Dataset Viewer
Auto-converted to Parquet Duplicate
text
stringlengths
778
789
target
stringclasses
17 values
metadata
dict
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The ge...
<answer>c1ccc2c(c1)C=CC3=CC=CC=C23</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The ge...
<answer>c1ccc2c3ccccc3ccc2c1</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The ge...
<answer>c1ccc2c(c1)C=CC3=CC=CC=C23</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The ge...
<answer>c1ccc2c3ccccc3ccc2c1</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The ge...
<answer>c1ccc2ccccc2c1</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The ge...
<answer>c1cncc2c1[nH]c(=O)[nH]c2=O</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The ge...
<answer>c1ccc2ccccc2c1</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The ge...
<answer>c1cncc2c1[nH]c(=O)[nH]c2=O</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The ge...
<answer>c1ccc2ccccc2c1</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The ge...
<answer>c1cncc2c1[nH]c(=O)[nH]c2=O</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The ge...
<answer>O=C1C=CC(=O)c2ccccc12</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The ge...
<answer>O=C1C=CC(=O)c2ccccc12</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The ge...
<answer>c1ccc2c(c1)C=CC3=CC=CC=C23</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The ge...
<answer>c1ccc2c3ccccc3ccc2c1</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The ge...
<answer>O=C1C=CC(=O)c2ccccc12</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The ge...
<answer>c1ccc2c(c1)C=CC3=CC=CC=C23</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The ge...
<answer>c1ccc2c3ccccc3ccc2c1</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The ge...
<answer>c1ccc2ccccc2c1</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The ge...
<answer>c1cncc2c1[nH]c(=O)[nH]c2=O</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The ge...
<answer>C1COc2ccccc12</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The ge...
<answer>c1ccc2c(c1)C=CC3=CC=CC=C23</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The ge...
<answer>c1ccc2c3ccccc3ccc2c1</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The ge...
<answer>c1ccc2c(c1)C=CC3=CC=CC=C23</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The ge...
<answer>c1ccc2c3ccccc3ccc2c1</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The ge...
<answer>c1ccc2c(c1)C=CC3=CC=CC=C23</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The ge...
<answer>c1ccc2c3ccccc3ccc2c1</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The ge...
<answer>c1ccc2c(c1)C=CC3=CC=CC=C23</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The ge...
<answer>c1ccc2c3ccccc3ccc2c1</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The ge...
<answer>c1ccc2c(c1)C=CC3=CC=CC=C23</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The ge...
<answer>c1ccc2c3ccccc3ccc2c1</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The ge...
<answer>O=C1C=CC(=O)c2ccccc12</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The ge...
<answer>O=C1C=CC(=O)c2ccccc12</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The ge...
<answer>O=C1C=CC(=O)c2ccccc12</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The ge...
<answer>c1ccc2ccccc2c1</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The ge...
<answer>c1cncc2c1[nH]c(=O)[nH]c2=O</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The ge...
<answer>C1COc2ccccc12</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The ge...
<answer>O=C1C=CC(=O)c2ccccc12</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The ge...
<answer>c1ccc2c(c1)C=CC3=CC=CC=C23</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The ge...
<answer>c1ccc2c3ccccc3ccc2c1</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The ge...
<answer>c1ccc2ccccc2c1</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The ge...
<answer>c1cncc2c1[nH]c(=O)[nH]c2=O</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The ge...
<answer>c1ccc2c(c1)C=CC3=CC=CC=C23</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The ge...
<answer>c1ccc2c3ccccc3ccc2c1</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The ge...
<answer>c1ccc2c(c1)C=CC3=CC=CC=C23</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The ge...
<answer>c1ccc2c3ccccc3ccc2c1</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The ge...
<answer>c1ccccc1</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The ge...
<answer>c1ccncc1</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The ge...
<answer>c1ccc2c(c1)C=CC3=CC=CC=C23</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The ge...
<answer>c1ccc2c3ccccc3ccc2c1</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The ge...
<answer>c1ccc2c(c1)C=CC3=CC=CC=C23</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The ge...
