blob_id
stringlengths
40
40
language
stringclasses
1 value
repo_name
stringlengths
5
117
path
stringlengths
3
268
src_encoding
stringclasses
34 values
length_bytes
int64
6
4.23M
score
float64
2.52
5.19
int_score
int64
3
5
detected_licenses
listlengths
0
85
license_type
stringclasses
2 values
text
stringlengths
13
4.23M
download_success
bool
1 class
547232620f3ea16e813c8e9db17e4e6c0ef349c2
C++
RobPang/Algorithm_study
/백준알고리즘/BOJ-11049 행렬 곱셈순서.cpp
UTF-8
633
2.796875
3
[]
no_license
//행렬 곱셈 순서 - dp 각각을 분리 #include <iostream> #include <algorithm> #include <cstring> using namespace std; int r[501]; int c[501]; long long dp[501][501]; long long dfs(int a, int b) { if (b - a == 1) { int temp = r[a] * c[a] * c[b]; } if (a == b) return 0; long long& res = dp[a][b]; if (res != -1) { return res; } res = 9999999999; for (int i = a; i <= b-1; i++) { res = min(res, dfs(a, i) + dfs(i+1, b) + r[a]*c[i]*c[b]); } return res; } int main() { int n; cin >> n; for (int i = 1; i <= n; i++) { cin >> r[i] >> c[i]; } memset(dp, -1, sizeof(dp)); cout << dfs(1,n) << '\n'; }
true
0db452bd351fe7340772802296fbed2e548329c9
C++
Maesly/TareaCortaDatos2
/Singly_Linked_List.h
UTF-8
4,491
3.390625
3
[]
no_license
// // Created by parallels on 9/10/17. // #ifndef TAREA_SINGLY_LINKED_LIST_H #define TAREA_SINGLY_LINKED_LIST_H #include <iostream> #include <stdlib.h> using namespace std; /** * Inicializa el nodo */ struct nodo{ int nro; struct nodo *sgte; }; typedef struct nodo *Tlista; /** * Inserta valores al inicio de la lista enlazada. */ void insertarInicio(Tlista &lista, int valor) { Tlista q; q = new(struct nodo); q->nro = valor; q->sgte = lista; lista = q; } /** * */ /** * Su función es buscar el elemento deseado * dentro de una lista. */ void buscarElemento(Tlista lista, int valor) { Tlista q = lista; int i = 1, band = 0; while(q!=NULL) { if(q->nro==valor) { cout<<endl<<" Encontrada en posicion "<< i <<endl; band = 1; } q = q->sgte; i++; } if(band==0) cout<<"\n\n Numero no encontrado..!"<< endl; } /** * Imprime la Lista */ void reportarLista(Tlista lista) { int i = 0; while(lista != NULL) { cout <<' '<< i+1 <<") " << lista->nro << endl; lista = lista->sgte; i++; } } /** * Eliminar Elemento * */ void eliminarElemento(Tlista &lista, int valor) { Tlista p, ant; p = lista; if(lista!=NULL) { while(p!=NULL) { if(p->nro==valor) { if(p==lista) lista = lista->sgte; else ant->sgte = p->sgte; delete(p); return; } ant = p; p = p->sgte; } } else cout<<" Lista vacia..!"; } /** * * Eliminar Repetidos */ void eliminaRepetidos(Tlista &lista, int valor){ Tlista q, ant; q = lista; ant = lista; while(q!=NULL) { if(q->nro==valor) { if(q==lista) // primero elemento { lista = lista->sgte; delete(q); q = lista; } else { ant->sgte = q->sgte; delete(q); q = ant->sgte; } } else { ant = q; q = q->sgte; } }// fin del while cout<<"\n\n Valores eliminados..!"<<endl; } /** * * Main */ int mainSinglyLinkedList(){ Tlista lista = NULL; int n; double t1,t2; cout << "\n\t\t LISTA ENLAZADA SIMPLE \n\n"; int dato; cout << " Numero de elementos de la lista: "; cin >> n; cout << endl; srand(time(NULL)); for (int i = 0; i < n; i++) { int x = rand() % 10000; insertarInicio(lista, x); } cout << "\n\n MOSTRANDO LISTA\n\n"; reportarLista(lista); cout<<"\n"<<endl; /** * t1 y t2 miden el tiempo que tarda el algoritmo * en buscar un elemento * en la lista. */ int opcion = 0; while(opcion !=987){ cout<<"1.Buscar un Elemento"<<endl; cout<<"2.Eliminar Elemento"<<endl; cout<<"3.Ingresar Elemento"<<endl; cout<<"4.Salir"<<endl; cin>>opcion; switch (opcion){ case 1: cout << "\n Valor a buscar: "; cin >> dato; t1 = clock(); buscarElemento(lista, dato); t2 = clock(); cout << "\nTiempo Búsqueda: \t: " << ((t2 - t1)/CLOCKS_PER_SEC)*1000<<endl; break; case 2: cout<<"\n Mostrando Lista"<<endl; reportarLista(lista); cout << "\n Valor a Eliminar: "; cin >> dato; t1 = clock(); eliminarElemento(lista,dato); t2 = clock(); cout << "\nTiempo Eliminar: \t: " << ((t2 - t1)/CLOCKS_PER_SEC)*1000<<endl; break; case 3: cout << "\n Valor a Ingresar: "; cin >> dato; t1 = clock(); insertarInicio(lista,dato); t2 = clock(); reportarLista(lista); cout << "\nTiempo Ingreso: \t: " << ((t2 - t1)/CLOCKS_PER_SEC)*1000<<endl; break; case 4: opcion = 987; break; default: cout<<"Opcion Incorrecta"<<endl; } } } #endif //TAREA_SINGLY_LINKED_LIST_H
true
df3e070d90226ba4ce7aaa40e05571f10f95a597
C++
jjsuper/leetcode
/leetcode-viewer/solutions/228.summary-ranges/summary-ranges.cpp
UTF-8
1,259
2.765625
3
[]
no_license
class Solution { public: vector<string> summaryRanges(vector<int>& nums) { vector<string> vec; queue<int> que; int i; if(nums.empty()) return vec; que.push(nums[0]); for(i=1;i<nums.size();++i) { if(nums[i-1]+1!=nums[i]) { string s; int head=que.front(); que.pop(); if(head==nums[i-1]) { s=to_string(head); vec.push_back(s); } else { s=to_string(head)+"->"+to_string(nums[i-1]); vec.push_back(s); } que.push(nums[i]); } } while(!que.empty()) { int tmp=que.front(); que.pop(); if(tmp==nums.back()) { vec.push_back(to_string(tmp)); } else { string s; s=to_string(tmp)+"->"+to_string(nums.back()); vec.push_back(s); } } return vec; } };
true
2195aa33c236771d4518ef3c06c53c1696ae5e96
C++
dmccreary/moving-rainbow
/src/arduino/hsb-lab/hsb-lab.ino
UTF-8
4,829
2.625
3
[]
no_license
/* Control a RGB led with Hue, Saturation and Brightness (HSB / HSV ) Hue is change by an analog input. Brightness is changed by a fading function. Saturation stays constant at 255 getRGB() function based on <http://www.codeproject.com/miscctrl/CPicker.asp> dim_curve idea by Jims created 05-01-2010 by kasperkamperman.com */ /* dim_curve 'lookup table' to compensate for the nonlinearity of human vision. Used in the getRGB function on saturation and brightness to make 'dimming' look more natural. Exponential function used to create values below : x from 0 - 255 : y = round(pow( 2.0, x+64/40.0) - 1) */ const byte dim_curve[] = { 0, 1, 1, 2, 2, 2, 2, 2, 2, 3, 3, 3, 3, 3, 3, 3, 3, 3, 3, 3, 3, 3, 3, 4, 4, 4, 4, 4, 4, 4, 4, 4, 4, 4, 4, 5, 5, 5, 5, 5, 5, 5, 5, 5, 5, 6, 6, 6, 6, 6, 6, 6, 6, 7, 7, 7, 7, 7, 7, 7, 8, 8, 8, 8, 8, 8, 9, 9, 9, 9, 9, 9, 10, 10, 10, 10, 10, 11, 11, 11, 11, 11, 12, 12, 12, 12, 12, 13, 13, 13, 13, 14, 14, 14, 14, 15, 15, 15, 16, 16, 16, 16, 17, 17, 17, 18, 18, 18, 19, 19, 19, 20, 20, 20, 21, 21, 22, 22, 22, 23, 23, 24, 24, 25, 25, 25, 26, 26, 27, 27, 28, 28, 29, 29, 30, 30, 31, 32, 32, 33, 33, 34, 35, 35, 36, 36, 37, 38, 38, 39, 40, 40, 41, 42, 43, 43, 44, 45, 46, 47, 48, 48, 49, 50, 51, 52, 53, 54, 55, 56, 57, 58, 59, 60, 61, 62, 63, 64, 65, 66, 68, 69, 70, 71, 73, 74, 75, 76, 78, 79, 81, 82, 83, 85, 86, 88, 90, 91, 93, 94, 96, 98, 99, 101, 103, 105, 107, 109, 110, 112, 114, 116, 118, 121, 123, 125, 127, 129, 132, 134, 136, 139, 141, 144, 146, 149, 151, 154, 157, 159, 162, 165, 168, 171, 174, 177, 180, 183, 186, 190, 193, 196, 200, 203, 207, 211, 214, 218, 222, 226, 230, 234, 238, 242, 248, 255, }; const int sensorPin = 0; // pin the potmeter is attached too const int ledPinR = 9; // pwm pin with red led const int ledPinG = 10; // pwm pin with green led const int ledPinB = 11; // pwm pin with blue led int sensorVal = 0; // store the value coming from the sensor int fadeVal = 0; // value that changes between 0-255 int fadeSpeed = 4; // 'speed' of fading // getRGB function stores RGB values in this array // use these values for the red, blue, green led. int rgb_colors[3]; int hue; int saturation; int brightness; void setup() { pinMode(9, OUTPUT); pinMode(10, OUTPUT); pinMode(11, OUTPUT); Serial.begin(57600); } void loop() { sensorVal = analogRead(sensorPin); // fade from 0 - 255 and back with a certain speed fadeVal = fadeVal + fadeSpeed; // change fadeVal by speed fadeVal = constrain(fadeVal, 0, 255); // keep fadeVal between 0 and 255 if(fadeVal==255 || fadeVal==0) // change from up>down or down-up (negative/positive) { fadeSpeed = -fadeSpeed; } // set HSB values hue = map(sensorVal,0, 1023,0, 359); // hue is a number between 0 and 360 saturation = 255; // saturation is a number between 0 - 255 brightness = fadeVal; // value is a number between 0 - 255 getRGB(hue,saturation,brightness,rgb_colors); // converts HSB to RGB analogWrite(ledPinR, rgb_colors[0]); // red value in index 0 of rgb_colors array analogWrite(ledPinG, rgb_colors[1]); // green value in index 1 of rgb_colors array analogWrite(ledPinB, rgb_colors[2]); // blue value in index 2 of rgb_colors array delay(20); // delay to slow down fading } void getRGB(int hue, int sat, int val, int colors[3]) { /* convert hue, saturation and brightness ( HSB/HSV ) to RGB The dim_curve is used only on brightness/value and on saturation (inverted). This looks the most natural. */ val = dim_curve[val]; sat = 255-dim_curve[255-sat]; int r; int g; int b; int base; if (sat == 0) { // Acromatic color (gray). Hue doesn't mind. colors[0]=val; colors[1]=val; colors[2]=val; } else { base = ((255 - sat) * val)>>8; switch(hue/60) { case 0: r = val; g = (((val-base)*hue)/60)+base; b = base; break; case 1: r = (((val-base)*(60-(hue%60)))/60)+base; g = val; b = base; break; case 2: r = base; g = val; b = (((val-base)*(hue%60))/60)+base; break; case 3: r = base; g = (((val-base)*(60-(hue%60)))/60)+base; b = val; break; case 4: r = (((val-base)*(hue%60))/60)+base; g = base; b = val; break; case 5: r = val; g = base; b = (((val-base)*(60-(hue%60)))/60)+base; break; } colors[0]=r; colors[1]=g; colors[2]=b; } }
true
d2c92d4e66c75c447eb7f741a83a2ee0ead910c6
C++
SashiRin/protrode
/atcoder/abc104/B.cpp
UTF-8
1,179
2.65625
3
[ "MIT" ]
permissive
#include <iostream> #include <cstdio> #include <cmath> #include <string> #include <algorithm> #include <vector> #include <unordered_map> #include <stack> #include <set> using namespace std; int main() { ios::sync_with_stdio(false); cin.tie(0); string s; cin >> s; if (s[0] != 'A') { cout << "WA" << endl; } else { int cntC = 0; int indexC = -1; for (int i = 2; i < s.length() - 1; ++i) { if (s[i] == 'C') { cntC++; indexC = i; } } if (cntC != 1) { cout << "WA" << endl; } else { bool flag = true; for (int i = 1; i < s.length(); ++i) { if (i == indexC) { continue; } else { if (s[i] >= 'a' && s[i] <= 'z') { continue; } else { cout << "WA" << endl; flag = false; break; } } } if (flag) cout << "AC" << endl; } } return 0; }
true
6cf4c1a7cf6db109e0a827fa3eca6f01cdc50f7b
C++
debanjan877/Shipping-And-Bidding
/ShippingBiddingC.cpp
UTF-8
14,490
2.8125
3
[]
no_license
#include<stdlib.h> #include<iostream.h> #include<string.h> #include<stdio.h> #include<conio.h> #include"headers\Globals.h" #include"headers\BidInfo.h" #include"headers\ShipInfo.h" #include"headers\File.h" using namespace std; /* Non Static Functions */ BidInfo::BidInfo() { _id=_shipItemId=_shipperId=_timeReqDays=_bidAmount=0; } unsigned long BidInfo::getId(){ return_id; } unsigned long BidInfo::getShipItemId(){ return _shipItemId; } void BidInfo::displayDetails(){ cout<<"\n\tId: "<<_id; cout<<"\n\tAmount: "<<_bidAmount; cout<<"\n\tTime Required: "<<_time ReqDAys<<" days"; cout<<endl; } void BidInfo::displayAsRow(){ cout<<_id; cout<<"\t"<<_shipItemId; cout<<"\t"<<_shipperId; cout<<"\t"<<_bidAmount; cout<<"\t"<<_timeReqDays; cout<<endl; } void BidInfo::accept(){ ShipInfo*shipInfo=File<ShipInfo>::find(SHIPINFO_FILE,_shipItenId); if(shipInfo!=NULL){ shipInfo>setWonBy(_shipperId); } } /* Static Functions */ BidInfo*BidInfo::newEntry(unsigned long shipperId,unsigned long shipItemId){ BidInfo* temp=new BidInfo(); temp->_id=::newId(); temp->_shipperId=shipperId; temp->_shipItemId=shipItemId; if(File<BidInfo>::find(BIDINFO_FILE,temp->_id)!=NULL){ cout<<"Internal error.Please retry."; system('cls"); return BidInfo::newEntry(shipperId,shipItemId); } cout<<"\n\tTime Required(days): "; cin>>temp->_timeReqDays; cout<<"\n\tamount: "; cin>>temp->_bidAmount; if(::canProceed()==1){ File<BidInfo>::insert(BIDINFO_FILE,temp); return temp; } else{ return NULL; } } void BidInfo::displayColumns(){ cout<<"Id"; cout<<"\t"<<"Ship Item Id"; cout<<"\t"<<"Shipper Id"; cout<<"\t"<<"Bid Amount"; cout<<"\t"<<"Time Allocated (days)"; cout<<endl; cout<<"----------------------------------------------------------------"; cout<<endl; } #include<stdlib.h> #include<iostream.h> #include<string.h> #include<stdio.h> #include<conio.h> #include"headers\Globals.h" #include"headers\Contact.h" #include"headers\ShipInfo.h" #include"headers\File.h" using namespace std; /* Non Static Functions */ ShipInfo::ShipInfo(){ _id=_customerId=_wonByShipperId=0; strcpy(_description,""); strcpy(_destinationLocation,""); strcpy(_status,""); _width=_height=_depth=_weight=_maxAmount=_maxDaysToTransport; } unsigned long ShipInfo::getCustomerId(){ return_customerId; } unsigned long ShipInfo::getWonByShipperId(){ return_wonByShipperId; } const char* ShipInfo::getStatus(){ return_satus; } void ShipInfo::close(){ if(::canProceed()){ stcpy(_status,"Closed"); File<ShipInfo>::update(SHIPINFO_FILE,this); } } void ShipInfo::setWonBy(unsigned long shipperId){ if(::canProceed()){ strcpy(_status,"Accepted"); _wonByShipperId=shipperId; File<ShipInfo>::update(SHIPINFO_FILE,this); } } void ShipInfo::displayDetails(){ cout<<"\n\tId: "<<_id; cout<<"\n\tCustomer Id: "<<_wonbyShipperId; cout<<"\n\tDescription: "<<_description; cout<<"\n\tLocation To: "<<_destinationLocation; cout<<"\n\tLocation From: "<<_sourceLocation; cout<<"\n\tWidth: "<<_width; cout<<"\n\tHeight: "<<_height; cout<<"\n\tDepth: "<<_dept; cout<<"\n\tweight: "<<_weight; cout<<"\n\tMax Bid: "<<_maxAmount; cout<<"\n\tMax Days: "<<_maxDaysToTransport; cout<<"\n\tCreated On: "<<ctime(&_createdOn); cout<<"\n\tExpire On:<<ctime(&_expireOn); cout<<"\n\tStatus: "<<_status; cout<<endl; } void ShipInfo::displayAsRow(){ cout<<_id; cout<<"\t"<<_status; cout<<"\t"<<_sourceLocation; cout<<"\t"<<_destinationLocation; cout<<"\t"<<ctime(&_createdOn); cout<<"\t"<<ctime(&_expireOn); cout<<"\t"<<_description; cout<<endl; } /* Static Functions */ ShipInfo* ShipInfo::newEntry(unsigned long customerId){ ShipInfo* temp=new ShipINfo(); temp->_id=::newId(); temp->_customerId=customerId; temp->_createdOn=time(NULL); strcpy(temp->_status,"New"); if(FIle<ShipInfo>::find(ShIPINFO_FILE,temp->_id)!=NULL){ cout<<"Internal error.Please retry."; system("cls"); reutrn ShipInfo::newEntry(customerId); } cin.ignore(); cout<<"\n\tItem DEscription: "; cin.getline(temp->_description,255); cout<<"\tItem weight: "; cin>>temp->_weight; cout<<"\tItem height: "; cin>>temp->_height; cout<<"\tItem depth: "; cin>>temp->_depth; cout<<"\tItem width: "; cin>>temp->_width; cin.ignore(); cout<<"\tSource location: "; cin.getline(temp->_sourceLocation: "; cin.getline(temp->_destinationLocation,255); cout<<"\tInitial price: "; cin>>temp->_maxAmount; int iVal; cout<<"\texpire after(days): "; cin>>iVal; struct tm* t=localtime(&temp->_createdOn); t->tm_mday+=iVal; temp->_expireOn=mktime(t); cout<<"\tTime allocated(days): "; cin>>temp->_maxDaystoTransport; if(::canProceed()==1){ File<ShipInfo>::insert(SHIPINFO_FILE,temp); return temp; } else{ return NULL; } } void ShipInfo::displayColumns(){ cout<<"Id"; cout<<"\t"<<"\tStatus"; cout<<"\t"<<"\tSource Location:"; cout<<"\t"<<"\tDestination Location"; cout<<"\t"<<"\tCreated On"; cout<<"\t"<<"\tExpire On"; cout<<"\t"<<"\tDescription"; cout<<endl; cout<<"---------------------------------------------------------------------"; cout<<endl; } #include<stdlib.h> #include<iostream.h> #include<string.h> #include<conio.h> #include"headers\Globals.h" #include"headers\BidInfo.h" #include"headers\ShipInfo.h" #include"headers\File.h" using namespace std; Contact* shipper; void shipperMenu(contact*item){ shipper=item; int ch; unsigned long id; ShipInfo* itemShip=NULL; BidInfo* itemBid=NULL; File<ShipInfo>*fShip=NULL; File<BidInfo>* fBid=NULL; system("cls"); do{ cout<<"\n*****************************"; cout<<"\nSHIPPER MENU: "<<shipper->getId(); cout<<"\n*****************************"; cout<<"\n1.Display available ship items."; cout<<"\n2.Display my bids"; cout<<"\n3.Bid details"; cout<<"\n4.New Bid"; cout<<"\n58.clear screen"; cout<<"\n9.Logoff"; cout<<"\nEnter your choice: "; cin>>ch; switch(ch){ case 1: ShipInfo::displayColumns(); fShip=new File<ShipInfo>(SHIPINFO_FILE); while(!fShip->eof()){ itemShip=fShip->read(); if(itemShip!=NULL && strcmp(itemShip->getStatus(),"Closed")!=0 && itemShip->getWonByShipperId()==0){ itemShip->displayAsRow(); } delete(itemShip); } ::pressKey(); break; case 2: BidInfo::displayColumns(); fBid=new File<BidInfo>(BIDINFO_FILE); while(!fBid->eof()){ itemBid=fBid->read(); if(itemBid!=NULL && itemBid->getShipperId()==shipper->getId()){ itemBid->displayAsRow(); } delete(itemBid); } ::pressKey(); break; case 3: cout<<"enter Bid id: "; cin>>id; itemBid=FIle<BidInfo>::find(BIDINFO_FILE,id); if(itemBid==NULL){ cout<<"no item Found!"; } else{ itemBid->displayDetails(); delete(itemBid); } ::pressKey(); break; case 4: cout<<"enter ship id: "; cin>>id; itemShip=FIle<ShipInfo>::find(SHIPINFO_FILE,id); if(itemShip==NULL){ cout<<"no item found!"; } else{ itemShip->displayDetails(); if(::canProceed()==1){ itemBid=BidInfo::newEntry(shipper->getId(),id); if(itemBid!=NULL){ cout<<"Item successfully created with id: "<<itemBid->getId(); delete(itemBid); } } } ::pressKey(); break; case 8: system("cls"); break; case 9: system("cls"); break; default: cout<<"\tError:101.Invalid option!"; break; } }while(ch!=9); } #include<stdlib.h> #include<iostream.h> #include<string.h> #include<conio.h> #include"headers\Globals.h" #include"headers\BidInfo.h" #include"headers\ShipInfo.h" #include"headers\File.h" using namespace std; Contact* customer; void customerMenu(Contact* item){ customer=item; int ch; unsigned long id; ShipInfo* itemShip=NULL; BidInfo* itemBid=NULL; File<ShipInfo>* fShip=NULL; File<BidInfo>* fBid=NULL; system("cls"); do{ cout<<"\n***************************************************"; cout<<"\nCUSTOMER MENU : FOR CUSTOMER Id "<<customer->getId(); cout<<"\n***************************************************"; cout<<"\n1.Input an item for shipping"; cout<<"\n2.Remove an item from the list"; cout<<"\n3.Display items whose bidding are not done yet"; cout<<"\n4.Display the all ny items"; cout<<"\n5.Accept Bid"; cout<<"\n8.Clear screen"; cout<<"\n9. Logoff"; cout<<\nEnter your choice: "; cin>>ch; switch(ch){ case 1: system("cls"); cout<<"***********************************************"; cout<<"\n\tNEW SHIP INFORMATION FORM"; cout<<"\n*********************************************"; itemShip=ShipInfo::newEntry(customer->getId()); if(itemShip!=NULL){ cout<<"\nShip Item successfully created with id"<<itemShip->getId(); delete(itemShip); } ::pressKey(); break; case 2: cout<<"Enter Ship Item id: "; cin>>id; itemShip=File<ShipInfo>::find(SHIPINFO_FILE,id); if(itemShip==NULL){ } else{ itemShip->close(); delete(itemShip); } ::pressKey(); break; case 3: ShipInfo::displayColumns(); fShip=new File<ShipInfo>(SHIPINFO_FILE); while(!fShip->eof()){ itemShip=fShip->read(); if(itemShip!=NULL && itemShip->getCustomerId()==customer->getId()){ itemShip->displayAsRow(); } delete(itemShip); } ::pressKey(); break; case 4: cout<<"Enter Ship Item Id: "; cin>>id; BidInfo::displayColumns(); fBid=new File<BidInfo>(BIDINFO_FILE); while(!fBid->eof()){ itemBid=fBid->read(); if(itemBid!=NULL && itemBid->getShipItemId()==itemBid->getId()){ itemBid->displayAsRow(); } delete(itemBid); } ::pressKey(); break; case 5: cout<<"enter Bid Item Id: "; cin>>id; itemBid=File<BidInfo>::find(BIDINFO_FILE,id); if(itemBid==NULL){ cout<<"no items found!!!"; } else{ itemBid->displayDetails(); itemBid->accept(); delete(itemBid); } ::pressKey(); break; case 8: system("cls") break; case 9: system('cls"); break; default: cout<<"ERROR:303.Invalid input"; break; } }while(ch!=9); } #include<stdlib.h> #include<iostream.h> #include<string.h> #include<conio.h> #include"headers\Globals.h" #include"headers\LogWriter.h" #include"headers\Contact.h" #include<windows.h> using namespace std; void mainMenu(); void contactRegistration(const char* contactType); void contactLogin(const char* contactType); void administrations(); void customerMenu(Contact*); void shipperMenu(Contact*); void mainMenu(){ int ch; system("cls"); do{ cout<<"\n**************************************************"; cout<<"\n\tMAIN MENU"; cout<<"\n1.New Customer Registration"; cout<<"\n2.Customer Login"; cout<<"\n3.New Shipper Registration"; cout<<"\n4.Shipper Login"; cout<<"\n8.Clear screen"; cout<<"\n9.Exit"; cout<<"\nEnter your choice: "; cin>>ch; switch(ch){ case 1: contactRegistration("Customer"); break; case 2: contactLogin("Customer"); break; case 3: contactRegistration("Shipper"); break; case 4: contactLogin("Shipper"); break; case 5: administrations(); break; case 8: system("cls"); break; case 9: cout<<"Press any key to exit"; break; default: cout<<"ERROR:420...invalid"; break; } }while(ch!=9); } void contactRegistration(const char* contactType){ system("cls"); cout<<"**********************************************************"; if(strcmpi(contactType,"Customer")==0) cout<<"\nNEW CUSTOMER REGISTRATION FORM": else cout<<"\nNEW SHIPPER REGISTRATION FORM": cout<<"\n************************************************************"; Contact* temp=Contact::newEntry(contactType); if(temp!=NULL){ cout<<"\nYour login id: "<<temp->getId(); cout<<"\nPress any key to Continue...": getchar(); } } void contactLogin(const char* contactType){ char sval[20]; unsigned long id; system("cls"); cout<<"Enter your login Id: "; cin>>id; cin.ignore(); cout<<"enter oyur password: "; cin>>id; cin.ignore(); cout<<"enter your password:"; strcpy(sval,readPassword()); Contact* temp=Contact::validateLOgin(id,sval); if(temp!=NULL){ getch(); if(strcmpi(contactType,"Customer")==0) customerMenu(temp); else shipperMenu(temp); } else{ cout<<"\nERROR........"; ::pressKey(); } } void administrations(){ system("cls"); } int canProceed(){ char ch; cout<<"\ndo you want to proceed?(y/n): "; cin>>ch; if(ch=='y'||ch=='Y') return 1; else return 0; } const char* readPassword(){ string pass==""; char ch; ch=getch(); while(ch!=13){ pass.push_back(ch); cout<<'*'; ch=getch(); } return pass.c_str(); } int newId(){ unsigned long uid=GetTickCount(); ::Sleep(10); int id=(int)uid; return id; } void pressKey(){ cout<<"\nPress anyKey..."; getch(); } int main(){ char input=0; system("cls"); LogWriter::Enable(); mainMenu() return 1; } #include<stdlib.h> #include<iostream.h> #include<string.h> #include"headers\Globals.h" #include"headers\Contact.h" //#include"headers\ShipInfo.h" #include"headers\File.h" using namespace std; /* int canProceed(); const char* readPassword(); int newId();*/ /* Non Static Functionc*/ Contact::Contact(){ _id=0; strcpy(_name,""); strcpy(_address,""); strcpy(_type,""); strcpy(_password,""); _contactNo=_altContactNo=0; } unsigned long Contact::getId(){ return_id; } void Contact::displayDetails(){ cout<<"\n\tId: "<<_id; cout<<"\n\tName: "<<_name; cout<<"\n\tAddress: "<<_address; cout<<"\n\tContact No: "<<_contactNo; cout<<"\n\tAlt Contact No: "<<_altContactno; cout<<endl; } /* Static Functions*/ Contact* Contact::newEntry(const char* contactType){ Contact* temp=new Contact(); temp->_id=::newId(); strcpy(temp-._type,contactType); if(File<Contact>::(CONTACT_FILE,temp->getId())!=NULL){ cout<<"Internal error.retry"; system("cls"); reutrn Contact::newEntry(contactType); } cin.ignore(); cout<<"\n\tName: "; cin.getline(temp->_name,100); cout<<"\tAddress: '; cingetline(temp->_address,500); cout<<"\tContact No: "; cin>>temp->_contactno; cout<<"\tAlt Contactno: "; cin>>temp->_altContactNo;
true
dd9810e0ad7e8e0ec97023e351a061ab624484d5
C++
aashrayjain/Simple-Mobile-Phone
/AT_by_serial.ino
UTF-8
915
3.375
3
[]
no_license
/* * Author: Devvrat arya * * The code enable user to directly enter AT command in Serial window * The response of GSM also printed on the Serial window */ #include <SoftwareSerial.h> SoftwareSerial mySerial(10, 11); // RX, TX // can be replaced to any other PWM pin /* * GSM module is connected to software serial (declared as mySerial) at 10, 11 Pin of arduino */ void setup() { Serial.begin(9600); Serial.println("Enter AT commands"); mySerial.begin(9600); delay(500); } void loop() { if(Serial.available()) // If data available on hard Serial, pirnt it on soft Serial { char input=Serial.read(); mySerial.print(input); } if(mySerial.available()) // If data available on soft Serial,print it on hard Serial { char output=mySerial.read(); Serial.print(output); } }
true
5cb98a34a5a3c959be3dd875e80bde737af89254
C++
MKwiatosz/Programming
/KURS C++ PRATA/Rozdział 3/2.4/2.4/2.4.cpp
UTF-8
777
3.015625
3
[]
no_license
// 2.4.cpp : Defines the entry point for the console application. // #include "stdafx.h" #include <iostream> int main() { using namespace std; const int MIN = 60; const int GODZ = 3600; const int DZIEN = 3600 * 24; long long sekundy; cout << "Podaj liczbe sekund: "; cin >> sekundy; int dni = sekundy / DZIEN; // ile dni miesci sie w tych sekundach sekundy = sekundy % DZIEN; // ile dni miesci sie w sekundach tyle ze zwracamy pozostala ilosc sekund int godziny = sekundy / GODZ; sekundy = sekundy % GODZ; int minuty = sekundy / MIN; sekundy = sekundy % MIN; cout << sekundy << " sekund to: " << dni << " dni, " << godziny << " godzin, " << minuty << " minut, " << sekundy << " sekund" << endl; cin.get(); cin.get(); return 0; }
true
838a7625193af5d195763e43ff661ce69a56cd0b
C++
mickebackman/EDA031
/clientserver/memorydatabase.cc
UTF-8
2,066
3.234375
3
[]
no_license
#include "memorydatabase.h" #include <string> #include <iostream> #include "article.h" #include "newsgroup.h" #include <vector> #include <map> using namespace std; void MemoryDatabase::addArticle(int newsGroupId, string name, string author, string text){ try{ groups.at(newsGroupId).addArticle(name, author, text); }catch(...){ // Group does not exist throw 0; } } void MemoryDatabase::addNewsGroup(string newsGroupName){ for(auto p : groups){ if(p.second.getName() == newsGroupName){ throw runtime_error("The group already exists!"); } } groups.insert(make_pair(nextGroupId, NewsGroup(newsGroupName, nextGroupId))); ++nextGroupId; } Article MemoryDatabase::getArticle(int newsGroupId, int articleId){ NewsGroup g; try{ g = groups.at(newsGroupId); }catch(...){ // group does not exist - 0 throw 0; } try{ return g.getArticle(articleId); }catch(exception& e){ throw 1; } } void MemoryDatabase::deleteArticle(int newsGroupId, int articleId){ try{ groups.at(newsGroupId); }catch(...){ // group does not exist - 0 throw 0; } if(!groups.at(newsGroupId).deleteArticle(articleId)){ throw 1; } } void MemoryDatabase::deleteNewsGroup(int newsGroupId){ auto it = groups.find(newsGroupId); if(it == groups.end()){ throw runtime_error("The group does not exist!"); } groups.erase(it); } vector<pair<int, string>> MemoryDatabase::getNewsGroups(){ vector<pair<int, string>> result; for (auto p : groups){ result.push_back(make_pair(p.first, p.second.getName())); } return result; } map<int, Article> MemoryDatabase::getArticlesInNewsGroup(int newsGroupId){ NewsGroup g; try{ g = groups.at(newsGroupId); }catch(...){ // group does not exist - 0 throw 0; } return g.getArticles(); } int MemoryDatabase::numberOfNewsGroups(){ return groups.size(); } int MemoryDatabase::numberOfArticlesInNewsGroup(int newsGroupId){ try{ return getArticlesInNewsGroup(newsGroupId).size(); }catch(...){ throw 0; } }
true
474fa25442c88f85ea05511572277a754565aa21
C++
ayushsherpa111/GBEmu
/GameBoyEmulator/WRAM.h
UTF-8
221
2.78125
3
[]
no_license
#pragma once class WRAM { public: WRAM(); ~WRAM(); virtual int ReadByte(long address); virtual void WriteByte(int value, long address); protected: virtual void InitializeRAM(); unsigned char *RAM; long RAMSize; };
true
0bf1800a441102e95ed4e65b848b02e32566ce90
C++
newspring97/coding_test
/Dongju/boj1874.cpp
UTF-8
495
2.796875
3
[]
no_license
#include <iostream> #include <stack> #include <vector> using namespace std; int main(int argc, char** argv) { int n,x; cin>>n; stack<int> stck; int idx=1,t=0; vector<char> ans(2*n); for(int i=0;i<n;i++){ cin>>x; while(stck.empty() || stck.top()!=x) { if(idx>n) { printf("NO"); return 0; } stck.push(idx++); ans[t++] = '+'; } stck.pop(); ans[t++]='-'; } for(int i=0;i<ans.size();i++) { cout<<ans[i]<<"\n"; } return 0; }
