entities listlengths 1 8.61k | max_stars_repo_path stringlengths 7 172 | max_stars_repo_name stringlengths 5 89 | max_stars_count int64 0 82k | content stringlengths 14 1.05M | id stringlengths 2 6 | new_content stringlengths 15 1.05M | modified bool 1 class | references stringlengths 29 1.05M |
|---|---|---|---|---|---|---|---|---|
[
{
"context": "9\\[\\]/\"'\\*=~\\-\\u2013\\u2014])|$)///gi\n\t,\n\t\tosis: [\"2John\"]\n\t\tregexp: ///(^|[^0-9A-Za-zªµºÀ-ÖØ-öø-ɏḀ-ỿⱠ",
"end": 15465,
"score": 0.6340222358703613,
"start": 15464,
"tag": "NAME",
"value": "2"
},
{
"context": "\\[\\]/\"'\\*=~\\-\\u2013\\u2014])|$)///gi\n\t,\n\t\tosis: [\"2John\"]\n\t\tregexp: ///(^|[^0-9A-Za-zªµºÀ-ÖØ-öø-ɏḀ-ỿⱠ-ⱿꜢ-",
"end": 15469,
"score": 0.4958961606025696,
"start": 15465,
"tag": "NAME",
"value": "John"
},
{
"context": "-9A-Za-zªµºÀ-ÖØ-öø-ɏḀ-ỿⱠ-ⱿꜢ-ꞈꞋ-ꞎꞐ-ꞓꞠ-Ɦꟸ-ꟿ])(\n\t\t(?:2John)|(?:2[\\s\\xa0]*Joh(?:annes(?:['’][\\s\\xa0]*Brev",
"end": 15542,
"score": 0.5597615242004395,
"start": 15541,
"tag": "NAME",
"value": "2"
},
{
"context": "9\\[\\]/\"'\\*=~\\-\\u2013\\u2014])|$)///gi\n\t,\n\t\tosis: [\"3John\"]\n\t\tregexp: ///(^|[^0-9A-Za-zªµºÀ-ÖØ-öø-ɏḀ-ỿⱠ",
"end": 15876,
"score": 0.832212507724762,
"start": 15875,
"tag": "NAME",
"value": "3"
},
{
"context": "\\[\\]/\"'\\*=~\\-\\u2013\\u2014])|$)///gi\n\t,\n\t\tosis: [\"3John\"]\n\t\tregexp: ///(^|[^0-9A-Za-zªµºÀ-ÖØ-öø-ɏḀ-ỿⱠ-ⱿꜢ-",
"end": 15880,
"score": 0.5119724273681641,
"start": 15876,
"tag": "NAME",
"value": "John"
},
{
"context": "-9A-Za-zªµºÀ-ÖØ-öø-ɏḀ-ỿⱠ-ⱿꜢ-ꞈꞋ-ꞎꞐ-ꞓꞠ-Ɦꟸ-ꟿ])(\n\t\t(?:3John)|(?:(?:3(?:\\.[\\s\\xa0]*Johannes['’]|[\\s\\xa0]*J",
"end": 15953,
"score": 0.7581199407577515,
"start": 15952,
"tag": "NAME",
"value": "3"
}
] | lib/bible-tools/lib/Bible-Passage-Reference-Parser/src/da/regexps.coffee | saiba-mais/bible-lessons | 149 | bcv_parser::regexps.space = "[\\s\\xa0]"
bcv_parser::regexps.escaped_passage = ///
(?:^ | [^\x1f\x1e\dA-Za-zªµºÀ-ÖØ-öø-ɏḀ-ỿⱠ-ⱿꜢ-ꞈꞋ-ꞎꞐ-ꞓꞠ-Ɦꟸ-ꟿ] ) # Beginning of string or not in the middle of a word or immediately following another book. Only count a book if it's part of a sequence: `Matt5John3` is OK, but not `1Matt5John3`
(
# Start inverted book/chapter (cb)
(?:
(?: ch (?: apters? | a?pts?\.? | a?p?s?\.? )? \s*
\d+ \s* (?: [\u2013\u2014\-] | through | thru | to) \s* \d+ \s*
(?: from | of | in ) (?: \s+ the \s+ book \s+ of )?\s* )
| (?: ch (?: apters? | a?pts?\.? | a?p?s?\.? )? \s*
\d+ \s*
(?: from | of | in ) (?: \s+ the \s+ book \s+ of )?\s* )
| (?: \d+ (?: th | nd | st ) \s*
ch (?: apter | a?pt\.? | a?p?\.? )? \s* #no plurals here since it's a single chapter
(?: from | of | in ) (?: \s+ the \s+ book \s+ of )? \s* )
)? # End inverted book/chapter (cb)
\x1f(\d+)(?:/\d+)?\x1f #book
(?:
/\d+\x1f #special Psalm chapters
| [\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014]
| title (?! [a-z] ) #could be followed by a number
| kapitlerne | kapitel | vers | kap | ff | og | jf | - | v
| [a-e] (?! \w ) #a-e allows 1:1a
| $ #or the end of the string
)+
)
///gi
# These are the only valid ways to end a potential passage match. The closing parenthesis allows for fully capturing parentheses surrounding translations (ESV**)**. The last one, `[\d\x1f]` needs not to be +; otherwise `Gen5ff` becomes `\x1f0\x1f5ff`, and `adjust_regexp_end` matches the `\x1f5` and incorrectly dangles the ff.
bcv_parser::regexps.match_end_split = ///
\d \W* title
| \d \W* ff (?: [\s\xa0*]* \.)?
| \d [\s\xa0*]* [a-e] (?! \w )
| \x1e (?: [\s\xa0*]* [)\]\uff09] )? #ff09 is a full-width closing parenthesis
| [\d\x1f]
///gi
bcv_parser::regexps.control = /[\x1e\x1f]/g
bcv_parser::regexps.pre_book = "[^A-Za-zªµºÀ-ÖØ-öø-ɏḀ-ỿⱠ-ⱿꜢ-ꞈꞋ-ꞎꞐ-ꞓꞠ-Ɦꟸ-ꟿ]"
bcv_parser::regexps.first = "(?:Første|1)\\.?#{bcv_parser::regexps.space}*"
bcv_parser::regexps.second = "(?:Anden|2)\\.?#{bcv_parser::regexps.space}*"
bcv_parser::regexps.third = "(?:Tredje|3)\\.?#{bcv_parser::regexps.space}*"
bcv_parser::regexps.range_and = "(?:[&\u2013\u2014-]|(?:og|jf)|-)"
bcv_parser::regexps.range_only = "(?:[\u2013\u2014-]|-)"
# Each book regexp should return two parenthesized objects: an optional preliminary character and the book itself.
bcv_parser::regexps.get_books = (include_apocrypha, case_sensitive) ->
books = [
osis: ["Ps"]
apocrypha: true
extra: "2"
regexp: ///(\b)( # Don't match a preceding \d like usual because we only want to match a valid OSIS, which will never have a preceding digit.
Ps151
# Always follwed by ".1"; the regular Psalms parser can handle `Ps151` on its own.
)(?=\.1)///g # Case-sensitive because we only want to match a valid OSIS.
,
osis: ["Gen"]
regexp: ///(^|[^0-9A-Za-zªµºÀ-ÖØ-öø-ɏḀ-ỿⱠ-ⱿꜢ-ꞈꞋ-ꞎꞐ-ꞓꞠ-Ɦꟸ-ꟿ])(
(?:1[\s\xa0]*Mos(?:ebog)?|Gen(?:esis)?|1\.[\s\xa0]*Mos(?:ebog)?|F\xF8rste[\s\xa0]*Mos(?:ebog)?)
)(?:(?=[\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014])|$)///gi
,
osis: ["Exod"]
regexp: ///(^|[^0-9A-Za-zªµºÀ-ÖØ-öø-ɏḀ-ỿⱠ-ⱿꜢ-ꞈꞋ-ꞎꞐ-ꞓꞠ-Ɦꟸ-ꟿ])(
(?:2[\s\xa0]*Mos(?:ebog)?|Exod(?:us)?|2\.[\s\xa0]*Mos(?:ebog)?|Anden[\s\xa0]*Mos(?:ebog)?)
)(?:(?=[\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014])|$)///gi
,
osis: ["Bel"]
apocrypha: true
regexp: ///(^|#{bcv_parser::regexps.pre_book})(
(?:Bel(?:[\s\xa0]*og[\s\xa0]*Dragen)?)
)(?:(?=[\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014])|$)///gi
,
osis: ["Lev"]
regexp: ///(^|[^0-9A-Za-zªµºÀ-ÖØ-öø-ɏḀ-ỿⱠ-ⱿꜢ-ꞈꞋ-ꞎꞐ-ꞓꞠ-Ɦꟸ-ꟿ])(
(?:3[\s\xa0]*Mos(?:ebog)?|Lev(?:iticus)?|3\.[\s\xa0]*Mos(?:ebog)?|Tredje[\s\xa0]*Mos(?:ebog)?)
)(?:(?=[\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014])|$)///gi
,
osis: ["Num"]
regexp: ///(^|[^0-9A-Za-zªµºÀ-ÖØ-öø-ɏḀ-ỿⱠ-ⱿꜢ-ꞈꞋ-ꞎꞐ-ꞓꞠ-Ɦꟸ-ꟿ])(
(?:4[\s\xa0]*Mos(?:ebog)?|Num(?:eri)?|4\.[\s\xa0]*Mos(?:ebog)?|Fjerde[\s\xa0]*Mos(?:ebog)?)
)(?:(?=[\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014])|$)///gi
,
osis: ["Sir"]
apocrypha: true
regexp: ///(^|#{bcv_parser::regexps.pre_book})(
(?:Sir(?:ak(?:s[\s\xa0]*Bog)?)?)
)(?:(?=[\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014])|$)///gi
,
osis: ["Wis"]
apocrypha: true
regexp: ///(^|#{bcv_parser::regexps.pre_book})(
(?:Visdommen(?:s[\s\xa0]*Bog)?|Wis)
)(?:(?=[\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014])|$)///gi
,
osis: ["Lam"]
regexp: ///(^|#{bcv_parser::regexps.pre_book})(
(?:Klag(?:es(?:angene)?)?|Lam)
)(?:(?=[\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014])|$)///gi
,
osis: ["EpJer"]
apocrypha: true
regexp: ///(^|#{bcv_parser::regexps.pre_book})(
(?:Jeremias['’][\s\xa0]*Brev|EpJer)
)(?:(?=[\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014])|$)///gi
,
osis: ["Rev"]
regexp: ///(^|#{bcv_parser::regexps.pre_book})(
(?:(?:A(?:benbaringsbo|abenbarin)|\xC5benbaringsbo)gen|[A\xC5]benbaringen|Rev|Apokalypsen|[A\xC5]b|Joh(?:annes(?:['’][\s\xa0]*[A\xC5]benbaring|apokalypsen)|s(?:\.[\s\xa0]*[A\xC5]|[\s\xa0]*[A\xC5])benbaring))
)(?:(?=[\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014])|$)///gi
,
osis: ["PrMan"]
apocrypha: true
regexp: ///(^|#{bcv_parser::regexps.pre_book})(
(?:(?:Manasses[\s\xa0]*B\xF8|PrMa)n)
)(?:(?=[\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014])|$)///gi
,
osis: ["Deut"]
regexp: ///(^|[^0-9A-Za-zªµºÀ-ÖØ-öø-ɏḀ-ỿⱠ-ⱿꜢ-ꞈꞋ-ꞎꞐ-ꞓꞠ-Ɦꟸ-ꟿ])(
(?:(?:Femte|5\.?)[\s\xa0]*Mosebog|(?:Femte|5\.?)[\s\xa0]*Mos|Deut(?:eronomium)?)
)(?:(?=[\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014])|$)///gi
,
osis: ["Josh"]
regexp: ///(^|#{bcv_parser::regexps.pre_book})(
(?:Jos(?:va(?:bog(?:en)?|s[\s\xa0]*Bog)|ua|h)?)
)(?:(?=[\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014])|$)///gi
,
osis: ["Judg"]
regexp: ///(^|#{bcv_parser::regexps.pre_book})(
(?:Dom(?:mer(?:bogen)?)?|Judg)
)(?:(?=[\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014])|$)///gi
,
osis: ["Ruth"]
regexp: ///(^|#{bcv_parser::regexps.pre_book})(
(?:Rut(?:h(?:s[\s\xa0]*Bog)?)?)
)(?:(?=[\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014])|$)///gi
,
osis: ["1Esd"]
apocrypha: true
regexp: ///(^|[^0-9A-Za-zªµºÀ-ÖØ-öø-ɏḀ-ỿⱠ-ⱿꜢ-ꞈꞋ-ꞎꞐ-ꞓꞠ-Ɦꟸ-ꟿ])(
(?:[13][\s\xa0]*Esdrasbog|1Esd|[13]\.[\s\xa0]*Esdrasbog|Tredje[\s\xa0]*Esdrasbog|F\xF8rste[\s\xa0]*Esdrasbog)
)(?:(?=[\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014])|$)///gi
,
osis: ["2Esd"]
apocrypha: true
regexp: ///(^|[^0-9A-Za-zªµºÀ-ÖØ-öø-ɏḀ-ỿⱠ-ⱿꜢ-ꞈꞋ-ꞎꞐ-ꞓꞠ-Ɦꟸ-ꟿ])(
(?:(?:Anden|[24]\.)[\s\xa0]*Esdrasbog|[24][\s\xa0]*Esdrasbog|2Esd|Fjerde[\s\xa0]*Esdrasbog)
)(?:(?=[\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014])|$)///gi
,
osis: ["Isa"]
regexp: ///(^|#{bcv_parser::regexps.pre_book})(
(?:Es(?:ajas(?:['’][\s\xa0]*Bog)?)?|(?:Jesai|Is)a)
)(?:(?=[\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014])|$)///gi
,
osis: ["2Sam"]
regexp: ///(^|[^0-9A-Za-zªµºÀ-ÖØ-öø-ɏḀ-ỿⱠ-ⱿꜢ-ꞈꞋ-ꞎꞐ-ꞓꞠ-Ɦꟸ-ꟿ])(
(?:2(?:[\s\xa0]*(?:Sam(?:uelsbog|uel)?|Kongerigernes[\s\xa0]*Bog)|Sam|\.[\s\xa0]*(?:Sam(?:uelsbog|uel)?|Kongerigernes[\s\xa0]*Bog))|Anden[\s\xa0]*(?:Sam(?:uelsbog|uel)?|Kongerigernes[\s\xa0]*Bog))
)(?:(?=[\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014])|$)///gi
,
osis: ["1Sam"]
regexp: ///(^|[^0-9A-Za-zªµºÀ-ÖØ-öø-ɏḀ-ỿⱠ-ⱿꜢ-ꞈꞋ-ꞎꞐ-ꞓꞠ-Ɦꟸ-ꟿ])(
(?:1(?:[\s\xa0]*(?:Sam(?:uelsbog|uel)?|Kongerigernes[\s\xa0]*Bog)|Sam|\.[\s\xa0]*(?:Sam(?:uelsbog|uel)?|Kongerigernes[\s\xa0]*Bog))|F\xF8rste[\s\xa0]*(?:Sam(?:uelsbog|uel)?|Kongerigernes[\s\xa0]*Bog))
)(?:(?=[\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014])|$)///gi
,
osis: ["2Kgs"]
regexp: ///(^|[^0-9A-Za-zªµºÀ-ÖØ-öø-ɏḀ-ỿⱠ-ⱿꜢ-ꞈꞋ-ꞎꞐ-ꞓꞠ-Ɦꟸ-ꟿ])(
(?:(?:Anden|2\.?)[\s\xa0]*Kongebog)|(?:(?:Anden|2\.?)[\s\xa0]*Kong|2Kgs|4[\s\xa0]*Kongerigernes[\s\xa0]*Bog|4\.[\s\xa0]*Kongerigernes[\s\xa0]*Bog|Fjerde[\s\xa0]*Kongerigernes[\s\xa0]*Bog)
)(?:(?=[\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014])|$)///gi
,
osis: ["1Kgs"]
regexp: ///(^|[^0-9A-Za-zªµºÀ-ÖØ-öø-ɏḀ-ỿⱠ-ⱿꜢ-ꞈꞋ-ꞎꞐ-ꞓꞠ-Ɦꟸ-ꟿ])(
(?:(?:F\xF8rste|1\.?)[\s\xa0]*Kongebog)|(?:(?:F\xF8rste|1\.?)[\s\xa0]*Kong|1Kgs|3[\s\xa0]*Kongerigernes[\s\xa0]*Bog|3\.[\s\xa0]*Kongerigernes[\s\xa0]*Bog|Tredje[\s\xa0]*Kongerigernes[\s\xa0]*Bog)
)(?:(?=[\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014])|$)///gi
,
osis: ["2Chr"]
regexp: ///(^|[^0-9A-Za-zªµºÀ-ÖØ-öø-ɏḀ-ỿⱠ-ⱿꜢ-ꞈꞋ-ꞎꞐ-ꞓꞠ-Ɦꟸ-ꟿ])(
(?:2(?:[\s\xa0]*Kr(?:\xF8n(?:ikebog)?|on)|Chr|\.[\s\xa0]*Kr(?:\xF8n(?:ikebog)?|on))|Anden[\s\xa0]*Kr(?:\xF8n(?:ikebog)?|on))
)(?:(?=[\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014])|$)///gi
,
osis: ["1Chr"]
regexp: ///(^|[^0-9A-Za-zªµºÀ-ÖØ-öø-ɏḀ-ỿⱠ-ⱿꜢ-ꞈꞋ-ꞎꞐ-ꞓꞠ-Ɦꟸ-ꟿ])(
(?:1(?:[\s\xa0]*Kr(?:\xF8n(?:ikebog)?|on)|Chr|\.[\s\xa0]*Kr(?:\xF8n(?:ikebog)?|on))|F\xF8rste[\s\xa0]*Kr(?:\xF8n(?:ikebog)?|on))
)(?:(?=[\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014])|$)///gi
,
osis: ["Ezra"]
regexp: ///(^|#{bcv_parser::regexps.pre_book})(
(?:Ezra(?:s[\s\xa0]*Bog)?)
)(?:(?=[\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014])|$)///gi
,
osis: ["Neh"]
regexp: ///(^|#{bcv_parser::regexps.pre_book})(
(?:Neh(?:emias(?:’[\s\xa0]*Bog)?)?)
)(?:(?=[\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014])|$)///gi
,
osis: ["GkEsth"]
apocrypha: true
regexp: ///(^|#{bcv_parser::regexps.pre_book})(
(?:GkEsth)
)(?:(?=[\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014])|$)///gi
,
osis: ["Esth"]
regexp: ///(^|#{bcv_parser::regexps.pre_book})(
(?:Est(?:er(?:s[\s\xa0]*Bog)?|h)?)
)(?:(?=[\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014])|$)///gi
,
osis: ["Job"]
regexp: ///(^|#{bcv_parser::regexps.pre_book})(
(?:Job(?:s[\s\xa0]*Bog)?|Hiob)
)(?:(?=[\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014])|$)///gi
,
osis: ["Ps"]
regexp: ///(^|#{bcv_parser::regexps.pre_book})(
(?:S(?:alme(?:rne(?:s[\s\xa0]*Bog)?)?|l)|Ps)
)(?:(?=[\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014])|$)///gi
,
osis: ["PrAzar"]
apocrypha: true
regexp: ///(^|#{bcv_parser::regexps.pre_book})(
(?:Azarjas[\s\xa0]*[Bb]\xF8n|PrAzar)
)(?:(?=[\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014])|$)///gi
,
osis: ["Prov"]
regexp: ///(^|#{bcv_parser::regexps.pre_book})(
(?:Ordsp(?:rogene(?:s[\s\xa0]*Bog)?)?|Prov)
)(?:(?=[\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014])|$)///gi
,
osis: ["Eccl"]
regexp: ///(^|#{bcv_parser::regexps.pre_book})(
(?:Pr(?:\xE6d(?:ikeren(?:s[\s\xa0]*Bog)?)?|ad)|Eccl)
)(?:(?=[\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014])|$)///gi
,
osis: ["SgThree"]
apocrypha: true
regexp: ///(^|#{bcv_parser::regexps.pre_book})(
(?:De[\s\xa0]*(?:Tre[\s\xa0]*M\xE6nds[\s\xa0]*L|tre[\s\xa0]*m\xE6nds[\s\xa0]*l)ovsang|SgThree)
)(?:(?=[\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014])|$)///gi
,
osis: ["Song"]
regexp: ///(^|#{bcv_parser::regexps.pre_book})(
(?:H(?:\xF8jsangen|ojs|\xF8js)|S(?:alomons[\s\xa0]*H\xF8jsa|o)ng)
)(?:(?=[\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014])|$)///gi
,
osis: ["Jer"]
regexp: ///(^|#{bcv_parser::regexps.pre_book})(
(?:Jer(?:emias(?:['’][\s\xa0]*Bog)?)?)
)(?:(?=[\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014])|$)///gi
,
osis: ["Ezek"]
regexp: ///(^|#{bcv_parser::regexps.pre_book})(
(?:Ez(?:ek(?:iel(?:s’?[\s\xa0]*Bog)?)?)?|Hezechiel)
)(?:(?=[\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014])|$)///gi
,
osis: ["Dan"]
regexp: ///(^|#{bcv_parser::regexps.pre_book})(
(?:Dan(?:iel(?:s[\s\xa0]*Bog)?)?)
)(?:(?=[\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014])|$)///gi
,
osis: ["Hos"]
regexp: ///(^|#{bcv_parser::regexps.pre_book})(
(?:Hos(?:eas(?:’[\s\xa0]*Bog)?)?)
)(?:(?=[\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014])|$)///gi
,
osis: ["Joel"]
regexp: ///(^|#{bcv_parser::regexps.pre_book})(
(?:Joel(?:s[\s\xa0]*Bog)?)
)(?:(?=[\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014])|$)///gi
,
osis: ["Amos"]
regexp: ///(^|#{bcv_parser::regexps.pre_book})(
(?:Am(?:os(?:['’][\s\xa0]*Bog)?)?)
)(?:(?=[\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014])|$)///gi
,
osis: ["Obad"]
regexp: ///(^|#{bcv_parser::regexps.pre_book})(
(?:Obad(?:ias(?:['’][\s\xa0]*Bog)?)?)
)(?:(?=[\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014])|$)///gi
,
osis: ["Jonah"]
regexp: ///(^|#{bcv_parser::regexps.pre_book})(
(?:Jon(?:a(?:s(?:['’][\s\xa0]*Bog)?|h))?)
)(?:(?=[\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014])|$)///gi
,
osis: ["Mic"]
regexp: ///(^|#{bcv_parser::regexps.pre_book})(
(?:Mi(?:ka(?:s(?:[\s\xa0]*Bog)?)?|c))
)(?:(?=[\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014])|$)///gi
,
osis: ["Nah"]
regexp: ///(^|#{bcv_parser::regexps.pre_book})(
(?:Nah(?:um(?:s[\s\xa0]*Bog)?)?)
)(?:(?=[\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014])|$)///gi
,
osis: ["Hab"]
regexp: ///(^|#{bcv_parser::regexps.pre_book})(
(?:Hab(?:akkuk(?:s[\s\xa0]*Bog)?)?)
)(?:(?=[\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014])|$)///gi
,
osis: ["Zeph"]
regexp: ///(^|#{bcv_parser::regexps.pre_book})(
(?:Zefanias’[\s\xa0]*Bog)|(?:Sef(?:anias['’][\s\xa0]*Bog)?|Ze(?:fanias|ph|f))
)(?:(?=[\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014])|$)///gi
,
osis: ["Hag"]
regexp: ///(^|#{bcv_parser::regexps.pre_book})(
(?:Hag(?:g(?:aj(?:s[\s\xa0]*Bog)?)?)?)
)(?:(?=[\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014])|$)///gi
,
osis: ["Zech"]
regexp: ///(^|#{bcv_parser::regexps.pre_book})(
(?:Z(?:ak(?:arias(?:['’][\s\xa0]*Bog)?)?|ech))
)(?:(?=[\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014])|$)///gi
,
osis: ["Mal"]
regexp: ///(^|#{bcv_parser::regexps.pre_book})(
(?:Mal(?:akias(?:’[\s\xa0]*Bog)?)?)
)(?:(?=[\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014])|$)///gi
,
osis: ["Matt"]
regexp: ///(^|#{bcv_parser::regexps.pre_book})(
(?:Matt(?:h\xE6us(?:evangeliet)?|\xE6usevangeliet)?)
)(?:(?=[\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014])|$)///gi
,
osis: ["Mark"]
regexp: ///(^|#{bcv_parser::regexps.pre_book})(
(?:Mark(?:us(?:evangeliet)?)?)
)(?:(?=[\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014])|$)///gi
,
osis: ["Luke"]
regexp: ///(^|#{bcv_parser::regexps.pre_book})(
(?:L(?:uk(?:as(?:evangeliet)?|e)?|k))
)(?:(?=[\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014])|$)///gi
,
osis: ["1John"]
regexp: ///(^|[^0-9A-Za-zªµºÀ-ÖØ-öø-ɏḀ-ỿⱠ-ⱿꜢ-ꞈꞋ-ꞎꞐ-ꞓꞠ-Ɦꟸ-ꟿ])(
(?:Johannes['’][\s\xa0]*(?:F\xF8rste|1\.)[\s\xa0]*Brev|Johannes['’][\s\xa0]*1[\s\xa0]*Brev|1John|1[\s\xa0]*Joh(?:annes(?:['’][\s\xa0]*B|b)rev)?|1\.[\s\xa0]*Joh(?:annes(?:['’][\s\xa0]*B|b)rev)?|F\xF8rste[\s\xa0]*Joh(?:annes(?:['’][\s\xa0]*B|b)rev)?)|(?:(?:F\xF8rste|1\.?)[\s\xa0]*Johannes)
)(?:(?=[\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014])|$)///gi
,
osis: ["2John"]
regexp: ///(^|[^0-9A-Za-zªµºÀ-ÖØ-öø-ɏḀ-ỿⱠ-ⱿꜢ-ꞈꞋ-ꞎꞐ-ꞓꞠ-Ɦꟸ-ꟿ])(
(?:2John)|(?:2[\s\xa0]*Joh(?:annes(?:['’][\s\xa0]*Brev|brev)?)?|Johannes['’][\s\xa0]*Andet[\s\xa0]*Brev|2\.[\s\xa0]*Joh(?:annes(?:['’][\s\xa0]*Brev|brev)?)?|Ande(?:n[\s\xa0]*Joh(?:annes(?:['’][\s\xa0]*Brev|brev)?)?|t[\s\xa0]*Johannesbrev))
)(?:(?=[\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014])|$)///gi
,
osis: ["3John"]
regexp: ///(^|[^0-9A-Za-zªµºÀ-ÖØ-öø-ɏḀ-ỿⱠ-ⱿꜢ-ꞈꞋ-ꞎꞐ-ꞓꞠ-Ɦꟸ-ꟿ])(
(?:3John)|(?:(?:3(?:\.[\s\xa0]*Johannes['’]|[\s\xa0]*Johannes['’])|Tredje[\s\xa0]*Johannes['’])[\s\xa0]*Brev|(?:Tredje|3\.?)[\s\xa0]*Johannesbrev|(?:Tredje|3\.?)[\s\xa0]*Joh|Johannes['’][\s\xa0]*(?:Tredje|3\.?)[\s\xa0]*Brev)|(?:(?:Tredje|3\.?)[\s\xa0]*Johannes)
)(?:(?=[\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014])|$)///gi
,
osis: ["John"]
regexp: ///(^|#{bcv_parser::regexps.pre_book})(
(?:Joh(?:annes(?:evangeliet)?|n)?)
)(?:(?=[\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014])|$)///gi
,
osis: ["Acts"]
regexp: ///(^|#{bcv_parser::regexps.pre_book})(
(?:A(?:p(?:ostlenes[\s\xa0]*Gerninger|[Gg]|\.G)|cts)|Gerninger)
)(?:(?=[\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014])|$)///gi
,
osis: ["Rom"]
regexp: ///(^|#{bcv_parser::regexps.pre_book})(
(?:Paulus['’][\s\xa0]*Brev[\s\xa0]*til[\s\xa0]*Romerne|Rom(?:erbrevet|erne)?)
)(?:(?=[\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014])|$)///gi
,
osis: ["2Cor"]
regexp: ///(^|[^0-9A-Za-zªµºÀ-ÖØ-öø-ɏḀ-ỿⱠ-ⱿꜢ-ꞈꞋ-ꞎꞐ-ꞓꞠ-Ɦꟸ-ꟿ])(
(?:(?:Anden|2\.?)[\s\xa0]*Korinterne)|(?:2(?:[\s\xa0]*Korinth?erbrev|Cor|\.[\s\xa0]*Korinth?erbrev)|Ande(?:n[\s\xa0]*Korinth?|t[\s\xa0]*Korinth)erbrev|(?:Anden|2\.?)[\s\xa0]*Kor|Paulus['’][\s\xa0]*Andet[\s\xa0]*Brev[\s\xa0]*til[\s\xa0]*Korintherne)
)(?:(?=[\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014])|$)///gi
,
osis: ["1Cor"]
regexp: ///(^|[^0-9A-Za-zªµºÀ-ÖØ-öø-ɏḀ-ỿⱠ-ⱿꜢ-ꞈꞋ-ꞎꞐ-ꞓꞠ-Ɦꟸ-ꟿ])(
(?:(?:F\xF8rste|1\.?)[\s\xa0]*Korinterne)|(?:1(?:[\s\xa0]*Korinth?erbrev|Cor|\.[\s\xa0]*Korinth?erbrev)|F\xF8rste[\s\xa0]*Korinth?erbrev|(?:F\xF8rste|1\.?)[\s\xa0]*Kor|Paulus['’][\s\xa0]*(?:F\xF8rste|1\.?)[\s\xa0]*Brev[\s\xa0]*til[\s\xa0]*Korintherne)
)(?:(?=[\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014])|$)///gi
,
osis: ["Gal"]
regexp: ///(^|#{bcv_parser::regexps.pre_book})(
(?:Gal(?:aterbrevet|aterne)?|Brevet[\s\xa0]*til[\s\xa0]*Galaterne|Paulus['’][\s\xa0]*Brev[\s\xa0]*til[\s\xa0]*Galaterne)
)(?:(?=[\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014])|$)///gi
,
osis: ["Eph"]
regexp: ///(^|#{bcv_parser::regexps.pre_book})(
(?:Efeserne)|(?:Paulus['’][\s\xa0]*Brev[\s\xa0]*til[\s\xa0]*Efeserne|E(?:feserbrevet|ph|f))
)(?:(?=[\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014])|$)///gi
,
osis: ["Phil"]
regexp: ///(^|#{bcv_parser::regexps.pre_book})(
(?:P(?:aulus['’][\s\xa0]*Brev[\s\xa0]*til[\s\xa0]*Filipperne|hil)|Fil(?:ipperbrevet|ipperne)?)
)(?:(?=[\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014])|$)///gi
,
osis: ["Col"]
regexp: ///(^|#{bcv_parser::regexps.pre_book})(
(?:Paulus['’][\s\xa0]*Brev[\s\xa0]*til[\s\xa0]*Kolossenserne|Kolossenser(?:brevet|n)|Col|Kol)
)(?:(?=[\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014])|$)///gi
,
osis: ["2Thess"]
regexp: ///(^|[^0-9A-Za-zªµºÀ-ÖØ-öø-ɏḀ-ỿⱠ-ⱿꜢ-ꞈꞋ-ꞎꞐ-ꞓꞠ-Ɦꟸ-ꟿ])(
(?:2(?:[\s\xa0]*Thessalonikerbrev|Thess|\.[\s\xa0]*Thessalonikerbrev)|Ande[nt][\s\xa0]*Thessalonikerbrev|(?:Anden|2\.?)[\s\xa0]*Thess|(?:Anden|2\.?)[\s\xa0]*Tessalonikerne|Paulus['’][\s\xa0]*Andet[\s\xa0]*Brev[\s\xa0]*til[\s\xa0]*Thessalonikerne)
)(?:(?=[\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014])|$)///gi
,
osis: ["1Thess"]
regexp: ///(^|[^0-9A-Za-zªµºÀ-ÖØ-öø-ɏḀ-ỿⱠ-ⱿꜢ-ꞈꞋ-ꞎꞐ-ꞓꞠ-Ɦꟸ-ꟿ])(
(?:1(?:[\s\xa0]*Thessalonikerbrev|Thess|\.[\s\xa0]*Thessalonikerbrev)|F\xF8rste[\s\xa0]*Thessalonikerbrev|(?:F\xF8rste|1\.?)[\s\xa0]*Thess|(?:F\xF8rste|1\.?)[\s\xa0]*Tessalonikerne|Paulus['’][\s\xa0]*(?:F\xF8rste|1\.?)[\s\xa0]*Brev[\s\xa0]*til[\s\xa0]*Thessalonikerne)
)(?:(?=[\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014])|$)///gi
,
osis: ["2Tim"]
regexp: ///(^|[^0-9A-Za-zªµºÀ-ÖØ-öø-ɏḀ-ỿⱠ-ⱿꜢ-ꞈꞋ-ꞎꞐ-ꞓꞠ-Ɦꟸ-ꟿ])(
(?:2(?:[\s\xa0]*Timoth?eusbrev|Tim|\.[\s\xa0]*Timoth?eusbrev)|Ande(?:n[\s\xa0]*Timoth?|t[\s\xa0]*Timoth)eusbrev|2(?:\.[\s\xa0]*Tim(?:oteus)?|[\s\xa0]*Tim(?:oteus)?)|Anden[\s\xa0]*Tim(?:oteus)?|Paulus['’][\s\xa0]*Andet[\s\xa0]*Brev[\s\xa0]*til[\s\xa0]*Timotheus)
)(?:(?=[\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014])|$)///gi
,
osis: ["1Tim"]
regexp: ///(^|[^0-9A-Za-zªµºÀ-ÖØ-öø-ɏḀ-ỿⱠ-ⱿꜢ-ꞈꞋ-ꞎꞐ-ꞓꞠ-Ɦꟸ-ꟿ])(
(?:1(?:[\s\xa0]*Timoth?eusbrev|Tim|\.[\s\xa0]*Timoth?eusbrev)|F\xF8rste[\s\xa0]*Timoth?eusbrev|1(?:\.[\s\xa0]*Tim(?:oteus)?|[\s\xa0]*Tim(?:oteus)?)|F\xF8rste[\s\xa0]*Tim(?:oteus)?|Paulus['’][\s\xa0]*(?:F\xF8rste|1\.?)[\s\xa0]*Brev[\s\xa0]*til[\s\xa0]*Timotheus)
)(?:(?=[\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014])|$)///gi
,
osis: ["Titus"]
regexp: ///(^|#{bcv_parser::regexps.pre_book})(
(?:Paulus['’][\s\xa0]*Brev[\s\xa0]*til[\s\xa0]*Titus|Tit(?:usbrevet|us)?)
)(?:(?=[\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014])|$)///gi
,
osis: ["Phlm"]
regexp: ///(^|#{bcv_parser::regexps.pre_book})(
(?:P(?:aulus['’][\s\xa0]*Brev[\s\xa0]*til[\s\xa0]*Filemon|hlm)|F(?:ilemonbrevet|lm|ilem(?:on)?))
)(?:(?=[\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014])|$)///gi
,
osis: ["Heb"]
regexp: ///(^|#{bcv_parser::regexps.pre_book})(
(?:Hebr\xE6erne)|(?:Brevet[\s\xa0]*til[\s\xa0]*Hebr\xE6erne|Heb(?:r\xE6erbrevet|r)?)
