from qiskit import QiskitError from qiskit.quantum_info.states import DensityMatrix from qiskit.quantum_info.operators.predicates import matrix_equal from qiskit.quantum_info.operators.operator import Operator from qiskit.quantum_info.operators.channel.choi import Choi from qiskit.quantum_info.operators.channel.superop import SuperOp from qiskit.quantum_info.operators.channel.kraus import Kraus from qiskit.quantum_info.operators.channel.stinespring import Stinespring from qiskit.quantum_info.operators.channel.ptm import PTM from qiskit.quantum_info.operators.channel.chi import Chi from .channel_test_case import ChannelTestCase class TestTransformations(ChannelTestCase): """Tests for Operator channel representation.""" unitary_mat = [ ChannelTestCase.UI, ChannelTestCase.UX, ChannelTestCase.UY, ChannelTestCase.UZ, ChannelTestCase.UH, ] unitary_choi = [ ChannelTestCase.choiI, ChannelTestCase.choiX, ChannelTestCase.choiY, ChannelTestCase.choiZ, ChannelTestCase.choiH, ] unitary_chi = [ ChannelTestCase.chiI, ChannelTestCase.chiX, ChannelTestCase.chiY, ChannelTestCase.chiZ, ChannelTestCase.chiH, ] unitary_sop = [ ChannelTestCase.sopI, ChannelTestCase.sopX, ChannelTestCase.sopY, ChannelTestCase.sopZ, ChannelTestCase.sopH, ] unitary_ptm = [ ChannelTestCase.ptmI, ChannelTestCase.ptmX, ChannelTestCase.ptmY, ChannelTestCase.ptmZ, ChannelTestCase.ptmH, ] def test_operator_to_operator(self): """Test Operator to Operator transformation.""" # Test unitary channels for mat in self.unitary_mat: chan1 = Operator(mat) chan2 = Operator(chan1) self.assertEqual(chan1, chan2) def test_operator_to_choi(self): """Test Operator to Choi transformation.""" # Test unitary channels for mat, choi in zip(self.unitary_mat, self.unitary_choi): chan1 = Choi(choi) chan2 = Choi(Operator(mat)) self.assertEqual(chan1, chan2) def test_operator_to_superop(self): """Test Operator to SuperOp transformation.""" # Test unitary channels for mat, sop in zip(self.unitary_mat, self.unitary_sop): chan1 = SuperOp(sop) chan2 = SuperOp(Operator(mat)) self.assertEqual(chan1, chan2) def test_operator_to_kraus(self): """Test Operator to Kraus transformation.""" # Test unitary channels for mat in self.unitary_mat: chan1 = Kraus(mat) chan2 = Kraus(Operator(mat)) self.assertEqual(chan1, chan2) def test_operator_to_stinespring(self): """Test Operator to Stinespring transformation.""" # Test unitary channels for mat in self.unitary_mat: chan1 = Stinespring(mat) chan2 = Stinespring(Operator(chan1)) self.assertEqual(chan1, chan2) def test_operator_to_chi(self): """Test Operator to Chi transformation.""" # Test unitary channels for mat, chi in zip(self.unitary_mat, self.unitary_chi): chan1 = Chi(chi) chan2 = Chi(Operator(mat)) self.assertEqual(chan1, chan2) def test_operator_to_ptm(self): """Test Operator to PTM transformation.""" # Test unitary channels for mat, ptm in zip(self.unitary_mat, self.unitary_ptm): chan1 = PTM(ptm) chan2 = PTM(Operator(mat)) self.assertEqual(chan1, chan2) def test_choi_to_operator(self): """Test Choi to Operator transformation.""" # Test unitary channels for mat, choi in zip(self.unitary_mat, self.unitary_choi): chan1 = Operator(mat) chan2 = Operator(Choi(choi)) self.assertTrue(matrix_equal(chan2.data, chan1.data, ignore_phase=True)) def test_choi_to_choi(self): """Test Choi to Choi transformation.""" # Test unitary channels for choi in self.unitary_choi: chan1 = Choi(choi) chan2 = Choi(chan1) self.assertEqual(chan1, chan2) # Test depolarizing channels for p in [0.25, 0.5, 0.75, 1]: chan1 = Choi(self.depol_choi(p)) chan2 = Choi(chan1) self.assertEqual(chan1, chan2) def test_choi_to_superop(self): """Test Choi to SuperOp transformation.""" # Test unitary channels for choi, sop in zip(self.unitary_choi, self.unitary_sop): chan1 = SuperOp(sop) chan2 = SuperOp(Choi(choi)) self.assertEqual(chan1, chan2) # Test depolarizing channels for p in [0.25, 0.5, 0.75, 1]: chan1 = SuperOp(self.depol_sop(p)) chan2 = SuperOp(Choi(self.depol_choi(p))) self.assertEqual(chan1, chan2) def test_choi_to_kraus(self): """Test Choi to Kraus transformation.""" # Test unitary channels for mat, choi in zip(self.unitary_mat, self.unitary_choi): chan1 = Kraus(mat) chan2 = Kraus(Choi(choi)) self.assertTrue(matrix_equal(chan2.data[0], chan1.data[0], ignore_phase=True)) # Test depolarizing channels rho = DensityMatrix(np.diag([1, 0])) for p in [0.25, 0.5, 0.75, 1]: target = rho.evolve(Kraus(self.depol_kraus(p))) output = rho.evolve(Kraus(Choi(self.depol_choi(p)))) self.assertEqual(output, target) def test_choi_to_stinespring(self): """Test Choi to Stinespring transformation.""" # Test unitary channels for mat, choi in zip(self.unitary_mat, self.unitary_choi): chan1 = Kraus(mat) chan2 = Kraus(Choi(choi)) self.assertTrue(matrix_equal(chan2.data[0], chan1.data[0], ignore_phase=True)) # Test depolarizing channels rho = DensityMatrix(np.diag([1, 0])) for p in [0.25, 0.5, 0.75, 1]: target = rho.evolve(Stinespring(self.depol_stine(p))) output = rho.evolve(Stinespring(Choi(self.depol_choi(p)))) self.assertEqual(output, target) def test_choi_to_chi(self): """Test Choi to Chi transformation.""" # Test unitary channels for choi, chi in zip(self.unitary_choi, self.unitary_chi): chan1 = Chi(chi) chan2 = Chi(Choi(choi)) self.assertEqual(chan1, chan2) # Test depolarizing channels for p in [0.25, 0.5, 0.75, 1]: chan1 = Chi(self.depol_chi(p)) chan2 = Chi(Choi(self.depol_choi(p))) self.assertEqual(chan1, chan2) def test_choi_to_ptm(self): """Test Choi to PTM transformation.""" # Test unitary channels for choi, ptm in zip(self.unitary_choi, self.unitary_ptm): chan1 = PTM(ptm) chan2 = PTM(Choi(choi)) self.assertEqual(chan1, chan2) # Test depolarizing channels for p in [0.25, 0.5, 0.75, 1]: chan1 = PTM(self.depol_ptm(p)) chan2 = PTM(Choi(self.depol_choi(p))) self.assertEqual(chan1, chan2) def test_superop_to_operator(self): """Test SuperOp to Operator transformation.""" for mat, sop in zip(self.unitary_mat, self.unitary_sop): chan1 = Operator(mat) chan2 = Operator(SuperOp(sop)) self.assertTrue(matrix_equal(chan2.data, chan1.data, ignore_phase=True)) self.assertRaises(QiskitError, Operator, SuperOp(self.depol_sop(0.5))) def test_superop_to_choi(self): """Test SuperOp to Choi transformation.""" # Test unitary channels for choi, sop in zip(self.unitary_choi, self.unitary_sop): chan1 = Choi(choi) chan2 = Choi(SuperOp(sop)) self.assertEqual(chan1, chan2) # Test depolarizing channels for p in [0, 0.25, 0.5, 0.75, 1]: chan1 = Choi(self.depol_choi(p)) chan2 = Choi(SuperOp(self.depol_sop(p))) self.assertEqual(chan1, chan2) def test_superop_to_superop(self): """Test SuperOp to SuperOp transformation.""" # Test unitary channels for sop in self.unitary_sop: chan1 = SuperOp(sop) chan2 = SuperOp(chan1) self.assertEqual(chan1, chan2) # Test depolarizing channels for p in [0, 0.25, 0.5, 0.75, 1]: chan1 = SuperOp(self.depol_sop(p)) chan2 = SuperOp(chan1) self.assertEqual(chan1, chan2) def test_superop_to_kraus(self): """Test SuperOp to Kraus transformation.""" # Test unitary channels for mat, sop in zip(self.unitary_mat, self.unitary_sop): chan1 = Kraus(mat) chan2 = Kraus(SuperOp(sop)) self.assertTrue(matrix_equal(chan2.data[0], chan1.data[0], ignore_phase=True)) # Test depolarizing channels rho = DensityMatrix(np.diag([1, 0])) for p in [0.25, 0.5, 0.75, 1]: target = rho.evolve(Kraus(self.depol_kraus(p))) output = rho.evolve(Kraus(SuperOp(self.depol_sop(p)))) self.assertEqual(output, target) def test_superop_to_stinespring(self): """Test SuperOp to Stinespring transformation.""" # Test unitary channels for mat, sop in zip(self.unitary_mat, self.unitary_sop): chan1 = Stinespring(mat) chan2 = Stinespring(SuperOp(sop)) self.assertTrue(matrix_equal(chan2.data[0], chan1.data[0], ignore_phase=True)) # Test depolarizing channels rho = DensityMatrix(np.diag([1, 0])) for p in [0.25, 0.5, 0.75, 1]: target = rho.evolve(Stinespring(self.depol_stine(p))) output = rho.evolve(Stinespring(SuperOp(self.depol_sop(p)))) self.assertEqual(output, target) def test_superop_to_chi(self): """Test SuperOp to Chi transformation.""" # Test unitary channels for sop, ptm in zip(self.unitary_sop, self.unitary_ptm): chan1 = PTM(ptm) chan2 = PTM(SuperOp(sop)) self.assertEqual(chan1, chan2) # Test depolarizing channels for p in [0.25, 0.5, 0.75, 1]: chan1 = Chi(self.depol_chi(p)) chan2 = Chi(SuperOp(self.depol_sop(p))) self.assertEqual(chan1, chan2) def test_superop_to_ptm(self): """Test SuperOp to PTM transformation.""" # Test unitary channels for sop, ptm in zip(self.unitary_sop, self.unitary_ptm): chan1 = PTM(ptm) chan2 = PTM(SuperOp(sop)) self.assertEqual(chan1, chan2) # Test depolarizing channels for p in [0.25, 0.5, 0.75, 1]: chan1 = PTM(self.depol_ptm(p)) chan2 = PTM(SuperOp(self.depol_sop(p))) self.assertEqual(chan1, chan2) def test_kraus_to_operator(self): """Test Kraus to Operator transformation.""" for mat in self.unitary_mat: chan1 = Operator(mat) chan2 = Operator(Kraus(mat)) self.assertTrue(matrix_equal(chan2.data, chan1.data, ignore_phase=True)) self.assertRaises(QiskitError, Operator, Kraus(self.depol_kraus(0.5))) def test_kraus_to_choi(self): """Test Kraus to Choi transformation.""" # Test unitary channels for mat, choi in zip(self.unitary_mat, self.unitary_choi): chan1 = Choi(choi) chan2 = Choi(Kraus(mat)) self.assertEqual(chan1, chan2) # Test depolarizing channels for p in [0.25, 0.5, 0.75, 1]: chan1 = Choi(self.depol_choi(p)) chan2 = Choi(Kraus(self.depol_kraus(p))) self.assertEqual(chan1, chan2) def test_kraus_to_superop(self): """Test Kraus to SuperOp transformation.""" # Test unitary channels for mat, sop in zip(self.unitary_mat, self.unitary_sop): chan1 = SuperOp(sop) chan2 = SuperOp(Kraus(mat)) self.assertEqual(chan1, chan2) # Test depolarizing channels for p in [0.25, 0.5, 0.75, 1]: chan1 = SuperOp(self.depol_sop(p)) chan2 = SuperOp(Kraus(self.depol_kraus(p))) self.assertEqual(chan1, chan2) def test_kraus_to_kraus(self): """Test Kraus to Kraus transformation.""" # Test unitary channels for mat in self.unitary_mat: chan1 = Kraus(mat) chan2 = Kraus(chan1) self.assertEqual(chan1, chan2) # Test depolarizing channels for p in [0.25, 0.5, 0.75, 1]: chan1 = Kraus(self.depol_kraus(p)) chan2 = Kraus(chan1) self.assertEqual(chan1, chan2) def test_kraus_to_stinespring(self): """Test Kraus to Stinespring transformation.""" # Test unitary channels for mat in self.unitary_mat: chan1 = Stinespring(mat) chan2 = Stinespring(Kraus(mat)) self.assertTrue(matrix_equal(chan2.data[0], chan1.data[0], ignore_phase=True)) # Test depolarizing channels rho = DensityMatrix(np.diag([1, 0])) for p in [0.25, 0.5, 0.75, 1]: target = rho.evolve(Stinespring(self.depol_stine(p))) output = rho.evolve(Stinespring(Kraus(self.depol_kraus(p)))) self.assertEqual(output, target) def test_kraus_to_chi(self): """Test Kraus to Chi transformation.""" # Test unitary channels for mat, chi in zip(self.unitary_mat, self.unitary_chi): chan1 = Chi(chi) chan2 = Chi(Kraus(mat)) self.assertEqual(chan1, chan2) # Test depolarizing channels for p in [0.25, 0.5, 0.75, 1]: chan1 = Chi(self.depol_chi(p)) chan2 = Chi(Kraus(self.depol_kraus(p))) self.assertEqual(chan1, chan2) def test_kraus_to_ptm(self): """Test Kraus to PTM transformation.""" # Test unitary channels for mat, ptm in zip(self.unitary_mat, self.unitary_ptm): chan1 = PTM(ptm) chan2 = PTM(Kraus(mat)) self.assertEqual(chan1, chan2) # Test depolarizing channels for p in [0.25, 0.5, 0.75, 1]: chan1 = PTM(self.depol_ptm(p)) chan2 = PTM(Kraus(self.depol_kraus(p))) self.assertEqual(chan1, chan2) def test_stinespring_to_operator(self): """Test Stinespring to Operator transformation.""" for mat in self.unitary_mat: chan1 = Operator(mat) chan2 = Operator(Stinespring(mat)) self.assertTrue(matrix_equal(chan2.data, chan1.data, ignore_phase=True)) self.assertRaises(QiskitError, Operator, Stinespring(self.depol_stine(0.5))) def test_stinespring_to_choi(self): """Test Stinespring to Choi transformation.""" # Test unitary channels for mat, choi in zip(self.unitary_mat, self.unitary_choi): chan1 = Choi(choi) chan2 = Choi(Stinespring(mat)) self.assertEqual(chan1, chan2) # Test depolarizing channels for p in [0.25, 0.5, 0.75, 1]: chan1 = Choi(self.depol_choi(p)) chan2 = Choi(Stinespring(self.depol_stine(p))) self.assertEqual(chan1, chan2) def test_stinespring_to_superop(self): """Test Stinespring to SuperOp transformation.""" # Test unitary channels for mat, sop in zip(self.unitary_mat, self.unitary_sop): chan1 = SuperOp(sop) chan2 = SuperOp(Kraus(mat)) self.assertEqual(chan1, chan2) # Test depolarizing channels for p in [0.25, 0.5, 0.75, 1]: chan1 = SuperOp(self.depol_sop(p)) chan2 = SuperOp(Stinespring(self.depol_stine(p))) self.assertEqual(chan1, chan2) def test_stinespring_to_kraus(self): """Test Stinespring to Kraus transformation.""" # Test unitary channels for mat in self.unitary_mat: chan1 = Kraus(mat) chan2 = Kraus(Stinespring(mat)) self.assertEqual(chan1, chan2) # Test depolarizing channels for p in [0.25, 0.5, 0.75, 1]: chan1 = Kraus(self.depol_kraus(p)) chan2 = Kraus(Stinespring(self.depol_stine(p))) self.assertEqual(chan1, chan2) def test_stinespring_to_stinespring(self): """Test Stinespring to Stinespring transformation.""" # Test unitary channels for mat in self.unitary_mat: chan1 = Stinespring(mat) chan2 = Stinespring(chan1) self.assertEqual(chan1, chan2) # Test depolarizing channels for p in [0.25, 0.5, 0.75, 1]: chan1 = Stinespring(self.depol_stine(p)) chan2 = Stinespring(chan1) self.assertEqual(chan1, chan2) def test_stinespring_to_chi(self): """Test Stinespring to Chi transformation.""" # Test unitary channels for mat, chi in zip(self.unitary_mat, self.unitary_chi): chan1 = Chi(chi) chan2 = Chi(Stinespring(mat)) self.assertEqual(chan1, chan2) # Test depolarizing channels for p in [0.25, 0.5, 0.75, 1]: chan1 = Chi(self.depol_chi(p)) chan2 = Chi(Stinespring(self.depol_stine(p))) self.assertEqual(chan1, chan2) def test_stinespring_to_ptm(self): """Test Stinespring to PTM transformation.""" # Test unitary channels for mat, ptm in zip(self.unitary_mat, self.unitary_ptm): chan1 = PTM(ptm) chan2 = PTM(Stinespring(mat)) self.assertEqual(chan1, chan2) # Test depolarizing channels for p in [0.25, 0.5, 0.75, 1]: chan1 = PTM(self.depol_ptm(p)) chan2 = PTM(Stinespring(self.depol_stine(p))) self.assertEqual(chan1, chan2) def test_chi_to_operator(self): """Test Chi to Operator transformation.""" for mat, chi in zip(self.unitary_mat, self.unitary_chi): chan1 = Operator(mat) chan2 = Operator(Chi(chi)) self.assertTrue(matrix_equal(chan2.data, chan1.data, ignore_phase=True)) self.assertRaises(QiskitError, Operator, Chi(self.depol_chi(0.5))) def test_chi_to_choi(self): """Test Chi to Choi transformation.""" # Test unitary channels for chi, choi in zip(self.unitary_chi, self.unitary_choi): chan1 = Choi(choi) chan2 = Choi(Chi(chi)) self.assertEqual(chan1, chan2) # Test depolarizing channels for p in [0.25, 0.5, 0.75, 1]: chan1 = Choi(self.depol_choi(p)) chan2 = Choi(Chi(self.depol_chi(p))) self.assertEqual(chan1, chan2) def test_chi_to_superop(self): """Test Chi to SuperOp transformation.""" # Test unitary channels for chi, sop in zip(self.unitary_chi, self.unitary_sop): chan1 = SuperOp(sop) chan2 = SuperOp(Chi(chi)) self.assertEqual(chan1, chan2) # Test depolarizing channels for p in [0.25, 0.5, 0.75, 1]: chan1 = SuperOp(self.depol_sop(p)) chan2 = SuperOp(Chi(self.depol_chi(p))) self.assertEqual(chan1, chan2) def test_chi_to_kraus(self): """Test Chi to Kraus transformation.""" # Test unitary channels for mat, chi in zip(self.unitary_mat, self.unitary_chi): chan1 = Kraus(mat) chan2 = Kraus(Chi(chi)) self.assertTrue(matrix_equal(chan2.data[0], chan1.data[0], ignore_phase=True)) # Test depolarizing channels rho = DensityMatrix(np.diag([1, 0])) for p in [0.25, 0.5, 0.75, 1]: target = rho.evolve(Kraus(self.depol_kraus(p))) output = rho.evolve(Kraus(Chi(self.depol_chi(p)))) self.assertEqual(output, target) def test_chi_to_stinespring(self): """Test Chi to Stinespring transformation.""" # Test unitary channels for mat, chi in zip(self.unitary_mat, self.unitary_chi): chan1 = Kraus(mat) chan2 = Kraus(Chi(chi)) self.assertTrue(matrix_equal(chan2.data[0], chan1.data[0], ignore_phase=True)) # Test depolarizing channels rho = DensityMatrix(np.diag([1, 0])) for p in [0.25, 0.5, 0.75, 1]: target = rho.evolve(Stinespring(self.depol_stine(p))) output = rho.evolve(Stinespring(Chi(self.depol_chi(p)))) self.assertEqual(output, target) def test_chi_to_chi(self): """Test Chi to Chi transformation.""" # Test unitary channels for chi in self.unitary_chi: chan1 = Chi(chi) chan2 = Chi(chan1) self.assertEqual(chan1, chan2) # Test depolarizing channels for p in [0.25, 0.5, 0.75, 1]: chan1 = Chi(self.depol_chi(p)) chan2 = Chi(chan1) self.assertEqual(chan1, chan2) def test_chi_to_ptm(self): """Test Chi to PTM transformation.""" # Test unitary channels for chi, ptm in zip(self.unitary_chi, self.unitary_ptm): chan1 = PTM(ptm) chan2 = PTM(Chi(chi)) self.assertEqual(chan1, chan2) # Test depolarizing channels for p in [0.25, 0.5, 0.75, 1]: chan1 = PTM(self.depol_ptm(p)) chan2 = PTM(Chi(self.depol_chi(p))) self.assertEqual(chan1, chan2) def test_ptm_to_operator(self): """Test PTM to Operator transformation.""" for mat, ptm in zip(self.unitary_mat, self.unitary_ptm): chan1 = Operator(mat) chan2 = Operator(PTM(ptm)) self.assertTrue(matrix_equal(chan2.data, chan1.data, ignore_phase=True)) self.assertRaises(QiskitError, Operator, PTM(self.depol_ptm(0.5))) def test_ptm_to_choi(self): """Test PTM to Choi transformation.""" # Test unitary channels for ptm, choi in zip(self.unitary_ptm, self.unitary_choi): chan1 = Choi(choi) chan2 = Choi(PTM(ptm)) self.assertEqual(chan1, chan2) # Test depolarizing channels for p in [0.25, 0.5, 0.75, 1]: chan1 = Choi(self.depol_choi(p)) chan2 = Choi(PTM(self.depol_ptm(p))) self.assertEqual(chan1, chan2) def test_ptm_to_superop(self): """Test PTM to SuperOp transformation.""" # Test unitary channels for ptm, sop in zip(self.unitary_ptm, self.unitary_sop): chan1 = SuperOp(sop) chan2 = SuperOp(PTM(ptm)) self.assertEqual(chan1, chan2) # Test depolarizing channels for p in [0.25, 0.5, 0.75, 1]: chan1 = SuperOp(self.depol_sop(p)) chan2 = SuperOp(PTM(self.depol_ptm(p))) self.assertEqual(chan1, chan2) def test_ptm_to_kraus(self): """Test PTM to Kraus transformation.""" # Test unitary channels for mat, ptm in zip(self.unitary_mat, self.unitary_ptm): chan1 = Kraus(mat) chan2 = Kraus(PTM(ptm)) self.assertTrue(matrix_equal(chan2.data[0], chan1.data[0], ignore_phase=True)) # Test depolarizing channels rho = DensityMatrix(np.diag([1, 0])) for p in [0.25, 0.5, 0.75, 1]: target = rho.evolve(Kraus(self.depol_kraus(p))) output = rho.evolve(Kraus(PTM(self.depol_ptm(p)))) self.assertEqual(output, target) def test_ptm_to_stinespring(self): """Test PTM to Stinespring transformation.""" # Test unitary channels for mat, ptm in zip(self.unitary_mat, self.unitary_ptm): chan1 = Kraus(mat) chan2 = Kraus(PTM(ptm)) self.assertTrue(matrix_equal(chan2.data[0], chan1.data[0], ignore_phase=True)) # Test depolarizing channels rho = DensityMatrix(np.diag([1, 0])) for p in [0.25, 0.5, 0.75, 1]: target = rho.evolve(Stinespring(self.depol_stine(p))) output = rho.evolve(Stinespring(PTM(self.depol_ptm(p)))) self.assertEqual(output, target) def test_ptm_to_chi(self): """Test PTM to Chi transformation.""" # Test unitary channels for chi, ptm in zip(self.unitary_chi, self.unitary_ptm): chan1 = Chi(chi) chan2 = Chi(PTM(ptm)) self.assertEqual(chan1, chan2) # Test depolarizing channels for p in [0.25, 0.5, 0.75, 1]: chan1 = Chi(self.depol_chi(p)) chan2 = Chi(PTM(self.depol_ptm(p))) self.assertEqual(chan1, chan2) def test_ptm_to_ptm(self): """Test PTM to PTM transformation.""" # Test unitary channels for ptm in self.unitary_ptm: chan1 = PTM(ptm) chan2 = PTM(chan1) self.assertEqual(chan1, chan2) # Test depolarizing channels for p in [0.25, 0.5, 0.75, 1]: chan1 = PTM(self.depol_ptm(p)) chan2 = PTM(chan1) self.assertEqual(chan1, chan2) if __name__ == "__main__": unittest.main()
https://github.com/qiskit-community/qiskit-translations-staging
qiskit-community
from qiskit import QuantumCircuit, transpile, schedule from qiskit.visualization.pulse_v2 import draw, IQXSimple from qiskit.providers.fake_provider import FakeBoeblingen qc = QuantumCircuit(2) qc.h(0) qc.cx(0, 1) qc.measure_all() qc = transpile(qc, FakeBoeblingen(), layout_method='trivial') sched = schedule(qc, FakeBoeblingen()) draw(sched, style=IQXSimple(), backend=FakeBoeblingen())
https://github.com/qiskit-community/qiskit-translations-staging
qiskit-community
import numpy as np import matplotlib.pyplot as plt from IPython.display import display, clear_output from qiskit.primitives import Estimator from qiskit.algorithms.minimum_eigensolvers import VQE from qiskit.algorithms.observables_evaluator import estimate_observables from qiskit.algorithms.optimizers import COBYLA, SLSQP from qiskit.circuit import QuantumCircuit, Parameter from qiskit.circuit.library import TwoLocal from qiskit.quantum_info import Pauli, SparsePauliOp from qiskit.utils import algorithm_globals from qiskit_nature.second_q.operators import FermionicOp from qiskit_nature.second_q.mappers import JordanWignerMapper def kronecker_delta_function(n: int, m: int) -> int: """An implementation of the Kronecker delta function. Args: n (int): The first integer argument. m (int): The second integer argument. Returns: Returns 1 if n = m, else returns 0. """ return int(n == m) def create_deuteron_hamiltonian( N: int, hbar_omega: float = 7.0, V_0: float = -5.68658111 ) -> SparsePauliOp: """Creates a version of the Deuteron Hamiltonian as a qubit operator. Args: N (int): An integer number that represents the dimension of the basis. hbar_omega (float, optional): The value of the product of hbar and omega. Defaults to 7.0. V_0 (float, optional): The value of the potential energy. Defaults to -5.68658111. Returns: SparsePauliOp: The qubit-space Hamiltonian that represents the Deuteron. """ hamiltonian_terms = {} for m in range(N): for n in range(N): label = "+_{} -_{}".format(str(n), str(m)) coefficient_kinect = (hbar_omega / 2) * ( (2 * n + 3 / 2) * kronecker_delta_function(n, m) - np.sqrt(n * (n + (1 / 2))) * kronecker_delta_function(n, m + 1) - np.sqrt((n + 1) * (n + (3 / 2)) * kronecker_delta_function(n, m - 1)) ) hamiltonian_terms[label] = coefficient_kinect coefficient_potential = ( V_0 * kronecker_delta_function(n, 0) * kronecker_delta_function(n, m) ) hamiltonian_terms[label] += coefficient_potential hamiltonian = FermionicOp(hamiltonian_terms, num_spin_orbitals=N) mapper = JordanWignerMapper() qubit_hamiltonian = mapper.map(hamiltonian) if not isinstance(qubit_hamiltonian, SparsePauliOp): qubit_hamiltonian = qubit_hamiltonian.primitive return qubit_hamiltonian deuteron_hamiltonians = [create_deuteron_hamiltonian(i) for i in range(1, 5)] for i, hamiltonian in enumerate(deuteron_hamiltonians): print("Deuteron Hamiltonian: H_{}".format(i + 1)) print(hamiltonian) print("\n") theta = Parameter(r"$\theta$") eta = Parameter(r"$\eta$") wavefunction = QuantumCircuit(1) wavefunction.ry(theta, 0) wavefunction.draw("mpl") wavefunction2 = QuantumCircuit(2) wavefunction2.x(0) wavefunction2.ry(theta, 1) wavefunction2.cx(1, 0) wavefunction2.draw("mpl") wavefunction3 = QuantumCircuit(3) wavefunction3.x(0) wavefunction3.ry(eta, 1) wavefunction3.ry(theta, 2) wavefunction3.cx(2, 0) wavefunction3.cx(0, 1) wavefunction3.ry(-eta, 1) wavefunction3.cx(0, 1) wavefunction3.cx(1, 0) wavefunction3.draw("mpl") ansatz = [wavefunction, wavefunction2, wavefunction3] reference_values = [] print("Exact binding energies calculated through numpy.linalg.eigh \n") for i, hamiltonian in enumerate(deuteron_hamiltonians): eigenvalues, eigenstates = np.linalg.eigh(hamiltonian.to_matrix()) reference_values.append(eigenvalues[0]) print("Exact binding energy for H_{}: {}".format(i + 1, eigenvalues[0])) print( "Results using Estimator for H_1, H_2 and H_3 with the ansatz given in the reference paper \n" ) for i in range(3): seed = 42 algorithm_globals.random_seed = seed vqe = VQE(Estimator(), ansatz=ansatz[i], optimizer=SLSQP()) vqe_result = vqe.compute_minimum_eigenvalue(deuteron_hamiltonians[i]) binding_energy = vqe_result.optimal_value print("Binding energy for H_{}: {} MeV".format(i + 1, binding_energy)) def callback(eval_count, parameters, mean, std): # Overwrites the same line when printing display("Evaluation: {}, Energy: {}, Std: {}".format(eval_count, mean, std)) clear_output(wait=True) counts.append(eval_count) values.append(mean) params.append(parameters) deviation.append(std) plots = [] for i in range(3): counts = [] values = [] params = [] deviation = [] seed = 42 algorithm_globals.random_seed = seed vqe = VQE(Estimator(), ansatz=ansatz[i], optimizer=COBYLA(), callback=callback) vqe_result = vqe.compute_minimum_eigenvalue(deuteron_hamiltonians[i]) plots.append([counts, values]) fig, ax = plt.subplots(nrows=3, ncols=1) fig.set_size_inches((12, 12)) for i, plot in enumerate(plots): ax[i].plot(plot[0], plot[1], "o-", label="COBYLA") ax[i].axhline( y=reference_values[i], color="k", linestyle="--", label=f"Reference Value: {reference_values[i]}", ) ax[i].legend() ax[i].set_xlabel("Cost Function Evaluations", fontsize=15) ax[i].set_ylabel(r"$\langle H_{} \rangle$ - Energy (MeV)".format(i + 1), fontsize=15) plt.show() twolocal_ansatzes = [] for i in range(1, 5): ansatz = TwoLocal( deuteron_hamiltonians[i - 1].num_qubits, ["rz", "ry"], "cx", entanglement="full", reps=i, initial_state=None, ) twolocal_ansatzes.append(ansatz) print("Results using Estimator for H_1, H_2, H_3 and H_4 with TwoLocal ansatz \n") seed = 42 algorithm_globals.random_seed = seed for i in range(4): vqe = VQE(Estimator(), ansatz=twolocal_ansatzes[i], optimizer=SLSQP()) vqe_result = vqe.compute_minimum_eigenvalue(deuteron_hamiltonians[i]) binding_energy = vqe_result.optimal_value print("Binding energy for H_{}:".format(i + 1), binding_energy, "MeV") seed = 42 algorithm_globals.random_seed = seed plots_tl = [] for i in range(4): counts = [] values = [] params = [] deviation = [] vqe = VQE( Estimator(), ansatz=twolocal_ansatzes[i], optimizer=SLSQP(), callback=callback, ) vqe_result = vqe.compute_minimum_eigenvalue(deuteron_hamiltonians[i]) plots_tl.append([counts, values]) fig, ax = plt.subplots(nrows=4, ncols=1) fig.set_size_inches((15, 15)) for i, plot in enumerate(plots_tl): ax[i].plot(plot[0], plot[1], "o-", label="COBYLA") ax[i].axhline( y=reference_values[i], color="k", linestyle="--", label=f"Reference Value: {reference_values[i]}", ) ax[i].legend() ax[i].set_xlabel("Cost Function Evaluations", fontsize=15) ax[i].set_ylabel(r"$\langle H_{} \rangle$ - Energy (MeV)".format(i + 1), fontsize=15) plt.show() def calculate_observables_exp_values( quantum_circuit: QuantumCircuit, observables: list, angles: list ) -> list: """Calculate the expectation value of an observable given the quantum circuit that represents the wavefunction and a list of parameters. Args: quantum_circuit (QuantumCircuit): A parameterized quantum circuit that represents the wavefunction of the system. observables (list): A list containing the observables that we want to know the expectation values. angles (list): A list with the values that will be used in the 'bind_parameters' method. Returns: list_exp_values (list): A list containing the expectation values of the observables given as input. """ list_exp_values = [] for observable in observables: exp_values = [] for angle in angles: qc = quantum_circuit.bind_parameters({theta: angle}) result = estimate_observables( Estimator(), quantum_state=qc, observables=[observable], ) exp_values.append(result[0][0]) list_exp_values.append(exp_values) return list_exp_values angles = list(np.linspace(-np.pi, np.pi, 100)) observables = [ Pauli("IZ"), Pauli("ZI"), Pauli("XX"), Pauli("YY"), deuteron_hamiltonians[1], ] h2_observables_exp_values = calculate_observables_exp_values(wavefunction2, observables, angles) fig, ax = plt.subplots(nrows=2, ncols=1) fig.set_size_inches((12, 12)) ax[0].plot(angles, h2_observables_exp_values[0], "o", label=r"$Z_0$") ax[0].plot(angles, h2_observables_exp_values[1], "o", label=r"$Z_1$") ax[0].plot(angles, h2_observables_exp_values[2], "o", label=r"$X_0X_1$") ax[0].plot(angles, h2_observables_exp_values[3], "o", label=r"$Y_0Y_1$") ax[0].axhline( y=1, color="k", linestyle="--", ) ax[0].axhline(y=-1, color="k", linestyle="--") ax[0].legend() ax[0].set_xlabel(r"Theta - $\theta$", fontsize=15) ax[0].set_ylabel(r"$\langle O \rangle $ - Operator Expectation Value", fontsize=15) ax[0].set_xticks( [-np.pi, -np.pi / 2, 0, np.pi / 2, np.pi], labels=[r"$-\pi$", r"$-\pi/2$", "0", r"$\pi/2$", r"$\pi$"], ) ax[0].set_title( r"Expectation value of the observables $Z_0$, $Z_1$, $X_0X_1$ and $Y_0Y_1$ when we vary $\theta$ in the ansatz.", fontsize=15, ) ax[1].plot(angles, h2_observables_exp_values[4], "o") ax[1].axhline( y=reference_values[1], color="k", linestyle="--", label="Binding Energy: {} MeV".format(np.round(reference_values[1], 3)), ) ax[1].legend() ax[1].set_xlabel(r"Theta - $\theta$", fontsize=15) ax[1].set_ylabel(r"$\langle H_2 \rangle $ - Energy (MeV)", fontsize=15) ax[1].set_xticks( [-np.pi, -np.pi / 2, 0, np.pi / 2, np.pi], labels=[r"$-\pi$", r"$-\pi/2$", "0", r"$\pi/2$", r"$\pi$"], ) ax[1].set_title( r"Behavior of the expectation value of $H_2$ when we vary $\theta$ in the ansatz.", fontsize=15 ) plt.show() import qiskit.tools.jupyter %qiskit_version_table %qiskit_copyright
https://github.com/yatharth0610/Quantum-Algorithms-qiskit-
yatharth0610
from qiskit import * from qiskit.compiler import * from qiskit.tools.jupyter import * from qiskit.visualization import * import matplotlib.pyplot as plotter import numpy as np from IPython.display import display, Math, Latex %matplotlib inline # Loading your IBM Q account(s) provider = IBMQ.load_account() qc1=QuantumCircuit(2) qc1.h(0) qc1.h(1) qc1.barrier() #The part between the barriers is our oracle qc1.cz(0,1) #We are using a controlled-Z gate which flips the sign of the second qubit when both qubits are set to '1' qc1.barrier() qc1.draw('mpl') def final_vector(qc): backend = Aer.get_backend('statevector_simulator') job = execute(qc, backend) result = job.result() outputstate = result.get_statevector(qc, decimals=3) return outputstate print(final_vector(qc1)) #We can see that the desired state has been obtained qc2=QuantumCircuit(3) qc2.h(0) qc2.h(1) qc2.h(2) qc2.barrier() #The part between the barriers is our oracle qc2.x(0) qc2.h(1) qc2.x(2) qc2.ccx(0, 2, 1) qc2.x(0) qc2.h(1) qc2.x(2) qc2.barrier() qc2.draw('mpl') def final_vector(qc): backend = Aer.get_backend('statevector_simulator') job = execute(qc, backend) result = job.result() outputstate = result.get_statevector(qc, decimals=3) return outputstate print(final_vector(qc2)) def ccz_gate(qc,a,b,c): qc.h(c) qc.ccx(a,b,c) qc.h(c) #Let's create an oracle which will mark the states 101 and 110 #(This particular oracle won't be using ancilla qubits) def phase_oracle(circuit): circuit.cz(0, 2) circuit.cz(0, 1) n=3 qc2=QuantumCircuit(n,n) for i in range(0,n): qc2.h(i) qc2.barrier([0,1,2]) #This creates a superposition of all states #We will now perform the Grover iteration phase_oracle(qc2) qc2.barrier([0,1,2]) for i in range(0,n): qc2.h(i) #Performing a conditional phase shift qc2.x(0) qc2.x(1) qc2.x(2) ccz_gate(qc2,0,1,2) qc2.x(0) qc2.x(1) qc2.x(2) for i in range(0,n): qc2.h(i) #The Grover iteration is now complete qc2.barrier([0,1,2]) qc2.draw('mpl') qc2.measure(0,0) qc2.measure(1,1) qc2.measure(2,2) qc2.draw('mpl') def counts_circ(circ): backend_sim = Aer.get_backend('qasm_simulator') job_sim = execute(circ, backend_sim, shots=2000) result_sim = job_sim.result() counts = result_sim.get_counts(circ) return(counts) plot_histogram(counts_circ(qc2)) qc_mct=QuantumCircuit(5,5) for i in range(0,4): qc_mct.x(i) qc_mct.mct([0,1,2,3],4) qc_mct.draw('mpl') qc_mct.measure(0,0) qc_mct.measure(1,1) qc_mct.measure(2,2) qc_mct.measure(3,3) qc_mct.measure(4,4) plot_histogram(counts_circ(qc_mct)) def c3z_gate(qc, a, b, c, d): qc.h(d) qc.mct([a, b, c], d) qc.h(d) def phase_oracle(qc): qc.x(1) qc.x(3) c3z_gate(qc, 0, 1, 2, 3) # Handles 1010 qc.x(2) c3z_gate(qc, 0, 1, 2, 3) # Handles 1000 qc.x(3) c3z_gate(qc, 0, 1, 2, 3) # Handles 1001 qc.x(2) qc.x(0) qc.x(3) c3z_gate(qc, 0, 1, 2, 3) # Handles 0010 qc.x(0) qc.x(1) qc.x(3) n = 4 qc3 = QuantumCircuit(n, n) for i in range(0,n): qc3.h(i) qc3.barrier([0, 1, 2, 3]) phase_oracle(qc3) qc3.barrier([0, 1, 2, 3]) for i in range(0,n): qc3.h(i) qc3.x(0) qc3.x(1) qc3.x(2) qc3.x(3) c3z_gate(qc3, 0, 1, 2, 3) qc3.x(0) qc3.x(1) qc3.x(2) qc3.x(3) for i in range(0,n): qc3.h(i) qc3.barrier([0, 1, 2, 3]) qc3.measure(0, 0) qc3.measure(1, 1) qc3.measure(2, 2) qc3.measure(3, 3) qc3.draw('mpl') def counts_circ(circ): backend_sim = Aer.get_backend('qasm_simulator') job_sim = execute(circ, backend_sim, shots=2000) result_sim = job_sim.result() counts = result_sim.get_counts(circ) return(counts) plot_histogram(counts_circ(qc3))
https://github.com/joemoorhouse/quantum-mc
joemoorhouse
from quantum_mc.arithmetic.piecewise_linear_transform import PiecewiseLinearTransform3 import unittest import numpy as np from qiskit.test.base import QiskitTestCase import quantum_mc.calibration.fitting as ft import quantum_mc.calibration.time_series as ts from scipy.stats import multivariate_normal, norm from qiskit.test.base import QiskitTestCase from qiskit import execute, Aer, QuantumCircuit, QuantumRegister, ClassicalRegister, AncillaRegister from qiskit.circuit.library import NormalDistribution from qiskit.quantum_info import Statevector from qiskit.circuit.library import NormalDistribution, LogNormalDistribution, IntegerComparator from qiskit.utils import QuantumInstance from qiskit.algorithms import IterativeAmplitudeEstimation, EstimationProblem def get_sims(normal_distribution): import numpy as np values = normal_distribution._values probs = normal_distribution._probabilities # we generate a bunch of realisation of values, based upper_bounds = [0.0] stop = 0.0 for val, prob in zip(values, probs): stop += prob upper_bounds.append(stop) r = np.random.uniform(low=0.0, high=1.0, size=10) indices = np.searchsorted(upper_bounds, r, side='left', sorter=None) - 1 g1, g2 = np.meshgrid(range(2**3), range(2**3), indexing="ij",) i1 = g1.flatten()[indices] i2 = g2.flatten()[indices] #x = list(zip(*(grid.flatten() for grid in meshgrid))) return i1, i2 class TestMcVar(QiskitTestCase): def test_no_discretisation(self): correl = ft.get_correl("AAPL", "MSFT") coeff_set = [] pl_set = [] for ticker in ["MSFT", "AAPL"]: ((cdf_x, cdf_y), sigma) = ft.get_cdf_data(ticker) (x, y) = ft.get_fit_data(ticker, norm_to_rel = False) (pl, coeffs) = ft.fit_piecewise_linear(x, y) # scale, to apply an arbitrary delta (we happen to use the same value here, but could be different) coeffs = ft.scaled_coeffs(coeffs, 1.0 if ticker == "MSFT" else 1.0) coeff_set.append(coeffs) pl_set.append(lambda z : ft.piecewise_linear(z, *coeff_set[0])) pl_set.append(lambda z : ft.piecewise_linear(z, *coeff_set[1])) c = np.linalg.cholesky(correl) r = np.random.normal(0, 1, size = (2, 10)) v = c@r v1 = np.vectorize(pl_set[0])(v[0, :]) v2 = np.vectorize(pl_set[1])(v[1, :]) v = v1 + v2 def test_distribution_load(self): """ Test that calculates a cumulative probability from the P&L distribution.""" correl = ft.get_correl("AAPL", "MSFT") bounds_std = 3.0 num_qubits = [3, 3] sigma = correl bounds = [(-bounds_std, bounds_std), (-bounds_std, bounds_std)] mu = [0, 0] # starting point is a multi-variate normal distribution normal = NormalDistribution(num_qubits, mu=mu, sigma=sigma, bounds=bounds) pl_set = [] coeff_set = [] for ticker in ["MSFT", "AAPL"]: ((cdf_x, cdf_y), sigma) = ft.get_cdf_data(ticker) (x, y) = ft.get_fit_data(ticker, norm_to_rel = False) (pl, coeffs) = ft.fit_piecewise_linear(x, y) # scale, to apply an arbitrary delta (we happen to use the same value here, but could be different) coeffs = ft.scaled_coeffs(coeffs, 1.2) pl_set.append(lambda z : ft.piecewise_linear(z, *coeffs)) coeff_set.append(coeffs) # calculate the max and min P&Ls p_max = max(pl_set[0](bounds_std), pl_set[1](bounds_std)) p_min = min(pl_set[0](-bounds_std), pl_set[1](-bounds_std)) # we discretise the transforms and create the circuits transforms = [] i_to_js = [] for i,ticker in enumerate(["MSFT", "AAPL"]): (i_0, i_1, a0, a1, a2, b0, b1, b2, i_to_j, i_to_x, j_to_y) = ft.integer_piecewise_linear_coeffs(coeff_set[i], x_min = -bounds_std, x_max = bounds_std, y_min = p_min, y_max = p_max) transforms.append(PiecewiseLinearTransform3(i_0, i_1, a0, a1, a2, b0, b1, b2)) i_to_js.append(np.vectorize(i_to_j)) i1, i2 = get_sims(normal) j1 = i_to_js[0](i1) j2 = i_to_js[1](i2) j_tot = j1 + j2 num_ancillas = transforms[0].num_ancilla_qubits qr_input = QuantumRegister(6, 'input') # 2 times 3 registers qr_objective = QuantumRegister(1, 'objective') qr_result = QuantumRegister(6, 'result') qr_ancilla = QuantumRegister(num_ancillas, 'ancilla') #output = ClassicalRegister(6, 'output') state_preparation = QuantumCircuit(qr_input, qr_objective, qr_result, qr_ancilla) #, output) state_preparation.append(normal, qr_input) for i in range(2): offset = i * 3 state_preparation.append(transforms[i], qr_input[offset:offset + 3] + qr_result[:] + qr_ancilla[:]) # to calculate the cdf, we use an additional comparator x_eval = 4 comparator = IntegerComparator(len(qr_result), x_eval + 1, geq=False) state_preparation.append(comparator, qr_result[:] + qr_objective[:] + qr_ancilla[0:comparator.num_ancillas]) # now check check = False if check: job = execute(state_preparation, backend=Aer.get_backend('statevector_simulator')) var_prob = 0 for i, a in enumerate(job.result().get_statevector()): b = ('{0:0%sb}' % (len(qr_input) + 1)).format(i)[-(len(qr_input) + 1):] prob = np.abs(a)**2 if prob > 1e-6 and b[0] == '1': var_prob += prob print('Operator CDF(%s)' % x_eval + ' = %.4f' % var_prob) # now do AE problem = EstimationProblem(state_preparation=state_preparation, objective_qubits=[len(qr_input)]) # target precision and confidence level epsilon = 0.01 alpha = 0.05 qi = QuantumInstance(Aer.get_backend('aer_simulator'), shots=100) ae_cdf = IterativeAmplitudeEstimation(epsilon, alpha=alpha, quantum_instance=qi) result_cdf = ae_cdf.estimate(problem) conf_int = np.array(result_cdf.confidence_interval) print('Estimated value:\t%.4f' % result_cdf.estimation) print('Confidence interval: \t[%.4f, %.4f]' % tuple(conf_int)) state_preparation.draw()
