name stringlengths 15 44 | language stringclasses 1 value | prompt stringlengths 104 1.4k | doctests stringclasses 1 value | original stringlengths 130 159 | prompt_terminology stringclasses 1 value | tests stringlengths 125 1.69k | stop_tokens stringclasses 1 value |
|---|---|---|---|---|---|---|---|
HumanEval_0_has_close_elements | jl | """ Check if in given vector of numbers, are any two numbers closer to each other than
given threshold.
>>> has_close_elements([1.0, 2.0, 3.0], 0.5)
false
>>> has_close_elements([1.0, 2.8, 3.0, 4.0, 5.0, 2.0], 0.3)
true"""
function has_close_elements(numbers::Vector{Float64}, threshold::Float64)::Bool
| transform | /work/arjunguha-research-group/arjun/repos/nuprl/MultiPL-E/datasets/../datasets/originals-with-cleaned-doctests/HumanEval_0_has_close_elements.py | reworded | using Test
@testset begin
candidate = has_close_elements;
@test(candidate([1.0, 2.0, 3.9, 4.0, 5.0, 2.2], 0.3) == true)
@test(candidate([1.0, 2.0, 3.9, 4.0, 5.0, 2.2], 0.05) == false)
@test(candidate([1.0, 2.0, 5.9, 4.0, 5.0], 0.95) == true)
@test(candidate([1.0, 2.0, 5.9, 4.0, 5.0], 0.8) == false)
@test(candidate([1.0, 2.0, 3.0, 4.0, 5.0, 2.0], 0.1) == true)
@test(candidate([1.1, 2.2, 3.1, 4.1, 5.1], 1.0) == true)
@test(candidate([1.1, 2.2, 3.1, 4.1, 5.1], 0.5) == false)
end
| ['\nfunction' '\nmacro' '\n\n'] |
HumanEval_1_separate_paren_groups | jl | """ Input to this function is a string containing multiple groups of nested parentheses. Your goal is to
separate those group into separate strings and return the vector of those.
Separate groups are balanced (each open brace is properly closed) and not nested within each other
Ignore any spaces in the input string.
>>> separate_paren_groups("( ) (( )) (( )( ))")
["()", "(())", "(()())"]"""
function separate_paren_groups(paren_string::String)::Vector{String}
| transform | /work/arjunguha-research-group/arjun/repos/nuprl/MultiPL-E/datasets/../datasets/originals-with-cleaned-doctests/HumanEval_1_separate_paren_groups.py | reworded | using Test
@testset begin
candidate = separate_paren_groups;
@test(candidate("(()()) ((())) () ((())()())") == ["(()())", "((()))", "()", "((())()())"])
@test(candidate("() (()) ((())) (((())))") == ["()", "(())", "((()))", "(((())))"])
@test(candidate("(()(())((())))") == ["(()(())((())))"])
@test(candidate("( ) (( )) (( )( ))") == ["()", "(())", "(()())"])
end
| ['\nfunction' '\nmacro' '\n\n'] |
HumanEval_2_truncate_number | jl | """ Given a positive floating point number, it can be decomposed into
and integer part (largest integer smaller than given number) and decimals
(leftover part always smaller than 1).
Return the decimal part of the number.
>>> truncate_number(3.5)
0.5"""
function truncate_number(number::Float64)::Float64
| transform | /work/arjunguha-research-group/arjun/repos/nuprl/MultiPL-E/datasets/../datasets/originals-with-cleaned-doctests/HumanEval_2_truncate_number.py | reworded | using Test
@testset begin
candidate = truncate_number;
@test(candidate(3.5) == 0.5)
@test(candidate(1.25) == 0.25)
@test(candidate(123.0) == 0.0)
end
| ['\nfunction' '\nmacro' '\n\n'] |
HumanEval_3_below_zero | jl | """ You're given a vector of deposit and withdrawal operations on a bank account that starts with
zero balance. Your task is to detect if at any point the balance of account fallls below zero, and
at that point function should return true. Otherwise it should return false.
>>> below_zero([1, 2, 3])
false
>>> below_zero([1, 2, -4, 5])
true"""
function below_zero(operations::Vector{Int64})::Bool
| transform | /work/arjunguha-research-group/arjun/repos/nuprl/MultiPL-E/datasets/../datasets/originals-with-cleaned-doctests/HumanEval_3_below_zero.py | reworded | using Test
@testset begin
candidate = below_zero;
@test(candidate(Vector{Int64}([])) == false)
@test(candidate([1, 2, -3, 1, 2, -3]) == false)
@test(candidate([1, 2, -4, 5, 6]) == true)
@test(candidate([1, -1, 2, -2, 5, -5, 4, -4]) == false)
@test(candidate([1, -1, 2, -2, 5, -5, 4, -5]) == true)
@test(candidate([1, -2, 2, -2, 5, -5, 4, -4]) == true)
end
| ['\nfunction' '\nmacro' '\n\n'] |
HumanEval_4_mean_absolute_deviation | jl | """ For a given vector of input numbers, calculate Mean Absolute Deviation
around the mean of this dataset.
Mean Absolute Deviation is the average absolute difference between each
element and a centerpoint (mean in this case):
MAD = average | x - x_mean |
>>> mean_absolute_deviation([1.0, 2.0, 3.0, 4.0])
1.0"""
function mean_absolute_deviation(numbers::Vector{Float64})::Float64
| transform | /work/arjunguha-research-group/arjun/repos/nuprl/MultiPL-E/datasets/../datasets/originals-with-cleaned-doctests/HumanEval_4_mean_absolute_deviation.py | reworded | using Test
@testset begin
candidate = mean_absolute_deviation;
@test(candidate([1.0, 2.0]) == 0.5)
@test(candidate([1.0, 2.0, 3.0, 4.0]) == 1.0)
@test(candidate([1.0, 2.0, 3.0, 4.0, 5.0]) == 1.2)
end
| ['\nfunction' '\nmacro' '\n\n'] |
HumanEval_5_intersperse | jl | """ Insert a number 'delimeter' between every two consecutive elements of input vector `numbers'
>>> intersperse([], 4)
[]
>>> intersperse([1, 2, 3], 4)
[1, 4, 2, 4, 3]"""
function intersperse(numbers::Vector{Int64}, delimeter::Int64)::Vector{Int64}
| transform | /work/arjunguha-research-group/arjun/repos/nuprl/MultiPL-E/datasets/../datasets/originals-with-cleaned-doctests/HumanEval_5_intersperse.py | reworded | using Test
@testset begin
candidate = intersperse;
@test(candidate(Vector{Int64}([]), 7) == Vector{Int64}([]))
@test(candidate([5, 6, 3, 2], 8) == [5, 8, 6, 8, 3, 8, 2])
@test(candidate([2, 2, 2], 2) == [2, 2, 2, 2, 2])
end
| ['\nfunction' '\nmacro' '\n\n'] |
HumanEval_6_parse_nested_parens | jl | """ Input to this function is a string represented multiple groups for nested parentheses separated by spaces.
For each of the group, output the deepest level of nesting of parentheses.
E.g. (()()) has maximum two levels of nesting while ((())) has three.
>>> parse_nested_parens("(()()) ((())) () ((())()())")
[2, 3, 1, 3]"""
function parse_nested_parens(paren_string::String)::Vector{Int64}
| transform | /work/arjunguha-research-group/arjun/repos/nuprl/MultiPL-E/datasets/../datasets/originals-with-cleaned-doctests/HumanEval_6_parse_nested_parens.py | reworded | using Test
@testset begin
candidate = parse_nested_parens;
@test(candidate("(()()) ((())) () ((())()())") == [2, 3, 1, 3])
@test(candidate("() (()) ((())) (((())))") == [1, 2, 3, 4])
@test(candidate("(()(())((())))") == [4])
end
| ['\nfunction' '\nmacro' '\n\n'] |
HumanEval_7_filter_by_substring | jl | """ Filter an input vector of strings only for ones that contain given substring
>>> filter_by_substring([], "a")
[]
>>> filter_by_substring(["abc", "bacd", "cde", "array"], "a")
["abc", "bacd", "array"]"""
function filter_by_substring(strings::Vector{String}, substring::String)::Vector{String}
| transform | /work/arjunguha-research-group/arjun/repos/nuprl/MultiPL-E/datasets/../datasets/originals-with-cleaned-doctests/HumanEval_7_filter_by_substring.py | reworded | using Test
@testset begin
candidate = filter_by_substring;
@test(candidate(Vector{String}([]), "john") == Vector{String}([]))
@test(candidate(["xxx", "asd", "xxy", "john doe", "xxxAAA", "xxx"], "xxx") == ["xxx", "xxxAAA", "xxx"])
@test(candidate(["xxx", "asd", "aaaxxy", "john doe", "xxxAAA", "xxx"], "xx") == ["xxx", "aaaxxy", "xxxAAA", "xxx"])
@test(candidate(["grunt", "trumpet", "prune", "gruesome"], "run") == ["grunt", "prune"])
end
| ['\nfunction' '\nmacro' '\n\n'] |
HumanEval_8_sum_product | jl | """ For a given vector of integers, return a tuple consisting of a sum and a product of all the integers in a vector.
Empty sum should be equal to 0 and empty product should be equal to 1.
>>> sum_product([])
(0, 1)
>>> sum_product([1, 2, 3, 4])
(10, 24)"""
function sum_product(numbers::Vector{Int64})::Tuple{Int64, Int64}
| transform | /work/arjunguha-research-group/arjun/repos/nuprl/MultiPL-E/datasets/../datasets/originals-with-cleaned-doctests/HumanEval_8_sum_product.py | reworded | using Test
@testset begin
candidate = sum_product;
@test(candidate(Vector{Int64}([])) == (0, 1))
@test(candidate([1, 1, 1]) == (3, 1))
@test(candidate([100, 0]) == (100, 0))
@test(candidate([3, 5, 7]) == (15, 105))
@test(candidate([10]) == (10, 10))
end
| ['\nfunction' '\nmacro' '\n\n'] |
HumanEval_9_rolling_max | jl | """ From a given vector of integers, generate a vector of rolling maximum element found until given moment
in the sequence.
>>> rolling_max([1, 2, 3, 2, 3, 4, 2])
[1, 2, 3, 3, 3, 4, 4]"""
function rolling_max(numbers::Vector{Int64})::Vector{Int64}
| transform | /work/arjunguha-research-group/arjun/repos/nuprl/MultiPL-E/datasets/../datasets/originals-with-cleaned-doctests/HumanEval_9_rolling_max.py | reworded | using Test
@testset begin
candidate = rolling_max;
@test(candidate(Vector{Int64}([])) == Vector{Int64}([]))
@test(candidate([1, 2, 3, 4]) == [1, 2, 3, 4])
@test(candidate([4, 3, 2, 1]) == [4, 4, 4, 4])
@test(candidate([3, 2, 3, 100, 3]) == [3, 3, 3, 100, 100])
end
| ['\nfunction' '\nmacro' '\n\n'] |
HumanEval_10_make_palindrome | jl | """ Find the shortest palindrome that begins with a supplied string.
Algorithm idea is simple:
- Find the longest postfix of supplied string that is a palindrome.
- Append to the end of the string reverse of a string prefix that comes before the palindromic suffix.
>>> make_palindrome("")
""
>>> make_palindrome("cat")
"catac"
>>> make_palindrome("cata")
"catac"
"""
function make_palindrome(string::String)::String
| transform | /work/arjunguha-research-group/arjun/repos/nuprl/MultiPL-E/datasets/../datasets/originals-with-cleaned-doctests/HumanEval_10_make_palindrome.py | reworded | using Test
@testset begin
candidate = make_palindrome;
@test(candidate("") == "")
@test(candidate("x") == "x")
@test(candidate("xyz") == "xyzyx")
@test(candidate("xyx") == "xyx")
@test(candidate("jerry") == "jerryrrej")
end
| ['\nfunction' '\nmacro' '\n\n'] |
HumanEval_11_string_xor | jl | """ Input are two strings a and b consisting only of 1s and 0s.
Perform binary XOR on these inputs and return result also as a string.
>>> string_xor("010", "110")
"100"
"""
function string_xor(a::String, b::String)::String
| transform | /work/arjunguha-research-group/arjun/repos/nuprl/MultiPL-E/datasets/../datasets/originals-with-cleaned-doctests/HumanEval_11_string_xor.py | reworded | using Test
@testset begin
candidate = string_xor;
@test(candidate("111000", "101010") == "010010")
@test(candidate("1", "1") == "0")
@test(candidate("0101", "0000") == "0101")
end
| ['\nfunction' '\nmacro' '\n\n'] |
HumanEval_12_longest | jl | """ Out of vector of strings, return the longest one. Return the first one in case of multiple
strings of the same length. Return nothing in case the input vector is empty.
>>> longest([])
nothing
>>> longest(["a", "b", "c"])
"a"
>>> longest(["a", "bb", "ccc"])
"ccc"
"""
function longest(strings::Vector{String})::Union{String, Nothing}
| transform | /work/arjunguha-research-group/arjun/repos/nuprl/MultiPL-E/datasets/../datasets/originals-with-cleaned-doctests/HumanEval_12_longest.py | reworded | using Test
@testset begin
candidate = longest;
@test(candidate(Vector{String}([])) == nothing)
@test(candidate(["x", "y", "z"]) == "x")
@test(candidate(["x", "yyy", "zzzz", "www", "kkkk", "abc"]) == "zzzz")
end
| ['\nfunction' '\nmacro' '\n\n'] |
HumanEval_13_greatest_common_divisor | jl | """ Return a greatest common divisor of two integers a and b
>>> greatest_common_divisor(3, 5)
1
>>> greatest_common_divisor(25, 15)
5"""
function greatest_common_divisor(a::Int64, b::Int64)::Int64
| transform | /work/arjunguha-research-group/arjun/repos/nuprl/MultiPL-E/datasets/../datasets/originals-with-cleaned-doctests/HumanEval_13_greatest_common_divisor.py | reworded | using Test
@testset begin
candidate = greatest_common_divisor;
@test(candidate(3, 7) == 1)
@test(candidate(10, 15) == 5)
@test(candidate(49, 14) == 7)
@test(candidate(144, 60) == 12)
end
| ['\nfunction' '\nmacro' '\n\n'] |
HumanEval_14_all_prefixes | jl | """ Return vector of all prefixes from shortest to longest of the input string
>>> all_prefixes("abc")
["a", "ab", "abc"]"""
function all_prefixes(string::String)::Vector{String}
| transform | /work/arjunguha-research-group/arjun/repos/nuprl/MultiPL-E/datasets/../datasets/originals-with-cleaned-doctests/HumanEval_14_all_prefixes.py | reworded | using Test
@testset begin
candidate = all_prefixes;
@test(candidate("") == Vector{String}([]))
@test(candidate("asdfgh") == ["a", "as", "asd", "asdf", "asdfg", "asdfgh"])
@test(candidate("WWW") == ["W", "WW", "WWW"])
end
| ['\nfunction' '\nmacro' '\n\n'] |
HumanEval_15_string_sequence | jl | """ Return a string containing space-delimited numbers starting from 0 upto n inclusive.