true
ad49bfb87644e99af872449901b057e79cf6d072
C++
P17seongbin/Graphics_Assn
/Assn4/Project File/Assn1/ObjLoader.hpp
UHC
6,006
2.828125
3
[]
no_license
//Reference : http://www.opengl-tutorial.org/kr/beginners-tutorials/tutorial-7-model-loading/ #pragma once #include "State.h" #include "RenderManager.h" #include <vector> #include <map> #include "Const.h" using namespace std; class ObjLoader { public: ObjLoader(RenderManager* t); int findID(std::string name); bool loadOBJ(vector<string> list); GLuint vertexbuffer; private: std::map<std::string, GLuint> MeshID; RenderManager* RM; GLuint VertexArrayID; }; inline ObjLoader::ObjLoader(RenderManager * t) { RM = t; vector<string> mlist; string spath = "Meshlist.txt"; const char* path = spath.c_str(); FILE * file = fopen(path, "r"); if (file == NULL) { printf("Impossible to open the file !\n"); } while (true) { char line[127]; // read the first word of the line int res = fscanf(file, "%s", line); if (res == EOF) break; // EOF = End Of File. Quit the loop. else { mlist.push_back(string(line)); } } loadOBJ(mlist); } inline int ObjLoader::findID(std::string name) { std::map<std::string, GLuint>::iterator it = MeshID.find(name); if (it != MeshID.end()) return it->second; else return -1; } bool ObjLoader::loadOBJ(vector<string> list) { std::vector<float> out_vertices(0); //Obj ణ ؼ Texture File ̸ t prefix Բ . //Ʈ OBJ ϳϳ ε for (int i = 0; i < list.size(); i++) { std::vector< unsigned int > vertexIndices, uvIndices, normalIndices; std::vector< glm::vec3 > temp_vertices; std::vector< glm::vec3 > temp_normals; std::vector<glm::vec2> temp_uvs; UnitMesh tmesh; tmesh.ID = i; tmesh.offset = out_vertices.size() / 8; int len = 0; string t = list[i]; t.append(".obj"); const char* path = t.c_str(); FILE* file; if (path[0] == '#') file = fopen(path + 1, "r"); else file = fopen(path, "r"); if (file == NULL) { printf("Impossible to open the file %s !\n", path); return false; } tmesh.TextureID = -1; while (true) { char lineHeader[128]; // read the first word of the line int res = fscanf(file, "%s", lineHeader); if (res == EOF) break; // EOF = End Of File. Quit the loop. if (strcmp(lineHeader, "v") == 0) { glm::vec3 vertex; fscanf(file, "%f %f %f\n", &vertex.x, &vertex.y, &vertex.z); temp_vertices.push_back(vertex); } else if (strcmp(lineHeader, "tdds") == 0) { char* path = new char[128]; fscanf(file, "%s", path); tmesh.TextureID = (GLuint)loadDDS(path); } else if (strcmp(lineHeader, "tbmp") == 0) { char* path = new char[128]; fscanf(file, "%s", path); tmesh.TextureID = (GLuint)loadBMP(path); } else if (strcmp(lineHeader, "vt") == 0) { glm::vec2 uv; fscanf(file, "%f %f\n", &uv.x, &uv.y); temp_uvs.push_back(uv); } else if (strcmp(lineHeader, "vn") == 0) { glm::vec3 normal; fscanf(file, "%f %f %f\n", &normal.x, &normal.y, &normal.z); temp_normals.push_back(normal); } else if (strcmp(lineHeader, "f") == 0) { unsigned int vertexIndex[3], uvIndex[3], normalIndex[3]; int matches = fscanf(file, "%d/%d/%d %d/%d/%d %d/%d/%d\n", &vertexIndex[0], &uvIndex[0], &normalIndex[0], &vertexIndex[1], &uvIndex[1], &normalIndex[1], &vertexIndex[2], &uvIndex[2], &normalIndex[2]); if (matches != 9) { printf("File can't be read by this parser\n"); return false; } vertexIndices.push_back(vertexIndex[0]); vertexIndices.push_back(vertexIndex[1]); vertexIndices.push_back(vertexIndex[2]); uvIndices.push_back(uvIndex[0]); uvIndices.push_back(uvIndex[1]); uvIndices.push_back(uvIndex[2]); normalIndices.push_back(normalIndex[0]); normalIndices.push_back(normalIndex[1]); normalIndices.push_back(normalIndex[2]); } } // For each vertex of each triangle ( ﰢ ȸմϴ.) for (unsigned int i = 0; i < vertexIndices.size(); i++) { //save vertex data unsigned int vertexIndex = vertexIndices[i]; glm::vec3 vertex = temp_vertices[vertexIndex - 1]; out_vertices.push_back(vertex.x); out_vertices.push_back(vertex.y); out_vertices.push_back(vertex.z); //save uv data unsigned int uvindex = uvIndices[i]; glm::vec2 uv = temp_uvs[uvindex - 1]; out_vertices.push_back(uv.x); out_vertices.push_back(uv.y); //save normal data unsigned int normalindex = normalIndices[i]; glm::vec3 norm = temp_normals[uvindex - 1]; out_vertices.push_back(norm.x); out_vertices.push_back(norm.y); out_vertices.push_back(norm.z); len++; } tmesh.len = len; printf("%d %d %d %d\n", tmesh.ID, tmesh.len, tmesh.offset, tmesh.TextureID ); RM->enqueueMesh(tmesh); } GLuint VAO; glGenVertexArrays(1, &VAO); glBindVertexArray(VAO); glGenBuffers(1, &vertexbuffer); // Ʒ ɾ "vertexbuffer" ۿ ؼ ٷϴ. glBindBuffer(GL_ARRAY_BUFFER, vertexbuffer); // Vertex OpenGL Ѱݴϴ glBufferData(GL_ARRAY_BUFFER, out_vertices.size() * sizeof(float), &out_vertices[0], GL_STATIC_DRAW); glVertexAttribPointer( 2, 3, // ũ(size) GL_FLOAT, // Ÿ(type) GL_FALSE, // ȭ(normalized)? 8 * sizeof(float), // (stride) (void*)(5 * sizeof(float)) // 迭 (offset; ű ) ); glVertexAttribPointer( 1, 2, GL_FLOAT, GL_FALSE, 8 * sizeof(float), (void*)(3 * sizeof(float)) ); // ù° Ӽ(attribute) : ؽ glVertexAttribPointer( 0, // 0° Ӽ(attribute) 3, // ũ(size) GL_FLOAT, // Ÿ(type) GL_FALSE, // ȭ(normalized)? 8 * sizeof(float), // (stride) (void*)0 // 迭 (offset; ű ) ); RM->setVAO(VAO); RM->setVBO(vertexbuffer); return true; }
true
7b098e4886000a76ce9762e03e337a712fcabe19
C++
1red2blue4/Paradox-Billiards
/BallPhysics.cpp
UTF-8
1,651
2.828125
3
[]
no_license
#pragma once #include "BallPhysics.h" BallPhysics::BallPhysics() { netForce = vector3(); velocity = vector3(); speedCap = 1.5f; gravity = vector3(); freedom = 0.035; name = "default"; } BallPhysics::~BallPhysics() { //NO MEMORY ALLOCATED } void BallPhysics::SetGravity(vector3 yfrc) { gravity = yfrc; } vector3 BallPhysics::GetGravity() { return gravity; } void BallPhysics::SetBounce(vector3 bounceFrc) { //TODO bounceForce = bounceFrc; } vector3 BallPhysics::GetBounce() { return bounceForce; } void BallPhysics::AddForce(vector3 frc) { netForce += frc; } vector3 BallPhysics::ApplyForces(vector3 objectPosition) { velocity += netForce; if (velocity.x*velocity.x + velocity.y*velocity.y + velocity.z*velocity.z > speedCap*speedCap) { float vectorDistance = sqrt(velocity.x*velocity.x + velocity.y*velocity.y + velocity.z*velocity.z); velocity = vector3(velocity.x*speedCap / vectorDistance, velocity.y*speedCap / vectorDistance, velocity.z*speedCap / vectorDistance); } objectPosition += velocity; return objectPosition; } void BallPhysics::SetVelocity(vector3 vel) { velocity = vel; } vector3 BallPhysics::GetVelocity() { return velocity; } void BallPhysics::ZeroVelocity() { SetVelocity(vector3()); } vector3 BallPhysics::GetForce(void) { return netForce; } void BallPhysics::SetForce(vector3 frc) { netForce = frc; } void BallPhysics::SetName(String nm) { name = nm; } String BallPhysics::GetName() { return name; } void BallPhysics::SetType(String typ) { type = typ; } String BallPhysics::GetType() { return type; }
true
08c5b10fff7741f8e80980432bc81d35b6378708
C++
srimedhabc/Data-Structures
/DS/lab 1/ADD_MAX.CPP
UTF-8
687
2.921875
3
[]
no_license
#include<iostream> using namespace std; int main() { int A[20][20],B[20][20],C[20][20],i,j,a,b,m,n; cout<<"enter the number of rows and columns in A and B respectively"<<endl; cin>>a>>b>>m>>n; if(a!=m||b!=n) cout<<"Comparision not possible"<<endl; else { cout<<"enter the elements of A"<<endl; for(i=0;i<a;i++) { for(j=0;j<b;j++) { cin>>A[i][j]; } } cout<<"enter the elements of B"<<endl; for(i=0;i<m;i++) { for(j=0;j<n;j++) { cin>>B[i][j]; } } for(i=0;i<a;i++) { for(j=0;j<b;j++) { if(A[i][j]>B[i][j]) C[i][j]=A[i][j]; else C[i][j]=B[i][j]; } } for(i=0;i<a;i++) { for(j=0;j<b;j++) { cout<<C[i][j]<<ends; } cout<<endl; } } return 0; }
true
99680dacf9daf5e82f1370abad92b347a24b9c5b
C++
jandy14/LinkedListInCPP
/List.h
UTF-8
1,783
3.15625
3
[]
no_license
template <class T> class List { class Node; //전방선언 public: class Iterator { public: Node* current; private: bool isReversed; public: Iterator():isReversed(false) {} Iterator(bool pIsReversed):isReversed(pIsReversed) {} Iterator(bool pIsReversed, Node* pCurrent):isReversed(pIsReversed), current(pCurrent) {} Iterator& operator++() { return isReversed? Prev() : Next(); } Iterator& operator--() { return isReversed? Next() : Prev(); } Iterator operator++(int) { return isReversed? Prev() : Next(); } Iterator operator--(int) { return isReversed? Next() : Prev(); } bool operator==(const Iterator& pIter) { return current == pIter.current; } bool operator!=(const Iterator& pIter) { return current != pIter.current; } T& operator*() { return current->item; } private: Iterator& Next(); Iterator& Prev(); }; private: class Node { public: T item; Node* prev; Node* next; Node(T pItem, Node* pPrev, Node* pNext):item(pItem), next(pNext), prev(pPrev) {} Node():next(nullptr), prev(nullptr) {} }; Node begin; Node end; int size; public: List(); ~List(); T& Front(); T& Back(); int Size(); Iterator Begin() { return Iterator(false, begin.next); } Iterator End() { return Iterator(false, &end); } Iterator RBegin() { return Iterator(true, end.prev); } Iterator REnd() { return Iterator(true, &begin); } void PushFront (const T& item); void PushBack (const T& item); T PopFront(); T PopBack(); void InsertRight(Iterator&, const T&); void InsertLeft(Iterator&, const T&); void Insert(Iterator&, const T&); T Erase(Iterator&); void Clear(); private: void RemoveNode(Node*); void LinkNode(Node*); };
true
84805b5ed4a7b3432a20dcd08fc16f056a790040
C++
singhshu250/Os_Simulator
/scheduling.cpp
UTF-8
26,717
3.046875
3
[]
no_license
#include <bits/stdc++.h> using namespace std; void roundRobin() { cout << "Enter the number of processes: "; int n, i, j; cin >> n; while (n < 0) { cout << "Wrong input, try again\nEnter number of processes: "; cin >> n; } vector<tuple<int, int, int, int, int>> times(n); // {at, bt, ct, tat, wt} for (i = 0; i < n; i++) { int t; cout << "For process " << i + 1 << ":" << endl; cout << "Arrival Time: "; cin >> t; while (t < 0) { cout << "Wrong input, try again\nArrival time: "; cin >> t; } get<0>(times[i]) = t; // Arrival time cout << "Burst Time: "; cin >> t; while (t < 0) { cout << "Wrong input, try again\nBurst time: "; cin >> t; } cout << endl; get<1>(times[i]) = t; // Burst time get<2>(times[i]) = 0; // Completion time get<3>(times[i]) = 0; // Turn around time get<4>(times[i]) = 0; // Waiting time } int ti = INT_MAX; // current time int slicetime; cout << "Enter slice time: "; cin >> slicetime; while (slicetime <= 0) { cout << "Wrong input, try again\nEnter slice time: "; cin >> slicetime; } for (i = 0; i < n; i++) { ti = min(ti, get<0>(times[i])); } int visited[n] = {0}, bt[n]; // completed programs and Burst time for (i = 0; i < n; i++) { bt[i] = get<1>(times[i]); } while (1) { int f = 0; for (i = 0; i < n; i++) { if (visited[i]) continue; if (get<0>(times[i]) <= ti && get<1>(times[i]) > 0) { f = 1; ti += min(bt[i], slicetime); bt[i] = max(0, bt[i] - slicetime); if (bt[i] == 0) { get<2>(times[i]) = ti; get<3>(times[i]) = get<2>(times[i]) - get<0>(times[i]); get<4>(times[i]) = get<3>(times[i]) - get<1>(times[i]); visited[i] = 1; } } } if (f == 0) { ti++; } f = 0; // checking if all programs completed for (i = 0; i < n; i++) { if (visited[i] == 0) { f = 1; break; } } if (f == 0) break; } double TAT = 0, TWT = 0; for (i = 0; i < n; i++) { TAT += get<3>(times[i]); TWT += get<4>(times[i]); } cout << "\nProcess No.\tArrival Time\tBurst Time\tCompletion Time\t\tTurn-around Time\tWaiting Time\n"; for (i = 0; i < n; i++) { cout << i + 1 << "\t\t" << get<0>(times[i]) << "\t\t" << get<1>(times[i]) << "\t\t" << get<2>(times[i]) << "\t\t\t" << get<3>(times[i]) << "\t\t\t" << get<4>(times[i]) << "\n"; } TAT = TAT / (1.0 * n); // Average TAT TWT = TWT / (1.0 * n); // Average WT cout << "\nAverage Turn around time is: " << TAT << "\n"; cout << "Average Waiting time is: " << TWT << "\n"; return; } void sjf() { int size; cout << "Enter the number of processes: "; cin >> size; int at[size]; //arrival time of each process int bt[size]; //burst time of each process for (int i = 0; i < size; i++) { cout << "For process " << i + 1 << ":" << endl; cout << "Arrival time: "; cin >> at[i]; cout << "Burst time: "; cin >> bt[i]; cout << endl; } long long wt[size], tat[size], total_WT = 0, total_TAT = 0; //finding waiting time long long rt[size]; for (int i = 0; i < size; i++) rt[i] = bt[i]; long long comp = 0, t = 0, minm = INT_MAX; long long shortest = 0, fin_time; bool check = false; while (comp != size) { for (int j = 0; j < size; j++) { if ((at[j] <= t) && (rt[j] < minm) && rt[j] > 0) { minm = rt[j]; shortest = j; check = true; } } if (check == false) { t++; continue; } // decrementing the remaining time rt[shortest]--; minm = rt[shortest]; if (minm == 0) minm = INT_MAX; // If a process gets completly executed if (rt[shortest] == 0) { comp++; check = false; fin_time = t + 1; // Calculate waiting time wt[shortest] = fin_time - bt[shortest] - at[shortest]; if (wt[shortest] < 0) wt[shortest] = 0; } t++; } //turn around time for (int i = 0; i < size; i++) tat[i] = bt[i] + wt[i]; cout << "\nProcess No.\tArrival Time\tBurst Time\tTurn-around Time\tWaiting Time\n"; for (int i = 0; i < size; i++) { total_TAT += tat[i]; total_WT += wt[i]; cout << i + 1 << "\t\t" << at[i] << "\t\t" << bt[i] << "\t\t" << tat[i] << "\t\t\t" << wt[i] << "\n"; } cout << "\nAverage Turn around time is: " << (double)total_TAT / size << "\n"; cout << "Average Waiting time is: " << (double)total_WT / size << "\n"; } void fcfs() { cout << "\nEnter the number of processes: "; int n, i; cin >> n; while (n < 0) { cout << "Wrong input, try again" << "\nEnter number of processes: "; cin >> n; } vector<tuple<int, int, int, int, int>> times(n); // {at, bt, ct, tat, wt} cout << "Process Details" << endl << endl; for (i = 0; i < n; i++) { int t; cout << "For process " << i + 1 << ":" << endl; cout << "Arrival time: "; cin >> t; while (t < 0) { cout << "Wrong input, try again\nArrival Time P" << i << ": "; cin >> t; } get<0>(times[i]) = t; // Arrival time cout << "Burst time: "; cin >> t; while (t < 0) { cout << "Wrong input, try again\nBurst Time P" << i << ": "; cin >> t; } cout << endl; get<1>(times[i]) = t; // Burst time get<2>(times[i]) = 0; // Completion time get<3>(times[i]) = 0; // Turn around time get<4>(times[i]) = 0; // Waiting time } sort(times.begin(), times.end()); // sorting according to Arrival time int ti = 0; // current time for (i = 0; i < n; i++) { if (ti < get<0>(times[i])) ti = get<0>(times[i]); get<2>(times[i]) = ti + get<1>(times[i]); ti += get<1>(times[i]); get<3>(times[i]) = get<2>(times[i]) - get<0>(times[i]); get<4>(times[i]) = get<3>(times[i]) - get<1>(times[i]); } double TAT = 0, TWT = 0; for (i = 0; i < n; i++) { TAT += get<3>(times[i]); TWT += get<4>(times[i]); } cout << "\n" "Process No.\tArrival Time\tBurst Time\tCompletion Time\t\tTurn-around Time\tWaiting Time\n"; for (i = 0; i < n; i++) { cout << i + 1 << "\t\t" << get<0>(times[i]) << "\t\t" << get<1>(times[i]) << "\t\t" << get<2>(times[i]) << "\t\t\t" << get<3>(times[i]) << "\t\t\t" << get<4>(times[i]) << "\n"; } TAT = TAT / (1.0 * n); // Average TAT TWT = TWT / (1.0 * n); // Average WT cout << "\nAverage Turn around time is: " << TAT << "\n"; cout << "Average Waiting time is : " << TWT << "\n"; return; } void LJF() { struct processes { int pid; int at; int bt; int ct; int tat; int wt; }; int n, i, j, sumtat = 0, sumwt = 0; cout << "Enter no of processes" << endl; cin >> n; struct processes arr[n]; struct processes k; // temporary structure used in swapping for (i = 0; i < n; i++) { cout << "For process " << i + 1 << ":" << endl; cout << "Arrival time: "; cin >> arr[i].at; cout << "Burst time: "; cin >> arr[i].bt; arr[i].pid = i + 1; cout << endl; } //sorting the array of structures according to arrival time and if arrival time is same then sorting it according to processid for (i = 0; i < n; i++) { for (j = 0; j < n - 1; j++) { if (arr[j].at > arr[j + 1].at) { k = arr[j]; arr[j] = arr[j + 1]; arr[j + 1] = k; } else if (arr[j].at == arr[j + 1].at) { if (arr[j].pid > arr[j + 1].pid) { k = arr[j]; arr[j] = arr[j + 1]; arr[j + 1] = k; } } } } //finding the task which will be executed first int maxt, l = 0; maxt = arr[0].bt; for (i = 1; arr[i].at == arr[0].at; i++) { if (arr[i].bt > maxt) { maxt = arr[i].bt; l = i; } } k = arr[0]; arr[0] = arr[l]; arr[l] = k; arr[0].ct = arr[0].at + arr[0].bt; //sorting the array of structures according to largest burst times for arrival times less than the previous completion time for (i = 1; i < n; i++) { maxt = arr[i].bt; int val = i; for (j = i; j < n; j++) { if (arr[j].at <= arr[i - 1].ct && arr[j].bt > maxt) { maxt = arr[j].bt; val = j; } } k = arr[i]; arr[i] = arr[val]; arr[val] = k; //takes account of the case where if all the arrival times are greater than previous completion time if (arr[i].at > arr[i - 1].ct) { arr[i].ct = arr[i].at + arr[i].bt; } else { arr[i].ct = arr[i - 1].ct + arr[i].bt; } } //finding the turnaround time and the waiting time for (i = 0; i < n; i++) { arr[i].tat = arr[i].ct - arr[i].at; arr[i].wt = arr[i].tat - arr[i].bt; sumtat += arr[i].tat; sumwt += arr[i].wt; } cout << "\nProcess No.\tArrival Time\tBurst Time\tCompletion Time\t\tTurn-around Time\tWaiting Time\n"; for (i = 0; i < n; i++) { cout << arr[i].pid << "\t" << arr[i].at << "\t" << arr[i].bt << "\t" << arr[i].ct << "\t" << arr[i].tat << "\t" << arr[i].wt << endl; } cout << "The average turnaround time is: " << float(sumtat) / float(n) << endl; cout << "The average waiting time is: " << float(sumwt) / float(n) << endl; } // void LRTF() { struct processes { int pid; int at; int bt; int ct; int tat; int wt; int rembt; }; int n, i, j, sumtat = 0, sumwt = 0, timeslice; cout << "Enter no of processes: "; cin >> n; cout << "Enter the timeslice: "; cin >> timeslice; struct processes arr[n]; struct processes k; // temporary structure used in swapping for (i = 0; i < n; i++) { cout << "For process " << i + 1 << ":" << endl; cout << "Arrival time: "; cin >> arr[i].at; cout << "Burst time: "; cin >> arr[i].bt; arr[i].rembt = arr[i].bt; arr[i].pid = i + 1; cout << endl; } //sorting the array of structures according to arrival time and if arrival time is same then sorting it according to processid for (i = 0; i < n; i++) { for (j = 0; j < n - 1; j++) { if (arr[j].at > arr[j + 1].at) { k = arr[j]; arr[j] = arr[j + 1]; arr[j + 1] = k; } else if (arr[j].at == arr[j + 1].at) { if (arr[j].pid > arr[j + 1].pid) { k = arr[j]; arr[j] = arr[j + 1]; arr[j + 1] = k; } } } } //finding the task which will be executed first int maxt, l = 0; maxt = arr[0].bt; for (i = 1; arr[i].at == arr[0].at; i++) { if (arr[i].bt > maxt) { maxt = arr[i].bt; l = i; } } k = arr[0]; arr[0] = arr[l]; arr[l] = k; int comptasks = 0, currtime = 0; l = 0; bool chk[n] = {false}; while (comptasks != n) { if (arr[l].at > currtime) { currtime = arr[l].at; } if (arr[l].rembt <= timeslice) { currtime += arr[l].rembt; arr[l].rembt = 0; arr[l].ct = currtime; comptasks++; } else { currtime += timeslice; arr[l].rembt -= timeslice; } maxt = arr[l].rembt; for (i = 0; i < n; i++) { if (arr[i].at <= currtime && arr[i].rembt > maxt) { maxt = arr[i].rembt; l = i; } else if (arr[i].at <= currtime && arr[i].rembt == maxt && arr[i].rembt != 0) { if (i < l) { l = i; } } } if (maxt == 0) { for (i = 0; i < n; i++) { if (arr[i].rembt > 0) { l = i; break; } } } } //finding the turnaround time and the waiting time for (i = 0; i < n; i++) { arr[i].tat = arr[i].ct - arr[i].at; arr[i].wt = arr[i].tat - arr[i].bt; sumtat += arr[i].tat; sumwt += arr[i].wt; } cout << "The table is as follows: (its shown according to the process that happens first) " << endl; cout << "\nProcess No.\tArrival Time\tBurst Time\tCompletion Time\t\tTurn-around Time\tWaiting Time\n"; for (i = 0; i < n; i++) { cout << arr[i].pid << "\t\t" << arr[i].at << "\t\t" << arr[i].bt << "\t\t" << arr[i].ct << "\t\t\t\t" << arr[i].tat << "\t\t" << arr[i].wt << endl; } cout << "The average turnaround time is: " << float(sumtat) / float(n) << endl; cout << "The average waiting time is: " << float(sumwt) / float(n) << endl; } //priority premptive struct Process { int processID; int burstTime; int tempburstTime; int responsetime; int arrivalTime; int priority; int outtime; int intime; }; // It is used to include all the valid and eligible // processes in the heap for execution. heapsize defines // the number of processes in execution depending on // the current time currentTime keeps a record of // the current CPU time. void insert(Process Heap[], Process value, int *heapsize, int *currentTime) { int start = *heapsize, i; Heap[*heapsize] = value; if (Heap[*heapsize].intime == -1) Heap[*heapsize].intime = *currentTime; ++(*heapsize); // Ordering the Heap while (start != 0 && Heap[(start - 1) / 2].priority > Heap[start].priority) { Process temp = Heap[(start - 1) / 2]; Heap[(start - 1) / 2] = Heap[start]; Heap[start] = temp; start = (start - 1) / 2; } } // It is used to reorder the heap according to // priority if the processes after insertion // of new process. void order(Process Heap[], int *heapsize, int start) { int smallest = start; int left = 2 * start + 1; int right = 2 * start + 2; if (left < *heapsize && Heap[left].priority < Heap[smallest].priority) smallest = left; if (right < *heapsize && Heap[right].priority < Heap[smallest].priority) smallest = right; // Ordering the Heap if (smallest != start) { Process temp = Heap[smallest]; Heap[smallest] = Heap[start]; Heap[start] = temp; order(Heap, heapsize, smallest); } } // This function is used to find the process with // highest priority from the heap. It also reorders // the heap after extracting the highest priority process. Process extractminimum(Process Heap[], int *heapsize, int *currentTime) { Process min = Heap[0]; if (min.responsetime == -1) min.responsetime = *currentTime - min.arrivalTime; --(*heapsize); if (*heapsize >= 1) { Heap[0] = Heap[*heapsize]; order(Heap, heapsize, 0); } return min; } // Compares two intervals according to staring times. bool compare(Process p1, Process p2) { return (p1.arrivalTime < p2.arrivalTime); } int prevtime = -1; // This function is responsible for executing // the highest priority extracted from Heap[]. void scheduling(Process Heap[], Process array[], int n, int *heapsize, int *currentTime) { if (heapsize == 0) return; Process min = extractminimum(Heap, heapsize, currentTime); min.outtime = *currentTime + 1; --min.burstTime; if (prevtime != *currentTime) { printf(" %d\t %d \n", *currentTime, min.processID); prevtime = *currentTime; } // If the process is not yet finished // insert it back into the Heap*/ if (min.burstTime > 0) { insert(Heap, min, heapsize, currentTime); return; } for (int i = 0; i < n; i++) if (array[i].processID == min.processID) { array[i] = min; break; } } // This function is responsible for // managing the entire execution of the // processes as they arrive in the CPU // according to their arrival time. void priority(Process array[], int n) { sort(array, array + n, compare); int totalwaitingtime = 0, totalbursttime = 0, totalturnaroundtime = 0, i, insertedprocess = 0, heapsize = 0, currentTime = array[0].arrivalTime, totalresponsetime = 0; Process Heap[4 * n]; // Calculating the total burst time // of the processes for (int i = 0; i < n; i++) { totalbursttime += array[i].burstTime; array[i].tempburstTime = array[i].burstTime; } printf("At\tProcess\n"); // Inserting the processes in Heap // according to arrival time do { if (insertedprocess != n) { for (i = 0; i < n; i++) { if (array[i].arrivalTime == currentTime) { ++insertedprocess; array[i].intime = -1; array[i].responsetime = -1; insert(Heap, array[i], &heapsize, &currentTime); } } } scheduling(Heap, array, n, &heapsize, &currentTime); ++currentTime; if (heapsize == 0 && insertedprocess == n) break; } while (1); for (int i = 0; i < n; i++) { totalresponsetime += array[i].responsetime; totalwaitingtime += (array[i].outtime - array[i].intime - array[i].tempburstTime); totalbursttime += array[i].burstTime; } printf("Average waiting time = %f\n", ((float)totalwaitingtime / (float)n)); printf("Average response time =%f\n", ((float)totalresponsetime / (float)n)); printf("Average turn around time = %f\n", ((float)(totalwaitingtime + totalbursttime) / (float)n)); } // Driver code void priority_premptive() { int n, i; cout << "Enter the number of processes: "; cin >> n; Process a[n]; for (i = 0; i < n; i++) { a[i].processID = i + 1; cout << "For process " << i + 1 << ":" << endl; cout << "Arrival time: "; cin >> a[i].arrivalTime; cout << "Burst time: "; cin >> a[i].burstTime; cout << "Piority: "; cin >> a[i].priority; cout << endl; } priority(a, n); return; } //hrrn struct node { int pname; int btime; int atime; int wtime; float rr = 0; } a[50]; void insert(int n) { int i; for (int i = 0; i < n; i++) { cout << "For process " << i + 1 << ":" << endl; cout << "Arrival time: "; cin >> a[i].atime; cout << "Burst time: "; cin >> a[i].btime; a[i].rr = 0; a[i].pname = i + 1; a[i].wtime = -a[i].atime; cout << endl; } } bool btimeSort(node a, node b) { return a.btime < b.btime; } bool atimeSort(node a, node b) { return a.atime < b.atime; } bool rrtimeSort(node a, node b) { return a.rr > b.rr; } void disp(int n) { sort(a, a + n, btimeSort); sort(a, a + n, atimeSort); int ttime = 0, i; int j, tArray[n]; for (i = 0; i < n; i++) { j = i; while (a[j].atime <= ttime && j != n) { j++; } for (int q = i; q < j; q++) { a[q].wtime = ttime - a[q].atime; a[q].rr = (float)(a[q].wtime + a[q].btime) / (float)a[q].btime; } sort(a + i, a + j, rrtimeSort); tArray[i] = ttime; cout << endl; ttime += a[i].btime; } tArray[i] = ttime; float averageWaitingTime = 0; float averageResponseTime = 0; float averageTAT = 0; cout << "\nProcess No.\tArrival Time\tBurst Time\tCompletion Time\t\tTurn-around Time\tWaiting Time\n"; for (i = 0; i < n; i++) { cout << 'P' << a[i].pname << "\t\t"; cout << a[i].atime << "\t\t"; cout << a[i].btime << "\t\t"; cout << tArray[i + 1] << "\t\t"; cout << tArray[i] - a[i].atime + a[i].btime << "\t\t"; averageTAT += tArray[i] - a[i].atime + a[i].btime; cout << a[i].wtime << "\t\t"; averageWaitingTime += tArray[i] - a[i].atime; cout << tArray[i] - a[i].atime << "\t\t"; averageResponseTime += tArray[i] - a[i].atime; cout << "\n"; } cout << "\n"; cout << "\n"; cout << "Average Response time: " << (float)averageResponseTime / (float)n << endl; cout << "Average Waiting time: " << (float)averageWaitingTime / (float)n << endl; cout << "Average TA time: " << (float)averageTAT / (float)n << endl; } void hrrn() { int nop, choice, i; cout << "Enter number of processes: "; cin >> nop; insert(nop); disp(nop); return; } //SRTF struct process_srtf { int pid; int arrival_time; int burst_time; int start_time; int completion_time; int turnaround_time; int waiting_time; int response_time; }; void srtf() { int n; struct process_srtf p[100]; float avg_turnaround_time; float avg_waiting_time; float avg_response_time; float cpu_utilisation; int total_turnaround_time = 0; int total_waiting_time = 0; int total_response_time = 0; int total_idle_time = 0; float throughput; int burst_remaining[100]; int is_completed[100]; memset(is_completed, 0, sizeof(is_completed)); cout << setprecision(2) << fixed; cout << "Enter the number of processes: "; cin >> n; for (int i = 0; i < n; i++) { cout << "For process " << i + 1 << ":" << endl; cout << "Arrival Time: "; cin >> p[i].arrival_time; cout << "Burst time" << ": "; cin >> p[i].burst_time; p[i].pid = i + 1; burst_remaining[i] = p[i].burst_time; cout << endl; } int current_time = 0; int completed = 0; int prev = 0; while (completed != n) { int idx = -1; int mn = 10000000; for (int i = 0; i < n; i++) { if (p[i].arrival_time <= current_time && is_completed[i] == 0) { if (burst_remaining[i] < mn) { mn = burst_remaining[i]; idx = i; } if (burst_remaining[i] == mn) { if (p[i].arrival_time < p[idx].arrival_time) { mn = burst_remaining[i]; idx = i; } } } } if (idx != -1) { if (burst_remaining[idx] == p[idx].burst_time) { p[idx].start_time = current_time; total_idle_time += p[idx].start_time - prev; } burst_remaining[idx] -= 1; current_time++; prev = current_time; if (burst_remaining[idx] == 0) { p[idx].completion_time = current_time; p[idx].turnaround_time = p[idx].completion_time - p[idx].arrival_time; p[idx].waiting_time = p[idx].turnaround_time - p[idx].burst_time; p[idx].response_time = p[idx].start_time - p[idx].arrival_time; total_turnaround_time += p[idx].turnaround_time; total_waiting_time += p[idx].waiting_time; total_response_time += p[idx].response_time; is_completed[idx] = 1; completed++; } } else { current_time++; } } int min_arrival_time = 10000000; int max_completion_time = -1; for (int i = 0; i < n; i++) { min_arrival_time = min(min_arrival_time, p[i].arrival_time); max_completion_time = max(max_completion_time, p[i].completion_time); } avg_turnaround_time = (float)total_turnaround_time / n; avg_waiting_time = (float)total_waiting_time / n; avg_response_time = (float)total_response_time / n; // cpu_utilisation = ((max_completion_time - total_idle_time) / (float)max_completion_time) * 100; // throughput = float(n) / (max_completion_time - min_arrival_time); cout << endl << endl; cout << "\nProcess No.\tArrival Time\tStart Time\tBurst Time\tCompletion Time\t\tTurn-around Time\tWaiting Time\tResponse Time\n"; for (int i = 0; i < n; i++) { cout << p[i].pid << "\t\t" << p[i].arrival_time << "\t\t" << p[i].burst_time << "\t\t" << p[i].start_time << "\t\t" << p[i].completion_time << "\t\t\t\t" << p[i].turnaround_time << "\t\t" << p[i].waiting_time << "\t\t" << p[i].response_time << "\t\t" << "\n" << endl; } cout << "Average Turnaround Time = " << avg_turnaround_time << endl; cout << "Average Waiting Time = " << avg_waiting_time << endl; cout << "Average Response Time = " << avg_response_time << endl; }