https://github.com/maheshwaripranav/Qiskit-Fall-Fest-Kolkata-Hackathon
maheshwaripranav
# Essentials import matplotlib.pyplot as plt import numpy as np import pandas as pd # Classical Machine Learning from sklearn.svm import SVC from sklearn.datasets import make_blobs, make_circles from sklearn.cluster import SpectralClustering from sklearn.metrics import normalized_mutual_info_score, accuracy_score from sklearn.model_selection import train_test_split from sklearn.preprocessing import StandardScaler, MinMaxScaler # Quantum Machine Learning from qiskit import BasicAer from qiskit.circuit.library import ZZFeatureMap, ZFeatureMap, PauliFeatureMap from qiskit.utils import QuantumInstance, algorithm_globals from qiskit_machine_learning.algorithms import QSVC from qiskit_machine_learning.kernels import QuantumKernel dataset = pd.read_csv(r'iris_data\iris.data') features_all= dataset.iloc[:, :4].values features_sepal= dataset.iloc[:, :2].values features_petal= dataset.iloc[:, 2:4].values label = dataset.iloc[:, 4].values for i in range(len(label)): if label[i] == 'Iris-setosa': label[i] = 0 elif label[i] == 'Iris-versicolor': label[i] = 1 elif label[i] == 'Iris-virginica': label[i] = 2 label = label.astype(str).astype(int) X_train, X_test, y_train, y_test = train_test_split(features_all, label, test_size=0.25, random_state=12) sc = StandardScaler() X_train = sc.fit_transform(X_train) X_test = sc.transform(X_test) # Normalize mms = MinMaxScaler((-1, 1)) X_train = mms.fit_transform(X_train) X_test = mms.transform(X_test) clf = SVC(kernel="linear", random_state=2) clf.fit(X_train, y_train) y_pred = clf.predict(X_test) print("Accuracy is", accuracy_score(y_test, y_pred)) X_train, X_test, y_train, y_test = train_test_split(features_sepal, label, test_size=0.25, random_state=12) sc = StandardScaler() X_train = sc.fit_transform(X_train) X_test = sc.transform(X_test) # Normalize mms = MinMaxScaler((-1, 1)) X_train = mms.fit_transform(X_train) X_test = mms.transform(X_test) clf = SVC(kernel="rbf", random_state=2) clf.fit(X_train, y_train) y_pred = clf.predict(X_test) print("Accuracy is", accuracy_score(y_test, y_pred)) X_train, X_test, y_train, y_test = train_test_split(features_petal, label, test_size=0.25, random_state=12) sc = StandardScaler() X_train = sc.fit_transform(X_train) X_test = sc.transform(X_test) # Normalize mms = MinMaxScaler((-1, 1)) X_train = mms.fit_transform(X_train) X_test = mms.transform(X_test) clf = SVC(kernel="linear", random_state=2) clf.fit(X_train, y_train) y_pred = clf.predict(X_test) print("Accuracy is", accuracy_score(y_test, y_pred)) feature_map = ZZFeatureMap(feature_dimension=2, reps=2, entanglement='linear') backend = QuantumInstance(BasicAer.get_backend('qasm_simulator'), shots=8000) kernel = QuantumKernel(feature_map=feature_map, quantum_instance=backend) X_train, X_test, y_train, y_test = train_test_split(features_all, label, test_size=0.25, random_state=12) sc = StandardScaler() X_train = sc.fit_transform(X_train) X_test = sc.transform(X_test) # Normalize mms = MinMaxScaler((-1, 1)) X_train = mms.fit_transform(X_train) X_test = mms.transform(X_test) clf = SVC(kernel=kernel.evaluate) clf.fit(X_train, y_train) y_pred = clf.predict(X_test) print("Accuracy is", accuracy_score(y_test, y_pred)) X_train, X_test, y_train, y_test = train_test_split(features_sepal, label, test_size=0.25, random_state=12) sc = StandardScaler() X_train = sc.fit_transform(X_train) X_test = sc.transform(X_test) # Normalize mms = MinMaxScaler((-1, 1)) X_train = mms.fit_transform(X_train) X_test = mms.transform(X_test) clf = SVC(kernel="rbf", random_state=2) clf.fit(X_train, y_train) y_pred = clf.predict(X_test) print("Accuracy is", accuracy_score(y_test, y_pred)) X_train, X_test, y_train, y_test = train_test_split(features_petal, label, test_size=0.25, random_state=12) sc = StandardScaler() X_train = sc.fit_transform(X_train) X_test = sc.transform(X_test) # Normalize mms = MinMaxScaler((-1, 1)) X_train = mms.fit_transform(X_train) X_test = mms.transform(X_test) clf = SVC(kernel="linear", random_state=2) clf.fit(X_train, y_train) y_pred = clf.predict(X_test) print("Accuracy is", accuracy_score(y_test, y_pred))
https://github.com/qiskit-community/qiskit-translations-staging
qiskit-community
from qiskit_nature.units import DistanceUnit from qiskit_nature.second_q.drivers import PySCFDriver driver = PySCFDriver( atom="H 0 0 0; H 0 0 0.735", basis="sto3g", charge=0, spin=0, unit=DistanceUnit.ANGSTROM, ) es_problem = driver.run() from qiskit_nature.second_q.mappers import JordanWignerMapper mapper = JordanWignerMapper() from qiskit.algorithms.eigensolvers import NumPyEigensolver numpy_solver = NumPyEigensolver(filter_criterion=es_problem.get_default_filter_criterion()) from qiskit.algorithms.minimum_eigensolvers import VQE from qiskit.algorithms.optimizers import SLSQP from qiskit.primitives import Estimator from qiskit_nature.second_q.algorithms import GroundStateEigensolver, QEOM from qiskit_nature.second_q.circuit.library import HartreeFock, UCCSD ansatz = UCCSD( es_problem.num_spatial_orbitals, es_problem.num_particles, mapper, initial_state=HartreeFock( es_problem.num_spatial_orbitals, es_problem.num_particles, mapper, ), ) estimator = Estimator() # This first part sets the ground state solver # see more about this part in the ground state calculation tutorial solver = VQE(estimator, ansatz, SLSQP()) solver.initial_point = [0.0] * ansatz.num_parameters gse = GroundStateEigensolver(mapper, solver) # The qEOM algorithm is simply instantiated with the chosen ground state solver and Estimator primitive qeom_excited_states_solver = QEOM(gse, estimator, "sd") from qiskit_nature.second_q.algorithms import ExcitedStatesEigensolver numpy_excited_states_solver = ExcitedStatesEigensolver(mapper, numpy_solver) numpy_results = numpy_excited_states_solver.solve(es_problem) qeom_results = qeom_excited_states_solver.solve(es_problem) print(numpy_results) print("\n\n") print(qeom_results) import numpy as np def filter_criterion(eigenstate, eigenvalue, aux_values): return np.isclose(aux_values["ParticleNumber"][0], 2.0) new_numpy_solver = NumPyEigensolver(filter_criterion=filter_criterion) new_numpy_excited_states_solver = ExcitedStatesEigensolver(mapper, new_numpy_solver) new_numpy_results = new_numpy_excited_states_solver.solve(es_problem) print(new_numpy_results) import qiskit.tools.jupyter %qiskit_version_table %qiskit_copyright
https://github.com/swe-bench/Qiskit__qiskit
swe-bench
# This code is part of Qiskit. # # (C) Copyright IBM 2020, 2023. # # This code is licensed under the Apache License, Version 2.0. You may # obtain a copy of this license in the LICENSE.txt file in the root directory # of this source tree or at http://www.apache.org/licenses/LICENSE-2.0. # # Any modifications or derivative works of this code must retain this # copyright notice, and modified files need to carry a notice indicating # that they have been altered from the originals. """PauliBasisChange Class""" from functools import partial, reduce from typing import Callable, List, Optional, Tuple, Union, cast import numpy as np from qiskit import QuantumCircuit from qiskit.opflow.converters.converter_base import ConverterBase from qiskit.opflow.list_ops.composed_op import ComposedOp from qiskit.opflow.list_ops.list_op import ListOp from qiskit.opflow.list_ops.summed_op import SummedOp from qiskit.opflow.operator_base import OperatorBase from qiskit.opflow.operator_globals import H, I, S from qiskit.opflow.primitive_ops.pauli_op import PauliOp from qiskit.opflow.primitive_ops.pauli_sum_op import PauliSumOp from qiskit.opflow.primitive_ops.primitive_op import PrimitiveOp from qiskit.opflow.state_fns.operator_state_fn import OperatorStateFn from qiskit.opflow.state_fns.state_fn import StateFn from qiskit.quantum_info import Pauli from qiskit.utils.deprecation import deprecate_func class PauliBasisChange(ConverterBase): r""" Deprecated: Converter for changing Paulis into other bases. By default, the diagonal basis composed only of Pauli {Z, I}^n is used as the destination basis to which to convert. Meaning, if a Pauli containing X or Y terms is passed in, which cannot be sampled or evolved natively on some Quantum hardware, the Pauli can be replaced by a composition of a change of basis circuit and a Pauli composed of only Z and I terms (diagonal), which can be evolved or sampled natively on the Quantum hardware. The replacement function determines how the ``PauliOps`` should be replaced by their computed change-of-basis ``CircuitOps`` and destination ``PauliOps``. Several convenient out-of-the-box replacement functions have been added as static methods, such as ``measurement_replacement_fn``. This class uses the typical basis change method found in most Quantum Computing textbooks (such as on page 210 of Nielsen and Chuang's, "Quantum Computation and Quantum Information", ISBN: 978-1-107-00217-3), which involves diagonalizing the single-qubit Paulis with H and S† gates, mapping the eigenvectors of the diagonalized origin Pauli to the diagonalized destination Pauli using CNOTS, and then de-diagonalizing any single qubit Paulis to their non-diagonal destination values. Many other methods are possible, as well as variations on this method, such as the placement of the CNOT chains. """ @deprecate_func( since="0.24.0", additional_msg="For code migration guidelines, visit https://qisk.it/opflow_migration.", ) def __init__( self, destination_basis: Optional[Union[Pauli, PauliOp]] = None, traverse: bool = True, replacement_fn: Optional[Callable] = None, ) -> None: """ Args: destination_basis: The Pauli into the basis of which the operators will be converted. If None is specified, the destination basis will be the diagonal ({I, Z}^n) basis requiring only single qubit rotations. traverse: If true and the operator passed into convert contains sub-Operators, such as ListOp, traverse the Operator and apply the conversion to every applicable sub-operator within it. replacement_fn: A function specifying what to do with the basis-change ``CircuitOp`` and destination ``PauliOp`` when converting an Operator and replacing converted values. By default, this will be 1) For StateFns (or Measurements): replacing the StateFn with ComposedOp(StateFn(d), c) where c is the conversion circuit and d is the destination Pauli, so the overall beginning and ending operators are equivalent. 2) For non-StateFn Operators: replacing the origin p with c·d·c†, where c is the conversion circuit and d is the destination, so the overall beginning and ending operators are equivalent. """ super().__init__() if destination_basis is not None: self.destination = destination_basis # type: ignore else: self._destination = None # type: Optional[PauliOp] self._traverse = traverse self._replacement_fn = replacement_fn or PauliBasisChange.operator_replacement_fn @property def destination(self) -> Optional[PauliOp]: r""" The destination ``PauliOp``, or ``None`` if using the default destination, the diagonal basis. """ return self._destination @destination.setter def destination(self, dest: Union[Pauli, PauliOp]) -> None: r""" The destination ``PauliOp``, or ``None`` if using the default destination, the diagonal basis. """ if isinstance(dest, Pauli): dest = PauliOp(dest) if not isinstance(dest, PauliOp): raise TypeError( f"PauliBasisChange can only convert into Pauli bases, not {type(dest)}." ) self._destination = dest # TODO see whether we should make this performant by handling ListOps of Paulis later. # pylint: disable=too-many-return-statements def convert(self, operator: OperatorBase) -> OperatorBase: r""" Given a ``PauliOp``, or an Operator containing ``PauliOps`` if ``_traverse`` is True, converts each Pauli into the basis specified by self._destination and a basis-change-circuit, calls ``replacement_fn`` with these two Operators, and replaces the ``PauliOps`` with the output of ``replacement_fn``. For example, for the built-in ``operator_replacement_fn`` below, each PauliOp p will be replaced by the composition of the basis-change Clifford ``CircuitOp`` c with the destination PauliOp d and c†, such that p = c·d·c†, up to global phase. Args: operator: The Operator to convert. Returns: The converted Operator. """ if ( isinstance(operator, OperatorStateFn) and isinstance(operator.primitive, PauliSumOp) and operator.primitive.grouping_type == "TPB" ): primitive = operator.primitive.primitive.copy() origin_x = reduce(np.logical_or, primitive.paulis.x) origin_z = reduce(np.logical_or, primitive.paulis.z) origin_pauli = Pauli((origin_z, origin_x)) cob_instr_op, _ = self.get_cob_circuit(origin_pauli) primitive.paulis.z = np.logical_or(primitive.paulis.x, primitive.paulis.z) primitive.paulis.x = False # The following line is because the deprecated PauliTable did not have a phase # and did not track it, so phase=0 was always guaranteed. # But the new PauliList may change phase. primitive.paulis.phase = 0 dest_pauli_sum_op = PauliSumOp(primitive, coeff=operator.coeff, grouping_type="TPB") return self._replacement_fn(cob_instr_op, dest_pauli_sum_op) if ( isinstance(operator, OperatorStateFn) and isinstance(operator.primitive, SummedOp) and all( isinstance(op, PauliSumOp) and op.grouping_type == "TPB" for op in operator.primitive.oplist ) ): sf_list: List[OperatorBase] = [ StateFn(op, is_measurement=operator.is_measurement) for op in operator.primitive.oplist ] listop_of_statefns = SummedOp(oplist=sf_list, coeff=operator.coeff) return listop_of_statefns.traverse(self.convert) if isinstance(operator, OperatorStateFn) and isinstance(operator.primitive, PauliSumOp): operator = OperatorStateFn( operator.primitive.to_pauli_op(), coeff=operator.coeff, is_measurement=operator.is_measurement, ) if isinstance(operator, PauliSumOp): operator = operator.to_pauli_op() if isinstance(operator, (Pauli, PauliOp)): cob_instr_op, dest_pauli_op = self.get_cob_circuit(operator) return self._replacement_fn(cob_instr_op, dest_pauli_op) if isinstance(operator, StateFn) and "Pauli" in operator.primitive_strings(): # If the StateFn/Meas only contains a Pauli, use it directly. if isinstance(operator.primitive, PauliOp): cob_instr_op, dest_pauli_op = self.get_cob_circuit(operator.primitive) return self._replacement_fn(cob_instr_op, dest_pauli_op * operator.coeff) # TODO make a canonical "distribute" or graph swap as method in ListOp? elif operator.primitive.distributive: if operator.primitive.abelian: origin_pauli = self.get_tpb_pauli(operator.primitive) cob_instr_op, _ = self.get_cob_circuit(origin_pauli) diag_ops: List[OperatorBase] = [ self.get_diagonal_pauli_op(op) for op in operator.primitive.oplist ] dest_pauli_op = operator.primitive.__class__( diag_ops, coeff=operator.coeff, abelian=True ) return self._replacement_fn(cob_instr_op, dest_pauli_op) else: sf_list = [ StateFn(op, is_measurement=operator.is_measurement) for op in operator.primitive.oplist ] listop_of_statefns = operator.primitive.__class__( oplist=sf_list, coeff=operator.coeff ) return listop_of_statefns.traverse(self.convert) elif ( isinstance(operator, ListOp) and self._traverse and "Pauli" in operator.primitive_strings() ): # If ListOp is abelian we can find a single post-rotation circuit # for the whole set. For now, # assume operator can only be abelian if all elements are # Paulis (enforced in AbelianGrouper). if operator.abelian: origin_pauli = self.get_tpb_pauli(operator) cob_instr_op, _ = self.get_cob_circuit(origin_pauli) oplist = cast(List[PauliOp], operator.oplist) diag_ops = [self.get_diagonal_pauli_op(op) for op in oplist] dest_list_op = operator.__class__(diag_ops, coeff=operator.coeff, abelian=True) return self._replacement_fn(cob_instr_op, dest_list_op) else: return operator.traverse(self.convert) return operator @staticmethod def measurement_replacement_fn( cob_instr_op: PrimitiveOp, dest_pauli_op: Union[PauliOp, PauliSumOp, ListOp] ) -> OperatorBase: r""" A built-in convenience replacement function which produces measurements isomorphic to an ``OperatorStateFn`` measurement holding the origin ``PauliOp``. Args: cob_instr_op: The basis-change ``CircuitOp``. dest_pauli_op: The destination Pauli type operator. Returns: The ``~StateFn @ CircuitOp`` composition equivalent to a measurement by the original ``PauliOp``. """ return ComposedOp([StateFn(dest_pauli_op, is_measurement=True), cob_instr_op]) @staticmethod def statefn_replacement_fn( cob_instr_op: PrimitiveOp, dest_pauli_op: Union[PauliOp, PauliSumOp, ListOp] ) -> OperatorBase: r""" A built-in convenience replacement function which produces state functions isomorphic to an ``OperatorStateFn`` state function holding the origin ``PauliOp``. Args: cob_instr_op: The basis-change ``CircuitOp``. dest_pauli_op: The destination Pauli type operator. Returns: The ``~CircuitOp @ StateFn`` composition equivalent to a state function defined by the original ``PauliOp``. """ return ComposedOp([cob_instr_op.adjoint(), StateFn(dest_pauli_op)]) @staticmethod def operator_replacement_fn( cob_instr_op: PrimitiveOp, dest_pauli_op: Union[PauliOp, PauliSumOp, ListOp] ) -> OperatorBase: r""" A built-in convenience replacement function which produces Operators isomorphic to the origin ``PauliOp``. Args: cob_instr_op: The basis-change ``CircuitOp``. dest_pauli_op: The destination ``PauliOp``. Returns: The ``~CircuitOp @ PauliOp @ CircuitOp`` composition isomorphic to the original ``PauliOp``. """ return ComposedOp([cob_instr_op.adjoint(), dest_pauli_op, cob_instr_op]) def get_tpb_pauli(self, list_op: ListOp) -> Pauli: r""" Gets the Pauli (not ``PauliOp``!) whose diagonalizing single-qubit rotations is a superset of the diagonalizing single-qubit rotations for each of the Paulis in ``list_op``. TPB stands for `Tensor Product Basis`. Args: list_op: the :class:`ListOp` whose TPB Pauli to return. Returns: The TBP Pauli. """ oplist = cast(List[PauliOp], list_op.oplist) origin_z = reduce(np.logical_or, [p_op.primitive.z for p_op in oplist]) origin_x = reduce(np.logical_or, [p_op.primitive.x for p_op in oplist]) return Pauli((origin_z, origin_x)) def get_diagonal_pauli_op(self, pauli_op: PauliOp) -> PauliOp: """Get the diagonal ``PualiOp`` to which ``pauli_op`` could be rotated with only single-qubit operations. Args: pauli_op: The ``PauliOp`` whose diagonal to compute. Returns: The diagonal ``PauliOp``. """ return PauliOp( Pauli( ( np.logical_or(pauli_op.primitive.z, pauli_op.primitive.x), [False] * pauli_op.num_qubits, ) ), coeff=pauli_op.coeff, ) def get_diagonalizing_clifford(self, pauli: Union[Pauli, PauliOp]) -> OperatorBase: r""" Construct a ``CircuitOp`` with only single-qubit gates which takes the eigenvectors of ``pauli`` to eigenvectors composed only of \|0⟩ and \|1⟩ tensor products. Equivalently, finds the basis-change circuit to take ``pauli`` to a diagonal ``PauliOp`` composed only of Z and I tensor products. Note, underlying Pauli bits are in Qiskit endianness, so we need to reverse before we begin composing with Operator flow. Args: pauli: the ``Pauli`` or ``PauliOp`` to whose diagonalizing circuit to compute. Returns: The diagonalizing ``CircuitOp``. """ if isinstance(pauli, PauliOp): pauli = pauli.primitive tensorall = cast( Callable[[List[PrimitiveOp]], PrimitiveOp], partial(reduce, lambda x, y: x.tensor(y)) ) y_to_x_origin = tensorall( [S if has_y else I for has_y in reversed(np.logical_and(pauli.x, pauli.z))] ).adjoint() x_to_z_origin = tensorall( # pylint: disable=assignment-from-no-return [H if has_x else I for has_x in reversed(pauli.x)] ) return x_to_z_origin.compose(y_to_x_origin) def pad_paulis_to_equal_length( self, pauli_op1: PauliOp, pauli_op2: PauliOp ) -> Tuple[PauliOp, PauliOp]: r""" If ``pauli_op1`` and ``pauli_op2`` do not act over the same number of qubits, pad identities to the end of the shorter of the two so they are of equal length. Padding is applied to the end of the Paulis. Note that the Terra represents Paulis in big-endian order, so this will appear as padding to the beginning of the Pauli x and z bit arrays. Args: pauli_op1: A pauli_op to possibly pad. pauli_op2: A pauli_op to possibly pad. Returns: A tuple containing the padded PauliOps. """ num_qubits = max(pauli_op1.num_qubits, pauli_op2.num_qubits) pauli_1, pauli_2 = pauli_op1.primitive, pauli_op2.primitive # Padding to the end of the Pauli, but remember that Paulis are in reverse endianness. if not len(pauli_1.z) == num_qubits: missing_qubits = num_qubits - len(pauli_1.z) pauli_1 = Pauli( ( ([False] * missing_qubits) + pauli_1.z.tolist(), ([False] * missing_qubits) + pauli_1.x.tolist(), ) ) if not len(pauli_2.z) == num_qubits: missing_qubits = num_qubits - len(pauli_2.z) pauli_2 = Pauli( ( ([False] * missing_qubits) + pauli_2.z.tolist(), ([False] * missing_qubits) + pauli_2.x.tolist(), ) ) return PauliOp(pauli_1, coeff=pauli_op1.coeff), PauliOp(pauli_2, coeff=pauli_op2.coeff) def construct_cnot_chain(self, diag_pauli_op1: PauliOp, diag_pauli_op2: PauliOp) -> PrimitiveOp: r""" Construct a ``CircuitOp`` (or ``PauliOp`` if equal to the identity) which takes the eigenvectors of ``diag_pauli_op1`` to the eigenvectors of ``diag_pauli_op2``, assuming both are diagonal (or performing this operation on their diagonalized Paulis implicitly if not). This works by the insight that the eigenvalue of a diagonal Pauli's eigenvector is equal to or -1 if the parity is 1 and 1 if the parity is 0, or 1 - (2 * parity). Therefore, using CNOTs, we can write the parity of diag_pauli_op1's significant bits onto some qubit, and then write out that parity onto diag_pauli_op2's significant bits. Args: diag_pauli_op1: The origin ``PauliOp``. diag_pauli_op2: The destination ``PauliOp``. Return: The ``PrimitiveOp`` performs the mapping. """ # TODO be smarter about connectivity and actual distance between pauli and destination # TODO be smarter in general pauli_1 = ( diag_pauli_op1.primitive if isinstance(diag_pauli_op1, PauliOp) else diag_pauli_op1 ) pauli_2 = ( diag_pauli_op2.primitive if isinstance(diag_pauli_op2, PauliOp) else diag_pauli_op2 ) origin_sig_bits = np.logical_or(pauli_1.z, pauli_1.x) destination_sig_bits = np.logical_or(pauli_2.z, pauli_2.x) num_qubits = max(len(pauli_1.z), len(pauli_2.z)) sig_equal_sig_bits = np.logical_and(origin_sig_bits, destination_sig_bits) non_equal_sig_bits = np.logical_not(origin_sig_bits == destination_sig_bits) # Equivalent to np.logical_xor(origin_sig_bits, destination_sig_bits) if not any(non_equal_sig_bits): return I ^ num_qubits # I am deeply sorry for this code, but I don't know another way to do it. sig_in_origin_only_indices = np.extract( np.logical_and(non_equal_sig_bits, origin_sig_bits), np.arange(num_qubits) ) sig_in_dest_only_indices = np.extract( np.logical_and(non_equal_sig_bits, destination_sig_bits), np.arange(num_qubits) ) if len(sig_in_origin_only_indices) > 0 and len(sig_in_dest_only_indices) > 0: origin_anchor_bit = min(sig_in_origin_only_indices) dest_anchor_bit = min(sig_in_dest_only_indices) else: # Set to lowest equal bit origin_anchor_bit = min(np.extract(sig_equal_sig_bits, np.arange(num_qubits))) dest_anchor_bit = origin_anchor_bit cnots = QuantumCircuit(num_qubits) # Step 3) Take the indices of bits which are sig_bits in # pauli but but not in dest, and cnot them to the pauli anchor. for i in sig_in_origin_only_indices: if not i == origin_anchor_bit: cnots.cx(i, origin_anchor_bit) # Step 4) if not origin_anchor_bit == dest_anchor_bit: cnots.swap(origin_anchor_bit, dest_anchor_bit) # Need to do this or a Terra bug sometimes flips cnots. No time to investigate. cnots.i(0) # Step 6) for i in sig_in_dest_only_indices: if not i == dest_anchor_bit: cnots.cx(i, dest_anchor_bit) return PrimitiveOp(cnots) def get_cob_circuit(self, origin: Union[Pauli, PauliOp]) -> Tuple[PrimitiveOp, PauliOp]: r""" Construct an Operator which maps the +1 and -1 eigenvectors of the origin Pauli to the +1 and -1 eigenvectors of the destination Pauli. It does so by 1) converting any \|i+⟩ or \|i+⟩ eigenvector bits in the origin to \|+⟩ and \|-⟩ with S†s, then 2) converting any \|+⟩ or \|+⟩ eigenvector bits in the converted origin to \|0⟩ and \|1⟩ with Hs, then 3) writing the parity of the significant (Z-measured, rather than I) bits in the origin to a single "origin anchor bit," using cnots, which will hold the parity of these bits, 4) swapping the parity of the pauli anchor bit into a destination anchor bit using a swap gate (only if they are different, if there are any bits which are significant in both origin and dest, we set both anchors to one of these bits to avoid a swap). 5) writing the parity of the destination anchor bit into the other significant bits of the destination, 6) converting the \|0⟩ and \|1⟩ significant eigenvector bits to \|+⟩ and \|-⟩ eigenvector bits in the destination where the destination demands it (e.g. pauli.x == true for a bit), using Hs 8) converting the \|+⟩ and \|-⟩ significant eigenvector bits to \|i+⟩ and \|i-⟩ eigenvector bits in the destination where the destination demands it (e.g. pauli.x == true and pauli.z == true for a bit), using Ss Args: origin: The ``Pauli`` or ``PauliOp`` to map. Returns: A tuple of a ``PrimitiveOp`` which equals the basis change mapping and a ``PauliOp`` which equals the destination basis. Raises: TypeError: Attempting to convert from non-Pauli origin. ValueError: Attempting to change a non-identity Pauli to an identity Pauli, or vice versa. """ # If pauli is an PrimitiveOp, extract the Pauli if isinstance(origin, Pauli): origin = PauliOp(origin) if not isinstance(origin, PauliOp): raise TypeError( f"PauliBasisChange can only convert Pauli-based OpPrimitives, not {type(origin)}" ) # If no destination specified, assume nearest Pauli in {Z,I}^n basis, # the standard basis change for expectations. destination = self.destination or self.get_diagonal_pauli_op(origin) # Pad origin or destination if either are not as long as the other origin, destination = self.pad_paulis_to_equal_length(origin, destination) origin_sig_bits = np.logical_or(origin.primitive.x, origin.primitive.z) destination_sig_bits = np.logical_or(destination.primitive.x, destination.primitive.z) if not any(origin_sig_bits) or not any(destination_sig_bits): if not (any(origin_sig_bits) or any(destination_sig_bits)): # Both all Identity, just return Identities return I ^ origin.num_qubits, destination else: # One is Identity, one is not raise ValueError("Cannot change to or from a fully Identity Pauli.") # Steps 1 and 2 cob_instruction = self.get_diagonalizing_clifford(origin) # Construct CNOT chain, assuming full connectivity... - Steps 3)-5) cob_instruction = self.construct_cnot_chain(origin, destination).compose(cob_instruction) # Step 6 and 7 dest_diagonlizing_clifford = self.get_diagonalizing_clifford(destination).adjoint() cob_instruction = dest_diagonlizing_clifford.compose(cob_instruction) return cast(PrimitiveOp, cob_instruction), destination
https://github.com/qiskit-community/qiskit-translations-staging
qiskit-community
from qiskit import QuantumCircuit, transpile, schedule from qiskit.visualization.pulse_v2 import draw, IQXSimple from qiskit.providers.fake_provider import FakeBoeblingen qc = QuantumCircuit(2) qc.h(0) qc.cx(0, 1) qc.measure_all() qc = transpile(qc, FakeBoeblingen(), layout_method='trivial') sched = schedule(qc, FakeBoeblingen()) draw(sched, style=IQXSimple(), backend=FakeBoeblingen())
https://github.com/SaashaJoshi/IBM-Qiskit-Summer-School-2020
SaashaJoshi
!pip install -U -r grading_tools/requirements.txt from IPython.display import clear_output clear_output() # our backend is the Pulse Simulator from resources import helper from qiskit.providers.aer import PulseSimulator backend_sim = PulseSimulator() # sample duration for pulse instructions dt = 1e-9 # create the model duffing_model = helper.get_transmon(dt) # get qubit frequency from Duffing model qubit_lo_freq = duffing_model.hamiltonian.get_qubit_lo_from_drift() import numpy as np # visualization tools import matplotlib.pyplot as plt plt.style.use('dark_background') # unit conversion factors -> all backend properties returned in SI (Hz, sec, etc) GHz = 1.0e9 # Gigahertz MHz = 1.0e6 # Megahertz kHz = 1.0e3 # kilohertz us = 1.0e-6 # microseconds ns = 1.0e-9 # nanoseconds from qiskit import pulse from qiskit.pulse import Play, Acquire from qiskit.pulse.pulse_lib import GaussianSquare # qubit to be used throughout the notebook qubit = 0 ### Collect the necessary channels drive_chan = pulse.DriveChannel(qubit) meas_chan = pulse.MeasureChannel(qubit) acq_chan = pulse.AcquireChannel(qubit) # Construct a measurement schedule and add it to an InstructionScheduleMap meas_samples = 1200 meas_pulse = GaussianSquare(duration=meas_samples, amp=0.025, sigma=4, width=1150) measure_sched = Play(meas_pulse, meas_chan) | Acquire(meas_samples, acq_chan, pulse.MemorySlot(qubit)) inst_map = pulse.InstructionScheduleMap() inst_map.add('measure', [qubit], measure_sched) # save the measurement/acquire pulse for later measure = inst_map.get('measure', qubits=[qubit]) from qiskit.pulse import pulse_lib def build_rabi_pulse_schedule(drive_duration, drive_amp, drive_sigma): ### create a Rabi schedule (already done) ### create a Gaussian Rabi pulse using pulse_lib ### play Rabi pulse on the Rabi schedule and return rabi_schedule = pulse.Schedule(name='rabi_experiment') ### WRITE YOUR CODE BETWEEN THESE LINES - START rabi_pulse = pulse_lib.gaussian(duration=drive_duration, amp=drive_amp, sigma=drive_sigma) rabi_schedule = pulse.Schedule() rabi_schedule += Play(rabi_pulse, drive_chan) ### WRITE YOUR CODE BETWEEN THESE LINES - END # add measurement to rabi_schedule # << indicates time shift the beginning to the start of the schedule rabi_schedule += measure << rabi_schedule.duration return rabi_schedule # Gaussian pulse parameters, with varying amplitude drive_duration = 128 num_rabi_points = 41 drive_amps = np.linspace(0, 0.9, num_rabi_points) drive_sigma = 16 # now vary the amplitude for each drive amp rabi_schedules = [] for drive_amp in drive_amps: rabi_schedules.append(build_rabi_pulse_schedule(drive_duration, drive_amp, drive_sigma)) rabi_schedules[-1].draw() # assemble the schedules into a Qobj from qiskit import assemble rabi_qobj = assemble(**helper.get_params('rabi', globals())) answer1a = rabi_qobj # run the simulation rabi_result = backend_sim.run(rabi_qobj, duffing_model).result() # retrieve the data from the experiment rabi_values = helper.get_values_from_result(rabi_result, qubit) fit_params, y_fit = helper.fit_sinusoid(drive_amps, rabi_values, [1, 0, 0.5, 0]) plt.scatter(drive_amps, rabi_values, color='white') plt.plot(drive_amps, y_fit, color='red') drive_period = fit_params[2] # get period of rabi oscillation plt.axvline(0, color='red', linestyle='--') plt.axvline(drive_period/2, color='red', linestyle='--') plt.xlabel("Drive amp [a.u.]", fontsize=15) plt.ylabel("Measured signal [a.u.]", fontsize=15) plt.show() print("Pi pulse amplitude is %f"%float(drive_period/2)) # x_90 is a concise way to say pi_over_2; i.e., an X rotation of 90 degrees x90_pulse = pulse_lib.gaussian(duration=drive_duration, amp=drive_period/4, sigma=drive_sigma, name='x90_pulse') # Ramsey experiment parameters time_max_us = 0.4 time_step_us = 0.0035 times_us = np.arange(0.1, time_max_us, time_step_us) # Convert to units of dt delay_times_dt = times_us * us / dt def build_ramsey_pulse_schedule(delay): ### create a Ramsey pulse schedule (already done) ### play an x90 pulse on the drive channel ### play another x90 pulse after delay ### add measurement pulse to schedule ramsey_schedule = pulse.Schedule(name='ramsey_experiment') ### HINT: include delay by adding it to the duration of the schedule ### round delay to nearest integer with int(delay) ### WRITE YOUR CODE BETWEEN THESE LINES - START ramsey_schedule = pulse.Schedule() ramsey_schedule += Play(x90_pulse, drive_chan) ramsey_schedule += Play(x90_pulse, drive_chan) << ramsey_schedule.duration + int(delay) ramsey_schedule += measure << ramsey_schedule.duration ### WRITE YOUR CODE BETWEEN THESE LINES - END return ramsey_schedule # create schedules for Ramsey experiment ramsey_schedules = [] for delay in delay_times_dt: ramsey_schedules.append(build_ramsey_pulse_schedule(delay)) ramsey_schedules[-1].draw() # assemble the schedules into a Qobj # the helper will drive the pulses off-resonantly by an unknown value ramsey_qobj = assemble(**helper.get_params('ramsey', globals())) answer1b = ramsey_qobj # run the simulation ramsey_result = backend_sim.run(ramsey_qobj, duffing_model).result() # retrieve the data from the experiment ramsey_values = helper.get_values_from_result(ramsey_result, qubit) # off-resonance component fit_params, y_fit = helper.fit_sinusoid(times_us, ramsey_values, [1, 0.7, 0.1, 0.25]) _, _, ramsey_period_us, _, = fit_params del_f_MHz = 1/ramsey_period_us # freq is MHz since times in us plt.scatter(times_us, np.real(ramsey_values), color='white') plt.plot(times_us, y_fit, color='red', label=f"df = {del_f_MHz:.6f} MHz") plt.xlim(np.min(times_us), np.max(times_us)) plt.xlabel('Delay between X90 pulses [$\mu$s]', fontsize=15) plt.ylabel('Measured Signal [a.u.]', fontsize=15) plt.title('Ramsey Experiment', fontsize=15) plt.legend(loc=3) plt.show() print("Drive is off-resonant by %f MHz"%float(del_f_MHz)) name = 'Saasha Joshi' email = 'saashajoshi08@gmail.com' from grading_tools import grade grade(answer1a, name, email, 'lab6', 'ex1a') grade(answer1b, name, email, 'lab6', 'ex1b') from IPython.display import display, Javascript;display(Javascript('IPython.notebook.save_checkpoint();')); from grading_tools import send_code;send_code('ex1.ipynb')
https://github.com/hamburgerguy/Quantum-Algorithm-Implementations
hamburgerguy
"""The following is python code utilizing the qiskit library that can be run on extant quantum hardware using 5 qubits for factoring the integer 15 into 3 and 5. Using period finding, for a^r mod N = 1, where a = 11 and N = 15 (the integer to be factored) the problem is to find r values for this identity such that one can find the prime factors of N. For 11^r mod(15) =1, results (as shown in fig 1.) correspond with period r = 4 (|00100>) and r = 0 (|00000>). To find the factor, use the equivalence a^r mod 15. From this: (a^r -1) mod 15 = (a^(r/2) + 1)(a^(r/2) - 1) mod 15.In this case, a = 11. Plugging in the two r values for this a value yields (11^(0/2) +1)(11^(4/2) - 1) mod 15 = 2*(11 +1)(11-1) mod 15 Thus, we find (24)(20) mod 15. By finding the greatest common factor between the two coefficients, gcd(24,15) and gcd(20,15), yields 3 and 5 respectively. These are the prime factors of 15, so the result of running shors algorithm to find the prime factors of an integer using quantum hardware are demonstrated. Note, this is not the same as the technical implementation of shor's algorithm described in this section for breaking the discrete log hardness assumption, though the proof of concept remains.""" # Import libraries from qiskit.compiler import transpile, assemble from qiskit.tools.jupyter import * from qiskit.visualization import * from numpy import pi from qiskit import IBMQ, Aer, QuantumCircuit, ClassicalRegister, QuantumRegister, execute from qiskit.providers.ibmq import least_busy from qiskit.visualization import plot_histogram # Initialize qubit registers qreg_q = QuantumRegister(5, 'q') creg_c = ClassicalRegister(5, 'c') circuit = QuantumCircuit(qreg_q, creg_c) circuit.reset(qreg_q[0]) circuit.reset(qreg_q[1]) circuit.reset(qreg_q[2]) circuit.reset(qreg_q[3]) circuit.reset(qreg_q[4]) # Apply Hadamard transformations to qubit registers circuit.h(qreg_q[0]) circuit.h(qreg_q[1]) circuit.h(qreg_q[2]) # Apply first QFT, modular exponentiation, and another QFT circuit.h(qreg_q[1]) circuit.cx(qreg_q[2], qreg_q[3]) circuit.crx(pi/2, qreg_q[0], qreg_q[1]) circuit.ccx(qreg_q[2], qreg_q[3], qreg_q[4]) circuit.h(qreg_q[0]) circuit.rx(pi/2, qreg_q[2]) circuit.crx(pi/2, qreg_q[1], qreg_q[2]) circuit.crx(pi/2, qreg_q[1], qreg_q[2]) circuit.cx(qreg_q[0], qreg_q[1]) # Measure the qubit registers 0-2 circuit.measure(qreg_q[2], creg_c[2]) circuit.measure(qreg_q[1], creg_c[1]) circuit.measure(qreg_q[0], creg_c[0]) # Get least busy quantum hardware backend to run on provider = IBMQ.load_account() device = least_busy(provider.backends(filters=lambda x: x.configuration().n_qubits >= 3 and not x.configuration().simulator and x.status().operational==True)) print("Running on current least busy device: ", device) # Run the circuit on available quantum hardware and plot histogram from qiskit.tools.monitor import job_monitor job = execute(circuit, backend=device, shots=1024, optimization_level=3) job_monitor(job, interval = 2) results = job.result() answer = results.get_counts(circuit) plot_histogram(answer) #largest amplitude results correspond with r values used to find the prime factor of N.