>>> string_sequence(0)
"0"
>>> string_sequence(5)
"0 1 2 3 4 5"
"""
function string_sequence(n::Int64)::String
| transform | /work/arjunguha-research-group/arjun/repos/nuprl/MultiPL-E/datasets/../datasets/originals-with-cleaned-doctests/HumanEval_15_string_sequence.py | reworded | using Test
@testset begin
candidate = string_sequence;
@test(candidate(0) == "0")
@test(candidate(3) == "0 1 2 3")
@test(candidate(10) == "0 1 2 3 4 5 6 7 8 9 10")
end
| ['\nfunction' '\nmacro' '\n\n'] |
HumanEval_16_count_distinct_characters | jl | """ Given a string, find out how many distinct characters (regardless of case) does it consist of
>>> count_distinct_characters("xyzXYZ")
3
>>> count_distinct_characters("Jerry")
4"""
function count_distinct_characters(string::String)::Int64
| transform | /work/arjunguha-research-group/arjun/repos/nuprl/MultiPL-E/datasets/../datasets/originals-with-cleaned-doctests/HumanEval_16_count_distinct_characters.py | reworded | using Test
@testset begin
candidate = count_distinct_characters;
@test(candidate("") == 0)
@test(candidate("abcde") == 5)
@test(candidate("abcdecadeCADE") == 5)
@test(candidate("aaaaAAAAaaaa") == 1)
@test(candidate("Jerry jERRY JeRRRY") == 5)
end
| ['\nfunction' '\nmacro' '\n\n'] |
HumanEval_17_parse_music | jl | """ Input to this function is a string representing musical notes in a special ASCII format.
Your task is to parse this string and return vector of integers corresponding to how many beats does each
not last.
Here is a legend:
'o' - whole note, lasts four beats
'o|' - half note, lasts two beats
'.|' - quater note, lasts one beat
>>> parse_music("o o| .| o| o| .| .| .| .| o o")
[4, 2, 1, 2, 2, 1, 1, 1, 1, 4, 4]"""
function parse_music(music_string::String)::Vector{Int64}
| transform | /work/arjunguha-research-group/arjun/repos/nuprl/MultiPL-E/datasets/../datasets/originals-with-cleaned-doctests/HumanEval_17_parse_music.py | reworded | using Test
@testset begin
candidate = parse_music;
@test(candidate("") == Vector{Int64}([]))
@test(candidate("o o o o") == [4, 4, 4, 4])
@test(candidate(".| .| .| .|") == [1, 1, 1, 1])
@test(candidate("o| o| .| .| o o o o") == [2, 2, 1, 1, 4, 4, 4, 4])
@test(candidate("o| .| o| .| o o| o o|") == [2, 1, 2, 1, 4, 2, 4, 2])
end
| ['\nfunction' '\nmacro' '\n\n'] |
HumanEval_18_how_many_times | jl | """ Find how many times a given substring can be found in the original string. Count overlaping cases.
>>> how_many_times("", "a")
0
>>> how_many_times("aaa", "a")
3
>>> how_many_times("aaaa", "aa")
3"""
function how_many_times(string::String, substring::String)::Int64
| transform | /work/arjunguha-research-group/arjun/repos/nuprl/MultiPL-E/datasets/../datasets/originals-with-cleaned-doctests/HumanEval_18_how_many_times.py | reworded | using Test
@testset begin
candidate = how_many_times;
@test(candidate("", "x") == 0)
@test(candidate("xyxyxyx", "x") == 4)
@test(candidate("cacacacac", "cac") == 4)
@test(candidate("john doe", "john") == 1)
end
| ['\nfunction' '\nmacro' '\n\n'] |
HumanEval_19_sort_numbers | jl | """ Input is a space-delimited string of numberals from 'zero' to 'nine'.
Valid choices are 'zero', 'one', 'two', 'three', 'four', 'five', 'six', 'seven', 'eight' and 'nine'.
Return the string with numbers sorted from smallest to largest
>>> sort_numbers("three one five")
"one three five"
"""
function sort_numbers(numbers::String)::String
| transform | /work/arjunguha-research-group/arjun/repos/nuprl/MultiPL-E/datasets/../datasets/originals-with-cleaned-doctests/HumanEval_19_sort_numbers.py | reworded | using Test
@testset begin
candidate = sort_numbers;
@test(candidate("") == "")
@test(candidate("three") == "three")
@test(candidate("three five nine") == "three five nine")
@test(candidate("five zero four seven nine eight") == "zero four five seven eight nine")
@test(candidate("six five four three two one zero") == "zero one two three four five six")
end
| ['\nfunction' '\nmacro' '\n\n'] |
HumanEval_20_find_closest_elements | jl | """ From a supplied vector of numbers (of length at least two) select and return two that are the closest to each
other and return them in order (smaller number, larger number).
>>> find_closest_elements([1.0, 2.0, 3.0, 4.0, 5.0, 2.2])
(2.0, 2.2)
>>> find_closest_elements([1.0, 2.0, 3.0, 4.0, 5.0, 2.0])
(2.0, 2.0)"""
function find_closest_elements(numbers::Vector{Float64})::Tuple{Float64, Float64}
| transform | /work/arjunguha-research-group/arjun/repos/nuprl/MultiPL-E/datasets/../datasets/originals-with-cleaned-doctests/HumanEval_20_find_closest_elements.py | reworded | using Test
@testset begin
candidate = find_closest_elements;
@test(candidate([1.0, 2.0, 3.9, 4.0, 5.0, 2.2]) == (3.9, 4.0))
@test(candidate([1.0, 2.0, 5.9, 4.0, 5.0]) == (5.0, 5.9))
@test(candidate([1.0, 2.0, 3.0, 4.0, 5.0, 2.2]) == (2.0, 2.2))
@test(candidate([1.0, 2.0, 3.0, 4.0, 5.0, 2.0]) == (2.0, 2.0))
@test(candidate([1.1, 2.2, 3.1, 4.1, 5.1]) == (2.2, 3.1))
end
| ['\nfunction' '\nmacro' '\n\n'] |
HumanEval_21_rescale_to_unit | jl | """ Given vector of numbers (of at least two elements), apply a linear transform to that vector,
such that the smallest number will become 0 and the largest will become 1
>>> rescale_to_unit([1.0, 2.0, 3.0, 4.0, 5.0])
[0.0, 0.25, 0.5, 0.75, 1.0]"""
function rescale_to_unit(numbers::Vector{Float64})::Vector{Float64}
| transform | /work/arjunguha-research-group/arjun/repos/nuprl/MultiPL-E/datasets/../datasets/originals-with-cleaned-doctests/HumanEval_21_rescale_to_unit.py | reworded | using Test
@testset begin
candidate = rescale_to_unit;
@test(candidate([2.0, 49.9]) == [0.0, 1.0])
@test(candidate([100.0, 49.9]) == [1.0, 0.0])
@test(candidate([1.0, 2.0, 3.0, 4.0, 5.0]) == [0.0, 0.25, 0.5, 0.75, 1.0])
@test(candidate([2.0, 1.0, 5.0, 3.0, 4.0]) == [0.25, 0.0, 1.0, 0.5, 0.75])
@test(candidate([12.0, 11.0, 15.0, 13.0, 14.0]) == [0.25, 0.0, 1.0, 0.5, 0.75])
end
| ['\nfunction' '\nmacro' '\n\n'] |
HumanEval_22_filter_integers | jl | """ Filter given vector of any jlthon values only for integers
>>> filter_integers(["a", 3.14, 5])
[5]
>>> filter_integers([1, 2, 3, "abc", Dict(), []])
[1, 2, 3]"""
function filter_integers(values::Vector{Any})::Vector{Int64}
| transform | /work/arjunguha-research-group/arjun/repos/nuprl/MultiPL-E/datasets/../datasets/originals-with-cleaned-doctests/HumanEval_22_filter_integers.py | reworded | using Test
@testset begin
candidate = filter_integers;
@test(candidate(Vector{Any}([])) == Vector{Int64}([]))
@test(candidate([4, Dict(), [], 23.2, 9, "adasd"]) == [4, 9])
@test(candidate([3, "c", 3, 3, "a", "b"]) == [3, 3, 3])
end
| ['\nfunction' '\nmacro' '\n\n'] |
HumanEval_23_strlen | jl | """ Return length of given string
>>> strlen("")
0
>>> strlen("abc")
3"""
function strlen(string::String)::Int64
| transform | /work/arjunguha-research-group/arjun/repos/nuprl/MultiPL-E/datasets/../datasets/originals-with-cleaned-doctests/HumanEval_23_strlen.py | reworded | using Test
@testset begin
candidate = strlen;
@test(candidate("") == 0)
@test(candidate("x") == 1)
@test(candidate("asdasnakj") == 9)
end
| ['\nfunction' '\nmacro' '\n\n'] |
HumanEval_24_largest_divisor | jl | """ For a given number n, find the largest number that divides n evenly, smaller than n
>>> largest_divisor(15)
5"""
function largest_divisor(n::Int64)::Int64
| transform | /work/arjunguha-research-group/arjun/repos/nuprl/MultiPL-E/datasets/../datasets/originals-with-cleaned-doctests/HumanEval_24_largest_divisor.py | reworded | using Test
@testset begin
candidate = largest_divisor;
@test(candidate(3) == 1)
@test(candidate(7) == 1)
@test(candidate(10) == 5)
@test(candidate(100) == 50)
@test(candidate(49) == 7)
end
| ['\nfunction' '\nmacro' '\n\n'] |
HumanEval_25_factorize | jl | """ Return vector of prime factors of given integer in the order from smallest to largest.
Each of the factors should be vectored number of times corresponding to how many times it appeares in factorization.
Input number should be equal to the product of all factors
>>> factorize(8)
[2, 2, 2]
>>> factorize(25)
[5, 5]
>>> factorize(70)
[2, 5, 7]"""
function factorize(n::Int64)::Vector{Int64}
| transform | /work/arjunguha-research-group/arjun/repos/nuprl/MultiPL-E/datasets/../datasets/originals-with-cleaned-doctests/HumanEval_25_factorize.py | reworded | using Test
@testset begin
candidate = factorize;
@test(candidate(2) == [2])
@test(candidate(4) == [2, 2])
@test(candidate(8) == [2, 2, 2])
@test(candidate(57) == [3, 19])
@test(candidate(3249) == [3, 3, 19, 19])
@test(candidate(185193) == [3, 3, 3, 19, 19, 19])
@test(candidate(20577) == [3, 19, 19, 19])
@test(candidate(18) == [2, 3, 3])
end
| ['\nfunction' '\nmacro' '\n\n'] |
HumanEval_26_remove_duplicates | jl | """ From a vector of integers, remove all elements that occur more than once.
Keep order of elements left the same as in the input.
>>> remove_duplicates([1, 2, 3, 2, 4])
[1, 3, 4]"""
function remove_duplicates(numbers::Vector{Int64})::Vector{Int64}
| transform | /work/arjunguha-research-group/arjun/repos/nuprl/MultiPL-E/datasets/../datasets/originals-with-cleaned-doctests/HumanEval_26_remove_duplicates.py | reworded | using Test
@testset begin
candidate = remove_duplicates;
@test(candidate(Vector{Int64}([])) == Vector{Int64}([]))
@test(candidate([1, 2, 3, 4]) == [1, 2, 3, 4])
@test(candidate([1, 2, 3, 2, 4, 3, 5]) == [1, 4, 5])
end
| ['\nfunction' '\nmacro' '\n\n'] |
HumanEval_27_flip_case | jl | """ For a given string, flip lowercase characters to uppercase and uppercase to lowercase.
>>> flip_case("Hello")
"hELLO"
"""
function flip_case(string::String)::String
| transform | /work/arjunguha-research-group/arjun/repos/nuprl/MultiPL-E/datasets/../datasets/originals-with-cleaned-doctests/HumanEval_27_flip_case.py | reworded | using Test
@testset begin
candidate = flip_case;
@test(candidate("") == "")
@test(candidate("Hello!") == "hELLO!")
@test(candidate("These violent delights have violent ends") == "tHESE VIOLENT DELIGHTS HAVE VIOLENT ENDS")
end
| ['\nfunction' '\nmacro' '\n\n'] |
HumanEval_28_concatenate | jl | """ Concatenate vector of strings into a single string
>>> concatenate([])
""
>>> concatenate(["a", "b", "c"])
"abc"
"""
function concatenate(strings::Vector{String})::String
| transform | /work/arjunguha-research-group/arjun/repos/nuprl/MultiPL-E/datasets/../datasets/originals-with-cleaned-doctests/HumanEval_28_concatenate.py | reworded | using Test
@testset begin
candidate = concatenate;
@test(candidate(Vector{String}([])) == "")
@test(candidate(["x", "y", "z"]) == "xyz")
@test(candidate(["x", "y", "z", "w", "k"]) == "xyzwk")
end
| ['\nfunction' '\nmacro' '\n\n'] |
HumanEval_29_filter_by_prefix | jl | """ Filter an input vector of strings only for ones that start with a given prefix.
>>> filter_by_prefix([], "a")
[]
>>> filter_by_prefix(["abc", "bcd", "cde", "array"], "a")
["abc", "array"]"""
function filter_by_prefix(strings::Vector{String}, prefix::String)::Vector{String}
| transform | /work/arjunguha-research-group/arjun/repos/nuprl/MultiPL-E/datasets/../datasets/originals-with-cleaned-doctests/HumanEval_29_filter_by_prefix.py | reworded | using Test
@testset begin
candidate = filter_by_prefix;
@test(candidate(Vector{String}([]), "john") == Vector{String}([]))
@test(candidate(["xxx", "asd", "xxy", "john doe", "xxxAAA", "xxx"], "xxx") == ["xxx", "xxxAAA", "xxx"])
end
| ['\nfunction' '\nmacro' '\n\n'] |
HumanEval_30_get_positive | jl | """Return only positive numbers in the vector.