true
66d18e5dfbd6d22420853e49046eaf0c44129c69
C++
MintYiqingchen/learnByCode
/c++/template/variableTuple.cpp
UTF-8
2,363
3.3125
3
[]
no_license
#include <memory> #include <vector> #include <iostream> #include <numeric> #include <utility> using namespace std; // test 1 namespace test { template <typename T, typename... Args> inline unique_ptr<T> make_unique(Args&&... args) { return unique_ptr<T>(new T(forward<Args>(args)...)); } } // test 2 template <typename T> constexpr auto sum(T x) { return x; } template <typename T1, typename T2, typename... Targ> constexpr auto sum(T1 x, T2 y, Targ... args) { return sum(x + y, args...); } // test 3 template <typename... Args> auto compose() { return [](auto&&... x) {return compose<Args...>();}; } template <typename F> auto compose(F f) { return [f](auto&&... x) { return f(forward<decltype(x)>(x)...); }; } template <typename F, typename... Args> auto compose(F f, Args... other) { return [f, other...](auto&&... x) { return f(compose(other...)(forward<decltype(x)>(x)...)); }; } template <template <typename, typename> class OutContainer = vector, typename F, class R> auto fmap(F&& f, R&& inputs) { typedef decay_t<decltype(f(*inputs.begin()))> result_type; OutContainer<result_type, allocator<result_type>> result; for (auto&& item : inputs) { result.push_back(f(item)); } return result; } // test 4 constexpr int count_bits(unsigned char value) { if (value == 0) { return 0; } else { return (value & 1) + count_bits(value >> 1); } } template <size_t... V> struct bit_count_t { unsigned char count[sizeof...(V)] = {static_cast<unsigned char>(count_bits(V))...}; }; template <size_t... V> bit_count_t<V...> get_bit_count(index_sequence<V...>) { return bit_count_t<V...>(); } auto bit_count = get_bit_count( make_index_sequence<256>()); int main(int argc, char** argv) { auto a = test::make_unique<vector<int>>(100, 1); auto b = sum(1,1.2, 1.3,10, -2); cout << b << endl; // test 3 auto square_list = [](auto&& container) { return fmap([](int x) { return x * x; }, container);}; auto sum_list = [](auto&& container) { return accumulate(container.begin(),container.end(), 0);}; auto square_sum = compose(sum_list, square_list); auto c = vector<int>{1,2,3,4}; cout << square_sum(c) << endl; // test 4 auto bitStruct = get_bit_count(make_index_sequence<256>()); cout << sizeof(bitStruct.count) << endl; }
true
5b502e33330149d38c1add2a780b83c3b1918b60
C++
ethanmick/Blowfish482
/Blowfish.cpp
UTF-8
4,661
2.84375
3
[]
no_license
#include "Blowfish.h" #include <iostream> #include <cmath> #include <cstring> using namespace std; Blowfish::Blowfish() { hexStart = 0; } uint32_t Blowfish::blockSize(){ return 8; } uint32_t Blowfish::keySize(){ //56 is the maximum, this is variable return 8; } void Blowfish::setKey(uint8_t* key){ for (int i = 0; i < 18; i++) { pArray[i] = computeHexPi(); } for (int i=0; i < 256; i++) { s1[i] = computeHexPi(); } for (int i=0; i < 256; i++) { s2[i] = computeHexPi(); } for (int i=0; i < 256; i++) { s3[i] = computeHexPi(); } for (int i=0; i < 256; i++) { s4[i] = computeHexPi(); } uint32_t key_size = keySize(); uint32_t subkeyCounter = 0; for (int pI=0; pI < 18; pI++) { uint32_t subkey = 0; for (int i=0; i < 4; i++, subkeyCounter++) { if (subkeyCounter >= key_size) { subkeyCounter = 0; } subkey <<= 8; subkey |= (uint32_t)key[subkeyCounter]; } pArray[pI] ^= subkey; } uint8_t* zeros = new uint8_t[ 8 ]; for( int i = 0; i < 8; i++ ){ zeros[ i ] = 0; } for (int i=0; i < 18; i += 2) { encrypt(zeros); pArray[i] = pack32BitWord(zeros, 0); pArray[i+1] = pack32BitWord(zeros, 4); } for (int i=0; i < 256; i += 2) { encrypt(zeros); s1[i] = pack32BitWord(zeros, 0); s1[i+1] = pack32BitWord(zeros, 4); } for (int i=0; i < 256; i += 2) { encrypt(zeros); s2[i] = pack32BitWord(zeros, 0); s2[i+1] = pack32BitWord(zeros, 4); } for (int i=0; i < 256; i += 2) { encrypt(zeros); s3[i] = pack32BitWord(zeros, 0); s3[i+1] = pack32BitWord(zeros, 4); } for (int i=0; i < 256; i += 2) { encrypt(zeros); s4[i] = pack32BitWord(zeros, 0); s4[i+1] = pack32BitWord(zeros, 4); } } void Blowfish::encrypt(uint8_t* text){ uint32_t xL, xR, temp; xL = pack32BitWord( text, 0 ); xR = pack32BitWord( text, 4 ); for( int i = 0; i <= 15; i++ ){ xL ^= pArray[ i ]; xR ^= F( xL ); temp = xL; xL = xR; xR = temp; } temp = xL; xL = xR; xR = temp; xR ^= pArray[ 16 ]; xL ^= pArray[ 17 ]; //merge into xR and xL into xL uint64_t final = 0; final |= xL; final <<= 32; final |= xR; //now final is the ciphertext, need to convert to ascii text[ 0 ] = final >> 56; text[ 1 ] = final >> 48; text[ 2 ] = final >> 40; text[ 3 ] = final >> 32; text[ 4 ] = final >> 24; text[ 5 ] = final >> 16; text[ 6 ] = final >> 8; text[ 7 ] = final; } uint32_t Blowfish::F( uint32_t input ){ uint8_t a, b, c, d; d = (uint8_t) input; input >>= 8; c = (uint8_t) input; input >>= 8; b = (uint8_t) input; input >>= 8; a = (uint8_t) input; return ( ( s1[ a ] + s2[ b ] ) ^ s3[ c ] ) + s4[ d ]; } uint32_t Blowfish::pack32BitWord( uint8_t* input, uint32_t startVal ){ uint32_t result = 0; for( unsigned int i = startVal; i < startVal + 4; i++ ){ result <<= 8; result |= input[ i ]; } return result; } uint32_t Blowfish::computeHexPi() { double s1 = series(hexStart, 1); double s2 = series(hexStart, 4); double s3 = series(hexStart, 5); double s4 = series(hexStart, 6); double pi = (4.0 * s1) - (2.0 * s2) - s3 - s4; pi = pi - (int)pi + 1.0; uint32_t pihex= 0; for (int i=0; i < 8; i++) { pi *= 16; uint32_t hVal = floor(pi); pihex <<= 4; pihex |= hVal; pi -= hVal; } hexStart += 8; return pihex; } double Blowfish::series(uint32_t d, uint32_t j) { double sum = 0; for ( unsigned int k = 0; k < d; k++ ) { sum += (binaryExp(16, (d - k), (8 * k + j))) / (8 * k + j); sum = sum - (int)sum; } for ( unsigned int k = d; k < d + 100; k++ ) { sum += pow(16.0, (double) d - k) / (8 * k + j); sum = sum - (int)sum; } return sum; } double Blowfish::binaryExp(int b, int n, double mod) { if (mod == 1.0) { return 0; } // Largest power of 2 less than n double t = pow(2, floor(log2(n))); double r = 1; while (t >= 1) { if (n >= t) { r = fmod(b * r, mod); n = n - t; } t = t / 2; if (t >= 1) { r = fmod(r * r, mod); } } return r; }
true
54dff18e0e92589ce104112c9700b511459492da
C++
patrickfreed/regency
/world/Region.cpp
UTF-8
4,102
3.078125
3
[]
no_license
#include <regency/world/Region.h> #include <regency/Game.h> namespace regency::world { Region::Region(Location a, Location b, bool checks): _world(Game::get_instance().get_world()), _a(a), _b(b) { _min_x = std::min(_a.get_x(), _b.get_x()); _min_y = std::min(_a.get_y(), _b.get_y()); _max_x = std::max(_a.get_x(), _b.get_x()); _max_y = std::max(_a.get_y(), _b.get_y()); if (checks) { _using_marks = true; _marks.resize(size()); } } Region& Region::operator=(const Region& other) { _min_x = other._min_x; _max_x = other._max_x; _a = other._a; _b = other._b; _using_marks = other._using_marks; _marks = other._marks; _min_y = other._min_y; _max_y = other._max_y; return *this; } bool Region::contains(const Location& loc) const { return _min_x <= loc.get_x() && loc.get_x() <= _max_x && _min_y <= loc.get_y() && loc.get_y() <= _max_y; } int Region::get_max_x() { return _max_x; } int Region::get_min_x() { return _min_x; } int Region::get_max_y() { return _max_y; } int Region::get_min_y() { return _min_y; } int Region::size() { return (_max_x - _min_x + 1) * (_max_y - _min_y + 1); } bool Region::is_marked(int x, int y)const { if (!_using_marks) { return false; } int width = _max_x - _min_x + 1; return _marks[(x - _min_x) % width + (y - _min_y) * width]; } bool Region::is_marked(const Tile &t) { return is_marked(t.get_location().get_x(), t.get_location().get_y()); } void Region::set_marked(int x, int y, bool mark) { if (!_using_marks) { _marks.resize(size()); _using_marks = true; } int width = _max_x - _min_x + 1; _marks[(x - _min_x) % width + (y - _min_y) * width] = mark; } void Region::set_marked(const Tile &t, bool mark) { set_marked(t.get_location().get_x(), t.get_location().get_y(), mark); } int Region::get_number_marked() const { int num = 0; for (int x = _min_x; x <= _max_x; ++x) { for (int y = _min_y; y <= _max_y; ++y) { if (is_marked(x, y)) { ++num; } } } return num; } Region::RegionIterator Region::begin() const { return RegionIterator(*this); } Region::RegionIterator Region::end() const { RegionIterator it(*this); it._y = it._max_y + 1; it._x = it._min_x; return it; } Location Region::get_closest_point(Location other) { int x = std::min(std::max(_min_x, other.get_x()), _max_x); int y = std::min(std::max(_min_y, other.get_y()), _max_y); return Location{x, y}; } bool Region::is_on_border(const Location& l) { return contains(l) && (l.get_y() == _min_y || l.get_y() == _max_y || l.get_x() == _max_x || l.get_x() == _min_x); } Region::RegionIterator::RegionIterator(const Region& region) { _world = &region._world; _x = region._min_x; _y = region._min_y; _min_x = _x; _min_y = _y; _max_x = region._max_x; _max_y = std::max(region._a.get_y(), region._b.get_y()); } Region::RegionIterator &Region::RegionIterator::operator++() { _x++; if (_x > _max_x) { _x = _min_x; _y++; } } Tile& Region::RegionIterator::operator*() { if (!_world || _y > _max_y) { throw std::runtime_error("dereferencing end iterator"); } return _world->get_tile(_x, _y); } bool Region::RegionIterator::operator==(const Region::RegionIterator &other) const { return other._x == _x && other._y == _y && other._world == _world && other._min_x == _min_x && other._max_x == _max_x && other._max_y == _max_y && other._min_y == _min_y; } bool Region::RegionIterator::operator!=(const Region::RegionIterator &other) const { return !(other == *this); } int Region::get_width() { return _max_x - _min_x + 1; } int Region::get_height() { return _max_y - _min_y + 1; } bool Region::intersects(Region& other) { if (_min_x > other._max_x || other._min_x > _max_x) { return false; } else return !(_min_y > other._max_y || other._min_y > _max_y); } }
true
b3f56d29340c5f2c6fbfebf6882309fa5c81bb6f
C++
zhufangda/Telecom-Paristech
/IGR201/QT/paintExample/paintarea.cpp
UTF-8
3,892
2.546875
3
[ "Apache-2.0" ]
permissive
#include "paintarea.h" #include <QApplication> #include<iostream> PaintArea::PaintArea(QWidget *parent):QWidget(parent) { QPalette pal = palette(); pal.setColor(QPalette::Background, Qt::white); this->setAutoFillBackground(true); this->setPalette(pal); this->setMinimumSize(500,400); myPenColor=Qt::blue; myPenWidth=3; } void PaintArea::paintEvent(QPaintEvent *event) { //std::cout << pens.length(); QWidget::paintEvent(event); QPainter painter(this); myPen.setColor(myPenColor); myPen.setWidth(myPenWidth); painter.setPen(myPen); //painter.drawPath(xxx); //Qlist<QPainterPath> for(int i=0; i<paths.size();i++){ painter.setPen(pens[i]); painter.drawPath(paths[i]); } switch(state){ case 1 : path = QPainterPath(); path.moveTo(startPoint); path.lineTo(endPoint); painter.drawPath(path); break; case 2 : path = QPainterPath(); path.moveTo(startPoint); path.addEllipse(startPoint.x(), startPoint.y(), endPoint.x() - startPoint.x(), endPoint.y() - startPoint.y()); painter.drawPath(path); break; case 3 : path = QPainterPath(); path.moveTo(startPoint); path.addRect(startPoint.x(), startPoint.y(), endPoint.x() - startPoint.x(), endPoint.y() - startPoint.y()); painter.drawPath(path); break; default: break; } } /* for(int i=0; i<_lines.size();i++){ const QVector<QPoint> &line = _lines.at(i); const QVector<QPen> &penAttribute = _pensAttribute.at(i); for(int j=0;j<line.size()-1;j++){ painter.setPen(penAttribute.at(j)); painter.drawLine(line.at(j), line.at(j+1)); } } }*/ void PaintArea::setPenColor(const QColor &newColor){ myPenColor=newColor; } void PaintArea::setPenWidth(int newWidth){ myPenWidth=newWidth; } void PaintArea::setState(int choice){ state=choice; } void PaintArea::mousePressEvent(QMouseEvent *event){ if(event->button() == Qt::LeftButton){ startPoint = event->QMouseEvent::pos(); } /* //每次点击鼠标都会为之绘画一条新的线,并将该线的起点位置添加到_lines中 QVector<QPoint> line; QVector<QPen> penAttribute; _lines.append(line); _pensAttribute.append(penAttribute); //记录下该条线当前的位置 QVector<QPoint> &lastLine = _lines.last(); lastLine.append(event->pos()); QVector<QPen> &lastPenAttribute = _pensAttribute.last(); lastPenAttribute.append(pen); */ } void PaintArea::mouseMoveEvent(QMouseEvent *event){ if(event->type() == QEvent::MouseMove){ QMouseEvent *mouseEvent = static_cast<QMouseEvent*>(event); endPoint = mouseEvent->pos(); } update(); /*if(_lines.size() == 0) { QVector<QPoint> line; QVector<QPen> penAttribute; _lines.append(line); _pensAttribute.append(penAttribute); } QVector<QPoint> &lastLine = _lines.last(); QVector<QPen> &lastPenAttribute=_pensAttribute.last(); //记录该条线当前的位置 lastLine.append(event->pos()); lastPenAttribute.append(pen); //强制重绘 update(); */ } void PaintArea::mouseReleaseEvent(QMouseEvent *event){ if(event->button() == Qt::LeftButton){ paths.append(path); pens.append(myPen); } /* QVector<QPoint> &lastLine = _lines.last(); QVector<QPen> &lastPenAttribute = _pensAttribute.last(); lastLine.append(event->pos()); lastPenAttribute.append(pen); */ }
true
8d5e34e6e9ebcaf4cf2d02bb5518b945f6d5272e
C++
tvphu20th2/baitapOOP
/QL_Sach.cpp
UTF-8
2,324
2.53125
3
[]
no_license
#include <conio.h> #include <stdio.h> #include <math.h> #include <string.h> #include<stdlib.h> #include <iomanip> #include <iostream> using namespace std; #define MAX_NXB 50 //Class Nhanvien class QLSach { protected: char MaSach[12]; char NgayNhap[12]; float DonGia; int SoLuong; char NXB[50]; float ThanhTien; public: QLSach(); virtual void Nhap(); void Xuat(); virtual void TinhTien()=0; //Ham thuan ao //...bo sung code }; //Class Bien che class SachGK: public QLSach { protected: int TinhTrang; //1-Moi; 0-Cu public: SachGK(); void TinhTien(); void Nhap(); //...bo sung code }; //Dinh nghia lop SachTK class SachTK : public QLSach { protected: float Thue; public: SachTK(); void Nhap(); void TinhTien(); //...bo sung code }; //Dinh nghia ham thanh vien cho lop QLSach QLSach::QLSach() { strcpy(MaSach,""); strcpy(NgayNhap,""); strcpy(NXB,""); ThanhTien=DonGia=SoLuong=0; } void QLSach::Nhap() { //bo sung code } void QLSach::Xuat() { cout<<"MS: "<<MaSach<<",NG: "<<NgayNhap; cout<<",DG: "<<DonGia<<",SL: "<<SoLuong; cout<<",TT: "<<ThanhTien<<"NXB: "<<NXB<<endl; } //Dinh nghia ham thanh vien cho lop SachGK SachGK::SachGK(): QLSach() { //QLSach::QLSach(); TinhTrang=1; //mac nhien la Sach moi } void SachGK::TinhTien() { if (TinhTrang==1) ThanhTien=SoLuong*DonGia; else ThanhTien=SoLuong*DonGia*0.5; } void SachGK::Nhap() { //...bo sung code } //Cac ham thanh vien trong lop SachTK SachTK::SachTK(): QLSach() { Thue=0; } void SachTK::Nhap() { //...bo sung code } void SachTK::TinhTien() { ThanhTien= SoLuong*DonGia + Thue; } int main() { QLSach *MSach[100]; int i=0,n=0; char Chon,Loai, nxb_ct[50]; cout<<setiosflags(ios::fixed)<<setprecision(2); cout<<"Nhap thong tin cho cac loai sach"<<endl; do { cout<<"Sack Giao khoa hay Sach Tham khao (G/T)? "; cin>>Loai; Loai=toupper(Loai); if (Loai=='G') { //...bo sung code } else { //...bo sung code } n++; //tang len so luong sach cout<<"Tiep tuc (C/K)? "; cin>>Chon; Chon=toupper(Chon); if ((n==100)||(Chon=='K')) break; } while (1); //...bo sung code getch(); return 1; }
true
f8e650ca87d01577e2e20dbd2118759c01c471a2
C++
zhrv/heat_2d
/src/methods/heat_bnd.cpp
WINDOWS-1251
2,269
2.796875
3
[]
no_license
#include "heat_bnd.h" const char* HeatBoundary::TYPE_CONST = "BOUND_CONST"; const char* HeatBoundary::TYPE_FLOW = "BOUND_FLOW"; const char* HeatBoundary::TYPE_NOFLOW = "BOUND_NOFLOW"; HeatBoundary* HeatBoundary::create(TiXmlNode* bNode) { HeatBoundary * b = 0; TiXmlNode* node = 0; TiXmlNode* node1 = 0; const char * type = bNode->FirstChild("type")->ToElement()->GetText(); if (strcmp(type, HeatBoundary::TYPE_CONST) == 0) { b = new HeatBndConst(); bNode->ToElement()->Attribute("edgeType", &b->edgeType); b->parCount = 1; b->par = new double[1]; node = bNode->FirstChild("parameters"); node1 = node->FirstChild("T"); if (!node1) throw Exception("Parameter 'T' isn't specified for BOUND_FLOW.", Exception::TYPE_BOUND_NOPAR); node1->ToElement()->Attribute("value", &b->par[0]); } if (strcmp(type, HeatBoundary::TYPE_NOFLOW) == 0) { b = new HeatBndNoFlow(); bNode->ToElement()->Attribute("edgeType", &b->edgeType); b->parCount = 0; b->par = NULL; } if (strcmp(type, HeatBoundary::TYPE_FLOW) == 0) { b = new HeatBndFlow(); bNode->ToElement()->Attribute("edgeType", &b->edgeType); b->parCount = 2; b->par = new double[2]; node = bNode->FirstChild("parameters"); node1 = node->FirstChild("factor"); if (!node1) throw Exception("Parameter 'factor' isn't specified for BOUND_FLOW.", Exception::TYPE_BOUND_NOPAR); node1->ToElement()->Attribute("value", &b->par[0]); // factor*(dT/dX)=flowValue node1 = node->FirstChild("flowValue"); if (!node1) throw Exception("Parameter 'flowValue' isn't specified for BOUND_FLOW.", Exception::TYPE_BOUND_NOPAR); node1->ToElement()->Attribute("value", &b->par[1]); } const char * name = bNode->FirstChild("name")->ToElement()->GetText(); strcpy(b->name, name); if (!b) { throw Exception("Unknown bountary type '%s' specified.", Exception::TYPE_BOUND_UNKNOWN); } return b; } void HeatBndConst::run(Param& pL, Param& pR) { pR.T = par[0]; pR.u = pL.u; pR.v = pL.v; } void HeatBndFlow::run(Param& pL, Param& pR) // @todo - { pR.T = pL.T+par[1]/par[0]; pR.u = pL.u; pR.v = pL.v; } void HeatBndNoFlow::run(Param& pL, Param& pR) { pR.T = pL.T; pR.u = pL.u; pR.v = pL.v; }
true
ee565ea6ded26ca2b301cdeaa3984bf667b75d89
C++
deathcod/mycode
/My_Algorithmic_CODES/DP_0-1knapsack.cpp
UTF-8
718
2.640625
3
[]
no_license
/* 0-1 knapscak by chinmay rakshit date:20/11/2015 */ #include <bits/stdc++.h> int max(int a,int b) { return(a>b)?a:b; } int main() { int dp[101][101]={0},w[101]={0},val[101]={0},n,m; scanf("%d %d",&n,&m); for(int i=1;i<=m;i++) scanf("%d %d",&w[i],&val[i]); for(int i=1;i<=m;i++) { for(int j=1;j<=n;j++) { if(w[i]<=j) dp[i][j]=max(dp[i-1][j-w[i]]+val[i],dp[i-1][j]); else dp[i][j]=dp[i-1][j]; } } // row items and column is weight..... for(int i=0;i<=m;i++) { for(int j=0;j<=n;j++) printf("%d ",dp[i][j]); printf("\n"); } printf("%d\n",dp[m][n] ); return 0; }
true
ee74de25ca38acd421c554ad4fec30497333b8d5
C++
KaPrimov/cpp-courses
/Advance/d_classMembers/e_lectures/LecturesMain.cpp
UTF-8
843
2.9375
3
[ "MIT" ]
permissive
#include <iostream> #include <vector> #include <set> #include <map> #include "ResourceType.h" #include "Resource.h" #include "Lecture.h" int main() { using SoftUni::Resource; using SoftUni::Lecture; using SoftUni::ResourceType; Lecture lecture; std::map<ResourceType, int> numberOfResourcesByType; int numResources; std::cin >> numResources; for (int i = 0; i < numResources; i++) { Resource r; std::cin >> r; lecture << r; } std::cout << "... by id:" << std::endl; for (const Resource& r : lecture) { std::cout << r << std::endl; } std::cout << "... by type:" << std::endl; std::vector<ResourceType> resourceTypes; resourceTypes << lecture; for (ResourceType type : resourceTypes) { std::cout << type << ": " << lecture[type] << std::endl; } return 0; }
true
b3ecf3790f8d10a151f03a2eafb3b94925521861
C++
asnows/opencv_vs2013
/opencv_algorithm/opencv_algorithm/fpga_imgsharp.cpp
UTF-8
971
2.640625
3
[]
no_license
#include"include.h" void laplacian_sharp(cv::Mat srcImg, cv::Mat dstImg) { int lalp_delt1; int lalp_delt2; int value; cv::Mat tmpImg(srcImg.rows,srcImg.cols,CV_8U); unsigned int rows = srcImg.rows; unsigned int cols = srcImg.cols; for (int y = 1; y < rows - 1; y++) { for (int x = 1; x < cols - 1; x++) { lalp_delt1 = srcImg.at<unsigned char>(y - 1, x - 1) + srcImg.at<unsigned char>(y - 1, x) + srcImg.at<unsigned char>(y - 1, x + 1) + srcImg.at<unsigned char>(y, x - 1) + srcImg.at<unsigned char>(y, x + 1) + srcImg.at<unsigned char>(y + 1, x - 1) + srcImg.at<unsigned char>(y + 1, x) + srcImg.at<unsigned char>(y + 1, x + 1); lalp_delt2 = 8 * srcImg.at<unsigned char>(y, x) - lalp_delt1; if (lalp_delt2 < 0) { lalp_delt2 = 0; } lalp_delt2 = srcImg.at<unsigned char>(y, x) + lalp_delt2; if (lalp_delt2 > 255) { lalp_delt2 = 255; } dstImg.at<unsigned char>(y, x) = lalp_delt2; } } }
true
6fe9076099c478f3735fa0707889e27be022449b
C++
TrueElement/CPlusPlus
/Simple Game/include/Creature.h
UTF-8
2,391
3.28125
3
[]
no_license
#ifndef CREATURE_H #define CREATURE_H #include <iostream> class Room; /* * Creature Superclass Declaration */ class Creature { public: Creature(); ~Creature(); void print(); void performAction(bool type); void speak(bool pos_neg); bool move(int direction); bool moveRoom(Room *toMove); void look(); int getName(); void setName(int creature_name); int getType(); void setType(int creature_type); Room * getCurrentRoom(); void setCurrentRoom(Room *new_room); void setCurrentRoomName(int room_name); int getCurrentRoomName(); bool moveOnStateChange(); bool processStateChange(); void commandClean(); void commandDirty(); private: int type; int currentRoomName; int name; Room *current_room; }; /* * Animal Subclass Declaration */ class Animal : public Creature { public: Animal(); ~Animal(); void speak(bool pos_neg); void print(); bool move(int direction); bool checkRoom(); void enteringRoom(); bool processStateChange(); bool processCommand(std::string *command); bool moveOnStateChange(); bool moveRoom(Room *room); void processInitialState(); void commandClean(); void commandDirty(); }; /* * NPC Subclass Declaration */ class NPC: public Creature { public: NPC(); ~NPC(); void speak(bool pos_neg); void print(); bool move(int direction); bool checkRoom(); bool processStateChange(); bool processCommand(std::string *command); bool moveOnStateChange(); void processInitialState(); bool moveRoom(Room *room); void commandClean(); void commandDirty(); void enteringRoom(); }; /* * PC Subclass Declaration */ class PC : public Creature { public: PC(); ~PC(); void decrementRespect(); int getRespect(); void setRespect(int new_respect); void modRespect(int modify); void print(); bool move(int direction); void printMoveFail(std::string direction); void printMoveSuccess(std::string direction); void look(); void look(std::string *direction); bool commandClean(); bool commandDirty(); private: int respect; bool moveNorth(); bool moveSouth(); bool moveEast(); bool moveWest(); }; #endif
true
272ef7ccac301f85596c51b4de9703eb60f87188
C++
JasbirCodeSpace/du-CS-4th-Sem-Algorithms
/Practicals CPP files/selection sort/SLSRT100.CPP
UTF-8
999
2.8125
3
[]
no_license
#include<stdio.h> #include<conio.h> #include<time.h> #include<limits.h> #include<stdlib.h> #include<fstream.h> double selsort(int [],int); void main() { clrscr(); time_t t; fstream f; f.open("abc.txt",ios::out); srand((unsigned) time(&t)); int Test; int *A; int n,size=20; double counter; cout<<"Number of test cases:"; scanf("%d",&Test); while(Test--) { size=size+10; n=size; A=new int[n]; for(int i=0;i<n;++i) A[i]=rand()%INT_MAX+INT_MIN ; counter=selsort(A,n); printf("\n%lf",counter); f<<"\n"; f<<n; f<<"\t"; f<<counter; delete A; } getch(); } double selsort(int A[],int n) { int pos,temp; double counter=0; //pos to store current pos of min element ,counter for no. of comparisons for(int i=0;i<n-1;++i) { pos=i; for(int j=i+1;j<n;j++) { if(A[j]<A[pos]) { pos=j; counter++; } else counter++; } temp=A[i]; A[i]=A[pos]; A[pos]=temp; } return counter; }
true
6679b8ddef601edfe4d86fff13cee83b52ed47e0
C++
amanmaldar/LinuxPerf
/main.cpp
UTF-8
840
3.328125
3
[]
no_license
//new #include <iostream> #include <cstdlib> #include <vector> #include <ctime> using namespace std; void bar(); void foo(); vector <int> data; vector <int> ans; int lenght = 20000; int sum = 0; void foo(void) { for(int i = 0; i < lenght ; i++){ sum = 0; for(int j = 0; j < lenght ; j++){ sum += data.at(j); } ans.push_back(sum); //this will be same all the time } } void bar(void) { for(int i = 0; i < lenght ; i++){ sum = 0; for(int j = 0; j < lenght ; j++){ sum += data.at(j); } ans.push_back(sum); //this will be same all the time } foo(); //calls foo } int main() { for(int i = 0; i < lenght ; i++){ data.push_back((rand() % 5) + 1); } bar(); return 0; } /* for(int i = 0; i < lenght ; i++){ sum += data.at(i); } cout << "sum = " << sum << endl; */
true
ea4ee1e4249332fcddab83aa39f65f0e2b5d5e6d
C++
cedricxs/LeetCode
/56-merge-intervals.cpp
UTF-8
1,009
3.078125
3
[]
no_license
/*author : cedricxs *level : middle */ /** * Definition for an interval. * struct Interval { * int start; * int end; * Interval() : start(0), end(0) {} * Interval(int s, int e) : start(s), end(e) {} * }; */ static const auto _____ = []() { ios::sync_with_stdio(false); cin.tie(nullptr); return nullptr; }(); class Solution { public: vector<Interval> merge(vector<Interval>& intervals) { vector<Interval>res;if(intervals.empty())return res; sort(intervals.begin(),intervals.end(),[&](Interval a,Interval b)->bool{return a.start<b.start;}); bool alive[intervals.size()]; memset(alive,true,intervals.size()*sizeof(bool)); for(int i=0;i<intervals.size();) {if(alive[i]){ Interval temp=intervals[i]; while(temp.end>=intervals[i].start&&i<intervals.size()){temp.end=max(temp.end,intervals[i].end);alive[i]=false;i++;} res.push_back(temp);} } return res; } };
true
12fbdae650e49730457a6d0dece65e20262a34ae
C++
eriqwalker/algo
/Assign_01/assign_01/rgi.cc
UTF-8
1,076
3.328125
3
[]
no_license
/* * Eriq Walker * z1908120 * CSCI-340-2 * * I certify that this is my own work and where appropriate an extension * of the starter code provided for the addignment. * * */ #include "rgi.h" // Add needed constants const int VEC_SIZE = 200, LOW = 1, HIGH = 10000, SEED = 1; // Generates and adds the random numbers to our vector void genRndNums(vector<int> &v) { srand(SEED); for(int i = 0; i < VEC_SIZE; i++) { v[i] = rand()%((HIGH-LOW)+1)+LOW; } } // Prints all the items in our vector with a set width and // output design void printVec(const vector<int> &v) { const int NO_ITEMS = 12, ITEM_W = 5; int count = 0; for (int i = 0; i < VEC_SIZE; i++) { if (count == NO_ITEMS) { count = 0; cout << endl; } cout << setw(ITEM_W) << v[i] << ' '; count++; } cout << endl; } int main() { vector<int> v(VEC_SIZE); genRndNums(v); // Sorts our vector using STL sort sort(v.begin(), v.end()); printVec(v); return 1; }