https://github.com/Sanjay-995/Qiskit-Developer-Prep-Guide
Sanjay-995
import qiskit qiskit.__version__ qiskit.__qiskit_version__ #Import the required packages from qiskit import QuantumCircuit, QuantumRegister,ClassicalRegister,Aer,execute from qiskit.visualization import * qc1=QuantumCircuit(2) qc1.x(0) qc1.cx(0,1) qc1.draw('mpl') backend=Aer.get_backend('statevector_simulator') job=execute(qc1,backend) result=job.result() sv=result.get_statevector() sv.draw(output="latex") qc2=QuantumCircuit(2) qc2.x(0) qc2.cnot(0,1) qc2.draw('mpl') backend=Aer.get_backend('statevector_simulator') job=execute(qc2,backend) result=job.result() sv=result.get_statevector() sv.draw(output="latex") # We create 5-qubit mct gate # We have a list of control qubits :0,1,2,3 and a target qubit 4. qc3=QuantumCircuit(5) qc3.x(range(4)) qc3.mct([0,1,2,3],4) qc3.draw('mpl') backend=Aer.get_backend('statevector_simulator') job=execute(qc3,backend) result=job.result() sv=result.get_statevector() sv.draw(output="latex") qc4=QuantumCircuit(2) qc4.cz(0,1) qc4.draw('mpl') backend=Aer.get_backend('statevector_simulator') job=execute(qc4,backend) result=job.result() sv=result.get_statevector() print("statevector:", sv) sv.draw(output="latex") backend=Aer.get_backend('unitary_simulator') job=execute(qc4,backend) result=job.result() sv=result.get_unitary() print(sv) #Let's apply a X on the control qubit qc4=QuantumCircuit(2) qc4.x(0) qc4.cz(0,1) qc4.draw('mpl') backend=Aer.get_backend('statevector_simulator') job=execute(qc4,backend) result=job.result() sv=result.get_statevector() print("statevector:", sv) sv.draw(output="latex") backend=Aer.get_backend('unitary_simulator') job=execute(qc4,backend) result=job.result() sv=result.get_unitary() print(sv) plot_state_qsphere(sv,show_state_phases=True)
https://github.com/tanmaybisen31/Quantum-Teleportation
tanmaybisen31
from qiskit import* # Loading your IBM Quantum account(s) provider = IBMQ.load_account() qc=QuantumCircuit(1,1) from qiskit.tools.visualization import plot_bloch_multivector qc.x(0) sim=Aer.get_backend('statevector_simulator') result=execute(qc,backend=sim).result() sv=result.get_statevector() print(sv) qc.draw() plot_bloch_multivector(sv) qc.measure(range(1),range(1)) backend=Aer.get_backend('qasm_simulator') result=execute(qc,backend=backend).result() count=result.get_counts() from qiskit.tools.visualization import plot_histogram plot_histogram(count) s=Aer.get_backend('unitary_simulator') result=execute(qc,backend=s).result() unitary=result.get_unitary() print(unitary)
https://github.com/swe-bench/Qiskit__qiskit
swe-bench
# This code is part of Qiskit. # # (C) Copyright IBM 2017, 2023. # # This code is licensed under the Apache License, Version 2.0. You may # obtain a copy of this license in the LICENSE.txt file in the root directory # of this source tree or at http://www.apache.org/licenses/LICENSE-2.0. # # Any modifications or derivative works of this code must retain this # copyright notice, and modified files need to carry a notice indicating # that they have been altered from the originals. """Tests for PauliTable class.""" import unittest from test import combine import numpy as np from ddt import ddt from scipy.sparse import csr_matrix from qiskit import QiskitError from qiskit.quantum_info.operators.symplectic import PauliTable from qiskit.test import QiskitTestCase def pauli_mat(label): """Return Pauli matrix from a Pauli label""" mat = np.eye(1, dtype=complex) for i in label: if i == "I": mat = np.kron(mat, np.eye(2, dtype=complex)) elif i == "X": mat = np.kron(mat, np.array([[0, 1], [1, 0]], dtype=complex)) elif i == "Y": mat = np.kron(mat, np.array([[0, -1j], [1j, 0]], dtype=complex)) elif i == "Z": mat = np.kron(mat, np.array([[1, 0], [0, -1]], dtype=complex)) else: raise QiskitError(f"Invalid Pauli string {i}") return mat class TestPauliTableInit(QiskitTestCase): """Tests for PauliTable initialization.""" def test_array_init(self): """Test array initialization.""" # Matrix array initialization with self.subTest(msg="bool array"): target = np.array([[False, False], [True, True]]) with self.assertWarns(DeprecationWarning): value = PauliTable(target)._array self.assertTrue(np.all(value == target)) with self.subTest(msg="bool array no copy"): target = np.array([[False, True], [True, True]]) with self.assertWarns(DeprecationWarning): value = PauliTable(target)._array value[0, 0] = not value[0, 0] self.assertTrue(np.all(value == target)) with self.subTest(msg="bool array raises"): array = np.array([[False, False, False], [True, True, True]]) with self.assertWarns(DeprecationWarning): self.assertRaises(QiskitError, PauliTable, array) def test_vector_init(self): """Test vector initialization.""" # Vector array initialization with self.subTest(msg="bool vector"): target = np.array([False, False, False, False]) with self.assertWarns(DeprecationWarning): value = PauliTable(target)._array self.assertTrue(np.all(value == target)) with self.subTest(msg="bool vector no copy"): target = np.array([False, True, True, False]) with self.assertWarns(DeprecationWarning): value = PauliTable(target)._array value[0, 0] = not value[0, 0] self.assertTrue(np.all(value == target)) def test_string_init(self): """Test string initialization.""" # String initialization with self.subTest(msg='str init "I"'): with self.assertWarns(DeprecationWarning): value = PauliTable("I")._array target = np.array([[False, False]], dtype=bool) self.assertTrue(np.all(np.array(value == target))) with self.subTest(msg='str init "X"'): with self.assertWarns(DeprecationWarning): value = PauliTable("X")._array target = np.array([[True, False]], dtype=bool) self.assertTrue(np.all(np.array(value == target))) with self.subTest(msg='str init "Y"'): with self.assertWarns(DeprecationWarning): value = PauliTable("Y")._array target = np.array([[True, True]], dtype=bool) self.assertTrue(np.all(np.array(value == target))) with self.subTest(msg='str init "Z"'): with self.assertWarns(DeprecationWarning): value = PauliTable("Z")._array target = np.array([[False, True]], dtype=bool) self.assertTrue(np.all(np.array(value == target))) with self.subTest(msg='str init "IX"'): with self.assertWarns(DeprecationWarning): value = PauliTable("IX")._array target = np.array([[True, False, False, False]], dtype=bool) self.assertTrue(np.all(np.array(value == target))) with self.subTest(msg='str init "XI"'): with self.assertWarns(DeprecationWarning): value = PauliTable("XI")._array target = np.array([[False, True, False, False]], dtype=bool) self.assertTrue(np.all(np.array(value == target))) with self.subTest(msg='str init "YZ"'): with self.assertWarns(DeprecationWarning): value = PauliTable("YZ")._array target = np.array([[False, True, True, True]], dtype=bool) self.assertTrue(np.all(np.array(value == target))) with self.subTest(msg='str init "XIZ"'): with self.assertWarns(DeprecationWarning): value = PauliTable("XIZ")._array target = np.array([[False, False, True, True, False, False]], dtype=bool) self.assertTrue(np.all(np.array(value == target))) def test_table_init(self): """Test table initialization.""" # Pauli Table initialization with self.subTest(msg="PauliTable"): with self.assertWarns(DeprecationWarning): target = PauliTable.from_labels(["XI", "IX", "IZ"]) value = PauliTable(target) self.assertEqual(value, target) with self.subTest(msg="PauliTable no copy"): with self.assertWarns(DeprecationWarning): target = PauliTable.from_labels(["XI", "IX", "IZ"]) value = PauliTable(target) value[0] = "II" self.assertEqual(value, target) class TestPauliTableProperties(QiskitTestCase): """Tests for PauliTable properties.""" def test_array_propertiy(self): """Test array property""" with self.subTest(msg="array"): with self.assertWarns(DeprecationWarning): pauli = PauliTable("II") array = np.zeros([2, 4], dtype=bool) self.assertTrue(np.all(pauli.array == array)) with self.subTest(msg="set array"): with self.assertWarns(DeprecationWarning): pauli = PauliTable("XX") array = np.zeros([1, 4], dtype=bool) pauli.array = array self.assertTrue(np.all(pauli.array == array)) with self.subTest(msg="set array raises"): def set_array_raise(): with self.assertWarns(DeprecationWarning): pauli = PauliTable("XXX") pauli.array = np.eye(4) return pauli self.assertRaises(ValueError, set_array_raise) def test_x_propertiy(self): """Test X property""" with self.subTest(msg="X"): with self.assertWarns(DeprecationWarning): pauli = PauliTable.from_labels(["XI", "IZ", "YY"]) array = np.array([[False, True], [False, False], [True, True]], dtype=bool) self.assertTrue(np.all(pauli.X == array)) with self.subTest(msg="set X"): with self.assertWarns(DeprecationWarning): pauli = PauliTable.from_labels(["XI", "IZ"]) val = np.array([[False, False], [True, True]], dtype=bool) pauli.X = val with self.assertWarns(DeprecationWarning): self.assertEqual(pauli, PauliTable.from_labels(["II", "XY"])) with self.subTest(msg="set X raises"): def set_x(): with self.assertWarns(DeprecationWarning): pauli = PauliTable.from_labels(["XI", "IZ"]) val = np.array([[False, False, False], [True, True, True]], dtype=bool) pauli.X = val return pauli self.assertRaises(Exception, set_x) def test_z_propertiy(self): """Test Z property""" with self.subTest(msg="Z"): with self.assertWarns(DeprecationWarning): pauli = PauliTable.from_labels(["XI", "IZ", "YY"]) array = np.array([[False, False], [True, False], [True, True]], dtype=bool) self.assertTrue(np.all(pauli.Z == array)) with self.subTest(msg="set Z"): with self.assertWarns(DeprecationWarning): pauli = PauliTable.from_labels(["XI", "IZ"]) val = np.array([[False, False], [True, True]], dtype=bool) pauli.Z = val with self.assertWarns(DeprecationWarning): self.assertEqual(pauli, PauliTable.from_labels(["XI", "ZZ"])) with self.subTest(msg="set Z raises"): def set_z(): with self.assertWarns(DeprecationWarning): pauli = PauliTable.from_labels(["XI", "IZ"]) val = np.array([[False, False, False], [True, True, True]], dtype=bool) pauli.Z = val return pauli self.assertRaises(Exception, set_z) def test_shape_propertiy(self): """Test shape property""" shape = (3, 8) with self.assertWarns(DeprecationWarning): pauli = PauliTable(np.zeros(shape)) self.assertEqual(pauli.shape, shape) def test_size_propertiy(self): """Test size property""" with self.subTest(msg="size"): for j in range(1, 10): shape = (j, 8) with self.assertWarns(DeprecationWarning): pauli = PauliTable(np.zeros(shape)) self.assertEqual(pauli.size, j) def test_n_qubit_propertiy(self): """Test n_qubit property""" with self.subTest(msg="num_qubits"): for j in range(1, 10): shape = (5, 2 * j) with self.assertWarns(DeprecationWarning): pauli = PauliTable(np.zeros(shape)) self.assertEqual(pauli.num_qubits, j) def test_eq(self): """Test __eq__ method.""" with self.assertWarns(DeprecationWarning): pauli1 = PauliTable.from_labels(["II", "XI"]) pauli2 = PauliTable.from_labels(["XI", "II"]) self.assertEqual(pauli1, pauli1) self.assertNotEqual(pauli1, pauli2) def test_len_methods(self): """Test __len__ method.""" for j in range(1, 10): labels = j * ["XX"] with self.assertWarns(DeprecationWarning): pauli = PauliTable.from_labels(labels) self.assertEqual(len(pauli), j) def test_add_methods(self): """Test __add__ method.""" labels1 = ["XXI", "IXX"] labels2 = ["XXI", "ZZI", "ZYZ"] with self.assertWarns(DeprecationWarning): pauli1 = PauliTable.from_labels(labels1) pauli2 = PauliTable.from_labels(labels2) target = PauliTable.from_labels(labels1 + labels2) self.assertEqual(target, pauli1 + pauli2) def test_add_qargs(self): """Test add method with qargs.""" with self.assertWarns(DeprecationWarning): pauli1 = PauliTable.from_labels(["IIII", "YYYY"]) pauli2 = PauliTable.from_labels(["XY", "YZ"]) with self.subTest(msg="qargs=[0, 1]"): with self.assertWarns(DeprecationWarning): target = PauliTable.from_labels(["IIII", "YYYY", "IIXY", "IIYZ"]) self.assertEqual(pauli1 + pauli2([0, 1]), target) with self.subTest(msg="qargs=[0, 3]"): with self.assertWarns(DeprecationWarning): target = PauliTable.from_labels(["IIII", "YYYY", "XIIY", "YIIZ"]) self.assertEqual(pauli1 + pauli2([0, 3]), target) with self.subTest(msg="qargs=[2, 1]"): with self.assertWarns(DeprecationWarning): target = PauliTable.from_labels(["IIII", "YYYY", "IYXI", "IZYI"]) self.assertEqual(pauli1 + pauli2([2, 1]), target) with self.subTest(msg="qargs=[3, 1]"): with self.assertWarns(DeprecationWarning): target = PauliTable.from_labels(["IIII", "YYYY", "YIXI", "ZIYI"]) self.assertEqual(pauli1 + pauli2([3, 1]), target) def test_getitem_methods(self): """Test __getitem__ method.""" with self.subTest(msg="__getitem__ single"): labels = ["XI", "IY"] with self.assertWarns(DeprecationWarning): pauli = PauliTable.from_labels(labels) self.assertEqual(pauli[0], PauliTable(labels[0])) self.assertEqual(pauli[1], PauliTable(labels[1])) with self.subTest(msg="__getitem__ array"): labels = np.array(["XI", "IY", "IZ", "XY", "ZX"]) with self.assertWarns(DeprecationWarning): pauli = PauliTable.from_labels(labels) inds = [0, 3] with self.assertWarns(DeprecationWarning): self.assertEqual(pauli[inds], PauliTable.from_labels(labels[inds])) inds = np.array([4, 1]) with self.assertWarns(DeprecationWarning): self.assertEqual(pauli[inds], PauliTable.from_labels(labels[inds])) with self.subTest(msg="__getitem__ slice"): labels = np.array(["XI", "IY", "IZ", "XY", "ZX"]) with self.assertWarns(DeprecationWarning): pauli = PauliTable.from_labels(labels) self.assertEqual(pauli[:], pauli) with self.assertWarns(DeprecationWarning): self.assertEqual(pauli[1:3], PauliTable.from_labels(labels[1:3])) def test_setitem_methods(self): """Test __setitem__ method.""" with self.subTest(msg="__setitem__ single"): labels = ["XI", "IY"] with self.assertWarns(DeprecationWarning): pauli = PauliTable.from_labels(["XI", "IY"]) pauli[0] = "II" with self.assertWarns(DeprecationWarning): self.assertEqual(pauli[0], PauliTable("II")) pauli[1] = "XX" with self.assertWarns(DeprecationWarning): self.assertEqual(pauli[1], PauliTable("XX")) def raises_single(): # Wrong size Pauli pauli[0] = "XXX" self.assertRaises(Exception, raises_single) with self.subTest(msg="__setitem__ array"): labels = np.array(["XI", "IY", "IZ"]) with self.assertWarns(DeprecationWarning): pauli = PauliTable.from_labels(labels) target = PauliTable.from_labels(["II", "ZZ"]) inds = [2, 0] pauli[inds] = target self.assertEqual(pauli[inds], target) def raises_array(): with self.assertWarns(DeprecationWarning): pauli[inds] = PauliTable.from_labels(["YY", "ZZ", "XX"]) self.assertRaises(Exception, raises_array) with self.subTest(msg="__setitem__ slice"): labels = np.array(5 * ["III"]) with self.assertWarns(DeprecationWarning): pauli = PauliTable.from_labels(labels) target = PauliTable.from_labels(5 * ["XXX"]) pauli[:] = target self.assertEqual(pauli[:], target) with self.assertWarns(DeprecationWarning): target = PauliTable.from_labels(2 * ["ZZZ"]) pauli[1:3] = target self.assertEqual(pauli[1:3], target) class TestPauliTableLabels(QiskitTestCase): """Tests PauliTable label representation conversions.""" def test_from_labels_1q(self): """Test 1-qubit from_labels method.""" labels = ["I", "Z", "Z", "X", "Y"] array = np.array( [[False, False], [False, True], [False, True], [True, False], [True, True]], dtype=bool ) with self.assertWarns(DeprecationWarning): target = PauliTable(array) value = PauliTable.from_labels(labels) self.assertEqual(target, value) def test_from_labels_2q(self): """Test 2-qubit from_labels method.""" labels = ["II", "YY", "XZ"] array = np.array( [[False, False, False, False], [True, True, True, True], [False, True, True, False]], dtype=bool, ) with self.assertWarns(DeprecationWarning): target = PauliTable(array) value = PauliTable.from_labels(labels) self.assertEqual(target, value) def test_from_labels_5q(self): """Test 5-qubit from_labels method.""" labels = [5 * "I", 5 * "X", 5 * "Y", 5 * "Z"] array = np.array( [10 * [False], 5 * [True] + 5 * [False], 10 * [True], 5 * [False] + 5 * [True]], dtype=bool, ) with self.assertWarns(DeprecationWarning): target = PauliTable(array) value = PauliTable.from_labels(labels) self.assertEqual(target, value) def test_to_labels_1q(self): """Test 1-qubit to_labels method.""" with self.assertWarns(DeprecationWarning): pauli = PauliTable( np.array( [[False, False], [False, True], [False, True], [True, False], [True, True]], dtype=bool, ) ) target = ["I", "Z", "Z", "X", "Y"] value = pauli.to_labels() self.assertEqual(value, target) def test_to_labels_1q_array(self): """Test 1-qubit to_labels method w/ array=True.""" with self.assertWarns(DeprecationWarning): pauli = PauliTable( np.array( [[False, False], [False, True], [False, True], [True, False], [True, True]], dtype=bool, ) ) target = np.array(["I", "Z", "Z", "X", "Y"]) value = pauli.to_labels(array=True) self.assertTrue(np.all(value == target)) def test_labels_round_trip(self): """Test from_labels and to_labels round trip.""" target = ["III", "IXZ", "XYI", "ZZZ"] with self.assertWarns(DeprecationWarning): value = PauliTable.from_labels(target).to_labels() self.assertEqual(value, target) def test_labels_round_trip_array(self): """Test from_labels and to_labels round trip w/ array=True.""" labels = ["III", "IXZ", "XYI", "ZZZ"] target = np.array(labels) with self.assertWarns(DeprecationWarning): value = PauliTable.from_labels(labels).to_labels(array=True) self.assertTrue(np.all(value == target)) class TestPauliTableMatrix(QiskitTestCase): """Tests PauliTable matrix representation conversions.""" def test_to_matrix_1q(self): """Test 1-qubit to_matrix method.""" labels = ["X", "I", "Z", "Y"] targets = [pauli_mat(i) for i in labels] with self.assertWarns(DeprecationWarning): values = PauliTable.from_labels(labels).to_matrix() self.assertTrue(isinstance(values, list)) for target, value in zip(targets, values): self.assertTrue(np.all(value == target)) def test_to_matrix_1q_array(self): """Test 1-qubit to_matrix method w/ array=True.""" labels = ["Z", "I", "Y", "X"] target = np.array([pauli_mat(i) for i in labels]) with self.assertWarns(DeprecationWarning): value = PauliTable.from_labels(labels).to_matrix(array=True) self.assertTrue(isinstance(value, np.ndarray)) self.assertTrue(np.all(value == target)) def test_to_matrix_1q_sparse(self): """Test 1-qubit to_matrix method w/ sparse=True.""" labels = ["X", "I", "Z", "Y"] targets = [pauli_mat(i) for i in labels] with self.assertWarns(DeprecationWarning): values = PauliTable.from_labels(labels).to_matrix(sparse=True) for mat, targ in zip(values, targets): self.assertTrue(isinstance(mat, csr_matrix)) self.assertTrue(np.all(targ == mat.toarray())) def test_to_matrix_2q(self): """Test 2-qubit to_matrix method.""" labels = ["IX", "YI", "II", "ZZ"] targets = [pauli_mat(i) for i in labels] with self.assertWarns(DeprecationWarning): values = PauliTable.from_labels(labels).to_matrix() self.assertTrue(isinstance(values, list)) for target, value in zip(targets, values): self.assertTrue(np.all(value == target)) def test_to_matrix_2q_array(self): """Test 2-qubit to_matrix method w/ array=True.""" labels = ["ZZ", "XY", "YX", "IZ"] target = np.array([pauli_mat(i) for i in labels]) with self.assertWarns(DeprecationWarning): value = PauliTable.from_labels(labels).to_matrix(array=True) self.assertTrue(isinstance(value, np.ndarray)) self.assertTrue(np.all(value == target)) def test_to_matrix_2q_sparse(self): """Test 2-qubit to_matrix method w/ sparse=True.""" labels = ["IX", "II", "ZY", "YZ"] targets = [pauli_mat(i) for i in labels] with self.assertWarns(DeprecationWarning): values = PauliTable.from_labels(labels).to_matrix(sparse=True) for mat, targ in zip(values, targets): self.assertTrue(isinstance(mat, csr_matrix)) self.assertTrue(np.all(targ == mat.toarray())) def test_to_matrix_5q(self): """Test 5-qubit to_matrix method.""" labels = ["IXIXI", "YZIXI", "IIXYZ"] targets = [pauli_mat(i) for i in labels] with self.assertWarns(DeprecationWarning): values = PauliTable.from_labels(labels).to_matrix() self.assertTrue(isinstance(values, list)) for target, value in zip(targets, values): self.assertTrue(np.all(value == target)) def test_to_matrix_5q_sparse(self): """Test 5-qubit to_matrix method w/ sparse=True.""" labels = ["XXXYY", "IXIZY", "ZYXIX"] targets = [pauli_mat(i) for i in labels] with self.assertWarns(DeprecationWarning): values = PauliTable.from_labels(labels).to_matrix(sparse=True) for mat, targ in zip(values, targets): self.assertTrue(isinstance(mat, csr_matrix)) self.assertTrue(np.all(targ == mat.toarray())) class TestPauliTableIteration(QiskitTestCase): """Tests for PauliTable iterators class.""" def test_enumerate(self): """Test enumerate with PauliTable.""" labels = ["III", "IXI", "IYY", "YIZ", "XYZ", "III"] with self.assertWarns(DeprecationWarning): pauli = PauliTable.from_labels(labels) for idx, i in enumerate(pauli): with self.assertWarns(DeprecationWarning): self.assertEqual(i, PauliTable(labels[idx])) def test_iter(self): """Test iter with PauliTable.""" labels = ["III", "IXI", "IYY", "YIZ", "XYZ", "III"] with self.assertWarns(DeprecationWarning): pauli = PauliTable.from_labels(labels) for idx, i in enumerate(iter(pauli)): with self.assertWarns(DeprecationWarning): self.assertEqual(i, PauliTable(labels[idx])) def test_zip(self): """Test zip with PauliTable.""" labels = ["III", "IXI", "IYY", "YIZ", "XYZ", "III"] with self.assertWarns(DeprecationWarning): pauli = PauliTable.from_labels(labels) for label, i in zip(labels, pauli): with self.assertWarns(DeprecationWarning): self.assertEqual(i, PauliTable(label)) def test_label_iter(self): """Test PauliTable label_iter method.""" labels = ["III", "IXI", "IYY", "YIZ", "XYZ", "III"] with self.assertWarns(DeprecationWarning): pauli = PauliTable.from_labels(labels) for idx, i in enumerate(pauli.label_iter()): self.assertEqual(i, labels[idx]) def test_matrix_iter(self): """Test PauliTable dense matrix_iter method.""" labels = ["III", "IXI", "IYY", "YIZ", "XYZ", "III"] with self.assertWarns(DeprecationWarning): pauli = PauliTable.from_labels(labels) for idx, i in enumerate(pauli.matrix_iter()): self.assertTrue(np.all(i == pauli_mat(labels[idx]))) def test_matrix_iter_sparse(self): """Test PauliTable sparse matrix_iter method.""" labels = ["III", "IXI", "IYY", "YIZ", "XYZ", "III"] with self.assertWarns(DeprecationWarning): pauli = PauliTable.from_labels(labels) for idx, i in enumerate(pauli.matrix_iter(sparse=True)): self.assertTrue(isinstance(i, csr_matrix)) self.assertTrue(np.all(i.toarray() == pauli_mat(labels[idx]))) @ddt class TestPauliTableOperator(QiskitTestCase): """Tests for PauliTable base operator methods.""" @combine(j=range(1, 10)) def test_tensor(self, j): """Test tensor method j={j}.""" labels1 = ["XX", "YY"] labels2 = [j * "I", j * "Z"] with self.assertWarns(DeprecationWarning): pauli1 = PauliTable.from_labels(labels1) pauli2 = PauliTable.from_labels(labels2) value = pauli1.tensor(pauli2) with self.assertWarns(DeprecationWarning): target = PauliTable.from_labels([i + j for i in labels1 for j in labels2]) self.assertEqual(value, target) @combine(j=range(1, 10)) def test_expand(self, j): """Test expand method j={j}.""" labels1 = ["XX", "YY"] labels2 = [j * "I", j * "Z"] with self.assertWarns(DeprecationWarning): pauli1 = PauliTable.from_labels(labels1) pauli2 = PauliTable.from_labels(labels2) value = pauli1.expand(pauli2) with self.assertWarns(DeprecationWarning): target = PauliTable.from_labels([j + i for j in labels2 for i in labels1]) self.assertEqual(value, target) def test_compose_1q(self): """Test 1-qubit compose methods.""" # Test single qubit Pauli dot products with self.assertWarns(DeprecationWarning): pauli = PauliTable.from_labels(["I", "X", "Y", "Z"]) with self.subTest(msg="compose single I"): with self.assertWarns(DeprecationWarning): target = PauliTable.from_labels(["I", "X", "Y", "Z"]) value = pauli.compose("I") self.assertEqual(target, value) with self.subTest(msg="compose single X"): with self.assertWarns(DeprecationWarning): target = PauliTable.from_labels(["X", "I", "Z", "Y"]) value = pauli.compose("X") self.assertEqual(target, value) with self.subTest(msg="compose single Y"): with self.assertWarns(DeprecationWarning): target = PauliTable.from_labels(["Y", "Z", "I", "X"]) value = pauli.compose("Y") self.assertEqual(target, value) with self.subTest(msg="compose single Z"): with self.assertWarns(DeprecationWarning): target = PauliTable.from_labels(["Z", "Y", "X", "I"]) value = pauli.compose("Z") self.assertEqual(target, value) def test_dot_1q(self): """Test 1-qubit dot method.""" # Test single qubit Pauli dot products with self.assertWarns(DeprecationWarning): pauli = PauliTable.from_labels(["I", "X", "Y", "Z"]) with self.subTest(msg="dot single I"): with self.assertWarns(DeprecationWarning): target = PauliTable.from_labels(["I", "X", "Y", "Z"]) value = pauli.dot("I") self.assertEqual(target, value) with self.subTest(msg="dot single X"): with self.assertWarns(DeprecationWarning): target = PauliTable.from_labels(["X", "I", "Z", "Y"]) value = pauli.dot("X") self.assertEqual(target, value) with self.subTest(msg="dot single Y"): with self.assertWarns(DeprecationWarning): target = PauliTable.from_labels(["Y", "Z", "I", "X"]) value = pauli.dot("Y") self.assertEqual(target, value) with self.subTest(msg="dot single Z"): with self.assertWarns(DeprecationWarning): target = PauliTable.from_labels(["Z", "Y", "X", "I"]) value = pauli.dot("Z") self.assertEqual(target, value) def test_qargs_compose_1q(self): """Test 1-qubit compose method with qargs.""" with self.assertWarns(DeprecationWarning): pauli1 = PauliTable.from_labels(["III", "XXX"]) pauli2 = PauliTable("Z") with self.subTest(msg="compose 1-qubit qargs=[0]"): with self.assertWarns(DeprecationWarning): target = PauliTable.from_labels(["IIZ", "XXY"]) value = pauli1.compose(pauli2, qargs=[0]) self.assertEqual(value, target) with self.subTest(msg="compose 1-qubit qargs=[1]"): with self.assertWarns(DeprecationWarning): target = PauliTable.from_labels(["IZI", "XYX"]) value = pauli1.compose(pauli2, qargs=[1]) self.assertEqual(value, target) with self.subTest(msg="compose 1-qubit qargs=[2]"): with self.assertWarns(DeprecationWarning): target = PauliTable.from_labels(["ZII", "YXX"]) value = pauli1.compose(pauli2, qargs=[2]) self.assertEqual(value, target) def test_qargs_dot_1q(self): """Test 1-qubit dot method with qargs.""" with self.assertWarns(DeprecationWarning): pauli1 = PauliTable.from_labels(["III", "XXX"]) pauli2 = PauliTable("Z") with self.subTest(msg="dot 1-qubit qargs=[0]"): with self.assertWarns(DeprecationWarning): target = PauliTable.from_labels(["IIZ", "XXY"]) value = pauli1.dot(pauli2, qargs=[0]) self.assertEqual(value, target) with self.subTest(msg="dot 1-qubit qargs=[1]"): with self.assertWarns(DeprecationWarning): target = PauliTable.from_labels(["IZI", "XYX"]) value = pauli1.dot(pauli2, qargs=[1]) self.assertEqual(value, target) with self.subTest(msg="dot 1-qubit qargs=[2]"): with self.assertWarns(DeprecationWarning): target = PauliTable.from_labels(["ZII", "YXX"]) value = pauli1.dot(pauli2, qargs=[2]) self.assertEqual(value, target) def test_qargs_compose_2q(self): """Test 2-qubit compose method with qargs.""" with self.assertWarns(DeprecationWarning): pauli1 = PauliTable.from_labels(["III", "XXX"]) pauli2 = PauliTable("ZY") with self.subTest(msg="compose 2-qubit qargs=[0, 1]"): with self.assertWarns(DeprecationWarning): target = PauliTable.from_labels(["IZY", "XYZ"]) value = pauli1.compose(pauli2, qargs=[0, 1]) self.assertEqual(value, target) with self.subTest(msg="compose 2-qubit qargs=[1, 0]"): with self.assertWarns(DeprecationWarning): target = PauliTable.from_labels(["IYZ", "XZY"]) value = pauli1.compose(pauli2, qargs=[1, 0]) self.assertEqual(value, target) with self.subTest(msg="compose 2-qubit qargs=[0, 2]"): with self.assertWarns(DeprecationWarning): target = PauliTable.from_labels(["ZIY", "YXZ"]) value = pauli1.compose(pauli2, qargs=[0, 2]) self.assertEqual(value, target) with self.subTest(msg="compose 2-qubit qargs=[2, 0]"): with self.assertWarns(DeprecationWarning): target = PauliTable.from_labels(["YIZ", "ZXY"]) value = pauli1.compose(pauli2, qargs=[2, 0]) self.assertEqual(value, target) def test_qargs_dot_2q(self): """Test 2-qubit dot method with qargs.""" with self.assertWarns(DeprecationWarning): pauli1 = PauliTable.from_labels(["III", "XXX"]) pauli2 = PauliTable("ZY") with self.subTest(msg="dot 2-qubit qargs=[0, 1]"): with self.assertWarns(DeprecationWarning): target = PauliTable.from_labels(["IZY", "XYZ"]) value = pauli1.dot(pauli2, qargs=[0, 1]) self.assertEqual(value, target) with self.subTest(msg="dot 2-qubit qargs=[1, 0]"): with self.assertWarns(DeprecationWarning): target = PauliTable.from_labels(["IYZ", "XZY"]) value = pauli1.dot(pauli2, qargs=[1, 0]) self.assertEqual(value, target) with self.subTest(msg="dot 2-qubit qargs=[0, 2]"): with self.assertWarns(DeprecationWarning): target = PauliTable.from_labels(["ZIY", "YXZ"]) value = pauli1.dot(pauli2, qargs=[0, 2]) self.assertEqual(value, target) with self.subTest(msg="dot 2-qubit qargs=[2, 0]"): with self.assertWarns(DeprecationWarning): target = PauliTable.from_labels(["YIZ", "ZXY"]) value = pauli1.dot(pauli2, qargs=[2, 0]) self.assertEqual(value, target) def test_qargs_compose_3q(self): """Test 3-qubit compose method with qargs.""" with self.assertWarns(DeprecationWarning): pauli1 = PauliTable.from_labels(["III", "XXX"]) pauli2 = PauliTable("XYZ") with self.subTest(msg="compose 3-qubit qargs=None"): with self.assertWarns(DeprecationWarning): target = PauliTable.from_labels(["XYZ", "IZY"]) value = pauli1.compose(pauli2) self.assertEqual(value, target) with self.subTest(msg="compose 3-qubit qargs=[0, 1, 2]"): with self.assertWarns(DeprecationWarning): target = PauliTable.from_labels(["XYZ", "IZY"]) value = pauli1.compose(pauli2, qargs=[0, 1, 2]) self.assertEqual(value, target) with self.subTest(msg="compose 3-qubit qargs=[2, 1, 0]"): with self.assertWarns(DeprecationWarning): target = PauliTable.from_labels(["ZYX", "YZI"]) value = pauli1.compose(pauli2, qargs=[2, 1, 0]) self.assertEqual(value, target) with self.subTest(msg="compose 3-qubit qargs=[1, 0, 2]"): with self.assertWarns(DeprecationWarning): target = PauliTable.from_labels(["XZY", "IYZ"]) value = pauli1.compose(pauli2, qargs=[1, 0, 2]) self.assertEqual(value, target) def test_qargs_dot_3q(self): """Test 3-qubit dot method with qargs.""" with self.assertWarns(DeprecationWarning): pauli1 = PauliTable.from_labels(["III", "XXX"]) pauli2 = PauliTable("XYZ") with self.subTest(msg="dot 3-qubit qargs=None"): with self.assertWarns(DeprecationWarning): target = PauliTable.from_labels(["XYZ", "IZY"]) value = pauli1.dot(pauli2, qargs=[0, 1, 2]) self.assertEqual(value, target) with self.subTest(msg="dot 3-qubit qargs=[0, 1, 2]"): with self.assertWarns(DeprecationWarning): target = PauliTable.from_labels(["XYZ", "IZY"]) value = pauli1.dot(pauli2, qargs=[0, 1, 2]) self.assertEqual(value, target) with self.subTest(msg="dot 3-qubit qargs=[2, 1, 0]"): with self.assertWarns(DeprecationWarning): target = PauliTable.from_labels(["ZYX", "YZI"]) value = pauli1.dot(pauli2, qargs=[2, 1, 0]) self.assertEqual(value, target) with self.subTest(msg="dot 3-qubit qargs=[1, 0, 2]"): with self.assertWarns(DeprecationWarning): target = PauliTable.from_labels(["XZY", "IYZ"]) value = pauli1.dot(pauli2, qargs=[1, 0, 2]) self.assertEqual(value, target) class TestPauliTableMethods(QiskitTestCase): """Tests for PauliTable utility methods class.""" def test_sort(self): """Test sort method.""" with self.subTest(msg="1 qubit standard order"): unsrt = ["X", "Z", "I", "Y", "X", "Z"] srt = ["I", "X", "X", "Y", "Z", "Z"] with self.assertWarns(DeprecationWarning): target = PauliTable.from_labels(srt) value = PauliTable.from_labels(unsrt).sort() self.assertEqual(target, value) with self.subTest(msg="1 qubit weight order"): unsrt = ["X", "Z", "I", "Y", "X", "Z"] srt = ["I", "X", "X", "Y", "Z", "Z"] with self.assertWarns(DeprecationWarning): target = PauliTable.from_labels(srt) value = PauliTable.from_labels(unsrt).sort(weight=True) self.assertEqual(target, value) with self.subTest(msg="2 qubit standard order"): srt = [ "II", "IX", "IY", "IY", "XI", "XX", "XY", "XZ", "YI", "YX", "YY", "YZ", "ZI", "ZI", "ZX", "ZY", "ZZ", "ZZ", ] unsrt = srt.copy() np.random.shuffle(unsrt) with self.assertWarns(DeprecationWarning): target = PauliTable.from_labels(srt) value = PauliTable.from_labels(unsrt).sort() self.assertEqual(target, value) with self.subTest(msg="2 qubit weight order"): srt = [ "II", "IX", "IX", "IY", "IZ", "XI", "YI", "YI", "ZI", "XX", "XX", "XY", "XZ", "YX", "YY", "YY", "YZ", "ZX", "ZX", "ZY", "ZZ", ] unsrt = srt.copy() np.random.shuffle(unsrt) with self.assertWarns(DeprecationWarning): target = PauliTable.from_labels(srt) value = PauliTable.from_labels(unsrt).sort(weight=True) self.assertEqual(target, value) with self.subTest(msg="3 qubit standard order"): srt = [ "III", "III", "IIX", "IIY", "IIZ", "IXI", "IXX", "IXY", "IXZ", "IYI", "IYX", "IYY", "IYZ", "IZI", "IZX", "IZY", "IZY", "IZZ", "XII", "XII", "XIX", "XIY", "XIZ", "XXI", "XXX", "XXY", "XXZ", "XYI", "XYX", "XYY", "XYZ", "XYZ", "XZI", "XZX", "XZY", "XZZ", "YII", "YIX", "YIY", "YIZ", "YXI", "YXX", "YXY", "YXZ", "YXZ", "YYI", "YYX", "YYX", "YYY", "YYZ", "YZI", "YZX", "YZY", "YZZ", "ZII", "ZIX", "ZIY", "ZIZ", "ZXI", "ZXX", "ZXX", "ZXY", "ZXZ", "ZYI", "ZYI", "ZYX", "ZYY", "ZYZ", "ZZI", "ZZX", "ZZY", "ZZZ", ] unsrt = srt.copy() np.random.shuffle(unsrt) with self.assertWarns(DeprecationWarning): target = PauliTable.from_labels(srt) value = PauliTable.from_labels(unsrt).sort() self.assertEqual(target, value) with self.subTest(msg="3 qubit weight order"): srt = [ "III", "IIX", "IIY", "IIZ", "IXI", "IYI", "IZI", "XII", "YII", "ZII", "IXX", "IXY", "IXZ", "IYX", "IYY", "IYZ", "IZX", "IZY", "IZZ", "XIX", "XIY", "XIZ", "XXI", "XYI", "XZI", "XZI", "YIX", "YIY", "YIZ", "YXI", "YYI", "YZI", "YZI", "ZIX", "ZIY", "ZIZ", "ZXI", "ZYI", "ZZI", "ZZI", "XXX", "XXY", "XXZ", "XYX", "XYY", "XYZ", "XZX", "XZY", "XZZ", "YXX", "YXY", "YXZ", "YYX", "YYY", "YYZ", "YZX", "YZY", "YZZ", "ZXX", "ZXY", "ZXZ", "ZYX", "ZYY", "ZYZ", "ZZX", "ZZY", "ZZZ", ] unsrt = srt.copy() np.random.shuffle(unsrt) with self.assertWarns(DeprecationWarning): target = PauliTable.from_labels(srt) value = PauliTable.from_labels(unsrt).sort(weight=True) self.assertEqual(target, value) def test_unique(self): """Test unique method.""" with self.subTest(msg="1 qubit"): labels = ["X", "Z", "X", "X", "I", "Y", "I", "X", "Z", "Z", "X", "I"] unique = ["X", "Z", "I", "Y"] with self.assertWarns(DeprecationWarning): target = PauliTable.from_labels(unique) value = PauliTable.from_labels(labels).unique() self.assertEqual(target, value) with self.subTest(msg="2 qubit"): labels = ["XX", "IX", "XX", "II", "IZ", "ZI", "YX", "YX", "ZZ", "IX", "XI"] unique = ["XX", "IX", "II", "IZ", "ZI", "YX", "ZZ", "XI"] with self.assertWarns(DeprecationWarning): target = PauliTable.from_labels(unique) value = PauliTable.from_labels(labels).unique() self.assertEqual(target, value) with self.subTest(msg="10 qubit"): labels = [10 * "X", 10 * "I", 10 * "X"] unique = [10 * "X", 10 * "I"] with self.assertWarns(DeprecationWarning): target = PauliTable.from_labels(unique) value = PauliTable.from_labels(labels).unique() self.assertEqual(target, value) def test_delete(self): """Test delete method.""" with self.subTest(msg="single row"): for j in range(1, 6): with self.assertWarns(DeprecationWarning): pauli = PauliTable.from_labels([j * "X", j * "Y"]) self.assertEqual(pauli.delete(0), PauliTable(j * "Y")) self.assertEqual(pauli.delete(1), PauliTable(j * "X")) with self.subTest(msg="multiple rows"): for j in range(1, 6): with self.assertWarns(DeprecationWarning): pauli = PauliTable.from_labels([j * "X", j * "Y", j * "Z"]) self.assertEqual(pauli.delete([0, 2]), PauliTable(j * "Y")) self.assertEqual(pauli.delete([1, 2]), PauliTable(j * "X")) self.assertEqual(pauli.delete([0, 1]), PauliTable(j * "Z")) with self.subTest(msg="single qubit"): with self.assertWarns(DeprecationWarning): pauli = PauliTable.from_labels(["IIX", "IYI", "ZII"]) value = pauli.delete(0, qubit=True) with self.assertWarns(DeprecationWarning): target = PauliTable.from_labels(["II", "IY", "ZI"]) self.assertEqual(value, target) value = pauli.delete(1, qubit=True) with self.assertWarns(DeprecationWarning): target = PauliTable.from_labels(["IX", "II", "ZI"]) self.assertEqual(value, target) value = pauli.delete(2, qubit=True) with self.assertWarns(DeprecationWarning): target = PauliTable.from_labels(["IX", "YI", "II"]) self.assertEqual(value, target) with self.subTest(msg="multiple qubits"): with self.assertWarns(DeprecationWarning): pauli = PauliTable.from_labels(["IIX", "IYI", "ZII"]) value = pauli.delete([0, 1], qubit=True) with self.assertWarns(DeprecationWarning): target = PauliTable.from_labels(["I", "I", "Z"]) self.assertEqual(value, target) value = pauli.delete([1, 2], qubit=True) with self.assertWarns(DeprecationWarning): target = PauliTable.from_labels(["X", "I", "I"]) self.assertEqual(value, target) value = pauli.delete([0, 2], qubit=True) with self.assertWarns(DeprecationWarning): target = PauliTable.from_labels(["I", "Y", "I"]) self.assertEqual(value, target) def test_insert(self): """Test insert method.""" # Insert single row for j in range(1, 10): with self.assertWarns(DeprecationWarning): pauli = PauliTable(j * "X") target0 = PauliTable.from_labels([j * "I", j * "X"]) target1 = PauliTable.from_labels([j * "X", j * "I"]) with self.subTest(msg=f"single row from str ({j})"): value0 = pauli.insert(0, j * "I") self.assertEqual(value0, target0) value1 = pauli.insert(1, j * "I") self.assertEqual(value1, target1) with self.subTest(msg=f"single row from PauliTable ({j})"): with self.assertWarns(DeprecationWarning): value0 = pauli.insert(0, PauliTable(j * "I")) self.assertEqual(value0, target0) with self.assertWarns(DeprecationWarning): value1 = pauli.insert(1, PauliTable(j * "I")) self.assertEqual(value1, target1) with self.subTest(msg=f"single row from array ({j})"): with self.assertWarns(DeprecationWarning): value0 = pauli.insert(0, PauliTable(j * "I").array) self.assertEqual(value0, target0) with self.assertWarns(DeprecationWarning): value1 = pauli.insert(1, PauliTable(j * "I").array) self.assertEqual(value1, target1) # Insert multiple rows for j in range(1, 10): with self.assertWarns(DeprecationWarning): pauli = PauliTable(j * "X") insert = PauliTable.from_labels([j * "I", j * "Y", j * "Z"]) target0 = insert + pauli target1 = pauli + insert with self.subTest(msg=f"multiple-rows from PauliTable ({j})"): value0 = pauli.insert(0, insert) self.assertEqual(value0, target0) value1 = pauli.insert(1, insert) self.assertEqual(value1, target1) with self.subTest(msg=f"multiple-rows from array ({j})"): value0 = pauli.insert(0, insert.array) self.assertEqual(value0, target0) value1 = pauli.insert(1, insert.array) self.assertEqual(value1, target1) # Insert single column pauli = PauliTable.from_labels(["X", "Y", "Z"]) for i in ["I", "X", "Y", "Z"]: with self.assertWarns(DeprecationWarning): target0 = PauliTable.from_labels(["X" + i, "Y" + i, "Z" + i]) target1 = PauliTable.from_labels([i + "X", i + "Y", i + "Z"]) with self.subTest(msg="single-column single-val from str"): value = pauli.insert(0, i, qubit=True) self.assertEqual(value, target0) value = pauli.insert(1, i, qubit=True) self.assertEqual(value, target1) with self.subTest(msg="single-column single-val from PauliTable"): with self.assertWarns(DeprecationWarning): value = pauli.insert(0, PauliTable(i), qubit=True) self.assertEqual(value, target0) with self.assertWarns(DeprecationWarning): value = pauli.insert(1, PauliTable(i), qubit=True) self.assertEqual(value, target1) with self.subTest(msg="single-column single-val from array"): with self.assertWarns(DeprecationWarning): value = pauli.insert(0, PauliTable(i).array, qubit=True) self.assertEqual(value, target0) with self.assertWarns(DeprecationWarning): value = pauli.insert(1, PauliTable(i).array, qubit=True) self.assertEqual(value, target1) # Insert single column with multiple values with self.assertWarns(DeprecationWarning): pauli = PauliTable.from_labels(["X", "Y", "Z"]) for i in [("I", "X", "Y"), ("X", "Y", "Z"), ("Y", "Z", "I")]: with self.assertWarns(DeprecationWarning): target0 = PauliTable.from_labels(["X" + i[0], "Y" + i[1], "Z" + i[2]]) target1 = PauliTable.from_labels([i[0] + "X", i[1] + "Y", i[2] + "Z"]) with self.subTest(msg="single-column multiple-vals from PauliTable"): with self.assertWarns(DeprecationWarning): value = pauli.insert(0, PauliTable.from_labels(i), qubit=True) self.assertEqual(value, target0) with self.assertWarns(DeprecationWarning): value = pauli.insert(1, PauliTable.from_labels(i), qubit=True) self.assertEqual(value, target1) with self.subTest(msg="single-column multiple-vals from array"): with self.assertWarns(DeprecationWarning): value = pauli.insert(0, PauliTable.from_labels(i).array, qubit=True) self.assertEqual(value, target0) with self.assertWarns(DeprecationWarning): value = pauli.insert(1, PauliTable.from_labels(i).array, qubit=True) self.assertEqual(value, target1) # Insert multiple columns from single with self.assertWarns(DeprecationWarning): pauli = PauliTable.from_labels(["X", "Y", "Z"]) for j in range(1, 5): for i in [j * "I", j * "X", j * "Y", j * "Z"]: with self.assertWarns(DeprecationWarning): target0 = PauliTable.from_labels(["X" + i, "Y" + i, "Z" + i]) target1 = PauliTable.from_labels([i + "X", i + "Y", i + "Z"]) with self.subTest(msg="multiple-columns single-val from str"): value = pauli.insert(0, i, qubit=True) self.assertEqual(value, target0) value = pauli.insert(1, i, qubit=True) self.assertEqual(value, target1) with self.subTest(msg="multiple-columns single-val from PauliTable"): with self.assertWarns(DeprecationWarning): value = pauli.insert(0, PauliTable(i), qubit=True) self.assertEqual(value, target0) with self.assertWarns(DeprecationWarning): value = pauli.insert(1, PauliTable(i), qubit=True) self.assertEqual(value, target1) with self.subTest(msg="multiple-columns single-val from array"): with self.assertWarns(DeprecationWarning): value = pauli.insert(0, PauliTable(i).array, qubit=True) self.assertEqual(value, target0) with self.assertWarns(DeprecationWarning): value = pauli.insert(1, PauliTable(i).array, qubit=True) self.assertEqual(value, target1) # Insert multiple columns multiple row values with self.assertWarns(DeprecationWarning): pauli = PauliTable.from_labels(["X", "Y", "Z"]) for j in range(1, 5): for i in [ (j * "I", j * "X", j * "Y"), (j * "X", j * "Z", j * "Y"), (j * "Y", j * "Z", j * "I"), ]: with self.assertWarns(DeprecationWarning): target0 = PauliTable.from_labels(["X" + i[0], "Y" + i[1], "Z" + i[2]]) target1 = PauliTable.from_labels([i[0] + "X", i[1] + "Y", i[2] + "Z"]) with self.subTest(msg="multiple-column multiple-vals from PauliTable"): with self.assertWarns(DeprecationWarning): value = pauli.insert(0, PauliTable.from_labels(i), qubit=True) self.assertEqual(value, target0) with self.assertWarns(DeprecationWarning): value = pauli.insert(1, PauliTable.from_labels(i), qubit=True) self.assertEqual(value, target1) with self.subTest(msg="multiple-column multiple-vals from array"): with self.assertWarns(DeprecationWarning): value = pauli.insert(0, PauliTable.from_labels(i).array, qubit=True) self.assertEqual(value, target0) with self.assertWarns(DeprecationWarning): value = pauli.insert(1, PauliTable.from_labels(i).array, qubit=True) self.assertEqual(value, target1) def test_commutes(self): """Test commutes method.""" # Single qubit Pauli with self.assertWarns(DeprecationWarning): pauli = PauliTable.from_labels(["I", "X", "Y", "Z"]) with self.subTest(msg="commutes single-Pauli I"): value = list(pauli.commutes("I")) target = [True, True, True, True] self.assertEqual(value, target) with self.subTest(msg="commutes single-Pauli X"): value = list(pauli.commutes("X")) target = [True, True, False, False] self.assertEqual(value, target) with self.subTest(msg="commutes single-Pauli Y"): value = list(pauli.commutes("Y")) target = [True, False, True, False] self.assertEqual(value, target) with self.subTest(msg="commutes single-Pauli Z"): value = list(pauli.commutes("Z")) target = [True, False, False, True] self.assertEqual(value, target) # 2-qubit Pauli with self.assertWarns(DeprecationWarning): pauli = PauliTable.from_labels(["II", "IX", "YI", "XY", "ZZ"]) with self.subTest(msg="commutes single-Pauli II"): value = list(pauli.commutes("II")) target = [True, True, True, True, True] self.assertEqual(value, target) with self.subTest(msg="commutes single-Pauli IX"): value = list(pauli.commutes("IX")) target = [True, True, True, False, False] self.assertEqual(value, target) with self.subTest(msg="commutes single-Pauli XI"): value = list(pauli.commutes("XI")) target = [True, True, False, True, False] self.assertEqual(value, target) with self.subTest(msg="commutes single-Pauli YI"): value = list(pauli.commutes("YI")) target = [True, True, True, False, False] self.assertEqual(value, target) with self.subTest(msg="commutes single-Pauli IY"): value = list(pauli.commutes("IY")) target = [True, False, True, True, False] self.assertEqual(value, target) with self.subTest(msg="commutes single-Pauli XY"): value = list(pauli.commutes("XY")) target = [True, False, False, True, True] self.assertEqual(value, target) with self.subTest(msg="commutes single-Pauli YX"): value = list(pauli.commutes("YX")) target = [True, True, True, True, True] self.assertEqual(value, target) with self.subTest(msg="commutes single-Pauli ZZ"): value = list(pauli.commutes("ZZ")) target = [True, False, False, True, True] self.assertEqual(value, target) def test_commutes_with_all(self): """Test commutes_with_all method.""" # 1-qubit with self.assertWarns(DeprecationWarning): pauli = PauliTable.from_labels(["I", "X", "Y", "Z"]) with self.subTest(msg="commutes_with_all [I]"): value = list(pauli.commutes_with_all("I")) target = [0, 1, 2, 3] self.assertEqual(value, target) with self.subTest(msg="commutes_with_all [X]"): value = list(pauli.commutes_with_all("X")) target = [0, 1] self.assertEqual(value, target) with self.subTest(msg="commutes_with_all [Y]"): value = list(pauli.commutes_with_all("Y")) target = [0, 2] self.assertEqual(value, target) with self.subTest(msg="commutes_with_all [Z]"): value = list(pauli.commutes_with_all("Z")) target = [0, 3] self.assertEqual(value, target) # 2-qubit Pauli with self.assertWarns(DeprecationWarning): pauli = PauliTable.from_labels(["II", "IX", "YI", "XY", "ZZ"]) with self.subTest(msg="commutes_with_all [IX, YI]"): with self.assertWarns(DeprecationWarning): other = PauliTable.from_labels(["IX", "YI"]) value = list(pauli.commutes_with_all(other)) target = [0, 1, 2] self.assertEqual(value, target) with self.subTest(msg="commutes_with_all [XY, ZZ]"): with self.assertWarns(DeprecationWarning): other = PauliTable.from_labels(["XY", "ZZ"]) value = list(pauli.commutes_with_all(other)) target = [0, 3, 4] self.assertEqual(value, target) with self.subTest(msg="commutes_with_all [YX, ZZ]"): with self.assertWarns(DeprecationWarning): other = PauliTable.from_labels(["YX", "ZZ"]) value = list(pauli.commutes_with_all(other)) target = [0, 3, 4] self.assertEqual(value, target) with self.subTest(msg="commutes_with_all [XY, YX]"): with self.assertWarns(DeprecationWarning): other = PauliTable.from_labels(["XY", "YX"]) value = list(pauli.commutes_with_all(other)) target = [0, 3, 4] self.assertEqual(value, target) with self.subTest(msg="commutes_with_all [XY, IX]"): with self.assertWarns(DeprecationWarning): other = PauliTable.from_labels(["XY", "IX"]) value = list(pauli.commutes_with_all(other)) target = [0] self.assertEqual(value, target) with self.subTest(msg="commutes_with_all [YX, IX]"): with self.assertWarns(DeprecationWarning): other = PauliTable.from_labels(["YX", "IX"]) value = list(pauli.commutes_with_all(other)) target = [0, 1, 2] self.assertEqual(value, target) def test_anticommutes_with_all(self): """Test anticommutes_with_all method.""" # 1-qubit with self.assertWarns(DeprecationWarning): pauli = PauliTable.from_labels(["I", "X", "Y", "Z"]) with self.subTest(msg="anticommutes_with_all [I]"): value = list(pauli.anticommutes_with_all("I")) target = [] self.assertEqual(value, target) with self.subTest(msg="antianticommutes_with_all [X]"): value = list(pauli.anticommutes_with_all("X")) target = [2, 3] self.assertEqual(value, target) with self.subTest(msg="anticommutes_with_all [Y]"): value = list(pauli.anticommutes_with_all("Y")) target = [1, 3] self.assertEqual(value, target) with self.subTest(msg="anticommutes_with_all [Z]"): value = list(pauli.anticommutes_with_all("Z")) target = [1, 2] self.assertEqual(value, target) # 2-qubit Pauli with self.assertWarns(DeprecationWarning): pauli = PauliTable.from_labels(["II", "IX", "YI", "XY", "ZZ"]) with self.subTest(msg="anticommutes_with_all [IX, YI]"): with self.assertWarns(DeprecationWarning): other = PauliTable.from_labels(["IX", "YI"]) value = list(pauli.anticommutes_with_all(other)) target = [3, 4] self.assertEqual(value, target) with self.subTest(msg="anticommutes_with_all [XY, ZZ]"): with self.assertWarns(DeprecationWarning): other = PauliTable.from_labels(["XY", "ZZ"]) value = list(pauli.anticommutes_with_all(other)) target = [1, 2] self.assertEqual(value, target) with self.subTest(msg="anticommutes_with_all [YX, ZZ]"): with self.assertWarns(DeprecationWarning): other = PauliTable.from_labels(["YX", "ZZ"]) value = list(pauli.anticommutes_with_all(other)) target = [] self.assertEqual(value, target) with self.subTest(msg="anticommutes_with_all [XY, YX]"): with self.assertWarns(DeprecationWarning): other = PauliTable.from_labels(["XY", "YX"]) value = list(pauli.anticommutes_with_all(other)) target = [] self.assertEqual(value, target) with self.subTest(msg="anticommutes_with_all [XY, IX]"): with self.assertWarns(DeprecationWarning): other = PauliTable.from_labels(["XY", "IX"]) value = list(pauli.anticommutes_with_all(other)) target = [] self.assertEqual(value, target) with self.subTest(msg="anticommutes_with_all [YX, IX]"): with self.assertWarns(DeprecationWarning): other = PauliTable.from_labels(["YX", "IX"]) value = list(pauli.anticommutes_with_all(other)) target = [] self.assertEqual(value, target) if __name__ == "__main__": unittest.main()
https://github.com/qiskit-community/qiskit-translations-staging
qiskit-community
from qiskit import QuantumCircuit, transpile, schedule from qiskit.visualization.pulse_v2 import draw from qiskit.providers.fake_provider import FakeBoeblingen qc = QuantumCircuit(2) qc.h(0) qc.cx(0, 1) qc.measure_all() qc = transpile(qc, FakeBoeblingen(), layout_method='trivial') sched = schedule(qc, FakeBoeblingen()) draw(sched, backend=FakeBoeblingen())
https://github.com/BOBO1997/osp_solutions
BOBO1997
filename = "job_ids_jakarta_100step_20220412_030333_.pkl" import pickle with open(filename, "rb") as f: print(pickle.load(f)) filename = "job_ids_jakarta_100step_20220413_012425_.pkl" with open(filename, "rb") as f: print(pickle.load(f))
https://github.com/qiskit-community/qiskit-translations-staging
qiskit-community
from qiskit import IBMQ IBMQ.load_account() provider = IBMQ.get_provider(hub="ibm-q", group="open", project="main") program_id = "qaoa" qaoa_program = provider.runtime.program(program_id) print(f"Program name: {qaoa_program.name}, Program id: {qaoa_program.program_id}") print(qaoa_program.parameters()) import numpy as np from qiskit.tools import job_monitor from qiskit.opflow import PauliSumOp, Z, I from qiskit.algorithms.optimizers import SPSA # Define the cost operator to run. op = ( (Z ^ Z ^ I ^ I ^ I) - (I ^ I ^ Z ^ Z ^ I) + (I ^ I ^ Z ^ I ^ Z) - (Z ^ I ^ Z ^ I ^ I) - (I ^ Z ^ Z ^ I ^ I) + (I ^ Z ^ I ^ Z ^ I) + (I ^ I ^ I ^ Z ^ Z) ) # SPSA helps deal with noisy environments. optimizer = SPSA(maxiter=100) # We will run a depth two QAOA. reps = 2 # The initial point for the optimization, chosen at random. initial_point = np.random.random(2 * reps) # The backend that will run the programm. options = {"backend_name": "ibmq_qasm_simulator"} # The inputs of the program as described above. runtime_inputs = { "operator": op, "reps": reps, "optimizer": optimizer, "initial_point": initial_point, "shots": 2**13, # Set to True when running on real backends to reduce circuit # depth by leveraging swap strategies. If False the # given optimization_level (default is 1) will be used. "use_swap_strategies": False, # Set to True when optimizing sparse problems. "use_initial_mapping": False, # Set to true when using echoed-cross-resonance hardware. "use_pulse_efficient": False, } job = provider.runtime.run( program_id=program_id, options=options, inputs=runtime_inputs, ) job_monitor(job) print(f"Job id: {job.job_id()}") print(f"Job status: {job.status()}") result = job.result() from collections import defaultdict def op_adj_mat(op: PauliSumOp) -> np.array: """Extract the adjacency matrix from the op.""" adj_mat = np.zeros((op.num_qubits, op.num_qubits)) for pauli, coeff in op.primitive.to_list(): idx = tuple([i for i, c in enumerate(pauli[::-1]) if c == "Z"]) # index of Z adj_mat[idx[0], idx[1]], adj_mat[idx[1], idx[0]] = np.real(coeff), np.real(coeff) return adj_mat def get_cost(bit_str: str, adj_mat: np.array) -> float: """Return the cut value of the bit string.""" n, x = len(bit_str), [int(bit) for bit in bit_str[::-1]] cost = 0 for i in range(n): for j in range(n): cost += adj_mat[i, j] * x[i] * (1 - x[j]) return cost def get_cut_distribution(result) -> dict: """Extract the cut distribution from the result. Returns: A dict of cut value: probability. """ adj_mat = op_adj_mat(PauliSumOp.from_list(result["inputs"]["operator"])) state_results = [] for bit_str, amp in result["eigenstate"].items(): state_results.append((bit_str, get_cost(bit_str, adj_mat), amp**2 * 100)) vals = defaultdict(int) for res in state_results: vals[res[1]] += res[2] return dict(vals) import matplotlib.pyplot as plt cut_vals = get_cut_distribution(result) fig, axs = plt.subplots(1, 2, figsize=(14, 5)) axs[0].plot(result["optimizer_history"]["energy"]) axs[1].bar(list(cut_vals.keys()), list(cut_vals.values())) axs[0].set_xlabel("Energy evaluation number") axs[0].set_ylabel("Energy") axs[1].set_xlabel("Cut value") axs[1].set_ylabel("Probability") from qiskit_optimization.runtime import QAOAClient from qiskit_optimization.algorithms import MinimumEigenOptimizer from qiskit_optimization import QuadraticProgram qubo = QuadraticProgram() qubo.binary_var("x") qubo.binary_var("y") qubo.binary_var("z") qubo.minimize(linear=[1, -2, 3], quadratic={("x", "y"): 1, ("x", "z"): -1, ("y", "z"): 2}) print(qubo.prettyprint()) qaoa_mes = QAOAClient( provider=provider, backend=provider.get_backend("ibmq_qasm_simulator"), reps=2, alpha=0.75 ) qaoa = MinimumEigenOptimizer(qaoa_mes) result = qaoa.solve(qubo) print(result.prettyprint()) from qiskit.transpiler import PassManager from qiskit.circuit.library.standard_gates.equivalence_library import ( StandardEquivalenceLibrary as std_eqlib, ) from qiskit.transpiler.passes import ( Collect2qBlocks, ConsolidateBlocks, UnrollCustomDefinitions, BasisTranslator, Optimize1qGatesDecomposition, ) from qiskit.transpiler.passes.calibration.builders import RZXCalibrationBuilderNoEcho from qiskit.transpiler.passes.optimization.echo_rzx_weyl_decomposition import ( EchoRZXWeylDecomposition, ) from qiskit.test.mock import FakeBelem backend = FakeBelem() inst_map = backend.defaults().instruction_schedule_map channel_map = backend.configuration().qubit_channel_mapping rzx_basis = ["rzx", "rz", "x", "sx"] pulse_efficient = PassManager( [ # Consolidate consecutive two-qubit operations. Collect2qBlocks(), ConsolidateBlocks(basis_gates=["rz", "sx", "x", "rxx"]), # Rewrite circuit in terms of Weyl-decomposed echoed RZX gates. EchoRZXWeylDecomposition(backend.defaults().instruction_schedule_map), # Attach scaled CR pulse schedules to the RZX gates. RZXCalibrationBuilderNoEcho( instruction_schedule_map=inst_map, qubit_channel_mapping=channel_map ), # Simplify single-qubit gates. UnrollCustomDefinitions(std_eqlib, rzx_basis), BasisTranslator(std_eqlib, rzx_basis), Optimize1qGatesDecomposition(rzx_basis), ] ) from qiskit import QuantumCircuit circ = QuantumCircuit(3) circ.h([0, 1, 2]) circ.rzx(0.5, 0, 1) circ.swap(0, 1) circ.cx(2, 1) circ.rz(0.4, 1) circ.cx(2, 1) circ.rx(1.23, 2) circ.cx(2, 1) circ.draw("mpl") pulse_efficient.run(circ).draw("mpl", fold=False) import qiskit.tools.jupyter %qiskit_version_table %qiskit_copyright
https://github.com/Qottmann/Quantum-anomaly-detection
Qottmann
import time import datetime import numpy as np from matplotlib import pyplot as plt import qiskit from qiskit import * from qiskit.opflow import X,Z,I from qiskit.opflow.state_fns import StateFn, CircuitStateFn from qiskit.providers.aer import StatevectorSimulator, AerSimulator from qiskit.algorithms import VQE from qiskit.algorithms.optimizers import COBYLA, SLSQP, SPSA from qiskit.opflow import CircuitSampler from qiskit.ignis.mitigation.measurement import CompleteMeasFitter # you will need to pip install qiskit-ignis from qiskit.ignis.mitigation.measurement import complete_meas_cal from scipy import sparse import scipy.sparse.linalg.eigen.arpack as arp from modules.utils import * anti = -1 L = 5 num_trash = 2 name = "ibmq_antiferro-1D-load_bogota-optimize-20points" # 01.06.2021 experiment filename = "data/noisy_VQE_maxiter-500_Ising_L5_anti_-1_20" #"data/noisy_VQE_maxiter-100_Ising_L5_anti_-1_20_recycle" print("filename: ", filename, "notebook name: ", name) # where to get the simulated thetas values from? needs to contain a thetas_mitigated array filename_simulated_thetas = 'data/ibmq_antiferro-1D-load_bogota-optimize_thetas-loss-cost_run2.npz' load = True recompute = False # whether or not to recompute Magnetization, makes sense on device # this is noisy simulation data L = 5 num_trash = 2 anti = -1 VQE_params = np.load(filename + ".npz", allow_pickle=True) pick = np.arange(0,len(VQE_params['gx_list'])) gx_list = VQE_params['gx_list'][pick] gz_list = VQE_params['gz_list'][pick] opt_params = VQE_params['opt_params'][pick] Qmags = VQE_params["Qmag"][pick] Qen = VQE_params["Qen"][pick] Sen = VQE_params["Sen"][pick] Smags = VQE_params["Smag"][pick] gx_vals = np.unique(gx_list) gz_vals = np.unique(gz_list) # these are the results from using precalculated VQE values from noisy simulation on the real device (ibmq_bogota) if load: temp = np.load("data/" + name + "executed_mags-Es.npz",allow_pickle=True) Qmags_executed = temp["Qmags"] # these are values actually obtained with VQE on ibmq_rome VQE_params = np.load("data/rome_VQE_maxiter-30_Ising_L5_anti_-1_20_recycle.npz", allow_pickle=True) print(VQE_params.files) pick = np.arange(0,len(VQE_params['gx_list'])) gx_list2 = VQE_params['gx_list'][pick] gz_list2 = VQE_params['gz_list'][pick] opt_params2 = VQE_params['opt_params'][pick] Qmags2 = VQE_params["Qmag"][pick] Qen2 = VQE_params["Qen"][pick] Sen2 = VQE_params["Sen"][pick] Smags2 = VQE_params["Smag"][pick] gx_vals2 = np.unique(gx_list2) gz_vals2 = np.unique(gz_list2) fig, axs = plt.subplots(ncols=2,figsize=(14,4)) ax=axs[0] ax.plot(gx_list, Qmags_executed,"x--", label="simulated VQE on ibmq_bogota") ax.plot(gx_list2, Qmags2,".:", label = "full mag on ibmq_rome") ax.set_xscale("log") ax.legend() ax=axs[1] ax.plot(gx_list, abs(Qmags_executed),"x--", label="simulated VQE on ibmq_bogota") ax.plot(gx_list2, abs(Qmags2),".:", label = "full mag on ibmq_rome") ax.set_xscale("log") ax.legend() fig, axs = plt.subplots(ncols=2, figsize=(10,5)) ax = axs[0] ax.plot(gx_list, Smags,"x--", label="ED") ax.plot(gx_list, Qmags,"x--", label="VQE simu w/ noise") ax.set_xscale("log") if recompute or load: ax.plot(gx_list, Qmags_executed,"x--", label="IBMQ") ax.legend() ax.set_title("$M$") ax = axs[1] ax.plot(gx_list, Smags,"x--", label="ED") ax.plot(gx_list, abs(Qmags),"x--", label="VQE simu w/ noise") ax.set_xscale("log") if recompute or load: ax.plot(gx_list, abs(Qmags_executed),"x--", label="ibmq_bogota") ax.legend() ax.set_title("$\\mid M \\mid$") ############################################################################## ### II - Training ########################################################### ############################################################################## cal_matrix = np.array([[0.982, 0.036, 0.032, 0.003], [0.011, 0.959, 0., 0.036], [0.007, 0.001, 0.962, 0.023], [0., 0.004, 0.006, 0.938]]) # this was the one from the experiment from qiskit.tools.visualization import * temp = np.load("data/" + 'ibmq_antiferro-1D-load_simu' + "raw-vs-mitigated-counts.npz",allow_pickle=True) plot_histogram([temp["raw_counts"].item(), temp["mitigated_counts"].item()], legend=['raw', 'mitigated']) counts0 = temp["raw_counts"].item() counts1 = temp["mitigated_counts"].item() sortkeys = list(sorted([_ for _ in counts0])) fig, ax = plt.subplots(figsize=(5,3)) plt.grid() sortkeys = list(sorted([_ for _ in counts0])) vals = np.array([counts0[_] for _ in sortkeys]) vals = vals/np.sum(vals) ax.bar(sortkeys,vals, width=-0.3, align="edge", label="raw") sortkeys = list(sorted([_ for _ in counts1])) vals = np.array([counts1[_] for _ in sortkeys]) vals = vals/np.sum(vals) ax.bar(sortkeys,vals, width=0.3, align="edge", label="mitigated") ax.legend() plt.tick_params(labelsize=14) ax.set_ylabel("counts/shots", fontsize=20) plt.tight_layout() plt.savefig("plots/counts_mitigated-vs-raw.png") plt.savefig("plots/counts_mitigated-vs-raw.pdf") phis = opt_params # translate to Rikes naming gxs = gx_list gzs = gz_list phys_params= [0] fig, ax = plt.subplots(ncols=1,figsize=(6,5)) ax.set_title("Mitigated results") cost = np.load("data/" + "ibmq_antiferro-1D-load_simu" + "_thetas-loss-cost_run1.npz", allow_pickle=True)["cost_mitigated"] ax.plot(gx_list, cost,".:", label="loss noisy sim.") cost = np.load("data/" + name + "_thetas-loss-cost_run1.npz", allow_pickle=True)["cost_mitigated"] ax.plot(gx_list, cost,".:", label="loss ibmq_bogota") ax.plot(gx_list, Qmags,"x--", label="$\\langle \\sigma_z \\rangle$ noisy sim.") ax.plot(gx_list, Qmags_executed,"x--", label="$\\langle \\sigma_z \\rangle$ ibmq_bogota") ax.set_xscale("log") for p in phys_params: ax.plot(gx_list[p],cost[p],"o",alpha=0.3,color="magenta") ax.legend() phys_params = [-1] fig, ax = plt.subplots(ncols=1,figsize=(6,5)) ax.set_title("Mitigated results") cost = np.load("data/" + "ibmq_antiferro-1D-load_simu" + "_thetas-loss-cost_run2.npz", allow_pickle=True)["cost_mitigated"] ax.plot(gx_list, cost,"x--", label="loss noisy sim.") cost = np.load("data/" + name + "_thetas-loss-cost_run2.npz", allow_pickle=True)["cost_mitigated"] ax.plot(gx_list, cost,".:", label="loss ibmq_bogota") ax.plot(gx_list, abs(Qmags),"x--", label="$\\mid M \\mid$ noisy sim.") ax.plot(gx_list, abs(Qmags_executed),".:", label="$\\mid M \\mid$ ibmq_bogota") ax.set_xscale("log") for p in phys_params: ax.plot(gx_list[p],cost[p],"o",alpha=0.3,color="magenta") ax.legend() name fig, axs = plt.subplots(nrows=2,figsize=(6,6),sharex=True,gridspec_kw={'height_ratios': [2, 2]}) ax = axs[0] cost = np.load("data/" + "ibmq_antiferro-1D-load_simu" + "_thetas-loss-cost_run1.npz", allow_pickle=True)["cost_mitigated"] ax.plot(gx_list, cost,".:")#, label="loss noisy sim.") cost = np.load("data/" + name + "_thetas-loss-cost_run1.npz", allow_pickle=True)["cost_mitigated"] ax.plot(gx_list, cost,".:")#, label="loss ibmq_bogota") ax.plot(gx_list, Qmags,"x--", label="$\hat{S}$ noisy sim.") ax.plot(gx_list, Qmags_executed,"x--", label="$\hat{S}$ ibmq_bogota") ax.set_xscale("log") ax.plot(gx_list[0],cost[0], "X",markersize=20,alpha=0.4,color="magenta") ax = axs[1] cost = np.load("data/" + "ibmq_antiferro-1D-load_simu" + "_thetas-loss-cost_run2.npz", allow_pickle=True)["cost_mitigated"] ax.plot(gx_list, cost,"x--", label="cost noisy sim.") cost = np.load("data/" + name + "_thetas-loss-cost_run2.npz", allow_pickle=True)["cost_mitigated"] ax.plot(gx_list, cost,".:", label="cost ibmq_bogota") ax.plot(gx_list, abs(Qmags),"x--", label="$\\mid \hat{S} \\mid$ noisy sim.") ax.plot(gx_list, abs(Qmags_executed),".:", label="$\\mid \hat{S} \\mid$ ibmq_bogota") ax.set_xscale("log") ax.plot(gx_list[-1],cost[-1],"X",markersize=20,alpha=0.4,color="magenta") for ax in axs: ax.legend() ax.tick_params(labelsize=14) axs[-1].set_xlabel("$g_x$", fontsize=14) plt.tight_layout() axs[0].text(0.01,0.9,"a", fontweight="bold", size=18, transform = axs[0].transAxes) axs[1].text(0.01,0.9,"b", fontweight="bold", size=18, transform = axs[1].transAxes) plt.savefig("plots/" + name + "_mainplot.png", bbox_inches='tight') plt.savefig("plots/" + name + "_mainplot.pdf", bbox_inches='tight') fig, ax = plt.subplots(ncols=1,figsize=(6,5)) ax.set_title("Mitigated results") cost = np.load("data/" + "ibmq_antiferro-1D-load_simu" + "_thetas-loss-cost_run2.npz", allow_pickle=True)["cost_mitigated"] ax.plot(gx_list, cost,"x--", label="loss noisy sim.") cost = np.load("data/" + name + "_thetas-loss-cost_run2.npz", allow_pickle=True)["cost_mitigated"] ax.plot(gx_list, cost,".:", label="loss ibmq_bogota") ax.plot(gx_list, abs(Qmags),"x--", label="order parameter") #ax.plot(gx_list, abs(Qmags_executed),".:", label="$\\mid M \\mid$ ibmq_bogota") ax.set_xscale("log") ax.plot(gx_list[-1],cost[-1], "X",markersize=20,alpha=0.4,color="magenta") ax.legend(fontsize=16) ax.tick_params(labelsize=14) ax.set_xlabel("$g_x$", fontsize=14) plt.savefig("plots/IBMQ_presentation.png", dpi=400, bbox_inches='tight') cost = np.load("data/ibmq_antiferro-2D_load-AD_10x10_noisy-rome-simu_thetas-loss-cost_run1.npy",allow_pickle=True) qmag = np.load("data/noisy_rome_simu_VQE_maxiter-500_Ising_L5_anti_-1_10x10.npz", allow_pickle=True)["Qmag"].reshape(10,10) x,y = np.logspace(-2,2,10), np.logspace(-2,2,10) x,y = np.meshgrid(x,y) fig,axs = plt.subplots(ncols=1, nrows=2,figsize=(5,5),sharex=True, sharey=True, squeeze=False) cmap = plt.get_cmap("plasma") #'viridis' cbar_labelsize = 14 cbar = np.zeros((2,2), dtype="object") ax = axs[0,0] im = ax.pcolormesh(x,y,qmag, cmap=cmap, shading="auto",rasterized=True) #,rasterized=True necessary for pdf export cbar[0,0] = fig.colorbar(im, ax=ax) cbar[0,0].ax.tick_params(labelsize=cbar_labelsize) ax = axs[1,0] im = ax.pcolormesh(x,y,cost,vmin=0, cmap=cmap, shading="auto",rasterized=True) cbar[1,0] = fig.colorbar(im, ax=ax) cbar[1,0].ax.tick_params(labelsize=cbar_labelsize) #ax.plot(vs[47],ds[25],"x", color="magenta") axs[1,0].plot(1e-2,1e-2,"x", markersize=12, color="magenta") for ax in axs.flatten(): ax.set_xscale("log") ax.set_yscale("log") ax.tick_params(labelsize=14) axs[1,0].set_xlabel(r"$g_x$",fontsize=18) axs[0,0].set_ylabel(r"$g_z$",fontsize=18) axs[1,0].set_ylabel(r"$g_z$",fontsize=18) plt.tight_layout() # has to happen after tight_layout() axs[0,0].text(-0.25,0.9,"a", fontweight="bold", size=18, transform = axs[0,0].transAxes) axs[1,0].text(-0.25,0.9,"b", fontweight="bold", size=18, transform = axs[1,0].transAxes) axs[0,0].text(0.05,0.9,"Staggered Magnetization", size=14, transform = axs[0,0].transAxes) axs[1,0].text(0.05,0.9,"cost", size=14, transform = axs[1,0].transAxes) plt.savefig("plots/antiferro2D.pdf", bbox_inches='tight') fig,axs = plt.subplots(ncols=2,figsize=(9,4),sharex=True, sharey=True) cmap = plt.get_cmap("plasma") #'viridis' cbar_labelsize = 14 cbar = np.zeros((2), dtype="object") ax = axs[0] im = ax.pcolormesh(x,y,qmag, cmap=cmap, shading="auto",rasterized=True) #,rasterized=True necessary for pdf export cbar[0] = fig.colorbar(im, ax=ax) cbar[0].ax.tick_params(labelsize=cbar_labelsize) ax = axs[1] im = ax.pcolormesh(x,y,cost,vmin=0, cmap=cmap, shading="auto",rasterized=True) cbar[1] = fig.colorbar(im, ax=ax) cbar[1].ax.tick_params(labelsize=cbar_labelsize) #ax.plot(vs[47],ds[25],"x", color="magenta") axs[1].plot(1e-2,1e-2,"x", markersize=12, color="magenta") for ax in axs: ax.set_xscale("log") ax.set_yscale("log") ax.tick_params(labelsize=14) axs[1].set_xlabel(r"$g_x$",fontsize=18) axs[0].set_xlabel(r"$g_x$",fontsize=18) axs[0].set_ylabel(r"$g_z$",fontsize=18) plt.tight_layout() # has to happen after tight_layout() #axs[0].text(0.05,0.9,"a Staggered Magnetization", fontweight="bold", size=18, transform = axs[0].transAxes) #axs[1].text(0.05,0.9,"b cost", fontweight="bold", size=18, transform = axs[1].transAxes) axs[0].set_title("order parameter", fontsize=14) axs[1].set_title("cost", fontsize=14) plt.savefig("plots/antiferro2D_bigger.pdf", bbox_inches='tight') plt.savefig("plots/antiferro2D_bigger.png", bbox_inches='tight')
https://github.com/qiskit-community/qiskit-translations-staging
qiskit-community
import numpy as np from qiskit import QuantumCircuit from qiskit.providers.fake_provider import FakeVigoV2 backend = FakeVigoV2() qc = QuantumCircuit(2, 1) qc.h(0) qc.x(1) qc.cp(np.pi/4, 0, 1) qc.h(0) qc.measure([0], [0]) qc.draw(output='mpl')
https://github.com/BOBO1997/osp_solutions
BOBO1997
import numpy as np import matplotlib.pyplot as plt import itertools from pprint import pprint import pickle import time import datetime # Import qubit states Zero (|0>) and One (|1>), and Pauli operators (X, Y, Z) from qiskit.opflow import Zero, One, I, X, Y, Z from qiskit import QuantumCircuit, QuantumRegister, IBMQ, execute, transpile, Aer from qiskit.tools.monitor import job_monitor from qiskit.circuit import Parameter from qiskit.transpiler.passes import RemoveBarriers # Import QREM package from qiskit.ignis.mitigation.measurement import complete_meas_cal, CompleteMeasFitter from qiskit.ignis.mitigation import expectation_value # Import mitiq for zne import mitiq # Import state tomography modules from qiskit.ignis.verification.tomography import state_tomography_circuits from qiskit.quantum_info import state_fidelity import sys import importlib sys.path.append("../utils/") import circuit_utils, zne_utils, tomography_utils, sgs_algorithm importlib.reload(circuit_utils) importlib.reload(zne_utils) importlib.reload(tomography_utils) importlib.reload(sgs_algorithm) from circuit_utils import * from zne_utils import * from tomography_utils import * from sgs_algorithm import * # Combine subcircuits into a single multiqubit gate representing a single trotter step num_qubits = 3 # The final time of the state evolution target_time = np.pi # Parameterize variable t to be evaluated at t=pi later dt = Parameter('t') # Convert custom quantum circuit into a gate trot_gate = trotter_gate(dt) # initial layout initial_layout = [5,3,1] # Number of trotter steps num_steps = 100 print("trotter step: ", num_steps) scale_factors = [1.0, 2.0, 3.0] # Initialize quantum circuit for 3 qubits qr = QuantumRegister(num_qubits, name="q") qc = QuantumCircuit(qr) # Prepare initial state (remember we are only evolving 3 of the 7 qubits on jakarta qubits (q_5, q_3, q_1) corresponding to the state |110>) make_initial_state(qc, "110") # DO NOT MODIFY (|q_5,q_3,q_1> = |110>) subspace_encoder_init110(qc, targets=[0, 1, 2]) # encode trotterize(qc, trot_gate, num_steps, targets=[1, 2]) # Simulate time evolution under H_heis3 Hamiltonian subspace_decoder_init110(qc, targets=[0, 1, 2]) # decode # Evaluate simulation at target_time (t=pi) meaning each trotter step evolves pi/trotter_steps in time qc = qc.bind_parameters({dt: target_time / num_steps}) print("created qc") # Generate state tomography circuits to evaluate fidelity of simulation st_qcs = state_tomography_circuits(qc, [0, 1, 2][::-1]) #! state tomography requires === BIG ENDIAN === print("created st_qcs (length:", len(st_qcs), ")") # remove barriers st_qcs = [RemoveBarriers()(qc) for qc in st_qcs] print("removed barriers from st_qcs") # optimize circuit t3_st_qcs = transpile(st_qcs, optimization_level=3, basis_gates=["sx", "cx", "rz"]) t3_st_qcs = transpile(t3_st_qcs, optimization_level=3, basis_gates=["sx", "cx", "rz"]) print("created t3_st_qcs (length:", len(t3_st_qcs), ")") # zne wrapping zne_qcs = zne_wrapper(t3_st_qcs, scale_factors = scale_factors, pt = True) # Pauli Twirling print("created zne_qcs (length:", len(zne_qcs), ")") # optimization_level must be 0 # feed initial_layout here to see the picture of the circuits before casting the job t3_zne_qcs = transpile(zne_qcs, optimization_level=0, basis_gates=["sx", "cx", "rz"], initial_layout=initial_layout) print("created t3_zne_qcs (length:", len(t3_zne_qcs), ")") t3_zne_qcs[-3].draw("mpl") # from qiskit.test.mock import FakeJakarta # backend = FakeJakarta() # backend = Aer.get_backend("qasm_simulator") IBMQ.load_account() provider = IBMQ.get_provider(hub='ibm-q-community', group='ibmquantumawards', project='open-science-22') print("provider:", provider) backend = provider.get_backend("ibmq_jakarta") print(str(backend)) shots = 1 << 13 reps = 8 # unused jobs = [] for _ in range(reps): #! CHECK: run t3_zne_qcs, with optimization_level = 0 and straightforward initial_layout job = execute(t3_zne_qcs, backend, shots=shots, optimization_level=0) print('Job ID', job.job_id()) jobs.append(job) # QREM qr = QuantumRegister(num_qubits, name="calq") meas_calibs, state_labels = complete_meas_cal(qr=qr, circlabel='mcal') # we have to feed initial_layout to calibration matrix cal_job = execute(meas_calibs, backend=backend, shots=shots, optimization_level=3, initial_layout = initial_layout) print('Job ID', cal_job.job_id()) meas_calibs[0].draw("mpl") dt_now = datetime.datetime.now() print(dt_now) filename = "job_ids_" + str(backend) + "_100step_" + dt_now.strftime('%Y%m%d_%H%M%S') + "_.pkl" print(filename) with open("jobs_" + str(backend) + "_100step_" + dt_now.strftime('%Y%m%d_%H%M%S') + "_.pkl", "wb") as f: pickle.dump({"jobs": jobs, "cal_job": cal_job}, f) with open(filename, "wb") as f: pickle.dump({"job_ids": [job.job_id() for job in jobs], "cal_job_id": cal_job.job_id()}, f) with open("properties_" + str(backend) + "_" + dt_now.strftime('%Y%m%d_%H%M%S') + "_.pkl", "wb") as f: pickle.dump(backend.properties(), f) filename = "job_ids_ibmq_jakarta_100step_20220413_030821_.pkl" # change here with open(filename, "rb") as f: job_ids_dict = pickle.load(f) job_ids = job_ids_dict["job_ids"] cal_job_id = job_ids_dict["cal_job_id"] retrieved_jobs = [] for job_id in job_ids: retrieved_jobs.append(backend.retrieve_job(job_id)) retrieved_cal_job = backend.retrieve_job(cal_job_id) cal_results = retrieved_cal_job.result() meas_fitter = CompleteMeasFitter(cal_results, state_labels, circlabel='mcal') target_state = (One^One^Zero).to_matrix() # DO NOT CHANGE!!! fids = [] for job in retrieved_jobs: mit_results = meas_fitter.filter.apply(job.result()) zne_expvals = zne_decoder(num_qubits, mit_results, scale_factors = scale_factors) rho = expvals_to_valid_rho(num_qubits, zne_expvals) fid = state_fidelity(rho, target_state) fids.append(fid) print('state tomography fidelity = {:.4f} \u00B1 {:.4f}'.format(np.mean(fids), np.std(fids))) import qiskit.tools.jupyter %qiskit_version_table
