text stringlengths 778 789 | target stringclasses 17
values | metadata dict |
|---|---|---|
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:
1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).
2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string.
3. **Constraints:**
* The ge... | <answer>c1ccc2c(c1)C=CC3=CC=CC=C23</answer> | {
"original_format": "scaffold-dataset"
} |
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:
1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).
2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string.
3. **Constraints:**
* The ge... | <answer>c1ccc2c3ccccc3ccc2c1</answer> | {
"original_format": "scaffold-dataset"
} |
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:
1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).
2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string.
3. **Constraints:**
* The ge... | <answer>c1ccc2c(c1)C=CC3=CC=CC=C23</answer> | {
"original_format": "scaffold-dataset"
} |
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:
1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).
2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string.
3. **Constraints:**
* The ge... | <answer>c1ccc2c3ccccc3ccc2c1</answer> | {
"original_format": "scaffold-dataset"
} |
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:
1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).
2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string.
3. **Constraints:**
* The ge... | <answer>c1ccc2ccccc2c1</answer> | {
"original_format": "scaffold-dataset"
} |
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:
1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).
2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string.
3. **Constraints:**
* The ge... | <answer>c1cncc2c1[nH]c(=O)[nH]c2=O</answer> | {
"original_format": "scaffold-dataset"
} |
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:
1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).
2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string.
3. **Constraints:**
* The ge... | <answer>c1ccc2ccccc2c1</answer> | {
"original_format": "scaffold-dataset"
} |
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:
1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).
2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string.
3. **Constraints:**
* The ge... | <answer>c1cncc2c1[nH]c(=O)[nH]c2=O</answer> | {
"original_format": "scaffold-dataset"
} |
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:
1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).
2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string.
3. **Constraints:**
* The ge... | <answer>c1ccc2ccccc2c1</answer> | {
"original_format": "scaffold-dataset"
} |
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:
1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).
2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string.
3. **Constraints:**
* The ge... | <answer>c1cncc2c1[nH]c(=O)[nH]c2=O</answer> | {
"original_format": "scaffold-dataset"
} |
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:
1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).
2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string.
3. **Constraints:**
* The ge... | <answer>O=C1C=CC(=O)c2ccccc12</answer> | {
"original_format": "scaffold-dataset"
} |
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:
1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).
2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string.
3. **Constraints:**
* The ge... | <answer>O=C1C=CC(=O)c2ccccc12</answer> | {
"original_format": "scaffold-dataset"
} |
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:
1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).
2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string.
3. **Constraints:**
* The ge... | <answer>c1ccc2c(c1)C=CC3=CC=CC=C23</answer> | {
"original_format": "scaffold-dataset"
} |
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:
1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).
2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string.
3. **Constraints:**
* The ge... | <answer>c1ccc2c3ccccc3ccc2c1</answer> | {
"original_format": "scaffold-dataset"
} |
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:
1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).
2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string.
3. **Constraints:**
* The ge... | <answer>O=C1C=CC(=O)c2ccccc12</answer> | {
"original_format": "scaffold-dataset"
} |
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:
1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).
2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string.
3. **Constraints:**
* The ge... | <answer>c1ccc2c(c1)C=CC3=CC=CC=C23</answer> | {
"original_format": "scaffold-dataset"
} |
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:
1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).
2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string.
3. **Constraints:**
* The ge... | <answer>c1ccc2c3ccccc3ccc2c1</answer> | {
"original_format": "scaffold-dataset"
} |
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:
1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).
2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string.
3. **Constraints:**
* The ge... | <answer>c1ccc2ccccc2c1</answer> | {
"original_format": "scaffold-dataset"
} |
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:
1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).
2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string.
3. **Constraints:**
* The ge... | <answer>c1cncc2c1[nH]c(=O)[nH]c2=O</answer> | {
"original_format": "scaffold-dataset"
} |
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:
1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).
2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string.