>>> get_positive([-1, 2, -4, 5, 6])
[2, 5, 6]
>>> get_positive([5, 3, -5, 2, -3, 3, 9, 0, 123, 1, -10])
[5, 3, 2, 3, 9, 123, 1]"""
function get_positive(l::Vector{Int64})::Vector{Int64}
| transform | /work/arjunguha-research-group/arjun/repos/nuprl/MultiPL-E/datasets/../datasets/originals-with-cleaned-doctests/HumanEval_30_get_positive.py | reworded | using Test
@testset begin
candidate = get_positive;
@test(candidate([-1, -2, 4, 5, 6]) == [4, 5, 6])
@test(candidate([5, 3, -5, 2, 3, 3, 9, 0, 123, 1, -10]) == [5, 3, 2, 3, 3, 9, 123, 1])
@test(candidate([-1, -2]) == Vector{Int64}([]))
@test(candidate(Vector{Int64}([])) == Vector{Int64}([]))
end
| ['\nfunction' '\nmacro' '\n\n'] |
HumanEval_31_is_prime | jl | """Return true if a given number is prime, and false otherwise.
>>> is_prime(6)
false
>>> is_prime(101)
true
>>> is_prime(11)
true
>>> is_prime(13441)
true
>>> is_prime(61)
true
>>> is_prime(4)
false
>>> is_prime(1)
false"""
function is_prime(n::Int64)::Bool
| transform | /work/arjunguha-research-group/arjun/repos/nuprl/MultiPL-E/datasets/../datasets/originals-with-cleaned-doctests/HumanEval_31_is_prime.py | reworded | using Test
@testset begin
candidate = is_prime;
@test(candidate(6) == false)
@test(candidate(101) == true)
@test(candidate(11) == true)
@test(candidate(13441) == true)
@test(candidate(61) == true)
@test(candidate(4) == false)
@test(candidate(1) == false)
@test(candidate(5) == true)
@test(candidate(11) == true)
@test(candidate(17) == true)
@test(candidate(85) == false)
@test(candidate(77) == false)
@test(candidate(255379) == false)
end
| ['\nfunction' '\nmacro' '\n\n'] |
HumanEval_33_sort_third | jl | """This function takes a vector l and returns a vector l' such that
l' is identical to l in the indicies that are not divisible by three, while its values at the indicies that are divisible by three are equal
to the values of the corresponding indicies of l, but sorted.
Note: In this problem, all index-related conditions (e.g., even, odd, multiples of k) are defined with 0-based indexing.
>>> sort_third([1, 2, 3])
[1, 2, 3]
>>> sort_third([5, 6, 3, 4, 8, 9, 2])
[2, 6, 3, 4, 8, 9, 5]"""
function sort_third(l::Vector{Int64})::Vector{Int64}
| transform | /work/arjunguha-research-group/arjun/repos/nuprl/MultiPL-E/datasets/../datasets/originals-with-cleaned-doctests/HumanEval_33_sort_third.py | reworded | using Test
@testset begin
candidate = sort_third;
@test(candidate([5, 6, 3, 4, 8, 9, 2]) == [2, 6, 3, 4, 8, 9, 5])
@test(candidate([5, 8, 3, 4, 6, 9, 2]) == [2, 8, 3, 4, 6, 9, 5])
@test(candidate([5, 6, 9, 4, 8, 3, 2]) == [2, 6, 9, 4, 8, 3, 5])
@test(candidate([5, 6, 3, 4, 8, 9, 2, 1]) == [2, 6, 3, 4, 8, 9, 5, 1])
end
| ['\nfunction' '\nmacro' '\n\n'] |
HumanEval_34_unique | jl | """Return sorted unique elements in a vector
>>> unique([5, 3, 5, 2, 3, 3, 9, 0, 123])
[0, 2, 3, 5, 9, 123]"""
function unique(l::Vector{Int64})::Vector{Int64}
| transform | /work/arjunguha-research-group/arjun/repos/nuprl/MultiPL-E/datasets/../datasets/originals-with-cleaned-doctests/HumanEval_34_unique.py | reworded | using Test
@testset begin
candidate = unique;
@test(candidate([5, 3, 5, 2, 3, 3, 9, 0, 123]) == [0, 2, 3, 5, 9, 123])
end
| ['\nfunction' '\nmacro' '\n\n'] |
HumanEval_35_max_element | jl | """Return maximum element in the vector.
>>> max_element([1, 2, 3])
3
>>> max_element([5, 3, -5, 2, -3, 3, 9, 0, 123, 1, -10])
123"""
function max_element(l::Vector{Int64})::Int64
| transform | /work/arjunguha-research-group/arjun/repos/nuprl/MultiPL-E/datasets/../datasets/originals-with-cleaned-doctests/HumanEval_35_max_element.py | reworded | using Test
@testset begin
candidate = max_element;
@test(candidate([1, 2, 3]) == 3)
@test(candidate([5, 3, -5, 2, -3, 3, 9, 0, 124, 1, -10]) == 124)
end
| ['\nfunction' '\nmacro' '\n\n'] |
HumanEval_36_fizz_buzz | jl | """Return the number of times the digit 7 appears in integers less than n which are divisible by 11 or 13.
>>> fizz_buzz(50)
0
>>> fizz_buzz(78)
2
>>> fizz_buzz(79)
3"""
function fizz_buzz(n::Int64)::Int64
| transform | /work/arjunguha-research-group/arjun/repos/nuprl/MultiPL-E/datasets/../datasets/originals-with-cleaned-doctests/HumanEval_36_fizz_buzz.py | reworded | using Test
@testset begin
candidate = fizz_buzz;
@test(candidate(50) == 0)
@test(candidate(78) == 2)
@test(candidate(79) == 3)
@test(candidate(100) == 3)
@test(candidate(200) == 6)
@test(candidate(4000) == 192)
@test(candidate(10000) == 639)
@test(candidate(100000) == 8026)
end
| ['\nfunction' '\nmacro' '\n\n'] |
HumanEval_37_sort_even | jl | """This function takes a vector l and returns a vector l' such that
l' is identical to l in the odd indicies, while its values at the even indicies are equal
to the values of the even indicies of l, but sorted.
Note: In this problem, all index-related conditions (e.g., even, odd, multiples of k) are defined with 0-based indexing.
>>> sort_even([1, 2, 3])
[1, 2, 3]
>>> sort_even([5, 6, 3, 4])
[3, 6, 5, 4]"""
function sort_even(l::Vector{Int64})::Vector{Int64}
| transform | /work/arjunguha-research-group/arjun/repos/nuprl/MultiPL-E/datasets/../datasets/originals-with-cleaned-doctests/HumanEval_37_sort_even.py | reworded | using Test
@testset begin
candidate = sort_even;
@test(candidate([1, 2, 3]) == [1, 2, 3])
@test(candidate([5, 3, -5, 2, -3, 3, 9, 0, 123, 1, -10]) == [-10, 3, -5, 2, -3, 3, 5, 0, 9, 1, 123])
@test(candidate([5, 8, -12, 4, 23, 2, 3, 11, 12, -10]) == [-12, 8, 3, 4, 5, 2, 12, 11, 23, -10])
end
| ['\nfunction' '\nmacro' '\n\n'] |
HumanEval_39_prime_fib | jl | """prime_fib returns n-th number that is a Fibonacci number and it's also prime.
>>> prime_fib(1)
2
>>> prime_fib(2)
3
>>> prime_fib(3)
5
>>> prime_fib(4)
13
>>> prime_fib(5)
89"""
function prime_fib(n::Int64)::Int64
| transform | /work/arjunguha-research-group/arjun/repos/nuprl/MultiPL-E/datasets/../datasets/originals-with-cleaned-doctests/HumanEval_39_prime_fib.py | reworded | using Test
@testset begin
candidate = prime_fib;
@test(candidate(1) == 2)
@test(candidate(2) == 3)
@test(candidate(3) == 5)
@test(candidate(4) == 13)
@test(candidate(5) == 89)
@test(candidate(6) == 233)
@test(candidate(7) == 1597)
@test(candidate(8) == 28657)
@test(candidate(9) == 514229)
@test(candidate(10) == 433494437)
end
| ['\nfunction' '\nmacro' '\n\n'] |
HumanEval_40_triples_sum_to_zero | jl | """triples_sum_to_zero takes a vector of integers as an input.
it returns true if there are three distinct elements in the vector that
sum to zero, and false otherwise.
>>> triples_sum_to_zero([1, 3, 5, 0])
false
>>> triples_sum_to_zero([1, 3, -2, 1])
true
>>> triples_sum_to_zero([1, 2, 3, 7])
false
>>> triples_sum_to_zero([2, 4, -5, 3, 9, 7])
true
>>> triples_sum_to_zero([1])
false"""
function triples_sum_to_zero(l::Vector{Int64})::Bool
| transform | /work/arjunguha-research-group/arjun/repos/nuprl/MultiPL-E/datasets/../datasets/originals-with-cleaned-doctests/HumanEval_40_triples_sum_to_zero.py | reworded | using Test
@testset begin
candidate = triples_sum_to_zero;
@test(candidate([1, 3, 5, 0]) == false)
@test(candidate([1, 3, 5, -1]) == false)
@test(candidate([1, 3, -2, 1]) == true)
@test(candidate([1, 2, 3, 7]) == false)
@test(candidate([1, 2, 5, 7]) == false)
@test(candidate([2, 4, -5, 3, 9, 7]) == true)
@test(candidate([1]) == false)
@test(candidate([1, 3, 5, -100]) == false)
@test(candidate([100, 3, 5, -100]) == false)
end
| ['\nfunction' '\nmacro' '\n\n'] |
HumanEval_41_car_race_collision | jl | """Imagine a road that's a perfectly straight infinitely long line.
n cars are driving left to right; simultaneously, a different set of n cars
are driving right to left. The two sets of cars start out being very far from
each other. All cars move in the same speed. Two cars are said to collide
when a car that's moving left to right hits a car that's moving right to left.
However, the cars are infinitely sturdy and strong; as a result, they continue moving
in their trajectory as if they did not collide.
This function outputs the number of such collisions."""
function car_race_collision(n::Int64)::Int64
| transform | /work/arjunguha-research-group/arjun/repos/nuprl/MultiPL-E/datasets/../datasets/originals-with-cleaned-doctests/HumanEval_41_car_race_collision.py | reworded | using Test
@testset begin
candidate = car_race_collision;
@test(candidate(2) == 4)
@test(candidate(3) == 9)
@test(candidate(4) == 16)
@test(candidate(8) == 64)
@test(candidate(10) == 100)
end
| ['\nfunction' '\nmacro' '\n\n'] |
HumanEval_42_incr_list | jl | """Return vector with elements incremented by 1.
>>> incr_list([1, 2, 3])
[2, 3, 4]
>>> incr_list([5, 3, 5, 2, 3, 3, 9, 0, 123])
[6, 4, 6, 3, 4, 4, 10, 1, 124]"""
function incr_list(l::Vector{Int64})::Vector{Int64}
| transform | /work/arjunguha-research-group/arjun/repos/nuprl/MultiPL-E/datasets/../datasets/originals-with-cleaned-doctests/HumanEval_42_incr_list.py | reworded | using Test
@testset begin
candidate = incr_list;
@test(candidate(Vector{Int64}([])) == Vector{Int64}([]))
@test(candidate([3, 2, 1]) == [4, 3, 2])
@test(candidate([5, 2, 5, 2, 3, 3, 9, 0, 123]) == [6, 3, 6, 3, 4, 4, 10, 1, 124])
end
| ['\nfunction' '\nmacro' '\n\n'] |
HumanEval_43_pairs_sum_to_zero | jl | """pairs_sum_to_zero takes a vector of integers as an input.
it returns true if there are two distinct elements in the vector that
sum to zero, and false otherwise.
>>> pairs_sum_to_zero([1, 3, 5, 0])
false
>>> pairs_sum_to_zero([1, 3, -2, 1])
false
>>> pairs_sum_to_zero([1, 2, 3, 7])
false
>>> pairs_sum_to_zero([2, 4, -5, 3, 5, 7])
true
>>> pairs_sum_to_zero([1])
false"""
function pairs_sum_to_zero(l::Vector{Int64})::Bool
| transform | /work/arjunguha-research-group/arjun/repos/nuprl/MultiPL-E/datasets/../datasets/originals-with-cleaned-doctests/HumanEval_43_pairs_sum_to_zero.py | reworded | using Test
@testset begin
candidate = pairs_sum_to_zero;
@test(candidate([1, 3, 5, 0]) == false)
@test(candidate([1, 3, -2, 1]) == false)
@test(candidate([1, 2, 3, 7]) == false)
@test(candidate([2, 4, -5, 3, 5, 7]) == true)
@test(candidate([1]) == false)
@test(candidate([-3, 9, -1, 3, 2, 30]) == true)
@test(candidate([-3, 9, -1, 3, 2, 31]) == true)
@test(candidate([-3, 9, -1, 4, 2, 30]) == false)
@test(candidate([-3, 9, -1, 4, 2, 31]) == false)
end
| ['\nfunction' '\nmacro' '\n\n'] |
HumanEval_44_change_base | jl | """Change numerical base of input number x to base.
return string representation after the conversion.
base numbers are less than 10.
>>> change_base(8, 3)
"22"
>>> change_base(8, 2)
"1000"
>>> change_base(7, 2)
"111"
"""
function change_base(x::Int64, base::Int64)::String
| transform | /work/arjunguha-research-group/arjun/repos/nuprl/MultiPL-E/datasets/../datasets/originals-with-cleaned-doctests/HumanEval_44_change_base.py | reworded | using Test
@testset begin
candidate = change_base;
@test(candidate(8, 3) == "22")
@test(candidate(9, 3) == "100")
@test(candidate(234, 2) == "11101010")
@test(candidate(16, 2) == "10000")
@test(candidate(8, 2) == "1000")
@test(candidate(7, 2) == "111")
@test(candidate(2, 3) == "2")
@test(candidate(3, 4) == "3")
@test(candidate(4, 5) == "4")
@test(candidate(5, 6) == "5")
@test(candidate(6, 7) == "6")
@test(candidate(7, 8) == "7")
end
| ['\nfunction' '\nmacro' '\n\n'] |
HumanEval_45_triangle_area | jl | """Given length of a side and high return area for a triangle.