https://github.com/miamico/Quantum_Generative_Adversarial_Networks
miamico
"""Simple example on how to log scalars and images to tensorboard without tensor ops. License: Copyleft """ __author__ = "Michael Gygli" import tensorflow as tf # from StringIO import StringIO import matplotlib.pyplot as plt import numpy as np class Logger(object): """Logging in tensorboard without tensorflow ops.""" def __init__(self, log_dir): """Creates a summary writer logging to log_dir.""" self.writer = tf.summary.FileWriter(log_dir) def log_scalar(self, tag, value, step): """Log a scalar variable. Parameter ---------- tag : basestring Name of the scalar value step : int training iteration """ summary = tf.Summary(value=[tf.Summary.Value(tag=tag, simple_value=value)]) self.writer.add_summary(summary, step) def log_images(self, tag, images, step): """Logs a list of images.""" im_summaries = [] for nr, img in enumerate(images): # Write the image to a string s = StringIO() plt.imsave(s, img, format='png') # Create an Image object img_sum = tf.Summary.Image(encoded_image_string=s.getvalue(), height=img.shape[0], width=img.shape[1]) # Create a Summary value im_summaries.append(tf.Summary.Value(tag='%s/%d' % (tag, nr), image=img_sum)) # Create and write Summary summary = tf.Summary(value=im_summaries) self.writer.add_summary(summary, step) def log_histogram(self, tag, values, step, bins=1000): """Logs the histogram of a list/vector of values.""" # Convert to a numpy array values = np.array(values) # Create histogram using numpy counts, bin_edges = np.histogram(values, bins=bins) # Fill fields of histogram proto hist = tf.HistogramProto() hist.min = float(np.min(values)) hist.max = float(np.max(values)) hist.num = int(np.prod(values.shape)) hist.sum = float(np.sum(values)) hist.sum_squares = float(np.sum(values ** 2)) # Requires equal number as bins, where the first goes from -DBL_MAX to bin_edges[1] # See https://github.com/tensorflow/tensorflow/blob/master/tensorflow/core/framework/summary.proto#L30 # Thus, we drop the start of the first bin bin_edges = bin_edges[1:] # Add bin edges and counts for edge in bin_edges: hist.bucket_limit.append(edge) for c in counts: hist.bucket.append(c) # Create and write Summary summary = tf.Summary(value=[tf.Summary.Value(tag=tag, histo=hist)]) self.writer.add_summary(summary, step) self.writer.flush()
https://github.com/qiskit-community/qiskit-translations-staging
qiskit-community
from qiskit import QuantumCircuit, transpile, schedule from qiskit.visualization.pulse_v2 import draw, IQXSimple from qiskit.providers.fake_provider import FakeBoeblingen qc = QuantumCircuit(2) qc.h(0) qc.cx(0, 1) qc.measure_all() qc = transpile(qc, FakeBoeblingen(), layout_method='trivial') sched = schedule(qc, FakeBoeblingen()) draw(sched, style=IQXSimple(), backend=FakeBoeblingen())
https://github.com/Christophe-pere/Deutsch_Jozsa_qiskit
Christophe-pere
import numpy as np # Importing standard Qiskit libraries from qiskit import QuantumCircuit, transpile, assemble, Aer, IBMQ, execute from qiskit.quantum_info import Statevector from qiskit.visualization import plot_bloch_multivector, plot_histogram class DeutschJozsa: ''' Class to generate a DeutschJozsa object containing: - init functions - oracle function - dj function ''' def __init__(self, case, input_str): ''' Initialization of the object: @case: (str) type of oracle balanced or constant @input_str: (str) string input state values ''' self.case = case self.number_qubit = len(input_str) self.str_input = input_str def oracle(self): ''' Will create the oracle needed for the Deutsch-Jozsa algorithm No input, the function will be used in the dj function @return the oracle in form of a gate ''' # Create the QuantumCircuit with n+1 qubits self.oracle_circuit = QuantumCircuit(self.number_qubit+1) # Balanced case if self.case == "balanced": # apply an X-gate to a qubit when its value is 1 for qubit in range(len(self.str_input)): if self.str_input[qubit] == '1': self.oracle_circuit.x(qubit) # Apply CNOT gates on each qubit for qubit in range(self.number_qubit): self.oracle_circuit.cx(qubit, self.number_qubit) # apply another set of X gates when the input qubit == 1 for qubit in range(len(self.str_input)): if self.str_input[qubit] == '1': self.oracle_circuit.x(qubit) # Constant case if self.case == "constant": # Output 0 for a constant oracle self.output = np.random.randint(2) if self.output == 1: self.oracle_circuit.x(self.number_qubit) # convert the quantum circuit into a gate self.oracle_gate = self.oracle_circuit.to_gate() # name of the oracle self.oracle_gate.name = "Oracle" return self.oracle_gate def dj(self): ''' Create the Deutsch-Jozsa algorithm in the general case with n qubit No input @return the quantum circuit of the DJ ''' self.dj_circuit = QuantumCircuit(self.number_qubit+1, self.number_qubit) # Set up the output qubit: self.dj_circuit.x(self.number_qubit) self.dj_circuit.h(self.number_qubit) # Psi_0 for qubit in range(self.number_qubit): self.dj_circuit.h(qubit) # Psi_1 + oracle self.dj_circuit.append(self.oracle(), range(self.number_qubit+1)) # Psi_2 for qubit in range(self.number_qubit): self.dj_circuit.h(qubit) # Psi_3 # Let's put some measurement for i in range(self.number_qubit): self.dj_circuit.measure(i, i) return self.dj_circuit test = DeutschJozsa('constant', '0110') #circuit = test.oracle() dj_circuit = test.dj() dj_circuit.draw('mpl') qasm_sim = Aer.get_backend('qasm_simulator') transpiled_dj_circuit = transpile(dj_circuit, qasm_sim) qobj = assemble(transpiled_dj_circuit) results = qasm_sim.run(qobj).result() answer = results.get_counts() plot_histogram(answer) from qiskit import IBMQ #TOKEN = 'paste your token here' #IBMQ.save_account(TOKEN) IBMQ.load_account() # Load account from disk IBMQ.providers() provider = IBMQ.get_provider(hub='ibm-q') provider.backends() provider.backends(filters=lambda x: x.configuration().n_qubits >= 5 and not x.configuration().simulator and x.status().operational==True) backend = provider.get_backend('ibmq_manila') backend mapped_circuit = transpile(dj_circuit, backend=backend) qobj = assemble(mapped_circuit, backend=backend, shots=1024) job = backend.run(qobj) job.status() # 9:17 pm result = job.result() counts = result.get_counts() print(counts) plot_histogram(counts) plot_histogram(counts,figsize=(10,8), filename='DJ.jpeg')
https://github.com/qiskit-community/qiskit-translations-staging
qiskit-community
from qiskit_optimization import QuadraticProgram qp = QuadraticProgram() qp.binary_var("x") qp.binary_var("y") qp.integer_var(lowerbound=0, upperbound=7, name="z") qp.maximize(linear={"x": 2, "y": 1, "z": 1}) qp.linear_constraint(linear={"x": 1, "y": 1, "z": 1}, sense="LE", rhs=5.5, name="xyz_leq") qp.linear_constraint(linear={"x": 1, "y": 1, "z": 1}, sense="GE", rhs=2.5, name="xyz_geq") print(qp.prettyprint()) from qiskit_optimization.converters import InequalityToEquality ineq2eq = InequalityToEquality() qp_eq = ineq2eq.convert(qp) print(qp_eq.prettyprint()) print(qp_eq.prettyprint()) from qiskit_optimization.converters import IntegerToBinary int2bin = IntegerToBinary() qp_eq_bin = int2bin.convert(qp_eq) print(qp_eq_bin.prettyprint()) print(qp_eq_bin.prettyprint()) from qiskit_optimization.converters import LinearEqualityToPenalty lineq2penalty = LinearEqualityToPenalty() qubo = lineq2penalty.convert(qp_eq_bin) print(qubo.prettyprint()) import qiskit.tools.jupyter %qiskit_version_table %qiskit_copyright
https://github.com/abbarreto/qiskit4
abbarreto
%run init.ipynb from qiskit import * nshots = 8192 IBMQ.load_account() provider= qiskit.IBMQ.get_provider(hub='ibm-q-research-2',group='federal-uni-sant-1',project='main') device = provider.get_backend('ibmq_bogota') simulator = Aer.get_backend('qasm_simulator') from qiskit.visualization import plot_histogram from qiskit.tools.monitor import job_monitor from qiskit.quantum_info import state_fidelity
https://github.com/qiskit-community/qiskit-pocket-guide
qiskit-community
from qiskit import Aer print(Aer.backends()) from qiskit import QuantumCircuit,Aer,transpile qc = QuantumCircuit(2) qc.h(0) qc.cx(0, 1) qc.measure_all() backend = Aer.get_backend("aer_simulator") tqc = transpile(qc, backend) job = backend.run(tqc, shots=1000) result = job.result() counts = result.get_counts(tqc) print(counts) from qiskit import QuantumCircuit,Aer,transpile qc = QuantumCircuit(2) qc.h(0) qc.cx(0, 1) backend = Aer.get_backend("aer_simulator") qc.save_statevector() tqc = transpile(qc, backend) job = backend.run(tqc) result = job.result() statevector = result.get_statevector(tqc, 4) print(statevector) from qiskit import QuantumCircuit,Aer,transpile qc = QuantumCircuit(2) qc.h(0) qc.cx(0, 1) backend = Aer.get_backend("aer_simulator") qc.save_unitary() tqc = transpile(qc, backend) job = backend.run(tqc) result = job.result() unitary = result.get_unitary(qc, 4) print(unitary) from qiskit import QuantumCircuit, Aer, transpile from qiskit.providers.aer.noise import \ NoiseModel, depolarizing_error err_1 = depolarizing_error(0.95, 1) err_2 = depolarizing_error(0.01, 2) noise_model = NoiseModel() noise_model.add_all_qubit_quantum_error(err_1, ['u1', 'u2', 'u3']) noise_model.add_all_qubit_quantum_error(err_2, ['cx']) qc = QuantumCircuit(2) qc.h(0) qc.cx(0, 1) qc.measure_all() backend = Aer.get_backend("aer_simulator") backend.set_options(noise_model=noise_model) tqc = transpile(qc, backend) job = backend.run(tqc, shots=1000) result = job.result() counts = result.get_counts(tqc) print(counts) from qiskit import QuantumCircuit, transpile from qiskit.providers.aer import AerSimulator from qiskit.test.mock import FakeVigo qc = QuantumCircuit(2) qc.h(0) qc.cx(0, 1) qc.measure_all() device_backend = FakeVigo() backend = AerSimulator.from_backend(device_backend) tqc = transpile(qc, backend) job = backend.run(tqc, shots=1000) result = job.result() counts = result.get_counts(tqc) print(counts)
https://github.com/QuantumVic/discrete-time-quantum-walks
QuantumVic
from qiskit import * import numpy as np import matplotlib as mpl from qiskit.tools.visualization import plot_histogram, plot_state_city from qiskit.tools.monitor import job_monitor state_sim = Aer.get_backend('statevector_simulator') qasm_sim = Aer.get_backend('qasm_simulator') unitary_sim = Aer.get_backend('unitary_simulator') qiskit.__qiskit_version__ #developed in q0.14.0, q-terra0.11.0 # Definition of c_Increment, c_Decrement gates # def increment(qc,qr): """controlled-increment gate, cf. PhysRevA.72.032329""" for i in range(num_qubits - 1): qc.mct(qr[0:num_qubits - 1 - i], qr[num_qubits - 1 - i] , qr_aux) def decrement(qc,qr): """controlled-decrement gate, cf. PhysRevA.72.032329""" for i in range(num_qubits - 1): qc.mct(qr[0:i+1], qr[i+1], qr_aux) # Definition of QW cycle # def quantum_walk(qc,qr): """implement DTQW on a previously defined circuit and register cf. PhysRevA.72.032329""" # coin operator qc.h(qr[0]) #conditional shift increment(qc,qr) qc.x(qr[0]) decrement(qc,qr) qc.x(qr[0]) # Definition of circuit analysis functions # def get_tot_gates(qc): """get the total number of basic gates of a circuit""" tot_gates = 0 for key in qc.decompose().count_ops(): tot_gates = tot_gates + qc.decompose().count_ops()[key] return tot_gates def get_cx_gates(qc): """get the total number of cx gates of a circuit""" cx_gates = qc.decompose().count_ops()['cx'] return cx_gates # Total number of qubits (lattice nodes + coin) num_qubits = 4 num_steps = 1 # Define qRegister and cRegister qr = QuantumRegister(num_qubits, 'qr') cr = ClassicalRegister(num_qubits - 1, 'cr') # Define qCircuit # We need (num_qubits - 3) aux qubits for mct-gates if num_qubits > 3: qr_aux = QuantumRegister(num_qubits - 3, 'aux') qc = QuantumCircuit(qr,qr_aux,cr) else: qr_aux = None qc = QuantumCircuit(qr,cr) # BEGINNING OF QUANTUM CIRCUIT # Initialization for symmetric state 1/sqrt(2) [|0> + i|1>] of coin qc.h(qr[0]) qc.s(qr[0]) qc.barrier() # Initialization for middle state |1000...> of nodes qc.x(qr[num_qubits - 1]) qc.barrier() # Running the QW for i in range(num_steps): quantum_walk(qc,qr) qc.barrier() # Measurement qc.measure(qr[1:num_qubits],cr) qc.draw(output='mpl') # Execute the circuit job = execute(qc, backend=qasm_sim) results_dict = job.result().get_counts() # Convert the results to decimal value of cReg and plot results_dec = {} for key, value in results_dict.items(): results_dec[str(int(key,2))] = value plot_histogram(results_dec)
https://github.com/1chooo/Quantum-Oracle
1chooo
from qiskit import QuantumCircuit import math from qiskit.quantum_info import Statevector from qiskit.quantum_info import Statevector from qiskit.visualization import plot_bloch_multivector qc = QuantumCircuit(4,4) qc.initialize([1,0],0) qc.initialize([0,1],1) qc.initialize([1/math.sqrt(2), 1/math.sqrt(2)],2) qc.initialize([1/math.sqrt(2), -1/math.sqrt(2)],3) qc.draw("mpl") state = Statevector.from_instruction(qc) plot_bloch_multivector(state)
https://github.com/aryashah2k/Quantum-Computing-Collection-Of-Resources
aryashah2k
from random import randrange # # you may use method 'randrange' for this task # randrange(n) returns a value from {0,1,...,n-1} randomly # # # your solution is here # from random import randrange for experiment in [100,1000,10000,100000]: heads = tails = 0 for i in range(experiment): if randrange(2) == 0: heads = heads + 1 else: tails = tails + 1 print("experiment:",experiment) print("heads =",heads," tails = ",tails) print("the ratio of #heads/#tails is",(round(heads/tails,4))) print() # empty line # # you may use method 'randrange' for this task # randrange(n) returns a value from {0,1,...,n-1} randomly # # # your solution is here # from random import randrange # let's pick a random number between {0,1,...,99} # it is expected to be less than 60 with probability 0.6 # and greater than or equal to 60 with probability 0.4 for experiment in [100,1000,10000,100000]: heads = tails = 0 for i in range(experiment): if randrange(100) <60: heads = heads + 1 # with probability 0.6 else: tails = tails + 1 # with probability 0.4 print("experiment:",experiment) print("heads =",heads," tails = ",tails) print("the ratio of #heads/#tails is",(round(heads/tails,4))) print() # empty line def biased_coin(N,B): from random import randrange random_number = randrange(N) if random_number < B: return "Heads" else: return "Tails" def biased_coin(N,B): from random import randrange random_number = randrange(N) if random_number < B: return "Heads" else: return "Tails" from random import randrange N = 101 B = randrange(100) total_tosses = 500 the_number_of_heads = 0 for i in range(total_tosses): if biased_coin(N,B) == "Heads": the_number_of_heads = the_number_of_heads + 1 my_guess = the_number_of_heads/total_tosses real_bias = B/N error = abs(my_guess-real_bias)/real_bias*100 print("my guess is",my_guess) print("real bias is",real_bias) print("error (%) is",error)
https://github.com/W-Bernau/QiskitAlgorithms
W-Bernau
from qiskit import * from math import pi import numpy as np from qiskit_aer import Aer from qiskit.visualization import * import matplotlib.pyplot as plt from qutip import * qc = QuantumCircuit(2) qc.h(1) qc.barrier() qc.cu(np.pi/2, 0, 1, 0, 0 ,1) qc.barrier() qc.h(0) qc.barrier() qc.swap(0,1) qc.draw() backend = Aer.get_backend('statevector_simulator') out = (backend.run(transpile(qc,backend))).result().get_statevector() print(out) def qft3(): n = 3 q = QuantumRegister(n) c = ClassicalRegister(n) qc = QuantumCircuit(q,c) qc.h(q[2]) qc.barrier() qc.cu(np.pi/2, 0, 0, 0, q[1], q[2]) qc.barrier() qc.h(q[1]) qc.barrier() qc.cu(np.pi/4, 0, 0, 0, q[0], q[2]) qc.barrier() qc.cu(np.pi/2, 0, 0, 0, q[0], q[1]) qc.barrier() qc.h(q[0]) qc.barrier() qc.swap(q[0], q[2]) return q,c,qc q,c,qc = qft3() qc.barrier() qc.draw()
https://github.com/qiskit-community/qiskit-translations-staging
qiskit-community
import numpy as np from qiskit import * # Create a Quantum Circuit acting on a quantum register of three qubits circ = QuantumCircuit(3) # Add a H gate on qubit $q_{0}$, putting this qubit in superposition. circ.h(0) # Add a CX (CNOT) gate on control qubit $q_{0}$ and target qubit $q_{1}$, putting # the qubits in a Bell state. circ.cx(0, 1) # Add a CX (CNOT) gate on control qubit $q_{0}$ and target qubit $q_{2}$, putting # the qubits in a GHZ state. circ.cx(0, 2) circ.draw('mpl') # Import Aer from qiskit import Aer # Run the quantum circuit on a statevector simulator backend backend = Aer.get_backend('statevector_simulator') # Create a Quantum Program for execution job = backend.run(circ) result = job.result() outputstate = result.get_statevector(circ, decimals=3) print(outputstate) from qiskit.visualization import plot_state_city plot_state_city(outputstate) # Run the quantum circuit on a unitary simulator backend backend = Aer.get_backend('unitary_simulator') job = backend.run(circ) result = job.result() # Show the results print(result.get_unitary(circ, decimals=3)) # Create a Quantum Circuit meas = QuantumCircuit(3, 3) meas.barrier(range(3)) # map the quantum measurement to the classical bits meas.measure(range(3), range(3)) # The Qiskit circuit object supports composition using # the compose method. circ.add_register(meas.cregs[0]) qc = circ.compose(meas) #drawing the circuit qc.draw() # Use Aer's qasm_simulator backend_sim = Aer.get_backend('qasm_simulator') # Execute the circuit on the qasm simulator. # We've set the number of repeats of the circuit # to be 1024, which is the default. job_sim = backend_sim.run(transpile(qc, backend_sim), shots=1024) # Grab the results from the job. result_sim = job_sim.result() counts = result_sim.get_counts(qc) print(counts) from qiskit.visualization import plot_histogram plot_histogram(counts) import qiskit.tools.jupyter %qiskit_version_table %qiskit_copyright
https://github.com/grossiM/Qiskit_workshop1019
grossiM
# initialization import matplotlib.pyplot as plt %matplotlib inline import numpy as np # importing Qiskit from qiskit import IBMQ, BasicAer from qiskit.providers.ibmq import least_busy from qiskit import QuantumCircuit, ClassicalRegister, QuantumRegister, execute # import basic plot tools from qiskit.tools.visualization import plot_histogram # Creating registers # n qubits for querying the oracle and one qubit for storing the answer qr = QuantumRegister(2,name='qr') crsingle = ClassicalRegister(1) deutsch = QuantumCircuit(qr,crsingle) deutsch.x(qr[1]) deutsch.h(qr[1]) deutsch.draw(output='latex') deutsch.h(qr[0]) deutsch.draw(output='mpl') deutsch.cx(qr[0],qr[1]) deutsch.h(qr[0]) deutsch.measure(qr[0],crsingle[0]) deutsch.draw(output='mpl') # use local simulator backend = BasicAer.get_backend('qasm_simulator') shots = 1024 results = execute(deutsch, backend=backend, shots=shots).result() answer = results.get_counts() plot_histogram(answer) # set the length of the $n$-bit string. n = 2 # set the oracle, b for balanced, c for constant oracle = "b" # if the oracle is balanced, set the hidden bitstring, b if oracle == "b": b = 3 # np.random.randint(1,2**n) uncomment for a random value # if the oracle is constant, set c = 0 or 1 randomly. if oracle == "c": c = np.random.randint(2) # Creating registers # n qubits for querying the oracle and one qubit for storing the answer qr = QuantumRegister(n+1) cr = ClassicalRegister(n) djCircuit = QuantumCircuit(qr, cr) barriers = True # Since all qubits are initialized to |0>, we need to flip the second register qubit to the the |1> state djCircuit.x(qr[n]) # Apply barrier if barriers: djCircuit.barrier() # Apply Hadamard gates to all qubits djCircuit.h(qr) # Apply barrier if barriers: djCircuit.barrier() # Query the oracle if oracle == "c": # if the oracle is constant, return c if c == 1: djCircuit.x(qr[n]) else: djCircuit.iden(qr[n]) else: # otherwise, the oracle is balanced and it returns the inner product of the input with b (non-zero bitstring) for i in range(n): if (b & (1 << i)): djCircuit.cx(qr[i], qr[n]) # Apply barrier if barriers: djCircuit.barrier() # Apply Hadamard gates to the first register after querying the oracle for i in range(n): djCircuit.h(qr[i]) # Measure the first register for i in range(n): djCircuit.measure(qr[i], cr[i]) djCircuit.draw(output='mpl') # use local simulator backend = BasicAer.get_backend('qasm_simulator') shots = 1024 results = execute(djCircuit, backend=backend, shots=shots).result() answer = results.get_counts() plot_histogram(answer) # Load our saved IBMQ accounts and get the least busy backend device with less than or equal to 5 qubits #IBMQ.load_account() provider = IBMQ.get_provider(hub='ibm-q') provider.backends() backend = least_busy(provider.backends(filters=lambda x: x.configuration().n_qubits <= 5 and not x.configuration().simulator and x.status().operational==True)) # Run our circuit on the least busy backend. Monitor the execution of the job in the queue from qiskit.tools.monitor import job_monitor shots = 1024 job = execute(djCircuit, backend=backend, shots=shots) job_monitor(job, interval = 2) # Get the results of the computation results = job.result() answer = results.get_counts() plot_histogram(answer) N = 4 qrQFT = QuantumRegister(N,'qftr') QFT = QuantumCircuit(qrQFT) for i in range(N): QFT.h(qrQFT[i]) for k in range(i+1,N): l = k-i+1 QFT.cu1(2*math.pi/(2**l),qrQFT[k],qrQFT[i]) QFT.draw(output='mpl') import qiskit qiskit.__qiskit_version__
https://github.com/qiskit-community/qiskit-jku-provider
qiskit-community
# -*- coding: utf-8 -*- # Copyright 2018, IBM. # # This source code is licensed under the Apache License, Version 2.0 found in # the LICENSE.txt file in the root directory of this source tree. # pylint: disable=missing-docstring,broad-except import unittest from qiskit import QuantumCircuit, QuantumRegister from qiskit import execute from .common import QiskitTestCase from qiskit_jku_provider import QasmSimulator class JKUSnapshotTest(QiskitTestCase): """Test JKU's statevector return capatbilities.""" def setUp(self): super().setUp() self.backend = QasmSimulator(silent=True) qr = QuantumRegister(2) self.q_circuit = QuantumCircuit(qr) self.q_circuit.h(qr[0]) self.q_circuit.cx(qr[0], qr[1]) def test_statevector_output(self): """Test final state vector for single circuit run.""" result = execute(self.q_circuit, backend=self.backend).result() self.assertEqual(result.success, True) actual = result.get_statevector(self.q_circuit) # state is 1/sqrt(2)|00> + 1/sqrt(2)|11>, up to a global phase self.assertAlmostEqual((abs(actual[0]))**2, 1/2, places=5) self.assertEqual(actual[1], 0) self.assertEqual(actual[2], 0) self.assertAlmostEqual((abs(actual[3]))**2, 1/2, places=5) if __name__ == '__main__': unittest.main()
https://github.com/quantum-tokyo/qiskit-handson
quantum-tokyo
# Qiskitライブラリーを導入 from qiskit import * # 描画のためのライブラリーを導入 import matplotlib.pyplot as plt %matplotlib inline # Qiskitバージョンの確認 qiskit.__qiskit_version__ # 2量子ビット回路を用意してください qc=QuantumCircuit(2,2) # 回路を描画します qc.draw(output="mpl") # EveがEPRペアを作ってAliceとBobに渡します qc.h(0) qc.cx(0,1) qc.barrier() # 回路を描画します qc.draw(output="mpl") # Aliceが送りたい2古典ビットをセットします msg = "11" # 送りたいメッセージの入力 if msg == "00": pass elif msg == "10": #10の場合 qc.x(0) elif msg == "01": #01の場合 qc.z(0) elif msg == "11": #01の場合 qc.z(0) qc.x(0) # 回路を描画します qc.draw(output="mpl") # BobはAliceからEPRビットをもらい、復元のためのゲートを適用します qc.cx(0,1) qc.h(0) qc.barrier() # 回路を描画します qc.draw(output="mpl") # Bobが測定します qc.measure(0,0) qc.measure(1,1) # 回路を描画します qc.draw(output="mpl") # qasm_simulator で実行して、AliceからBobに2ビットが転送されたか確認します。 backend = Aer.get_backend('qasm_simulator') job_sim = execute(qc,backend) sim_result = job_sim.result() print(sim_result.get_counts(qc)) from qiskit.visualization import plot_histogram plot_histogram(sim_result.get_counts(qc)) # 初めて実デバイスで実行する人はこちらを実行 from qiskit import IBMQ IBMQ.save_account('MY_API_TOKEN') # ご自分のトークンを入れてください # アカウント情報をロードして、使える量子デバイスを確認します IBMQ.load_account() provider = IBMQ.get_provider(hub='ibm-q') provider.backends() # 最もすいているバックエンドを選びます from qiskit.providers.ibmq import least_busy large_enough_devices = IBMQ.get_provider().backends(filters=lambda x: x.configuration().n_qubits > 3 and not x.configuration().simulator) print(large_enough_devices) real_backend = least_busy(large_enough_devices) print("ベストなバックエンドは " + real_backend.name()) # 上記のバックエンドで実行します job = execute(qc,real_backend) # ジョブの実行状態を確認します from qiskit.tools.monitor import job_monitor job_monitor(job) # 結果を確認します real_result= job.result() print(real_result.get_counts(qc)) plot_histogram(real_result.get_counts(qc))
https://github.com/Gopal-Dahale/qiskit-qulacs
Gopal-Dahale
import numpy as np from qiskit.circuit.library import IQP from qiskit.transpiler.preset_passmanagers import generate_preset_pass_manager from qiskit.quantum_info import SparsePauliOp, random_hermitian n_qubits = 4 mat = np.real(random_hermitian(n_qubits, seed=1234)) circuit = IQP(mat) observable = SparsePauliOp("Z" * n_qubits) print(f">>> Observable: {observable.paulis}") from qiskit_qulacs.qulacs_backend import QulacsBackend backend = QulacsBackend() pm = generate_preset_pass_manager(optimization_level=1, backend=backend) isa_circuit = pm.run(circuit) isa_observable = observable.apply_layout(isa_circuit.layout) isa_circuit.draw("mpl") from qiskit_qulacs.qulacs_estimator import QulacsEstimator qulacs_estimator = QulacsEstimator() job = qulacs_estimator.run(isa_circuit, isa_observable) print(f">>> Job ID: {job.job_id()}") print(f">>> Job Status: {job.status()}") result = job.result() print(f">>> {result}") print(f" > Expectation value: {result.values[0]}") print(f" > Metadata: {result.metadata[0]}") import numpy as np from qiskit.circuit.library import IQP from qiskit.transpiler.preset_passmanagers import generate_preset_pass_manager from qiskit.quantum_info import SparsePauliOp, random_hermitian n_qubits = 4 mat = np.real(random_hermitian(n_qubits, seed=1234)) circuit = IQP(mat) circuit.measure_all() pm = generate_preset_pass_manager(optimization_level=1, backend=backend) isa_circuit = pm.run(circuit) from qiskit_qulacs.qulacs_sampler import QulacsSampler qulacs_sampler = QulacsSampler() job = qulacs_sampler.run(isa_circuit) print(f">>> Job ID: {job.job_id()}") print(f">>> Job Status: {job.status()}") result = job.result() print(f">>> {result}") print(f" > Quasi-probability distribution: {result.quasi_dists[0]}") print(f" > Metadata: {result.metadata[0]}") from qiskit.visualization import plot_histogram plot_histogram(result.quasi_dists[0]) import qiskit qiskit.__version__
https://github.com/qiskit-community/qiskit-translations-staging
qiskit-community
from qiskit import QuantumCircuit, transpile from qiskit.visualization import plot_circuit_layout from qiskit.providers.fake_provider import FakeVigo backend = FakeVigo() ghz = QuantumCircuit(3, 3) ghz.h(0) ghz.cx(0,range(1,3)) ghz.barrier() ghz.measure(range(3), range(3)) # Virtual -> physical # 0 -> 3 # 1 -> 4 # 2 -> 2 my_ghz = transpile(ghz, backend, initial_layout=[3, 4, 2]) plot_circuit_layout(my_ghz, backend)
https://github.com/Z-928/Bugs4Q
Z-928
from qiskit.circuit import Parameter from qiskit import pulse from qiskit.test.mock.backends.almaden import * phase = Parameter('phase') with pulse.build(FakeAlmaden()) as phase_test_sched: pulse.shift_phase(phase, pulse.drive_channel(0)) phase_test_sched.instructions # ()
https://github.com/TRSasasusu/qiskit-quantum-zoo
TRSasasusu
""" Implementing [arXiv:quant-ph/9511018](https://arxiv.org/abs/quant-ph/9511018) """ from typing import Optional import numpy as np from qiskit import QuantumCircuit, QuantumRegister from qiskit.circuit import Gate def carry() -> Gate: """CARRY. It requires 4 qubits. Returns: its gate """ qc = QuantumCircuit(4) qc.ccx(1, 2, 3) qc.cx(1, 2) qc.ccx(0, 2, 3) return qc.to_gate() def qsum() -> Gate: """SUM. It requires 3 qubits. Returns: its gate """ qc = QuantumCircuit(3) qc.cx(1, 2) qc.cx(0, 2) return qc.to_gate() def adder(n: int) -> Gate: r"""ADDER: $a,b\to a,a+b$. It requires $3n+1$ qubits: $a$ uses $n$ qubits, $b$ uses $n+1$ qubits, and $c$ uses $n$ qubits. Args: n (int): $n$ bits for representing $a$. Returns: its gate """ qubits = QuantumRegister(n + (n + 1) + n) a = qubits[:n] b = qubits[n:n + (n + 1)] c = qubits[n + (n + 1):] qc = QuantumCircuit(qubits) carry_gate = carry() carry_gate_dag = carry_gate.inverse() sum_gate = qsum() for i in range(n - 1): qc.append(carry_gate, [c[i]] + [a[i]] + [b[i]] + [c[i + 1]]) qc.append(carry_gate, [c[n - 1]] + [a[-1]] + [b[n - 1]] + [b[n]]) qc.cx(a[-1], b[n - 1]) qc.append(sum_gate, [c[n - 1]] + [a[-1]] + [b[n - 1]]) for i in reversed(range(n - 1)): qc.append(carry_gate_dag, [c[i]] + [a[i]] + [b[i]] + [c[i + 1]]) qc.append(sum_gate, [c[i]] + [a[i]] + [b[i]]) return qc.to_gate() def adder_modM(M: int, N_len: int) -> Gate: r"""ADDER MOD: $a,b\to a,a+b\mod M$. It requires $4N_\mathit{len}+2$ qubits: $a$ uses $N_\mathit{len}$ qubits, $b$ uses $N_\mathit{len}+1$ qubits, $c$ uses $N_\mathit{len}$ qubits, $M$ uses $N_\mathit{len}$ qubits, and $t$ uses 1 qubit. Args: M (int): $N$ in the paper, but we uses $M$ instead. N_len (int): a number of bits for representing $a$. Returns: its gate """ M_val = M qubits = QuantumRegister(N_len + (N_len + 1) + N_len + N_len + 1) a, left_qubits = qubits[:N_len], qubits[N_len:] b, left_qubits = left_qubits[:N_len + 1], left_qubits[N_len + 1:] c, left_qubits = left_qubits[:N_len], left_qubits[N_len:] M, left_qubits = left_qubits[:N_len], left_qubits[N_len:] t = left_qubits[:1] qc = QuantumCircuit(qubits) adder_gate = adder(N_len) adder_gate_dag = adder_gate.inverse() for i, char in enumerate(bin(M_val)[2:][::-1]): if char == '1': qc.x(M[i]) qc.append(adder_gate, a + b + c) qc.append(adder_gate_dag, M + b + c) qc.x(b[-1]) qc.cx(b[-1], t[0]) qc.x(b[-1]) for i, char in enumerate(bin(M_val)[2:][::-1]): if char == '1': qc.cx(t[0], M[i]) qc.append(adder_gate, M + b + c) for i, char in enumerate(bin(M_val)[2:][::-1]): if char == '1': qc.cx(t[0], M[i]) qc.append(adder_gate_dag, a + b + c) qc.cx(b[-1], t[0]) qc.append(adder_gate, a + b + c) for i, char in enumerate(bin(M_val)[2:][::-1]): if char == '1': qc.x(M[i]) return qc.to_gate() def ctrl_multi_modM(a: int, M: int, N_len: int) -> Gate: r"""Ctrl MULT MOD: $x,0\to x,ax\mod M$ if $c=1$, otherwise $x,0\to x,x$. It requires $9N_\mathit{len}-1$ qubits: $\mathit{ctrl}$ uses 1 qubit, $x$ uses $N_\mathit{len}$ qubits, $y$ uses $2N_\mathit{len}$ qubits, $\mathit{xx}$ (which is a register in the middle of Fig. 5 in the paper) uses $2N_\mathit{len}-1$ qubits, $c$ (which is $c$ for ADDER MOD) uses $2N_\mathit{len}-1$ qubits, $M$ (which is $M$ for ADDER MOD) uses $2N_\mathit{len}-1$ qubits, and $t$ (which is $t$ for ADDER MOD) uses 1 qubit. Args: a (int): $a$ M (int): $M$ (see `adder_modM`) N_len (int): a number of bits for representing $x$ Returns: its gate """ M_val = M N_len = N_len qubits = QuantumRegister(9 * N_len - 1) ctrl, left_qubits = qubits[:1], qubits[1:] x, left_qubits = left_qubits[:N_len], left_qubits[N_len:] y, left_qubits = left_qubits[:2 * N_len], left_qubits[2 * N_len:] xx, left_qubits = left_qubits[:2 * N_len - 1], left_qubits[2 * N_len - 1:] c, left_qubits = left_qubits[:2 * N_len - 1], left_qubits[2 * N_len - 1:] M, left_qubits = left_qubits[:2 * N_len - 1], left_qubits[2 * N_len - 1:] t, left_qubits = left_qubits[:1], qubits[1:] qc = QuantumCircuit(qubits) adder_modM_gate = adder_modM(M=M_val, N_len=2 * N_len - 1) for i in range(N_len): for j, char in enumerate(bin(2 ** i * a % M_val)[2:][::-1]): if char == '1': qc.ccx(ctrl[0], x[i], xx[j]) qc.append(adder_modM_gate, xx + y + c + M + t) for j, char in enumerate(bin(2 ** i * a % M_val)[2:][::-1]): if char == '1': qc.ccx(ctrl[0], x[i], xx[j]) qc.x(ctrl[0]) for x_bit, y_bit in zip(x, y): qc.ccx(ctrl[0], x_bit, y_bit) qc.x(ctrl[0]) return qc.to_gate() def ax_modM(a: int, M: int, N_len: Optional[int] = None, x_0_at_first: bool = True) -> Gate: r"""Modular exponentiation, $a^x\mod M$. It requires $10N_\mathit{len}-2$ qubits: $x$ uses $N_\mathit{len}$ qubits, $\mathit{x\ for\ Ctrl\ MULT\ MOD}$ uses $N_\mathit{len}$ qubits, $y$ uses $2N_\mathit{len}$ qubits, $\mathit{xx}$ uses $2N_\mathit{len}-1$ qubits, $c$ (which is $c$ for ADDER MOD) uses $2N_\mathit{len}-1$ qubits, $M$ (which is $M$ for ADDER MOD) uses $2N_\mathit{len}-1$ qubits, and $t$ (which is $t$ for ADDER MOD) uses 1 qubit. Args: a (int): $a$ M (int): $M$ (see `adder_modM`) N_len (int): a number of bits for representing $x$ x_0_at_first (bool): if True, it adds 1 into the target register before calculating modular exponentiation Returns: its gate """ M_val = M if N_len is None: N_len = int(np.ceil(np.log2(M))) qubits = QuantumRegister(10 * N_len - 2) x, left_qubits = qubits[:N_len], qubits[N_len:] x_for_ctrl_multi_modM_gate, left_qubits = left_qubits[:N_len], left_qubits[N_len:] y, left_qubits = left_qubits[:2 * N_len], left_qubits[2 * N_len:] xx, left_qubits = left_qubits[:2 * N_len - 1], left_qubits[2 * N_len - 1:] c, left_qubits = left_qubits[:2 * N_len - 1], left_qubits[2 * N_len - 1:] M, left_qubits = left_qubits[:2 * N_len - 1], left_qubits[2 * N_len - 1:] t, left_qubits = left_qubits[:1], qubits[1:] qc = QuantumCircuit(qubits) if x_0_at_first: qc.x(x_for_ctrl_multi_modM_gate[0]) for i in range(N_len): ctrl_multi_modM_gate = ctrl_multi_modM(pow(a, 2 ** i, M_val), M_val, N_len) ctrl_multi_modM_gate_dag = ctrl_multi_modM(pow(a, -2 ** i, M_val), M_val, N_len).inverse() qc.append(ctrl_multi_modM_gate, [x[i]] + x_for_ctrl_multi_modM_gate + y + xx + c + M + t) for j in range(N_len): qc.cswap(x[i], x_for_ctrl_multi_modM_gate[j], y[j]) qc.append(ctrl_multi_modM_gate_dag, [x[i]] + x_for_ctrl_multi_modM_gate + y + xx + c + M + t) return qc.to_gate()