3. **Constraints:**
* The ge... | <answer>C1COc2ccccc12</answer> | {
"original_format": "scaffold-dataset"
} |
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:
1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).
2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string.
3. **Constraints:**
* The ge... | <answer>c1ccc2c(c1)C=CC3=CC=CC=C23</answer> | {
"original_format": "scaffold-dataset"
} |
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:
1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).
2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string.
3. **Constraints:**
* The ge... | <answer>c1ccc2c3ccccc3ccc2c1</answer> | {
"original_format": "scaffold-dataset"
} |
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:
1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).
2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string.
3. **Constraints:**
* The ge... | <answer>c1ccc2c(c1)C=CC3=CC=CC=C23</answer> | {
"original_format": "scaffold-dataset"
} |
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:
1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).
2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string.
3. **Constraints:**
* The ge... | <answer>c1ccc2c3ccccc3ccc2c1</answer> | {
"original_format": "scaffold-dataset"
} |
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:
1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).
2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string.
3. **Constraints:**
* The ge... | <answer>c1ccc2c(c1)C=CC3=CC=CC=C23</answer> | {
"original_format": "scaffold-dataset"
} |
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:
1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).
2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string.
3. **Constraints:**
* The ge... | <answer>c1ccc2c3ccccc3ccc2c1</answer> | {
"original_format": "scaffold-dataset"
} |
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:
1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).
2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string.
3. **Constraints:**
* The ge... | <answer>c1ccc2c(c1)C=CC3=CC=CC=C23</answer> | {
"original_format": "scaffold-dataset"
} |
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:
1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).
2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string.
3. **Constraints:**
* The ge... | <answer>c1ccc2c3ccccc3ccc2c1</answer> | {
"original_format": "scaffold-dataset"
} |
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:
1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).
2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string.
3. **Constraints:**
* The ge... | <answer>c1ccc2c(c1)C=CC3=CC=CC=C23</answer> | {
"original_format": "scaffold-dataset"
} |
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:
1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).
2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string.
3. **Constraints:**
* The ge... | <answer>c1ccc2c3ccccc3ccc2c1</answer> | {
"original_format": "scaffold-dataset"
} |
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:
1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).
2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string.
3. **Constraints:**
* The ge... | <answer>O=C1C=CC(=O)c2ccccc12</answer> | {
"original_format": "scaffold-dataset"
} |
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:
1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).
2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string.
3. **Constraints:**
* The ge... | <answer>O=C1C=CC(=O)c2ccccc12</answer> | {
"original_format": "scaffold-dataset"
} |
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:
1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).
2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string.
3. **Constraints:**
* The ge... | <answer>O=C1C=CC(=O)c2ccccc12</answer> | {
"original_format": "scaffold-dataset"
} |
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:
1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).
2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string.
3. **Constraints:**
* The ge... | <answer>c1ccc2ccccc2c1</answer> | {
"original_format": "scaffold-dataset"
} |
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:
1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).
2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string.
3. **Constraints:**
* The ge... | <answer>c1cncc2c1[nH]c(=O)[nH]c2=O</answer> | {
"original_format": "scaffold-dataset"
} |
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:
1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).
2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string.
3. **Constraints:**
* The ge... | <answer>C1COc2ccccc12</answer> | {
"original_format": "scaffold-dataset"
} |
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:
1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).
2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string.
3. **Constraints:**
* The ge... | <answer>O=C1C=CC(=O)c2ccccc12</answer> | {
"original_format": "scaffold-dataset"
} |
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:
1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).
2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string.
3. **Constraints:**
* The ge... | <answer>c1ccc2c(c1)C=CC3=CC=CC=C23</answer> | {
"original_format": "scaffold-dataset"
} |
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:
1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).
2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string.
3. **Constraints:**
* The ge... | <answer>c1ccc2c3ccccc3ccc2c1</answer> | {
"original_format": "scaffold-dataset"
} |
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:
1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).
2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string.
