max_stars_repo_path
stringlengths
3
269
max_stars_repo_name
stringlengths
4
119
max_stars_count
int64
0
191k
id
stringlengths
1
7
content
stringlengths
6
1.05M
score
float64
0.23
5.13
int_score
int64
0
5
neuralmonkey/nn/projection.py
Simon-Will/neuralmonkey
5
16500
"""Module which implements various types of projections.""" from typing import List, Callable import tensorflow as tf from neuralmonkey.nn.utils import dropout def maxout(inputs: tf.Tensor, size: int, scope: str = "MaxoutProjection") -> tf.Tensor: """Apply a maxout operation. Implementation of Maxout layer (Goodfellow et al., 2013). http://arxiv.org/pdf/1302.4389.pdf z = Wx + b y_i = max(z_{2i-1}, z_{2i}) Arguments: inputs: A tensor or list of tensors. It should be 2D tensors with equal length in the first dimension (batch size) size: The size of dimension 1 of the output tensor. scope: The name of the scope used for the variables Returns: A tensor of shape batch x size """ with tf.variable_scope(scope): projected = tf.layers.dense(inputs, size * 2, name=scope) maxout_input = tf.reshape(projected, [-1, 1, 2, size]) maxpooled = tf.nn.max_pool( maxout_input, [1, 1, 2, 1], [1, 1, 2, 1], "SAME") reshaped = tf.reshape(maxpooled, [-1, size]) return reshaped def multilayer_projection( input_: tf.Tensor, layer_sizes: List[int], train_mode: tf.Tensor, activation: Callable[[tf.Tensor], tf.Tensor] = tf.nn.relu, dropout_keep_prob: float = 1.0, scope: str = "mlp") -> tf.Tensor: mlp_input = input_ with tf.variable_scope(scope): for i, size in enumerate(layer_sizes): mlp_input = tf.layers.dense( mlp_input, size, activation=activation, name="mlp_layer_{}".format(i)) mlp_input = dropout(mlp_input, dropout_keep_prob, train_mode) return mlp_input def glu(input_: tf.Tensor, gating_fn: Callable[[tf.Tensor], tf.Tensor] = tf.sigmoid) -> tf.Tensor: """Apply a Gated Linear Unit. Gated Linear Unit - Dauphin et al. (2016). http://arxiv.org/abs/1612.08083 """ dimensions = input_.get_shape().as_list() if dimensions[-1] % 2 != 0: raise ValueError("Input size should be an even number") lin, nonlin = tf.split(input_, 2, axis=len(dimensions) - 1) return lin * gating_fn(nonlin)
3.546875
4
test_default_application/application.py
Ca11MeE/dophon
1
16501
<filename>test_default_application/application.py # properties detail please read \ # default_properties.py in dophon_properties module \ # inside your used dophon module package. # author: CallMeE
1.085938
1
afk.py
bsoyka/sunset-bot
1
16502
<filename>afk.py from datetime import datetime from textwrap import shorten from typing import Optional, Union import discord from discord.abc import Messageable from discord.errors import Forbidden from discord.ext.commands import Bot, Cog, Context, check, command, is_owner from discord.utils import get from config import CONFIG from database import Afk as DbAfk from database import User as DbUser from database import get_user def afk_access(ctx: Context) -> bool: return any( role.id in (CONFIG.guild.roles.afk_access, CONFIG.guild.roles.staff) for role in ctx.author.roles ) class AfkCog(Cog, name='AFK'): def __init__(self, bot: Bot): self.bot = bot @command(name='afk') @check(afk_access) async def afk_command(self, ctx: Context, *, reason: str) -> None: """Marks you as AFK Shows the given reason (shortened to 75 characters) when someone mentions you in Sunset City and adds `[AFK]` to your nickname AFK status is automatically removed when you start typing or send a message in our server """ reason = shorten(reason, 75, placeholder='...') account = get_user(ctx.author.id) afk = DbAfk(reason=reason, old_nick=ctx.author.nick) try: await ctx.author.edit(nick='[AFK] ' + ctx.author.display_name) except Forbidden: pass account.afk = afk account.save() embed = discord.Embed( title='You have been marked AFK', color=discord.Color.blurple() ) embed.add_field(name='Reason', value=reason) embed.set_footer( text='This will be cleared automatically when you start typing in ' 'Sunset City' ) await ctx.send(embed=embed, delete_after=5) await ctx.message.delete() @command(name='removeafk') @is_owner() async def remove_afk(self, ctx: Context, user: discord.Member) -> None: await self.remove_afk_if_needed(get_user(user.id), user, ctx.channel) await ctx.message.add_reaction('✅') async def remove_afk_if_needed( self, account: DbUser, user: discord.Member, channel: Optional[discord.TextChannel] = None, ) -> None: if account.afk is None: return if channel is None: channel = self.bot.get_channel(CONFIG.guild.channels.chat) try: await user.edit(nick=account.afk.old_nick) except Forbidden: pass await channel.send( user.mention, embed=discord.Embed( title='Your AFK status has been removed', color=discord.Color.blurple(), ), delete_after=4, ) del account.afk account.save() @Cog.listener() async def on_message(self, message: discord.Message) -> None: if message.author.bot: return from_account = get_user(message.author.id) if from_account is not None: await self.remove_afk_if_needed( from_account, message.author, message.channel ) for mentioned_user in message.mentions: if ( mentioned_user.bot or self.bot.get_user(mentioned_user.id) is None ): return mentioned_account = get_user(mentioned_user.id) if ( mentioned_account is not None and mentioned_account.afk is not None ): old_name = ( mentioned_account.afk.old_nick if mentioned_account.afk.old_nick is not None else mentioned_user.name ) embed = discord.Embed( title=f'{old_name} is currently AFK', color=discord.Color.gold(), ) embed.add_field( name='Reason', value=mentioned_account.afk.reason ) await message.reply(embed=embed, delete_after=8) @Cog.listener() async def on_typing( self, channel: Messageable, user: Union[discord.User, discord.Member], when: datetime, ) -> None: if user.bot or type(user) != discord.Member: return from_account = get_user(user.id) if from_account is not None: await self.remove_afk_if_needed(from_account, user, channel) @Cog.listener() async def on_raw_reaction_add( self, payload: discord.RawReactionActionEvent ) -> None: user = self.bot.get_user(payload.user_id) if user.bot or payload.member is None: return from_account = get_user(user.id) if from_account is not None: await self.remove_afk_if_needed(from_account, payload.member) @Cog.listener() async def on_user_update( self, before: discord.User, after: discord.User ) -> None: member = get(self.bot.guilds, id=CONFIG.guild.id).get_member(after.id) if member is None: return if member.bot: return from_account = get_user(member.id) if from_account is not None: await self.remove_afk_if_needed(from_account, member) @Cog.listener() async def on_invite_create(self, invite: discord.Invite) -> None: user = self.bot.guilds[0].get_member(invite.inviter.id) if user is None: return if user.bot: return from_account = get_user(user.id) if from_account is not None: await self.remove_afk_if_needed(from_account, user) def setup(bot: Bot) -> None: bot.add_cog(AfkCog(bot))
2.765625
3
dice/dice.pyde
ahoefnagel/ProjectA-Digital-Components
0
16503
<reponame>ahoefnagel/ProjectA-Digital-Components<filename>dice/dice.pyde # The shape of the numbers for the dice dice = { 1: [[None, None, None], [None, "", None], [None, None, None]], 2: [["", None, None], [None, None, None], [None, None, ""]], 3: [["", None, None], [None, "", None], [None, None, ""]], 4: [["", None, ""], [None, None, None], ["", None, ""]], 5: [["", None, ""], [None, "", None], ["", None, ""]], 6: [["", None, ""], ["", None, ""], ["", None, ""]]} dice_cnt = 3 def setup(): # Variable initialization global dice_no, score, count, debug dice_no = [] score = 0 count = 0 debug = True size(130 * dice_cnt, 155) def draw(): global dice_no, score, count textAlign(TOP, LEFT) textSize(12) # Clear the previous draws on the screen clear() fill(255) rect(0, 0, width, height) if dice_no == []: pushMatrix() fill(0) textAlign(CENTER, CENTER) textSize(8*dice_cnt) text("Click anywhere to roll the dice!", width/2, height/2) popMatrix() basex = 35 + width/2 - (dice_cnt * 130) / 2 if debug: basey = 60 else: basey = 30 for i in range(len(dice_no)): bx = (basex+i*130) # Fill the whole field with color x fill(232, 227, 218) # Draw a rect, this will be the dice rect(bx-30, basey-30, 120, 120, 12, 12, 12, 12) if dice_no != []: for y in range(len(dice[dice_no[i]])): for x in range(len(dice[dice_no[i]][y])): if dice[dice_no[i]][y][x] != None: # Draw the eye's of the dice, in the desired color fill(0) ellipse(bx + (x * 30), basey + (y * 30), 20, 20) if debug and dice_no != []: text("score: " + str(score) + " - Count: " + str(count) + " - Dice_No: " + str(dice_no), 0, 20) def mousePressed(): global dice_no, score, count if mouseButton == LEFT: score = 0 count = 0 # Get a random value for the dice dice_no = [int(random(1,7)) for x in range(dice_cnt)] score = sum(dice_no)
3.703125
4
src/pdf/domain/encrypt.py
ichiro-kazusa/PDFCon
0
16504
<filename>src/pdf/domain/encrypt.py from ..command.encrypt import EncryptionCommand class Encryption: def __init__(self, owner: str = '', user: str = '') -> None: self.__owner = owner self.__user = user self.__verify_entries() @property def owner(self): return self.__owner @property def user(self): return self.__user def __verify_entries(self): # ## verify encryption rules # when user password is given, empty owner password is not allowed . # -> use user password as owner password if self.__owner == '' and self.__user != '': self.__owner = self.__user @staticmethod def create_encryption_from_CMD(cmd: EncryptionCommand) -> 'Encryption': raise NotImplementedError()
3.125
3
photos/migrations/0002_auto_20190616_1812.py
savannah8/The-gallery
0
16505
# -*- coding: utf-8 -*- # Generated by Django 1.11 on 2019-06-16 15:12 from __future__ import unicode_literals from django.db import migrations class Migration(migrations.Migration): dependencies = [ ('photos', '0001_initial'), ] operations = [ migrations.RemoveField( model_name='image', name='image_category', ), migrations.RemoveField( model_name='image', name='image_location', ), migrations.DeleteModel( name='Category', ), migrations.DeleteModel( name='Image', ), migrations.DeleteModel( name='Location', ), ]
1.53125
2
scripts/old_scripts/test1.py
noambuckman/mpc-multiple-vehicles
1
16506
import time, datetime, argparse import os, sys import numpy as np np.set_printoptions(precision=2) import matplotlib.pyplot as plt import copy as cp import pickle PROJECT_PATH = '/home/nbuckman/Dropbox (MIT)/DRL/2020_01_cooperative_mpc/mpc-multiple-vehicles/' sys.path.append(PROJECT_PATH) import casadi as cas import src.MPC_Casadi as mpc import src.TrafficWorld as tw import src.IterativeBestResponseMPCMultiple as mibr import src.car_plotting_multiple as cmplot ########################################################## svo_theta = np.pi/4.0 # random_seed = args.random_seed[0] random_seed = 3 NEW = True if NEW: optional_suffix = "ellipses" subdir_name = datetime.datetime.now().strftime("%Y%m%d_%H%M%S") + optional_suffix folder = "results/" + subdir_name + "/" os.makedirs(folder) os.makedirs(folder+"imgs/") os.makedirs(folder+"data/") os.makedirs(folder+"vids/") os.makedirs(folder+"plots/") else: subdir_name = "20200224-103456_real_dim_CA" folder = "results/" + subdir_name + "/" print(folder) if random_seed > 0: np.random.seed(random_seed) ####################################################################### T = 3 # MPC Planning Horizon dt = 0.3 N = int(T/dt) #Number of control intervals in MPC n_rounds_mpc = 6 percent_mpc_executed = 0.5 ## This is the percent of MPC that is executed number_ctrl_pts_executed = int(np.floor(N*percent_mpc_executed)) XAMB_ONLY = False n_other = 2 n_rounds_ibr = 2 world = tw.TrafficWorld(2, 0, 1000) # large_world = tw.TrafficWorld(2, 0, 1000, 5.0) ######################################################################### actual_xamb = np.zeros((6, n_rounds_mpc*number_ctrl_pts_executed + 1)) actual_uamb = np.zeros((2, n_rounds_mpc*number_ctrl_pts_executed)) actual_xothers = [np.zeros((6, n_rounds_mpc*number_ctrl_pts_executed + 1)) for i in range(n_other)] actual_uothers = [np.zeros((2, n_rounds_mpc*number_ctrl_pts_executed)) for i in range(n_other)] actual_all_other_x0 = [np.zeros((6, 2*N)) for i in range(n_other)] xamb = np.zeros(shape=(6, N+1)) t_start_time = time.time() #################################################### ## Create the Cars in this Problem all_other_x0 = [] all_other_u = [] all_other_MPC = [] all_other_x = [np.zeros(shape=(6, N+1)) for i in range(n_other)] next_x0 = 0 for i in range(n_other): x1_MPC = mpc.MPC(dt) x1_MPC.n_circles = 3 x1_MPC.theta_iamb = svo_theta x1_MPC.N = N x1_MPC.k_change_u_v = 0.001 x1_MPC.max_delta_u = 50 * np.pi/180 * x1_MPC.dt x1_MPC.k_u_v = 0.01 x1_MPC.k_u_delta = .00001 x1_MPC.k_change_u_v = 0.01 x1_MPC.k_change_u_delta = 0.001 x1_MPC.k_s = 0 x1_MPC.k_x = 0 x1_MPC.k_x_dot = -1.0 / 100.0 x1_MPC.k_lat = 0.001 x1_MPC.k_lon = 0.0 x1_MPC.k_phi_error = 0.001 x1_MPC.k_phi_dot = 0.01 ####Vehicle Initial Conditions if i%2 == 0: lane_number = 0 next_x0 += x1_MPC.L + 2*x1_MPC.min_dist else: lane_number = 1 initial_speed = 0.75*x1_MPC.max_v traffic_world = world x1_MPC.fd = x1_MPC.gen_f_desired_lane(traffic_world, lane_number, True) x0 = np.array([next_x0, traffic_world.get_lane_centerline_y(lane_number), 0, 0, initial_speed, 0]).T ## Set the initial control of the other vehicles u1 = np.zeros((2,N)) # u1[0,:] = np.clip(np.pi/180 *np.random.normal(size=(1,N)), -2 * np.pi/180, 2 * np.pi/180) SAME_SIDE = False if lane_number == 1 or SAME_SIDE: u1[0,0] = 2 * np.pi/180 else: u1[0,0] = -2 * np.pi/180 u1[0,0] = 0 all_other_MPC += [x1_MPC] all_other_x0 += [x0] all_other_u += [u1] # Settings for Ambulance amb_MPC = cp.deepcopy(x1_MPC) amb_MPC.theta_iamb = 0.0 amb_MPC.k_u_v = 0.0000 amb_MPC.k_u_delta = .01 amb_MPC.k_change_u_v = 0.0000 amb_MPC.k_change_u_delta = 0 amb_MPC.k_s = 0 amb_MPC.k_x = 0 amb_MPC.k_x_dot = -1.0 / 100.0 amb_MPC.k_x = -1.0/100 amb_MPC.k_x_dot = 0 amb_MPC.k_lat = 0.00001 amb_MPC.k_lon = 0.0 # amb_MPC.min_v = 0.8*initial_speed amb_MPC.max_v = 35 * 0.447 # m/s amb_MPC.k_phi_error = 0.1 amb_MPC.k_phi_dot = 0.01 NO_GRASS = False amb_MPC.min_y = world.y_min amb_MPC.max_y = world.y_max if NO_GRASS: amb_MPC.min_y += world.grass_width amb_MPC.max_y -= world.grass_width amb_MPC.fd = amb_MPC.gen_f_desired_lane(world, 0, True) x0_amb = np.array([0, 0, 0, 0, initial_speed , 0]).T pickle.dump(x1_MPC, open(folder + "data/"+"mpc%d"%i + ".p",'wb')) pickle.dump(amb_MPC, open(folder + "data/"+"mpcamb" + ".p",'wb')) ######################################################################## #### SOLVE THE MPC ##################################################### for i_mpc in range(n_rounds_mpc): min_slack = np.infty actual_t = i_mpc * number_ctrl_pts_executed ###### Update the initial conditions for all vehicles if i_mpc > 0: x0_amb = xamb[:, number_ctrl_pts_executed] for i in range(len(all_other_x0)): all_other_x0[i] = all_other_x[i][:, number_ctrl_pts_executed] ###### Initial guess for the other u. This will be updated once the other vehicles ###### solve the best response to the ambulance. Initial guess just looks at the last solution. This could also be a lange change # Obtain a simulated trajectory from other vehicle control inputs all_other_x = [np.zeros(shape=(6, N+1)) for i in range(n_other)] all_other_x_des = [np.zeros(shape=(3, N+1)) for i in range(n_other)] for i in range(n_other): if i_mpc == 0: all_other_u[i] = np.zeros(shape=(6,N)) else: all_other_u[i] = np.concatenate((all_other_u[i][:, number_ctrl_pts_executed:], np.tile(all_other_u[i][:,-1:],(1, number_ctrl_pts_executed))),axis=1) ## x_mpci, u_all_i, x_0_i = all_other_MPC[i], all_other_u[i], all_other_x0[i] all_other_x[i], all_other_x_des[i] = x_mpci.forward_simulate_all(x_0_i, u_all_i) for i_rounds_ibr in range(n_rounds_ibr): ########## Solve the Ambulance MPC ########## response_MPC = amb_MPC response_x0 = x0_amb nonresponse_MPC_list = all_other_MPC nonresponse_x0_list = all_other_x0 nonresponse_u_list = all_other_u nonresponse_x_list = all_other_x nonresponse_xd_list = all_other_x_des ################# Generate the warm starts ############################### u_warm_profiles = mibr.generate_warm_u(N, response_MPC) ### Ambulance Warm Start if i_rounds_ibr > 0: # warm start with the solution from the last IBR round u_warm_profiles["previous"] = uamb else: # take the control inputs of the last MPC and continue the ctrl if i_mpc > 0: u_warm_profiles["previous"] = np.concatenate((uamb[:, number_ctrl_pts_executed:], np.tile(uamb[:,-1:],(1, number_ctrl_pts_executed))),axis=1) ## ####################################################################### min_response_cost = 99999999 for k_warm in u_warm_profiles.keys(): u_warm = u_warm_profiles[k_warm] x_warm, x_des_warm = response_MPC.forward_simulate_all(response_x0.reshape(6,1), u_warm) bri = mibr.IterativeBestResponseMPCMultiple(response_MPC, None, nonresponse_MPC_list ) k_slack = 10000.0 k_CA = 0.000000000000000 k_CA_power = 4 wall_CA = True bri.k_slack = k_slack bri.k_CA = k_CA bri.k_CA_power = k_CA_power bri.world = world bri.wall_CA = wall_CA # for slack_var in bri.slack_vars_list: ## Added to constrain slacks # bri.opti.subject_to(cas.vec(slack_var) <= 1.0) INFEASIBLE = True bri.generate_optimization(N, T, response_x0, None, nonresponse_x0_list, 1, slack=False) bri.opti.set_initial(bri.u_opt, u_warm) bri.opti.set_initial(bri.x_opt, x_warm) bri.opti.set_initial(bri.x_desired, x_des_warm) ### Set the trajectories of the nonresponse vehicles (as given) for i in range(n_other): bri.opti.set_value(bri.allother_x_opt[i], nonresponse_x_list[i]) bri.opti.set_value(bri.allother_x_desired[i], nonresponse_xd_list[i]) ### Solve the Optimization # Debugging # plot_range = [N] # bri.opti.callback(lambda i: bri.debug_callback(i, plot_range)) # bri.opti.callback(lambda i: print("J_i %.03f, J_j %.03f, Slack %.03f, CA %.03f"%(bri.solution.value(bri.response_svo_cost), bri.solution.value(bri.other_svo_cost), bri.solution.value(bri.k_slack*bri.slack_cost), bri.solution.value(bri.k_CA*bri.collision_cost)))) try: bri.solve(None, nonresponse_u_list) x1, u1, x1_des, _, _, _, _, _, _ = bri.get_solution() print("i_mpc %d n_round %d i %02d Cost %.02f Slack %.02f "%(i_mpc, i_rounds_ibr, i, bri.solution.value(bri.total_svo_cost), bri.solution.value(bri.slack_cost))) print("J_i %.03f, J_j %.03f, Slack %.03f, CA %.03f"%(bri.solution.value(bri.response_svo_cost), bri.solution.value(bri.other_svo_cost), bri.solution.value(bri.k_slack*bri.slack_cost), bri.solution.value(bri.k_CA*bri.collision_cost))) print("Dir:", subdir_name) print("k_warm", k_warm) INFEASIBLE = False if bri.solution.value(bri.slack_cost) < min_slack: current_cost = bri.solution.value(bri.total_svo_cost) if current_cost < min_response_cost: uamb = u1 xamb = x1 xamb_des = x1_des min_response_cost = current_cost min_response_warm = k_warm min_bri = bri # file_name = folder + "data/"+'%03d'%ibr_sub_it # mibr.save_state(file_name, xamb, uamb, xamb_des, all_other_x, all_other_u, all_other_x_des) # mibr.save_costs(file_name, bri) except RuntimeError: print("Infeasibility: k_warm %s"%k_warm) # ibr_sub_it +=1 ########### SOLVE FOR THE OTHER VEHICLES ON THE ROAD if not XAMB_ONLY: for i in range(len(all_other_MPC)): response_MPC = all_other_MPC[i] response_x0 = all_other_x0[i] nonresponse_MPC_list = all_other_MPC[:i] + all_other_MPC[i+1:] nonresponse_x0_list = all_other_x0[:i] + all_other_x0[i+1:] nonresponse_u_list = all_other_u[:i] + all_other_u[i+1:] nonresponse_x_list = all_other_x[:i] + all_other_x[i+1:] nonresponse_xd_list = all_other_x_des[:i] + all_other_x_des[i+1:] ################ Warm Start u_warm_profiles = mibr.generate_warm_u(N, response_MPC) if i_rounds_ibr > 0: # warm start with the solution from the last IBR round u_warm_profiles["previous"] = all_other_u[i] else: # take the control inputs of the last MPC and continue the ctrl if i_mpc > 0: u_warm_profiles["previous"] = np.concatenate((all_other_u[i][:, number_ctrl_pts_executed:], np.tile(all_other_u[i][:,-1:],(1, number_ctrl_pts_executed))),axis=1) ## min_response_cost = 99999999 for k_warm in u_warm_profiles.keys(): u_warm = u_warm_profiles[k_warm] x_warm, x_des_warm = response_MPC.forward_simulate_all(response_x0.reshape(6,1), u_warm) bri = mibr.IterativeBestResponseMPCMultiple(response_MPC, amb_MPC, nonresponse_MPC_list) bri.k_slack = k_slack bri.k_CA = k_CA bri.k_CA_power = k_CA_power bri.world = world bri.wall_CA = wall_CA INFEASIBLE = True bri.generate_optimization(N, T, response_x0, x0_amb, nonresponse_x0_list, 1, slack=False) # for slack_var in bri.slack_vars_list: ## Added to constrain slacks # bri.opti.subject_to(cas.vec(slack_var) <= 1.0) bri.opti.set_initial(bri.u_opt, u_warm) bri.opti.set_initial(bri.x_opt, x_warm) bri.opti.set_initial(bri.x_desired, x_des_warm) ### Set the trajectories of the nonresponse vehicles (as given) bri.opti.set_value(bri.xamb_opt, xamb) for i in range(len(nonresponse_x_list)): bri.opti.set_value(bri.allother_x_opt[i], nonresponse_x_list[i]) bri.opti.set_value(bri.allother_x_desired[i], nonresponse_xd_list[i]) # Debugging # bri.opti.callback(lambda i: bri.debug_callback(i, [N])) # bri.opti.callback(lambda i: print("J_i %.03f, J_j %.03f, Slack %.03f, CA %.03f"%(bri.solution.value(bri.response_svo_cost), bri.solution.value(bri.other_svo_cost), bri.solution.value(bri.k_slack*bri.slack_cost), bri.solution.value(bri.k_CA*bri.collision_cost)))) try: ### Solve the Optimization bri.solve(uamb, nonresponse_u_list) x1_nr, u1_nr, x1_des_nr, _, _, _, _, _, _ = bri.get_solution() print(" i_mpc %d n_round %d i %02d Cost %.02f Slack %.02f "%(i_mpc, i_rounds_ibr, i, bri.solution.value(bri.total_svo_cost), bri.solution.value(bri.slack_cost))) print(" J_i %.03f, J_j %.03f, Slack %.03f, CA %.03f"%(bri.solution.value(bri.response_svo_cost), bri.solution.value(bri.other_svo_cost), bri.solution.value(bri.k_slack*bri.slack_cost), bri.solution.value(bri.k_CA*bri.collision_cost))) print(" Dir:", subdir_name) print(" k_warm", k_warm) INFEASIBLE = False if bri.solution.value(bri.slack_cost) < min_slack: current_cost = bri.solution.value(bri.total_svo_cost) if current_cost < min_response_cost: all_other_u[i] = u1_nr all_other_x = all_other_x[:i] + [x1_nr] + all_other_x[i:] all_other_u = all_other_u[:i] + [u1_nr] + all_other_u[i:] all_other_x_des = all_other_x_des[:i] + [x1_des_nr] + all_other_x_des[i:] min_response_cost = current_cost min_response_warm = k_warm min_bri = bri # file_name = folder + "data/"+'%03d'%ibr_sub_it # mibr.save_state(file_name, xamb, uamb, xamb_des, all_other_x, all_other_u, all_other_x_des) # mibr.save_costs(file_name, bri) except RuntimeError: print(" Infeasibility: k_warm %s"%k_warm) # ibr_sub_it +=1 # print(" IBR Done: Rd %02d / %02d"%(i_rounds_ibr, n_rounds_ibr)) file_name = folder + "data/"+'r%02d%03d'%(i_mpc, i_rounds_ibr) if not INFEASIBLE: mibr.save_state(file_name, xamb, uamb, xamb_des, xothers, uothers, xothers_des) mibr.save_costs(file_name, bri) actual_t = i_mpc * number_ctrl_pts_executed actual_xamb[:,actual_t:actual_t+number_ctrl_pts_executed+1] = xamb[:,:number_ctrl_pts_executed+1] print(" MPC Done: Rd %02d / %02d"%(i_mpc, n_rounds_mpc)) print(" Full MPC Solution", xamb[0:2,:]) print(" Executed MPC", xamb[0:2,:number_ctrl_pts_executed+1]) print(" Solution Costs...") for cost in bri.car1_costs_list: print("%.04f"%bri.solution.value(cost)) print(min_bri.solution.value(min_bri.k_CA * min_bri.collision_cost), min_bri.solution.value(min_bri.collision_cost)) print(min_bri.solution.value(min_bri.k_slack * min_bri.slack_cost), min_bri.solution.value(min_bri.slack_cost)) print(" Save to...", file_name) actual_uamb[:,actual_t:actual_t+number_ctrl_pts_executed] = uamb[:,:number_ctrl_pts_executed] plot_range = range(N+1) for k in plot_range: cmplot.plot_multiple_cars( k, min_bri.responseMPC, xothers, xamb, True, None, None, None, min_bri.world, 0) plt.show() plt.plot(xamb[4,:],'--') plt.plot(xamb[4,:] * np.cos(xamb[2,:])) plt.ylabel("Velocity / Vx") plt.hlines(35*0.447,0,xamb.shape[1]) plt.show() plt.plot(uamb[1,:],'o') plt.hlines(amb_MPC.max_v_u,0,xamb.shape[1]) plt.ylabel("delta_u_v") plt.show() for i in range(len(xothers)): actual_xothers[i][:,actual_t:actual_t+number_ctrl_pts_executed+1] = xothers[i][:,:number_ctrl_pts_executed+1] actual_uothers[i][:,actual_t:actual_t+number_ctrl_pts_executed] = uothers[i][:,:number_ctrl_pts_executed] # all_other_u[i] = np.concatenate((uothers[i][:, number_ctrl_pts_executed:],uothers[i][:,:number_ctrl_pts_executed]),axis=1) else: raise Exception("Xamb is None", i_mpc, i_rounds_ibr, "slack cost", bri.solution.value(bri.slack_cost)) print("Solver Done! Runtime: %.1d"%(time.time()-t_start_time))
1.992188
2
RenameMaps.py
uesp/uesp-dbmapscripts
0
16507
<reponame>uesp/uesp-dbmapscripts<filename>RenameMaps.py import os import sys import shutil import re INPUT_PATH = "d:\\dbmaps\\test\\final\\" OUTPUT_PATH = "d:\\dbmaps\\test\\zoom17\\" for filename in os.listdir(INPUT_PATH): InputFile = INPUT_PATH + filename matchResult = re.search('([a-zA-Z]+)-([0-9]+)-([0-9]+)-([0-9]+)\.', filename) if (not matchResult): continue cellX = int(matchResult.group(2)) - 90 cellY = int(matchResult.group(3)) - 40 zoom = matchResult.group(4) newFilename = "db-" + str(cellX) + "-" + str(cellY) + "-" + str(zoom) + ".jpg" OutputFile = OUTPUT_PATH + newFilename print("Copying " + filename + " to " + newFilename + "...") shutil.copyfile(InputFile, OutputFile)
2.453125
2
my/rtm.py
almereyda/HPI
0
16508
<reponame>almereyda/HPI """ [[https://rememberthemilk.com][Remember The Milk]] tasks and notes """ REQUIRES = [ 'icalendar', ] import re from pathlib import Path from typing import Dict, List, Optional, Iterator from datetime import datetime from .common import LazyLogger, get_files, group_by_key, cproperty, make_dict from my.config import rtm as config import icalendar # type: ignore from icalendar.cal import Todo # type: ignore logger = LazyLogger(__name__) # TODO extract in a module to parse RTM's ical? class MyTodo: def __init__(self, todo: Todo, revision=None) -> None: self.todo = todo self.revision = revision @cproperty def notes(self) -> List[str]: # TODO can there be multiple?? desc = self.todo['DESCRIPTION'] notes = re.findall(r'---\n\n(.*?)\n\nUpdated:', desc, flags=re.DOTALL) return notes @cproperty def tags(self) -> List[str]: desc = self.todo['DESCRIPTION'] [tags_str] = re.findall(r'\nTags: (.*?)\n', desc, flags=re.DOTALL) if tags_str == 'none': return [] tags = [t.strip() for t in tags_str.split(',')] return tags @cproperty def uid(self) -> str: return str(self.todo['UID']) @cproperty def title(self) -> str: return str(self.todo['SUMMARY']) def get_status(self) -> str: if 'STATUS' not in self.todo: return None # type: ignore # TODO 'COMPLETED'? return str(self.todo['STATUS']) # TODO tz? @cproperty def time(self) -> datetime: t1 = self.todo['DTSTAMP'].dt t2 = self.todo['LAST-MODIFIED'].dt assert t1 == t2 # TODO not sure which one is correct return t1 def is_completed(self) -> bool: return self.get_status() == 'COMPLETED' def __repr__(self): return repr(self.todo) def __str__(self): return str(self.todo) @staticmethod def alala_key(mtodo): return (mtodo.revision, mtodo.get_time()) class DAL: def __init__(self, data: str, revision=None) -> None: self.cal = icalendar.Calendar.from_ical(data) self.revision = revision def all_todos(self) -> Iterator[MyTodo]: for t in self.cal.walk('VTODO'): yield MyTodo(t, self.revision) def get_todos_by_uid(self) -> Dict[str, MyTodo]: todos = self.all_todos() return make_dict(todos, key=lambda t: t.uid) def get_todos_by_title(self) -> Dict[str, List[MyTodo]]: todos = self.all_todos() return group_by_key(todos, lambda todo: todo.title) def dal(): last = get_files(config.export_path)[-1] data = last.read_text() return DAL(data=data, revision='TODO') def all_tasks() -> Iterator[MyTodo]: yield from dal().all_todos() def active_tasks() -> Iterator[MyTodo]: for t in all_tasks(): if not t.is_completed(): yield t def print_all_todos(): for t in all_tasks(): print(t)
2.3125
2
learnpython/fib.py
Octoberr/swm0920
2
16509
# def fib2(n): # 返回到 n 的斐波那契数列 # result = [] # a, b = 0, 1 # while b < n: # result.append(b) # a, b = b, a+b # return result # # a = fib2(500) # print(a) def recur_fibo(n): """递归函数 输出斐波那契数列""" if n <= 1: return n else: return(recur_fibo(n-1) + recur_fibo(n-2)) a = recur_fibo(10) print(a)
3.609375
4
taco/tests/aws_wrappers/dynamodb/integration/consts.py
Intsights/taco
18
16510
<gh_stars>10-100 import taco.aws_wrappers.dynamodb_wrapper.consts as dynamodb_consts from taco.boto3.boto_config import Regions DEFAULT_REGION = Regions.n_virginia.value RESPONSE_KEY_NAME = 'Responses' PRIMARY_KEY_NAME = 'KEY1' ATTRIBUTE_DEFINITIONS = [ dynamodb_consts.property_schema(PRIMARY_KEY_NAME, dynamodb_consts.AttributeTypes.string_type.value) ] PRIMARY_KEYS = [dynamodb_consts.property_schema(PRIMARY_KEY_NAME, dynamodb_consts.PrimaryKeyTypes.hash_type.value)] ITEMS_TO_PUT_WITHOUT_PRIMARY_KEY = [{'q': 'qqq'}] ITEMS_TO_PUT_WITH_MISMATCH_PRIMARY_KEY_VALUE = [{PRIMARY_KEY_NAME: 12}] DEFAULT_PRIMARY_KEY_VALUE = '123abc' VALID_ITEMS_TO_PUT = [{PRIMARY_KEY_NAME: DEFAULT_PRIMARY_KEY_VALUE}] TABLE_ALREADY_EXISTS_MESSAGE = 'Table already exists' SKIP_TABLE_DELETION_ERROR_MESSAGE = 'Table does not exists, skip deletion'
1.898438
2
examples/HMF_oxidation_WO3/model.py
flboudoire/chemical-kinetics
0
16511
<gh_stars>0 import numpy as np from scipy import constants measured_species = ["HMF", "DFF", "HMFCA", "FFCA", "FDCA"] all_species = measured_species.copy() all_species.extend(["H_" + s for s in measured_species]) all_species.extend(["Hx_" + s for s in measured_species]) def c_to_q(c): c_e = list() for i, s in enumerate(all_species): c_e.append(2*(i%5 + int(i/5))*c[:,i]) c_e = np.sum(c_e, axis = 0) # uM c_e *= 1e-6 # M V = 100e-3 # L q = c_e*V*constants.N_A*constants.e # number of charge in coulombs return q def derivatives(y, t, p): """ Calculates the derivatives from local values, used by scipy.integrate.solve_ivp """ c = {s:y[i] for i, s in enumerate(all_species)} dc = dict() dc["HMF"] = - (p["k11"] + p["k12"] + p["kH1"])*c["HMF"] dc["DFF"] = p["k11"]*c["HMF"] - (p["k21"] + p["kH21"])*c["DFF"] dc["HMFCA"] = p["k12"]*c["HMF"] - (p["k22"] + p["kH22"])*c["HMFCA"] dc["FFCA"] = p["k21"]*c["DFF"] + p["k22"]*c["HMFCA"] - (p["k3"] + p["kH3"])*c["FFCA"] dc["FDCA"] = p["k3"]*c["FFCA"] - p["kH4"]*c["FDCA"] dc["H_HMF"] = p["kH1"]*c["HMF"] - p["kHx"]*c["H_HMF"] dc["H_DFF"] = p["kH21"]*c["DFF"] - p["kHx"]*c["H_DFF"] dc["H_HMFCA"] = p["kH22"]*c["HMFCA"] - p["kHx"]*c["H_HMFCA"] dc["H_FFCA"] = p["kH3"]*c["FFCA"] - p["kHx"]*c["H_FFCA"] dc["H_FDCA"] = p["kH4"]*c["FDCA"] - p["kHx"]*c["H_FDCA"] dc["Hx_HMF"] = p["kHx"]*c["H_HMF"] dc["Hx_DFF"] = p["kHx"]*c["H_DFF"] dc["Hx_HMFCA"] = p["kHx"]*c["H_HMFCA"] dc["Hx_FFCA"] = p["kHx"]*c["H_FFCA"] dc["Hx_FDCA"] = p["kHx"]*c["H_FDCA"] dy = [dc[name] for name in all_species] return dy
2.375
2
cayennelpp/tests/test_lpp_type_humidity.py
smlng/pycayennelpp
16
16512
<filename>cayennelpp/tests/test_lpp_type_humidity.py import pytest from cayennelpp.lpp_type import LppType @pytest.fixture def hum(): return LppType.get_lpp_type(104) def test_humidity(hum): val = (50.00,) hum_buf = hum.encode(val) assert hum.decode(hum_buf) == val hum_buf = hum.encode(50.25) assert hum.decode(hum_buf) == val val = (50.50,) hum_buf = hum.encode(val) assert hum.decode(hum_buf) == val hum_buf = hum.encode(50.75) assert hum.decode(hum_buf) == val def test_humidity_negative_val(hum): with pytest.raises(Exception): val = (-50.50,) hum.encode(val) def test_humidity_invalid_buf(hum): with pytest.raises(Exception): hum.decode(bytearray([0x00, 0x00])) def test_humidity_invalid_val_type(hum): with pytest.raises(Exception): hum.encode([0x00]) def test_humidity_invalid_val(hum): with pytest.raises(Exception): hum.encode((0, 0))
2.109375
2
src/frogtips/api/__init__.py
FROG-TIPS/frog.tips-python-client
2
16513
<filename>src/frogtips/api/__init__.py from frogtips.api.Credentials import Credentials from frogtips.api.Tip import Tip from frogtips.api.Tips import Tips
1.289063
1
scripts/studs_dist.py
inesc-tec-robotics/carlos_controller
0
16514
<reponame>inesc-tec-robotics/carlos_controller<filename>scripts/studs_dist.py #!/usr/bin/env python from mission_ctrl_msgs.srv import * from studs_defines import * import rospy import time import carlos_vision as crlv from geometry_msgs.msg import PointStamped from geometry_msgs.msg import PoseArray from geometry_msgs.msg import Pose from carlos_controller.msg import StudsPoses #import geometry_msgs.msg #import std_msgs.msg # incomming handlers def set_mode_hnd(req): print 'Set mode requested: '+str(req.mode) global working_mode working_mode = req.mode # if working_mode != WMODE_STOPPED: # for i in range(12): # puntos, stiff1, stiff2, tipo= crlv.calcula_dist(working_mode) # time.sleep(0.3) return SetModeResponse(req.mode) def get_mode_hnd(req): print 'Mode requested' global working_mode return GetModeResponse(working_mode) # publisher def publica(dato, stiff1, stiff2, tipo): global working_mode global studs_pub global wall_pub #pub = rospy.Publisher(CRL_STUDS_POS_MSG, StudsPoses, queue_size=1) studs = PoseArray() mes = StudsPoses() studs.header.stamp = rospy.Time.now() if tipo==WMODE_TRACK: #studs.header.frame_id = "orientation" #studi = Pose() if dato[0][0][0]!=0 or dato[0][0][1]!=0 or dato[0][0][2]!=0: wall_or = PointStamped() wall_or.point.x = dato[0][0][0]+0.0 wall_or.point.y = dato[0][0][1]-0.035 wall_or.point.z = dato[0][0][2]-0.015 wall_pub.publish(wall_or) elif tipo==WMODE_STOPPED: studs.header.frame_id = "idle" studi = Pose() studi.position.x = 0 studi.position.y = 0 studi.position.z = 0 studi.orientation.x = 0 studi.orientation.y = 0 studi.orientation.z = 0 studi.orientation.w = 0 studs.poses.append(studi) else: studs.header.frame_id = "/base_link" for i in range(len(dato)): studi = Pose() studi.position.y = (dato[i][0][0])/1000.0 studi.position.x = -(dato[i][0][1]-110)/1000.0 studi.position.z = (dato[i][0][2]-175)/1000.0 studi.orientation.x = dato[i][1][0] studi.orientation.y = dato[i][1][1] studi.orientation.z = dato[i][1][2] studi.orientation.w = dato[i][1][3] studs.poses.append(studi) mes.pose_array=studs mes.stiff1=stiff1/1000.0 mes.stiff2=stiff2/1000.0 if dato[0][0][0]!=0 or dato[0][0][1]!=0 or dato[0][0][2]!=0: studs_pub.publish(mes) # timer callback for state machine update def timer_callback(event): global working_mode global pattern global init_time global laser_threshold if working_mode==WMODE_DETECT: pattern = rospy.get_param(STUDS_PATTERN) laser_threshold=rospy.get_param(STUDS_PATTERN_LASER_THRESHOLD) crlv.cambia_patron(pattern, stud_margin, stud_prox) puntos, stiff1, stiff2, tipo= crlv.calcula_dist(working_mode, laser_threshold) print 'Detecting...' print 'Studs detected: '+ str(len(puntos)) for i in range(len(puntos)): print 'Stud '+str(i)+': '+ str(puntos[i][0]) print 'Stiff. 1: ' +str(stiff1) + ' Stiff. 2: ' +str(stiff2) + ' SD:' + str(stiff2-stiff1) if puntos[0][1][0]!=2 and tipo==working_mode: publica(puntos, stiff1, stiff2, tipo) else: publica(puntos, stiff1, stiff2, WMODE_STOPPED) elif working_mode==WMODE_TRACK: pattern = rospy.get_param(STUDS_PATTERN) laser_threshold=rospy.get_param(STUDS_PATTERN_LASER_THRESHOLD) crlv.cambia_patron(pattern, stud_margin, stud_prox) puntos, stiff1, stiff2, tipo= crlv.calcula_dist(working_mode, laser_threshold) print 'Tracking...' print 'Orientation = ' + str(puntos[0][0]) print 'Stiff. 1: ' +str(stiff1) + ' Stiff. 2: ' +str(stiff2) + ' SD:' + str(stiff2-stiff1) if puntos[0][1][0]!=2 and tipo==working_mode: publica(puntos, stiff1, stiff2, tipo) else: publica(puntos, stiff1, stiff2, WMODE_STOPPED) else: print 'Idle ' + str(rospy.Time.to_sec(rospy.Time.now())-rospy.Time.to_sec(init_time)) def install_params(): global pattern pattern = rospy.get_param(STUDS_PATTERN) global stud_margin stud_margin = rospy.get_param(STUDS_PATTERN_DIST) global stud_prox stud_prox = rospy.get_param(STUDS_PATTERN_PROX) global laser_threshold laser_threshold = rospy.get_param(STUDS_PATTERN_LASER_THRESHOLD) def init_server(): global init_time global thres_laser thres_laser=220 rospy.init_node(MODULE_NAME) crlv.arranca() install_params() global working_mode working_mode = WMODE_STOPPED #working_mode = WMODE_DETECT #working_mode = WMODE_TRACK global studs_pub global wall_pub wall_pub = rospy.Publisher(CRL_WALL_ORIENT_MSG, PointStamped, queue_size=1) studs_pub = rospy.Publisher(CRL_STUDS_POS_MSG, StudsPoses, queue_size=1) s = rospy.Service(SET_MODE_SRV, SetMode, set_mode_hnd) init_time=rospy.Time.now() rospy.Timer(rospy.Duration(0.25), timer_callback) rospy.spin() if __name__ == "__main__": init_server()
2.140625
2
code/bodmas/utils.py
whyisyoung/BODMAS
18
16515
<reponame>whyisyoung/BODMAS # -*- coding: utf-8 -*- """ utils.py ~~~~~~~~ Helper functions for setting up the environment and parsing args, etc. """ import os os.environ['PYTHONHASHSEED'] = '0' from numpy.random import seed import random random.seed(1) seed(1) import sys import logging import argparse import pickle import json import numpy as np import pandas as pd import smtplib import traceback import lightgbm as lgb from pprint import pformat from collections import Counter from email.mime.text import MIMEText from sklearn.preprocessing import LabelEncoder from sklearn.preprocessing import MinMaxScaler def create_folder(name): if not os.path.exists(name): os.makedirs(name) def create_parent_folder(file_path): if not os.path.exists(os.path.dirname(file_path)): os.makedirs(os.path.dirname(file_path)) def parse_multiple_dataset_args(): """Parse the command line configuration for a particular run. Raises: ValueError: if the tree value for RandomForest is negative. Returns: argparse.Namespace -- a set of parsed arguments. """ p = argparse.ArgumentParser() p.add_argument('--task', default='binary', choices=['binary', 'multiclass'], help='Whether to perform binary classification or multi-class classification.') p.add_argument('--training-set', help='Which extra dataset to use as training. Blue Hexagon first 3 months is the default training set.') p.add_argument('--diversity', choices=['no', 'size', 'family', 'timestamp', 'timestamp_part', 'legacy', 'packed', 'family_fixed_size'], help='Which diversity metric to use in the training set: size, timestamp, family, packed. \ "no" means the original setting: use the 3 months of bluehex dataset as the training set.') p.add_argument('--setting-name', help='name for this particular setting, for saving corresponding data, model, and results') p.add_argument('-c', '--classifier', choices=['rf', 'gbdt', 'mlp'], help='The classifier used for binary classification or multi-class classification') p.add_argument('--testing-time', help='The beginning time and ending time (separated by comma) for a particular testing set (bluehex data)') p.add_argument('--quiet', default=1, type=int, choices=[0, 1], help='whether to print DEBUG logs or just INFO') p.add_argument('--retrain', type=int, choices=[0, 1], default=0, help='Whether to retrain the classifier, default NO.') p.add_argument('--seed', type=int, default=42, help='random seed for training and validation split.') # sub-arguments for the family (binary) and family_fixed_size (binary) diversity and multi-class classification p.add_argument('--families', type=int, help='add top N families from the first three months of bluehex.') # sub-arguments for the MLP classifier. p.add_argument('--mlp-hidden', help='The hidden layers of the MLP classifier, e.g.,: "2400-1200-1200", would make the architecture as 2381-2400-1200-1200-2') p.add_argument('--mlp-batch-size', default=32, type=int, help='MLP classifier batch_size.') p.add_argument('--mlp-lr', default=0.001, type=float, help='MLP classifier Adam learning rate.') p.add_argument('--mlp-epochs', default=50, type=int, help='MLP classifier epochs.') p.add_argument('--mlp-dropout', default=0.2, type=float, help='MLP classifier Droput rate.') # sub-arguments for the RandomForest classifier. p.add_argument('--tree', type=int, default=100, help='The n_estimators of RandomForest classifier when --classifier = "rf"') args = p.parse_args() if args.tree < 0: raise ValueError('invalid tree value') return args def get_model_dims(model_name, input_layer_num, hidden_layer_num, output_layer_num): """convert hidden layer arguments to the architecture of a model (list) Arguments: model_name {str} -- 'MLP' or 'Contrastive AE'. input_layer_num {int} -- The number of the features. hidden_layer_num {str} -- The '-' connected numbers indicating the number of neurons in hidden layers. output_layer_num {int} -- The number of the classes. Returns: [list] -- List represented model architecture. """ try: if '-' not in hidden_layer_num: dims = [input_layer_num, int(hidden_layer_num), output_layer_num] else: hidden_layers = [int(dim) for dim in hidden_layer_num.split('-')] dims = [input_layer_num] for dim in hidden_layers: dims.append(dim) dims.append(output_layer_num) logging.debug(f'{model_name} dims: {dims}') except: logging.error(f'get_model_dims {model_name}\n{traceback.format_exc()}') sys.exit(-1) return dims def dump_json(data, output_dir, filename, overwrite=True): dump_data('json', data, output_dir, filename, overwrite) def dump_data(protocol, data, output_dir, filename, overwrite=True): file_mode = 'w' if protocol == 'json' else 'wb' fname = os.path.join(output_dir, filename) logging.info(f'Dumping data to {fname}...') if overwrite or not os.path.exists(fname): with open(fname, file_mode) as f: if protocol == 'json': json.dump(data, f, indent=4) else: # pickle.dump(data, f) pickle.dump(data, f, protocol=pickle.HIGHEST_PROTOCOL) def load_json(filename): with open(filename, 'r') as f: d = json.load(f) # dict return d def parse_drift_args(): """Parse the command line configuration for a particular run. Raises: ValueError: if the tree value for RandomForest is negative. Returns: argparse.Namespace -- a set of parsed arguments. """ p = argparse.ArgumentParser() p.add_argument('--task', default='binary', choices=['binary', 'multiclass'], help='Whether to perform binary classification or multi-class classification.') p.add_argument('--setting-name', help='name for this particular setting, for saving corresponding data, model, and results') p.add_argument('-c', '--classifier', choices=['rf', 'gbdt', 'mlp'], help='The classifier used for binary classification or multi-class classification') p.add_argument('--testing-time', help='The beginning time and ending time (separated by comma) for a particular testing set (bluehex data)') p.add_argument('--month-interval', type=int, default=1, help='specify how many months for sampling.') # sub-arguments for the family (binary) and family_fixed_size (binary) diversity and multi-class classification p.add_argument('--families', type=int, help='add top N families from the first three months of bluehex.') p.add_argument('--quiet', default=1, type=int, choices=[0, 1], help='whether to print DEBUG logs or just INFO') p.add_argument('--retrain', type=int, choices=[0, 1], default=0, help='Whether to retrain the classifier, default NO.') p.add_argument('--sample-ratio', default=0.01, type=float, help='how many samples to add back to the training set for retraining to combat concept drift.') p.add_argument('--ember-ratio', default=0.3, type=float, help='how many Ember samples to train Transcend / CADE.') p.add_argument('--seed', default=1, type=int, help='random seed for the random experiment') args = p.parse_args() return args def normalize_sample_month(X_train_origin, X_sample_full): scaler = MinMaxScaler() X_train_scale = scaler.fit_transform(X_train_origin) X_sample_scale = scaler.transform(X_sample_full) return X_sample_scale def get_ember_sample_idx_by_pred_proba(X_sample_full, y_sample_full, sample_month_str, args, test_begin_time, REPORT_FOLDER, baseline_model_path, fpr_threshold): SUB_REPORT_FOLDER = os.path.join(REPORT_FOLDER, 'intermediate') os.makedirs(SUB_REPORT_FOLDER, exist_ok=True) report_path = os.path.join(SUB_REPORT_FOLDER, f'{args.classifier}_{test_begin_time}_ranked_proba_sample_{sample_month_str}.csv') if os.path.exists(report_path): df = pd.read_csv(report_path) sorted_sample_idx = df['idx'].to_numpy() else: clf = lgb.Booster(model_file=baseline_model_path) y_sample_pred = clf.predict(X_sample_full) y_sample_prob = np.array([1 - t if t < 0.5 else t for t in y_sample_pred]) y_sample_pred_label = np.array(y_sample_pred > fpr_threshold, dtype=np.int) sorted_sample_idx = np.argsort(y_sample_prob) with open(report_path, 'w') as f: f.write(f'idx,real,pred,proba\n') for i in sorted_sample_idx: f.write(f'{i},{y_sample_full[i]},{y_sample_pred_label[i]},{y_sample_prob[i]}\n') return sorted_sample_idx
2.5
2
session11.py
sahanashetty31/session_11_epai3_assignment
0
16516
import math from functools import lru_cache class Polygon: def __init__(self, n, R): if n < 3: raise ValueError('Polygon must have at least 3 vertices.') self._n = n self._R = R def __repr__(self): return f'Polygon(n={self._n}, R={self._R})' @property def count_vertices(self): return self._n @property def count_edges(self): return self._n @property def circumradius(self): return self._R @property def interior_angle(self): return (self._n - 2) * 180 / self._n @property def side_length(self): return 2 * self._R * math.sin(math.pi / self._n) @property def apothem(self): return self._R * math.cos(math.pi / self._n) @property def area(self): return self._n / 2 * self.side_length * self.apothem @property def perimeter(self): return self._n * self.side_length def __eq__(self, other): if isinstance(other, self.__class__): return (self.count_edges == other.count_edges and self.circumradius == other.circumradius) else: return NotImplemented def __gt__(self, other): if isinstance(other, self.__class__): return self.count_vertices > other.count_vertices else: return NotImplemented class Polygons: def __init__(self, m, R): if m < 3: raise ValueError('m must be greater than 3') self._m = m self._R = R self._polygons = [Polygon(i, R) for i in range(3, m+1)] def __len__(self): return self._m - 2 def __repr__(self): return f'Polygons(m={self._m}, R={self._R})' def __getitem__(self, s): return self._polygons[s] def __iter__(self): return self.PolygonIterator(self) @property def max_efficiency_polygon(self): sorted_polygons = sorted(self._polygons, key=lambda p: p.area/p.perimeter, reverse=True) return sorted_polygons[0] class PolyIterator: def __init__(self, poly_obj): self._poly_obj = poly_obj self._index = 0 def __iter__(self): return self def __next__(self): if self._index >= len(self._poly_obj): raise StopIteration else: item = self._poly_obj._polygons[self._index] self._index += 1 return item
3.65625
4
Software for Other Building Blocks and Integration/PoW.py
fkerem/Cryptocurrency-Blockchain
0
16517
<reponame>fkerem/Cryptocurrency-Blockchain<gh_stars>0 """ PoW.py """ import DSA import sys import hashlib if sys.version_info < (3, 6): import sha3 def rootMerkle(TxBlockFile, TxLen): #To Get the Root Hash of the Merkle Tree TxBlockFileBuffer = open(TxBlockFile, "r") lines = TxBlockFileBuffer.readlines() TxBlockFileBuffer.close() TxCount = len(lines)/TxLen #Num of Transactions in a Block hashTree = [] for i in range(0,TxCount): transaction = "".join(lines[i*TxLen:(i+1)*TxLen]) hashTree.append(hashlib.sha3_256(transaction).hexdigest()) t = TxCount j = 0 while(t>1): for i in range(j,j+t,2): hashTree.append(hashlib.sha3_256(hashTree[i]+hashTree[i+1]).hexdigest()) j += t t = t>>1 h = hashTree[2*TxCount-2] return h def PoW(TxBlockFile, ChainFile, PoWLen, TxLen): #Updates LongestChain File for Each Block block = "" if TxBlockFile[-5] != "0": chainBuffer = open(ChainFile, "r") chain = chainBuffer.readlines() chainBuffer.close() block = chain[-1] #PoW for the Previous Transaction Block else: #for TransactionBlock0.txt block = "Day Zero Link in the Chain" + "\n" block += rootMerkle(TxBlockFile, TxLen) + "\n" #The Root Hash of the Merkle Tree while True: new_block = block + str(DSA.bitGenerator(2**128-1)) + "\n" new_PoW = hashlib.sha3_256(new_block).hexdigest() if new_PoW[:PoWLen] == "0"*PoWLen: new_PoW += "\n" #PoW block = new_block block += new_PoW break #Write/append to the ChainFile if TxBlockFile[-5] != "0": chainBuffer = open(ChainFile, "a") chainBuffer.write(block) chainBuffer.close() else: #for TransactionBlock0.txt chainBuffer = open(ChainFile, "w") chainBuffer.write(block) chainBuffer.close()
2.890625
3
core/cdag/node/sub.py
prorevizor/noc
84
16518
# ---------------------------------------------------------------------- # SubNode # ---------------------------------------------------------------------- # Copyright (C) 2007-2020 The NOC Project # See LICENSE for details # ---------------------------------------------------------------------- # Python modules from typing import Optional # NOC modules from .base import BaseCDAGNode, ValueType, Category class SubNode(BaseCDAGNode): """ Subtract `y` from `y` """ name = "sub" categories = [Category.OPERATION] def get_value(self, x: ValueType, y: ValueType) -> Optional[ValueType]: return x - y
2.921875
3
chapter03/3.5_simulate_output_layer.py
Myeonghan-Jeong/deep-learning-from-scratch
0
16519
import numpy as np # softmax function def softmax(a): exp_a = np.exp(a) sum_a = np.sum(exp_a) return exp_a / sum_a # modified softmax function def modified_softmax(a): maxA = np.max(a) exp_a = np.exp(a - maxA) sum_a = np.sum(exp_a) return exp_a / sum_a
3.1875
3
example.py
luisfciencias/intro-cv
0
16520
<reponame>luisfciencias/intro-cv # example of mask inference with a pre-trained model (COCO) import sys from keras.preprocessing.image import img_to_array from keras.preprocessing.image import load_img from mrcnn.config import Config from mrcnn.model import MaskRCNN from mrcnn.visualize import display_instances from tools import load_config # load config params - labels cfg_dict = load_config('config.yaml') class_names = cfg_dict['class_names'] # config settings for model inference class ConfigParams(Config): NAME = "test" GPU_COUNT = 1 IMAGES_PER_GPU = 1 NUM_CLASSES = 1 + 80 # replicate the model for pure inference rcnn_model = MaskRCNN(mode='inference', model_dir='models/', config=ConfigParams()) # model weights input <<<<<<< HEAD rcnn_model.load_weights('models/mask_rcnn_coco.h5', by_name=True) ======= >>>>>>> 2ffc4581f4632ec494d19a7af0f5912e7482a631 path_weights_file = 'models/mask_rcnn_coco.h5' rcnn_model.load_weights(path_weights_file, by_name=True) # single image input path_to_image = sys.argv[1] img = load_img(path_to_image) # transition to array img = img_to_array(img) print('Image shape:', img.shape) # make inference results = rcnn_model.detect([img], verbose=0) # the output is a list of dictionaries, where each dict has a single object detection # {'rois': array([[ 30, 54, 360, 586]], dtype=int32), # 'class_ids': array([21], dtype=int32), # 'scores': array([0.9999379], dtype=float32), # 'masks': huge_boolean_array_here ... result_params = results[0] # show photo with bounding boxes, masks, class labels and scores display_instances(img, result_params['rois'], result_params['masks'], result_params['class_ids'], class_names, result_params['scores'])
3.546875
4
rubi/datasets/vqa2.py
abhipsabasu/rubi.bootstrap.pytorch
83
16521