<answer>c1ccc2c3ccccc3ccc2c1</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The ge...
<answer>c1ccc2c(c1)C=CC3=CC=CC=C23</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The ge...
<answer>c1ccc2c3ccccc3ccc2c1</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The ge...
<answer>O=C1C=CC(=O)c2ccccc12</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The ge...
<answer>O=C1C=CC(=O)c2ccccc12</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The ge...
<answer>c1ccc2c(c1)C=CC3=CC=CC=C23</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The ge...
<answer>c1ccc2c3ccccc3ccc2c1</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The ge...
<answer>c1ccc2ccccc2c1</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The ge...
<answer>c1cncc2c1[nH]c(=O)[nH]c2=O</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The ge...
<answer>c1ccc2C=CCc2c1</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The ge...
<answer>c1ccc2ccccc2c1</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The ge...
<answer>c1cncc2c1[nH]c(=O)[nH]c2=O</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The ge...
<answer>c1ccc2c(c1)C=CC3=CC=CC=C23</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The ge...
<answer>c1ccc2c3ccccc3ccc2c1</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The ge...
<answer>c1ccc2c(c1)C=CC3=CC=CC=C23</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The ge...
<answer>c1ccc2c3ccccc3ccc2c1</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The ge...
<answer>c1ccc2c(c1)C=CC3=CC=CC=C23</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The ge...
<answer>c1ccc2c3ccccc3ccc2c1</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The ge...
<answer>c1ccc2ccccc2c1</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The ge...
<answer>c1cncc2c1[nH]c(=O)[nH]c2=O</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The ge...
<answer>C1COc2ccccc12</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The ge...
<answer>c1ccc2c(c1)C=CC3=CC=CC=C23</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The ge...
<answer>c1ccc2c3ccccc3ccc2c1</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The ge...
<answer>c1ccc2c(c1)C=CC3=CC=CC=C23</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The ge...
<answer>c1ccc2c3ccccc3ccc2c1</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The ge...
<answer>c1ccc2C=CCc2c1</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The ge...
<answer>C1COc2ccccc12</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The ge...
<answer>c1ccc2c(c1)C=CC3=CC=CC=C23</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The ge...
<answer>c1ccc2c3ccccc3ccc2c1</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The ge...
<answer>C1COc2ccccc12</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The ge...
<answer>c1ccc2ccccc2c1</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The ge...
<answer>c1cncc2c1[nH]c(=O)[nH]c2=O</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The ge...
<answer>O=C1C=CC(=O)c2ccccc12</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The ge...
<answer>c1ccc2c(c1)C=CC3=CC=CC=C23</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The ge...
<answer>c1ccc2c3ccccc3ccc2c1</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The ge...
<answer>c1ccc2C=CCc2c1</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The ge...
<answer>O=C1C=CC(=O)c2ccccc12</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The ge...
<answer>c1ccc2c(c1)C=CC3=CC=CC=C23</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The ge...
<answer>c1ccc2c3ccccc3ccc2c1</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The ge...
<answer>C=CCC</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The ge...
<answer>C1CCCCC1</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The ge...
<answer>O=C1C=CC(=O)c2ccccc12</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The ge...
<answer>c1ccc2c(c1)C=CC3=CC=CC=C23</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The ge...
<answer>c1ccc2c3ccccc3ccc2c1</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The ge...
<answer>c1ccc2ccccc2c1</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The ge...
<answer>c1cncc2c1[nH]c(=O)[nH]c2=O</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The ge...
<answer>c1ccc2C=CCc2c1</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The ge...
<answer>c1ccc2ccccc2c1</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The ge...
<answer>c1cncc2c1[nH]c(=O)[nH]c2=O</answer>
{ "original_format": "scaffold-dataset" }
You are a specialized cheminformatics AI assistant. Follow these instructions precisely: 1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU). 2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string. 3. **Constraints:** * The ge...
<answer>c1ccc2c(c1)C=CC3=CC=CC=C23</answer>
{ "original_format": "scaffold-dataset" }
End of preview. Expand in Data Studio
README.md exists but content is empty.
Downloads last month
7