true
b5642110b9f81af70c3ba04996d266d768f01106
C++
Martisum/Algorithm
/邻接表建图深搜(实例)/adjacency list.cpp
GB18030
773
2.671875
3
[]
no_license
#include<cstdio> #include<iostream> using namespace std; const int maxm=1001; int p,s,a,b; struct edge{ int u,v,next; }e[maxm]; int head[maxm],js; int book[maxm]; void addedge(int u,int v){ e[++js].u=u; e[js].v=v; e[js].next=head[u]; head[u]=js; return; } void dfs(int x){ book[x]=1; for(int i=head[x];i;i=e[i].next){ if(book[e[i].v]!=1){ cout<<e[i].u<<"to"<<e[i].v<<endl; dfs(e[i].v); } } return; } int main(){ freopen("ain.txt","r",stdin); cin>>p>>s; for(int i=1;i<=s;i++){ cin>>a>>b; addedge(a,b); } freopen("CON","r",stdin); int start; cin>>start; dfs(start); // for(int i=1;i<=p;i++){ // cout<<""<<i<<"ȥеΪ"; // for(int j=head[i];j;j=e[j].next) cout<<e[j].v<<" "; // cout<<endl; // } return 0; }
true
50cb1bb83c1e8bf0b197b0970db6e4434fd6b1d6
C++
wisdom-weaver/c_cpp_mini
/data-structures_using_cpp/q-queue/queue_using_stack/queue_using_stack_rec_pop.cpp
UTF-8
785
3.4375
3
[]
no_license
#include "bits/stdc++.h" using namespace std; class queue_s2{ stack<int> s1; public: void push(int x){ s1.push(x); } int pop(){ if(s1.empty()){ cout<<"Queue is empty"<<endl; return -1; } // get the top element int x = s1.top(); s1.pop(); // base case=> if stack is empty then return the elem x if(s1.empty()) return x; // recursive case => call pop to get the next elem and so on till base case is hit int item = pop(); // finally push back all the elements into the stack s1.push(x); return item; } bool empty(){ return s1.empty(); } }; int main(){ queue_s2 q; int i=0, n=5; while(i<n) q.push(++i); i=0; do cout<<q.pop()<<endl; while(++i<n+1); return 0; }
true
b5a1e0793d60527375fde7295cf88107a145a21f
C++
uwuser/MCsim
/IntegrationWithMacSim/src/MCsim/system/PipeCAS/RequestScheduler_PipeCAS.h
UTF-8
2,370
2.546875
3
[ "MIT" ]
permissive
#ifndef REQUESTSCHEDULER_PIPECAS_H #define REQUESTSCHEDULER_PIPECAS_H #include "../../src/RequestScheduler.h" namespace MCsim { class RequestScheduler_PipeCAS: public RequestScheduler { private: bool newRound; bool firstACT; RequestType bundlingType; vector<unsigned int> scheduledCmdQueue; bool isSchedulable(Request* request, bool open) { if(requestorCriticalTable.at(scheduledRequest->requestorID)== true) { for(unsigned int index=0; index<scheduledCmdQueue.size(); index++) { if(commandQueue[scheduledCmdQueue[index]]->getSize(true) < 2) return false; } } return true; } public: RequestScheduler_PipeCAS(std::vector<RequestQueue*>&requestQueues, std::vector<CommandQueue*>& commandQueues, const std::map<unsigned int, bool>& requestorTable): RequestScheduler(requestQueues, commandQueues, requestorTable) { newRound = true; bundlingType = RequestType::DATA_READ; } void requestSchedule() { newRound = true; // Check if all the commands for scheduled requests are executed firstACT = false; // Check if the execution already starts? if(scheduledCmdQueue.size() > 0) { for(unsigned int index=0; index<scheduledCmdQueue.size(); index++) { if(commandQueue[scheduledCmdQueue[index]]->getSize(true) > 0) { newRound = false; if(commandQueue[scheduledCmdQueue[index]]->getSize(true) < 2) { firstACT = true; } } } if(newRound) scheduledCmdQueue.clear(); } if(newRound || !firstACT) { for(int index=0; index < requestQueue.size(); index++) { if(requestQueue[index]->getSize(false, 0) > 0) { scheduledRequest = scheduleFR(index); if(scheduledRequest->requestType == bundlingType) { if(isSchedulable(scheduledRequest, isRowHit(scheduledRequest))) { if(requestorCriticalTable.at(scheduledRequest->requestorID) == true ){ scheduledCmdQueue.push_back(scheduledRequest->requestorID); } updateRowTable(scheduledRequest->rank, scheduledRequest->bank, scheduledRequest->row); requestQueue[index]->removeRequest(); } } } } } else { if(bundlingType == RequestType::DATA_WRITE) {bundlingType = RequestType::DATA_WRITE; } else {bundlingType = RequestType::DATA_WRITE; } } } }; } #endif /* REQUESTSCHEDULER_PIPECAS_H */
true
65bd36282801e530e83f4429be0612dd6ee6d8b1
C++
ziggyman/stella
/cpp/msetapstozero/src/MSetApsToZero.cpp
UTF-8
3,393
2.625
3
[]
no_license
/* author: Andreas Ritter created: 03/20/2007 last edited: 03/20/2007 compiler: g++ 4.0 basis machine: Ubuntu Linux 6.06 */ #include "MSetApsToZero.h" int main(int argc, char *argv[]) { cout << "MSetApsToZero::main: argc = " << argc << endl; if (argc < 4) { cout << "MSetApsToZero::main: ERROR: Not enough parameters specified!" << endl; cout << "USAGE: setapstozero <char[] FitsFileName_In> <char[] DatabaseFileName_In> <char[] FitsFileName_Out>" << endl; exit(EXIT_FAILURE); } char *P_CharArr_In = (char*)argv[1]; char *P_CharArr_DB = (char*)argv[2]; char *P_CharArr_Out = (char*)argv[3]; CString CS_FitsFileName_In; CS_FitsFileName_In.Set(P_CharArr_In); CString CS_FitsFileName_Out; CS_FitsFileName_Out.Set(P_CharArr_Out); CString CS_DatabaseFileName_In; CS_DatabaseFileName_In.Set(P_CharArr_DB); CFits F_Image; if (!F_Image.SetFileName(CS_FitsFileName_In)) { cout << "MSetApsToZero::main: ERROR: F_Image.SetFileName(" << CS_FitsFileName_In.Get() << ") returned FALSE!" << endl; exit(EXIT_FAILURE); } cout << "MSetApsToZero::main: FileName <" << CS_FitsFileName_In.Get() << "> set" << endl; /// Read FitsFile if (!F_Image.ReadArray()) { cout << "MSetApsToZero::main: ERROR: F_Image.ReadArray() returned FALSE!" << endl; exit(EXIT_FAILURE); } cout << "MSetApsToZero::main: F_Image: Array read" << endl; /// Set DatabaseFileName_In if (!F_Image.SetDatabaseFileName(CS_DatabaseFileName_In)) { cout << "MSetApsToZero::main: ERROR: F_Image.SetDatabaseFileName(" << CS_DatabaseFileName_In << ") returned FALSE!" << endl; exit(EXIT_FAILURE); } cout << "MSetApsToZero::main: F_Image: DatabaseFileName <" << CS_DatabaseFileName_In << "> set" << endl; // CString CS_Path(" "); // F_Image.Get_Path(CS_Path); // cout << "MSetApsToZero: CS_Path = <" << CS_Path << ">" << endl; // exit(EXIT_FAILURE); /// Read DatabaseFileName_In if (!F_Image.ReadDatabaseEntry()) { cout << "MSetApsToZero::main: ERROR: F_Image.ReadDatabaseEntry() returned FALSE!" << endl; exit(EXIT_FAILURE); } cout << "MSetApsToZero::main: F_Image: DatabaseEntry read" << endl; /// Calculate Trace Functions if (!F_Image.CalcTraceFunctions()) { cout << "MSetApsToZero::main: ERROR: F_Image.CalcTraceFunctions() returned FALSE!" << endl; exit(EXIT_FAILURE); } cout << "MSetApsToZero::main: F_Image: TraceFunctions calculated" << endl; /// Array<double, 1> D_A1_YLow(1); /// D_A1_YLow(0) = 1; /// F_Image.Set_YLow(D_A1_YLow); /// Mark Centers if (!F_Image.Set_ApertureDataToZero(0,0)) { cout << "MSetApsToZero::main: ERROR: F_Image.Set_ApertureDataToZero() returned FALSE!" << endl; exit(EXIT_FAILURE); } cout << "MSetApsToZero::main: F_Image: Apertures set to zero" << endl; /// Set CS_FitsFileName_Out if (!F_Image.SetFileName(CS_FitsFileName_Out)) { cout << "MSetApsToZero::main: ERROR: F_Image.SetFileName(" << CS_FitsFileName_Out << ") returned FALSE!" << endl; exit(EXIT_FAILURE); } cout << "MSetApsToZero::main: F_Image: FileName <" << CS_FitsFileName_Out << "> set" << endl; /// Write Center Image if (!F_Image.WriteArray()) { cout << "MSetApsToZero::main: ERROR: F_Image.WriteArray() returned FALSE!" << endl; exit(EXIT_FAILURE); } cout << "MSetApsToZero::main: F_Image: Array written" << endl; return EXIT_SUCCESS; }
true
99961e0c99e7478805865bba763c21477ad4eef9
C++
winshining/common_algorithms
/findmaxin/findmaxin.cpp
UTF-8
1,682
3.296875
3
[]
no_license
#include "findmaxin.h" /* * More details refer to: http://blog.csdn.net/winshining/article/details/50389596 */ static bool gt(const int a, const int b) { return a > b; } static void swap(int* buff, const int i, const int j) { assert(buff); int temp = buff[i]; buff[i] = buff[j]; buff[j] = temp; } void findmaxin(int* buff, const int k, const int size, const int delta) { if (!buff || delta <= 0 || delta > k || k <= 0 || size <= 0 || k > size - k) { cout << "bad parameters." << endl; return; } int minElemIdx, zoneBeginIdx; sort(buff, buff + k, gt); // 首先对前k个数进行排序 minElemIdx = k - 1; // 最小的数是第k - 1个数,数组下标从0开始计算 zoneBeginIdx = minElemIdx; // 将标记范围的变量也指向第k - 1个数,主要用于后续的排序 for (int i = k; i < size; i++) // 从第k个数开始循环 { if (buff[i] > buff[minElemIdx]) // 从后size - k个数中找到比前k个数中最小的数大的数 { swap(buff, i, minElemIdx); // 交换 if (minElemIdx == zoneBeginIdx) { zoneBeginIdx--; // 标记范围的变量往前移动 if (zoneBeginIdx < k - delta) // 无序的范围已经超过阈值了 { sort(buff, buff + k, gt); // 再次排序 zoneBeginIdx = minElemIdx = k - 1; // 复位 continue; } } int idx = zoneBeginIdx; int j = idx + 1; // 在标记范围内查找最小的数 for (; j < k; j++) { if(buff[idx] > buff[j]) idx = j; } minElemIdx = idx; // 将指向最小数的标志置成找到的最小数的索引 } } }
true
63c267484078678d88ab1cd4426f969ce1a34f87
C++
yeonie/Algorithm
/bokli_Calculate/bokli_Calculate/main.cpp
UTF-8
595
3.171875
3
[]
no_license
// // main.cpp // bokli_Calculate // // Created by 이동연 on 2021/01/23. // #include <iostream> #include <cmath> using namespace std; int bokli(long long money, int n, float interest){ for(int i = 0 ; i < n ; i++){ money = money*interest; } cout<<n<<"일 후 "<<"잔액 :"<< money<< endl; return 0; } int main(){ long long capitalStock = 0; int date=0; float interest = 0; cout<<"입금액 : "; cin>> capitalStock; cout<<"날짜 : "; cin>> date; cout<<"이율 : "; cin>> interest; bokli(capitalStock, date, interest); }
true
ca5874a2668dcbd1815593276f2957316e68dc59
C++
chronos-cosine/Chronos
/src/Collections/Concurrent/Queue.h
UTF-8
2,286
3.15625
3
[]
no_license
/* * To change this license header, choose License Headers in Project Properties. * To change this template file, choose Tools | Templates * and open the template in the editor. */ /* * File: Collections/ConcurrentQueue.h * Author: Chronos Cosine <chronos.cosine@gmail.com> * * Created on 12 October 2018, 10:52 PM */ #ifndef COLLECTIONS_CONCURRENT_QUEUE_H #define COLLECTIONS_CONCURRENT_QUEUE_H #include "Collections/ICollection.h" #include <condition_variable> #include <iostream> #include <mutex> #include <queue> namespace Collections { namespace Concurrent { template <typename T> class Queue : public ICollection<T> { Queue(const Queue&) = delete; Queue& operator=(const Queue&) = delete; Queue(const Queue&&) = delete; Queue& operator=(const Queue&&) = delete; private: std::queue<T> queue; std::mutex mutex; std::condition_variable condition_variable; public: virtual ~Queue() = default; Queue() = default; virtual void push(T item) noexcept; virtual T pop() noexcept; virtual bool empty() const noexcept; typename std::queue<T>::size_type size() const noexcept; }; /* class Queue */ template <typename T> void Queue<T>::push(T item) noexcept { std::lock_guard<std::mutex> lock(mutex); queue.push(std::move(item)); condition_variable.notify_one(); } template <typename T> T Queue<T>::pop() noexcept { std::unique_lock<std::mutex> lock(mutex); condition_variable.wait(lock, [this] { return !queue.empty(); }); T item = std::move(queue.front()); queue.pop(); return item; } template <typename T> bool Queue<T>::empty() const noexcept { return queue.empty(); } template <typename T> typename std::queue<T>::size_type Queue<T>::size() const noexcept { return queue.size(); } } /* namespace Concurrent */ } /* namespace Collections */ #endif /* COLLECTIONS_CONCURRENT_QUEUE_H */
true
ff1413a53ad715ade4b4e8d9694f5accff58543d
C++
iChenLei/c-_primer_plus
/day25.cpp
UTF-8
159
2.578125
3
[]
no_license
#include<iostream> #include<string> using namespace std; typedef string str; int main(){ str s = "string"; cout<<"typedef------->"<<s<<endl; }
true
de5f8762ab5dcab149ce7f12d70a4cf7073e4af6
C++
haz/fd-multisearch
/downward/search/operator_registry.h
UTF-8
1,042
2.640625
3
[]
no_license
#ifndef OPERATOR_REGISTRY_H #define OPERATOR_REGISTRY_H #include "globals.h" #include <vector> class Operator; class OperatorRegistry { std::vector<const Operator *> canonical_operators; inline int get_op_index(const Operator *op) const; int num_vars; int num_operators; int num_canonical_operators; public: OperatorRegistry( const std::vector<const Operator *> &relevant_operators, const std::vector<int> &pruned_vars); ~OperatorRegistry(); inline const Operator *get_canonical_operator( const Operator *) const; void statistics() const; }; inline int OperatorRegistry::get_op_index(const Operator *op) const { int op_index = op - &*g_operators.begin(); assert(op_index >= 0 && op_index < g_operators.size()); return op_index; } inline const Operator *OperatorRegistry::get_canonical_operator( const Operator *op) const { const Operator *canonical_op = canonical_operators[get_op_index(op)]; assert(canonical_op); return canonical_op; } #endif
true
3438f2b12a17691b71274f25cc0f803542bcc73d
C++
mwiegant/CS480_wiegant
/PA7/include/object.h
UTF-8
1,834
2.703125
3
[]
no_license
/** * @file object.h * * @brief Definition file for object class * * @author Cactus Coolers * * @details Specifies all methods and variables for object class * * @version 1.00 * * @Note None */ #ifndef OBJECT_H #define OBJECT_H #include <vector> #include <string> #include <cstdio> #include <fstream> #include <iostream> #include "graphics_headers.h" #include <assimp/Importer.hpp> #include <assimp/scene.h> #include <assimp/postprocess.h> #include <assimp/color4.h> #include <Magick++.h> class Object { public: Object(); ~Object(); bool Initialize(); void Update(unsigned int dt, float speedModifier, glm::mat4 systemModel); void Render(); glm::mat4 GetModel(); void AddSatellite(Object* satellite); void ToggleChairMode(); //function to read in the required parts from the config file bool ReadConfig(std::ifstream& fileIn); private: bool InitializeTexture(); bool InitializeModel(bool chairMode); // Update functions void updateAngles(float dt); void drawObject(glm::mat4 matrix); glm::mat4 model; std::vector<Vertex> Vertices; std::vector<unsigned int> Indices; GLuint VB; GLuint IB; //Texture GLuint aTexture; // Unique Identifier char* name; // Path names char* modelFilePath; char* textureFilePath; char* chairFilePath; bool chairMode; // Spin variables float spinAngle; float spinSpeed; int spinAngleDivisor; bool spinEnabled; int spinDirection; glm::vec3 spinAxisVector; // Orbit variables float orbitAngle; float orbitSpeed; int orbitAngleDivisor; bool orbitEnabled; int orbitDirection; glm::vec3 orbitVector; // For objects that orbit around this object std::vector<Object *> satellites; }; #endif /* OBJECT_H */
true
ce378156419bd845830b3c9be9005b9faddad1a4
C++
DriftingLQK/TrainCamp
/TrainTask/Solve_Question_Code/NimGame.cpp
GB18030
754
3.34375
3
[]
no_license
#include<iostream> using namespace std; /*****************************************ʮһ************************************* [Ҫ] ѣһ Nim Ϸһʯͷÿõ1-3ʯͷ õһʯͷ˾ǻʤߡ Ϊ֣ ǴˣÿһŽ⡣ дһжǷڸʯͷӮϷ *****************************************************************************************/ bool NimGame(int n) { if (n <= 0 ) { return false; } else if (n<4) { return true; } else { if (n % 4 == 0) return false; else return true; } }
true
4b80dd932ea96030254714a68ab602bb40bbcd13
C++
ang421/Pacman2
/src/pacman.cpp
UTF-8
9,256
3.25
3
[]
no_license
#include "pacman.h" #include "pacmangame.h" #include "ghost.h" #include "wall.h" #include "ghostwall.h" Pacman::Pacman(PacmanGame* pacmangame, int row, int col, Character* (*board)[31][28], Mode mode) : Character(row, col, board), pacmangame(pacmangame), direction(Dir::NONE), mode(mode), has_eaten_piece(false), has_eaten_ghost(false), has_encountered_ghost(false), gain(false), lose(false), addpoints(-1) { //if classic, then start normally and with 5 lives if(mode == Mode::CLASSIC) { superpower = -1; lives = 3; } //if reverse, superpower is our timer and no lives else if (mode == Mode::REVERSE) { superpower = 200; lives = 0; } } char Pacman::getImage() const { return IMAGE_PACMAN; } bool Pacman::just_eaten_superpower() const { return gain; } bool Pacman::just_lost_superpower() const { return lose; } void Pacman::set_gain() { gain = false; } void Pacman::set_lose() { lose = false; } Dir Pacman::get_direction() const { return direction; } int Pacman::get_superpower() const { return superpower; } void Pacman::set_superpower(int num) { superpower = num; } void Pacman::update_superpower() { //if newly gained superpower, extend time if (gain) superpower = 100; //otherwise, decrement superpower until zero and reset to -1 else if (superpower > 0) --superpower; else if (superpower == 0) { lose = true; superpower = -1; } //safeguar to reset superpower else superpower = -1; } void Pacman::update_direction(Dir dir) { //make sure that pacman stays in the map and does not hit a wall or ghost wall if (dir == Dir::UP){ if (row==30) return; if ((*board)[row+1][col]!=nullptr){ if ((*board)[row+1][col]->getImage()== Wall::IMAGE_WALL || (*board)[row+1][col]->getImage()== Ghostwall::IMAGE_GHOSTWALL){ return; } } } else if (dir == Dir::DOWN){ if (row==0) return; if ((*board)[row-1][col]!=nullptr){ if ((*board)[row-1][col]->getImage()== Wall::IMAGE_WALL || (*board)[row-1][col]->getImage()== Ghostwall::IMAGE_GHOSTWALL){ return; } } } else if (dir == Dir::LEFT){ if (col==0) return; if ((*board)[row][col-1]!=nullptr){ if ((*board)[row][col-1]->getImage()== Wall::IMAGE_WALL || (*board)[row][col-1]->getImage()== Ghostwall::IMAGE_GHOSTWALL){ return; } } } else if (dir == Dir::RIGHT){ if (col==27) return; if ((*board)[row][col+1]!=nullptr){ if ((*board)[row][col+1]->getImage()== Wall::IMAGE_WALL || (*board)[row][col+1]->getImage()== Ghostwall::IMAGE_GHOSTWALL){ return; } } } direction = dir; } void Pacman::eats_piece(Food* f) { //set status variable and increment points has_eaten_piece = true; addpoints = f->get_points(); } void Pacman::not_eat_piece() { //reset status variables has_eaten_piece = false; addpoints = -1; } void Pacman::encounter_ghost() { //if pacman encounters ghost in classic mode has_encountered_ghost = true; --lives; direction = Dir::NONE; //reset pacman back to start, but has multiple cases, in case map is filled with ghosts ((*board)[this->row][this->col]) = nullptr; if ((*board)[7][13] == nullptr) { ((*board)[7][13]) = this; this->row = 7; this->col = 13; } else if ((*board)[7][12] == nullptr) { ((*board)[7][12]) = this; this->row = 7; this->col = 12; } else if ((*board)[7][11] == nullptr) { ((*board)[7][11]) = this; this->row = 7; this->col = 11; } else { ((*board)[7][10]) = this; this->row = 7; this->col = 10; } } void Pacman::eats_ghost(Ghost* g, int row, int col) { //set status variables and points when pacman eats ghosts in superpower mode has_eaten_piece = true; has_eaten_ghost = true; addpoints = g->get_points(); if(mode == Mode::CLASSIC) { //reset ghost status variables and move the ghost back to the box g -> set_eatmode(false); if ((*board)[15][12] == nullptr) g -> move(15, 12); else if ((*board)[16][12] == nullptr) g -> move(16, 12); else if ((*board)[15][15] == nullptr) g -> move(15, 15); else if ((*board)[16][15] == nullptr) g -> move(16, 15); else if ((*board)[15][14] == nullptr) g -> move(15, 14); else if ((*board)[16][14] == nullptr) g -> move(16, 14); else if ((*board)[15][13] == nullptr) g -> move(15, 13); else if ((*board)[16][13] == nullptr) g -> move(16, 13); g -> set_time_in_box(20); } else if(mode == Mode::REVERSE) { //in reverse, remove the ghost from the game and add points depending on time remaining (*board)[g->getRow()][g->getCol()] = nullptr; pacmangame->remove_ghost(g->get_number()); g = nullptr; addpoints += (superpower * 5); } //move pacman to new pixel ((*board)[this->row][this->col]) = nullptr; ((*board)[row][col]) = this; this->row = row; this->col = col; } void Pacman::not_eat_ghost() { has_eaten_ghost = false; } bool Pacman::get_has_encountered_ghost() { if (has_encountered_ghost == true) { has_encountered_ghost = false; return true; } return false; } bool Pacman::get_has_eaten_ghost() const { return has_eaten_ghost; } int Pacman::get_points_to_add() const { return addpoints; } int Pacman::get_lives() const { return lives; } void Pacman::move(int row, int col) { //warping for pacman for edge case if (col == -1 && row == 16) { ((*board)[this->row][this->col]) = nullptr; ((*board)[16][27]) = this; this->row = 16; this->col = 27; return; } if (col == 28 && row == 16) { ((*board)[this->row][this->col]) = nullptr; ((*board)[16][0]) = this; this->row = 16; this->col = 0; return; } //in case coordinates exceeds map size if (row < 0 || col < 0 || row >= 31 || col >= 28) return; //if ghost is directly beside pacman in non-superpower mode, then gets eaten if ((*board)[this->row][this->col-1] != nullptr) { if ((*board)[this->row][this->col-1]->getImage() == 'C' || (*board)[this->row][this->col-1]->getImage() == 'A' || (*board)[this->row][this->col-1]->getImage() == 'R') { encounter_ghost(); return; } } if ((*board)[this->row][this->col+1] != nullptr) { if ((*board)[this->row][this->col+1]->getImage() == 'C' || (*board)[this->row][this->col+1]->getImage() == 'A' || (*board)[this->row][this->col+1]->getImage() == 'R') { encounter_ghost(); return; } } if ((*board)[this->row-1][this->col] != nullptr) { if ((*board)[this->row-1][this->col]->getImage() == 'C' || (*board)[this->row-1][this->col]->getImage() == 'A' || (*board)[this->row-1][this->col]->getImage() == 'R') { encounter_ghost(); return; } } if ((*board)[this->row+1][this->col] != nullptr) { if ((*board)[this->row+1][this->col]->getImage() == 'C' || (*board)[this->row+1][this->col]->getImage() == 'A' || (*board)[this->row+1][this->col]->getImage() == 'R') { encounter_ghost(); return; } } //move pacman to empty space if ((*board)[row][col] == nullptr) { ((*board)[this->row][this->col]) = nullptr; ((*board)[row][col]) = this; this->row = row; this->col = col; return; } //pacman hits a wall else if ((*board)[row][col] -> getImage() == 'W' || (*board)[row][col] -> getImage() == 'V') return; //pacman eats some food else if ((*board)[row][col] -> getImage() == 'F') { eats_piece(dynamic_cast<Food*>((*board)[row][col])); ((*board)[this->row][this->col]) = nullptr; ((*board)[row][col]) = this; this->row = row; this->col = col; } //pacman eats a supwerpower else if ((*board)[row][col] -> getImage() == 'U') { eats_piece(dynamic_cast<Food*>((*board)[row][col])); gain = true; ((*board)[this->row][this->col]) = nullptr; ((*board)[row][col]) = this; this->row = row; this->col = col; } //in case pacman and ghost collide on the same square else if ((*board)[row][col] -> getImage() == 'C' || (*board)[row][col] -> getImage() == 'A' || (*board)[row][col] -> getImage() == 'R') { encounter_ghost(); } //pacman collides with a ghost in superpower mode else if ((*board)[row][col] -> getImage() == 'E') { eats_ghost(dynamic_cast<Ghost*>((*board)[row][col]), row, col); } }
true
a4da165598587b565f5984c72bac05b50397e415
C++
chanmufeng/data_structure
/heap/SortTestHelper.h
GB18030
1,502
3.78125
4
[]
no_license
#ifndef BASIC_SORT_GENERATION_H #define BASIC_SORT_GENERATION_H #include <iostream> #include <ctime> #include <cassert> namespace SortTestHelper { //nԪص飬ÿԪصΧΪ[rangeL,rangeR] int* generateRandomArray(int n,int rangeL,int rangeR) { assert(rangeL <= rangeR); int* arr=new int[n]; srand(time(NULL)); for (int i = 0; i < n; i++) { arr[i]=rand() % (rangeR - rangeL + 1) + rangeL; } return arr; } //ɽ int* generateNearlyOrderedArray(int n,int swapTimes) { int* arr=new int[n]; srand(time(NULL)); int posX,posY; for (int i = 0;i < n;i ++){ arr[i] = i; } for (int i = 0; i < swapTimes; i ++) { posX = rand()%n; posY = rand()%n; std::swap(arr[posX],arr[posY]); } return arr; } //鿽 int* copyArray(int arr[],int n){ int* dest =new int[n]; std::copy(arr,arr+n,dest); return dest; } //õ template<typename T> void printArray(T arr[], int n) { for (int i = 0; i < n; i++) std::cout << arr[i] << " "; std::cout << std::endl; return; } template <typename T> void testSort(std::string sortMethod,void (*sort)(T[],int ),T arr[],int n) { clock_t startTime=clock(); sort(arr,n); clock_t endTime=clock(); std::cout<< sortMethod << "" << n <<"Ԫع" <<double(endTime - startTime)/CLOCKS_PER_SEC <<""; } }; #endif
true
2c7d96827f6632bb21c110679d09b739d9525412
C++
Floopion/Home-Projects
/C++ Rouglike/Checkpoint/TileList.h
UTF-8
1,013
2.640625
3
[]
no_license
/* Program name: Rougelike Project file name: TileList.h Date: 15/05/2020 Language: C++ Platform: Microsoft Visual Studio 2017 - 2019 Purpose: To specify the methods and variables needed, whether they are public or private. Description: Header file for the TileList, contains the variables and methods needed that will be implemented within the .cpp file. Known Bugs: Nothing currently */ #pragma once #include "Tile.h" using namespace System; using namespace System::ComponentModel; using namespace System::Collections; using namespace System::Windows::Forms; using namespace System::Data; using namespace System::Drawing; ref class TileList { private: // variables array<Tile^>^ tileArray; int nTiles; public: // constructor TileList(int startNTiles); // methods void SetTileArrayEntry(int tileIndex, Tile^ tileToEnter); Bitmap^ GetTileBitmap(int tileIndex); bool isTileWalkable(int tileIndex); bool isEndTile(int tileIndex); };
true
920ed967f040e545f917e84948748274557ecb9a
C++
yuxz09/algsLearning
/程序员代码面试指南/KsortedlistToOne/KsortedlistToOne.cpp
UTF-8
2,004
3.8125
4
[]
no_license
/* 给定k个有序链表的头节点,怎么把他们merge成一个有序的链表。 */ #include <iostream> #include <queue>//using std::priority_queue using namespace std; struct Node { int val; Node* next; Node(int value) { val = value; } }; struct cmp { bool operator()(Node* node1, Node* node2) { return node1->val > node2->val; } }; Node* KsortedlistToOne(vector<Node*> vect) { priority_queue<Node*, vector<Node*>, cmp> minheap; for(int i = 0; i < vect.size(); i++) { if(vect[i] != NULL) { minheap.push(vect[i]); } } struct Node* head = NULL; struct Node* pre = NULL; while(!minheap.empty()) { struct Node* cur = minheap.top(); cout << cur -> val << endl; minheap.pop(); if(head == NULL) { head = cur; } if(pre != NULL) { pre -> next = cur; } pre = cur; if(cur -> next != NULL) { minheap.push(cur->next); } } return head; } int main() { struct Node* node1 = new Node(1); node1 -> next = NULL; struct Node* node2 = new Node(14); node1 -> next = NULL; struct Node* node3 = new Node(3); struct Node* node4 = new Node(8); node3 -> next = node4; node4 -> next = NULL; struct Node* node5 = new Node(2); struct Node* node6 = new Node(26); node5 -> next = node6; node6 -> next = NULL; struct Node* node7 = new Node(5); node7 -> next = NULL; struct Node* node8 = new Node(4); node8 -> next = NULL; vector<Node*> v; v.push_back(node1); v.push_back(node2); v.push_back(node3); // v.push_back(node4); v.push_back(node5); // v.push_back(node6); v.push_back(node7); v.push_back(node8); struct Node* res = KsortedlistToOne(v); while(res != NULL) { cout << res -> val << endl; res = res -> next; } }
true
66a58180dde0aabb1b694d9b2e1279e030414bbb
C++
Noele/Cherri
/Response.h
UTF-8
418
2.65625
3
[ "MIT" ]
permissive
#include "sleepy_discord/sleepy_discord.h" class Response { public: enum type {embed, message, action}; std::string rmessage; SleepyDiscord::Embed rembed; Response::type rtype; Response (std::string rmessage, SleepyDiscord::Embed rembed, Response::type responseType) { this->rmessage = rmessage; this->rembed = rembed; this->rtype = responseType; } Response() {} };
true
8fc7138eacd4b06d7898bb0b0fb72839cc5f976b
C++
jkrecek/ShutdownApp
/NOSA-Server/src/mainsocket.cpp
UTF-8
1,542
2.765625
3
[]
no_license