>>> triangle_area(5, 3)
7.5"""
function triangle_area(a::Int64, h::Int64)::Float64
| transform | /work/arjunguha-research-group/arjun/repos/nuprl/MultiPL-E/datasets/../datasets/originals-with-cleaned-doctests/HumanEval_45_triangle_area.py | reworded | using Test
@testset begin
candidate = triangle_area;
@test(candidate(5, 3) == 7.5)
@test(candidate(2, 2) == 2.0)
@test(candidate(10, 8) == 40.0)
end
| ['\nfunction' '\nmacro' '\n\n'] |
HumanEval_46_fib4 | jl | """The Fib4 number sequence is a sequence similar to the Fibbonacci sequnece that's defined as follows:
fib4(0) -> 0
fib4(1) -> 0
fib4(2) -> 2
fib4(3) -> 0
fib4(n) -> fib4(n-1) + fib4(n-2) + fib4(n-3) + fib4(n-4).
Please write a function to efficiently compute the n-th element of the fib4 number sequence. Do not use recursion.
>>> fib4(5)
4
>>> fib4(6)
8
>>> fib4(7)
14"""
function fib4(n::Int64)::Int64
| transform | /work/arjunguha-research-group/arjun/repos/nuprl/MultiPL-E/datasets/../datasets/originals-with-cleaned-doctests/HumanEval_46_fib4.py | reworded | using Test
@testset begin
candidate = fib4;
@test(candidate(5) == 4)
@test(candidate(8) == 28)
@test(candidate(10) == 104)
@test(candidate(12) == 386)
end
| ['\nfunction' '\nmacro' '\n\n'] |
HumanEval_47_median | jl | """Return median of elements in the vector l.
>>> median([3, 1, 2, 4, 5])
3
>>> median([-10, 4, 6, 1000, 10, 20])
15.0"""
function median(l::Vector{Int64})::Float64
| transform | /work/arjunguha-research-group/arjun/repos/nuprl/MultiPL-E/datasets/../datasets/originals-with-cleaned-doctests/HumanEval_47_median.py | reworded | using Test
@testset begin
candidate = median;
@test(candidate([3, 1, 2, 4, 5]) == 3)
@test(candidate([-10, 4, 6, 1000, 10, 20]) == 8.0)
@test(candidate([5]) == 5)
@test(candidate([6, 5]) == 5.5)
@test(candidate([8, 1, 3, 9, 9, 2, 7]) == 7)
end
| ['\nfunction' '\nmacro' '\n\n'] |
HumanEval_48_is_palindrome | jl | """Checks if given string is a palindrome
>>> is_palindrome("")
true
>>> is_palindrome("aba")
true
>>> is_palindrome("aaaaa")
true
>>> is_palindrome("zbcd")
false"""
function is_palindrome(text::String)::Bool
| transform | /work/arjunguha-research-group/arjun/repos/nuprl/MultiPL-E/datasets/../datasets/originals-with-cleaned-doctests/HumanEval_48_is_palindrome.py | reworded | using Test
@testset begin
candidate = is_palindrome;
@test(candidate("") == true)
@test(candidate("aba") == true)
@test(candidate("aaaaa") == true)
@test(candidate("zbcd") == false)
@test(candidate("xywyx") == true)
@test(candidate("xywyz") == false)
@test(candidate("xywzx") == false)
end
| ['\nfunction' '\nmacro' '\n\n'] |
HumanEval_49_modp | jl | """Return 2^n modulo p (be aware of numerics).
>>> modp(3, 5)
3
>>> modp(1101, 101)
2
>>> modp(0, 101)
1
>>> modp(3, 11)
8
>>> modp(100, 101)
1"""
function modp(n::Int64, p::Int64)::Int64
| transform | /work/arjunguha-research-group/arjun/repos/nuprl/MultiPL-E/datasets/../datasets/originals-with-cleaned-doctests/HumanEval_49_modp.py | reworded | using Test
@testset begin
candidate = modp;
@test(candidate(3, 5) == 3)
@test(candidate(1101, 101) == 2)
@test(candidate(0, 101) == 1)
@test(candidate(3, 11) == 8)
@test(candidate(100, 101) == 1)
@test(candidate(30, 5) == 4)
@test(candidate(31, 5) == 3)
end
| ['\nfunction' '\nmacro' '\n\n'] |
HumanEval_51_remove_vowels | jl | """remove_vowels is a function that takes string and returns string without vowels.
>>> remove_vowels("")
""
>>> remove_vowels("abcdef")
"bcdf"
>>> remove_vowels("aaaaa")
""
>>> remove_vowels("aaBAA")
"B"
>>> remove_vowels("zbcd")
"zbcd"
"""
function remove_vowels(text::String)::String
| transform | /work/arjunguha-research-group/arjun/repos/nuprl/MultiPL-E/datasets/../datasets/originals-with-cleaned-doctests/HumanEval_51_remove_vowels.py | reworded | using Test
@testset begin
candidate = remove_vowels;
@test(candidate("") == "")
@test(candidate("abcdef
ghijklm") == "bcdf
ghjklm")
@test(candidate("fedcba") == "fdcb")
@test(candidate("eeeee") == "")
@test(candidate("acBAA") == "cB")
@test(candidate("EcBOO") == "cB")
@test(candidate("ybcd") == "ybcd")
end
| ['\nfunction' '\nmacro' '\n\n'] |
HumanEval_52_below_threshold | jl | """Return true if all numbers in the vector l are below threshold t.
>>> below_threshold([1, 2, 4, 10], 100)
true
>>> below_threshold([1, 20, 4, 10], 5)
false"""
function below_threshold(l::Vector{Int64}, t::Int64)::Bool
| transform | /work/arjunguha-research-group/arjun/repos/nuprl/MultiPL-E/datasets/../datasets/originals-with-cleaned-doctests/HumanEval_52_below_threshold.py | reworded | using Test
@testset begin
candidate = below_threshold;
@test(candidate([1, 2, 4, 10], 100) == true)
@test(candidate([1, 20, 4, 10], 5) == false)
@test(candidate([1, 20, 4, 10], 21) == true)
@test(candidate([1, 20, 4, 10], 22) == true)
@test(candidate([1, 8, 4, 10], 11) == true)
@test(candidate([1, 8, 4, 10], 10) == false)
end
| ['\nfunction' '\nmacro' '\n\n'] |
HumanEval_53_add | jl | """Add two numbers x and y
>>> add(2, 3)
5
>>> add(5, 7)
12"""
function add(x::Int64, y::Int64)::Int64
| transform | /work/arjunguha-research-group/arjun/repos/nuprl/MultiPL-E/datasets/../datasets/originals-with-cleaned-doctests/HumanEval_53_add.py | reworded | using Test
@testset begin
candidate = add;
@test(candidate(0, 1) == 1)
@test(candidate(1, 0) == 1)
@test(candidate(2, 3) == 5)
@test(candidate(5, 7) == 12)
@test(candidate(7, 5) == 12)
end
| ['\nfunction' '\nmacro' '\n\n'] |
HumanEval_54_same_chars | jl | """Check if two words have the same characters.
>>> same_chars("eabcdzzzz", "dddzzzzzzzddeddabc")
true
>>> same_chars("abcd", "dddddddabc")
true
>>> same_chars("dddddddabc", "abcd")
true
>>> same_chars("eabcd", "dddddddabc")
false
>>> same_chars("abcd", "dddddddabce")
false
>>> same_chars("eabcdzzzz", "dddzzzzzzzddddabc")
false"""
function same_chars(s0::String, s1::String)::Bool
| transform | /work/arjunguha-research-group/arjun/repos/nuprl/MultiPL-E/datasets/../datasets/originals-with-cleaned-doctests/HumanEval_54_same_chars.py | reworded | using Test
@testset begin
candidate = same_chars;
@test(candidate("eabcdzzzz", "dddzzzzzzzddeddabc") == true)
@test(candidate("abcd", "dddddddabc") == true)
@test(candidate("dddddddabc", "abcd") == true)
@test(candidate("eabcd", "dddddddabc") == false)
@test(candidate("abcd", "dddddddabcf") == false)
@test(candidate("eabcdzzzz", "dddzzzzzzzddddabc") == false)
@test(candidate("aabb", "aaccc") == false)
end
| ['\nfunction' '\nmacro' '\n\n'] |
HumanEval_55_fib | jl | """Return n-th Fibonacci number.
>>> fib(10)
55
>>> fib(1)
1
>>> fib(8)
21"""
function fib(n::Int64)::Int64
| transform | /work/arjunguha-research-group/arjun/repos/nuprl/MultiPL-E/datasets/../datasets/originals-with-cleaned-doctests/HumanEval_55_fib.py | reworded | using Test
@testset begin
candidate = fib;
@test(candidate(10) == 55)
@test(candidate(1) == 1)
@test(candidate(8) == 21)
@test(candidate(11) == 89)
@test(candidate(12) == 144)
end
| ['\nfunction' '\nmacro' '\n\n'] |
HumanEval_56_correct_bracketing | jl | """ brackets is a string of "<" and ">".
return true if every opening bracket has a corresponding closing bracket.
>>> correct_bracketing("<")
false
>>> correct_bracketing("<>")
true
>>> correct_bracketing("<<><>>")
true
>>> correct_bracketing("><<>")
false"""
function correct_bracketing(brackets::String)::Bool
| transform | /work/arjunguha-research-group/arjun/repos/nuprl/MultiPL-E/datasets/../datasets/originals-with-cleaned-doctests/HumanEval_56_correct_bracketing.py | reworded | using Test
@testset begin
candidate = correct_bracketing;
@test(candidate("<>") == true)
@test(candidate("<<><>>") == true)
@test(candidate("<><><<><>><>") == true)
@test(candidate("<><><<<><><>><>><<><><<>>>") == true)
@test(candidate("<<<><>>>>") == false)
@test(candidate("><<>") == false)
@test(candidate("<") == false)
@test(candidate("<<<<") == false)
@test(candidate(">") == false)
@test(candidate("<<>") == false)
@test(candidate("<><><<><>><>><<>") == false)
@test(candidate("<><><<><>><>>><>") == false)
end
| ['\nfunction' '\nmacro' '\n\n'] |
HumanEval_57_monotonic | jl | """Return true is vector elements are monotonically increasing or decreasing.
>>> monotonic([1, 2, 4, 20])
true
>>> monotonic([1, 20, 4, 10])
false
>>> monotonic([4, 1, 0, -10])
true"""
function monotonic(l::Vector{Int64})::Bool
| transform | /work/arjunguha-research-group/arjun/repos/nuprl/MultiPL-E/datasets/../datasets/originals-with-cleaned-doctests/HumanEval_57_monotonic.py | reworded | using Test
@testset begin
candidate = monotonic;
@test(candidate([1, 2, 4, 10]) == true)
@test(candidate([1, 2, 4, 20]) == true)
@test(candidate([1, 20, 4, 10]) == false)
@test(candidate([4, 1, 0, -10]) == true)
@test(candidate([4, 1, 1, 0]) == true)
@test(candidate([1, 2, 3, 2, 5, 60]) == false)
@test(candidate([1, 2, 3, 4, 5, 60]) == true)
@test(candidate([9, 9, 9, 9]) == true)
end
| ['\nfunction' '\nmacro' '\n\n'] |
HumanEval_58_common | jl | """Return sorted unique common elements for two vectors.
>>> common([1, 4, 3, 34, 653, 2, 5], [5, 7, 1, 5, 9, 653, 121])
[1, 5, 653]
>>> common([5, 3, 2, 8], [3, 2])
[2, 3]"""
function common(l1::Vector{Int64}, l2::Vector{Int64})::Vector{Int64}
| transform | /work/arjunguha-research-group/arjun/repos/nuprl/MultiPL-E/datasets/../datasets/originals-with-cleaned-doctests/HumanEval_58_common.py | reworded | using Test
@testset begin
candidate = common;
@test(candidate([1, 4, 3, 34, 653, 2, 5], [5, 7, 1, 5, 9, 653, 121]) == [1, 5, 653])
@test(candidate([5, 3, 2, 8], [3, 2]) == [2, 3])
@test(candidate([4, 3, 2, 8], [3, 2, 4]) == [2, 3, 4])
@test(candidate([4, 3, 2, 8], Vector{Int64}([])) == Vector{Int64}([]))
end
| ['\nfunction' '\nmacro' '\n\n'] |
HumanEval_59_largest_prime_factor | jl | """Return the largest prime factor of n. Assume n > 1 and is not a prime.
>>> largest_prime_factor(13195)
29
>>> largest_prime_factor(2048)
2"""
function largest_prime_factor(n::Int64)::Int64
| transform | /work/arjunguha-research-group/arjun/repos/nuprl/MultiPL-E/datasets/../datasets/originals-with-cleaned-doctests/HumanEval_59_largest_prime_factor.py | reworded | using Test
@testset begin
candidate = largest_prime_factor;
@test(candidate(15) == 5)
@test(candidate(27) == 3)
@test(candidate(63) == 7)
@test(candidate(330) == 11)
@test(candidate(13195) == 29)
end
| ['\nfunction' '\nmacro' '\n\n'] |
HumanEval_60_sum_to_n | jl | """sum_to_n is a function that sums numbers from 1 to n.
>>> sum_to_n(30)
465
>>> sum_to_n(100)
5050
>>> sum_to_n(5)
15
>>> sum_to_n(10)
55
>>> sum_to_n(1)
1"""
function sum_to_n(n::Int64)::Int64
| transform | /work/arjunguha-research-group/arjun/repos/nuprl/MultiPL-E/datasets/../datasets/originals-with-cleaned-doctests/HumanEval_60_sum_to_n.py | reworded | using Test
@testset begin
candidate = sum_to_n;
@test(candidate(1) == 1)
@test(candidate(6) == 21)
@test(candidate(11) == 66)
@test(candidate(30) == 465)
@test(candidate(100) == 5050)
end
| ['\nfunction' '\nmacro' '\n\n'] |
HumanEval_61_correct_bracketing | jl | """ brackets is a string of "(" and ")".
return true if every opening bracket has a corresponding closing bracket.