)(?:(?=[\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014])|$)///gi
,
osis: ["Jas"]
regexp: ///(^|#{bcv_parser::regexps.pre_book})(
(?:Ja(?:k(?:ob(?:s(?:brevet|[\s\xa0]*Brev))?)?|s))
)(?:(?=[\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014])|$)///gi
,
osis: ["2Pet"]
regexp: ///(^|[^0-9A-Za-zªµºÀ-ÖØ-öø-ɏḀ-ỿⱠ-ⱿꜢ-ꞈꞋ-ꞎꞐ-ꞓꞠ-Ɦꟸ-ꟿ])(
(?:(?:Anden|2\.?)[\s\xa0]*Petersbrev)|(?:2(?:[\s\xa0]*Peter|Pet|\.[\s\xa0]*Peter)|Anden[\s\xa0]*Peter|(?:Anden|2\.?)[\s\xa0]*Pet|Andet[\s\xa0]*Petersbrev|Peters[\s\xa0]*Andet[\s\xa0]*Brev)
)(?:(?=[\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014])|$)///gi
,
osis: ["1Pet"]
regexp: ///(^|[^0-9A-Za-zªµºÀ-ÖØ-öø-ɏḀ-ỿⱠ-ⱿꜢ-ꞈꞋ-ꞎꞐ-ꞓꞠ-Ɦꟸ-ꟿ])(
(?:(?:F\xF8rste|1\.?)[\s\xa0]*Petersbrev)|(?:1(?:[\s\xa0]*Peter|Pet|\.[\s\xa0]*Peter)|F\xF8rste[\s\xa0]*Peter|(?:F\xF8rste|1\.?)[\s\xa0]*Pet|Peters[\s\xa0]*(?:F\xF8rste|1\.?)[\s\xa0]*Brev)
)(?:(?=[\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014])|$)///gi
,
osis: ["Jude"]
regexp: ///(^|#{bcv_parser::regexps.pre_book})(
(?:Jud(?:as(?:['’][\s\xa0]*Brev|brevet)?|e)?)
)(?:(?=[\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014])|$)///gi
,
osis: ["Tob"]
apocrypha: true
regexp: ///(^|#{bcv_parser::regexps.pre_book})(
(?:Tob(?:it(?:s[\s\xa0]*Bog)?)?)
)(?:(?=[\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014])|$)///gi
,
osis: ["Jdt"]
apocrypha: true
regexp: ///(^|#{bcv_parser::regexps.pre_book})(
(?:J(?:udit(?:s[\s\xa0]*Bog)?|dt))
)(?:(?=[\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014])|$)///gi
,
osis: ["Bar"]
apocrypha: true
regexp: ///(^|#{bcv_parser::regexps.pre_book})(
(?:Bar(?:uk(?:s[\s\xa0]*Bog)?)?)
)(?:(?=[\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014])|$)///gi
,
osis: ["Sus"]
apocrypha: true
regexp: ///(^|#{bcv_parser::regexps.pre_book})(
(?:Sus(?:anna)?)
)(?:(?=[\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014])|$)///gi
,
osis: ["2Macc"]
apocrypha: true
regexp: ///(^|[^0-9A-Za-zªµºÀ-ÖØ-öø-ɏḀ-ỿⱠ-ⱿꜢ-ꞈꞋ-ꞎꞐ-ꞓꞠ-Ɦꟸ-ꟿ])(
(?:2(?:[\s\xa0]*Makk(?:ab\xE6erbog)?|Macc|\.[\s\xa0]*Makk(?:ab\xE6erbog)?)|Anden[\s\xa0]*Makk(?:ab\xE6erbog)?)
)(?:(?=[\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014])|$)///gi
,
osis: ["3Macc"]
apocrypha: true
regexp: ///(^|[^0-9A-Za-zªµºÀ-ÖØ-öø-ɏḀ-ỿⱠ-ⱿꜢ-ꞈꞋ-ꞎꞐ-ꞓꞠ-Ɦꟸ-ꟿ])(
(?:3(?:[\s\xa0]*Makk(?:ab\xE6erbog)?|Macc|\.[\s\xa0]*Makk(?:ab\xE6erbog)?)|Tredje[\s\xa0]*Makk(?:ab\xE6erbog)?)
)(?:(?=[\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014])|$)///gi
,
osis: ["4Macc"]
apocrypha: true
regexp: ///(^|[^0-9A-Za-zªµºÀ-ÖØ-öø-ɏḀ-ỿⱠ-ⱿꜢ-ꞈꞋ-ꞎꞐ-ꞓꞠ-Ɦꟸ-ꟿ])(
(?:4(?:[\s\xa0]*Makk(?:ab\xE6erbog)?|Macc|\.[\s\xa0]*Makk(?:ab\xE6erbog)?)|Fjerde[\s\xa0]*Makk(?:ab\xE6erbog)?)
)(?:(?=[\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014])|$)///gi
,
osis: ["1Macc"]
apocrypha: true
regexp: ///(^|[^0-9A-Za-zªµºÀ-ÖØ-öø-ɏḀ-ỿⱠ-ⱿꜢ-ꞈꞋ-ꞎꞐ-ꞓꞠ-Ɦꟸ-ꟿ])(
(?:1(?:[\s\xa0]*Makk(?:ab\xE6erbog)?|Macc|\.[\s\xa0]*Makk(?:ab\xE6erbog)?)|F\xF8rste[\s\xa0]*Makk(?:ab\xE6erbog)?)
)(?:(?=[\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014])|$)///gi
]
# Short-circuit the look if we know we want all the books.
return books if include_apocrypha is true and case_sensitive is "none"
# Filter out books in the Apocrypha if we don't want them. `Array.map` isn't supported below IE9.
out = []
for book in books
continue if include_apocrypha is false and book.apocrypha? and book.apocrypha is true
if case_sensitive is "books"
book.regexp = new RegExp book.regexp.source, "g"
out.push book
out
# Default to not using the Apocrypha
bcv_parser::regexps.books = bcv_parser::regexps.get_books false, "none"
| 16686 | bcv_parser::regexps.space = "[\\s\\xa0]"
bcv_parser::regexps.escaped_passage = ///
(?:^ | [^\x1f\x1e\dA-Za-zªµºÀ-ÖØ-öø-ɏḀ-ỿⱠ-ⱿꜢ-ꞈꞋ-ꞎꞐ-ꞓꞠ-Ɦꟸ-ꟿ] ) # Beginning of string or not in the middle of a word or immediately following another book. Only count a book if it's part of a sequence: `Matt5John3` is OK, but not `1Matt5John3`
(
# Start inverted book/chapter (cb)
(?:
(?: ch (?: apters? | a?pts?\.? | a?p?s?\.? )? \s*
\d+ \s* (?: [\u2013\u2014\-] | through | thru | to) \s* \d+ \s*
(?: from | of | in ) (?: \s+ the \s+ book \s+ of )?\s* )
| (?: ch (?: apters? | a?pts?\.? | a?p?s?\.? )? \s*
\d+ \s*
(?: from | of | in ) (?: \s+ the \s+ book \s+ of )?\s* )
| (?: \d+ (?: th | nd | st ) \s*
ch (?: apter | a?pt\.? | a?p?\.? )? \s* #no plurals here since it's a single chapter
(?: from | of | in ) (?: \s+ the \s+ book \s+ of )? \s* )
)? # End inverted book/chapter (cb)
\x1f(\d+)(?:/\d+)?\x1f #book
(?:
/\d+\x1f #special Psalm chapters
| [\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014]
| title (?! [a-z] ) #could be followed by a number
| kapitlerne | kapitel | vers | kap | ff | og | jf | - | v
| [a-e] (?! \w ) #a-e allows 1:1a
| $ #or the end of the string
)+
)
///gi
# These are the only valid ways to end a potential passage match. The closing parenthesis allows for fully capturing parentheses surrounding translations (ESV**)**. The last one, `[\d\x1f]` needs not to be +; otherwise `Gen5ff` becomes `\x1f0\x1f5ff`, and `adjust_regexp_end` matches the `\x1f5` and incorrectly dangles the ff.
bcv_parser::regexps.match_end_split = ///
\d \W* title
| \d \W* ff (?: [\s\xa0*]* \.)?
| \d [\s\xa0*]* [a-e] (?! \w )
| \x1e (?: [\s\xa0*]* [)\]\uff09] )? #ff09 is a full-width closing parenthesis
| [\d\x1f]
///gi
bcv_parser::regexps.control = /[\x1e\x1f]/g
bcv_parser::regexps.pre_book = "[^A-Za-zªµºÀ-ÖØ-öø-ɏḀ-ỿⱠ-ⱿꜢ-ꞈꞋ-ꞎꞐ-ꞓꞠ-Ɦꟸ-ꟿ]"
bcv_parser::regexps.first = "(?:Første|1)\\.?#{bcv_parser::regexps.space}*"
bcv_parser::regexps.second = "(?:Anden|2)\\.?#{bcv_parser::regexps.space}*"
bcv_parser::regexps.third = "(?:Tredje|3)\\.?#{bcv_parser::regexps.space}*"
bcv_parser::regexps.range_and = "(?:[&\u2013\u2014-]|(?:og|jf)|-)"
bcv_parser::regexps.range_only = "(?:[\u2013\u2014-]|-)"
# Each book regexp should return two parenthesized objects: an optional preliminary character and the book itself.
bcv_parser::regexps.get_books = (include_apocrypha, case_sensitive) ->
books = [
osis: ["Ps"]
apocrypha: true
extra: "2"
regexp: ///(\b)( # Don't match a preceding \d like usual because we only want to match a valid OSIS, which will never have a preceding digit.
Ps151
# Always follwed by ".1"; the regular Psalms parser can handle `Ps151` on its own.
)(?=\.1)///g # Case-sensitive because we only want to match a valid OSIS.
,
osis: ["Gen"]
regexp: ///(^|[^0-9A-Za-zªµºÀ-ÖØ-öø-ɏḀ-ỿⱠ-ⱿꜢ-ꞈꞋ-ꞎꞐ-ꞓꞠ-Ɦꟸ-ꟿ])(
(?:1[\s\xa0]*Mos(?:ebog)?|Gen(?:esis)?|1\.[\s\xa0]*Mos(?:ebog)?|F\xF8rste[\s\xa0]*Mos(?:ebog)?)
)(?:(?=[\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014])|$)///gi
,
osis: ["Exod"]
regexp: ///(^|[^0-9A-Za-zªµºÀ-ÖØ-öø-ɏḀ-ỿⱠ-ⱿꜢ-ꞈꞋ-ꞎꞐ-ꞓꞠ-Ɦꟸ-ꟿ])(
(?:2[\s\xa0]*Mos(?:ebog)?|Exod(?:us)?|2\.[\s\xa0]*Mos(?:ebog)?|Anden[\s\xa0]*Mos(?:ebog)?)
)(?:(?=[\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014])|$)///gi
,
osis: ["Bel"]
apocrypha: true
regexp: ///(^|#{bcv_parser::regexps.pre_book})(
(?:Bel(?:[\s\xa0]*og[\s\xa0]*Dragen)?)
)(?:(?=[\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014])|$)///gi
,
osis: ["Lev"]
regexp: ///(^|[^0-9A-Za-zªµºÀ-ÖØ-öø-ɏḀ-ỿⱠ-ⱿꜢ-ꞈꞋ-ꞎꞐ-ꞓꞠ-Ɦꟸ-ꟿ])(
(?:3[\s\xa0]*Mos(?:ebog)?|Lev(?:iticus)?|3\.[\s\xa0]*Mos(?:ebog)?|Tredje[\s\xa0]*Mos(?:ebog)?)
)(?:(?=[\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014])|$)///gi
,
osis: ["Num"]
regexp: ///(^|[^0-9A-Za-zªµºÀ-ÖØ-öø-ɏḀ-ỿⱠ-ⱿꜢ-ꞈꞋ-ꞎꞐ-ꞓꞠ-Ɦꟸ-ꟿ])(
(?:4[\s\xa0]*Mos(?:ebog)?|Num(?:eri)?|4\.[\s\xa0]*Mos(?:ebog)?|Fjerde[\s\xa0]*Mos(?:ebog)?)
)(?:(?=[\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014])|$)///gi
,
osis: ["Sir"]
apocrypha: true
regexp: ///(^|#{bcv_parser::regexps.pre_book})(
(?:Sir(?:ak(?:s[\s\xa0]*Bog)?)?)
)(?:(?=[\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014])|$)///gi
,
osis: ["Wis"]
apocrypha: true
regexp: ///(^|#{bcv_parser::regexps.pre_book})(
(?:Visdommen(?:s[\s\xa0]*Bog)?|Wis)
)(?:(?=[\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014])|$)///gi
,
osis: ["Lam"]
regexp: ///(^|#{bcv_parser::regexps.pre_book})(
(?:Klag(?:es(?:angene)?)?|Lam)
)(?:(?=[\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014])|$)///gi
,
osis: ["EpJer"]
apocrypha: true
regexp: ///(^|#{bcv_parser::regexps.pre_book})(
(?:Jeremias['’][\s\xa0]*Brev|EpJer)
)(?:(?=[\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014])|$)///gi
,
osis: ["Rev"]
regexp: ///(^|#{bcv_parser::regexps.pre_book})(
(?:(?:A(?:benbaringsbo|abenbarin)|\xC5benbaringsbo)gen|[A\xC5]benbaringen|Rev|Apokalypsen|[A\xC5]b|Joh(?:annes(?:['’][\s\xa0]*[A\xC5]benbaring|apokalypsen)|s(?:\.[\s\xa0]*[A\xC5]|[\s\xa0]*[A\xC5])benbaring))
)(?:(?=[\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014])|$)///gi
,
osis: ["PrMan"]
apocrypha: true
regexp: ///(^|#{bcv_parser::regexps.pre_book})(
(?:(?:Manasses[\s\xa0]*B\xF8|PrMa)n)
)(?:(?=[\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014])|$)///gi
,
osis: ["Deut"]
regexp: ///(^|[^0-9A-Za-zªµºÀ-ÖØ-öø-ɏḀ-ỿⱠ-ⱿꜢ-ꞈꞋ-ꞎꞐ-ꞓꞠ-Ɦꟸ-ꟿ])(
(?:(?:Femte|5\.?)[\s\xa0]*Mosebog|(?:Femte|5\.?)[\s\xa0]*Mos|Deut(?:eronomium)?)
)(?:(?=[\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014])|$)///gi
,
osis: ["Josh"]
regexp: ///(^|#{bcv_parser::regexps.pre_book})(
(?:Jos(?:va(?:bog(?:en)?|s[\s\xa0]*Bog)|ua|h)?)
)(?:(?=[\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014])|$)///gi
,
osis: ["Judg"]
regexp: ///(^|#{bcv_parser::regexps.pre_book})(
(?:Dom(?:mer(?:bogen)?)?|Judg)
)(?:(?=[\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014])|$)///gi
,
osis: ["Ruth"]
regexp: ///(^|#{bcv_parser::regexps.pre_book})(
(?:Rut(?:h(?:s[\s\xa0]*Bog)?)?)
)(?:(?=[\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014])|$)///gi
,
osis: ["1Esd"]
apocrypha: true
regexp: ///(^|[^0-9A-Za-zªµºÀ-ÖØ-öø-ɏḀ-ỿⱠ-ⱿꜢ-ꞈꞋ-ꞎꞐ-ꞓꞠ-Ɦꟸ-ꟿ])(
(?:[13][\s\xa0]*Esdrasbog|1Esd|[13]\.[\s\xa0]*Esdrasbog|Tredje[\s\xa0]*Esdrasbog|F\xF8rste[\s\xa0]*Esdrasbog)
)(?:(?=[\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014])|$)///gi
,
osis: ["2Esd"]
apocrypha: true
regexp: ///(^|[^0-9A-Za-zªµºÀ-ÖØ-öø-ɏḀ-ỿⱠ-ⱿꜢ-ꞈꞋ-ꞎꞐ-ꞓꞠ-Ɦꟸ-ꟿ])(
(?:(?:Anden|[24]\.)[\s\xa0]*Esdrasbog|[24][\s\xa0]*Esdrasbog|2Esd|Fjerde[\s\xa0]*Esdrasbog)
)(?:(?=[\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014])|$)///gi
,
osis: ["Isa"]
regexp: ///(^|#{bcv_parser::regexps.pre_book})(
(?:Es(?:ajas(?:['’][\s\xa0]*Bog)?)?|(?:Jesai|Is)a)
)(?:(?=[\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014])|$)///gi
,
osis: ["2Sam"]
regexp: ///(^|[^0-9A-Za-zªµºÀ-ÖØ-öø-ɏḀ-ỿⱠ-ⱿꜢ-ꞈꞋ-ꞎꞐ-ꞓꞠ-Ɦꟸ-ꟿ])(
(?:2(?:[\s\xa0]*(?:Sam(?:uelsbog|uel)?|Kongerigernes[\s\xa0]*Bog)|Sam|\.[\s\xa0]*(?:Sam(?:uelsbog|uel)?|Kongerigernes[\s\xa0]*Bog))|Anden[\s\xa0]*(?:Sam(?:uelsbog|uel)?|Kongerigernes[\s\xa0]*Bog))
)(?:(?=[\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014])|$)///gi
,
osis: ["1Sam"]
regexp: ///(^|[^0-9A-Za-zªµºÀ-ÖØ-öø-ɏḀ-ỿⱠ-ⱿꜢ-ꞈꞋ-ꞎꞐ-ꞓꞠ-Ɦꟸ-ꟿ])(
(?:1(?:[\s\xa0]*(?:Sam(?:uelsbog|uel)?|Kongerigernes[\s\xa0]*Bog)|Sam|\.[\s\xa0]*(?:Sam(?:uelsbog|uel)?|Kongerigernes[\s\xa0]*Bog))|F\xF8rste[\s\xa0]*(?:Sam(?:uelsbog|uel)?|Kongerigernes[\s\xa0]*Bog))
)(?:(?=[\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014])|$)///gi
,
osis: ["2Kgs"]
regexp: ///(^|[^0-9A-Za-zªµºÀ-ÖØ-öø-ɏḀ-ỿⱠ-ⱿꜢ-ꞈꞋ-ꞎꞐ-ꞓꞠ-Ɦꟸ-ꟿ])(
(?:(?:Anden|2\.?)[\s\xa0]*Kongebog)|(?:(?:Anden|2\.?)[\s\xa0]*Kong|2Kgs|4[\s\xa0]*Kongerigernes[\s\xa0]*Bog|4\.[\s\xa0]*Kongerigernes[\s\xa0]*Bog|Fjerde[\s\xa0]*Kongerigernes[\s\xa0]*Bog)
)(?:(?=[\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014])|$)///gi
,
osis: ["1Kgs"]
regexp: ///(^|[^0-9A-Za-zªµºÀ-ÖØ-öø-ɏḀ-ỿⱠ-ⱿꜢ-ꞈꞋ-ꞎꞐ-ꞓꞠ-Ɦꟸ-ꟿ])(
(?:(?:F\xF8rste|1\.?)[\s\xa0]*Kongebog)|(?:(?:F\xF8rste|1\.?)[\s\xa0]*Kong|1Kgs|3[\s\xa0]*Kongerigernes[\s\xa0]*Bog|3\.[\s\xa0]*Kongerigernes[\s\xa0]*Bog|Tredje[\s\xa0]*Kongerigernes[\s\xa0]*Bog)
)(?:(?=[\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014])|$)///gi
,
osis: ["2Chr"]
regexp: ///(^|[^0-9A-Za-zªµºÀ-ÖØ-öø-ɏḀ-ỿⱠ-ⱿꜢ-ꞈꞋ-ꞎꞐ-ꞓꞠ-Ɦꟸ-ꟿ])(
(?:2(?:[\s\xa0]*Kr(?:\xF8n(?:ikebog)?|on)|Chr|\.[\s\xa0]*Kr(?:\xF8n(?:ikebog)?|on))|Anden[\s\xa0]*Kr(?:\xF8n(?:ikebog)?|on))
)(?:(?=[\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014])|$)///gi
,
osis: ["1Chr"]
regexp: ///(^|[^0-9A-Za-zªµºÀ-ÖØ-öø-ɏḀ-ỿⱠ-ⱿꜢ-ꞈꞋ-ꞎꞐ-ꞓꞠ-Ɦꟸ-ꟿ])(
(?:1(?:[\s\xa0]*Kr(?:\xF8n(?:ikebog)?|on)|Chr|\.[\s\xa0]*Kr(?:\xF8n(?:ikebog)?|on))|F\xF8rste[\s\xa0]*Kr(?:\xF8n(?:ikebog)?|on))
)(?:(?=[\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014])|$)///gi
,
osis: ["Ezra"]
regexp: ///(^|#{bcv_parser::regexps.pre_book})(
(?:Ezra(?:s[\s\xa0]*Bog)?)
)(?:(?=[\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014])|$)///gi
,
osis: ["Neh"]
regexp: ///(^|#{bcv_parser::regexps.pre_book})(
(?:Neh(?:emias(?:’[\s\xa0]*Bog)?)?)
)(?:(?=[\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014])|$)///gi
,
osis: ["GkEsth"]
apocrypha: true
regexp: ///(^|#{bcv_parser::regexps.pre_book})(
(?:GkEsth)
)(?:(?=[\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014])|$)///gi
,
osis: ["Esth"]
regexp: ///(^|#{bcv_parser::regexps.pre_book})(
(?:Est(?:er(?:s[\s\xa0]*Bog)?|h)?)
)(?:(?=[\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014])|$)///gi
,
osis: ["Job"]
regexp: ///(^|#{bcv_parser::regexps.pre_book})(
(?:Job(?:s[\s\xa0]*Bog)?|Hiob)
)(?:(?=[\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014])|$)///gi
,
osis: ["Ps"]
regexp: ///(^|#{bcv_parser::regexps.pre_book})(
(?:S(?:alme(?:rne(?:s[\s\xa0]*Bog)?)?|l)|Ps)
)(?:(?=[\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014])|$)///gi
,
osis: ["PrAzar"]
apocrypha: true
regexp: ///(^|#{bcv_parser::regexps.pre_book})(
(?:Azarjas[\s\xa0]*[Bb]\xF8n|PrAzar)
)(?:(?=[\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014])|$)///gi
,
osis: ["Prov"]
regexp: ///(^|#{bcv_parser::regexps.pre_book})(
(?:Ordsp(?:rogene(?:s[\s\xa0]*Bog)?)?|Prov)
)(?:(?=[\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014])|$)///gi
,
osis: ["Eccl"]
regexp: ///(^|#{bcv_parser::regexps.pre_book})(
(?:Pr(?:\xE6d(?:ikeren(?:s[\s\xa0]*Bog)?)?|ad)|Eccl)
)(?:(?=[\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014])|$)///gi
,
osis: ["SgThree"]
apocrypha: true
regexp: ///(^|#{bcv_parser::regexps.pre_book})(
(?:De[\s\xa0]*(?:Tre[\s\xa0]*M\xE6nds[\s\xa0]*L|tre[\s\xa0]*m\xE6nds[\s\xa0]*l)ovsang|SgThree)
)(?:(?=[\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014])|$)///gi
,
osis: ["Song"]
regexp: ///(^|#{bcv_parser::regexps.pre_book})(
(?:H(?:\xF8jsangen|ojs|\xF8js)|S(?:alomons[\s\xa0]*H\xF8jsa|o)ng)
)(?:(?=[\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014])|$)///gi
,
osis: ["Jer"]
regexp: ///(^|#{bcv_parser::regexps.pre_book})(
(?:Jer(?:emias(?:['’][\s\xa0]*Bog)?)?)
)(?:(?=[\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014])|$)///gi
,
osis: ["Ezek"]
regexp: ///(^|#{bcv_parser::regexps.pre_book})(
(?:Ez(?:ek(?:iel(?:s’?[\s\xa0]*Bog)?)?)?|Hezechiel)
)(?:(?=[\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014])|$)///gi
,
osis: ["Dan"]
regexp: ///(^|#{bcv_parser::regexps.pre_book})(
(?:Dan(?:iel(?:s[\s\xa0]*Bog)?)?)
)(?:(?=[\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014])|$)///gi
,
osis: ["Hos"]
regexp: ///(^|#{bcv_parser::regexps.pre_book})(
(?:Hos(?:eas(?:’[\s\xa0]*Bog)?)?)
)(?:(?=[\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014])|$)///gi
,
osis: ["Joel"]
regexp: ///(^|#{bcv_parser::regexps.pre_book})(
(?:Joel(?:s[\s\xa0]*Bog)?)
)(?:(?=[\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014])|$)///gi
,
osis: ["Amos"]
regexp: ///(^|#{bcv_parser::regexps.pre_book})(
(?:Am(?:os(?:['’][\s\xa0]*Bog)?)?)
)(?:(?=[\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014])|$)///gi
,
osis: ["Obad"]
regexp: ///(^|#{bcv_parser::regexps.pre_book})(
(?:Obad(?:ias(?:['’][\s\xa0]*Bog)?)?)
)(?:(?=[\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014])|$)///gi
,
osis: ["Jonah"]
regexp: ///(^|#{bcv_parser::regexps.pre_book})(
(?:Jon(?:a(?:s(?:['’][\s\xa0]*Bog)?|h))?)
)(?:(?=[\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014])|$)///gi
,
osis: ["Mic"]
regexp: ///(^|#{bcv_parser::regexps.pre_book})(
(?:Mi(?:ka(?:s(?:[\s\xa0]*Bog)?)?|c))
)(?:(?=[\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014])|$)///gi
,
osis: ["Nah"]
regexp: ///(^|#{bcv_parser::regexps.pre_book})(
(?:Nah(?:um(?:s[\s\xa0]*Bog)?)?)
)(?:(?=[\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014])|$)///gi
,
osis: ["Hab"]
regexp: ///(^|#{bcv_parser::regexps.pre_book})(
(?:Hab(?:akkuk(?:s[\s\xa0]*Bog)?)?)
)(?:(?=[\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014])|$)///gi
,
osis: ["Zeph"]
regexp: ///(^|#{bcv_parser::regexps.pre_book})(
(?:Zefanias’[\s\xa0]*Bog)|(?:Sef(?:anias['’][\s\xa0]*Bog)?|Ze(?:fanias|ph|f))
)(?:(?=[\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014])|$)///gi
,
osis: ["Hag"]
regexp: ///(^|#{bcv_parser::regexps.pre_book})(
(?:Hag(?:g(?:aj(?:s[\s\xa0]*Bog)?)?)?)
)(?:(?=[\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014])|$)///gi
,
osis: ["Zech"]
regexp: ///(^|#{bcv_parser::regexps.pre_book})(
(?:Z(?:ak(?:arias(?:['’][\s\xa0]*Bog)?)?|ech))
)(?:(?=[\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014])|$)///gi
,
osis: ["Mal"]
regexp: ///(^|#{bcv_parser::regexps.pre_book})(
(?:Mal(?:akias(?:’[\s\xa0]*Bog)?)?)
)(?:(?=[\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014])|$)///gi
,
osis: ["Matt"]
regexp: ///(^|#{bcv_parser::regexps.pre_book})(
(?:Matt(?:h\xE6us(?:evangeliet)?|\xE6usevangeliet)?)
)(?:(?=[\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014])|$)///gi
,
osis: ["Mark"]
regexp: ///(^|#{bcv_parser::regexps.pre_book})(
(?:Mark(?:us(?:evangeliet)?)?)
)(?:(?=[\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014])|$)///gi
,
osis: ["Luke"]
regexp: ///(^|#{bcv_parser::regexps.pre_book})(
(?:L(?:uk(?:as(?:evangeliet)?|e)?|k))
)(?:(?=[\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014])|$)///gi
,
osis: ["1John"]
regexp: ///(^|[^0-9A-Za-zªµºÀ-ÖØ-öø-ɏḀ-ỿⱠ-ⱿꜢ-ꞈꞋ-ꞎꞐ-ꞓꞠ-Ɦꟸ-ꟿ])(
(?:Johannes['’][\s\xa0]*(?:F\xF8rste|1\.)[\s\xa0]*Brev|Johannes['’][\s\xa0]*1[\s\xa0]*Brev|1John|1[\s\xa0]*Joh(?:annes(?:['’][\s\xa0]*B|b)rev)?|1\.[\s\xa0]*Joh(?:annes(?:['’][\s\xa0]*B|b)rev)?|F\xF8rste[\s\xa0]*Joh(?:annes(?:['’][\s\xa0]*B|b)rev)?)|(?:(?:F\xF8rste|1\.?)[\s\xa0]*Johannes)
)(?:(?=[\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014])|$)///gi
,
osis: ["<NAME> <NAME>"]
regexp: ///(^|[^0-9A-Za-zªµºÀ-ÖØ-öø-ɏḀ-ỿⱠ-ⱿꜢ-ꞈꞋ-ꞎꞐ-ꞓꞠ-Ɦꟸ-ꟿ])(
(?:<NAME>John)|(?:2[\s\xa0]*Joh(?:annes(?:['’][\s\xa0]*Brev|brev)?)?|Johannes['’][\s\xa0]*Andet[\s\xa0]*Brev|2\.[\s\xa0]*Joh(?:annes(?:['’][\s\xa0]*Brev|brev)?)?|Ande(?:n[\s\xa0]*Joh(?:annes(?:['’][\s\xa0]*Brev|brev)?)?|t[\s\xa0]*Johannesbrev))
)(?:(?=[\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014])|$)///gi
,
osis: ["<NAME> <NAME>"]
regexp: ///(^|[^0-9A-Za-zªµºÀ-ÖØ-öø-ɏḀ-ỿⱠ-ⱿꜢ-ꞈꞋ-ꞎꞐ-ꞓꞠ-Ɦꟸ-ꟿ])(
(?:<NAME>John)|(?:(?:3(?:\.[\s\xa0]*Johannes['’]|[\s\xa0]*Johannes['’])|Tredje[\s\xa0]*Johannes['’])[\s\xa0]*Brev|(?:Tredje|3\.?)[\s\xa0]*Johannesbrev|(?:Tredje|3\.?)[\s\xa0]*Joh|Johannes['’][\s\xa0]*(?:Tredje|3\.?)[\s\xa0]*Brev)|(?:(?:Tredje|3\.?)[\s\xa0]*Johannes)
)(?:(?=[\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014])|$)///gi
,
osis: ["John"]
regexp: ///(^|#{bcv_parser::regexps.pre_book})(
(?:Joh(?:annes(?:evangeliet)?|n)?)
)(?:(?=[\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014])|$)///gi
,
osis: ["Acts"]
regexp: ///(^|#{bcv_parser::regexps.pre_book})(
(?:A(?:p(?:ostlenes[\s\xa0]*Gerninger|[Gg]|\.G)|cts)|Gerninger)
)(?:(?=[\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014])|$)///gi
,
osis: ["Rom"]
regexp: ///(^|#{bcv_parser::regexps.pre_book})(
(?:Paulus['’][\s\xa0]*Brev[\s\xa0]*til[\s\xa0]*Romerne|Rom(?:erbrevet|erne)?)
)(?:(?=[\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014])|$)///gi
,
osis: ["2Cor"]
regexp: ///(^|[^0-9A-Za-zªµºÀ-ÖØ-öø-ɏḀ-ỿⱠ-ⱿꜢ-ꞈꞋ-ꞎꞐ-ꞓꞠ-Ɦꟸ-ꟿ])(
(?:(?:Anden|2\.?)[\s\xa0]*Korinterne)|(?:2(?:[\s\xa0]*Korinth?erbrev|Cor|\.[\s\xa0]*Korinth?erbrev)|Ande(?:n[\s\xa0]*Korinth?|t[\s\xa0]*Korinth)erbrev|(?:Anden|2\.?)[\s\xa0]*Kor|Paulus['’][\s\xa0]*Andet[\s\xa0]*Brev[\s\xa0]*til[\s\xa0]*Korintherne)
)(?:(?=[\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014])|$)///gi
,
osis: ["1Cor"]
regexp: ///(^|[^0-9A-Za-zªµºÀ-ÖØ-öø-ɏḀ-ỿⱠ-ⱿꜢ-ꞈꞋ-ꞎꞐ-ꞓꞠ-Ɦꟸ-ꟿ])(
(?:(?:F\xF8rste|1\.?)[\s\xa0]*Korinterne)|(?:1(?:[\s\xa0]*Korinth?erbrev|Cor|\.[\s\xa0]*Korinth?erbrev)|F\xF8rste[\s\xa0]*Korinth?erbrev|(?:F\xF8rste|1\.?)[\s\xa0]*Kor|Paulus['’][\s\xa0]*(?:F\xF8rste|1\.?)[\s\xa0]*Brev[\s\xa0]*til[\s\xa0]*Korintherne)
)(?:(?=[\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014])|$)///gi
,
osis: ["Gal"]
regexp: ///(^|#{bcv_parser::regexps.pre_book})(
(?:Gal(?:aterbrevet|aterne)?|Brevet[\s\xa0]*til[\s\xa0]*Galaterne|Paulus['’][\s\xa0]*Brev[\s\xa0]*til[\s\xa0]*Galaterne)
)(?:(?=[\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014])|$)///gi
,
osis: ["Eph"]
regexp: ///(^|#{bcv_parser::regexps.pre_book})(
(?:Efeserne)|(?:Paulus['’][\s\xa0]*Brev[\s\xa0]*til[\s\xa0]*Efeserne|E(?:feserbrevet|ph|f))
)(?:(?=[\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014])|$)///gi
,
osis: ["Phil"]
regexp: ///(^|#{bcv_parser::regexps.pre_book})(
(?:P(?:aulus['’][\s\xa0]*Brev[\s\xa0]*til[\s\xa0]*Filipperne|hil)|Fil(?:ipperbrevet|ipperne)?)