#include "mainsocket.h" #include <iostream> #include <ctime> #include "defines.h" #ifndef _WIN32 #include <netdb.h> #include <stdio.h> #include <string.h> #endif MainSocket::MainSocket(TCPSocket socket, sockaddr_in info) : NetworkSocket(socket, info) { } MainSocket* MainSocket::createSocket(Configuration* configuration) { hostent *host; sockaddr_in sockInfo; TCPSocket baseSocket; const char* hostname = configuration->getString("REMOTE_ADDRESS").c_str(); if ((host = gethostbyname(hostname)) == NULL) { std::cout << "Wrong address" << std::endl; return NULL; } if ((baseSocket = ::socket(AF_INET, SOCK_STREAM, IPPROTO_TCP)) == SOCKET_ERROR) { std::cout << "Could not create socket" << std::endl; return NULL; } sockInfo.sin_family = AF_INET; sockInfo.sin_port = htons(SOCKET_PORT); memcpy(&(sockInfo.sin_addr), host->h_addr, host->h_length); if (connect(baseSocket, (sockaddr *)&sockInfo, sizeof(sockInfo)) == SOCKET_ERROR) { std::cout << "Could not link connection" << std::endl; return NULL; } MainSocket* sock = new MainSocket(baseSocket, sockInfo); sock->sendMsg(generateAuthMessage(configuration)); return sock; } const char* MainSocket::generateAuthMessage(Configuration *configuration) { char buffer[1024]; snprintf(buffer, 1024, "type=PC user=%s pass=%s", configuration->getString("USER").c_str(), configuration->getString("PASS").c_str()); return strdup(buffer); }
true
b65ceeee4017bdd57e8950629a4071bc1ece6047
C++
Ioann87/houses
/main.cpp
UTF-8
2,801
3.421875
3
[]
no_license
#include <cstring> #include <ctime> #include <iostream> #include <vector> using namespace std; vector<char*> names = { "Ivan", "Petr", "Viktor", "Stepan", "Josiph", "Vladimir", "Kiryll", "Anton", "Jury", "Boris" }; vector<char*> surnames = { "Ivanov", "Petrov", "Viktorov", "Stepanov", "Josiphov", "Vladimirov", "Kiryllov", "Antonov", "Juryov", "Borisov" }; class Person { private: char* name; char* surname; int age; public: Person(); Person(char name); ~Person(); void init_person(char* name, char* surname, int age); void show_info(); }; class Flat { private: Person* flats; int size; public: Flat(); ~Flat(); void init_flat(); void show_flat(); }; class House { private: Flat* flats_count; int size; public: House(); ~House(); void show_house(); void init_house(); }; int main() { srand(time(NULL)); House* houses = new House[5]; for (int i = 0; i < 3; i++) { houses[i].init_house(); } for (int i = 0; i < 3; i++) { houses[i].show_house(); } delete[] houses; return 0; } Person::Person() { this->name = nullptr; this->surname = nullptr; this->age = 0; } Person::~Person() { delete name; delete surname; } void Person::init_person(char* name, char* surname, int age) { this->name = new char[15]; strcpy(this->name, name); this->surname = new char[15]; strcpy(this->surname, surname); this->age = age; return; } void Person::show_info() { cout << "Name: " << this->name << endl; cout << "Surname: " << this->surname << endl; cout << "Age: " << this->age << endl; cout << endl; } Flat::Flat() { this->flats = nullptr; this->size = 0; } Flat::~Flat() { delete[] flats; } void Flat::init_flat() { this->size = rand() % 3 + 1; this->flats = new Person[this->size]; for (int i = 0; i < size; i++) { flats[i].init_person( names[rand() % 10], surnames[rand() % 10], rand() % 50 + 20); } return; } void Flat::show_flat() { for (int i = 0; i < this->size; i++) { cout << "Flat #" << i + 1 << endl; flats[i].show_info(); } return; } House::House() { this->flats_count = nullptr; this->size = 0; } House::~House() { delete[] flats_count; } void House::init_house() { this->size = rand() % 5 + 1; this->flats_count = new Flat[size]; for (int i = 0; i < this->size; i++) { flats_count[i].init_flat(); } return; } void House::show_house() { for (int i = 0; i < this->size; i++) { cout << "House #" << i + 1 << endl; flats_count[i].show_flat(); } }
true
4eb2776dd60cb3d61c93b913d4e3ffeaf94a437e
C++
kentatakiguchi/GameCompetition2016_2
/DXBase/DXBase/sources/Actor/Person/Enemy/FloorSearchPoint.cpp
SHIFT_JIS
3,082
2.515625
3
[]
no_license
#include "FloorSearchPoint.h" #include "../../../ResourceLoader/ResourceLoader.h" #include "../../Base/ActorGroup.h" #include"../../Body/CollisionBase.h" #include "../../../World/IWorld.h" #include "../../../Math/Math.h" #include "../../../Define.h" FloorSearchPoint::FloorSearchPoint( IWorld * world, const Vector2& enemyPosition, const Vector2& addPosition, const Vector2& bodyScale ) : Actor(world, "FSP", enemyPosition + addPosition, CollisionBase( Vector2((enemyPosition.x + addPosition.x) + bodyScale.x / 2.0f, (enemyPosition.y + addPosition.y) + bodyScale.y / 2.0f), Vector2((enemyPosition.x + addPosition.x) - bodyScale.x / 2.0f, (enemyPosition.y + addPosition.y) + bodyScale.y / 2.0f), Vector2((enemyPosition.x + addPosition.x) + bodyScale.x / 2.0f, (enemyPosition.y + addPosition.y) - bodyScale.y / 2.0f), Vector2((enemyPosition.x + addPosition.x) - bodyScale.x / 2.0f, (enemyPosition.y + addPosition.y) - bodyScale.y / 2.0f) ) ), turnCount_(0), isFloor_(false), isGround_(false), isGroundBegin_(false), direction_(1.0f, 1.0f), enemyPosition_(enemyPosition), addPosition_(addPosition), floorPosition_(Vector2::Zero) { } FloorSearchPoint::FloorSearchPoint( IWorld * world, const Vector2 & enemyPosition, const Vector2 & addPosition, const float radius) : Actor(world, "FSP", enemyPosition + addPosition, CollisionBase(position_, radius)), turnCount_(0), isFloor_(false), isGround_(false), isGroundBegin_(false), direction_(1.0f, 1.0f), enemyPosition_(enemyPosition), addPosition_(addPosition), floorPosition_(Vector2::Zero) { } void FloorSearchPoint::onUpdate(float deltaTime) { auto addPos = Vector2( addPosition_.x * direction_.x, addPosition_.y * direction_.y); position_ = enemyPosition_ + addPos; isFloor_ = false; isGround_ = false; isGroundBegin_ = false; } void FloorSearchPoint::onDraw() const{ //auto vec3Pos = Vector3(position_.x, position_.y, 0.0f); //vec3Pos = vec3Pos * inv_; ////// 摜̕\ //DrawGraph( // vec3Pos.x, vec3Pos.y, // ResourceLoader::GetInstance().getTextureID(TextureID::ENEMY_NEEDLE_TEX), // true); } void FloorSearchPoint::onCollide(Actor & actor) { auto actorName = actor.getName(); // vC[֘ÃIuWFNgɓĂȂ auto getFloorName = strstr(actorName.c_str(), "Floor"); // ɓĂAU񐔂Zbg if (getFloorName != NULL || actorName == "Door") { turnCount_ = 0; isGround_ = true; isFloor_ = true; return; } } void FloorSearchPoint::onMessage(EventMessage event, void *){} // ʒu̐ݒ void FloorSearchPoint::setPosition(const Vector2& position) { enemyPosition_ = position; } // ̐ݒ void FloorSearchPoint::setDirection(const Vector2& direction) { direction_ = direction; } // ƓԂ܂ bool FloorSearchPoint::isFloor() { return isFloor_; } bool FloorSearchPoint::isGround() { return isGround_; } // ƓꏊԂ܂ Vector2 FloorSearchPoint::getFloorPosition() { return floorPosition_; }
true
a20d34ddf142dc31402d4dc46a9dfbf4a7947de5
C++
georgiosdoumas/ProgrammingCplusplus-
/CplusplusPrimer_5thEd_2012/chapter10/Exercise10.07.cpp
UTF-8
1,628
4.0625
4
[]
no_license
/* Exercise 10.7: Determine if there are any errors in the following programs and, if so, correct the error(s): (a) vector<int> vec; list<int> lst; int i; while (cin >> i) lst.push_back(i); copy(lst.cbegin(), lst.cend(), vec.begin()); (b) vector<int> vec; vec.reserve(10); // reserve is covered in § 9.4 (p. 356) fill_n(vec.begin(), 10, 0); */ #include <algorithm> #include <vector> #include <list> #include <iostream> #include <iterator> int main() { std::vector<int> vec; // declaring and defining an empty vector std::list<int> lst; // declaring and defining an empty list int i; std::cout << " Enter integers, to populate a vector, and a list that will be copy of the vector (ctr+d to finish):"; while (std::cin >> i) lst.push_back(i); // lst is growing now fill_n(back_inserter(vec), lst.size(), 0); // grow the vector by filling-expanding it with 0 values copy(lst.cbegin(), lst.cend(), vec.begin()); std::cout << " Vector has elements: "; for(auto elem: vec) std::cout << elem << " "; std::cout<< std::endl; std::cout << " List has elements: "; for(auto elem: lst) std::cout << elem << " "; std::cout<< std::endl; std::vector<int> ivec; //ivec.reserve(10); // WRONG! reserve() does not grow the actual vector, only allocates some memory for its easier expantion //fill_n(ivec.begin(), 10, 0); fill_n(back_inserter(ivec), 10, 0); // that is the correct way to grow it and fill it with 10 values of 0 for(auto elem: ivec) std::cout << elem << " "; std::cout<< std::endl; return 0; } // g++ -Wall -std=c++11 Exercise10.07.cpp -o Exercise10.07
true
3b9970aa939518f8835e786596f735af68d9969b
C++
ZhongZeng/Leetcode
/lc944dltColSrt.cpp
UTF-8
606
2.90625
3
[]
no_license
/* Leetcode 944. Delete Columns to Make Sorted Test Cases: ["cba","daf","ghi"] ["a","b"] ["zyx","wvu","tsr"] Runtime: 48 ms */ class Solution { public: int minDeletionSize(vector<string>& A) { // remove all unsorted columns if(A.size()<2||A[0].size()<1) return 0; int rt=0; for( int i=0; i<A[0].size(); i++){ for( int j=1; j<A.size(); j++){ if(A[j][i]<A[j-1][i]){ rt++; break; } } } return rt; } };
true
7d090bc836a90fff1280d8287309ad2e54e62e9d
C++
aditya865/LeetCode-June-Challenge
/week_1/day7.cpp
UTF-8
488
2.625
3
[]
no_license
class Solution { public: int change(int amount, vector<int>& coins) { int n=coins.size(); int table[amount+1]; memset(table,0,sizeof(table)); table[0]=1; for(int i=0; i<n; i++) { for(int j=coins[i];j<=amount; j++) table[j] += table[j-coins[i]]; for(int k=0;k<amount+1;k++) { cout<<table[k]; } cout<<endl; } return table[amount]; } };
true
85b50cad28d08f98dbd000ace9ad223cec8a6f85
C++
emctague/Tasks
/examples/Sensor Polling/SensorPolling.ino
UTF-8
774
3
3
[]
no_license
#include <Tasks.h> class SensorPolling : public Task { private: uint16_t lastReading; const uint8_t pin; void update() { lastReading = analogRead(pin); } public: SensorPolling(uint8_t pin , uint16_t pollingInterval) : Task(pollingInterval), pin(pin) { } SensorPolling(uint8_t pin) : SensorPolling(pin, 0) { } uint16_t get() { return lastReading; } }; SensorPolling potentiometer = SensorPolling(A0, 20); //Important! quick updates. SensorPolling mySensor = SensorPolling(A1, 120); //Less important. void setup() { Serial.begin(9600); } void loop() { Serial.print("potentiometer: "); Serial.print(potentiometer.get()); Serial.print(", mySensor: "); Serial.println(mySensor.get()); }
true
2016d9506dd745a0e5da847f3c20e3e4552e205e
C++
n1ghtk1ng/Interview-Coding-Questions
/wormhole_without_dijkstra.cpp
UTF-8
960
2.734375
3
[]
no_license
#include<bits/stdc++.h> using namespace std; int cost=INT_MAX; struct wormhole{ int sx; int sy; int ex; int ey; int cost; wormhole(){} wormhole(int a,b,c,d,e){ sx=a; sy=b; ex=c; ey=d; cost=e; } }; int sx,sy,dx,dy; int calcdist(int i,wormhole w[],int a,int b){ if(i==-1){ int x=sx-dx; int y=sy-dy; return abs(x)+abs(y); } int x=abs(a-w[i].sx); int y=abs(b-w[i].sy); return x+y+w[i].cost; } void dfs(wormhole w[],int n,int i,int dist,bool vis[],int cnt,int a,int b){ dist+=calcdist(i,w,a,b); if(i!=-1) vis[i]=true; if(cnt==n){ return; } for(int j=0;j<n;j++){ if(!vis[j]){ dfs(w,n,j,dist,vis,cnt+1,); } } vis[i]=false; } int main(){ int n; cin>>n; wormhole w[n]; bool vis[n]={false}; cin>>sx>>sy>>dx>>dy; for(int i=0;i<n;i++){ cin>>w[i].sx>>w[i].sy>>w[i].ex>>w[i].ey>>w[i].cost; } dfs(w,n,0); cout<<cost; return 0; }
true
7fc5dcab357b897936ca105dc99c61ce3e9fa96a
C++
AlixAbbasi/fsfw
/unittest/testtemplate/TestTemplate.cpp
UTF-8
955
3.015625
3
[ "Apache-2.0", "LicenseRef-scancode-public-domain" ]
permissive
#include <fsfw/unittest/catch2/catch.hpp> #include <fsfw/unittest/core/CatchDefinitions.h> /** * @brief Template test file * @details * In each test case, the code outside the sections is executed * for EACH section. * The most common macros to perform tests are: * - CHECK(...): assert expression and continues even if it fails * - REQUIRE(...): test case fails if assertion fails * * Tests are generally sturctured in test cases and sections, see example * below. * * More Documentation: * - https://github.com/catchorg/Catch2 * - https://github.com/catchorg/Catch2/blob/master/docs/assertions.md * - https://github.com/catchorg/Catch2/blob/master/docs/test-cases-and-sections.md */ TEST_CASE("Dummy Test" , "[DummyTest]") { uint8_t testVariable = 1; //perform set-up here CHECK(testVariable == 1); SECTION("TestSection") { // set-up is run for each section REQUIRE(testVariable == 1); } // perform tear-down here }
true
65a6411816d9e3492b9d4eed1c6c7835b7b02b66
C++
zimkjh/-vmware_data_save
/algo/picnic1.cpp
UTF-8
1,296
3.234375
3
[]
no_license
#include<iostream> #include<string> using namespace std; int goodcase(int human, int group, int *groups){ bool checkL[human]; for (int i4 = 0; i4<human; i4++){ checkL[i4]= false; } // make default false } int main() { int cases; cin >> cases; for(int i1 = 0; i1<cases ; i1++) { // cases int human, group; cin>>human>>group; int groups[group*2]; for(int i2 = 0; i2 < group ; i2++){ cin>>groups[i2*2]>>groups[i2*2+1]; } //goodcase(human, group, groups); bool checkL[human]; bool allchecked; int casenum = 0; for(int i3 = 0; i3 < group ; i3++){ // choose the first right group for (int i4 = 0; i4<human; i4++){// make default false checkL[i4]= false; } allchecked = true ;// make allchecked true for(int i5 = i3; i5 < group ; i5++){ if(checkL[groups[i5*2]] == false && checkL[groups[i5*2+1]] == false){ // two all not checked than check! checkL[groups[i5*2]] = true; checkL[groups[i5*2+1]] = true; } //if one of them is checked, then pass } for(int i6= 0;i6<human; i6++){ if(checkL[i6] ==false){ //if something is unchecked , allchecked is false allchecked = false; } } if(allchecked ==true){ casenum += 1; } } cout<<"case : "<< i1 << " ::::: "<<casenum<<endl; } }
true
e76d3fa61ecaa1de6e575991e2d02bfeec18592c
C++
singhankush01/datastructure-algorithms
/maximum_sum_colum.cpp
UTF-8
568
2.9375
3
[]
no_license
#include<iostream> #include<limits> using namespace std; int main() { int m,n; int ar[100][100]; cin>>m>>n; for(int i=0;i<m;i++) { for(int j=0;j<n;j++) { cin>>ar[i][j]; } } int max = INT_MIN,column; for(int i=0;i<m;i++) { int sum = 0; for(int j=0;j<n;j++) { sum+=ar[i][j]; } if(sum>max) { max = sum; column = i; } } cout<<"Maximum Column:"<<column<<endl; cout<<"Sum :"<<max; return 0; }
true
5557d59cd03130b46bde6ac49f32b0b2108d956f
C++
Tybus/AVLTree
/include/AVLTree.h
UTF-8
1,051
3.046875
3
[]
no_license
#ifndef AVLTREE_H #define AVLTREE_H #include <stdexcept> #include <iostream> #include "AVLNode.h" #include <string> class AVLTree{ public: //! Creates a empty AVLTREE AVLTree(); //! Creates a AVLTree based on arrays of strings and cedulas AVLTree(int i_ammount, AVLNode::NameAndID * i_aNameAndID); //! Creates an AVLTree based on a String and a Cedula AVLTree(AVLNode::NameAndID i_NameAndID); //! Inserts a new entry to the AVL Tree void AVLTreeInsert(AVLNode::NameAndID i_NameAndID); //! Removes a entry from the AVL Tree using a Cedula void AVLTreeRemove(uint32_t i_u32Cedula); //! Removes an entry using a NameAndID data structure. void AVLTreeRemove(AVLNode::NameAndID i_NameAndID); //! Returns the Size of the AVL Tree uint64_t AVLTreeGetSize(void); //! Returns the Maxheight of the AVL Tree. uint64_t AVLTreeGetMaxHeight(void); //!Returns the higuestValue uint64_t AVLTreeGetHighest(void); //!Returns the LowestValue uint64_t AVLTreeGetLowest(void); private: AVLNode * m_rootNode; uint64_t m_size; }; #endif //AVLNODE_H
true
98b576c4efe263933c5540000952a465155a11c3
C++
ChenGuyc/Projects
/silver_lining/include/singleton.hpp
UTF-8
1,715
3.421875
3
[]
no_license
/* Singleton ensures a class only has a single instance and provides global point of access to it T must have a default private ctor Singleton must be a friend class T Singleton has self-destruction Version Date Comments 0.1 7.12.20 mentor approval */ #ifndef ILRD_HRD14_SINGLETON_HPP #define ILRD_HRD14_SINGLETON_HPP #include <mutex> // std::mutex #include <atomic> // std::atomic #include <memory> // std::sh #include "scope_lock.hpp" namespace hrd14 { template <typename T> class Singleton { public: Singleton()= delete; ~Singleton()= delete; Singleton(const Singleton&)= delete; Singleton& operator=(const Singleton&)= delete; static T* GetInstance(); private: static std::mutex s_mutex; static std::atomic<T*> s_instance; static void FreeInstance(); }; template <typename T> std::mutex Singleton<T>::s_mutex; template <typename T> std::atomic<T*> Singleton<T>::s_instance; template <typename T> T* Singleton<T>::GetInstance() { T* temp = s_instance.load(std::memory_order_relaxed); std::atomic_thread_fence(std::memory_order_acquire); if (nullptr == temp) { ScopeLock<std::mutex> lock(s_mutex); temp = s_instance.load(std::memory_order_relaxed); if (nullptr == temp) { temp = new T; std::atomic_thread_fence(std::memory_order_relaxed); s_instance.store(temp, std::memory_order_relaxed); atexit(FreeInstance); } } return (temp); } template <typename T> void Singleton<T>::FreeInstance() { delete s_instance.exchange(nullptr); } }//hrd14 #endif //ILRD_HRD14_SINGLETON_HPP
true
c3b1dae5741636ff0acedac81afe5c624571854e
C++
QinghuiXing/BinaryTree
/HuffmanTree.cpp
GB18030
6,082
2.578125
3
[]
no_license
#include "pch.h" #include "HuffmanTree.h" #include<iostream> #include<cstdlib> #include<cstring> #include<cstdio> #include<algorithm> void HuffmanCoding(HmTree & HT, HuffmanCode & HC, int * w, int n) { if (n < 1)return; int m = 2 * n - 1; HT = (HmTree)malloc((m+1)* sizeof(HTNode)); HC = (HuffmanCode)malloc(n * sizeof(char *)); HTNode* p = HT; int i = 1; p++; int s1, s2; for (; i <= n; ++i, ++p, ++w)*p = { *w,0,0,0 }; for (; i <= m; ++i, ++p)*p = { 0,0,0,0 }; for (i = n + 1; i <= m;i++) { Select(HT,i-1,s1,s2); HT[s1].parent = i; HT[s2].parent = i; HT[i].lchild = s1; HT[i].rchild = s2; HT[i].weight = HT[s1].weight + HT[s2].weight; } char* cd = (char*)malloc(n * sizeof(char)), *ch1= (char*)malloc(n * sizeof(char)); cd[n - 1] = '\0'; for (int i = 1; i <= n; i++) { int start = n - 1; int f = HT[i].parent; for (int c = i; f != 0; c = f, f = HT[f].parent) { if (HT[f].lchild == c)cd[--start] = '0'; else cd[--start] = '1'; } HC[i] = (char*)malloc((n - start) * sizeof(char)); //for (int k1 = start, k2 = n-2; k1 <=n-2; k1++,k2--) { // ch1[k1] = cd[k2]; //} //ch1[n - 1] = '\0'; strcpy(HC[i], &cd[start]); } free(cd); } void Select(HmTree & HT, int m, int &s1, int &s2) { for(int i=1;i<=m;i++) if (HT[i].parent == 0) { s1 = i; break; } for (int i = 1; i <= m; i++) { if (HT[i].weight < HT[s1].weight&&HT[i].parent==0) s1 = i; } for (int i = 1; i <= m; i++) if (HT[i].parent == 0 && i != s1) { s2 = i; break; } for (int i = 1; i <= m; i++) { if (HT[i].weight < HT[s2].weight&&i != s1 && HT[i].parent == 0) { s2 = i; } } } void LoadHuffmanTree(HmTree & HT, HuffmanCode & HC, int * &w, char * &ch, int & n, char* weightsfilename) { //char filename[weightsfilename.length + 1] = weightsfilename; FILE *f = fopen(weightsfilename, "r+"); fscanf(f, "%d\n", &n); w = (int*)malloc(n * sizeof(int)); ch = (char*)malloc(n * sizeof(char)); for (int i = 0; i < n; i++) { fscanf(f, "%c ", &ch[i]); fscanf(f, "%d\n", &w[i]); } fclose(f); } void SaveHuffmanTree(HmTree & HT, char* HuffTreefilename, int n) { //char filename[HuffTreefilename.length] = HuffTreefilename; FILE *wr = fopen(HuffTreefilename, "w+"); int parent, weight, lchild, rchild; for (int i = 1; i <= 2 * n - 1; i++) { weight = HT[i].weight; parent= HT[i].parent; lchild = HT[i].lchild; rchild = HT[i].rchild; fprintf(wr, "%d %d %d %d\n", weight, parent, lchild, rchild); } fclose(wr); } void Encode(HuffmanCode & HC, char *ToBeTran, char *CodedFile) { FILE *tobetran, *codedfile; tobetran = fopen(ToBeTran, "r+"); codedfile = fopen(CodedFile, "a+"); char n; n = fgetc(tobetran); do { if (n == ' ') fprintf(codedfile, "%s", HC[1]); else if (n == '\n') fprintf(codedfile, "\n"); else fprintf(codedfile, "%s", HC[n - 'A' + 2]); n = fgetc(tobetran); } while (n!=-1); fclose(tobetran); fclose(codedfile); } void Decode(HmTree & HT, char * CodedFile, char * PlainFile, int n) { FILE *c = fopen(CodedFile, "r+"), *p = fopen(PlainFile, "a+"); char huffcodes[5000]; //char tmpch; fscanf(c, "%s", huffcodes); fclose(c); //tmpch = fgetc(c); int i = 0,j=2*n-1, len = strlen(huffcodes); //int tmp = int(huffcodes[i]) - 48; //if(c==0) // fprintf(p,"%c",) if (huffcodes[i] == '0') j = HT[2 * n - 1].lchild; else j = HT[2 * n - 1].rchild; while (i <= len) { if (HT[j].lchild == 0) {//Ҷ if (j == 1)// '.' fprintf(p, "%c", ' '); else // A - Z fprintf(p, "%c", char(j - 2 + 'A')); i++; if (huffcodes[i] == '0') j = HT[2 * n - 1].lchild; else j = HT[2 * n - 1].rchild; } else { i++; if (huffcodes[i] == '0') j = HT[j].lchild; else j = HT[j].rchild; } } fclose(p); /* if (tmp == 0) {// if (HT[j].lchild == 0) {//Ҷ if (j == 1) {// . fprintf(p, "%c", '.'); j = 2 * n - 1; i++; if (huffcodes[i] == '0') j = HT[2 * n - 1].lchild; else j = HT[2 * n - 1].rchild; } else { // A - Z fprintf(p, "%c", char(j - 2 + 'A')); j = 2 * n - 1; i++; if (huffcodes[i] == '0') j = HT[2 * n - 1].lchild; else j = HT[2 * n - 1].rchild; } }//if else {//Ҷڵ j = HT[j].lchild;//ӽ } } else {//Һ if (HT[j].rchild == 0) {//Ҷ if (j == 1) {// . fprintf(p, "%c", '.'); j = 2 * n - 1; i++; if (huffcodes[i] == '0') j = HT[2 * n - 1].lchild; else j = HT[2 * n - 1].rchild; } else { // A - Z fprintf(p, "%c", char(j - 2 + 'A')); j = 2 * n - 1; i++; if (huffcodes[i] == '0') j = HT[2 * n - 1].lchild; else j = HT[2 * n - 1].rchild; } }//if else {//Ҷڵ j = HT[j].rchild;//Һӽ } }//if i++; tmp = int(huffcodes[i]) - 48; }//while */ } void EncodeStdin(HuffmanCode & HC) { //int len = str.length(); //int len = strlen(str); char n='\0', str1[100]; int i = 0; rewind(stdin); do{ scanf("%c", &n); str1[i++] = n; } while (n != '\n'); for (int j = 0; j < i-1; j++) { n = str1[j]; if (n == ' ') printf("%s", HC[1]); else printf("%s", HC[n - 'A' + 2]); } } void DecodeStdout(HmTree & HT, char * tobedecode, int n) { int i = 0, j = 2 * n - 1, len = strlen(tobedecode); if (tobedecode[i] == '0') j = HT[2 * n - 1].lchild; else j = HT[2 * n - 1].rchild; while (i <= len) { if (HT[j].lchild == 0) {//Ҷ if (j == 1)// '.' printf("%c", ' '); else // A - Z printf("%c", char(j - 2 + 'A')); i++; if (tobedecode[i] == '0') j = HT[2 * n - 1].lchild; else j = HT[2 * n - 1].rchild; } else { i++; if (tobedecode[i] == '0') j = HT[j].lchild; else j = HT[j].rchild; } } }
true
ea88f4b2f15baa684cc415d268db8783949d8e46
C++
alexsawyer13/TheGauntletCpp
/GauntletCpp/src/MoveContainer.h
UTF-8
687
3.640625
4
[]
no_license
#pragma once #include "Move.h" #include <vector> class MoveContainer { public: Move Punch() { return Move("Punch", "Throws a punch at the target", 90, 30); } Move BodySlam() { return Move("Body Slam", "Slams into the target.", 60, 90); } Move GetMove(int index) { switch (index) { case 1: return Punch(); break; case 2: return BodySlam(); break; default: return Punch(); break; // Default move is punch } } std::vector<Move> GetMoves(int* indices) { std::vector<Move> moves; for (int i = 0; i < sizeof(indices) / sizeof(indices[0]); i++) { moves.push_back(GetMove(i)); } delete[] indices; return moves; } };
true
ea4b69c54cd28852d09d63c07e314d3acd55b018
C++
DriftingLQK/TrainCamp
/TrainTask/UnitTest_Solve/Test6.cpp
GB18030
1,358
2.546875
3
[]
no_license
#include "stdafx.h" void Test6(CString Title) { //// ȡ int TestNum = GetPrivateProfileInt(Title, TestNumKey, 0, FILEPATH); CString TitleFind, ArrayFind, ValueFind; //ʽϢ ArrayFind = TestInputKey_Input; ValueFind = TestOutputKey; char SSS[DATASUM_BUFFER]; for (int i = 0; i < TestNum; i++) //for ѭԲ { _itoa(i + 1, SSS, 10); CString index = SSS; TitleFind = Title + "_" + index; #pragma region ȡһ char Iutputstr[GET_INI_MAXSIZE]; int len = GetPrivateProfileString(TitleFind, ArrayFind, "DefaultName", Iutputstr, GET_INI_MAXSIZE, FILEPATH); char Outputbool[GET_INI_BOOL]; GetPrivateProfileString(TitleFind, ValueFind, "DefaultName", Outputbool, GET_INI_BOOL, FILEPATH); #pragma endregion #pragma region һݽַָ vector<int>nums; vector<int>flags; if (Iutputstr[0]=='[') { for (int jj = 0; jj < len; jj++) { Iutputstr[jj] = Iutputstr[jj + 1]; } len = len - 2; } int Numlen = StrToInt_New(Iutputstr, len, nums, flags); #pragma endregion #pragma region ԵõIJ bool Expect_Value = (string(Outputbool) == "true"); bool Act_Value = ContainsDuplicate(nums); Assert::AreEqual(Expect_Value, Act_Value); #pragma endregion } //for ѭԲ }
true
441306cd242253272b4d6c2adee63dc8dec6fa8b
C++
nfb1799/IGME-209
/Exam2/Exam2/Ogre.cpp
UTF-8
711
3.046875
3
[]
no_license
#include "Ogre.h" #include <iostream> using namespace std; Ogre::Ogre() : MovableObject() { inventoryIds = new int[3]{ 3, 9, 12 }; } Ogre::Ogre(int _xPosition, int _yPosition) : MovableObject(_xPosition, _yPosition) { inventoryIds = new int[3]{ 3, 9, 12 }; } Ogre::Ogre(int _xPosition, int _yPosition, int* _inventoryIds) : MovableObject(_xPosition, _yPosition) { inventoryIds = _inventoryIds; } Ogre::~Ogre() { delete[] inventoryIds; inventoryIds = nullptr; } void Ogre::Display() { cout << "Object: Ogre" << endl; cout << "Inventory IDs: " << inventoryIds[0] << ", " << inventoryIds[1] << ", " << inventoryIds[2] << endl; cout << "Position: (" << xPosition << ", " << yPosition << ")" << endl; }
true
1df971e9bef6da5d9f915e0f30f6be1d2d403791
C++
hustlyhang/WSlyh
/http/timer.cpp
UTF-8
3,201
2.84375
3
[]
no_license
#include "timer.h" #include <string.h> CHeapTimer::CHeapTimer(int _delaytime) { m_iExpireTime = time(NULL) + _delaytime; m_iPos = 0; } CTimerHeap::CTimerHeap(int _capacity):m_iCapacity(_capacity), m_iCurNum(0) { m_aTimers = new CHeapTimer*[m_iCapacity](); if (!m_aTimers) throw std::exception(); } CTimerHeap::~CTimerHeap() { delete [] m_aTimers; for (int i = 0; i < m_iCurNum; ++i) m_aTimers[i] = nullptr; } // 小根堆 void CTimerHeap::HeapDown(int heap_node) { CHeapTimer* tmp_timer = m_aTimers[heap_node]; int child = 0; for (; heap_node * 2 + 1 < m_iCurNum; heap_node = child) { child = heap_node * 2 + 1; if (child + 1 < m_iCurNum && m_aTimers[child + 1]->m_iExpireTime < m_aTimers[child]->m_iExpireTime) child++; if (tmp_timer->m_iExpireTime > m_aTimers[child]->m_iExpireTime) { m_aTimers[heap_node] = m_aTimers[child]; m_aTimers[heap_node]->m_iPos = heap_node; } else break; } m_aTimers[heap_node] = tmp_timer; m_aTimers[heap_node]->m_iPos = heap_node; } void CTimerHeap::AddTimer(CHeapTimer* add_timer) { if (!add_timer) return; if (m_iCurNum >= m_iCapacity) Resize(); int last_node = m_iCurNum++; int parent = 0; // 新加入的节点在最后,向上调整 for( ; last_node > 0; last_node = parent ) { parent = ( last_node - 1 ) / 2; if( m_aTimers[parent]->m_iExpireTime > add_timer->m_iExpireTime ) { m_aTimers[last_node] = m_aTimers[parent]; m_aTimers[last_node]->m_iPos = last_node; } else { break; } } m_aTimers[last_node] = add_timer; m_aTimers[last_node]->m_iPos = last_node; LOG_INFO("add timer"); for (int i = 0; i < m_iCurNum; ++i) { LOG_INFO("%d, %d", m_aTimers[i]->m_iExpireTime, m_aTimers[i]->m_iPos); } } void CTimerHeap::Adjust(CHeapTimer* _tnode) { HeapDown(_tnode->m_iPos); } void CTimerHeap::DelTimer( CHeapTimer* del_timer ) { if( !del_timer ) return; del_timer->callback_func = nullptr; } void CTimerHeap::PopTimer() { if(!m_iCurNum) return; if(m_aTimers[0]) { m_aTimers[0] = m_aTimers[--m_iCurNum]; // m_aTimers[m_iCurNum] = nullptr; HeapDown(0); // 对新的根节点进行下滤 } } void CTimerHeap::Tick() { CHeapTimer* tmp_timer = m_aTimers[0]; time_t cur_time = time(NULL); LOG_INFO("timer tick %d", cur_time); while(m_iCurNum) { if(!tmp_timer) break; if(tmp_timer->m_iExpireTime > cur_time) break; if(m_aTimers[0]->callback_func) { m_aTimers[0]->callback_func(m_aTimers[0]->m_sClientData); } PopTimer(); LOG_INFO("pop timer"); tmp_timer = m_aTimers[0]; } } void CTimerHeap::Resize() { LOG_INFO("resize"); CHeapTimer** tmp = new CHeapTimer*[m_iCapacity * 2](); if(!tmp) throw std::exception(); memcpy(tmp, m_aTimers, m_iCurNum * sizeof(CHeapTimer*)); m_iCapacity *= 2; delete[] m_aTimers; m_aTimers = tmp; } CHeapTimer* CTimerHeap::GetTop(){ if (m_iCurNum != 0) { return m_aTimers[0]; } return nullptr; }
true
1db3b3503e1a65195e0d6609b44c2b860f406d6b
C++
shubha360/CPP-Practice-Codes
/DS & Algo (Bari tutorial)/Stack/Infix to postfix 1/main.cpp
UTF-8
1,156
3.53125
4
[]
no_license