>>> correct_bracketing("(")
false
>>> correct_bracketing("()")
true
>>> correct_bracketing("(()())")
true
>>> correct_bracketing(")(()")
false"""
function correct_bracketing(brackets::String)::Bool
| transform | /work/arjunguha-research-group/arjun/repos/nuprl/MultiPL-E/datasets/../datasets/originals-with-cleaned-doctests/HumanEval_61_correct_bracketing.py | reworded | using Test
@testset begin
candidate = correct_bracketing;
@test(candidate("()") == true)
@test(candidate("(()())") == true)
@test(candidate("()()(()())()") == true)
@test(candidate("()()((()()())())(()()(()))") == true)
@test(candidate("((()())))") == false)
@test(candidate(")(()") == false)
@test(candidate("(") == false)
@test(candidate("((((") == false)
@test(candidate(")") == false)
@test(candidate("(()") == false)
@test(candidate("()()(()())())(()") == false)
@test(candidate("()()(()())()))()") == false)
end
| ['\nfunction' '\nmacro' '\n\n'] |
HumanEval_62_derivative | jl | """ xs represent coefficients of a polynomial.
xs[0] + xs[1] * x + xs[2] * x^2 + ....
Return derivative of this polynomial in the same form.
Note: In this problem, all index-related conditions (e.g., even, odd, multiples of k) are defined with 0-based indexing.
>>> derivative([3, 1, 2, 4, 5])
[1, 4, 12, 20]
>>> derivative([1, 2, 3])
[2, 6]"""
function derivative(xs::Vector{Int64})::Vector{Int64}
| transform | /work/arjunguha-research-group/arjun/repos/nuprl/MultiPL-E/datasets/../datasets/originals-with-cleaned-doctests/HumanEval_62_derivative.py | reworded | using Test
@testset begin
candidate = derivative;
@test(candidate([3, 1, 2, 4, 5]) == [1, 4, 12, 20])
@test(candidate([1, 2, 3]) == [2, 6])
@test(candidate([3, 2, 1]) == [2, 2])
@test(candidate([3, 2, 1, 0, 4]) == [2, 2, 0, 16])
@test(candidate([1]) == Vector{Int64}([]))
end
| ['\nfunction' '\nmacro' '\n\n'] |
HumanEval_63_fibfib | jl | """The FibFib number sequence is a sequence similar to the Fibbonacci sequnece that's defined as follows:
fibfib(0) == 0
fibfib(1) == 0
fibfib(2) == 1
fibfib(n) == fibfib(n-1) + fibfib(n-2) + fibfib(n-3).
Please write a function to efficiently compute the n-th element of the fibfib number sequence.
>>> fibfib(1)
0
>>> fibfib(5)
4
>>> fibfib(8)
24"""
function fibfib(n::Int64)::Int64
| transform | /work/arjunguha-research-group/arjun/repos/nuprl/MultiPL-E/datasets/../datasets/originals-with-cleaned-doctests/HumanEval_63_fibfib.py | reworded | using Test
@testset begin
candidate = fibfib;
@test(candidate(2) == 1)
@test(candidate(1) == 0)
@test(candidate(5) == 4)
@test(candidate(8) == 24)
@test(candidate(10) == 81)
@test(candidate(12) == 274)
@test(candidate(14) == 927)
end
| ['\nfunction' '\nmacro' '\n\n'] |
HumanEval_64_vowels_count | jl | """Write a function vowels_count which takes a string representing
a word as input and returns the number of vowels in the string.
Vowels in this case are 'a', 'e', 'i', 'o', 'u'. Here, 'y' is also a
vowel, but only when it is at the end of the given word.
Example:
>>> vowels_count("abcde")
2
>>> vowels_count("ACEDY")
3"""
function vowels_count(s::String)::Int64
| transform | /work/arjunguha-research-group/arjun/repos/nuprl/MultiPL-E/datasets/../datasets/originals-with-cleaned-doctests/HumanEval_64_vowels_count.py | reworded | using Test
@testset begin
candidate = vowels_count;
@test(candidate("abcde") == 2)
@test(candidate("Alone") == 3)
@test(candidate("key") == 2)
@test(candidate("bye") == 1)
@test(candidate("keY") == 2)
@test(candidate("bYe") == 1)
@test(candidate("ACEDY") == 3)
end
| ['\nfunction' '\nmacro' '\n\n'] |
HumanEval_65_circular_shift | jl | """Circular shift the digits of the integer x, shift the digits right by shift
and return the result as a string.
If shift > number of digits, return digits reversed.
>>> circular_shift(12, 1)
"21"
>>> circular_shift(12, 2)
"12"
"""
function circular_shift(x::Int64, shift::Int64)::String
| transform | /work/arjunguha-research-group/arjun/repos/nuprl/MultiPL-E/datasets/../datasets/originals-with-cleaned-doctests/HumanEval_65_circular_shift.py | reworded | using Test
@testset begin
candidate = circular_shift;
@test(candidate(100, 2) == "001")
@test(candidate(12, 2) == "12")
@test(candidate(97, 8) == "79")
@test(candidate(12, 1) == "21")
@test(candidate(11, 101) == "11")
end
| ['\nfunction' '\nmacro' '\n\n'] |
HumanEval_66_digitSum | jl | """Task
Write a function that takes a string as input and returns the sum of the upper characters only'
ASCII codes.
Examples:
>>> digitSum("")
0
>>> digitSum("abAB")
131
>>> digitSum("abcCd")
67
>>> digitSum("helloE")
69
>>> digitSum("woArBld")
131
>>> digitSum("aAaaaXa")
153"""
function digitSum(s::String)::Int64
| transform | /work/arjunguha-research-group/arjun/repos/nuprl/MultiPL-E/datasets/../datasets/originals-with-cleaned-doctests/HumanEval_66_digitSum.py | reworded | using Test
@testset begin
candidate = digitSum;
@test(candidate("") == 0)
@test(candidate("abAB") == 131)
@test(candidate("abcCd") == 67)
@test(candidate("helloE") == 69)
@test(candidate("woArBld") == 131)
@test(candidate("aAaaaXa") == 153)
@test(candidate(" How are yOu?") == 151)
@test(candidate("You arE Very Smart") == 327)
end
| ['\nfunction' '\nmacro' '\n\n'] |
HumanEval_67_fruit_distribution | jl | """In this task, you will be given a string that represents a number of apples and oranges
that are distributed in a basket of fruit this basket contains
apples, oranges, and mango fruits. Given the string that represents the total number of
the oranges and apples and an integer that represent the total number of the fruits
in the basket return the number of the mango fruits in the basket.
for examble:
>>> fruit_distribution("5 apples and 6 oranges", 19)
8
>>> fruit_distribution("0 apples and 1 oranges", 3)
2
>>> fruit_distribution("2 apples and 3 oranges", 100)
95
>>> fruit_distribution("100 apples and 1 oranges", 120)
19"""
function fruit_distribution(s::String, n::Int64)::Int64
| transform | /work/arjunguha-research-group/arjun/repos/nuprl/MultiPL-E/datasets/../datasets/originals-with-cleaned-doctests/HumanEval_67_fruit_distribution.py | reworded | using Test
@testset begin
candidate = fruit_distribution;
@test(candidate("5 apples and 6 oranges", 19) == 8)
@test(candidate("5 apples and 6 oranges", 21) == 10)
@test(candidate("0 apples and 1 oranges", 3) == 2)
@test(candidate("1 apples and 0 oranges", 3) == 2)
@test(candidate("2 apples and 3 oranges", 100) == 95)
@test(candidate("2 apples and 3 oranges", 5) == 0)
@test(candidate("1 apples and 100 oranges", 120) == 19)
end
| ['\nfunction' '\nmacro' '\n\n'] |
HumanEval_68_pluck | jl | """Given a vector representing a branch of a tree that has non-negative integer nodes
your task is to pluck one of the nodes and return it.
The plucked node should be the node with the smallest even value.
If multiple nodes with the same smallest even value are found return the node that has smallest index.
The plucked node should be returned in a vector, [ smalest_value, its index ],
If there are no even values or the given vector is empty, return [].
Note: In this problem, all index-related conditions (e.g., even, odd, multiples of k) are defined with 0-based indexing.
Example 1:
>>> pluck([4, 2, 3])
[2, 1]
Explanation: 2 has the smallest even value, and 2 has the smallest index.
Example 2:
>>> pluck([1, 2, 3])
[2, 1]
Explanation: 2 has the smallest even value, and 2 has the smallest index.
Example 3:
>>> pluck([])
[]
Example 4:
>>> pluck([5, 0, 3, 0, 4, 2])
[0, 1]
Explanation: 0 is the smallest value, but there are two zeros,
so we will choose the first zero, which has the smallest index.
Constraints:
* 1 <= nodes.length <= 10000
* 0 <= node.value"""
function pluck(arr::Vector{Int64})::Vector{Int64}
| transform | /work/arjunguha-research-group/arjun/repos/nuprl/MultiPL-E/datasets/../datasets/originals-with-cleaned-doctests/HumanEval_68_pluck.py | reworded | using Test
@testset begin
candidate = pluck;
@test(candidate([4, 2, 3]) == [2, 1])
@test(candidate([1, 2, 3]) == [2, 1])
@test(candidate(Vector{Int64}([])) == Vector{Int64}([]))
@test(candidate([5, 0, 3, 0, 4, 2]) == [0, 1])
@test(candidate([1, 2, 3, 0, 5, 3]) == [0, 3])
@test(candidate([5, 4, 8, 4, 8]) == [4, 1])
@test(candidate([7, 6, 7, 1]) == [6, 1])
@test(candidate([7, 9, 7, 1]) == Vector{Int64}([]))
end
| ['\nfunction' '\nmacro' '\n\n'] |
HumanEval_69_search | jl | """You are given a non-empty vector of positive integers. Return the greatest integer that is greater than
zero, and has a frequency greater than or equal to the value of the integer itself.
The frequency of an integer is the number of times it appears in the vector.
If no such a value exist, return -1.
Examples:
>>> search([4, 1, 2, 2, 3, 1])
2
>>> search([1, 2, 2, 3, 3, 3, 4, 4, 4])
3
>>> search([5, 5, 4, 4, 4])
-1"""
function search(lst::Vector{Int64})::Int64
| transform | /work/arjunguha-research-group/arjun/repos/nuprl/MultiPL-E/datasets/../datasets/originals-with-cleaned-doctests/HumanEval_69_search.py | reworded | using Test
@testset begin
candidate = search;
@test(candidate([5, 5, 5, 5, 1]) == 1)
@test(candidate([4, 1, 4, 1, 4, 4]) == 4)
@test(candidate([3, 3]) == -1)
@test(candidate([8, 8, 8, 8, 8, 8, 8, 8]) == 8)
@test(candidate([2, 3, 3, 2, 2]) == 2)
@test(candidate([2, 7, 8, 8, 4, 8, 7, 3, 9, 6, 5, 10, 4, 3, 6, 7, 1, 7, 4, 10, 8, 1]) == 1)
@test(candidate([3, 2, 8, 2]) == 2)
@test(candidate([6, 7, 1, 8, 8, 10, 5, 8, 5, 3, 10]) == 1)
@test(candidate([8, 8, 3, 6, 5, 6, 4]) == -1)
@test(candidate([6, 9, 6, 7, 1, 4, 7, 1, 8, 8, 9, 8, 10, 10, 8, 4, 10, 4, 10, 1, 2, 9, 5, 7, 9]) == 1)
@test(candidate([1, 9, 10, 1, 3]) == 1)
@test(candidate([6, 9, 7, 5, 8, 7, 5, 3, 7, 5, 10, 10, 3, 6, 10, 2, 8, 6, 5, 4, 9, 5, 3, 10]) == 5)
@test(candidate([1]) == 1)
@test(candidate([8, 8, 10, 6, 4, 3, 5, 8, 2, 4, 2, 8, 4, 6, 10, 4, 2, 1, 10, 2, 1, 1, 5]) == 4)
@test(candidate([2, 10, 4, 8, 2, 10, 5, 1, 2, 9, 5, 5, 6, 3, 8, 6, 4, 10]) == 2)
@test(candidate([1, 6, 10, 1, 6, 9, 10, 8, 6, 8, 7, 3]) == 1)
@test(candidate([9, 2, 4, 1, 5, 1, 5, 2, 5, 7, 7, 7, 3, 10, 1, 5, 4, 2, 8, 4, 1, 9, 10, 7, 10, 2, 8, 10, 9, 4]) == 4)
@test(candidate([2, 6, 4, 2, 8, 7, 5, 6, 4, 10, 4, 6, 3, 7, 8, 8, 3, 1, 4, 2, 2, 10, 7]) == 4)
@test(candidate([9, 8, 6, 10, 2, 6, 10, 2, 7, 8, 10, 3, 8, 2, 6, 2, 3, 1]) == 2)
@test(candidate([5, 5, 3, 9, 5, 6, 3, 2, 8, 5, 6, 10, 10, 6, 8, 4, 10, 7, 7, 10, 8]) == -1)
@test(candidate([10]) == -1)
@test(candidate([9, 7, 7, 2, 4, 7, 2, 10, 9, 7, 5, 7, 2]) == 2)
@test(candidate([5, 4, 10, 2, 1, 1, 10, 3, 6, 1, 8]) == 1)
@test(candidate([7, 9, 9, 9, 3, 4, 1, 5, 9, 1, 2, 1, 1, 10, 7, 5, 6, 7, 6, 7, 7, 6]) == 1)
@test(candidate([3, 10, 10, 9, 2]) == -1)
end
| ['\nfunction' '\nmacro' '\n\n'] |
HumanEval_70_strange_sort_list | jl | """Given vector of integers, return vector in strange order.
Strange sorting, is when you start with the minimum value,
then maximum of the remaining integers, then minimum and so on.
Examples:
>>> strange_sort_list([1, 2, 3, 4])
[1, 4, 2, 3]
>>> strange_sort_list([5, 5, 5, 5])
[5, 5, 5, 5]
>>> strange_sort_list([])
[]"""
function strange_sort_list(lst::Vector{Int64})::Vector{Int64}
| transform | /work/arjunguha-research-group/arjun/repos/nuprl/MultiPL-E/datasets/../datasets/originals-with-cleaned-doctests/HumanEval_70_strange_sort_list.py | reworded | using Test
@testset begin
candidate = strange_sort_list;
@test(candidate([1, 2, 3, 4]) == [1, 4, 2, 3])
@test(candidate([5, 6, 7, 8, 9]) == [5, 9, 6, 8, 7])
@test(candidate([1, 2, 3, 4, 5]) == [1, 5, 2, 4, 3])
@test(candidate([5, 6, 7, 8, 9, 1]) == [1, 9, 5, 8, 6, 7])
@test(candidate([5, 5, 5, 5]) == [5, 5, 5, 5])
@test(candidate(Vector{Int64}([])) == Vector{Int64}([]))
@test(candidate([1, 2, 3, 4, 5, 6, 7, 8]) == [1, 8, 2, 7, 3, 6, 4, 5])
@test(candidate([0, 2, 2, 2, 5, 5, -5, -5]) == [-5, 5, -5, 5, 0, 2, 2, 2])
@test(candidate([111111]) == [111111])
end
| ['\nfunction' '\nmacro' '\n\n'] |
HumanEval_71_triangle_area | jl | """Given the lengths of the three sides of a triangle. Return the area of
the triangle rounded to 2 decimal points if the three sides form a valid triangle.