https://github.com/0sophy1/Qiskit-Dev-Cert-lectures
0sophy1
import numpy as np from math import sqrt #define 0, 1, +, - state zero = np.array([[1],[0]]) one = np.array([[0],[1]]) plus = np.array([[1/sqrt(2)],[1/sqrt(2)]]) minus = np.array([[1/sqrt(2)],[ -1/sqrt(2)]]) #define H operation H = np.array([[1/sqrt(2), 1/sqrt(2)], [1/sqrt(2), -1/sqrt(2)]]) np.matmul(H,zero) #=plus np.matmul(H, one) #=minus np.matmul(H, plus) #=zero np.matmul(H, minus) #=one
https://github.com/Aman-Agrawal01/Quantum-Computing-Qiskit-Tutorial
Aman-Agrawal01
from qiskit import * %matplotlib inline import numpy as np from qiskit.visualization import plot_histogram n = 2 #Number of qubits qr1 = QuantumRegister(size=n) qr2 = QuantumRegister(size=1) cr = ClassicalRegister(size=n) def function(circuit,fn): if fn == 'const-0': circuit.x(qr2) circuit.barrier() circuit.h(qr1) circuit.h(qr2) circuit.barrier() circuit.barrier() circuit.h(qr1) circuit.barrier() circuit.measure(qr1,cr) elif fn == 'const-1': circuit.x(qr2) circuit.barrier() circuit.h(qr1) circuit.h(qr2) circuit.barrier() circuit.x(qr1) circuit.barrier() circuit.h(qr1) circuit.barrier() circuit.measure(qr1,cr) elif fn == 'balanced': circuit.x(qr2) circuit.barrier() circuit.h(qr1) circuit.h(qr2) circuit.barrier() circuit.cx(qr1[0],qr2) circuit.barrier() circuit.h(qr1) circuit.barrier() circuit.measure(qr1,cr) return circuit circuit_1 = QuantumCircuit(qr1,qr2,cr) circuit_1 = function(circuit_1,'const-1') circuit_1.draw(output='mpl') simulator = Aer.get_backend('qasm_simulator') result = execute(circuit_1,backend=simulator).result() plot_histogram(result.get_counts()) circuit_0 = QuantumCircuit(qr1,qr2,cr) circuit_0 = function(circuit_0,'const-0') circuit_0.draw(output='mpl') simulator = Aer.get_backend('qasm_simulator') result = execute(circuit_0,backend=simulator).result() plot_histogram(result.get_counts()) circuit_b = QuantumCircuit(qr1,qr2,cr) circuit_b = function(circuit_b,'balanced') circuit_b.draw(output='mpl') simulator = Aer.get_backend('qasm_simulator') result = execute(circuit_b,backend=simulator).result() plot_histogram(result.get_counts())
https://github.com/apcarrik/qiskit-dev
apcarrik
import numpy as np import pylab from qiskit import Aer from qiskit.utils import QuantumInstance, algorithm_globals from qiskit.algorithms import VQE, NumPyMinimumEigensolver from qiskit.algorithms.optimizers import SPSA from qiskit.circuit.library import TwoLocal from qiskit.opflow import I, X, Z H2_op = (-1.052373245772859 * I ^ I) + \ (0.39793742484318045 * I ^ Z) + \ (-0.39793742484318045 * Z ^ I) + \ (-0.01128010425623538 * Z ^ Z) + \ (0.18093119978423156 * X ^ X) print(f'Number of qubits: {H2_op.num_qubits}') # Compute reference using classical method npme = NumPyMinimumEigensolver() result = npme.compute_minimum_eigenvalue(operator=H2_op) ref_value = result.eigenvalue.real print(f'Reference value: {ref_value:.5f}') ### Performance Without Noise seed = 170 iterations = 125 algorithm_globals.random_seed = seed backend = Aer.get_backend('aer_simulator') qi = QuantumInstance(backend=backend, seed_simulator=seed, seed_transpiler=seed) counts = [] values = [] def store_intermediate_result(eval_count, parameters, mean, std): counts.append(eval_count) values.append(mean) ansatz = TwoLocal(rotation_blocks='ry', entanglement_blocks='cz') spsa = SPSA(maxiter=iterations) vqe = VQE(ansatz, optimizer=spsa, callback=store_intermediate_result, quantum_instance=qi) result = vqe.compute_minimum_eigenvalue(operator=H2_op) print(f"VQE on Aer qasm simulator (no noise): {result.eigenvalue.real:.5f}") print(f"Delta from reference energy value is: {(result.eigenvalue.real-ref_value):.5f}") # Plot energy values pylab.rcParams['figure.figsize'] = (12, 4) pylab.plot(counts,values) pylab.xlabel('Eval count') pylab.ylabel('Energy') pylab.title('Convergence without noise') pylab.show() ### Performance With Noise import os from qiskit.providers.aer import QasmSimulator from qiskit.providers.aer.noise import NoiseModel from qiskit.test.mock import FakeVigo device_backend = FakeVigo() backend = Aer.get_backend('aer_simulator') counts1 = [] values1 = [] noise_model = None device = QasmSimulator.from_backend(device_backend) coupling_map = device.configuration().coupling_map noise_model = NoiseModel.from_backend(device) basis_gate = noise_model.basis_gates print(noise_model) print() algorithm_globals.random_seed = seed qi = QuantumInstance(backend=backend, seed_simulator=seed, seed_transpiler=seed, coupling_map=coupling_map, noise_model=noise_model) def store_intermediate_result1(eval_count, parameters, mean, std): counts1.append(eval_count) values1.append(mean) var_form = TwoLocal(rotation_blocks='ry', entanglement_blocks='cz') spsa = SPSA(maxiter=iterations) vqe = VQE(ansatz, optimizer=spsa, callback=store_intermediate_result1, quantum_instance=qi) result1 = vqe.compute_minimum_eigenvalue(operator=H2_op) print(f"VQE on Aer qasm simulator (with noise): {result1.eigenvalue.real:.5f}") print(f"Delta from reference energy value is: {(result1.eigenvalue.real-ref_value):.5f}") # Plot energy values if counts1 or values1: pylab.rcParams['figure.figsize'] = (12, 4) pylab.plot(counts1,values1) pylab.xlabel('Eval count') pylab.ylabel('Energy') pylab.title('Convergence with noise') pylab.show() ### Performance With Noise And Measurement Error Mitigation from qiskit.ignis.mitigation.measurement import CompleteMeasFitter counts2 = [] values2 = [] if noise_model is not None: algorithm_globals.random_seed = seed qi = QuantumInstance(backend=backend, seed_simulator=seed, seed_transpiler=seed, coupling_map=coupling_map, noise_model=noise_model, measurement_error_mitigation_cls=CompleteMeasFitter, cals_matrix_refresh_period=30) def store_intermediate_result2(eval_count, parameters, mean, std): counts2.append(eval_count) values2.append(mean) ansatz = TwoLocal(rotation_blocks='ry', entanglement_blocks='cz') spsa = SPSA(maxiter=iterations) vqe = VQE(ansatz, optimizer=spsa, callback=store_intermediate_result2, quantum_instance=qi) result2 = vqe.compute_minimum_eigenvalue(operator=H2_op) print(f"VQE on Aer qasm simulator (with noise and measurement error mitigation): {result2.eigenvalue.real:.5f}") print(f"Delta from reference energy value is: {(result2.eigenvalue.real - ref_value):.5f}") # Plot energy values if counts2 or values2: pylab.rcParams['figure.figsize'] = (12, 4) pylab.plot(counts2,values2) pylab.xlabel('Eval count') pylab.ylabel('Energy') pylab.title('Convergence with noise and measurement error mitigation') pylab.show() # Summary print('--------- Summary ---------') print(f'Reference value: {ref_value:.5f}') print(f"VQE on Aer qasm simulator (no noise): {result.eigenvalue.real:.5f}") print(f"VQE on Aer qasm simulator (with noise): {result1.eigenvalue.real:.5f}") print(f"VQE on Aer qasm simulator (with noise and measurement error mitigation): {result2.eigenvalue.real:.5f}")
https://github.com/qiskit-community/qiskit-translations-staging
qiskit-community
from qiskit import QuantumRegister, ClassicalRegister, QuantumCircuit from qiskit.tools.visualization import circuit_drawer q = QuantumRegister(1) c = ClassicalRegister(1) qc = QuantumCircuit(q, c) qc.h(q) qc.measure(q, c) circuit_drawer(qc, output='mpl', style={'backgroundcolor': '#EEEEEE'})
https://github.com/qclib/qclib
qclib
# Copyright 2021 qclib project. # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # http://www.apache.org/licenses/LICENSE-2.0 # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. """ An Efficient Algorithm for Sparse Quantum State Preparation https://ieeexplore.ieee.org/document/9586240 """ import numpy as np from qiskit import QuantumCircuit, QuantumRegister from qiskit.circuit.library import UGate from qclib.gates.ldmcu import Ldmcu from qclib.gates.initialize_sparse import InitializeSparse class MergeInitialize(InitializeSparse): """ An Efficient Algorithm for Sparse Quantum State Preparation https://ieeexplore.ieee.org/document/9586240 """ def __init__(self, params, label=None): """ Classical algorithm that creates a quantum circuit C that loads a sparse quantum state, applying a sequence of operations maping the desired state |sigma> to |0>. And then inverting C to obtain the mapping of |0> to the desired state |sigma>. Args: params: A dictionary with the non-zero amplitudes corresponding to each state in format { '000': <value>, ... , '111': <value> } Returns: Creates a quantum gate that maps |0> to the desired state |params> """ self._name = "merge" if label is None: label = "MERGESP" # Parameters need to be validated first by superclass self._get_num_qubits(params) super().__init__(self._name, self.num_qubits, params.items(), label=label) def _define(self): self.definition = self._define_initialize() def _define_initialize(self): state_dict = dict(self.params) b_strings = list(state_dict.keys()) n_qubits = len(b_strings[0]) quantum_register = QuantumRegister(n_qubits) quantum_circuit = QuantumCircuit(quantum_register) while len(b_strings) > 1: bitstr1, bitstr2, dif, dif_qubits = self._select_strings(state_dict) bitstr1, bitstr2, state_dict, quantum_circuit = self._preprocess_states( bitstr1, bitstr2, dif, dif_qubits, state_dict, quantum_circuit ) state_dict, quantum_circuit = self._merge( state_dict, quantum_circuit, bitstr1, bitstr2, dif_qubits, dif ) b_strings = list(state_dict.keys()) b_string = b_strings.pop() for (bit_idx, bit) in enumerate(b_string): if bit == "1": quantum_circuit.x(bit_idx) return quantum_circuit.reverse_ops() @staticmethod def initialize(q_circuit, state, qubits=None): if qubits is None: q_circuit.append(MergeInitialize(state), q_circuit.qubits) else: q_circuit.append(MergeInitialize(state), qubits) @staticmethod def _maximizing_difference_bit_search(b_strings, dif_qubits): """ Splits the set of bit strings into two (t_0 and t_1), by setting t_0 as the set of bit_strings with 0 in the bit_index position, and t_1 as the set of bit_strings with 1 in the bit_index position. Searching for the bit_index not in dif_qubits that maximizes the difference between the size of the nonempty t_0 and t_1. Args: b_string: A list of bit strings eg.: ['000', '011', ...,'101'] dif_qubits: A list of previous qubits found to maximize the difference Returns: bit_index: The qubit index that maximizes abs(len(t_0)-len(t_1)) t_0: List of binary strings with 0 on the bit_index qubit t_1: List of binary strings with 1 on the bit_index qubit """ t_0 = [] t_1 = [] bit_index = 0 set_difference = -1 bit_search_space = list(set(range(len(b_strings[0]))) - set(dif_qubits)) for bit in bit_search_space: temp_t0 = [x for x in b_strings if x[bit] == "0"] temp_t1 = [x for x in b_strings if x[bit] == "1"] if temp_t0 and temp_t1: temp_difference = np.abs(len(temp_t0) - len(temp_t1)) if temp_difference > set_difference: t_0 = temp_t0 t_1 = temp_t1 bit_index = bit set_difference = temp_difference return bit_index, t_0, t_1 @staticmethod def _build_bit_string_set(b_strings, dif_qubits, dif_values): """ Creates a new set of bit strings from b_strings, where the bits in the indexes in dif_qubits match the values in dif_values. Args: b_strings: list of bit strings eg.: ['000', '011', ...,'101'] dif_qubits: list of integers with the bit indexes dif_values: list of integers values containing the values each bit with index in dif_qubits shoud have Returns: A new list of bit_strings, with matching values in dif_values on indexes dif_qubits """ bit_string_set = [] for b_string in b_strings: if [b_string[i] for i in dif_qubits] == dif_values: bit_string_set.append(b_string) return bit_string_set def _bit_string_search(self, b_strings, dif_qubits, dif_values): """ Searches for the bit strings with unique qubit values in `dif_values` on indexes `dif_qubits`. Args: b_strings: List of binary strings where the search is to be performed e.g.: ['000', '010', '101', '111'] dif_qubits: List of indices on a binary string of size N e.g.: [1, 3, 5] dif_values: List of values each qubit must have on indexes stored in dif_qubits [0, 1, 1] Returns: b_strings: One size list with the string found, to have values dif_values on indexes dif_qubits dif_qubits: Updated list with new indexes dif_values: Updated list with new values """ temp_strings = b_strings while len(temp_strings) > 1: bit, t_0, t_1 = self._maximizing_difference_bit_search( temp_strings, dif_qubits ) dif_qubits.append(bit) if len(t_0) < len(t_1): dif_values.append("0") temp_strings = t_0 else: dif_values.append("1") temp_strings = t_1 return temp_strings, dif_qubits, dif_values def _select_strings(self, state_dict): """ Searches for the states described by the bit strings bitstr1 and bitstr2 to be merged Args: state_dict: A dictionary with the non-zero amplitudes associated to their corresponding binary strings as keys e.g.: {'001': <value>, '101': <value>} Returns: bitstr1: First binary string bitstr2: Second binary string dif_qubit: Qubit index to be used as target for the merging operation dif_qubits: List of qubit indexes where bitstr1 and bitstr2 must be equal, because the correspondig qubits of those indexes are to be used as control for the merging operation """ # Initialization dif_qubits = [] dif_values = [] b_strings1 = b_strings2 = list(state_dict.keys()) # Searching for bitstr1 (b_strings1, dif_qubits, dif_values) = self._bit_string_search( b_strings1, dif_qubits, dif_values ) dif_qubit = dif_qubits.pop() dif_values.pop() bitstr1 = b_strings1[0] # Searching for bitstr2 b_strings2.remove(bitstr1) b_strings1 = self._build_bit_string_set(b_strings2, dif_qubits, dif_values) (b_strings1, dif_qubits, dif_values) = self._bit_string_search( b_strings1, dif_qubits, dif_values ) bitstr2 = b_strings1[0] return bitstr1, bitstr2, dif_qubit, dif_qubits @staticmethod def _apply_operation_to_bit_string(b_string, operation, qubit_indexes): """ Applies changes on binary strings according to the operation Args: b_string: Binary string '00110' operation: Operation to be applied to the string qubit_indexes: Indexes of the qubits on the binary strings where the operations are to be applied Returns: Updated binary string """ assert operation in ["x", "cx"] if operation == "x": compute = _compute_op_x else: compute = _compute_op_cx return compute(b_string, qubit_indexes) @staticmethod def _update_state_dict_according_to_operation( state_dict, operation, qubit_indexes, merge_strings=None ): """ Updates the keys of the state_dict according to the operation being applied to the circuit Args: state_dict: A dictionary with the non-zero amplitudes associated to their corresponding binary strings as keys e.g.: {'001': <value>, '101': <value>} operation: Operation to be applied to the states, it must be ['x', 'cx', 'merge'] qubit_indexes: Indexes of the qubits on the binary strings where the operations are to be applied merge_strings: Binary strings associated ot the states on the quantum processor to be merge e.g.:['01001', '10110'] Returns: A state_dict with the updated states """ assert operation in ["x", "cx", "merge"] state_list = list(state_dict.items()) new_state_dict = {} if operation == "merge": assert merge_strings is not None # Computes the norm of bitstr1 and bitstr2 new_state_dict = state_dict.copy() norm = np.linalg.norm( [new_state_dict[merge_strings[0]], new_state_dict[merge_strings[1]]] ) new_state_dict.pop(merge_strings[1], None) new_state_dict[merge_strings[0]] = norm else: for (bit_string, value) in state_list: temp_bstring = MergeInitialize._apply_operation_to_bit_string( bit_string, operation, qubit_indexes ) new_state_dict[temp_bstring] = value return new_state_dict @staticmethod def _equalize_bit_string_states( bitstr1, bitstr2, dif, state_dict, quantum_circuit ): """ Applies operations to the states represented by bit strings bitstr1 and bitstr2 equalizing them at every qubit except the one in the dif index. And alters the bit strings and state_dict accordingly. Args: bitstr1: First bit string bitstr2: Second bit string dif: index where both bitstr1 and bitstr2 must be different state_dict: A dictionary with the non-zero amplitudes associated to their corresponding binary strings as keys e.g.: {'001': <value>, '101': <value>} quantum_circuit: Qiskit's quantum circuit's object with the gates applied to the circuit Returns: Updated bitstr1, bitstr2, state_dict and quantum_circuit """ b_index_list = list(range(len(bitstr1))) b_index_list.remove(dif) for b_index in b_index_list: if bitstr1[b_index] != bitstr2[b_index]: quantum_circuit.cx(dif, b_index) bitstr1 = MergeInitialize._apply_operation_to_bit_string( bitstr1, "cx", [dif, b_index] ) bitstr2 = MergeInitialize._apply_operation_to_bit_string( bitstr2, "cx", [dif, b_index] ) state_dict = MergeInitialize._update_state_dict_according_to_operation( state_dict, "cx", [dif, b_index] ) return bitstr1, bitstr2, state_dict, quantum_circuit @staticmethod def _apply_not_gates_to_qubit_index_list( bitstr1, bitstr2, dif_qubits, state_dict, quantum_circuit ): """ Applies quantum not gate at the qubit at a given index, where the state represented by the bit string bitstr2 is different than '1' at index in diff_qubits. Args: bitstr1: First bit string bitstr2: Second bit string dif_qubits: indexes where both bitstr1 and bitstr2 are equal state_dict: A dictionary with the non-zero amplitudes associated to their corresponding binary strings as keys e.g.: {'001': <value>, '101': <value>} quantum_circuit: Qiskit's quantum circuit's object with the gates applied to the circuit Returns: Updated bitstr1, bitstr2, state_dict and quantum_circuit """ for b_index in dif_qubits: if bitstr2[b_index] != "1": quantum_circuit.x(b_index) bitstr1 = MergeInitialize._apply_operation_to_bit_string(bitstr1, "x", b_index) bitstr2 = MergeInitialize._apply_operation_to_bit_string(bitstr2, "x", b_index) state_dict = MergeInitialize._update_state_dict_according_to_operation( state_dict, "x", b_index ) return bitstr1, bitstr2, state_dict, quantum_circuit def _preprocess_states( self, bitstr1, bitstr2, dif, dif_qubits, state_dict, quantum_circuit ): """ Apply the operations on the basis states to prepare for merging bitstr1 and bitstr2. Args: state_dict: A dictionary with the non-zero amplitudes associated to their corresponding binary strings as keys e.g.: {'001': <value>, '101': <value>} bitstr1: First binary string to be merged bitstr2: Second binary string to be merged dif_qubits: List of qubit indexes on the binary strings dif: Target qubit index where the merge operation is to be applied quantum_circuit: Qiskit's QuantumCircuit object where the operations are to be called Returns: state_dict: Updated state dict bitstr1: First updated binary string to be merged bitstr2: Second updated binary string to be merged quantum_circuit: Qiskit's quantum circuit's object with the gates applied to the circuit """ if bitstr1[dif] != "1": quantum_circuit.x(dif) bitstr1 = MergeInitialize._apply_operation_to_bit_string(bitstr1, "x", dif) bitstr2 = MergeInitialize._apply_operation_to_bit_string(bitstr2, "x", dif) state_dict = self._update_state_dict_according_to_operation( state_dict, "x", dif ) ( bitstr1, bitstr2, state_dict, quantum_circuit, ) = self._equalize_bit_string_states( bitstr1, bitstr2, dif, state_dict, quantum_circuit ) ( bitstr1, bitstr2, state_dict, quantum_circuit, ) = self._apply_not_gates_to_qubit_index_list( bitstr1, bitstr2, dif_qubits, state_dict, quantum_circuit ) return bitstr1, bitstr2, state_dict, quantum_circuit @staticmethod def _compute_angles(amplitude_1, amplitude_2): """ Computes the angles for the adjoint of the merge matrix M that is going to map the dif qubit to zero e.g.: M(a|0> + b|1>) -> |1> Args: amplitude_1: A complex/real value, associated with the string with 1 on the dif qubit amplitude_2: A complex/real value, associated with the string with 0 on the dif qubit Returns: The angles theta, lambda and phi for the U operator """ norm = np.linalg.norm([amplitude_1, amplitude_2]) phi = 0 lamb = 0 # there is no minus on the theta because the intetion is to compute the inverse if isinstance(amplitude_1, complex) or isinstance(amplitude_2, complex): amplitude_1 = ( complex(amplitude_1) if not isinstance(amplitude_1, complex) else amplitude_1 ) amplitude_2 = ( complex(amplitude_2) if not isinstance(amplitude_2, complex) else amplitude_2 ) theta = -2 * np.arcsin(np.abs(amplitude_2 / norm)) lamb = np.log(amplitude_2 / norm).imag phi = np.log(amplitude_1 / norm).imag - lamb else: theta = -2 * np.arcsin(amplitude_2 / norm) return theta, phi, lamb def _merge(self, state_dict, quantum_circuit, bitstr1, bitstr2, dif_qubits, dif): theta, phi, lamb = self._compute_angles( state_dict[bitstr1], state_dict[bitstr2] ) # Applying merge operation merge_gate = UGate(theta, phi, lamb, label="U") if not dif_qubits: quantum_circuit.append(merge_gate, dif_qubits + [dif], []) else: gate_definition = UGate(theta, phi, lamb, label="U").to_matrix() Ldmcu.ldmcu(quantum_circuit, gate_definition, dif_qubits, dif) state_dict = self._update_state_dict_according_to_operation( state_dict, "merge", None, merge_strings=[bitstr1, bitstr2] ) return state_dict, quantum_circuit def _compute_op_cx(xlist, idx): return ( f'{xlist[: idx[1]]}{(not int(xlist[idx[1]])) * 1}{xlist[idx[1] + 1:]}' if xlist[idx[0]] == "1" else xlist ) def _compute_op_x(xlist, idx): return ( xlist[:idx] + "1" + xlist[idx + 1:] if xlist[idx] == "0" else xlist[0:idx] + "0" + xlist[idx + 1:] )
https://github.com/swe-bench/Qiskit__qiskit
swe-bench
# This code is part of Qiskit. # # (C) Copyright IBM 2019. # # This code is licensed under the Apache License, Version 2.0. You may # obtain a copy of this license in the LICENSE.txt file in the root directory # of this source tree or at http://www.apache.org/licenses/LICENSE-2.0. # # Any modifications or derivative works of this code must retain this # copyright notice, and modified files need to carry a notice indicating # that they have been altered from the originals. """Diagonal gate tests.""" import unittest import numpy as np from qiskit import QuantumCircuit, QuantumRegister, BasicAer, execute from qiskit import QiskitError from qiskit.test import QiskitTestCase from qiskit.compiler import transpile from qiskit.extensions.quantum_initializer import DiagonalGate from qiskit.quantum_info.operators.predicates import matrix_equal class TestDiagonalGate(QiskitTestCase): """ Diagonal gate tests. """ def test_diag_gate(self): """Test diagonal gates.""" for phases in [ [0, 0], [0, 0.8], [0, 0, 1, 1], [0, 1, 0.5, 1], (2 * np.pi * np.random.rand(2**3)).tolist(), (2 * np.pi * np.random.rand(2**4)).tolist(), (2 * np.pi * np.random.rand(2**5)).tolist(), ]: with self.subTest(phases=phases): diag = [np.exp(1j * ph) for ph in phases] num_qubits = int(np.log2(len(diag))) q = QuantumRegister(num_qubits) qc = QuantumCircuit(q) qc.diagonal(diag, q[0:num_qubits]) # Decompose the gate qc = transpile(qc, basis_gates=["u1", "u3", "u2", "cx", "id"], optimization_level=0) # Simulate the decomposed gate simulator = BasicAer.get_backend("unitary_simulator") result = execute(qc, simulator).result() unitary = result.get_unitary(qc) unitary_desired = _get_diag_gate_matrix(diag) self.assertTrue(matrix_equal(unitary, unitary_desired, ignore_phase=False)) def test_mod1_entries(self): """Test that diagonal raises if entries do not have modules of 1.""" from qiskit.quantum_info.operators.predicates import ATOL_DEFAULT, RTOL_DEFAULT with self.assertRaises(QiskitError): DiagonalGate([1, 1 - 2 * ATOL_DEFAULT - RTOL_DEFAULT]) def _get_diag_gate_matrix(diag): return np.diagflat(diag) if __name__ == "__main__": unittest.main()
https://github.com/qiskit-community/qiskit-translations-staging
qiskit-community
from qiskit import QuantumCircuit from qiskit.providers.fake_provider import FakeManilaV2 from qiskit import transpile from qiskit.tools.visualization import plot_histogram # Get a fake backend from the fake provider backend = FakeManilaV2() # Create a simple circuit circuit = QuantumCircuit(3) circuit.h(0) circuit.cx(0,1) circuit.cx(0,2) circuit.measure_all() circuit.draw('mpl') # Transpile the ideal circuit to a circuit that can be directly executed by the backend transpiled_circuit = transpile(circuit, backend) transpiled_circuit.draw('mpl') # Run the transpiled circuit using the simulated fake backend job = backend.run(transpiled_circuit) counts = job.result().get_counts() plot_histogram(counts)
https://github.com/qiskit-community/qiskit-translations-staging
qiskit-community
from sklearn.datasets import load_iris iris_data = load_iris() print(iris_data.DESCR) features = iris_data.data labels = iris_data.target from sklearn.preprocessing import MinMaxScaler features = MinMaxScaler().fit_transform(features) import pandas as pd import seaborn as sns df = pd.DataFrame(iris_data.data, columns=iris_data.feature_names) df["class"] = pd.Series(iris_data.target) sns.pairplot(df, hue="class", palette="tab10") from sklearn.model_selection import train_test_split from qiskit.utils import algorithm_globals algorithm_globals.random_seed = 123 train_features, test_features, train_labels, test_labels = train_test_split( features, labels, train_size=0.8, random_state=algorithm_globals.random_seed ) from sklearn.svm import SVC svc = SVC() _ = svc.fit(train_features, train_labels) # suppress printing the return value train_score_c4 = svc.score(train_features, train_labels) test_score_c4 = svc.score(test_features, test_labels) print(f"Classical SVC on the training dataset: {train_score_c4:.2f}") print(f"Classical SVC on the test dataset: {test_score_c4:.2f}") from qiskit.circuit.library import ZZFeatureMap num_features = features.shape[1] feature_map = ZZFeatureMap(feature_dimension=num_features, reps=1) feature_map.decompose().draw(output="mpl", fold=20) from qiskit.circuit.library import RealAmplitudes ansatz = RealAmplitudes(num_qubits=num_features, reps=3) ansatz.decompose().draw(output="mpl", fold=20) from qiskit.algorithms.optimizers import COBYLA optimizer = COBYLA(maxiter=100) from qiskit.primitives import Sampler sampler = Sampler() from matplotlib import pyplot as plt from IPython.display import clear_output objective_func_vals = [] plt.rcParams["figure.figsize"] = (12, 6) def callback_graph(weights, obj_func_eval): clear_output(wait=True) objective_func_vals.append(obj_func_eval) plt.title("Objective function value against iteration") plt.xlabel("Iteration") plt.ylabel("Objective function value") plt.plot(range(len(objective_func_vals)), objective_func_vals) plt.show() import time from qiskit_machine_learning.algorithms.classifiers import VQC vqc = VQC( sampler=sampler, feature_map=feature_map, ansatz=ansatz, optimizer=optimizer, callback=callback_graph, ) # clear objective value history objective_func_vals = [] start = time.time() vqc.fit(train_features, train_labels) elapsed = time.time() - start print(f"Training time: {round(elapsed)} seconds") train_score_q4 = vqc.score(train_features, train_labels) test_score_q4 = vqc.score(test_features, test_labels) print(f"Quantum VQC on the training dataset: {train_score_q4:.2f}") print(f"Quantum VQC on the test dataset: {test_score_q4:.2f}") from sklearn.decomposition import PCA features = PCA(n_components=2).fit_transform(features) plt.rcParams["figure.figsize"] = (6, 6) sns.scatterplot(x=features[:, 0], y=features[:, 1], hue=labels, palette="tab10") train_features, test_features, train_labels, test_labels = train_test_split( features, labels, train_size=0.8, random_state=algorithm_globals.random_seed ) svc.fit(train_features, train_labels) train_score_c2 = svc.score(train_features, train_labels) test_score_c2 = svc.score(test_features, test_labels) print(f"Classical SVC on the training dataset: {train_score_c2:.2f}") print(f"Classical SVC on the test dataset: {test_score_c2:.2f}") num_features = features.shape[1] feature_map = ZZFeatureMap(feature_dimension=num_features, reps=1) ansatz = RealAmplitudes(num_qubits=num_features, reps=3) optimizer = COBYLA(maxiter=40) vqc = VQC( sampler=sampler, feature_map=feature_map, ansatz=ansatz, optimizer=optimizer, callback=callback_graph, ) # clear objective value history objective_func_vals = [] # make the objective function plot look nicer. plt.rcParams["figure.figsize"] = (12, 6) start = time.time() vqc.fit(train_features, train_labels) elapsed = time.time() - start print(f"Training time: {round(elapsed)} seconds") train_score_q2_ra = vqc.score(train_features, train_labels) test_score_q2_ra = vqc.score(test_features, test_labels) print(f"Quantum VQC on the training dataset using RealAmplitudes: {train_score_q2_ra:.2f}") print(f"Quantum VQC on the test dataset using RealAmplitudes: {test_score_q2_ra:.2f}") from qiskit.circuit.library import EfficientSU2 ansatz = EfficientSU2(num_qubits=num_features, reps=3) optimizer = COBYLA(maxiter=40) vqc = VQC( sampler=sampler, feature_map=feature_map, ansatz=ansatz, optimizer=optimizer, callback=callback_graph, ) # clear objective value history objective_func_vals = [] start = time.time() vqc.fit(train_features, train_labels) elapsed = time.time() - start print(f"Training time: {round(elapsed)} seconds") train_score_q2_eff = vqc.score(train_features, train_labels) test_score_q2_eff = vqc.score(test_features, test_labels) print(f"Quantum VQC on the training dataset using EfficientSU2: {train_score_q2_eff:.2f}") print(f"Quantum VQC on the test dataset using EfficientSU2: {test_score_q2_eff:.2f}") print(f"Model | Test Score | Train Score") print(f"SVC, 4 features | {train_score_c4:10.2f} | {test_score_c4:10.2f}") print(f"VQC, 4 features, RealAmplitudes | {train_score_q4:10.2f} | {test_score_q4:10.2f}") print(f"----------------------------------------------------------") print(f"SVC, 2 features | {train_score_c2:10.2f} | {test_score_c2:10.2f}") print(f"VQC, 2 features, RealAmplitudes | {train_score_q2_ra:10.2f} | {test_score_q2_ra:10.2f}") print(f"VQC, 2 features, EfficientSU2 | {train_score_q2_eff:10.2f} | {test_score_q2_eff:10.2f}") import qiskit.tools.jupyter %qiskit_version_table %qiskit_copyright
https://github.com/qiskit-community/qiskit-translations-staging
qiskit-community
from qiskit import QuantumCircuit from qiskit.quantum_info import Operator from qiskit.transpiler.passes import UnitarySynthesis circuit = QuantumCircuit(1) circuit.rx(0.8, 0) unitary = Operator(circuit).data unitary_circ = QuantumCircuit(1) unitary_circ.unitary(unitary, [0]) synth = UnitarySynthesis(basis_gates=["h", "s"], method="sk") out = synth(unitary_circ) out.draw('mpl')
https://github.com/MonitSharma/Qiskit-Summer-School-and-Quantum-Challenges
MonitSharma
from qiskit import * import numpy as np from numpy import linalg as la from qiskit.tools.monitor import job_monitor import qiskit.tools.jupyter qc = QuantumCircuit(1) #### your code goes here # z measurement of qubit 0 measure_z = QuantumCircuit(1,1) measure_z.measure(0,0) # x measurement of qubit 0 measure_x = QuantumCircuit(1,1) # your code goes here # y measurement of qubit 0 measure_y = QuantumCircuit(1,1) # your code goes here shots = 2**14 # number of samples used for statistics sim = Aer.get_backend('qasm_simulator') bloch_vector_measure = [] for measure_circuit in [measure_x, measure_y, measure_z]: # run the circuit with a the selected measurement and get the number of samples that output each bit value counts = execute(qc+measure_circuit, sim, shots=shots).result().get_counts() # calculate the probabilities for each bit value probs = {} for output in ['0','1']: if output in counts: probs[output] = counts[output]/shots else: probs[output] = 0 bloch_vector_measure.append( probs['0'] - probs['1'] ) # normalizing the bloch sphere vector bloch_vector = bloch_vector_measure/la.norm(bloch_vector_measure) print('The bloch sphere coordinates are [{0:4.3f}, {1:4.3f}, {2:4.3f}]' .format(*bloch_vector)) from kaleidoscope.interactive import bloch_sphere bloch_sphere(bloch_vector, vectors_annotation=True) from qiskit.visualization import plot_bloch_vector plot_bloch_vector( bloch_vector ) # circuit for the state Tri1 Tri1 = QuantumCircuit(2) # your code goes here # circuit for the state Tri2 Tri2 = QuantumCircuit(2) # your code goes here # circuit for the state Tri3 Tri3 = QuantumCircuit(2) # your code goes here # circuit for the state Sing Sing = QuantumCircuit(2) # your code goes here # <ZZ> measure_ZZ = QuantumCircuit(2) measure_ZZ.measure_all() # <XX> measure_XX = QuantumCircuit(2) # your code goes here # <YY> measure_YY = QuantumCircuit(2) # your code goes here shots = 2**14 # number of samples used for statistics A = 1.47e-6 #unit of A is eV E_sim = [] for state_init in [Tri1,Tri2,Tri3,Sing]: Energy_meas = [] for measure_circuit in [measure_XX, measure_YY, measure_ZZ]: # run the circuit with a the selected measurement and get the number of samples that output each bit value qc = state_init+measure_circuit counts = execute(qc, sim, shots=shots).result().get_counts() # calculate the probabilities for each computational basis probs = {} for output in ['00','01', '10', '11']: if output in counts: probs[output] = counts[output]/shots else: probs[output] = 0 Energy_meas.append( probs['00'] - probs['01'] - probs['10'] + probs['11'] ) E_sim.append(A * np.sum(np.array(Energy_meas))) # Run this cell to print out your results print('Energy expection value of the state Tri1 : {:.3e} eV'.format(E_sim[0])) print('Energy expection value of the state Tri2 : {:.3e} eV'.format(E_sim[1])) print('Energy expection value of the state Tri3 : {:.3e} eV'.format(E_sim[2])) print('Energy expection value of the state Sing : {:.3e} eV'.format(E_sim[3])) # reduced plank constant in (eV) and the speed of light(cgs units) hbar, c = 4.1357e-15, 3e10 # energy difference between the triplets and singlet E_del = abs(E_sim[0] - E_sim[3]) # frequency associated with the energy difference f = E_del/hbar # convert frequency to wavelength in (cm) wavelength = c/f print('The wavelength of the radiation from the transition\ in the hyperfine structure is : {:.1f} cm'.format(wavelength)) provider = IBMQ.load_account() backend = provider.get_backend('ibmq_athens') # run this cell to get the backend information through the widget backend # assign your choice for the initial layout to the list variable `initial_layout`. initial_layout = qc_all = [state_init+measure_circuit for state_init in [Tri1,Tri2,Tri3,Sing] for measure_circuit in [measure_XX, measure_YY, measure_ZZ] ] shots = 8192 job = execute(qc_all, backend, initial_layout=initial_layout, optimization_level=3, shots=shots) print(job.job_id()) job_monitor(job) # getting the results of your job results = job.result() ## To access the results of the completed job #results = backend.retrieve_job('job_id').result() def Energy(results, shots): """Compute the energy levels of the hydrogen ground state. Parameters: results (obj): results, results from executing the circuits for measuring a hamiltonian. shots (int): shots, number of shots used for the circuit execution. Returns: Energy (list): energy values of the four different hydrogen ground states """ E = [] A = 1.47e-6 for ind_state in range(4): Energy_meas = [] for ind_comp in range(3): counts = results.get_counts(ind_state*3+ind_comp) # calculate the probabilities for each computational basis probs = {} for output in ['00','01', '10', '11']: if output in counts: probs[output] = counts[output]/shots else: probs[output] = 0 Energy_meas.append( probs['00'] - probs['01'] - probs['10'] + probs['11'] ) E.append(A * np.sum(np.array(Energy_meas))) return E E = Energy(results, shots) print('Energy expection value of the state Tri1 : {:.3e} eV'.format(E[0])) print('Energy expection value of the state Tri2 : {:.3e} eV'.format(E[1])) print('Energy expection value of the state Tri3 : {:.3e} eV'.format(E[2])) print('Energy expection value of the state Sing : {:.3e} eV'.format(E[3])) from qiskit.ignis.mitigation.measurement import * # your code to create the circuits, meas_calibs, goes here meas_calibs, state_labels = # execute meas_calibs on your choice of the backend job = execute(meas_calibs, backend, shots = shots) print(job.job_id()) job_monitor(job) cal_results = job.result() ## To access the results of the completed job #cal_results = backend.retrieve_job('job_id').result() # your code to obtain the measurement filter object, 'meas_filter', goes here results_new = meas_filter.apply(results) E_new = Energy(results_new, shots) print('Energy expection value of the state Tri1 : {:.3e} eV'.format(E_new[0])) print('Energy expection value of the state Tri2 : {:.3e} eV'.format(E_new[1])) print('Energy expection value of the state Tri3 : {:.3e} eV'.format(E_new[2])) print('Energy expection value of the state Sing : {:.3e} eV'.format(E_new[3])) # results for the energy estimation from the simulation, # execution on a quantum system without error mitigation and # with error mitigation in numpy array format Energy_exact, Energy_exp_orig, Energy_exp_new = np.array(E_sim), np.array(E), np.array(E_new) # Calculate the relative errors of the energy values without error mitigation # and assign to the numpy array variable `Err_rel_orig` of size 4 Err_rel_orig = # Calculate the relative errors of the energy values with error mitigation # and assign to the numpy array variable `Err_rel_new` of size 4 Err_rel_new = np.set_printoptions(precision=3) print('The relative errors of the energy values for four bell basis\ without measurement error mitigation : {}'.format(Err_rel_orig)) np.set_printoptions(precision=3) print('The relative errors of the energy values for four bell basis\ with measurement error mitigation : {}'.format(Err_rel_new))
