problem stringlengths 733 744 | scaffold stringclasses 17
values |
|---|---|
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:\n1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).\n2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string.\n3. **Constraints:**\n * Th... | c1ccc2c(c1)C=CC3=CC=CC=C23 |
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:\n1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).\n2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string.\n3. **Constraints:**\n * Th... | c1ccc2c3ccccc3ccc2c1 |
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:\n1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).\n2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string.\n3. **Constraints:**\n * Th... | c1ccc2c(c1)C=CC3=CC=CC=C23 |
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:\n1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).\n2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string.\n3. **Constraints:**\n * Th... | c1ccc2c3ccccc3ccc2c1 |
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:\n1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).\n2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string.\n3. **Constraints:**\n * Th... | c1ccc2ccccc2c1 |
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:\n1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).\n2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string.\n3. **Constraints:**\n * Th... | c1ccc2ccccc2c1 |
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:\n1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).\n2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string.\n3. **Constraints:**\n * Th... | c1ccc2ccccc2c1 |
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:\n1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).\n2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string.\n3. **Constraints:**\n * Th... | O=C1C=CC(=O)c2ccccc12 |
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:\n1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).\n2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string.\n3. **Constraints:**\n * Th... | c1cncc2c1[nH]c(=O)[nH]c2=O |
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:\n1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).\n2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string.\n3. **Constraints:**\n * Th... | O=C1C=CC(=O)c2ccccc12 |
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:\n1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).\n2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string.\n3. **Constraints:**\n * Th... | c1cncc2c1[nH]c(=O)[nH]c2=O |
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:\n1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).\n2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string.\n3. **Constraints:**\n * Th... | c1ccc2c(c1)C=CC3=CC=CC=C23 |
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:\n1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).\n2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string.\n3. **Constraints:**\n * Th... | c1ccc2c3ccccc3ccc2c1 |
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:\n1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).\n2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string.\n3. **Constraints:**\n * Th... | O=C1C=CC(=O)c2ccccc12 |
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:\n1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).\n2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string.\n3. **Constraints:**\n * Th... | c1cncc2c1[nH]c(=O)[nH]c2=O |
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:\n1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).\n2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string.\n3. **Constraints:**\n * Th... | c1ccc2c(c1)C=CC3=CC=CC=C23 |
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:\n1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).\n2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string.\n3. **Constraints:**\n * Th... | c1ccc2c3ccccc3ccc2c1 |
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:\n1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).\n2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string.\n3. **Constraints:**\n * Th... | c1ccc2ccccc2c1 |
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:\n1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).\n2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string.\n3. **Constraints:**\n * Th... | C1COc2ccccc12 |
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:\n1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).\n2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string.\n3. **Constraints:**\n * Th... | c1ccc2c(c1)C=CC3=CC=CC=C23 |
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:\n1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).\n2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string.\n3. **Constraints:**\n * Th... | c1ccc2c3ccccc3ccc2c1 |
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:\n1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).\n2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string.\n3. **Constraints:**\n * Th... | c1ccc2c(c1)C=CC3=CC=CC=C23 |
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:\n1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).\n2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string.\n3. **Constraints:**\n * Th... | c1ccc2c3ccccc3ccc2c1 |
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:\n1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).\n2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string.\n3. **Constraints:**\n * Th... | c1ccc2c(c1)C=CC3=CC=CC=C23 |
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:\n1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).\n2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string.\n3. **Constraints:**\n * Th... | c1ccc2c3ccccc3ccc2c1 |
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:\n1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).\n2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string.\n3. **Constraints:**\n * Th... | c1ccc2c(c1)C=CC3=CC=CC=C23 |
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:\n1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).\n2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string.\n3. **Constraints:**\n * Th... | c1ccc2c3ccccc3ccc2c1 |
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:\n1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).\n2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string.\n3. **Constraints:**\n * Th... | c1ccc2c(c1)C=CC3=CC=CC=C23 |
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:\n1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).\n2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string.\n3. **Constraints:**\n * Th... | c1ccc2c3ccccc3ccc2c1 |
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:\n1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).\n2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string.\n3. **Constraints:**\n * Th... | O=C1C=CC(=O)c2ccccc12 |
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:\n1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).\n2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string.\n3. **Constraints:**\n * Th... | c1cncc2c1[nH]c(=O)[nH]c2=O |
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:\n1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).\n2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string.\n3. **Constraints:**\n * Th... | O=C1C=CC(=O)c2ccccc12 |
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:\n1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).\n2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string.\n3. **Constraints:**\n * Th... | c1cncc2c1[nH]c(=O)[nH]c2=O |