<reponame>abhipsabasu/rubi.bootstrap.pytorch import os import csv import copy import json import torch import numpy as np from os import path as osp from bootstrap.lib.logger import Logger from bootstrap.lib.options import Options from block.datasets.vqa_utils import AbstractVQA from copy import deepcopy import random import tqdm import h5py class VQA2(AbstractVQA): def __init__(self, dir_data='data/vqa2', split='train', batch_size=10, nb_threads=4, pin_memory=False, shuffle=False, nans=1000, minwcount=10, nlp='mcb', proc_split='train', samplingans=False, dir_rcnn='data/coco/extract_rcnn', adversarial=False, dir_cnn=None ): super(VQA2, self).__init__( dir_data=dir_data, split=split, batch_size=batch_size, nb_threads=nb_threads, pin_memory=pin_memory, shuffle=shuffle, nans=nans, minwcount=minwcount, nlp=nlp, proc_split=proc_split, samplingans=samplingans, has_valset=True, has_testset=True, has_answers_occurence=True, do_tokenize_answers=False) self.dir_rcnn = dir_rcnn self.dir_cnn = dir_cnn self.load_image_features() # to activate manually in visualization context (notebo# to activate manually in visualization context (notebook) self.load_original_annotation = False def add_rcnn_to_item(self, item): path_rcnn = os.path.join(self.dir_rcnn, '{}.pth'.format(item['image_name'])) item_rcnn = torch.load(path_rcnn) item['visual'] = item_rcnn['pooled_feat'] item['coord'] = item_rcnn['rois'] item['norm_coord'] = item_rcnn.get('norm_rois', None) item['nb_regions'] = item['visual'].size(0) return item def add_cnn_to_item(self, item): image_name = item['image_name'] if image_name in self.image_names_to_index_train: index = self.image_names_to_index_train[image_name] image = torch.tensor(self.image_features_train['att'][index]) elif image_name in self.image_names_to_index_val: index = self.image_names_to_index_val[image_name] image = torch.tensor(self.image_features_val['att'][index]) image = image.permute(1, 2, 0).view(196, 2048) item['visual'] = image return item def load_image_features(self): if self.dir_cnn: filename_train = os.path.join(self.dir_cnn, 'trainset.hdf5') filename_val = os.path.join(self.dir_cnn, 'valset.hdf5') Logger()(f"Opening file {filename_train}, {filename_val}") self.image_features_train = h5py.File(filename_train, 'r', swmr=True) self.image_features_val = h5py.File(filename_val, 'r', swmr=True) # load txt with open(os.path.join(self.dir_cnn, 'trainset.txt'.format(self.split)), 'r') as f: self.image_names_to_index_train = {} for i, line in enumerate(f): self.image_names_to_index_train[line.strip()] = i with open(os.path.join(self.dir_cnn, 'valset.txt'.format(self.split)), 'r') as f: self.image_names_to_index_val = {} for i, line in enumerate(f): self.image_names_to_index_val[line.strip()] = i def __getitem__(self, index): item = {} item['index'] = index # Process Question (word token) question = self.dataset['questions'][index] if self.load_original_annotation: item['original_question'] = question item['question_id'] = question['question_id'] item['question'] = torch.tensor(question['question_wids'], dtype=torch.long) item['lengths'] = torch.tensor([len(question['question_wids'])], dtype=torch.long) item['image_name'] = question['image_name'] # Process Object, Attribut and Relational features # Process Object, Attribut and Relational features if self.dir_rcnn: item = self.add_rcnn_to_item(item) elif self.dir_cnn: item = self.add_cnn_to_item(item) # Process Answer if exists if 'annotations' in self.dataset: annotation = self.dataset['annotations'][index] if self.load_original_annotation: item['original_annotation'] = annotation if 'train' in self.split and self.samplingans: proba = annotation['answers_count'] proba = proba / np.sum(proba) item['answer_id'] = int(np.random.choice(annotation['answers_id'], p=proba)) else: item['answer_id'] = annotation['answer_id'] item['class_id'] = torch.tensor([item['answer_id']], dtype=torch.long) item['answer'] = annotation['answer'] item['question_type'] = annotation['question_type'] else: if item['question_id'] in self.is_qid_testdev: item['is_testdev'] = True else: item['is_testdev'] = False # if Options()['model.network.name'] == 'xmn_net': # num_feat = 36 # relation_mask = np.zeros((num_feat, num_feat)) # boxes = item['coord'] # for i in range(num_feat): # for j in range(i+1, num_feat): # # if there is no overlap between two bounding box # if boxes[0,i]>boxes[2,j] or boxes[0,j]>boxes[2,i] or boxes[1,i]>boxes[3,j] or boxes[1,j]>boxes[3,i]: # pass # else: # relation_mask[i,j] = relation_mask[j,i] = 1 # relation_mask = torch.from_numpy(relation_mask).byte() # item['relation_mask'] = relation_mask return item def download(self): dir_zip = osp.join(self.dir_raw, 'zip') os.system('mkdir -p '+dir_zip) dir_ann = osp.join(self.dir_raw, 'annotations') os.system('mkdir -p '+dir_ann) os.system('wget http://visualqa.org/data/mscoco/vqa/v2_Questions_Train_mscoco.zip -P '+dir_zip) os.system('wget http://visualqa.org/data/mscoco/vqa/v2_Questions_Val_mscoco.zip -P '+dir_zip) os.system('wget http://visualqa.org/data/mscoco/vqa/v2_Questions_Test_mscoco.zip -P '+dir_zip) os.system('wget http://visualqa.org/data/mscoco/vqa/v2_Annotations_Train_mscoco.zip -P '+dir_zip) os.system('wget http://visualqa.org/data/mscoco/vqa/v2_Annotations_Val_mscoco.zip -P '+dir_zip) os.system('unzip '+osp.join(dir_zip, 'v2_Questions_Train_mscoco.zip')+' -d '+dir_ann) os.system('unzip '+osp.join(dir_zip, 'v2_Questions_Val_mscoco.zip')+' -d '+dir_ann) os.system('unzip '+osp.join(dir_zip, 'v2_Questions_Test_mscoco.zip')+' -d '+dir_ann) os.system('unzip '+osp.join(dir_zip, 'v2_Annotations_Train_mscoco.zip')+' -d '+dir_ann) os.system('unzip '+osp.join(dir_zip, 'v2_Annotations_Val_mscoco.zip')+' -d '+dir_ann) os.system('mv '+osp.join(dir_ann, 'v2_mscoco_train2014_annotations.json')+' ' +osp.join(dir_ann, 'mscoco_train2014_annotations.json')) os.system('mv '+osp.join(dir_ann, 'v2_mscoco_val2014_annotations.json')+' ' +osp.join(dir_ann, 'mscoco_val2014_annotations.json')) os.system('mv '+osp.join(dir_ann, 'v2_OpenEnded_mscoco_train2014_questions.json')+' ' +osp.join(dir_ann, 'OpenEnded_mscoco_train2014_questions.json')) os.system('mv '+osp.join(dir_ann, 'v2_OpenEnded_mscoco_val2014_questions.json')+' ' +osp.join(dir_ann, 'OpenEnded_mscoco_val2014_questions.json')) os.system('mv '+osp.join(dir_ann, 'v2_OpenEnded_mscoco_test2015_questions.json')+' ' +osp.join(dir_ann, 'OpenEnded_mscoco_test2015_questions.json')) os.system('mv '+osp.join(dir_ann, 'v2_OpenEnded_mscoco_test-dev2015_questions.json')+' ' +osp.join(dir_ann, 'OpenEnded_mscoco_test-dev2015_questions.json'))
2.171875
2
W3Schools/dates.py
FRX-DEV/Python-Practice-Challenges
0
16522
<reponame>FRX-DEV/Python-Practice-Challenges<gh_stars>0 import datetime x = datetime.datetime.now() print(x) # 2021-07-13 22:55:43.029046 print(x.year) print(x.strftime("%A")) """ 2021 Tuesday """ x = datetime.datetime(2020, 5, 17) print(x) # 2020-05-17 00:00:00 x = datetime.datetime(2018, 6, 1) print(x.strftime("%B")) # June
3.625
4
venv/lib/python2.7/site-packages/ebcli/objects/tier.py
zwachtel11/fruitful-backend
4
16523
# Copyright 2014 Amazon.com, Inc. or its affiliates. All Rights Reserved. # # Licensed under the Apache License, Version 2.0 (the "License"). You # may not use this file except in compliance with the License. A copy of # the License is located at # # http://aws.amazon.com/apache2.0/ # # or in the "license" file accompanying this file. This file is # distributed on an "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF # ANY KIND, either express or implied. See the License for the specific # language governing permissions and limitations under the License. from ..objects.exceptions import NotFoundError import re class Tier(): def __init__(self, name, typ, version): self.name = name self.type = typ self.version = version.strip() self.string = self.__str__() def to_struct(self): strct = { 'Name': self.name, 'Type': self.type, } if self.version: strct['Version'] = self.version return strct def __str__(self): s = self.name + '-' + self.type if self.version: s += '-' + self.version return s def __eq__(self, other): if not isinstance(other, Tier): return False return self.string.lower() == other.string.lower() @staticmethod def get_all_tiers(): lst = [ Tier('WebServer', 'Standard', '1.0'), Tier('Worker', 'SQS/HTTP', '1.0'), Tier('Worker', 'SQS/HTTP', '1.1'), Tier('Worker', 'SQS/HTTP', ''), ] return lst @staticmethod def parse_tier(string): if string.lower() == 'web' or string.lower() == 'webserver': return Tier('WebServer', 'Standard', '1.0') if string.lower() == 'worker': return Tier('Worker', 'SQS/HTTP', '') params = string.split('-') if len(params) == 3: name, typ, version = string.split('-') elif len(params) == 2: name, typ = string.split('-') if re.match('\d+[.]\d+', typ): version = typ else: version = '' else: raise NotFoundError('Tier Not found') # we want to return the Proper, uppercase version if name.lower() == 'webserver' or name.lower() == 'web': return Tier('WebServer', 'Standard', version) elif name.lower() == 'worker': return Tier('Worker', 'SQS/HTTP', version) # tier not found raise NotFoundError('Tier Not found')
2.15625
2
Leetcode.py
SakuraSa/Leetcode_CodeDownloader
3
16524
#!/usr/bin/env python #coding=utf-8 import os import re import requests import datetime import BeautifulSoup #url requests setting host_url = 'https://oj.leetcode.com' login_url = 'https://oj.leetcode.com/accounts/login/' question_list_url = 'https://oj.leetcode.com/problems/' code_base_url = 'https://oj.leetcode.com/submissions/detail/%s/' code_list_base_url = 'https://oj.leetcode.com/submissions/%d/' github_login_url = 'https://oj.leetcode.com/accounts/github/login/' code_regex = re.compile("storage\.put\('(python|cpp|java)', '([^']+)'\);") leetcode_request_header = { 'Host': 'oj.leetcode.com', 'Origin': 'https://oj.leetcode.com', 'Referer': 'https://oj.leetcode.com/accounts/login/' } github_request_header = { 'Host': 'github.com', 'Origin': 'https://github.com', 'Referer': 'https://github.com/' } #code setting ext_dic = {'python': '.py', 'cpp': '.cpp', 'java': '.java'} comment_char_dic = {'python': '#', 'cpp': '//', 'java': '//'} class LeetcodeDownloader(object): def __init__(self, proxies=None, code_path='codes/', output_encoding='utf-8', session=None): self.proxies = proxies or {} self.code_path = code_path self.output_encoding = output_encoding self.session = session or requests.Session() self.session.proxies = self.proxies self.username = self.password = '' def login(self, username, password): self.username = username self.password = password login_page = self.session.get(login_url) soup = BeautifulSoup.BeautifulSoup(login_page.text) secret_input = soup.find('form').find('input', type='hidden') payload = dict( login=self.username, password=self.password, ) payload[secret_input['name']] = secret_input['value'] self.session.post(login_url, data=payload, headers=leetcode_request_header) return self.is_logged_in @property def is_logged_in(self): return bool(self.session.cookies.get("PHPSESSID", None)) def login_from_github(self, username, password): self.username = username self.password = password leetcode_github_login_page = self.session.get('https://github.com/login') soup = BeautifulSoup.BeautifulSoup(leetcode_github_login_page.text) post_div = soup.find('div', id='login') github_post_url = 'https://github.com/session' payload = dict() for ip in post_div.findAll('input'): value = ip.get('value', None) if value: payload[ip['name']] = value payload['login'], payload['password'] = username, password self.session.post(github_post_url, data=payload, headers=github_request_header) if self.session.cookies['logged_in'] != 'yes': return False rsp = self.session.get(github_login_url) return rsp.status_code == 200 def get_questions(self): rsp = self.session.get(question_list_url) soup = BeautifulSoup.BeautifulSoup(rsp.text) question_table = soup.find('table', id='problemList') question_table_body = question_table.find('tbody') for table_row in question_table_body.findAll('tr'): table_data = table_row.findAll('td') status = table_data[0].find('span')['class'] name = table_data[1].find('a').text url = table_data[1].find('a')['href'] date = datetime.datetime.strptime(table_data[2].text, '%Y-%m-%d') per = float(table_data[3].text.strip('%')) yield dict( status=status, name=name, url=url, date=date, per=per ) def get_question_description(self, url): rsp = self.session.get(url) soup = BeautifulSoup.BeautifulSoup(rsp.text) name = soup.find("h3").text accepted_count = int(soup.find("span", attrs={"class": "total-ac text-info"}).find("strong").text) submission_count = int(soup.find("span", attrs={"class": "total-submit text-info"}).find("strong").text) def transform(div): lst = [] for item in div: if isinstance(item, BeautifulSoup.NavigableString): lst.append(item) elif isinstance(item, BeautifulSoup.Tag): if item.name == "p": lst.append("%s\n" % transform(item)) elif item.name == "b": lst.append("###%s###" % transform(item)) elif item.name == "a": lst.append("[%s](%s)" % (transform(item), item["href"])) elif item.name == "code": lst.append("`%s`" % transform(item)) elif item.name == "pre": lst.append("```%s```" % transform(item)) elif item.name == "ul": lst.append(transform(item)) elif item.name == "div": lst.append(transform(item)) elif item.name == "li": lst.append("* %s" % transform(item)) elif item.name == "br": lst.append("\n") else: lst.append(item.text) return "".join(lst) description = transform(soup.find("div", attrs={"class": "question-content"})) return { 'name': name, 'accepted_count': accepted_count, 'submission_count': submission_count, 'description': description.replace("\r", "") } def code(self, code_id): code_url = code_base_url % code_id rsp = self.session.get(code_url) match = code_regex.search(rsp.text) return match.group(2).decode('raw_unicode_escape') def page_code(self, page_index=0): code_url = code_list_base_url % page_index rsp = self.session.get(code_url) soup = BeautifulSoup.BeautifulSoup(rsp.text) table = soup.find('table', id='result_testcases') if table is None: return [] table_body = table.find('tbody') number_reg = re.compile('\d+') lst = list() for table_row in table_body.findAll('tr'): table_data = table_row.findAll('td') name = table_data[1].find('a').text questions_url = host_url + table_data[1].find('a')['href'] status = table_data[2].find('strong').text code_id = int(number_reg.search(table_data[2].find('a')['href']).group(0)) runtime = table_data[3].text.strip() lang = table_data[4].text file_name = "%s-%s" % (status, code_id) file_ext = ext_dic.get(lang, '.txt') file_path = os.path.join(self.code_path, name) file_full_name = os.path.join(file_path, file_name + file_ext) exists = os.path.exists(file_full_name) lst.append(dict( name=name, questions_url=questions_url, status=status, code_id=code_id, runtime=runtime, lang=lang, exists=exists )) return lst def page_code_all(self): page_index = 0 while 1: lst = self.page_code(page_index) if lst: for data in lst: yield data else: break page_index += 1 def save_code(self, table_data_list): file_path = os.path.join(self.code_path, table_data_list['name']) if not os.path.exists(file_path): os.makedirs(file_path) file_name = "%s-%s" % (table_data_list['status'], table_data_list['code_id']) file_ext = ext_dic.get(table_data_list['lang'], '.txt') file_full_name = os.path.join(file_path, file_name + file_ext) exists = os.path.exists(file_full_name) if not exists: comment_char = comment_char_dic.get(table_data_list['lang'], '//') description = self.get_question_description(table_data_list['questions_url']) with open(file_full_name, 'w') as file_handle: file_handle.write(comment_char + 'Author : %s\n' % self.username) file_handle.write(comment_char + 'Question : %s\n' % table_data_list['name']) file_handle.write(comment_char + 'Link : %s\n' % table_data_list['questions_url']) file_handle.write(comment_char + 'Language : %s\n' % table_data_list['lang']) file_handle.write(comment_char + 'Status : %s\n' % table_data_list['status']) file_handle.write(comment_char + 'Run Time : %s\n' % table_data_list['runtime']) file_handle.write(comment_char + 'Description: \n') for line in description["description"].split("\n"): if line.strip(): file_handle.write(comment_char) file_handle.write(line.encode(self.output_encoding)) file_handle.write("\n") file_handle.write('\n') file_handle.write(comment_char + 'Code : \n') file_handle.write(self.code(table_data_list['code_id']) .encode(self.output_encoding) .replace('\r', '')) return { "file_full_name": file_full_name, "exists": exists, } def get_and_save_all_codes(self): for table_data_list in self.page_code_all(): result = dict(table_data_list) code_result = self.save_code(table_data_list) result['path'] = code_result["file_full_name"] result['exists'] = code_result["exists"] yield result if __name__ == '__main__': #login form leetcode account USERNAME = 'YOUR USERNAME' PASSWORD = '<PASSWORD>' #login form github account #downloader.login_from_github(username='YOUR USERNAME', password='<PASSWORD>') from taskbar import TaskBar downloader = LeetcodeDownloader() print "Logging..." if downloader.login(username=USERNAME, password=PASSWORD): print "ok, logged in." else: print "error, logging failed." exit() def func(row): result = dict(row) code_result = downloader.save_code(row) result['path'] = code_result["file_full_name"] result['exists'] = code_result["exists"] return result task_bar = TaskBar(40) print "Loading submissions..." task_param_list = task_bar.processing( task=lambda: list((func, ([table_data_list], {})) for table_data_list in downloader.page_code_all()), title=" Loading submissions...", show_total=False ) print "ok, %s submissions found in %.2fs." % (len(task_param_list), task_bar.time_cost) print "Downloading submissions..." task_bar.do_task(task_param_list)
2.5
2
tokenizer.py
momennaas/kalam-lp
6
16525
# -*- encoding: utf-8 -*- ############################################################## ## Author: <NAME> ## Description: Arabic Natural Language Processor (Kalam-lp) ## Version: 0.0.1 ## Copyright (c) 2014 <NAME> ############################################################## import re import string from constants import * class Tokenizer: @classmethod def wordTokenize(self, s, xPunct= False): """wordTokenize: return a list words as tokens from a raw of text.""" if not s or s == "": return None punct_regex = re.compile(r"[%s\s]+" % re.escape(string.punctuation)) w_regex = re.compile(r"[\w]+|[%s]" % re.escape(string.punctuation)) #_TODO_: Adding arabic punctuations if not xPunct: #Not exclude punctuation tokens = re.findall(w_regex, s) return tokens elif xPunct: r = punct_regx.sub(" ", s) tokens = r.split() return tokens else: return None def main(): print "It works" if __name__ == "__main__": main()
3.3125
3
Class4/shoppingcart_pom/features/lib/pages/summer_dresses_catalog_page.py
techsparksguru/python_ci_automation
0
16526
<reponame>techsparksguru/python_ci_automation __author__ = 'techsparksguru' from selenium.webdriver.common.by import By from .base_page_object import BasePage class SummerDressesCatalogPage(BasePage): def __init__(self, context): BasePage.__init__( self, context.browser, base_url='http://www.automationpractice.com') locator_dictionary = { "category_name":(By.CLASS_NAME,"cat-name"), "size_short":(By.ID,"layered_id_attribute_group_1"), "size_medium":(By.ID,"layered_id_attribute_group_2"), "color_white":(By.ID,"layered_id_attribute_group_8") } class PrintedSummerDress1(BasePage): def __init__(self, context): BasePage.__init__( self, context.browser, base_url='http://www.automationpractice.com') locator_dictionary = { "img_dress1":(By.XPATH,"//*[@id='center_column']/ul/li[1]/div/div[1]/div/a[1]/img"), "add_cart_dress1":(By.XPATH,"//*[@id='center_column']/ul/li[1]/div/div[2]/div[2]/a[1]"), "product_price":(By.CLASS_NAME,"product-price") } class CartPopup(BasePage): def __init__(self, context): BasePage.__init__( self, context.browser, base_url='http://www.automationpractice.com') locator_dictionary = { "continue_shopping":(By.XPATH,"//*[@title='Continue shopping']"), "proceed_to_checkout":(By.XPATH,"//*[@title='Proceed to checkout']") }
2.5625
3
ch3/collatz_test.py
jakdept/pythonbook
0
16527
<filename>ch3/collatz_test.py import unittest import collatz class TestCollatz(unittest.TestCase): '''tests the collatz.py script''' def test_collatz(self): '''table driven test to verify collatz''' tests = ((742, 371), (418, 209), (118, 59), (1978, 989)) for test in tests: self.assertEqual(collatz.collatz(test[0]), test[1]) if __name__ == "__main__": unittest.main()
2.96875
3
test/surrogate/test_sk_random_forest.py
Dee-Why/lite-bo
184
16528
<gh_stars>100-1000 from sklearn.ensemble import RandomForestRegressor from openbox.utils.config_space import ConfigurationSpace from openbox.utils.config_space import UniformFloatHyperparameter, \ CategoricalHyperparameter, Constant, UniformIntegerHyperparameter import numpy as np from openbox.utils.config_space.util import convert_configurations_to_array import threading from joblib import Parallel, delayed from sklearn.utils.fixes import _joblib_parallel_args from sklearn.utils.validation import check_is_fitted from sklearn.ensemble._base import _partition_estimators def _accumulate_prediction(predict, X, out, lock): """ This is a utility function for joblib's Parallel. It can't go locally in ForestClassifier or ForestRegressor, because joblib complains that it cannot pickle it when placed there. """ prediction = predict(X, check_input=False) with lock: if len(out) == 1: out[0] += prediction else: for i in range(len(out)): out[i] += prediction[i] def _collect_prediction(predict, X, out, lock): """ This is a utility function for joblib's Parallel. It can't go locally in ForestClassifier or ForestRegressor, because joblib complains that it cannot pickle it when placed there. """ prediction = predict(X, check_input=False) with lock: out.append(prediction) def predictmv(rf, X): check_is_fitted(rf) # Check data X = rf._validate_X_predict(X) # Assign chunk of trees to jobs n_jobs, _, _ = _partition_estimators(rf.n_estimators, rf.n_jobs) print('n_jobs=', n_jobs) # avoid storing the output of every estimator by summing them here if rf.n_outputs_ > 1: y_hat = np.zeros((X.shape[0], rf.n_outputs_), dtype=np.float64) else: print('here, rf.n_outputs_=1') y_hat = np.zeros((X.shape[0]), dtype=np.float64) # Parallel loop lock = threading.Lock() # Parallel(n_jobs=n_jobs, verbose=rf.verbose, # **_joblib_parallel_args(require="sharedmem"))( # delayed(_accumulate_prediction)(e.predict, X, [y_hat], lock) # for e in rf.estimators_) # # y_hat /= len(rf.estimators_) # # return y_hat all_y_preds = list() Parallel(n_jobs=n_jobs, verbose=rf.verbose, **_joblib_parallel_args(require="sharedmem"))( delayed(_collect_prediction)(e.predict, X, all_y_preds, lock) for e in rf.estimators_) all_y_preds = np.asarray(all_y_preds, dtype=np.float64) return all_y_preds def get_cs(): cs = ConfigurationSpace() n_estimators = UniformIntegerHyperparameter("n_estimators", 100, 1000, default_value=500, q=50) num_leaves = UniformIntegerHyperparameter("num_leaves", 31, 2047, default_value=128) max_depth = Constant('max_depth', 15) learning_rate = UniformFloatHyperparameter("learning_rate", 1e-3, 0.3, default_value=0.1, log=True) min_child_samples = UniformIntegerHyperparameter("min_child_samples", 5, 30, default_value=20) subsample = UniformFloatHyperparameter("subsample", 0.7, 1, default_value=1, q=0.1) colsample_bytree = UniformFloatHyperparameter("colsample_bytree", 0.7, 1, default_value=1, q=0.1) cs.add_hyperparameters([n_estimators, num_leaves, max_depth, learning_rate, min_child_samples, subsample, colsample_bytree]) return cs n_obs = 50 n_new = 5 cs = get_cs() cs.seed(1) configs = cs.sample_configuration(n_obs) new_configs = cs.sample_configuration(n_new) X = convert_configurations_to_array(configs) Y = np.random.RandomState(47).random(size=(n_obs,)) pX = convert_configurations_to_array(new_configs) print('shape of pX', pX.shape) rf = RandomForestRegressor(random_state=np.random.RandomState(47), n_estimators=3) rf.fit(X, Y) preds = rf.predict(pX) print(preds) ppp = predictmv(rf, pX) print('final predict', ppp) m = np.mean(ppp, axis=0) v = np.var(ppp, axis=0) print(m, v) print(type(m), type(v)) from joblib import effective_n_jobs print(effective_n_jobs(None))
2.15625
2
cli_wrapper.py
anirbandas18/report-engine
0
16529
<filename>cli_wrapper.py import subprocess, os # constants with global scope INPUT = "--input" OUTPUT = "--output" FILTERS = "--filters" SUPPPLEMENTS = "--supplements" JAR_DIRECTORY = "target" JAR_NAME = "report-engine.jar" def build_jar(): should_package = input("\nBuild " + JAR_NAME + " file from src (Y/N) ? ") # check if jar is to be built if len(should_package) != 0 and (should_package[0] == 'Y' or should_package[0] == 'y'): # define build commands for maven mvn_cmd = ['mvn', 'clean', 'package'] print("\nBuilding " + JAR_NAME + " from src using command:\n" + ' '.join(mvn_cmd) + '\n') # build jar using maven through an external process spawned from python mvn_process = subprocess.Popen(mvn_cmd, shell=True) mvn_process.wait() return mvn_process.returncode else: return None def execute_jar(app_cmd_args): should_run = input("\nRun " + JAR_NAME + " file from target (Y/N) ? ") # check if jar is to be run if len(should_run) != 0 and (should_run[0] == 'Y' or should_run[0] == 'y'): # form jar file path based on underlying os jar_location = os.path.join(JAR_DIRECTORY,JAR_NAME) # define commands for executing .jar file using java jar_cmd = ['java', '-jar', jar_location] # parse arguments for key,value in app_cmd_args.items(): jar_cmd.append(key + '=' + value) print("\nExecuting " + JAR_NAME + " using command: \n" + ' '.join(jar_cmd) + '\n') # execute jar using java through an external process spawned from python jar_process = subprocess.Popen(jar_cmd, shell=True) jar_process.wait() return jar_process.returncode; else: return None def main(): # input from user through stdin input_path = input("Enter the directory path containing profiles to be parsed (--input): ") output_path = input("Enter the directory path where reports will be dumped (--output): ") filters = input("Profile properties for which filtered reports will be generated (--filters optional): ") supplements = input("Profile properties for which supplementary reports will be generated (--supplements optional): ") # format arguments app_cmd_args = dict([(INPUT,input_path)]) # validate optional arguments if len(filters) != 0: app_cmd_args[FILTERS] = filters if len(output_path) != 0: app_cmd_args[OUTPUT] = output_path if len(supplements) != 0: app_cmd_args[SUPPPLEMENTS] = supplements # validate arguments if len(app_cmd_args.get(INPUT)) == 0: print("\n" + INPUT + " option is mandatory! Please re-run the cli_wrapper.py script\n") else : # argument validated successfully mvn_exit_code = build_jar() # execute .jar file only if maven build is successful print("\nMaven exit code: " + str(mvn_exit_code)) if mvn_exit_code == 0 or mvn_exit_code == None: jar_exit_code = execute_jar(app_cmd_args) print("\nJava exit code: " + str(jar_exit_code)) print('\nReport engine terminated!') if __name__ == '__main__': main()
2.578125
3
19-05-150_protein_ridge/inference.py
danhtaihoang/sparse-network
0
16530
<gh_stars>0 ##======================================================================================== import numpy as np from scipy import linalg from sklearn.preprocessing import OneHotEncoder from scipy.spatial import distance #========================================================================================= def itab(n,m): i1 = np.zeros(n) i2 = np.zeros(n) for i in range(n): i1[i] = i*m i2[i] = (i+1)*m return i1.astype(int),i2.astype(int) #========================================================================================= # generate coupling matrix w0: wji from j to i def generate_interactions(n,m,g,sp): nm = n*m w = np.random.normal(0.0,g/np.sqrt(nm),size=(nm,nm)) i1tab,i2tab = itab(n,m) # sparse for i in range(n): for j in range(n): if (j != i) and (np.random.rand() < sp): w[i1tab[i]:i2tab[i],i1tab[j]:i2tab[j]] = 0. # sum_j wji to each position i = 0 for i in range(n): i1,i2 = i1tab[i],i2tab[i] w[:,i1:i2] -= w[:,i1:i2].mean(axis=1)[:,np.newaxis] # no self-interactions for i in range(n): i1,i2 = i1tab[i],i2tab[i] w[i1:i2,i1:i2] = 0. # no self-interactions # symmetry for i in range(nm): for j in range(nm): if j > i: w[i,j] = w[j,i] return w #========================================================================================= def generate_external_local_field(n,m,g): nm = n*m h0 = np.random.normal(0.0,g/np.sqrt(nm),size=nm) i1tab,i2tab = itab(n,m) for i in range(n): i1,i2 = i1tab[i],i2tab[i] h0[i1:i2] -= h0[i1:i2].mean(axis=0) return h0 #========================================================================================= # 2018.10.27: generate time series by MCMC def generate_sequences(w,h0,n,m,l): i1tab,i2tab = itab(n,m) # initial s (categorical variables) s_ini = np.random.randint(0,m,size=(l,n)) # integer values # onehot encoder enc = OneHotEncoder(n_values=m) s = enc.fit_transform(s_ini).toarray() nrepeat = 5*n for irepeat in range(nrepeat): for i in range(n): i1,i2 = i1tab[i],i2tab[i] h = h0[np.newaxis,i1:i2] + s.dot(w[:,i1:i2]) # h[t,i1:i2] k0 = np.argmax(s[:,i1:i2],axis=1) for t in range(l): k = np.random.randint(0,m) while k == k0[t]: k = np.random.randint(0,m) if np.exp(h[t,k] - h[t,k0[t]]) > np.random.rand(): s[t,i1:i2],s[t,i1+k] = 0.,1. if irepeat%n == 0: print('irepeat:',irepeat) return s #=================================================================================================== # 2018.12.22: inverse of covariance between values of x def cov_inv(x,y): l,mx = x.shape my = y.shape[1] cab_inv = np.empty((my,my,mx,mx)) for ia in range(my): for ib in range(my): if ib != ia: eps = y[:,ia] - y[:,ib] which_ab = eps !=0. xab = x[which_ab] xab_av = np.mean(xab,axis=0) dxab = xab - xab_av cab = np.cov(dxab,rowvar=False,bias=True) cab_inv[ia,ib,:,:] = linalg.pinv(cab,rcond=1e-15) return cab_inv #========================================================================================= # 2018.12.28: fit interaction to residues at position i # additive update def fit_additive(x,y,regu,nloop=10): mx = x.shape[1] my = y.shape[1] # find elements having low probs, set w = 0 #iprobs = y.sum(axis=0)/float(y.shape[0]) #ilow = [i for i in range(my) if iprobs[i] < 0.02] #print(ilow) x_av = x.mean(axis=0) dx = x - x_av c = np.cov(dx,rowvar=False,bias=True) c_inv = linalg.pinvh(c) w = np.random.normal(0.0,1./np.sqrt(mx),size=(mx,my)) h0 = np.random.normal(0.0,1./np.sqrt(mx),size=my) cost = np.full(nloop,100.) for iloop in range(nloop): h = h0[np.newaxis,:] + x.dot(w) p = np.exp(h) p_sum = p.sum(axis=1) p /= p_sum[:,np.newaxis] #cost[iloop] = ((y - p)**2).mean() + l1*np.sum(np.abs(w)) cost[iloop] = ((y - p)**2).mean() + regu*np.sum(w**2) #print(iloop,cost[iloop]) if iloop > 1 and cost[iloop] >= cost[iloop-1]: break h += y - p h_av = h.mean(axis=0) dh = h - h_av dhdx = dh[:,np.newaxis,:]*dx[:,:,np.newaxis] dhdx_av = dhdx.mean(axis=0) w = c_inv.dot(dhdx_av) h0 = h_av - x_av.dot(w) #if len(ilow) > 0: # w[:,ilow] = 0. # h0[ilow] = 0. w -= w.mean(axis=0) h0 -= h0.mean() return w,h0,cost,iloop #========================================================================================= # 2019.02.25: fit interaction to residues at position i # multiplicative update (new version, NOT select each pair as the old version) def fit_multiplicative(x,y,nloop=10): mx = x.shape[1] my = y.shape[1] y2 = 2*y-1 x_av = x.mean(axis=0) dx = x - x_av c = np.cov(dx,rowvar=False,bias=True) c_inv = linalg.pinvh(c) w = np.random.normal(0.0,1./np.sqrt(mx),size=(mx,my)) h0 = np.random.normal(0.0,1./np.sqrt(mx),size=my) cost = np.full(nloop,100.) for iloop in range(nloop): h = h0[np.newaxis,:] + x.dot(w) p = np.exp(h) # normalize p_sum = p.sum(axis=1) p /= p_sum[:,np.newaxis] h = np.log(p) #p2 = p_sum[:,np.newaxis] - p p2 = 1. - p h2 = np.log(p2) hh2 = h-h2 model_ex = np.tanh(hh2/2) cost[iloop] = ((y2 - model_ex)**2).mean() if iloop > 0 and cost[iloop] >= cost[iloop-1]: break #print(cost[iloop]) t = hh2 !=0 h[t] = h2[t] + y2[t]*hh2[t]/model_ex[t] h[~t] = h2[~t] + y2[~t]*2 h_av = h.mean(axis=0) dh = h - h_av dhdx = dh[:,np.newaxis,:]*dx[:,:,np.newaxis] dhdx_av = dhdx.mean(axis=0) w = c_inv.dot(dhdx_av) w -= w.mean(axis=0) # 2019.03.29: ignore small w #for i in range(my): # j = np.abs(w[:,i]) < fraction*np.mean(np.abs(w[:,i])) # w[j,i] = 0. h0 = h_av - x_av.dot(w) h0 -= h0.mean() return w,h0,cost,iloop #========================================================================================= # 2019.05.15: add ridge regression term to coupling w def fit_multiplicative_ridge(x,y,nloop=10,lamda=0.1): mx = x.shape[1] my = y.shape[1] y2 = 2*y-1 x_av = x.mean(axis=0) dx = x - x_av c = np.cov(dx,rowvar=False,bias=True) # 2019.05.15: ridge regression c += lamda*np.identity(mx) c_inv = linalg.pinvh(c) w = np.random.normal(0.0,1./np.sqrt(mx),size=(mx,my)) h0 = np.random.normal(0.0,1./np.sqrt(mx),size=my) cost = np.full(nloop,100.) for iloop in range(nloop): h = h0[np.newaxis,:] + x.dot(w) p = np.exp(h) # normalize p_sum = p.sum(axis=1) p /= p_sum[:,np.newaxis] h = np.log(p) #p2 = p_sum[:,np.newaxis] - p p2 = 1. - p h2 = np.log(p2) hh2 = h-h2 model_ex = np.tanh(hh2/2) cost[iloop] = ((y2 - model_ex)**2).mean() if iloop > 0 and cost[iloop] >= cost[iloop-1]: break #print(cost[iloop]) t = hh2 !=0 h[t] = h2[t] + y2[t]*hh2[t]/model_ex[t] h[~t] = h2[~t] + y2[~t]*2 h_av = h.mean(axis=0) dh = h - h_av dhdx = dh[:,np.newaxis,:]*dx[:,:,np.newaxis] dhdx_av = dhdx.mean(axis=0) w = c_inv.dot(dhdx_av) w -= w.mean(axis=0) h0 = h_av - x_av.dot(w) h0 -= h0.mean() return w,h0,cost,iloop #=================================================================================================== def dca(s0,theta=0.2,pseudo_weight=0.5): #input: s0[L,n] (integer values, not one-hot) #theta: threshold for finding similarity of sequences #pseudo_weight = lamda/(lamda + pseudo_weight) #output: w[mx_cumsum,mx_cumsum] coupling matrix ; di[n,n]: direct information n = s0.shape[1] mx = np.array([len(np.unique(s0[:,i])) for i in range(n)]) mx_cumsum = np.insert(mx.cumsum(),0,0) i1i2 = np.stack([mx_cumsum[:-1],mx_cumsum[1:]]).T # hamming distance dst = distance.squareform(distance.pdist(s0, 'hamming')) ma = (dst <= theta).sum(axis=1).astype(float) Meff = (1/ma).sum() # convert to onehot onehot_encoder = OneHotEncoder(sparse=False) s = onehot_encoder.fit_transform(s0) fi_true = (s/ma[:,np.newaxis]).sum(axis=0) fi_true /= Meff fij_true = (s[:,:,np.newaxis]*s[:,np.newaxis,:]/ma[:,np.newaxis,np.newaxis]).sum(axis=0) fij_true /= Meff # add pseudo_weight fi = (1 - pseudo_weight)*fi_true + pseudo_weight/mx[0] ## q = mx[0] fij = (1 - pseudo_weight)*fij_true + pseudo_weight/(mx[0]**2) ## q = mx[0] cw = fij - fi[:,np.newaxis]*fi[np.newaxis,:] cw_inv = -linalg.pinvh(cw) # set self-interations to be zeros for i0 in range(n): i1,i2 = i1i2[i0,0],i1i2[i0,1] cw_inv[i1:i2,i1:i2] = 0. # normalize w w = cw_inv.copy() for i0 in range(n): i1,i2 = i1i2[i0,0],i1i2[i0,1] w[:,i1:i2] -= w[:,i1:i2].mean(axis=1)[:,np.newaxis] w[i1:i2,:] -= w[i1:i2,:].mean(axis=0)[np.newaxis,:] #----------------------------------------------------------------------------------------------- # calculate direct information ew_all = np.exp(w) di = np.zeros((n,n)) tiny = 10**(-100.) diff_thres = 10**(-4.) for i0 in range(n-1): i1,i2 = i1i2[i0,0],i1i2[i0,1] fi0 = fi[i1:i2] for j0 in range(i0+1,n): j1,j2 = i1i2[j0,0],i1i2[j0,1] fj0 = fi[j1:j2] # fit h1[A] and h2[B] (eh = np.exp(h), ew = np.exp(w)) ew = ew_all[i1:i2,j1:j2] diff = diff_thres + 1. # initial value eh1 = np.full(mx[i0],1./mx[i0]) eh2 = np.full(mx[i0],1./mx[i0]) for iloop in range(100): eh_ew1 = eh2.dot(ew.T) eh_ew2 = eh1.dot(ew) eh1_new = fi0/eh_ew1 eh1_new /= eh1_new.sum() eh2_new = fi0/eh_ew2 eh2_new /= eh2_new.sum() diff = max(np.max(np.abs(eh1_new - eh1)),np.max(np.abs(eh2_new - eh2))) eh1,eh2 = eh1_new,eh2_new if diff < diff_thres: break # direct information pdir = ew*((eh1.T).dot(eh2)) pdir /= pdir.sum() di[i0,j0] = (pdir*np.log(pdir+tiny/np.outer(fi0+tiny,fj0+tiny))).sum() # fill the lower triangular part di = di+di.T return w,di
2.15625
2
src/test/resources/script/jython/testReturnString.py
adchilds/jythonutil
5
16531
import sys if __name__ == '__main__': # Set the defaults a = '' b = '' # If arguments were passed to this script, use those try: a = sys.argv[1] b = sys.argv[2] except Exception: pass # Sets the result to the longer of the two Strings result = a if len(a) > len(b) else b
2.875
3
scraper.py
quake0day/chessreview
0
16532
""" PGN Scraper is a small program which downloads each of a user's archived games from chess.com and stores them in a pgn file. When running the user is asked for the account name which shall be scraped and for game types. The scraper only downloads games of the correct type. Supported types are: bullet, rapid, blitz rated, unrated standard chess, other ruless (chess960, oddchess, etc.) """ from datetime import datetime import json import urllib.request import os def CheckFileName(file_name): """ This function checks if a file with file_name already exists. If yes an error message is printed and the script aborted. """ if os.path.isfile(os.getcwd()+f"/{file_name}"): print(f"Error: A file named '{file_name}' already exists.") print("Exiting...") quit() def GameTypeTrue(game,game_type,rated,rules): """ This function checks if the game is of the type defined in game_type (bullet, rapid or blitz) and returns either True or False. """ # Check if game is of the correct type for type in game_type: for ra in rated: for ru in rules: if (game["time_class"] == type) and (game["rated"] == ra) and ( (game["rules"] == "chess") == ru): return True # If not correct type return False return False def initScrape(): """ This functions is used to set up the scraping parameters like account name and game type. """ # Input account name acc_name = input("Enter account name: ").strip() # Check if acc_name is empty if bool(acc_name) == False: print("Error: Empty account name!") quit() # Input game type #game_type_code = input("Enter game type [1] All (default), [2] Rapid, [3] Blitz, [4] Bullet, [5] Rapid and Blitz: ").strip() # If game_type_code is empty set to 1 #if bool(game_type_code) == False: game_type_code = "1" # Create dictionary for different game type options und apply input game_type_dict = { "1" : ["bullet", "blitz", "rapid"], "2" : ["rapid"], "3" : ["blitz"], "4" : ["bullet"], "5" : ["blitz", "rapid"] } game_type = game_type_dict["1"] # Input rated/unrated #rated_code = input("Consider [1] only rated games (default), [2] only unrated or [3] all games: ").strip() # If rated_code is empty set to 1 #if bool(rated_code) == False: rated_code = "1" # Create dictionary for rated/unraked and apply input rated_dict = { "1" : [True], "2" : [False], "3" : [True, False] } # try: rated = rated_dict["3"] # except KeyError: # print("Error: Invalid input!\nExiting...") # quit() # Input rules ("chess"/other) # rules_code = input("Consider [1] only standard chess (default), [2] only other modes (oddchess, bughouse etc.) or [3] any type: ").strip() # If rules_code is empty set to 1 # if bool(rules_code) == False: rules_code = "1" # Create dictionary for rules and apply input rules_dict = { "1" : [True], "2" : [False], "3" : [True, False] } #try: rules = rules_dict[rules_code] # except KeyError: # print("Error: Invalid input!\nExiting...") # quit() # Print warning if only rated and only other rules are selected if (rated_code == "1") and (rules_code == "2"): print("Warning: You selected only rated AND only other chess modes!") print(" Other chess modes are often unrated!") return [acc_name, game_type, rated, rules] def beginScrape(params): """ The downloading of the PGN archives happens here. The file is saved as "username_YYYY-MM-dd.pgn" """ # Passing the predefined parameters acc_name = params[0] game_type = params[1] rated = params[2] rules = params[3] # Create name of pgn file now = datetime.now() date = now.strftime("%Y-%m-%d") game_type_string = "_".join(game_type) file_name = f"{acc_name}_{date}_{game_type_string}.pgn" # Check if file already exists CheckFileName(file_name) # Run the request, check games for type and write correct ones to file with urllib.request.urlopen(f"https://api.chess.com/pub/player/{acc_name}/games/archives") as url: archives = list(dict(json.loads(url.read().decode()))["archives"]) for archive in archives: with urllib.request.urlopen(archive) as url: games = list(dict(json.loads(url.read().decode()))["games"]) for game in games: if GameTypeTrue(game,game_type,rated,rules): with open(file_name, "a") as text_file: print(game["pgn"], file=text_file) print("\n", file=text_file) def main(): """ Scrape PGN files from chess.com . """ params = initScrape() beginScrape(params) if __name__ == '__main__': main()
3.453125
3
testpro1/DB_handler_jjd.py
dongkakika/OXS
4
16533
import sqlite3 import codecs # for using '한글' import os # 타이틀 정보 읽어오기 f = codecs.open("jjd_info_title.txt", "r") title_list = [] while True: line = f.readline() # 한 줄씩 읽 if not line: break # break the loop when it's End Of File title_list.append(line) # split the line and append it to list f.close() # 날짜 정보 읽어오기 f = codecs.open("jjd_info_date.txt", "r") date_list = [] while True: line = f.readline() # 한 줄씩 읽 if not line: break # break the loop when it's End Of File date_list.append(line) # split the line and append it to list f.close() # 조회수 정보 읽어오기 f = codecs.open("jjd_info_view.txt", "r") view_list = [] while True: line = f.readline() if not line: break view_list.append(line) f.close # href(링크) 정보 읽어오기 f = codecs.open("jjd_info_href.txt", "r") href_list = [] while True: line = f.readline() if not line: break href_list.append(line) f.close ################################################################################ ###################################### DB ###################################### # below 'print' is for checking the data structure. Don't care. #print("saved data(1) : ", list[0][0]) #print("saved data(2) : ", list[1]) # connect 'db.sqlite3' in the django folder and manipulate it con = sqlite3.connect("db.sqlite3") cur = con.cursor() # use 'cursor' to use DB # you don't need to care the below CREATE TABLE command. # cur.execute("CREATE TABLE if not exists website1_crawlingdata(Name text, Period text);") total_list = [] for i in range(len(date_list)): temp = [str(i+1), title_list[i], date_list[i], view_list[i], href_list[i]] total_list.append(temp) # print(total_list) cur.execute("delete from website1_jjd_info;") idx = 0 # 리스트의 인덱스에 접근하는 변수 while idx < len(date_list): cur.execute("INSERT INTO website1_jjd_info VALUES(?, ?, ?, ?, ?);", total_list[idx]) # 'INSERT' each value of the total_list to the table of DB. idx += 1 con.commit() # The new input is gonna be saved in the DB with 'commit' command idx = 0 con.close()
3.15625
3
scripts/regression_tests.py
zhangxaochen/Opt
260
16534
from opt_utils import * import argparse parser = argparse.ArgumentParser() parser.add_argument("-s", "--skip_compilation", action='store_true', help="skip compilation") args = parser.parse_args() if not args.skip_compilation: compile_all_opt_examples() for example in all_examples: args = [] output = run_example(example, args, True).decode('ascii') with open(example + ".log", "w") as text_file: text_file.write(output)
2.734375
3
rec/migrations/0005_auto_20200922_1701.py
lpkyrius/rg1
0
16535
<reponame>lpkyrius/rg1<filename>rec/migrations/0005_auto_20200922_1701.py # Generated by Django 3.1.1 on 2020-09-22 20:01 from django.db import migrations, models class Migration(migrations.Migration): dependencies = [ ('rec', '0004_auto_20200922_1633'), ] operations = [ migrations.AlterField( model_name='convenio', name='cnpj', field=models.CharField(blank=True, default=' ', max_length=14, null=True), ), migrations.AlterField( model_name='convenio', name='obs', field=models.CharField(blank=True, default=' ', max_length=300, null=True), ), migrations.AlterField( model_name='convenio', name='telefone', field=models.CharField(blank=True, default=' ', max_length=100, null=True), ), ]
1.328125
1
deeppavlov/deep.py
cclauss/DeepPavlov
3
16536
<reponame>cclauss/DeepPavlov """ Copyright 2017 Neural Networks and Deep Learning lab, MIPT Licensed under the Apache License, Version 2.0 (the "License"); you may not use this file except in compliance with the License. You may obtain a copy of the License at http://www.apache.org/licenses/LICENSE-2.0 Unless required by applicable law or agreed to in writing, software distributed under the License is distributed on an "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the License for the specific language governing permissions and limitations under the License. """ import argparse from logging import getLogger from deeppavlov.core.commands.infer import interact_model, predict_on_stream from deeppavlov.core.commands.train import train_evaluate_model_from_config from deeppavlov.core.common.cross_validation import calc_cv_score from deeppavlov.core.common.file import find_config from deeppavlov.download import deep_download from deeppavlov.utils.alexa.server import run_alexa_default_agent from deeppavlov.utils.alice import start_alice_server from deeppavlov.utils.ms_bot_framework.server import run_ms_bf_default_agent from deeppavlov.utils.pip_wrapper import install_from_config from deeppavlov.utils.server.server import start_model_server from deeppavlov.utils.telegram.telegram_ui import interact_model_by_telegram log = getLogger(__name__) parser = argparse.ArgumentParser() parser.add_argument("mode", help="select a mode, train or interact", type=str, choices={'train', 'evaluate', 'interact', 'predict', 'interactbot', 'interactmsbot', 'alexa', 'riseapi', 'download', 'install', 'crossval'}) parser.add_argument("config_path", help="path to a pipeline json config", type=str) parser.add_argument("-e", "--start-epoch-num", dest="start_epoch_num", default=None, help="Start epoch number", type=int) parser.add_argument("--recursive", action="store_true", help="Train nested configs") parser.add_argument("-b", "--batch-size", dest="batch_size", default=1, help="inference batch size", type=int) parser.add_argument("-f", "--input-file", dest="file_path", default=None, help="Path to the input file", type=str) parser.add_argument("-d", "--download", action="store_true", help="download model components") parser.add_argument("--folds", help="number of folds", type=int, default=5) parser.add_argument("-t", "--token", default=None, help="telegram bot token", type=str) parser.add_argument("-i", "--ms-id", default=None, help="microsoft bot framework app id", type=str) parser.add_argument("-s", "--ms-secret", default=None, help="microsoft bot framework app secret", type=str) parser.add_argument("--multi-instance", action="store_true", help="allow rising of several instances of the model") parser.add_argument("--stateful", action="store_true", help="interact with a stateful model") parser.add_argument("--no-default-skill", action="store_true", help="do not wrap with default skill") parser.add_argument("--https", action="store_true", help="run model in https mode") parser.add_argument("--key", default=None, help="ssl key", type=str) parser.add_argument("--cert", default=None, help="ssl certificate", type=str) parser.add_argument("-p", "--port", default=None, help="api port", type=str) parser.add_argument("--api-mode", help="rest api mode: 'basic' with batches or 'alice' for Yandex.Dialogs format", type=str, default='basic', choices={'basic', 'alice'}) def main(): args = parser.parse_args() pipeline_config_path = find_config(args.config_path) https = args.https ssl_key = args.key ssl_cert = args.cert if args.download or args.mode == 'download': deep_download(pipeline_config_path) multi_instance = args.multi_instance stateful = args.stateful if args.mode == 'train': train_evaluate_model_from_config(pipeline_config_path, recursive=args.recursive, start_epoch_num=args.start_epoch_num) elif args.mode == 'evaluate': train_evaluate_model_from_config(pipeline_config_path, to_train=False, start_epoch_num=args.start_epoch_num) elif args.mode == 'interact': interact_model(pipeline_config_path) elif args.mode == 'interactbot': token = args.token interact_model_by_telegram(model_config=pipeline_config_path, token=token, default_skill_wrap=not args.no_default_skill) elif args.mode == 'interactmsbot': ms_id = args.ms_id ms_secret = args.ms_secret run_ms_bf_default_agent(model_config=pipeline_config_path, app_id=ms_id, app_secret=ms_secret, multi_instance=multi_instance, stateful=stateful, port=args.port, https=https, ssl_key=ssl_key, ssl_cert=ssl_cert, default_skill_wrap=not args.no_default_skill) elif args.mode == 'alexa': run_alexa_default_agent(model_config=pipeline_config_path, multi_instance=multi_instance, stateful=stateful, port=args.port, https=https, ssl_key=ssl_key, ssl_cert=ssl_cert, default_skill_wrap=not args.no_default_skill) elif args.mode == 'riseapi': alice = args.api_mode == 'alice' if alice: start_alice_server(pipeline_config_path, https, ssl_key, ssl_cert, port=args.port) else: start_model_server(pipeline_config_path, https, ssl_key, ssl_cert, port=args.port) elif args.mode == 'predict': predict_on_stream(pipeline_config_path, args.batch_size, args.file_path) elif args.mode == 'install': install_from_config(pipeline_config_path) elif args.mode == 'crossval': if args.folds < 2: log.error('Minimum number of Folds is 2') else: n_folds = args.folds calc_cv_score(pipeline_config_path, n_folds=n_folds, is_loo=False) if __name__ == "__main__": main()
1.695313
2
test/test_cfg/read_grammar.py
wannaphong/pycfg
8
16537
<reponame>wannaphong/pycfg '''Read grammar specifications for test cases.''' import re import sys from pprint import pprint from cfg.core import ContextFreeGrammar, Terminal, Nonterminal, Marker from cfg.table import END_MARKER, ParseTableNormalForm class GrammarTestCase(object): '''Contains a CFG and optionally a parse table.''' def __init__(self, sections, filename): self._sections = sections self.filename = filename def __getattr__(self, name): return self._sections.get(name) def __str__(self): return self.filename + '\n' + '\n'.join(self._section_strs()) def _section_strs(self): for k, v in self._sections.iteritems(): yield '''\ ==%s== %s ''' % (k.upper(), v) label_re = re.compile('^\s*==\s*(.*?)\s*==\s*$') comment_re = re.compile('^([^#]*)') shift_re = re.compile('^sh(\d+)$') reduce_re = re.compile('^re(\d+)$') def read_test_case(finname): '''Read a grammar test case from a file.''' label = 'grammar' sections = {} with open(finname, 'r') as fin: for line in filter(None, map(lambda s: comment_re.match(s).group(1).strip(), fin)): m = label_re.match(line) if m: label = m.group(1).lower() else: sections.setdefault(label, []).append(line) def retype(s, t): if s in sections: sections[s] = t(sections[s]) retype('grammar', read_grammar) def retype_table(lines): return read_table(lines, sections['grammar']) retype('table', retype_table) retype('tablea', retype_table) retype('tableb', retype_table) retype('result', read_bool) return GrammarTestCase(sections, finname) def read_grammar(lines): return ContextFreeGrammar('\n'.join(lines)) def read_table(lines, grammar): terminals = grammar.terminals nonterminals = grammar.nonterminals T = ParseTableNormalForm() for line in lines: left, right = line.split('=') q, X = left.split(',') q = int(q) is_terminal = False if Terminal(X) in terminals: is_terminal = True X = Terminal(X) elif Marker(X) == END_MARKER: is_terminal = True X = END_MARKER if is_terminal: actions = right.split(',') for a in actions: m = shift_re.match(a) if m: T.set_gotoshift(q, X, int(m.group(1))) else: m = reduce_re.match(a) if m: T.add_reduction(q, X, int(m.group(1))) elif a == 'acc': T.set_accept(q, X) else: raise ValueError('cell value %r not recognized' % a) elif Nonterminal(X) in nonterminals: T.set_gotoshift(q, Nonterminal(X), int(right)) else: raise ValueError('a symbol in the table is not in the grammar at %s,%s' % (q, X)) return T def read_bool(lines): s = '\n'.join(lines).strip().lower() if s == 'true': return True elif s == 'false': return False else: return bool(int(s)) if __name__ == '__main__': if len(sys.argv) != 2: sys.stderr.write('Usage: read_grammar.py <file>\n') sys.exit(1) print read_test_case(sys.argv[1])