)(?:(?=[\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014])|$)///gi
,
osis: ["Col"]
regexp: ///(^|#{bcv_parser::regexps.pre_book})(
(?:Paulus['’][\s\xa0]*Brev[\s\xa0]*til[\s\xa0]*Kolossenserne|Kolossenser(?:brevet|n)|Col|Kol)
)(?:(?=[\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014])|$)///gi
,
osis: ["2Thess"]
regexp: ///(^|[^0-9A-Za-zªµºÀ-ÖØ-öø-ɏḀ-ỿⱠ-ⱿꜢ-ꞈꞋ-ꞎꞐ-ꞓꞠ-Ɦꟸ-ꟿ])(
(?:2(?:[\s\xa0]*Thessalonikerbrev|Thess|\.[\s\xa0]*Thessalonikerbrev)|Ande[nt][\s\xa0]*Thessalonikerbrev|(?:Anden|2\.?)[\s\xa0]*Thess|(?:Anden|2\.?)[\s\xa0]*Tessalonikerne|Paulus['’][\s\xa0]*Andet[\s\xa0]*Brev[\s\xa0]*til[\s\xa0]*Thessalonikerne)
)(?:(?=[\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014])|$)///gi
,
osis: ["1Thess"]
regexp: ///(^|[^0-9A-Za-zªµºÀ-ÖØ-öø-ɏḀ-ỿⱠ-ⱿꜢ-ꞈꞋ-ꞎꞐ-ꞓꞠ-Ɦꟸ-ꟿ])(
(?:1(?:[\s\xa0]*Thessalonikerbrev|Thess|\.[\s\xa0]*Thessalonikerbrev)|F\xF8rste[\s\xa0]*Thessalonikerbrev|(?:F\xF8rste|1\.?)[\s\xa0]*Thess|(?:F\xF8rste|1\.?)[\s\xa0]*Tessalonikerne|Paulus['’][\s\xa0]*(?:F\xF8rste|1\.?)[\s\xa0]*Brev[\s\xa0]*til[\s\xa0]*Thessalonikerne)
)(?:(?=[\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014])|$)///gi
,
osis: ["2Tim"]
regexp: ///(^|[^0-9A-Za-zªµºÀ-ÖØ-öø-ɏḀ-ỿⱠ-ⱿꜢ-ꞈꞋ-ꞎꞐ-ꞓꞠ-Ɦꟸ-ꟿ])(
(?:2(?:[\s\xa0]*Timoth?eusbrev|Tim|\.[\s\xa0]*Timoth?eusbrev)|Ande(?:n[\s\xa0]*Timoth?|t[\s\xa0]*Timoth)eusbrev|2(?:\.[\s\xa0]*Tim(?:oteus)?|[\s\xa0]*Tim(?:oteus)?)|Anden[\s\xa0]*Tim(?:oteus)?|Paulus['’][\s\xa0]*Andet[\s\xa0]*Brev[\s\xa0]*til[\s\xa0]*Timotheus)
)(?:(?=[\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014])|$)///gi
,
osis: ["1Tim"]
regexp: ///(^|[^0-9A-Za-zªµºÀ-ÖØ-öø-ɏḀ-ỿⱠ-ⱿꜢ-ꞈꞋ-ꞎꞐ-ꞓꞠ-Ɦꟸ-ꟿ])(
(?:1(?:[\s\xa0]*Timoth?eusbrev|Tim|\.[\s\xa0]*Timoth?eusbrev)|F\xF8rste[\s\xa0]*Timoth?eusbrev|1(?:\.[\s\xa0]*Tim(?:oteus)?|[\s\xa0]*Tim(?:oteus)?)|F\xF8rste[\s\xa0]*Tim(?:oteus)?|Paulus['’][\s\xa0]*(?:F\xF8rste|1\.?)[\s\xa0]*Brev[\s\xa0]*til[\s\xa0]*Timotheus)
)(?:(?=[\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014])|$)///gi
,
osis: ["Titus"]
regexp: ///(^|#{bcv_parser::regexps.pre_book})(
(?:Paulus['’][\s\xa0]*Brev[\s\xa0]*til[\s\xa0]*Titus|Tit(?:usbrevet|us)?)
)(?:(?=[\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014])|$)///gi
,
osis: ["Phlm"]
regexp: ///(^|#{bcv_parser::regexps.pre_book})(
(?:P(?:aulus['’][\s\xa0]*Brev[\s\xa0]*til[\s\xa0]*Filemon|hlm)|F(?:ilemonbrevet|lm|ilem(?:on)?))
)(?:(?=[\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014])|$)///gi
,
osis: ["Heb"]
regexp: ///(^|#{bcv_parser::regexps.pre_book})(
(?:Hebr\xE6erne)|(?:Brevet[\s\xa0]*til[\s\xa0]*Hebr\xE6erne|Heb(?:r\xE6erbrevet|r)?)
)(?:(?=[\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014])|$)///gi
,
osis: ["Jas"]
regexp: ///(^|#{bcv_parser::regexps.pre_book})(
(?:Ja(?:k(?:ob(?:s(?:brevet|[\s\xa0]*Brev))?)?|s))
)(?:(?=[\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014])|$)///gi
,
osis: ["2Pet"]
regexp: ///(^|[^0-9A-Za-zªµºÀ-ÖØ-öø-ɏḀ-ỿⱠ-ⱿꜢ-ꞈꞋ-ꞎꞐ-ꞓꞠ-Ɦꟸ-ꟿ])(
(?:(?:Anden|2\.?)[\s\xa0]*Petersbrev)|(?:2(?:[\s\xa0]*Peter|Pet|\.[\s\xa0]*Peter)|Anden[\s\xa0]*Peter|(?:Anden|2\.?)[\s\xa0]*Pet|Andet[\s\xa0]*Petersbrev|Peters[\s\xa0]*Andet[\s\xa0]*Brev)
)(?:(?=[\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014])|$)///gi
,
osis: ["1Pet"]
regexp: ///(^|[^0-9A-Za-zªµºÀ-ÖØ-öø-ɏḀ-ỿⱠ-ⱿꜢ-ꞈꞋ-ꞎꞐ-ꞓꞠ-Ɦꟸ-ꟿ])(
(?:(?:F\xF8rste|1\.?)[\s\xa0]*Petersbrev)|(?:1(?:[\s\xa0]*Peter|Pet|\.[\s\xa0]*Peter)|F\xF8rste[\s\xa0]*Peter|(?:F\xF8rste|1\.?)[\s\xa0]*Pet|Peters[\s\xa0]*(?:F\xF8rste|1\.?)[\s\xa0]*Brev)
)(?:(?=[\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014])|$)///gi
,
osis: ["Jude"]
regexp: ///(^|#{bcv_parser::regexps.pre_book})(
(?:Jud(?:as(?:['’][\s\xa0]*Brev|brevet)?|e)?)
)(?:(?=[\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014])|$)///gi
,
osis: ["Tob"]
apocrypha: true
regexp: ///(^|#{bcv_parser::regexps.pre_book})(
(?:Tob(?:it(?:s[\s\xa0]*Bog)?)?)
)(?:(?=[\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014])|$)///gi
,
osis: ["Jdt"]
apocrypha: true
regexp: ///(^|#{bcv_parser::regexps.pre_book})(
(?:J(?:udit(?:s[\s\xa0]*Bog)?|dt))
)(?:(?=[\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014])|$)///gi
,
osis: ["Bar"]
apocrypha: true
regexp: ///(^|#{bcv_parser::regexps.pre_book})(
(?:Bar(?:uk(?:s[\s\xa0]*Bog)?)?)
)(?:(?=[\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014])|$)///gi
,
osis: ["Sus"]
apocrypha: true
regexp: ///(^|#{bcv_parser::regexps.pre_book})(
(?:Sus(?:anna)?)
)(?:(?=[\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014])|$)///gi
,
osis: ["2Macc"]
apocrypha: true
regexp: ///(^|[^0-9A-Za-zªµºÀ-ÖØ-öø-ɏḀ-ỿⱠ-ⱿꜢ-ꞈꞋ-ꞎꞐ-ꞓꞠ-Ɦꟸ-ꟿ])(
(?:2(?:[\s\xa0]*Makk(?:ab\xE6erbog)?|Macc|\.[\s\xa0]*Makk(?:ab\xE6erbog)?)|Anden[\s\xa0]*Makk(?:ab\xE6erbog)?)
)(?:(?=[\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014])|$)///gi
,
osis: ["3Macc"]
apocrypha: true
regexp: ///(^|[^0-9A-Za-zªµºÀ-ÖØ-öø-ɏḀ-ỿⱠ-ⱿꜢ-ꞈꞋ-ꞎꞐ-ꞓꞠ-Ɦꟸ-ꟿ])(
(?:3(?:[\s\xa0]*Makk(?:ab\xE6erbog)?|Macc|\.[\s\xa0]*Makk(?:ab\xE6erbog)?)|Tredje[\s\xa0]*Makk(?:ab\xE6erbog)?)
)(?:(?=[\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014])|$)///gi
,
osis: ["4Macc"]
apocrypha: true
regexp: ///(^|[^0-9A-Za-zªµºÀ-ÖØ-öø-ɏḀ-ỿⱠ-ⱿꜢ-ꞈꞋ-ꞎꞐ-ꞓꞠ-Ɦꟸ-ꟿ])(
(?:4(?:[\s\xa0]*Makk(?:ab\xE6erbog)?|Macc|\.[\s\xa0]*Makk(?:ab\xE6erbog)?)|Fjerde[\s\xa0]*Makk(?:ab\xE6erbog)?)
)(?:(?=[\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014])|$)///gi
,
osis: ["1Macc"]
apocrypha: true
regexp: ///(^|[^0-9A-Za-zªµºÀ-ÖØ-öø-ɏḀ-ỿⱠ-ⱿꜢ-ꞈꞋ-ꞎꞐ-ꞓꞠ-Ɦꟸ-ꟿ])(
(?:1(?:[\s\xa0]*Makk(?:ab\xE6erbog)?|Macc|\.[\s\xa0]*Makk(?:ab\xE6erbog)?)|F\xF8rste[\s\xa0]*Makk(?:ab\xE6erbog)?)
)(?:(?=[\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014])|$)///gi
]
# Short-circuit the look if we know we want all the books.
return books if include_apocrypha is true and case_sensitive is "none"
# Filter out books in the Apocrypha if we don't want them. `Array.map` isn't supported below IE9.
out = []
for book in books
continue if include_apocrypha is false and book.apocrypha? and book.apocrypha is true
if case_sensitive is "books"
book.regexp = new RegExp book.regexp.source, "g"
out.push book
out
# Default to not using the Apocrypha
bcv_parser::regexps.books = bcv_parser::regexps.get_books false, "none"
| true | bcv_parser::regexps.space = "[\\s\\xa0]"
bcv_parser::regexps.escaped_passage = ///
(?:^ | [^\x1f\x1e\dA-Za-zªµºÀ-ÖØ-öø-ɏḀ-ỿⱠ-ⱿꜢ-ꞈꞋ-ꞎꞐ-ꞓꞠ-Ɦꟸ-ꟿ] ) # Beginning of string or not in the middle of a word or immediately following another book. Only count a book if it's part of a sequence: `Matt5John3` is OK, but not `1Matt5John3`
(
# Start inverted book/chapter (cb)
(?:
(?: ch (?: apters? | a?pts?\.? | a?p?s?\.? )? \s*
\d+ \s* (?: [\u2013\u2014\-] | through | thru | to) \s* \d+ \s*
(?: from | of | in ) (?: \s+ the \s+ book \s+ of )?\s* )
| (?: ch (?: apters? | a?pts?\.? | a?p?s?\.? )? \s*
\d+ \s*
(?: from | of | in ) (?: \s+ the \s+ book \s+ of )?\s* )
| (?: \d+ (?: th | nd | st ) \s*
ch (?: apter | a?pt\.? | a?p?\.? )? \s* #no plurals here since it's a single chapter
(?: from | of | in ) (?: \s+ the \s+ book \s+ of )? \s* )
)? # End inverted book/chapter (cb)
\x1f(\d+)(?:/\d+)?\x1f #book
(?:
/\d+\x1f #special Psalm chapters
| [\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014]
| title (?! [a-z] ) #could be followed by a number
| kapitlerne | kapitel | vers | kap | ff | og | jf | - | v
| [a-e] (?! \w ) #a-e allows 1:1a
| $ #or the end of the string
)+
)
///gi
# These are the only valid ways to end a potential passage match. The closing parenthesis allows for fully capturing parentheses surrounding translations (ESV**)**. The last one, `[\d\x1f]` needs not to be +; otherwise `Gen5ff` becomes `\x1f0\x1f5ff`, and `adjust_regexp_end` matches the `\x1f5` and incorrectly dangles the ff.
bcv_parser::regexps.match_end_split = ///
\d \W* title
| \d \W* ff (?: [\s\xa0*]* \.)?
| \d [\s\xa0*]* [a-e] (?! \w )
| \x1e (?: [\s\xa0*]* [)\]\uff09] )? #ff09 is a full-width closing parenthesis
| [\d\x1f]
///gi
bcv_parser::regexps.control = /[\x1e\x1f]/g
bcv_parser::regexps.pre_book = "[^A-Za-zªµºÀ-ÖØ-öø-ɏḀ-ỿⱠ-ⱿꜢ-ꞈꞋ-ꞎꞐ-ꞓꞠ-Ɦꟸ-ꟿ]"
bcv_parser::regexps.first = "(?:Første|1)\\.?#{bcv_parser::regexps.space}*"
bcv_parser::regexps.second = "(?:Anden|2)\\.?#{bcv_parser::regexps.space}*"
bcv_parser::regexps.third = "(?:Tredje|3)\\.?#{bcv_parser::regexps.space}*"
bcv_parser::regexps.range_and = "(?:[&\u2013\u2014-]|(?:og|jf)|-)"
bcv_parser::regexps.range_only = "(?:[\u2013\u2014-]|-)"
# Each book regexp should return two parenthesized objects: an optional preliminary character and the book itself.
bcv_parser::regexps.get_books = (include_apocrypha, case_sensitive) ->
books = [
osis: ["Ps"]
apocrypha: true
extra: "2"
regexp: ///(\b)( # Don't match a preceding \d like usual because we only want to match a valid OSIS, which will never have a preceding digit.
Ps151
# Always follwed by ".1"; the regular Psalms parser can handle `Ps151` on its own.
)(?=\.1)///g # Case-sensitive because we only want to match a valid OSIS.
,
osis: ["Gen"]
regexp: ///(^|[^0-9A-Za-zªµºÀ-ÖØ-öø-ɏḀ-ỿⱠ-ⱿꜢ-ꞈꞋ-ꞎꞐ-ꞓꞠ-Ɦꟸ-ꟿ])(
(?:1[\s\xa0]*Mos(?:ebog)?|Gen(?:esis)?|1\.[\s\xa0]*Mos(?:ebog)?|F\xF8rste[\s\xa0]*Mos(?:ebog)?)
)(?:(?=[\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014])|$)///gi
,
osis: ["Exod"]
regexp: ///(^|[^0-9A-Za-zªµºÀ-ÖØ-öø-ɏḀ-ỿⱠ-ⱿꜢ-ꞈꞋ-ꞎꞐ-ꞓꞠ-Ɦꟸ-ꟿ])(
(?:2[\s\xa0]*Mos(?:ebog)?|Exod(?:us)?|2\.[\s\xa0]*Mos(?:ebog)?|Anden[\s\xa0]*Mos(?:ebog)?)
)(?:(?=[\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014])|$)///gi
,
osis: ["Bel"]
apocrypha: true
regexp: ///(^|#{bcv_parser::regexps.pre_book})(
(?:Bel(?:[\s\xa0]*og[\s\xa0]*Dragen)?)
)(?:(?=[\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014])|$)///gi
,
osis: ["Lev"]
regexp: ///(^|[^0-9A-Za-zªµºÀ-ÖØ-öø-ɏḀ-ỿⱠ-ⱿꜢ-ꞈꞋ-ꞎꞐ-ꞓꞠ-Ɦꟸ-ꟿ])(
(?:3[\s\xa0]*Mos(?:ebog)?|Lev(?:iticus)?|3\.[\s\xa0]*Mos(?:ebog)?|Tredje[\s\xa0]*Mos(?:ebog)?)
)(?:(?=[\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014])|$)///gi
,
osis: ["Num"]
regexp: ///(^|[^0-9A-Za-zªµºÀ-ÖØ-öø-ɏḀ-ỿⱠ-ⱿꜢ-ꞈꞋ-ꞎꞐ-ꞓꞠ-Ɦꟸ-ꟿ])(
(?:4[\s\xa0]*Mos(?:ebog)?|Num(?:eri)?|4\.[\s\xa0]*Mos(?:ebog)?|Fjerde[\s\xa0]*Mos(?:ebog)?)
)(?:(?=[\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014])|$)///gi
,
osis: ["Sir"]
apocrypha: true
regexp: ///(^|#{bcv_parser::regexps.pre_book})(
(?:Sir(?:ak(?:s[\s\xa0]*Bog)?)?)
)(?:(?=[\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014])|$)///gi
,
osis: ["Wis"]
apocrypha: true
regexp: ///(^|#{bcv_parser::regexps.pre_book})(
(?:Visdommen(?:s[\s\xa0]*Bog)?|Wis)
)(?:(?=[\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014])|$)///gi
,
osis: ["Lam"]
regexp: ///(^|#{bcv_parser::regexps.pre_book})(
(?:Klag(?:es(?:angene)?)?|Lam)
)(?:(?=[\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014])|$)///gi
,
osis: ["EpJer"]
apocrypha: true
regexp: ///(^|#{bcv_parser::regexps.pre_book})(
(?:Jeremias['’][\s\xa0]*Brev|EpJer)
)(?:(?=[\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014])|$)///gi
,
osis: ["Rev"]
regexp: ///(^|#{bcv_parser::regexps.pre_book})(
(?:(?:A(?:benbaringsbo|abenbarin)|\xC5benbaringsbo)gen|[A\xC5]benbaringen|Rev|Apokalypsen|[A\xC5]b|Joh(?:annes(?:['’][\s\xa0]*[A\xC5]benbaring|apokalypsen)|s(?:\.[\s\xa0]*[A\xC5]|[\s\xa0]*[A\xC5])benbaring))
)(?:(?=[\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014])|$)///gi
,
osis: ["PrMan"]
apocrypha: true
regexp: ///(^|#{bcv_parser::regexps.pre_book})(
(?:(?:Manasses[\s\xa0]*B\xF8|PrMa)n)
)(?:(?=[\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014])|$)///gi
,
osis: ["Deut"]
regexp: ///(^|[^0-9A-Za-zªµºÀ-ÖØ-öø-ɏḀ-ỿⱠ-ⱿꜢ-ꞈꞋ-ꞎꞐ-ꞓꞠ-Ɦꟸ-ꟿ])(
(?:(?:Femte|5\.?)[\s\xa0]*Mosebog|(?:Femte|5\.?)[\s\xa0]*Mos|Deut(?:eronomium)?)
)(?:(?=[\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014])|$)///gi
,
osis: ["Josh"]
regexp: ///(^|#{bcv_parser::regexps.pre_book})(
(?:Jos(?:va(?:bog(?:en)?|s[\s\xa0]*Bog)|ua|h)?)
)(?:(?=[\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014])|$)///gi
,
osis: ["Judg"]
regexp: ///(^|#{bcv_parser::regexps.pre_book})(
(?:Dom(?:mer(?:bogen)?)?|Judg)
)(?:(?=[\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014])|$)///gi
,
osis: ["Ruth"]
regexp: ///(^|#{bcv_parser::regexps.pre_book})(
(?:Rut(?:h(?:s[\s\xa0]*Bog)?)?)
)(?:(?=[\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014])|$)///gi
,
osis: ["1Esd"]
apocrypha: true
regexp: ///(^|[^0-9A-Za-zªµºÀ-ÖØ-öø-ɏḀ-ỿⱠ-ⱿꜢ-ꞈꞋ-ꞎꞐ-ꞓꞠ-Ɦꟸ-ꟿ])(
(?:[13][\s\xa0]*Esdrasbog|1Esd|[13]\.[\s\xa0]*Esdrasbog|Tredje[\s\xa0]*Esdrasbog|F\xF8rste[\s\xa0]*Esdrasbog)
)(?:(?=[\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014])|$)///gi
,
osis: ["2Esd"]
apocrypha: true
regexp: ///(^|[^0-9A-Za-zªµºÀ-ÖØ-öø-ɏḀ-ỿⱠ-ⱿꜢ-ꞈꞋ-ꞎꞐ-ꞓꞠ-Ɦꟸ-ꟿ])(
(?:(?:Anden|[24]\.)[\s\xa0]*Esdrasbog|[24][\s\xa0]*Esdrasbog|2Esd|Fjerde[\s\xa0]*Esdrasbog)
)(?:(?=[\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014])|$)///gi
,
osis: ["Isa"]
regexp: ///(^|#{bcv_parser::regexps.pre_book})(
(?:Es(?:ajas(?:['’][\s\xa0]*Bog)?)?|(?:Jesai|Is)a)
)(?:(?=[\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014])|$)///gi
,
osis: ["2Sam"]
regexp: ///(^|[^0-9A-Za-zªµºÀ-ÖØ-öø-ɏḀ-ỿⱠ-ⱿꜢ-ꞈꞋ-ꞎꞐ-ꞓꞠ-Ɦꟸ-ꟿ])(
(?:2(?:[\s\xa0]*(?:Sam(?:uelsbog|uel)?|Kongerigernes[\s\xa0]*Bog)|Sam|\.[\s\xa0]*(?:Sam(?:uelsbog|uel)?|Kongerigernes[\s\xa0]*Bog))|Anden[\s\xa0]*(?:Sam(?:uelsbog|uel)?|Kongerigernes[\s\xa0]*Bog))
)(?:(?=[\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014])|$)///gi
,
osis: ["1Sam"]
regexp: ///(^|[^0-9A-Za-zªµºÀ-ÖØ-öø-ɏḀ-ỿⱠ-ⱿꜢ-ꞈꞋ-ꞎꞐ-ꞓꞠ-Ɦꟸ-ꟿ])(
(?:1(?:[\s\xa0]*(?:Sam(?:uelsbog|uel)?|Kongerigernes[\s\xa0]*Bog)|Sam|\.[\s\xa0]*(?:Sam(?:uelsbog|uel)?|Kongerigernes[\s\xa0]*Bog))|F\xF8rste[\s\xa0]*(?:Sam(?:uelsbog|uel)?|Kongerigernes[\s\xa0]*Bog))
)(?:(?=[\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014])|$)///gi
,
osis: ["2Kgs"]
regexp: ///(^|[^0-9A-Za-zªµºÀ-ÖØ-öø-ɏḀ-ỿⱠ-ⱿꜢ-ꞈꞋ-ꞎꞐ-ꞓꞠ-Ɦꟸ-ꟿ])(
(?:(?:Anden|2\.?)[\s\xa0]*Kongebog)|(?:(?:Anden|2\.?)[\s\xa0]*Kong|2Kgs|4[\s\xa0]*Kongerigernes[\s\xa0]*Bog|4\.[\s\xa0]*Kongerigernes[\s\xa0]*Bog|Fjerde[\s\xa0]*Kongerigernes[\s\xa0]*Bog)
)(?:(?=[\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014])|$)///gi
,
osis: ["1Kgs"]
regexp: ///(^|[^0-9A-Za-zªµºÀ-ÖØ-öø-ɏḀ-ỿⱠ-ⱿꜢ-ꞈꞋ-ꞎꞐ-ꞓꞠ-Ɦꟸ-ꟿ])(
(?:(?:F\xF8rste|1\.?)[\s\xa0]*Kongebog)|(?:(?:F\xF8rste|1\.?)[\s\xa0]*Kong|1Kgs|3[\s\xa0]*Kongerigernes[\s\xa0]*Bog|3\.[\s\xa0]*Kongerigernes[\s\xa0]*Bog|Tredje[\s\xa0]*Kongerigernes[\s\xa0]*Bog)
)(?:(?=[\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014])|$)///gi
,
osis: ["2Chr"]
regexp: ///(^|[^0-9A-Za-zªµºÀ-ÖØ-öø-ɏḀ-ỿⱠ-ⱿꜢ-ꞈꞋ-ꞎꞐ-ꞓꞠ-Ɦꟸ-ꟿ])(
(?:2(?:[\s\xa0]*Kr(?:\xF8n(?:ikebog)?|on)|Chr|\.[\s\xa0]*Kr(?:\xF8n(?:ikebog)?|on))|Anden[\s\xa0]*Kr(?:\xF8n(?:ikebog)?|on))
)(?:(?=[\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014])|$)///gi
,
osis: ["1Chr"]
regexp: ///(^|[^0-9A-Za-zªµºÀ-ÖØ-öø-ɏḀ-ỿⱠ-ⱿꜢ-ꞈꞋ-ꞎꞐ-ꞓꞠ-Ɦꟸ-ꟿ])(
(?:1(?:[\s\xa0]*Kr(?:\xF8n(?:ikebog)?|on)|Chr|\.[\s\xa0]*Kr(?:\xF8n(?:ikebog)?|on))|F\xF8rste[\s\xa0]*Kr(?:\xF8n(?:ikebog)?|on))
)(?:(?=[\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014])|$)///gi
,
osis: ["Ezra"]
regexp: ///(^|#{bcv_parser::regexps.pre_book})(
(?:Ezra(?:s[\s\xa0]*Bog)?)
)(?:(?=[\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014])|$)///gi
,
osis: ["Neh"]
regexp: ///(^|#{bcv_parser::regexps.pre_book})(
(?:Neh(?:emias(?:’[\s\xa0]*Bog)?)?)
)(?:(?=[\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014])|$)///gi
,
osis: ["GkEsth"]
apocrypha: true
regexp: ///(^|#{bcv_parser::regexps.pre_book})(
(?:GkEsth)
)(?:(?=[\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014])|$)///gi
,
osis: ["Esth"]
regexp: ///(^|#{bcv_parser::regexps.pre_book})(
(?:Est(?:er(?:s[\s\xa0]*Bog)?|h)?)
)(?:(?=[\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014])|$)///gi
,
osis: ["Job"]
regexp: ///(^|#{bcv_parser::regexps.pre_book})(
(?:Job(?:s[\s\xa0]*Bog)?|Hiob)
)(?:(?=[\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014])|$)///gi
,
osis: ["Ps"]
regexp: ///(^|#{bcv_parser::regexps.pre_book})(
(?:S(?:alme(?:rne(?:s[\s\xa0]*Bog)?)?|l)|Ps)
)(?:(?=[\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014])|$)///gi
,
osis: ["PrAzar"]
apocrypha: true
regexp: ///(^|#{bcv_parser::regexps.pre_book})(
(?:Azarjas[\s\xa0]*[Bb]\xF8n|PrAzar)
)(?:(?=[\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014])|$)///gi
,
osis: ["Prov"]
regexp: ///(^|#{bcv_parser::regexps.pre_book})(
(?:Ordsp(?:rogene(?:s[\s\xa0]*Bog)?)?|Prov)
)(?:(?=[\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014])|$)///gi
,
osis: ["Eccl"]
regexp: ///(^|#{bcv_parser::regexps.pre_book})(
(?:Pr(?:\xE6d(?:ikeren(?:s[\s\xa0]*Bog)?)?|ad)|Eccl)
)(?:(?=[\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014])|$)///gi
,
osis: ["SgThree"]
apocrypha: true
regexp: ///(^|#{bcv_parser::regexps.pre_book})(
(?:De[\s\xa0]*(?:Tre[\s\xa0]*M\xE6nds[\s\xa0]*L|tre[\s\xa0]*m\xE6nds[\s\xa0]*l)ovsang|SgThree)
)(?:(?=[\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014])|$)///gi
,
osis: ["Song"]
regexp: ///(^|#{bcv_parser::regexps.pre_book})(
(?:H(?:\xF8jsangen|ojs|\xF8js)|S(?:alomons[\s\xa0]*H\xF8jsa|o)ng)
)(?:(?=[\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014])|$)///gi
,
osis: ["Jer"]
regexp: ///(^|#{bcv_parser::regexps.pre_book})(
(?:Jer(?:emias(?:['’][\s\xa0]*Bog)?)?)
)(?:(?=[\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014])|$)///gi
,
osis: ["Ezek"]
regexp: ///(^|#{bcv_parser::regexps.pre_book})(
(?:Ez(?:ek(?:iel(?:s’?[\s\xa0]*Bog)?)?)?|Hezechiel)
)(?:(?=[\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014])|$)///gi
,
osis: ["Dan"]
regexp: ///(^|#{bcv_parser::regexps.pre_book})(
(?:Dan(?:iel(?:s[\s\xa0]*Bog)?)?)
)(?:(?=[\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014])|$)///gi
,
osis: ["Hos"]
regexp: ///(^|#{bcv_parser::regexps.pre_book})(
(?:Hos(?:eas(?:’[\s\xa0]*Bog)?)?)
)(?:(?=[\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014])|$)///gi
,
osis: ["Joel"]
regexp: ///(^|#{bcv_parser::regexps.pre_book})(
(?:Joel(?:s[\s\xa0]*Bog)?)
)(?:(?=[\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014])|$)///gi
,
osis: ["Amos"]
regexp: ///(^|#{bcv_parser::regexps.pre_book})(
(?:Am(?:os(?:['’][\s\xa0]*Bog)?)?)
)(?:(?=[\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014])|$)///gi
,
osis: ["Obad"]
regexp: ///(^|#{bcv_parser::regexps.pre_book})(
(?:Obad(?:ias(?:['’][\s\xa0]*Bog)?)?)
)(?:(?=[\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014])|$)///gi
,
osis: ["Jonah"]
regexp: ///(^|#{bcv_parser::regexps.pre_book})(
(?:Jon(?:a(?:s(?:['’][\s\xa0]*Bog)?|h))?)
)(?:(?=[\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014])|$)///gi
,
osis: ["Mic"]
regexp: ///(^|#{bcv_parser::regexps.pre_book})(
(?:Mi(?:ka(?:s(?:[\s\xa0]*Bog)?)?|c))
)(?:(?=[\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014])|$)///gi
,
osis: ["Nah"]
regexp: ///(^|#{bcv_parser::regexps.pre_book})(
(?:Nah(?:um(?:s[\s\xa0]*Bog)?)?)
)(?:(?=[\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014])|$)///gi
,
osis: ["Hab"]
regexp: ///(^|#{bcv_parser::regexps.pre_book})(
(?:Hab(?:akkuk(?:s[\s\xa0]*Bog)?)?)
)(?:(?=[\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014])|$)///gi
,
osis: ["Zeph"]
regexp: ///(^|#{bcv_parser::regexps.pre_book})(
(?:Zefanias’[\s\xa0]*Bog)|(?:Sef(?:anias['’][\s\xa0]*Bog)?|Ze(?:fanias|ph|f))
)(?:(?=[\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014])|$)///gi
,
osis: ["Hag"]
regexp: ///(^|#{bcv_parser::regexps.pre_book})(
(?:Hag(?:g(?:aj(?:s[\s\xa0]*Bog)?)?)?)
)(?:(?=[\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014])|$)///gi
,
osis: ["Zech"]
regexp: ///(^|#{bcv_parser::regexps.pre_book})(
(?:Z(?:ak(?:arias(?:['’][\s\xa0]*Bog)?)?|ech))
)(?:(?=[\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014])|$)///gi
,
osis: ["Mal"]
regexp: ///(^|#{bcv_parser::regexps.pre_book})(
(?:Mal(?:akias(?:’[\s\xa0]*Bog)?)?)
)(?:(?=[\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014])|$)///gi
,
osis: ["Matt"]
regexp: ///(^|#{bcv_parser::regexps.pre_book})(
(?:Matt(?:h\xE6us(?:evangeliet)?|\xE6usevangeliet)?)
)(?:(?=[\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014])|$)///gi
,
osis: ["Mark"]
regexp: ///(^|#{bcv_parser::regexps.pre_book})(
(?:Mark(?:us(?:evangeliet)?)?)
)(?:(?=[\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014])|$)///gi
,
osis: ["Luke"]
regexp: ///(^|#{bcv_parser::regexps.pre_book})(
(?:L(?:uk(?:as(?:evangeliet)?|e)?|k))
)(?:(?=[\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014])|$)///gi
,
osis: ["1John"]
regexp: ///(^|[^0-9A-Za-zªµºÀ-ÖØ-öø-ɏḀ-ỿⱠ-ⱿꜢ-ꞈꞋ-ꞎꞐ-ꞓꞠ-Ɦꟸ-ꟿ])(
(?:Johannes['’][\s\xa0]*(?:F\xF8rste|1\.)[\s\xa0]*Brev|Johannes['’][\s\xa0]*1[\s\xa0]*Brev|1John|1[\s\xa0]*Joh(?:annes(?:['’][\s\xa0]*B|b)rev)?|1\.[\s\xa0]*Joh(?:annes(?:['’][\s\xa0]*B|b)rev)?|F\xF8rste[\s\xa0]*Joh(?:annes(?:['’][\s\xa0]*B|b)rev)?)|(?:(?:F\xF8rste|1\.?)[\s\xa0]*Johannes)
)(?:(?=[\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014])|$)///gi
,
osis: ["PI:NAME:<NAME>END_PI PI:NAME:<NAME>END_PI"]
regexp: ///(^|[^0-9A-Za-zªµºÀ-ÖØ-öø-ɏḀ-ỿⱠ-ⱿꜢ-ꞈꞋ-ꞎꞐ-ꞓꞠ-Ɦꟸ-ꟿ])(
(?:PI:NAME:<NAME>END_PIJohn)|(?:2[\s\xa0]*Joh(?:annes(?:['’][\s\xa0]*Brev|brev)?)?|Johannes['’][\s\xa0]*Andet[\s\xa0]*Brev|2\.[\s\xa0]*Joh(?:annes(?:['’][\s\xa0]*Brev|brev)?)?|Ande(?:n[\s\xa0]*Joh(?:annes(?:['’][\s\xa0]*Brev|brev)?)?|t[\s\xa0]*Johannesbrev))
)(?:(?=[\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014])|$)///gi
,
osis: ["PI:NAME:<NAME>END_PI PI:NAME:<NAME>END_PI"]
regexp: ///(^|[^0-9A-Za-zªµºÀ-ÖØ-öø-ɏḀ-ỿⱠ-ⱿꜢ-ꞈꞋ-ꞎꞐ-ꞓꞠ-Ɦꟸ-ꟿ])(
(?:PI:NAME:<NAME>END_PIJohn)|(?:(?:3(?:\.[\s\xa0]*Johannes['’]|[\s\xa0]*Johannes['’])|Tredje[\s\xa0]*Johannes['’])[\s\xa0]*Brev|(?:Tredje|3\.?)[\s\xa0]*Johannesbrev|(?:Tredje|3\.?)[\s\xa0]*Joh|Johannes['’][\s\xa0]*(?:Tredje|3\.?)[\s\xa0]*Brev)|(?:(?:Tredje|3\.?)[\s\xa0]*Johannes)
)(?:(?=[\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014])|$)///gi
,
osis: ["John"]
regexp: ///(^|#{bcv_parser::regexps.pre_book})(
(?:Joh(?:annes(?:evangeliet)?|n)?)
)(?:(?=[\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014])|$)///gi
,
osis: ["Acts"]
regexp: ///(^|#{bcv_parser::regexps.pre_book})(
(?:A(?:p(?:ostlenes[\s\xa0]*Gerninger|[Gg]|\.G)|cts)|Gerninger)
)(?:(?=[\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014])|$)///gi
,
osis: ["Rom"]
regexp: ///(^|#{bcv_parser::regexps.pre_book})(
(?:Paulus['’][\s\xa0]*Brev[\s\xa0]*til[\s\xa0]*Romerne|Rom(?:erbrevet|erne)?)
)(?:(?=[\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014])|$)///gi
,
osis: ["2Cor"]
regexp: ///(^|[^0-9A-Za-zªµºÀ-ÖØ-öø-ɏḀ-ỿⱠ-ⱿꜢ-ꞈꞋ-ꞎꞐ-ꞓꞠ-Ɦꟸ-ꟿ])(
(?:(?:Anden|2\.?)[\s\xa0]*Korinterne)|(?:2(?:[\s\xa0]*Korinth?erbrev|Cor|\.[\s\xa0]*Korinth?erbrev)|Ande(?:n[\s\xa0]*Korinth?|t[\s\xa0]*Korinth)erbrev|(?:Anden|2\.?)[\s\xa0]*Kor|Paulus['’][\s\xa0]*Andet[\s\xa0]*Brev[\s\xa0]*til[\s\xa0]*Korintherne)
)(?:(?=[\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014])|$)///gi
,
osis: ["1Cor"]
regexp: ///(^|[^0-9A-Za-zªµºÀ-ÖØ-öø-ɏḀ-ỿⱠ-ⱿꜢ-ꞈꞋ-ꞎꞐ-ꞓꞠ-Ɦꟸ-ꟿ])(
(?:(?:F\xF8rste|1\.?)[\s\xa0]*Korinterne)|(?:1(?:[\s\xa0]*Korinth?erbrev|Cor|\.[\s\xa0]*Korinth?erbrev)|F\xF8rste[\s\xa0]*Korinth?erbrev|(?:F\xF8rste|1\.?)[\s\xa0]*Kor|Paulus['’][\s\xa0]*(?:F\xF8rste|1\.?)[\s\xa0]*Brev[\s\xa0]*til[\s\xa0]*Korintherne)
)(?:(?=[\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014])|$)///gi
,
osis: ["Gal"]
regexp: ///(^|#{bcv_parser::regexps.pre_book})(
(?:Gal(?:aterbrevet|aterne)?|Brevet[\s\xa0]*til[\s\xa0]*Galaterne|Paulus['’][\s\xa0]*Brev[\s\xa0]*til[\s\xa0]*Galaterne)
)(?:(?=[\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014])|$)///gi
,
osis: ["Eph"]
regexp: ///(^|#{bcv_parser::regexps.pre_book})(
(?:Efeserne)|(?:Paulus['’][\s\xa0]*Brev[\s\xa0]*til[\s\xa0]*Efeserne|E(?:feserbrevet|ph|f))
)(?:(?=[\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014])|$)///gi
,
osis: ["Phil"]
regexp: ///(^|#{bcv_parser::regexps.pre_book})(
(?:P(?:aulus['’][\s\xa0]*Brev[\s\xa0]*til[\s\xa0]*Filipperne|hil)|Fil(?:ipperbrevet|ipperne)?)