3. **Constraints:**
* The ge... | <answer>c1ccc2ccccc2c1</answer> | {
"original_format": "scaffold-dataset"
} |
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:
1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).
2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string.
3. **Constraints:**
* The ge... | <answer>c1cncc2c1[nH]c(=O)[nH]c2=O</answer> | {
"original_format": "scaffold-dataset"
} |
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:
1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).
2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string.
3. **Constraints:**
* The ge... | <answer>c1ccc2c(c1)C=CC3=CC=CC=C23</answer> | {
"original_format": "scaffold-dataset"
} |
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:
1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).
2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string.
3. **Constraints:**
* The ge... | <answer>c1ccc2c3ccccc3ccc2c1</answer> | {
"original_format": "scaffold-dataset"
} |
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:
1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).
2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string.
3. **Constraints:**
* The ge... | <answer>c1ccc2c(c1)C=CC3=CC=CC=C23</answer> | {
"original_format": "scaffold-dataset"
} |
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:
1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).
2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string.
3. **Constraints:**
* The ge... | <answer>c1ccc2c3ccccc3ccc2c1</answer> | {
"original_format": "scaffold-dataset"
} |
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:
1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).
2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string.
3. **Constraints:**
* The ge... | <answer>c1ccccc1</answer> | {
"original_format": "scaffold-dataset"
} |
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:
1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).
2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string.
3. **Constraints:**
* The ge... | <answer>c1ccncc1</answer> | {
"original_format": "scaffold-dataset"
} |
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:
1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).
2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string.
3. **Constraints:**
* The ge... | <answer>c1ccc2c(c1)C=CC3=CC=CC=C23</answer> | {
"original_format": "scaffold-dataset"
} |
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:
1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).
2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string.
3. **Constraints:**
* The ge... | <answer>c1ccc2c3ccccc3ccc2c1</answer> | {
"original_format": "scaffold-dataset"
} |
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:
1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).
2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string.
3. **Constraints:**
* The ge... | <answer>c1ccc2c(c1)C=CC3=CC=CC=C23</answer> | {
"original_format": "scaffold-dataset"
} |
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:
1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).
2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string.
3. **Constraints:**
* The ge... | <answer>c1ccc2c3ccccc3ccc2c1</answer> | {
"original_format": "scaffold-dataset"
} |
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:
1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).
2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string.
3. **Constraints:**
* The ge... | <answer>c1ccc2c(c1)C=CC3=CC=CC=C23</answer> | {
"original_format": "scaffold-dataset"
} |
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:
1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).
2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string.
3. **Constraints:**
* The ge... | <answer>c1ccc2c3ccccc3ccc2c1</answer> | {
"original_format": "scaffold-dataset"
} |
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:
1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).
2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string.
3. **Constraints:**
* The ge... | <answer>O=C1C=CC(=O)c2ccccc12</answer> | {
"original_format": "scaffold-dataset"
} |
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:
1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).
2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string.
3. **Constraints:**
* The ge... | <answer>O=C1C=CC(=O)c2ccccc12</answer> | {
"original_format": "scaffold-dataset"
} |
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:
1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).
2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string.
3. **Constraints:**
* The ge... | <answer>c1ccc2c(c1)C=CC3=CC=CC=C23</answer> | {
"original_format": "scaffold-dataset"
} |
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:
1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).
2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string.
3. **Constraints:**
* The ge... | <answer>c1ccc2c3ccccc3ccc2c1</answer> | {
"original_format": "scaffold-dataset"
} |
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:
1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).
2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string.
3. **Constraints:**
* The ge... | <answer>c1ccc2ccccc2c1</answer> | {
"original_format": "scaffold-dataset"
} |
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:
1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).
2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string.
3. **Constraints:**
* The ge... | <answer>c1cncc2c1[nH]c(=O)[nH]c2=O</answer> | {
"original_format": "scaffold-dataset"
} |
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:
1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).
2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string.
3. **Constraints:**
* The ge... | <answer>c1ccc2C=CCc2c1</answer> | {
"original_format": "scaffold-dataset"
} |
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:
1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).