https://github.com/hkhetawat/QArithmetic
hkhetawat
# Import the Qiskit SDK from qiskit import QuantumCircuit, ClassicalRegister, QuantumRegister from qiskit import execute, Aer from QArithmetic import sub_swap # Input N N = 4 a = QuantumRegister(N+1) b = QuantumRegister(N+1) ca = ClassicalRegister(N+1) cb = ClassicalRegister(N+1) qc = QuantumCircuit(a, b, ca, cb) # Input Superposition # a = 01110 qc.x(a[1]) qc.x(a[2]) qc.x(a[3]) # b = 01011 qc.x(b[0]) qc.x(b[1]) qc.x(b[3]) sub_swap(qc, a, b, N+1) qc.measure(a, ca) qc.measure(b, cb) backend_sim = Aer.get_backend('qasm_simulator') job_sim = execute(qc, backend_sim) result_sim = job_sim.result() print(result_sim.get_counts(qc))
https://github.com/qiskit-community/qiskit-translations-staging
qiskit-community
from qiskit_nature.second_q.drivers import PySCFDriver driver = PySCFDriver() problem = driver.run() fermionic_op = problem.hamiltonian.second_q_op() from qiskit_nature.second_q.mappers import JordanWignerMapper mapper = JordanWignerMapper() qubit_jw_op = mapper.map(fermionic_op) print(qubit_jw_op) from qiskit_nature.second_q.mappers import ParityMapper mapper = ParityMapper() qubit_p_op = mapper.map(fermionic_op) print(qubit_p_op) mapper = ParityMapper(num_particles=problem.num_particles) qubit_op = mapper.map(fermionic_op) print(qubit_op) tapered_mapper = problem.get_tapered_mapper(mapper) print(type(tapered_mapper)) qubit_op = tapered_mapper.map(fermionic_op) print(qubit_op) from qiskit_nature.second_q.circuit.library import HartreeFock hf_state = HartreeFock(2, (1, 1), JordanWignerMapper()) hf_state.draw() from qiskit_nature.second_q.mappers import InterleavedQubitMapper interleaved_mapper = InterleavedQubitMapper(JordanWignerMapper()) hf_state = HartreeFock(2, (1, 1), interleaved_mapper) hf_state.draw() import qiskit.tools.jupyter %qiskit_version_table %qiskit_copyright
https://github.com/Qiskit/qiskit-transpiler-service
Qiskit
import pydoc import re import pytket.passes as tkps def get_arguments_from_doc(tket_pass): arguments = [] _doc = pydoc.getdoc(tket_pass) if 'Overloaded function.' in _doc: #Return the first signature #TODO: We should return all possible signatures. This would requires changes in ToQiskitPass also. matches = re.findall("[1-9]\. (" + tket_pass.__name__ + '[^\n]+)', _doc) synopsis_line = matches[0] else: synopsis_line = pydoc.splitdoc(_doc)[0] # To avoid issue caused by callable parentheses: synopsis_line = re.sub('Callable\[\[[^\[]+\][^\[]+\]', 'Callable', synopsis_line) match = re.search("\(([^(]+)\)", synopsis_line) if match is not None: splitted_args = match.group(1).split(', ') for arg_str in splitted_args: if arg_str == '**kwargs': continue else: argument = arg_str.split(': ') eq_index = argument[1].find('=') if eq_index > 0: (_type, _default) = argument[1].split(' = ') arguments.append((argument[0], _type, _default)) else: arguments.append(tuple(argument)) return arguments # This is **temp**. Conversion should be done in a better way # https://github.com/CQCL/pytket-qiskit/blob/develop/pytket/extensions/qiskit/qiskit_convert.py from pytket.extensions.qiskit import qiskit_to_tk, tk_to_qiskit from qiskit.converters import dag_to_circuit, circuit_to_dag from pytket.circuit import Circuit from qiskit.dagcircuit import DAGCircuit def qiskit_dag_to_tk(dag: DAGCircuit): # Replace any gate that is not known to pyket by its definition from pytket.extensions.qiskit.qiskit_convert import _known_qiskit_gate for node in dag.op_nodes(): if not type(node.op) in _known_qiskit_gate: dag.substitute_node_with_dag(node, circuit_to_dag(node.op.definition)) return qiskit_to_tk(dag_to_circuit(dag)) def tk_to_qiskit_dag(tkcirc: Circuit): return circuit_to_dag(tk_to_qiskit(tkcirc))
https://github.com/AsishMandoi/VRP-explorations
AsishMandoi
import pandas as pd with open('Results/sol9_2.log', 'r') as file: data = file.read() rows_list = [] for dline in data.split('\n\n'): if dline.startswith('n = '): lines=dline.split('\n') for line in lines: if line.startswith('n = '): words=line.split(', ') for word in words: if word.startswith('n = '): n=int(word.strip('n = ')) if word.startswith('m = '): k=int(word.strip('m = ')) if word.startswith('instance = '): instance=word.strip('instance = ') if line.startswith('Classical cost from best known solution: '): classical_cost=f"{float(line.strip('Classical cost from best known solution: ')):.5f}" if line.startswith('RAS: '): words=line.split(' \t ') for word in words: if word.startswith('quantum cost = '): ras_quantum_cost=f"{float(word.strip('quantum cost = ')):.5f}" if word.strip('quantum cost = ') != 'None' else None if word.startswith('approximation ratio = '): ras_approximation_ratio=f"{float(word.strip('approximation ratio = ')):.5f}" if word.strip('approximation ratio = ') != 'None' else None if word.startswith('number of variables = '): ras_no_of_variables=int(word.strip('number of variables = ')) if word.startswith('runtime = '): ras_runtime=f"{float(word.strip('runtime = ')):.5f}" if line.startswith('FQS: '): words=line.split(' \t ') for word in words: if word.startswith('quantum cost = '): fqs_quantum_cost=f"{float(word.strip('quantum cost = ')):.5f}" if word.strip('quantum cost = ') != 'None' else None if word.startswith('approximation ratio = '): fqs_approximation_ratio=f"{float(word.strip('approximation ratio = ')):.5f}" if word.strip('approximation ratio = ') != 'None' else None if word.startswith('number of variables = '): fqs_no_of_variables=int(word.strip('number of variables = ')) if word.startswith('runtime = '): fqs_runtime=f"{float(word.strip('runtime = ')):.5f}" if line.startswith('GPS: '): words=line.split(' \t ') for word in words: if word.startswith('quantum cost = '): gps_quantum_cost=f"{float(word.strip('quantum cost = ')):.5f}" if word.strip('quantum cost = ') != 'None' else None if word.startswith('approximation ratio = '): gps_approximation_ratio=f"{float(word.strip('approximation ratio = ')):.5f}" if word.strip('approximation ratio = ') != 'None' else None if word.startswith('number of variables = '): gps_no_of_variables=int(word.strip('number of variables = ')) if word.startswith('runtime = '): gps_runtime=f"{float(word.strip('runtime = ')):.5f}" rows_list.append({'n': n, 'k': k, 'instance': instance, 'Classical Cost': classical_cost, 'RAS: Quantum Cost': ras_quantum_cost, 'RAS: Approximation Ratio': ras_approximation_ratio, 'RAS: No. of Variables': ras_no_of_variables, 'RAS: Runtime': ras_runtime, 'FQS: Quantum Cost': fqs_quantum_cost, 'FQS: Approximation Ratio': fqs_approximation_ratio, 'FQS: No. of Variables': fqs_no_of_variables, 'FQS: Runtime': fqs_runtime, 'GPS: Quantum Cost': gps_quantum_cost, 'GPS: Approximation Ratio': gps_approximation_ratio, 'GPS: No. of Variables': gps_no_of_variables, 'GPS: Runtime': gps_runtime}) df = pd.DataFrame(rows_list) df.sort_values(by=['n', 'k', 'instance'], inplace=True) df.head() df.to_csv('Results/sol9_2.csv', index=False)
https://github.com/GabrielPontolillo/Quantum_Algorithm_Implementations
GabrielPontolillo
from qiskit import QuantumCircuit def create_bell_pair(): qc = QuantumCircuit(2) qc.h(1) qc.cx(1, 0) return qc def encode_message(qc, qubit, msg): if len(msg) != 2 or not set([0,1]).issubset({0,1}): raise ValueError(f"message '{msg}' is invalid") if msg[1] == "1": qc.x(qubit) if msg[0] == "1": ### replaced z gate ### qc.x(qubit) return qc def decode_message(qc): qc.cx(1, 0) qc.h(1) return qc
https://github.com/qiskit-community/qiskit-pocket-guide
qiskit-community
from qiskit import QuantumCircuit,Aer,transpile from qiskit.visualization import plot_histogram qc = QuantumCircuit(2) qc.h(0) qc.cx(0, 1) qc.measure_all() backend = Aer.get_backend("aer_simulator") tqc = transpile(qc, backend) job = backend.run(tqc, shots=1000) result = job.result() counts = result.get_counts(tqc) plot_histogram(counts)
https://github.com/2lambda123/Qiskit-qiskit
2lambda123
# This code is part of Qiskit. # # (C) Copyright IBM 2019. # # This code is licensed under the Apache License, Version 2.0. You may # obtain a copy of this license in the LICENSE.txt file in the root directory # of this source tree or at http://www.apache.org/licenses/LICENSE-2.0. # # Any modifications or derivative works of this code must retain this # copyright notice, and modified files need to carry a notice indicating # that they have been altered from the originals. """Isometry tests.""" import unittest import numpy as np from ddt import ddt, data from qiskit.quantum_info.random import random_unitary from qiskit import BasicAer from qiskit import QuantumCircuit from qiskit import QuantumRegister from qiskit import execute from qiskit.test import QiskitTestCase from qiskit.compiler import transpile from qiskit.quantum_info import Operator from qiskit.extensions.quantum_initializer.isometry import Isometry @ddt class TestIsometry(QiskitTestCase): """Qiskit isometry tests.""" @data( np.eye(2, 2), random_unitary(2, seed=868540).data, np.eye(4, 4), random_unitary(4, seed=16785).data[:, 0], np.eye(4, 4)[:, 0:2], random_unitary(4, seed=660477).data, np.eye(4, 4)[:, np.random.RandomState(seed=719010).permutation(4)][:, 0:2], np.eye(8, 8)[:, np.random.RandomState(seed=544326).permutation(8)], random_unitary(8, seed=247924).data[:, 0:4], random_unitary(8, seed=765720).data, random_unitary(16, seed=278663).data, random_unitary(16, seed=406498).data[:, 0:8], ) def test_isometry(self, iso): """Tests for the decomposition of isometries from m to n qubits""" if len(iso.shape) == 1: iso = iso.reshape((len(iso), 1)) num_q_output = int(np.log2(iso.shape[0])) num_q_input = int(np.log2(iso.shape[1])) q = QuantumRegister(num_q_output) qc = QuantumCircuit(q) qc.isometry(iso, q[:num_q_input], q[num_q_input:]) # Verify the circuit can be decomposed self.assertIsInstance(qc.decompose(), QuantumCircuit) # Decompose the gate qc = transpile(qc, basis_gates=["u1", "u3", "u2", "cx", "id"]) # Simulate the decomposed gate simulator = BasicAer.get_backend("unitary_simulator") result = execute(qc, simulator).result() unitary = result.get_unitary(qc) iso_from_circuit = unitary[::, 0 : 2**num_q_input] iso_desired = iso self.assertTrue(np.allclose(iso_from_circuit, iso_desired)) @data( np.eye(2, 2), random_unitary(2, seed=99506).data, np.eye(4, 4), random_unitary(4, seed=673459).data[:, 0], np.eye(4, 4)[:, 0:2], random_unitary(4, seed=124090).data, np.eye(4, 4)[:, np.random.RandomState(seed=889848).permutation(4)][:, 0:2], np.eye(8, 8)[:, np.random.RandomState(seed=94795).permutation(8)], random_unitary(8, seed=986292).data[:, 0:4], random_unitary(8, seed=632121).data, random_unitary(16, seed=623107).data, random_unitary(16, seed=889326).data[:, 0:8], ) def test_isometry_tolerance(self, iso): """Tests for the decomposition of isometries from m to n qubits with a custom tolerance""" if len(iso.shape) == 1: iso = iso.reshape((len(iso), 1)) num_q_output = int(np.log2(iso.shape[0])) num_q_input = int(np.log2(iso.shape[1])) q = QuantumRegister(num_q_output) qc = QuantumCircuit(q) # Compute isometry with custom tolerance qc.isometry(iso, q[:num_q_input], q[num_q_input:], epsilon=1e-3) # Verify the circuit can be decomposed self.assertIsInstance(qc.decompose(), QuantumCircuit) # Decompose the gate qc = transpile(qc, basis_gates=["u1", "u3", "u2", "cx", "id"]) # Simulate the decomposed gate simulator = BasicAer.get_backend("unitary_simulator") result = execute(qc, simulator).result() unitary = result.get_unitary(qc) iso_from_circuit = unitary[::, 0 : 2**num_q_input] self.assertTrue(np.allclose(iso_from_circuit, iso)) @data( np.eye(2, 2), random_unitary(2, seed=272225).data, np.eye(4, 4), random_unitary(4, seed=592640).data[:, 0], np.eye(4, 4)[:, 0:2], random_unitary(4, seed=714210).data, np.eye(4, 4)[:, np.random.RandomState(seed=719934).permutation(4)][:, 0:2], np.eye(8, 8)[:, np.random.RandomState(seed=284469).permutation(8)], random_unitary(8, seed=656745).data[:, 0:4], random_unitary(8, seed=583813).data, random_unitary(16, seed=101363).data, random_unitary(16, seed=583429).data[:, 0:8], ) def test_isometry_inverse(self, iso): """Tests for the inverse of isometries from m to n qubits""" if len(iso.shape) == 1: iso = iso.reshape((len(iso), 1)) num_q_output = int(np.log2(iso.shape[0])) q = QuantumRegister(num_q_output) qc = QuantumCircuit(q) qc.append(Isometry(iso, 0, 0), q) qc.append(Isometry(iso, 0, 0).inverse(), q) result = Operator(qc) np.testing.assert_array_almost_equal(result.data, np.identity(result.dim[0])) if __name__ == "__main__": unittest.main()
https://github.com/qiskit-community/qiskit-translations-staging
qiskit-community
from qiskit import QuantumCircuit, QuantumRegister from qiskit.circuit.library.standard_gates import HGate qr = QuantumRegister(3) qc = QuantumCircuit(qr) c3h_gate = HGate().control(2) qc.append(c3h_gate, qr) qc.draw('mpl')
https://github.com/biswaroopmukherjee/Quantum-Waddle
biswaroopmukherjee
import numpy as np import time import networkx as nx import matplotlib.pyplot as plt import random from qiskit import (QuantumCircuit, QuantumRegister, ClassicalRegister, execute, Aer) %matplotlib qt import os print(os.environ.get('QT_API')) n=3 steps = 8 def counts_to_prob_2d(counts): states = list(counts.keys()) state_counts = list(counts.values()) nshots = sum(state_counts) n = int(len(states[0])/2) def sep_xy(states): # Separate x and y coordinates in state vector states_x = [s[:n] for s in states] states_y = [s[n:] for s in states] states_x = np.array([int(s[::-1],2) for s in states_x]) states_y = np.array([int(s[::-1],2) for s in states_y]) return states_x, states_y x,y = sep_xy(states) # Create array of probability values probabilities = np.zeros((2**n,2**n)) probabilities[x,y] = state_counts probabilities /= nshots return probabilities def increment_gate(circuit, qpos, qcoin): n = len(qpos) for i in range(n): circuit.mct(qcoin[:]+qpos[i+1:], qpos[i], None, mode='noancilla') def decrement_gate(circuit, qpos, qcoin): n = len(qpos) for i in range(n): if i+1 < n: circuit.x(qpos[i+1:]) circuit.mct(qcoin[:]+qpos[i+1:], qpos[i], None, mode='noancilla') if i+1 < n: circuit.x(qpos[i+1:]) def step(circuit, qpos, qcoin): circuit.h(qcoin) circuit.barrier() # y operations increment_gate(circuit, qpos[len(qpos)//2:], qcoin) circuit.x(qcoin[0]) decrement_gate(circuit, qpos[len(qpos)//2:], qcoin) # x operations circuit.x(qcoin) increment_gate(circuit, qpos[:len(qpos)//2], qcoin) circuit.x(qcoin[0]) decrement_gate(circuit, qpos[:len(qpos)//2:], qcoin) circuit.barrier() def initialize_2D(circuit, n, pos): # convert position to binary x = "{:b}".format(pos[0]) y = "{:b}".format(pos[1]) for i in range(len(x)): if x[i]=='1': circuit.x((n-i)-1) for j in range(len(y)): if y[j]=='1': circuit.x((2*n-j)-1) return circuit def run(steps): simulator = Aer.get_backend('qasm_simulator') qpos = QuantumRegister(2*n,'qc') qcoin = QuantumRegister(2,'qanc') cpos = ClassicalRegister(2*n,'cr') circuit = QuantumCircuit(qpos, qcoin, cpos) circuit = initialize_2D(circuit, n, (3,3)) for i in range(steps): step(circuit, qpos, qcoin) # # Map the quantum measurement to the classical bits circuit.measure(qpos,cpos) # # Execute the circuit on the qasm simulator job = execute(circuit, simulator, shots=1000) # # Grab results from the job result = job.result() # # Returns counts counts = result.get_counts(circuit) return counts seed = 12 random.seed(seed) np.random.seed(seed) def plotSquareGraph(propMat): colorarray = [] # generate array of colors numProp = len(propMat) for idx in range(numProp): for jdx in range(numProp): colorarray.append([1-propMat[idx][jdx],1-propMat[idx][jdx],1]) G = nx.grid_2d_graph(numProp, numProp) # 5x5 grid # print the adjacency list for line in nx.generate_adjlist(G): pass # write edgelist to grid.edgelist nx.write_edgelist(G, path="grid.edgelist", delimiter=":") nx.draw(G,node_color = colorarray,cmap=plt.cm.Blues) plt.plot() for i in range(steps+1): counts = run(i) prop = counts_to_prob_2d(counts) plt.close() plt.imshow(prop) # plotSquareGraph(prop) plt.pause(1/steps)
https://github.com/noamsgl/IBMAscolaChallenge
noamsgl
import matplotlib.pyplot as plt import pandas as pd import seaborn as sns from ipywidgets import interact, interactive, fixed, interact_manual, FloatSlider import ipywidgets as widgets sns.set(style='whitegrid', palette='deep', font_scale=1.1, rc={'figure.figsize': [8, 5]}) filepath = "../datasets/universal_error/AllErrors/U3_5.csv" df = pd.read_csv(filepath) # reorder columns df = df[['theta', 'phi', 'lam', 'E', 'depol_prob', 't1', 't2', 'population', 'p0_0', 'p0_1', 'p1_0', 'p1_1']] df.info() df.head() sns.distplot(df['E'], norm_hist=False, kde=False, bins=20, hist_kws={'alpha': 1}).set(xlabel="'Expected Value", ylabel='Count') df.hist(bins=50, figsize=(20,15), layout=(3,4)); sns.scatterplot(x=df['theta'], y=df['E']); sns.scatterplot(x=df['phi'], y=df['E']); sns.scatterplot(x=df['lam'], y=df['E']); sns.scatterplot(x=df['theta'], y=df['phi']); sns.pairplot(data=df.sample(1000)); sns.pairplot(data=df.sample(10000));
https://github.com/rmlarose/qcbq
rmlarose
"""Imports for the notebook.""" _req = """This notebook is written for qiskit-aqua==0.6.0 Your code may not execute properly. """ import matplotlib.pyplot as plt import networkx as nx import numpy as np import warnings import qiskit if "0.6" not in qiskit.__qiskit_version__.get("qiskit-aqua"): warnings.warn(_req) """Optional: Turn off warnings for the notebook.""" warnings.filterwarnings("ignore") """Specific imports for QAOA with MaxCut.""" # Import the QAOA object from qiskit.aqua.algorithms.adaptive import QAOA # Import tools for the MaxCut problem from qiskit.aqua.translators.ising.max_cut import ( get_max_cut_qubitops, max_cut_value, random_graph ) from qiskit.aqua.operators.weighted_pauli_operator import ( Pauli, WeightedPauliOperator ) # Import optimizers in Qiskit for finding the best parameters in the QAOA circuit from qiskit.aqua.components.optimizers import ADAM, AQGD, COBYLA, POWELL """Helper function for drawing weighted graphs. You don't need to know how this function works. You will see how to use it below. """ def draw_weighted(graph: nx.Graph, pos_color: str = "blue", neg_color: str = "red", scale: float = 2.0, **kwargs) -> None: """Shows a visual of a graph with edges scaled by weight and colored by sign. Args: graph: The weighted graph to visualize. pos_color: Color for edges with a positive weight. neg_color: Color for edges with a negative weight. scale: Floating point value to scale edge weights by in the visualization. Keyword Args: cut (List[Int]): A list of 0, 1 values specifying which nodes are in which class. The number of values must be equal to the number of nodes in the graph. """ pos = nx.spring_layout(graph) if "cut" in kwargs.keys(): keys = kwargs["cut"] if len(keys) != len(graph.nodes): raise ValueError( f"ecolor_key has length {len(keys)} but graph has {len(graph.nodes)} nodes." ) nx.draw_networkx_nodes(graph, pos, node_size=700, node_color=keys, cmap=plt.cm.Greens) else: nx.draw_networkx_nodes(graph, pos, node_size=700) col = lambda sgn: pos_color if sgn > 0 else neg_color for edge in graph.edges: weight = graph.get_edge_data(*edge)["weight"] sgn = np.sign(weight) size = abs(weight) nx.draw_networkx_edges(graph, pos, edgelist=[edge], width=scale * size, edge_color=col(sgn), alpha=0.5) nx.draw_networkx_labels(graph, pos, font_size=20) plt.axis("off") plt.show() """Define the graph for MaxCut via an adjacency matrix.""" nodes = 6 # Vary the number of nodes here matrix = random_graph(n=nodes, edge_prob=0.5, seed=2) print("The adjacency matrix is:") print(matrix) """Convert the adjacency matrix to a (weighted) graph and visualize it.""" graph = nx.from_numpy_array(matrix, parallel_edges=False) draw_weighted(graph) """TODO: Put a list of 1s and 0s to assign vertex sets and see what the value of your cut is. """ cut = np.array() ### <-- Your code here! print("The value of this cut is:", max_cut_value(cut, matrix)) """Visualize the cut by coloring nodes in distinct vertex sets different colors.""" draw_weighted(graph, cut=[0, 0, 0, 1, 1, 1]) """Pauli operators from matrix.""" op, shift = get_max_cut_qubitops(matrix) """Inspect the Pauli operators.""" print("Edge set of the graph:") for edge in graph.edges: print("Weight:", graph.get_edge_data(*edge)["weight"], "Edge:", edge) print("\nWeighted Pauli operators.") for pauli in op.paulis: print(2 * np.real(pauli[0]), "*", pauli[1].to_label()[::-1]) """Make the QAOA instance.""" qaoa = QAOA(op, POWELL(), p=1) """See the settings of the QAOA object.""" print(qaoa.print_settings()) """Inspect the circuits.""" backend = qiskit.BasicAer.get_backend("qasm_simulator") circs = qaoa.construct_circuit([1, 2], backend=backend) print(f"There are {len(circs)} circuits.") print(circs[0]) """Set the number of points N to define the grid. Larger N ==> longer runtime.""" N = 10 gammas = np.linspace(-np.pi, np.pi, N) betas = np.linspace(-np.pi, np.pi, N) """Minor hacks for the QAOA instance to make the grid search possible. Run this cell without too much thought -- this is necessary because the way Aqua is set up. """ quantum_instance = qiskit.aqua.QuantumInstance(backend=qiskit.BasicAer.get_backend("qasm_simulator")) qaoa._quantum_instance = quantum_instance qaoa._use_simulator_operator_mode = True """Do the grid search and display the progress.""" import progressbar bar = progressbar.ProgressBar(maxval=N**2) costs = np.zeros((len(gammas), len(betas)), dtype=float) bar.start() for (ii, gamma) in enumerate(gammas): for (jj, beta) in enumerate(betas): costs[ii][jj] = qaoa._energy_evaluation(np.array([gamma, beta])) bar.update(N * ii + jj) bar.finish() """Visualize the landscape.""" plt.figure(figsize=(7, 7)); plt.imshow(costs, origin=(0, 0)); plt.xlabel("Gammas") plt.ylabel("Betas") plt.colorbar(); """Your code here!""" """Write code to answer the above question here.""" print("Min cost =", np.min(costs)) # Your code here! """Get a quantum instance and run the algorithm.""" qaoa._optimizer = POWELL() result = qaoa.run(quantum_instance) """View the optimal cost.""" qaoa.get_optimal_cost() """Get the circuit with optimal parameters.""" circ = qaoa.get_optimal_circuit() qreg = circ.qregs[0] creg = qiskit.ClassicalRegister(6) circ.add_register(creg) circ.measure(qreg, creg) print(circ) """Execute the circuit to sample from it.""" job = qiskit.execute(circ, backend=backend, shots=100000) res = job.result() counts = res.get_counts() """Visualize the statistics.""" qiskit.visualization.plot_histogram(counts, figsize=(17, 6)) """Get the top sampled bit strings.""" import operator ntop = 10 top_cuts = sorted(counts, key=operator.itemgetter(1)) print(f"Top {ntop} sampled cuts.") for cut in top_cuts[:ntop]: print(cut[::-1]) """Select a sampled cut and see its value.""" cut = np.array() ### <-- Your answer here! print("The value of this cut is:", max_cut_value(cut, matrix)) """Brute force search for the maximum cut.""" import itertools high = -np.inf conf = np.zeros(nodes) cuts = itertools.product(*[[0, 1]] * nodes) for cut in cuts: cur = max_cut_value(np.array(cut), matrix) if cur > high: conf = np.array(cut) high = cur print("Value of maximum cut:", high) print("Optimal cut:", conf) """Visualize the graph to see the maximum cut.""" draw_weighted(graph, cut=conf)
https://github.com/qiskit-community/qiskit-translations-staging
qiskit-community
# You can make the bars more transparent to better see the ones that are behind # if they overlap. import numpy as np from qiskit.quantum_info import Statevector from qiskit.visualization import plot_state_city from qiskit import QuantumCircuit qc = QuantumCircuit(2) qc.h(0) qc.cx(0, 1) qc = QuantumCircuit(2) qc.h([0, 1]) qc.cz(0,1) qc.ry(np.pi/3, 0) qc.rx(np.pi/5, 1) state = Statevector(qc) plot_state_city(state, alpha=0.6)
https://github.com/qiskit-community/qiskit-translations-staging
qiskit-community
from qiskit.circuit.library import MCXGate gate = MCXGate(4) from qiskit import QuantumCircuit circuit = QuantumCircuit(5) circuit.append(gate, [0, 1, 4, 2, 3]) circuit.draw('mpl')
https://github.com/qclib/qclib
qclib
# This code is part of Qiskit. # # (C) Copyright IBM 2023 # # This code is licensed under the Apache License, Version 2.0. You may # obtain a copy of this license in the LICENSE.txt file in the root directory # of this source tree or at http://www.apache.org/licenses/LICENSE-2.0. # # Any modifications or derivative works of this code must retain this # copyright notice, and modified files need to carry a notice indicating # that they have been altered from the originals. # pylint: disable=missing-docstring,invalid-name,no-member # pylint: disable=attribute-defined-outside-init # pylint: disable=unused-argument from qiskit import QuantumRegister, QuantumCircuit from qiskit.compiler import transpile from qiskit.quantum_info.random import random_unitary class IsometryTranspileBench: params = ([0, 1, 2, 3], [3, 4, 5, 6]) param_names = ["number of input qubits", "number of output qubits"] def setup(self, m, n): q = QuantumRegister(n) qc = QuantumCircuit(q) if not hasattr(qc, "iso"): raise NotImplementedError iso = random_unitary(2**n, seed=0).data[:, 0 : 2**m] if len(iso.shape) == 1: iso = iso.reshape((len(iso), 1)) qc.iso(iso, q[:m], q[m:]) self.circuit = qc def track_cnot_counts_after_mapping_to_ibmq_16_melbourne(self, *unused): coupling = [ [1, 0], [1, 2], [2, 3], [4, 3], [4, 10], [5, 4], [5, 6], [5, 9], [6, 8], [7, 8], [9, 8], [9, 10], [11, 3], [11, 10], [11, 12], [12, 2], [13, 1], [13, 12], ] circuit = transpile( self.circuit, basis_gates=["u1", "u3", "u2", "cx"], coupling_map=coupling, seed_transpiler=0, ) counts = circuit.count_ops() cnot_count = counts.get("cx", 0) return cnot_count
https://github.com/anishrverma/Hybrid-Quantum-Endowment-Portfolio-Optimization
anishrverma
# %pip install --upgrade pip # %pip install -r requirements.txt import seaborn as sn import matplotlib.pyplot as plt from qiskit.visualization import plot_histogram from datetime import datetime import numpy as np from itertools import permutations from qiskit_finance.data_providers import YahooDataProvider import json # Necessary for YahooDataProvider import http.client # Necessary for YahooDataProvider import pandas as pd import pandas_datareader as web import os from docplex.mp.model import Model from qiskit_optimization.translators import from_docplex_mp from qiskit_optimization.algorithms import MinimumEigenOptimizer from qiskit.algorithms import NumPyMinimumEigensolver from qiskit_optimization.converters import LinearEqualityToPenalty from qiskit.circuit.library import TwoLocal # For Ansatz from qiskit.algorithms.optimizers import COBYLA, ADAM, NELDER_MEAD, POWELL, SPSA, QNSPSA from qiskit.opflow import CVaRExpectation from qiskit.opflow import PauliExpectation from qiskit.algorithms import VQE from qiskit.algorithms import QAOA from qiskit import Aer dfMonthlyReturns = pd.read_csv('data/Equity-Benchmarks-Monthly-Return.csv',parse_dates=["Date"],index_col=0) dfMonthlyReturnsRiskScaled = pd.read_csv('data/Equity-Benchmarks-Monthly-Risk-Scaled.csv',parse_dates=["Date"],index_col=0) assets = dfMonthlyReturns.columns.to_list() numAssets = len(assets) print("We have " + str(numAssets) + " Assets:\n") [print(asset + " ") for asset in assets]; q = 0.5 # risk apetite B = 5 # budget #Whole Period startDate=datetime(2001, 1, 31) endDate=datetime(2021, 12, 31) # #Pre 2008 # startDate=datetime(2001, 1, 31) # endDate=datetime(2008, 6, 30) # #QE Era # startDate=datetime(2010, 1, 31) # endDate=datetime(2019, 12, 31) # #Pandemic # startDate=datetime(2020, 6, 30) # endDate=datetime(2021, 12, 31) startStr = str(startDate.date()) endStr = str(endDate.date()) backend = Aer.get_backend('statevector_simulator') # statevector_simulator, qasm_simulator, aer_simulator_statevector maxIter = 10000 # fidelity = QNSPSA.get_fidelity(ansatz) # only for QNSPSA optimizer = SPSA(maxiter=500) # Classical optimizer – COBYLA(maxiter=maxIter), ADAM(maxiter=maxIter), NELDER_MEAD(maxiter=maxIter), # POWELL(maxiter=maxIter), SPSA(maxiter=100), QNSPSA(fidelity,maxiter=100) penalty = numAssets # scaling of penalty term. This can be changed at your discretion. mu = dfMonthlyReturns[startDate:endDate].mean().to_numpy() sigma = dfMonthlyReturns[startDate:endDate].cov().to_numpy() muRisk = dfMonthlyReturnsRiskScaled[startDate:endDate].mean().to_numpy() sigmaRisk = dfMonthlyReturnsRiskScaled[startDate:endDate].cov().to_numpy() covHeatmap = sn.heatmap(sigma,cmap="mako") covHeatmap.set(xticklabels=assets,yticklabels=assets) plt.yticks(rotation='horizontal') plt.xticks(rotation='vertical') plt.title("Covariance of Monthly Returns\n"+startStr+" to " +endStr) plt.show() covHeatmapRisk = sn.heatmap(sigmaRisk,cmap="mako") covHeatmapRisk.set(xticklabels=assets,yticklabels=assets) plt.yticks(rotation='horizontal') plt.xticks(rotation='vertical') plt.title("Covariance of Monthly Returns (Risk Scaled)\n"+startStr+" to " +endStr) plt.show() covHeatmap = sn.heatmap(sigma,cmap="mako",vmin=0,vmax=0.004) covHeatmap.set(xticklabels=assets,yticklabels=assets) plt.yticks(rotation='horizontal') plt.xticks(rotation='vertical') plt.title("Covariance of Monthly Returns\n"+startStr+" to " +endStr) plt.show() fig = covHeatmap.get_figure() fig.savefig("figures/CovarianceMonthlyReturns-" + startStr + "-to-" + endStr + ".pdf",bbox_inches='tight') covHeatmapRisk = sn.heatmap(sigmaRisk,cmap="mako",vmin=0,vmax=0.00011) covHeatmapRisk.set(xticklabels=assets,yticklabels=assets) plt.yticks(rotation='horizontal') plt.xticks(rotation='vertical') plt.title("Covariance of Monthly Returns (Risk Scaled)\n"+startStr+" to " +endStr) plt.show() figRisk = covHeatmapRisk.get_figure() figRisk.savefig("figures/CovarianceMonthlyReturnsRisk-" + startStr + "-to-" + endStr + ".pdf",bbox_inches='tight') mdl = Model("Non-Scaled") # You can input a string into the argument if you want to name the model. x = mdl.binary_var_list('x{}'.format(i) for i in range(numAssets)) # binary decision variables # Objective Function to be maximized objective = mdl.sum([mu[i]*x[i] for i in range(numAssets)]) objective -= q * mdl.sum([sigma[i,j]*x[i]*x[j] for i in range(numAssets) for j in range(numAssets)]) mdl.maximize(objective) mdl.add_constraint(mdl.sum(x[i] for i in range(numAssets)) == B) # Adding the budget constraint qp = from_docplex_mp(mdl) # Conversion to a quadratic program qp mdlRisk = Model("Risk-Scaled") # You can input a string into the argument if you want to name the model. y = mdlRisk.binary_var_list('y{}'.format(i) for i in range(numAssets)) # binary decision variables # Objective Function to be maximized objectiveRisk = mdlRisk.sum([muRisk[i]*y[i] for i in range(numAssets)]) objectiveRisk -= q * mdlRisk.sum([sigmaRisk[i,j]*y[i]*y[j] for i in range(numAssets) for j in range(numAssets)]) mdlRisk.maximize(objectiveRisk) mdlRisk.add_constraint(mdlRisk.sum(y[i] for i in range(numAssets)) == B) # Adding the budget constraint qpRisk = from_docplex_mp(mdlRisk) # Conversion to a quadratic program qpRisk classicalResult = MinimumEigenOptimizer(NumPyMinimumEigensolver()).solve(qp) # classicalResultEigenstate = (classicalResult.min_eigen_solver_result.eigenstate._primitive.data.real).tolist() classicalResultEigenstate = classicalResult.min_eigen_solver_result.eigenstate.to_dict_fn().primitive classicalResult # making the labels for plotting # labels = [] # for i in range(2**numAssets): # labels.append(format(i,'0'+str(numAssets)+'b')) # fig = plot_histogram(dict(zip(labels, classicalResultEigenstate)),figsize=(60,10)) fig = plot_histogram(classicalResultEigenstate,figsize=(60,10)) fig.savefig("figures/ClassicalEigensolver-"+startStr+"-"+endStr+".pdf") # fig classicalResultRisk = MinimumEigenOptimizer(NumPyMinimumEigensolver()).solve(qpRisk) #classicalResultRiskEigenstate = (classicalResultRisk.min_eigen_solver_result.eigenstate._primitive.data.real).tolist() classicalResultRiskEigenstate = classicalResultRisk.min_eigen_solver_result.eigenstate.to_dict_fn().primitive classicalResultRisk # making the labels for plotting # labels = [] # for i in range(2**numAssets): # labels.append(format(i,'0'+str(numAssets)+'b')) # fig = plot_histogram(dict(zip(labels, classicalResultRiskEigenstate)),figsize=(60,10)) fig = plot_histogram(classicalResultRiskEigenstate,figsize=(60,10)) fig.savefig("figures/ClassicalEigensolverRisk-"+startStr+"-"+endStr+".pdf") # fig linearToPenalty = LinearEqualityToPenalty(penalty=penalty) qubo = linearToPenalty.convert(qp) quboRisk = linearToPenalty.convert(qpRisk) qubo quboRisk reps = 2 ansatz = TwoLocal(num_qubits=numAssets, rotation_blocks='rx', entanglement_blocks= 'cz', reps=reps, entanglement='full') ansatz.decompose().draw() maxIter = 10000 # fidelity = QNSPSA.get_fidelity(ansatz) # only for QNSPSA optimizer = SPSA(maxiter=500) # Classical optimizer – COBYLA(maxiter=maxIter), ADAM(maxiter=maxIter), NELDER_MEAD(maxiter=maxIter), # POWELL(maxiter=maxIter), SPSA(maxiter=100), QNSPSA(fidelity,maxiter=100) def pauliDict(H): tempKey = [] tempVal = [] tempDict = {} for i in range(len(H)): tempDict[H.primitive.to_list()[i][0]] = H.primitive.to_list()[i][1] return tempDict H, offset = qubo.to_ising() pauliDict(H) HRisk, offsetRisk = quboRisk.to_ising() pauliDict(HRisk) def getCountDictStateVecSim(vqeResult): tempState = [] tempProb = [] for sample in vqeResult.samples: tempProb.append(sample.probability) tempStr = '' for stateElement in reversed(sample.x): tempStr += str(int(stateElement)) tempState.append(tempStr) return dict(zip(tempState, tempProb)) vqeInit = VQE(ansatz=ansatz,optimizer=optimizer, quantum_instance=backend) vqe = MinimumEigenOptimizer(vqeInit) vqeResult = vqe.solve(qubo) if backend.name() == 'qasm_simulator': counts = vqeResult.min_eigen_solver_result.eigenstate elif backend.name() == 'statevector_simulator': counts = getCountDictStateVecSim(vqeResult) #endif vqeResult vqeFig = plot_histogram(counts,figsize=(60,10)) vqeFig.savefig("figures/VQE"+startStr+"-"+endStr+".pdf") vqeFig ## ALTERNATIVE PLOT SCHEME # samples_for_plot = { # " ".join(f"{vqeResult.variables[i].name}={int(v)}" for i, v in enumerate(sample.x)): sample.probability # for sample in vqeResult.samples # } # plot_histogram(samples_for_plot,figsize=(60,5)) vqeRiskInit = VQE(ansatz=ansatz,optimizer=optimizer, quantum_instance=backend) vqeRisk = MinimumEigenOptimizer(vqeRiskInit) vqeRiskResult = vqeRisk.solve(quboRisk) if backend.name() == 'qasm_simulator': countsRisk = vqeRiskResult.min_eigen_solver_result.eigenstate elif backend.name() == 'statevector_simulator': countsRisk = getCountDictStateVecSim(vqeRiskResult) #endif vqeRiskResult vqeRiskFig = plot_histogram(countsRisk,figsize=(60,10)) vqeRiskFig.savefig("figures/VQERisk"+startStr+"-"+endStr+".pdf") vqeRiskFig qaoaInit = QAOA(optimizer=optimizer, reps=reps, quantum_instance=backend) qaoa = MinimumEigenOptimizer(qaoaInit) qaoaResult = qaoa.solve(qubo) if backend.name() == 'qasm_simulator': counts = qaoaResult.min_eigen_solver_result.eigenstate elif backend.name() == 'statevector_simulator': counts = getCountDictStateVecSim(qaoaResult) #endif qaoaResult qaoaFig = plot_histogram(counts,figsize=(60,10)) qaoaFig.savefig("figures/QAOA-"+startStr+"-"+endStr+".pdf") qaoaFig qaoaRiskInit = QAOA(optimizer=optimizer, reps=reps, quantum_instance=backend) qaoaRisk = MinimumEigenOptimizer(qaoaRiskInit) qaoaRiskResult = qaoaRisk.solve(quboRisk) if backend.name() == 'qasm_simulator': countsRisk = qaoaRiskResult.min_eigen_solver_result.eigenstate elif backend.name() == 'statevector_simulator': countsRisk = getCountDictStateVecSim(qaoaRiskResult) #endif qaoaRiskResult qaoaRiskFig = plot_histogram(countsRisk,figsize=(60,10)) qaoaRiskFig.savefig("figures/QAOARisk-"+startStr+"-"+endStr+".pdf") qaoaRiskFig classicalResult vqeResult qaoaResult classicalResultRisk vqeRiskResult qaoaRiskResult def getCombinations(inputVal): combinations = [] if type(inputVal) == str: for perm in set(permutations(inputVal)): combinations.append(''.join(perm)) #endFor elif type(inputVal) == list: for i in range(len(inputVal)): inputVal[i] = int(inputVal[i]) #endFor for perm in set(permutations(inputVal)): combinations.append(list(perm)) #endFor else: print("Input a string or list of ones and zeroes") return combinations def countNonZeroElemInList(inputList): numNonZeroElem = 0. for x in inputList: if x != 0: numNonZeroElem += 1 else: numNonZeroElem += 0 #endIf #endFor return numNonZeroElem def assetTotalPortfolioGrowth(initialPortfolioValue,selectedAssets,testDF): amountSplit = initialPortfolioValue/countNonZeroElemInList(selectedAssets) assetGrowth = [] for i in range(len(selectedAssets)): if selectedAssets[i] == 1: tempDF = testDF.iloc[:,i] amountTemp = amountSplit for pctChg in tempDF: amountTemp += pctChg*amountTemp assetGrowth.append(amountTemp) else: assetGrowth.append(0.) #endIf #endFor return assetGrowth def assetGrowthTimeSeries(initialPortfolioValue,selectedAssets,testDF): amountSplit = initialPortfolioValue/countNonZeroElemInList(selectedAssets) assetGrowthTS = [] for i in range(len(selectedAssets)): if selectedAssets[i] == 1: tempVec = [] tempDF = testDF.iloc[:,i] amountTemp = amountSplit for pctChg in tempDF: amountTemp += pctChg*amountTemp tempVec.append(amountTemp) assetGrowthTS.append(tempVec) else: tempVec = [] tempDF = testDF.iloc[:,i] for pctChg in tempDF: tempVec.append(0.0) assetGrowthTS.append(tempVec) #endIf #endFor return assetGrowthTS def assetGrowthTimeSeriesWeighted(initialPortfolioValue,selectedAssets,testDF,weights): assetGrowthTS = [] for i in range(len(selectedAssets)): if selectedAssets[i] == 1: tempVec = [] tempDF = testDF.iloc[:,i] amountTemp = initialPortfolioValue*weights[i] for pctChg in tempDF: amountTemp += pctChg*amountTemp tempVec.append(amountTemp) assetGrowthTS.append(tempVec) else: tempVec = [] tempDF = testDF.iloc[:,i] for pctChg in tempDF: tempVec.append(0.0) assetGrowthTS.append(tempVec) #endIf #endFor return assetGrowthTS def portfolioGrowthTimeSeries(portfolioTS): portfolioValueTS = [] for i in range(len(portfolioTS[0])): tempVal = 0.0 for j in range(len(portfolioTS)): tempVal += portfolioTS[j][i] portfolioValueTS.append(tempVal) return portfolioValueTS assetTest = qaoaRiskResult.x.tolist() amountInit = 1000 allAssetCombinations = getCombinations(assetTest) dateList = dfMonthlyReturns.index # # Gives total number of chosen assets, AKA budget. More of a sanity check. # numAssetsChosen = countNonZeroElemInList(assetTest) # # Gives each selected asset's total final value in a list # finalAssetValues = assetTotalPortfolioGrowth(amountInit,assetTest,dfMonthlyReturns) # # Gives the time series of each portfolio element as a list of lists. In each list, # # the final element is the final value of the held asset. # chosenAssetsTimeSeries = assetGrowthTimeSeries(amountInit,assetTest,dfMonthlyReturns) # # Gives the time series for the total portfolio value. The final element is the final portfolio value. # portfolioTimeSeries = portfolioGrowthTimeSeries(chosenAssetsTimeSeries) fig = plt.figure() ax = fig.add_subplot(1, 1, 1) for i in range(len(allAssetCombinations)): chosenAssetsTimeSeries = assetGrowthTimeSeries(amountInit,allAssetCombinations[i],dfMonthlyReturns) portfolioTimeSeries = portfolioGrowthTimeSeries(chosenAssetsTimeSeries) label = '' for element in allAssetCombinations[i]: label+=str(element) #endFor ax.plot(dateList,portfolioTimeSeries,color='blue',linestyle='--',alpha=0.1,linewidth=0.5) #endFor winningAssetCombination = assetTest winningAssetTimeSeries = assetGrowthTimeSeries(amountInit,winningAssetCombination,dfMonthlyReturns) winningPortfolioTimeSeries = portfolioGrowthTimeSeries(winningAssetTimeSeries) label = '' for element in winningAssetCombination: label+=str(element) #endFor ax.plot(dateList,winningPortfolioTimeSeries,label=label,color='red',alpha=1,linewidth=2) plt.xlim(startDate,endDate) plt.ylabel('Total Portfolio Value') plt.xlabel('Date') plt.legend()#bbox_to_anchor=(1.02, 1), loc='upper left', borderaxespad=0) plt.show() fig.savefig('figures/portfolio-'+label+'risk-'+str(q)+'-'+startStr+"-"+endStr+'.pdf',bbox_inches='tight') fig = plt.figure() ax = fig.add_subplot(1, 1, 1) for i in range(len(allAssetCombinations)): chosenAssetsTimeSeries = assetGrowthTimeSeries(amountInit,allAssetCombinations[i],dfMonthlyReturns) portfolioTimeSeries = portfolioGrowthTimeSeries(chosenAssetsTimeSeries) label = '' for element in allAssetCombinations[i]: label+=str(element) #endFor ax.plot(dateList,portfolioTimeSeries,color='blue',linestyle='--',alpha=0.1,linewidth=0.5) #endFor winningAssetCombination = assetTest winningAssetTimeSeries = assetGrowthTimeSeries(amountInit,winningAssetCombination,dfMonthlyReturns) winningPortfolioTimeSeries = portfolioGrowthTimeSeries(winningAssetTimeSeries) label = '' for element in winningAssetCombination: label+=str(element) #endFor label += ' equally weighted' ax.plot(dateList,winningPortfolioTimeSeries,label=label,color='red',alpha=1,linewidth=2) portfolioWeights = [0.223214286,0.233800935,0.2042007,0.0,0.0,0.0,0.172583826,0.165250236] weightedWinningAssetTimeSeries = assetGrowthTimeSeriesWeighted(amountInit,assetTest,dfMonthlyReturns,portfolioWeights) weightedWinningPortfolioTimeSeries = portfolioGrowthTimeSeries(weightedWinningAssetTimeSeries) label = '' for element in winningAssetCombination: label+=str(element) #endFor label += ' risk-parity weighted' ax.plot(dateList,weightedWinningPortfolioTimeSeries,label=label,color='purple',alpha=1,linewidth=2) plt.xlim(startDate,endDate) plt.ylabel('Total Portfolio Value') plt.xlabel('Date') plt.legend()#bbox_to_anchor=(1.02, 1), loc='upper left', borderaxespad=0) plt.show() fig.savefig('figures/weighted-comparison-portfolio-'+label+'risk-'+str(q)+'-'+startStr+"-"+endStr+'.pdf',bbox_inches='tight') from qiskit import QuantumCircuit, assemble, Aer from math import pi, sqrt from qiskit.visualization import plot_bloch_multivector, plot_histogram, plot_bloch_vector sim = Aer.get_backend('aer_simulator') qc = QuantumCircuit(1) qc.draw() qc.save_statevector() qobj = assemble(qc) state = sim.run(qobj).result().get_statevector() plot_bloch_multivector(state) qc = QuantumCircuit(1) qc.draw() qc.save_statevector() qobj = assemble(qc) state = sim.run(qobj).result().get_statevector() fig=plot_bloch_multivector(state) fig.savefig('figures/bloch-no-rotate.pdf', bbox_inches='tight') qc = QuantumCircuit(1) qc.rx(theta=pi/2,qubit=0) qc.draw() qc.save_statevector() qobj = assemble(qc) state = sim.run(qobj).result().get_statevector() fig=plot_bloch_multivector(state) fig.savefig('figures/bloch-pi-over-two-x-rotate.pdf', bbox_inches='tight')
https://github.com/usamisaori/qLipschitz
usamisaori
from sklearn import datasets import pennylane as qml import numpy as np from pennylane.optimize import AdamOptimizer import matplotlib.pyplot as plt import warnings warnings.filterwarnings('ignore') X_train, Y_train = datasets.make_circles(n_samples=200, noise=0.09, factor=0.4) X_test, Y_test = datasets.make_circles(n_samples=50, noise=0.09, factor=0.4) print('Training Data:') print(X_train[:10]) print('\nTraining Label:') print(Y_train[:10]) plt.scatter(X_train[:, 0], X_train[:, 1], c=Y_train) plt.show() print(f'Total datas: {len(X_train)}') print(f'labels: {list(set(Y_train))}') print(f'label 0 datas: {len(list(filter(lambda x: x==0, Y_train)))}') print(f'label 1 datas: {len(list(filter(lambda x: x==1, Y_train)))}') Z_train = (X_train[:, 0] ** 2 + X_train[:, 1] ** 2) ** 0.5 temp = np.zeros((X_train.shape[0], len(X_train[0]) + 1)) temp[:, :-1] = X_train temp[:, -1] = Z_train X_train2 = temp Z_test = (X_test[:, 0] ** 2 + X_test[:, 1] ** 2) ** 0.5 temp = np.zeros((X_test.shape[0], len(X_test[0]) + 1)) temp[:, :-1] = X_test temp[:, -1] = Z_test X_test2 = temp print('Solved Training Data:') print(X_train2[:10]) def plot3D(X, Y): fig = plt.figure(figsize=(10, 10)) ax = fig.add_subplot(111, projection='3d') ax.scatter( X[:, 0], X[:, 1], X[:, 2], zdir='z', s=30, c=Y, depthshade=True ) plt.show() plot3D(X_train2, Y_train) print(f'Total datas: {len(X_train2)}') print(f'labels: {list(set(Y_train))}') print(f'label 0 datas: {len(list(filter(lambda x: x==0, Y_train)))}') print(f'label 1 datas: {len(list(filter(lambda x: x==1, Y_train)))}') qubits_num = 3 layers_num = 2 dev = qml.device("default.qubit", wires=qubits_num) class VQC: def __init__(self): # 3 => U3(theta, phi, lambda) self.params = (0.05 * np.random.randn(layers_num, qubits_num, 3)) self.bestparams = self.params self.bestcost = 10 self.opt = AdamOptimizer(0.08) self.weights = [] self.costs = [] self.accuracies = [] def fit(self, X_train, Y_train, epoch=300): batch_size = 20 for turn in range(epoch): # Update the weights by one optimizer step batch_index = np.random.randint(0, len(X_train), (batch_size,)) X_train_batch = X_train[batch_index] Y_train_batch = Y_train[batch_index] self.params = self.opt.step(lambda v: cost(v, X_train_batch, Y_train_batch), self.params) cost_now = cost(self.params, X_train, Y_train) acc_now = accuracy(self.params, X_train, Y_train) if cost_now < self.bestcost: self.bestcost = cost_now self.bestparams = self.params self.weights.append(self.params) self.costs.append(cost_now) self.accuracies.append(acc_now) print( "Turn: {:5d} | Cost: {:0.7f} | Accuracy: {:0.2f}% ".format( turn + 1, cost_now, acc_now * 100 )) def score(self, X_test, Y_test): predictions = [ predict(self.bestparams, data) for data in X_test ] acc = accuracy(self.bestparams, X_test, Y_test) print("FINAL ACCURACY: {:0.2f}%".format(acc * 100)) @qml.qnode(dev) def circuit(params, data): angles = [ i * np.pi for i in data ] for i in range(qubits_num): qml.RX(angles[i], wires=i) qml.Rot( *params[0, i], wires=i ) qml.CZ(wires=[1, 0]) qml.CZ(wires=[1, 2]) qml.CZ(wires=[0, 2]) for i in range(qubits_num): qml.Rot( *params[1, i], wires=i ) # PauliZ measure => 1 -> |0> while -1 -> |1> return qml.expval(qml.PauliZ(0)), qml.expval(qml.PauliZ(1)), qml.expval(qml.PauliZ(2)) import qiskit import numpy as np from qiskit import QuantumCircuit from qiskit import Aer, execute unitary_backend = Aer.get_backend('unitary_simulator') qasm_backend = Aer.get_backend('qasm_simulator') def predict(params, data): qcircuit = QuantumCircuit(3, 3) qubits = qcircuit.qubits for i, d in enumerate(data): qcircuit.rx(d * np.pi, qubits[i]) for i in range(qubits_num): qcircuit.u3(*params[0][i], qubits[i]) qcircuit.cz(qubits[0], qubits[1]) qcircuit.cz(qubits[1], qubits[2]) qcircuit.cz(qubits[0], qubits[2]) for i in range(qubits_num): qcircuit.u3(*params[1][i], qubits[i]) # the measurement qcircuit.measure([0, 1, 2], [0, 1, 2]) # job execution shots = 1000 job_sim = execute(qcircuit, qasm_backend, shots=shots) result_sim = job_sim.result() counts = result_sim.get_counts(qcircuit) p1 = (counts.get('100', 0) + counts.get('111', 0) + counts.get('101', 0) + counts.get('110', 0)) / shots if p1 > 0.5: return 1 else: return 0 def cost(weights, datas, labels): loss = 0 for i, data in enumerate(datas): # like [-1, 1, 1] measured = circuit(weights, data) p = measured[0] if labels[i] == 0: loss += (1 - p) ** 2 else: loss += (-1 - p) ** 2 return loss / len(datas) def accuracy(weights, datas, labels): predictions = [ predict(weights, data) for data in datas ] acc = 0 for i, p in enumerate(predictions): if p == labels[i]: acc += 1 return acc / len(predictions) vqc = VQC() # vqc.params = np.array([[[-1.18991246e-01, -8.69694713e-01, 1.43722811e-03], # [ 3.47641545e+00, -4.73632073e-02, 1.97135609e+00], # [ 1.95775707e+00, -1.12139160e-02, -6.21796144e-03]], # [[ 2.02460380e-02, -2.25797547e+00, 5.14234265e-03], # [-1.71552299e-02, 2.46283604e-03, -1.03805722e-02], # [-2.37244982e-03, -3.35799404e-03, 6.10191152e-03]]]) vqc.fit(X_train2, Y_train, epoch=10) print(cost(vqc.bestparams, X_train2, Y_train)) print(cost(vqc.bestparams, X_test2, Y_test)) vqc.score(X_test2, Y_test) def createCircuit(params, data): qcircuit = QuantumCircuit(3, 3) qubits = qcircuit.qubits for i, d in enumerate(data): qcircuit.rx(d * np.pi, qubits[i]) for i in range(qubits_num): qcircuit.u3(*params[0][i], qubits[i]) qcircuit.cz(qubits[0], qubits[1]) qcircuit.cz(qubits[1], qubits[2]) qcircuit.cz(qubits[0], qubits[2]) for i in range(qubits_num): qcircuit.u3(*params[1][i], qubits[i]) return qcircuit qcircuit = createCircuit(vqc.bestparams, X_train2[0]) qcircuit.draw(output='mpl') def measure(qcircuit, label): # the measurement qcircuit.measure([0, 1, 2], [0, 1, 2]) # job execution shots = 1000 job_sim = execute(qcircuit, qasm_backend, shots=shots) result_sim = job_sim.result() counts = result_sim.get_counts(qcircuit) print(f'simulation results: \n{counts}') p1 = (counts.get('100', 0) + counts.get('111', 0) + counts.get('101', 0) + counts.get('110',0)) / shots print(f'p1: {p1}') print(f'Expected label: {label}') example = [3, 30, 35, 70] for index in example: qcircuit = createCircuit(vqc.bestparams, X_train2[index]) measure(qcircuit, Y_train[index]) print() # origin data plt.scatter(X_train2[:, 0], X_train2[:, 1], c=Y_train) plt.show() predictions = [ predict(vqc.bestparams, data) for data in X_test2 ] Y_ = [ Y_test[i] if Y_test[i] == predictions[i] else 2 for i in range(len(Y_test)) ] plt.scatter(X_test2[:, 0], X_test2[:, 1], c=Y_) plt.show() train_params(X_train2[10:50], Y_train[10:50])
https://github.com/mathelatics/QGSS-2023-From-Theory-to-Implementations
mathelatics
from IPython.display import IFrame IFrame(src="http://www.youtube.com/embed/RrUTwq5jKM4", width=1920/2, height=1080/2) from qiskit import * qr = QuantumRegister(2) cr = ClassicalRegister(2) circuit = QuantumCircuit(qr, cr) circuit = QuantumCircuit(2,2) circuit.draw() %matplotlib inline circuit.draw(output='mpl') # the quantum circuit has two qubits. they are indexed as qubits 0 and 1 circuit.h(0) circuit.cx(0,1) # order is control, target circuit.measure([0,1], [0,1]) # qubits [0,1] are measured and results are stored in classical bits [0,1] in order circuit.draw(output='mpl') simulator = Aer.get_backend('qasm_simulator') result = execute(circuit, backend=simulator).result() from qiskit.visualization import plot_histogram plot_histogram(result.get_counts(circuit)) IBMQ.load_account() provider = IBMQ.get_provider(hub = 'ibm-q') qcomp = provider.get_backend('ibmq_16_melbourne') num_qubits = 2 from qiskit.providers.ibmq import least_busy possible_devices = provider.backends(filters=lambda x: x.configuration().n_qubits >= num_qubits and x.configuration().simulator == False) qcomp = least_busy(possible_devices) print(qcomp) import qiskit.tools.jupyter %qiskit_job_watcher job = execute(circuit, backend=qcomp) from qiskit.tools.monitor import job_monitor job_monitor(job) result = job.result() plot_histogram(result.get_counts(circuit)) %qiskit_disable_job_watcher qiskit.__qiskit_version__ %qiskit_copyright
https://github.com/qiskit-community/qiskit-translations-staging
qiskit-community
from qiskit import QuantumCircuit, transpile, schedule from qiskit.visualization.pulse_v2 import draw, IQXSimple from qiskit.providers.fake_provider import FakeBoeblingen qc = QuantumCircuit(2) qc.h(0) qc.cx(0, 1) qc.measure_all() qc = transpile(qc, FakeBoeblingen(), layout_method='trivial') sched = schedule(qc, FakeBoeblingen()) draw(sched, style=IQXSimple(), backend=FakeBoeblingen())
https://github.com/tomtuamnuq/compare-qiskit-ocean
tomtuamnuq
from dwave.system import DWaveCliqueSampler, LeapHybridSampler from helpers import * qps = createModelsFromDir('BURKARDT_DATA/INT/') for qp in qps.values(): print(qp.model.solve()) solvers = [createSolver(LeapHybridSampler()), createSolver(DWaveCliqueSampler(),1000)] results = {} for qp_name in qps.keys(): print(qp_name) qp_name = "testprob" results[qp_name] = [optimizer.solve(qps[qp_name]) for optimizer in solvers] # problem ids : # Leap db6c6b80-8882-4636-9879-a18c3b57c980 # Advantage system 0b80397c-22a2-41e1-9dce-2c6cffca3ff3 for res in results[qp_name]: print(res) qp_name = "three_vars_quadratic" results[qp_name] = [optimizer.solve(qps[qp_name]) for optimizer in solvers]
https://github.com/qiskit-community/qiskit-translations-staging
qiskit-community
from qiskit import QuantumCircuit from qiskit.quantum_info import Statevector from qiskit.visualization import plot_state_qsphere qc = QuantumCircuit(2) qc.h(0) qc.cx(0, 1) state = Statevector(qc) plot_state_qsphere(state)
https://github.com/ankitkmisra/Quantum-Computing-and-Cryptography
ankitkmisra
%matplotlib inline # Importing standard Qiskit libraries and configuring account from qiskit import QuantumCircuit, execute, Aer, IBMQ from qiskit.compiler import transpile, assemble from qiskit.tools.jupyter import * from qiskit.visualization import * import numpy as np from fractions import Fraction as frac import qiskit.quantum_info as qi # Loading your IBM Q account(s) provider = IBMQ.load_account() qc=QuantumCircuit(4) #In this particular oracle, the last qubit is storing the value of the function qc.cx(0,3) qc.cx(1,3) qc.cx(2,3) #The last qubit is 1 if there are odd no. of 1s in the other 3 qubits #and 0 otherwise #Hence it is a balanced function qc.draw('mpl') qc1=QuantumCircuit(3) qc1.x(2) qc1.h(0) qc1.h(1) qc1.h(2) qc1.barrier(range(3)) qc1.cx(0,2) qc1.cx(1,2) qc1.barrier(range(3)) qc1.h(0) qc1.h(1) meas = QuantumCircuit(3, 2) meas.measure(range(2),range(2)) # The Qiskit circuit object supports composition using # the addition operator. circ = qc1+meas circ.draw('mpl') backend_sim = Aer.get_backend('qasm_simulator') job_sim = execute(circ, backend_sim, shots=1000) result_sim = job_sim.result() counts = result_sim.get_counts(circ) print(counts) plot_histogram(counts) qc2=QuantumCircuit(5) qc2.x(4) qc2.h(0) qc2.h(1) qc2.h(2) qc2.h(3) qc2.h(4) qc2.barrier(range(5)) #Your code for the oracle here #YOU ARE PERMITTED TO USE ONLY SINGLE QUBIT GATES AND CNOT(cx) GATES qc2.cx(0,4) qc2.cx(1,4) qc2.cx(2,4) qc2.cx(3,4) qc2.x(4) qc2.barrier(range(5)) qc2.h(0) qc2.h(1) qc2.h(2) qc2.h(3) meas2 = QuantumCircuit(5, 4) meas2.measure(range(4),range(4)) circ2 = qc2+meas2 circ2.draw('mpl') #verification cell, reinitialising the circuit so that it's easier for you to copy-paste the oracle qc2=QuantumCircuit(5) #Add X gates HERE as required to change the input state qc2.x([0,2]) qc2.barrier(range(5)) qc2.cx(0,4) qc2.cx(1,4) qc2.cx(2,4) qc2.cx(3,4) qc2.x(4) qc2.barrier(range(5)) measv = QuantumCircuit(5, 1) measv.measure(4,0) circv = qc2+measv circv.draw('mpl') #DO NOT RUN THIS CELL WITHOUT EDITING THE ABOVE ONE AS DESIRED #The following code will give you f(x) for the value of x you chose in the above cell backend_sim2 = Aer.get_backend('qasm_simulator') job_sim2 = execute(circv, backend_sim2, shots=1000) result_sim2 = job_sim2.result() counts2 = result_sim2.get_counts(circv) print(counts2) plot_histogram(counts2)
https://github.com/nahumsa/Introduction-to-IBM_Qiskit
nahumsa
# Let's import all functions import numpy as np import scipy as sp from qiskit import Aer from qiskit.opflow import PauliTrotterEvolution, StateFn, PauliExpectation from qiskit.opflow import CircuitSampler, PauliOp from qiskit.opflow import I, X, Y, Z, Zero, One, Plus, Minus from qiskit.circuit import Parameter hamiltonian = (Z^Z) evo_time = Parameter('t') evolution_op = (evo_time*hamiltonian).exp_i() print(evolution_op) num_time_slices = 1 trotterized_op = PauliTrotterEvolution( trotter_mode='trotter', reps=num_time_slices).convert(evolution_op) trotterized_op.to_circuit().draw() hamiltonian = (X^X) evo_time = Parameter('t') evolution_op = (evo_time*hamiltonian).exp_i() num_time_slices = 1 trotterized_op = PauliTrotterEvolution( trotter_mode='trotter', reps=num_time_slices).convert(evolution_op) trotterized_op.to_circuit().draw() hamiltonian = (Y^Y) evo_time = Parameter('t') evolution_op = (evo_time*hamiltonian).exp_i() num_time_slices = 1 trotterized_op = PauliTrotterEvolution( trotter_mode='trotter', reps=num_time_slices).convert(evolution_op) trotterized_op.to_circuit().draw() hamiltonian = (Z^Z^Z^Z) evo_time = Parameter('t') evolution_op = (evo_time*hamiltonian).exp_i() num_time_slices = 1 trotterized_op = PauliTrotterEvolution( trotter_mode='trotter', reps=num_time_slices).convert(evolution_op) trotterized_op.to_circuit().draw() hamiltonian = (Z^Z) + (X^X) observable = (X^X) evo_time = Parameter('t') evolution_op = (evo_time*hamiltonian).exp_i() observable_measurement = StateFn(observable).adjoint() eigenvalues, eigenstates = np.linalg.eigh(hamiltonian.to_matrix()) initial_state = StateFn(eigenstates[0]) print(initial_state.to_circuit_op()) evo_and_measure = observable_measurement @ evolution_op @ initial_state print(evo_and_measure) num_time_slices = 1 trotterized_op = PauliTrotterEvolution( trotter_mode='trotter', reps=num_time_slices).convert(evo_and_measure) print(trotterized_op) # Let's calculate expectation values diagonalized_meas_op = PauliExpectation().convert(trotterized_op) print(diagonalized_meas_op) evo_time_points = [0.5, 0.75] hamiltonian_trotter_expectations = diagonalized_meas_op.bind_parameters({evo_time: evo_time_points}) print(f"Observable at time {evo_time_points}: {np.round(hamiltonian_trotter_expectations.eval(), 3)}") sampler = CircuitSampler(backend=Aer.get_backend("qasm_simulator")) # sampler.quantum_instance.run_config.shots = 1000 sampled_trotter_exp_op = sampler.convert(hamiltonian_trotter_expectations) sampled_trotter_energies = sampled_trotter_exp_op.eval() print(f"Energies: {np.round(np.real(sampled_trotter_energies),3)}") import matplotlib.pyplot as plt def run_hs(shots): sampler = CircuitSampler(backend=Aer.get_backend("qasm_simulator")) sampler.quantum_instance.run_config.shots = shots hamiltonian_trotter_expectations = diagonalized_meas_op.bind_parameters({evo_time: 0.5}) sampled_trotter_exp_op = sampler.convert(hamiltonian_trotter_expectations) sampled_trotter_energies = sampled_trotter_exp_op.eval() return np.real(sampled_trotter_energies) n_shots = [100, 1000, 2000, 5000, 7000, 10000] exp = [] for shots in n_shots: exp.append(run_hs(shots)) plt.plot(n_shots, exp, 'o', label=f"t={0.5}") plt.hlines(y=0., xmin=min(n_shots), xmax=max(n_shots) + 1, colors='red') plt.xlabel("# shots", size=16) plt.ylabel(r"$ \langle O \rangle $", size=16) plt.show()
https://github.com/qiskit-community/qiskit-translations-staging
qiskit-community
from qiskit.circuit.library import MCXGate gate = MCXGate(4) from qiskit import QuantumCircuit circuit = QuantumCircuit(5) circuit.append(gate, [0, 1, 4, 2, 3]) circuit.draw('mpl')
https://github.com/shesha-raghunathan/DATE2019-qiskit-tutorial
shesha-raghunathan
# we can break lines when defining our list M = [ [8 , 0 , -1 , 0 , 2], [-2 , -3 , 1 , 1 , 4], [0 , 0 , 1 , -7 , 1], [1 , 4 , -2 , 5 , 9] ] # let's print matrix M print(M) # let's print M in matrix form, row by row for i in range(4): # there are 4 rows print(M[i]) M = [ [8 , 0 , -1 , 0 , 2], [-2 , -3 , 1 , 1 , 4], [0 , 0 , 1 , -7 , 1], [1 , 4 , -2 , 5 , 9] ] #let's print the element of M in the 1st row and the 1st column. print(M[0][0]) #let's print the element of M in the 3rd row and the 4th column. print(M[2][3]) #let's print the element of M in the 4th row and the 5th column. print(M[3][4]) # we use double nested for-loops N =[] # the result matrix for i in range(4): # for each row N.append([]) # create an empty sub-list for each row in the result matrix for j in range(5): # in row (i+1), for each column N[i].append(M[i][j]*-2) # we add new elements into the i-th sub-list # let's print M and N, and see the results print("I am M:") for i in range(4): print(M[i]) print() print("I am N:") for i in range(4): print(N[i]) # create an empty list for the result matrix K=[] for i in range(len(M)): # len(M) return the number of rows in M K.append([]) # we create a new row for K for j in range(len(M[0])): # len(M[0]) returns the number of columns in M K[i].append(M[i][j]+N[i][j]) # we add new elements into the i-th sublist/rows # print each matrix in a single line print("M=",M) print("N=",N) print("K=",K) from random import randrange # # your solution is here # M = [ [-2,3,0,4], [-1,1,5,9] ] N =[ [1,2,3], [4,5,6], [7,8,9] ] # # your solution is here # # matrix M M = [ [-1,0,1], [-2,-3,4], [1,5,6] ] # vector v v = [1,-3,2] # the result vector u u = [] # for each row, we do an inner product for i in range(3): # inner product for one row is initiated inner_result = 0 # this variable keeps the summation of the pairwise multiplications for j in range(3): # the elements in the i-th row inner_result = inner_result + M[i][j] * v[j] # inner product for one row is completed u.append(inner_result) print("M is") for i in range(len(M)): print(M[i]) print() print("v=",v) print() print("u=",u) # # your solution is here # # matrix M M = [ [-1,0,1], [-2,-1,2], [1,2,-2] ] # matrix N M = [ [0,2,1], [3,-1,-2], [-1,1,0] ] # matrix K K = [] # # your solution is here # # # your solution is here #
https://github.com/swe-train/qiskit__qiskit
swe-train
# -*- coding: utf-8 -*- # This code is part of Qiskit. # # (C) Copyright IBM 2017. # # This code is licensed under the Apache License, Version 2.0. You may # obtain a copy of this license in the LICENSE.txt file in the root directory # of this source tree or at http://www.apache.org/licenses/LICENSE-2.0. # # Any modifications or derivative works of this code must retain this # copyright notice, and modified files need to carry a notice indicating # that they have been altered from the originals. # pylint: disable=wrong-import-order """Main Qiskit public functionality.""" import pkgutil # First, check for required Python and API version from . import util # qiskit errors operator from .exceptions import QiskitError # The main qiskit operators from qiskit.circuit import ClassicalRegister from qiskit.circuit import QuantumRegister from qiskit.circuit import QuantumCircuit # pylint: disable=redefined-builtin from qiskit.tools.compiler import compile # TODO remove after 0.8 from qiskit.execute import execute # The qiskit.extensions.x imports needs to be placed here due to the # mechanism for adding gates dynamically. import qiskit.extensions import qiskit.circuit.measure import qiskit.circuit.reset # Allow extending this namespace. Please note that currently this line needs # to be placed *before* the wrapper imports or any non-import code AND *before* # importing the package you want to allow extensions for (in this case `backends`). __path__ = pkgutil.extend_path(__path__, __name__) # Please note these are global instances, not modules. from qiskit.providers.basicaer import BasicAer # Try to import the Aer provider if installed. try: from qiskit.providers.aer import Aer except ImportError: pass # Try to import the IBMQ provider if installed. try: from qiskit.providers.ibmq import IBMQ except ImportError: pass from .version import __version__ from .version import __qiskit_version__
https://github.com/qiskit-community/qiskit-translations-staging
qiskit-community
import torch from qiskit.utils import algorithm_globals algorithm_globals.random_seed = 123456 _ = torch.manual_seed(123456) # suppress output import numpy as np num_dim = 2 num_discrete_values = 8 num_qubits = num_dim * int(np.log2(num_discrete_values)) from scipy.stats import multivariate_normal coords = np.linspace(-2, 2, num_discrete_values) rv = multivariate_normal(mean=[0.0, 0.0], cov=[[1, 0], [0, 1]], seed=algorithm_globals.random_seed) grid_elements = np.transpose([np.tile(coords, len(coords)), np.repeat(coords, len(coords))]) prob_data = rv.pdf(grid_elements) prob_data = prob_data / np.sum(prob_data) import matplotlib.pyplot as plt from matplotlib import cm mesh_x, mesh_y = np.meshgrid(coords, coords) grid_shape = (num_discrete_values, num_discrete_values) fig, ax = plt.subplots(figsize=(9, 9), subplot_kw={"projection": "3d"}) prob_grid = np.reshape(prob_data, grid_shape) surf = ax.plot_surface(mesh_x, mesh_y, prob_grid, cmap=cm.coolwarm, linewidth=0, antialiased=False) fig.colorbar(surf, shrink=0.5, aspect=5) plt.show() from qiskit import QuantumCircuit from qiskit.circuit.library import EfficientSU2 qc = QuantumCircuit(num_qubits) qc.h(qc.qubits) ansatz = EfficientSU2(num_qubits, reps=6) qc.compose(ansatz, inplace=True) qc.decompose().draw("mpl") qc.num_parameters from qiskit.primitives import Sampler shots = 10000 sampler = Sampler(options={"shots": shots, "seed": algorithm_globals.random_seed}) from qiskit_machine_learning.connectors import TorchConnector from qiskit_machine_learning.neural_networks import SamplerQNN def create_generator() -> TorchConnector: qnn = SamplerQNN( circuit=qc, sampler=sampler, input_params=[], weight_params=qc.parameters, sparse=False, ) initial_weights = algorithm_globals.random.random(qc.num_parameters) return TorchConnector(qnn, initial_weights) from torch import nn class Discriminator(nn.Module): def __init__(self, input_size): super(Discriminator, self).__init__() self.linear_input = nn.Linear(input_size, 20) self.leaky_relu = nn.LeakyReLU(0.2) self.linear20 = nn.Linear(20, 1) self.sigmoid = nn.Sigmoid() def forward(self, input: torch.Tensor) -> torch.Tensor: x = self.linear_input(input) x = self.leaky_relu(x) x = self.linear20(x) x = self.sigmoid(x) return x generator = create_generator() discriminator = Discriminator(num_dim) def adversarial_loss(input, target, w): bce_loss = target * torch.log(input) + (1 - target) * torch.log(1 - input) weighted_loss = w * bce_loss total_loss = -torch.sum(weighted_loss) return total_loss from torch.optim import Adam lr = 0.01 # learning rate b1 = 0.7 # first momentum parameter b2 = 0.999 # second momentum parameter generator_optimizer = Adam(generator.parameters(), lr=lr, betas=(b1, b2), weight_decay=0.005) discriminator_optimizer = Adam( discriminator.parameters(), lr=lr, betas=(b1, b2), weight_decay=0.005 ) from IPython.display import clear_output def plot_training_progress(): # we don't plot if we don't have enough data if len(generator_loss_values) < 2: return clear_output(wait=True) fig, (ax1, ax2) = plt.subplots(1, 2, figsize=(18, 9)) # Generator Loss ax1.set_title("Loss") ax1.plot(generator_loss_values, label="generator loss", color="royalblue") ax1.plot(discriminator_loss_values, label="discriminator loss", color="magenta") ax1.legend(loc="best") ax1.set_xlabel("Iteration") ax1.set_ylabel("Loss") ax1.grid() # Relative Entropy ax2.set_title("Relative entropy") ax2.plot(entropy_values) ax2.set_xlabel("Iteration") ax2.set_ylabel("Relative entropy") ax2.grid() plt.show() import time from scipy.stats import multivariate_normal, entropy n_epochs = 50 num_qnn_outputs = num_discrete_values**num_dim generator_loss_values = [] discriminator_loss_values = [] entropy_values = [] start = time.time() for epoch in range(n_epochs): valid = torch.ones(num_qnn_outputs, 1, dtype=torch.float) fake = torch.zeros(num_qnn_outputs, 1, dtype=torch.float) # Configure input real_dist = torch.tensor(prob_data, dtype=torch.float).reshape(-1, 1) # Configure samples samples = torch.tensor(grid_elements, dtype=torch.float) disc_value = discriminator(samples) # Generate data gen_dist = generator(torch.tensor([])).reshape(-1, 1) # Train generator generator_optimizer.zero_grad() generator_loss = adversarial_loss(disc_value, valid, gen_dist) # store for plotting generator_loss_values.append(generator_loss.detach().item()) generator_loss.backward(retain_graph=True) generator_optimizer.step() # Train Discriminator discriminator_optimizer.zero_grad() real_loss = adversarial_loss(disc_value, valid, real_dist) fake_loss = adversarial_loss(disc_value, fake, gen_dist.detach()) discriminator_loss = (real_loss + fake_loss) / 2 # Store for plotting discriminator_loss_values.append(discriminator_loss.detach().item()) discriminator_loss.backward() discriminator_optimizer.step() entropy_value = entropy(gen_dist.detach().squeeze().numpy(), prob_data) entropy_values.append(entropy_value) plot_training_progress() elapsed = time.time() - start print(f"Fit in {elapsed:0.2f} sec") with torch.no_grad(): generated_probabilities = generator().numpy() fig = plt.figure(figsize=(18, 9)) # Generated CDF gen_prob_grid = np.reshape(np.cumsum(generated_probabilities), grid_shape) ax1 = fig.add_subplot(1, 3, 1, projection="3d") ax1.set_title("Generated CDF") ax1.plot_surface(mesh_x, mesh_y, gen_prob_grid, linewidth=0, antialiased=False, cmap=cm.coolwarm) ax1.set_zlim(-0.05, 1.05) # Real CDF real_prob_grid = np.reshape(np.cumsum(prob_data), grid_shape) ax2 = fig.add_subplot(1, 3, 2, projection="3d") ax2.set_title("True CDF") ax2.plot_surface(mesh_x, mesh_y, real_prob_grid, linewidth=0, antialiased=False, cmap=cm.coolwarm) ax2.set_zlim(-0.05, 1.05) # Difference ax3 = fig.add_subplot(1, 3, 3, projection="3d") ax3.set_title("Difference between CDFs") ax3.plot_surface( mesh_x, mesh_y, real_prob_grid - gen_prob_grid, linewidth=2, antialiased=False, cmap=cm.coolwarm ) ax3.set_zlim(-0.05, 0.1) plt.show() import qiskit.tools.jupyter %qiskit_version_table %qiskit_copyright
https://github.com/Harcipan/QAI_GroverSim
Harcipan
# Importing standard Qiskit libraries from qiskit import QuantumCircuit, transpile from qiskit.tools.jupyter import * from qiskit.visualization import * from ibm_quantum_widgets import * # qiskit-ibmq-provider has been deprecated. # Please see the Migration Guides in https://ibm.biz/provider_migration_guide for more detail. from qiskit_ibm_runtime import QiskitRuntimeService, Sampler, Estimator, Session, Options # Loading your IBM Quantum account(s) service = QiskitRuntimeService(channel="ibm_quantum") # Invoke a primitive. For more details see https://qiskit.org/documentation/partners/qiskit_ibm_runtime/tutorials.html # result = Sampler("ibmq_qasm_simulator").run(circuits).result() # Built-in modules import math # Imports from Qiskit from qiskit import QuantumCircuit from qiskit.circuit.library import GroverOperator, MCMT, ZGate from qiskit.visualization import plot_distribution # Imports from Qiskit Runtime from qiskit_ibm_runtime import QiskitRuntimeService, Sampler, Session # Add your token below service = QiskitRuntimeService(channel="ibm_quantum") from qiskit import IBMQ IBMQ.save_account('33b329939cf6fe545c64afb41b84e0993a774c578c2d3e3a07b2ed8644261511d4712974c684ae3050ca82dd8f4ca161930bb344995de7934be32214bdb17079')
https://github.com/qiskit-community/qiskit-translations-staging
qiskit-community
from qiskit import QuantumCircuit from qiskit.quantum_info import Statevector from qiskit.visualization import plot_bloch_multivector qc = QuantumCircuit(2) qc.h(0) qc.x(1) state = Statevector(qc) plot_bloch_multivector(state)