)(?:(?=[\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014])|$)///gi
,
osis: ["Col"]
regexp: ///(^|#{bcv_parser::regexps.pre_book})(
(?:Paulus['’][\s\xa0]*Brev[\s\xa0]*til[\s\xa0]*Kolossenserne|Kolossenser(?:brevet|n)|Col|Kol)
)(?:(?=[\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014])|$)///gi
,
osis: ["2Thess"]
regexp: ///(^|[^0-9A-Za-zªµºÀ-ÖØ-öø-ɏḀ-ỿⱠ-ⱿꜢ-ꞈꞋ-ꞎꞐ-ꞓꞠ-Ɦꟸ-ꟿ])(
(?:2(?:[\s\xa0]*Thessalonikerbrev|Thess|\.[\s\xa0]*Thessalonikerbrev)|Ande[nt][\s\xa0]*Thessalonikerbrev|(?:Anden|2\.?)[\s\xa0]*Thess|(?:Anden|2\.?)[\s\xa0]*Tessalonikerne|Paulus['’][\s\xa0]*Andet[\s\xa0]*Brev[\s\xa0]*til[\s\xa0]*Thessalonikerne)
)(?:(?=[\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014])|$)///gi
,
osis: ["1Thess"]
regexp: ///(^|[^0-9A-Za-zªµºÀ-ÖØ-öø-ɏḀ-ỿⱠ-ⱿꜢ-ꞈꞋ-ꞎꞐ-ꞓꞠ-Ɦꟸ-ꟿ])(
(?:1(?:[\s\xa0]*Thessalonikerbrev|Thess|\.[\s\xa0]*Thessalonikerbrev)|F\xF8rste[\s\xa0]*Thessalonikerbrev|(?:F\xF8rste|1\.?)[\s\xa0]*Thess|(?:F\xF8rste|1\.?)[\s\xa0]*Tessalonikerne|Paulus['’][\s\xa0]*(?:F\xF8rste|1\.?)[\s\xa0]*Brev[\s\xa0]*til[\s\xa0]*Thessalonikerne)
)(?:(?=[\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014])|$)///gi
,
osis: ["2Tim"]
regexp: ///(^|[^0-9A-Za-zªµºÀ-ÖØ-öø-ɏḀ-ỿⱠ-ⱿꜢ-ꞈꞋ-ꞎꞐ-ꞓꞠ-Ɦꟸ-ꟿ])(
(?:2(?:[\s\xa0]*Timoth?eusbrev|Tim|\.[\s\xa0]*Timoth?eusbrev)|Ande(?:n[\s\xa0]*Timoth?|t[\s\xa0]*Timoth)eusbrev|2(?:\.[\s\xa0]*Tim(?:oteus)?|[\s\xa0]*Tim(?:oteus)?)|Anden[\s\xa0]*Tim(?:oteus)?|Paulus['’][\s\xa0]*Andet[\s\xa0]*Brev[\s\xa0]*til[\s\xa0]*Timotheus)
)(?:(?=[\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014])|$)///gi
,
osis: ["1Tim"]
regexp: ///(^|[^0-9A-Za-zªµºÀ-ÖØ-öø-ɏḀ-ỿⱠ-ⱿꜢ-ꞈꞋ-ꞎꞐ-ꞓꞠ-Ɦꟸ-ꟿ])(
(?:1(?:[\s\xa0]*Timoth?eusbrev|Tim|\.[\s\xa0]*Timoth?eusbrev)|F\xF8rste[\s\xa0]*Timoth?eusbrev|1(?:\.[\s\xa0]*Tim(?:oteus)?|[\s\xa0]*Tim(?:oteus)?)|F\xF8rste[\s\xa0]*Tim(?:oteus)?|Paulus['’][\s\xa0]*(?:F\xF8rste|1\.?)[\s\xa0]*Brev[\s\xa0]*til[\s\xa0]*Timotheus)
)(?:(?=[\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014])|$)///gi
,
osis: ["Titus"]
regexp: ///(^|#{bcv_parser::regexps.pre_book})(
(?:Paulus['’][\s\xa0]*Brev[\s\xa0]*til[\s\xa0]*Titus|Tit(?:usbrevet|us)?)
)(?:(?=[\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014])|$)///gi
,
osis: ["Phlm"]
regexp: ///(^|#{bcv_parser::regexps.pre_book})(
(?:P(?:aulus['’][\s\xa0]*Brev[\s\xa0]*til[\s\xa0]*Filemon|hlm)|F(?:ilemonbrevet|lm|ilem(?:on)?))
)(?:(?=[\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014])|$)///gi
,
osis: ["Heb"]
regexp: ///(^|#{bcv_parser::regexps.pre_book})(
(?:Hebr\xE6erne)|(?:Brevet[\s\xa0]*til[\s\xa0]*Hebr\xE6erne|Heb(?:r\xE6erbrevet|r)?)
)(?:(?=[\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014])|$)///gi
,
osis: ["Jas"]
regexp: ///(^|#{bcv_parser::regexps.pre_book})(
(?:Ja(?:k(?:ob(?:s(?:brevet|[\s\xa0]*Brev))?)?|s))
)(?:(?=[\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014])|$)///gi
,
osis: ["2Pet"]
regexp: ///(^|[^0-9A-Za-zªµºÀ-ÖØ-öø-ɏḀ-ỿⱠ-ⱿꜢ-ꞈꞋ-ꞎꞐ-ꞓꞠ-Ɦꟸ-ꟿ])(
(?:(?:Anden|2\.?)[\s\xa0]*Petersbrev)|(?:2(?:[\s\xa0]*Peter|Pet|\.[\s\xa0]*Peter)|Anden[\s\xa0]*Peter|(?:Anden|2\.?)[\s\xa0]*Pet|Andet[\s\xa0]*Petersbrev|Peters[\s\xa0]*Andet[\s\xa0]*Brev)
)(?:(?=[\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014])|$)///gi
,
osis: ["1Pet"]
regexp: ///(^|[^0-9A-Za-zªµºÀ-ÖØ-öø-ɏḀ-ỿⱠ-ⱿꜢ-ꞈꞋ-ꞎꞐ-ꞓꞠ-Ɦꟸ-ꟿ])(
(?:(?:F\xF8rste|1\.?)[\s\xa0]*Petersbrev)|(?:1(?:[\s\xa0]*Peter|Pet|\.[\s\xa0]*Peter)|F\xF8rste[\s\xa0]*Peter|(?:F\xF8rste|1\.?)[\s\xa0]*Pet|Peters[\s\xa0]*(?:F\xF8rste|1\.?)[\s\xa0]*Brev)
)(?:(?=[\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014])|$)///gi
,
osis: ["Jude"]
regexp: ///(^|#{bcv_parser::regexps.pre_book})(
(?:Jud(?:as(?:['’][\s\xa0]*Brev|brevet)?|e)?)
)(?:(?=[\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014])|$)///gi
,
osis: ["Tob"]
apocrypha: true
regexp: ///(^|#{bcv_parser::regexps.pre_book})(
(?:Tob(?:it(?:s[\s\xa0]*Bog)?)?)
)(?:(?=[\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014])|$)///gi
,
osis: ["Jdt"]
apocrypha: true
regexp: ///(^|#{bcv_parser::regexps.pre_book})(
(?:J(?:udit(?:s[\s\xa0]*Bog)?|dt))
)(?:(?=[\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014])|$)///gi
,
osis: ["Bar"]
apocrypha: true
regexp: ///(^|#{bcv_parser::regexps.pre_book})(
(?:Bar(?:uk(?:s[\s\xa0]*Bog)?)?)
)(?:(?=[\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014])|$)///gi
,
osis: ["Sus"]
apocrypha: true
regexp: ///(^|#{bcv_parser::regexps.pre_book})(
(?:Sus(?:anna)?)
)(?:(?=[\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014])|$)///gi
,
osis: ["2Macc"]
apocrypha: true
regexp: ///(^|[^0-9A-Za-zªµºÀ-ÖØ-öø-ɏḀ-ỿⱠ-ⱿꜢ-ꞈꞋ-ꞎꞐ-ꞓꞠ-Ɦꟸ-ꟿ])(
(?:2(?:[\s\xa0]*Makk(?:ab\xE6erbog)?|Macc|\.[\s\xa0]*Makk(?:ab\xE6erbog)?)|Anden[\s\xa0]*Makk(?:ab\xE6erbog)?)
)(?:(?=[\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014])|$)///gi
,
osis: ["3Macc"]
apocrypha: true
regexp: ///(^|[^0-9A-Za-zªµºÀ-ÖØ-öø-ɏḀ-ỿⱠ-ⱿꜢ-ꞈꞋ-ꞎꞐ-ꞓꞠ-Ɦꟸ-ꟿ])(
(?:3(?:[\s\xa0]*Makk(?:ab\xE6erbog)?|Macc|\.[\s\xa0]*Makk(?:ab\xE6erbog)?)|Tredje[\s\xa0]*Makk(?:ab\xE6erbog)?)
)(?:(?=[\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014])|$)///gi
,
osis: ["4Macc"]
apocrypha: true
regexp: ///(^|[^0-9A-Za-zªµºÀ-ÖØ-öø-ɏḀ-ỿⱠ-ⱿꜢ-ꞈꞋ-ꞎꞐ-ꞓꞠ-Ɦꟸ-ꟿ])(
(?:4(?:[\s\xa0]*Makk(?:ab\xE6erbog)?|Macc|\.[\s\xa0]*Makk(?:ab\xE6erbog)?)|Fjerde[\s\xa0]*Makk(?:ab\xE6erbog)?)
)(?:(?=[\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014])|$)///gi
,
osis: ["1Macc"]
apocrypha: true
regexp: ///(^|[^0-9A-Za-zªµºÀ-ÖØ-öø-ɏḀ-ỿⱠ-ⱿꜢ-ꞈꞋ-ꞎꞐ-ꞓꞠ-Ɦꟸ-ꟿ])(
(?:1(?:[\s\xa0]*Makk(?:ab\xE6erbog)?|Macc|\.[\s\xa0]*Makk(?:ab\xE6erbog)?)|F\xF8rste[\s\xa0]*Makk(?:ab\xE6erbog)?)
)(?:(?=[\d\s\xa0.:,;\x1e\x1f&\(\)\uff08\uff09\[\]/"'\*=~\-\u2013\u2014])|$)///gi
]
# Short-circuit the look if we know we want all the books.
return books if include_apocrypha is true and case_sensitive is "none"
# Filter out books in the Apocrypha if we don't want them. `Array.map` isn't supported below IE9.
out = []
for book in books
continue if include_apocrypha is false and book.apocrypha? and book.apocrypha is true
if case_sensitive is "books"
book.regexp = new RegExp book.regexp.source, "g"
out.push book
out
# Default to not using the Apocrypha
bcv_parser::regexps.books = bcv_parser::regexps.get_books false, "none"
|
[
{
"context": " form = req.form()\n form.append('username', '012345678901234567890123456789012345')\n form.append('pas",
"end": 981,
"score": 0.8803354501724243,
"start": 970,
"tag": "USERNAME",
"value": "01234567890"
},
{
"context": "m()\n form.append('username', '012345678901234567890123456789012345')\n form.append('password', '12345')\n )\n ",
"end": 1006,
"score": 0.9638223052024841,
"start": 985,
"tag": "PASSWORD",
"value": "567890123456789012345"
},
{
"context": "0123456789012345')\n form.append('password', '12345')\n )\n form = req.form()\n form.append('io",
"end": 1045,
"score": 0.9993699789047241,
"start": 1040,
"tag": "PASSWORD",
"value": "12345"
},
{
"context": "orm()\n form.append('iosIdentifierForVendor', '012345678901234567890123456789012345')\n form.append('password', '12345')\n \n it 'c",
"end": 1155,
"score": 0.9782623052597046,
"start": 1120,
"tag": "PASSWORD",
"value": "12345678901234567890123456789012345"
},
{
"context": "890123456789012345')\n form.append('password', '12345')\n \n it 'clears Users', (done) ->\n clearMode",
"end": 1192,
"score": 0.999413788318634,
"start": 1187,
"tag": "PASSWORD",
"value": "12345"
},
{
"context": " form = req.form()\n form.append('username', 'scott@gmail.com')\n form.append('password', 'nada",
"end": 1609,
"score": 0.9888311624526978,
"start": 1608,
"tag": "USERNAME",
"value": "s"
},
{
"context": " form = req.form()\n form.append('username', 'scott@gmail.com')\n form.append('password', 'nada')\n\n it 'crea",
"end": 1623,
"score": 0.9999324679374695,
"start": 1609,
"tag": "EMAIL",
"value": "cott@gmail.com"
},
{
"context": ", 'scott@gmail.com')\n form.append('password', 'nada')\n\n it 'creates a user', (done) ->\n req = req",
"end": 1659,
"score": 0.9994716644287109,
"start": 1655,
"tag": "PASSWORD",
"value": "nada"
},
{
"context": ")\n form = req.form()\n form.append('email', 'scott@gmail.com')\n form.append('password', 'nada')\n\n it 'find",
"end": 1935,
"score": 0.9999227523803711,
"start": 1920,
"tag": "EMAIL",
"value": "scott@gmail.com"
},
{
"context": ", 'scott@gmail.com')\n form.append('password', 'nada')\n\n it 'finds that created user', (done) ->\n ",
"end": 1971,
"score": 0.9994874000549316,
"start": 1967,
"tag": "PASSWORD",
"value": "nada"
},
{
"context": " form = req.form()\n form.append('username', 'scott@gmail.com')\n form.append('password', 'nada')\n\n it 'reje",
"end": 2237,
"score": 0.999917209148407,
"start": 2222,
"tag": "EMAIL",
"value": "scott@gmail.com"
},
{
"context": ", 'scott@gmail.com')\n form.append('password', 'nada')\n\n it 'rejects wrong passwords', (done) ->\n ",
"end": 2273,
"score": 0.9994760155677795,
"start": 2269,
"tag": "PASSWORD",
"value": "nada"
},
{
"context": " form = req.form()\n form.append('username', 'scott@gmail.com')\n form.append('password', 'blahblah')\n\n it '",
"end": 2567,
"score": 0.9999119639396667,
"start": 2552,
"tag": "EMAIL",
"value": "scott@gmail.com"
},
{
"context": ", 'scott@gmail.com')\n form.append('password', 'blahblah')\n\n it 'is completely case insensitive', (done) ",
"end": 2607,
"score": 0.9994752407073975,
"start": 2599,
"tag": "PASSWORD",
"value": "blahblah"
},
{
"context": " form = req.form()\n form.append('username', 'scoTT@gmaIL.com')\n form.append('password', 'NaDa')\n\ndescribe '",
"end": 2843,
"score": 0.999919056892395,
"start": 2828,
"tag": "EMAIL",
"value": "scoTT@gmaIL.com"
},
{
"context": ", 'scoTT@gmaIL.com')\n form.append('password', 'NaDa')\n\ndescribe '/auth/reset', ->\n passwordReset = '",
"end": 2879,
"score": 0.9994721412658691,
"start": 2875,
"tag": "PASSWORD",
"value": "NaDa"
},
{
"context": " form = req.form()\n form.append('username', 'scott@gmail.com')\n\n it 'can\\'t reset an unknown user', (done) ->",
"end": 3185,
"score": 0.9999194741249084,
"start": 3170,
"tag": "EMAIL",
"value": "scott@gmail.com"
},
{
"context": ")\n form = req.form()\n form.append('email', 'scott@gmail.com')\n\n it 'can login after resetting', (done) ->\n ",
"end": 3782,
"score": 0.9999176859855652,
"start": 3767,
"tag": "EMAIL",
"value": "scott@gmail.com"
},
{
"context": " form = req.form()\n form.append('username', 'scott@gmail.com')\n form.append('password', passwordReset)\n\n i",
"end": 4050,
"score": 0.999900758266449,
"start": 4035,
"tag": "EMAIL",
"value": "scott@gmail.com"
},
{
"context": "e', 'scott@gmail.com')\n form.append('password', passwordReset)\n\n it 'resetting password is not permanent', (do",
"end": 4094,
"score": 0.9724664688110352,
"start": 4081,
"tag": "PASSWORD",
"value": "passwordReset"
},
{
"context": " form = req.form()\n form.append('username', 'scott@gmail.com')\n form.append('password', passwordReset)\n\n\n ",
"end": 4371,
"score": 0.9998878836631775,
"start": 4356,
"tag": "EMAIL",
"value": "scott@gmail.com"
},
{
"context": "e', 'scott@gmail.com')\n form.append('password', passwordReset)\n\n\n it 'can still login with old password', (don",
"end": 4415,
"score": 0.9801411032676697,
"start": 4402,
"tag": "PASSWORD",
"value": "passwordReset"
},
{
"context": " form = req.form()\n form.append('username', 'scott@gmail.com')\n form.append('password', 'nada')\n\ndescribe '",
"end": 4691,
"score": 0.9998928904533386,
"start": 4676,
"tag": "EMAIL",
"value": "scott@gmail.com"
},
{
"context": ", 'scott@gmail.com')\n form.append('password', 'nada')\n\ndescribe '/auth/unsubscribe', ->\n it 'clears ",
"end": 4727,
"score": 0.9992369413375854,
"start": 4723,
"tag": "PASSWORD",
"value": "nada"
},
{
"context": ").toBe 200\n expect(response.body.name).toBe 'Gandalf'\n done()\n\n it 'can GET a new name in case o",
"end": 5947,
"score": 0.768572986125946,
"start": 5940,
"tag": "NAME",
"value": "Gandalf"
}
] | spec/server/functional/auth.spec.coffee | JurianLock/codecombat | 1 | require '../common'
request = require 'request'
User = require '../../../server/users/User'
urlLogin = getURL('/auth/login')
urlReset = getURL('/auth/reset')
describe '/auth/whoami', ->
it 'returns 200', (done) ->
request.get(getURL('/auth/whoami'), (err, response) ->
expect(response).toBeDefined()
expect(response.statusCode).toBe(200)
done()
)
describe '/auth/login', ->
it 'clears Users', (done) ->
clearModels [User], (err) ->
throw err if err
request.get getURL('/auth/whoami'), ->
throw err if err
done()
it 'allows logging in by iosIdentifierForVendor', (done) ->
req = request.post(getURL('/db/user'),
(error, response) ->
expect(response).toBeDefined()
expect(response.statusCode).toBe(200)
req = request.post(urlLogin, (error, response) ->
expect(response.statusCode).toBe(200)
done()
)
form = req.form()
form.append('username', '012345678901234567890123456789012345')
form.append('password', '12345')
)
form = req.form()
form.append('iosIdentifierForVendor', '012345678901234567890123456789012345')
form.append('password', '12345')
it 'clears Users', (done) ->
clearModels [User], (err) ->
throw err if err
request.get getURL('/auth/whoami'), ->
throw err if err
done()
it 'finds no user', (done) ->
req = request.post(urlLogin, (error, response) ->
expect(response).toBeDefined()
expect(response.statusCode).toBe(401)
done()
)
form = req.form()
form.append('username', 'scott@gmail.com')
form.append('password', 'nada')
it 'creates a user', (done) ->
req = request.post(getURL('/db/user'),
(error, response) ->
expect(response).toBeDefined()
expect(response.statusCode).toBe(200)
done()
)
form = req.form()
form.append('email', 'scott@gmail.com')
form.append('password', 'nada')
it 'finds that created user', (done) ->
req = request.post(urlLogin, (error, response) ->
expect(response).toBeDefined()
expect(response.statusCode).toBe(200)
done()
)
form = req.form()
form.append('username', 'scott@gmail.com')
form.append('password', 'nada')
it 'rejects wrong passwords', (done) ->
req = request.post(urlLogin, (error, response) ->
expect(response.statusCode).toBe(401)
expect(response.body.indexOf('wrong')).toBeGreaterThan(-1)
done()
)
form = req.form()
form.append('username', 'scott@gmail.com')
form.append('password', 'blahblah')
it 'is completely case insensitive', (done) ->
req = request.post(urlLogin, (error, response) ->
expect(response.statusCode).toBe(200)
done()
)
form = req.form()
form.append('username', 'scoTT@gmaIL.com')
form.append('password', 'NaDa')
describe '/auth/reset', ->
passwordReset = ''
it 'emails require', (done) ->
req = request.post(urlReset, (error, response) ->
expect(response).toBeDefined()
expect(response.statusCode).toBe(422)
done()
)
form = req.form()
form.append('username', 'scott@gmail.com')
it 'can\'t reset an unknown user', (done) ->
req = request.post(urlReset, (error, response) ->
expect(response).toBeDefined()
expect(response.statusCode).toBe(404)
done()
)
form = req.form()
form.append('email', 'unknow')
it 'resets user password', (done) ->
req = request.post(urlReset, (error, response) ->
expect(response).toBeDefined()
expect(response.statusCode).toBe(200)
expect(response.body).toBeDefined()
passwordReset = response.body
done()
)
form = req.form()
form.append('email', 'scott@gmail.com')
it 'can login after resetting', (done) ->
req = request.post(urlLogin, (error, response) ->
expect(response).toBeDefined()
expect(response.statusCode).toBe(200)
done()
)
form = req.form()
form.append('username', 'scott@gmail.com')
form.append('password', passwordReset)
it 'resetting password is not permanent', (done) ->
req = request.post(urlLogin, (error, response) ->
expect(response).toBeDefined()
expect(response.statusCode).toBe(401)
done()
)
form = req.form()
form.append('username', 'scott@gmail.com')
form.append('password', passwordReset)
it 'can still login with old password', (done) ->
req = request.post(urlLogin, (error, response) ->
expect(response).toBeDefined()
expect(response.statusCode).toBe(200)
done()
)
form = req.form()
form.append('username', 'scott@gmail.com')
form.append('password', 'nada')
describe '/auth/unsubscribe', ->
it 'clears Users first', (done) ->
clearModels [User], (err) ->
throw err if err
request.get getURL('/auth/whoami'), ->
throw err if err
done()
it 'removes just recruitment emails if you include ?recruitNotes=1', (done) ->
loginJoe (joe) ->
url = getURL('/auth/unsubscribe?recruitNotes=1&email='+joe.get('email'))
request.get url, (error, response) ->
expect(response.statusCode).toBe(200)
user = User.findOne(joe.get('_id')).exec (err, user) ->
expect(user.get('emails').recruitNotes.enabled).toBe(false)
expect(user.isEmailSubscriptionEnabled('generalNews')).toBeTruthy()
done()
describe '/auth/name', ->
url = '/auth/name'
it 'must provide a name to check with', (done) ->
request.get {url: getURL(url + '/'), json: {}}, (err, response) ->
expect(err).toBeNull()
expect(response.statusCode).toBe 422
done()
it 'can GET a non-conflicting name', (done) ->
request.get {url: getURL(url + '/Gandalf'), json: {}}, (err, response) ->
expect(err).toBeNull()
expect(response.statusCode).toBe 200
expect(response.body.name).toBe 'Gandalf'
done()
it 'can GET a new name in case of conflict', (done) ->
request.get {url: getURL(url + '/joe'), json: {}}, (err, response) ->
expect(err).toBeNull()
expect(response.statusCode).toBe 409
expect(response.body.name).not.toBe 'joe'
expect(response.body.name.length).toBe 4 # 'joe' and a random number
done()
| 150201 | require '../common'
request = require 'request'
User = require '../../../server/users/User'
urlLogin = getURL('/auth/login')
urlReset = getURL('/auth/reset')
describe '/auth/whoami', ->
it 'returns 200', (done) ->
request.get(getURL('/auth/whoami'), (err, response) ->
expect(response).toBeDefined()
expect(response.statusCode).toBe(200)
done()
)
describe '/auth/login', ->
it 'clears Users', (done) ->
clearModels [User], (err) ->
throw err if err
request.get getURL('/auth/whoami'), ->
throw err if err
done()
it 'allows logging in by iosIdentifierForVendor', (done) ->
req = request.post(getURL('/db/user'),
(error, response) ->
expect(response).toBeDefined()
expect(response.statusCode).toBe(200)
req = request.post(urlLogin, (error, response) ->
expect(response.statusCode).toBe(200)
done()
)
form = req.form()
form.append('username', '012345678901234<PASSWORD>')
form.append('password', '<PASSWORD>')
)
form = req.form()
form.append('iosIdentifierForVendor', '0<PASSWORD>')
form.append('password', '<PASSWORD>')
it 'clears Users', (done) ->
clearModels [User], (err) ->
throw err if err
request.get getURL('/auth/whoami'), ->
throw err if err
done()
it 'finds no user', (done) ->
req = request.post(urlLogin, (error, response) ->
expect(response).toBeDefined()
expect(response.statusCode).toBe(401)
done()
)
form = req.form()
form.append('username', 's<EMAIL>')
form.append('password', '<PASSWORD>')
it 'creates a user', (done) ->
req = request.post(getURL('/db/user'),
(error, response) ->
expect(response).toBeDefined()
expect(response.statusCode).toBe(200)
done()
)
form = req.form()
form.append('email', '<EMAIL>')
form.append('password', '<PASSWORD>')
it 'finds that created user', (done) ->
req = request.post(urlLogin, (error, response) ->
expect(response).toBeDefined()
expect(response.statusCode).toBe(200)
done()
)
form = req.form()
form.append('username', '<EMAIL>')
form.append('password', '<PASSWORD>')
it 'rejects wrong passwords', (done) ->
req = request.post(urlLogin, (error, response) ->
expect(response.statusCode).toBe(401)
expect(response.body.indexOf('wrong')).toBeGreaterThan(-1)
done()
)
form = req.form()
form.append('username', '<EMAIL>')
form.append('password', '<PASSWORD>')
it 'is completely case insensitive', (done) ->
req = request.post(urlLogin, (error, response) ->
expect(response.statusCode).toBe(200)
done()
)
form = req.form()
form.append('username', '<EMAIL>')
form.append('password', '<PASSWORD>')
describe '/auth/reset', ->
passwordReset = ''
it 'emails require', (done) ->
req = request.post(urlReset, (error, response) ->
expect(response).toBeDefined()
expect(response.statusCode).toBe(422)
done()
)
form = req.form()
form.append('username', '<EMAIL>')
it 'can\'t reset an unknown user', (done) ->
req = request.post(urlReset, (error, response) ->
expect(response).toBeDefined()
expect(response.statusCode).toBe(404)
done()
)
form = req.form()
form.append('email', 'unknow')
it 'resets user password', (done) ->
req = request.post(urlReset, (error, response) ->
expect(response).toBeDefined()
expect(response.statusCode).toBe(200)
expect(response.body).toBeDefined()
passwordReset = response.body
done()
)
form = req.form()
form.append('email', '<EMAIL>')
it 'can login after resetting', (done) ->
req = request.post(urlLogin, (error, response) ->
expect(response).toBeDefined()
expect(response.statusCode).toBe(200)
done()
)
form = req.form()
form.append('username', '<EMAIL>')
form.append('password', <PASSWORD>)
it 'resetting password is not permanent', (done) ->
req = request.post(urlLogin, (error, response) ->
expect(response).toBeDefined()
expect(response.statusCode).toBe(401)
done()
)
form = req.form()
form.append('username', '<EMAIL>')
form.append('password', <PASSWORD>)
it 'can still login with old password', (done) ->
req = request.post(urlLogin, (error, response) ->
expect(response).toBeDefined()
expect(response.statusCode).toBe(200)
done()
)
form = req.form()
form.append('username', '<EMAIL>')
form.append('password', '<PASSWORD>')
describe '/auth/unsubscribe', ->
it 'clears Users first', (done) ->
clearModels [User], (err) ->
throw err if err
request.get getURL('/auth/whoami'), ->
throw err if err
done()
it 'removes just recruitment emails if you include ?recruitNotes=1', (done) ->
loginJoe (joe) ->
url = getURL('/auth/unsubscribe?recruitNotes=1&email='+joe.get('email'))
request.get url, (error, response) ->
expect(response.statusCode).toBe(200)
user = User.findOne(joe.get('_id')).exec (err, user) ->
expect(user.get('emails').recruitNotes.enabled).toBe(false)
expect(user.isEmailSubscriptionEnabled('generalNews')).toBeTruthy()
done()
describe '/auth/name', ->
url = '/auth/name'
it 'must provide a name to check with', (done) ->
request.get {url: getURL(url + '/'), json: {}}, (err, response) ->
expect(err).toBeNull()
expect(response.statusCode).toBe 422
done()
it 'can GET a non-conflicting name', (done) ->
request.get {url: getURL(url + '/Gandalf'), json: {}}, (err, response) ->
expect(err).toBeNull()
expect(response.statusCode).toBe 200
expect(response.body.name).toBe '<NAME>'
done()
it 'can GET a new name in case of conflict', (done) ->
request.get {url: getURL(url + '/joe'), json: {}}, (err, response) ->
expect(err).toBeNull()
expect(response.statusCode).toBe 409
expect(response.body.name).not.toBe 'joe'
expect(response.body.name.length).toBe 4 # 'joe' and a random number
done()
| true | require '../common'
request = require 'request'
User = require '../../../server/users/User'
urlLogin = getURL('/auth/login')
urlReset = getURL('/auth/reset')
describe '/auth/whoami', ->
it 'returns 200', (done) ->
request.get(getURL('/auth/whoami'), (err, response) ->
expect(response).toBeDefined()
expect(response.statusCode).toBe(200)
done()
)
describe '/auth/login', ->
it 'clears Users', (done) ->
clearModels [User], (err) ->
throw err if err
request.get getURL('/auth/whoami'), ->
throw err if err
done()
it 'allows logging in by iosIdentifierForVendor', (done) ->
req = request.post(getURL('/db/user'),
(error, response) ->
expect(response).toBeDefined()
expect(response.statusCode).toBe(200)
req = request.post(urlLogin, (error, response) ->
expect(response.statusCode).toBe(200)
done()
)
form = req.form()
form.append('username', '012345678901234PI:PASSWORD:<PASSWORD>END_PI')
form.append('password', 'PI:PASSWORD:<PASSWORD>END_PI')
)
form = req.form()
form.append('iosIdentifierForVendor', '0PI:PASSWORD:<PASSWORD>END_PI')
form.append('password', 'PI:PASSWORD:<PASSWORD>END_PI')
it 'clears Users', (done) ->
clearModels [User], (err) ->
throw err if err
request.get getURL('/auth/whoami'), ->
throw err if err
done()
it 'finds no user', (done) ->
req = request.post(urlLogin, (error, response) ->
expect(response).toBeDefined()
expect(response.statusCode).toBe(401)
done()
)
form = req.form()
form.append('username', 'sPI:EMAIL:<EMAIL>END_PI')
form.append('password', 'PI:PASSWORD:<PASSWORD>END_PI')
it 'creates a user', (done) ->
req = request.post(getURL('/db/user'),
(error, response) ->
expect(response).toBeDefined()
expect(response.statusCode).toBe(200)
done()
)
form = req.form()
form.append('email', 'PI:EMAIL:<EMAIL>END_PI')
form.append('password', 'PI:PASSWORD:<PASSWORD>END_PI')
it 'finds that created user', (done) ->
req = request.post(urlLogin, (error, response) ->
expect(response).toBeDefined()
expect(response.statusCode).toBe(200)
done()
)
form = req.form()
form.append('username', 'PI:EMAIL:<EMAIL>END_PI')
form.append('password', 'PI:PASSWORD:<PASSWORD>END_PI')
it 'rejects wrong passwords', (done) ->
req = request.post(urlLogin, (error, response) ->
expect(response.statusCode).toBe(401)
expect(response.body.indexOf('wrong')).toBeGreaterThan(-1)
done()
)
form = req.form()
form.append('username', 'PI:EMAIL:<EMAIL>END_PI')
form.append('password', 'PI:PASSWORD:<PASSWORD>END_PI')
it 'is completely case insensitive', (done) ->
req = request.post(urlLogin, (error, response) ->
expect(response.statusCode).toBe(200)
done()
)
form = req.form()
form.append('username', 'PI:EMAIL:<EMAIL>END_PI')
form.append('password', 'PI:PASSWORD:<PASSWORD>END_PI')
describe '/auth/reset', ->
passwordReset = ''
it 'emails require', (done) ->
req = request.post(urlReset, (error, response) ->
expect(response).toBeDefined()
expect(response.statusCode).toBe(422)
done()
)
form = req.form()
form.append('username', 'PI:EMAIL:<EMAIL>END_PI')
it 'can\'t reset an unknown user', (done) ->
req = request.post(urlReset, (error, response) ->
expect(response).toBeDefined()
expect(response.statusCode).toBe(404)
done()
)
form = req.form()
form.append('email', 'unknow')
it 'resets user password', (done) ->
req = request.post(urlReset, (error, response) ->
expect(response).toBeDefined()
expect(response.statusCode).toBe(200)
expect(response.body).toBeDefined()
passwordReset = response.body
done()
)
form = req.form()
form.append('email', 'PI:EMAIL:<EMAIL>END_PI')
it 'can login after resetting', (done) ->
req = request.post(urlLogin, (error, response) ->
expect(response).toBeDefined()
expect(response.statusCode).toBe(200)
done()
)
form = req.form()
form.append('username', 'PI:EMAIL:<EMAIL>END_PI')
form.append('password', PI:PASSWORD:<PASSWORD>END_PI)
it 'resetting password is not permanent', (done) ->
req = request.post(urlLogin, (error, response) ->
expect(response).toBeDefined()
expect(response.statusCode).toBe(401)
done()
)
form = req.form()
form.append('username', 'PI:EMAIL:<EMAIL>END_PI')
form.append('password', PI:PASSWORD:<PASSWORD>END_PI)
it 'can still login with old password', (done) ->
req = request.post(urlLogin, (error, response) ->
expect(response).toBeDefined()
expect(response.statusCode).toBe(200)
done()
)
form = req.form()
form.append('username', 'PI:EMAIL:<EMAIL>END_PI')
form.append('password', 'PI:PASSWORD:<PASSWORD>END_PI')
describe '/auth/unsubscribe', ->
it 'clears Users first', (done) ->
clearModels [User], (err) ->
throw err if err
request.get getURL('/auth/whoami'), ->
throw err if err
done()
it 'removes just recruitment emails if you include ?recruitNotes=1', (done) ->
loginJoe (joe) ->
url = getURL('/auth/unsubscribe?recruitNotes=1&email='+joe.get('email'))
request.get url, (error, response) ->
expect(response.statusCode).toBe(200)
user = User.findOne(joe.get('_id')).exec (err, user) ->
expect(user.get('emails').recruitNotes.enabled).toBe(false)
expect(user.isEmailSubscriptionEnabled('generalNews')).toBeTruthy()
done()
describe '/auth/name', ->
url = '/auth/name'
it 'must provide a name to check with', (done) ->
request.get {url: getURL(url + '/'), json: {}}, (err, response) ->
expect(err).toBeNull()
expect(response.statusCode).toBe 422
done()
it 'can GET a non-conflicting name', (done) ->
request.get {url: getURL(url + '/Gandalf'), json: {}}, (err, response) ->
expect(err).toBeNull()
expect(response.statusCode).toBe 200
expect(response.body.name).toBe 'PI:NAME:<NAME>END_PI'
done()
it 'can GET a new name in case of conflict', (done) ->
request.get {url: getURL(url + '/joe'), json: {}}, (err, response) ->
expect(err).toBeNull()
expect(response.statusCode).toBe 409
expect(response.body.name).not.toBe 'joe'
expect(response.body.name.length).toBe 4 # 'joe' and a random number
done()
|
[
{
"context": "# Copyright Joyent, Inc. and other Node contributors.\n#\n# Permission",
"end": 18,
"score": 0.9989607334136963,
"start": 12,
"tag": "NAME",
"value": "Joyent"
}
] | test/simple/test-vm-run-in-new-context.coffee | lxe/io.coffee | 0 | # Copyright Joyent, Inc. and other Node contributors.