2.75
3
pype/plugins/global/publish/extract_review.py
barklaya/pype
0
16538
<reponame>barklaya/pype import os import re import copy import json import pyblish.api import clique import pype.api import pype.lib class ExtractReview(pyblish.api.InstancePlugin): """Extracting Review mov file for Ftrack Compulsory attribute of representation is tags list with "review", otherwise the representation is ignored. All new represetnations are created and encoded by ffmpeg following presets found in `pype-config/presets/plugins/global/ publish.json:ExtractReview:outputs`. """ label = "Extract Review" order = pyblish.api.ExtractorOrder + 0.02 families = ["review"] hosts = ["nuke", "maya", "shell", "nukestudio", "premiere", "harmony"] # Supported extensions image_exts = ["exr", "jpg", "jpeg", "png", "dpx"] video_exts = ["mov", "mp4"] supported_exts = image_exts + video_exts # FFmpeg tools paths ffmpeg_path = pype.lib.get_ffmpeg_tool_path("ffmpeg") # Preset attributes profiles = None # Legacy attributes outputs = {} ext_filter = [] to_width = 1920 to_height = 1080 def process(self, instance): # ffmpeg doesn't support multipart exrs if instance.data.get("multipartExr") is True: instance_label = ( getattr(instance, "label", None) or instance.data.get("label") or instance.data.get("name") ) self.log.info(( "Instance \"{}\" contain \"multipartExr\". Skipped." ).format(instance_label)) return # Use legacy processing when `profiles` is not set. if self.profiles is None: return self.legacy_process(instance) # Run processing self.main_process(instance) # Make sure cleanup happens and pop representations with "delete" tag. for repre in tuple(instance.data["representations"]): tags = repre.get("tags") or [] if "delete" in tags: instance.data["representations"].remove(repre) def main_process(self, instance): host_name = os.environ["AVALON_APP"] task_name = os.environ["AVALON_TASK"] family = self.main_family_from_instance(instance) self.log.info("Host: \"{}\"".format(host_name)) self.log.info("Task: \"{}\"".format(task_name)) self.log.info("Family: \"{}\"".format(family)) profile = self.find_matching_profile( host_name, task_name, family ) if not profile: self.log.info(( "Skipped instance. None of profiles in presets are for" " Host: \"{}\" | Family: \"{}\" | Task \"{}\"" ).format(host_name, family, task_name)) return self.log.debug("Matching profile: \"{}\"".format(json.dumps(profile))) instance_families = self.families_from_instance(instance) _profile_outputs = self.filter_outputs_by_families( profile, instance_families ) if not _profile_outputs: self.log.info(( "Skipped instance. All output definitions from selected" " profile does not match to instance families. \"{}\"" ).format(str(instance_families))) return # Store `filename_suffix` to save arguments profile_outputs = [] for filename_suffix, definition in _profile_outputs.items(): definition["filename_suffix"] = filename_suffix profile_outputs.append(definition) # Loop through representations for repre in tuple(instance.data["representations"]): tags = repre.get("tags") or [] if "review" not in tags or "thumbnail" in tags: continue input_ext = repre["ext"] if input_ext.startswith("."): input_ext = input_ext[1:] if input_ext not in self.supported_exts: self.log.info( "Representation has unsupported extension \"{}\"".format( input_ext ) ) continue # Filter output definition by representation tags (optional) outputs = self.filter_outputs_by_tags(profile_outputs, tags) if not outputs: self.log.info(( "Skipped representation. All output definitions from" " selected profile does not match to representation's" " tags. \"{}\"" ).format(str(tags))) continue for _output_def in outputs: output_def = copy.deepcopy(_output_def) # Make sure output definition has "tags" key if "tags" not in output_def: output_def["tags"] = [] # Create copy of representation new_repre = copy.deepcopy(repre) # Remove "delete" tag from new repre if there is if "delete" in new_repre["tags"]: new_repre["tags"].remove("delete") # Add additional tags from output definition to representation for tag in output_def["tags"]: if tag not in new_repre["tags"]: new_repre["tags"].append(tag) self.log.debug( "New representation tags: `{}`".format(new_repre["tags"]) ) temp_data = self.prepare_temp_data(instance, repre, output_def) ffmpeg_args = self._ffmpeg_arguments( output_def, instance, new_repre, temp_data ) subprcs_cmd = " ".join(ffmpeg_args) # run subprocess self.log.debug("Executing: {}".format(subprcs_cmd)) output = pype.api.subprocess(subprcs_cmd) self.log.debug("Output: {}".format(output)) output_name = output_def["filename_suffix"] if temp_data["without_handles"]: output_name += "_noHandles" new_repre.update({ "name": output_def["filename_suffix"], "outputName": output_name, "outputDef": output_def, "frameStartFtrack": temp_data["output_frame_start"], "frameEndFtrack": temp_data["output_frame_end"] }) # Force to pop these key if are in new repre new_repre.pop("preview", None) new_repre.pop("thumbnail", None) # adding representation self.log.debug( "Adding new representation: {}".format(new_repre) ) instance.data["representations"].append(new_repre) def input_is_sequence(self, repre): """Deduce from representation data if input is sequence.""" # TODO GLOBAL ISSUE - Find better way how to find out if input # is sequence. Issues( in theory): # - there may be multiple files ant not be sequence # - remainders are not checked at all # - there can be more than one collection return isinstance(repre["files"], (list, tuple)) def prepare_temp_data(self, instance, repre, output_def): """Prepare dictionary with values used across extractor's process. All data are collected from instance, context, origin representation and output definition. There are few required keys in Instance data: "frameStart", "frameEnd" and "fps". Args: instance (Instance): Currently processed instance. repre (dict): Representation from which new representation was copied. output_def (dict): Definition of output of this plugin. Returns: dict: All data which are used across methods during process. Their values should not change during process but new keys with values may be added. """ frame_start = instance.data["frameStart"] handle_start = instance.data.get( "handleStart", instance.context.data["handleStart"] ) frame_end = instance.data["frameEnd"] handle_end = instance.data.get( "handleEnd", instance.context.data["handleEnd"] ) frame_start_handle = frame_start - handle_start frame_end_handle = frame_end + handle_end # Change output frames when output should be without handles without_handles = bool("no-handles" in output_def["tags"]) if without_handles: output_frame_start = frame_start output_frame_end = frame_end else: output_frame_start = frame_start_handle output_frame_end = frame_end_handle return { "fps": float(instance.data["fps"]), "frame_start": frame_start, "frame_end": frame_end, "handle_start": handle_start, "handle_end": handle_end, "frame_start_handle": frame_start_handle, "frame_end_handle": frame_end_handle, "output_frame_start": int(output_frame_start), "output_frame_end": int(output_frame_end), "pixel_aspect": instance.data.get("pixelAspect", 1), "resolution_width": instance.data.get("resolutionWidth"), "resolution_height": instance.data.get("resolutionHeight"), "origin_repre": repre, "input_is_sequence": self.input_is_sequence(repre), "without_handles": without_handles } def _ffmpeg_arguments(self, output_def, instance, new_repre, temp_data): """Prepares ffmpeg arguments for expected extraction. Prepares input and output arguments based on output definition and input files. Args: output_def (dict): Currently processed output definition. instance (Instance): Currently processed instance. new_repre (dict): Reprensetation representing output of this process. temp_data (dict): Base data for successfull process. """ # Get FFmpeg arguments from profile presets out_def_ffmpeg_args = output_def.get("ffmpeg_args") or {} ffmpeg_input_args = out_def_ffmpeg_args.get("input") or [] ffmpeg_output_args = out_def_ffmpeg_args.get("output") or [] ffmpeg_video_filters = out_def_ffmpeg_args.get("video_filters") or [] ffmpeg_audio_filters = out_def_ffmpeg_args.get("audio_filters") or [] # Prepare input and output filepaths self.input_output_paths(new_repre, output_def, temp_data) if temp_data["input_is_sequence"]: # Set start frame ffmpeg_input_args.append( "-start_number {}".format(temp_data["output_frame_start"]) ) # TODO add fps mapping `{fps: fraction}` ? # - e.g.: { # "25": "25/1", # "24": "24/1", # "23.976": "24000/1001" # } # Add framerate to input when input is sequence ffmpeg_input_args.append( "-framerate {}".format(temp_data["fps"]) ) elif temp_data["without_handles"]: # TODO use frames ubstead if `-ss`: # `select="gte(n\,{handle_start}),setpts=PTS-STARTPTS` # Pros: # 1.) Python is not good at float operation # 2.) FPS on instance may not be same as input's start_sec = float(temp_data["handle_start"]) / temp_data["fps"] ffmpeg_input_args.append("-ss {:0.2f}".format(start_sec)) # Set output frames len to 1 when ouput is single image if ( temp_data["output_ext_is_image"] and not temp_data["output_is_sequence"] ): output_frames_len = 1 else: output_frames_len = ( temp_data["output_frame_end"] - temp_data["output_frame_start"] + 1 ) # NOTE used `-frames` instead of `-t` - should work the same way # NOTE this also replaced `-shortest` argument ffmpeg_output_args.append("-frames {}".format(output_frames_len)) # Add video/image input path ffmpeg_input_args.append( "-i \"{}\"".format(temp_data["full_input_path"]) ) # Add audio arguments if there are any. Skipped when output are images. if not temp_data["output_ext_is_image"]: audio_in_args, audio_filters, audio_out_args = self.audio_args( instance, temp_data ) ffmpeg_input_args.extend(audio_in_args) ffmpeg_audio_filters.extend(audio_filters) ffmpeg_output_args.extend(audio_out_args) res_filters = self.rescaling_filters(temp_data, output_def, new_repre) ffmpeg_video_filters.extend(res_filters) ffmpeg_input_args = self.split_ffmpeg_args(ffmpeg_input_args) lut_filters = self.lut_filters(new_repre, instance, ffmpeg_input_args) ffmpeg_video_filters.extend(lut_filters) # Add argument to override output file ffmpeg_output_args.append("-y") # NOTE This must be latest added item to output arguments. ffmpeg_output_args.append( "\"{}\"".format(temp_data["full_output_path"]) ) return self.ffmpeg_full_args( ffmpeg_input_args, ffmpeg_video_filters, ffmpeg_audio_filters, ffmpeg_output_args ) def split_ffmpeg_args(self, in_args): """Makes sure all entered arguments are separated in individual items. Split each argument string with " -" to identify if string contains one or more arguments. """ splitted_args = [] for arg in in_args: sub_args = arg.split(" -") if len(sub_args) == 1: if arg and arg not in splitted_args: splitted_args.append(arg) continue for idx, arg in enumerate(sub_args): if idx != 0: arg = "-" + arg if arg and arg not in splitted_args: splitted_args.append(arg) return splitted_args def ffmpeg_full_args( self, input_args, video_filters, audio_filters, output_args ): """Post processing of collected FFmpeg arguments. Just verify that output arguments does not contain video or audio filters which may cause issues because of duplicated argument entry. Filters found in output arguments are moved to list they belong to. Args: input_args (list): All collected ffmpeg arguments with inputs. video_filters (list): All collected video filters. audio_filters (list): All collected audio filters. output_args (list): All collected ffmpeg output arguments with output filepath. Returns: list: Containing all arguments ready to run in subprocess. """ output_args = self.split_ffmpeg_args(output_args) video_args_dentifiers = ["-vf", "-filter:v"] audio_args_dentifiers = ["-af", "-filter:a"] for arg in tuple(output_args): for identifier in video_args_dentifiers: if identifier in arg: output_args.remove(arg) arg = arg.replace(identifier, "").strip() video_filters.append(arg) for identifier in audio_args_dentifiers: if identifier in arg: output_args.remove(arg) arg = arg.replace(identifier, "").strip() audio_filters.append(arg) all_args = [] all_args.append(self.ffmpeg_path) all_args.extend(input_args) if video_filters: all_args.append("-filter:v {}".format(",".join(video_filters))) if audio_filters: all_args.append("-filter:a {}".format(",".join(audio_filters))) all_args.extend(output_args) return all_args def input_output_paths(self, new_repre, output_def, temp_data): """Deduce input nad output file paths based on entered data. Input may be sequence of images, video file or single image file and same can be said about output, this method helps to find out what their paths are. It is validated that output directory exist and creates if not. During process are set "files", "stagingDir", "ext" and "sequence_file" (if output is sequence) keys to new representation. """ staging_dir = new_repre["stagingDir"] repre = temp_data["origin_repre"] if temp_data["input_is_sequence"]: collections = clique.assemble(repre["files"])[0] full_input_path = os.path.join( staging_dir, collections[0].format("{head}{padding}{tail}") ) filename = collections[0].format("{head}") if filename.endswith("."): filename = filename[:-1] # Make sure to have full path to one input file full_input_path_single_file = os.path.join( staging_dir, repre["files"][0] ) else: full_input_path = os.path.join( staging_dir, repre["files"] ) filename = os.path.splitext(repre["files"])[0] # Make sure to have full path to one input file full_input_path_single_file = full_input_path filename_suffix = output_def["filename_suffix"] output_ext = output_def.get("ext") # Use input extension if output definition do not specify it if output_ext is None: output_ext = os.path.splitext(full_input_path)[1] # TODO Define if extension should have dot or not if output_ext.startswith("."): output_ext = output_ext[1:] # Store extension to representation new_repre["ext"] = output_ext self.log.debug("New representation ext: `{}`".format(output_ext)) # Output is image file sequence witht frames output_ext_is_image = bool(output_ext in self.image_exts) output_is_sequence = bool( output_ext_is_image and "sequence" in output_def["tags"] ) if output_is_sequence: new_repre_files = [] frame_start = temp_data["output_frame_start"] frame_end = temp_data["output_frame_end"] filename_base = "{}_{}".format(filename, filename_suffix) # Temporary tempalte for frame filling. Example output: # "basename.%04d.exr" when `frame_end` == 1001 repr_file = "{}.%{:0>2}d.{}".format( filename_base, len(str(frame_end)), output_ext ) for frame in range(frame_start, frame_end + 1): new_repre_files.append(repr_file % frame) new_repre["sequence_file"] = repr_file full_output_path = os.path.join( staging_dir, filename_base, repr_file ) else: repr_file = "{}_{}.{}".format( filename, filename_suffix, output_ext ) full_output_path = os.path.join(staging_dir, repr_file) new_repre_files = repr_file # Store files to representation new_repre["files"] = new_repre_files # Make sure stagingDire exists staging_dir = os.path.normpath(os.path.dirname(full_output_path)) if not os.path.exists(staging_dir): self.log.debug("Creating dir: {}".format(staging_dir)) os.makedirs(staging_dir) # Store stagingDir to representaion new_repre["stagingDir"] = staging_dir # Store paths to temp data temp_data["full_input_path"] = full_input_path temp_data["full_input_path_single_file"] = full_input_path_single_file temp_data["full_output_path"] = full_output_path # Store information about output temp_data["output_ext_is_image"] = output_ext_is_image temp_data["output_is_sequence"] = output_is_sequence self.log.debug("Input path {}".format(full_input_path)) self.log.debug("Output path {}".format(full_output_path)) def audio_args(self, instance, temp_data): """Prepares FFMpeg arguments for audio inputs.""" audio_in_args = [] audio_filters = [] audio_out_args = [] audio_inputs = instance.data.get("audio") if not audio_inputs: return audio_in_args, audio_filters, audio_out_args for audio in audio_inputs: # NOTE modified, always was expected "frameStartFtrack" which is # STRANGE?!!! There should be different key, right? # TODO use different frame start! offset_seconds = 0 frame_start_ftrack = instance.data.get("frameStartFtrack") if frame_start_ftrack is not None: offset_frames = frame_start_ftrack - audio["offset"] offset_seconds = offset_frames / temp_data["fps"] if offset_seconds > 0: audio_in_args.append( "-ss {}".format(offset_seconds) ) elif offset_seconds < 0: audio_in_args.append( "-itsoffset {}".format(abs(offset_seconds)) ) audio_in_args.append("-i \"{}\"".format(audio["filename"])) # NOTE: These were changed from input to output arguments. # NOTE: value in "-ac" was hardcoded to 2, changed to audio inputs len. # Need to merge audio if there are more than 1 input. if len(audio_inputs) > 1: audio_out_args.append("-filter_complex amerge") audio_out_args.append("-ac {}".format(len(audio_inputs))) return audio_in_args, audio_filters, audio_out_args def rescaling_filters(self, temp_data, output_def, new_repre): """Prepare vieo filters based on tags in new representation. It is possible to add letterboxes to output video or rescale to different resolution. During this preparation "resolutionWidth" and "resolutionHeight" are set to new representation. """ filters = [] letter_box = output_def.get("letter_box") # Get instance data pixel_aspect = temp_data["pixel_aspect"] # NOTE Skipped using instance's resolution full_input_path_single_file = temp_data["full_input_path_single_file"] input_data = pype.lib.ffprobe_streams(full_input_path_single_file)[0] input_width = input_data["width"] input_height = input_data["height"] self.log.debug("pixel_aspect: `{}`".format(pixel_aspect)) self.log.debug("input_width: `{}`".format(input_width)) self.log.debug("input_height: `{}`".format(input_height)) # NOTE Setting only one of `width` or `heigth` is not allowed output_width = output_def.get("width") output_height = output_def.get("height") # Use instance resolution if output definition has not set it. if output_width is None or output_height is None: output_width = temp_data["resolution_width"] output_height = temp_data["resolution_height"] # Use source's input resolution instance does not have set it. if output_width is None or output_height is None: self.log.debug("Using resolution from input.") output_width = input_width output_height = input_height self.log.debug( "Output resolution is {}x{}".format(output_width, output_height) ) # Skip processing if resolution is same as input's and letterbox is # not set if ( output_width == input_width and output_height == input_height and not letter_box and pixel_aspect == 1 ): self.log.debug( "Output resolution is same as input's" " and \"letter_box\" key is not set. Skipping reformat part." ) new_repre["resolutionWidth"] = input_width new_repre["resolutionHeight"] = input_height return filters # defining image ratios input_res_ratio = ( (float(input_width) * pixel_aspect) / input_height ) output_res_ratio = float(output_width) / float(output_height) self.log.debug("input_res_ratio: `{}`".format(input_res_ratio)) self.log.debug("output_res_ratio: `{}`".format(output_res_ratio)) # Round ratios to 2 decimal places for comparing input_res_ratio = round(input_res_ratio, 2) output_res_ratio = round(output_res_ratio, 2) # get scale factor scale_factor_by_width = ( float(output_width) / (input_width * pixel_aspect) ) scale_factor_by_height = ( float(output_height) / input_height ) self.log.debug( "scale_factor_by_with: `{}`".format(scale_factor_by_width) ) self.log.debug( "scale_factor_by_height: `{}`".format(scale_factor_by_height) ) # letter_box if letter_box: if input_res_ratio == output_res_ratio: letter_box /= pixel_aspect elif input_res_ratio < output_res_ratio: letter_box /= scale_factor_by_width else: letter_box /= scale_factor_by_height scale_filter = "scale={}x{}:flags=lanczos".format( output_width, output_height ) top_box = ( "drawbox=0:0:iw:round((ih-(iw*(1/{})))/2):t=fill:c=black" ).format(letter_box) bottom_box = ( "drawbox=0:ih-round((ih-(iw*(1/{0})))/2)" ":iw:round((ih-(iw*(1/{0})))/2):t=fill:c=black" ).format(letter_box) # Add letter box filters filters.extend([scale_filter, "setsar=1", top_box, bottom_box]) # scaling none square pixels and 1920 width if ( input_height != output_height or input_width != output_width or pixel_aspect != 1 ): if input_res_ratio < output_res_ratio: self.log.debug( "Input's resolution ratio is lower then output's" ) width_scale = int(input_width * scale_factor_by_height) width_half_pad = int((output_width - width_scale) / 2) height_scale = output_height height_half_pad = 0 else: self.log.debug("Input is heigher then output") width_scale = output_width width_half_pad = 0 height_scale = int(input_height * scale_factor_by_width) height_half_pad = int((output_height - height_scale) / 2) self.log.debug("width_scale: `{}`".format(width_scale)) self.log.debug("width_half_pad: `{}`".format(width_half_pad)) self.log.debug("height_scale: `{}`".format(height_scale)) self.log.debug("height_half_pad: `{}`".format(height_half_pad)) filters.extend([ "scale={}x{}:flags=lanczos".format( width_scale, height_scale ), "pad={}:{}:{}:{}:black".format( output_width, output_height, width_half_pad, height_half_pad ), "setsar=1" ]) new_repre["resolutionWidth"] = output_width new_repre["resolutionHeight"] = output_height return filters def lut_filters(self, new_repre, instance, input_args): """Add lut file to output ffmpeg filters.""" filters = [] # baking lut file application lut_path = instance.data.get("lutPath") if not lut_path or "bake-lut" not in new_repre["tags"]: return filters # Prepare path for ffmpeg argument lut_path = lut_path.replace("\\", "/").replace(":", "\\:") # Remove gamma from input arguments if "-gamma" in input_args: input_args.remove("-gamme") # Prepare filters filters.append("lut3d=file='{}'".format(lut_path)) # QUESTION hardcoded colormatrix? filters.append("colormatrix=bt601:bt709") self.log.info("Added Lut to ffmpeg command.") return filters def main_family_from_instance(self, instance): """Returns main family of entered instance.""" family = instance.data.get("family") if not family: family = instance.data["families"][0] return family def families_from_instance(self, instance): """Returns all families of entered instance.""" families = [] family = instance.data.get("family") if family: families.append(family) for family in (instance.data.get("families") or tuple()): if family not in families: families.append(family) return families def compile_list_of_regexes(self, in_list): """Convert strings in entered list to compiled regex objects.""" regexes = [] if not in_list: return regexes for item in in_list: if not item: continue try: regexes.append(re.compile(item)) except TypeError: self.log.warning(( "Invalid type \"{}\" value \"{}\"." " Expected string based object. Skipping." ).format(str(type(item)), str(item))) return regexes def validate_value_by_regexes(self, value, in_list): """Validates in any regexe from list match entered value. Args: in_list (list): List with regexes. value (str): String where regexes is checked. Returns: int: Returns `0` when list is not set or is empty. Returns `1` when any regex match value and returns `-1` when none of regexes match value entered. """ if not in_list: return 0 output = -1 regexes = self.compile_list_of_regexes(in_list) for regex in regexes: if re.match(regex, value): output = 1 break return output def profile_exclusion(self, matching_profiles): """Find out most matching profile byt host, task and family match. Profiles are selectivelly filtered. Each profile should have "__value__" key with list of booleans. Each boolean represents existence of filter for specific key (host, taks, family). Profiles are looped in sequence. In each sequence are split into true_list and false_list. For next sequence loop are used profiles in true_list if there are any profiles else false_list is used. Filtering ends when only one profile left in true_list. Or when all existence booleans loops passed, in that case first profile from left profiles is returned. Args: matching_profiles (list): Profiles with same values. Returns: dict: Most matching profile. """ self.log.info( "Search for first most matching profile in match order:" " Host name -> Task name -> Family." ) # Filter all profiles with highest points value. First filter profiles # with matching host if there are any then filter profiles by task # name if there are any and lastly filter by family. Else use first in # list. idx = 0 final_profile = None while True: profiles_true = [] profiles_false = [] for profile in matching_profiles: value = profile["__value__"] # Just use first profile when idx is greater than values. if not idx < len(value): final_profile = profile break if value[idx]: profiles_true.append(profile) else: profiles_false.append(profile) if final_profile is not None: break if profiles_true: matching_profiles = profiles_true else: matching_profiles = profiles_false if len(matching_profiles) == 1: final_profile = matching_profiles[0] break idx += 1 final_profile.pop("__value__") return final_profile def find_matching_profile(self, host_name, task_name, family): """ Filter profiles by Host name, Task name and main Family. Filtering keys are "hosts" (list), "tasks" (list), "families" (list). If key is not find or is empty than it's expected to match. Args: profiles (list): Profiles definition from presets. host_name (str): Current running host name. task_name (str): Current context task name. family (str): Main family of current Instance. Returns: dict/None: Return most matching profile or None if none of profiles match at least one criteria. """ matching_profiles = None if not self.profiles: return matching_profiles highest_profile_points = -1 # Each profile get 1 point for each matching filter. Profile with most # points is returnd. For cases when more than one profile will match # are also stored ordered lists of matching values. for profile in self.profiles: profile_points = 0 profile_value = [] # Host filtering host_names = profile.get("hosts") match = self.validate_value_by_regexes(host_name, host_names) if match == -1: self.log.debug( "\"{}\" not found in {}".format(host_name, host_names) ) continue profile_points += match profile_value.append(bool(match)) # Task filtering task_names = profile.get("tasks") match = self.validate_value_by_regexes(task_name, task_names) if match == -1: self.log.debug( "\"{}\" not found in {}".format(task_name, task_names) ) continue profile_points += match profile_value.append(bool(match)) # Family filtering families = profile.get("families") match = self.validate_value_by_regexes(family, families) if match == -1: self.log.debug( "\"{}\" not found in {}".format(family, families) ) continue profile_points += match profile_value.append(bool(match)) if profile_points < highest_profile_points: continue if profile_points > highest_profile_points: matching_profiles = [] highest_profile_points = profile_points if profile_points == highest_profile_points: profile["__value__"] = profile_value matching_profiles.append(profile) if not matching_profiles: self.log.warning(( "None of profiles match your setup." " Host \"{}\" | Task: \"{}\" | Family: \"{}\"" ).format(host_name, task_name, family)) return if len(matching_profiles) == 1: # Pop temporary key `__value__` matching_profiles[0].pop("__value__") return matching_profiles[0] self.log.warning(( "More than one profile match your setup." " Host \"{}\" | Task: \"{}\" | Family: \"{}\"" ).format(host_name, task_name, family)) return self.profile_exclusion(matching_profiles) def families_filter_validation(self, families, output_families_filter): """Determines if entered families intersect with families filters. All family values are lowered to avoid unexpected results. """ if not output_families_filter: return True single_families = [] combination_families = [] for family_filter in output_families_filter: if not family_filter: continue if isinstance(family_filter, (list, tuple)): _family_filter = [] for family in family_filter: if family: _family_filter.append(family.lower()) combination_families.append(_family_filter) else: single_families.append(family_filter.lower()) for family in single_families: if family in families: return True for family_combination in combination_families: valid = True for family in family_combination: if family not in families: valid = False break if valid: return True return False def filter_outputs_by_families(self, profile, families): """Return outputs matching input instance families. Output definitions without families filter are marked as valid. Args: profile (dict): Profile from presets matching current context. families (list): All families of current instance. Returns: list: Containg all output definitions matching entered families. """ outputs = profile.get("outputs") or [] if not outputs: return outputs # lower values # QUESTION is this valid operation? families = [family.lower() for family in families] filtered_outputs = {} for filename_suffix, output_def in outputs.items(): output_filters = output_def.get("filter") # If no filter on output preset, skip filtering and add output # profile for farther processing if not output_filters: filtered_outputs[filename_suffix] = output_def continue families_filters = output_filters.get("families") if not self.families_filter_validation(families, families_filters): continue filtered_outputs[filename_suffix] = output_def return filtered_outputs def filter_outputs_by_tags(self, outputs, tags): """Filter output definitions by entered representation tags. Output definitions without tags filter are marked as valid. Args: outputs (list): Contain list of output definitions from presets. tags (list): Tags of processed representation. Returns: list: Containg all output definitions matching entered tags. """ filtered_outputs = [] repre_tags_low = [tag.lower() for tag in tags] for output_def in outputs: valid = True output_filters = output_def.get("filter") if output_filters: # Check tag filters tag_filters = output_filters.get("tags") if tag_filters: tag_filters_low = [tag.lower() for tag in tag_filters] valid = False for tag in repre_tags_low: if tag in tag_filters_low: valid = True break if not valid: continue if valid: filtered_outputs.append(output_def) return filtered_outputs def legacy_process(self, instance): self.log.warning("Legacy review presets are used.") output_profiles = self.outputs or {} inst_data = instance.data context_data = instance.context.data fps = float(inst_data.get("fps")) frame_start = inst_data.get("frameStart") frame_end = inst_data.get("frameEnd") handle_start = inst_data.get("handleStart", context_data.get("handleStart")) handle_end = inst_data.get("handleEnd", context_data.get("handleEnd")) pixel_aspect = inst_data.get("pixelAspect", 1) resolution_width = inst_data.get("resolutionWidth", self.to_width) resolution_height = inst_data.get("resolutionHeight", self.to_height) self.log.debug("Families In: `{}`".format(inst_data["families"])) self.log.debug("__ frame_start: {}".format(frame_start)) self.log.debug("__ frame_end: {}".format(frame_end)) self.log.debug("__ handle_start: {}".format(handle_start)) self.log.debug("__ handle_end: {}".format(handle_end)) # get representation and loop them representations = inst_data["representations"] ffmpeg_path = pype.lib.get_ffmpeg_tool_path("ffmpeg") # filter out mov and img sequences representations_new = representations[:] for repre in representations: if repre['ext'] not in self.ext_filter: continue tags = repre.get("tags", []) if instance.data.get("multipartExr") is True: # ffmpeg doesn't support multipart exrs continue if "thumbnail" in tags: continue self.log.info("Try repre: {}".format(repre)) if "review" not in tags: continue staging_dir = repre["stagingDir"] # iterating preset output profiles for name, profile in output_profiles.items(): repre_new = repre.copy() ext = profile.get("ext", None) p_tags = profile.get('tags', []) # append repre tags into profile tags for t in tags: if t not in p_tags: p_tags.append(t) self.log.info("p_tags: `{}`".format(p_tags)) # adding control for presets to be sequence # or single file is_sequence = ("sequence" in p_tags) and (ext in ( "png", "jpg", "jpeg")) # no handles switch from profile tags no_handles = "no-handles" in p_tags self.log.debug("Profile name: {}".format(name)) if not ext: ext = "mov" self.log.warning( str("`ext` attribute not in output " "profile. Setting to default ext: `mov`")) self.log.debug( "instance.families: {}".format( instance.data['families'])) self.log.debug( "profile.families: {}".format(profile['families'])) profile_family_check = False for _family in profile['families']: if _family in instance.data['families']: profile_family_check = True break if not profile_family_check: continue if isinstance(repre["files"], list): collections, remainder = clique.assemble( repre["files"]) full_input_path = os.path.join( staging_dir, collections[0].format( '{head}{padding}{tail}') ) filename = collections[0].format('{head}') if filename.endswith('.'): filename = filename[:-1] else: full_input_path = os.path.join( staging_dir, repre["files"]) filename = repre["files"].split(".")[0] repr_file = filename + "_{0}.{1}".format(name, ext) full_output_path = os.path.join( staging_dir, repr_file) if is_sequence: filename_base = filename + "_{0}".format(name) repr_file = filename_base + ".%08d.{0}".format( ext) repre_new["sequence_file"] = repr_file full_output_path = os.path.join( staging_dir, filename_base, repr_file) self.log.info("input {}".format(full_input_path)) self.log.info("output {}".format(full_output_path)) new_tags = [x for x in tags if x != "delete"] # add families [instance.data["families"].append(t) for t in p_tags if t not in instance.data["families"]] # add to [new_tags.append(t) for t in p_tags if t not in new_tags] self.log.info("new_tags: `{}`".format(new_tags)) input_args = [] output_args = [] # overrides output file input_args.append("-y") # preset's input data input_args.extend(profile.get('input', [])) # necessary input data # adds start arg only if image sequence frame_start_handle = frame_start - handle_start frame_end_handle = frame_end + handle_end if isinstance(repre["files"], list): if frame_start_handle != repre.get( "detectedStart", frame_start_handle): frame_start_handle = repre.get("detectedStart") # exclude handle if no handles defined if no_handles: frame_start_handle = frame_start frame_end_handle = frame_end input_args.append( "-start_number {0} -framerate {1}".format( frame_start_handle, fps)) else: if no_handles: start_sec = float(handle_start) / fps input_args.append("-ss {:0.2f}".format(start_sec)) frame_start_handle = frame_start frame_end_handle = frame_end input_args.append("-i {}".format(full_input_path)) for audio in instance.data.get("audio", []): offset_frames = ( instance.data.get("frameStartFtrack") - audio["offset"] ) offset_seconds = offset_frames / fps if offset_seconds > 0: input_args.append("-ss") else: input_args.append("-itsoffset") input_args.append(str(abs(offset_seconds))) input_args.extend( ["-i", audio["filename"]] ) # Need to merge audio if there are more # than 1 input. if len(instance.data["audio"]) > 1: input_args.extend( [ "-filter_complex", "amerge", "-ac", "2" ] ) codec_args = profile.get('codec', []) output_args.extend(codec_args) # preset's output data output_args.extend(profile.get('output', [])) # defining image ratios resolution_ratio = (float(resolution_width) * pixel_aspect) / resolution_height delivery_ratio = float(self.to_width) / float(self.to_height) self.log.debug( "__ resolution_ratio: `{}`".format(resolution_ratio)) self.log.debug( "__ delivery_ratio: `{}`".format(delivery_ratio)) # get scale factor scale_factor = float(self.to_height) / ( resolution_height * pixel_aspect) # shorten two decimals long float number for testing conditions resolution_ratio_test = float( "{:0.2f}".format(resolution_ratio)) delivery_ratio_test = float( "{:0.2f}".format(delivery_ratio)) if resolution_ratio_test != delivery_ratio_test: scale_factor = float(self.to_width) / ( resolution_width * pixel_aspect) if int(scale_factor * 100) == 100: scale_factor = ( float(self.to_height) / resolution_height ) self.log.debug("__ scale_factor: `{}`".format(scale_factor)) # letter_box lb = profile.get('letter_box', 0) if lb != 0: ffmpeg_width = self.to_width ffmpeg_height = self.to_height if "reformat" not in p_tags: lb /= pixel_aspect if resolution_ratio_test != delivery_ratio_test: ffmpeg_width = resolution_width ffmpeg_height = int( resolution_height * pixel_aspect) else: if resolution_ratio_test != delivery_ratio_test: lb /= scale_factor else: lb /= pixel_aspect output_args.append(str( "-filter:v scale={0}x{1}:flags=lanczos," "setsar=1,drawbox=0:0:iw:" "round((ih-(iw*(1/{2})))/2):t=fill:" "c=black,drawbox=0:ih-round((ih-(iw*(" "1/{2})))/2):iw:round((ih-(iw*(1/{2})))" "/2):t=fill:c=black").format( ffmpeg_width, ffmpeg_height, lb)) # In case audio is longer than video. output_args.append("-shortest") if no_handles: duration_sec = float(frame_end_handle - frame_start_handle + 1) / fps output_args.append("-t {:0.2f}".format(duration_sec)) # output filename output_args.append(full_output_path) self.log.debug( "__ pixel_aspect: `{}`".format(pixel_aspect)) self.log.debug( "__ resolution_width: `{}`".format( resolution_width)) self.log.debug( "__ resolution_height: `{}`".format( resolution_height)) # scaling none square pixels and 1920 width if "reformat" in p_tags: if resolution_ratio_test < delivery_ratio_test: self.log.debug("lower then delivery") width_scale = int(self.to_width * scale_factor) width_half_pad = int(( self.to_width - width_scale)/2) height_scale = self.to_height height_half_pad = 0 else: self.log.debug("heigher then delivery") width_scale = self.to_width width_half_pad = 0 scale_factor = float(self.to_width) / (float( resolution_width) * pixel_aspect) self.log.debug( "__ scale_factor: `{}`".format( scale_factor)) height_scale = int( resolution_height * scale_factor) height_half_pad = int( (self.to_height - height_scale)/2) self.log.debug( "__ width_scale: `{}`".format(width_scale)) self.log.debug( "__ width_half_pad: `{}`".format( width_half_pad)) self.log.debug( "__ height_scale: `{}`".format( height_scale)) self.log.debug( "__ height_half_pad: `{}`".format( height_half_pad)) scaling_arg = str( "scale={0}x{1}:flags=lanczos," "pad={2}:{3}:{4}:{5}:black,setsar=1" ).format(width_scale, height_scale, self.to_width, self.to_height, width_half_pad, height_half_pad ) vf_back = self.add_video_filter_args( output_args, scaling_arg) # add it to output_args output_args.insert(0, vf_back) # baking lut file application lut_path = instance.data.get("lutPath") if lut_path and ("bake-lut" in p_tags): # removing Gama info as it is all baked in lut gamma = next((g for g in input_args if "-gamma" in g), None) if gamma: input_args.remove(gamma) # create lut argument lut_arg = "lut3d=file='{}'".format( lut_path.replace( "\\", "/").replace(":/", "\\:/") ) lut_arg += ",colormatrix=bt601:bt709" vf_back = self.add_video_filter_args( output_args, lut_arg) # add it to output_args output_args.insert(0, vf_back) self.log.info("Added Lut to ffmpeg command") self.log.debug( "_ output_args: `{}`".format(output_args)) if is_sequence: stg_dir = os.path.dirname(full_output_path) if not os.path.exists(stg_dir): self.log.debug( "creating dir: {}".format(stg_dir)) os.mkdir(stg_dir) mov_args = [ ffmpeg_path, " ".join(input_args), " ".join(output_args) ] subprcs_cmd = " ".join(mov_args) # run subprocess self.log.debug("Executing: {}".format(subprcs_cmd)) output = pype.api.subprocess(subprcs_cmd) self.log.debug("Output: {}".format(output)) # create representation data repre_new.update({ 'name': name, 'ext': ext, 'files': repr_file, "tags": new_tags, "outputName": name, "codec": codec_args, "_profile": profile, "resolutionHeight": resolution_height, "resolutionWidth": resolution_width, "frameStartFtrack": frame_start_handle, "frameEndFtrack": frame_end_handle }) if is_sequence: repre_new.update({ "stagingDir": stg_dir, "files": os.listdir(stg_dir) }) if no_handles: repre_new.update({ "outputName": name + "_noHandles", "frameStartFtrack": frame_start, "frameEndFtrack": frame_end }) if repre_new.get('preview'): repre_new.pop("preview") if repre_new.get('thumbnail'): repre_new.pop("thumbnail") # adding representation self.log.debug("Adding: {}".format(repre_new)) representations_new.append(repre_new) for repre in representations_new: if "delete" in repre.get("tags", []): representations_new.remove(repre) instance.data.update({ "reviewToWidth": self.to_width, "reviewToHeight": self.to_height }) self.log.debug( "new representations: {}".format(representations_new)) instance.data["representations"] = representations_new self.log.debug("Families Out: `{}`".format(instance.data["families"])) def add_video_filter_args(self, args, inserting_arg): """ Fixing video filter argumets to be one long string Args: args (list): list of string arguments inserting_arg (str): string argument we want to add (without flag `-vf`) Returns: str: long joined argument to be added back to list of arguments """ # find all video format settings vf_settings = [p for p in args for v in ["-filter:v", "-vf"] if v in p] self.log.debug("_ vf_settings: `{}`".format(vf_settings)) # remove them from output args list for p in vf_settings: self.log.debug("_ remove p: `{}`".format(p)) args.remove(p) self.log.debug("_ args: `{}`".format(args)) # strip them from all flags vf_fixed = [p.replace("-vf ", "").replace("-filter:v ", "") for p in vf_settings] self.log.debug("_ vf_fixed: `{}`".format(vf_fixed)) vf_fixed.insert(0, inserting_arg) self.log.debug("_ vf_fixed: `{}`".format(vf_fixed)) # create new video filter setting vf_back = "-vf " + ",".join(vf_fixed) return vf_back
1.789063
2
tests/peerfinder_test.py
wusel42/PeerFinder
49
16539
import unittest from unittest.mock import Mock import mock import peerfinder.peerfinder as peerfinder import requests from ipaddress import IPv6Address, IPv4Address class testPeerFinder(unittest.TestCase): def setUp(self): self.netixlan_set = { "id": 1, "ix_id": 2, "name": "Test IX", "ixlan_id": 3, "notes": "", "speed": 1000, "asn": 65536, "ipaddr4": ["192.0.2.1"], "ipaddr6": ["0100::"], "is_rs_peer": True, "operational": True, "created": "2010-01-01T00:00:00Z", "updated": "2010-01-01T00:00:00Z", "status": "ok", } self.netfac_set = { "id": 1, "name": "Test Facility", "city": "Dublin", "country": "IE", "fac_id": 1, "local_asn": 65536, "created": "2010-01-01T00:00:00Z", "updated": "2010-01-01T00:00:00Z", "status": "ok", } self.peer = {"name": "<NAME>", "asn": 65536} def test_pdb_to_ixp(self): expected = peerfinder.IXP( name="Test IX", subnet4=[IPv4Address("192.0.2.1")], subnet6=[IPv6Address("0100::")], speed=1000, ) self.assertEqual(expected, peerfinder.pdb_to_ixp(self.netixlan_set)) def test_pdb_to_peer(self): ixp = peerfinder.pdb_to_ixp(self.netixlan_set) fac = peerfinder.pdb_to_fac(self.netfac_set) expected = peerfinder.Peer( name="<NAME>", ASN=65536, peering_on=ixp, present_in=fac, ) self.assertEqual(expected, peerfinder.pdb_to_peer(self.peer, ixp, fac)) def test_pdb_to_fac(self): expected = peerfinder.Facility(name="Test Facility", ASN=65536) self.assertEqual(expected, peerfinder.pdb_to_fac(self.netfac_set)) def test__dedup_ixs(self): expected = { "Test IX": { "ipaddr4": [["192.0.2.1"], ["192.0.2.1"]], "ipaddr6": [["0100::"], ["0100::"]], "name": "Test IX", "speed": 2000, } } self.assertEqual( expected, peerfinder._dedup_ixs([self.netixlan_set, self.netixlan_set]), ) def test_fetch_ix_from_ixps(self): expected = peerfinder.pdb_to_ixp(self.netixlan_set) ixp = [peerfinder.pdb_to_ixp(self.netixlan_set)] self.assertEqual(expected, peerfinder.fetch_ix_from_ixps("Test IX", ixp)) def test_fetch_fac_from_facilities(self): expected = peerfinder.pdb_to_fac(self.netfac_set) fac = [peerfinder.pdb_to_fac(self.netfac_set)] self.assertEqual(expected, peerfinder.fetch_ix_from_ixps("Test Facility", fac)) def test_fetch_common_ixps(self): ixp = [peerfinder.pdb_to_ixp(self.netixlan_set)] fac = [peerfinder.pdb_to_fac(self.netfac_set)] peer = [peerfinder.pdb_to_peer(self.peer, ixp, fac)] expected = {"Test IX"} self.assertEqual(expected, peerfinder.fetch_common_ixps(peer)) def test_fetch_common_facilities(self): ixp = [peerfinder.pdb_to_ixp(self.netixlan_set)] fac = [peerfinder.pdb_to_fac(self.netfac_set)] peer = [peerfinder.pdb_to_peer(self.peer, ixp, fac)] expected = {"Test Facility"} self.assertEqual(expected, peerfinder.fetch_common_facilities(peer)) @mock.patch.object(requests, "get", autospec=True) def test_getPeeringDBSuccess(self, requests_mock): r_mock = Mock() r_mock.status_code = 200 r_mock.text = "some text" r_mock.json.return_value = {"data": [0]} requests_mock.return_value = r_mock expected = {"data": [0]} self.assertEqual(expected, peerfinder.getPeeringDB("23456")) def test_fetch_fac_from_facilities(self): fac = [peerfinder.pdb_to_fac(self.netfac_set)] fac_name = "Test Facility" expected = peerfinder.Facility(name="Test Facility", ASN=65536) self.assertEqual(expected, peerfinder.fetch_fac_from_facilities(fac_name, fac)) def test_fetch_different_ixps(self): ix1 = peerfinder.IXP( name="Test IX1", subnet4=[IPv4Address("192.0.2.1")], subnet6=[IPv6Address("0100::")], speed=1000, ) ix2 = peerfinder.IXP( name="Test IX2", subnet4=[IPv4Address("192.0.2.2")], subnet6=[IPv6Address("0100::")], speed=1000, ) expected = ["Test IX1", "Test IX2"] peer1 = peerfinder.Peer(name="peer1", ASN=1, present_in=[], peering_on=[ix1]) peer2 = peerfinder.Peer(name="peer2", ASN=1, present_in=[], peering_on=[ix2]) self.assertEqual(expected, peerfinder.fetch_different_ixps([peer1, peer2])) def test_print_ixp(self): ix1 = peerfinder.IXP( name="Test IX1", subnet4=[IPv4Address("192.0.2.1")], subnet6=[IPv6Address("0100::")], speed=1000, ) ix2 = peerfinder.IXP( name="Test IX2", subnet4=[IPv4Address("192.0.2.2")], subnet6=[IPv6Address("0100::")], speed=1000, ) peer1 = peerfinder.Peer(name="peer1", ASN=1, present_in=[], peering_on=[ix1]) peer2 = peerfinder.Peer( name="peer2", ASN=1, present_in=[], peering_on=[ix1, ix2] ) self.assertIsNone(peerfinder.print_ixp([peer1, peer2])) def test_print_fac(self): fac1 = peerfinder.Facility(name="Test Facility 1", ASN=1,) fac2 = peerfinder.Facility(name="Test Facility 2", ASN=1,) peer1 = peerfinder.Peer( name="peer1", ASN=1, present_in=[fac1, fac2], peering_on=[] ) peer2 = peerfinder.Peer(name="peer2", ASN=1, present_in=[fac1], peering_on=[]) self.assertIsNone(peerfinder.print_fac([peer1, peer2])) def test_print_uncommon(self): ix1 = peerfinder.IXP( name="Test IX1", subnet4=[IPv4Address("192.0.2.1")], subnet6=[IPv6Address("0100::")], speed=1000, ) ix2 = peerfinder.IXP( name="Test IX2", subnet4=[IPv4Address("192.0.2.2")], subnet6=[IPv6Address("0100::")], speed=1000, ) peer1 = peerfinder.Peer(name="peer1", ASN=1, present_in=[], peering_on=[ix1]) peer2 = peerfinder.Peer( name="peer2", ASN=1, present_in=[], peering_on=[ix1, ix2] ) self.assertIsNone(peerfinder.print_uncommon([peer1, peer2])) if __name__ == "__main__": unittest.main()
2.75
3
ceilometer/network/notifications.py
rackerlabs/instrumented-ceilometer
3
16540
# -*- encoding: utf-8 -*- # # Copyright © 2012 New Dream Network, LLC (DreamHost) # # Author: <NAME> <<EMAIL>> # # Licensed under the Apache License, Version 2.0 (the "License"); you may # not use this file except in compliance with the License. You may obtain # a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, WITHOUT # WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the # License for the specific language governing permissions and limitations # under the License. """Handler for producing network counter messages from Neutron notification events. """ from oslo.config import cfg from ceilometer.openstack.common.gettextutils import _ # noqa from ceilometer.openstack.common import log from ceilometer import plugin from ceilometer import sample OPTS = [ cfg.StrOpt('neutron_control_exchange', default='neutron', help="Exchange name for Neutron notifications", deprecated_name='quantum_control_exchange'), ] cfg.CONF.register_opts(OPTS) LOG = log.getLogger(__name__) class NetworkNotificationBase(plugin.NotificationBase): resource_name = None @property def event_types(self): return [ # NOTE(flwang): When the *.create.start notification sending, # there is no resource id assigned by Neutron yet. So we ignore # the *.create.start notification for now and only listen the # *.create.end to make sure the resource id is existed. '%s.create.end' % (self.resource_name), '%s.update.*' % (self.resource_name), '%s.exists' % (self.resource_name), # FIXME(dhellmann): Neutron delete notifications do # not include the same metadata as the other messages, # so we ignore them for now. This isn't ideal, since # it may mean we miss charging for some amount of time, # but it is better than throwing away the existing # metadata for a resource when it is deleted. ##'%s.delete.start' % (self.resource_name), ] @staticmethod def get_exchange_topics(conf): """Return a sequence of ExchangeTopics defining the exchange and topics to be connected for this plugin. """ return [ plugin.ExchangeTopics( exchange=conf.neutron_control_exchange, topics=set(topic + ".info" for topic in conf.notification_topics)), ] def process_notification(self, message): LOG.info(_('network notification %r') % message) message['payload'] = message['payload'][self.resource_name] counter_name = getattr(self, 'counter_name', self.resource_name) unit_value = getattr(self, 'unit', self.resource_name) yield sample.Sample.from_notification( name=counter_name, type=sample.TYPE_GAUGE, unit=unit_value, volume=1, user_id=message['_context_user_id'], project_id=message['payload']['tenant_id'], resource_id=message['payload']['id'], message=message) event_type_split = message['event_type'].split('.') if len(event_type_split) > 2: yield sample.Sample.from_notification( name=counter_name + "." + event_type_split[1], type=sample.TYPE_DELTA, unit=unit_value, volume=1, user_id=message['_context_user_id'], project_id=message['payload']['tenant_id'], resource_id=message['payload']['id'], message=message) class Network(NetworkNotificationBase): """Listen for Neutron network notifications in order to mediate with the metering framework. """ resource_name = 'network' class Subnet(NetworkNotificationBase): """Listen for Neutron notifications in order to mediate with the metering framework. """ resource_name = 'subnet' class Port(NetworkNotificationBase): """Listen for Neutron notifications in order to mediate with the metering framework. """ resource_name = 'port' class Router(NetworkNotificationBase): """Listen for Neutron notifications in order to mediate with the metering framework. """ resource_name = 'router' class FloatingIP(NetworkNotificationBase): """Listen for Neutron notifications in order to mediate with the metering framework. """ resource_name = 'floatingip' counter_name = 'ip.floating' unit = 'ip' class Bandwidth(NetworkNotificationBase): """Listen for Neutron notifications in order to mediate with the metering framework. """ event_types = ['l3.meter'] def process_notification(self, message): yield sample.Sample.from_notification( name='bandwidth', type=sample.TYPE_DELTA, unit='B', volume=message['payload']['bytes'], user_id=None, project_id=message['payload']['tenant_id'], resource_id=message['payload']['label_id'], message=message)
1.5625