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:\n1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).\n2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string.\n3. **Constraints:**\n * Th... | O=C1C=CC(=O)c2ccccc12 |
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:\n1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).\n2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string.\n3. **Constraints:**\n * Th... | c1cncc2c1[nH]c(=O)[nH]c2=O |
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:\n1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).\n2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string.\n3. **Constraints:**\n * Th... | c1ccc2ccccc2c1 |
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:\n1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).\n2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string.\n3. **Constraints:**\n * Th... | C1COc2ccccc12 |
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:\n1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).\n2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string.\n3. **Constraints:**\n * Th... | O=C1C=CC(=O)c2ccccc12 |
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:\n1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).\n2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string.\n3. **Constraints:**\n * Th... | c1cncc2c1[nH]c(=O)[nH]c2=O |
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:\n1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).\n2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string.\n3. **Constraints:**\n * Th... | c1ccc2c(c1)C=CC3=CC=CC=C23 |
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:\n1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).\n2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string.\n3. **Constraints:**\n * Th... | c1ccc2c3ccccc3ccc2c1 |
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:\n1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).\n2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string.\n3. **Constraints:**\n * Th... | c1ccc2ccccc2c1 |
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:\n1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).\n2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string.\n3. **Constraints:**\n * Th... | c1ccc2c(c1)C=CC3=CC=CC=C23 |
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:\n1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).\n2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string.\n3. **Constraints:**\n * Th... | c1ccc2c3ccccc3ccc2c1 |
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:\n1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).\n2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string.\n3. **Constraints:**\n * Th... | c1ccc2c(c1)C=CC3=CC=CC=C23 |
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:\n1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).\n2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string.\n3. **Constraints:**\n * Th... | c1ccc2c3ccccc3ccc2c1 |
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:\n1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).\n2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string.\n3. **Constraints:**\n * Th... | c1ccccc1 |
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:\n1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).\n2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string.\n3. **Constraints:**\n * Th... | c1ccncc1 |
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:\n1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).\n2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string.\n3. **Constraints:**\n * Th... | c1ccc2c(c1)C=CC3=CC=CC=C23 |
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:\n1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).\n2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string.\n3. **Constraints:**\n * Th... | c1ccc2c3ccccc3ccc2c1 |
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:\n1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).\n2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string.\n3. **Constraints:**\n * Th... | c1ccc2c(c1)C=CC3=CC=CC=C23 |
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:\n1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).\n2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string.\n3. **Constraints:**\n * Th... | c1ccc2c3ccccc3ccc2c1 |
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:\n1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).\n2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string.\n3. **Constraints:**\n * Th... | c1ccc2c(c1)C=CC3=CC=CC=C23 |
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:\n1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).\n2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string.\n3. **Constraints:**\n * Th... | c1ccc2c3ccccc3ccc2c1 |
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:\n1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).\n2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string.\n3. **Constraints:**\n * Th... | O=C1C=CC(=O)c2ccccc12 |
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:\n1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).\n2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string.\n3. **Constraints:**\n * Th... | c1cncc2c1[nH]c(=O)[nH]c2=O |
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:\n1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).\n2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string.\n3. **Constraints:**\n * Th... | O=C1C=CC(=O)c2ccccc12 |
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:\n1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).\n2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string.\n3. **Constraints:**\n * Th... | c1cncc2c1[nH]c(=O)[nH]c2=O |
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:\n1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).\n2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string.\n3. **Constraints:**\n * Th... | c1ccc2c(c1)C=CC3=CC=CC=C23 |
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:\n1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).\n2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string.\n3. **Constraints:**\n * Th... | c1ccc2c3ccccc3ccc2c1 |
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:\n1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).\n2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string.\n3. **Constraints:**\n * Th... | c1ccc2ccccc2c1 |
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:\n1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).\n2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string.\n3. **Constraints:**\n * Th... | c1ccc2C=CCc2c1 |
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:\n1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).\n2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string.\n3. **Constraints:**\n * Th... | c1ccc2ccccc2c1 |
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:\n1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).\n2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string.\n3. **Constraints:**\n * Th... | c1ccc2c(c1)C=CC3=CC=CC=C23 |
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:\n1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).\n2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string.\n3. **Constraints:**\n * Th... | c1ccc2c3ccccc3ccc2c1 |
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:\n1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).\n2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string.\n3. **Constraints:**\n * Th... | c1ccc2c(c1)C=CC3=CC=CC=C23 |
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:\n1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).\n2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string.\n3. **Constraints:**\n * Th... | c1ccc2c3ccccc3ccc2c1 |