#
# Permission is hereby granted, free of charge, to any person obtaining a
# copy of this software and associated documentation files (the
# "Software"), to deal in the Software without restriction, including
# without limitation the rights to use, copy, modify, merge, publish,
# distribute, sublicense, and/or sell copies of the Software, and to permit
# persons to whom the Software is furnished to do so, subject to the
# following conditions:
#
# The above copyright notice and this permission notice shall be included
# in all copies or substantial portions of the Software.
#
# THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS
# OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF
# MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN
# NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM,
# DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR
# OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE
# USE OR OTHER DEALINGS IN THE SOFTWARE.
# Flags: --expose-gc
changeFoo = ->
foo = 100
return
common = require("../common")
assert = require("assert")
vm = require("vm")
assert.equal typeof gc, "function", "Run this test with --expose-gc"
common.globalCheck = false
console.error "run a string"
result = vm.runInNewContext("'passed';")
assert.equal "passed", result
console.error "thrown error"
assert.throws ->
vm.runInNewContext "throw new Error('test');"
return
hello = 5
vm.runInNewContext "hello = 2"
assert.equal 5, hello
console.error "pass values in and out"
code = "foo = 1;" + "bar = 2;" + "if (baz !== 3) throw new Error('test fail');"
foo = 2
obj =
foo: 0
baz: 3
baz = vm.runInNewContext(code, obj)
assert.equal 1, obj.foo
assert.equal 2, obj.bar
assert.equal 2, foo
console.error "call a function by reference"
vm.runInNewContext "f()",
f: changeFoo
assert.equal foo, 100
console.error "modify an object by reference"
f = a: 1
vm.runInNewContext "f.a = 2",
f: f
assert.equal f.a, 2
console.error "use function in context without referencing context"
fn = vm.runInNewContext("(function() { obj.p = {}; })",
obj: {}
)
gc()
fn()
# Should not crash
| 164928 | # Copyright <NAME>, Inc. and other Node contributors.
#
# Permission is hereby granted, free of charge, to any person obtaining a
# copy of this software and associated documentation files (the
# "Software"), to deal in the Software without restriction, including
# without limitation the rights to use, copy, modify, merge, publish,
# distribute, sublicense, and/or sell copies of the Software, and to permit
# persons to whom the Software is furnished to do so, subject to the
# following conditions:
#
# The above copyright notice and this permission notice shall be included
# in all copies or substantial portions of the Software.
#
# THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS
# OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF
# MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN
# NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM,
# DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR
# OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE
# USE OR OTHER DEALINGS IN THE SOFTWARE.
# Flags: --expose-gc
changeFoo = ->
foo = 100
return
common = require("../common")
assert = require("assert")
vm = require("vm")
assert.equal typeof gc, "function", "Run this test with --expose-gc"
common.globalCheck = false
console.error "run a string"
result = vm.runInNewContext("'passed';")
assert.equal "passed", result
console.error "thrown error"
assert.throws ->
vm.runInNewContext "throw new Error('test');"
return
hello = 5
vm.runInNewContext "hello = 2"
assert.equal 5, hello
console.error "pass values in and out"
code = "foo = 1;" + "bar = 2;" + "if (baz !== 3) throw new Error('test fail');"
foo = 2
obj =
foo: 0
baz: 3
baz = vm.runInNewContext(code, obj)
assert.equal 1, obj.foo
assert.equal 2, obj.bar
assert.equal 2, foo
console.error "call a function by reference"
vm.runInNewContext "f()",
f: changeFoo
assert.equal foo, 100
console.error "modify an object by reference"
f = a: 1
vm.runInNewContext "f.a = 2",
f: f
assert.equal f.a, 2
console.error "use function in context without referencing context"
fn = vm.runInNewContext("(function() { obj.p = {}; })",
obj: {}
)
gc()
fn()
# Should not crash
| true | # Copyright PI:NAME:<NAME>END_PI, Inc. and other Node contributors.
#
# Permission is hereby granted, free of charge, to any person obtaining a
# copy of this software and associated documentation files (the
# "Software"), to deal in the Software without restriction, including
# without limitation the rights to use, copy, modify, merge, publish,
# distribute, sublicense, and/or sell copies of the Software, and to permit
# persons to whom the Software is furnished to do so, subject to the
# following conditions:
#
# The above copyright notice and this permission notice shall be included
# in all copies or substantial portions of the Software.
#
# THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS
# OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF
# MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN
# NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM,
# DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR
# OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE
# USE OR OTHER DEALINGS IN THE SOFTWARE.
# Flags: --expose-gc
changeFoo = ->
foo = 100
return
common = require("../common")
assert = require("assert")
vm = require("vm")
assert.equal typeof gc, "function", "Run this test with --expose-gc"
common.globalCheck = false
console.error "run a string"
result = vm.runInNewContext("'passed';")
assert.equal "passed", result
console.error "thrown error"
assert.throws ->
vm.runInNewContext "throw new Error('test');"
return
hello = 5
vm.runInNewContext "hello = 2"
assert.equal 5, hello
console.error "pass values in and out"
code = "foo = 1;" + "bar = 2;" + "if (baz !== 3) throw new Error('test fail');"
foo = 2
obj =
foo: 0
baz: 3
baz = vm.runInNewContext(code, obj)
assert.equal 1, obj.foo
assert.equal 2, obj.bar
assert.equal 2, foo
console.error "call a function by reference"
vm.runInNewContext "f()",
f: changeFoo
assert.equal foo, 100
console.error "modify an object by reference"
f = a: 1
vm.runInNewContext "f.a = 2",
f: f
assert.equal f.a, 2
console.error "use function in context without referencing context"
fn = vm.runInNewContext("(function() { obj.p = {}; })",
obj: {}
)
gc()
fn()
# Should not crash
|
[
{
"context": "#\n# MConn Framework\n# https://www.github.com/livespotting/mconn\n#\n# @copyright 2015 Livespotting Media GmbH",
"end": 57,
"score": 0.9948635101318359,
"start": 45,
"tag": "USERNAME",
"value": "livespotting"
},
{
"context": "tting Media GmbH\n# @license Apache-2.0\n#\n# @author Christoph Johannsdotter [c.johannsdotter@livespottingmedia.com]\n# @author",
"end": 165,
"score": 0.9998743534088135,
"start": 142,
"tag": "NAME",
"value": "Christoph Johannsdotter"
},
{
"context": "e Apache-2.0\n#\n# @author Christoph Johannsdotter [c.johannsdotter@livespottingmedia.com]\n# @author Jan Stabenow [j.stabenow@livespottingm",
"end": 204,
"score": 0.9999269247055054,
"start": 167,
"tag": "EMAIL",
"value": "c.johannsdotter@livespottingmedia.com"
},
{
"context": " [c.johannsdotter@livespottingmedia.com]\n# @author Jan Stabenow [j.stabenow@livespottingmedia.com]\n#\n\nModule = re",
"end": 228,
"score": 0.9998652338981628,
"start": 216,
"tag": "NAME",
"value": "Jan Stabenow"
},
{
"context": "er@livespottingmedia.com]\n# @author Jan Stabenow [j.stabenow@livespottingmedia.com]\n#\n\nModule = require(require(\"path\").join(process",
"end": 262,
"score": 0.9999229907989502,
"start": 230,
"tag": "EMAIL",
"value": "j.stabenow@livespottingmedia.com"
}
] | src/module.coffee | livespotting/mconn-helloworld | 0 | #
# MConn Framework
# https://www.github.com/livespotting/mconn
#
# @copyright 2015 Livespotting Media GmbH
# @license Apache-2.0
#
# @author Christoph Johannsdotter [c.johannsdotter@livespottingmedia.com]
# @author Jan Stabenow [j.stabenow@livespottingmedia.com]
#
Module = require(require("path").join(process.env.MCONN_PATH, "bin/classes/Module"))
Q = require("q")
class HelloWorld extends Module
timeout: 600000
constructor: ->
super("HelloWorld")
@
init: (options, moduleRouter, folder) ->
Q = require("q") #requirement for init method
deferred = Q.defer()
super(options, moduleRouter, folder)
.then =>
moduleRouter.get @createModuleRoute("custom"), (req, res) =>
res.render(@getTemplatePath("custom"),
modulename: @name
activeSubmenu: "custom"
)
fruits = ["Bananas", "Apple", "Blackberries", "Cranberries"]
i = 0
setInterval =>
@getWebsocketHandler().then (io) ->
if io
fruitsSnippet = fruits.slice(0,i)
i = (i + 1) % 4
io.of("/HelloWorld").emit("updateHelloWorld", fruitsSnippet)
, 1500
deferred.resolve()
.catch (error) =>
@logger.error error
deferred.promise
on_TASK_RUNNING: (taskData, modulePreset, callback) ->
delay = if process.env.MCONN_MODULE_HELLOWORLD_DELAY then process.env.MCONN_MODULE_HELLOWORLD_DELAY else 250
Q.delay(delay)
.then =>
path = taskData.getData().taskId
customData = modulePreset.options.actions.add
return @addToZKInventory(path, customData, taskData)
.then =>
@logger.info(modulePreset.options.actions.add + " \"" + taskData.getData().taskId + "\"")
@success(taskData, callback)
@updateInventoryOnGui()
.catch (error) =>
@failed(taskData, callback, error)
on_TASK_FAILED: (taskData, modulePreset, callback) ->
delay = if process.env.MCONN_MODULE_HELLOWORLD_DELAY then process.env.MCONN_MODULE_HELLOWORLD_DELAY else 250
Q.delay(delay)
.then =>
path = taskData.getData().taskId
@removeFromZKInventory(path)
.then =>
@logger.info(modulePreset.options.actions.remove + " " + taskData.getData().taskId)
@success(taskData, callback)
@updateInventoryOnGui()
.catch (error) =>
@failed(taskData, callback, error)
on_UNDEFINED_STATUS: (taskData, modulePreset, callback) ->
delay = if process.env.MCONN_MODULE_HELLOWORLD_DELAY then process.env.MCONN_MODULE_HELLOWORLD_DELAY else 0
Q.delay(delay)
.then =>
@logger.info("\"" + taskData.getData().taskStatus + "\" is an undefined taskStatus and the task
\"" + taskData.getData().taskId + "\" will be proceed without actions")
@undefinedStatus(taskData, callback)
@updateInventoryOnGui()
.catch (error) =>
@failed(taskData, callback, error)
on_TASK_KILLED: (taskData, modulePreset, callback) ->
@on_TASK_FAILED(taskData, modulePreset, callback)
on_TASK_LOST: (taskData, modulePreset, callback) ->
@on_TASK_FAILED(taskData, modulePreset, callback)
on_TASK_FINISHED: (taskData, modulePreset, callback) ->
@on_TASK_FAILED(taskData, modulePreset, callback)
on_TASK_STAGING: (taskData, modulePreset, callback) ->
@on_UNDEFINED_STATUS(taskData, modulePreset, callback)
on_TASK_STARTING: (taskData, modulePreset, callback) ->
@on_UNDEFINED_STATUS(taskData, modulePreset, callback)
cleanUpInventory: (result) ->
@logger.debug("INFO", "Starting inventory cleanup")
deferred = Q.defer()
for m in result.missing
m.taskStatus = "TASK_RUNNING"
@addTask(m, =>
@logger.info("Cleanup task \"" + m.getData().taskId + "\" successfully added")
)
for o in result.wrong
o.taskStatus = "TASK_KILLED"
@addTask(o, =>
@logger.info("Cleanup task \"" + o.getData().taskId + "\" successfully removed")
)
@logger.info("Cleanup initiated, added \"" + (result.wrong.length + result.missing.length) + "\" tasks")
deferred.resolve()
deferred.promise
module.exports = HelloWorld
| 104877 | #
# MConn Framework
# https://www.github.com/livespotting/mconn
#
# @copyright 2015 Livespotting Media GmbH
# @license Apache-2.0
#
# @author <NAME> [<EMAIL>]
# @author <NAME> [<EMAIL>]
#
Module = require(require("path").join(process.env.MCONN_PATH, "bin/classes/Module"))
Q = require("q")
class HelloWorld extends Module
timeout: 600000
constructor: ->
super("HelloWorld")
@
init: (options, moduleRouter, folder) ->
Q = require("q") #requirement for init method
deferred = Q.defer()
super(options, moduleRouter, folder)
.then =>
moduleRouter.get @createModuleRoute("custom"), (req, res) =>
res.render(@getTemplatePath("custom"),
modulename: @name
activeSubmenu: "custom"
)
fruits = ["Bananas", "Apple", "Blackberries", "Cranberries"]
i = 0
setInterval =>
@getWebsocketHandler().then (io) ->
if io
fruitsSnippet = fruits.slice(0,i)
i = (i + 1) % 4
io.of("/HelloWorld").emit("updateHelloWorld", fruitsSnippet)
, 1500
deferred.resolve()
.catch (error) =>
@logger.error error
deferred.promise
on_TASK_RUNNING: (taskData, modulePreset, callback) ->
delay = if process.env.MCONN_MODULE_HELLOWORLD_DELAY then process.env.MCONN_MODULE_HELLOWORLD_DELAY else 250
Q.delay(delay)
.then =>
path = taskData.getData().taskId
customData = modulePreset.options.actions.add
return @addToZKInventory(path, customData, taskData)
.then =>
@logger.info(modulePreset.options.actions.add + " \"" + taskData.getData().taskId + "\"")
@success(taskData, callback)
@updateInventoryOnGui()
.catch (error) =>
@failed(taskData, callback, error)
on_TASK_FAILED: (taskData, modulePreset, callback) ->
delay = if process.env.MCONN_MODULE_HELLOWORLD_DELAY then process.env.MCONN_MODULE_HELLOWORLD_DELAY else 250
Q.delay(delay)
.then =>
path = taskData.getData().taskId
@removeFromZKInventory(path)
.then =>
@logger.info(modulePreset.options.actions.remove + " " + taskData.getData().taskId)
@success(taskData, callback)
@updateInventoryOnGui()
.catch (error) =>
@failed(taskData, callback, error)
on_UNDEFINED_STATUS: (taskData, modulePreset, callback) ->
delay = if process.env.MCONN_MODULE_HELLOWORLD_DELAY then process.env.MCONN_MODULE_HELLOWORLD_DELAY else 0
Q.delay(delay)
.then =>
@logger.info("\"" + taskData.getData().taskStatus + "\" is an undefined taskStatus and the task
\"" + taskData.getData().taskId + "\" will be proceed without actions")
@undefinedStatus(taskData, callback)
@updateInventoryOnGui()
.catch (error) =>
@failed(taskData, callback, error)
on_TASK_KILLED: (taskData, modulePreset, callback) ->
@on_TASK_FAILED(taskData, modulePreset, callback)
on_TASK_LOST: (taskData, modulePreset, callback) ->
@on_TASK_FAILED(taskData, modulePreset, callback)
on_TASK_FINISHED: (taskData, modulePreset, callback) ->
@on_TASK_FAILED(taskData, modulePreset, callback)
on_TASK_STAGING: (taskData, modulePreset, callback) ->
@on_UNDEFINED_STATUS(taskData, modulePreset, callback)
on_TASK_STARTING: (taskData, modulePreset, callback) ->
@on_UNDEFINED_STATUS(taskData, modulePreset, callback)
cleanUpInventory: (result) ->
@logger.debug("INFO", "Starting inventory cleanup")
deferred = Q.defer()
for m in result.missing
m.taskStatus = "TASK_RUNNING"
@addTask(m, =>
@logger.info("Cleanup task \"" + m.getData().taskId + "\" successfully added")
)
for o in result.wrong
o.taskStatus = "TASK_KILLED"
@addTask(o, =>
@logger.info("Cleanup task \"" + o.getData().taskId + "\" successfully removed")
)
@logger.info("Cleanup initiated, added \"" + (result.wrong.length + result.missing.length) + "\" tasks")
deferred.resolve()
deferred.promise
module.exports = HelloWorld
| true | #
# MConn Framework
# https://www.github.com/livespotting/mconn
#
# @copyright 2015 Livespotting Media GmbH
# @license Apache-2.0
#
# @author PI:NAME:<NAME>END_PI [PI:EMAIL:<EMAIL>END_PI]
# @author PI:NAME:<NAME>END_PI [PI:EMAIL:<EMAIL>END_PI]
#
Module = require(require("path").join(process.env.MCONN_PATH, "bin/classes/Module"))
Q = require("q")
class HelloWorld extends Module
timeout: 600000
constructor: ->
super("HelloWorld")
@
init: (options, moduleRouter, folder) ->
Q = require("q") #requirement for init method
deferred = Q.defer()
super(options, moduleRouter, folder)
.then =>
moduleRouter.get @createModuleRoute("custom"), (req, res) =>
res.render(@getTemplatePath("custom"),
modulename: @name
activeSubmenu: "custom"
)
fruits = ["Bananas", "Apple", "Blackberries", "Cranberries"]
i = 0
setInterval =>
@getWebsocketHandler().then (io) ->
if io
fruitsSnippet = fruits.slice(0,i)
i = (i + 1) % 4
io.of("/HelloWorld").emit("updateHelloWorld", fruitsSnippet)
, 1500
deferred.resolve()
.catch (error) =>
@logger.error error
deferred.promise
on_TASK_RUNNING: (taskData, modulePreset, callback) ->
delay = if process.env.MCONN_MODULE_HELLOWORLD_DELAY then process.env.MCONN_MODULE_HELLOWORLD_DELAY else 250
Q.delay(delay)
.then =>
path = taskData.getData().taskId
customData = modulePreset.options.actions.add
return @addToZKInventory(path, customData, taskData)
.then =>
@logger.info(modulePreset.options.actions.add + " \"" + taskData.getData().taskId + "\"")
@success(taskData, callback)
@updateInventoryOnGui()
.catch (error) =>
@failed(taskData, callback, error)
on_TASK_FAILED: (taskData, modulePreset, callback) ->
delay = if process.env.MCONN_MODULE_HELLOWORLD_DELAY then process.env.MCONN_MODULE_HELLOWORLD_DELAY else 250
Q.delay(delay)
.then =>
path = taskData.getData().taskId
@removeFromZKInventory(path)
.then =>
@logger.info(modulePreset.options.actions.remove + " " + taskData.getData().taskId)
@success(taskData, callback)
@updateInventoryOnGui()
.catch (error) =>
@failed(taskData, callback, error)
on_UNDEFINED_STATUS: (taskData, modulePreset, callback) ->
delay = if process.env.MCONN_MODULE_HELLOWORLD_DELAY then process.env.MCONN_MODULE_HELLOWORLD_DELAY else 0
Q.delay(delay)
.then =>
@logger.info("\"" + taskData.getData().taskStatus + "\" is an undefined taskStatus and the task
\"" + taskData.getData().taskId + "\" will be proceed without actions")
@undefinedStatus(taskData, callback)
@updateInventoryOnGui()
.catch (error) =>
@failed(taskData, callback, error)
on_TASK_KILLED: (taskData, modulePreset, callback) ->
@on_TASK_FAILED(taskData, modulePreset, callback)
on_TASK_LOST: (taskData, modulePreset, callback) ->
@on_TASK_FAILED(taskData, modulePreset, callback)
on_TASK_FINISHED: (taskData, modulePreset, callback) ->
@on_TASK_FAILED(taskData, modulePreset, callback)
on_TASK_STAGING: (taskData, modulePreset, callback) ->
@on_UNDEFINED_STATUS(taskData, modulePreset, callback)
on_TASK_STARTING: (taskData, modulePreset, callback) ->
@on_UNDEFINED_STATUS(taskData, modulePreset, callback)
cleanUpInventory: (result) ->
@logger.debug("INFO", "Starting inventory cleanup")
deferred = Q.defer()
for m in result.missing
m.taskStatus = "TASK_RUNNING"
@addTask(m, =>
@logger.info("Cleanup task \"" + m.getData().taskId + "\" successfully added")
)
for o in result.wrong
o.taskStatus = "TASK_KILLED"
@addTask(o, =>
@logger.info("Cleanup task \"" + o.getData().taskId + "\" successfully removed")
)
@logger.info("Cleanup initiated, added \"" + (result.wrong.length + result.missing.length) + "\" tasks")
deferred.resolve()
deferred.promise
module.exports = HelloWorld
|
[
{
"context": "w Tests for require-unicode-regexp rule.\n# @author Toru Nagashima\n###\n\n'use strict'\n\n#-----------------------------",
"end": 84,
"score": 0.9998664855957031,
"start": 70,
"tag": "NAME",
"value": "Toru Nagashima"
}
] | src/tests/rules/require-unicode-regexp.coffee | danielbayley/eslint-plugin-coffee | 21 | ###*
# @fileoverview Tests for require-unicode-regexp rule.
# @author Toru Nagashima
###
'use strict'
#------------------------------------------------------------------------------
# Requirements
#------------------------------------------------------------------------------
rule = require 'eslint/lib/rules/require-unicode-regexp'
{RuleTester} = require 'eslint'
path = require 'path'
#------------------------------------------------------------------------------
# Tests
#------------------------------------------------------------------------------
ruleTester = new RuleTester parser: path.join __dirname, '../../..'
ruleTester.run 'require-unicode-regexp', rule,
valid: [
'/foo/u'
'/foo/gimuy'
"RegExp('', 'u')"
"new RegExp('', 'u')"
"RegExp '', 'gimuy'"
"new RegExp('', 'gimuy')"
'''
flags = 'u'
new RegExp('', flags)
'''
'''
flags = 'g'
new RegExp('', flags + 'u')
'''
'''
flags = 'gimu'
new RegExp('foo', flags.slice(1))
'''
"new RegExp('', flags)"
"f = (flags) -> new RegExp('', flags)"
"f = (RegExp) -> return new RegExp('foo')"
]
invalid: [
code: '/foo/'
errors: [messageId: 'requireUFlag']
,
code: '/foo/gimy'
errors: [messageId: 'requireUFlag']
,
code: "RegExp('foo')"
errors: [messageId: 'requireUFlag']
,
code: "RegExp('foo', '')"
errors: [messageId: 'requireUFlag']
,
code: "RegExp 'foo', 'gimy'"
errors: [messageId: 'requireUFlag']
,
code: "new RegExp('foo')"
errors: [messageId: 'requireUFlag']
,
code: "new RegExp('foo', '')"
errors: [messageId: 'requireUFlag']
,
code: "new RegExp('foo', 'gimy')"
errors: [messageId: 'requireUFlag']
,
# ,
# code: """
# flags = 'gi'
# new RegExp('foo', flags)
# """
# errors: [messageId: 'requireUFlag']
# ,
# code: """
# flags = 'gimu'
# new RegExp('foo', flags.slice(0, -1))
# """
# errors: [messageId: 'requireUFlag']
code: "new window.RegExp('foo')"
errors: [messageId: 'requireUFlag']
env: browser: yes
,
code: "new global.RegExp('foo')"
errors: [messageId: 'requireUFlag']
env: node: yes
]
| 10283 | ###*
# @fileoverview Tests for require-unicode-regexp rule.
# @author <NAME>
###
'use strict'
#------------------------------------------------------------------------------
# Requirements
#------------------------------------------------------------------------------
rule = require 'eslint/lib/rules/require-unicode-regexp'
{RuleTester} = require 'eslint'
path = require 'path'
#------------------------------------------------------------------------------
# Tests
#------------------------------------------------------------------------------
ruleTester = new RuleTester parser: path.join __dirname, '../../..'
ruleTester.run 'require-unicode-regexp', rule,
valid: [
'/foo/u'
'/foo/gimuy'
"RegExp('', 'u')"
"new RegExp('', 'u')"
"RegExp '', 'gimuy'"
"new RegExp('', 'gimuy')"
'''
flags = 'u'
new RegExp('', flags)
'''
'''
flags = 'g'
new RegExp('', flags + 'u')
'''
'''
flags = 'gimu'
new RegExp('foo', flags.slice(1))
'''
"new RegExp('', flags)"
"f = (flags) -> new RegExp('', flags)"
"f = (RegExp) -> return new RegExp('foo')"
]
invalid: [
code: '/foo/'
errors: [messageId: 'requireUFlag']
,
code: '/foo/gimy'
errors: [messageId: 'requireUFlag']
,
code: "RegExp('foo')"
errors: [messageId: 'requireUFlag']
,
code: "RegExp('foo', '')"
errors: [messageId: 'requireUFlag']
,
code: "RegExp 'foo', 'gimy'"
errors: [messageId: 'requireUFlag']
,
code: "new RegExp('foo')"
errors: [messageId: 'requireUFlag']
,
code: "new RegExp('foo', '')"
errors: [messageId: 'requireUFlag']
,
code: "new RegExp('foo', 'gimy')"
errors: [messageId: 'requireUFlag']
,
# ,
# code: """
# flags = 'gi'
# new RegExp('foo', flags)
# """
# errors: [messageId: 'requireUFlag']
# ,
# code: """
# flags = 'gimu'
# new RegExp('foo', flags.slice(0, -1))
# """
# errors: [messageId: 'requireUFlag']
code: "new window.RegExp('foo')"
errors: [messageId: 'requireUFlag']
env: browser: yes
,
code: "new global.RegExp('foo')"
errors: [messageId: 'requireUFlag']
env: node: yes
]
| true | ###*
# @fileoverview Tests for require-unicode-regexp rule.
# @author PI:NAME:<NAME>END_PI
###
'use strict'
#------------------------------------------------------------------------------
# Requirements
#------------------------------------------------------------------------------
rule = require 'eslint/lib/rules/require-unicode-regexp'
{RuleTester} = require 'eslint'
path = require 'path'
#------------------------------------------------------------------------------
# Tests
#------------------------------------------------------------------------------
ruleTester = new RuleTester parser: path.join __dirname, '../../..'