Otherwise return -1
Three sides make a valid triangle when the sum of any two sides is greater
than the third side.
Example:
>>> triangle_area(3, 4, 5)
6.0
>>> triangle_area(1, 2, 10)
-1"""
function triangle_area(a::Int64, b::Int64, c::Int64)::Float64
| transform | /work/arjunguha-research-group/arjun/repos/nuprl/MultiPL-E/datasets/../datasets/originals-with-cleaned-doctests/HumanEval_71_triangle_area.py | reworded | using Test
@testset begin
candidate = triangle_area;
@test(candidate(3, 4, 5) == 6.0)
@test(candidate(1, 2, 10) == -1)
@test(candidate(4, 8, 5) == 8.18)
@test(candidate(2, 2, 2) == 1.73)
@test(candidate(1, 2, 3) == -1)
@test(candidate(10, 5, 7) == 16.25)
@test(candidate(2, 6, 3) == -1)
@test(candidate(1, 1, 1) == 0.43)
@test(candidate(2, 2, 10) == -1)
end
| ['\nfunction' '\nmacro' '\n\n'] |
HumanEval_72_will_it_fly | jl | """Write a function that returns true if the object q will fly, and false otherwise.
The object q will fly if it's balanced (it is a palindromic vector) and the sum of its elements is less than or equal the maximum possible weight w.
Example:
>>> will_it_fly([1, 2], 5)
false
# 1+2 is less than the maximum possible weight, but it's unbalanced.
>>> will_it_fly([3, 2, 3], 1)
false
# it's balanced, but 3+2+3 is more than the maximum possible weight.
>>> will_it_fly([3, 2, 3], 9)
true
# 3+2+3 is less than the maximum possible weight, and it's balanced.
>>> will_it_fly([3], 5)
true
# 3 is less than the maximum possible weight, and it's balanced."""
function will_it_fly(q::Vector{Int64}, w::Int64)::Bool
| transform | /work/arjunguha-research-group/arjun/repos/nuprl/MultiPL-E/datasets/../datasets/originals-with-cleaned-doctests/HumanEval_72_will_it_fly.py | reworded | using Test
@testset begin
candidate = will_it_fly;
@test(candidate([3, 2, 3], 9) == true)
@test(candidate([1, 2], 5) == false)
@test(candidate([3], 5) == true)
@test(candidate([3, 2, 3], 1) == false)
@test(candidate([1, 2, 3], 6) == false)
@test(candidate([5], 5) == true)
end
| ['\nfunction' '\nmacro' '\n\n'] |
HumanEval_73_smallest_change | jl | """Given a vector arr of integers, find the minimum number of elements that
need to be changed to make the vector palindromic. A palindromic vector is a vector that
is read the same backwards and forwards. In one change, you can change one element to any other element.
For example:
>>> smallest_change([1, 2, 3, 5, 4, 7, 9, 6])
4
>>> smallest_change([1, 2, 3, 4, 3, 2, 2])
1
>>> smallest_change([1, 2, 3, 2, 1])
0"""
function smallest_change(arr::Vector{Int64})::Int64
| transform | /work/arjunguha-research-group/arjun/repos/nuprl/MultiPL-E/datasets/../datasets/originals-with-cleaned-doctests/HumanEval_73_smallest_change.py | reworded | using Test
@testset begin
candidate = smallest_change;
@test(candidate([1, 2, 3, 5, 4, 7, 9, 6]) == 4)
@test(candidate([1, 2, 3, 4, 3, 2, 2]) == 1)
@test(candidate([1, 4, 2]) == 1)
@test(candidate([1, 4, 4, 2]) == 1)
@test(candidate([1, 2, 3, 2, 1]) == 0)
@test(candidate([3, 1, 1, 3]) == 0)
@test(candidate([1]) == 0)
@test(candidate([0, 1]) == 1)
end
| ['\nfunction' '\nmacro' '\n\n'] |
HumanEval_74_total_match | jl | """Write a function that accepts two vectors of strings and returns the vector that has
total number of chars in the all strings of the vector less than the other vector.
if the two vectors have the same number of chars, return the first vector.
Examples
>>> total_match([], [])
[]
>>> total_match(["hi", "admin"], ["hI", "Hi"])
["hI", "Hi"]
>>> total_match(["hi", "admin"], ["hi", "hi", "admin", "project"])
["hi", "admin"]
>>> total_match(["hi", "admin"], ["hI", "hi", "hi"])
["hI", "hi", "hi"]
>>> total_match(["4"], ["1", "2", "3", "4", "5"])
["4"]"""
function total_match(lst1::Vector{String}, lst2::Vector{String})::Vector{String}
| transform | /work/arjunguha-research-group/arjun/repos/nuprl/MultiPL-E/datasets/../datasets/originals-with-cleaned-doctests/HumanEval_74_total_match.py | reworded | using Test
@testset begin
candidate = total_match;
@test(candidate(Vector{String}([]), Vector{String}([])) == Vector{String}([]))
@test(candidate(["hi", "admin"], ["hi", "hi"]) == ["hi", "hi"])
@test(candidate(["hi", "admin"], ["hi", "hi", "admin", "project"]) == ["hi", "admin"])
@test(candidate(["4"], ["1", "2", "3", "4", "5"]) == ["4"])
@test(candidate(["hi", "admin"], ["hI", "Hi"]) == ["hI", "Hi"])
@test(candidate(["hi", "admin"], ["hI", "hi", "hi"]) == ["hI", "hi", "hi"])
@test(candidate(["hi", "admin"], ["hI", "hi", "hii"]) == ["hi", "admin"])
@test(candidate(Vector{String}([]), ["this"]) == Vector{String}([]))
@test(candidate(["this"], Vector{String}([])) == Vector{String}([]))
end
| ['\nfunction' '\nmacro' '\n\n'] |
HumanEval_75_is_multiply_prime | jl | """Write a function that returns true if the given number is the multiplication of 3 prime numbers
and false otherwise.
Knowing that (a) is less then 1000.
Example:
>>> is_multiply_prime(30)
true
30 = 2 * 3 * 5"""
function is_multiply_prime(a::Int64)::Bool
| transform | /work/arjunguha-research-group/arjun/repos/nuprl/MultiPL-E/datasets/../datasets/originals-with-cleaned-doctests/HumanEval_75_is_multiply_prime.py | reworded | using Test
@testset begin
candidate = is_multiply_prime;
@test(candidate(5) == false)
@test(candidate(30) == true)
@test(candidate(8) == true)
@test(candidate(10) == false)
@test(candidate(125) == true)
@test(candidate(105) == true)
@test(candidate(126) == false)
@test(candidate(729) == false)
end
| ['\nfunction' '\nmacro' '\n\n'] |
HumanEval_76_is_simple_power | jl | """Your task is to write a function that returns true if a number x is a simple
power of n and false in other cases.
x is a simple power of n if n**int=x
For example:
>>> is_simple_power(1, 4)
true
>>> is_simple_power(2, 2)
true
>>> is_simple_power(8, 2)
true
>>> is_simple_power(3, 2)
false
>>> is_simple_power(3, 1)
false
>>> is_simple_power(5, 3)
false"""
function is_simple_power(x::Int64, n::Int64)::Bool
| transform | /work/arjunguha-research-group/arjun/repos/nuprl/MultiPL-E/datasets/../datasets/originals-with-cleaned-doctests/HumanEval_76_is_simple_power.py | reworded | using Test
@testset begin
candidate = is_simple_power;
@test(candidate(16, 2) == true)
@test(candidate(143214, 16) == false)
@test(candidate(4, 2) == true)
@test(candidate(9, 3) == true)
@test(candidate(16, 4) == true)
@test(candidate(24, 2) == false)
@test(candidate(128, 4) == false)
@test(candidate(12, 6) == false)
@test(candidate(1, 1) == true)
@test(candidate(1, 12) == true)
end
| ['\nfunction' '\nmacro' '\n\n'] |
HumanEval_77_iscube | jl | """Write a function that takes an integer a and returns true
if this ingeger is a cube of some integer number.
Note: you may assume the input is always valid.
Examples:
>>> iscube(1)
true
>>> iscube(2)
false
>>> iscube(-1)
true
>>> iscube(64)
true
>>> iscube(0)
true
>>> iscube(180)
false"""
function iscube(a::Int64)::Bool
| transform | /work/arjunguha-research-group/arjun/repos/nuprl/MultiPL-E/datasets/../datasets/originals-with-cleaned-doctests/HumanEval_77_iscube.py | reworded | using Test
@testset begin
candidate = iscube;
@test(candidate(1) == true)
@test(candidate(2) == false)
@test(candidate(-1) == true)
@test(candidate(64) == true)
@test(candidate(180) == false)
@test(candidate(1000) == true)
@test(candidate(0) == true)
@test(candidate(1729) == false)
end
| ['\nfunction' '\nmacro' '\n\n'] |
HumanEval_78_hex_key | jl | """You have been tasked to write a function that receives
a hexadecimal number as a string and counts the number of hexadecimal
digits that are primes (prime number, or a prime, is a natural number
greater than 1 that is not a product of two smaller natural numbers).
Hexadecimal digits are 0, 1, 2, 3, 4, 5, 6, 7, 8, 9, A, B, C, D, E, F.
Prime numbers are 2, 3, 5, 7, 11, 13, 17,...
So you have to determine a number of the following digits: 2, 3, 5, 7,
B (=decimal 11), D (=decimal 13).
Note: you may assume the input is always correct or empty string,
and symbols A,B,C,D,E,F are always uppercase.
Examples:
>>> hex_key("AB")
1
>>> hex_key("1077E")
2
>>> hex_key("ABED1A33")
4
>>> hex_key("123456789ABCDEF0")
6
>>> hex_key("2020")
2"""
function hex_key(num::String)::Int64
| transform | /work/arjunguha-research-group/arjun/repos/nuprl/MultiPL-E/datasets/../datasets/originals-with-cleaned-doctests/HumanEval_78_hex_key.py | reworded | using Test
@testset begin
candidate = hex_key;
@test(candidate("AB") == 1)
@test(candidate("1077E") == 2)
@test(candidate("ABED1A33") == 4)
@test(candidate("2020") == 2)
@test(candidate("123456789ABCDEF0") == 6)
@test(candidate("112233445566778899AABBCCDDEEFF00") == 12)
end
| ['\nfunction' '\nmacro' '\n\n'] |
HumanEval_79_decimal_to_binary | jl | """You will be given a number in decimal form and your task is to convert it to
binary format. The function should return a string, with each character representing a binary
number. Each character in the string will be '0' or '1'.
There will be an extra couple of characters 'db' at the beginning and at the end of the string.
The extra characters are there to help with the format.
Examples:
>>> decimal_to_binary(15)
"db1111db"
>>> decimal_to_binary(32)
"db100000db"
"""
function decimal_to_binary(decimal::Int64)::String
| transform | /work/arjunguha-research-group/arjun/repos/nuprl/MultiPL-E/datasets/../datasets/originals-with-cleaned-doctests/HumanEval_79_decimal_to_binary.py | reworded | using Test
@testset begin
candidate = decimal_to_binary;
@test(candidate(0) == "db0db")
@test(candidate(32) == "db100000db")
@test(candidate(103) == "db1100111db")
@test(candidate(15) == "db1111db")
end
| ['\nfunction' '\nmacro' '\n\n'] |
HumanEval_80_is_happy | jl | """You are given a string s.
Your task is to check if the string is hapjl or not.
A string is hapjl if its length is at least 3 and every 3 consecutive letters are distinct
For example:
>>> is_happy("a")
false
>>> is_happy("aa")
false
>>> is_happy("abcd")
true
>>> is_happy("aabb")
false
>>> is_happy("adb")
true
>>> is_happy("xyy")
false"""
function is_happy(s::String)::Bool
| transform | /work/arjunguha-research-group/arjun/repos/nuprl/MultiPL-E/datasets/../datasets/originals-with-cleaned-doctests/HumanEval_80_is_happy.py | reworded | using Test
@testset begin
candidate = is_happy;
@test(candidate("a") == false)
@test(candidate("aa") == false)
@test(candidate("abcd") == true)
@test(candidate("aabb") == false)
@test(candidate("adb") == true)
@test(candidate("xyy") == false)
@test(candidate("iopaxpoi") == true)
@test(candidate("iopaxioi") == false)
end
| ['\nfunction' '\nmacro' '\n\n'] |
HumanEval_81_numerical_letter_grade | jl | """It is the last week of the semester and the teacher has to give the grades
to students. The teacher has been making her own algorithm for grading.
The only problem is, she has lost the code she used for grading.