// only supports +,-,*,/ #include<iostream> #include<stack> using namespace std; bool isOperand(char c) { if (c == '+' || c == '-' || c == '*' || c == '/') return 0; return 1; } int precedence(char c) { if (c == '+' || c == '-') return 1; else if (c == '*' || c == '/') return 2; return 0; } string convert (string infix) { stack<char> st; string postfix; auto it = infix.begin(); while (it != infix.end()) { if (isOperand(*it)) postfix.push_back(*it++); else { if (st.empty() || precedence(*it) > precedence(st.top())) st.push(*it++); else { postfix.push_back(st.top()); st.pop(); } } } while (!st.empty()) { postfix.push_back(st.top()); st.pop(); } return postfix; } int main() { string infix = "a+b*c/d+e-f"; string postfix = convert(infix); cout << postfix << endl; return 0; }
true
f3f68376718cf24cefacac920649899716f6af25
C++
orangewangjie/Algorithm-Dryad
/05.LinkedList/143.重排链表.cpp
UTF-8
2,326
3.484375
3
[]
no_license
/* * @lc app=leetcode.cn id=143 lang=cpp * * [143] 重排链表 * * https://leetcode-cn.com/problems/reorder-list/description/ * * algorithms * Medium (59.50%) * Likes: 500 * Dislikes: 0 * Total Accepted: 77.9K * Total Submissions: 130.9K * Testcase Example: '[1,2,3,4]' * * 给定一个单链表 L:L0→L1→…→Ln-1→Ln , * 将其重新排列后变为: L0→Ln→L1→Ln-1→L2→Ln-2→… * * 你不能只是单纯的改变节点内部的值,而是需要实际的进行节点交换。 * * 示例 1: * * 给定链表 1->2->3->4, 重新排列为 1->4->2->3. * * 示例 2: * * 给定链表 1->2->3->4->5, 重新排列为 1->5->2->4->3. * */ // @lc code=start /** * Definition for singly-linked list. * struct ListNode { * int val; * ListNode *next; * ListNode() : val(0), next(nullptr) {} * ListNode(int x) : val(x), next(nullptr) {} * ListNode(int x, ListNode *next) : val(x), next(next) {} * }; */ class Solution { ListNode* split(ListNode* head) { auto pre = head; auto s1 = head; auto s2 = head; while (s2 && s2->next) { pre = s1; s1 = s1->next; s2 = s2->next->next; } return s2 ? s1 : pre; } ListNode* reverse(ListNode* head) { ListNode dummy; auto p = head; while (p) { auto back = p->next; p->next = dummy.next; dummy.next = p; p = back; } return dummy.next; } public: void reorderList(ListNode* head) { if (!head || !head->next) { return; } auto mid = split(head); auto front = head; auto back = mid->next; mid->next = nullptr; back = reverse(back); ListNode dummy; ListNode* tail = &dummy; bool is_front = true; while (front || back) { if (!back || is_front && front) { tail->next = front; tail = tail->next; front = front->next; } else { tail->next = back; tail = tail->next; back = back->next; } is_front = !is_front; } tail->next = nullptr; } }; // @lc code=end
true
39b2c6e57c36c1d2051f62fe9d7ed7df7484f1cb
C++
zitanguo/sph_cpp_serial
/calculate_variables.cpp
UTF-8
3,459
2.609375
3
[]
no_license
#include <mpi.h> #include <hdf5.h> #include <stdio.h> #include <stdlib.h> #include <string.h> #include <math.h> #include <string.h> #include <vector> #include <iterator> #include "particle.h" void calculate_sml_den_prs(int NumoNgb, int NumoPar, std::vector<Particle *> VecoPtr2Par, double gamma, double &SmtLenMax) { for (size_t i = 0; i < NumoPar; i++) { //*****find the smoothing length first***** //cpp maps are sorted, so just use the # of ngbth's distance as the smt std::map<double, Particle *>::iterator temp_stopper = VecoPtr2Par[i] -> GetDisMap().begin(); if(NumoNgb <= VecoPtr2Par[i] -> GetDisMap().size()) { std::advance(temp_stopper, NumoNgb - 1); //move the iterator to the ngb th distance} VecoPtr2Par[i] -> SetSmtLen(temp_stopper -> first); //"fisrt" is the key or the distance, set to the smt } else { std::cout << "warning: insufficient neighbours: " << VecoPtr2Par[i] -> GetDisMap().size()<<std::endl; temp_stopper = VecoPtr2Par[i] -> GetDisMap().end(); VecoPtr2Par[i] -> SetSmtLen(temp_stopper -> first); //"fisrt" is the key or the distance, set to the smt } if(temp_stopper -> first > SmtLenMax){SmtLenMax = temp_stopper -> first;} //*****then find the density using the just found smoothing length***** int temp_counter = 0; //count the times of iteration double temp_density = 0.0; //this for loop needs -std=c++17 for(auto const& [Dis, Ptr2Par] : VecoPtr2Par[i] -> GetDisMap()){ temp_counter++; temp_density += Ptr2Par -> GetMas() * kernel_2d3(Dis, temp_stopper -> first); if (temp_counter >= NumoNgb) break; } VecoPtr2Par[i] -> SetDen(temp_density); //*****then set the pressure using density and internal energy***** VecoPtr2Par[i] -> CalPrs(gamma); if(i % 10000 == 0){ std::cout << "mark 4.4.1 this particle's h, rho, prs: "<<temp_stopper -> first <<" "<<temp_density <<" "<<VecoPtr2Par[i] -> GetPrs() <<std::endl;} } } //This loop is dependent on the pressure, density and sml of every particle so has to be carried out after the first one. void calculate_acc_intengvel_timstp(int NumoNgb, int NumoPar, std::vector<Particle *> VecoPtr2Par, double &TimStp, std::vector<double> Bdr) { for (size_t i = 0; i < NumoPar; i++) { VecoPtr2Par[i] -> CalAccIntEngVel(NumoNgb, Bdr); //clear the map here because the assignment isn't particlely linear (it's meshly linear) VecoPtr2Par[i] -> GetDisMap().clear(); if(i % 10000 == 0){ std::cout << "mark 4.5.1 this particle's engvel, acc: "<<VecoPtr2Par[i] -> GetIntEngVel()<<" "; for (auto acc : VecoPtr2Par[i] -> GetAcc()) {std::cout << acc << " ";} std::cout << std::endl; } //calculate timestep double temp_time_step = pow(VecoPtr2Par[i] -> GetSmtLen() / VecoPtr2Par[i] -> GetAccAbs(), 0.5); // std::cout <<i <<" "<<VecoPtr2Par[i] -> GetDen()<<" "<<VecoPtr2Par[i] -> GetMas() <<" "<<VecoPtr2Par[i] -> GetIntEng()<<" " // <<VecoPtr2Par[i] -> GetSmtLen()<<" "<<VecoPtr2Par[i] -> GetPrs()<<" "<<VecoPtr2Par[i] -> GetAcc()[0]<<" " // <<VecoPtr2Par[i] -> GetAcc()[1]<<" "<< VecoPtr2Par[i] -> GetAccAbs()<<std::endl; //std::cout <<temp_time_step<<" " <<TimStp<<std::endl; if( temp_time_step < TimStp) TimStp = temp_time_step; } std::cout << "mark 4.5.2 finished calculating acc with timestep "<<TimStp<<std::endl; }
true
6b523e25a1f00eda90df0f4b7e6a743c55d64f20
C++
ankenman/CS162_Winter2020
/Final/final.cc
UTF-8
3,646
4.15625
4
[]
no_license
#include <iostream> using namespace std; // TODO: use a loop and pointers to add all elements in array ptr // There shouldn't be any square brackets [] in the solution // 15 points double sumLoop(double* ptr, size_t size) { return 0.0; } // TODO: use recursion to sum all the elements in array ptr // Define your base case and recursive call // 15 points double sumRec(double* ptr, size_t size) { return 0.0; } class LinkedList { public: LinkedList() { // TODO: initialize list // head can point to a dummy node or to null, but ensure that your // member functions adhere to that representation // 5 points } ~LinkedList() { // Deallocate all nodes in the list. You can use a loop or recursive helper // Suggestion: use your popFront member function // 10 points } void printList() { // TODO: Call recursive helper function to print out the list // Use this form (no need to check for end of list): // { 1.0 2.0 3.0 } // 10 points } void pushFront(double newData) { // TODO: Add element to front of list // 10 points } void pushBack(double newData) { // TODO: Add an element to the back of the list using helper function // 15 points } double popFront() { // TODO: Remove and return element from front of list // ASSUMEPTION: We will not remove from an empty list // Do NOT do any error checking for that // 15 points return 0.0; } int getLength() { // TODO: Call recursive helper function to count the number of nodes // 10 points return 0; } private: struct Node { double data; Node *next; }; Node *head; // Private helper functions void printHelper(Node *n) { // TODO: Print out list recursively // 15 points } int countNodes(Node *n) { // TODO: Recursively count nodes // 15 points return 0; } Node* findEnd(Node *n) { // TODO: Retrun last node of the list // e.g., the node that is pointing to null // 15 points return nullptr; } }; int main() { double array[] = { 3.4, -5.6, 1.2, -3.5 }; int size = 4; cout << "Testing sumLoop ****************\n"; cout << "\t Expecting -4.5, got " << sumLoop(array, size) << endl; cout << "Testing sumRec ****************\n"; cout << "\t Expecting -4.5, got " << sumRec(array, size) << endl; cout << "\n\nTesting LinkedList ****************\n"; LinkedList list; for (double i = -8.4; i < 8.0; i += 3.3) { list.pushFront(i); } cout << "\tTesting pushFront, printList, getLength\n"; cout << "\tprintList: Expecting { 4.8 1.5 -1.8 -5.1 -8.4 } and got "; list.printList(); cout << endl; cout << "\tgetLength: Expecting 5 and got " << list.getLength() << endl; cout << "\n\tTesting pushBack\n"; list.pushBack(3.4); cout << "\tprintList: Expecting { 4.8 1.5 -1.8 -5.1 -8.4 3.4 } and got "; list.printList(); cout << endl; cout << "\tgetLength: Expecting 6 and got " << list.getLength() << endl; cout << "\n\tTesting popFront\n"; double poppedValue = list.popFront(); cout << "\tExpected 4.8 and got " << poppedValue << endl; list.printList(); cout << endl; return 0; }
true
f923a919ab982a68db19d4671d574859ac982bfc
C++
nchkdxlq/Algorithm
/Algorithm/Algorithm/Graph/SparseGraph.hpp
UTF-8
1,478
3.15625
3
[ "MIT" ]
permissive
// // SparseGraph.hpp // Algorithm // // Created by nchkdxlq on 2017/9/13. // Copyright © 2017年 nchkdxlq. All rights reserved. // #ifndef SparseGraph_hpp #define SparseGraph_hpp #include <stdio.h> #include <vector> using namespace std; /* 稀疏图 邻接表 缺点: 1. */ class SparseGraph { private: int m_v; // 顶点的个数 (vertex count) int m_e; // 边数 (edge count) bool m_directed; vector<vector<int>> m_graph; public: SparseGraph(int n, bool directed); ~SparseGraph(); int V(); int E(); bool hasEdge(int v, int w); void addEdge(int v, int w); void show(); class Iterator { private: SparseGraph &m_G; int m_vertex; int m_index; public: Iterator(SparseGraph &g, int v): m_G(g) { m_vertex = v; m_index = -1; } ~Iterator() { } int begin() { m_index = 0; if (m_G.m_graph[m_vertex].size() > 0) return m_G.m_graph[m_vertex][0]; return -1; } int next() { m_index++; if (m_index < m_G.m_graph[m_vertex].size()) return m_G.m_graph[m_vertex][m_index]; return -1; } bool end() { return m_index >= m_G.m_graph[m_vertex].size(); } }; }; #endif /* SparseGraph_hpp */
true
cc59cb549447be754a3fbefb6062fefdbab55e28
C++
mvdsanden/mvds
/Process/execute.cc
UTF-8
1,835
2.953125
3
[]
no_license
#include "process.ih" #include <cstdlib> #include <fcntl.h> #include <iostream> #include "../FDStream/fdstream.hh" #include "../IOError/ioerror.hh" int Process::execute(std::string const &command) { d_inPipe[0] = 0; d_inPipe[1] = 0; // Create the pipes if (pipe(d_inPipe) < 0) throw IOError(errno,"Process: error creating in pipe"); if (pipe(d_outPipe) < 0) throw IOError(errno,"Process: error creating out pipe"); if (pipe(d_errPipe) < 0) throw IOError(errno,"Process: error creating err pipe"); // Fork! d_pid = fork(); if (d_pid < 0) throw runtime_error("Process: error forking"); else if (!d_pid) { // We are the child process! try { close(d_inPipe[1]); close(d_outPipe[0]); close(d_errPipe[0]); // Redirect stdin to the in pipe. if (dup2(d_inPipe[0],0) < 0) throw IOError(errno,"Process: redirecting stdin to in pipe"); close(d_inPipe[0]); // Redirect the stdout to the out pipe. if (dup2(d_outPipe[1],1) < 0) throw IOError(errno,"Process: redirecting stdout to out pipe"); close(d_outPipe[1]); // Redirect the stderr to the err pipe. if (dup2(d_errPipe[1],2) < 0) throw IOError(errno,"Process: redirecting stderr to err pipe"); close(d_errPipe[1]); // Run the command. if (execl("/bin/sh","/bin/sh","-c",command.c_str(),static_cast<char*>(0)) < 0) throw IOError(errno,"Process: executing process"); } catch (runtime_error &e) { cerr << "Process error in fork: " << e.what() << endl; // If it returns an error has occured... exit(1); } } else { // Close the end of the pipes we do not use. close(d_inPipe[0]); close(d_outPipe[1]); close(d_errPipe[1]); // Create stl streams from them. d_in = new OFDStream(d_inPipe[1]); d_out = new IFDStream(d_outPipe[0]); d_err = new IFDStream(d_errPipe[0]); } return d_pid; }
true
ca4b0600873cb8ded22578c9e3bc8534102b1070
C++
hobbang2/Algorithm
/legacy/백준알고리즘/boj6044_애너그램.cpp
UTF-8
1,060
3.109375
3
[]
no_license
//#include <iostream> //#include <string> //#include <vector> //#include <set> //#include <algorithm> //using namespace std; // //int main() //{ // int N; // cin >> N; // getchar(); // // vector <vector <char> > word_dict(N); // char alpha = '0'; // // for(int i = 0; i < N ; i++) // { // while (scanf("%c", &alpha), alpha != '\n') // { // word_dict[i].push_back(alpha); // } // // sort(word_dict[i].begin(), word_dict[i].end()); // do // { // for (auto it = word_dict[i].begin(); it != word_dict[i].end(); it++) // { // cout << *it; // } // cout << "\n"; // } while (next_permutation(word_dict[i].begin(), word_dict[i].end())); // } // // // return 0; //} #include <iostream> #include <string> #include <vector> #include <set> #include <algorithm> using namespace std; int main() { int N; cin >> N; getchar(); char alpha = '0'; for (int i = 0; i < N; i++) { string word; cin >> word; sort(word.begin(), word.end()); do { cout << word<<"\n"; } while (next_permutation(word.begin(), word.end())); } return 0; }
true
2a25ad3edcb6b83415b771ebb691a34959ecf916
C++
d3v1c3nv11/eduArdu
/SOFTWARE/3_eduArdu_LightSensor/Light_Sensor.cpp
UTF-8
259
3
3
[ "Apache-2.0" ]
permissive
#include "Light_Sensor.h" Light_Sensor::Light_Sensor (int _Pin) { Pin = _Pin; pinMode (Pin, INPUT_PULLUP); } int Light_Sensor::Read () { return analogRead(Pin); } float Light_Sensor::ReadPercentage () { return Read() * 100.0/1023.0; }
true
7d07a07c3c573fb1b779eb6a8701dffdb42f80f0
C++
ruher/libcanon
/include/libcanon/eldag.h
UTF-8
35,799
2.890625
3
[ "MIT" ]
permissive
/** Canonicalization of edge-labelled directed acyclic graphs. * * Edge-labelled directly acyclic graphs (ELDAGs) are generalization of the * normal DAGs with a label for each edge. And the labels for the edges can * possibly be permuted. The algorithm here is based on the spirit of the * algorithm by B McKay for normal graphs. */ #ifndef LIBCANON_ELDAG_H #define LIBCANON_ELDAG_H #include <algorithm> #include <cassert> #include <iterator> #include <memory> #include <numeric> #include <type_traits> #include <unordered_map> #include <utility> #include <vector> #include <libcanon/partition.h> #include <libcanon/perm.h> #include <libcanon/sims.h> #include <libcanon/string.h> #include <libcanon/utils.h> namespace libcanon { // // Type for eldags // --------------- // /** Data type for an Eldag. * * This is basically a CSR format to stored the children of each node. This * data structure should have very high cache friendliness. * * Note that variant information like the colour and symmetry at each node is * not stored here. * * It is implemented here as a struct since the structure should be transparent * to developers. */ struct Eldag { /** The edges from each node to other nodes. * * Stored as list of indices for the index of the nodes that they are * connected to. */ std::vector<size_t> edges; /** The start index for the connections of each node. * * This is basically the same as the IA array for CSR. */ std::vector<size_t> ia; /** Gets the number of nodes in the Eldag. */ size_t size() const { return ia.size() - 1; } /** Gets the number of edges in the Eldag. */ size_t n_edges() const { return edges.size(); } /** Gets the number of valences of a node. */ size_t n_valences(Point node) const { assert(node >= 0 && node < size()); return ia[node + 1] - ia[node]; } /** Creates an Eldag of a given size. * * Note that here the vectors are only set to the correct size without any * valid content. */ Eldag(size_t n_nodes, size_t n_edges) : edges(n_edges) , ia(n_nodes + 1) { } /** Creates an empty Eldag. * * This empty Eldag is not completely empty, a zero is already added to the * ia array. */ Eldag() : edges() , ia{ 0 } { } /** Constructs an eldag directly from its edges and ia. */ template <typename T1, typename T2, typename = std::enable_if_t< std::is_constructible<std::vector<size_t>, T1>::value>, typename = std::enable_if_t< std::is_constructible<std::vector<size_t>, T2>::value>> Eldag(T1&& edges, T2&& ia) : edges(std::forward<T1>(edges)) , ia(std::forward<T2>(ia)) { } /** Copy constructs an eldag. */ Eldag(const Eldag& eldag) = default; /** Move constructs an eldag. */ Eldag(Eldag&& eldag) = default; /** Copy assignment for an eldag. */ Eldag& operator=(const Eldag& eldag) = default; /** Move assignment for an eldag. */ Eldag& operator=(Eldag&& eldag) = default; /** Pushes the current number of edges into ia. * * This method can be helpful after finish adding edges from a node. */ void update_ia() { ia.push_back(edges.size()); } /** Evaluates the hash of an Eldag. * * This is a very simple-minded hash function, just the values in the two * arrays are combined. */ size_t hash() const { size_t seed = 0; for (size_t i : edges) { combine_hash(seed, i); } for (size_t i : ia) { combine_hash(seed, i); } return seed; } /** Compares two eldags for equality. */ bool operator==(const Eldag& other) const { return ia == other.ia && edges == other.edges; } /** Compares two eldges lexicographically. * * This comparison does not have any actual physical meanings. However, it * does constitute a total order on the set of all eldags. */ bool operator<(const Eldag& other) const { return ia < other.ia || (ia == other.ia && edges < other.edges); } }; // // Utilities for node symmetries and permutations // ---------------------------------------------- // /** The data type to given symmetries for the nodes in an Eldag. * * Here the container is fixed to vector for the ease of coding. Null values * are considered to be the absence of any symmetries. * * This type is going to be mainly used as input for the symmetries of nodes in * the public driver functions for Eldag canonicalization. */ template <typename P> using Node_symms = std::vector<const Sims_transv<P>*>; /** The data type for the permutations to be applied to nodes in an Eldag. * * A vector of unique pointer to the given permutation type. This is going to * be mainly in the return value of the public driver function for Eldag * canonicalization. Note that here the value owns the reference to the * permutations. */ template <typename P> using Node_perms = std::vector<std::unique_ptr<P>>; /** Data type for owned references to node symmetries. */ template <typename P> using Owned_node_symms = std::vector<std::unique_ptr<Sims_transv<P>>>; /** Data type for borrowed references to node permutations. */ template <typename P> using Borrowed_node_perms = std::vector<const P*>; /** Borrows references from owned references. * * It is here implemented with vector hard-coded. This is designed solely for * the node symmetry and permutation types. */ template <typename T> std::vector<const T*> borrow_pointers( const std::vector<std::unique_ptr<T>>& owned_pointers) { std::vector<const T*> res; std::transform(owned_pointers.begin(), owned_pointers.end(), std::back_inserter(res), [](const auto& i) { return i.get(); }); return res; } /** Acts permutations on an Eldag. * * Here the global permutation of the nodes should be given in a * permutation-like object supporting operators `<<` and `>>`, the local * permutation acting on each node should be given as an indexable container * containing pointer-like objects pointing to the actual permutations on each * node. Null values indicates the absence of any permutation. */ template <typename G, typename L> Eldag act_eldag(const G& gl_perm, const L& perms, const Eldag& eldag) { size_t size = eldag.size(); Eldag res(size, eldag.n_edges()); res.ia.clear(); // The index that the next connection is going to be written to. size_t curr_idx = 0; res.ia.push_back(curr_idx); // Constructs the nodes in the result one-by-one. for (size_t curr = 0; curr < size; ++curr) { Point pre_img = gl_perm >> curr; size_t prev_base = eldag.ia[pre_img]; size_t valence = eldag.ia[pre_img + 1] - prev_base; for (size_t i = 0; i < valence; ++i) { size_t offset = i; if (perms[pre_img]) { offset = *perms[pre_img] >> offset; } assert(offset >= 0 && offset < valence); Point conn = gl_perm << eldag.edges[prev_base + offset]; res.edges[curr_idx] = conn; ++curr_idx; } res.ia.push_back(curr_idx); } return res; } /** Data type for a permutation on an Eldag. * * Inside it, we have not only the global permutation of the nodes, but the * permutation on valences of each nodes as well. * * Note that the permutation stored in the graph automorphism are not of * this type, but rather simple permutations of the nodes. This is * achieved by delegate to proxy types for the expression `g | ~h`. */ template <typename P> struct Eldag_perm { /** The permutations on each of the nodes. */ Node_perms<P> perms; /** The global partition of the nodes. * * It should be a singleton partition already. */ Partition partition; /** The class for the inversion of an Eldag permutation. */ struct Inv_eldag_perm { const Eldag_perm& operand; }; /** Inverses a permutation. * * No actual inversion is done. Just a proxy is returned. */ Inv_eldag_perm operator~() const { return { *this }; } /** Forms an automorphism. * * This function will be called by the generic canonicalization * function by the evaluation of the expression `p | ~q`. */ Simple_perm operator|(const Inv_eldag_perm& inv) { size_t size = partition.size(); std::vector<Point> pre_imgs(size); const auto& p = partition.get_pre_imgs(); const auto& q = inv.operand.partition.get_pre_imgs(); for (size_t i = 0; i < size; ++i) { // By ~q, q[i] <- i; pre_imgs[q[i]] = p[i]; } return std::move(pre_imgs); } /** Gets the pre-image of a given point. */ Point operator>>(Point point) const { return partition >> point; } /** Gets the permutations for each node. * * The returned vector will have borrowed reference for the permutations. */ Borrowed_node_perms<P> get_perms() const { return borrow_pointers(perms); } }; /** Acts an eldag with a given permutation. * * This is a convenience wrapper function for acting the permutations * encapsulated in an Eldag_perm object onto an Eldag. */ template <typename P> Eldag act_eldag(const Eldag_perm<P>& perm, const Eldag& eldag) { return act_eldag(perm.partition.make_perm(), perm.get_perms(), eldag); } // // Core canonicalization support // ----------------------------- // /** Data type for a coset in the canonicalization of an Eldag. * * Basically, it has a global partition of the nodes, the symmetries and * applied permutations for each of the nodes, which can be from the parent * coset or from the refined permutation and symmetries owned by itself. */ template <typename P> class Eldag_coset { public: /** Constructs a coset based on initial partition and symmetries. * * This is useful for the creation of root coset. * * The templating here is just for perfect forwarding. The initial * partition is assumed to be a Partition object. */ template <typename T> Eldag_coset( const Eldag& eldag, T&& init_part, const Node_symms<P>& init_symms) : partition_(std::forward<T>(init_part)) , perms_(init_part.size(), nullptr) , symms_(init_symms) , refined_perms_(init_part.size()) , refined_symms_(init_part.size()) , individualized_(init_part.size()) { assert(init_part.size() == init_symms.size()); refine(eldag); } /** Constructs a coset by individualizing a point. * * This is useful for the individualization step. Note that this * construction is better used on cosets after refinement. */ Eldag_coset(const Eldag& eldag, const Eldag_coset& base, Point point) : partition_(base.partition_, point) , perms_(base.perms_) , symms_(base.symms_) , refined_perms_(eldag.size()) , refined_symms_(eldag.size()) , individualized_(point) { refine(eldag); } /** Constructs a coset by acting a permutation. * * This is useful for the pruning of the refinement tree. Note that the * created coset is not actually fully valid one. Just the individualized * point is correctly set for the sake of removing the actual coset in a * hash set/map. */ Eldag_coset(const Eldag_coset& base, const Simple_perm& perm) : partition_() , perms_() , symms_() , refined_perms_() , refined_symms_() , individualized_(perm << base.individualized()) { } // // Individualization support // // The cosets with individualized node needs to be able to be looped over // lazily. // /** Container for a non-singleton cell. * * In addition to storing a pair of iterators for the points in the cell, * here we also have reference to the eldag and the parent coset. In this * way, it can be iterable to get the cosets from individualizing the * points in the cell. * * For convenience, it is implemented as a template in case we need other * forms of iterators. */ template <typename Cell_it> class Nonsingleton_cell { public: /** Constructs a non-singleton cell. */ Nonsingleton_cell(const Eldag& eldag, const Eldag_coset& coset, Cell_it cell_begin, Cell_it cell_end) : eldag_(eldag) , parent_(coset) , cell_begin_(cell_begin) , cell_end_(cell_end) { } /** Gets the begin of the iterator over the cell. * * Here we make a copy that is slightly redundant. In this way, the * cell can be iterated over multiple times when it is really needed. */ Cell_it cell_begin() const { return cell_begin_; } /** Gets the end of the iterator over the cell. */ Cell_it cell_end() const { return cell_end_; } /** Gets the eldag. */ const Eldag& eldag() const { return eldag_; } /** Gets the parent coset. */ const Eldag_coset& parent() const { return parent_; } private: /** The eldag that the coset is for. */ const Eldag& eldag_; /** The parent coset. */ const Eldag_coset& parent_; /** The begin of the iterators for the non-singleton cell. */ Cell_it cell_begin_; /** Sentinel for iterating over the points in the non-singleton cell. */ Cell_it cell_end_; }; /** Forms a non-singleton cell instance. * * Let's just hope for earlier wide adoption of C++17. */ template <typename Cell_it> static Nonsingleton_cell<Cell_it> make_nonsingleton_cell(const Eldag& eldag, const Eldag_coset& coset, Cell_it cell_begin, Cell_it cell_end) { return { eldag, coset, cell_begin, cell_end }; } /** Iterator for iterating over cosets from individualizing points in cell. */ template <typename Cell_it> struct Invididualized_it { /** The actual iterator over the points. */ Cell_it curr; /** Reference to the non-singleton cell. */ const Nonsingleton_cell<Cell_it>& cell; /** Increments the iterator. */ Invididualized_it& operator++() { ++curr; return *this; } /** Dereferences the iterator. * * Note that here the dereferencing gives values directly (R-value). */ Eldag_coset operator*() const { return { cell.eldag(), cell.parent(), *curr }; } /** Compares two iterators for equality. */ bool operator==(const Invididualized_it& other) const { return curr == other.curr; } /** Compares two iterators for inequality. */ bool operator!=(const Invididualized_it& other) const { return !