2
optax/_src/update_test.py
pierricklee/optax
2
16541
<reponame>pierricklee/optax<filename>optax/_src/update_test.py<gh_stars>1-10 # Lint as: python3 # Copyright 2019 DeepMind Technologies Limited. All Rights Reserved. # # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. # ============================================================================== """Tests for `update.py`.""" from absl.testing import absltest import chex import jax import jax.numpy as jnp from optax._src import update class UpdateTest(chex.TestCase): @chex.all_variants() def test_apply_updates(self): params = ({'a': jnp.ones((3, 2))}, jnp.ones((1,))) grads = jax.tree_map(lambda t: 2 * t, params) exp_params = jax.tree_map(lambda t: 3 * t, params) new_params = self.variant(update.apply_updates)(params, grads) chex.assert_tree_all_close( exp_params, new_params, atol=1e-10, rtol=1e-5) @chex.all_variants() def test_incremental_update(self): params_1 = ({'a': jnp.ones((3, 2))}, jnp.ones((1,))) params_2 = jax.tree_map(lambda t: 2 * t, params_1) exp_params = jax.tree_map(lambda t: 1.5 * t, params_1) new_params = self.variant( update.incremental_update)(params_2, params_1, 0.5) chex.assert_tree_all_close( exp_params, new_params, atol=1e-10, rtol=1e-5) @chex.all_variants() def test_periodic_update(self): params_1 = ({'a': jnp.ones((3, 2))}, jnp.ones((1,))) params_2 = jax.tree_map(lambda t: 2 * t, params_1) update_period = 5 update_fn = self.variant(update.periodic_update) for j in range(3): for i in range(1, update_period): new_params = update_fn( params_2, params_1, j*update_period+i, update_period) chex.assert_tree_all_close( params_1, new_params, atol=1e-10, rtol=1e-5) new_params = update_fn( params_2, params_1, (j+1)*update_period, update_period) chex.assert_tree_all_close( params_2, new_params, atol=1e-10, rtol=1e-5) if __name__ == '__main__': absltest.main()
2.03125
2
scripts/venv/lib/python2.7/site-packages/cogent/core/entity.py
sauloal/cnidaria
3
16542
#!/usr/bin/env python """Provides the entities, the building blocks of the SMRCA hierachy representation of a macromolecular structure. The MultiEntity class is a special Entity class to hold multiple instances of other entities. All Entities apart from the Atom can hold others and inherit from the MultiEntity. The Entity is the most basic class to deal with structural and molecular data. Do not use it directly since some functions depend on methods provided by sub-classes. Classes inheriting from MultiEntity have to provide some attributes during init e.g: self.level = a valid string inside the SMCRA hierarchy). Holders of entities are like normal MultiEntities, but are temporary and are outside the parent-children axes. """ import cogent from cogent.core.annotation import SimpleVariable from numpy import (sqrt, arctan2, power, array, mean, sum) from cogent.data.protein_properties import AA_NAMES, AA_ATOM_BACKBONE_ORDER, \ AA_ATOM_REMOTE_ORDER, AREAIMOL_VDW_RADII, \ DEFAULT_AREAIMOL_VDW_RADIUS, AA_NAMES_3to1 from cogent.data.ligand_properties import HOH_NAMES, LIGAND_AREAIMOL_VDW_RADII from operator import itemgetter, gt, ge, lt, le, eq, ne, or_, and_, contains, \ is_, is_not from collections import defaultdict from itertools import izip from copy import copy, deepcopy __author__ = "<NAME>" __copyright__ = "Copyright 2007-2012, The Cogent Project" __credits__ = ["<NAME>"] __license__ = "GPL" __version__ = "1.5.3" __maintainer__ = "<NAME>" __email__ = "<EMAIL>" __status__ = "Development" ALPHABET = 'ABCDEFGHIJKLMNOPQRSTUVWXYZ_ ' HIERARCHY = ['H', 'S', 'M', 'C', 'R', 'A'] AREAIMOL_VDW_RADII.update(LIGAND_AREAIMOL_VDW_RADII) # error while creating a structure (non-recoverable error) class ConstructionError(Exception): """Cannot unambiguously create a structure.""" pass # warning while creating a structure # (something wrong with the input, but recoverable) class ConstructionWarning(Exception): """Input violates some construction rules (contiguity).""" pass def sort_id_list(id_list, sort_tuple): """Sorts lists of id tuples. The order is defined by the PDB file specification.""" (hol_loc, str_loc, mod_loc, chn_loc, res_loc, at_loc) = sort_tuple # even a simple id is a tuple, this makes sorting general def space_last(ch_id1, ch_id2): # this is for chain sorting if ch_id1 == ' ' and ch_id2 != ' ': return 1 if ch_id2 == ' ' and ch_id1 != ' ': return - 1 if ch_id1 == ' ' and ch_id2 == ' ': return 0 return cmp(ch_id1, ch_id2) def atom(at_id1, at_id2): # hydrogen atoms come last is_hydrogen1 = (at_id1[0] == 'H') is_hydrogen2 = (at_id2[0] == 'H') diff = cmp(is_hydrogen1, is_hydrogen2) # back bone come first if not diff: order1 = AA_ATOM_BACKBONE_ORDER.get(at_id1) order2 = AA_ATOM_BACKBONE_ORDER.get(at_id2) diff = cmp(order2, order1) # (B)eta, (D)elta, (G)amma, .... o(X)t if not diff: remote1 = AA_ATOM_REMOTE_ORDER.get(at_id1[1:2]) remote2 = AA_ATOM_REMOTE_ORDER.get(at_id2[1:2]) diff = cmp(remote1, remote2) # branching comes last if not diff: diff = cmp(at_id1[2:4], at_id2[2:4]) return diff # SE vs CE - selenium first if not diff: alpha1 = ALPHABET.index(at_id1[0:1]) alpha2 = ALPHABET.index(at_id2[0:1]) diff = cmp(alpha2, alpha1) def residue(res_id1, res_id2): r1, r2 = 1, 1 if res_id1 in AA_NAMES: r1 = 2 if res_id1 in HOH_NAMES: r1 = 0 if res_id2 in AA_NAMES: r2 = 2 if res_id2 in HOH_NAMES: r2 = 0 if r1 is r2: return cmp(res_id1, res_id2) else: return cmp(r2, r1) # this assumes that the implementation of sorting is stable. # does it work for others then cPython. if res_loc or res_loc is 0: id_list.sort(key=itemgetter(res_loc), cmp=lambda x, y: residue(x[0], y[0])) # by res_name if at_loc or at_loc is 0: id_list.sort(key=itemgetter(at_loc), cmp=lambda x, y: space_last(x[1], y[1])) # by alt_loc if at_loc or at_loc is 0: id_list.sort(key=itemgetter(at_loc), cmp=lambda x, y: atom(x[0], y[0])) # by at_id if res_loc or res_loc is 0: id_list.sort(key=itemgetter(res_loc), cmp=lambda x, y: cmp(x[2], y[2])) # by res_ic if res_loc or res_loc is 0: id_list.sort(key=itemgetter(res_loc), cmp=lambda x, y: cmp(x[1], y[1])) # by res_id if chn_loc or chn_loc is 0: id_list.sort(key=itemgetter(chn_loc), cmp=space_last) # by chain if mod_loc or mod_loc is 0: id_list.sort(key=itemgetter(mod_loc)) # by model if str_loc or str_loc is 0: id_list.sort(key=itemgetter(str_loc)) # by structure return id_list def merge(dicts): """Merges multiple dictionaries into a new one.""" master_dict = {} for dict_ in dicts: master_dict.update(dict_) return master_dict def unique(lists): """Merges multiple iterables into a unique sorted tuple (sorted set).""" master_set = set() for set_ in lists: master_set.update(set_) return tuple(sorted(master_set)) class Entity(dict): """Container object all entities inherit from it. Inherits from dict.""" def __init__(self, id, name=None, *args): # This class has to be sub-classed! # the masked attribute has to be set before the __init__ of an Entity # because during __setstate__, __getstate__ sub-entities are iterated # by .values(), which relies on the attribute masked. to decide which # children should be omitted. self.masked = False self.parent = None # mandatory parent attribute self.modified = True # modified on creation self.id = (id,) # ids are non-zero lenght tuples self.name = (name or id) # prefer name over duplicate id self.xtra = {} # mandatory xtra dict attribute # Dictionary that keeps additional properties dict.__init__(self, *args) # finish init as dictionary def __copy__(self): return deepcopy(self) def __deepcopy__(self, memo): new_state = self.__getstate__() new_instance = self.__new__(type(self)) new_instance.__setstate__(new_state) return new_instance def __getstate__(self): new_state = copy(self.__dict__) # shallow new_state['parent'] = None return new_state def __setstate__(self, new_state): self.__dict__.update(new_state) def __repr__(self): """Default representation.""" # mandatory getLevel from sub-class return "<Entity id=%s, level=%s>" % (self.getId(), self.getLevel()) def __sub__(self, entity): """Override "-" as Euclidean distance between coordinates.""" return sqrt(sum(pow(self.coords - entity.coords, 2))) def _setId(self, id): self.name = id[0] def _getId(self): return (self.name,) def getId(self): """Return the id.""" return self._getId() def getFull_id(self): """Return the full id.""" parent = self.getParent() if parent: full_id = parent.getFull_id() else: full_id = () # we create a tuple on the top full_id = full_id + self.getId() # merge tuples from the left return full_id def setId(self, id_=None): """Set the id. Calls the ``_setId`` method.""" if (id_ and id_ != self.id) or (not id_ and (self.getId() != self.id)): self.id = (id_ or self.getId()) self.setModified(True, True) self._setId(self.id) if self.parent: self.parent.updateIds() def _setMasked(self, masked, force=False): if masked != self.masked or force: self.masked = masked # mask or unmask self.setModified(True, False) # set parents as modified def setMasked(self, *args, **kwargs): """Set masked flag (``masked``) ``True``.""" self._setMasked(True, *args, **kwargs) def setUnmasked(self, *args, **kwargs): """Set masked flag (``masked``) ``False``.""" self._setMasked(False, *args, **kwargs) def setModified(self, up=True, down=False): """Set modified flag (``modified``) ``True``.""" self.modified = True if up and self.parent: self.parent.setModified(True, False) def setUnmodified(self, up=False, down=False): """Set modified flag (``modified``) ``False``.""" self.modified = False if up and self.parent: self.parent.setUnmodified(True, False) def setParent(self, entity): """Set the parent ``Entity`` and adds oneself as the child.""" if self.parent != entity: # delete old parent self.delParent() # add new parent self.parent = entity self.parent.addChild(self) self.setModified(False, True) def delParent(self): """Detach mutually from the parent. Sets both child and parent modified flags (``modified``) as ``True``.""" if self.parent: self.parent.pop(self.getId()) self.parent.setModified(True, False) self.parent = None self.setModified(False, True) def getModified(self): """Return value of the modified flag (``modified``).""" return self.modified def getMasked(self): """Return value of the masked flag (``masked``).""" return self.masked def setLevel(self, level): """Set level (``level``).""" self.level = level def getLevel(self): """Return level (``level``)in the hierarchy.""" return self.level def setName(self, name): """Set name.""" self.name = name self.setId() def getName(self): """Return name.""" return self.name def getParent(self, level=None): """Return the parent ``Entity`` instance.""" if not level: return self.parent elif level == self.level: return self return self.parent.getParent(level) def move(self, origin): """Subtract the origin coordinates from the coordintats (``coords``).""" self.coords = self.coords - origin def setCoords(self, coords): """Set the entity coordinates. Coordinates should be a ``numpy.array``.""" self.coords = coords def getCoords(self): """Get the entity coordinates.""" return self.coords def getScoords(self): """Return spherical (r, theta, phi) coordinates.""" x, y, z = self.coords x2, y2, z2 = power(self.coords, 2) scoords = array([sqrt(x2 + y2 + z2), \ arctan2(sqrt(x2 + y2), z), \ arctan2(y, x)]) return scoords def getCcoords(self): """Return redundant, polar, clustering-coordinates on the unit-sphere. This is only useful for clustering.""" x, y, z = self.coords x2, y2, z2 = power(self.coords, 2) ccoords = array([arctan2(sqrt(y2 + z2), x), \ arctan2(sqrt(x2 + z2), y), \ arctan2(sqrt(x2 + y2), z) ]) return ccoords def setScoords(self): """Set ``entity.scoords``, see: getScoords.""" self.scoords = self.getScoords() def setCcoords(self): """Set ``entity.ccoords``, see: getCcoords.""" self.ccoords = self.getCcoords() class MultiEntity(Entity): """The ``MultiEntity`` contains other ``Entity`` or ``MultiEntity`` instances.""" def __init__(self, long_id, short_id=None, *args): self.index = HIERARCHY.index(self.level) # index corresponding to the hierarchy level self.table = dict([(level, {}) for level in HIERARCHY[self.index + 1:]]) # empty table Entity.__init__(self, long_id, short_id, *args) def __repr__(self): id_ = self.getId() return "<MultiEntity id=%s, holding=%s>" % (id_, len(self)) def _link(self): """Recursively adds a parent pointer to children.""" for child in self.itervalues(unmask=True): child.parent = self try: child._link() except AttributeError: pass def _unlink(self): """Recursively deletes the parent pointer from children.""" for child in self.itervalues(unmask=True): child.parent = None try: child._unlink() except AttributeError: pass def __getstate__(self): new_dict = copy(self.__dict__) # shallow copy new_dict['parent'] = None # remove recursion new_children = [] for child in self.itervalues(unmask=True): new_child_instance = deepcopy(child) new_children.append(new_child_instance) return (new_children, new_dict) def __setstate__(self, new_state): new_children, new_dict = new_state self.__dict__.update(new_dict) for child in new_children: self.addChild(child) def __copy__(self): return deepcopy(self) def __deepcopy__(self, memo): new_state = self.__getstate__() new_instance = self.__new__(type(self)) new_instance.__setstate__(new_state) return new_instance def __iter__(self): return self.itervalues() def setSort_tuple(self, sort_tuple=None): """Set the ``sort_tuple attribute``. The ``sort_tuple`` is a tuple needed by the ``sort_id_list`` function to correctly sort items within entities.""" if sort_tuple: self.sort_tuple = sort_tuple else: # making the sort tuple, ugly, uggly, uaughhlly ble sort_tuple = [None, None, None, None, None, None] key_lenght = len(self.keys()[0]) stop_i = self.index + 2 # next level, open right [) start_i = stop_i - key_lenght # before all nones indexes = range(start_i, stop_i) # Nones to change for value, index in enumerate(indexes): sort_tuple[index] = value self.sort_tuple = sort_tuple def getSort_tuple(self): """Return the ``sort_tuple`` attribute. If not set calls the ``setSort_tuple`` method first. See: ``setSort_tuple``.""" if not hasattr(self, 'sort_tuple'): self.setSort_tuple() return self.sort_tuple def itervalues(self, unmask=False): return (v for v in super(MultiEntity, self).itervalues() if not v.masked or unmask) def iteritems(self, unmask=False): return ((k, v) for k, v in super(MultiEntity, self).iteritems() if not v.masked or unmask) def iterkeys(self, unmask=False): return (k for k, v in super(MultiEntity, self).iteritems() if not v.masked or unmask) def values(self, *args, **kwargs): return list(self.itervalues(*args, **kwargs)) def items(self, *args, **kwargs): return list(self.iteritems(*args, **kwargs)) def keys(self, *args, **kwargs): return list(self.iterkeys(*args, **kwargs)) def __contains__(self, key, *args, **kwargs): return key in self.keys(*args, **kwargs) def sortedkeys(self, *args, **kwargs): list_ = sort_id_list(self.keys(*args, **kwargs), self.getSort_tuple()) return list_ def sortedvalues(self, *args, **kwargs): values = [self[i] for i in self.sortedkeys(*args, **kwargs)] return values def sorteditems(self, *args, **kwargs): items = [(i, self[i]) for i in self.sortedkeys()] return items def _setMasked(self, masked, force=False): """Set the masked flag (``masked``) recursively. If forced proceed even if the flag is already set correctly.""" if masked != self.masked or force: # the second condition is when if masked: # an entity has all children masked # we have to mask children # but is not masked itself for child in self.itervalues(): # only unmasked children child.setMasked() child.setModified(False, False) else: # we have to unmask children for child in self.itervalues(unmask=True): if child.masked or force: # only masked children child.setUnmasked(force=force) child.setModified(False, False) self.masked = masked self.setModified(True, False) # set parents as modified def setModified(self, up=True, down=True): """Set the modified flag (``modified``) ``True``. If down proceeds recursively for all children. If up proceeds recursively for all parents.""" self.modified = True if up and self.parent: self.parent.setModified(True, False) if down: for child in self.itervalues(unmask=True): child.setModified(False, True) def setUnmodified(self, up=False, down=False): """Set the modified (``modified``) flag ``False``. If down proceeds recursively for all children. If up proceeds recursively for all parents.""" self.modified = False if up and self.parent: self.parent.setUnmodified(True, False) if down: for child in self.itervalues(unmask=True): child.setUnmodified(False, True) def _initChild(self, child): """Initialize a child (during construction).""" child.parent = self self[child.getId()] = child def addChild(self, child): """Add a child.""" child.setParent(self) child_id = child.getId() self[child_id] = child self.setModified(True, False) def delChild(self, child_id): """Remove a child.""" child = self.get(child_id) if child: child.delParent() self.setModified(True, False) def getChildren(self, ids=None, **kwargs): """Return a copy of the list of children.""" if ids: children = [] for (id_, child) in self.iteritems(**kwargs): if id_ in ids: children.append(child) else: children = self.values(**kwargs) return children def _setTable(self, entity): """Recursive helper method for ``entity.setTable``.""" for e in entity.itervalues(): self.table[e.getLevel()].update({e.getFull_id():e}) self._setTable(e) def setTable(self, force=True, unmodify=True): """Populate the children table (``table``) recursively with all children grouped into hierarchy levels. If forced is ``True`` the table will be updated even if the ``Entity`` instance is not modified. If unmodify is ``True`` the ``Entity`` modified flag (``modified``) will be set ``False`` afterwards.""" if self.modified or force: # a table is accurate as long as the contents of a dictionary do not # change. self.delTable() self._setTable(self) if unmodify: self.setUnmodified() def delTable(self): """Delete all children from the children-table (``table``). This does not modify the hierarchy.""" self.table = dict([(level, {}) for level in HIERARCHY[self.index + 1:]]) self.modified = True def getTable(self, level): """Return children of given level from the children-table (``table``).""" return self.table[level] def updateIds(self): """Update self with children ids.""" ids = [] for (id_, child) in self.iteritems(): new_id = child.getId() if id_ != new_id: ids.append((id_, new_id)) for (old_id, new_id) in ids: child = self.pop(old_id) self.update(((new_id, child),)) def getData(self, attr, xtra=False, method=False, forgiving=True, sorted=False): """Get data from children attributes, methods and xtra dicts as a list. If is ``True`` forgiving remove ``None`` values from the output. ``Nones`` are place-holders if a child does not have the requested data. If xtra is True the xtra dictionary (``xtra``) will be searched, if method is ``True`` the child attribute will be called.""" values = self.sortedvalues() if sorted else self.values() if xtra: # looking inside the xtra of children data = [child.xtra.get(attr) for child in values] # could get None else: # looking at attributes data = [] for child in values: try: if not method: data.append(getattr(child, attr)) else: data.append(getattr(child, attr)()) except AttributeError: # data.append(None) if forgiving: # remove Nones data = [point for point in data if point is not None] return data def propagateData(self, function, level, attr, **kwargs): """Propagate data from child level to this ``Entity`` instance. The function defines how children data should be transformed to become the parents data e.g. summed.""" if self.index <= HIERARCHY.index(level) - 2: for child in self.itervalues(): child.propagateData(function, level, attr, **kwargs) datas = self.getData(attr, **kwargs) if isinstance(function, basestring): function = eval(function) transformed_datas = function(datas) if kwargs.get('xtra'): self.xtra[attr] = transformed_datas else: setattr(self, attr, transformed_datas) return transformed_datas def countChildren(self, *args, **kwargs): """Count children based on ``getData``. Additional arguments and keyworded arguments are passed to the ``getData`` method.""" data = self.getData(*args, **kwargs) children = defaultdict(int) # by default returns 0 for d in data: children[d] += 1 return children def freqChildren(self, *args, **kwargs): """Frequency of children based on ``countChildren``. Additional arguments and keyworded arguments are passed to the ``countChildren`` method.""" children_count = self.countChildren(*args, **kwargs) lenght = float(len(self)) # it could be len(children_count)? for (key_, value_) in children_count.iteritems(): children_count[key_] = value_ / lenght return children_count def splitChildren(self, *args, **kwargs): """Splits children into groups children based on ``getData``. Additional arguments and keyworded arguments are passed to the ``getData`` method.""" kwargs['forgiving'] = False data = self.getData(*args, **kwargs) clusters = defaultdict(dict) # by default returns {} for (key, (id_, child)) in izip(data, self.iteritems()): clusters[key].update({id_:child}) return clusters def selectChildren(self, value, operator, *args, **kwargs): """Generic method to select children, based on ``getData``. Returns a dictionary of children indexed by ids. Compares the data item for each child using the operator name e.g. "eq" and a value e.g. "H_HOH". Additional arguments and keyworded arguments are passed to the ``getData`` method.""" kwargs['forgiving'] = False data = self.getData(*args, **kwargs) children = {} for (got, (id_, child)) in izip(data, self.iteritems()): if isinstance(operator, basestring): operator = eval(operator) if operator(value, got): children.update({id_:child}) return children def ornamentChildren(self, *args, **kwargs): """Return a list of (ornament, (id, child)) tuples, based on ``getData``. Useful for sorting see: Schwartzian transform. Forgiving is set False. Additional arguments and keyworded arguments are passed to the ``getData`` method.""" kwargs['forgiving'] = False data = self.getData(*args, **kwargs) children = [] for (got, (id_, child)) in izip(data, self.iteritems()): children.append((got, (id_, child))) return children def ornamentdictChildren(self, *args, **kwargs): """Return a dictionary of ornaments indexed by child ids, based on ``getData``. Forgiving is set False. Additional arguments and keyworded arguments are passed to the ``getData`` method.""" kwargs['forgiving'] = False data = self.getData(*args, **kwargs) propertydict = {} for (got, id_) in izip(data, self.iterkeys()): propertydict.update(((id_, got),)) return propertydict def stripChildren(self, *args, **kwargs): """Strips children based on selection criteria. See: ``selectChildren``. Additional arguments and keyworded arguments are passed to the ``selectChildren`` method.""" children_ids = self.selectChildren(*args, **kwargs).keys() for id_ in children_ids: self.delChild(id_) def maskChildren(self, *args, **kwargs): """Mask children based on selection criteria. See: ``selectChildren``. Additional arguments and keyworded arguments are passed to the ``selectChildren`` method.""" children = self.selectChildren(*args, **kwargs).itervalues() for child in children: child.setMasked() # child.setModified child.parent.setModified def unmaskChildren(self, *args, **kwargs): """Unmask children based on selection criteria. See: ``selectChildren``. Additional arguments and keyworded arguments are passed to the ``selectChildren`` method.""" children = self.selectChildren(*args, **kwargs).itervalues() for child in children: child.setUnmasked() # child.setModified child.parent.setModified def moveRecursively(self, origin): """Move ``Entity`` instance recursively to the origin.""" for child in self.itervalues(): try: child.moveRecursively(origin) except: # Atoms do not have this child.move(origin) pass self.setCoords() def setCoordsRecursively(self): """Set coordinates (``coords``) recursively. Useful if any child had its coordinates changed.""" for child in self.itervalues(): try: child.setCoordsRecursively() except: #Atoms do not have this pass self.setCoords() def setCoords(self, *args, **kwargs): """Set coordinates (``coords``) as a centroid of children coordinates. A subset of children can be selected for the calculation. See: ``Entity.selectChildren``. Additional arguments and keyworded arguments are passed to the ``getData`` method.""" # select only some children if args or kwargs: children = self.selectChildren(*args, **kwargs).values() else: children = self coords = [] for child in children: coords.append(child.getCoords()) self.coords = mean(coords, axis=0) def getCoords(self): """Returns the current coordinates (``coords``). Raises an ``AttributeError`` if not set.""" try: return self.coords except AttributeError: raise AttributeError, "Entity has coordinates not set." def dispatch(self, method, *args, **kwargs): """Calls a method of all children with given arguments and keyworded arguments.""" for child in self.itervalues(): getattr(child, method)(*args, **kwargs) class Structure(MultiEntity): """The ``Structure`` instance contains ``Model`` instances.""" def __init__(self, id, *args, **kwargs): self.level = 'S' MultiEntity.__init__(self, id, *args, **kwargs) def __repr__(self): return '<Structure id=%s>' % self.getId() def removeAltmodels(self): """Remove all models with an id != 0""" self.stripChildren((0,), 'ne', 'id', forgiving=False) def getDict(self): """See: ``Entity.getDict``.""" return {'structure':self.getId()[0]} class Model(MultiEntity): """The ``Model`` instance contains ``Chain`` instances.""" def __init__(self, id, *args, **kwargs): self.level = 'M' MultiEntity.__init__(self, id, *args, **kwargs) def __repr__(self): return "<Model id=%s>" % self.getId() def getDict(self): """See: ``Entity.getDict``.""" try: from_parent = self.parent.getDict() except AttributeError: # we are allowed to silence this becaus a structure id is not # required to write a proper pdb line. from_parent = {} from_parent.update({'model':self.getId()[0]}) return from_parent class Chain(MultiEntity): """The ``Chain`` instance contains ``Residue`` instances.""" def __init__(self, id, *args, **kwargs): self.level = 'C' MultiEntity.__init__(self, id, *args, **kwargs) def __repr__(self): return "<Chain id=%s>" % self.getId() def removeHetero(self): """Remove residues with the hetero flag.""" self.stripChildren('H', 'eq', 'h_flag', forgiving=False) def removeWater(self): """Remove water residues.""" self.stripChildren('H_HOH', 'eq', 'name', forgiving=False) def residueCount(self): """Count residues based on ``name``.""" return self.countChildren('name') def residueFreq(self): """Calculate residue frequency (based on ``name``).""" return self.freqChildren('name') def getSeq(self, moltype ='PROTEIN'): """Returns a Sequence object from the ordered residues. The "seq_type" determines allowed residue names.""" if moltype == 'PROTEIN': valid_names = AA_NAMES moltype = cogent.PROTEIN elif moltype == 'DNA': raise NotImplementedError('The sequence type: %s is not implemented' % moltype) elif moltype == 'RNA': raise NotImplementedError('The sequence type: %s is not implemented' % moltype) else: raise ValueError('The \'seq_type\' is not supported.') aa = ResidueHolder('aa', self.selectChildren(valid_names, contains, 'name')) aa_noic = ResidueHolder('noic', aa.selectChildren(' ', eq, 'res_ic')) raw_seq = [] full_ids = [] for res in aa_noic.sortedvalues(): raw_seq.append(AA_NAMES_3to1[res.name]) full_ids.append(res.getFull_id()[1:]) raw_seq = "".join(raw_seq) seq = cogent.Sequence(moltype, raw_seq, self.getName()) seq.addAnnotation(SimpleVariable, 'entity_id', 'S_id', full_ids) return seq def getDict(self): """See: ``Entity.getDict``.""" from_parent = self.parent.getDict() from_parent.update({'chain_id':self.getId()[0]}) return from_parent class Residue(MultiEntity): """The ``Residue`` instance contains ``Atom`` instances.""" def __init__(self, res_long_id, h_flag, seg_id, *args, **kwargs): self.level = 'R' self.seg_id = seg_id self.h_flag = h_flag self.res_id = res_long_id[1] #ID number self.res_ic = res_long_id[2] #ID long NAME MultiEntity.__init__(self, res_long_id, res_long_id[0], *args, **kwargs) def __repr__(self): res_name, res_id, res_ic = self.getId()[0] full_name = (res_name, res_id, res_ic) return "<Residue %s resseq=%s icode=%s>" % full_name def _getId(self): """Return the residue full id. ``(name, res_id, res_ic)``.""" return ((self.name, self.res_id, self.res_ic),) def _setId(self, id): """Set the residue id ``res_id``, name ``name`` and insertion code ``res_ic`` from a full id.""" (self.name, self.res_id, self.res_ic) = id[0] def removeHydrogens(self): """Remove hydrogen atoms.""" self.stripChildren(' H', 'eq', 'element', forgiving=False) def getSeg_id(self): """Return the segment id.""" return self.seg_id def setSeg_id(self, seg_id): """Set the segment id. This does not change the id.""" self.seg_id = seg_id def getIc(self): """Return the insertion code.""" return self.res_ic def setIc(self, res_ic): """Set the insertion code.""" self.res_ic = res_ic self.setId() def getRes_id(self): """Get the id.""" return self.res_id def setRes_id(self, res_id): """Set the id.""" self.res_id = res_id self.setId() def getH_flag(self): """Return the hetero flag.""" return self.h_flag def setH_flag(self, h_flag): """Sets the hetero flag. A valid flag is ' ' or 'H'. If 'H' the flag becomes part of the residue name i.e. H_XXX.""" if not h_flag in (' ', 'H'): raise AttributeError, "Only ' ' and 'H' hetero flags allowed." if len(self.name) == 3: self.name = "%s_%s" % (h_flag, self.name) elif len(self.name) == 5: self.name = "%s_%s" % (h_flag, self.name[2:]) else: raise ValueError, 'Non-standard residue name' self.h_flag = h_flag self.setId() def getDict(self): """See: ``Entity.getDict``.""" from_parent = self.parent.getDict() if self.h_flag != ' ': at_type = 'HETATM' else: at_type = 'ATOM ' from_parent.update({'at_type': at_type, 'h_flag': self.h_flag, 'res_name': self.name, 'res_long_id': self.getId()[0], 'res_id': self.res_id, 'res_ic': self.res_ic, 'seg_id': self.seg_id, }) return from_parent class Atom(Entity): """The ``Atom`` class contains no children.""" def __init__(self, at_long_id, at_name, ser_num, coords, occupancy, bfactor, element): self.level = 'A' self.index = HIERARCHY.index(self.level) self.coords = coords self.bfactor = bfactor self.occupancy = occupancy self.ser_num = ser_num self.at_id = at_long_id[0] self.alt_loc = at_long_id[1] self.table = dict([(level, {}) for level in HIERARCHY[self.index + 1:]]) self.element = element Entity.__init__(self, at_long_id, at_name) def __nonzero__(self): return bool(self.id) def __repr__(self): return "<Atom %s>" % self.getId() def _getId(self): """Return the full id. The id of an atom is not its ' XX ' name but this string after left/right spaces striping. The full id is ``(at_id, alt_loc)``.""" return ((self.at_id, self.alt_loc),) def _setId(self, id): """Set the atom id ``at_id`` and alternate location ``alt_loc`` from a full id. See: ``_getId``.""" (self.at_id, self.alt_loc) = id[0] def setElement(self, element): """Set the atom element ``element``.""" self.element = element def setName(self, name): """Set name and update the id.""" self.name = name self.setAt_id(name.strip()) def setAt_id(self, at_id): """Set id. An atom id should be derived from the atom name. See: ``_getId``.""" self.at_id = at_id self.setId() def setAlt_loc(self, alt_loc): """Set alternate location identifier.""" self.alt_loc = alt_loc self.setId() def setSer_num(self, n): """Set serial number.""" self.ser_num = n def setBfactor(self, bfactor): """Set B-factor.""" self.bfactor = bfactor def setOccupancy(self, occupancy): """Set occupancy.""" self.occupancy = occupancy def setRadius(self, radius=None, radius_type=AREAIMOL_VDW_RADII, \ default_radius=DEFAULT_AREAIMOL_VDW_RADIUS): """Set radius, defaults to the AreaIMol VdW radius.""" if radius: self.radius = radius else: try: self.radius = radius_type[(self.parent.name, self.name)] except KeyError: self.radius = default_radius def getSer_num(self): """Return the serial number.""" return self.ser_num def getBfactor(self): """Return the B-factor.""" return self.bfactor def getOccupancy(self): """Return the occupancy.""" return self.occupancy def getRadius(self): """Return the radius.""" return self.radius def getDict(self): """See: ``Entity.getDict``.""" from_parent = self.parent.getDict() from_parent.update({'at_name': self.name, 'ser_num': self.ser_num, 'coords': self.coords, 'occupancy': self.occupancy, 'bfactor': self.bfactor, 'alt_loc': self.alt_loc, 'at_long_id': self.getId()[0], 'at_id': self.at_id, 'element': self.element}) return from_parent class Holder(MultiEntity): """The ``Holder`` instance exists outside the SMCRA hierarchy. Elements in a ``Holder`` instance are indexed by the full id.""" def __init__(self, name, *args): if not hasattr(self, 'level'): self.level = name MultiEntity.__init__(self, name, name, *args) def __repr__(self): return '<Holder level=%s name=%s>' % (self.level, self.getName()) def addChild(self, child): """Add a child.""" child_id = child.getFull_id() self[child_id] = child def delChild(self, child_id): """Remove a child.""" self.pop(child_id) def updateIds(self): """Update self with children long ids.""" ids = [] for (id_, child) in self.iteritems(): new_id = child.getFull_id() if id_ != new_id: ids.append((id_, new_id)) for (old_id, new_id) in ids: child = self.pop(old_id) self.update(((new_id, child),)) class StructureHolder(Holder): """The ``StructureHolder`` contains ``Structure`` instances. See: ``Holder``.""" def __init__(self, *args): self.level = 'H' Holder.__init__(self, *args) def __repr__(self): return "<StructureHolder name=%s>" % self.getName() class ModelHolder(Holder): """The ``ModelHolder`` contains ``Model`` instances. See: ``Holder``.""" def __init__(self, *args): self.level = 'S' Holder.__init__(self, *args) def __repr__(self): return "<ModelHolder name=%s>" % self.getName() class ChainHolder(Holder): """The ``ChainHolder`` contains ``Chain`` instances. See: ``Holder``.""" def __init__(self, *args): self.level = 'M' Holder.__init__(self, *args) def __repr__(self): return "<ChainHolder name=%s>" % self.getName() class ResidueHolder(Holder): """The ``ResidueHolder`` contains ``Residue`` instances. See: ``Holder``.""" def __init__(self, *args): self.level = 'C' Holder.__init__(self, *args) def __repr__(self): return "<ResidueHolder name=%s>" % self.getName() class AtomHolder(Holder): """The ``AtomHolder`` contains ``Atom`` instances. See: ``Holder``.""" def __init__(self, *args): self.level = 'R' Holder.__init__(self, *args) def __repr__(self): return "<AtomHolder name=%s>" % self.getName() class StructureBuilder(object): """Constructs a ``Structure`` object. The ``StructureBuilder`` class is used by a parser class to parse a file into a ``Structure`` object. An instance of a ``StructureBuilder`` has methods to create ``Entity`` instances and add them into the SMCRA hierarchy``.""" def __init__(self): self.structure = None def initStructure(self, structure_id): """Initialize a ``Structure`` instance.""" self.structure = Structure(structure_id) def initModel(self, model_id): """Initialize a ``Model`` instance and add it as a child to the ``Structure`` instance. If a model is defined twice a ``ConstructionError`` is raised.""" if not (model_id,) in self.structure: self.model = Model(model_id) self.model.junk = AtomHolder('junk') self.structure._initChild(self.model) else: raise ConstructionError def initChain(self, chain_id): """Initialize a ``Chain`` instance and add it as a child to the ``Model`` instance. If a chain is defined twice a ``ConstructionWarning`` is raised. This means that the model is not continuous.""" if not (chain_id,) in self.model: self.chain = Chain(chain_id) self.model._initChild(self.chain) else: self.chain = self.model[(chain_id,)] raise ConstructionWarning, "Chain %s is not continous" % chain_id def initSeg(self, seg_id): """Does not create an ``Entity`` instance, but updates the segment id, ``seg_id`` which is used to initialize ``Residue`` instances.""" self.seg_id = seg_id def initResidue(self, res_long_id, res_name): """Initialize a ``Residue`` instance and add it as a child to the ``Chain`` instance. If a residue is defined twice a ``ConstructionWarning`` is raised. This means that the chain is not continuous.""" if not (res_long_id,) in self.chain: self.residue = Residue(res_long_id, res_name, self.seg_id) self.chain._initChild(self.residue) else: self.residue = self.chain[(res_long_id,)] raise ConstructionWarning, "Residue %s%s%s is not continuous" % \ res_long_id def initAtom(self, at_long_id, at_name, ser_num, coord, occupancy, \ bfactor, element): """Initialize an ``Atom`` instance and add is as child to the ``Residue`` instance. If an atom is defined twice a ``ConstructionError`` is raised and the ``Atom`` instance is added to the ``structure.model.junk`` ``Holder`` instance.""" if not (at_long_id,) in self.residue: self.atom = Atom(at_long_id, at_name, ser_num, coord, occupancy, \ bfactor, element) self.residue._initChild(self.atom) else: full_id = (tuple(self.residue[(at_long_id,)].getFull_id()), \ ser_num) self.model.junk._initChild(Atom(full_id, at_name, ser_num, coord, \ occupancy, bfactor, element)) raise ConstructionError, 'Atom %s%s is defined twice.' % at_long_id def getStructure(self): """Update coordinates (``coords``), set the children-table (``table``) and return the ``Structure`` instance.""" self.structure.setTable() self.structure.setCoordsRecursively() return self.structure
2.53125
3
venv/lib/python3.9/site-packages/ajsonrpc/tests/test_dispatcher.py
janten/ESP32-Paxcounter
12
16543
import unittest from ..dispatcher import Dispatcher class Math: @staticmethod def sum(a, b): return a + b @classmethod def diff(cls, a, b): return a - b def mul(self, a, b): return a * b class TestDispatcher(unittest.TestCase): def test_empty(self): self.assertEqual(len(Dispatcher()), 0) def test_add_function(self): d = Dispatcher() @d.add_function def one(): return 1 def two(): return 2 d.add_function(two) d.add_function(two, name="two_alias") self.assertIn("one", d) self.assertEqual(d["one"](), 1) self.assertIsNotNone(one) # do not remove function from the scope self.assertIn("two", d) self.assertIn("two_alias", d) def test_class(self): d1 = Dispatcher() d1.add_class(Math) self.assertIn("math.sum", d1) self.assertIn("math.diff", d1) self.assertIn("math.mul", d1) self.assertEqual(d1["math.sum"](3, 8), 11) self.assertEqual(d1["math.diff"](6, 9), -3) self.assertEqual(d1["math.mul"](2, 3), 6) d2 = Dispatcher(Math) self.assertNotIn("__class__", d2) self.assertEqual(d1.keys(), d2.keys()) for method in ["math.sum", "math.diff"]: self.assertEqual(d1[method], d2[method]) def test_class_prefix(self): d = Dispatcher(Math, prefix="") self.assertIn("sum", d) self.assertNotIn("math.sum", d) def test_object(self): math = Math() d1 = Dispatcher() d1.add_object(math) self.assertIn("math.sum", d1) self.assertIn("math.diff", d1) self.assertEqual(d1["math.sum"](3, 8), 11) self.assertEqual(d1["math.diff"](6, 9), -3) d2 = Dispatcher(math) self.assertNotIn("__class__", d2) self.assertEqual(d1, d2) def test_object_prefix(self): d = Dispatcher(Math(), prefix="") self.assertIn("sum", d) self.assertNotIn("math.sum", d) def test_add_dict(self): d = Dispatcher() d.add_prototype({"sum": lambda *args: sum(args)}, "util.") self.assertIn("util.sum", d) self.assertEqual(d["util.sum"](13, -2), 11) def test_init_from_dict(self): d = Dispatcher({ "one": lambda: 1, "two": lambda: 2, }) self.assertIn("one", d) self.assertIn("two", d) def test_del_method(self): d = Dispatcher() d["method"] = lambda: "" self.assertIn("method", d) del d["method"] self.assertNotIn("method", d) def test_to_dict(self): d = Dispatcher() def func(): return "" d["method"] = func self.assertEqual(dict(d), {"method": func}) def test__getattr_function(self): # class self.assertEqual(Dispatcher._getattr_function(Math, "sum")(3, 2), 5) self.assertEqual(Dispatcher._getattr_function(Math, "diff")(3, 2), 1) self.assertEqual(Dispatcher._getattr_function(Math, "mul")(3, 2), 6) # object self.assertEqual(Dispatcher._getattr_function(Math(), "sum")(3, 2), 5) self.assertEqual(Dispatcher._getattr_function(Math(), "diff")(3, 2), 1) self.assertEqual(Dispatcher._getattr_function(Math(), "mul")(3, 2), 6)
3.28125
3
mesh.py
msellens/pms
0
16544
from itertools import product import struct import pickle import numpy as np from scipy import sparse from scipy import isnan as scipy_isnan import numpy.matlib ASCII_FACET = """facet normal 0 0 0 outer loop vertex {face[0][0]:.4f} {face[0][1]:.4f} {face[0][2]:.4f} vertex {face[1][0]:.4f} {face[1][1]:.4f} {face[1][2]:.4f} vertex {face[2][0]:.4f} {face[2][1]:.4f} {face[2][2]:.4f} endloop endfacet """ BINARY_HEADER ="80sI" BINARY_FACET = "12fH" class ASCII_STL_Writer(object): """ Export 3D objects build of 3 or 4 vertices as ASCII STL file. """ def __init__(self, stream): self.fp = stream self._write_header() def _write_header(self): self.fp.write("solid python\n") def close(self): self.fp.write("endsolid python\n") def _write(self, face): self.fp.write(ASCII_FACET.format(face=face)) def _split(self, face): p1, p2, p3, p4 = face return (p1, p2, p3), (p3, p4, p1) def add_face(self, face): """ Add one face with 3 or 4 vertices. """ if len(face) == 4: face1, face2 = self._split(face) self._write(face1) self._write(face2) elif len(face) == 3: self._write(face) else: raise ValueError('only 3 or 4 vertices for each face') def add_faces(self, faces): """ Add many faces. """ for face in faces: self.add_face(face) class Binary_STL_Writer(ASCII_STL_Writer): """ Export 3D objects build of 3 or 4 vertices as binary STL file. """ def __init__(self, stream): self.counter = 0 super(Binary_STL_Writer, self).__init__(stream) def close(self): self._write_header() def _write_header(self): self.fp.seek(0) self.fp.write(struct.pack(BINARY_HEADER, b'Python Binary STL Writer', self.counter)) def _write(self, face): self.counter += 1 data = [ 0., 0., 0., face[0][0], face[0][1], face[0][2], face[1][0], face[1][1], face[1][2], face[2][0], face[2][1], face[2][2], 0 ] self.fp.write(struct.pack(BINARY_FACET, *data)) def get_quad(center, n, side=1.): x, y, z = np.array(center).astype('float64') n1, n2, n3 = np.array(n).astype('float64') l = side/2. nm = np.linalg.norm s = np.sign if any(np.isnan(v) for v in n): return if np.allclose(n, np.zeros(n.shape)): return # Build two vectors orthogonal between themselves and the normal if (np.abs(n2) > 0.2 or np.abs(n3) > 0.2): C = np.array([1, 0, 0]) else: C = np.array([0, 1, 0]) ortho1 = np.cross(n, C) ortho1 *= l / np.linalg.norm(ortho1) ortho2 = np.cross(n, ortho1) ortho2 *= l / np.linalg.norm(ortho2) #ortho1[[2,1]] = ortho1[[1,2]] #ortho2[[2,1]] = ortho2[[1,2]] ortho1[1] = -ortho1[1] ortho2[1] = -ortho2[1] return [[ center + ortho1, center + ortho2, center - ortho1, center - ortho2, ]] def surfaceFromNormals(normals): valid_indices = ~np.isnan(normals) w, h, d = normals.shape nx = np.transpose(np.hstack(( normals[:,:,0].ravel(), normals[:,:,0].ravel(), ))) ny = np.transpose(np.hstack(( normals[:,:,1].ravel(), normals[:,:,1].ravel(), ))) nz = np.transpose(np.hstack(( normals[:,:,2].ravel(), normals[:,:,2].ravel(), ))) vectorsize = nz.shape valid_idx = ~np.isnan(nz) M = sparse.dia_matrix((2*w*h, w*h), dtype=np.float64) # n_z z(x + 1, y) - n_z z(x,y) = n_x M.setdiag(-nz, 0) M.setdiag(nz, 1) # n_z z(x, y + 1) - n_z z(x,y) = n_y M.setdiag(-nz, -w*h) M.setdiag(np.hstack(([0] * w, nz)), -w*h + w) # Boundary values # n_y ( z(x,y) - z(x + 1, y)) = n_x ( z(x,y) - z(x, y + 1)) # TODO: Redo for boundaries in Y-axis M = M.tolil() half_size = valid_idx.size // 2 bidxd = np.hstack((np.diff(valid_idx.astype('int8')[:half_size]), [0])) inner_boundaries = np.roll(bidxd==1, 1) | (bidxd==-1) outer_boundaries = (bidxd==1) | (np.roll(bidxd==-1, 1)) nz_t = np.transpose(valid_idx.reshape((w,h,d*2//3)), (1, 0, 2)).ravel() valid_idx_t = ~np.isnan(nz_t) bidxd = np.hstack((np.diff(valid_idx_t.astype('int8')[:half_size]), [0])) inner_boundaries |= np.roll(bidxd==1, 1) | (bidxd==-1) outer_boundaries |= (bidxd==1) | (np.roll(bidxd==-1, 1)) bidx = np.zeros((half_size,), dtype=np.bool) bidx[inner_boundaries] = True bidx = np.indices(bidx.shape)[0][bidx] M[bidx, bidx] = nx[bidx] M[bidx, bidx + w] = -nx[bidx] M[bidx + half_size, bidx] = ny[bidx] M[bidx + half_size, bidx + 1] = -ny[bidx] M = M.tocsr()[valid_idx] weight = 1 OB = np.zeros((outer_boundaries.sum(), w*h,)) OB[np.indices((outer_boundaries.sum(),))[0], np.where(outer_boundaries==True)] = weight M = sparse.vstack((M,OB)) # Build [ n_x n_y ]' m = np.hstack(( normals[:,:,0].ravel(), normals[:,:,1].ravel(), )).reshape(-1, 1) print(inner_boundaries.shape, m.shape) i_b = np.hstack((inner_boundaries, inner_boundaries)).reshape(-1,1) print(i_b.shape, m.shape) m[i_b] = 0 m = m[valid_idx] m = np.vstack(( m, np.zeros((outer_boundaries.sum(), 1)), )) # Solve least squares assert not np.isnan(m).any() # x, istop, itn, r1norm, r2norm, anorm, acond, arnorm, xnorm, var = sparse.linalg.lsqr(M, m) x, istop, itn, normr, normar, norma, conda, normx = sparse.linalg.lsmr(M, m) # Build the surface (x, y, z) with the computed values of z surface = np.dstack(( np.indices((w, h))[0], np.indices((w, h))[1], x.reshape((w, h)) )) return surface def writeMesh(surface, normals, filename): s = surface with open(filename, 'wb') as fp: writer = Binary_STL_Writer(fp) for x in range(0, s.shape[0], 5): for y in range(0, s.shape[1], 5): #for x, y in product(range(s.shape[0]), range(s.shape[1])): quad = get_quad( s[x,y,:], normals[x,y,:], 4, ) if quad: writer.add_faces(quad) writer.close() def write3dNormals(normals, filename): with open(filename, 'wb') as fp: writer = Binary_STL_Writer(fp) for x in range(0, normals.shape[0], 5): for y in range(0, normals.shape[1], 5): quad = get_quad( (0, x, y), normals[x,y,:], 4, ) if quad: writer.add_faces(quad) writer.close() def surfaceToHeight(surface): minH = np.amin(surface[:,:,2]) maxH = np.amax(surface[:,:,2]) scale = maxH - minH height = (surface[:,:,2] - minH) / scale return height def writeObj(surface, normals, filename): print('obj here') if __name__ == '__main__': with open('data.pkl', 'rb') as fhdl: normals = pickle.load(fhdl) writeMesh(normals)
2.53125
3
vaccine.py
brannbrann/findavaccinesms
0
16545
''' This is a python script that requires you have python installed, or in a cloud environment. This script scrapes the CVS website looking for vaccine appointments in the cities you list. To update for your area, update the locations commented below. If you receive an error that says something is not installed, type pip install requests etc. Happy vaccination! ''' import requests import time import smtplib from email.mime.multipart import MIMEMultipart from email.mime.text import MIMEText from datetime import datetime, timedelta def send(message, thetime, state): carriers = { 'att': '@mms.att.net', 'tmobile': '@tmomail.net', 'verizon': '@vtext.com', 'sprint': '@page.nextel.com', 'gmail': '@gmail.com' } # Replace the receivernumber, senderaddr, and senderpass with your own # Consider using a list for multiple recievers. # To use gmail, you need to allow less secure apps to connect # Also, probably a good idea to set up a burner gmail for the sending to_number = f"RECEIVERADDR{carriers['tmobile']}" # ", ".join() for multiple sender = f"SENDERADDR{carriers['gmail']}" password = '<PASSWORD>' subject = f"CVS Availability in {state}" # prepend thetime message.insert(0, thetime.strftime("%m/%d/%Y, %H:%M %p")) # append the link if len(message) == 1: message.append('No new appointments available.') else: message.append('https://www.cvs.com/vaccine/intake/store/covid-screener/covid-qns') port = 587 # 587 for starttls, 465 for SSL and use ssl smtp_server = "smtp.gmail.com" msg_body = ", ".join(message) msg = MIMEMultipart('alternative') msg['From'] = sender msg['To'] = to_number msg['subject'] = subject part = MIMEText(msg_body, 'plain', 'UTF-8') msg.attach(part) # Establish a secure session with gmail's outgoing SMTP server using your gmail account server = smtplib.SMTP( smtp_server, port ) server.starttls() server.login(sender, password) # Send text message through SMS gateway of destination number server.sendmail( sender, to_number, msg.as_string()) server.quit() def findAVaccine(): timer = 3600 init_time = datetime.now() hours_to_run = 24 ###Update this to set the number of hours you want the script to run. max_time = init_time + timedelta(hours=hours_to_run) state = 'CA' ###Update with your state abbreviation. Be sure to use all CAPS, e.g. RI cvs_url = f"https://www.cvs.com/immunizations/covid-19-vaccine.vaccine-status.{state.lower()}.json?vaccineinfo" header = "https://www.cvs.com/immunizations/covid-19-vaccine" ###Update with your cities nearby cities = ['ALAMEDA', 'ALAMO', 'ALBANY', 'ANTIOCH', 'BERKELEY', 'CHICO', 'COLMA', 'CUPERTINO', 'DALY CITY', 'DAVIS', 'EAST PALO ALTO', 'HAYWARD', 'LAFAYETTE', 'LATHROP', 'LIVERMORE', 'LOS GATOS', 'DANVILLE', 'DIXON', 'DUBLIN', 'EL CERRITO', 'ELK GROVE', 'EMERYVILLE' 'FAIRFIELD', 'FREMONT', 'MENLO PARK', 'SAN FRANCISCO', 'OAKLAND', 'WOODLAND', 'SACRAMENTO', 'STOCKTON', 'VACAVILLE', 'VALLEJO', 'WALNUT CREEK', 'MILL VALLEY', 'MORAGA', 'NEWARK', 'NOVATO', 'ORINDA', 'PITTSBURG', 'PINOLE', 'PLEASANT HILL', 'REDWOOD CITY', 'RICHMOND', '<NAME>', '<NAME>', '<NAME>', '<NAME>', '<NAME>', '<NAME>', '<NAME>', 'SAUSALITO', 'SARATOGA' ] previousmessage = [] while datetime.now() < max_time: thetime = datetime.now() message = [] response = requests.get(cvs_url, headers={"Referer":header}) payload = response.json() print(thetime) for item in payload["responsePayloadData"]["data"][state]: city = item.get('city') status = item.get('status') if (city in cities) and (status == 'Available'): message.append(f"{city}, {state} -- {status}") print(f"{city}, {state} -- {status}") print() # Decouple the checking to sending alerts # if no change for an hour, just send a message that there's no change if (message != previousmessage) or ((thetime - init_time).total_seconds() > timer): # set previous to this new one previousmessage = message[:] # reset the timer init_time = datetime.now() # send the email! print('Sending status update...') send(message, thetime, state) # This runs every 300 seconds (5 minutes) # Email will be sent every hour, or when a change is detected time.sleep(300) if __name__ == '__main__': try: findAVaccine() except KeyboardInterrupt: print('Exiting...')