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:\n1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).\n2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string.\n3. **Constraints:**\n * Th... | c1ccc2c(c1)C=CC3=CC=CC=C23 |
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:\n1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).\n2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string.\n3. **Constraints:**\n * Th... | c1ccc2c3ccccc3ccc2c1 |
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:\n1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).\n2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string.\n3. **Constraints:**\n * Th... | c1ccc2ccccc2c1 |
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:\n1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).\n2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string.\n3. **Constraints:**\n * Th... | C1COc2ccccc12 |
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:\n1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).\n2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string.\n3. **Constraints:**\n * Th... | c1ccc2c(c1)C=CC3=CC=CC=C23 |
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:\n1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).\n2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string.\n3. **Constraints:**\n * Th... | c1ccc2c3ccccc3ccc2c1 |
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:\n1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).\n2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string.\n3. **Constraints:**\n * Th... | c1ccc2c(c1)C=CC3=CC=CC=C23 |
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:\n1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).\n2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string.\n3. **Constraints:**\n * Th... | c1ccc2c3ccccc3ccc2c1 |
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:\n1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).\n2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string.\n3. **Constraints:**\n * Th... | c1ccc2C=CCc2c1 |
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:\n1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).\n2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string.\n3. **Constraints:**\n * Th... | C1COc2ccccc12 |
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:\n1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).\n2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string.\n3. **Constraints:**\n * Th... | c1ccc2c(c1)C=CC3=CC=CC=C23 |
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:\n1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).\n2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string.\n3. **Constraints:**\n * Th... | c1ccc2c3ccccc3ccc2c1 |
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:\n1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).\n2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string.\n3. **Constraints:**\n * Th... | C1COc2ccccc12 |
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:\n1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).\n2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string.\n3. **Constraints:**\n * Th... | c1ccc2ccccc2c1 |
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:\n1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).\n2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string.\n3. **Constraints:**\n * Th... | O=C1C=CC(=O)c2ccccc12 |
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:\n1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).\n2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string.\n3. **Constraints:**\n * Th... | c1cncc2c1[nH]c(=O)[nH]c2=O |
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:\n1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).\n2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string.\n3. **Constraints:**\n * Th... | c1ccc2c(c1)C=CC3=CC=CC=C23 |
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:\n1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).\n2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string.\n3. **Constraints:**\n * Th... | c1ccc2c3ccccc3ccc2c1 |
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:\n1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).\n2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string.\n3. **Constraints:**\n * Th... | c1ccc2C=CCc2c1 |
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:\n1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).\n2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string.\n3. **Constraints:**\n * Th... | O=C1C=CC(=O)c2ccccc12 |
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:\n1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).\n2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string.\n3. **Constraints:**\n * Th... | c1cncc2c1[nH]c(=O)[nH]c2=O |
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:\n1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).\n2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string.\n3. **Constraints:**\n * Th... | c1ccc2c(c1)C=CC3=CC=CC=C23 |
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:\n1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).\n2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string.\n3. **Constraints:**\n * Th... | c1ccc2c3ccccc3ccc2c1 |
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:\n1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).\n2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string.\n3. **Constraints:**\n * Th... | C=CCC |
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:\n1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).\n2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string.\n3. **Constraints:**\n * Th... | C1CCCCC1 |
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:\n1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).\n2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string.\n3. **Constraints:**\n * Th... | O=C1C=CC(=O)c2ccccc12 |
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:\n1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).\n2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string.\n3. **Constraints:**\n * Th... | c1cncc2c1[nH]c(=O)[nH]c2=O |
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:\n1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).\n2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string.\n3. **Constraints:**\n * Th... | c1ccc2c(c1)C=CC3=CC=CC=C23 |
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:\n1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).\n2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string.\n3. **Constraints:**\n * Th... | c1ccc2c3ccccc3ccc2c1 |
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:\n1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).\n2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string.\n3. **Constraints:**\n * Th... | c1ccc2ccccc2c1 |
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:\n1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).\n2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string.\n3. **Constraints:**\n * Th... | c1ccc2C=CCc2c1 |
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:\n1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).\n2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string.\n3. **Constraints:**\n * Th... | c1ccc2ccccc2c1 |
You are a specialized cheminformatics AI assistant. Follow these instructions precisely:\n1. **Input:** You will receive a Molecular Formula and its corresponding Degree of Unsaturation (DoU).\n2. **Task:** Generate a chemically valid core molecular scaffold represented as a SMILES string.\n3. **Constraints:**\n * Th... | c1ccc2c(c1)C=CC3=CC=CC=C23 |
End of preview. Expand in Data Studio
README.md exists but content is empty.
- Downloads last month
- 4