2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string.
3. **Constraints:**
* The ge... | <answer>c1ccc2ccccc2c1</answer> | {
"original_format": "scaffold-dataset"
} |
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:
1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).
2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string.
3. **Constraints:**
* The ge... | <answer>c1cncc2c1[nH]c(=O)[nH]c2=O</answer> | {
"original_format": "scaffold-dataset"
} |
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:
1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).
2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string.
3. **Constraints:**
* The ge... | <answer>c1ccc2c(c1)C=CC3=CC=CC=C23</answer> | {
"original_format": "scaffold-dataset"
} |
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:
1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).
2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string.
3. **Constraints:**
* The ge... | <answer>c1ccc2c3ccccc3ccc2c1</answer> | {
"original_format": "scaffold-dataset"
} |
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:
1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).
2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string.
3. **Constraints:**
* The ge... | <answer>c1ccc2c(c1)C=CC3=CC=CC=C23</answer> | {
"original_format": "scaffold-dataset"
} |
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:
1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).
2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string.
3. **Constraints:**
* The ge... | <answer>c1ccc2c3ccccc3ccc2c1</answer> | {
"original_format": "scaffold-dataset"
} |
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:
1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).
2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string.
3. **Constraints:**
* The ge... | <answer>c1ccc2c(c1)C=CC3=CC=CC=C23</answer> | {
"original_format": "scaffold-dataset"
} |
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:
1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).
2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string.
3. **Constraints:**
* The ge... | <answer>c1ccc2c3ccccc3ccc2c1</answer> | {
"original_format": "scaffold-dataset"
} |
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:
1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).
2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string.
3. **Constraints:**
* The ge... | <answer>c1ccc2ccccc2c1</answer> | {
"original_format": "scaffold-dataset"
} |
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:
1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).
2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string.
3. **Constraints:**
* The ge... | <answer>c1cncc2c1[nH]c(=O)[nH]c2=O</answer> | {
"original_format": "scaffold-dataset"
} |
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:
1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).
2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string.
3. **Constraints:**
* The ge... | <answer>C1COc2ccccc12</answer> | {
"original_format": "scaffold-dataset"
} |
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:
1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).
2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string.
3. **Constraints:**
* The ge... | <answer>c1ccc2c(c1)C=CC3=CC=CC=C23</answer> | {
"original_format": "scaffold-dataset"
} |
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:
1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).
2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string.
3. **Constraints:**
* The ge... | <answer>c1ccc2c3ccccc3ccc2c1</answer> | {
"original_format": "scaffold-dataset"
} |
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:
1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).
2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string.
3. **Constraints:**
* The ge... | <answer>c1ccc2c(c1)C=CC3=CC=CC=C23</answer> | {
"original_format": "scaffold-dataset"
} |
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:
1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).
2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string.
3. **Constraints:**
* The ge... | <answer>c1ccc2c3ccccc3ccc2c1</answer> | {
"original_format": "scaffold-dataset"
} |
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:
1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).
2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string.
3. **Constraints:**
* The ge... | <answer>c1ccc2C=CCc2c1</answer> | {
"original_format": "scaffold-dataset"
} |
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:
1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).
2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string.
3. **Constraints:**
* The ge... | <answer>C1COc2ccccc12</answer> | {
"original_format": "scaffold-dataset"
} |
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:
1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).
2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string.
3. **Constraints:**
* The ge... | <answer>c1ccc2c(c1)C=CC3=CC=CC=C23</answer> | {
"original_format": "scaffold-dataset"
} |
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:
1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).
2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string.
3. **Constraints:**
* The ge... | <answer>c1ccc2c3ccccc3ccc2c1</answer> | {
"original_format": "scaffold-dataset"
} |
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:
1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).
2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string.
3. **Constraints:**
* The ge... | <answer>C1COc2ccccc12</answer> | {
"original_format": "scaffold-dataset"
} |
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:
1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).