2.859375
3
pefile/__init__.py
0x1F9F1/binja-msvc
9
16546
<reponame>0x1F9F1/binja-msvc from .pefile import *
0.953125
1
examples/viewer3DVolume.py
vincefn/silx
0
16547
<gh_stars>0 # coding: utf-8 # /*########################################################################## # # Copyright (c) 2016-2017 European Synchrotron Radiation Facility # # Permission is hereby granted, free of charge, to any person obtaining a copy # of this software and associated documentation files (the "Software"), to deal # in the Software without restriction, including without limitation the rights # to use, copy, modify, merge, publish, distribute, sublicense, and/or sell # copies of the Software, and to permit persons to whom the Software is # furnished to do so, subject to the following conditions: # # The above copyright notice and this permission notice shall be included in # all copies or substantial portions of the Software. # # THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR # IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, # FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE # AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER # LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, # OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN # THE SOFTWARE. # # ###########################################################################*/ """This script illustrates the use of :class:`silx.gui.plot3d.ScalarFieldView`. It loads a 3D scalar data set from a file and displays iso-surfaces and an interactive cutting plane. It can also be started without providing a file. """ from __future__ import absolute_import, division, unicode_literals __authors__ = ["<NAME>"] __license__ = "MIT" __date__ = "05/01/2017" import argparse import logging import os.path import sys import numpy from silx.gui import qt from silx.gui.plot3d.ScalarFieldView import ScalarFieldView from silx.gui.plot3d import SFViewParamTree logging.basicConfig() _logger = logging.getLogger(__name__) import h5py def load(filename): """Load 3D scalar field from file. It supports 3D stack HDF5 files and numpy files. :param str filename: Name of the file to open and path in file for hdf5 file :return: numpy.ndarray with 3 dimensions. """ if not os.path.isfile(filename.split('::')[0]): raise IOError('No input file: %s' % filename) if h5py.is_hdf5(filename.split('::')[0]): if '::' not in filename: raise ValueError( 'HDF5 path not provided: Use <filename>::<path> format') filename, path = filename.split('::') path, indices = path.split('#')[0], path.split('#')[1:] with h5py.File(filename) as f: data = f[path] # Loop through indices along first dimensions for index in indices: data = data[int(index)] data = numpy.array(data, order='C', dtype='float32') else: # Try with numpy try: data = numpy.load(filename) except IOError: raise IOError('Unsupported file format: %s' % filename) if data.ndim != 3: raise RuntimeError( 'Unsupported data set dimensions, only supports 3D datasets') return data def default_isolevel(data): """Compute a default isosurface level: mean + 1 std :param numpy.ndarray data: The data to process :rtype: float """ data = data[numpy.isfinite(data)] if len(data) == 0: return 0 else: return numpy.mean(data) + numpy.std(data) # Parse input arguments parser = argparse.ArgumentParser( description=__doc__) parser.add_argument( '-l', '--level', nargs='?', type=float, default=float('nan'), help="The value at which to generate the iso-surface") parser.add_argument( '-sx', '--xscale', nargs='?', type=float, default=1., help="The scale of the data on the X axis") parser.add_argument( '-sy', '--yscale', nargs='?', type=float, default=1., help="The scale of the data on the Y axis") parser.add_argument( '-sz', '--zscale', nargs='?', type=float, default=1., help="The scale of the data on the Z axis") parser.add_argument( '-ox', '--xoffset', nargs='?', type=float, default=0., help="The offset of the data on the X axis") parser.add_argument( '-oy', '--yoffset', nargs='?', type=float, default=0., help="The offset of the data on the Y axis") parser.add_argument( '-oz', '--zoffset', nargs='?', type=float, default=0., help="The offset of the data on the Z axis") parser.add_argument( 'filename', nargs='?', default=None, help="""Filename to open. It supports 3D volume saved as .npy or in .h5 files. It also support nD data set (n>=3) stored in a HDF5 file. For HDF5, provide the filename and path as: <filename>::<path_in_file>. If the data set has more than 3 dimensions, it is possible to choose a 3D data set as a subset by providing the indices along the first n-3 dimensions with '#': <filename>::<path_in_file>#<1st_dim_index>...#<n-3th_dim_index> E.g.: data.h5::/data_5D#1#1 """) args = parser.parse_args(args=sys.argv[1:]) # Start GUI app = qt.QApplication([]) # Create the viewer main window window = ScalarFieldView() # Create a parameter tree for the scalar field view treeView = SFViewParamTree.TreeView(window) treeView.setSfView(window) # Attach the parameter tree to the view # Add the parameter tree to the main window in a dock widget dock = qt.QDockWidget() dock.setWindowTitle('Parameters') dock.setWidget(treeView) window.addDockWidget(qt.Qt.RightDockWidgetArea, dock) # Load data from file if args.filename is not None: data = load(args.filename) _logger.info('Data:\n\tShape: %s\n\tRange: [%f, %f]', str(data.shape), data.min(), data.max()) else: # Create dummy data _logger.warning('Not data file provided, creating dummy data') coords = numpy.linspace(-10, 10, 64) z = coords.reshape(-1, 1, 1) y = coords.reshape(1, -1, 1) x = coords.reshape(1, 1, -1) data = numpy.sin(x * y * z) / (x * y * z) # Set ScalarFieldView data window.setData(data) # Set scale of the data window.setScale(args.xscale, args.yscale, args.zscale) # Set offset of the data window.setTranslation(args.xoffset, args.yoffset, args.zoffset) # Set axes labels window.setAxesLabels('X', 'Y', 'Z') # Add an iso-surface if not numpy.isnan(args.level): # Add an iso-surface at the given iso-level window.addIsosurface(args.level, '#FF0000FF') else: # Add an iso-surface from a function window.addIsosurface(default_isolevel, '#FF0000FF') window.show() app.exec_()
1.265625
1
solentware_misc/core/__init__.py
RogerMarsh/solentware-misc
0
16548
# __init__.py # Copyright 2017 <NAME> # Licence: See LICENCE (BSD licence) """Miscellaneous modules for applications available at solentware.co.uk. These do not belong in the solentware_base or solentware_grid packages, siblings of solentware_misc. """
0.941406
1
learn_tf/MNIST.py
pkumusic/AI
1
16549
__author__ = "Music" # MNIST For ML Beginners # https://www.tensorflow.org/versions/r0.9/tutorials/mnist/beginners/index.html
1.015625
1
EXC/CW1/task7/mapper.py
easyCZ/UoE-Projects
0
16550
#!/usr/bin/python # mapper.py import sys for line in sys.stdin: row, values = line.strip().split('\t') row_values = values.split(' ') for (col, col_value) in enumerate(row_values): # out: <col> <row> <value> print("{0}\t{1}\t{2}".format(col, row, col_value))
3.03125
3
rllib/algorithms/maddpg/__init__.py
willfrey/ray
0
16551
from ray.rllib.algorithms.maddpg.maddpg import ( MADDPGConfig, MADDPGTrainer, DEFAULT_CONFIG, ) __all__ = ["MADDPGConfig", "MADDPGTrainer", "DEFAULT_CONFIG"]
1.289063
1
Fig8_RTM/RTM.py
GeoCode-polymtl/Seis_float16
0
16552
<reponame>GeoCode-polymtl/Seis_float16 #!/usr/bin/env python3 # -*- coding: utf-8 -*- """ Perform RTM on marmousi """ import os import numpy as np import h5py as h5 from scipy.ndimage.filters import gaussian_filter import sys import shutil from SeisCL import SeisCL names = ['fp32', 'fp16io', 'fp16com'] filedata = os.getcwd() + '/marmfp32' seis = SeisCL() seis.file = os.getcwd() + '/marmfp32' seis.read_csts(workdir="") seis.file = 'SeisCL' seis.file_datalist = filedata + '_din.mat' seis.file_din = filedata + '_din.mat' file = h5.File(filedata + '_model.mat', "r") models = {'vp': gaussian_filter(np.transpose(file['vp']), sigma=3), 'vs': np.transpose(file['vs']), 'rho': np.transpose(file['rho'])} file.close() """ _________________Set inversion parameters for SeisCL____________________ """ seis.csts['gradout'] = 1 # SeisCl has to output the gradient seis.csts['scalerms'] = 0 # We don't scale each trace by the rms of the data seis.csts['scalermsnorm'] = 0 # We don't scale each trave by the rms its rms seis.csts['scaleshot'] = 0 # We don't scale each shots seis.csts['back_prop_type'] = 1 seis.csts['restype'] = 1 # Migration cost function seis.csts['tmin'] = 0*(np.float(seis.csts['NT'])-2) * seis.csts['dt'] for ii, FP16 in enumerate([1, 2, 3]): """ _______________________Constants for inversion__________________________ """ filework = os.getcwd() + '/marmgrad_' + names[ii] seis.csts['FP16'] = FP16 """ _________________________Perform Migration______________________________ """ if not os.path.isfile(filework + '_gout.mat'): seis.set_forward(seis.src_pos_all[3, :], models, withgrad=True) seis.execute() shutil.copy2(seis.workdir + "/" + seis.file_gout, filework + '_gout.mat') sys.stdout.write('Gradient calculation completed \n') sys.stdout.flush()
1.8125
2
doc/default_issue/fix.py
nadavweidman/pytconf
0
16553
<reponame>nadavweidman/pytconf #!/usr/bin/python3 from typing import List from registry import the_registry from param_collector import the_collector class MetaConfig(type): """ Meta class for all configs """ def __new__(mcs, name, bases, namespace): ret = super().__new__(mcs, name, bases, namespace) i = 0 for k, v in namespace.items(): if not k.startswith("__") and not isinstance(v, classmethod): the_registry.register(ret, k, the_collector.get_item(i)) i += 1 the_collector.clear() return ret class Config(metaclass=MetaConfig): """ Base class for all configs """ class Unique: pass NO_DEFAULT = Unique() NO_DEFAULT_TYPE = type(NO_DEFAULT) def create_list_int( default=None, ) -> List[int]: if default is None: return [] return default class Foobar(Config): columns = create_list_int() for x in Foobar.columns: print(x)
2.734375
3
argonneV14.py
floresab/Toy-Models
0
16554
<reponame>floresab/Toy-Models """ File : argonneV14.py Language : Python 3.6 Created : 7/13/2018 Edited : 7/13/2018 San Digeo State University Department of Physics and Astronomy #https://journals.aps.org/prc/pdf/10.1103/PhysRevC.51.38 --argonneV18 This code implements Argonne V14 potential outlined in ... --CONSTANTS -- Hbar*c | 197.33 MeV fm pion-Mass | 138.03 MeV Wood-Saxon| R | 0.5 fm a | 0.2 fm Operator | p | Ip | Sp | Index | ----------------------------------------------------------- central | c | -4.801125 | 2061.5625 | 0 | tao dot tao | tao | 0.798925 | -477.3125 | 1 | sigma dot sigma| sigma | 1.189325 | -502.3125 | 2 | (sigma)(tao) | sigma-tao | 0.182875 | 97.0625 | 3 | Sij | t | -0.1575 | 108.75 | 4 | Sij(tao) | t-tao | -0.7525 | 297.25 | 5 | L dot S | b | 0.5625 | -719.75 | 6 | L dot S (tao) | b-tao | 0.0475 | -159.25 | 7 | L squared | q | 0.070625 | 8.625 | 8 | L^2(tao) | q-tao | -0.148125 | 5.625 | 9 | L^2(sigma | q-sigma | -0.040625 | 17.375 | 10 | L^2(sigma)(tao)| q-sigma-tao | -0.001875 | -33.625 | 11 | (L dot S)^2 | bb | -0.5425 | 391.0 | 12 | (LS)^2(tao) | bb-tao | 0.0025 | 145.0 | 13 | """ import numpy as np def Yukawa(r): #mu = mc/hbar c = 2 #1/fm^2 mu = 138.03/197.33 return np.exp(-r*mu)/(mu*r)*(1-np.exp(-c*r**2)) def Tensor(r): c = 2 #1/fm^2 mu = 138.03/197.33 return (1+3/(mu*r) + 3/(mu*r)**2)*(np.exp(-mu*r)/(mu*r))*(1-np.exp(-c*r**2))**2 def V14(r): Vst = np.array([0,0,0,1,0,0,0,0,0,0,0,0,0,0]) Vttao = np.array([0,0,0,0,0,1,0,0,0,0,0,0,0,0]) #Short Range Strengths Sp = np.array([\ 2061.5625,\ -477.3125,\ -502.3125,\ 97.0625,\ 108.75,\ 297.25,\ -719.75,\ -159.25,\ 8.625,\ 5.625,\ 17.375,\ -33.625,\ 391.0,\ 145.0]) # phenomenological Strengths Ip = np.array([\ -4.801125,\ 0.798925,\ 1.189325,\ 0.182875,\ -0.1575,\ -0.7525,\ 0.5625,\ 0.0475,\ 0.070625,\ -0.148125,\ -0.040625,\ -0.001875,\ -0.5425,\ 0.0025]) #woods-Saxon short_range = Sp*1.0/(1+np.exp((r-0.5)/.2)) # phenomenological shape phenomenological = Ip*(Tensor(r)**2) #Explcit Pion Exchange pion = 3.72681*(Vst*Yukawa(r) + Vttao*Tensor(r)) #compute V14 potential -- of indivdual operators return short_range + phenomenological + pion
1.6875
2
solutions/python3/problem1556.py
tjyiiuan/LeetCode
0
16555
# -*- coding: utf-8 -*- """ 1556. Thousand Separator Given an integer n, add a dot (".") as the thousands separator and return it in string format. Constraints: 0 <= n < 2^31 """ class Solution: def thousandSeparator(self, n: int) -> str: res = "" str_n = str(n) count = 0 ind = len(str_n) - 1 while ind >= 0: count += 1 if count == 4: res = "." + res count = 1 res = str_n[ind] + res ind -= 1 return res
3.265625
3
app/resources/base.py
smartlab-br/datahub-api
1
16556
''' Controller para fornecer dados da CEE ''' from flask_restful import Resource from service.qry_options_builder import QueryOptionsBuilder from model.thematic import Thematic class BaseResource(Resource): ''' Classe de base de resource ''' DEFAULT_SWAGGER_PARAMS = [ {"name": "valor", "required": False, "type": 'string', "in": "query", "description": "Coluna com o valor agregado. Agrega o valor \ presente na coluna informada (vide opções nas categorias), de \ acordo com a função de agregação informada (vide parâmetro \ agregacao)."}, {"name": "agregacao", "required": False, "type": 'string', "in": "query", "description": "Função de agregação a ser usada. As funções \ disponíveis são DISTINCT, COUNT, SUM, MAX, MIN, PCT_COUNT, \ PCT_SUM, RANK_COUNT, RANK_SUM, RANK_DENSE_COUNT e \ RANK_DESNE_SUM. \ Os atributos retornados terão nome formado pelo nome da \ função precedido de 'agr_' (ex. 'agr_sum')."}, {"name": "ordenacao", "required": False, "type": 'string', "in": "query", "description": "Colunas de ordenação para o resultado, dentre \ as colunas presentes nas categorias. Adicionalmente, pode-se \ incluir a coluna de agregação (ex. 'sum'). Uma coluna com \ ordenação inversa deve ser precedida de '-' \ (ex. order=-sum)."}, {"name": "filtros", "required": False, "type": 'string', "in": "query", "description": "Operações lógicas para a filtragem dos registros \ do resultado. Operadores disponíveis: eq, ne, in, gt, ge, lt, le, \ and e or. Como redigir: ',' para separar operações e '-' para \ separar parâmetros da operação. \ Exemplo: &filtros=ge-ano-2014,and,lt-ano-2018."}, {"name": "calcs", "required": False, "type": 'string', "in": "query", "description": "Campo calculado sobre grupos padrões do resource. \ Havendo qualquer agregação, o agrupamento será feito pelas \ categorias fornecidas na query. \ Calcs disponiveis: min_part, max_part, avg_part, var_part, \ ln_var_part, norm_pos_part, ln_norm_pos_part, norm_part e \ ln_norm_part."} ] CAT_DETAIL = "Para renomear campos do dataset de retorno, após o campo de \ consulta, adicionar o novo nome, separado por '-' (ex: campo-campo_novo)." CAT_IND_BR = "Informações que devem ser trazidas no dataset. \ Campos disponíveis: cd_mun_ibge, nu_competencia, \ cd_indicador, ds_agreg_primaria, ds_agreg_secundaria, \ ds_indicador, ds_fonte, nu_competencia_min, nu_competencia_max, \ vl_indicador, vl_indicador_min, vl_indicador_max e media_br. \ " + CAT_DETAIL CAT_IND_UF = "Informações que devem ser trazidas no dataset. \ Campos disponíveis: cd_mun_ibge, nu_competencia, \ nu_competencia_min, nu_competencia_max, nm_uf, sg_uf, \ cd_prt, nm_prt, cd_regiao, nm_regiao, cd_uf, cd_indicador, \ ds_agreg_primaria, ds_agreg_secundaria, ds_indicador, \ ds_fonte, vl_indicador, vl_indicador_br, vl_indicador_min_br, \ vl_indicador_max_br, media_br, pct_br, rank_br e \ rank_br_total. " + CAT_DETAIL CAT_IND_MUN = "Informações que devem ser trazidas no dataset. \ Campos disponíveis: cd_mun_ibge, nu_competencia, \ nu_competencia_min, nu_competencia_max, nm_municipio_uf, \ latitude, longitude, nm_uf, sg_uf, cd_unidade, cd_prt, \ nm_prt, nm_unidade, tp_unidade, sg_unidade, cd_mesorregiao, \ nm_mesorregiao, cd_microrregiao, nm_microrregiao, \ cd_regiao, nm_regiao, cd_mun_ibge_dv, nm_municipio, cd_uf, \ cd_indicador, ds_agreg_primaria, ds_agreg_secundaria, \ ds_indicador, vl_indicador, vl_indicador_uf, \ vl_indicador_min_uf, vl_indicador_max_uf, media_uf, pct_uf, \ rank_uf, rank_uf_total, vl_indicador_br, vl_indicador_min_br \ vl_indicador_max_br, media_br, pct_br, rank_br e \ rank_br_total. " + CAT_DETAIL EMPRESA_DEFAULT_SWAGGER_PARAMS = [ { "name": "dados", "description": "Fonte de dados para consulta (rais, caged, catweb etc)", "required": False, "type": 'string', "in": "query" }, { "name": "competencia", "description": "Competência a ser retornada. Depende da fonte de dados \ (ex. para uma fonte pode ser AAAA, enquanto para outras AAAAMM)", "required": False, "type": 'string', "in": "query" }, { "name": "id_pf", "description": "Identificador da Pessoa Física, dentro da empresa. \ Tem que informar o dataset (param 'dados')", "required": False, "type": 'string', "in": "query" }, { "name": "perspectiva", "description": "Valor que filtra uma perspectiva predefinida de um dataset \ (ex. No catweb, 'Empregador'). Nem todos os datasets tem essa opção.", "required": False, "type": 'string', "in": "query" }, { "name": "reduzido", "description": "Sinalizador que indica conjunto reduzido de colunas (S para sim)", "required": False, "type": 'string', "in": "query" }, { "name": "cnpj_raiz", "required": True, "type": 'string', "in": "path", "description": "CNPJ Raiz da empresa consultada" } ] @staticmethod def build_options(r_args, rules='query'): ''' Constrói as opções da pesquisa ''' return QueryOptionsBuilder.build_options(r_args, rules) @staticmethod def build_person_options(r_args, mod='empresa'): ''' Constrói as opções da pesquisa ''' return QueryOptionsBuilder.build_person_options(r_args, mod) def __init__(self): ''' Construtor''' self.domain = None self.set_domain() def get_domain(self): ''' Carrega o modelo de domínio, se não o encontrar ''' if self.domain is None: self.domain = Thematic() return self.domain def set_domain(self): ''' Setter invoked from constructor ''' self.domain = Thematic()
2.484375
2
tapioca_trello/resource_mapping/checklist.py
humrochagf/tapioca-trello
0
16557
<reponame>humrochagf/tapioca-trello<gh_stars>0 # -*- coding: utf-8 -*- CHECKLIST_MAPPING = { 'checklist_retrieve': { 'resource': '/checklists/{id}', 'docs': ( 'https://developers.trello.com/v1.0/reference' '#checklistsid' ), 'methods': ['GET'], }, 'checklist_field_retrieve': { 'resource': '/checklists/{id}/{field}', 'docs': ( 'https://developers.trello.com/v1.0/reference' '#checklistsidfield' ), 'methods': ['GET'], }, 'checklist_board_retrieve': { 'resource': '/checklists/{id}/board', 'docs': ( 'https://developers.trello.com/v1.0/reference' '#checklistsidboard' ), 'methods': ['GET'], }, 'checklist_card_retrieve': { 'resource': '/checklists/{id}/cards', 'docs': ( 'https://developers.trello.com/v1.0/reference' '#checklistsidcards' ), 'methods': ['GET'], }, 'checklist_item_list': { 'resource': '/checklists/{id}/checkItems', 'docs': ( 'https://developers.trello.com/v1.0/reference' '#checklistsidcardscheckitems' ), 'methods': ['GET'], }, 'checklist_item_retrieve': { 'resource': '/checklists/{id}/checkItems/{idCheckItem}', 'docs': ( 'https://developers.trello.com/v1.0/reference' '#checklistsidcardscheckitemscheckitemid' ), 'methods': ['GET'], }, 'checklist_update': { 'resource': '/checklists/{id}', 'docs': ( 'https://developers.trello.com/v1.0/reference' '#checklistsid-1' ), 'methods': ['PUT'], }, 'checklist_item_update': { 'resource': '/checklists/{id}/checkItems/{idCheckItem}', 'docs': ( 'https://developers.trello.com/v1.0/reference' '#checklistsidcheckitemsidcheckitem' ), 'methods': ['PUT'], }, 'checklist_name_update': { 'resource': '/checklists/{id}/name', 'docs': ( 'https://developers.trello.com/v1.0/reference' '#checklistsidname' ), 'methods': ['PUT'], }, 'checklist_create': { 'resource': '/checklists', 'docs': ( 'https://developers.trello.com/v1.0/reference' '#checklists' ), 'methods': ['POST'], }, 'checklist_item_create': { 'resource': '/checklists/{id}/checkItems', 'docs': ( 'https://developers.trello.com/v1.0/reference' '#checklistsidcheckitems' ), 'methods': ['POST'], }, 'checklist_delete': { 'resource': '/checklists/{id}', 'docs': ( 'https://developers.trello.com/v1.0/reference' '#checklistsid-2' ), 'methods': ['DELETE'], }, 'checklist_item_delete': { 'resource': '/checklists/{id}/checkItems/{idCheckItem}', 'docs': ( 'https://developers.trello.com/v1.0/reference' '#checklistsidcheckitemsid' ), 'methods': ['DELETE'], }, }
1.46875
1
investimentos.py
isaiaspereira307/invest
0
16558
import json import os def calculo(self): meta = float(input('valor da meta: ')) # 1000000 valorinicial = float(input('valor inicial: ')) # 5637.99 valormensal = float(input('investimento mensal: ')) # 150 dividendos = float(input('dividendos: ')) # 16.86 meta = meta - valorinicial - valormensal - dividendos i = 0 while i < meta: meta = meta - valormensal - dividendos print(meta) dividendos = dividendos + 1.37 i = i + 1 print (i) return i def viver_de_renda_hglg(): preco = 194 div = 0.78 magic_number = int(preco/div) valor = preco * magic_number rmd = 1000 #renda mensal desejada valor_nescessario = magic_number*rmd return valor_nescessario def viver_de_renda_knri(self): preco = 185 div = 0.74 magic_number = int(preco/div) valor = preco * magic_number rmd = 10000 #renda mensal desejada valor_nescessario = magic_number*rmd return valor_nescessario def viver_de_renda_bcff(self): preco = 99 div = 0.53 magic_number = int(preco/div) valor = preco * magic_number rmd = 10000 #renda mensal desejada valor_nescessario = magic_number*rmd return valor_nescessario def vdrFII(): preco = 478 div = 2.05 rmd = 10000 magic_number = int(preco/div) valor_nescessario = magic_number*rmd print(valor_nescessario) def sair(): print("\nObrigado por utilizar a calculadora. Até logo!") exit() def chamarMenu(): #os.system('clear') escolha = int(input("##### INVESTPY #####" "\nDigite: " "\n<1> adicionar ação" "\n<2> exibir ações" "\n<3> sair\n> ")) return escolha def ler_arquivo(arquivo): if os.path.exists(arquivo): with open(arquivo, "r") as arq_json: dicionario=json.load(arq_json) else: dicionario = {} return dicionario def gravar_arquivo(dicionario,arquivo): with open(arquivo, "w") as arq_json: json.dump(dicionario, arq_json) def registrar(dicionario, arquivo): resp = "S" while resp == "S": dicionario[input("Digite o nome da ação: ")] = [ input("Digite o valor da ação: "), input("Digite o valor do dividendo: "), input("Digite a quantidade de cotas:")] resp = input("Digite <S> para continuar.").upper() gravar_arquivo(dicionario,arquivo) return "JSON gerado!!!!" def exibir(arquivo): dicionario = ler_arquivo(arquivo) for chave, dado in dicionario.items(): print("Ação.........: ", chave) print("Valor........: ", dado[0]) print("Dividendos...: ", dado[1]) print("Cotas........: ", dado[2]) acoes = ler_arquivo("acoes.json") opcao=chamarMenu() while opcao > 0 and opcao < 5: if opcao == 1: print(registrar(acoes, "acoes.json")) elif opcao == 2: exibir("acoes.json") elif opcao == 3: sair() opcao = chamarMenu()
3.34375
3
lib/ipython_view.py
drewp/light9
2
16559
# this version is adapted from http://wiki.ipython.org/Old_Embedding/GTK """ Backend to the console plugin. @author: <NAME> @organization: IBM Corporation @copyright: Copyright (c) 2007 IBM Corporation @license: BSD All rights reserved. This program and the accompanying materials are made available under the terms of the BSD which accompanies this distribution, and is available at U{http://www.opensource.org/licenses/bsd-license.php} """ # this file is a modified version of source code from the Accerciser project # http://live.gnome.org/accerciser from gi.repository import Gtk from gi.repository import Gdk import re import sys import os from gi.repository import Pango from io import StringIO from functools import reduce try: import IPython except Exception as e: raise "Error importing IPython (%s)" % str(e) ansi_colors = {'0;30': 'Black', '0;31': 'Red', '0;32': 'Green', '0;33': 'Brown', '0;34': 'Blue', '0;35': 'Purple', '0;36': 'Cyan', '0;37': 'LightGray', '1;30': 'DarkGray', '1;31': 'DarkRed', '1;32': 'SeaGreen', '1;33': 'Yellow', '1;34': 'LightBlue', '1;35': 'MediumPurple', '1;36': 'LightCyan', '1;37': 'White'} class IterableIPShell: def __init__(self,argv=None,user_ns=None,user_global_ns=None, cin=None, cout=None,cerr=None, input_func=None): if input_func: IPython.iplib.raw_input_original = input_func if cin: IPython.Shell.Term.cin = cin if cout: IPython.Shell.Term.cout = cout if cerr: IPython.Shell.Term.cerr = cerr if argv is None: argv=[] # This is to get rid of the blockage that occurs during # IPython.Shell.InteractiveShell.user_setup() IPython.iplib.raw_input = lambda x: None self.term = IPython.genutils.IOTerm(cin=cin, cout=cout, cerr=cerr) os.environ['TERM'] = 'dumb' excepthook = sys.excepthook self.IP = IPython.Shell.make_IPython(argv,user_ns=user_ns, user_global_ns=user_global_ns, embedded=True, shell_class=IPython.Shell.InteractiveShell) self.IP.system = lambda cmd: self.shell(self.IP.var_expand(cmd), header='IPython system call: ', verbose=self.IP.rc.system_verbose) sys.excepthook = excepthook self.iter_more = 0 self.history_level = 0 self.complete_sep = re.compile('[\s\{\}\[\]\(\)]') def execute(self): self.history_level = 0 orig_stdout = sys.stdout sys.stdout = IPython.Shell.Term.cout try: line = self.IP.raw_input(None, self.iter_more) if self.IP.autoindent: self.IP.readline_startup_hook(None) except KeyboardInterrupt: self.IP.write('\nKeyboardInterrupt\n') self.IP.resetbuffer() # keep cache in sync with the prompt counter: self.IP.outputcache.prompt_count -= 1 if self.IP.autoindent: self.IP.indent_current_nsp = 0 self.iter_more = 0 except: self.IP.showtraceback() else: self.iter_more = self.IP.push(line) if (self.IP.SyntaxTB.last_syntax_error and self.IP.rc.autoedit_syntax): self.IP.edit_syntax_error() if self.iter_more: self.prompt = str(self.IP.outputcache.prompt2).strip() if self.IP.autoindent: self.IP.readline_startup_hook(self.IP.pre_readline) else: self.prompt = str(self.IP.outputcache.prompt1).strip() sys.stdout = orig_stdout def historyBack(self): self.history_level -= 1 return self._getHistory() def historyForward(self): self.history_level += 1 return self._getHistory() def _getHistory(self): try: rv = self.IP.user_ns['In'][self.history_level].strip('\n') except IndexError: self.history_level = 0 rv = '' return rv def updateNamespace(self, ns_dict): self.IP.user_ns.update(ns_dict) def complete(self, line): split_line = self.complete_sep.split(line) possibilities = self.IP.complete(split_line[-1]) if possibilities: common_prefix = reduce(self._commonPrefix, possibilities) completed = line[:-len(split_line[-1])]+common_prefix else: completed = line return completed, possibilities def _commonPrefix(self, str1, str2): for i in range(len(str1)): if not str2.startswith(str1[:i+1]): return str1[:i] return str1 def shell(self, cmd,verbose=0,debug=0,header=''): stat = 0 if verbose or debug: print(header+cmd) # flush stdout so we don't mangle python's buffering if not debug: input, output = os.popen4(cmd) print(output.read()) output.close() input.close() class ConsoleView(Gtk.TextView): def __init__(self): Gtk.TextView.__init__(self) self.modify_font(Pango.FontDescription('Mono')) self.set_cursor_visible(True) self.text_buffer = self.get_buffer() self.mark = self.text_buffer.create_mark('scroll_mark', self.text_buffer.get_end_iter(), False) for code in ansi_colors: self.text_buffer.create_tag(code, foreground=ansi_colors[code], weight=700) self.text_buffer.create_tag('0') self.text_buffer.create_tag('notouch', editable=False) self.color_pat = re.compile('\x01?\x1b\[(.*?)m\x02?') self.line_start = \ self.text_buffer.create_mark('line_start', self.text_buffer.get_end_iter(), True ) self.connect('key-press-event', self._onKeypress) self.last_cursor_pos = 0 def write(self, text, editable=False): segments = self.color_pat.split(text) segment = segments.pop(0) start_mark = self.text_buffer.create_mark(None, self.text_buffer.get_end_iter(), True) self.text_buffer.insert(self.text_buffer.get_end_iter(), segment) if segments: ansi_tags = self.color_pat.findall(text) for tag in ansi_tags: i = segments.index(tag) self.text_buffer.insert_with_tags_by_name(self.text_buffer.get_end_iter(), segments[i+1], tag) segments.pop(i) if not editable: self.text_buffer.apply_tag_by_name('notouch', self.text_buffer.get_iter_at_mark(start_mark), self.text_buffer.get_end_iter()) self.text_buffer.delete_mark(start_mark) self.scroll_mark_onscreen(self.mark) def showPrompt(self, prompt): self.write(prompt) self.text_buffer.move_mark(self.line_start,self.text_buffer.get_end_iter()) def changeLine(self, text): iter = self.text_buffer.get_iter_at_mark(self.line_start) iter.forward_to_line_end() self.text_buffer.delete(self.text_buffer.get_iter_at_mark(self.line_start), iter) self.write(text, True) def getCurrentLine(self): rv = self.text_buffer.get_slice(self.text_buffer.get_iter_at_mark(self.line_start), self.text_buffer.get_end_iter(), False) return rv def showReturned(self, text): iter = self.text_buffer.get_iter_at_mark(self.line_start) iter.forward_to_line_end() self.text_buffer.apply_tag_by_name('notouch', self.text_buffer.get_iter_at_mark(self.line_start), iter) self.write('\n'+text) if text: self.write('\n') self.showPrompt(self.prompt) self.text_buffer.move_mark(self.line_start,self.text_buffer.get_end_iter()) self.text_buffer.place_cursor(self.text_buffer.get_end_iter()) def _onKeypress(self, obj, event): if not event.string: return insert_mark = self.text_buffer.get_insert() insert_iter = self.text_buffer.get_iter_at_mark(insert_mark) selection_mark = self.text_buffer.get_selection_bound() selection_iter = self.text_buffer.get_iter_at_mark(selection_mark) start_iter = self.text_buffer.get_iter_at_mark(self.line_start) if start_iter.compare(insert_iter) <= 0 and \ start_iter.compare(selection_iter) <= 0: return elif start_iter.compare(insert_iter) > 0 and \ start_iter.compare(selection_iter) > 0: self.text_buffer.place_cursor(start_iter) elif insert_iter.compare(selection_iter) < 0: self.text_buffer.move_mark(insert_mark, start_iter) elif insert_iter.compare(selection_iter) > 0: self.text_buffer.move_mark(selection_mark, start_iter) class IPythonView(ConsoleView, IterableIPShell): def __init__(self, **kw): ConsoleView.__init__(self) self.cout = StringIO() IterableIPShell.__init__(self, cout=self.cout,cerr=self.cout, input_func=self.raw_input, **kw) self.connect('key_press_event', self.keyPress) self.execute() self.cout.truncate(0) self.showPrompt(self.prompt) self.interrupt = False def raw_input(self, prompt=''): if self.interrupt: self.interrupt = False raise KeyboardInterrupt return self.getCurrentLine() def keyPress(self, widget, event): if event.state & Gdk.ModifierType.CONTROL_MASK and event.keyval == 99: self.interrupt = True self._processLine() return True elif event.keyval == Gtk.keysyms.Return: self._processLine() return True elif event.keyval == Gtk.keysyms.Up: self.changeLine(self.historyBack()) return True elif event.keyval == Gtk.keysyms.Down: self.changeLine(self.historyForward()) return True # todo: Home needs to advance past the ipython prompt elif event.keyval == Gtk.keysyms.Tab: if not self.getCurrentLine().strip(): return False completed, possibilities = self.complete(self.getCurrentLine()) if len(possibilities) > 1: slice = self.getCurrentLine() self.write('\n') for symbol in possibilities: self.write(symbol+'\n') self.showPrompt(self.prompt) self.changeLine(completed or slice) return True def _processLine(self): self.history_pos = 0 self.execute() rv = self.cout.getvalue() if rv: rv = rv.strip('\n') self.showReturned(rv) self.cout.truncate(0)
2.359375
2
todo/urls.py
incomparable/Django
0
16560
from django.conf.urls import url from . import views urlpatterns = [ url(r'^$', views.index, name='index'), url(r'^get', views.index, name='index'), url(r'^details/(?P<id>\w)/$', views.details, name='details'), url(r'^add', views.add, name='add'), url(r'^delete', views.delete, name='delete'), url(r'^update', views.update, name='update'), # url(r'^signup', views.signup, name='signup'), # url(r'^login', views.login, name='login'), # url(r'^login/$', auth_views.login), ]
1.742188
2
first_steps_in_coding_and_simple_operations_and_calculations/exercise/charity_campaign.py
PetkoAndreev/Python-basics
0
16561
days = int(input()) sladkar = int(input()) cake = int(input()) gofreta = int(input()) pancake = int(input()) cake_price = cake*45 gofreta_price = gofreta*5.8 pancake_price = pancake*3.2 day_price = (cake_price + gofreta_price + pancake_price)*sladkar total_price = days*day_price campaign = total_price - (total_price/8) print(campaign)
3.828125
4
deepbiome/loss_and_metric.py
Young-won/deepbiome
4
16562
<gh_stars>1-10 ###################################################################### ## DeepBiome ## - Loss and metrics (mse, cross-entropy) ## ## July 10. 2019 ## Youngwon (<EMAIL>) ## ## Reference ## - Keras (https://github.com/keras-team/keras) ###################################################################### import numpy as np import sklearn.metrics as skmetrics from keras.callbacks import Callback import tensorflow as tf import keras.backend as K from keras.losses import mean_squared_error, mean_absolute_error, binary_crossentropy, categorical_crossentropy, sparse_categorical_crossentropy from keras.metrics import binary_accuracy, categorical_accuracy, sparse_categorical_accuracy from sklearn.metrics import roc_auc_score, f1_score, precision_score, recall_score ############################################################################################################################### # tf loss functions def recall(y_true, y_pred): y_pred = K.round(y_pred) score = tf.py_function(lambda y_true, y_pred : recall_score(y_true, y_pred, average='macro', sample_weight=None).astype('float32'), [y_true, y_pred], Tout=tf.float32, name='sklearnRecall') return score # true_positives = K.sum(K.round(K.clip(y_true * y_pred, 0, 1))) # predicted_positives = K.sum(K.round(K.clip(y_true, 0, 1))) # recall = true_positives / (predicted_positives + K.epsilon()) # return recall # return K.sum(y_true==y_pred)/(K.sum(y_true==y_pred) + K.sum(y_true==(1-y_pred)) + 1e-10) def precision(y_true, y_pred): y_pred = K.round(y_pred) score = tf.py_function(lambda y_true, y_pred : precision_score(y_true, y_pred, average='macro', sample_weight=None).astype('float32'), [y_true, y_pred], Tout=tf.float32, name='sklearnPrecision') return score # true_positives = K.sum(K.round(K.clip(y_true * y_pred, 0, 1))) # predicted_positives = K.sum(K.round(K.clip(y_pred, 0, 1))) # precision = true_positives / (predicted_positives + K.epsilon()) # return precision # return K.sum(y_true==y_pred)/(K.sum(y_true==y_pred) + K.sum((1-y_true)==y_pred) + 1e-10) def sensitivity(y_true, y_pred): y_pred = K.cast(K.greater(K.clip(y_pred, 0, 1), 0.5), K.floatx()) neg_y_pred = 1 - y_pred true_positive = K.round(K.sum(K.clip(y_true * y_pred, 0, 1))) false_negative = K.round(K.sum(K.clip(y_true * neg_y_pred, 0, 1))) return (true_positive) / (true_positive + false_negative + K.epsilon()) def specificity(y_true, y_pred): y_pred = K.cast(K.greater(K.clip(y_pred, 0, 1), 0.5), K.floatx()) neg_y_true = 1 - y_true neg_y_pred = 1 - y_pred false_positive = K.round(K.sum(K.clip(neg_y_true * y_pred, 0, 1))) true_negative = K.round(K.sum(K.clip(neg_y_true * neg_y_pred, 0, 1))) return (true_negative) / (false_positive + true_negative + K.epsilon()) def gmeasure(y_true, y_pred): return (sensitivity(y_true, y_pred) * specificity(y_true, y_pred)) ** 0.5 def auc(y_true, y_pred): # https://stackoverflow.com/questions/43263111/defining-an-auc-metric-for-keras-to-support-evaluation-of-validation-dataset score = tf.py_function(lambda y_true, y_pred : roc_auc_score(y_true, y_pred, average='macro', sample_weight=None).astype('float32'), [y_true, y_pred], Tout=tf.float32, name='sklearnAUC') return score def f1_score_with_nan(y_true, y_pred, average='macro', sample_weight=None): try: score = f1_score(y_true, y_pred, average=average, sample_weight=sample_weight) except: score = np.nan return score def f1(y_true, y_pred): # precision = precision(y_true, y_pred) # recall = recall(y_true, y_pred) # return 2 * (precision * recall) / (precision + recall + K.epsilon()) # https://stackoverflow.com/questions/43263111/defining-an-auc-metric-for-keras-to-support-evaluation-of-validation-dataset y_pred = K.round(y_pred) score = tf.py_function(lambda y_true, y_pred : f1_score_with_nan(y_true, y_pred, average='macro', sample_weight=None).astype('float32'), [y_true, y_pred], Tout=tf.float32, name='sklearnF1') return score def ss(a, axis=0): # a, axis = _chk_asarray(a, axis) return np.sum(a*a, axis) def pearsonr(x,y): n = len(x) mx = np.mean(x) my = np.mean(y) xm, ym = x-mx, y-my r_num = np.add.reduce(xm * ym) r_den = np.sqrt(ss(xm) * ss(ym)) r = r_num / r_den # Presumably, if abs(r) > 1, then it is only some small artifact of floating # point arithmetic. r = max(min(r, 1.0), -1.0) return r def correlation_coefficient(y_true, y_pred): score = tf.py_function(lambda y_true, y_pred : pearsonr(y_true, y_pred), [y_true, y_pred], Tout=tf.float32, name='correlation_coefficient') return score # TODO # https://stackoverflow.com/questions/41032551/how-to-compute-receiving-operating-characteristic-roc-and-auc-in-keras # def auc(y_true, y_pred): # return NotImplementedError() ############################################################################################################################### # helper def np_binary_accuracy(y_true, y_pred): y_pred = (y_pred>=0.5).astype(np.int32) return skmetrics.accuracy_score(y_true, y_pred, normalize=True, sample_weight=None) def np_precision(y_true, y_pred): return precision_score(y_true, y_pred, labels=None, pos_label=1, average='macro', sample_weight=None) # return (np.sum(y_true*y_pred) + 1e-7)/(np.sum(y_true*y_pred) + np.sum((1-y_true)*y_pred) + 1e-7) def np_recall(y_true, y_pred): return recall_score(y_true, y_pred, labels=None, pos_label=1, average='macro', sample_weight=None) # return (np.sum(y_true*y_pred) + 1e-7)/(np.sum(y_true*y_pred) + np.sum(y_true*(1-y_pred)) + 1e-7) def np_f1_score(y_true, y_pred): return skmetrics.f1_score(y_true, y_pred, labels=None, pos_label=1, average='macro', sample_weight=None) def np_roc_auc(y_true, y_pred): return skmetrics.roc_auc_score(y_true, y_pred, average='macro', sample_weight=None) def np_confusion_matrix(y_true, y_pred): return skmetrics.confusion_matrix(y_true, y_pred).ravel() def np_sensitivity(y_true, y_pred): y_true = y_true.astype(np.int32) y_pred = (y_pred >= 0.5).astype(np.int32) neg_y_pred = 1 - y_pred tp = np.sum(y_true * y_pred) fn = np.sum(y_true * neg_y_pred) return tp / (tp+fn) def np_specificity(y_true, y_pred): y_true = y_true.astype(np.int32) y_pred = (y_pred >= 0.5).astype(np.int32) neg_y_true = 1 - y_true neg_y_pred = 1 - y_pred fp = np.sum(neg_y_true * y_pred) tn = np.sum(neg_y_true * neg_y_pred) return tn / (tn+fp) def np_PPV(y_true, y_pred): y_true = y_true.astype(np.int32) y_pred = (y_pred >= 0.5).astype(np.int32) neg_y_true = 1 - y_true tp = np.sum(y_true * y_pred) fp = np.sum(neg_y_true * y_pred) return tp/(tp+fp) def np_gmeasure(y_true, y_pred): sensitivity = np_sensitivity(y_true, y_pred) specificity = np_specificity(y_true, y_pred) return (sensitivity*specificity)**0.5 def metric_test(y_true, y_pred): return (np_sensitivity(y_true, y_pred), np_specificity(y_true, y_pred), np_gmeasure(y_true, y_pred), np_binary_accuracy(y_true, y_pred), np_roc_auc(y_true, y_pred)) ############################################################################################################################### # if __name__ == "__main__": # test_metrics = {'Accuracy':binary_accuracy, 'Precision':precision, 'Recall':recall} # print('Test loss functions %s' % test_metrics.keys()) # y_true_set = np.array([[[0,0,0,0,0], # [0,0,0,0,0], # [0,1,1,0,0], # [1,1,1,0,0], # [0,1,0,0,0]]]) # y_pred_set = np.array([[[0,0,0,0,1], # [0,0,0,0,0], # [0,1,0.6,0,0], # [0,1,1,0,0], # [0,0.3,0,0,0]]]) # def test(acc, y_true_set, y_pred_set): # sess = tf.Session() # K.set_session(sess) # with sess.as_default(): # return acc.eval(feed_dict={y_true: y_true_set, y_pred: y_pred_set}) # # tf # y_true = tf.placeholder("float32", shape=(None,y_true_set.shape[1],y_true_set.shape[2])) # y_pred = tf.placeholder("float32", shape=(None,y_pred_set.shape[1],y_pred_set.shape[2])) # metric_list = [binary_accuracy(y_true, y_pred), # precision(y_true, y_pred), # recall(y_true, y_pred)] # # numpy # print('%15s %15s %15s' % tuple(test_metrics.keys())) # print('tf : {}'.format([test(acc, y_true_set, y_pred_set) for acc in metric_list])) # print('np : {}'.format(np.round(metric_test(y_true_set[0],y_pred_set[0]),8)))
2.328125
2
Hough.py
andresgmz/Scripts-Python
0
16563
import cv2 import numpy as np import matplotlib.pyplot as plt #from matplotlib import pyplot as plt from tkinter import filedialog from tkinter import * root = Tk() root.withdraw() root.filename = filedialog.askopenfilename(initialdir = "/",title = "Select file",filetypes = (("all files",".*"),("jpg files",".jpg"))) img = cv2.imread(root.filename) root.destroy() # Convert to gray-scale gray = cv2.cvtColor(img, cv2.COLOR_BGR2GRAY) # Blur the image to reduce noise img_blur = cv2.medianBlur(gray, 5) # Apply hough transform on the image8 $$$img.shape[0]/16, param1=100, param2=11, minRadius=62, maxRadius=67 # Draw detected circles; circles = cv2.HoughCircles(img_blur, cv2.HOUGH_GRADIENT, 1, img.shape[0]/16, param1=200, param2=25, minRadius=60, maxRadius=67) face_cascade = cv2.CascadeClassifier('C:/Users/andre/Desktop/NovenoSemestre/VisionArtificial/Python/haarcascade_frontalface_alt.xml') gray=cv2.cvtColor(img,cv2.COLOR_BGR2GRAY) faces = face_cascade.detectMultiScale(gray, 1.3, 5) for (x,y,w,h) in faces: center = (x + w//2, y + h//2) #circles = cv2.HoughCircles(img_blur, cv2.HOUGH_GRADIENT, 1, img.shape[0]/128, param1=100, param2=11, minRadius=50, maxRadius=100) circles = cv2.HoughCircles(img_blur, cv2.HOUGH_GRADIENT, 1, img.shape[0]/128, param1=100, param2=11, minRadius=(w//2-10), maxRadius=(w//2+10)) (h, w) = img_blur.shape[:2] #Calcular tamaño de la imageb (pointRefX,pointRefY) = center puntoMinimo =100 if circles is not None: circles = np.uint16(np.around(circles)) for i in circles[0, :]: #Definir el circulo mas cercano de la xCercano =np.absolute(i[0]-pointRefX) yCercano =np.absolute(i[1]-pointRefY) puntoCercano = xCercano+yCercano if (puntoCercano < puntoMinimo): puntoMinimo = puntoCercano circuloCercano = i # Draw outer circle #frame = cv2.ellipse(img, center, (w//2, h//2), 0, 0, 360,(100, 7, 55), 2) cv2.ellipse(img, (circuloCercano[0], circuloCercano[1]),(circuloCercano[2],circuloCercano[2]+15),0,0,360,(0, 255, 0), 2) # Draw inner circle cv2.circle(img, (circuloCercano[0], circuloCercano[1]), circuloCercano[2], (0, 255, 0), 2) cv2.circle(img, (circuloCercano[0], circuloCercano[1]), 2, (0, 0, 255), 3) """ cv2.circle(img, (circuloCercano[0], circuloCercano[1]), circuloCercano[2], (0, 255, 0), 2) # Draw inner circle cv2.circle(img, (circuloCercano[0], circuloCercano[1]), 2, (0, 0, 255), 3) """ """ if circles is not None: circles = np.uint16(np.around(circles)) for i in circles[0, :]: #Definir el circulo mas cercano de la xCercano =np.absolute(i[0]-pointRefX) yCercano =np.absolute(i[1]-pointRefY) puntoCercano = xCercano+yCercano if (puntoCercano < puntoMinimo): puntoMinimo = puntoCercano circuloCercano = i # Draw outer circle cv2.circle(img, (i[0], i[1]), i[2], (0, 255, 0), 2) # Draw inner circle cv2.circle(img, (i[0], i[1]), 2, (0, 0, 255), 3) """ cv2.imshow("Mascara",img) cv2.waitKey(0)
3.046875
3
src/SentimentAnalyzer.py
IChowdhury01/Sentiment-Analyzer
0
16564
<gh_stars>0 # Binary Sentiment Analysis using Recurrent Neural Networks # Import libraries & dataset list import tensorflow as tf import tensorflow_datasets as dslist # Load Dataset print("\nLoading dataset...") # Download dataset and dataset info DATASET_CODE = 'imdb_reviews/subwords8k' # Using a TensorFlow binary sentiment classification dataset dataset, dsinfo = dslist.load(DATASET_CODE, with_info=True, as_supervised=True) # Separate into training and testing data. training = dataset['train'] testing = dataset['test'] # Declare encoder (maps each word in a string to its index in the dataset's vocabulary) encoder = dsinfo.features['text'].encoder print("Dataset loaded.") # Setup for training # Prepare data. Create batches of encoded strings and zero-pad them. BUFFER_SIZE = 10000 BATCH_SIZE = 64 # Max number of encoded strings in batch padded_shapes = ([None], ()) training = (training .shuffle(BUFFER_SIZE) .padded_batch(BATCH_SIZE, padded_shapes=padded_shapes)) testing = (testing .padded_batch(BATCH_SIZE, padded_shapes=padded_shapes)) # Setup Recurrent Neural Network (RNN) # Create RNN model using Keras. OUTPUT_SIZE = 64 rnn_model = tf.keras.Sequential([ # Keras Sequential model: processes sequence of encoded strings (indices), embeds each index into vector, then processes through embedding layer tf.keras.layers.Embedding(encoder.vocab_size, OUTPUT_SIZE), # Add embedding layer: stores each word as trainable vector tf.keras.layers.Bidirectional(tf.keras.layers.LSTM(64)), # Make input sequence iterate both directions through LTSM layer (helps learn long-range dependencies). # Add layers tf.keras.layers.Dense(64, activation='relu'), tf.keras.layers.Dense(1) ]) # Compile RNN model rnn_model.compile(loss=tf.keras.losses.BinaryCrossentropy(from_logits=True), optimizer=tf.keras.optimizers.Adam(1e-4), metrics=['accuracy']) # Train RNN NUM_ITERATIONS = 1 print("\nTraining neural network...") history = rnn_model.fit(training, epochs=NUM_ITERATIONS, validation_data=testing) print("Training complete.") # Test RNN. print("\nTesting on dataset...") loss, accuracy = rnn_model.evaluate(testing) # Return test loss and test accuracy print("Testing complete.") # Process and print results loss = round(loss, 3) accuracy = round(accuracy*100, 2) print("Test Loss: {}".format(loss)) print("Test Accuracy: {}%".format(accuracy)) # Prediction # Zero-pads a vector up to a target size. def pad_vector(vec, target_size): num_zeros = [0] * (target_size - len(vec)) vec.extend(num_zeros) return vec # Predicts sentiment. Output will be a decimal number. def predict_sentiment(review): encoded_review = encoder.encode(review) # Encode review. Map each word to an index. encoded_review = pad_vector(encoded_review, BATCH_SIZE) # Zero-padding encoded_review = tf.cast(encoded_review, tf.float32) prediction = rnn_model.predict(tf.expand_dims(encoded_review, 0)) return prediction # Predictions with value over 0.5 are positive sentiments. def interpret_prediction(prediction): if prediction >= 0.5: return "Positive" else: return "Negative" # Predict sentiment of user-inputted review user_query = input("\nEnter a review to predict its sentiment, or enter nothing to exit the program:\n") while(user_query != ""): prediction = predict_sentiment(user_query) sentiment = interpret_prediction(prediction) print("\nSentiment: {} (Value: {})".format(sentiment, prediction)) user_query = input("\n\nEnter a review to predict its sentiment, or enter nothing to exit the program:\n")
3.3125
3
google_image_scraping_script_for_arg.py
KuoYuHong/Shihu-Cat-Image-Recognition-System
1
16565