ruleTester.run 'require-unicode-regexp', rule,
valid: [
'/foo/u'
'/foo/gimuy'
"RegExp('', 'u')"
"new RegExp('', 'u')"
"RegExp '', 'gimuy'"
"new RegExp('', 'gimuy')"
'''
flags = 'u'
new RegExp('', flags)
'''
'''
flags = 'g'
new RegExp('', flags + 'u')
'''
'''
flags = 'gimu'
new RegExp('foo', flags.slice(1))
'''
"new RegExp('', flags)"
"f = (flags) -> new RegExp('', flags)"
"f = (RegExp) -> return new RegExp('foo')"
]
invalid: [
code: '/foo/'
errors: [messageId: 'requireUFlag']
,
code: '/foo/gimy'
errors: [messageId: 'requireUFlag']
,
code: "RegExp('foo')"
errors: [messageId: 'requireUFlag']
,
code: "RegExp('foo', '')"
errors: [messageId: 'requireUFlag']
,
code: "RegExp 'foo', 'gimy'"
errors: [messageId: 'requireUFlag']
,
code: "new RegExp('foo')"
errors: [messageId: 'requireUFlag']
,
code: "new RegExp('foo', '')"
errors: [messageId: 'requireUFlag']
,
code: "new RegExp('foo', 'gimy')"
errors: [messageId: 'requireUFlag']
,
# ,
# code: """
# flags = 'gi'
# new RegExp('foo', flags)
# """
# errors: [messageId: 'requireUFlag']
# ,
# code: """
# flags = 'gimu'
# new RegExp('foo', flags.slice(0, -1))
# """
# errors: [messageId: 'requireUFlag']
code: "new window.RegExp('foo')"
errors: [messageId: 'requireUFlag']
env: browser: yes
,
code: "new global.RegExp('foo')"
errors: [messageId: 'requireUFlag']
env: node: yes
]
|
[
{
"context": " { name: '+', description: '+' } }\n name: 'Name'\n description: 'Description'\n inner",
"end": 4579,
"score": 0.998112678527832,
"start": 4575,
"tag": "NAME",
"value": "Name"
},
{
"context": "' }, de: { name: '+' }, fr: {} }\n name: 'Name'\n }\n })\n\n m.updateI18NCoverage()",
"end": 4725,
"score": 0.9920344948768616,
"start": 4721,
"tag": "NAME",
"value": "Name"
},
{
"context": " new FlexibleClass()\n m.set({\n name: 'Name'\n i18n: {\n '-': {'-':'-'}\n ",
"end": 4975,
"score": 0.997887909412384,
"start": 4971,
"tag": "NAME",
"value": "Name"
}
] | test/app/models/CocoModel.spec.coffee | pickettd/codecombat | 0 | CocoModel = require 'models/CocoModel'
utils = require 'core/utils'
class BlandClass extends CocoModel
@className: 'Bland'
@schema: {
type: 'object'
additionalProperties: false
properties:
number: {type: 'number'}
object: {type: 'object'}
string: {type: 'string'}
_id: {type: 'string'}
}
urlRoot: '/db/bland'
describe 'CocoModel', ->
describe 'setProjection', ->
it 'takes an array of properties to project and adds them as a query parameter', ->
b = new BlandClass({})
b.setProjection ['number', 'object']
b.fetch()
request = jasmine.Ajax.requests.mostRecent()
expect(decodeURIComponent(request.url).indexOf('project=number,object')).toBeGreaterThan(-1)
it 'can update its projection', ->
baseURL = '/db/bland/test?filter-creator=Mojambo&project=number,object&ignore-evil=false'
unprojectedURL = baseURL.replace /&project=number,object/, ''
b = new BlandClass({})
b.setURL baseURL
expect(b.getURL()).toBe baseURL
b.setProjection ['number', 'object']
expect(b.getURL()).toBe baseURL
b.setProjection ['number']
expect(b.getURL()).toBe baseURL.replace /,object/, ''
b.setProjection []
expect(b.getURL()).toBe unprojectedURL
b.setProjection null
expect(b.getURL()).toBe unprojectedURL
b.setProjection ['object', 'number']
expect(b.getURL()).toBe unprojectedURL + '&project=object,number'
describe 'save', ->
it 'saves to db/<urlRoot>', ->
b = new BlandClass({})
res = b.save()
request = jasmine.Ajax.requests.mostRecent()
expect(res).toBeDefined()
expect(request.url).toBe(b.urlRoot)
expect(request.method).toBe('POST')
it 'does not save if the data is invalid based on the schema', ->
b = new BlandClass({number: 'NaN'})
res = b.save()
expect(res).toBe(false)
request = jasmine.Ajax.requests.mostRecent()
expect(request).toBeUndefined()
it 'uses PUT when _id is included', ->
b = new BlandClass({_id: 'test'})
b.save()
request = jasmine.Ajax.requests.mostRecent()
expect(request.method).toBe('PUT')
describe 'patch', ->
it 'PATCHes only properties that have changed', ->
b = new BlandClass({_id: 'test', number: 1})
b.loaded = true
b.set('string', 'string')
b.patch()
request = jasmine.Ajax.requests.mostRecent()
params = JSON.parse request.params
expect(params.string).toBeDefined()
expect(params.number).toBeUndefined()
it 'collates all changes made over several sets', ->
b = new BlandClass({_id: 'test', number: 1})
b.loaded = true
b.set('string', 'string')
b.set('object', {4: 5})
b.patch()
request = jasmine.Ajax.requests.mostRecent()
params = JSON.parse request.params
expect(params.string).toBeDefined()
expect(params.object).toBeDefined()
expect(params.number).toBeUndefined()
it 'does not include data from previous patches', ->
b = new BlandClass({_id: 'test', number: 1})
b.loaded = true
b.set('object', {1: 2})
b.patch()
request = jasmine.Ajax.requests.mostRecent()
attrs = JSON.stringify(b.attributes) # server responds with all
request.respondWith({status: 200, responseText: attrs})
b.set('number', 3)
b.patch()
request = jasmine.Ajax.requests.mostRecent()
params = JSON.parse request.params
expect(params.object).toBeUndefined()
it 'does nothing when there\'s nothing to patch', ->
b = new BlandClass({_id: 'test', number: 1})
b.loaded = true
b.set('number', 1)
b.patch()
request = jasmine.Ajax.requests.mostRecent()
expect(request).toBeUndefined()
describe 'updateI18NCoverage', ->
class FlexibleClass extends CocoModel
@className: 'Flexible'
@schema: {
type: 'object'
properties: {
name: { type: 'string' }
description: { type: 'string' }
innerObject: {
type: 'object'
properties: {
name: { type: 'string' }
i18n: { type: 'object', format: 'i18n', props: ['name']}
}
}
i18n: { type: 'object', format: 'i18n', props: ['description', 'name', 'prop1']}
}
}
it 'only includes languages for which all objects include a translation', ->
m = new FlexibleClass({
i18n: { es: { name: '+', description: '+' }, fr: { name: '+', description: '+' } }
name: 'Name'
description: 'Description'
innerObject: {
i18n: { es: { name: '+' }, de: { name: '+' }, fr: {} }
name: 'Name'
}
})
m.updateI18NCoverage()
expect(_.isEqual(m.get('i18nCoverage'), ['es'])).toBe(true)
it 'ignores objects for which there is nothing to translate', ->
m = new FlexibleClass()
m.set({
name: 'Name'
i18n: {
'-': {'-':'-'}
'es': {name: 'Name in Spanish'}
}
innerObject: {
i18n: { '-': {'-':'-'} }
}
})
m.updateI18NCoverage()
expect(_.isEqual(m.get('i18nCoverage'), ['es'])).toBe(true)
| 97785 | CocoModel = require 'models/CocoModel'
utils = require 'core/utils'
class BlandClass extends CocoModel
@className: 'Bland'
@schema: {
type: 'object'
additionalProperties: false
properties:
number: {type: 'number'}
object: {type: 'object'}
string: {type: 'string'}
_id: {type: 'string'}
}
urlRoot: '/db/bland'
describe 'CocoModel', ->
describe 'setProjection', ->
it 'takes an array of properties to project and adds them as a query parameter', ->
b = new BlandClass({})
b.setProjection ['number', 'object']
b.fetch()
request = jasmine.Ajax.requests.mostRecent()
expect(decodeURIComponent(request.url).indexOf('project=number,object')).toBeGreaterThan(-1)
it 'can update its projection', ->
baseURL = '/db/bland/test?filter-creator=Mojambo&project=number,object&ignore-evil=false'
unprojectedURL = baseURL.replace /&project=number,object/, ''
b = new BlandClass({})
b.setURL baseURL
expect(b.getURL()).toBe baseURL
b.setProjection ['number', 'object']
expect(b.getURL()).toBe baseURL
b.setProjection ['number']
expect(b.getURL()).toBe baseURL.replace /,object/, ''
b.setProjection []
expect(b.getURL()).toBe unprojectedURL
b.setProjection null
expect(b.getURL()).toBe unprojectedURL
b.setProjection ['object', 'number']
expect(b.getURL()).toBe unprojectedURL + '&project=object,number'
describe 'save', ->
it 'saves to db/<urlRoot>', ->
b = new BlandClass({})
res = b.save()
request = jasmine.Ajax.requests.mostRecent()
expect(res).toBeDefined()
expect(request.url).toBe(b.urlRoot)
expect(request.method).toBe('POST')
it 'does not save if the data is invalid based on the schema', ->
b = new BlandClass({number: 'NaN'})
res = b.save()
expect(res).toBe(false)
request = jasmine.Ajax.requests.mostRecent()
expect(request).toBeUndefined()
it 'uses PUT when _id is included', ->
b = new BlandClass({_id: 'test'})
b.save()
request = jasmine.Ajax.requests.mostRecent()
expect(request.method).toBe('PUT')
describe 'patch', ->
it 'PATCHes only properties that have changed', ->
b = new BlandClass({_id: 'test', number: 1})
b.loaded = true
b.set('string', 'string')
b.patch()
request = jasmine.Ajax.requests.mostRecent()
params = JSON.parse request.params
expect(params.string).toBeDefined()
expect(params.number).toBeUndefined()
it 'collates all changes made over several sets', ->
b = new BlandClass({_id: 'test', number: 1})
b.loaded = true
b.set('string', 'string')
b.set('object', {4: 5})
b.patch()
request = jasmine.Ajax.requests.mostRecent()
params = JSON.parse request.params
expect(params.string).toBeDefined()
expect(params.object).toBeDefined()
expect(params.number).toBeUndefined()
it 'does not include data from previous patches', ->
b = new BlandClass({_id: 'test', number: 1})
b.loaded = true
b.set('object', {1: 2})
b.patch()
request = jasmine.Ajax.requests.mostRecent()
attrs = JSON.stringify(b.attributes) # server responds with all
request.respondWith({status: 200, responseText: attrs})
b.set('number', 3)
b.patch()
request = jasmine.Ajax.requests.mostRecent()
params = JSON.parse request.params
expect(params.object).toBeUndefined()
it 'does nothing when there\'s nothing to patch', ->
b = new BlandClass({_id: 'test', number: 1})
b.loaded = true
b.set('number', 1)
b.patch()
request = jasmine.Ajax.requests.mostRecent()
expect(request).toBeUndefined()
describe 'updateI18NCoverage', ->
class FlexibleClass extends CocoModel
@className: 'Flexible'
@schema: {
type: 'object'
properties: {
name: { type: 'string' }
description: { type: 'string' }
innerObject: {
type: 'object'
properties: {
name: { type: 'string' }
i18n: { type: 'object', format: 'i18n', props: ['name']}
}
}
i18n: { type: 'object', format: 'i18n', props: ['description', 'name', 'prop1']}
}
}
it 'only includes languages for which all objects include a translation', ->
m = new FlexibleClass({
i18n: { es: { name: '+', description: '+' }, fr: { name: '+', description: '+' } }
name: '<NAME>'
description: 'Description'
innerObject: {
i18n: { es: { name: '+' }, de: { name: '+' }, fr: {} }
name: '<NAME>'
}
})
m.updateI18NCoverage()
expect(_.isEqual(m.get('i18nCoverage'), ['es'])).toBe(true)
it 'ignores objects for which there is nothing to translate', ->
m = new FlexibleClass()
m.set({
name: '<NAME>'
i18n: {
'-': {'-':'-'}
'es': {name: 'Name in Spanish'}
}
innerObject: {
i18n: { '-': {'-':'-'} }
}
})
m.updateI18NCoverage()
expect(_.isEqual(m.get('i18nCoverage'), ['es'])).toBe(true)
| true | CocoModel = require 'models/CocoModel'
utils = require 'core/utils'
class BlandClass extends CocoModel
@className: 'Bland'
@schema: {
type: 'object'
additionalProperties: false
properties:
number: {type: 'number'}
object: {type: 'object'}
string: {type: 'string'}
_id: {type: 'string'}
}
urlRoot: '/db/bland'
describe 'CocoModel', ->
describe 'setProjection', ->
it 'takes an array of properties to project and adds them as a query parameter', ->
b = new BlandClass({})
b.setProjection ['number', 'object']
b.fetch()
request = jasmine.Ajax.requests.mostRecent()
expect(decodeURIComponent(request.url).indexOf('project=number,object')).toBeGreaterThan(-1)
it 'can update its projection', ->
baseURL = '/db/bland/test?filter-creator=Mojambo&project=number,object&ignore-evil=false'
unprojectedURL = baseURL.replace /&project=number,object/, ''
b = new BlandClass({})
b.setURL baseURL
expect(b.getURL()).toBe baseURL
b.setProjection ['number', 'object']
expect(b.getURL()).toBe baseURL
b.setProjection ['number']
expect(b.getURL()).toBe baseURL.replace /,object/, ''
b.setProjection []
expect(b.getURL()).toBe unprojectedURL
b.setProjection null
expect(b.getURL()).toBe unprojectedURL
b.setProjection ['object', 'number']
expect(b.getURL()).toBe unprojectedURL + '&project=object,number'
describe 'save', ->
it 'saves to db/<urlRoot>', ->
b = new BlandClass({})
res = b.save()
request = jasmine.Ajax.requests.mostRecent()
expect(res).toBeDefined()
expect(request.url).toBe(b.urlRoot)
expect(request.method).toBe('POST')
it 'does not save if the data is invalid based on the schema', ->
b = new BlandClass({number: 'NaN'})
res = b.save()
expect(res).toBe(false)
request = jasmine.Ajax.requests.mostRecent()
expect(request).toBeUndefined()
it 'uses PUT when _id is included', ->
b = new BlandClass({_id: 'test'})
b.save()
request = jasmine.Ajax.requests.mostRecent()
expect(request.method).toBe('PUT')
describe 'patch', ->
it 'PATCHes only properties that have changed', ->
b = new BlandClass({_id: 'test', number: 1})
b.loaded = true
b.set('string', 'string')
b.patch()
request = jasmine.Ajax.requests.mostRecent()
params = JSON.parse request.params
expect(params.string).toBeDefined()
expect(params.number).toBeUndefined()
it 'collates all changes made over several sets', ->
b = new BlandClass({_id: 'test', number: 1})
b.loaded = true
b.set('string', 'string')
b.set('object', {4: 5})
b.patch()
request = jasmine.Ajax.requests.mostRecent()
params = JSON.parse request.params
expect(params.string).toBeDefined()
expect(params.object).toBeDefined()
expect(params.number).toBeUndefined()
it 'does not include data from previous patches', ->
b = new BlandClass({_id: 'test', number: 1})
b.loaded = true
b.set('object', {1: 2})
b.patch()
request = jasmine.Ajax.requests.mostRecent()
attrs = JSON.stringify(b.attributes) # server responds with all
request.respondWith({status: 200, responseText: attrs})
b.set('number', 3)
b.patch()
request = jasmine.Ajax.requests.mostRecent()
params = JSON.parse request.params
expect(params.object).toBeUndefined()
it 'does nothing when there\'s nothing to patch', ->
b = new BlandClass({_id: 'test', number: 1})
b.loaded = true
b.set('number', 1)
b.patch()
request = jasmine.Ajax.requests.mostRecent()
expect(request).toBeUndefined()
describe 'updateI18NCoverage', ->
class FlexibleClass extends CocoModel
@className: 'Flexible'
@schema: {
type: 'object'
properties: {
name: { type: 'string' }
description: { type: 'string' }
innerObject: {
type: 'object'
properties: {
name: { type: 'string' }
i18n: { type: 'object', format: 'i18n', props: ['name']}
}
}
i18n: { type: 'object', format: 'i18n', props: ['description', 'name', 'prop1']}
}
}
it 'only includes languages for which all objects include a translation', ->
m = new FlexibleClass({
i18n: { es: { name: '+', description: '+' }, fr: { name: '+', description: '+' } }
name: 'PI:NAME:<NAME>END_PI'
description: 'Description'
innerObject: {
i18n: { es: { name: '+' }, de: { name: '+' }, fr: {} }
name: 'PI:NAME:<NAME>END_PI'
}
})
m.updateI18NCoverage()
expect(_.isEqual(m.get('i18nCoverage'), ['es'])).toBe(true)
it 'ignores objects for which there is nothing to translate', ->
m = new FlexibleClass()
m.set({
name: 'PI:NAME:<NAME>END_PI'
i18n: {
'-': {'-':'-'}
'es': {name: 'Name in Spanish'}
}
innerObject: {
i18n: { '-': {'-':'-'} }
}
})
m.updateI18NCoverage()
expect(_.isEqual(m.get('i18nCoverage'), ['es'])).toBe(true)
|
[
{
"context": "l: '2212 3456'\n ci:\n country_name:\n en: 'Cote D\\'Ivoire'\n es: 'Costa de Marfil'\n country_",
"end": 5851,
"score": 0.7325536608695984,
"start": 5845,
"tag": "NAME",
"value": "Cote D"
},
{
"context": " 3456'\n ci:\n country_name:\n en: 'Cote D\\'Ivoire'\n es: 'Costa de Marfil'\n country_code: 22",
"end": 5859,
"score": 0.8163171410560608,
"start": 5853,
"tag": "NAME",
"value": "Ivoire"
},
{
"context": "untry_name:\n en: 'Cote D\\'Ivoire'\n es: 'Costa de Marfil'\n country_code: 225\n example_dial: '21 23 4",
"end": 5887,
"score": 0.9510963559150696,
"start": 5872,
"tag": "NAME",
"value": "Costa de Marfil"
},
{
"context": "2 12 34 56'\n io:\n country_name:\n en: 'Diego Garcia'\n es: 'Diego García'\n country_code",
"end": 6731,
"score": 0.8009935617446899,
"start": 6729,
"tag": "NAME",
"value": "go"
},
{
"context": " 34 56'\n io:\n country_name:\n en: 'Diego Garcia'\n es: 'Diego García'\n country_code: 246\n ",
"end": 6738,
"score": 0.75225830078125,
"start": 6733,
"tag": "NAME",
"value": "arcia"
},
{
"context": "ntry_name:\n en: 'Diego Garcia'\n es: 'Diego García'\n country_code: 246\n example_dial: '",
"end": 6756,
"score": 0.6633169054985046,
"start": 6754,
"tag": "NAME",
"value": "go"
}
] | src/countries.coffee | Tangol/widget | 2 | module.exports =
af:
country_name:
en: 'Afghanistan'
es: 'Afganistán'
country_code: 93
example_dial: '023 456 7890'
al:
country_name:
en: 'Albania'
es: 'Albania'
country_code: 355
example_dial: '022 345 678'
dz:
country_name:
en: 'Algeria'
es: 'Argelia'
country_code: 213
example_dial: '012 34 56 78'
as:
country_name:
en: 'American Samoa'
es: 'Samoa Americana'
country_code: 1684
example_dial: '(684) 622-1234'
ad:
country_name:
en: 'Andorra'
es: 'Andorra'
country_code: 376
example_dial: '712 345'
ao:
country_name:
en: 'Angola'
es: 'Angola'
country_code: 244
example_dial: '222 123 456'
ai:
country_name:
en: 'Anguilla'
es: 'Anguila'
country_code: 1264
example_dial: '(264) 461-2345'
aq:
country_name:
en: 'Antarctic Territories'
es: 'Antártida'
country_code: 672
example_dial: ''
ag:
country_name:
en: 'Antigua & Barbuda'
es: 'Antigua & Barbuda'
country_code: 1268
example_dial: '(268) 460-1234'
an:
country_name:
en: 'Antilles'
es: 'Antillas'
country_code: 599
example_dial: ''
ar:
country_name:
en: 'Argentina'
es: 'Argentina'
country_code: 54
example_dial: '11 2345-6789'
am:
country_name:
en: 'Armenia'
es: 'Armenia'
country_code: 374
example_dial: '(010) 123456'
aw:
country_name:
en: 'Aruba'
es: 'Aruba'
country_code: 297
example_dial: '521 2345'
au:
country_name:
en: 'Australia'
es: 'Australia'
country_code: 61
example_dial: '(02) 1234 5678'
at:
country_name:
en: 'Austria'
es: 'Austria'
country_code: 43
example_dial: '01 234567890'
az:
country_name:
en: 'Azerbaijan'
es: 'Azerbaiyán'
country_code: 994
example_dial: '(012) 312 34 56'
bs:
country_name:
en: 'Bahamas'
es: 'Bahamas'
country_code: 1242
example_dial: '(242) 345-6789'
bh:
country_name:
en: 'Bahrain'
es: 'Bahrein'
country_code: 973
example_dial: '1700 1234'
bd:
country_name:
en: 'Bangladesh'
es: 'Bangladesh'
country_code: 880
example_dial: '02-7111234'
bb:
country_name:
en: 'Barbados'
es: 'Barbados'
country_code: 1246
example_dial: '(246) 234-5678'
by:
country_name:
en: 'Belarus'
es: 'Bielorrusia'
country_code: 375
example_dial: '8 015 245 0911'
be:
country_name:
en: 'Belgium'
es: 'Bélgica'
country_code: 32
example_dial: '012 34 56 78'
bz:
country_name:
en: 'Belize'
es: 'Belice'
country_code: 501
example_dial: '222-1234'
bj:
country_name:
en: 'Benin'
es: 'Benin'
country_code: 229
example_dial: '20 21 12 34'
bm:
country_name:
en: 'Bermuda'
es: 'Bermuda'
country_code: 1441
example_dial: '(441) 234-5678'
bt:
country_name:
en: 'Bhutan'
es: 'Bután'
country_code: 975
example_dial: '2 345 678'
bo:
country_name:
en: 'Bolivia'
es: 'Bolivia'
country_code: 591
example_dial: '2 2123456'
ba:
country_name:
en: 'Bosnia & H.'
es: 'Bosnia & H.'
country_code: 387
example_dial: '030 123-456'
bw:
country_name:
en: 'Botswana'
es: 'Botswana'
country_code: 267
example_dial: '240 1234'
br:
country_name:
en: 'Brazil'
es: 'Brasil'
country_code: 55
example_dial: '(11) 2345-6789'
bn:
country_name:
en: 'Brunei'
es: 'Brunéi'
country_code: 673
example_dial: '234 5678'
bg:
country_name:
en: 'Bulgaria'
es: 'Bulgaria'
country_code: 359
example_dial: '02 123 456'
bf:
country_name:
en: 'Burkina Faso'
es: 'Burkina Faso'
country_code: 226
example_dial: '20 49 12 34'
bi:
country_name:
en: 'Burundi'
es: 'Burundi'
country_code: 257
example_dial: '22 20 12 34'
kh:
country_name:
en: 'Cambodia'
es: 'Camboya'
country_code: 855
example_dial: '023 456 789'
cm:
country_name:
en: 'Cameroon'
es: 'Camerún'
country_code: 237
example_dial: '22 12 34 56'
ca:
country_name:
en: 'Canada'
es: 'Canada'
country_code: 1
example_dial: '(204) 234-5678'
cv:
country_name:
en: 'Cape Verde Island'
es: 'Isla Cabo Verde'
country_code: 238
example_dial: '221 12 34'
ky:
country_name:
en: 'Cayman Islands'
es: 'Islas Caimán'
country_code: 1345
example_dial: '(345) 222-1234'
cf:
country_name:
en: 'Central African Rep.'
es: 'Rep Centroafricana.'
country_code: 236
example_dial: '21 61 23 45'
td:
country_name:
en: 'Chad'
es: 'Chad'
country_code: 235
example_dial: '22 50 12 34'
cl:
country_name:
en: 'Chile'
es: 'Chile'
country_code: 56
example_dial: '(2) 2123 4567'
cn:
country_name:
en: 'China'
es: 'China'
country_code: 86
example_dial: '010 1234 5678'
co:
country_name:
en: 'Colombia'
es: 'Colombia'
country_code: 57
example_dial: '(1) 2345678'
km:
country_name:
en: 'Comoros'
es: 'Comoras'
country_code: 269
example_dial: '771 23 45'
cg:
country_name:
en: 'Congo'
es: 'Congo'
country_code: 242
example_dial: '22 212 3456'
ck:
country_name:
en: 'Cook Islands'
es: 'Islas Cook'
country_code: 682
example_dial: '21 234'
cr:
country_name:
en: 'Costa Rica'
es: 'Costa Rica'
country_code: 506
example_dial: '2212 3456'
ci:
country_name:
en: 'Cote D\'Ivoire'
es: 'Costa de Marfil'
country_code: 225
example_dial: '21 23 45 67'
hr:
country_name:
en: 'Croatia'
es: 'Croacia'
country_code: 385
example_dial: '01 2345 678'
cu:
country_name:
en: 'Cuba'
es: 'Cuba'
country_code: 53
example_dial: '(07) 1234567'
cy:
country_name:
en: 'Cyprus South'
es: 'Chipre'
country_code: 357
example_dial: '22 345678'
cz:
country_name:
en: 'Czech Republic'
es: 'República Checa'
country_code: 420
example_dial: '212 345 678'
cd:
country_name:
en: 'Dem Rep Congo'
es: 'República Democrática del Congo'
country_code: 243
example_dial: '012 34567'
dk:
country_name:
en: 'Denmark'
es: 'Dinamarca'
country_code: 45
example_dial: '32 12 34 56'
io:
country_name:
en: 'Diego Garcia'
es: 'Diego García'
country_code: 246
example_dial: '370 9100'
dj:
country_name:
en: 'Djibouti'
es: 'Djibouti'
country_code: 253
example_dial: '21 36 00 03'
dm:
country_name:
en: 'Dominica'
es: 'Dominica'
country_code: 1767
example_dial: '(767) 420-1234'
tl:
country_name:
en: 'East Timor'
es: 'Timor del Este'
country_code: 670
example_dial: '211 2345'
ec:
country_name:
en: 'Ecuador'
es: 'Ecuador'
country_code: 593
example_dial: '(02) 212-3456'
eg:
country_name:
en: 'Egypt'
es: 'Egipto'
country_code: 20
example_dial: '02 34567890'
sv:
country_name:
en: 'El Salvador'
es: 'El Salvador'
country_code: 503
example_dial: '2123 4567'
gq:
country_name:
en: 'Equatorial Guinea'
es: 'Guinea Ecuatorial'
country_code: 240
example_dial: '333 091 234'
er:
country_name:
en: 'Eritrea'
es: 'Eritrea'
country_code: 291
example_dial: '08 370 362'
ee:
country_name:
en: 'Estonia'
es: 'Estonia'
country_code: 372
example_dial: '321 2345'
et:
country_name:
en: 'Ethiopia'
es: 'Etiopía'
country_code: 251
example_dial: '011 111 2345'
fo:
country_name:
en: 'Faeroe Islands'
es: 'Islas Feroe'
country_code: 298
example_dial: '201234'
fk:
country_name:
en: 'Falkland Islands'
es: 'Islas Malvinas'
country_code: 500
example_dial: '31234'
fj:
country_name:
en: 'Fiji'
es: 'Fiji'
country_code: 679
example_dial: '321 2345'
fi:
country_name:
en: 'Finland'
es: 'Finlandia'
country_code: 358
example_dial: '013 12345678'
fr:
country_name:
en: 'France'
es: 'Francia'
country_code: 33
example_dial: '01 23 45 67 89'
gf:
country_name:
en: 'French Guiana'
es: 'Guayana Francesa'
country_code: 594
example_dial: '0594 10 12 34'
pf:
country_name:
en: 'French Polynesia'
es: 'Polinesia Francesa'
country_code: 689
example_dial: '40 12 34'
ga:
country_name:
en: 'Gabon'
es: 'Gabón'
country_code: 241
example_dial: '01 44 12 34'
gm:
country_name:
en: 'Gambia'
es: 'Gambia'
country_code: 220
example_dial: '566 1234'
ge:
country_name:
en: 'Georgia'
es: 'Georgia'
country_code: 995
example_dial: '8 322 12 34 56'
de:
country_name:
en: 'Germany'
es: 'Alemania'
country_code: 49
example_dial: '030 123456'
gh:
country_name:
en: 'Ghana'
es: 'Ghana'
country_code: 233
example_dial: '030 234 5678'
gi:
country_name:
en: 'Gibraltar'
es: 'Gibraltar'
country_code: 350
example_dial: '20012345'
gr:
country_name:
en: 'Greece'
es: 'Grecia'
country_code: 30
example_dial: '21 2345 6789'
gl:
country_name:
en: 'Greenland'
es: 'Groenlandia'
country_code: 299
example_dial: '32 10 00'
gd:
country_name:
en: 'Grenada'
es: 'Granada'
country_code: 1473
example_dial: '(473) 269-1234'
bl:
country_name:
en: 'Guadeloupe'
es: 'Guadalupe'
country_code: 590
example_dial: '0590 27-1234'
gu:
country_name:
en: 'Guam'
es: 'Guam'
country_code: 1671
example_dial: '(671) 300-1234'
gt:
country_name:
en: 'Guatemala'
es: 'Guatemala'
country_code: 502
example_dial: '2245 6789'
gn:
country_name:
en: 'Guinea'
es: 'Guinea'
country_code: 224
example_dial: '30 24 12 34'
gy:
country_name:
en: 'Guyana'
es: 'Guyana'
country_code: 592
example_dial: '220 1234'
ht:
country_name:
en: 'Haiti'
es: 'Haití'
country_code: 509
example_dial: '22 45 3300'
hn:
country_name:
en: 'Honduras'
es: 'Honduras'
country_code: 504
example_dial: '2212-3456'
hk:
country_name:
en: 'Hong Kong'
es: 'Hong Kong'
country_code: 852
example_dial: '2123 4567'
hu:
country_name:
en: 'Hungary'
es: 'Hungría'
country_code: 36
example_dial: '(1) 234 5678'
is:
country_name:
en: 'Iceland'
es: 'Islandia'
country_code: 354
example_dial: '410 1234'
in:
country_name:
en: 'India'
es: 'India'
country_code: 91
example_dial: '011 2345 6789'
id:
country_name:
en: 'Indonesia'
es: 'Indonesia'
country_code: 62
example_dial: '(061) 2345678'
pn:
country_name:
en: 'Inmarsat HSD'
es: 'Inmarsat HSD'
country_code: 870
example_dial: ''
ir:
country_name:
en: 'Iran'
es: 'Irán'
country_code: 98
example_dial: '021 2345 6789'
iq:
country_name:
en: 'Iraq'
es: 'Irak'
country_code: 964
example_dial: '01 234 5678'
ie:
country_name:
en: 'Ireland'
es: 'Irlanda'
country_code: 353
example_dial: '(022) 12345'
il:
country_name:
en: 'Israel'
es: 'Israel'
country_code: 972
example_dial: '02-123-4567'
it:
country_name:
en: 'Italy'
es: 'Italia'
country_code: 39
example_dial: '02 1234 5678'
jm:
country_name:
en: 'Jamaica'
es: 'Jamaica'
country_code: 1876
example_dial: '(876) 512-3456'
jp:
country_name:
en: 'Japan'
es: 'Japón'
country_code: 81
example_dial: ''
jo:
country_name:
en: 'Jordan'
es: 'Jordan'
country_code: 962
example_dial: '(06) 200 1234'
kz:
country_name:
en: 'Kazakhstan'
es: 'Kazajstán'
country_code: 7
example_dial: '8 (712) 345 6789'
ke:
country_name:
en: 'Kenya'
es: 'Kenya'
country_code: 254
example_dial: '020 2012345'
ki:
country_name:
en: 'Kiribati'
es: 'Kiribati'
country_code: 686
example_dial: '31234'
kp:
country_name:
en: 'Korea North'
es: 'Corea del Norte'
country_code: 850
example_dial: '02 123 4567'
kr:
country_name:
en: 'Korea South'
es: 'Corea del Sur'
country_code: 82
example_dial: '02-212-3456'
kw:
country_name:
en: 'Kuwait'
es: 'Kuwait'
country_code: 965
example_dial: '2234 5678'
kg:
country_name:
en: 'Kyrgyzstan'
es: 'Kirguistán'
country_code: 996
example_dial: '0312 123 456'
la:
country_name:
en: 'Laos'
es: 'Laos'
country_code: 856
example_dial: '021 212 862'
lv:
country_name:
en: 'Latvia'
es: 'Letonia'
country_code: 371
example_dial: '63 123 456'
lb:
country_name:
en: 'Lebanon'
es: 'Líbano'
country_code: 961
example_dial: '01 123 456'
ls:
country_name:
en: 'Lesotho'
es: 'Lesotho'
country_code: 266
example_dial: '2212 3456'
lr:
country_name:
en: 'Liberia'
es: 'Liberia'
country_code: 231
example_dial: '021 234 567'
ly:
country_name:
en: 'Libya'
es: 'Libia'
country_code: 218
example_dial: '021-2345678'
li:
country_name:
en: 'Liechtenstein'
es: 'Liechtenstein'
country_code: 423
example_dial: '234 56 78'
lt:
country_name:
en: 'Lithuania'
es: 'Lituania'
country_code: 370
example_dial: '(8-312) 34567'
lu:
country_name:
en: 'Luxembourg'
es: 'Luxemburgo'
country_code: 352
example_dial: '27 12 34 56'
mo:
country_name:
en: 'Macao'
es: 'Macao'
country_code: 853
example_dial: '2821 2345'
mk:
country_name:
en: 'Macedonia'
es: 'Macedonia'
country_code: 389
example_dial: '02 221 2345'
mg:
country_name:
en: 'Madagascar'
es: 'Madagascar'
country_code: 261
example_dial: '020 21 234 56'
mw:
country_name:
en: 'Malawi'
es: 'Malawi'
country_code: 265
example_dial: '01 234 567'
my:
country_name:
en: 'Malaysia'
es: 'Malasia'
country_code: 60
example_dial: '03-2345 6789'
mv:
country_name:
en: 'Maldives'
es: 'Maldivas'
country_code: 960
example_dial: '670-1234'
ml:
country_name:
en: 'Mali'
es: 'Malí'
country_code: 223
example_dial: '20 21 23 45'
mt:
country_name:
en: 'Malta'
es: 'Malta'
country_code: 356
example_dial: '2100 1234'
mh:
country_name:
en: 'Marshall Islands'
es: 'Islas Marshall'
country_code: 692
example_dial: '247-1234'
mq:
country_name:
en: 'Martinique'
es: 'Martinica'
country_code: 596
example_dial: '0596 30 12 34'
mr:
country_name:
en: 'Mauritania'
es: 'Mauritania'
country_code: 222
example_dial: '35 12 34 56'
mu:
country_name:
en: 'Mauritius'
es: 'Mauricio'
country_code: 230
example_dial: '201 2345'
yt:
country_name:
en: 'Mayotte'
es: 'Mayotte'
country_code: 262
example_dial: '0269 60 12 34'
mx:
country_name:
en: 'Mexico'
es: 'México'
country_code: 52
example_dial: '55 1234 5678'
fm:
country_name:
en: 'Micronesia'
es: 'Micronesia'
country_code: 691
example_dial: '320 1234'
md:
country_name:
en: 'Moldova'
es: 'Moldavia'
country_code: 373
example_dial: '022 212 345'
mc:
country_name:
en: 'Monaco'
es: 'Mónaco'
country_code: 377
example_dial: '99 12 34 56'
mn:
country_name:
en: 'Mongolia'
es: 'Mongolia'
country_code: 976
example_dial: '5012 3456'
ms:
country_name:
en: 'Montserrat'
es: 'Montserrat'
country_code: 1664
example_dial: '(664) 491-2345'
ma:
country_name:
en: 'Morocco'
es: 'Marruecos'
country_code: 212
example_dial: '0520-123456'
mz:
country_name:
en: 'Mozambique'
es: 'Mozambique'
country_code: 258
example_dial: '21 123 456'
mm:
country_name:
en: 'Myanmar'
es: 'Myanmar'
country_code: 95
example_dial: '01 234 567'
na:
country_name:
en: 'Namibia'
es: 'Namibia'
country_code: 264
example_dial: '061 201 2345'
nr:
country_name:
en: 'Nauru'
es: 'Nauru'
country_code: 674
example_dial: '444 1234'
np:
country_name:
en: 'Nepal'
es: 'Nepal'
country_code: 977
example_dial: '01-4567890'
nl:
country_name:
en: 'Netherlands'
es: 'Países Bajos'
country_code: 31
example_dial: '010 123 4567'
nc:
country_name:
en: 'New Caledonia'
es: 'Nueva Caledonia'
country_code: 687
example_dial: '20.12.34'
nz:
country_name:
en: 'New Zealand'
es: 'Nueva Zelanda'
country_code: 64
example_dial: '03-234 5678'
ni:
country_name:
en: 'Nicaragua'
es: 'Nicaragua'
country_code: 505
example_dial: '2123 4567'
ne:
country_name:
en: 'Niger'
es: 'Níger'
country_code: 227
example_dial: '20 20 12 34'
nu:
country_name:
en: 'Niue'
es: 'Niue'
country_code: 683
example_dial: '4002'
nf:
country_name:
en: 'Norfolk Islands'
es: 'Islas Norfolk'
country_code: 6723
example_dial: '10 6609'
mp:
country_name:
en: 'Northern Marianas'
es: 'Islas Marianas del Norte'
country_code: 1670
example_dial: '(670) 234-5678'
no:
country_name:
en: 'Norway'
es: 'Noruega'
country_code: 47
example_dial: '21 23 45 67'
om:
country_name:
en: 'Oman'
es: 'Omán'
country_code: 968
example_dial: '23 123456'
pk:
country_name:
en: 'Pakistan'
es: 'Pakistán'
country_code: 92
example_dial: '(021) 23456789'
pw:
country_name:
en: 'Palau'
es: 'Palau'
country_code: 680
example_dial: '277 1234'
ps:
country_name:
en: 'Palestine'
es: 'Palestina'
country_code: 970
example_dial: '02 223 4567'
pa:
country_name:
en: 'Panama'
es: 'Panamá'
country_code: 507
example_dial: '200-1234'
pg:
country_name:
en: 'Papua New Guinea'
es: 'Papúa Nueva Guinea'
country_code: 675
example_dial: '312 3456'
py:
country_name:
en: 'Paraguay'
es: 'Paraguay'
country_code: 595
example_dial: '(21) 2345678'
pe:
country_name:
en: 'Peru'
es: 'Perú'
country_code: 51
example_dial: '(01) 1234567'
ph:
country_name:
en: 'Philippines'
es: 'Filipinas'
country_code: 63
example_dial: '(02) 123 4567'
pl:
country_name:
en: 'Poland'
es: 'Polonia'
country_code: 48
example_dial: '12 345 67 89'
pt:
country_name:
en: 'Portugal'
es: 'Portugal'
country_code: 351
example_dial: '212 345 678'
'pr-1':
country_name:
en: 'Puerto Rico'
es: 'Puerto Rico'
country_code: 1939
example_dial: '(939) 234-5678'
'pr-2':
country_name:
en: 'Puerto Rico'
es: 'Puerto Rico'
country_code: 1787
example_dial: '(787) 234-5678'
qa:
country_name:
en: 'Qatar'
es: 'Qatar'
country_code: 974
example_dial: '4412 3456'
re:
country_name:
en: 'Reunion'
es: 'Reunion'
country_code: 262
example_dial: '0262 16 12 34'
ro:
country_name:
en: 'Romania'
es: 'Rumania'
country_code: 40
example_dial: '021 123 4567'
ru:
country_name:
en: 'Russia'
es: 'Rusia'
country_code: 7
example_dial: '8 (301) 123-45-67'
rw:
country_name:
en: 'Rwanda'
es: 'Rwanda'
country_code: 250
example_dial: '250 123 456'
sm:
country_name:
en: 'San Marino'
es: 'San Marino'
country_code: 378
example_dial: '0549 886377'
st:
country_name:
en: 'Sao Tome & Principe'
es: 'Sao Tome & Principe'
country_code: 239
example_dial: '222 1234'
sa:
country_name:
en: 'Saudi Arabia'
es: 'Arabia Saudita'
country_code: 966
example_dial: '01 234 5678'
sn:
country_name:
en: 'Senegal'
es: 'Senegal'
country_code: 221
example_dial: '30 101 23 45'
rs:
country_name:
en: 'Serbia'
es: 'Serbia'
country_code: 381
example_dial: '010 234567'
sc:
country_name:
en: 'Seychelles'
es: 'Seychelles'
country_code: 248
example_dial: '4 217 123'
sl:
country_name:
en: 'Sierra Leone'
es: 'Sierra Leona'
country_code: 232
example_dial: '(022) 221234'
sg:
country_name:
en: 'Singapore'
es: 'Singapur'
country_code: 65
example_dial: '6123 4567'
sk:
country_name:
en: 'Slovak Rep'
es: 'República Eslovaca'
country_code: 421
example_dial: '02x2F123 456 78'
si:
country_name:
en: 'Slovenia'
es: 'Eslovenia'
country_code: 386
example_dial: '(01) 123 45 67'
sb:
country_name:
en: 'Solomon Islands'
es: 'Islas Salomón'
country_code: 677
example_dial: '40123'
so:
country_name:
en: 'Somalia'
es: 'Somalia'
country_code: 252
example_dial: '5 522010'
za:
country_name:
en: 'South Africa'
es: 'Sudáfrica'
country_code: 27
example_dial: '010 123 4567'
es:
country_name:
en: 'Spain'
es: 'España'
country_code: 34
example_dial: '810 12 34 56'
lk:
country_name:
en: 'Sri Lanka'
es: 'Sri Lanka'
country_code: 94
example_dial: '011 2 345678'
sh:
country_name:
en: 'St. Helena'
es: 'St. Helena'
country_code: 290
example_dial: '2158'
kn:
country_name:
en: 'St. Kitts & Nevis'
es: 'St. Kitts & Nieves'
country_code: 1869
example_dial: '(869) 236-1234'
lc:
country_name:
en: 'St. Lucia'
es: 'Santa Lucía'
country_code: 1758
example_dial: '(758) 234-5678'
pm:
country_name:
en: 'St. Pierre & Miquelon'
es: 'St. Pierre & Miquelón'
country_code: 508
example_dial: '041 12 34'
vc:
country_name:
en: 'St. Vincents'
es: 'St. Vincent'
country_code: 1784
example_dial: '(784) 266-1234'
sd:
country_name:
en: 'Sudan'
es: 'Sudán'
country_code: 249
example_dial: '012 123 1234'
sr:
country_name:
en: 'Suriname'
es: 'Suriname'
country_code: 597
example_dial: '211-234'
sz:
country_name:
en: 'Swaziland'
es: 'Swazilandia'
country_code: 268
example_dial: '2217 1234'
se:
country_name:
en: 'Sweden'
es: 'Suecia'
country_code: 46
example_dial: '08-12 34 56'
ch:
country_name:
en: 'Switzerland'
es: 'Suiza'
country_code: 41
example_dial: '021 234 56 78'
sy:
country_name:
en: 'Syria'
es: 'Siria'
country_code: 963
example_dial: '011 234 5678'
tw:
country_name:
en: 'Taiwan'
es: 'Taiwan'
country_code: 886
example_dial: '02 123 4567'
tj:
country_name:
en: 'Tajikstan'
es: 'Tayikistán'
country_code: 992
example_dial: '(8) 372 12 3456'
tz:
country_name:
en: 'Tanzania'
es: 'Tanzania'
country_code: 255
example_dial: '022 234 5678'
th:
country_name:
en: 'Thailand'
es: 'Tailandia'
country_code: 66
example_dial: '02 123 4567'
tg:
country_name:
en: 'Togo'
es: 'Togo'
country_code: 228
example_dial: '22 21 23 45'
tk:
country_name:
en: 'Tokelau'
es: 'Tokelau'
country_code: 690
example_dial: '3010'
to:
country_name:
en: 'Tonga'
es: 'Tonga'
country_code: 676
example_dial: '20-123'
tt:
country_name:
en: 'Trinidad & Tobago'
es: 'Trinidad & amp; Tobago'
country_code: 1868
example_dial: '(868) 221-1234'
tn:
country_name:
en: 'Tunisia'
es: 'Túnez'
country_code: 216
example_dial: '71 234 567'
tr:
country_name:
en: 'Turkey'
es: 'pavo'
country_code: 90
example_dial: '(0212) 345 6789'
tm:
country_name:
en: 'Turkmenistan'
es: 'Turkmenistán'
country_code: 993
example_dial: '(8 12) 34-56-78'
tc:
country_name:
en: 'Turks & Caicos'
es: 'Turks & amp; Caicos'
country_code: 1649
example_dial: '(649) 712-1234'
tv:
country_name:
en: 'Tuvalu'
es: 'Tuvalu'
country_code: 688
example_dial: '20123'
ug:
country_name:
en: 'Uganda'
es: 'Uganda'
country_code: 256
example_dial: '031 2345678'
gb:
country_name:
en: 'United Kingdom'
es: 'Reino Unido'
country_code: 44
example_dial: '0121 234 5678'
ua:
country_name:
en: 'Ukraine'
es: 'Ucrania'
country_code: 380
example_dial: '03112 34567'
ae:
country_name:
en: 'United Arab Emirates'
es: 'Emiratos Árabes Unidos'
country_code: 971
example_dial: '02 234 5678'
uy:
country_name:
en: 'Uruguay'
es: 'Uruguay'
country_code: 598
example_dial: '2123 1234'
us:
country_name:
en: 'United States'
es: 'Estados Unidos'
country_code: 1
example_dial: '(201) 555-0123'
uz:
country_name:
en: 'Uzbekistan'
es: 'Uzbekistán'
country_code: 998
example_dial: '8 66 234 56 78'
vu:
country_name:
en: 'Vanuatu'
es: 'Vanuatu'
country_code: 678
example_dial: '22123'
ve:
country_name:
en: 'Venezuela'
es: 'Venezuela'
country_code: 58
example_dial: '0212-1234567'
vn:
country_name:
en: 'Vietnam'
es: 'Vietnam'
country_code: 84
example_dial: '0210 1234 567'
vg:
country_name:
en: 'Virgin Islands GB'
es: 'Islas Vírgenes GB'
country_code: 1284
example_dial: '(284) 229-1234'
vi:
country_name:
en: 'Virgin Islands USA'
es: 'Islas Vírgenes de EE.UU.'