She has given you a vector of GPAs for some students and you have to write
a function that can output a vector of letter grades using the following table:
GPA | Letter grade
4.0 A+
> 3.7 A
> 3.3 A-
> 3.0 B+
> 2.7 B
> 2.3 B-
> 2.0 C+
> 1.7 C
> 1.3 C-
> 1.0 D+
> 0.7 D
> 0.0 D-
0.0 E
Example:
>>> grade_equation([4.0, 3, 1.7, 2, 3.5])
["A+", "B", "C-", "C", "A-"]"""
function numerical_letter_grade(grades::Vector{Float64})::Vector{String}
| transform | /work/arjunguha-research-group/arjun/repos/nuprl/MultiPL-E/datasets/../datasets/originals-with-cleaned-doctests/HumanEval_81_numerical_letter_grade.py | reworded | using Test
@testset begin
candidate = numerical_letter_grade;
@test(candidate([4.0, 3, 1.7, 2, 3.5]) == ["A+", "B", "C-", "C", "A-"])
@test(candidate([1.2]) == ["D+"])
@test(candidate([0.5]) == ["D-"])
@test(candidate([0.0]) == ["E"])
@test(candidate([1.0, 0.3, 1.5, 2.8, 3.3]) == ["D", "D-", "C-", "B", "B+"])
@test(candidate([0.0, 0.7]) == ["E", "D-"])
end
| ['\nfunction' '\nmacro' '\n\n'] |
HumanEval_82_prime_length | jl | """Write a function that takes a string and returns true if the string
length is a prime number or false otherwise
Examples
>>> prime_length("Hello")
true
>>> prime_length("abcdcba")
true
>>> prime_length("kittens")
true
>>> prime_length("orange")
false"""
function prime_length(string::String)::Bool
| transform | /work/arjunguha-research-group/arjun/repos/nuprl/MultiPL-E/datasets/../datasets/originals-with-cleaned-doctests/HumanEval_82_prime_length.py | reworded | using Test
@testset begin
candidate = prime_length;
@test(candidate("Hello") == true)
@test(candidate("abcdcba") == true)
@test(candidate("kittens") == true)
@test(candidate("orange") == false)
@test(candidate("wow") == true)
@test(candidate("world") == true)
@test(candidate("MadaM") == true)
@test(candidate("Wow") == true)
@test(candidate("") == false)
@test(candidate("HI") == true)
@test(candidate("go") == true)
@test(candidate("gogo") == false)
@test(candidate("aaaaaaaaaaaaaaa") == false)
@test(candidate("Madam") == true)
@test(candidate("M") == false)
@test(candidate("0") == false)
end
| ['\nfunction' '\nmacro' '\n\n'] |
HumanEval_83_starts_one_ends | jl | """Given a positive integer n, return the count of the numbers of n-digit
positive integers that start or end with 1."""
function starts_one_ends(n::Int64)::Int64
| transform | /work/arjunguha-research-group/arjun/repos/nuprl/MultiPL-E/datasets/../datasets/originals-with-cleaned-doctests/HumanEval_83_starts_one_ends.py | reworded | using Test
@testset begin
candidate = starts_one_ends;
@test(candidate(1) == 1)
@test(candidate(2) == 18)
@test(candidate(3) == 180)
@test(candidate(4) == 1800)
@test(candidate(5) == 18000)
end
| ['\nfunction' '\nmacro' '\n\n'] |
HumanEval_84_solve | jl | """Given a positive integer N, return the total sum of its digits in binary.
Example
>>> solve(1000)
"1"
>>> solve(150)
"110"
>>> solve(147)
"1100"
Variables:
@N integer
Constraints: 0 ≤ N ≤ 10000.
Output:
a string of binary number"""
function solve(N::Int64)::String
| transform | /work/arjunguha-research-group/arjun/repos/nuprl/MultiPL-E/datasets/../datasets/originals-with-cleaned-doctests/HumanEval_84_solve.py | reworded | using Test
@testset begin
candidate = solve;
@test(candidate(1000) == "1")
@test(candidate(150) == "110")
@test(candidate(147) == "1100")
@test(candidate(333) == "1001")
@test(candidate(963) == "10010")
end
| ['\nfunction' '\nmacro' '\n\n'] |
HumanEval_85_add | jl | """Given a non-empty vector of integers lst. add the even elements that are at odd indices.
Note: In this problem, all index-related conditions (e.g., even, odd, multiples of k) are defined with 0-based indexing
Examples:
>>> add([4, 2, 6, 7])
2"""
function add(lst::Vector{Int64})::Int64
| transform | /work/arjunguha-research-group/arjun/repos/nuprl/MultiPL-E/datasets/../datasets/originals-with-cleaned-doctests/HumanEval_85_add.py | reworded | using Test
@testset begin
candidate = add;
@test(candidate([4, 88]) == 88)
@test(candidate([4, 5, 6, 7, 2, 122]) == 122)
@test(candidate([4, 0, 6, 7]) == 0)
@test(candidate([4, 4, 6, 8]) == 12)
end
| ['\nfunction' '\nmacro' '\n\n'] |
HumanEval_86_anti_shuffle | jl | """Write a function that takes a string and returns an ordered version of it.
Ordered version of string, is a string where all words (separated by space)
are replaced by a new word where all the characters arranged in
ascending order based on ascii value.
Note: You should keep the order of words and blank spaces in the sentence.
For example:
>>> anti_shuffle("Hi")
"Hi"
>>> anti_shuffle("hello")
"ehllo"
>>> anti_shuffle("Hello World!!!")
"Hello !!!Wdlor"
"""
function anti_shuffle(s::String)::String
| transform | /work/arjunguha-research-group/arjun/repos/nuprl/MultiPL-E/datasets/../datasets/originals-with-cleaned-doctests/HumanEval_86_anti_shuffle.py | reworded | using Test
@testset begin
candidate = anti_shuffle;
@test(candidate("Hi") == "Hi")
@test(candidate("hello") == "ehllo")
@test(candidate("number") == "bemnru")
@test(candidate("abcd") == "abcd")
@test(candidate("Hello World!!!") == "Hello !!!Wdlor")
@test(candidate("") == "")
@test(candidate("Hi. My name is Mister Robot. How are you?") == ".Hi My aemn is Meirst .Rboot How aer ?ouy")
end
| ['\nfunction' '\nmacro' '\n\n'] |
HumanEval_87_get_row | jl | """You are given a 2 dimensional data, as a nested vectors,
which is similar to matrix, however, unlike matrices,
each row may contain a different number of columns.
Given lst, and integer x, find integers x in the vector,
and return vector of tuples, [(x1, y1), (x2, y2) ...] such that
each tuple is a coordinate - (row, columns), starting with 0.
Sort coordinates initially by rows in ascending order.
Also, sort coordinates of the row by columns in descending order.
Note: In this problem, all index-related conditions (e.g., even, odd, multiples of k) are defined with 0-based indexing.
Examples:
>>> get_row([[1, 2, 3, 4, 5, 6], [1, 2, 3, 4, 1, 6], [1, 2, 3, 4, 5, 1]], 1)
[(0, 0), (1, 4), (1, 0), (2, 5), (2, 0)]
>>> get_row([], 1)
[]
>>> get_row([[], [1], [1, 2, 3]], 3)
[(2, 2)]"""
function get_row(lst::Vector{Vector{Int64}}, x::Int64)::Vector{Tuple{Int64, Int64}}
| transform | /work/arjunguha-research-group/arjun/repos/nuprl/MultiPL-E/datasets/../datasets/originals-with-cleaned-doctests/HumanEval_87_get_row.py | reworded | using Test
@testset begin
candidate = get_row;
@test(candidate([[1, 2, 3, 4, 5, 6], [1, 2, 3, 4, 1, 6], [1, 2, 3, 4, 5, 1]], 1) == [(0, 0), (1, 4), (1, 0), (2, 5), (2, 0)])
@test(candidate([[1, 2, 3, 4, 5, 6], [1, 2, 3, 4, 5, 6], [1, 2, 3, 4, 5, 6], [1, 2, 3, 4, 5, 6], [1, 2, 3, 4, 5, 6], [1, 2, 3, 4, 5, 6]], 2) == [(0, 1), (1, 1), (2, 1), (3, 1), (4, 1), (5, 1)])
@test(candidate([[1, 2, 3, 4, 5, 6], [1, 2, 3, 4, 5, 6], [1, 1, 3, 4, 5, 6], [1, 2, 1, 4, 5, 6], [1, 2, 3, 1, 5, 6], [1, 2, 3, 4, 1, 6], [1, 2, 3, 4, 5, 1]], 1) == [(0, 0), (1, 0), (2, 1), (2, 0), (3, 2), (3, 0), (4, 3), (4, 0), (5, 4), (5, 0), (6, 5), (6, 0)])
@test(candidate(Vector{Vector{Int64}}([]), 1) == Vector{Tuple{Int64, Int64}}([]))
@test(candidate([[1]], 2) == Vector{Tuple{Int64, Int64}}([]))
@test(candidate([[], [1], [1, 2, 3]], 3) == [(2, 2)])
end
| ['\nfunction' '\nmacro' '\n\n'] |
HumanEval_88_sort_array | jl | """Given a vector of non-negative integers, return a cojl of the given vector after sorting,
you will sort the given vector in ascending order if the sum( first index value, last index value) is odd,
or sort it in descending order if the sum( first index value, last index value) is even.
Note:
* don't change the given vector.
Examples:
>>> sort_array([])
[]
>>> sort_array([5])
[5]
>>> sort_array([2, 4, 3, 0, 1, 5])
[0, 1, 2, 3, 4, 5]
>>> sort_array([2, 4, 3, 0, 1, 5, 6])
[6, 5, 4, 3, 2, 1, 0]"""
function sort_array(array::Vector{Int64})::Vector{Int64}
| transform | /work/arjunguha-research-group/arjun/repos/nuprl/MultiPL-E/datasets/../datasets/originals-with-cleaned-doctests/HumanEval_88_sort_array.py | reworded | using Test
@testset begin
candidate = sort_array;
@test(candidate(Vector{Int64}([])) == Vector{Int64}([]))
@test(candidate([5]) == [5])
@test(candidate([2, 4, 3, 0, 1, 5]) == [0, 1, 2, 3, 4, 5])
@test(candidate([2, 4, 3, 0, 1, 5, 6]) == [6, 5, 4, 3, 2, 1, 0])
@test(candidate([2, 1]) == [1, 2])
@test(candidate([15, 42, 87, 32, 11, 0]) == [0, 11, 15, 32, 42, 87])
@test(candidate([21, 14, 23, 11]) == [23, 21, 14, 11])
end
| ['\nfunction' '\nmacro' '\n\n'] |
HumanEval_89_encrypt | jl | """Create a function encrypt that takes a string as an argument and
returns a string encrypted with the alphabet being rotated.
The alphabet should be rotated in a manner such that the letters
shift down by two multiplied to two places.
For example:
>>> encrypt("hi")
"lm"
>>> encrypt("asdfghjkl")
"ewhjklnop"
>>> encrypt("gf")
"kj"
>>> encrypt("et")
"ix"
"""
function encrypt(s::String)::String
| transform | /work/arjunguha-research-group/arjun/repos/nuprl/MultiPL-E/datasets/../datasets/originals-with-cleaned-doctests/HumanEval_89_encrypt.py | reworded | using Test
@testset begin
candidate = encrypt;
@test(candidate("hi") == "lm")
@test(candidate("asdfghjkl") == "ewhjklnop")
@test(candidate("gf") == "kj")
@test(candidate("et") == "ix")
@test(candidate("faewfawefaewg") == "jeiajeaijeiak")
@test(candidate("hellomyfriend") == "lippsqcjvmirh")
@test(candidate("dxzdlmnilfuhmilufhlihufnmlimnufhlimnufhfucufh") == "hbdhpqrmpjylqmpyjlpmlyjrqpmqryjlpmqryjljygyjl")
@test(candidate("a") == "e")
end
| ['\nfunction' '\nmacro' '\n\n'] |
HumanEval_90_next_smallest | jl | """You are given a vector of integers.
Write a function next_smallest() that returns the 2nd smallest element of the vector.
Return nothing if there is no such element.
>>> next_smallest([1, 2, 3, 4, 5])
2
>>> next_smallest([5, 1, 4, 3, 2])
2
>>> next_smallest([])
nothing
>>> next_smallest([1, 1])
nothing"""
function next_smallest(lst::Vector{Int64})::Union{Int64, Nothing}
| transform | /work/arjunguha-research-group/arjun/repos/nuprl/MultiPL-E/datasets/../datasets/originals-with-cleaned-doctests/HumanEval_90_next_smallest.py | reworded | using Test
@testset begin
candidate = next_smallest;
@test(candidate([1, 2, 3, 4, 5]) == 2)
@test(candidate([5, 1, 4, 3, 2]) == 2)
@test(candidate(Vector{Int64}([])) == nothing)
@test(candidate([1, 1]) == nothing)
@test(candidate([1, 1, 1, 1, 0]) == 1)
@test(candidate([1, 1]) == nothing)
@test(candidate([-35, 34, 12, -45]) == -35)
end
| ['\nfunction' '\nmacro' '\n\n'] |
HumanEval_91_is_bored | jl | """You'll be given a string of words, and your task is to count the number
of boredoms. A boredom is a sentence that starts with the word "I".
Sentences are delimited by '.', '?' or '!'.
For example:
>>> is_bored("Hello world")
0
>>> is_bored("The sky is blue. The sun is shining. I love this weather")
1"""
function is_bored(S::String)::Int64
| transform | /work/arjunguha-research-group/arjun/repos/nuprl/MultiPL-E/datasets/../datasets/originals-with-cleaned-doctests/HumanEval_91_is_bored.py | reworded | using Test
@testset begin
candidate = is_bored;
@test(candidate("Hello world") == 0)
@test(candidate("Is the sky blue?") == 0)
@test(candidate("I love It !") == 1)
@test(candidate("bIt") == 0)
@test(candidate("I feel good today. I will be productive. will kill It") == 2)
@test(candidate("You and I are going for a walk") == 0)
end
| ['\nfunction' '\nmacro' '\n\n'] |
HumanEval_92_any_int | jl | """Create a function that takes 3 numbers.
Returns true if one of the numbers is equal to the sum of the other two, and all numbers are integers.
Returns false in any other cases.
Examples
>>> any_int(5, 2, 7)
true
>>> any_int(3, 2, 2)
false
>>> any_int(3, -2, 1)
true
>>> any_int(3.6, -2.2, 2)
false"""
function any_int(x::Float64, y::Float64, z::Float64)::Bool
| transform | /work/arjunguha-research-group/arjun/repos/nuprl/MultiPL-E/datasets/../datasets/originals-with-cleaned-doctests/HumanEval_92_any_int.py | reworded | using Test
@testset begin
candidate = any_int;
@test(candidate(2, 3, 1) == true)
@test(candidate(2.5, 2, 3) == false)
@test(candidate(1.5, 5, 3.5) == false)
@test(candidate(2, 6, 2) == false)
@test(candidate(4, 2, 2) == true)
@test(candidate(2.2, 2.2, 2.2) == false)
@test(candidate(-4, 6, 2) == true)
@test(candidate(2, 1, 1) == true)
@test(candidate(3, 4, 7) == true)
@test(candidate(3.0, 4, 7) == false)
end
| ['\nfunction' '\nmacro' '\n\n'] |
HumanEval_93_encode | jl | """Write a function that takes a message, and encodes in such a
way that it swaps case of all letters, replaces all vowels in
the message with the letter that appears 2 places ahead of that
vowel in the english alphabet.
Assume only letters.