<reponame>KuoYuHong/Shihu-Cat-Image-Recognition-System<filename>google_image_scraping_script_for_arg.py import selenium from selenium import webdriver import time import requests import os from PIL import Image import io import hashlib # All in same directory DRIVER_PATH = 'chromedriver.exe' def fetch_image_urls(query:str, max_links_to_fetch:int, wd:webdriver, sleep_between_interactions:int=0.5): def scroll_to_end(wd): wd.execute_script("window.scrollTo(0, document.body.scrollHeight);") time.sleep(sleep_between_interactions) # build the google query search_url = "https://www.google.com/search?safe=off&site=&tbm=isch&source=hp&q={q}&oq={q}&gs_l=img" # load the page wd.get(search_url.format(q=query)) image_urls = set() image_count = 0 results_start = 0 error_clicks = 0 while (image_count < max_links_to_fetch) & (error_clicks < 30): # error clicks to stop when there are no more results to show by Google Images. You can tune the number scroll_to_end(wd) print('Starting search for Images') # get all image thumbnail results thumbnail_results = wd.find_elements_by_css_selector("img.Q4LuWd") number_results = len(thumbnail_results) print(f"Found: {number_results} search results. Extracting links from {results_start}:{number_results}") if(results_start == number_results): print("results_start == number_results") break else: pass for img in thumbnail_results[results_start:max_links_to_fetch]: # try to click every thumbnail such that we can get the real image behind it print("Total Errors till now:", error_clicks) try: print('Trying to Click the Image') img.click() time.sleep(sleep_between_interactions) print('Image Click Successful!') except Exception: error_clicks = error_clicks + 1 print('ERROR: Unable to Click the Image') if(results_start < number_results): continue else: break results_start = results_start + 1 # extract image urls print('Extracting of Image URLs') actual_images = wd.find_elements_by_css_selector('img.n3VNCb') for actual_image in actual_images: if actual_image.get_attribute('src') and 'http' in actual_image.get_attribute('src'): image_urls.add(actual_image.get_attribute('src')) image_count = len(image_urls) print('Current Total Image Count:', image_count) if len(image_urls) >= max_links_to_fetch: print(f"Found: {len(image_urls)} image links, done!") break else: load_more_button = wd.find_element_by_css_selector(".mye4qd") if load_more_button: wd.execute_script("document.querySelector('.mye4qd').click();") results_start = len(thumbnail_results) return image_urls def persist_image(folder_path:str,file_name:str,url:str): try: image_content = requests.get(url).content except Exception as e: print(f"ERROR - Could not download {url} - {e}") try: image_file = io.BytesIO(image_content) image = Image.open(image_file).convert('RGB') folder_path = os.path.join(folder_path,file_name) if os.path.exists(folder_path): file_path = os.path.join(folder_path,hashlib.sha1(image_content).hexdigest()[:10] + '.jpg') else: os.mkdir(folder_path) file_path = os.path.join(folder_path,hashlib.sha1(image_content).hexdigest()[:10] + '.jpg') with open(file_path, 'wb') as f: image.save(f, "JPEG", quality=85) print(f"SUCCESS - saved {url} - as {file_path}") except Exception as e: print(f"ERROR - Could not save {url} - {e}") if __name__ == '__main__': ''' 使用方法: 在相同資料夾底下放置此程式和chromedriver.exe,並使用cmd執行指令撈取圖片 輸入格式: python google_image_scraping_script_for_arg.py 要搜尋的關鍵字 要抓取的圖片數量 範例: python google_image_scraping_script_for_arg.py 虎斑貓 30 python google_image_scraping_script_for_arg.py 石虎 50 ''' import sys import ast if len(sys.argv) == 3: query_name = sys.argv[1] number_of_picture = sys.argv[2] print("query_name:",query_name) #str print("number_of_picture:",number_of_picture) #str wd = webdriver.Chrome(executable_path=DRIVER_PATH) queries = [query_name] #change your set of queries here for query in queries: wd.get('https://google.com') search_box = wd.find_element_by_css_selector('input.gLFyf') search_box.send_keys(query) links = fetch_image_urls(query,int(number_of_picture),wd) # 200 denotes no. of images you want to download images_path = './' for i in links: persist_image(images_path,query,i) wd.quit() else: print("Error input format")
3.203125
3
pyslowloris/utils.py
goasdsdkai/daas
75
16566
""" MIT License Copyright (c) 2020 <NAME> Permission is hereby granted, free of charge, to any person obtaining a copy of this software and associated documentation files (the "Software"), to deal in the Software without restriction, including without limitation the rights to use, copy, modify, merge, publish, distribute, sublicense, and/or sell copies of the Software, and to permit persons to whom the Software is furnished to do so, subject to the following conditions: The above copyright notice and this permission notice shall be included in all copies or substantial portions of the Software. THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. """ import re url_pattern = re.compile( r"^(?:http)s?://" # http:// or https:// # domain... r"(?:(?:[A-Z0-9](?:[A-Z0-9-]{0,61}[A-Z0-9])?\.)" r"+(?:[A-Z]{2,6}\.?|[A-Z0-9-]{2,}\.?)|" r"localhost|" # localhost... r"\d{1,3}\.\d{1,3}\.\d{1,3}\.\d{1,3})" # ...or ip r"(?::\d+)?" # optional port r"(?:/?|[/?]\S+)$", re.IGNORECASE ) def validate_url(url: str) -> bool: return bool(url_pattern.match(url))
1.804688
2
brahe/data_models/geojson.py
duncaneddy/brahe
14
16567
<reponame>duncaneddy/brahe """The geojson module provides data model classes for initialization and storing of GeoJSON objects. """ import typing import typing_extensions import pydantic import numpy as np import brahe.astro as astro import brahe.coordinates as coords import brahe.frames as frames geographic_point = pydantic.conlist(float, min_items=2, max_items=3) class GeoJSONGeometry(pydantic.BaseModel): type: typing_extensions.Literal['Point', 'LineString', 'Polygon', 'MultiPoint', 'MultiLineString', 'MultiPolygon'] coordinates: typing.Union[geographic_point, typing.List[geographic_point], typing.List[typing.List[geographic_point]], typing.List[typing.List[typing.List[geographic_point]]]] = pydantic.Field(..., description='Geomtry Coordinates') class GeoJSONObject(pydantic.BaseModel): type: typing_extensions.Literal['Feature'] = pydantic.Field('Feature', description='GeoJSON Object type') geometry: GeoJSONGeometry = pydantic.Field('Feature', description='GeoJSON object type') properties: typing.Optional[dict] = pydantic.Field({}, description='Additional properties') @property def geotype(self): '''Return GeoJSON geometry type. Returns: str: GeoJSON geometry type ''' return self.geometry.type @property def num_points(self): '''Returns the number of unique points in the GeoJSON Object Returns: int: Number of points in object ''' if self.geometry.type == 'Point': return 1 elif self.geometry.type == 'LineString': return len(self.geometry.coordinates) elif self.geometry.type == 'Polygon': return len(self.geometry.coordinates[0]) - 1 else: raise NotImplementedError(f'Function not implemented for GeoJSON Geometry type: {self.geotype}') @property def center(self): '''Return center point of object. Given at [lon, lat] in degrees. Returns: np.ndarray: Center point of Geometry object. Units: [deg] ''' if self.geometry.type == 'Point': return np.array(self.geometry.coordinates) elif self.geometry.type == 'LineString': center = np.zeros(len(self.geometry.coordinates[0])) for idx in range(0, self.num_points): center += self.geometry.coordinates[0][idx]/self.num_points return center elif self.geometry.type == 'Polygon': center = np.zeros(len(self.geometry.coordinates[0][0])) for idx in range(0, self.num_points): center += np.array(self.geometry.coordinates[0][idx])/self.num_points return center else: raise NotImplementedError(f'Function not implemented for GeoJSON Geometry type: {self.geotype}') @property def center_ecef(self): '''Return center point of object. Given as ecef coordinates. Returns: np.ndarray: Center point of Geometry object in ECEF frame. Units: [m] ''' center = self.center # Ensure input has altitude if len(center) == 2: center = np.array([center[0], center[1], 0.0]) ecef = coords.sGEODtoECEF(center, use_degrees=True) # Convert point to ECEF frame return ecef @property def coordinates(self): '''Returns the coordinates of the GeoJSON Object. If polygon type the last point will be repeated. ''' if self.geometry.type == 'Point': pnt = self.geometry.coordinates if len(pnt) == 2: yield np.array([pnt[0], pnt[1], 0.0]) else: yield np.array(pnt) elif self.geometry.type == 'Polygon': if len(self.geometry.coordinates) > 1: raise RuntimeError('Polygon with multiple lines are not currently supported.') for idx in range(0, self.num_points + 1): pnt = self.geometry.coordinates[0][idx] if len(pnt) == 2: yield np.array([pnt[0], pnt[1], 0.0]) else: yield np.array(pnt) else: raise NotImplementedError(f'Function not implemented for GeoJSON Geometry type: {self.geotype}') @property def vertices(self): '''Returns the unique vertices of the GeoJSON Object. This ensures for polygon types the last point won't be repeated. ''' if self.geometry.type == 'Point': pnt = self.geometry.coordinates if len(pnt) == 2: yield np.array([pnt[0], pnt[1], 0.0]) else: yield np.array(pnt) elif self.geometry.type == 'Polygon': if len(self.geometry.coordinates) > 1: raise RuntimeError('Polygon with multiple lines are not currently supported.') for idx in range(0, self.num_points): pnt = self.geometry.coordinates[0][idx] if len(pnt) == 2: yield np.array([pnt[0], pnt[1], 0.0]) else: yield np.array(pnt) else: raise NotImplementedError(f'Function not implemented for GeoJSON Geometry type: {self.geotype}')
2.9375
3
lab7/7.7.py
rikudo765/algorithms
1
16568
<reponame>rikudo765/algorithms n = int(input()) lst = list(map(int, input().split())) def sort1(arr): l = len(arr) for i in range(1, n): cur = arr[i] pos = i check = False while pos > 0: if arr[pos - 1] > cur: check = True arr[pos] = arr[pos - 1] else: break pos -= 1 arr[pos] = cur if check: for j in range(len(arr)): print(arr[j], end=' ') print('') sort1(lst)
3.609375
4
CORE/engines/Gudmundsson_Constraint.py
geoffreynyaga/ostrich-project
15
16569
<filename>CORE/engines/Gudmundsson_Constraint.py #!/usr/bin/env python3 # -*- coding:utf-8 -*- ################################################################################## # File: c:\Projects\KENYA ONE PROJECT\CORE\engines\Gudmundsson_Constraint.py # # Project: c:\Projects\KENYA ONE PROJECT\CORE\engines # # Created Date: Thursday, January 9th 2020, 8:56:55 pm # # Author: <NAME> ( <<EMAIL>> ) # # ----- # # Last Modified: Thursday January 9th 2020 8:56:55 pm # # Modified By: <NAME> ( <<EMAIL>> ) # # ----- # # MIT License # # # # Copyright (c) 2020 KENYA ONE PROJECT # # # # Permission is hereby granted, free of charge, to any person obtaining a copy of# # this software and associated documentation files (the "Software"), to deal in # # the Software without restriction, including without limitation the rights to # # use, copy, modify, merge, publish, distribute, sublicense, and/or sell copies # # of the Software, and to permit persons to whom the Software is furnished to do # # so, subject to the following conditions: # # # # The above copyright notice and this permission notice shall be included in all # # copies or substantial portions of the Software. # # # # THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR # # IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, # # FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE # # AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER # # LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, # # OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE # # SOFTWARE. # # ----- # # Copyright (c) 2020 KENYA ONE PROJECT # ################################################################################## import sys sys.path.append("../") from CORE.API.db_API import write_to_db, read_from_db # type: ignore from math import sqrt, pi import numpy as np # type: ignore import matplotlib.pyplot as plt # type: ignore grossWeight = read_from_db("finalMTOW") cruiseSpeed = read_from_db("cruiseSpeed") ROC = read_from_db("rateOfClimb") * 3.28 * 60 vLof = read_from_db("stallSpeed") * 1.1 AR = read_from_db("AR") cdMin = read_from_db("cdMin") wsfromsizing = read_from_db("WS") rhoSL = read_from_db("rhoSL") propEff = read_from_db("propEff") cruiseAltitude: int = 10000 # ft gForce: float = 2.0 V_ROC: float = 80.0 groundRun: int = 900 serviceCeiling: int = 18000 wsInitial: float = 22.6 # lb/f**2 g: float = 32.174 CDto: float = 0.04 CLto: float = 0.5 groundFriction: float = 0.04 def oswaldEff(AR: float) -> float: e = (1.78 * (1 - (0.045 * AR ** 0.68))) - 0.64 return e e = oswaldEff(AR) k: float = 1 / (pi * AR * e) write_to_db("k", k) # dynamic pressure at altitude def rhoAlt(cruiseAltitude: int) -> float: rhoalt = rhoSL * (1 - 0.0000068756 * cruiseAltitude) ** 4.2561 return rhoalt rhoCruise = rhoAlt(cruiseAltitude) # print ('air density at cruise altitude, rho = ' +str(rhoCruise)) qAltitude = 0.5 * rhoCruise * (1.688 * cruiseSpeed) ** 2 # print('dynamic pressure at altitude = ' +str(qAltitude)) # Gag Ferrar Model def gagFerrar(bhp): "takes in bhp and returns normalised bhp" normBhp = bhp / (1.132 * (rhoCruise / rhoSL) - 0.132) return normBhp WS = np.arange(10, 30) twTurn = qAltitude * ((cdMin / WS) + k * (gForce / qAltitude) ** 2 * (WS)) qROC = 0.5 * rhoSL * (V_ROC * 1.688) ** 2 Vv = ROC / 60 twROC = (Vv / (V_ROC * 1.688)) + (qROC * cdMin / WS) + (k * WS / qROC) qVlof = 0.5 * rhoSL * (vLof * 1.688 / sqrt(2)) ** 2 twVlof = ( ((vLof * 1.688) ** 2 / (2 * g * groundRun)) + (qVlof * CDto / WS) + (groundFriction * (1 - (qVlof * CLto / WS))) ) rhoCeiling = rhoAlt(serviceCeiling) # print(rhoCeiling) twCruise = qAltitude * cdMin * (1 / WS) + (k) twCeiling = (1.667 / (np.sqrt((2 * WS / rhoCeiling) * sqrt(k / 3 * cdMin)))) + ( (k * cdMin / 3) * 4 ) plt.figure(1) plt.subplot(121) plt.plot(WS, twTurn, label="Rate of Turn") plt.plot(WS, twROC, label="Rate of Climb") plt.plot(WS, twVlof, label="Vlof") plt.plot(WS, twCruise, label="Cruise") plt.plot(WS, twCeiling, label="Ceiling") plt.axvline(x=wsfromsizing) plt.title(" Graph 1 \n HP/Weight ratio") plt.legend() # ax = plt.gca() # ax.set_xticklabels([]) ###NORMAlization norm_twTurn = gagFerrar((grossWeight * twTurn * 1.688 * cruiseSpeed / (propEff * 550))) test = grossWeight * twTurn * 1.688 * cruiseSpeed / (propEff * 550) norm_twROC = gagFerrar((grossWeight * twROC * 1.688 * V_ROC / (propEff * 550))) norm_twVlof = gagFerrar((grossWeight * twVlof * 1.688 * vLof / (propEff * 550))) norm_twCruise = gagFerrar( (grossWeight * twCruise * 1.688 * cruiseSpeed / (propEff * 550)) ) norm_twCeiling = gagFerrar( (grossWeight * twCeiling * 1.688 * cruiseSpeed / (propEff * 550)) ) plt.subplot(122) plt.plot(WS, norm_twTurn, label="Rate of Turn") plt.plot(WS, norm_twROC, label="Rate of Climb") plt.plot(WS, norm_twVlof, label="Vlof") plt.plot(WS, norm_twCruise, label="Cruise") plt.plot(WS, norm_twCeiling, label="Ceiling") plt.title("Graph 2 \n Normalised BHP") plt.legend() plt.axvline(x=wsfromsizing) plt.tight_layout() if __name__ == "__main__": plt.show() def find_nearest(array, value: float) -> int: idx = (np.abs(array - value)).argmin() return idx # print(find_nearest(ws, plotWS)) plotWS = read_from_db("WS") myidx = find_nearest(WS, plotWS) def point() -> float: cruiseidx = norm_twCruise[myidx] takeoffidx = norm_twVlof[myidx] climbidx = norm_twROC[myidx] turnidx = norm_twTurn[myidx] ceilingidx = norm_twCeiling[myidx] # print([cruiseidx,takeoffidx,climbidx,turnidx,ceilingidx]) # print (cruiseidx,"cruiseidx") x = np.array([cruiseidx, takeoffidx, climbidx, turnidx, ceilingidx]) return x[np.argmax(x)] finalBHP = point() write_to_db("finalBHP", finalBHP) print(finalBHP, "The Final normalised BHP") # now switch back to figure 1 and make some changes
1.335938
1
libs/blocks/tests/test_variable_filter.py
dendisuhubdy/attention-lvcsr
295
16570
<filename>libs/blocks/tests/test_variable_filter.py from nose.tools import raises from blocks.bricks import Bias, Linear, Logistic from blocks.bricks.parallel import Merge from blocks.filter import VariableFilter from blocks.graph import ComputationGraph from blocks.roles import BIAS, FILTER, PARAMETER, OUTPUT from theano import tensor def test_variable_filter(): # Creating computation graph brick1 = Linear(input_dim=2, output_dim=2, name='linear1') brick2 = Bias(2, name='bias1') activation = Logistic(name='sigm') x = tensor.vector() h1 = brick1.apply(x) h2 = activation.apply(h1) h2.name = "h2act" y = brick2.apply(h2) cg = ComputationGraph(y) parameters = [brick1.W, brick1.b, brick2.parameters[0]] bias = [brick1.b, brick2.parameters[0]] brick1_bias = [brick1.b] # Testing filtering by role role_filter = VariableFilter(roles=[PARAMETER]) assert parameters == role_filter(cg.variables) role_filter = VariableFilter(roles=[FILTER]) assert [] == role_filter(cg.variables) # Testing filtering by role using each_role flag role_filter = VariableFilter(roles=[PARAMETER, BIAS]) assert parameters == role_filter(cg.variables) role_filter = VariableFilter(roles=[PARAMETER, BIAS], each_role=True) assert not parameters == role_filter(cg.variables) assert bias == role_filter(cg.variables) # Testing filtering by bricks classes brick_filter = VariableFilter(roles=[BIAS], bricks=[Linear]) assert brick1_bias == brick_filter(cg.variables) # Testing filtering by bricks instances brick_filter = VariableFilter(roles=[BIAS], bricks=[brick1]) assert brick1_bias == brick_filter(cg.variables) # Testing filtering by brick instance brick_filter = VariableFilter(roles=[BIAS], bricks=[brick1]) assert brick1_bias == brick_filter(cg.variables) # Testing filtering by name name_filter = VariableFilter(name='W_norm') assert [cg.variables[2]] == name_filter(cg.variables) # Testing filtering by name regex name_filter_regex = VariableFilter(name_regex='W_no.?m') assert [cg.variables[2]] == name_filter_regex(cg.variables) # Testing filtering by theano name theano_name_filter = VariableFilter(theano_name='h2act') assert [cg.variables[11]] == theano_name_filter(cg.variables) # Testing filtering by theano name regex theano_name_filter_regex = VariableFilter(theano_name_regex='h2a.?t') assert [cg.variables[11]] == theano_name_filter_regex(cg.variables) # Testing filtering by application appli_filter = VariableFilter(applications=[brick1.apply]) variables = [cg.variables[1], cg.variables[8]] assert variables == appli_filter(cg.variables) # Testing filtering by application appli_filter_list = VariableFilter(applications=[brick1.apply]) assert variables == appli_filter_list(cg.variables) input1 = tensor.matrix('input1') input2 = tensor.matrix('input2') merge = Merge(['input1', 'input2'], [5, 6], 2) merged = merge.apply(input1, input2) merge_cg = ComputationGraph(merged) outputs = VariableFilter( roles=[OUTPUT], bricks=[merge])(merge_cg.variables) assert merged in outputs assert len(outputs) == 3 outputs_application = VariableFilter( roles=[OUTPUT], applications=[merge.apply])(merge_cg.variables) assert outputs_application == [merged] @raises(TypeError) def test_variable_filter_roles_error(): # Creating computation graph brick1 = Linear(input_dim=2, output_dim=2, name='linear1') x = tensor.vector() h1 = brick1.apply(x) cg = ComputationGraph(h1) # testing role error VariableFilter(roles=PARAMETER)(cg.variables) @raises(TypeError) def test_variable_filter_applications_error(): # Creating computation graph brick1 = Linear(input_dim=2, output_dim=2, name='linear1') x = tensor.vector() h1 = brick1.apply(x) cg = ComputationGraph(h1) VariableFilter(applications=brick1.apply)(cg.variables)
2.359375
2
techminer/gui/comparative_analysis.py
jdvelasq/techMiner
2
16571
<reponame>jdvelasq/techMiner from collections import Counter import pandas as pd import ipywidgets as widgets import techminer.core.dashboard as dash from techminer.core import ( CA, Dashboard, TF_matrix, TFIDF_matrix, add_counters_to_axis, clustering, corpus_filter, exclude_terms, ) #  from techminer.core.params import EXCLUDE_COLS from techminer.plots import counters_to_node_sizes, xy_clusters_plot from techminer.core.filter_records import filter_records ############################################################################### ## ## MODEL ## ############################################################################### class Model: def __init__( self, data, limit_to, exclude, years_range, clusters=None, cluster=None, ): ## if years_range is not None: initial_year, final_year = years_range data = data[(data.Year >= initial_year) & (data.Year <= final_year)] # # Filter for cluster members # if clusters is not None and cluster is not None: data = corpus_filter(data=data, clusters=clusters, cluster=cluster) self.data = data self.limit_to = limit_to self.exclude = exclude self.column = None self.min_occ = None self.max_items = None self.clustering_method = None self.n_clusters = None self.affinity = None self.linkage = None self.random_state = None self.top_n = None self.color_scheme = None self.x_axis = None self.y_axis = None self.width = None self.height = None def apply(self): ## ## Comparative analysis ## from https://tlab.it/en/allegati/help_en_online/mcluster.htm ## ## ## Computes TF matrix for terms in min_occurrence ## TF_matrix_ = TF_matrix( data=self.data, column=self.column, scheme="binary", min_occurrence=self.min_occ, ) ## ## Exclude Terms ## TF_matrix_ = exclude_terms(data=TF_matrix_, axis=1) ## ## Adds counter to axies ## TF_matrix_ = add_counters_to_axis( X=TF_matrix_, axis=1, data=self.data, column=self.column ) ## ## Computtes TFIDF matrix and select max_term frequent terms ## ## tf-idf = tf * (log(N / df) + 1) ## TFIDF_matrix_ = TFIDF_matrix( TF_matrix=TF_matrix_, norm=None, use_idf=True, smooth_idf=False, sublinear_tf=False, max_items=self.max_items, ) ## ## Correspondence Analysis ## 10 first factors for ploting ## ca = CA() ca.fit(TFIDF_matrix_) self.eigenvalues_ = ca.eigenvalues_[0:10] self.explained_variance_ = ca.explained_variance_[0:10] z = ca.principal_coordinates_rows_ z = z[z.columns[:10]] self.principal_coordinates_rows_ = z z = ca.principal_coordinates_cols_ z = z[z.columns[:10]] self.principal_coordinates_cols_ = z self.TF_matrix_ = TF_matrix_ self.TFIDF_matrix_ = TFIDF_matrix_ def ca_plot_of_keywords(self): self.apply() ## ## Selects the first n_factors to cluster ## X = pd.DataFrame( self.principal_coordinates_cols_, columns=["Dim-{}".format(i) for i in range(10)], index=self.TFIDF_matrix_.columns, ) return xy_clusters_plot( x=X["Dim-{}".format(self.x_axis)], y=X["Dim-{}".format(self.y_axis)], x_axis_at=0, y_axis_at=0, labels=self.TFIDF_matrix_.columns, node_sizes=counters_to_node_sizes(self.TFIDF_matrix_.columns), color_scheme=self.color_scheme, xlabel="Dim-{}".format(self.x_axis), ylabel="Dim-{}".format(self.y_axis), figsize=(self.width, self.height), ) def cluster_plot_of_keywords(self): self.apply() X = pd.DataFrame( self.principal_coordinates_cols_, columns=["Dim-{}".format(i) for i in range(10)], index=self.TFIDF_matrix_.columns, ) ( self.n_clusters, self.labels_, self.cluster_members_, self.cluster_centers_, self.cluster_names_, ) = clustering( X=X, method=self.clustering_method, n_clusters=self.n_clusters, affinity=self.affinity, linkage=self.linkage, random_state=self.random_state, top_n=self.top_n, name_prefix="Cluster {}", ) ## ## Cluster filters ## self.generate_cluster_filters( terms=X.index, labels=self.labels_, ) y = self.cluster_members_.copy() y = y.applymap(lambda w: pd.NA if w == "" else w) node_sizes = [500 + 2500 * len(y[m].dropna()) for m in y.columns] return xy_clusters_plot( x=self.cluster_centers_["Dim-{}".format(self.x_axis)], y=self.cluster_centers_["Dim-{}".format(self.y_axis)], x_axis_at=0, y_axis_at=0, labels=["CLUST_{} xxx".format(i) for i in range(self.n_clusters)], node_sizes=node_sizes, color_scheme=self.color_scheme, xlabel="Dim-{}".format(self.x_axis), ylabel="Dim-{}".format(self.y_axis), figsize=(self.width, self.height), ) def cluster_plot_of_documents(self): self.apply() X = pd.DataFrame( self.principal_coordinates_rows_, columns=["Dim-{}".format(i) for i in range(10)], index=[ "{} {}".format(i, i) for i in range(len(self.principal_coordinates_rows_)) ], ) ( self.n_clusters, self.labels_, self.cluster_members_, self.cluster_centers_, self.cluster_names_, ) = clustering( X=X, method=self.clustering_method, n_clusters=self.n_clusters, affinity=self.affinity, linkage=self.linkage, random_state=self.random_state, top_n=self.top_n, name_prefix="Cluster {}", ) ## ## Cluster filters ## self.generate_cluster_filters( terms=X.index, labels=self.labels_, ) y = self.cluster_members_.copy() y = y.applymap(lambda w: pd.NA if w == "" else w) node_sizes = [500 + 2500 * len(y[m].dropna()) for m in y.columns] return xy_clusters_plot( x=self.cluster_centers_["Dim-{}".format(self.x_axis)], y=self.cluster_centers_["Dim-{}".format(self.y_axis)], x_axis_at=0, y_axis_at=0, labels=["CLUST_{} xxx".format(i) for i in range(self.n_clusters)], node_sizes=node_sizes, color_scheme=self.color_scheme, xlabel="Dim-{}".format(self.x_axis), ylabel="Dim-{}".format(self.y_axis), figsize=(self.width, self.height), ) ############################################################################### ## ## DASHBOARD ## ############################################################################### COLUMNS = [ "Author_Keywords_CL", "Author_Keywords", "Index_Keywords_CL", "Index_Keywords", "Keywords_CL", ] class App(Dashboard, Model): def __init__( self, limit_to=None, exclude=None, years_range=None, ): data = filter_records(pd.read_csv("corpus.csv")) Model.__init__( self, data=data, limit_to=limit_to, exclude=exclude, years_range=years_range, ) #  COLUMNS = sorted( #   [column for column in sorted(data.columns) if column not in EXCLUDE_COLS] #  ) self.command_panel = [ dash.HTML("Display:", hr=False, margin="0px, 0px, 0px, 5px"), dash.Dropdown( options=[ "CA plot of keywords", "Cluster plot of keywords", "Cluster plot of documents", ], ), dash.HTML("Parameters:"), dash.Dropdown( description="Column:", options=sorted(data.columns), ), dash.min_occurrence(), dash.max_items(), dash.HTML("Clustering:"), dash.clustering_method(), dash.n_clusters(m=3, n=50, i=1), dash.affinity(), dash.linkage(), dash.random_state(), dash.HTML("Visualization:"), dash.top_n(m=10, n=51, i=5), dash.color_scheme(), dash.x_axis(), dash.y_axis(), dash.fig_width(), dash.fig_height(), ] # # interactive output function # widgets.interactive_output( f=self.interactive_output, controls={ # Display: "menu": self.command_panel[1], # Parameters: "column": self.command_panel[3], "min_occ": self.command_panel[4], "max_items": self.command_panel[5], # Clustering "clustering_method": self.command_panel[7], "n_clusters": self.command_panel[8], "affinity": self.command_panel[9], "linkage": self.command_panel[10], "random_state": self.command_panel[11], # Visualization "top_n": self.command_panel[13], "colors": self.command_panel[14], "x_axis": self.command_panel[15], "y_axis": self.command_panel[16], "width": self.command_panel[17], "height": self.command_panel[18], }, ) Dashboard.__init__(self) def interactive_output(self, **kwargs): Dashboard.interactive_output(self, **kwargs) def visualization_disabled(): self.set_disabled("Color Scheme:") self.set_disabled("X-axis:") self.set_disabled("Y-axis:") self.set_disabled("Width:") self.set_disabled("Height:") def visualization_enabled(): self.set_enabled("Color Scheme:") self.set_enabled("X-axis:") self.set_enabled("Y-axis:") self.set_enabled("Width:") self.set_enabled("Height:") def clustering_disabled(): self.set_disabled("N Factors:") self.set_disabled("Clustering Method:") self.set_disabled("N Clusters:") self.set_disabled("Affinity:") self.set_disabled("Linkage:") self.set_disabled("Random State:") def clustering_enabled(): self.set_enabled("N Factors:") self.set_enabled("Clustering Method:") self.set_enabled("N Clusters:") self.set_enabled("Affinity:") self.set_enabled("Linkage:") self.set_enabled("Random State:") self.enable_disable_clustering_options(include_random_state=True) if self.menu == "Correspondence analysis plot": clustering_disabled() visualization_enabled() if self.menu == "Cluster members": clustering_enabled() visualization_disabled() if self.menu == "Cluster plot": clustering_enabled() visualization_enabled() ############################################################################### ## ## EXTERNAL INTERFACE ## ############################################################################### def comparative_analysis( limit_to=None, exclude=None, years_range=None, ): return App( limit_to=limit_to, exclude=exclude, years_range=years_range, ).run()
2.234375
2
WayOfTheTurtle1.0.py
BYHu-2/-
2
16572
import sys from PyQt5.QtWidgets import * from PyQt5.QtCore import * from PyQt5.QtGui import * import qtawesome import matplotlib.pyplot as plt import csv import numpy as np import datetime import os class Stack: def __init__(self): self.items=[] def isEmpty(self): return self.items==[] def push(self,item): self.items.append(item) def peek(self): return self.items[len(self.items)-1] def pop(self): return self.items.pop() def size(self): return len(self.items) class MainUI(QMainWindow): def __init__(self): super().__init__() self.initUI() self.advice=[] self.stack=Stack() self.isLeftPressDown = False self.dragPosition = 0 self.Numbers = self.enum(UP=0, DOWN=1, LEFT=2, RIGHT=3, LEFTTOP=4, LEFTBOTTOM=5, RIGHTBOTTOM=6, RIGHTTOP=7,NONE=8) self.dir = self.Numbers.NONE self.setMouseTracking(True) def enum(self, **enums): return type('Enum', (), enums) def mouseReleaseEvent(self, event): if (event.button() == Qt.LeftButton): self.isLeftPressDown = False if (self.dir != self.Numbers.NONE): self.releaseMouse() def mousePressEvent(self, event): if (event.button() == Qt.LeftButton): self.isLeftPressDown = True if (self.dir != self.Numbers.NONE): self.mouseGrabber() else: self.dragPosition = event.globalPos() - self.frameGeometry().topLeft() def mouseMoveEvent(self, event): gloPoint = event.globalPos() rect = self.rect() tl = self.mapToGlobal(rect.topLeft()) rb = self.mapToGlobal(rect.bottomRight()) if (not self.isLeftPressDown): self.region(gloPoint) else: if (self.dir != self.Numbers.NONE): rmove = QRect(tl, rb) if (self.dir == self.Numbers.LEFT): if (rb.x() - gloPoint.x() <= self.minimumWidth()): rmove.setX(tl.x()) else: rmove.setX(gloPoint.x()) elif (self.dir == self.Numbers.RIGHT): rmove.setWidth(gloPoint.x() - tl.x()) elif (self.dir == self.Numbers.UP): if (rb.y() - gloPoint.y() <= self.minimumHeight()): rmove.setY(tl.y()) else: rmove.setY(gloPoint.y()) elif (self.dir == self.Numbers.DOWN): rmove.setHeight(gloPoint.y() - tl.y()) elif (self.dir == self.Numbers.LEFTTOP): if (rb.x() - gloPoint.x() <= self.minimumWidth()): rmove.setX(tl.x()) else: rmove.setX(gloPoint.x()) if (rb.y() - gloPoint.y() <= self.minimumHeight()): rmove.setY(tl.y()) else: rmove.setY(gloPoint.y()) elif (self.dir == self.Numbers.RIGHTTOP): rmove.setWidth(gloPoint.x() - tl.x()) rmove.setY(gloPoint.y()) elif (self.dir == self.Numbers.LEFTBOTTOM): rmove.setX(gloPoint.x()) rmove.setHeight(gloPoint.y() - tl.y()) elif (self.dir == self.Numbers.RIGHTBOTTOM): rmove.setWidth(gloPoint.x() - tl.x()) rmove.setHeight(gloPoint.y() - tl.y()) else: pass self.setGeometry(rmove) else: self.move(event.globalPos() - self.dragPosition) event.accept() def initUI(self): self.setFixedSize(1200,900) self.main_widget = QWidget() self.main_layout = QGridLayout() self.main_widget.setLayout(self.main_layout) self.left_widget = QWidget() self.left_widget.setObjectName('left_widget') self.left_layout = QGridLayout() self.left_widget.setLayout(self.left_layout) self.right_widget = QWidget() self.right_widget.setObjectName('right_widget') self.right_layout = QGridLayout() self.right_widget.setLayout(self.right_layout) self.main_layout.addWidget(self.left_widget,0,0,16,2) self.main_layout.addWidget(self.right_widget,0,2,16,9) self.setCentralWidget(self.main_widget) self.left_label_1 = QPushButton("参数设置") self.left_label_1.setObjectName('left_label') self.left_label_1.setEnabled(False) self.left_label_2 = QPushButton("图像显示") self.left_label_2.setObjectName('left_label') self.left_label_2.setEnabled(False) self.left_label_3 = QPushButton("帮助") self.left_label_3.setObjectName('left_label') self.left_label_3.setEnabled(False) self.left_button_1 = QPushButton(qtawesome.icon('fa.rmb', color='white'), "设置期初资金") self.left_button_1.setObjectName('left_button') self.left_button_1.clicked.connect(self.buttonDialog1) self.left_button_2 = QPushButton(qtawesome.icon('fa.hourglass-start', color='white'), "设置交易开始时间") self.left_button_2.setObjectName('left_button') self.left_button_2.clicked.connect(self.buttonDialog2) self.left_button_3 = QPushButton(qtawesome.icon('fa.hourglass-end', color='white'), "设置交易结束时间") self.left_button_3.setObjectName('left_button') self.left_button_3.clicked.connect(self.buttonDialog3) self.left_button_4 = QPushButton(qtawesome.icon('fa.line-chart', color='white'), "修改唐奇安通道") self.left_button_4.setObjectName('left_button') self.left_button_4.clicked.connect(self.buttonDialog4) self.left_button_5 = QPushButton(qtawesome.icon('fa.check-circle-o', color='white'), "修改ATR") self.left_button_5.setObjectName('left_button') self.left_button_5.clicked.connect(self.buttonDialog5) self.left_button_6 = QPushButton(qtawesome.icon('fa.pie-chart', color='white'), "修改手续费") self.left_button_6.setObjectName('left_button') self.left_button_6.clicked.connect(self.buttonDialog6) self.left_button_7 = QPushButton(qtawesome.icon('fa.sort-amount-asc', color='white'), "修改投资系数") self.left_button_7.setObjectName('left_button') self.left_button_7.clicked.connect(self.buttonDialog7) self.left_checkbox_1 = QCheckBox('策略收益') self.left_checkbox_1.setChecked(True) self.left_checkbox_2 = QCheckBox('沪深300') self.left_checkbox_2.setChecked(True) self.left_checkbox_3 = QCheckBox('仓位图') self.left_checkbox_3.setChecked(True) self.left_button_8 = QPushButton(qtawesome.icon('fa.question', color='white'), "专业名词含义查询") self.left_button_8.setObjectName('left_button') self.left_button_8.clicked.connect(self.buttonDialog8) self.left_button_9 = QPushButton(qtawesome.icon('fa.comment', color='white'), "反馈建议") self.left_button_9.setObjectName('left_button') self.left_button_9.clicked.connect(self.buttonDialog9) self.left_button_10 = QPushButton(qtawesome.icon('fa.envelope', color='white'), "联系我们") self.left_button_10.setObjectName('left_button') self.left_button_10.clicked.connect(self.buttonDialog10) self.left_layout.addWidget(self.left_label_1, 0, 0, 1, 3) self.left_layout.addWidget(self.left_button_1, 1, 0, 1, 3) self.left_layout.addWidget(self.left_button_2, 2, 0, 1, 3) self.left_layout.addWidget(self.left_button_3, 3, 0, 1, 3) self.left_layout.addWidget(self.left_button_4, 4, 0, 1, 3) self.left_layout.addWidget(self.left_button_5, 5, 0, 1, 3) self.left_layout.addWidget(self.left_button_6, 6, 0, 1, 3) self.left_layout.addWidget(self.left_button_7, 7, 0, 1, 3) self.left_layout.addWidget(self.left_label_2, 8, 0, 1, 3) self.left_layout.addWidget(self.left_checkbox_1, 9, 0, 1, 3) self.left_layout.addWidget(self.left_checkbox_2, 10, 0, 1, 3) self.left_layout.addWidget(self.left_checkbox_3, 11, 0, 1, 3) self.left_layout.addWidget(self.left_label_3, 12, 0, 1, 3) self.left_layout.addWidget(self.left_button_8, 13, 0, 1, 3) self.left_layout.addWidget(self.left_button_9, 14, 0, 1, 3) self.left_layout.addWidget(self.left_button_10, 15, 0, 1, 3) self.left_checkbox_1.setStyleSheet("QCheckBox{color:rgb(255,250,250)}") self.left_checkbox_2.setStyleSheet("QCheckBox{color:rgb(255,250,250)}") self.left_checkbox_3.setStyleSheet("QCheckBox{color:rgb(255,250,250)}") self.left_widget.setStyleSheet(''' QCheckBox{font-family: "Helvetica Neue", Helvetica, KaiTi, sans-serif; font-size:16px} QPushButton{border:none; color:white; text-align: left; font-family: "Helvetica Neue", Helvetica, KaiTi, sans-serif; font-size:16px} QPushButton#left_label{ border:none; border-bottom:1px solid white; font-size:20px; font-weight:700; font-family: "Helvetica Neue", Helvetica, KaiTi, sans-serif; } QPushButton#left_button:hover{border-left:4px solid blue;font-weight:700;} QWidget#left_widget{ background:gray; border-top:1px solid white; border-bottom:1px solid white; border-left:1px solid white; border-top-left-radius:10px; border-bottom-left-radius:10px; } ''') self.right_label_0 =QLabel('') self.right_label_1 = QLabel('期初资金') self.right_label_1.setAlignment(Qt.AlignCenter) self.right_label_1.setFont(QFont('KaiTi',12)) self.right_label_2 = QLabel('总资产') self.right_label_2.setAlignment(Qt.AlignCenter) self.right_label_2.setFont(QFont('KaiTi', 12)) self.right_label_3 = QLabel('累计盈亏') self.right_label_3.setAlignment(Qt.AlignCenter) self.right_label_3.setFont(QFont('KaiTi', 12)) self.right_label_4 = QLabel('可交易天数') self.right_label_4.setAlignment(Qt.AlignCenter) self.right_label_4.setFont(QFont('KaiTi', 12)) self.right_label_5 = QLabel('基准收益率') self.right_label_5.setAlignment(Qt.AlignCenter) self.right_label_5.setFont(QFont('KaiTi', 12)) self.right_label_6 = QLabel('年化收益率') self.right_label_6.setAlignment(Qt.AlignCenter) self.right_label_6.setFont(QFont('KaiTi', 12)) self.right_label_7 = QLabel('开始时间') self.right_label_7.setAlignment(Qt.AlignCenter) self.right_label_7.setFont(QFont('KaiTi', 12)) self.right_label_8 = QLabel('结束时间') self.right_label_8.setAlignment(Qt.AlignCenter) self.right_label_8.setFont(QFont('KaiTi', 12)) self.right_label_9 = QLabel('胜率') self.right_label_9.setAlignment(Qt.AlignCenter) self.right_label_9.setFont(QFont('KaiTi', 12)) self.right_layout.addWidget(self.right_label_0, 0, 3, 1, 3) self.right_layout.addWidget(self.right_label_1, 1, 3, 1, 1) self.right_layout.addWidget(self.right_label_2, 1, 4, 1, 1) self.right_layout.addWidget(self.right_label_3, 1, 5, 1, 1) self.right_layout.addWidget(self.right_label_4, 1, 6, 1, 1) self.right_layout.addWidget(self.right_label_5, 1, 7, 1, 1) self.right_layout.addWidget(self.right_label_6, 1, 8, 1, 1) self.right_layout.addWidget(self.right_label_7, 1, 9, 1, 1) self.right_layout.addWidget(self.right_label_8, 1, 10, 1, 1) self.right_layout.addWidget(self.right_label_9, 1, 11, 1, 1) self.right_lineEdit_1 = QLineEdit() self.right_lineEdit_1.setReadOnly(True) self.right_lineEdit_1.setText('') self.right_lineEdit_2 = QLineEdit() self.right_lineEdit_2.setReadOnly(True) self.right_lineEdit_2.setText('') self.right_lineEdit_3 = QLineEdit() self.right_lineEdit_3.setReadOnly(True) self.right_lineEdit_3.setText('') self.right_lineEdit_4 = QLineEdit() self.right_lineEdit_4.setReadOnly(True) self.right_lineEdit_4.setText('') self.right_lineEdit_5 = QLineEdit() self.right_lineEdit_5.setReadOnly(True) self.right_lineEdit_5.setText('') self.right_lineEdit_6 = QLineEdit() self.right_lineEdit_6.setReadOnly(True) self.right_lineEdit_6.setText('') self.right_lineEdit_7 = QLineEdit() self.right_lineEdit_7.setReadOnly(True) self.right_lineEdit_7.setText('') self.right_lineEdit_8 = QLineEdit() self.right_lineEdit_8.setReadOnly(True) self.right_lineEdit_8.setText('') self.right_lineEdit_9 = QLineEdit() self.right_lineEdit_9.setReadOnly(True) self.right_lineEdit_9.setText('') self.right_layout.addWidget(self.right_lineEdit_1, 2, 3, 1, 1) self.right_layout.addWidget(self.right_lineEdit_2, 2, 4, 1, 1) self.right_layout.addWidget(self.right_lineEdit_3, 2, 5, 1, 1) self.right_layout.addWidget(self.right_lineEdit_4, 2, 6, 1, 1) self.right_layout.addWidget(self.right_lineEdit_5, 2, 7, 1, 1) self.right_layout.addWidget(self.right_lineEdit_6, 2, 8, 1, 1) self.right_layout.addWidget(self.right_lineEdit_7, 2, 9, 1, 1) self.right_layout.addWidget(self.right_lineEdit_8, 2, 10, 1, 1) self.right_layout.addWidget(self.right_lineEdit_9, 2, 11, 1, 1) self.right_figure_1 = QLabel() self.figure_1 = QPixmap("猫咪老师4.png") self.right_figure_1.setPixmap(self.figure_1) self.right_figure_1.setScaledContents(True) self.right_figure_2 = QLabel() self.figure_2 = QPixmap("喵.png") self.right_figure_2.setPixmap(self.figure_2) self.right_figure_2.setScaledContents(True) self.right_layout.addWidget(self.right_figure_1, 3, 3, 7, 9) self.right_layout.addWidget(self.right_figure_2, 10, 3, 5, 9) self.right_button_1 = QPushButton(qtawesome.icon('fa.repeat', color='blue'), "测试/重测") self.right_button_1.clicked.connect(self.start) self.right_button_1.clicked.connect(self.tryOrRepeat1) self.right_button_1.clicked.connect(self.tryOrRepeat2) self.right_button_2 = QPushButton(qtawesome.icon('fa.floppy-o', color='gray'), "删除当前结果") self.right_button_2.clicked.connect(self.figuredelete) self.right_button_3 = QPushButton(qtawesome.icon('fa.times', color='red'), "退出") self.right_button_3.clicked.connect(self.quitApplicaton) self.right_layout.addWidget(self.right_button_1, 16, 3, 1, 3) self.right_layout.addWidget(self.right_button_2, 16, 6, 1, 3) self.right_layout.addWidget(self.right_button_3, 16, 9, 1, 3) self.right_widget.setStyleSheet(''' QWidget#right_widget{ color:#232C51; background:white; border-top:1px solid darkGray; border-bottom:1px solid darkGray; border-right:1px solid darkGray; border-top-right-radius:10px; border-bottom-right-radius:10px; } QLabel{ border:None; font-weight:700; font-size=25px; font-family: "Helvetica Neue", Helvetica, KaiTi, sans-serif; } QLineEdit{ font:bold; border:1px solid gray; width:300px; padding:2px 4px; background-color:rgb(255,250,250); selection-color:white; } QPushButton{font-family: "Helvetica Neue", Helvetica, KaiTi, sans-serif; font-size:16px} ''') self.setAttribute(Qt.WA_TranslucentBackground) self.setWindowFlag(Qt.FramelessWindowHint) self.main_layout.setSpacing(0) def buttonDialog1(self): self.dialog1 = QDialog() self.dialog1.setWindowIcon(QIcon("猫咪老师1.jpg")) self.dialog1.resize(250,100) self.dialog1.setWindowTitle('设置期初资金') formLayout = QFormLayout() label = QLabel('请输入您的期初资金(整数万元)') self.edit1 = QLineEdit() self.edit1.setValidator(QIntValidator()) self.edit1.setAlignment(Qt.AlignRight) self.edit1.setFont(QFont('Arial', 10)) button_ok = QPushButton('OK') button_ok.clicked.connect(self.okk1) button_cancel = QPushButton('Cancel') button_cancel.clicked.connect(self.cancel1) formLayout.addRow(label) formLayout.addRow(self.edit1) formLayout.addRow(button_ok, button_cancel) self.dialog1.setLayout(formLayout) self.dialog1.setStyleSheet(''' QPushButton{color:black;text-align: center;} QLabel{font-family: "Helvetica Neue", Helvetica, KaiTi, sans-serif;font-size:16px} QDialog{background:lightgray; border-top:1px solid royalblue; border-bottom:1px solid royalblue; border-left:1px solid royalblue; border-right:1px solid royalblue; border-top-left-radius:10px; border-bottom-left-radius:10px; border-top-right-radius:10px; border-bottom-right-radius:10px; } ''') self.dialog1.setWindowModality(Qt.ApplicationModal) self.dialog1.exec_() def okk1(self): if self.edit1.text() != '': global initial_cash global cash initial_cash=eval(self.edit1.text())*10000 self.dialog1.close() def cancel1(self): self.edit1.setText('') def buttonDialog2(self): self.dialog2 = QDialog() self.dialog2.setWindowIcon(QIcon("猫咪老师1.jpg")) self.dialog2.resize(280,100) self.dialog2.setWindowTitle('设置交易开始时间') formLayout = QFormLayout() label1 = QLabel('请输入您的交易开始时间') label2 = QLabel('时间格式示例:2011-03-01') label3 = QLabel('时间范围为2011-03-01至2021-04-01') self.edit2 = QLineEdit() self.edit2.setAlignment(Qt.AlignRight) self.edit2.setFont(QFont('Arial', 10)) button_ok = QPushButton('OK') button_ok.clicked.connect(self.okk2) button_cancel = QPushButton('Cancel') button_cancel.clicked.connect(self.cancel2) formLayout.addRow(label1) formLayout.addRow(label2) formLayout.addRow(label3) formLayout.addRow(self.edit2) formLayout.addRow(button_ok, button_cancel) self.dialog2.setLayout(formLayout) self.dialog2.setStyleSheet(''' QPushButton{color:black;text-align: center;} QLabel{font-family: "Helvetica Neue", Helvetica, KaiTi, sans-serif;font-size:16px} QDialog{background:lightgray; border-top:1px solid royalblue; border-bottom:1px solid royalblue; border-left:1px solid royalblue; border-right:1px solid royalblue; border-top-left-radius:10px; border-bottom-left-radius:10px; border-top-right-radius:10px; border-bottom-right-radius:10px; } ''') self.dialog2.setWindowModality(Qt.ApplicationModal) self.dialog2.exec_() def okk2(self): if self.edit2.text()!='': global start_time start_time=self.edit2.text() start_time = nearestdate(start_time, 1) self.dialog2.close() def cancel2(self): self.edit2.setText('') def buttonDialog3(self): self.dialog3 = QDialog() self.dialog3.setWindowIcon(QIcon("猫咪老师1.jpg")) self.dialog3.resize(280,100) self.dialog3.setWindowTitle('设置交易结束时间') formLayout = QFormLayout() label1 = QLabel('请输入您的交易结束时间') label2 = QLabel('时间格式示例:2021-04-01') label3 = QLabel('时间范围为2011-03-01至2021-04-01') self.edit3 = QLineEdit() self.edit3.setAlignment(Qt.AlignRight) self.edit3.setFont(QFont('Arial', 10)) button_ok = QPushButton('OK') button_ok.clicked.connect(self.okk3) button_cancel = QPushButton('Cancel') button_cancel.clicked.connect(self.cancel3) formLayout.addRow(label1) formLayout.addRow(label2) formLayout.addRow(label3) formLayout.addRow(self.edit3) formLayout.addRow(button_ok, button_cancel) self.dialog3.setLayout(formLayout) self.dialog3.setStyleSheet(''' QPushButton{color:black;text-align: center;} QLabel{font-family: "Helvetica Neue", Helvetica, KaiTi, sans-serif;font-size:16px} QDialog{background:lightgray; border-top:1px solid royalblue; border-bottom:1px solid royalblue; border-left:1px solid royalblue; border-right:1px solid royalblue; border-top-left-radius:10px; border-bottom-left-radius:10px; border-top-right-radius:10px; border-bottom-right-radius:10px; } ''') self.dialog3.setWindowModality(Qt.ApplicationModal) self.dialog3.exec_() def okk3(self): if self.edit3.text()!='': global end_time end_time=self.edit3.text() end_time = nearestdate(end_time, -1) self.dialog3.close() def cancel3(self): self.edit3.setText('') def buttonDialog4(self): self.dialog4 = QDialog() self.dialog4.setWindowIcon(QIcon("猫咪老师1.jpg")) self.dialog4.resize(280,100) self.dialog4.setWindowTitle('修改唐奇安通道') formLayout = QFormLayout() label = QLabel('唐奇安通道修改为(5~50):') self.edit4 = QLineEdit('20') self.edit4.setReadOnly(True) self.edit4.setAlignment(Qt.AlignRight) self.edit4.setFont(QFont('Arial', 10)) self.slider1 = QSlider(Qt.Horizontal) self.slider1.setMinimum(5) self.slider1.setMaximum(50) self.slider1.setSingleStep(1) self.slider1.setValue(20) self.slider1.setTickPosition(QSlider.TicksBelow) self.slider1.setTickInterval(1) self.slider1.valueChanged.connect(self.valueChange1) button_ok = QPushButton('OK') button_ok.clicked.connect(self.okk4) button_cancel = QPushButton('Cancel') button_cancel.clicked.connect(self.cancel4) formLayout.addRow(label) formLayout.addRow(self.edit4) formLayout.addRow(self.slider1) formLayout.addRow(button_ok, button_cancel) self.dialog4.setLayout(formLayout) self.dialog4.setStyleSheet(''' QPushButton{color:black;text-align: center;} QLabel{font-family: "Helvetica Neue", Helvetica, KaiTi, sans-serif;font-size:16px} QDialog{background:lightgray; border-top:1px solid royalblue; border-bottom:1px solid royalblue; border-left:1px solid royalblue; border-right:1px solid royalblue; border-top-left-radius:10px; border-bottom-left-radius:10px; border-top-right-radius:10px; border-bottom-right-radius:10px; } ''') self.dialog4.setWindowModality(Qt.ApplicationModal) self.dialog4.exec_() def okk4(self): global Dontime Dontime=int(self.edit4.text()) self.dialog4.close() def cancel4(self): self.slider1.setValue(20) def valueChange1(self): self.edit4.setText('%d'%self.slider1.value()) def buttonDialog5(self): self.dialog5 = QDialog() self.dialog5.setWindowIcon(QIcon("猫咪老师1.jpg")) self.dialog5.resize(250,100) self.dialog5.setWindowTitle('修改ATR') formLayout = QFormLayout() label = QLabel('ATR修改为(5~50):') self.edit5 = QLineEdit('20') self.edit5.setReadOnly(True) self.edit5.setAlignment(Qt.AlignRight) self.edit5.setFont(QFont('Arial', 10)) self.slider2 = QSlider(Qt.Horizontal) self.slider2.setMinimum(5) self.slider2.setMaximum(50) self.slider2.setSingleStep(1) self.slider2.setValue(20) self.slider2.setTickPosition(QSlider.TicksBelow) self.slider2.setTickInterval(1) self.slider2.valueChanged.connect(self.valueChange2) button_ok = QPushButton('OK') button_ok.clicked.connect(self.okk5) button_cancel = QPushButton('Cancel') button_cancel.clicked.connect(self.cancel5) formLayout.addRow(label) formLayout.addRow(self.edit5) formLayout.addRow(self.slider2) formLayout.addRow(button_ok, button_cancel) self.dialog5.setLayout(formLayout) self.dialog5.setStyleSheet(''' QPushButton{color:black;text-align: center;} QLabel{font-family: "Helvetica Neue", Helvetica, KaiTi, sans-serif;font-size:16px} QDialog{background:lightgray; border-top:1px solid royalblue; border-bottom:1px solid royalblue; border-left:1px solid royalblue; border-right:1px solid royalblue; border-top-left-radius:10px; border-bottom-left-radius:10px; border-top-right-radius:10px; border-bottom-right-radius:10px; } ''') self.dialog5.setWindowModality(Qt.ApplicationModal) self.dialog5.exec_() def okk5(self): global atrtime atrtime=int(self.edit5.text()) self.dialog5.close() def cancel5(self): self.slider2.setValue(20) def valueChange2(self): self.edit5.setText('%d'%self.slider2.value()) def buttonDialog6(self): self.dialog6 = QDialog() self.dialog6.setWindowIcon(QIcon("猫咪老师1.jpg")) self.dialog6.resize(280,100) self.dialog6.setWindowTitle('修改手续费') formLayout = QFormLayout() label = QLabel('修改手续费为(单位:万分之一):') self.edit6 = QLineEdit('1') self.edit6.setValidator(QIntValidator()) self.edit6.setAlignment(Qt.AlignRight) self.edit6.setFont(QFont('Arial', 10)) button_ok = QPushButton('OK') button_ok.clicked.connect(self.okk6) button_cancel = QPushButton('Cancel') button_cancel.clicked.connect(self.cancel6) formLayout.addRow(label) formLayout.addRow(self.edit6) formLayout.addRow(button_ok, button_cancel) self.dialog6.setLayout(formLayout) self.dialog6.setStyleSheet(''' QPushButton{color:black;text-align: center;} QLabel{font-family: "Helvetica Neue", Helvetica, KaiTi, sans-serif;font-size:16px} QDialog{background:lightgray; border-top:1px solid royalblue; border-bottom:1px solid royalblue; border-left:1px solid royalblue; border-right:1px solid royalblue; border-top-left-radius:10px; border-bottom-left-radius:10px; border-top-right-radius:10px; border-bottom-right-radius:10px; } ''') self.dialog6.setWindowModality(Qt.ApplicationModal) self.dialog6.exec_() def okk6(self): if self.edit6.text() != '': global backtest_commission_ratio backtest_commission_ratio=eval(self.edit6.text())/10000 self.dialog6.close() def cancel6(self): self.edit6.setText('1') def buttonDialog7(self): self.dialog7 = QDialog() self.dialog7.setWindowIcon(QIcon("猫咪老师1.jpg")) self.dialog7.resize(280,100) self.dialog7.setWindowTitle('修改投资系数') formLayout = QFormLayout() label = QLabel('修改投资系数为(单位:百分之一):') self.edit7 = QLineEdit('1') self.edit7.setAlignment(Qt.AlignRight) self.edit7.setFont(QFont('Arial', 10)) button_ok = QPushButton('OK') button_ok.clicked.connect(self.okk7) button_cancel = QPushButton('Cancel') button_cancel.clicked.connect(self.cancel7) formLayout.addRow(label) formLayout.addRow(self.edit7) formLayout.addRow(button_ok, button_cancel) self.dialog7.setLayout(formLayout) self.dialog7.setStyleSheet(''' QPushButton{color:black;text-align: center;} QLabel{font-family: "Helvetica Neue", Helvetica, KaiTi, sans-serif;font-size:16px} QDialog{background:lightgray; border-top:1px solid royalblue; border-bottom:1px solid royalblue; border-left:1px solid royalblue; border-right:1px solid royalblue; border-top-left-radius:10px; border-bottom-left-radius:10px; border-top-right-radius:10px; border-bottom-right-radius:10px; } ''') self.dialog7.setWindowModality(Qt.ApplicationModal) self.dialog7.exec_() def okk7(self): if self.edit7.text() != '': global unit_rate unit_rate=eval(self.edit7.text())/100 self.dialog7.close() def cancel7(self): self.edit7.setText('1') def buttonDialog8(self): self.dialog8 = QDialog() self.dialog8.setWindowIcon(QIcon("猫咪老师1.jpg")) self.dialog8.resize(280,100) self.dialog8.setWindowTitle('专业名词含义查询') layout=QVBoxLayout() self.label = QLabel('请选择专业名词:') self.cb = QComboBox() self.cb.addItems(['唐奇安通道', 'ATR', '投资系数', '基准收益率','年化收益率']) self.cb.currentIndexChanged.connect(self.selectionChange) layout.addWidget(self.label) layout.addWidget(self.cb) self.dialog8.setLayout(layout) self.dialog8.setStyleSheet(''' QLabel{font-family: "Helvetica Neue", Helvetica, KaiTi, sans-serif;font-size:16px} QComboBox{font-family: "Helvetica Neue", Helvetica, KaiTi, sans-serif;font-size:16px} QDialog{background:lightgray; border-top:1px solid royalblue; border-bottom:1px solid royalblue; border-left:1px solid royalblue; border-right:1px solid royalblue; border-top-left-radius:10px; border-bottom-left-radius:10px; border-top-right-radius:10px; border-bottom-right-radius:10px; } ''') self.dialog8.setWindowModality(Qt.ApplicationModal) self.dialog8.exec_() def selectionChange(self,i): dict0={'唐奇安通道':"唐奇安通道主要是一个突破型趋势跟踪指标,可以提供两种不同的突破信号", 'ATR':"ATR是日内指数最大波动的平均振幅,由当日最高、最低价和上一交易日的收盘价决定", '投资系数':"每一次开仓交易合约数unit的确定是将总资产的投资系数除以价值波动量得到", '基准收益率':"默认沪深300指数收益",'年化收益率':"年化收益率是指投资期限为一年的收益率"} self.label.setText('%s'%dict0[self.cb.currentText()]) def buttonDialog9(self): self.dialog9 = QDialog() self.dialog9.setWindowIcon(QIcon("猫咪老师1.jpg")) self.dialog9.resize(250,100) self.dialog9.setWindowTitle('反馈建议') formlayout=QFormLayout() label = QLabel('您的反馈与建议是:') self.edit9 = QTextEdit('') self.edit9.setAlignment(Qt.AlignLeft) self.edit9.setFont(QFont('KaiTi', 10)) button_ok = QPushButton('OK') button_ok.clicked.connect(self.okk9) button_cancel = QPushButton('Cancel') button_cancel.clicked.connect(self.cancel9) formlayout.addRow(label) formlayout.addRow(self.edit9) formlayout.addRow(button_ok,button_cancel) self.dialog9.setLayout(formlayout) self.dialog9.setStyleSheet(''' QPushButton{color:black;text-align: center;} QLabel{font-family: "Helvetica Neue", Helvetica, KaiTi, sans-serif;font-size:16px} QDialog{background:lightgray; border-top:1px solid royalblue; border-bottom:1px solid royalblue; border-left:1px solid royalblue; border-right:1px solid royalblue; border-top-left-radius:10px; border-bottom-left-radius:10px; border-top-right-radius:10px; border-bottom-right-radius:10px; } ''') self.dialog9.setWindowModality(Qt.ApplicationModal) self.dialog9.exec_() def okk9(self): QMessageBox.about(self,'感谢','感谢您的反馈与建议!