country_code: 1340
example_dial: '(340) 642-1234'
wf:
country_name:
en: 'Wallis & Futuna'
es: 'Wallis & Futuna'
country_code: 681
example_dial: '50 12 34'
ws:
country_name:
en: 'Western Samoa'
es: 'Samoa Occidental'
country_code: 685
example_dial: '22123'
ye:
country_name:
en: 'Yemen'
es: 'Yemen'
country_code: 967
example_dial: '01 234 567'
zm:
country_name:
en: 'Zambia'
es: 'Zambia'
country_code: 260
example_dial: '021 1234567'
zw:
country_name:
en: 'Zimbabwe'
es: 'Zimbabwe'
country_code: 263
example_dial: '013 12345'
'do-1':
country_name:
en: 'Dominican Republic'
es: 'República Dominicana'
country_code: 1849
example_dial: '(849) 234-5678'
'do-2':
country_name:
en: 'Dominican Republic'
es: 'República Dominicana'
country_code: 1809
example_dial: '(809) 234-5678'
'do-3':
country_name:
en: 'Dominican Republic'
es: 'República Dominicana'
country_code: 1829
example_dial: '(829) 234-5678'
gw:
country_name:
en: 'Guinea-Bissau'
es: 'Guinea-Bissau'
country_code: 245
example_dial: '320 1234'
me:
country_name:
en: 'Montenegro'
es: 'Montenegro'
country_code: 382
example_dial: '030 234 567'
ng:
country_name:
en: 'Nigeria'
es: 'Nigeria'
country_code: 234
example_dial: '01 234 5678'
mf:
country_name:
en: 'Saint Martin'
es: 'saint Martin'
country_code: 1599
example_dial: '0590 27-1234'
gp:
country_name:
en: 'Saint Barthelemy'
es: 'San Bartolomé'
country_code: 590
example_dial: '0590 20-1234'
ss:
country_name:
en: 'South Sudan'
es: 'Sudán del Sur'
country_code: 211
example_dial: ''
sx:
country_name:
en: 'Sint Maarten'
es: 'Sint Maarten'
country_code: 1721
example_dial: ''
| 49015 | module.exports =
af:
country_name:
en: 'Afghanistan'
es: 'Afganistán'
country_code: 93
example_dial: '023 456 7890'
al:
country_name:
en: 'Albania'
es: 'Albania'
country_code: 355
example_dial: '022 345 678'
dz:
country_name:
en: 'Algeria'
es: 'Argelia'
country_code: 213
example_dial: '012 34 56 78'
as:
country_name:
en: 'American Samoa'
es: 'Samoa Americana'
country_code: 1684
example_dial: '(684) 622-1234'
ad:
country_name:
en: 'Andorra'
es: 'Andorra'
country_code: 376
example_dial: '712 345'
ao:
country_name:
en: 'Angola'
es: 'Angola'
country_code: 244
example_dial: '222 123 456'
ai:
country_name:
en: 'Anguilla'
es: 'Anguila'
country_code: 1264
example_dial: '(264) 461-2345'
aq:
country_name:
en: 'Antarctic Territories'
es: 'Antártida'
country_code: 672
example_dial: ''
ag:
country_name:
en: 'Antigua & Barbuda'
es: 'Antigua & Barbuda'
country_code: 1268
example_dial: '(268) 460-1234'
an:
country_name:
en: 'Antilles'
es: 'Antillas'
country_code: 599
example_dial: ''
ar:
country_name:
en: 'Argentina'
es: 'Argentina'
country_code: 54
example_dial: '11 2345-6789'
am:
country_name:
en: 'Armenia'
es: 'Armenia'
country_code: 374
example_dial: '(010) 123456'
aw:
country_name:
en: 'Aruba'
es: 'Aruba'
country_code: 297
example_dial: '521 2345'
au:
country_name:
en: 'Australia'
es: 'Australia'
country_code: 61
example_dial: '(02) 1234 5678'
at:
country_name:
en: 'Austria'
es: 'Austria'
country_code: 43
example_dial: '01 234567890'
az:
country_name:
en: 'Azerbaijan'
es: 'Azerbaiyán'
country_code: 994
example_dial: '(012) 312 34 56'
bs:
country_name:
en: 'Bahamas'
es: 'Bahamas'
country_code: 1242
example_dial: '(242) 345-6789'
bh:
country_name:
en: 'Bahrain'
es: 'Bahrein'
country_code: 973
example_dial: '1700 1234'
bd:
country_name:
en: 'Bangladesh'
es: 'Bangladesh'
country_code: 880
example_dial: '02-7111234'
bb:
country_name:
en: 'Barbados'
es: 'Barbados'
country_code: 1246
example_dial: '(246) 234-5678'
by:
country_name:
en: 'Belarus'
es: 'Bielorrusia'
country_code: 375
example_dial: '8 015 245 0911'
be:
country_name:
en: 'Belgium'
es: 'Bélgica'
country_code: 32
example_dial: '012 34 56 78'
bz:
country_name:
en: 'Belize'
es: 'Belice'
country_code: 501
example_dial: '222-1234'
bj:
country_name:
en: 'Benin'
es: 'Benin'
country_code: 229
example_dial: '20 21 12 34'
bm:
country_name:
en: 'Bermuda'
es: 'Bermuda'
country_code: 1441
example_dial: '(441) 234-5678'
bt:
country_name:
en: 'Bhutan'
es: 'Bután'
country_code: 975
example_dial: '2 345 678'
bo:
country_name:
en: 'Bolivia'
es: 'Bolivia'
country_code: 591
example_dial: '2 2123456'
ba:
country_name:
en: 'Bosnia & H.'
es: 'Bosnia & H.'
country_code: 387
example_dial: '030 123-456'
bw:
country_name:
en: 'Botswana'
es: 'Botswana'
country_code: 267
example_dial: '240 1234'
br:
country_name:
en: 'Brazil'
es: 'Brasil'
country_code: 55
example_dial: '(11) 2345-6789'
bn:
country_name:
en: 'Brunei'
es: 'Brunéi'
country_code: 673
example_dial: '234 5678'
bg:
country_name:
en: 'Bulgaria'
es: 'Bulgaria'
country_code: 359
example_dial: '02 123 456'
bf:
country_name:
en: 'Burkina Faso'
es: 'Burkina Faso'
country_code: 226
example_dial: '20 49 12 34'
bi:
country_name:
en: 'Burundi'
es: 'Burundi'
country_code: 257
example_dial: '22 20 12 34'
kh:
country_name:
en: 'Cambodia'
es: 'Camboya'
country_code: 855
example_dial: '023 456 789'
cm:
country_name:
en: 'Cameroon'
es: 'Camerún'
country_code: 237
example_dial: '22 12 34 56'
ca:
country_name:
en: 'Canada'
es: 'Canada'
country_code: 1
example_dial: '(204) 234-5678'
cv:
country_name:
en: 'Cape Verde Island'
es: 'Isla Cabo Verde'
country_code: 238
example_dial: '221 12 34'
ky:
country_name:
en: 'Cayman Islands'
es: 'Islas Caimán'
country_code: 1345
example_dial: '(345) 222-1234'
cf:
country_name:
en: 'Central African Rep.'
es: 'Rep Centroafricana.'
country_code: 236
example_dial: '21 61 23 45'
td:
country_name:
en: 'Chad'
es: 'Chad'
country_code: 235
example_dial: '22 50 12 34'
cl:
country_name:
en: 'Chile'
es: 'Chile'
country_code: 56
example_dial: '(2) 2123 4567'
cn:
country_name:
en: 'China'
es: 'China'
country_code: 86
example_dial: '010 1234 5678'
co:
country_name:
en: 'Colombia'
es: 'Colombia'
country_code: 57
example_dial: '(1) 2345678'
km:
country_name:
en: 'Comoros'
es: 'Comoras'
country_code: 269
example_dial: '771 23 45'
cg:
country_name:
en: 'Congo'
es: 'Congo'
country_code: 242
example_dial: '22 212 3456'
ck:
country_name:
en: 'Cook Islands'
es: 'Islas Cook'
country_code: 682
example_dial: '21 234'
cr:
country_name:
en: 'Costa Rica'
es: 'Costa Rica'
country_code: 506
example_dial: '2212 3456'
ci:
country_name:
en: '<NAME>\'<NAME>'
es: '<NAME>'
country_code: 225
example_dial: '21 23 45 67'
hr:
country_name:
en: 'Croatia'
es: 'Croacia'
country_code: 385
example_dial: '01 2345 678'
cu:
country_name:
en: 'Cuba'
es: 'Cuba'
country_code: 53
example_dial: '(07) 1234567'
cy:
country_name:
en: 'Cyprus South'
es: 'Chipre'
country_code: 357
example_dial: '22 345678'
cz:
country_name:
en: 'Czech Republic'
es: 'República Checa'
country_code: 420
example_dial: '212 345 678'
cd:
country_name:
en: 'Dem Rep Congo'
es: 'República Democrática del Congo'
country_code: 243
example_dial: '012 34567'
dk:
country_name:
en: 'Denmark'
es: 'Dinamarca'
country_code: 45
example_dial: '32 12 34 56'
io:
country_name:
en: 'Die<NAME> G<NAME>'
es: 'Die<NAME> García'
country_code: 246
example_dial: '370 9100'
dj:
country_name:
en: 'Djibouti'
es: 'Djibouti'
country_code: 253
example_dial: '21 36 00 03'
dm:
country_name:
en: 'Dominica'
es: 'Dominica'
country_code: 1767
example_dial: '(767) 420-1234'
tl:
country_name:
en: 'East Timor'
es: 'Timor del Este'
country_code: 670
example_dial: '211 2345'
ec:
country_name:
en: 'Ecuador'
es: 'Ecuador'
country_code: 593
example_dial: '(02) 212-3456'
eg:
country_name:
en: 'Egypt'
es: 'Egipto'
country_code: 20
example_dial: '02 34567890'
sv:
country_name:
en: 'El Salvador'
es: 'El Salvador'
country_code: 503
example_dial: '2123 4567'
gq:
country_name:
en: 'Equatorial Guinea'
es: 'Guinea Ecuatorial'
country_code: 240
example_dial: '333 091 234'
er:
country_name:
en: 'Eritrea'
es: 'Eritrea'
country_code: 291
example_dial: '08 370 362'
ee:
country_name:
en: 'Estonia'
es: 'Estonia'
country_code: 372
example_dial: '321 2345'
et:
country_name:
en: 'Ethiopia'
es: 'Etiopía'
country_code: 251
example_dial: '011 111 2345'
fo:
country_name:
en: 'Faeroe Islands'
es: 'Islas Feroe'
country_code: 298
example_dial: '201234'
fk:
country_name:
en: 'Falkland Islands'
es: 'Islas Malvinas'
country_code: 500
example_dial: '31234'
fj:
country_name:
en: 'Fiji'
es: 'Fiji'
country_code: 679
example_dial: '321 2345'
fi:
country_name:
en: 'Finland'
es: 'Finlandia'
country_code: 358
example_dial: '013 12345678'
fr:
country_name:
en: 'France'
es: 'Francia'
country_code: 33
example_dial: '01 23 45 67 89'
gf:
country_name:
en: 'French Guiana'
es: 'Guayana Francesa'
country_code: 594
example_dial: '0594 10 12 34'
pf:
country_name:
en: 'French Polynesia'
es: 'Polinesia Francesa'
country_code: 689
example_dial: '40 12 34'
ga:
country_name:
en: 'Gabon'
es: 'Gabón'
country_code: 241
example_dial: '01 44 12 34'
gm:
country_name:
en: 'Gambia'
es: 'Gambia'
country_code: 220
example_dial: '566 1234'
ge:
country_name:
en: 'Georgia'
es: 'Georgia'
country_code: 995
example_dial: '8 322 12 34 56'
de:
country_name:
en: 'Germany'
es: 'Alemania'
country_code: 49
example_dial: '030 123456'
gh:
country_name:
en: 'Ghana'
es: 'Ghana'
country_code: 233
example_dial: '030 234 5678'
gi:
country_name:
en: 'Gibraltar'
es: 'Gibraltar'
country_code: 350
example_dial: '20012345'
gr:
country_name:
en: 'Greece'
es: 'Grecia'
country_code: 30
example_dial: '21 2345 6789'
gl:
country_name:
en: 'Greenland'
es: 'Groenlandia'
country_code: 299
example_dial: '32 10 00'
gd:
country_name:
en: 'Grenada'
es: 'Granada'
country_code: 1473
example_dial: '(473) 269-1234'
bl:
country_name:
en: 'Guadeloupe'
es: 'Guadalupe'
country_code: 590
example_dial: '0590 27-1234'
gu:
country_name:
en: 'Guam'
es: 'Guam'
country_code: 1671
example_dial: '(671) 300-1234'
gt:
country_name:
en: 'Guatemala'
es: 'Guatemala'
country_code: 502
example_dial: '2245 6789'
gn:
country_name:
en: 'Guinea'
es: 'Guinea'
country_code: 224
example_dial: '30 24 12 34'
gy:
country_name:
en: 'Guyana'
es: 'Guyana'
country_code: 592
example_dial: '220 1234'
ht:
country_name:
en: 'Haiti'
es: 'Haití'
country_code: 509
example_dial: '22 45 3300'
hn:
country_name:
en: 'Honduras'
es: 'Honduras'
country_code: 504
example_dial: '2212-3456'
hk:
country_name:
en: 'Hong Kong'
es: 'Hong Kong'
country_code: 852
example_dial: '2123 4567'
hu:
country_name:
en: 'Hungary'
es: 'Hungría'
country_code: 36
example_dial: '(1) 234 5678'
is:
country_name:
en: 'Iceland'
es: 'Islandia'
country_code: 354
example_dial: '410 1234'
in:
country_name:
en: 'India'
es: 'India'
country_code: 91
example_dial: '011 2345 6789'
id:
country_name:
en: 'Indonesia'
es: 'Indonesia'
country_code: 62
example_dial: '(061) 2345678'
pn:
country_name:
en: 'Inmarsat HSD'
es: 'Inmarsat HSD'
country_code: 870
example_dial: ''
ir:
country_name:
en: 'Iran'
es: 'Irán'
country_code: 98
example_dial: '021 2345 6789'
iq:
country_name:
en: 'Iraq'
es: 'Irak'
country_code: 964
example_dial: '01 234 5678'
ie:
country_name:
en: 'Ireland'
es: 'Irlanda'
country_code: 353
example_dial: '(022) 12345'
il:
country_name:
en: 'Israel'
es: 'Israel'
country_code: 972
example_dial: '02-123-4567'
it:
country_name:
en: 'Italy'
es: 'Italia'
country_code: 39
example_dial: '02 1234 5678'
jm:
country_name:
en: 'Jamaica'
es: 'Jamaica'
country_code: 1876
example_dial: '(876) 512-3456'
jp:
country_name:
en: 'Japan'
es: 'Japón'
country_code: 81
example_dial: ''
jo:
country_name:
en: 'Jordan'
es: 'Jordan'
country_code: 962
example_dial: '(06) 200 1234'
kz:
country_name:
en: 'Kazakhstan'
es: 'Kazajstán'
country_code: 7
example_dial: '8 (712) 345 6789'
ke:
country_name:
en: 'Kenya'
es: 'Kenya'
country_code: 254
example_dial: '020 2012345'
ki:
country_name:
en: 'Kiribati'
es: 'Kiribati'
country_code: 686
example_dial: '31234'
kp:
country_name:
en: 'Korea North'
es: 'Corea del Norte'
country_code: 850
example_dial: '02 123 4567'
kr:
country_name:
en: 'Korea South'
es: 'Corea del Sur'
country_code: 82
example_dial: '02-212-3456'
kw:
country_name:
en: 'Kuwait'
es: 'Kuwait'
country_code: 965
example_dial: '2234 5678'
kg:
country_name:
en: 'Kyrgyzstan'
es: 'Kirguistán'
country_code: 996
example_dial: '0312 123 456'
la:
country_name:
en: 'Laos'
es: 'Laos'
country_code: 856
example_dial: '021 212 862'
lv:
country_name:
en: 'Latvia'
es: 'Letonia'
country_code: 371
example_dial: '63 123 456'
lb:
country_name:
en: 'Lebanon'
es: 'Líbano'
country_code: 961
example_dial: '01 123 456'
ls:
country_name:
en: 'Lesotho'
es: 'Lesotho'
country_code: 266
example_dial: '2212 3456'
lr:
country_name:
en: 'Liberia'
es: 'Liberia'
country_code: 231
example_dial: '021 234 567'
ly:
country_name:
en: 'Libya'
es: 'Libia'
country_code: 218
example_dial: '021-2345678'
li:
country_name:
en: 'Liechtenstein'
es: 'Liechtenstein'
country_code: 423
example_dial: '234 56 78'
lt:
country_name:
en: 'Lithuania'
es: 'Lituania'
country_code: 370
example_dial: '(8-312) 34567'
lu:
country_name:
en: 'Luxembourg'
es: 'Luxemburgo'
country_code: 352
example_dial: '27 12 34 56'
mo:
country_name:
en: 'Macao'
es: 'Macao'
country_code: 853
example_dial: '2821 2345'
mk:
country_name:
en: 'Macedonia'
es: 'Macedonia'
country_code: 389
example_dial: '02 221 2345'
mg:
country_name:
en: 'Madagascar'
es: 'Madagascar'
country_code: 261
example_dial: '020 21 234 56'
mw:
country_name:
en: 'Malawi'
es: 'Malawi'
country_code: 265
example_dial: '01 234 567'
my:
country_name:
en: 'Malaysia'
es: 'Malasia'
country_code: 60
example_dial: '03-2345 6789'
mv:
country_name:
en: 'Maldives'
es: 'Maldivas'
country_code: 960
example_dial: '670-1234'
ml:
country_name:
en: 'Mali'
es: 'Malí'
country_code: 223
example_dial: '20 21 23 45'
mt:
country_name:
en: 'Malta'
es: 'Malta'
country_code: 356
example_dial: '2100 1234'
mh:
country_name:
en: 'Marshall Islands'
es: 'Islas Marshall'
country_code: 692
example_dial: '247-1234'
mq:
country_name:
en: 'Martinique'
es: 'Martinica'
country_code: 596
example_dial: '0596 30 12 34'
mr:
country_name:
en: 'Mauritania'
es: 'Mauritania'
country_code: 222
example_dial: '35 12 34 56'
mu:
country_name:
en: 'Mauritius'
es: 'Mauricio'
country_code: 230
example_dial: '201 2345'
yt:
country_name:
en: 'Mayotte'
es: 'Mayotte'
country_code: 262
example_dial: '0269 60 12 34'
mx:
country_name:
en: 'Mexico'
es: 'México'
country_code: 52
example_dial: '55 1234 5678'
fm:
country_name:
en: 'Micronesia'
es: 'Micronesia'
country_code: 691
example_dial: '320 1234'
md:
country_name:
en: 'Moldova'
es: 'Moldavia'
country_code: 373
example_dial: '022 212 345'
mc:
country_name:
en: 'Monaco'
es: 'Mónaco'
country_code: 377
example_dial: '99 12 34 56'
mn:
country_name:
en: 'Mongolia'
es: 'Mongolia'
country_code: 976
example_dial: '5012 3456'
ms:
country_name:
en: 'Montserrat'
es: 'Montserrat'
country_code: 1664
example_dial: '(664) 491-2345'
ma:
country_name:
en: 'Morocco'
es: 'Marruecos'
country_code: 212
example_dial: '0520-123456'
mz:
country_name:
en: 'Mozambique'
es: 'Mozambique'
country_code: 258
example_dial: '21 123 456'
mm:
country_name:
en: 'Myanmar'
es: 'Myanmar'
country_code: 95
example_dial: '01 234 567'
na:
country_name:
en: 'Namibia'
es: 'Namibia'
country_code: 264
example_dial: '061 201 2345'
nr:
country_name:
en: 'Nauru'
es: 'Nauru'
country_code: 674
example_dial: '444 1234'
np:
country_name:
en: 'Nepal'
es: 'Nepal'
country_code: 977
example_dial: '01-4567890'
nl:
country_name:
en: 'Netherlands'
es: 'Países Bajos'
country_code: 31
example_dial: '010 123 4567'
nc:
country_name:
en: 'New Caledonia'
es: 'Nueva Caledonia'
country_code: 687
example_dial: '20.12.34'
nz:
country_name:
en: 'New Zealand'
es: 'Nueva Zelanda'
country_code: 64
example_dial: '03-234 5678'
ni:
country_name:
en: 'Nicaragua'
es: 'Nicaragua'
country_code: 505
example_dial: '2123 4567'
ne:
country_name:
en: 'Niger'
es: 'Níger'
country_code: 227
example_dial: '20 20 12 34'
nu:
country_name:
en: 'Niue'
es: 'Niue'
country_code: 683
example_dial: '4002'
nf:
country_name:
en: 'Norfolk Islands'
es: 'Islas Norfolk'
country_code: 6723
example_dial: '10 6609'
mp:
country_name:
en: 'Northern Marianas'
es: 'Islas Marianas del Norte'
country_code: 1670
example_dial: '(670) 234-5678'
no:
country_name:
en: 'Norway'
es: 'Noruega'
country_code: 47
example_dial: '21 23 45 67'
om:
country_name:
en: 'Oman'
es: 'Omán'
country_code: 968
example_dial: '23 123456'
pk:
country_name:
en: 'Pakistan'
es: 'Pakistán'
country_code: 92
example_dial: '(021) 23456789'
pw:
country_name:
en: 'Palau'
es: 'Palau'
country_code: 680
example_dial: '277 1234'
ps:
country_name:
en: 'Palestine'
es: 'Palestina'
country_code: 970
example_dial: '02 223 4567'
pa:
country_name:
en: 'Panama'
es: 'Panamá'
country_code: 507
example_dial: '200-1234'
pg:
country_name:
en: 'Papua New Guinea'
es: 'Papúa Nueva Guinea'
country_code: 675
example_dial: '312 3456'
py:
country_name:
en: 'Paraguay'
es: 'Paraguay'
country_code: 595
example_dial: '(21) 2345678'
pe:
country_name:
en: 'Peru'
es: 'Perú'
country_code: 51
example_dial: '(01) 1234567'
ph:
country_name:
en: 'Philippines'
es: 'Filipinas'
country_code: 63
example_dial: '(02) 123 4567'
pl:
country_name:
en: 'Poland'
es: 'Polonia'
country_code: 48
example_dial: '12 345 67 89'
pt:
country_name:
en: 'Portugal'
es: 'Portugal'
country_code: 351
example_dial: '212 345 678'
'pr-1':
country_name:
en: 'Puerto Rico'
es: 'Puerto Rico'
country_code: 1939
example_dial: '(939) 234-5678'
'pr-2':
country_name:
en: 'Puerto Rico'
es: 'Puerto Rico'
country_code: 1787
example_dial: '(787) 234-5678'
qa:
country_name:
en: 'Qatar'
es: 'Qatar'
country_code: 974
example_dial: '4412 3456'
re:
country_name:
en: 'Reunion'
es: 'Reunion'
country_code: 262
example_dial: '0262 16 12 34'
ro:
country_name:
en: 'Romania'
es: 'Rumania'
country_code: 40
example_dial: '021 123 4567'
ru:
country_name:
en: 'Russia'
es: 'Rusia'
country_code: 7
example_dial: '8 (301) 123-45-67'
rw:
country_name:
en: 'Rwanda'
es: 'Rwanda'
country_code: 250
example_dial: '250 123 456'
sm:
country_name:
en: 'San Marino'
es: 'San Marino'
country_code: 378
example_dial: '0549 886377'
st:
country_name:
en: 'Sao Tome & Principe'
es: 'Sao Tome & Principe'
country_code: 239
example_dial: '222 1234'
sa:
country_name:
en: 'Saudi Arabia'
es: 'Arabia Saudita'
country_code: 966
example_dial: '01 234 5678'
sn:
country_name:
en: 'Senegal'
es: 'Senegal'
country_code: 221
example_dial: '30 101 23 45'
rs:
country_name:
en: 'Serbia'
es: 'Serbia'
country_code: 381
example_dial: '010 234567'
sc:
country_name:
en: 'Seychelles'
es: 'Seychelles'
country_code: 248
example_dial: '4 217 123'
sl:
country_name:
en: 'Sierra Leone'
es: 'Sierra Leona'
country_code: 232
example_dial: '(022) 221234'
sg:
country_name:
en: 'Singapore'
es: 'Singapur'
country_code: 65
example_dial: '6123 4567'
sk:
country_name:
en: 'Slovak Rep'
es: 'República Eslovaca'
country_code: 421
example_dial: '02x2F123 456 78'
si:
country_name:
en: 'Slovenia'
es: 'Eslovenia'
country_code: 386
example_dial: '(01) 123 45 67'
sb:
country_name:
en: 'Solomon Islands'
es: 'Islas Salomón'
country_code: 677
example_dial: '40123'
so:
country_name:
en: 'Somalia'
es: 'Somalia'
country_code: 252
example_dial: '5 522010'
za:
country_name:
en: 'South Africa'
es: 'Sudáfrica'
country_code: 27
example_dial: '010 123 4567'
es:
country_name:
en: 'Spain'
es: 'España'
country_code: 34
example_dial: '810 12 34 56'
lk:
country_name:
en: 'Sri Lanka'
es: 'Sri Lanka'
country_code: 94
example_dial: '011 2 345678'
sh:
country_name:
en: 'St. Helena'
es: 'St. Helena'
country_code: 290
example_dial: '2158'
kn:
country_name:
en: 'St. Kitts & Nevis'
es: 'St. Kitts & Nieves'
country_code: 1869
example_dial: '(869) 236-1234'
lc:
country_name:
en: 'St. Lucia'
es: 'Santa Lucía'
country_code: 1758
example_dial: '(758) 234-5678'
pm:
country_name:
en: 'St. Pierre & Miquelon'
es: 'St. Pierre & Miquelón'
country_code: 508
example_dial: '041 12 34'
vc:
country_name:
en: 'St. Vincents'
es: 'St. Vincent'
country_code: 1784
example_dial: '(784) 266-1234'
sd:
country_name:
en: 'Sudan'
es: 'Sudán'
country_code: 249
example_dial: '012 123 1234'
sr:
country_name:
en: 'Suriname'
es: 'Suriname'
country_code: 597
example_dial: '211-234'
sz:
country_name:
en: 'Swaziland'
es: 'Swazilandia'
country_code: 268
example_dial: '2217 1234'
se:
country_name:
en: 'Sweden'
es: 'Suecia'
country_code: 46
example_dial: '08-12 34 56'
ch:
country_name:
en: 'Switzerland'
es: 'Suiza'
country_code: 41
example_dial: '021 234 56 78'
sy:
country_name:
en: 'Syria'
es: 'Siria'
country_code: 963
example_dial: '011 234 5678'
tw:
country_name:
en: 'Taiwan'
es: 'Taiwan'
country_code: 886
example_dial: '02 123 4567'
tj:
country_name:
en: 'Tajikstan'
es: 'Tayikistán'
country_code: 992
example_dial: '(8) 372 12 3456'
tz:
country_name:
en: 'Tanzania'
es: 'Tanzania'
country_code: 255
example_dial: '022 234 5678'
th:
country_name:
en: 'Thailand'
es: 'Tailandia'
country_code: 66
example_dial: '02 123 4567'
tg:
country_name:
en: 'Togo'
es: 'Togo'
country_code: 228
example_dial: '22 21 23 45'
tk:
country_name:
en: 'Tokelau'
es: 'Tokelau'
country_code: 690
example_dial: '3010'
to:
country_name:
en: 'Tonga'
es: 'Tonga'
country_code: 676
example_dial: '20-123'
tt:
country_name:
en: 'Trinidad & Tobago'
es: 'Trinidad & amp; Tobago'
country_code: 1868
example_dial: '(868) 221-1234'
tn:
country_name:
en: 'Tunisia'
es: 'Túnez'
country_code: 216
example_dial: '71 234 567'
tr:
country_name:
en: 'Turkey'
es: 'pavo'
country_code: 90
example_dial: '(0212) 345 6789'
tm:
country_name:
en: 'Turkmenistan'
es: 'Turkmenistán'
country_code: 993
example_dial: '(8 12) 34-56-78'
tc:
country_name:
en: 'Turks & Caicos'
es: 'Turks & amp; Caicos'
country_code: 1649
example_dial: '(649) 712-1234'
tv:
country_name:
en: 'Tuvalu'
es: 'Tuvalu'
country_code: 688
example_dial: '20123'
ug:
country_name:
en: 'Uganda'
es: 'Uganda'
country_code: 256
example_dial: '031 2345678'
gb:
country_name:
en: 'United Kingdom'
es: 'Reino Unido'
country_code: 44
example_dial: '0121 234 5678'
ua:
country_name:
en: 'Ukraine'
es: 'Ucrania'
country_code: 380
example_dial: '03112 34567'
ae:
country_name:
en: 'United Arab Emirates'
es: 'Emiratos Árabes Unidos'
country_code: 971
example_dial: '02 234 5678'
uy:
country_name:
en: 'Uruguay'
es: 'Uruguay'
country_code: 598
example_dial: '2123 1234'
us:
country_name:
en: 'United States'
es: 'Estados Unidos'
country_code: 1
example_dial: '(201) 555-0123'
uz:
country_name:
en: 'Uzbekistan'
es: 'Uzbekistán'
country_code: 998
example_dial: '8 66 234 56 78'
vu:
country_name:
en: 'Vanuatu'
es: 'Vanuatu'
country_code: 678
example_dial: '22123'
ve:
country_name:
en: 'Venezuela'
es: 'Venezuela'
country_code: 58
example_dial: '0212-1234567'
vn:
country_name:
en: 'Vietnam'
es: 'Vietnam'
country_code: 84
example_dial: '0210 1234 567'
vg:
country_name:
en: 'Virgin Islands GB'
es: 'Islas Vírgenes GB'
country_code: 1284
example_dial: '(284) 229-1234'
vi:
country_name:
en: 'Virgin Islands USA'
es: 'Islas Vírgenes de EE.UU.'
country_code: 1340
example_dial: '(340) 642-1234'
wf:
country_name:
en: 'Wallis & Futuna'
es: 'Wallis & Futuna'
country_code: 681
example_dial: '50 12 34'
ws:
country_name:
en: 'Western Samoa'
es: 'Samoa Occidental'
country_code: 685
example_dial: '22123'
ye:
country_name:
en: 'Yemen'
es: 'Yemen'
country_code: 967
example_dial: '01 234 567'
zm:
country_name:
en: 'Zambia'
es: 'Zambia'
country_code: 260
example_dial: '021 1234567'
zw:
country_name:
en: 'Zimbabwe'
es: 'Zimbabwe'
country_code: 263
example_dial: '013 12345'
'do-1':
country_name:
en: 'Dominican Republic'
es: 'República Dominicana'
country_code: 1849
example_dial: '(849) 234-5678'
'do-2':
country_name:
en: 'Dominican Republic'
es: 'República Dominicana'
country_code: 1809
example_dial: '(809) 234-5678'
'do-3':
country_name:
en: 'Dominican Republic'
es: 'República Dominicana'
country_code: 1829
example_dial: '(829) 234-5678'
gw:
country_name:
en: 'Guinea-Bissau'
es: 'Guinea-Bissau'
country_code: 245
example_dial: '320 1234'
me:
country_name:
en: 'Montenegro'
es: 'Montenegro'
country_code: 382
example_dial: '030 234 567'
ng:
country_name:
en: 'Nigeria'
es: 'Nigeria'
country_code: 234
example_dial: '01 234 5678'
mf:
country_name:
en: 'Saint Martin'
es: 'saint Martin'
country_code: 1599
example_dial: '0590 27-1234'
gp:
country_name:
en: 'Saint Barthelemy'
es: 'San Bartolomé'
country_code: 590
example_dial: '0590 20-1234'
ss:
country_name:
en: 'South Sudan'
es: 'Sudán del Sur'
country_code: 211
example_dial: ''
sx:
country_name:
en: 'Sint Maarten'
es: 'Sint Maarten'
country_code: 1721
example_dial: ''
| true | module.exports =
af:
country_name:
en: 'Afghanistan'
es: 'Afganistán'
country_code: 93
example_dial: '023 456 7890'
al:
country_name:
en: 'Albania'
es: 'Albania'
country_code: 355
example_dial: '022 345 678'
dz:
country_name:
en: 'Algeria'
es: 'Argelia'
country_code: 213
example_dial: '012 34 56 78'
as:
country_name:
en: 'American Samoa'
es: 'Samoa Americana'
country_code: 1684
example_dial: '(684) 622-1234'
ad:
country_name:
en: 'Andorra'
es: 'Andorra'
country_code: 376
example_dial: '712 345'
ao:
country_name:
en: 'Angola'
es: 'Angola'
country_code: 244
example_dial: '222 123 456'
ai:
country_name:
en: 'Anguilla'
es: 'Anguila'
country_code: 1264
example_dial: '(264) 461-2345'
aq:
country_name:
en: 'Antarctic Territories'
es: 'Antártida'
country_code: 672
example_dial: ''
ag:
country_name:
en: 'Antigua & Barbuda'
es: 'Antigua & Barbuda'
country_code: 1268
example_dial: '(268) 460-1234'
an:
country_name:
en: 'Antilles'
es: 'Antillas'
country_code: 599
example_dial: ''
ar:
country_name:
en: 'Argentina'
es: 'Argentina'
country_code: 54
example_dial: '11 2345-6789'
am:
country_name:
en: 'Armenia'
es: 'Armenia'
country_code: 374
example_dial: '(010) 123456'
aw:
country_name:
en: 'Aruba'
es: 'Aruba'
country_code: 297
example_dial: '521 2345'
au:
country_name:
en: 'Australia'
es: 'Australia'
country_code: 61
example_dial: '(02) 1234 5678'
at:
country_name:
en: 'Austria'
es: 'Austria'
country_code: 43
example_dial: '01 234567890'
az:
country_name:
en: 'Azerbaijan'
es: 'Azerbaiyán'
country_code: 994
example_dial: '(012) 312 34 56'
bs:
country_name:
en: 'Bahamas'
es: 'Bahamas'
country_code: 1242
example_dial: '(242) 345-6789'
bh:
country_name:
en: 'Bahrain'
es: 'Bahrein'
country_code: 973
example_dial: '1700 1234'
bd:
country_name:
en: 'Bangladesh'
es: 'Bangladesh'
country_code: 880
example_dial: '02-7111234'
bb:
country_name:
en: 'Barbados'
es: 'Barbados'
country_code: 1246
example_dial: '(246) 234-5678'
by:
country_name:
en: 'Belarus'
es: 'Bielorrusia'
country_code: 375
example_dial: '8 015 245 0911'
be:
country_name:
en: 'Belgium'
es: 'Bélgica'
country_code: 32
example_dial: '012 34 56 78'
bz:
country_name:
en: 'Belize'
es: 'Belice'
country_code: 501
example_dial: '222-1234'
bj:
country_name:
en: 'Benin'
es: 'Benin'
country_code: 229
example_dial: '20 21 12 34'
bm:
country_name:
en: 'Bermuda'
es: 'Bermuda'
country_code: 1441
example_dial: '(441) 234-5678'
bt:
country_name:
en: 'Bhutan'
es: 'Bután'
country_code: 975
example_dial: '2 345 678'
bo:
country_name:
en: 'Bolivia'
es: 'Bolivia'
country_code: 591
example_dial: '2 2123456'
ba:
country_name:
en: 'Bosnia & H.'