(*this == other); } /** The reference type. * * This iterator generates the points as R-value directly. */ using reference = Eldag_coset; /** The value type. */ using value_type = Eldag_coset; /** The iterator category. */ using iterator_category = std::input_iterator_tag; /** The pointer type. * * Here we temporarily do not implement the -> operator. It can be * added when portability problem occurs. */ using pointer = void; /** Different type. * * Here we just use the major signed int type. */ using difference_type = ptrdiff_t; }; /** Begins the iteration over the individualized cosets. */ template <typename Cell_it> friend Invididualized_it<Cell_it> begin( const Nonsingleton_cell<Cell_it>& nonsingleton_cell) { return { nonsingleton_cell.cell_begin(), nonsingleton_cell }; } /** Gets the sentinel for iterating over individualized cosets. */ template <typename Cell_it> friend Invididualized_it<Cell_it> end( const Nonsingleton_cell<Cell_it>& nonsingleton_cell) { return { nonsingleton_cell.cell_end(), nonsingleton_cell }; } /** Individualizes the refined partition. * * Here we return a lazy iterable that can be looped over to get the actual * cosets from individualizing the points in the first non-singleton cell. */ auto individualize_first_nonsingleton(const Eldag& eldag) const { auto cell = std::find_if(partition_.begin(), partition_.end(), [&](auto cell) { return partition_.get_cell_size(cell) > 1; }); // When used correctly, we should find a non-singleton cell here. assert(cell != partition_.end()); return make_nonsingleton_cell(eldag, *this, partition_.cell_begin(*cell), partition_.cell_end(*cell)); } // // End of individualization section. // /** Tests if the result is a leaf. */ bool is_leaf(const Eldag& eldag) const { return partition_.is_discrete(); } /** Gets a perm from the coset. * * This method can only be called on leaves. And it will *move* the * information about the permutation into the result. */ Eldag_perm<P> get_a_perm() const { // Here we can skip some unnecessary copy by having the refined // permutations and partitions as mutable. // Node_perms<P> node_perms(size()); for (size_t i = 0; i < size(); ++i) { if (!perms_[i]) { // When we have never applied a permutation on the node. continue; } else if (refined_perms_[i]) { // When the leaf coset actually owns the permutation. node_perms[i] = std::move(refined_perms_[i]); } else { // Or we have to make a copy since it might still going to be // used by earlier cosets. node_perms[i] = std::make_unique<P>(*perms_[i]); } } return { std::move(node_perms), std::move(partition_) }; } /** Gets the point individualized during its construction. */ Point individualized() const { return individualized_; } /** Gets the size of the graph. * * Here we use the size of the immutable permutations vector, in case the * contents in mutable members has been moved out. */ size_t size() const { size_t size = perms_.size(); assert(symms_.size() == size); return size; } /** Compares two cosets for equality. * * Here only the point that is individualized is compared. So it is * actually only applicable to peers. */ bool operator==(const Eldag_coset& other) const { return individualized() == other.individualized(); } /** Evaluates the hash of a coset. * * Note that only the individualized point is used. So it is only * useful for retrieval amongst it peers. */ size_t hash() const { return individualized(); } private: // // Core refinement facilities // // Data types for node distinguishing. /** The orbit label of valences of a node. * * Values of this type can be used to map a valence of a node to its orbit * label. Here longer orbits are considered smaller so that nodes with * higher degree will be given smaller index, which might be more natural. */ class Orbit : public std::vector<Point> { public: /** Alias for the base type. */ using Base = std::vector<Point>; /** Inheriting all the constructors from the base type. */ using Base::Base; /** Makes revdeg comparison. */ bool operator<(const Orbit& other) const { return is_degrev_less<std::vector<Point>>(*this, other); } }; /** The orbits of nodes in an Eldag. * * The orbit vector for any node should be able to be queried by indexing * it. */ using Orbits = std::vector<Orbit>; /** An edge in detail. * * It is a sorted list of all the orbit labels of all the edges from * the parent node to the children. */ using Detailed_edge = std::vector<size_t>; /** Detailed description of the in/out edges between a node and a cell. * * The result should be sorted for set semantics. It is implemented as a * struct here to have better control over the comparison order among them. * Since the values are mostly only used for lexicographical comparison, * without need to be queried for a specific edge, here it is based on * vector rather than multi-set for better cache friendliness with the same * complexity. */ class Detailed_edges : public std::vector<Detailed_edge> { public: /** Compares two for order. * * Here larger number of connections is considered smaller. In * this way, when we sweep the cells from beginning to end, nodes * with more connection with nodes of earlier colour will be put * earlier. */ bool operator<(const Detailed_edges& other) const { return is_degrev_less<std::vector<Detailed_edge>>(*this, other); } }; /** Detailed description of the connection between a node and a cell. * * Here we have information about both the in and the out edges. Default * lexicographical order will be used. * * Normally for Eldag, either the in edges or the out edges are just empty. */ using Conn = std::pair<Detailed_edges, Detailed_edges>; /** The connection information of all nodes. * * This vector is designed to be directly indexed by node labels for the * connection description. Note that normally only the entries for nodes * in the same cell are comparable. */ using Conns = std::vector<Conn>; // Driver function. /** Refines the global partition and local symmetries. * * Most of the actual work of the canonicalization of Eldag actually * comes here. */ void refine(const Eldag& eldag) { // Refine until fixed point. while (true) { // First refine the automorphism at each node and form the orbits. refine_nodes(eldag); Orbits orbits = form_orbits(eldag); // // Unary split based on orbits. // bool split = false; // Back up the current partition for unary split, which does not // benefit from the repeated refinement. std::vector<size_t> curr_partition( partition_.begin(), partition_.end()); for (auto i : curr_partition) { split |= partition_.split_by_key(i, [&](auto point) -> const Orbit& { return orbits[point]; }); } if (split) { // Binary split is expensive. Refine as much as possible // before carrying it out. continue; } // Now all the nodes in the same cell must have identical orbit // labelling. So that their comparison by connection labels start // to make sense. // // Binary split. // split = false; Conns conns(size()); // Here for each loop, we always take advantage of the latest // refine due to the special semantics of looping over cells in a // partition. for (auto splittee_i = partition_.rbegin(); splittee_i != partition_.rend(); ++splittee_i) { for (auto splitter_i = partition_.begin(); splitter_i != partition_.end(); ++splitter_i) { // Short-cut singleton partitions. It is put here rather // than the upper loop since a cell might be partitioned to // singleton early before all the splitters are looped // over. if (partition_.get_cell_size(*splittee_i) < 2) break; update_conns4cell( conns, eldag, orbits, *splittee_i, *splitter_i); split |= partition_.split_by_key(*splittee_i, [&](auto point) -> const Conn& { return conns[point]; }, splittee_i, splitter_i); } // End loop over splitters. } // End loop over splittees. if (split) { continue; } else { // Now we reached a fixed point. break; } }; // End main loop. } // Local refinement of the symmetries. /** The class representing the valences of a node. * * This class is designed to be directly interoperable with the string * canonicalization facilities. */ class Valence { public: Valence(const Eldag& eldag, const Partition& partition, Point node, const P* perm) : eldag_(&eldag) , partition_(&partition) , node_(node) , perm_(perm) { assert(eldag.size() == partition.size()); assert(0 <= node && node < partition.size()); } /** Gets the colour of the node connected to a given slot. */ Point operator[](size_t slot) const { size_t offset = slot; if (perm_) { offset = *perm_ >> slot; } auto base_idx = eldag_->ia[node_]; assert(offset >= 0 && offset < eldag_->n_valences(node_)); return partition_->get_colour(eldag_->edges[base_idx + offset]); } private: /** The Eldag that the valence is for. */ const Eldag* eldag_; /** The current partition of the nodes in the Eldag. */ const Partition* partition_; /** The node label for this. */ Point node_; /** The current permutation of the node. */ const P* perm_; }; /** Refines the automorphism of all nodes. * * In this function, the permutations and symmetries for each node will be * refined as much as possible based on the current partition of the nodes. */ void refine_nodes(const Eldag& eldag) { // Refinement for nodes are independent. for (size_t i = 0; i < size(); ++i) { auto curr_symm = symms_[i]; if (!curr_symm) { // Nodes without symmetry, without need for *further* // refinement. continue; } Valence valence(eldag, partition_, i, perms_[i]); auto canon_res = canon_string(valence, *curr_symm); if (!perms_[i]) { // When nothing has ever been applied to the node. refined_perms_[i] = std::make_unique<P>(std::move(canon_res.first)); } else { // Just to be safe about the order of evaluation. auto new_perm = std::make_unique<P>(*perms_[i] | canon_res.first); refined_perms_[i] = std::move(new_perm); } refined_symms_[i] = std::move(canon_res.second); perms_[i] = refined_perms_[i].get(); symms_[i] = refined_symms_[i].get(); } } /** Forms the orbit label array for all nodes. */ Orbits form_orbits(const Eldag& eldag) const { Orbits res{}; for (size_t node = 0; node < eldag.size(); ++node) { size_t n_valences = eldag.n_valences(node); Orbit orbit(n_valences); std::iota(orbit.begin(), orbit.end(), 0); for (size_t base = 0; base < n_valences; ++base) { for (const Sims_transv<P>* transv = symms_[node]; transv != nullptr; transv = transv->next()) { for (const auto& perm : *transv) { orbit[perm << base] = orbit[base]; } } } res.push_back(std::move(orbit)); } return res; } // Binary refinements. /** Updates the connection information. */ void update_conns4cell(Conns& conns, const Eldag& eldag, const Orbits& orbits, Point splittee, Point splitter) { // Normally this function should not be called on singleton cells, // since it can be just purely waste. assert(partition_.get_cell_size(splittee) > 1); std::for_each(partition_.cell_begin(splittee), partition_.cell_end(splittee), [&](Point base) { Detailed_edges& ins = conns[base].first; Detailed_edges& outs = conns[base].second; ins.clear(); outs.clear(); std::for_each(partition_.cell_begin(splitter), partition_.cell_end(splitter), [&](Point curr) { // Add connection with the current point. add_detailed_edges(ins, eldag, orbits, curr, base); add_detailed_edges(outs, eldag, orbits, base, curr); }); std::sort(ins.begin(), ins.end()); std::sort(outs.begin(), outs.end()); }); } /** Adds detailed edge from a point to another if there is any. * * Empty connection will not be added. */ void add_detailed_edges(Detailed_edges& dest, const Eldag& eldag, const Orbits& orbits, Point from, Point to) { Detailed_edge edge{}; size_t base_idx = eldag.ia[from]; size_t n_valences = eldag.n_valences(from); for (size_t i = 0; i < n_valences; ++i) { Point conn_node = eldag.edges[base_idx + i]; if (conn_node == to) { size_t index = perms_[from] ? *perms_[from] << i : i; edge.push_back(orbits[from][index]); } } if (edge.size() == 0) return; std::sort(edge.begin(), edge.end()); dest.push_back(std::move(edge)); return; } // // Data fields // /** The partition of graph nodes. * * It will be refined in the initialization. It is set to be mutable here * so that the constant method for getting a permutation can move its * content out without copying. */ mutable Partition partition_; // // Here we have two arrays for both node permutations and node symmetries, // with one being owned pointers and another being borrowed. // // The rationale for this is that the borrowed pointers are for the // symmetries and permutations passed in from earlier cosets. And the // owned ones will be for the symmetries and permutations refined from the // current step. When further refinement is carried out for a node in the // current step, the two are actually identical. Or when further // refinement is not carried out for a node, the owned pointer will stay to // be null and the borrowed pointers will stay what it was set to be. // /** The current permutations applied to the nodes. */ Borrowed_node_perms<P> perms_; /** The current symmetries for each of the nodes. */ Node_symms<P> symms_; /** The permutation on each node after refinement. * * It is set to be mutable here so that the constant method for getting a * permutation can extract its content out. */ mutable Node_perms<P> refined_perms_; /** Refined symmetries for each node. */ Owned_node_symms<P> refined_symms_; /** * The point that is individualized in the construction of this coset. */ Point individualized_; }; /** The actual refiner for Eldag canonicalization. */ template <typename P> class Eldag_refiner { public: // // Types required by the refiner protocol. // using Coset = Eldag_coset<P>; using Structure = Eldag; // // Types not required by the refiner protocol. // // They are included here just for convenience. using Perm = Eldag_perm<P>; /** Refines the given coset. */ auto refine(const Eldag& eldag, const Coset& coset) { return coset.individualize_first_nonsingleton(eldag); } /** Decides if a coset is a leaf. */ bool is_leaf(const Eldag& eldag, const Coset& coset) { return coset.is_leaf(eldag); } /** Gets a permutation from a coset. */ Perm get_a_perm(const Coset& coset) { return coset.get_a_perm(); } /** Acts a permutation on an Eldag. */ Eldag act(const Perm& perm, const Eldag& eldag) { return act_eldag(perm, eldag); } /** Left multiplies an automorphism onto a coset. */ Coset left_mult(const Simple_perm& perm, const Coset& coset) { return { coset, perm }; } /** Creates a transversal system for automorphisms. */ auto create_transv(const Coset& upper, const Coset& lower) { assert(upper.size() == lower.size()); return std::make_unique<Sims_transv<P>>( lower.individualized(), upper.size()); } }; /** Canonicalizes the given Eldag. * * Similar to the case of string canonicalization, here the permutation bring * the Eldag into canonical form is returned. But the automorphism group * returned is with respect to the original graph rather than the canonical * form. */ template <typename P, typename F> std::pair<Eldag_perm<P>, std::unique_ptr<Sims_transv<P>>> canon_eldag( const Eldag& eldag, const Node_symms<P>& symms, F init_colour) { Partition init_part(eldag.size()); init_part.split_by_key(0, init_colour); Eldag_refiner<P> refiner{}; Eldag_coset<P> root_coset(eldag, init_part, symms); using Container = std::unordered_map<Eldag, Eldag_perm<P>>; Container container{}; auto aut = add_all_candidates(refiner, eldag, root_coset, container); const auto& canon_form = std::min_element(container.begin(), container.end(), [](const auto& a, const auto& b) { return a.first < b.first; }); auto min_aut = min_transv(std::move(aut)); return { std::move(canon_form->second), std::move(min_aut) }; } } // End namespace libcanon. // // Std namespace injection for default hashing. // namespace std { /** Hasher for Eldag. */ template <> struct hash<libcanon::Eldag> { size_t operator()(const libcanon::Eldag& eldag) const { return eldag.hash(); } }; /** Hash for Eldag coset. */ template <typename P> struct hash<libcanon::Eldag_coset<P>> { size_t operator()(const libcanon::Eldag_coset<P>& coset) const { return coset.hash(); } }; } // End namespace std #endif // LIBCANON_ELDAG_H
true
7d154998f07095fd1f467eaa0ec4a087177878ea
C++
tomaszkrysiuk/szkolenieWroclaw
/buyablesquare.cpp
UTF-8
684
2.6875
3
[]
no_license
#include "buyablesquare.h" void BuyableSquare::onEnter(Player& enteringPlayer) { if(owner) chargeFee(enteringPlayer); else proposePurchase(enteringPlayer); } void BuyableSquare::chargeFee(Player& playerToCharge) { auto fee = getFee(); if(owner)//todo (*owner)->giveMoney(playerToCharge.takeMoney(fee)); } void BuyableSquare::proposePurchase(Player& enteringPlayer) { if(enteringPlayer.proposePurchase(this)) owner = std::experimental::make_optional(&enteringPlayer); } void BuyableSquare::iOwnYou(Player& newOwner) { owner = &newOwner; } void BuyableSquare::free() { owner = std::experimental::optional<Player*>(); }
true
c4bdfcaf5be8e883514c2064626b6f7c4aa8edc8
C++
attkke/FuckCATS
/subject-4/OPT.cpp
UTF-8
2,722
3.109375
3
[]
no_license
// FILENAME: OPT.cpp #include <iostream> using namespace std; int main() { int memory[4] = {-1, -1, -1, -1}; int page[12] = {0, 6, 1, 5, 3, 7, 6, 7, 4, 3, 6, 1}; // the test pages int count = 0; // missing page count int replace[12]; // replace page record int pr = 0; // pointer of replace cout << "######OPT#######" << endl; // search begin for (int i = 0; i < 12; i++) { // there are 3 memory pages in memory ,so if i<3,just put it in memory if (i < 4) { memory[i] = page[i]; count++; } else { // check if this page is in memory already bool exist = false; for (int j = 0; j < 4; j++) { if (page[i] == memory[j]) { exist = true; break; } } if (exist == false) { //############################### // begin to choose a memory page to replace int later = 0; bool ok[4]; for (int j = 0; j < 4; j++) ok[j] = false; // check from i step -1 till 0 for (int j = i + 1; j < 12; j++) { for (int k = 0; k < 4; k++) { if (page[j] == memory[k]) { ok[k] = true; later++; break; } } if (later == 2) break; } // check which ok ==false for (int j = 0; j < 4; j++) { if (ok[j] == false) { // replace this memory[j] count++; replace[pr] = memory[j]; pr++; memory[j] = page[i]; break; } } //############################# } } // output cout << page[i] << ": [ "; for (int j = 0; j < 4; j++) { if (memory[j] == -1) cout << "* "; else cout << memory[j] << " "; } cout << "]" << endl; } cout << "######################" << endl; cout << "the lack page count = " << count << endl; cout << "repalce pages are : "; for (int i = 0; i < pr; i++) { cout << replace[i] << " "; } cout << endl; cout << "the rate of page lack is " << count / 12.0 * 100 << "%" << endl; return 0; }
true
27ad147e0ed12ed969f7baae1f362726e7987e4c
C++
Aya-ZIbra/Dijkstra
/Heap.h
UTF-8
1,943
3.40625
3
[]
no_license
/** * A simple Heap class. * * @author * Aya Zaki Ibrahim <aya.zaki.2012@gmail.com> */ /* supported operation - extractMin - removeMin - insert(key) - delete(key) - decreaseKey(key) */ #ifndef HEAP_H #define HEAP_H #include <vector> template <typename T> class Heap{ // no brackets after class name public: // if no constructor is present, we have an automatic default constructor // automatic default constructor initializes all member variables to their default values. Heap(); // custom default constructor: default = takes no arguments / custom = overrides default Heap(std::vector<T>& items); // custom non-default constructor T extractMin(); void removeMin(); void buildHeap(); void insert(T); std::ostream& print(std::ostream&); private: // Naming convention of private members // variables use _ after their name // functions use _ befor their name int capacity_; std::vector<T> container_; int _getLastIdx(); void _heapifyUp(int); void _heapifyDn(int); void _swap(int, int); bool _isLeaf(const int); int _getLeftChildIdx(const int idx); int _getRightChildIdx(const int idx); static int _getParentIdx(const int idx){ /* 1 : 2, 3 2: 4, 5 3: 6, 7 parent = idx/2 zero indexed : (idx+1)/2 -1 = (idx-1)/2 */ return (idx-1)/2; } }; // notice the ; after class definition //template <typename T> //std::ostream& operator<<(std::ostream&, const Heap<T>&); // for template class, declarations are not enough. // Function implementations need to be included // the implementations will be compiled within the client cpp file. No compilation is done to the hpp files. #include "Heap.hpp" #endif
true
215a6633727dd09991dd2c16f691a0f516a6188e
C++
PeachChen/test
/public/libutil/MyStream.h
GB18030
9,258
2.953125
3
[]
no_license
//ݲ #pragma once #include "DefineHeader.h" enum { STREAM_MAX_STRING_LEN=1024*1024*10, STREAM_MAX_VECTOR_LEN=1024*1024*10, STREAM_MAX_MAP_LEN=1024*1024*10, }; enum EStreamError { EStreamError_Error, EStreamError_OK, EStreamError_BufferFull, EStreamError_BadArg, }; //ݽӿ class BaseStream { public: uint8 m_StreamError; // BaseStream() :m_StreamError(EStreamError_OK){}; virtual ~BaseStream(){}; EStreamError GetError() const { return (EStreamError)m_StreamError; } bool IsOK() const { return (m_StreamError == EStreamError_OK); } //л virtual BaseStream& BytesSerialize(const void* data, size_t size) = 0; //л virtual BaseStream& BytesDeserialize(void* data, size_t size) = 0; //ʼַ //virtual uint8* GetBuffer() = 0; //ƫ virtual size_t GetOffset() = 0; //ܴС virtual size_t GetSize() = 0; //дС virtual size_t GetSpace() { return GetSize() - GetOffset(); } #define BASESTREAM_SERIALIZE(valueType) \ BaseStream& operator << (valueType value) \ {\ return BytesSerialize(&value, sizeof(valueType)); \ }\ BaseStream& operator >> (valueType& value) \ {\ return BytesDeserialize(&value, sizeof(valueType));\ } BASESTREAM_SERIALIZE(int); BASESTREAM_SERIALIZE(uint); BASESTREAM_SERIALIZE(int8); BASESTREAM_SERIALIZE(uint8); BASESTREAM_SERIALIZE(int16); BASESTREAM_SERIALIZE(uint16); BASESTREAM_SERIALIZE(int64); BASESTREAM_SERIALIZE(uint64); BASESTREAM_SERIALIZE(float); BASESTREAM_SERIALIZE(double); BaseStream& operator << (bool value) { uint8 i = (value ? 1 : 0); return BytesDeserialize(&i, sizeof(uint8)); } BaseStream& operator >> (bool& value) { uint8 i = 0; BytesDeserialize(&i, sizeof(uint8)); value = (i == 1); return *this; } BaseStream& operator << (const char* str) { if (str == NULL) { m_StreamError = EStreamError_BadArg; return *this; } uint size = (uint)strlen(str); if (size > STREAM_MAX_MAP_LEN) { m_StreamError = EStreamError_BadArg; return *this; } BytesSerialize(&size, sizeof(uint)); return BytesSerialize(str, size); } BaseStream& operator << (const string& str) { uint size = (uint)str.length();//64λ32λһ if (size > STREAM_MAX_STRING_LEN) { m_StreamError = EStreamError_BadArg; Assert(false); return *this; } BytesSerialize(&size, sizeof(uint)); return BytesSerialize(str.c_str(), size); } BaseStream& operator >> (string& str) { uint size = 0; BytesDeserialize(&size, sizeof(uint)); str.clear(); if (size > 0) { if (size > STREAM_MAX_STRING_LEN) { m_StreamError = EStreamError_BadArg; Assert(false); return *this; } str.insert(0, size, 0); return BytesDeserialize(&(str[0]), size); } return *this; } //for Lua script system int8 ReadInt8() { int8 v = 0; BytesDeserialize(&v, sizeof(int8)); return v; } void WriteInt8(int8 v) { BytesSerialize(&v, sizeof(int8)); } uint8 ReadUint8() { uint8 v = 0; BytesDeserialize(&v, sizeof(uint8)); return v; } void WriteUint8(uint8 v) { BytesSerialize(&v, sizeof(uint8)); } int ReadInt() { int v = 0; BytesDeserialize(&v, sizeof(int)); return v; } void WriteInt(int v) { BytesSerialize(&v, sizeof(int)); } std::string ReadStr() { uint size = 0; BytesDeserialize(&size, sizeof(uint)); std::string str; str.clear(); if (size > 0) { str.insert(0, size, 0); BytesDeserialize(&str[0], size); } return str; } }; //ȫģ ͨ͵л //ҪͨԼʵSerializeDeserialize template<typename T> inline BaseStream& operator<<(BaseStream& os, const T& data) { data.Serialize(os); return os; } template<typename T> inline BaseStream& operator>>(BaseStream& is, T& data) { data.Deserialize(is); return is; } //vector л template<typename T> inline BaseStream& operator<<(BaseStream& os, const std::vector<T>& data) { uint size = (uint)data.size(); if (size > STREAM_MAX_VECTOR_LEN) { os.m_StreamError = EStreamError_BadArg; return os; } os << size; for (uint i = 0; i < size; ++i) { os << data[i]; } return os; } template<typename T> inline BaseStream& operator>>(BaseStream& is, std::vector<T>& data) { uint size =0; is >> size; if (size > STREAM_MAX_VECTOR_LEN) { is.m_StreamError = EStreamError_BadArg; return is; } data.resize((size_t)size); for (uint i = 0; i < size; ++i) { is >> data[i]; } return is; } //̶ class Stream :public BaseStream { protected: bool m_IsNew; uint8* m_Buffer; //ʼַ uint8* m_Pointer;//ǰַ size_t m_Size; //ܴС public: //ⲿݳʼ Stream(uint8* pBuffer, size_t size); //ڲ̶size Stream(size_t size); virtual ~Stream(){ ReleaseBuffer(); } bool IsOk() const { return (m_StreamError == EStreamError_OK); } //ͷڴ void ReleaseBuffer(); //ƫ virtual size_t GetOffset() { return (size_t)(m_Pointer - m_Buffer); } //ܴС virtual size_t GetSize() { return m_Size; } //ָӿ uint8* GetBuffer() { return m_Buffer; } uint8* GetOffsetPointer(){ return m_Pointer; } void ResetPointer(){ m_Pointer = m_Buffer; } void SetPointer(size_t size); //д bool SetData(size_t pos, const void* data, size_t size) { if (pos + size > m_Size) { assert(false); m_StreamError = EStreamError_BufferFull; return false; } memcpy(&(m_Buffer[pos]), data, size); return true; } //ƫǰ bool Ignore(size_t size) { if (GetSpace() < size) { assert(false); m_StreamError = EStreamError_BufferFull; return false; } m_Pointer += size; return true; } //л virtual BaseStream& BytesSerialize(const void* data, size_t size) { if (GetSpace() < size) { assert(false); m_StreamError = EStreamError_BufferFull; return *this; } memcpy(m_Pointer, data, size); m_Pointer += size; return *this; } //л virtual BaseStream& BytesDeserialize(void* data, size_t size) { if (GetSpace() < size) { m_StreamError = EStreamError_BufferFull; return *this; } memcpy(data, m_Pointer, size); m_Pointer += size; return *this; } //лԼ virtual void Serialize(BaseStream& streamTo) { if (this == &streamTo) { return; } streamTo.BytesSerialize(GetBuffer(), GetOffset()); } virtual void Deserialize(BaseStream& streamFrom) { if (this == &streamFrom) { return; } size_t len = streamFrom.GetOffset(); streamFrom.BytesDeserialize(GetBuffer(), len); SetPointer(len); } }; //̶С template<uint BufferSize> class BufferStream :public Stream { protected: uint8 m_MemBuffer[BufferSize]; public: BufferStream() :Stream(m_MemBuffer, BufferSize) { memset(m_MemBuffer, 0, sizeof(m_MemBuffer)); } }; //̬С class StringStream :public BaseStream { protected: vector<int8> m_Buffer; size_t m_Offset; public: StringStream() { m_Offset = 0; } virtual ~StringStream() {} virtual size_t GetOffset(){ return m_Offset; } virtual size_t GetSize() { return m_Buffer.size(); } vector<int8>& GetBuffer() { return m_Buffer; } const vector<int8>& GetBuffer() const { return m_Buffer; } void ResetOffset() { m_Offset = 0; } void Clean() { ResetOffset(); m_Buffer.clear(); } //м bool SetData(size_t pos, const void* data, size_t size) { m_Buffer.resize(m_Offset + size); memcpy(&(m_Buffer[pos]), data, size); return true; } void swap(StringStream& rs) { m_Buffer.swap(rs.m_Buffer); std::swap(m_Offset, rs.m_Offset); } //л virtual BaseStream& BytesSerialize(const void* data, size_t size) { if (data == NULL) { m_StreamError = EStreamError_BadArg; return *this; } if (size) { m_Buffer.resize(m_Offset + size); memcpy(&(m_Buffer[m_Offset]), data, size); m_Offset += size; } return *this; } virtual BaseStream& BytesDeserialize(void* data, size_t size) { if (data == NULL) { m_StreamError = EStreamError_BadArg; return *this; } if (m_Offset + size > m_Buffer.size()) { m_StreamError = EStreamError_BufferFull; return *this; } memcpy(data, &(m_Buffer[m_Offset]), size); m_Offset += size; return *this; } //лԼ virtual void Serialize(BaseStream& streamTo) { if (this == &streamTo) { assert(false); return; } streamTo << (int)GetOffset(); streamTo.BytesSerialize(&GetBuffer()[0], GetOffset()); } virtual void Deserialize(BaseStream& streamFrom) { if (this == &streamFrom) { m_StreamError = EStreamError_BadArg; return; } int dataSize = 0; streamFrom >> dataSize; m_Buffer.resize(dataSize); streamFrom.BytesDeserialize(&GetBuffer()[0], dataSize); } };
true
e18cbc630434a91791542ad8ca5ef8030f7bd5ff
C++
m43/fer-ooup
/lab3/ex1-3/myfactory.h
UTF-8
1,613
3.125
3
[]
no_license
// // Created by m43 on 18. 05. 2020.. // #ifndef FER_OOUP_MYFACTORY_H #define FER_OOUP_MYFACTORY_H #include <map> #include <memory> using namespace std; template<typename PRODUCT> class MyFactory { public: typedef PRODUCT *(*CREATORFUN)(const string &); static MyFactory<PRODUCT> &instance(); int registerCreator(const string &name, CREATORFUN creatorFunction); const map<string, CREATORFUN> &getCreators(); CREATORFUN getCreator(const string &name); private: MyFactory() = default;; ~MyFactory() = default; map<std::string, CREATORFUN> creatorsMap_; }; // NOTE: decl and def are in one file cause: // https://stackoverflow.com/questions/115703/storing-c-template-function-definitions-in-a-cpp-file // https://isocpp.org/wiki/faq/templates#templates-defn-vs-decl template<typename PRODUCT> MyFactory<PRODUCT> &MyFactory<PRODUCT>::instance() { static MyFactory instance_; return instance_; } template<typename PRODUCT> int MyFactory<PRODUCT>::registerCreator(const string &name, MyFactory::CREATORFUN creatorFunction) { creatorsMap_[name] = creatorFunction; return creatorsMap_.size() - 1; } template<typename PRODUCT> const map<string, typename MyFactory<PRODUCT>::CREATORFUN> &MyFactory<PRODUCT>::getCreators() { return creatorsMap_; } template<typename PRODUCT> typename MyFactory<PRODUCT>::CREATORFUN MyFactory<PRODUCT>::getCreator(const string &name) { auto creator = creatorsMap_.find(name); if (creator == creatorsMap_.end()) { return nullptr; } return creator->second; } #endif //FER_OOUP_MYFACTORY_H