2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string.
3. **Constraints:**
* The ge... | <answer>c1ccc2ccccc2c1</answer> | {
"original_format": "scaffold-dataset"
} |
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:
1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).
2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string.
3. **Constraints:**
* The ge... | <answer>c1cncc2c1[nH]c(=O)[nH]c2=O</answer> | {
"original_format": "scaffold-dataset"
} |
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:
1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).
2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string.
3. **Constraints:**
* The ge... | <answer>O=C1C=CC(=O)c2ccccc12</answer> | {
"original_format": "scaffold-dataset"
} |
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:
1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).
2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string.
3. **Constraints:**
* The ge... | <answer>c1ccc2c(c1)C=CC3=CC=CC=C23</answer> | {
"original_format": "scaffold-dataset"
} |
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:
1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).
2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string.
3. **Constraints:**
* The ge... | <answer>c1ccc2c3ccccc3ccc2c1</answer> | {
"original_format": "scaffold-dataset"
} |
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:
1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).
2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string.
3. **Constraints:**
* The ge... | <answer>c1ccc2C=CCc2c1</answer> | {
"original_format": "scaffold-dataset"
} |
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:
1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).
2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string.
3. **Constraints:**
* The ge... | <answer>O=C1C=CC(=O)c2ccccc12</answer> | {
"original_format": "scaffold-dataset"
} |
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:
1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).
2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string.
3. **Constraints:**
* The ge... | <answer>c1ccc2c(c1)C=CC3=CC=CC=C23</answer> | {
"original_format": "scaffold-dataset"
} |
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:
1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).
2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string.
3. **Constraints:**
* The ge... | <answer>c1ccc2c3ccccc3ccc2c1</answer> | {
"original_format": "scaffold-dataset"
} |
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:
1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).
2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string.
3. **Constraints:**
* The ge... | <answer>C=CCC</answer> | {
"original_format": "scaffold-dataset"
} |
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:
1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).
2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string.
3. **Constraints:**
* The ge... | <answer>C1CCCCC1</answer> | {
"original_format": "scaffold-dataset"
} |
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:
1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).
2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string.
3. **Constraints:**
* The ge... | <answer>O=C1C=CC(=O)c2ccccc12</answer> | {
"original_format": "scaffold-dataset"
} |
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:
1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).
2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string.
3. **Constraints:**
* The ge... | <answer>c1ccc2c(c1)C=CC3=CC=CC=C23</answer> | {
"original_format": "scaffold-dataset"
} |
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:
1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).
2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string.
3. **Constraints:**
* The ge... | <answer>c1ccc2c3ccccc3ccc2c1</answer> | {
"original_format": "scaffold-dataset"
} |
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:
1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).
2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string.
3. **Constraints:**
* The ge... | <answer>c1ccc2ccccc2c1</answer> | {
"original_format": "scaffold-dataset"
} |
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:
1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).
2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string.
3. **Constraints:**
* The ge... | <answer>c1cncc2c1[nH]c(=O)[nH]c2=O</answer> | {
"original_format": "scaffold-dataset"
} |
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:
1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).
2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string.
3. **Constraints:**
* The ge... | <answer>c1ccc2C=CCc2c1</answer> | {
"original_format": "scaffold-dataset"
} |
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:
1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).
2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string.
3. **Constraints:**
* The ge... | <answer>c1ccc2ccccc2c1</answer> | {
"original_format": "scaffold-dataset"
} |
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:
1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).
2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string.
3. **Constraints:**
* The ge... | <answer>c1cncc2c1[nH]c(=O)[nH]c2=O</answer> | {
"original_format": "scaffold-dataset"
} |
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:
1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).
2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string.
3. **Constraints:**
* The ge... | <answer>c1ccc2c(c1)C=CC3=CC=CC=C23</answer> | {
"original_format": "scaffold-dataset"
} |
Subsets and Splits
No community queries yet
The top public SQL queries from the community will appear here once available.