Examples:
>>> encode("test")
"TGST"
>>> encode("This is a message")
"tHKS KS C MGSSCGG"
"""
function encode(message::String)::String
| transform | /work/arjunguha-research-group/arjun/repos/nuprl/MultiPL-E/datasets/../datasets/originals-with-cleaned-doctests/HumanEval_93_encode.py | reworded | using Test
@testset begin
candidate = encode;
@test(candidate("TEST") == "tgst")
@test(candidate("Mudasir") == "mWDCSKR")
@test(candidate("YES") == "ygs")
@test(candidate("This is a message") == "tHKS KS C MGSSCGG")
@test(candidate("I DoNt KnOw WhAt tO WrItE") == "k dQnT kNqW wHcT Tq wRkTg")
end
| ['\nfunction' '\nmacro' '\n\n'] |
HumanEval_94_skjkasdkd | jl | """You are given a vector of integers.
You need to find the largest prime value and return the sum of its digits.
Examples:
>>> skjkasdkd([0, 3, 2, 1, 3, 5, 7, 4, 5, 5, 5, 2, 181, 32, 4, 32, 3, 2, 32, 324, 4, 3])
10
>>> skjkasdkd([1, 0, 1, 8, 2, 4597, 2, 1, 3, 40, 1, 2, 1, 2, 4, 2, 5, 1])
25
>>> skjkasdkd([1, 3, 1, 32, 5107, 34, 83278, 109, 163, 23, 2323, 32, 30, 1, 9, 3])
13
>>> skjkasdkd([0, 724, 32, 71, 99, 32, 6, 0, 5, 91, 83, 0, 5, 6])
11
>>> skjkasdkd([0, 81, 12, 3, 1, 21])
3
>>> skjkasdkd([0, 8, 1, 2, 1, 7])
7"""
function skjkasdkd(lst::Vector{Int64})::Int64
| transform | /work/arjunguha-research-group/arjun/repos/nuprl/MultiPL-E/datasets/../datasets/originals-with-cleaned-doctests/HumanEval_94_skjkasdkd.py | reworded | using Test
@testset begin
candidate = skjkasdkd;
@test(candidate([0, 3, 2, 1, 3, 5, 7, 4, 5, 5, 5, 2, 181, 32, 4, 32, 3, 2, 32, 324, 4, 3]) == 10)
@test(candidate([1, 0, 1, 8, 2, 4597, 2, 1, 3, 40, 1, 2, 1, 2, 4, 2, 5, 1]) == 25)
@test(candidate([1, 3, 1, 32, 5107, 34, 83278, 109, 163, 23, 2323, 32, 30, 1, 9, 3]) == 13)
@test(candidate([0, 724, 32, 71, 99, 32, 6, 0, 5, 91, 83, 0, 5, 6]) == 11)
@test(candidate([0, 81, 12, 3, 1, 21]) == 3)
@test(candidate([0, 8, 1, 2, 1, 7]) == 7)
@test(candidate([8191]) == 19)
@test(candidate([8191, 123456, 127, 7]) == 19)
@test(candidate([127, 97, 8192]) == 10)
end
| ['\nfunction' '\nmacro' '\n\n'] |
HumanEval_95_check_dict_case | jl | """Given a dictionary, return true if all keys are strings in lower
case or all keys are strings in upper case, else return false.
The function should return false is the given dictionary is empty.
Examples:
>>> check_dict_case(Dict("a" => "apple", "b" => "banana"))
true
>>> check_dict_case(Dict("a" => "apple", "A" => "banana", "B" => "banana"))
false
>>> check_dict_case(Dict("a" => "apple", 8 => "banana", "a" => "apple"))
false
>>> check_dict_case(Dict("Name" => "John", "Age" => "36", "City" => "Houston"))
false
>>> check_dict_case(Dict("STATE" => "NC", "ZIP" => "12345"))
true"""
function check_dict_case(dict::Dict{String, String}>)::Bool
| transform | /work/arjunguha-research-group/arjun/repos/nuprl/MultiPL-E/datasets/../datasets/originals-with-cleaned-doctests/HumanEval_95_check_dict_case.py | reworded | using Test
@testset begin
candidate = check_dict_case;
@test(candidate(Dict("p" => "pineapple", "b" => "banana")) == true)
@test(candidate(Dict("p" => "pineapple", "A" => "banana", "B" => "banana")) == false)
@test(candidate(Dict("p" => "pineapple", "5" => "banana", "a" => "apple")) == false)
@test(candidate(Dict("Name" => "John", "Age" => "36", "City" => "Houston")) == false)
@test(candidate(Dict("STATE" => "NC", "ZIP" => "12345")) == true)
@test(candidate(Dict("fruit" => "Orange", "taste" => "Sweet")) == true)
@test(candidate(Dict()) == false)
end
| ['\nfunction' '\nmacro' '\n\n'] |
HumanEval_96_count_up_to | jl | """Implement a function that takes an non-negative integer and returns a vector of the first n
integers that are prime numbers and less than n.
for example:
>>> count_up_to(5)
[2, 3]
>>> count_up_to(11)
[2, 3, 5, 7]
>>> count_up_to(0)
[]
>>> count_up_to(20)
[2, 3, 5, 7, 11, 13, 17, 19]
>>> count_up_to(1)
[]
>>> count_up_to(18)
[2, 3, 5, 7, 11, 13, 17]"""
function count_up_to(n::Int64)::Vector{Int64}
| transform | /work/arjunguha-research-group/arjun/repos/nuprl/MultiPL-E/datasets/../datasets/originals-with-cleaned-doctests/HumanEval_96_count_up_to.py | reworded | using Test
@testset begin
candidate = count_up_to;
@test(candidate(5) == [2, 3])
@test(candidate(6) == [2, 3, 5])
@test(candidate(7) == [2, 3, 5])
@test(candidate(10) == [2, 3, 5, 7])
@test(candidate(0) == Vector{Int64}([]))
@test(candidate(22) == [2, 3, 5, 7, 11, 13, 17, 19])
@test(candidate(1) == Vector{Int64}([]))
@test(candidate(18) == [2, 3, 5, 7, 11, 13, 17])
@test(candidate(47) == [2, 3, 5, 7, 11, 13, 17, 19, 23, 29, 31, 37, 41, 43])
@test(candidate(101) == [2, 3, 5, 7, 11, 13, 17, 19, 23, 29, 31, 37, 41, 43, 47, 53, 59, 61, 67, 71, 73, 79, 83, 89, 97])
end
| ['\nfunction' '\nmacro' '\n\n'] |
HumanEval_97_multiply | jl | """Complete the function that takes two integers and returns
the product of their unit digits.
Assume the input is always valid.
Examples:
>>> multiply(148, 412)
16
>>> multiply(19, 28)
72
>>> multiply(2020, 1851)
0
>>> multiply(14, -15)
20"""
function multiply(a::Int64, b::Int64)::Int64
| transform | /work/arjunguha-research-group/arjun/repos/nuprl/MultiPL-E/datasets/../datasets/originals-with-cleaned-doctests/HumanEval_97_multiply.py | reworded | using Test
@testset begin
candidate = multiply;
@test(candidate(148, 412) == 16)
@test(candidate(19, 28) == 72)
@test(candidate(2020, 1851) == 0)
@test(candidate(14, -15) == 20)
@test(candidate(76, 67) == 42)
@test(candidate(17, 27) == 49)
@test(candidate(0, 1) == 0)
@test(candidate(0, 0) == 0)
end
| ['\nfunction' '\nmacro' '\n\n'] |
HumanEval_98_count_upper | jl | """Given a string s, count the number of uppercase vowels in even indices.
Note: In this problem, all index-related conditions (e.g., even, odd, multiples of k) are defined with 0-based indexing
For example:
>>> count_upper("aBCdEf")
1
>>> count_upper("abcdefg")
0
>>> count_upper("dBBE")
0"""
function count_upper(s::String)::Int64
| transform | /work/arjunguha-research-group/arjun/repos/nuprl/MultiPL-E/datasets/../datasets/originals-with-cleaned-doctests/HumanEval_98_count_upper.py | reworded | using Test
@testset begin
candidate = count_upper;
@test(candidate("aBCdEf") == 1)
@test(candidate("abcdefg") == 0)
@test(candidate("dBBE") == 0)
@test(candidate("B") == 0)
@test(candidate("U") == 1)
@test(candidate("") == 0)
@test(candidate("EEEE") == 2)
end
| ['\nfunction' '\nmacro' '\n\n'] |
HumanEval_99_closest_integer | jl | """Create a function that takes a value (string) representing a number
and returns the closest integer to it. If the number is equidistant
from two integers, round it away from zero.
Examples
>>> closest_integer("10")
10
>>> closest_integer("15.3")
15
Note:
Rounding away from zero means that if the given number is equidistant
from two integers, the one you should return is the one that is the
farthest from zero. For example closest_integer("14.5") should
return 15 and closest_integer("-14.5") should return -15."""
function closest_integer(value::String)::Int64
| transform | /work/arjunguha-research-group/arjun/repos/nuprl/MultiPL-E/datasets/../datasets/originals-with-cleaned-doctests/HumanEval_99_closest_integer.py | reworded | using Test
@testset begin
candidate = closest_integer;
@test(candidate("10") == 10)
@test(candidate("14.5") == 15)
@test(candidate("-15.5") == -16)
@test(candidate("15.3") == 15)
@test(candidate("0") == 0)
end
| ['\nfunction' '\nmacro' '\n\n'] |
HumanEval_100_make_a_pile | jl | """Given a positive integer n, you have to make a pile of n levels of stones.
The first level has n stones.
The number of stones in the next level is:
- the next odd number if n is odd.
- the next even number if n is even.
Return the number of stones in each level in a vector, where element at index
i represents the number of stones in the level (i+1).
Examples:
>>> make_a_pile(3)
[3, 5, 7]"""
function make_a_pile(n::Int64)::Vector{Int64}
| transform | /work/arjunguha-research-group/arjun/repos/nuprl/MultiPL-E/datasets/../datasets/originals-with-cleaned-doctests/HumanEval_100_make_a_pile.py | reworded | using Test
@testset begin
candidate = make_a_pile;
@test(candidate(3) == [3, 5, 7])
@test(candidate(4) == [4, 6, 8, 10])
@test(candidate(5) == [5, 7, 9, 11, 13])
@test(candidate(6) == [6, 8, 10, 12, 14, 16])
@test(candidate(8) == [8, 10, 12, 14, 16, 18, 20, 22])
end
| ['\nfunction' '\nmacro' '\n\n'] |
HumanEval_101_words_string | jl | """You will be given a string of words separated by commas or spaces. Your task is
to split the string into words and return a vector of the words.
For example:
>>> words_string("Hi, my name is John")
["Hi", "my", "name", "is", "John"]
>>> words_string("One, two, three, four, five, six")
["One", "two", "three", "four", "five", "six"]"""
function words_string(s::String)::Vector{String}
| transform | /work/arjunguha-research-group/arjun/repos/nuprl/MultiPL-E/datasets/../datasets/originals-with-cleaned-doctests/HumanEval_101_words_string.py | reworded | using Test
@testset begin
candidate = words_string;
@test(candidate("Hi, my name is John") == ["Hi", "my", "name", "is", "John"])
@test(candidate("One, two, three, four, five, six") == ["One", "two", "three", "four", "five", "six"])
@test(candidate("Hi, my name") == ["Hi", "my", "name"])
@test(candidate("One,, two, three, four, five, six,") == ["One", "two", "three", "four", "five", "six"])
@test(candidate("") == Vector{String}([]))
@test(candidate("ahmed , gamal") == ["ahmed", "gamal"])
end
| ['\nfunction' '\nmacro' '\n\n'] |
HumanEval_102_choose_num | jl | """This function takes two positive numbers x and y and returns the
biggest even integer number that is in the range [x, y] inclusive. If
there's no such number, then the function should return -1.
For example:
>>> choose_num(12, 15)
14
>>> choose_num(13, 12)
-1"""
function choose_num(x::Int64, y::Int64)::Int64
| transform | /work/arjunguha-research-group/arjun/repos/nuprl/MultiPL-E/datasets/../datasets/originals-with-cleaned-doctests/HumanEval_102_choose_num.py | reworded | using Test
@testset begin
candidate = choose_num;
@test(candidate(12, 15) == 14)
@test(candidate(13, 12) == -1)
@test(candidate(33, 12354) == 12354)
@test(candidate(5234, 5233) == -1)
@test(candidate(6, 29) == 28)
@test(candidate(27, 10) == -1)
@test(candidate(7, 7) == -1)
@test(candidate(546, 546) == 546)
end
| ['\nfunction' '\nmacro' '\n\n'] |
Dataset Card for MultiPL-E-fixed (OCaml, Lua, R, Racket, Julia)
This dataset provides corrections for the OCaml, Lua, R, Racket, and Julia portions of the nuprl/MultiPL-E benchmark.
Original Dataset Information
- Repository: https://github.com/nuprl/MultiPL-E
- Paper: https://ieeexplore.ieee.org/abstract/document/10103177
- Original Point of Contact: carolyn.anderson@wellesley.edu, mfeldman@oberlin.edu, a.guha@northeastern.edu
This Version
- Repository: https://github.com/jsbyun121/MultiPL-E-fixed
Dataset Summary
MultiPL-E is a large-scale dataset for evaluating code generation models across 22 programming languages.
However, analysis of the dataset revealed several logical errors, inconsistencies, and language-specific issues in the generated prompts and test cases. These issues can lead to inaccurate evaluation scores by unfairly penalizing models for correctly identifying flaws in the prompts.
This repository provides a corrected version of the dataset specifically for OCaml, Lua, R, Racket, and Julia. The goal of this version is to provide a more reliable and accurate benchmark for evaluating Large Language Models on these languages.
Summary of Corrections
A detailed table of all corrections (logical problems, prompt ambiguities, and language-specific fixes) is available here:
Using This Dataset
This corrected dataset is designed to be a drop-in replacement for the official MultiPL-E data for OCaml, Lua, R, Racket, and Julia.
To use it, simply replace the original humaneval-[lang] files with the corrected versions provided in this repository. The data structure remains compatible with standard evaluation frameworks.
Citation and Attribution
If you use this corrected version of the dataset in your work, we ask that you please cite the original MultiPL-E paper and also acknowledge this repository for the corrections.
Original Paper:
@inproceedings{cassano2023multipl,
title={MultiPL-E: A Scalable and Extensible Approach to Benchmarking Neural Code Generation},
author={Cassano, Federico and Gouwar, John and Nguyen, Daniel and Nguyen, Tuan and Phothilimthana, Phitchaya and Pinckney, David and Anderson, Carolyn and Feldman, Michael and Guha, Arjun},
booktitle={2023 IEEE/ACM 20th International Conference on Mining Software Repositories (MSR)},
pages={707--719},
year={2023},
organization={IEEE}
}
- Downloads last month
- 10