true
73310cce16aff975853ef18e261608f0b3dcfe17
C++
akuzdeuov/kangaroo_x2_sabertooth32
/include/motorControl.h
UTF-8
1,442
2.859375
3
[]
no_license
// // Created by askat on 1/6/20. // #ifndef MOTORCONTROL_MOTORCONTROL_H #define MOTORCONTROL_MOTORCONTROL_H #include <iostream> #include <utility> // C library headers #include <string.h> // Linux headers #include <fcntl.h> // Contains file controls like O_RDWR #include <termios.h> // Contains POSIX terminal control definitions #include <unistd.h> // write(), read(), close() class Kangaroo{ public: // constructors Kangaroo() = default; Kangaroo(std::string &pn, speed_t &br){ portName = pn; baudRate = br; } // open the serial port void openSerialPort(); // configure the serial port void configureSerialPort(); // close the serial port void closeSerialPort(); // start motors void startMotor(char &motorID); // get motor position std::pair<int, bool> getPosition(char &motorID); // get motor speed std::pair<int, bool> getSpeed(char &motorID); // set a reference position void setPosition(char &motorID, int &pos); // set a reference position and speed void setPositionSpeed(char &motorID, int &pos, int &speed); // home position void homePosition(char &motorID); private: std::string portName = "/dev/ttyUSB0"; speed_t baudRate = B19200; int fd = 0; // // file description for the serial port useconds_t readTime = 25000; // time to read position (microsecond) }; #endif //MOTORCONTROL_MOTORCONTROL_H
true
4b69ae59d313f7dac7ba9743a530776436ea0577
C++
danlipsa/foamvis
/AverageCacheT1KDEVelocity.h
UTF-8
952
2.75
3
[]
no_license
/** * @file AverageCacheT1KDEVelocity.h * @author Dan R. Lipsa * @date 10 March 2011 * @ingroup model * @brief Cache of 2D averages for T1KDE and velocity. */ #ifndef __AVERAGE_CACHE_T1KDE_VELOCITY_H__ #define __AVERAGE_CACHE_T1KDE_VELOCITY_H__ /** * @brief Cache of 2D averages for T1KDE and velocity. */ class AverageCacheT1KDEVelocity { public: void SetT1KDE (vtkSmartPointer<vtkImageData> average) { m_t1KDE = average; } vtkSmartPointer<vtkImageData> GetT1KDE () const { return m_t1KDE; } void SetVelocity (vtkSmartPointer<vtkImageData> average) { m_velocityAverage = average; } vtkSmartPointer<vtkImageData> GetVelocity () const { return m_velocityAverage; } private: vtkSmartPointer<vtkImageData> m_t1KDE; vtkSmartPointer<vtkImageData> m_velocityAverage; }; #endif //__AVERAGE_CACHE_T1KDE_VELOCITY_H__ // Local Variables: // mode: c++ // End:
true
904162db3b5d16ba335e2b04d1487bb274616368
C++
NUC-NCE/algorithm-codes
/codes - ac/Gym/101653W/19564434_AC_15ms_236kB.cpp
UTF-8
1,555
2.515625
3
[]
no_license
#include<bits/stdc++.h> using namespace std; typedef long long ll; const int MAXN = 1e7 + 5; const int maxn = 2e5 + 5; const int inf = 2e9; int T; int p, w, q;//点数,虫洞数,询问数 double a[100][100]; map<string, int>mp; struct Node { double x, y, z; }point[100]; double dist(double x1, double y1, double z1, double x2, double y2, double z2) { return sqrt((x1 - x2)*(x1 - x2) + (y1 - y2)*(y1 - y2) + (z1 - z2)*(z1 - z2)); } void floyed() { for (int k = 1; k <= p; k++) { for (int i = 1; i <= p; i++) { for (int j = 1; j <= p; j++) { if (a[i][j] > a[i][k] + a[k][j]) a[i][j] = a[i][k] + a[k][j]; } } } } int main() { ios::sync_with_stdio(false); cin >> T; for(int cas=1;cas<=T;cas++) { memset(a,0,sizeof(a)); cin >> p; for (int i = 1; i <= p; i++) { string t; double x, y, z; cin >> t >> x >> y >> z; mp[t] = i; point[i].x = x; point[i].y = y; point[i].z = z; } for (int i = 1; i <= p; i++) { Node tem1 = point[i]; for (int j = 1; j <= p; j++) { if (i == j)continue; Node tem2 = point[j]; a[i][j] = dist(tem1.x, tem1.y, tem1.z, tem2.x, tem2.y, tem2.z); } } cin >> w; for (int i = 1; i <= w; i++) { string t, s; cin >> t >> s; a[mp[t]][mp[s]] = 0; } floyed(); cin >> q; cout<<"Case "<<cas<<":"<<endl; for(int i=1;i<=q;i++){ string t, s; cin >> t >> s; cout<<"The distance from "<<t<<" to "<<s<<" is "<< (int)(a[mp[t]][mp[s]]+0.5)<<" parsecs." << endl; } } return 0; } /* 3 4 e 0 0 0 p 5 0 0 b 5 5 0 s 0 5 0 2 e b b s 6 e b b s */
true
586e2977ed3c251494c24e20d2ddb161e29cbcfc
C++
bmstu-ics7/computer-graphics
/lab_07/mymath.cpp
UTF-8
378
2.9375
3
[ "MIT" ]
permissive
#include "mymath.h" int absx(int x) { return x >= 0 ? x : -x; } double absx(double x) { return x >= 0 ? x : -x; } int myRound(double x) { return int(x + 0.5 * (x / x)); } int signx(double x) { return x == 0.0 ? 0 : x > 1 ? 1 : -1; } int signx(int x) { return x == 0 ? 0 : x > 1 ? 1 : -1; } int negative(int cx, int x) { return cx - absx(cx - x); }
true
5e8cf6b43db3669af58e1154151df8e6002dc224
C++
Yangmila/c_code
/4/4-10-11.cpp
UTF-8
184
2.828125
3
[]
no_license
#include <iostream.h> int a[8]={1,3,5,7,9,11,13}; void fun(int b[],int n) { for(int i=0;i<n-1;i++) b[7]+=b[i]; } void main() { int m=8; fun(a,m); cout<<a[7]<<endl; }
true
18742e25209c7fa3d831451c8c4f9ec360100b0a
C++
protim2001/LeetCode
/power-of-two/power-of-two.cpp
UTF-8
895
3.375
3
[]
no_license
class Solution { public: bool isPowerOfTwo(int n) { //1. doing AND: O(1) /* if(n <= 0) return false; return n && (!(n & n - 1)); */ //2. taking log: log2(n) /*if(n <= 0) return false; return floor(log2(n)) == ceil(log2(n)); */ //3. count set bits : O(number of set bits) /*if(n <= 0) return false; int count = 0; while(n) { n &= n - 1; count++; } if(count == 1) return true; return false; */ //4. using while loop : O(log2n) if(n <= 0) return false; while(n != 1) { if(n % 2 != 0) return false; n /= 2; } return true; } };
true
74ac70a85dda14bf8194ab40071e162b62f76083
C++
BackhausL/cgv
/libs/vr/vr_kit.cxx
UTF-8
941
2.671875
3
[]
permissive
#include "vr_kit.h" namespace vr { /// construct vr_kit::vr_kit(vr_driver* _driver, void* _handle, const std::string& _name, bool _ffb_support, bool _wireless) : driver(_driver), device_handle(_handle), name(_name), force_feedback_support(_ffb_support), wireless(_wireless) {} /// declare virtual destructor vr_kit::~vr_kit() { } /// return driver const vr_driver* vr_kit::get_driver() const { return driver; } /// return device handle void* vr_kit::get_device_handle() const { return device_handle; } /// return name of vr_kit const std::string& vr_kit::get_name() const { return name; } /// return last error of vr_kit const std::string& vr_kit::get_last_error() const { return last_error; } /// return whether vr_kit is wireless bool vr_kit::is_wireless() const { return wireless; } /// return whether controllers support force feedback bool vr_kit::has_force_feedback() const { return force_feedback_support; } }
true
cd8402bb15547ac5561e86ad7241b5400c254d3d
C++
troytoman/Project4
/StockServer/stock.cpp
UTF-8
2,766
3.15625
3
[]
no_license
/* * stock.cpp * StockServer * * Created by Troy Toman on 4/17/10. * Copyright 2010 Troy Toman. All rights reserved. * */ #include "stock.h" void Stock::createlisting (string ssymbol, float sprice, string coname) { stocksymbol = ssymbol; price = sprice; companyname = coname; } void Stock::updatePrice () { float r = (float)rand()/(float)RAND_MAX; // if (stocksymbol == "AAPL") // cout << stocksymbol << ": " << price << endl; if((rand() % 2) && price > 1.0) { price = price - (price*r/10000.0); } else { price = price + (price*r/10000.0); } // if (stocksymbol == "AAPL") // cout << stocksymbol << ": " << price << endl; } // Stock constructor allocates the stock and starts a thread to update the price StockHolding::StockHolding () { shares = 0; s = sm.getStock("NULL"); }; // Change the amount of shares in the Stock by numshares. If there are not enough // shares to sell that many, return. int StockHolding::Sell (int numshares) { if (numshares > shares) { return(0); } else { shares -= numshares; return(numshares); } }; // Change the amount of shares in the Stock by numshares. If there are not enough // shares to sell that many, return -1. int StockHolding::Buy (int numshares) { shares += numshares; return shares; }; int StockHolding::setStock(string stocksymbol) { s = sm.getStock(stocksymbol); if (s==0) { return 0; } else { return 1; } }; string Stock:: view() { stringstream retstr; retstr << "Stock: " << companyname << "( " << stocksymbol << " ) Price: " << price; return retstr.str(); } string StockHolding::view() { stringstream retstr; retstr << s->view() << " Shares: " << shares; return retstr.str(); } void StockMarket::gopricing(){ //Handles price changes //Walks through the stocklist and adjusts the price up or down by a randomly generated percentage while (1) { for (int i=0; i<NUMSTOCKS; i++) { stocklist[i].updatePrice(); } } }; StockMarket::StockMarket(){ //Starts up the StockMarket and initiates the pricing thread ifstream stockfile ("stocks.txt"); string ssym, coname; float openprice; if (stockfile.is_open()) { //Read the stock list and get the initial prices for (int i=0; i<NUMSTOCKS; i++) { stockfile >> ssym; stockfile >> openprice; stockfile >> coname; stocklist[i].createlisting(ssym, openprice, coname); cout << "Created company name: " << coname << endl; } } else { cout << "stockfile not found\n"; } stocklist[NUMSTOCKS].createlisting("NULL", 0, "NULL"); stockfile.close(); }; Stock * StockMarket::getStock(string stsym) { //Provides a pointer to the stock object for (int i=0; i<=NUMSTOCKS; i++) { if (stsym == stocklist[i].getsymbol()) { return &stocklist[i]; } } return 0; }
true
19fddaa94973a12b4bb7eccad6ad99cc35bf4fab
C++
amikai/flv2ts
/src/bin/parse-flv.cc
UTF-8
3,479
2.546875
3
[]
no_license
#include <flv/parser.hh> #include <iostream> #include <inttypes.h> int main(int argc, char** argv) { if(argc != 2) { std::cerr << "Usage: parse-flv FLV_FILE" << std::endl; return 1; } const char* filepath = argv[1]; flv2ts::flv::Parser parser(filepath); if(! parser) { std::cerr << "Can't open file: " << filepath << std::endl; } std::cout << "[file]" << std::endl << " path: " << filepath << std::endl << std::endl; flv2ts::flv::Header header; if(! parser.parseHeader(header)) { std::cerr << "parse flv header failed" << std::endl; return 1; } // header std::cout << "[header]" << std::endl << " signature: " << header.signature[0] << header.signature[1] << header.signature[2] << std::endl << " version: " << (int)header.version << std::endl << " is_audio: " << (header.is_audio ? "true" : "false") << std::endl << " is_video: " << (header.is_video ? "true" : "false") << std::endl << " data_offset: " << header.data_offset << std::endl << std::endl; parser.abs_seek(header.data_offset); // body for(int i=0;; i++) { size_t offset = parser.position(); flv2ts::flv::Tag tag; uint32_t prev_tag_size; if(! parser.parseTag(tag, prev_tag_size)) { std::cerr << "parse flv tag failed" << std::endl; return 1; } if(parser.eos()) { break; } std::cout << "[tag:" << i << ":" << offset << "]" << std::endl << " filter: " << (tag.filter ? "true" : "false") << std::endl << " type: " << (int)tag.type << std::endl << " data_size: " << tag.data_size << std::endl << " timestamp: " << tag.timestamp << std::endl << " stream_id: " << tag.stream_id << std::endl; switch(tag.type) { case flv2ts::flv::Tag::TYPE_SCRIPT_DATA: { std::cout << " [script_data]" << std::endl << " payload_size: " << tag.script_data.payload_size << std::endl; break; } case flv2ts::flv::Tag::TYPE_AUDIO: { std::cout << " [audio]" << std::endl << " sound_format: " << (int)tag.audio.sound_format << std::endl << " sound_rate: " << (int)tag.audio.sound_rate << std::endl << " sound_size: " << (int)tag.audio.sound_size << std::endl << " sound_type: " << (int)tag.audio.sound_type << std::endl; if(tag.audio.sound_format == 10) { std::cout << " aac_packet_type: " << (int)tag.audio.aac_packet_type << std::endl; } std::cout << " payload_size: " << tag.audio.payload_size << std::endl; break; } case flv2ts::flv::Tag::TYPE_VIDEO: { std::cout << " [video]" << std::endl << " frame_type: " << (int)tag.video.frame_type << std::endl << " codec_id: " << (int)tag.video.codec_id << std::endl; if(tag.video.codec_id == 7) { std::cout << " avc_packet_type: " << (int)tag.video.avc_packet_type << std::endl << " composition_time: " << (int)tag.video.composition_time << std::endl; } std::cout << " payload_size: " << tag.video.payload_size << std::endl; break; } default: std::cerr << "unknown tag type: " << (int)tag.type << std::endl; return 1; } std::cout << std::endl; } return 0; }
true
d43b483367eb8b8ae0e921429ff43500ce843055
C++
flourpower/cpp
/rev/rev.cpp
UTF-8
1,202
3.6875
4
[]
no_license
//reverse the words in an input string #include <iostream> #include <vector> using namespace std; void tokenize(const string& str, vector<string>& tokens, const string& delimiters = " \t") { // Skip delimiters at beginning. string::size_type lastPos = str.find_first_not_of(delimiters, 0); // Find first "non-delimiter". string::size_type pos = str.find_first_of(delimiters, lastPos); while (string::npos != pos || string::npos != lastPos) { // Found a token, add it to the vector. tokens.push_back(str.substr(lastPos, pos - lastPos)); // Skip delimiters. Note the "not_of" lastPos = str.find_first_not_of(delimiters, pos); // Find next "non-delimiter" pos = str.find_first_of(delimiters, lastPos); } } void rev(string str){ //reverse the words in this string int j; vector<string> words; tokenize(str, words, " \t"); for(vector<string>::iterator i = words.begin(); i != words.end(); i++){ for(j = (i->size()) - 1; j >= 0; j--){ cout << (*i)[j]; } cout << " "; } } int main(int argc, char** argv){ rev("my name is fred"); cout << endl; }
true
076234d23fa0a561af0e3436ae7bdbf2d262c21b
C++
Karlodun/c-
/Milestone 1/Spiel_des_Lebens_GUI/raptors.cpp
UTF-8
2,280
3.046875
3
[]
no_license
#include "raptors.h" #include "Raptors.h" Raptors::Raptors() { Locations = new int [Population]; Age = new int [Population]; } Raptors::~Raptors() { delete [] Locations; delete [] Age; } int Raptors::Grow(int newID){ // create and fill BackPack: BackPack = new int [Population]; for (int i=0; i<Population; i++) BackPack[i]=Locations[i]; // increase population, fix Locations length and copy BackPack back Population++; Locations = new int [Population]; for (int i=0; i<Population; i++) Locations[i]=BackPack[i]; // add new animal to locations: Locations[Population]=newID; // procede with Age for (int i=0; i<Population; i++) BackPack[i]=Age[i]; Age = new int [Population]; for (int i=0; i<Population; i++) Age[i]=BackPack[i]; Age[Population]=0; delete [] BackPack; return newID; } int Raptors::Decay(int deadID){ Population--; BackPack = new int [Population]; // drop id of dead animal // copy all values before dead animal for (int i=0; i<deadID; i++) BackPack[i]=Locations[i]; // copy all values after dead animal for (int i=deadID; i<=Population; i++) BackPack[i]=Locations[i+1]; // recreate and fill Locations Locations = new int [Population]; for (int i=0; i<=Population; i++) Locations[i]=BackPack[i]; // procede with Age for (int i=0; i<deadID; i++) BackPack[i]=Age[i]; // copy all values after dead animal for (int i=deadID; i<=Population; i++) BackPack[i]=Age[i+1]; // recreate and fill Locations Age = new int [Population]; for (int i=0; i<=Population; i++) Age[i]=BackPack[i]; delete [] BackPack; return deadID; } int Raptors::Move(int herdID, int newID, int newIDType){ /* randomization could be realized with a herdIds shuffle * like: * random_shuffle(std::begin(herdIDs), std::end(herdIDs)); * neither the necessary variables, nor functionality is implemented here * since there is just no need */ if (newIDType==1) Age[herdID]=0;//we had some food, reset age else Age[herdID]++; // we had no food, thus olden if (Age[herdID]>maxAge) return 0; // we tell the caller, that cell has reached end of life else Locations[herdID] = newID; return 1; }
true
0f7150238ac741733af85aeb20fc41db7ae0816b
C++
platinum78/cs_learning
/04_Programming Exercise/SWExpertAcademy/7853/7853.cpp
UTF-8
1,069
2.9375
3
[]
no_license
#include <cstdio> #include <cstring> #define DIV 1000000007 char strBuf[1001]; long tripleCmp(long n1, long n2, long n3) { if (n1 == n2) { if (n2 == n3) return 1; else return 2; } else { if (n2 == n3) return 2; else if (n1 == n3) return 2; else return 3; } } long charReplacable(int len) { long totalCase = 1; if (strBuf[0] != strBuf[1]) totalCase *= 2; // else // ++totalCase; for (int i = 1; i < len - 1; i++) totalCase = totalCase * tripleCmp(strBuf[i - 1], strBuf[i], strBuf[i + 1]) % DIV; if (strBuf[len - 2] != strBuf[len - 1]) totalCase *= 2; // else // ++totalCase; return totalCase % DIV; } int main(void) { freopen("input.txt", "r", stdin); int tcCnt; scanf("%d", &tcCnt); for (int tc = 1; tc <= tcCnt; tc++) { scanf("%s", strBuf); printf("#%d %ld \n", tc, charReplacable(strlen(strBuf))); } return 0; }
true
970cd139ea2e575e3279187965de7974cc0951f4
C++
venkat78/agrid
/surface_mesh/hole_filler.hpp
UTF-8
3,045
2.765625
3
[]
no_license
/* * hole_filler.hpp * * Created on: Nov 28, 2011 */ #ifndef _SURFACE_MESH_HOLE_FILLER_HPP_ #define _SURFACE_MESH_HOLE_FILLER_HPP_ #include <queue> using namespace std; #include "surface_mesh_class.hpp" class cHOLE_VERTEX_RECORD { public: cHOLE_VERTEX_RECORD(); VOID VertexIndex(cSURFACE_MESH::cVERTEX* vertex) {VertexIndex(vertex->Index());} VOID VertexIndex(iVERTEX vertexIndex) {m_vertex_index = vertexIndex;} VOID IncomingHE(cSURFACE_MESH::cHALF_EDGE* inHE) {m_in_half_edge = inHE;} VOID OutgoingHE(cSURFACE_MESH::cHALF_EDGE* outHE) {m_out_half_edge = outHE;} cSURFACE_MESH::cHALF_EDGE *IncomingHE() {return m_in_half_edge;} cSURFACE_MESH::cHALF_EDGE *OutgoingHE() {return m_out_half_edge;} REAL ComputeAngleCosine(cSURFACE_MESH *m_mesh); REAL AngleCosine() const {return m_angle_cosine;} iVERTEX VertexIndex() const {return m_vertex_index;} private: //fields iVERTEX m_vertex_index; cSURFACE_MESH::cHALF_EDGE *m_in_half_edge; cSURFACE_MESH::cHALF_EDGE *m_out_half_edge; REAL m_angle_cosine; }; struct sHOLE_VERTEX_RECORD_CMP { BOOL operator() ( const cHOLE_VERTEX_RECORD &hvr1, const cHOLE_VERTEX_RECORD &hvr2) { if (fabs(hvr1.AngleCosine() - hvr2.AngleCosine()) <= cLIMITS::Epsilon()) return hvr1.VertexIndex() < hvr2.VertexIndex(); else return hvr1.AngleCosine() < hvr2.AngleCosine(); } }; class cHOLE_FILLER { public: cHOLE_FILLER(cSURFACE_MESH *mesh); //constructor BOOL Perform(); private: //methods BOOL CloseHole1(); BOOL FindCycle(); BOOL FillHole(); VOID CollectCycleVertices(iVERTEX terminalVtx, BOOL checkTerminalVtx); VOID PrepareVetexRecords(); cSURFACE_MESH::cHALF_EDGE* RegisterVertexRecord(cSURFACE_MESH::cHALF_EDGE* currBorderHE); INT FillAtSmallestAngleVertex(); INT FillAtVertexZeroTriangles(cHOLE_VERTEX_RECORD &vertexRecord); INT FillAtVertexOneTriangle(cHOLE_VERTEX_RECORD &vertexRecord); INT FillAtVertexTwoTriangles(cHOLE_VERTEX_RECORD &vertexRecord); INT FillAtVertexThreeTriangles(cHOLE_VERTEX_RECORD &vertexRecord); // std::list<cHOLE_VERTEX_RECORD>::iterator FindSmallestAngleVertexRecord(); private: //fields cSURFACE_MESH *m_mesh; std::vector<BOOL> m_vertexVisited; std::vector<iVERTEX> m_cycleVertices; std::stack<cSURFACE_MESH::cHALF_EDGE*> m_boundaryHalfEdges; std::priority_queue<cHOLE_VERTEX_RECORD, std::vector<cHOLE_VERTEX_RECORD>, sHOLE_VERTEX_RECORD_CMP > m_vertex_records; REAL m_cosine_0; //adjacent edges are merged REAL m_cosine_1; //generates a single triangle REAL m_cosine_2; //generates two triangles REAL m_small_edge_length_squared; //size of a degenerate edge to be immediately removed REAL m_comparable_edge_size_coeff; REAL m_max_half_edge_squared_length; REAL m_min_half_edge_squared_length; iFACET m_first_hole_facet_index; iVERTEX m_first_hole_vertex_index; }; #endif // _SURFACE_MESH_HOLE_FILLER_HPP_
true
194c787d2b50bb744d10e0fcaf1d6b5dd7b74432
C++
Aarafat77VU/Data-Structure-Lab-Linked-List
/l.cpp
UTF-8
521
3.203125
3
[]
no_license
#include<iostream> #include<list> using namespace std; class Queue { list<int>mylist; public: void Push(int x) { mylist.push_back(x); } void Pop() { mylist.pop_front(); } int Front() { cout<<mylist.front()<<endl; } int Back() { cout<< mylist.back()<<endl; } }; int main() { Queue q; q.Push(1); q.Push(2); q.Push(2); q.Push(4); q.Front(); q.Pop(); q.Pop(); q.Front(); }
true
22436f642d2d56414b48bff272255531b860112c
C++
yumdeer/daily_practice
/vs_project/extern/extern/extern.cpp
UTF-8
272
2.84375
3
[]
no_license
#include <iostream> using namespace std; //fun.h template <typename T> void fun(T t) { cout << t << endl; } //use1.cpp void test1() { fun<int>(1); } //use2.cpp //extern template void fun<int>(int); void test2() { fun<int>(2); } int main() { test1(); test2(); }
true
d3497eba634af586e32fe818db6f1fcd7f43b740
C++
WhiZTiM/coliru
/Archive2/ce/969fb443886ae9/main.cpp
UTF-8
388
2.859375
3
[]
no_license
#include <iostream> #include <type_traits> struct A { int m; }; struct B { int m1; private: int m2; }; struct C { virtual void foo(); }; int main() { std::cout << std::boolalpha; std::cout << std::is_standard_layout<A>::value << '\n'; std::cout << std::is_standard_layout<B>::value << '\n'; std::cout << std::is_standard_layout<C>::value << '\n'; }
true
6e3f8ed7e6789b4e9e0bbad23691f5999c25ad9a
C++
google/fully-homomorphic-encryption
/transpiler/examples/calculator/calculator_test.cc
UTF-8
1,265
3.0625
3
[ "LicenseRef-scancode-unknown-license-reference", "Apache-2.0" ]
permissive
// Copyright 2021 Google LLC // // Licensed under the Apache License, Version 2.0 (the "License"); // you may not use this file except in compliance with the License. // You may obtain a copy of the License at // // http://www.apache.org/licenses/LICENSE-2.0 // // Unless required by applicable law or agreed to in writing, software // distributed under the License is distributed on an "AS IS" BASIS, // WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. // See the License for the specific language governing permissions and // limitations under the License. #include "calculator.h" #include "gtest/gtest.h" TEST(CalculatorTest, Sum) { Calculator st; int result = st.process(64, 45, '+'); EXPECT_EQ(result, 109); } TEST(CalculatorTest, SumNegativeValue) { Calculator st; int result = st.process(64, -45, '+'); EXPECT_EQ(result, 19); } TEST(CalculatorTest, SumTwoNegativeValues) { Calculator st; int result = st.process(-64, -45, '+'); EXPECT_EQ(result, -109); } TEST(CalculatorTest, Subtraction) { Calculator st; int result = st.process(64, 45, '-'); EXPECT_EQ(result, 19); } TEST(CalculatorTest, Multiplication) { Calculator st; int result = st.process(10, 20, '*'); EXPECT_EQ(result, 200); }
true
16607cd7d9e74cfd95926e05463b56b5255806d4
C++
Josedm92/UD2
/pipiiiii.cpp
UTF-8
1,179
3.828125
4
[]
no_license
//Ejemplo 3.5.2 de la página 82 - Programa que calcula el valor de pi con una precisión establecida. #include <iostream> //Incluimos librería iostream que permite la entrada por teclado y la salida por pantalla. #include <cmath> //Incluimos librería cmath para poder usar la raíz cúbica (cbrt) y la potencia (pow). #include <iomanip> //Incluimos librería iomanip para poder establecer la precisión en el cálculo de pi (setprecision). using namespace std; //Sentencia obligatoria. //Inicio del programa. int main () { //Declaración e inicialización de variables. int precision; long double sumandos=0.0; long double valor=0.0; //Pedimos por pantalla el numero de sumandos que se quieran para calcular pi. cout << "Introduzca el número de sumandos con los que se desea calcular pi: "; cin >> precision; //Bucle que calcula el valor de pi. for (int i=0; i<=precision; i++) { sumandos+=pow(-1.0,i)/pow(((2.0*i)+1.0),3); //Cálculo con los sumandos actuales. valor=cbrt(32.0*sumandos); //Cálculo de pi. //Sacamos por pantalla el valor actual de pi. cout << "Valor de PI aproximado (" << i << "): " << setprecision(precision) << valor << endl; } }
true
27994073e5c5624203ad5bc8eac2bb5a940b32a3
C++
Innand/ProjetInfo2
/Complet_sauf_k-connexe/Version22/accueil.cpp
ISO-8859-1
2,342
2.828125
3
[]
no_license
#include "accueil.h" /*************************************************** THING (test) Cette classe correspond au cadre en bas gauche avec diffrents bidules interactifs assembls dessus VOIR LE CONSTRUCTEUR ET LA METHODE UPDATE EN DETAIL ( dans test.cpp ) pour dcrypter l'utilisation des widgets proposs ( vous pouvez en ajouter d'autres en compltant widget.h et widget.cpp, rpertoire de projet grman ) ****************************************************/ /// Le constructeur de la classe (pas forcment par dfaut !) /// initialise les donnes des widgets, place la hirarchie des sous-cadres etc... /// Tous les widgets sont des attributs directs (PAS DES POINTEURS, PAS DE NEW) /// de la classe encapsulante (ici Thing) de telle sorte qu'ils sont dtruits /// automatiquement quand la classe Thing est dtruite. Thing::Thing() { /// Menu test m_menu.add_child(m_graphe_1); m_graphe_1.set_pos(235, 195); m_graphe_1.set_dim(310,40); m_menu.add_child(m_graphe_2); m_graphe_2.set_pos(235, 260); m_graphe_2.set_dim(310,40); m_menu.add_child(m_graphe_3); m_graphe_3.set_pos(235, 322); m_graphe_3.set_dim(310,40); m_menu.add_child(m_exit); m_exit.set_dim(35,18); m_exit.set_pos(765, 0); m_exit.set_bg_color(ROUGE); } /// Une mthode update de la classe doit tre appele dans la boucle de jeu /// et cette mthode doit propager l'appel update sur les widgets contenus... /// Cette mthode fait le lien entre l'interface, les vnements, et les consquences void Thing::update2() { m_menu.update(); } std::string Thing::accueil(BITMAP* fond_menu, bool *stop, bool *fin_boucle) { std::string nom=""; blit(fond_menu,grman::page, 0,0,0,0, SCREEN_W, SCREEN_H); if(m_graphe_1.clicked()) { nom="pics"; *stop=true; } if(m_graphe_2.clicked()) { nom="pics2"; *stop=true; } if(m_graphe_3.clicked()) { nom="pics3"; *stop=true; } if(m_exit.clicked()) { *stop=true; *fin_boucle=true; } return nom; } /// On a des allocations dynamiques dans m_dynaclowns => nettoyer dans le destructeur Thing::~Thing() {}
true
cfbee69c702829e27e3e07e5f0f13b8673f5113a
C++
BoHauHuang/Leetcode
/easy/110. Balanced Binary Tree/Balanced Binary Tree.cpp
UTF-8
689
3.375
3
[]
no_license
/** * Definition for a binary tree node. * struct TreeNode { * int val; * TreeNode *left; * TreeNode *right; * TreeNode() : val(0), left(nullptr), right(nullptr) {} * TreeNode(int x) : val(x), left(nullptr), right(nullptr) {} * TreeNode(int x, TreeNode *left, TreeNode *right) : val(x), left(left), right(right) {} * }; */ class Solution { public: bool ok = true; int dfs(TreeNode* root){ if(!root || !ok) return 0; int L = dfs(root->left); int R = dfs(root->right); if(abs(L-R) > 1) ok = false; return max(L, R)+1; } bool isBalanced(TreeNode* root) { dfs(root); return ok; } };
true
6bca3912108f1bc514f98d8c0b5a0cff5bae4ee6
C++
wojtek5739g/Programy
/main (14).cpp
UTF-8
380
3.203125
3
[]
no_license
#include <iostream> using namespace std; int funkcja (int k) { int w; for (int i=1; i<=k; i++) { if (i*i*i==k) { w=i; } } if (w*w*w==k) return 1; else return 0; } int main() { for (int i=1; i<=1000; i++) { if (funkcja(i)==1) cout << i << endl; } return 0; }
true
48bea8d9356df141edd00bc67788ed9950fcc314
C++
hliuliu/USACO
/milk/milk.cpp
UTF-8
813
2.84375
3
[]
no_license
/* ID: heng_li1 TASK: milk LANG: C++11 */ /* LANG can be C++11 or C++14 for those more recent releases */ #include <iostream> #include <fstream> #include <string> #include <vector> #include <utility> #include <algorithm> using namespace std; typedef pair<int,int> PII; int main() { ofstream fout ("milk.out"); ifstream fin ("milk.in"); int n,m; fin >> n >> m; vector<PII> markets (m,PII()); for (PII &p: markets) { fin >> p.first >> p.second; } sort(markets.begin(),markets.end(), [] (PII &a,PII &b) {return a.first<b.first;}); int ans =0; for (PII &p: markets) { int delta = min(n, p.second); ans += p.first*delta; n-= delta; if (!n) { break; } } fout << ans << endl; fout.close(); return 0; }
true