基于您的反馈与建议,我们会努力做得更好!') self.dialog9.close() def cancel9(self): self.edit9.setText('') def buttonDialog10(self): self.dialog10 = QDialog() self.dialog10.setWindowIcon(QIcon("猫咪老师1.jpg")) self.dialog10.resize(250,150) self.dialog10.setWindowTitle('联系我们') layout=QVBoxLayout() label1 = QLabel('欢迎您来信联系我们!') label2 = QLabel('我们的邮箱是:') label5 = QLabel('<EMAIL>') label6 = QLabel('<EMAIL>') label7 = QLabel('<EMAIL>') label3 = QLabel('') label3.setOpenExternalLinks(True) label3.setText("<A href='https://mail.163.com/'>网易邮箱</a>") label3.setAlignment(Qt.AlignCenter) label3.setToolTip('点击进入网易邮箱主页') label4 = QLabel('') label4.setOpenExternalLinks(True) label4.setText("<A href='https://mail.qq.com/'>QQ邮箱</a>") label4.setAlignment(Qt.AlignCenter) label4.setToolTip('点击进入QQ邮箱主页') layout.addWidget(label1) layout.addWidget(label2) layout.addWidget(label5) layout.addWidget(label6) layout.addWidget(label7) layout.addWidget(label3) layout.addWidget(label4) self.dialog10.setLayout(layout) self.dialog10.setStyleSheet(''' QLabel{font-family: "Helvetica Neue", Helvetica, KaiTi, sans-serif;font-size:16px} QDialog{background:lightgray; border-top:1px solid royalblue; border-bottom:1px solid royalblue; border-left:1px solid royalblue; border-right:1px solid royalblue; border-top-left-radius:10px; border-bottom-left-radius:10px; border-top-right-radius:10px; border-bottom-right-radius:10px; } ''') self.dialog10.setWindowModality(Qt.ApplicationModal) self.dialog10.exec_() def tryOrRepeat1(self): if self.left_checkbox_1.isChecked() or self.left_checkbox_2.isChecked(): plt.figure() plt.title('Asset-Time') if self.left_checkbox_1.isChecked(): plt.plot(xs, l_asset, linestyle='-', color='firebrick', linewidth=1.5, label='Asset') if self.left_checkbox_2.isChecked(): plt.plot(xs, l_index, linestyle='-', color='royalblue', linewidth=1, label='Index') plt.plot(xs, l_initial, linestyle='--', color='black', label='Initial') plt.xlabel('Time') plt.ylabel('Asset') plt.gcf().autofmt_xdate() plt.legend() plt.rcParams['figure.figsize'] = (9.0, 4.0) theTime1=datetime.datetime.now() figure_1_name='figure_1'+str(theTime1)+'.png' figure_1_name = ''.join(figure_1_name.split(':')) self.stack.push(figure_1_name) plt.savefig(figure_1_name,dpi=300,bbox_inches='tight') plt.close() self.figure_1=QPixmap(figure_1_name) self.right_figure_1.setPixmap(self.figure_1) else: self.figure_1 = QPixmap("猫咪老师4.png") self.right_figure_1.setPixmap(self.figure_1) def tryOrRepeat2(self): if self.left_checkbox_3.isChecked(): plt.figure() plt.title('Long/Short-Time') long_tem = [] short_tem = [] initial_bar = [] for i in range(len(position_long)-1): long_tem.append(position_long[i][1]) short_tem.append(-position_short[i][1]) initial_bar.append(0) plt.bar(xs, long_tem,linestyle='-', color='firebrick', linewidth=1, label='long') plt.bar(xs, short_tem,linestyle='-', color='royalblue', linewidth=1, label='short') plt.plot(xs, initial_bar, linestyle='--', color='black', label='Initial') plt.xlabel('Time') plt.ylabel('') plt.gcf().autofmt_xdate() plt.legend() plt.rcParams['figure.figsize'] = (9.0, 4.0) theTime2 = datetime.datetime.now() figure_2_name = 'figure_2' + str(theTime2) + '.png' figure_2_name = ''.join(figure_2_name.split(':')) self.stack.push(figure_2_name) plt.savefig(figure_2_name, dpi=300, bbox_inches='tight') plt.close() self.figure_2 = QPixmap(figure_2_name) self.right_figure_2.setPixmap(self.figure_2) else: self.figure_2 = QPixmap("喵.png") self.right_figure_2.setPixmap(self.figure_2) def quitApplicaton(self): app = MainUI.instance() app.quit() def figuredelete(self): figure_1_delete=self.stack.pop() figure_2_delete = self.stack.pop() os.remove(figure_1_delete) os.remove(figure_2_delete) self.right_button_2.setEnabled(False) def start(self): global time global date global winningRate global baseline global annualized_rate global xs global l_initial global position_long global position_short global l_time global l_asset global l_index self.right_button_2.setEnabled(True) position_long = [] position_short = [] for n in range(finddatepos(start_time), finddatepos(end_time) + 1): position_long.append([result[n][0], 0]) position_short.append([result[n][0], 0]) cash.append([result[n][0], 0]) cash[0][1] = initial_cash start_date_position = finddatepos(start_time) end_date_position = finddatepos(end_time) for d in range(start_date_position + 1, end_date_position + 1): on_bar(result[d][0], atrtime) in_bar(result[d][0], atrtime) l_time = [] l_asset = [] l_index = [] time = 0 for d in range(start_date_position + 1, end_date_position + 1): time += 1 l_time.append(result[d][0]) l_asset.append(current_asset(result[d][0])) l_index.append(result[d][4] * initial_cash / result[start_date_position + 1][4]) if position_short[time][1] != position_short[time - 1][1] or position_long[time][1] != \ position_long[time - 1][1]: date += 1 if current_asset(result[d][0]) >= current_asset(result[d - 1][0]): winningRate += 1 winningRate /= date baseline = (l_index[-1] / l_index[0]) - 1 d1 = datetime.datetime(int(start_time.split('-')[0]), int(start_time.split('-')[1]), int(start_time.split('-')[2])) d2 = datetime.datetime(int(end_time.split('-')[0]), int(end_time.split('-')[1]), int(end_time.split('-')[2])) interval = d2 - d1 annualized_rate = ((current_asset(end_time) / current_asset(start_time)) - 1) * 365 / interval.days xs =[] xs = [datetime.datetime.strptime(d, '%Y-%m-%d').date() for d in l_time] l_initial = [] l_initial = [initial_cash] * (end_date_position - start_date_position) self.right_lineEdit_1.setText('%d' % int(initial_cash)) self.right_lineEdit_2.setText('%d' % int(current_asset(end_time))) self.right_lineEdit_3.setText('%d' % int(current_asset(end_time)-initial_cash)) self.right_lineEdit_4.setText('%d' % date) baseline0 = baseline * 100 self.right_lineEdit_5.setText('%.2f' % baseline0 + '%') annualized_rate0 = annualized_rate * 100 self.right_lineEdit_6.setText('%.2f' % annualized_rate0 + '%') self.right_lineEdit_7.setText('%s' % start_time) self.right_lineEdit_8.setText('%s' % end_time) winningRate0 = winningRate * 100 self.right_lineEdit_9.setText('%.2f' % winningRate0 + '%') def main(): app = QApplication(sys.argv) gui = MainUI() gui.show() sys.exit(app.exec_()) def finddatepos(date): i = 0 while result[i][0] != date: i += 1 return i def calAtr(result, start_time, end_time, tr_list): # Calculate atr counter = 0 atr_list = [] for i in range(1, len(result)-1): if result[i][0] == start_time: counter = 1 if counter == 1: tr = max(float(result[i][2])-float(result[i][3]), float(result[i][2])-float(result[i-1][4]), float(result[i-1][4])-float(result[i][3])) tr_list.append([result[i][0], tr]) atr_list.append(tr) if result[i][0] == end_time: counter = 0 atr = int(np.floor(np.mean(atr_list))) atr_half = int(np.floor(0.5 * atr)) return [atr, atr_half] def calDon(result, time, atr_half, Dontime = 30): # Calculate Donchian tunnel for i in range(Dontime, len(result)-1): high_list = [] low_list = [] if result[i][0] == time: for j in range(i-Dontime, i): high_list.append(result[j][2]) low_list.append(result[j][3]) don_open = np.max(high_list) don_close = np.min(low_list) short_add_point = don_close - atr_half short_stop_loss = don_close + atr_half long_add_point = don_open + atr_half long_stop_loss = don_open - atr_half return [long_add_point, long_stop_loss, short_add_point, short_stop_loss] def on_bar(date, atrtime = 10): i = 0 while result[i][0] != date: i += 1 yesterday = result[i-1][0] startatrday = result[i-atrtime][0] open = result[i][1] atr = calAtr(result, startatrday, yesterday, tr_list)[0] atr_half = calAtr(result, startatrday, yesterday, tr_list)[1] Donlst = calDon(result, date, atr_half) long_add_point = Donlst[0] long_stop_loss = Donlst[1] short_add_point = Donlst[2] short_stop_loss = Donlst[3] date_pos = 0 while cash[date_pos][0] != date: date_pos += 1 position_long[date_pos][1] = position_long[date_pos - 1][1] position_short[date_pos][1] = position_short[date_pos - 1][1] cash[date_pos][1] = cash[date_pos - 1][1] if position_long[date_pos][1] == 0 and position_short[date_pos][1] == 0: if open > long_add_point - atr_half: # 如果向上突破唐奇安通道,则开多 if cash[date_pos][1] >= (1 + backtest_commission_ratio) * open * unit(current_asset(yesterday),yesterday): position_long[date_pos][1] = unit(current_asset(yesterday),yesterday) print(date, '开多仓%.1f'%(unit(current_asset(yesterday),yesterday))) cash[date_pos][1] -= (1 + backtest_commission_ratio) * open * unit(current_asset(yesterday),yesterday) else: position_long[date_pos][1] = cash[date_pos][1] / (1 + backtest_commission_ratio) / open print(date, '开多仓%.1f'%(cash[date_pos][1] / (1 + backtest_commission_ratio) / open)) cash[date_pos][1] = 0 if open < short_add_point + atr_half: # 如果向下突破唐奇安通道,则开空 position_short[date_pos][1] = unit(current_asset(yesterday),yesterday) print(date, '开空仓%.1f'%(unit(current_asset(yesterday),yesterday))) cash[date_pos][1] += (1 - backtest_commission_ratio) * open * unit(current_asset(yesterday),yesterday) if position_long[date_pos][1] != 0: if open > long_add_point: # 当突破1/2atr时加仓 if cash[date_pos][1] >= (1 + backtest_commission_ratio) * open * unit(current_asset(yesterday), yesterday): position_long[date_pos][1] += unit(current_asset(yesterday),yesterday) print(date, '继续加仓%.1f'%(unit(current_asset(yesterday),yesterday))) cash[date_pos][1] -= (1 + backtest_commission_ratio) * open * unit(current_asset(yesterday), yesterday) else: position_long[date_pos][1] += cash[date_pos][1] / (1 + backtest_commission_ratio) / open print(date, '继续加仓%.1f' % (cash[date_pos][1] / (1 + backtest_commission_ratio) / open)) cash[date_pos][1] = 0 if open < long_stop_loss: # 持多仓,止损位计算 if position_long[date_pos][1] - unit(current_asset(yesterday),yesterday) >= 0: print(date, '平多仓%.1f'%(unit(current_asset(yesterday),yesterday))) cash[date_pos][1] += (1 - backtest_commission_ratio) * open * unit(current_asset(yesterday), yesterday) else: print(date, '平多仓%.1f' % (position_long[date_pos][1])) cash[date_pos][1] += (1 - backtest_commission_ratio) * position_long[date_pos][1] * open position_long[date_pos][1] = max(position_long[date_pos][1] - unit(current_asset(yesterday),yesterday), 0) '''print(date, '平多仓%.1f'%(position_long[date_pos][1])) cash[date_pos][1] += (1 - backtest_commission_ratio) * open * position_long[date_pos][1] position_long[date_pos][1] = 0''' if position_short[date_pos][1] != 0: if open < short_add_point: # 当突破1/2atr时加仓 position_short[date_pos][1] += unit(current_asset(yesterday),yesterday) print(date, '继续加仓%.1f'%(unit(current_asset(yesterday),yesterday))) cash[date_pos][1] += (1 - backtest_commission_ratio) * open * unit(current_asset(yesterday), yesterday) if open > short_stop_loss: # 持空仓,止损位计算 m = min(position_short[date_pos][1] * open, open * unit(current_asset(yesterday),yesterday), cash[date_pos][1] / (1 + backtest_commission_ratio)) print(date, '平空仓%.1f'%(m / open)) cash[date_pos][1] -= (1 + backtest_commission_ratio) * m position_short[date_pos][1] = position_short[date_pos][1] - m / open '''m = position_short[date_pos][1] * open print(date, '平空仓%.1f'%(m / open)) cash[date_pos][1] -= (1 + backtest_commission_ratio) * m position_short[date_pos][1] = position_short[date_pos][1] - m / open''' def in_bar(date, atrtime = 10): i = 0 while result[i][0] != date: i += 1 yesterday = result[i-1][0] startatrday = result[i-atrtime][0] close = result[i][4] atr = calAtr(result, startatrday, yesterday, tr_list)[0] atr_half = calAtr(result, startatrday, yesterday, tr_list)[1] Donlst = calDon(result, date, atr_half) long_add_point = Donlst[0] long_stop_loss = Donlst[1] short_add_point = Donlst[2] short_stop_loss = Donlst[3] date_pos = 0 while cash[date_pos][0] != date: date_pos += 1 if position_long[date_pos][1] == 0 and position_short[date_pos][1] == 0: if close > long_add_point - atr_half: # 如果向上突破唐奇安通道,则开多 if cash[date_pos][1] >= (1 + backtest_commission_ratio) * close * unit(current_asset(yesterday),yesterday): position_long[date_pos][1] = unit(current_asset(yesterday),yesterday) print(date, '开多仓%.1f'%(unit(current_asset(yesterday),yesterday))) cash[date_pos][1] -= (1 + backtest_commission_ratio) * close * unit(current_asset(yesterday),yesterday) else: position_long[date_pos][1] = cash[date_pos][1] / (1 + backtest_commission_ratio) / close print(date, '开多仓%.1f'%(cash[date_pos][1] / (1 + backtest_commission_ratio) / close)) cash[date_pos][1] = 0 if close < short_add_point + atr_half: # 如果向下突破唐奇安通道,则开空 position_short[date_pos][1] = unit(current_asset(yesterday),yesterday) print(date, '开空仓%.1f'%(unit(current_asset(yesterday),yesterday))) cash[date_pos][1] += (1 - backtest_commission_ratio) * close * unit(current_asset(yesterday),yesterday) if position_long[date_pos][1] != 0: if close > long_add_point: # 当突破1/2atr时加仓 if cash[date_pos][1] >= (1 + backtest_commission_ratio) * close * unit(current_asset(yesterday), yesterday): position_long[date_pos][1] += unit(current_asset(yesterday),yesterday) print(date, '继续加仓%.1f'%(unit(current_asset(yesterday),yesterday))) cash[date_pos][1] -= (1 + backtest_commission_ratio) * close * unit(current_asset(yesterday), yesterday) else: position_long[date_pos][1] += cash[date_pos][1] / (1 + backtest_commission_ratio) / close print(date, '继续加仓%.1f' % (cash[date_pos][1] / (1 + backtest_commission_ratio) / close)) cash[date_pos][1] = 0 if close < long_stop_loss: # 持多仓,止损位计算 if position_long[date_pos][1] - unit(current_asset(yesterday),yesterday) >= 0: print(date, '平多仓%.1f'%(unit(current_asset(yesterday),yesterday))) cash[date_pos][1] += (1 - backtest_commission_ratio) * close * unit(current_asset(yesterday), yesterday) else: print(date, '平多仓%.1f' % (position_long[date_pos][1])) cash[date_pos][1] += (1 - backtest_commission_ratio) * position_long[date_pos][1] * close position_long[date_pos][1] = max(position_long[date_pos][1] - unit(current_asset(yesterday),yesterday), 0) '''print(date, '平多仓%.1f'%(position_long[date_pos][1])) cash[date_pos][1] += (1 - backtest_commission_ratio) * close * position_long[date_pos][1] position_long[date_pos][1] = 0''' if position_short[date_pos][1] != 0: if close < short_add_point: # 当突破1/2atr时加仓 position_short[date_pos][1] += unit(current_asset(yesterday),yesterday) print(date, '继续加仓%.1f'%(unit(current_asset(yesterday),yesterday))) cash[date_pos][1] += (1 - backtest_commission_ratio) * close * unit(current_asset(yesterday), yesterday) if close > short_stop_loss: # 持空仓,止损位计算 m = min(position_short[date_pos][1] * close, close * unit(current_asset(yesterday),yesterday), cash[date_pos][1] / (1 + backtest_commission_ratio)) print(date, '平空仓%.1f'%(m / close)) cash[date_pos][1] -= (1 + backtest_commission_ratio) * m position_short[date_pos][1] = position_short[date_pos][1] - m / close '''m = position_short[date_pos][1] * close print(date, '平空仓%.1f'%(m / close)) cash[date_pos][1] -= (1 + backtest_commission_ratio) * m position_short[date_pos][1] = position_short[date_pos][1] - m / close''' def unit(total_asset, date, atrtime = 10): i = 0 while result[i][0] != date: i += 1 end_time = result[i + atrtime - 1][0] DV = calAtr(result, date, end_time, tr_list)[0] return total_asset * unit_rate / DV def current_asset(date): date_pos = 0 while cash[date_pos][0] != date: date_pos += 1 return cash[date_pos][1] + (position_long[date_pos][1] - position_short[date_pos][1]) * result[finddatepos(date)][4] def nearestdate(date, counter = 1): dateset = set() for k in range(len(result)): dateset.add(result[k][0]) while date not in dateset: dt = datetime.datetime.strptime(date, '%Y-%m-%d') if counter == 1: date = (dt + datetime.timedelta(days=1)).strftime('%Y-%m-%d') if date[8] == '0': date = date[:8] + date[9:] if date[5] == '0': date = date[:5] + date[6:] elif counter == -1: date = (dt - datetime.timedelta(days=1)).strftime('%Y-%m-%d') if date[8] == '0': date = date[:8] + date[9:] if date[5] == '0': date = date[:5] + date[6:] return date if __name__ == '__main__': csvFile = open("data.csv", "r") reader = csv.reader(csvFile) result = [] for item in reader: # Ignore first line if reader.line_num == 1: continue result.append( [item[0], float(item[1]), float(item[2]), float(item[3]), float(item[4])]) # date, open, high, low, close csvFile.close() initial_cash = 0 backtest_commission_ratio = 0.0001 start_time = '2021-03-01' end_time = '2021-04-27' tr_list = [] cash = [] position_short = [] position_long = [] atrtime = 20 Dontime = 30 unit_rate = 0.01 winningRate = 0 date = 0 time = 0 baseline = 0 annualized_rate = 0 l_time = [] l_asset = [] l_index = [] xs=[] l_initial = [] main()
2.484375
2
posthog/test/test_update_person_props.py
csmatar/posthog
58
16573
from datetime import datetime from django.db import connection from posthog.models import Person from posthog.test.base import BaseTest # How we expect this function to behave: # | call | value exists | call TS is ___ existing TS | previous fn | write/override # 1| set | no | N/A | N/A | yes # 2| set_once | no | N/A | N/A | yes # 3| set | yes | before | set | no # 4| set | yes | before | set_once | yes # 5| set | yes | after | set | yes # 6| set | yes | after | set_once | yes # 7| set_once | yes | before | set | no # 8| set_once | yes | before | set_once | yes # 9| set_once | yes | after | set | no # 10| set_once | yes | after | set_once | no # 11| set | yes | equal | set | no # 12| set_once | yes | equal | set | no # 13| set | yes | equal | set_once | yes # 14| set_once | yes | equal | set_once | no FUTURE_TIMESTAMP = datetime(2050, 1, 1, 1, 1, 1).isoformat() PAST_TIMESTAMP = datetime(2000, 1, 1, 1, 1, 1).isoformat() # Refers to migration 0176_update_person_props_function # This is a Postgres function we use in the plugin server class TestShouldUpdatePersonProp(BaseTest): def test_update_without_properties_last_updated_at(self): person = Person.objects.create( team=self.team, properties={"a": 0, "b": 0}, properties_last_updated_at={}, properties_last_operation={"a": "set", "b": "set_once"}, ) with connection.cursor() as cursor: cursor.execute( f""" SELECT update_person_props( {person.id}, now()::text, array[ row('set', 'a', '1'::jsonb)::person_property_update, row('set_once', 'b', '1'::jsonb)::person_property_update ] ) """ ) updated_person = Person.objects.get(id=person.id) # dont update set_once call self.assertEqual(updated_person.properties, {"a": 1, "b": 0}) self.assertEqual(updated_person.properties_last_operation, {"a": "set", "b": "set_once"}) self.assertIsNotNone(updated_person.properties_last_updated_at["a"]) def test_update_without_properties_last_operation(self): person = Person.objects.create( team=self.team, properties={"a": 0, "b": 0}, properties_last_updated_at={"a": FUTURE_TIMESTAMP, "b": FUTURE_TIMESTAMP,}, properties_last_operation={}, ) with connection.cursor() as cursor: cursor.execute( f""" SELECT update_person_props( {person.id}, now()::text, array[ row('set', 'a', '1'::jsonb)::person_property_update, row('set_once', 'b', '1'::jsonb)::person_property_update ] ) """ ) updated_person = Person.objects.get(id=person.id) # dont update set_once call self.assertEqual(updated_person.properties, {"a": 1, "b": 0}) self.assertEqual(updated_person.properties_last_operation, {"a": "set"}) self.assertNotEqual(updated_person.properties_last_updated_at["a"], FUTURE_TIMESTAMP) # tests cases 1 and 2 from the table def test_update_non_existent_prop(self): person = Person.objects.create( team=self.team, properties={}, properties_last_updated_at={}, properties_last_operation={} ) with connection.cursor() as cursor: cursor.execute( f""" SELECT update_person_props( {person.id}, now()::text, array[ row('set', 'a', '1'::jsonb)::person_property_update, row('set_once', 'b', '1'::jsonb)::person_property_update ] ) """ ) updated_person = Person.objects.get(id=person.id) # both updated self.assertEqual(updated_person.properties, {"a": 1, "b": 1}) self.assertEqual(updated_person.properties_last_operation, {"a": "set", "b": "set_once"}) self.assertIsNotNone(updated_person.properties_last_updated_at["a"]) self.assertIsNotNone(updated_person.properties_last_updated_at["b"]) # # tests cases 3 and 4 from the table def test_set_operation_with_earlier_timestamp(self): person = Person.objects.create( team=self.team, properties={"a": 0, "b": 0}, properties_last_updated_at={"a": FUTURE_TIMESTAMP, "b": FUTURE_TIMESTAMP,}, properties_last_operation={"a": "set", "b": "set_once"}, ) with connection.cursor() as cursor: cursor.execute( f""" SELECT update_person_props( {person.id}, now()::text, array[ row('set', 'a', '1'::jsonb)::person_property_update, row('set', 'b', '1'::jsonb)::person_property_update ] ) """ ) updated_person = Person.objects.get(id=person.id) # b updated self.assertEqual(updated_person.properties, {"a": 0, "b": 1}) self.assertEqual(updated_person.properties_last_operation, {"a": "set", "b": "set"}) self.assertEqual(updated_person.properties_last_updated_at["a"], FUTURE_TIMESTAMP) self.assertNotEqual(updated_person.properties_last_updated_at["b"], FUTURE_TIMESTAMP) # # tests cases 5 and 6 from the table def test_set_operation_with_older_timestamp(self): person = Person.objects.create( team=self.team, properties={"a": 0, "b": 0}, properties_last_updated_at={"a": PAST_TIMESTAMP, "b": PAST_TIMESTAMP,}, properties_last_operation={"a": "set", "b": "set_once"}, ) with connection.cursor() as cursor: cursor.execute( f""" SELECT update_person_props( {person.id}, now()::text, array[ row('set', 'a', '1'::jsonb)::person_property_update, row('set', 'b', '1'::jsonb)::person_property_update ] ) """ ) updated_person = Person.objects.get(id=person.id) # both updated self.assertEqual(updated_person.properties, {"a": 1, "b": 1}) self.assertEqual(updated_person.properties_last_operation, {"a": "set", "b": "set"}) self.assertNotEqual(updated_person.properties_last_updated_at["a"], PAST_TIMESTAMP) self.assertNotEqual(updated_person.properties_last_updated_at["b"], PAST_TIMESTAMP) # tests cases 7 and 8 from the table def test_set_once_operation_with_earlier_timestamp(self): person = Person.objects.create( team=self.team, properties={"a": 0, "b": 0}, properties_last_updated_at={"a": FUTURE_TIMESTAMP, "b": FUTURE_TIMESTAMP,}, properties_last_operation={"a": "set", "b": "set_once"}, ) with connection.cursor() as cursor: cursor.execute( f""" SELECT update_person_props( {person.id}, now()::text, array[ row('set_once', 'a', '1'::jsonb)::person_property_update, row('set_once', 'b', '1'::jsonb)::person_property_update ] ) """ ) updated_person = Person.objects.get(id=person.id) # b updated self.assertEqual(updated_person.properties, {"a": 0, "b": 1}) self.assertEqual(updated_person.properties_last_operation, {"a": "set", "b": "set_once"}) self.assertEqual(updated_person.properties_last_updated_at["a"], FUTURE_TIMESTAMP) self.assertNotEqual(updated_person.properties_last_updated_at["b"], FUTURE_TIMESTAMP) # tests cases 9 and 10 from the table def test_set_once_operation_with_older_timestamp(self): person = Person.objects.create( team=self.team, properties={"a": 0, "b": 0}, properties_last_updated_at={"a": PAST_TIMESTAMP, "b": PAST_TIMESTAMP,}, properties_last_operation={"a": "set", "b": "set_once"}, ) with connection.cursor() as cursor: cursor.execute( f""" SELECT update_person_props( {person.id}, now()::text, array[ row('set_once', 'a', '1'::jsonb)::person_property_update, row('set_once', 'b', '1'::jsonb)::person_property_update ] ) """ ) updated_person = Person.objects.get(id=person.id) # neither updated self.assertEqual(updated_person.properties, {"a": 0, "b": 0}) self.assertEqual(updated_person.properties_last_operation, {"a": "set", "b": "set_once"}) self.assertEqual(updated_person.properties_last_updated_at["a"], PAST_TIMESTAMP) self.assertEqual(updated_person.properties_last_updated_at["b"], PAST_TIMESTAMP) # # tests cases 11-14 from the table def test_equal_timestamps(self): timestamp = PAST_TIMESTAMP person = Person.objects.create( team=self.team, properties={"a": 0, "b": 0, "c": 0, "d": 0}, properties_last_updated_at={"a": timestamp, "b": timestamp, "c": timestamp, "d": timestamp}, properties_last_operation={"a": "set", "b": "set", "c": "set_once", "d": "set_once"}, ) with connection.cursor() as cursor: cursor.execute( f""" SELECT update_person_props( {person.id}, '{timestamp}', array[ row('set', 'a', '1'::jsonb)::person_property_update, row('set_once', 'b', '1'::jsonb)::person_property_update, row('set', 'c', '1'::jsonb)::person_property_update, row('set_once', 'd', '1'::jsonb)::person_property_update ] ) """ ) updated_person = Person.objects.get(id=person.id) # update if current op is set and last op is set_once i.e. "c" self.assertEqual(updated_person.properties, {"a": 0, "b": 0, "c": 1, "d": 0}) self.assertEqual( updated_person.properties_last_operation, {"a": "set", "b": "set", "c": "set", "d": "set_once"} ) # c changed self.assertEqual(updated_person.properties_last_updated_at["a"], PAST_TIMESTAMP) self.assertEqual(updated_person.properties_last_updated_at["b"], PAST_TIMESTAMP) self.assertEqual(updated_person.properties_last_updated_at["c"], PAST_TIMESTAMP) self.assertEqual(updated_person.properties_last_updated_at["c"], PAST_TIMESTAMP)
2.53125
3
setup.py
cclauss/AIF360
0
16574
from setuptools import setup, find_packages with open("README.md", "r") as fh: long_description = fh.read() setup(name='aif360', version='0.1.0', description='IBM AI Fairness 360', author='aif360 developers', author_email='<EMAIL>', url='https://github.com/IBM/AIF360', long_description=long_description, long_description_content_type='text/markdown', license='Apache License 2.0', packages=find_packages(), # python_requires='>=2.7, !=3.0.*, !=3.1.*, !=3.2.*, !=3.3.*, !=3.4.*, <3.7', install_requires=[ 'numpy', 'scipy', 'pandas==0.23.3', 'scikit-learn', 'numba', ], include_package_data=True, zip_safe=False)
1.320313
1
src/examples/customstyle/wow_style/widgetstyle/radiobutton.py
robertkist/qtmodernredux
4
16575
radiobutton_style = ''' QRadioButton:disabled { background: transparent; } QRadioButton::indicator { background: palette(dark); width: 8px; height: 8px; border: 3px solid palette(dark); border-radius: 7px; } QRadioButton::indicator:checked { background: palette(highlight); } QRadioButton::indicator:checked:disabled { background: palette(midlight); } '''
1.085938
1
engine.py
kevioconnor/day0
0
16576
from __future__ import annotations import lzma, pickle from typing import TYPE_CHECKING from numpy import e from tcod.console import Console from tcod.map import compute_fov import exceptions, render_functions from message_log import MessageLog if TYPE_CHECKING: from entity import Actor from game_map import GameMap, GameWorld class Engine: game_map: GameMap game_world: GameWorld def __init__(self, player: Actor): self.message_log = MessageLog() self.mouse_location = (0, 0) self.player = player def handle_enemy_turns(self) -> None: for entity in set(self.game_map.actors) - {self.player}: if entity.ai: try: entity.ai.perform() except exceptions.Impossible: pass def update_fov(self) -> None: self.game_map.visible[:] = compute_fov( self.game_map.tiles["transparent"], (self.player.x, self.player.y), radius=8 ) self.game_map.explored |= self.game_map.visible def render(self, console: Console) -> None: self.game_map.render(console) self.message_log.render(console=console, x=21, y=45, width=40, height=5) render_functions.render_bar(console=console, current_val=self.player.fighter.hp, max_val=self.player.fighter.max_hp, total_width=20) render_functions.render_level(console=console, dungeon_level=self.game_world.current_floor, location=(0, 47)) render_functions.render_name_at_location(console=console, x=21, y=44, engine=self) def save_as(self, filename: str) -> None: save_data = lzma.compress(pickle.dumps(self)) with open(filename, "wb") as f: f.write(save_data)
2.3125
2
friday/models/__init__.py
alexa-infra/friday
1
16577
<filename>friday/models/__init__.py # flake8: noqa # pylint: disable=cyclic-import from .base import db, Model, metadata from .link import Link from .user import User from .event import Event, Repeat from .bookmark import Bookmark from .tag import Tag from .doc import Doc, DocTag from .recipe import Recipe, RecipeImage from .pagination import paginate, Pagination from .todo import TodoItem
1.257813
1
nqs_tf/models/ffnn.py
ameya1101/neural-quantum-states
0
16578
import tensorflow as tf from tensorflow.keras.models import Model from tensorflow.keras.layers import Dense from activations.activations import tan_sigmoid, exponential, ReLU class FFNN(Model): """ Creates a generic Feedforward neural network. """ def __init__(self): super(FFNN, self).__init__() def build(self, input_shape): self.dense1 = Dense(units=input_shape[-1], activation=ReLU) self.output_layer = Dense(units=1, activation=exponential) def call(self, inputs): x = self.dense1(inputs) x = self.output_layer(x) return tf.reduce_sum(x, axis=-1)
3.234375
3
examples/other/text_frontend/test_g2p.py
zh794390558/DeepSpeech
0
16579
<reponame>zh794390558/DeepSpeech<gh_stars>0 # Copyright (c) 2021 PaddlePaddle Authors. All Rights Reserved. # # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. import argparse import re from pathlib import Path from parakeet.frontend.zh_frontend import Frontend as zhFrontend from parakeet.utils.error_rate import word_errors SILENCE_TOKENS = {"sp", "sil", "sp1", "spl"} def text_cleaner(raw_text): text = re.sub('#[1-4]|“|”|(|)', '', raw_text) text = text.replace("…。", "。") text = re.sub(':|;|——|……|、|…|—', ',', text) return text def get_avg_wer(raw_dict, ref_dict, frontend, output_dir): edit_distances = [] ref_lens = [] wf_g2p = open(output_dir / "text.g2p", "w") wf_ref = open(output_dir / "text.ref.clean", "w") for utt_id in raw_dict: if utt_id not in ref_dict: continue raw_text = raw_dict[utt_id] text = text_cleaner(raw_text) g2p_phones = frontend.get_phonemes(text) g2p_phones = sum(g2p_phones, []) gt_phones = ref_dict[utt_id].split(" ") # delete silence tokens in predicted phones and ground truth phones g2p_phones = [phn for phn in g2p_phones if phn not in SILENCE_TOKENS] gt_phones = [phn for phn in gt_phones if phn not in SILENCE_TOKENS] gt_phones = " ".join(gt_phones) g2p_phones = " ".join(g2p_phones) wf_ref.write(gt_phones + "(baker_" + utt_id + ")" + "\n") wf_g2p.write(g2p_phones + "(baker_" + utt_id + ")" + "\n") edit_distance, ref_len = word_errors(gt_phones, g2p_phones) edit_distances.append(edit_distance) ref_lens.append(ref_len) return sum(edit_distances) / sum(ref_lens) def main(): parser = argparse.ArgumentParser(description="g2p example.") parser.add_argument( "--input-dir", default="data/g2p", type=str, help="directory to preprocessed test data.") parser.add_argument( "--output-dir", default="exp/g2p", type=str, help="directory to save g2p results.") args = parser.parse_args() input_dir = Path(args.input_dir).expanduser() output_dir = Path(args.output_dir).expanduser() output_dir.mkdir(parents=True, exist_ok=True) assert input_dir.is_dir() raw_dict, ref_dict = dict(), dict() raw_path = input_dir / "text" ref_path = input_dir / "text.ref" with open(raw_path, "r") as rf: for line in rf: line = line.strip() line_list = line.split(" ") utt_id, raw_text = line_list[0], " ".join(line_list[1:]) raw_dict[utt_id] = raw_text with open(ref_path, "r") as rf: for line in rf: line = line.strip() line_list = line.split(" ") utt_id, phones = line_list[0], " ".join(line_list[1:]) ref_dict[utt_id] = phones frontend = zhFrontend() avg_wer = get_avg_wer(raw_dict, ref_dict, frontend, output_dir) print("The avg WER of g2p is:", avg_wer) if __name__ == "__main__": main()
2.078125
2
data_split.py
DataXujing/ExtremeNet-Pytorch
9
16580
# VOC分割训练集和测试集 import os import random import shutil trainval_percent = 0.1 train_percent = 0.9 imgfilepath = '../myData/JPEGImages' #原数据存放地 total_img = os.listdir(imgfilepath) sample_num = len(total_img) trains = random.sample(total_img,int(sample_num*train_percent)) for file in total_img: if file in trains: shutil.copy(os.path.join(imgfilepath,file),"./myData/coco/images/train/"+file) else: shutil.copy(os.path.join(imgfilepath,file),"./myData/coco/images/val/"+file) print(file)
2.921875
3
sciunit/models/examples.py
russelljjarvis/sciun
1
16581
"""Example SciUnit model classes.""" import random from sciunit.models import Model from sciunit.capabilities import ProducesNumber from sciunit.utils import class_intern, method_cache from sciunit.utils import method_memoize # Decorator for caching of capability method results. from typing import Union class ConstModel(Model, ProducesNumber): """A model that always produces a constant number as output.""" def __init__(self, constant: Union[int, float], name: str=None): self.constant = constant super(ConstModel, self).__init__(name=name, constant=constant) def produce_number(self) -> Union[int, float]: return self.constant class UniformModel(Model, ProducesNumber): """A model that always produces a random uniformly distributed number. in [a,b] as output.""" def __init__(self, a, b, name=None): self.a, self.b = a, b super(UniformModel, self).__init__(name=name, a=a, b=b) def produce_number(self) -> float: """Produece a number between `a` and `b`. Returns: float: The number between a and b. """ return random.uniform(self.a, self.b) ################################################################ # Here are several examples of caching and sharing can be used # to reduce the computational load of testing. ################################################################ class UniqueRandomNumberModel(Model, ProducesNumber): """An example model to ProducesNumber.""" def produce_number(self) -> float: """Each call to this method will produce a different random number. Returns: float: A random number produced. """ return random.random() class RepeatedRandomNumberModel(Model, ProducesNumber): """An example model to demonstrate ProducesNumber with cypy.lazy.""" @method_memoize def produce_number(self): """Each call to this method will produce the same random number as was returned in the first call, ensuring reproducibility and eliminating computational overhead. Returns: float: A random number produced. """ return random.random() @class_intern class SharedModel(Model): """A model that, each time it is instantiated with the same parameters, will return the same instance at the same locaiton in memory. Attributes should not be set post-instantiation unless the goal is to set those attributes on all models of this class.""" pass class PersistentUniformModel(UniformModel): """TODO""" def run(self) -> None: self._x = random.uniform(self.a, self.b) def produce_number(self) -> float: return self._x class CacheByInstancePersistentUniformModel(PersistentUniformModel): """TODO""" @method_cache(by='instance', method='run') def produce_number(self) -> float: return self._x class CacheByValuePersistentUniformModel(PersistentUniformModel): """TODO""" @method_cache(by='value', method='run') def produce_number(self) -> float: return self._x
3.328125
3
semantic/semantic/model/model.py
VladimirSiv/semantic-search-system
1
16582
from sentence_transformers import SentenceTransformer from semantic.config import CONFIG model = SentenceTransformer(CONFIG["model_name"])
1.726563
2
utils/models.py
miladalipour99/time_series_augmentation
140
16583
from tensorflow.keras.models import Model from tensorflow.keras.layers import Dense, Flatten, Dropout, Input from tensorflow.keras.layers import MaxPooling1D, Conv1D from tensorflow.keras.layers import LSTM, Bidirectional from tensorflow.keras.layers import BatchNormalization, GlobalAveragePooling1D, Permute, concatenate, Activation, add import numpy as np import math def get_model(model_name, input_shape, nb_class): if model_name == "vgg": model = cnn_vgg(input_shape, nb_class) elif model_name == "lstm1": model = lstm1(input_shape, nb_class) elif model_name == "lstm": model = lstm1v0(input_shape, nb_class) elif model_name == "lstm2": model = lstm2(input_shape, nb_class) elif model_name == "blstm1": model = blstm1(input_shape, nb_class) elif model_name == "blstm2": model = blstm2(input_shape, nb_class) elif model_name == "lstmfcn": model = lstm_fcn(input_shape, nb_class) elif model_name == "resnet": model = cnn_resnet(input_shape, nb_class) elif model_name == "mlp": model = mlp4(input_shape, nb_class) elif model_name == "lenet": model = cnn_lenet(input_shape, nb_class) else: print("model name missing") return model def mlp4(input_shape, nb_class): # <NAME>, <NAME>, <NAME>, "Time Series Classification from Scratch with Deep Neural Networks: A Strong Baseline," Int. Joint Conf. Neural Networks, 2017, pp. 1578-1585 ip = Input(shape=input_shape) fc = Flatten()(ip) fc = Dropout(0.1)(fc) fc = Dense(500, activation='relu')(fc) fc = Dropout(0.2)(fc) fc = Dense(500, activation='relu')(fc) fc = Dropout(0.2)(fc) fc = Dense(500, activation='relu')(fc) fc = Dropout(0.3)(fc) out = Dense(nb_class, activation='softmax')(fc) model = Model([ip], [out]) model.summary() return model def cnn_lenet(input_shape, nb_class): # <NAME>, <NAME>, <NAME>, and <NAME>, “Gradient-based learning applied to document recognition,” Proceedings of the IEEE, vol. 86, no. 11, pp. 2278–2324, 1998. ip = Input(shape=input_shape) conv = ip nb_cnn = int(round(math.log(input_shape[0], 2))-3) print("pooling layers: %d"%nb_cnn) for i in range(nb_cnn): conv = Conv1D(6+10*i, 3, padding='same', activation="relu", kernel_initializer='he_uniform')(conv) conv = MaxPooling1D(pool_size=2)(conv) flat = Flatten()(conv) fc = Dense(120, activation='relu')(flat) fc = Dropout(0.5)(fc) fc = Dense(84, activation='relu')(fc) fc = Dropout(0.5)(fc) out = Dense(nb_class, activation='softmax')(fc) model = Model([ip], [out]) model.summary() return model def cnn_vgg(input_shape, nb_class): # <NAME> and <NAME>, "Very deep convolutional networks for large-scale image recognition," arXiv preprint arXiv:1409.1556, 2014. ip = Input(shape=input_shape) conv = ip nb_cnn = int(round(math.log(input_shape[0], 2))-3) print("pooling layers: %d"%nb_cnn) for i in range(nb_cnn): num_filters = min(64*2**i, 512) conv = Conv1D(num_filters, 3, padding='same', activation="relu", kernel_initializer='he_uniform')(conv) conv = Conv1D(num_filters, 3, padding='same', activation="relu", kernel_initializer='he_uniform')(conv) if i > 1: conv = Conv1D(num_filters, 3, padding='same', activation="relu", kernel_initializer='he_uniform')(conv) conv = MaxPooling1D(pool_size=2)(conv) flat = Flatten()(conv) fc = Dense(4096, activation='relu')(flat) fc = Dropout(0.5)(fc) fc = Dense(4096, activation='relu')(fc) fc = Dropout(0.5)(fc) out = Dense(nb_class, activation='softmax')(fc) model = Model([ip], [out]) model.summary() return model def lstm1v0(input_shape, nb_class): # Original proposal: # <NAME> and <NAME>, “Long Short-Term Memory,” Neural Computation, vol. 9, no. 8, pp. 1735–1780, Nov. 1997. ip = Input(shape=input_shape) l2 = LSTM(512)(ip) out = Dense(nb_class, activation='softmax')(l2) model = Model([ip], [out]) model.summary() return model def lstm1(input_shape, nb_class): # Original proposal: # <NAME> and <NAME>, “Long Short-Term Memory,” Neural Computation, vol. 9, no. 8, pp. 1735–1780, Nov. 1997. # Hyperparameter choices: # <NAME> and <NAME>, "Optimal hyperparameters for deep lstm-networks for sequence labeling tasks," arXiv, preprint arXiv:1707.06799, 2017 ip = Input(shape=input_shape) l2 = LSTM(100)(ip) out = Dense(nb_class, activation='softmax')(l2) model = Model([ip], [out]) model.summary() return model def lstm2(input_shape, nb_class): ip = Input(shape=input_shape) l1 = LSTM(100, return_sequences=True)(ip) l2 = LSTM(100)(l1) out = Dense(nb_class, activation='softmax')(l2) model = Model([ip], [out]) model.summary() return model def blstm1(input_shape, nb_class): # Original proposal: # <NAME> and <NAME>, “Bidirectional recurrent neural networks,” IEEE Transactions on Signal Processing, vol. 45, no. 11, pp. 2673–2681, 1997. # Hyperparameter choices: # <NAME> and <NAME>, "Optimal hyperparameters for deep lstm-networks for sequence labeling tasks," arXiv, preprint arXiv:1707.06799, 2017 ip = Input(shape=input_shape) l2 = Bidirectional(LSTM(100))(ip) out = Dense(nb_class, activation='softmax')(l2) model = Model([ip], [out]) model.summary() return model def blstm2(input_shape, nb_class): ip = Input(shape=input_shape) l1 = Bidirectional(LSTM(100, return_sequences=True))(ip) l2 = Bidirectional(LSTM(100))(l1) out = Dense(nb_class, activation='softmax')(l2) model = Model([ip], [out]) model.summary() return model def lstm_fcn(input_shape, nb_class): # <NAME>, <NAME>, <NAME>, and <NAME>, “LSTM Fully Convolutional Networks for Time Series Classification,” IEEE Access, vol. 6, pp. 1662–1669, 2018. ip = Input(shape=input_shape) # lstm part is a 1 time step multivariate as described in Karim et al. Seems strange, but works I guess. lstm = Permute((2, 1))(ip) lstm = LSTM(128)(lstm) lstm = Dropout(0.8)(lstm) conv = Conv1D(128, 8, padding='same', kernel_initializer='he_uniform')(ip) conv = BatchNormalization()(conv) conv = Activation('relu')(conv) conv = Conv1D(256, 5, padding='same', kernel_initializer='he_uniform')(conv) conv = BatchNormalization()(conv) conv = Activation('relu')(conv) conv = Conv1D(128, 3, padding='same', kernel_initializer='he_uniform')(conv) conv = BatchNormalization()(conv) conv = Activation('relu')(conv) flat = GlobalAveragePooling1D()(conv) flat = concatenate([lstm, flat]) out = Dense(nb_class, activation='softmax')(flat) model = Model([ip], [out]) model.summary() return model def cnn_resnet(input_shape, nb_class): # <NAME>, <NAME>, <NAME>, <NAME>, <NAME>, "Data augmentation using synthetic data for time series classification with deep residual networks," International Workshop on Advanced Analytics and Learning on Temporal Data ECML/PKDD, 2018 ip = Input(shape=input_shape) residual = ip conv = ip for i, nb_nodes in enumerate([64, 128, 128]): conv = Conv1D(nb_nodes, 8, padding='same', kernel_initializer="glorot_uniform")(conv) conv = BatchNormalization()(conv) conv = Activation('relu')(conv) conv = Conv1D(nb_nodes, 5, padding='same', kernel_initializer="glorot_uniform")(conv) conv = BatchNormalization()(conv) conv = Activation('relu')(conv) conv = Conv1D(nb_nodes, 3, padding='same', kernel_initializer="glorot_uniform")(conv) conv = BatchNormalization()(conv) conv = Activation('relu')(conv) if i < 2: # expands dimensions according to Fawaz et al. residual = Conv1D(nb_nodes, 1, padding='same', kernel_initializer="glorot_uniform")(residual) residual = BatchNormalization()(residual) conv = add([residual, conv]) conv = Activation('relu')(conv) residual = conv flat = GlobalAveragePooling1D()(conv) out = Dense(nb_class, activation='softmax')(flat) model = Model([ip], [out]) model.summary() return model
3.015625
3
ai_flow/test/util/test_sqlalchemy_db.py
flink-extended/ai-flow
79
16584
<reponame>flink-extended/ai-flow # Copyright 2022 The AI Flow Authors # # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, # software distributed under the License is distributed on an # "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY # KIND, either express or implied. See the License for the # specific language governing permissions and limitations # under the License. # import os import unittest import sqlalchemy from ai_flow.store.db.base_model import base from ai_flow.util import sqlalchemy_db SQLITE_FILE = 'ai_flow.db' TEST_URL = 'sqlite:///ai_flow.db' def create_engine(url): return sqlalchemy.create_engine(url) def get_tables(url): return sqlalchemy.inspect(create_engine(url)).get_table_names() def all_ai_flow_tables_exist(url): tables = set(get_tables(url)) for key in base.metadata.tables.keys(): if key not in tables: return False return True def none_ai_flow_tables_exist(url): tables = set(get_tables(url)) for key in base.metadata.tables.keys(): if key in tables: return False return True class TestSqlalchemyDB(unittest.TestCase): def setUp(self) -> None: sqlalchemy_db.clear_db(TEST_URL, base.metadata) def tearDown(self) -> None: if os.path.exists(SQLITE_FILE): os.remove(SQLITE_FILE) def test_upgrade(self): self.assertTrue(none_ai_flow_tables_exist(TEST_URL)) sqlalchemy_db.upgrade(TEST_URL) self.assertTrue(all_ai_flow_tables_exist(TEST_URL)) def test_upgrade_with_version(self): self.assertTrue(none_ai_flow_tables_exist(TEST_URL)) sqlalchemy_db.upgrade(TEST_URL, 'de1c96ef582a') self.assertFalse(all_ai_flow_tables_exist(TEST_URL)) self.assertTrue(len(get_tables(TEST_URL)) > 0) sqlalchemy_db.upgrade(TEST_URL) self.assertTrue(all_ai_flow_tables_exist(TEST_URL)) def test_downgrade(self): self.assertTrue(none_ai_flow_tables_exist(TEST_URL)) sqlalchemy_db.upgrade(TEST_URL) self.assertTrue(all_ai_flow_tables_exist(TEST_URL)) sqlalchemy_db.downgrade(TEST_URL, 'de1c96ef582a') self.assertFalse(all_ai_flow_tables_exist(TEST_URL)) if __name__ == '__main__': unittest.main()
1.984375
2
test.py
blodzbyte/isEven
44
16585
<reponame>blodzbyte/isEven #!/usr/bin/env python3 from isEven import isEven def testRange(min, max, evens): print('Testing [{},{}] {}...'.format(min, max, 'evens' if evens else 'odds')) for i in range(min, max, 2): i = i if evens else i - 1 result = isEven(i) if(not result and evens): raise Exception('Test failed. Got: isEven({}) = {}. Expected: '\ 'isEven({}) = {}.'.format(i, str(result), i,\ str(evens))) print('Test passed.') def main(): testRange(0, 10000, True) testRange(0, 10000, False) if __name__ == '__main__': main()
2.984375
3
comm.py
thedognexttothetrashcan/spi_tmall
0
16586
#! /usr/bin/python # encoding=utf-8 import os import datetime,time from selenium import webdriver import config import threading import numpy as np def writelog(msg,log): nt=datetime.datetime.now().strftime('%Y-%m-%d %H-%M-%S') text="[%s] %s " % (nt,msg) os.system("echo %s >> %s" % (text.encode('utf8'),log)) def create_chrome(): ops=webdriver.ChromeOptions() ops.add_experimental_option('mobileEmulation',config.mobileEmulation) web=webdriver.Chrome(chrome_options=ops) web.set_page_load_timeout(10) web.set_script_timeout(10) web.set_window_size(config.mWidth,config.mHeight) return web #Create Threading Pool def threading_pool(tnum,funname): threadlist=[] for i in range(tnum): t=threading.Thread(target=funname) threadlist.append(t) for t in threadlist: t.setDaemon(True) t.start() for t in threadlist: t.join() return threadlist def set_interval(*args): s = 3 e = 6 if len(args)>=1: s = args[0] if len(args)>=2: e = args[1] f = np.random.uniform(s,e) time.sleep(f)
2.75
3
sherlockpipe/objectinfo/preparer/LightcurveBuilder.py
LuisCerdenoMota/SHERLOCK
0
16587
<filename>sherlockpipe/objectinfo/preparer/LightcurveBuilder.py import re from abc import ABC, abstractmethod from sherlockpipe.star.EpicStarCatalog import EpicStarCatalog from sherlockpipe.star.KicStarCatalog import KicStarCatalog from sherlockpipe.star.TicStarCatalog import TicStarCatalog class LightcurveBuilder(ABC): OBJECT_ID_REGEX = "^(KIC|TIC|EPIC)[-_ ]([0-9]+)$" NUMBERS_REGEX = "[0-9]+$" MISSION_ID_KEPLER = "KIC" MISSION_ID_KEPLER_2 = "EPIC" MISSION_ID_TESS = "TIC" def __init__(self): self.star_catalogs = {} self.star_catalogs[self.MISSION_ID_KEPLER] = KicStarCatalog() self.star_catalogs[self.MISSION_ID_KEPLER_2] = EpicStarCatalog() self.star_catalogs[self.MISSION_ID_TESS] = TicStarCatalog() self.authors = {} self.authors["Kepler"] = "Kepler" self.authors["K2"] = "K2" self.authors["TESS"] = "SPOC" @abstractmethod def build(self, object_info, sherlock_dir): pass def parse_object_id(self, object_id): object_id_parsed = re.search(self.OBJECT_ID_REGEX, object_id) mission_prefix = object_id[object_id_parsed.regs[1][0]:object_id_parsed.regs[1][1]] id = object_id[object_id_parsed.regs[2][0]:object_id_parsed.regs[2][1]] if mission_prefix == self.MISSION_ID_KEPLER: mission = "Kepler" elif mission_prefix == self.MISSION_ID_KEPLER_2: mission = "K2" elif mission_prefix == self.MISSION_ID_TESS: mission = "TESS" else: raise ValueError("Invalid object id " + object_id) return mission, mission_prefix, int(id)
2.34375
2
dft/dft-hartree-hydrogen.py
marvinfriede/projects
0
16588
<filename>dft/dft-hartree-hydrogen.py<gh_stars>0 #!/bin/env python3 # coding: utf8 ''' My implementation of DFT Assignment 5.1: Hartree energy for H-atom GS Taught by <NAME> in 2019/2020. Links: https://tu-freiberg.de/fakultaet2/thph/lehre/density-functional-theory https://github.com/PandaScience/teaching-resources This script uses the last assignment's code to determine a solution of the radial Schrödinger equation for the hydrogen ground state (n=1, l=0). After normalizing, the Hartree potential energy w(r) = r*vh(r) is computed in a second "integration" step and numerically integrated to the Hartree energy (~0.3125 Ha). For hydrogen, the homogeneous solution w_hom(r) = beta * r is not required in order to match the boundary condition (--> beta = 0). Note, that the integration limits (tmin, tmax) and step size (h) need to be identical for solve_rseq() and solve_poisson() or you must use interpolated versions of the functions w(r) and u(r) when computing the Hartree energy. Further, tmin for solve_poisson() should not be smaller than tmin for solve_rseq(), because extrapolating u(r) beyond the computed data points may result in errors. ''' import time import numpy as np import matplotlib.pyplot as plt from scipy.integrate import solve_ivp, trapz from scipy.interpolate import interp1d nsteps = 10000 rmin = 0.000001 rmax = 20 def secant(f, x1=-12345, x2=6789, maxiter=10000, tol=1e-10): """secant method; x1 and x2 are crucial for finding the desired root""" for itr in range(maxiter): xnew = x2 - (x2 - x1) / (f(x2) - f(x1)) * f(x2) if abs(xnew - x2) < tol: break x1 = x2 x2 = xnew else: print("Calculation exceeded maximum number of iterations!") exit() return xnew, itr def trapezoidal(f, a, b, n=10000): """trapez method for numerical integration""" s = 0.0 h = (b - a) / n for i in range(0, n): s += f(a + i * h) return h * (s + 0.5 * (f(a) + f(b))) def rad_seq(t, y, energy): """returns radial SEQ as system of two 1st order differential equations""" # input: y = [y1, y2]; return y = [y1', y2'] # y1' = y2; y2' = (...)*y1 return [y[1], (- 2 * (1 / t + energy)) * y[0]] def initValues(r): """getting initial values for numeric intergration from correct solution""" u = 2 * r * np.exp(-r) uPrime = (1 - r) * 2 * np.exp(-r) return [u, uPrime] def solve_rad_seq(energy): """wrapper for ODE integration; energy and l as parameter, integration from rmax to rmin (inwards)""" sol = solve_ivp( lambda t, y: rad_seq(t, y, energy), t_span=[rmax, rmin], t_eval=np.linspace(rmax, rmin, nsteps), y0=initValues(rmax)) u = sol.y[0] r = sol.t return u[::-1], r[::-1] def u0(energy): """get first value of integrated Schrödinger equation; since the array is reversed, u[0] corresponds to the u-value at r = 0 (y-interscetion); different energies are passed in by secant method""" u, r = solve_rad_seq(energy) return u[0] def normalize(energy): """integrating with calculated energy eigenvalue and normalization""" u, r = solve_rad_seq(energy) norm = trapz(u * u, r) u_norm = u / np.sqrt(norm) return u_norm, r, norm def poisson(t, y, u): """returns poisson equation w''(t) = - u²(t) / t as system of two 1st order differential equations""" # input: y = [y1, y2]; return y = [y1', y2'] # y1' = y2; y2' = - u²(t) / t return [y[1], -u(t) ** 2 / t] def solve_poisson(f_int): """solve radial poisson equation; input is u(r) from interpolation""" sol = solve_ivp( lambda t, y: poisson(t, y, f_int), t_span=[rmin, rmax], t_eval=np.linspace(rmin, rmax, nsteps), y0=[0, 1]) return sol.y[0], sol.t def main(): # find lowest energy eigenvalue; corresponds to energy of hydrogen atom root_start_time = time.time() root, numIter = secant(u0, -0.6, -0.55) root_exec_time = round((time.time() - root_start_time), 2) print("Energy of hydrogen atom: {:.5f} Hartree\t\t ({:.2f}s)".format( root, root_exec_time)) # normalization norm_start_time = time.time() u_norm, r, norm = normalize(root) norm_exec_time = round((time.time() - norm_start_time), 2) print( "Normalization done ({:.5f} -> 1)\t\t\t ({:.2f}s)".format(norm, norm_exec_time)) # interpolation of radial SEQ u_norm_spline = interp1d(r, u_norm) # solving radial poisson equation result is w(r), the single orbital density w, r = solve_poisson(u_norm_spline) # adding homogeneous solution, so that boundary conditions are fulfilled addhom_start_time = time.time() qtot = 1 beta = (qtot - w[-1]) / r[-1] w += beta * r addhom_exec_time = round((time.time() - addhom_start_time), 2) print("Correction for boundary condition: beta = {:.5f}\t ({:.2f}s)".format( beta, addhom_exec_time)) # compute hartree energy: Z/2 * Int(dr v_h(r) u²(r)) with v_h(r) = w(r) / r hartree_start_time = time.time() e_hartree = 0.5 * trapz(w / r * u_norm * u_norm, r) hartree_exec_time = round((time.time() - hartree_start_time), 2) print("Hartree energy for hydrogen: E_h = {:.5f}\t\t ({:.2f}s)".format( e_hartree, hartree_exec_time)) # compute hartree energy with own trapezoidal method hartree2_start_time = time.time() spline = interp1d(r, w / r * u_norm * u_norm) eh = 0.5 * trapezoidal(spline, r[0], r[-1]) hartree2_exec_time = round((time.time() - hartree2_start_time), 2) print("Hartree energy for hydrogen: E_h = {:.5f}\t\t ({:.2f}s)".format( eh, hartree2_exec_time)) # plotting numerical solutions plt.plot(r, w, "g", lw=2, ls="--", label=r"$w_{\mathrm{num}}(r)$") plt.plot(r, w / r, "r", lw=2, ls="--", label=r"$v_{\mathrm{num}}(r)$") plt.plot(r, w / r * u_norm ** 2, "b", lw=2, ls="--", alpha=0.5, label=r"$v_{\mathrm{num}}(r) \, |u(r)|^2$") # plotting exact solutions def w_exact(r): return - (r + 1) * np.exp(- 2 * r) + 1 def v_exact(r): return w_exact(r) / r plt.plot(r, w_exact(r), "g", lw=4, alpha=0.5, ls="-", label=r"$w_{\mathrm{exact}}(r)$") plt.plot(r, v_exact(r), "r", lw=4, alpha=0.5, ls="-", label=r"$v_{\mathrm{exact}}(r)$") # plot styling plt.xlabel(r"$r$ in Bohr") plt.xlim(-0.3, 10) plt.axhline(y=0, color="k", ls="--", lw="0.5") plt.axvline(x=0, color="k", ls="--", lw="0.5") plt.legend(loc="best", fancybox=True, shadow=True) # plt.show() if __name__ == "__main__": main()
2.84375
3
workflow & analyses notebooks/fukushima_telomere_methods.py
Jared-Luxton/Fukushima-Nuclear-Disaster-Humans
0
16589
import numpy as np import pandas as pd import os import matplotlib.pyplot as plt from sklearn import datasets, linear_model from difflib import SequenceMatcher import seaborn as sns from statistics import mean from ast import literal_eval from scipy import stats from sklearn.linear_model import LinearRegression from sklearn.linear_model import LogisticRegression from pygam import LinearGAM, s, l, f from matplotlib import lines import six def extract_boar_teloFISH_as_list(path): """ FUNCTION FOR PULLING KELLY'S TELOFISH DATA FOR 40 BOARS into a LIST.. TO BE MADE INTO A DATAFRAME & JOINED W/ MAIN DATAFRAME if possible These excel files take forever to load.. the objective here is to synthesize all the excel files for telomere FISH data into one dataframe, then save that dataframe to csv file to be retrieved later loading one whole csv file containing all the data will be much, much faster than loading the parts of the whole Along the way, we'll normalize the teloFISH data using controls internal to each excel file """ boar_teloFISH_list = [] for file in os.scandir(path): if 'Hyb' in file.name: print(f'Handling {file.name}...') full_name = path + file.name # making a dict of excel sheets, where KEY:VALUE pairs are SAMPLE ID:TELO DATA telo_excel_dict = pd.read_excel(full_name, sheet_name=None, skiprows=4, usecols=[3], nrows=5000) if 'Telomere Template' in telo_excel_dict.keys(): del telo_excel_dict['Telomere Template'] excel_file_list = [] for sample_id, telos in telo_excel_dict.items(): telos_cleaned = clean_individ_telos(telos) if sample_id != 'Control': excel_file_list.append([sample_id, telos_cleaned.values, np.mean(telos_cleaned)]) elif sample_id == 'Control': control_value = np.mean(telos_cleaned) #normalize teloFISH values by control value for sample in excel_file_list: sample_data = sample #normalize individual telos sample_data[1] = np.divide(sample_data[1], control_value) #normalize telo means sample_data[2] = np.divide(sample_data[2], control_value) boar_teloFISH_list.append(sample_data) print('Finished collecting boar teloFISH data') return boar_teloFISH_list def gen_missing_values_andimpute_or_randomsampledown(n_cells, telosPercell, df): max_telos = n_cells * telosPercell half_telos = (n_cells * telosPercell) / 2 if df.size > max_telos: df_sampled = df.sample(max_telos) return df_sampled if df.size > 25 and df.size <= half_telos: missing_data_difference = abs( (n_cells * telosPercell) - df.size ) rsampled = df.sample(missing_data_difference, replace=True, random_state=28) concat_ed = pd.concat([rsampled, df], sort=False) np.random.shuffle(concat_ed.to_numpy()) return concat_ed if df.size > 25 and df.size < max_telos: missing_data_difference = abs( (n_cells * telosPercell) - df.size ) rsampled = df.sample(missing_data_difference, random_state=28) concat_ed = pd.concat([rsampled, df], sort=False) np.random.shuffle(concat_ed.to_numpy()) return concat_ed else: return df def clean_individ_telos(telo_data): labels=[6, 172, 338, 504, 670, 836, 1002, 1168, 1334, 1500, 1666, 1832, 1998, 2164, 2330, 2496, 2662, 2828, 2994, 3160, 3326, 3492, 3658, 3824, 3990, 4156, 4322, 4488, 4654, 4820] labels_offset_by6 = [(x-6) for x in labels] telo_data = telo_data.drop(labels_offset_by6) telo_data = pd.to_numeric(telo_data.iloc[:,0], errors='coerce') telo_data = telo_data.dropna(axis=0, how='any') telo_data = telo_data.to_frame(name=None) telo_data = telo_data[(np.abs(stats.zscore(telo_data)) < 3).all(axis=1)] telo_data = pd.Series(telo_data.iloc[:,0]) telo_data = gen_missing_values_andimpute_or_randomsampledown(30, 160, telo_data) telo_data.reset_index(drop=True, inplace=True) return telo_data def remove_dashes_space_sampleIDs(row): if '-' in str(row): row = str(row).replace('-', '').replace(' ', '') if '_' in str(row): row = str(row).replace('_', '') if ' ' in str(row): row = str(row).replace(' ', '') if 'gps' in str(row): row = str(row).replace('gps', '') if 'GPS' in str(row): row = str(row).replace('GPS', '') if 'collar' in (row): row = str(row).replace('collar', '') if 'COLLAR' in str(row): row = str(row).replace('COLLAR', '') return str(row) def readable_snake_df_dummy_variables(snake_df): Exposure_Status = [] for row in snake_df['Sample ID']: if row.startswith('C'): Exposure_Status.append('Control') elif row.startswith('E'): Exposure_Status.append('Exposed') snake_df['Exposure Status'] = Exposure_Status ### making dummy variables for snake exposure status snake_dum = pd.get_dummies(snake_df['Exposure Status'], prefix='Encoded', drop_first=True) snake_df['Encoded Exposed'] = snake_dum return snake_df def count_shared_sample_IDs(df1, df2, print_names=None): df1_IDs = set(df1['Sample ID'].unique()) df2_IDs = set(df2['Sample ID'].unique()) # common_IDs = df1_list - (df1_list - df2_list) common_IDs = list(df1_IDs & df2_IDs) print(f'The number of sample IDs in common are: {len(common_IDs)}') if print_names == 'yes' or print_names == 'Yes': print(f'The sample IDs in common are:\n{common_IDs}') def average_age_weeks(row): if '-' in str(row): numbers = str(row).split('-') average = (int(numbers[1]) + int(numbers[0])) / len(numbers) return int(average) else: return int(row) def quartile_cts_rel_to_df1(df1, df2): df1 = pd.DataFrame(df1) df2 = pd.DataFrame(df2) # count how many instances in df2 are below the 0.25 quantile of df1 quartile_1 = df2[df2 <= df1.quantile(0.25)].count() # count how many instances in df2 are within the 0.25 - 0.75 range quantile of df1 quartile_2_3 = df2[(df2 > df1.quantile(0.25)) & (df2 < df1.quantile(0.75))].count() # count how many instances in df2 are above 0.75 range quantile of df1 quartile_4 = df2[df2 >= df1.quantile(0.75)].count() # return counts of values return int(quartile_1.values), int(quartile_2_3.values), int(quartile_4.values) def make_quartiles_columns(total_boar_telos, df): pos_1, pos_2, pos_3 = 17, 18, 19 sample_id, telo_data = 0, 1 for i, row in df.iterrows(): boar_sample_telos = row[telo_data] df.iat[i, pos_1], df.iat[i, pos_2], df.iat[i, pos_3] = (quartile_cts_rel_to_df1(total_boar_telos, boar_sample_telos)) return df def linear_regression_graphs_between_variables(x=None, y=None, data=None, hue=None, col=None, hue_order=None, col_order=None, snake=False): if 'Binary' in y: ax=sns.lmplot(x=x, y=y, hue=hue, col=col, data=data, logistic=True, height=5.5, aspect=1, scatter_kws={"s": 175, "edgecolor":'black'}) else: ax=sns.lmplot(x=x, y=y, hue=hue, col=col, data=data, height=5.5, aspect=1, scatter_kws={"s": 175, "edgecolor":'black'}) fig = ax.fig ax.set_xlabels(x, fontsize=18) ax.set_xticklabels(fontsize=14) ax.set_ylabels(y, fontsize=18) ax.set_yticklabels(fontsize=14) ax.set_titles(size=14) # if 'Cortisol' in y: # ax.set(ylim=(0, 40)) plt.subplots_adjust(top=0.88) if hue == None and col == None: fig.suptitle(f'{x} vs.\n {y} in Fukushima Wild Boar', fontsize=18, ) # ax.savefig(f"../graphs/{x} vs {y}.png", dpi=400) if snake: fig.suptitle(f'{x} vs.\n {y} in Fukushima Wild Snake', fontsize=18, ) # elif hue == 'Sex' and col == 'Sex': # fig.suptitle(f'{x} vs. {y}\nper Sex in Fukushima Wild Boar', fontsize=16, weight='bold') # fig.legend(fontsize='large') # ax.savefig(f"../graphs/{x} vs {y} per sex.png", dpi=400) def graph_dose_age_vs_telos(df=None, x=None, x2=None, y=None, hue=None,): f, axes = plt.subplots(1, 2, figsize=(12,5), sharey=False, sharex=False) # dose vs. telomeres sns.regplot(x=x, y=y, data=df, ax=axes[0], # hue=hue, scatter_kws={'alpha':0.8, 'linewidth':1, 'edgecolor':'black', 's':df['Age (months)']*12, }) axes[0].set_xlabel(x, fontsize=14) axes[0].set_ylabel(y, fontsize=14) axes[0].tick_params(labelsize=12) # age vs. telomeres sns.regplot(x=x2, y=y, data=df, ax=axes[1], # hue=hue, scatter_kws={'alpha':0.8, 'linewidth':1, 'edgecolor':'black', 's':175, }) axes[1].set_xlabel(x2, fontsize=14) axes[1].set_xlim(-4,55) axes[1].set_ylabel(y, fontsize=14) if y == 'Mean Telomere Length (FISH)': axes[1].set_ylim(0.2,1.6) if y == 'Mean Telomere Length (qPCR)': axes[1].set_ylim(0.6,1.8) axes[1].tick_params(labelsize=12) def score_linear_regressions(x=None, y=None, data=None, sexes=['Overall']): for sex in sexes: if sex == 'Overall': X_r = data[x].values.reshape(-1, len(x)) y_r = data[y].values.reshape(-1, 1) regression = LinearRegression().fit(X_r,y_r) print(f'Linear regression for {x} vs. {y}:\nOverall R2 is {regression.score(X_r, y_r):.4f}\n') return regression else: X_r = data[data['Sex'] == sex][x].values.reshape(-1, len(x)) y_r = data[data['Sex'] == sex][y].values.reshape(-1, 1) regression = LinearRegression().fit(X_r,y_r) print(f"Linear regression for {x} vs. {y}:\nR2 for {sex}s is {regression.score(X_r, y_r):.4f}") return regression def eval_number(x): if x > 15: x = 1 return x elif x < 15: x = 0 return x def score_logistic_regressions(x=None, y=None, data=None): # for y in y_cols: sexes = [ # 'Male', # 'Female', 'Overall'] for sex in sexes: if sex == 'Overall': X_r = data[x].values.reshape(-1, 1) y_r = data[y].values.reshape(-1, ) log_reg = LogisticRegression(solver='lbfgs') regression = log_reg.fit(X_r,y_r) print(f'Logistic regression for {x} vs. {y}:\nOverall R2 is {regression.score(X_r, y_r):.4f}\n') else: X_r = data[data['Sex'] == sex][x].values.reshape(-1, 1) y_r = data[data['Sex'] == sex][y].values.reshape(-1, ) regression = LinearRegression().fit(X_r,y_r) print(f"Logistic regression for {x} vs. {y}:\nR2 for {sex}s is {regression.score(X_r, y_r):.4f}") def encode_sex(row): if row == 'Male': return 0 elif row == 'Female': return 1 else: print(f'ERROR.. row == {row}') def merge_return_df_cols_interest(dose_df, cortisol_df, cols_of_interest): merge_dose_cortisol = dose_df.merge(cortisol_df, on=['Sample ID']) trim_dose_cortisol = merge_dose_cortisol[cols_of_interest].copy() return trim_dose_cortisol def enforce_col_types(df): for col in df.columns: if col == 'Sample ID' or col == 'Sex': df[col] = df[col].astype('str') elif col == 'Age (months)' or col == 'encode sex': df[col] = df[col].astype('int64') else: df[col] = df[col].astype('float64') def male_or_female(row): if row == 'M' or row == 'm' or row == 'Male': return 'Male' elif row == 'F' or row == 'f' or row == 'Female': return 'Female' else: print(f'error... row == {row}') return np.NaN def make_age_class(row): if row <= 12: return 'piglet' elif row > 12 and row < 24: return 'yearling' elif row >= 20: return 'adult' def linear_regression_scores_X_y(df, y, y_name, dose_types): """ specifically for EDA """ for Xn in dose_types: features_list = [[Xn], [Xn, 'Age (months)'], [Xn, 'Age (months)', 'encoded sex']] for features in features_list: X = df[features].values.reshape(-1, len(features)) fit_lm = LinearRegression().fit(X, y) print(f'OLS | {features} vs. {y_name} --> R2: {fit_lm.score(X, y):.4f}') print('') return fit_lm def fit_gam_plot_dependencies(df=None, features=None, target=None, basis_1=s, basis_2=False, summary=False): X = df[features] y = df[target] if basis_1 and basis_2: gam = LinearGAM(basis_1(0, lam=60) + basis_2(1, lam=60), fit_intercept=True).fit(X, y) elif basis_1: gam = LinearGAM(basis_1(0, lam=60), fit_intercept=True).fit(X, y) else: print('no basis called for features.. error') if summary: print(gam.summary()) plot_gam_partial_dependencies(gam, features, target) def plot_gam_partial_dependencies(gam, features, target): for i, term in enumerate(gam.terms): if term.isintercept: continue XX = gam.generate_X_grid(term=i) pdep, confi = gam.partial_dependence(term=i, X=XX, width=0.95) plt.figure() plt.plot(XX[:, term.feature], pdep) plt.plot(XX[:, term.feature], confi, c='r', ls='--') plt.xlabel(f'{features[i]}', fontsize=14) plt.ylabel(f'{target}', fontsize=14) plt.title(f'Functional dependence of Y on X', fontsize=14) plt.show() def graph_y_vs_dose_age_sex(df=None, x=None, x2=None, x3=None, y=None, hue=None, dose_x_size='Age (months)', multiplier=12): f, axes = plt.subplots(1, 3, figsize=(15,5), sharey=True, sharex=False) fontsize=16 colors = sns.color_palette('Paired', len(df['Sample ID'].unique())), t = (0.7,) test = [x + t for x in colors[0]] # DOSE vs. Y sns.regplot(x=x, y=y, data=df, ax=axes[0], color=test[4], scatter_kws={'alpha':.8, 'linewidth':1, 'edgecolor':'black', 's':df[dose_x_size]*multiplier}) # AGE vs. Y # male O markers sns.regplot(x=x2, y=y, data=df[df['Sex'] == 'Male'], ax=axes[1], color=test[8], marker='o', fit_reg=False, scatter_kws={'alpha':.8, 'linewidth':1, 'edgecolor':'black', 's':175,}) # female X markers sns.regplot(x=x2, y=y, data=df[df['Sex'] == 'Female'], ax=axes[1], color=test[8], marker='X', fit_reg=False, scatter_kws={'alpha':.8, 'linewidth':1, 'edgecolor':'black', 's':200,}) # plotting just the linear reg sns.regplot(x=x2, y=y, data=df, ax=axes[1], color=test[8], scatter_kws={'s':0,}) # creating custom legend handles, labels = [], [] line1 = lines.Line2D([], [], color=test[8], alpha=.8, marker='o', mew=1, mec='black') line2 = lines.Line2D([], [], color=test[8], alpha=.8, marker='X', mew=1, mec='black') handles.append(line1) handles.append(line2) labels.append('Male') labels.append('Female') axes[1].legend(handles, labels, loc='upper right',ncol=1, fancybox=True, fontsize=fontsize, markerscale=2) # SEX vs. Y palette_cust = {'Male':test[0], 'Female':test[10]} sns.boxplot(x=x3, y=y, dodge=True, palette=palette_cust, order=['Male', 'Female'], data=df, ax=axes[2],) for patch in axes[2].artists: r, g, b, a = patch.get_facecolor() patch.set_facecolor((r, g, b, .6)) sns.swarmplot(x=x3, y=y, dodge=True, palette=palette_cust, order=['Male', 'Female'], data=df, ax=axes[2], size=12, edgecolor='black', linewidth=1, **{'alpha':0.8}) x_name = 'Reasonable Total Life Time Dose (mGy)' axes[0].set_xlabel(x_name, fontsize=fontsize) axes[0].set_ylabel(y, fontsize=fontsize) axes[0].tick_params(labelsize=fontsize) axes[1].set_xlabel(x2, fontsize=fontsize) axes[1].set_ylabel('', fontsize=fontsize) axes[1].tick_params(labelsize=fontsize) axes[2].set_xlabel(x3, fontsize=fontsize) axes[2].set_ylabel('', fontsize=fontsize) axes[2].tick_params(labelsize=fontsize) # axes[0].set_xlim(-50,700) # axes[1].set_xlim(-4,55) if y == 'Mean Telomere Length (Telo-FISH)': axes[0].set_ylim(0.2,1.6) axes[1].set_ylim(0.2,1.6) y_name = y elif y == 'Mean Telomere Length (qPCR)': axes[0].set_ylim(0.6,1.8) axes[1].set_ylim(0.6,1.8) y_name = y elif y == 'Cortisol (pg/mg)': axes[0].set_ylim(-3, 35) y_name = y.replace('/', '') elif y == 'Average # of dicentrics per cell': axes[0].set_ylim(-0.005, .065) y_name = y plt.tight_layout() plt.savefig(f'graphs/main figures/{y_name} vs {x} and {x2}.png', dpi=600, bbox_inches='tight') def render_mpl_table(data, col_width=3.0, row_height=0.625, font_size=14, header_color='#40466e', row_colors=['#f1f1f2', 'w'], edge_color='black', bbox=[0, 0, 1, 1], header_columns=0, path=None, ax=None, **kwargs): if ax is None: size = (np.array(data.shape[::-1]) + np.array([0, 1])) * np.array([col_width, row_height]) fig, ax = plt.subplots(figsize=size) ax.axis('off') mpl_table = ax.table(cellText=data.values, bbox=bbox, colLabels=data.columns, **kwargs) mpl_table.auto_set_font_size(False) mpl_table.set_fontsize(font_size) for k, cell in six.iteritems(mpl_table._cells): cell.set_edgecolor(edge_color) if k[0] == 0 or k[1] < header_columns: cell.set_text_props(weight='bold', color='w') cell.set_facecolor(header_color) else: cell.set_facecolor(row_colors[k[0]%len(row_colors) ]) plt.tight_layout() if path != None: plt.savefig(path, dpi=600, bbox_inches='tight') plt.close()
2.9375
3
src/xia2/cli/report.py
graeme-winter/xia2
10
16590
import json import os import sys from collections import OrderedDict import iotbx.phil import xia2.Handlers.Streams from dials.util.options import OptionParser from jinja2 import ChoiceLoader, Environment, PackageLoader from xia2.Modules.Report import Report from xia2.XIA2Version import Version phil_scope = iotbx.phil.parse( """\ title = 'xia2 report' .type = str prefix = 'xia2' .type = str log_include = None .type = path include scope xia2.Modules.Analysis.phil_scope json { indent = None .type = int(value_min=0) } """, process_includes=True, ) help_message = """ """ def run(args): usage = "xia2.report [options] scaled_unmerged.mtz" parser = OptionParser( usage=usage, phil=phil_scope, check_format=False, epilog=help_message ) params, options, args = parser.parse_args( show_diff_phil=True, return_unhandled=True ) if len(args) == 0: parser.print_help() return unmerged_mtz = args[0] report = Report.from_unmerged_mtz(unmerged_mtz, params, report_dir=".") # xtriage xtriage_success, xtriage_warnings, xtriage_danger = None, None, None if params.xtriage_analysis: try: xtriage_success, xtriage_warnings, xtriage_danger = report.xtriage_report() except Exception as e: params.xtriage_analysis = False print("Exception runnning xtriage:") print(e) json_data = {} if params.xtriage_analysis: json_data["xtriage"] = xtriage_success + xtriage_warnings + xtriage_danger ( overall_stats_table, merging_stats_table, stats_plots, ) = report.resolution_plots_and_stats() json_data.update(stats_plots) json_data.update(report.batch_dependent_plots()) json_data.update(report.intensity_stats_plots(run_xtriage=False)) json_data.update(report.pychef_plots()) resolution_graphs = OrderedDict( (k, json_data[k]) for k in ( "cc_one_half", "i_over_sig_i", "second_moments", "wilson_intensity_plot", "completeness", "multiplicity_vs_resolution", ) if k in json_data ) if params.include_radiation_damage: batch_graphs = OrderedDict( (k, json_data[k]) for k in ( "scale_rmerge_vs_batch", "i_over_sig_i_vs_batch", "completeness_vs_dose", "rcp_vs_dose", "scp_vs_dose", "rd_vs_batch_difference", ) ) else: batch_graphs = OrderedDict( (k, json_data[k]) for k in ("scale_rmerge_vs_batch", "i_over_sig_i_vs_batch") ) misc_graphs = OrderedDict( (k, json_data[k]) for k in ("cumulative_intensity_distribution", "l_test", "multiplicities") if k in json_data ) for k, v in report.multiplicity_plots().items(): misc_graphs[k] = {"img": v} styles = {} for axis in ("h", "k", "l"): styles["multiplicity_%s" % axis] = "square-plot" loader = ChoiceLoader( [PackageLoader("xia2", "templates"), PackageLoader("dials", "templates")] ) env = Environment(loader=loader) if params.log_include: with open(params.log_include, "rb") as fh: log_text = fh.read().decode("utf-8") else: log_text = "" template = env.get_template("report.html") html = template.render( page_title=params.title, filename=os.path.abspath(unmerged_mtz), space_group=report.intensities.space_group_info().symbol_and_number(), unit_cell=str(report.intensities.unit_cell()), mtz_history=[h.strip() for h in report.mtz_object.history()], xtriage_success=xtriage_success, xtriage_warnings=xtriage_warnings, xtriage_danger=xtriage_danger, overall_stats_table=overall_stats_table, merging_stats_table=merging_stats_table, cc_half_significance_level=params.cc_half_significance_level, resolution_graphs=resolution_graphs, batch_graphs=batch_graphs, misc_graphs=misc_graphs, styles=styles, xia2_version=Version, log_text=log_text, ) with open("%s-report.json" % params.prefix, "w") as fh: json.dump(json_data, fh, indent=params.json.indent) with open("%s-report.html" % params.prefix, "wb") as fh: fh.write(html.encode("utf-8", "xmlcharrefreplace")) def run_with_log(): xia2.Handlers.Streams.setup_logging( logfile="xia2.report.txt", debugfile="xia2.report-debug.txt" ) run(sys.argv[1:])
2.046875
2
minoan_project/minoan_project/urls.py
mtzirkel/minoan
0
16591
from django.conf.urls import patterns, include, url from django.conf.urls.static import static from django.conf import settings from django.views.generic import TemplateView from . import views # Uncomment the next two lines to enable the admin: from django.contrib import admin admin.autodiscover() urlpatterns = patterns('', url(r'^$', TemplateView.as_view(template_name='base.html')), url(r'^admin/', include(admin.site.urls)), #login url(r'^login/$', 'django.contrib.auth.views.login', {'template_name': 'login.html'}), #home url(r'^home/$', views.home), ) # Uncomment the next line to serve media files in dev. # urlpatterns += static(settings.MEDIA_URL, document_root=settings.MEDIA_ROOT)
1.6875
2
algorithm/__init__.py
sirCamp/bioinformatics
0
16592
from algorithm.InsertionLengthAlgorithm import InsertionLengthAlgorithm from algorithm.PhysicalCoverageAlgorithm import PhysicalCoverageAlgorithm from algorithm.SequenceCoverageAlgorithm import SequenceCoverageAlgorithm from algorithm.CigarAlgorithm import CigarAlgorithm from algorithm.KmersAlgorithm import KmersAlgorithm
1.257813
1
attackMain.py
saurabhK99/substitution-cipher
0
16593
from tkinter import * from attack import * #calls letter frequency attack def attack(on, cipherTxt): plainTxt = str() attack = LetterFrequencyAttack(cipherTxt, on) for i in range(10): plainTxt = plainTxt + attack.attack() + '\n\n' answer.config(text = plainTxt) #defining main window root = Tk() root.title('Letter Frequency Attack') root.configure( background='#221b1b', ) root.option_add('*Font', 'helvatica 12') root.option_add('*Foreground', 'whitesmoke') root.option_add('*Background', '#221b1b') root.option_add('*Entry.HighlightColor', 'whitesmoke') #key value pairs for radio buttons types = [ ('MONOALPHABETIC_CIPHER', 'MONOALPHABETIC_CIPHER'), ('ADDITIVE_CIPHER', 'ADDITIVE_CIPHER') ] #variable to store current selection of radio button attackOn= StringVar() attackOn.set('MONOALPHABETIC_CIPHER') Label(root, text='ATTACK ON').grid(row=0, column=0, padx=20) #radio buttons for i in range(2): Radiobutton( root, text=types[i][0], value=types[i][1], variable=attackOn, highlightthickness=0, activebackground='#221b1b', activeforeground='whitesmoke' ).grid( row=0, column=i+1, padx=20, pady=20 ) #label to show the result answer = Label(root, text='ANSWER HERE', wraplength=700, justify=CENTER) answer.grid(row=1, column=0, columnspan=3, pady=20) #entry widget to input cipher text to crack Label(root, text='CIPHER TXT').grid(row=6, column=0) cipherTxt = Entry(root) cipherTxt.grid(row=6, column=1, columnspan=2, pady=20) #button to call attack() Button( root, text='DECRYPT', justify=CENTER, command=lambda: attack( attackOn.get(), cipherTxt.get() ) ).grid( row=7, column=0, columnspan=3, pady=20 ) #mainloop of tkinter window root.mainloop()
3.53125
4
eden.py
nobesio/eden
0
16594
<filename>eden.py<gh_stars>0 from random import randint import copy # Auxiliary Function for rotating the DNA in each cycle. def rotate(l,n): return l[n:] + l[:n] # History is the object responsible for accounting all the organisms. class History: def __init__(self): self.orgs = [] def addOrganism(self, org): self.orgs.append(org) def getGenepool(self): genepool = [] genepooldetail = [] for organism in self.orgs: if not organism.dna in genepool: genepool.append(organism.dna) genepooldetail.append([[organism.name], organism.dna, 1]) else: for unit in genepooldetail: if unit[1] == organism.dna: unit[0].append(organism.name) unit[2] += 1 return genepooldetail # Organism is the structure for the living organisms. class Organism: def __init__(self, name, dna, energy): self.memory = 0 self.name = name self.dna = dna self.energy = energy self.size = len(dna) self.age = 0 self.sons = 0 self.parent = "" def __repr__(self): return self.name + " E:" + str(self.energy) + "Y:" + str(self.age) def toAge(self): self.age += 1 def reportStatus(self): print("Name: ", self.name) print("DNA: ", self.dna) print("Energy: ", self.energy) print("Size: ", self.size) print("Age: ", self.age) def divide(self): self.sons += 1 son = copy.deepcopy(self) son.sons = 0 son.parent = self.name son.name = son.name + "-" + str(self.sons) son.age = 0 son.energy = 5 self.energy += -5 for x in range(randint(0,10)): if randint(1,100) > 95: print("MUTACION!") if randint(0,1) == 0: # ADD GEN son.dna.insert(randint(0,len(son.dna)-1), randint(0,12)) else: # REMOVE GEN son.dna.pop(randint(0, len(son.dna)-1)) print(son.dna) return son def decreaseEnergy(self): print("Bajando de ", self.energy) self.energy = self.energy - 1 def increaseEnergy(self, energy): self.energy = energy + energy # QuantumPackages are the "food" of this simulation. The name comes from the concept used in operative systems. class QuantumPackage: def __init__(self, quantums): self.quantums = quantums def __repr__(self): return 'QP' # Enviroment is the class responsible for holding all the living organisms. class Enviroment: def __init__(self, size): self.size = size self.landscape = [[0 for x in range(size)] for x in range(size)] def reportStatus(self): print("LANDSCAPE:") for row in self.landscape: print(row) def getOrganismsCoor(self): organisms = [] fila = 0 columna = 0 for row in self.landscape: columna = 0 for element in row: if isinstance(element,Organism): organisms.append((fila, columna)) columna += 1 fila += 1 print("FOUND ", len(organisms)) return organisms def getOrganisms(self): orgs = [] for row in self.landscape: for element in row: if isinstance(element,Organism): orgs.append(element) return orgs def countOrgs(self): cont = 0 for row in self.landscape: for element in row: if isinstance(element, Organism): cont += 1 return cont # Time is the class responsible for aging the living organisms. class Time: def aging(self, enviroment): for row in enviroment.landscape: for element in row: if isinstance(element, Organism): element.toAge() # Death is the class responsible for killing old or starving organisms. class Death: def __init__(self): self.killed = [] def kill(self, enviroment): fila=0 for row in enviroment.landscape: columna = 0 for element in row: if isinstance(element, Organism): if element.energy <= 0 or element.age > 20: self.killed.append(element) print("Killing ", fila, columna) enviroment.landscape[fila][columna] = 0 columna +=1 fila +=1 # Interpreter is the class that gives life to the organism. It executes the code in their DNA. class Interpreter: def interprete(self, enviroment): def up(): enviroment.landscape[x][y].decreaseEnergy() print("Move Up" , x, y) if x > 0: if enviroment.landscape[x-1][y] == 0: enviroment.landscape[x-1][y] = enviroment.landscape[x][y] enviroment.landscape[x][y] = 0 elif isinstance(enviroment.landscape[x-1][y],QuantumPackage): enviroment.landscape[x][y].increaseEnergy(enviroment.landscape[x-1][y].quantums) enviroment.landscape[x-1][y] = enviroment.landscape[x][y] enviroment.landscape[x][y] = 0 def down(): enviroment.landscape[x][y].decreaseEnergy() print("Move Down", x, y) if x < enviroment.size-1: if enviroment.landscape[x+1][y] == 0: enviroment.landscape[x+1][y] = enviroment.landscape[x][y] enviroment.landscape[x][y] = 0 elif isinstance(enviroment.landscape[x+1][y],QuantumPackage): enviroment.landscape[x][y].increaseEnergy(enviroment.landscape[x+1][y].quantums) enviroment.landscape[x+1][y] = enviroment.landscape[x][y] enviroment.landscape[x][y] = 0 def right(): enviroment.landscape[x][y].decreaseEnergy() print("Move Right", x, y) if y < enviroment.size-1: if enviroment.landscape[x][y+1] == 0: enviroment.landscape[x][y+1] = enviroment.landscape[x][y] enviroment.landscape[x][y] = 0 elif isinstance(enviroment.landscape[x][y+1],QuantumPackage): enviroment.landscape[x][y].increaseEnergy(enviroment.landscape[x][y+1].quantums) enviroment.landscape[x][y+1] = enviroment.landscape[x][y] enviroment.landscape[x][y] = 0 def left(): enviroment.landscape[x][y].decreaseEnergy() print("Move Left", x, y) if y > 0: if enviroment.landscape[x][y-1] == 0: enviroment.landscape[x][y-1] = enviroment.landscape[x][y] enviroment.landscape[x][y] = 0 elif isinstance(enviroment.landscape[x][y-1],QuantumPackage): enviroment.landscape[x][y].increaseEnergy(enviroment.landscape[x][y-1].quantums) enviroment.landscape[x][y-1] = enviroment.landscape[x][y] enviroment.landscape[x][y] = 0 def divide(): if enviroment.landscape[x][y].energy > 7: enviroment.landscape[x][y].decreaseEnergy() sonX = randint(-1,1) sonY = randint(-1,1) if sonX != 0 or sonY != 0: if x + sonX > 0 and x + sonX < enviroment.size-1: if y + sonY > 0 and y + sonY < enviroment.size-1: if enviroment.landscape[x + sonX][y + sonY] == 0: enviroment.landscape[x + sonX][y + sonY] = enviroment.landscape[x][y].divide() else: enviroment.landscape[x][y].decreaseEnergy() def writeOne(): print("WRITE 1") enviroment.landscape[x][y].memory = 1 def writeCero(): print("WRITE 0") enviroment.landscape[x][y].memory = 0 def ifTrue(): print("CHECKING iF TRUE") if enviroment.landscape[x][y].memory != 1: enviroment.landscape[x][y].dna = rotate(enviroment.landscape[x][y].dna, 1) def checkUp(): print("CHECKING UP") if x > 0: if enviroment.landscape[x-1][y] != 0: enviroment.landscape[x][y].memory = 1 else: enviroment.landscape[x][y].memory = 0 else: enviroment.landscape[x][y].memory = 0 def checkDown(): print("CHECKING DOWN") if x < enviroment.size-1: if enviroment.landscape[x+1][y] != 0: enviroment.landscape[x][y].memory = 1 else: enviroment.landscape[x][y].memory = 0 else: enviroment.landscape[x][y].memory = 0 def checkRight(): print("CHECKING RIGHT") if y < enviroment.size-1: if enviroment.landscape[x][y+1] != 0: enviroment.landscape[x][y].memory = 1 else: enviroment.landscape[x][y].memory = 0 else: enviroment.landscape[x][y].memory = 0 def checkLeft(): print("CHECKING LEFT") if y > 0: if enviroment.landscape[x][y-1] != 0: enviroment.landscape[x][y].memory = 1 else: enviroment.landscape[x][y].memory = 0 else: enviroment.landscape[x][y].memory = 0 def checkEnergyDivide(): if enviroment.landscape[x][y].energy > 7: enviroment.landscape[x][y].memory = 1 else: enviroment.landscape[x][y].memory = 0 options = {0 : up, 1 : down, 2 : right, 3 : left, 4 : divide, 5 : writeOne, 6 : writeCero, 7 : ifTrue, 8 : checkUp, 9 : checkDown, 10 : checkRight, 11 : checkLeft, 12: checkEnergyDivide } for organismCoordinates in enviroment.getOrganismsCoor(): x = organismCoordinates[0] y = organismCoordinates[1] gen = enviroment.landscape[x][y].dna[0] enviroment.landscape[x][y].dna = rotate(enviroment.landscape[x][y].dna, 1) print("ejecutando en ", x, y, "gen ", gen) options[gen]() if __name__ == '__main__': book = History() earth = Enviroment(10) earth.reportStatus() earth.landscape[0][0] = QuantumPackage(10) earth.landscape[1][1] = Organism("Eva", [8,7,0,9,7,1,10,7,2,11,7,3,12,7,4], 15) #<NAME> for i in range(0,4): x = randint(0, earth.size-1) y = randint(0, earth.size-1) if earth.landscape[x][y] == 0: dna = [] for a in range(1,11): dna.append(randint(0,12)) earth.landscape[x][y] = Organism("Eva"+str(i), dna, 15) earth.reportStatus() chronos = Time() parca = Death() god = Interpreter() for i in range(0,200): if earth.countOrgs() > 0: print("ciclo: ", i) god.interprete((earth)) chronos.aging(earth) parca.kill(earth) earth.reportStatus() for i in range(1,4): x = randint(0,9) y = randint(0,9) if earth.landscape[x][y] == 0: earth.landscape[x][y] = QuantumPackage(randint(5,10)) for org in earth.getOrganisms(): if not org in book.orgs: book.addOrganism(org) else: print("SE MURIERON TODOS EN EL CICLO: ", i) break print("Living:", len(earth.getOrganisms())) print("GENEPOOL:", book.getGenepool())
3.359375
3
examples/example_pipeline.py
madconsulting/datanectar
0
16595
import os import datetime from pathlib import Path import pandas as pd import luigi PROCESSED_DIR = 'processed' ROLLUP_DIR = 'rollups' class PrepareDataTask(luigi.Task): def __init__(self): super().__init__() self.last_processed_id = 0 if os.path.exists('last_processed_id.txt'): try: with open('last_processed_id.txt', 'r') as f: self.last_processed_id = int(f.read()) except Exception as e: print('Error reading last_processed_id.txt') self.last_id = self.last_processed_id self.df = pd.read_json('test_data/trip_data.json') # Simulate only getting the latest (unprocessed). self.df = self.df[self.df['id'] > self.last_processed_id] if len(self.df): self.last_id = int(self.df.iloc[-1]['id']) def requires(self): return None def run(self): if not os.path.exists(PROCESSED_DIR): os.makedirs(PROCESSED_DIR) # Simulate work #import time #time.sleep(10) # Simulate error #import random #if random.random() > 0.5: # raise Exception('Fake error') output_path = f'{PROCESSED_DIR}/processed_{self.last_id}.parquet' self.df.to_parquet(output_path) with open('last_processed_id.txt', 'w') as f: f.write(f'{self.last_id}') def output(self): output_path = f'{PROCESSED_DIR}/processed_{self.last_id}.parquet' return luigi.LocalTarget(output_path) class RollupTask(luigi.Task): date_param = luigi.DateParameter(default=datetime.date.today()) rollup_dir = Path(ROLLUP_DIR) def _output_path(self): return f'{ROLLUP_DIR}/rollup_{self.date_param}.parquet' def requires(self): return PrepareDataTask() def run(self): if not os.path.exists(ROLLUP_DIR): os.makedirs(ROLLUP_DIR) data_dir = Path(PROCESSED_DIR) df = pd.concat( pd.read_parquet(parquet_file) for parquet_file in data_dir.glob('*.parquet') ) # Average travel times rollup = df.groupby(['origin_id', 'destination_id'])['travel_time'].mean().to_frame() rollup.to_parquet(self._output_path()) def output(self): return luigi.LocalTarget(self._output_path()) if __name__ == '__main__': luigi.run()
2.640625
3
scripts/tflite_model_tools/tflite/Metadata.py
LaudateCorpus1/edgeai-tidl-tools
15
16596
<reponame>LaudateCorpus1/edgeai-tidl-tools # automatically generated by the FlatBuffers compiler, do not modify # namespace: tflite import flatbuffers from flatbuffers.compat import import_numpy np = import_numpy() class Metadata(object): __slots__ = ['_tab'] @classmethod def GetRootAsMetadata(cls, buf, offset): n = flatbuffers.encode.Get(flatbuffers.packer.uoffset, buf, offset) x = Metadata() x.Init(buf, n + offset) return x @classmethod def MetadataBufferHasIdentifier(cls, buf, offset, size_prefixed=False): return flatbuffers.util.BufferHasIdentifier(buf, offset, b"\x54\x46\x4C\x33", size_prefixed=size_prefixed) # Metadata def Init(self, buf, pos): self._tab = flatbuffers.table.Table(buf, pos) # Metadata def Name(self): o = flatbuffers.number_types.UOffsetTFlags.py_type(self._tab.Offset(4)) if o != 0: return self._tab.String(o + self._tab.Pos) return None # Metadata def Buffer(self): o = flatbuffers.number_types.UOffsetTFlags.py_type(self._tab.Offset(6)) if o != 0: return self._tab.Get(flatbuffers.number_types.Uint32Flags, o + self._tab.Pos) return 0 def MetadataStart(builder): builder.StartObject(2) def MetadataAddName(builder, name): builder.PrependUOffsetTRelativeSlot(0, flatbuffers.number_types.UOffsetTFlags.py_type(name), 0) def MetadataAddBuffer(builder, buffer): builder.PrependUint32Slot(1, buffer, 0) def MetadataEnd(builder): return builder.EndObject() class MetadataT(object): # MetadataT def __init__(self): self.name = None # type: str self.buffer = 0 # type: int @classmethod def InitFromBuf(cls, buf, pos): metadata = Metadata() metadata.Init(buf, pos) return cls.InitFromObj(metadata) @classmethod def InitFromObj(cls, metadata): x = MetadataT() x._UnPack(metadata) return x # MetadataT def _UnPack(self, metadata): if metadata is None: return self.name = metadata.Name() self.buffer = metadata.Buffer() # MetadataT def Pack(self, builder): if self.name is not None: name = builder.CreateString(self.name) MetadataStart(builder) if self.name is not None: MetadataAddName(builder, name) MetadataAddBuffer(builder, self.buffer) metadata = MetadataEnd(builder) return metadata
1.96875
2
kukur/config.py
timeseer-ai/kukur
2
16597
<gh_stars>1-10 """Read the Kukur configuration.""" # SPDX-FileCopyrightText: 2021 Timeseer.AI # # SPDX-License-Identifier: Apache-2.0 import glob import toml class InvalidIncludeException(Exception): """Raised when the include configuration is invalid.""" def __init__(self, message: str): Exception.__init__(self, f"invalid include: {message}") def from_toml(path): """Read the configuration from a TOML file, processing includes.""" config = toml.load(path) for include_options in config.get("include", []): if "glob" not in include_options: raise InvalidIncludeException('"glob" is required') for include_path in glob.glob(include_options["glob"]): include_config = toml.load(include_path) for k, v in include_config.items(): if k not in config: config[k] = v elif isinstance(config[k], list): config[k].append(v) elif isinstance(config[k], dict): config[k].update(v) else: config[k] = v return config
2.5
2
scheduletest.py
ambimanus/appsim
0
16598
import time from datetime import datetime import numpy as np from matplotlib import pyplot as plt from matplotlib.dates import epoch2num import device_factory if __name__ == '__main__': amount = 50 devices = [] for i in range(amount): device = device_factory.ecopower_4(i, i) devices.append(device) start = int(time.mktime(datetime(2010, 1, 2).timetuple()) // 60) end = int(time.mktime(datetime(2010, 1, 3).timetuple()) // 60) sample_time = start + 15 * 24 sample_dur = 16 P = [[] for d in devices] T = [[] for d in devices] Th = [[] for d in devices] for now in range(start, sample_time): for idx, device in enumerate(devices): device.step(now) P[idx].append(device.components.consumer.P) T[idx].append(device.components.storage.T) Th[idx].append(device.components.heatsink.in_heat) samples = [] for d in devices: # d.components.sampler.setpoint_density = 0.1 samples.append(d.components.sampler.sample(100, sample_dur)) # samples = [d.components.sampler.sample(100, sample_dur) for d in devices] schedule = np.zeros(sample_dur) for idx, device in enumerate(devices): # min_schedule_idx = np.argmin(np.sum(np.abs(samples[idx]), axis=1)) # device.components.scheduler.schedule = samples[idx][min_schedule_idx] # schedule += samples[idx][min_schedule_idx] max_schedule_idx = np.argmax(np.sum(np.abs(samples[idx]), axis=1)) device.components.scheduler.schedule = samples[idx][max_schedule_idx] schedule += samples[idx][max_schedule_idx] for now in range(sample_time, end): for idx, device in enumerate(devices): device.step(now) P[idx].append(device.components.consumer.P) T[idx].append(device.components.storage.T) Th[idx].append(device.components.heatsink.in_heat) P = np.sum(P, axis=0) Th = np.sum(Th, axis=0) T = np.mean(T, axis=0) ax = plt.subplot(2, 1, 1) ax.grid(True) tz = 60 # timezone deviation in minutes x = epoch2num(np.arange((start + tz) * 60, (end + tz) * 60, 60)) Th = np.reshape(Th, (len(x) // 15, 15)).mean(axis=1) ax.plot_date(x[::15], Th, color='magenta', label='P$_{th,out}$ (kW)', ls='-', marker=None) ax.legend() ax = plt.subplot(2, 1, 2, sharex=ax) ax.grid(True) l1 = ax.plot_date(x, P, label='P$_{el}$ (kW)', ls='-', marker=None) sched_x = epoch2num(np.arange( (sample_time + tz) * 60, ((sample_time + tz) + sample_dur * 15) * 60, 60)) l2 = ax.plot_date(sched_x[::15], schedule, color='r', label='Schedule', ls='-', marker=None) ax = plt.twinx() l3 = ax.plot_date(x, T, color='g', label='T (\\textdegree C)', ls='-', marker=None) lines = l1 + l2 + l3 labels = [l.get_label() for l in lines] ax.legend(lines, labels) plt.gcf().autofmt_xdate() # # Samples plot # fig, ax = plt.subplots(len(samples)) # if len(samples) == 1: # ax = [ax] # for i, sample in enumerate(samples): # t = np.arange(len(sample[0])) # for s in sample: # ax[i].plot(t, s) plt.show()
2.40625
2
src/genie/libs/parser/iosxe/tests/ShowInstallState/cli/equal/golden_output3_expected.py
ykoehler/genieparser
0
16599
<reponame>ykoehler/genieparser<filename>src/genie/libs/parser/iosxe/tests/ShowInstallState/cli/equal/golden_output3_expected.py expected_output = { "location": { "R0 R1": { "auto_abort_timer": "inactive", "pkg_state": { 1: { "filename_version": "17.08.01.0.149429", "state": "U", "type": "IMG", } }, } } }
1.09375
1