es: 'Bosnia & H.'
country_code: 387
example_dial: '030 123-456'
bw:
country_name:
en: 'Botswana'
es: 'Botswana'
country_code: 267
example_dial: '240 1234'
br:
country_name:
en: 'Brazil'
es: 'Brasil'
country_code: 55
example_dial: '(11) 2345-6789'
bn:
country_name:
en: 'Brunei'
es: 'Brunéi'
country_code: 673
example_dial: '234 5678'
bg:
country_name:
en: 'Bulgaria'
es: 'Bulgaria'
country_code: 359
example_dial: '02 123 456'
bf:
country_name:
en: 'Burkina Faso'
es: 'Burkina Faso'
country_code: 226
example_dial: '20 49 12 34'
bi:
country_name:
en: 'Burundi'
es: 'Burundi'
country_code: 257
example_dial: '22 20 12 34'
kh:
country_name:
en: 'Cambodia'
es: 'Camboya'
country_code: 855
example_dial: '023 456 789'
cm:
country_name:
en: 'Cameroon'
es: 'Camerún'
country_code: 237
example_dial: '22 12 34 56'
ca:
country_name:
en: 'Canada'
es: 'Canada'
country_code: 1
example_dial: '(204) 234-5678'
cv:
country_name:
en: 'Cape Verde Island'
es: 'Isla Cabo Verde'
country_code: 238
example_dial: '221 12 34'
ky:
country_name:
en: 'Cayman Islands'
es: 'Islas Caimán'
country_code: 1345
example_dial: '(345) 222-1234'
cf:
country_name:
en: 'Central African Rep.'
es: 'Rep Centroafricana.'
country_code: 236
example_dial: '21 61 23 45'
td:
country_name:
en: 'Chad'
es: 'Chad'
country_code: 235
example_dial: '22 50 12 34'
cl:
country_name:
en: 'Chile'
es: 'Chile'
country_code: 56
example_dial: '(2) 2123 4567'
cn:
country_name:
en: 'China'
es: 'China'
country_code: 86
example_dial: '010 1234 5678'
co:
country_name:
en: 'Colombia'
es: 'Colombia'
country_code: 57
example_dial: '(1) 2345678'
km:
country_name:
en: 'Comoros'
es: 'Comoras'
country_code: 269
example_dial: '771 23 45'
cg:
country_name:
en: 'Congo'
es: 'Congo'
country_code: 242
example_dial: '22 212 3456'
ck:
country_name:
en: 'Cook Islands'
es: 'Islas Cook'
country_code: 682
example_dial: '21 234'
cr:
country_name:
en: 'Costa Rica'
es: 'Costa Rica'
country_code: 506
example_dial: '2212 3456'
ci:
country_name:
en: 'PI:NAME:<NAME>END_PI\'PI:NAME:<NAME>END_PI'
es: 'PI:NAME:<NAME>END_PI'
country_code: 225
example_dial: '21 23 45 67'
hr:
country_name:
en: 'Croatia'
es: 'Croacia'
country_code: 385
example_dial: '01 2345 678'
cu:
country_name:
en: 'Cuba'
es: 'Cuba'
country_code: 53
example_dial: '(07) 1234567'
cy:
country_name:
en: 'Cyprus South'
es: 'Chipre'
country_code: 357
example_dial: '22 345678'
cz:
country_name:
en: 'Czech Republic'
es: 'República Checa'
country_code: 420
example_dial: '212 345 678'
cd:
country_name:
en: 'Dem Rep Congo'
es: 'República Democrática del Congo'
country_code: 243
example_dial: '012 34567'
dk:
country_name:
en: 'Denmark'
es: 'Dinamarca'
country_code: 45
example_dial: '32 12 34 56'
io:
country_name:
en: 'DiePI:NAME:<NAME>END_PI GPI:NAME:<NAME>END_PI'
es: 'DiePI:NAME:<NAME>END_PI García'
country_code: 246
example_dial: '370 9100'
dj:
country_name:
en: 'Djibouti'
es: 'Djibouti'
country_code: 253
example_dial: '21 36 00 03'
dm:
country_name:
en: 'Dominica'
es: 'Dominica'
country_code: 1767
example_dial: '(767) 420-1234'
tl:
country_name:
en: 'East Timor'
es: 'Timor del Este'
country_code: 670
example_dial: '211 2345'
ec:
country_name:
en: 'Ecuador'
es: 'Ecuador'
country_code: 593
example_dial: '(02) 212-3456'
eg:
country_name:
en: 'Egypt'
es: 'Egipto'
country_code: 20
example_dial: '02 34567890'
sv:
country_name:
en: 'El Salvador'
es: 'El Salvador'
country_code: 503
example_dial: '2123 4567'
gq:
country_name:
en: 'Equatorial Guinea'
es: 'Guinea Ecuatorial'
country_code: 240
example_dial: '333 091 234'
er:
country_name:
en: 'Eritrea'
es: 'Eritrea'
country_code: 291
example_dial: '08 370 362'
ee:
country_name:
en: 'Estonia'
es: 'Estonia'
country_code: 372
example_dial: '321 2345'
et:
country_name:
en: 'Ethiopia'
es: 'Etiopía'
country_code: 251
example_dial: '011 111 2345'
fo:
country_name:
en: 'Faeroe Islands'
es: 'Islas Feroe'
country_code: 298
example_dial: '201234'
fk:
country_name:
en: 'Falkland Islands'
es: 'Islas Malvinas'
country_code: 500
example_dial: '31234'
fj:
country_name:
en: 'Fiji'
es: 'Fiji'
country_code: 679
example_dial: '321 2345'
fi:
country_name:
en: 'Finland'
es: 'Finlandia'
country_code: 358
example_dial: '013 12345678'
fr:
country_name:
en: 'France'
es: 'Francia'
country_code: 33
example_dial: '01 23 45 67 89'
gf:
country_name:
en: 'French Guiana'
es: 'Guayana Francesa'
country_code: 594
example_dial: '0594 10 12 34'
pf:
country_name:
en: 'French Polynesia'
es: 'Polinesia Francesa'
country_code: 689
example_dial: '40 12 34'
ga:
country_name:
en: 'Gabon'
es: 'Gabón'
country_code: 241
example_dial: '01 44 12 34'
gm:
country_name:
en: 'Gambia'
es: 'Gambia'
country_code: 220
example_dial: '566 1234'
ge:
country_name:
en: 'Georgia'
es: 'Georgia'
country_code: 995
example_dial: '8 322 12 34 56'
de:
country_name:
en: 'Germany'
es: 'Alemania'
country_code: 49
example_dial: '030 123456'
gh:
country_name:
en: 'Ghana'
es: 'Ghana'
country_code: 233
example_dial: '030 234 5678'
gi:
country_name:
en: 'Gibraltar'
es: 'Gibraltar'
country_code: 350
example_dial: '20012345'
gr:
country_name:
en: 'Greece'
es: 'Grecia'
country_code: 30
example_dial: '21 2345 6789'
gl:
country_name:
en: 'Greenland'
es: 'Groenlandia'
country_code: 299
example_dial: '32 10 00'
gd:
country_name:
en: 'Grenada'
es: 'Granada'
country_code: 1473
example_dial: '(473) 269-1234'
bl:
country_name:
en: 'Guadeloupe'
es: 'Guadalupe'
country_code: 590
example_dial: '0590 27-1234'
gu:
country_name:
en: 'Guam'
es: 'Guam'
country_code: 1671
example_dial: '(671) 300-1234'
gt:
country_name:
en: 'Guatemala'
es: 'Guatemala'
country_code: 502
example_dial: '2245 6789'
gn:
country_name:
en: 'Guinea'
es: 'Guinea'
country_code: 224
example_dial: '30 24 12 34'
gy:
country_name:
en: 'Guyana'
es: 'Guyana'
country_code: 592
example_dial: '220 1234'
ht:
country_name:
en: 'Haiti'
es: 'Haití'
country_code: 509
example_dial: '22 45 3300'
hn:
country_name:
en: 'Honduras'
es: 'Honduras'
country_code: 504
example_dial: '2212-3456'
hk:
country_name:
en: 'Hong Kong'
es: 'Hong Kong'
country_code: 852
example_dial: '2123 4567'
hu:
country_name:
en: 'Hungary'
es: 'Hungría'
country_code: 36
example_dial: '(1) 234 5678'
is:
country_name:
en: 'Iceland'
es: 'Islandia'
country_code: 354
example_dial: '410 1234'
in:
country_name:
en: 'India'
es: 'India'
country_code: 91
example_dial: '011 2345 6789'
id:
country_name:
en: 'Indonesia'
es: 'Indonesia'
country_code: 62
example_dial: '(061) 2345678'
pn:
country_name:
en: 'Inmarsat HSD'
es: 'Inmarsat HSD'
country_code: 870
example_dial: ''
ir:
country_name:
en: 'Iran'
es: 'Irán'
country_code: 98
example_dial: '021 2345 6789'
iq:
country_name:
en: 'Iraq'
es: 'Irak'
country_code: 964
example_dial: '01 234 5678'
ie:
country_name:
en: 'Ireland'
es: 'Irlanda'
country_code: 353
example_dial: '(022) 12345'
il:
country_name:
en: 'Israel'
es: 'Israel'
country_code: 972
example_dial: '02-123-4567'
it:
country_name:
en: 'Italy'
es: 'Italia'
country_code: 39
example_dial: '02 1234 5678'
jm:
country_name:
en: 'Jamaica'
es: 'Jamaica'
country_code: 1876
example_dial: '(876) 512-3456'
jp:
country_name:
en: 'Japan'
es: 'Japón'
country_code: 81
example_dial: ''
jo:
country_name:
en: 'Jordan'
es: 'Jordan'
country_code: 962
example_dial: '(06) 200 1234'
kz:
country_name:
en: 'Kazakhstan'
es: 'Kazajstán'
country_code: 7
example_dial: '8 (712) 345 6789'
ke:
country_name:
en: 'Kenya'
es: 'Kenya'
country_code: 254
example_dial: '020 2012345'
ki:
country_name:
en: 'Kiribati'
es: 'Kiribati'
country_code: 686
example_dial: '31234'
kp:
country_name:
en: 'Korea North'
es: 'Corea del Norte'
country_code: 850
example_dial: '02 123 4567'
kr:
country_name:
en: 'Korea South'
es: 'Corea del Sur'
country_code: 82
example_dial: '02-212-3456'
kw:
country_name:
en: 'Kuwait'
es: 'Kuwait'
country_code: 965
example_dial: '2234 5678'
kg:
country_name:
en: 'Kyrgyzstan'
es: 'Kirguistán'
country_code: 996
example_dial: '0312 123 456'
la:
country_name:
en: 'Laos'
es: 'Laos'
country_code: 856
example_dial: '021 212 862'
lv:
country_name:
en: 'Latvia'
es: 'Letonia'
country_code: 371
example_dial: '63 123 456'
lb:
country_name:
en: 'Lebanon'
es: 'Líbano'
country_code: 961
example_dial: '01 123 456'
ls:
country_name:
en: 'Lesotho'
es: 'Lesotho'
country_code: 266
example_dial: '2212 3456'
lr:
country_name:
en: 'Liberia'
es: 'Liberia'
country_code: 231
example_dial: '021 234 567'
ly:
country_name:
en: 'Libya'
es: 'Libia'
country_code: 218
example_dial: '021-2345678'
li:
country_name:
en: 'Liechtenstein'
es: 'Liechtenstein'
country_code: 423
example_dial: '234 56 78'
lt:
country_name:
en: 'Lithuania'
es: 'Lituania'
country_code: 370
example_dial: '(8-312) 34567'
lu:
country_name:
en: 'Luxembourg'
es: 'Luxemburgo'
country_code: 352
example_dial: '27 12 34 56'
mo:
country_name:
en: 'Macao'
es: 'Macao'
country_code: 853
example_dial: '2821 2345'
mk:
country_name:
en: 'Macedonia'
es: 'Macedonia'
country_code: 389
example_dial: '02 221 2345'
mg:
country_name:
en: 'Madagascar'
es: 'Madagascar'
country_code: 261
example_dial: '020 21 234 56'
mw:
country_name:
en: 'Malawi'
es: 'Malawi'
country_code: 265
example_dial: '01 234 567'
my:
country_name:
en: 'Malaysia'
es: 'Malasia'
country_code: 60
example_dial: '03-2345 6789'
mv:
country_name:
en: 'Maldives'
es: 'Maldivas'
country_code: 960
example_dial: '670-1234'
ml:
country_name:
en: 'Mali'
es: 'Malí'
country_code: 223
example_dial: '20 21 23 45'
mt:
country_name:
en: 'Malta'
es: 'Malta'
country_code: 356
example_dial: '2100 1234'
mh:
country_name:
en: 'Marshall Islands'
es: 'Islas Marshall'
country_code: 692
example_dial: '247-1234'
mq:
country_name:
en: 'Martinique'
es: 'Martinica'
country_code: 596
example_dial: '0596 30 12 34'
mr:
country_name:
en: 'Mauritania'
es: 'Mauritania'
country_code: 222
example_dial: '35 12 34 56'
mu:
country_name:
en: 'Mauritius'
es: 'Mauricio'
country_code: 230
example_dial: '201 2345'
yt:
country_name:
en: 'Mayotte'
es: 'Mayotte'
country_code: 262
example_dial: '0269 60 12 34'
mx:
country_name:
en: 'Mexico'
es: 'México'
country_code: 52
example_dial: '55 1234 5678'
fm:
country_name:
en: 'Micronesia'
es: 'Micronesia'
country_code: 691
example_dial: '320 1234'
md:
country_name:
en: 'Moldova'
es: 'Moldavia'
country_code: 373
example_dial: '022 212 345'
mc:
country_name:
en: 'Monaco'
es: 'Mónaco'
country_code: 377
example_dial: '99 12 34 56'
mn:
country_name:
en: 'Mongolia'
es: 'Mongolia'
country_code: 976
example_dial: '5012 3456'
ms:
country_name:
en: 'Montserrat'
es: 'Montserrat'
country_code: 1664
example_dial: '(664) 491-2345'
ma:
country_name:
en: 'Morocco'
es: 'Marruecos'
country_code: 212
example_dial: '0520-123456'
mz:
country_name:
en: 'Mozambique'
es: 'Mozambique'
country_code: 258
example_dial: '21 123 456'
mm:
country_name:
en: 'Myanmar'
es: 'Myanmar'
country_code: 95
example_dial: '01 234 567'
na:
country_name:
en: 'Namibia'
es: 'Namibia'
country_code: 264
example_dial: '061 201 2345'
nr:
country_name:
en: 'Nauru'
es: 'Nauru'
country_code: 674
example_dial: '444 1234'
np:
country_name:
en: 'Nepal'
es: 'Nepal'
country_code: 977
example_dial: '01-4567890'
nl:
country_name:
en: 'Netherlands'
es: 'Países Bajos'
country_code: 31
example_dial: '010 123 4567'
nc:
country_name:
en: 'New Caledonia'
es: 'Nueva Caledonia'
country_code: 687
example_dial: '20.12.34'
nz:
country_name:
en: 'New Zealand'
es: 'Nueva Zelanda'
country_code: 64
example_dial: '03-234 5678'
ni:
country_name:
en: 'Nicaragua'
es: 'Nicaragua'
country_code: 505
example_dial: '2123 4567'
ne:
country_name:
en: 'Niger'
es: 'Níger'
country_code: 227
example_dial: '20 20 12 34'
nu:
country_name:
en: 'Niue'
es: 'Niue'
country_code: 683
example_dial: '4002'
nf:
country_name:
en: 'Norfolk Islands'
es: 'Islas Norfolk'
country_code: 6723
example_dial: '10 6609'
mp:
country_name:
en: 'Northern Marianas'
es: 'Islas Marianas del Norte'
country_code: 1670
example_dial: '(670) 234-5678'
no:
country_name:
en: 'Norway'
es: 'Noruega'
country_code: 47
example_dial: '21 23 45 67'
om:
country_name:
en: 'Oman'
es: 'Omán'
country_code: 968
example_dial: '23 123456'
pk:
country_name:
en: 'Pakistan'
es: 'Pakistán'
country_code: 92
example_dial: '(021) 23456789'
pw:
country_name:
en: 'Palau'
es: 'Palau'
country_code: 680
example_dial: '277 1234'
ps:
country_name:
en: 'Palestine'
es: 'Palestina'
country_code: 970
example_dial: '02 223 4567'
pa:
country_name:
en: 'Panama'
es: 'Panamá'
country_code: 507
example_dial: '200-1234'
pg:
country_name:
en: 'Papua New Guinea'
es: 'Papúa Nueva Guinea'
country_code: 675
example_dial: '312 3456'
py:
country_name:
en: 'Paraguay'
es: 'Paraguay'
country_code: 595
example_dial: '(21) 2345678'
pe:
country_name:
en: 'Peru'
es: 'Perú'
country_code: 51
example_dial: '(01) 1234567'
ph:
country_name:
en: 'Philippines'
es: 'Filipinas'
country_code: 63
example_dial: '(02) 123 4567'
pl:
country_name:
en: 'Poland'
es: 'Polonia'
country_code: 48
example_dial: '12 345 67 89'
pt:
country_name:
en: 'Portugal'
es: 'Portugal'
country_code: 351
example_dial: '212 345 678'
'pr-1':
country_name:
en: 'Puerto Rico'
es: 'Puerto Rico'
country_code: 1939
example_dial: '(939) 234-5678'
'pr-2':
country_name:
en: 'Puerto Rico'
es: 'Puerto Rico'
country_code: 1787
example_dial: '(787) 234-5678'
qa:
country_name:
en: 'Qatar'
es: 'Qatar'
country_code: 974
example_dial: '4412 3456'
re:
country_name:
en: 'Reunion'
es: 'Reunion'
country_code: 262
example_dial: '0262 16 12 34'
ro:
country_name:
en: 'Romania'
es: 'Rumania'
country_code: 40
example_dial: '021 123 4567'
ru:
country_name:
en: 'Russia'
es: 'Rusia'
country_code: 7
example_dial: '8 (301) 123-45-67'
rw:
country_name:
en: 'Rwanda'
es: 'Rwanda'
country_code: 250
example_dial: '250 123 456'
sm:
country_name:
en: 'San Marino'
es: 'San Marino'
country_code: 378
example_dial: '0549 886377'
st:
country_name:
en: 'Sao Tome & Principe'
es: 'Sao Tome & Principe'
country_code: 239
example_dial: '222 1234'
sa:
country_name:
en: 'Saudi Arabia'
es: 'Arabia Saudita'
country_code: 966
example_dial: '01 234 5678'
sn:
country_name:
en: 'Senegal'
es: 'Senegal'
country_code: 221
example_dial: '30 101 23 45'
rs:
country_name:
en: 'Serbia'
es: 'Serbia'
country_code: 381
example_dial: '010 234567'
sc:
country_name:
en: 'Seychelles'
es: 'Seychelles'
country_code: 248
example_dial: '4 217 123'
sl:
country_name:
en: 'Sierra Leone'
es: 'Sierra Leona'
country_code: 232
example_dial: '(022) 221234'
sg:
country_name:
en: 'Singapore'
es: 'Singapur'
country_code: 65
example_dial: '6123 4567'
sk:
country_name:
en: 'Slovak Rep'
es: 'República Eslovaca'
country_code: 421
example_dial: '02x2F123 456 78'
si:
country_name:
en: 'Slovenia'
es: 'Eslovenia'
country_code: 386
example_dial: '(01) 123 45 67'
sb:
country_name:
en: 'Solomon Islands'
es: 'Islas Salomón'
country_code: 677
example_dial: '40123'
so:
country_name:
en: 'Somalia'
es: 'Somalia'
country_code: 252
example_dial: '5 522010'
za:
country_name:
en: 'South Africa'
es: 'Sudáfrica'
country_code: 27
example_dial: '010 123 4567'
es:
country_name:
en: 'Spain'
es: 'España'
country_code: 34
example_dial: '810 12 34 56'
lk:
country_name:
en: 'Sri Lanka'
es: 'Sri Lanka'
country_code: 94
example_dial: '011 2 345678'
sh:
country_name:
en: 'St. Helena'
es: 'St. Helena'
country_code: 290
example_dial: '2158'
kn:
country_name:
en: 'St. Kitts & Nevis'
es: 'St. Kitts & Nieves'
country_code: 1869
example_dial: '(869) 236-1234'
lc:
country_name:
en: 'St. Lucia'
es: 'Santa Lucía'
country_code: 1758
example_dial: '(758) 234-5678'
pm:
country_name:
en: 'St. Pierre & Miquelon'
es: 'St. Pierre & Miquelón'
country_code: 508
example_dial: '041 12 34'
vc:
country_name:
en: 'St. Vincents'
es: 'St. Vincent'
country_code: 1784
example_dial: '(784) 266-1234'
sd:
country_name:
en: 'Sudan'
es: 'Sudán'
country_code: 249
example_dial: '012 123 1234'
sr:
country_name:
en: 'Suriname'
es: 'Suriname'
country_code: 597
example_dial: '211-234'
sz:
country_name:
en: 'Swaziland'
es: 'Swazilandia'
country_code: 268
example_dial: '2217 1234'
se:
country_name:
en: 'Sweden'
es: 'Suecia'
country_code: 46
example_dial: '08-12 34 56'
ch:
country_name:
en: 'Switzerland'
es: 'Suiza'
country_code: 41
example_dial: '021 234 56 78'
sy:
country_name:
en: 'Syria'
es: 'Siria'
country_code: 963
example_dial: '011 234 5678'
tw:
country_name:
en: 'Taiwan'
es: 'Taiwan'
country_code: 886
example_dial: '02 123 4567'
tj:
country_name:
en: 'Tajikstan'
es: 'Tayikistán'
country_code: 992
example_dial: '(8) 372 12 3456'
tz:
country_name:
en: 'Tanzania'
es: 'Tanzania'
country_code: 255
example_dial: '022 234 5678'
th:
country_name:
en: 'Thailand'
es: 'Tailandia'
country_code: 66
example_dial: '02 123 4567'
tg:
country_name:
en: 'Togo'
es: 'Togo'
country_code: 228
example_dial: '22 21 23 45'
tk:
country_name:
en: 'Tokelau'
es: 'Tokelau'
country_code: 690
example_dial: '3010'
to:
country_name:
en: 'Tonga'
es: 'Tonga'
country_code: 676
example_dial: '20-123'
tt:
country_name:
en: 'Trinidad & Tobago'
es: 'Trinidad & amp; Tobago'
country_code: 1868
example_dial: '(868) 221-1234'
tn:
country_name:
en: 'Tunisia'
es: 'Túnez'
country_code: 216
example_dial: '71 234 567'
tr:
country_name:
en: 'Turkey'
es: 'pavo'
country_code: 90
example_dial: '(0212) 345 6789'
tm:
country_name:
en: 'Turkmenistan'
es: 'Turkmenistán'
country_code: 993
example_dial: '(8 12) 34-56-78'
tc:
country_name:
en: 'Turks & Caicos'
es: 'Turks & amp; Caicos'
country_code: 1649
example_dial: '(649) 712-1234'
tv:
country_name:
en: 'Tuvalu'
es: 'Tuvalu'
country_code: 688
example_dial: '20123'
ug:
country_name:
en: 'Uganda'
es: 'Uganda'
country_code: 256
example_dial: '031 2345678'
gb:
country_name:
en: 'United Kingdom'
es: 'Reino Unido'
country_code: 44
example_dial: '0121 234 5678'
ua:
country_name:
en: 'Ukraine'
es: 'Ucrania'
country_code: 380
example_dial: '03112 34567'
ae:
country_name:
en: 'United Arab Emirates'
es: 'Emiratos Árabes Unidos'
country_code: 971
example_dial: '02 234 5678'
uy:
country_name:
en: 'Uruguay'
es: 'Uruguay'
country_code: 598
example_dial: '2123 1234'
us:
country_name:
en: 'United States'
es: 'Estados Unidos'
country_code: 1
example_dial: '(201) 555-0123'
uz:
country_name:
en: 'Uzbekistan'
es: 'Uzbekistán'
country_code: 998
example_dial: '8 66 234 56 78'
vu:
country_name:
en: 'Vanuatu'
es: 'Vanuatu'
country_code: 678
example_dial: '22123'
ve:
country_name:
en: 'Venezuela'
es: 'Venezuela'
country_code: 58
example_dial: '0212-1234567'
vn:
country_name:
en: 'Vietnam'
es: 'Vietnam'
country_code: 84
example_dial: '0210 1234 567'
vg:
country_name:
en: 'Virgin Islands GB'
es: 'Islas Vírgenes GB'
country_code: 1284
example_dial: '(284) 229-1234'
vi:
country_name:
en: 'Virgin Islands USA'
es: 'Islas Vírgenes de EE.UU.'
country_code: 1340
example_dial: '(340) 642-1234'
wf:
country_name:
en: 'Wallis & Futuna'
es: 'Wallis & Futuna'
country_code: 681
example_dial: '50 12 34'
ws:
country_name:
en: 'Western Samoa'
es: 'Samoa Occidental'
country_code: 685
example_dial: '22123'
ye:
country_name:
en: 'Yemen'
es: 'Yemen'
country_code: 967
example_dial: '01 234 567'
zm:
country_name:
en: 'Zambia'
es: 'Zambia'
country_code: 260
example_dial: '021 1234567'
zw:
country_name:
en: 'Zimbabwe'
es: 'Zimbabwe'
country_code: 263
example_dial: '013 12345'
'do-1':
country_name:
en: 'Dominican Republic'
es: 'República Dominicana'
country_code: 1849
example_dial: '(849) 234-5678'
'do-2':
country_name:
en: 'Dominican Republic'
es: 'República Dominicana'
country_code: 1809
example_dial: '(809) 234-5678'
'do-3':
country_name:
en: 'Dominican Republic'
es: 'República Dominicana'
country_code: 1829
example_dial: '(829) 234-5678'
gw:
country_name:
en: 'Guinea-Bissau'
es: 'Guinea-Bissau'
country_code: 245
example_dial: '320 1234'
me:
country_name:
en: 'Montenegro'
es: 'Montenegro'
country_code: 382
example_dial: '030 234 567'
ng:
country_name:
en: 'Nigeria'
es: 'Nigeria'
country_code: 234
example_dial: '01 234 5678'
mf:
country_name:
en: 'Saint Martin'
es: 'saint Martin'
country_code: 1599
example_dial: '0590 27-1234'
gp:
country_name:
en: 'Saint Barthelemy'
es: 'San Bartolomé'
country_code: 590
example_dial: '0590 20-1234'
ss:
country_name:
en: 'South Sudan'
es: 'Sudán del Sur'
country_code: 211
example_dial: ''
sx:
country_name:
en: 'Sint Maarten'
es: 'Sint Maarten'
country_code: 1721
example_dial: ''
|
[
{
"context": "# @author Tim Knip / http://www.floorplanner.com/ / tim at floorplan",
"end": 18,
"score": 0.9998931288719177,
"start": 10,
"tag": "NAME",
"value": "Tim Knip"
},
{
"context": "orplanner.com/ / tim at floorplanner.com\n# @author aladjev.andrew@gmail.com\n\n#= require new_src/loaders/collada/instance_effe",
"end": 110,
"score": 0.9999256134033203,
"start": 86,
"tag": "EMAIL",
"value": "aladjev.andrew@gmail.com"
}
] | source/javascripts/new_src/loaders/collada/material.coffee | andrew-aladev/three.js | 0 | # @author Tim Knip / http://www.floorplanner.com/ / tim at floorplanner.com
# @author aladjev.andrew@gmail.com
#= require new_src/loaders/collada/instance_effect
class Material
constructor: ->
@id = ""
@name = ""
@instance_effect = null
parse: (element) ->
@id = element.getAttribute "id"
@name = element.getAttribute "name"
length = element.childNodes.length
for i in [0...length]
if element.childNodes[i].nodeName is "instance_effect"
@instance_effect = new THREE.Collada.InstanceEffect().parse element.childNodes[i]
break
this
namespace "THREE.Collada", (exports) ->
exports.Material = Material | 26539 | # @author <NAME> / http://www.floorplanner.com/ / tim at floorplanner.com
# @author <EMAIL>
#= require new_src/loaders/collada/instance_effect
class Material
constructor: ->
@id = ""
@name = ""
@instance_effect = null
parse: (element) ->
@id = element.getAttribute "id"
@name = element.getAttribute "name"
length = element.childNodes.length
for i in [0...length]
if element.childNodes[i].nodeName is "instance_effect"
@instance_effect = new THREE.Collada.InstanceEffect().parse element.childNodes[i]
break
this
namespace "THREE.Collada", (exports) ->
exports.Material = Material | true | # @author PI:NAME:<NAME>END_PI / http://www.floorplanner.com/ / tim at floorplanner.com
# @author PI:EMAIL:<EMAIL>END_PI
#= require new_src/loaders/collada/instance_effect
class Material
constructor: ->
@id = ""
@name = ""
@instance_effect = null
parse: (element) ->
@id = element.getAttribute "id"
@name = element.getAttribute "name"
length = element.childNodes.length
for i in [0...length]
if element.childNodes[i].nodeName is "instance_effect"
@instance_effect = new THREE.Collada.InstanceEffect().parse element.childNodes[i]
break
this
namespace "THREE.Collada", (exports) ->
exports.Material = Material |
[
{
"context": "###\n\t(c) 2016 Julian Gonggrijp\n###\n\ndefine [\n\t'handlebars.runtime'\n], (hbsRuntim",
"end": 30,
"score": 0.9998806715011597,
"start": 14,
"tag": "NAME",
"value": "Julian Gonggrijp"
}
] | client/script/handlebars.coffee | NBOCampbellToets/CampbellSoup | 0 | ###
(c) 2016 Julian Gonggrijp
###
define [
'handlebars.runtime'
], (hbsRuntime) -> hbsRuntime.default
| 126790 | ###
(c) 2016 <NAME>
###
define [
'handlebars.runtime'
], (hbsRuntime) -> hbsRuntime.default
| true | ###
(c) 2016 PI:NAME:<NAME>END_PI
###
define [
'handlebars.runtime'
], (hbsRuntime) -> hbsRuntime.default
|
[
{
"context": "/authorization\"\n\nspaceless = \"\"\"\nDigest username=\"Mufasa\",realm=\"testrealm@host.com\",nonce=\"dcd98b7102dd2f",
"end": 136,
"score": 0.9997264742851257,
"start": 130,
"tag": "USERNAME",
"value": "Mufasa"
},
{
"context": "\n\nspaceless = \"\"\"\nDigest username=\"Mufasa\",realm=\"testrealm@host.com\",nonce=\"dcd98b7102dd2f0e8b11d0f600bfb0c093\",uri=\"",
"end": 163,
"score": 0.9999201893806458,
"start": 145,
"tag": "EMAIL",
"value": "testrealm@host.com"
},
{
"context": "71e9517f40e41\"\n\"\"\"\n\nspaced = \"\"\"\nDigest username=\"Mufasa\",\n realm=\"testrealm@host.com\",\n nonce=\"dcd98b71",
"end": 396,
"score": 0.9997183680534363,
"start": 390,
"tag": "USERNAME",
"value": "Mufasa"
},
{
"context": "\n\nspaced = \"\"\"\nDigest username=\"Mufasa\",\n realm=\"testrealm@host.com\",\n nonce=\"dcd98b7102dd2f0e8b11d0f600bfb0c093\",\n ",
"end": 426,
"score": 0.9999186396598816,
"start": 408,
"tag": "EMAIL",
"value": "testrealm@host.com"
},
{
"context": "login, \"smurf\"\n assert.equal params.password, \"smurfy\"\n\n context.test \"params with no spaces\", ->\n ",
"end": 907,
"score": 0.9994229674339294,
"start": 901,
"tag": "PASSWORD",
"value": "smurfy"
},
{
"context": "\"\n assert.deepEqual params, {\n username: \"Mufasa\"\n realm: \"testrealm@host.com\"\n nonce: \"",
"end": 1081,
"score": 0.9997335076332092,
"start": 1075,
"tag": "USERNAME",
"value": "Mufasa"
},
{
"context": " params, {\n username: \"Mufasa\"\n realm: \"testrealm@host.com\"\n nonce: \"dcd98b7102dd2f0e8b11d0f600bfb0c093",
"end": 1115,
"score": 0.9999184012413025,
"start": 1097,
"tag": "EMAIL",
"value": "testrealm@host.com"
},
{
"context": "\"\n assert.deepEqual params, {\n username: \"Mufasa\"\n realm: \"testrealm@host.com\"\n nonce: \"",
"end": 1525,
"score": 0.9997398257255554,
"start": 1519,
"tag": "USERNAME",
"value": "Mufasa"
},
{
"context": " params, {\n username: \"Mufasa\"\n realm: \"testrealm@host.com\"\n nonce: \"dcd98b7102dd2f0e8b11d0f600bfb0c093",
"end": 1559,
"score": 0.9999129176139832,
"start": 1541,
"tag": "EMAIL",
"value": "testrealm@host.com"
}
] | test/authorization_parsing_test.coffee | patchboard/patchboard | 38 | assert = require "assert"
Testify = require "testify"
{parse} = require "../src/authorization"
spaceless = """
Digest username="Mufasa",realm="testrealm@host.com",nonce="dcd98b7102dd2f0e8b11d0f600bfb0c093",uri="/dir/index.html",qop=auth,nc=00000001,cnonce="0a4f113b",response="6629fae49393a05397450978507c4ef1",opaque="5ccc069c403ebaf9f0171e9517f40e41"
"""
spaced = """
Digest username="Mufasa",
realm="testrealm@host.com",
nonce="dcd98b7102dd2f0e8b11d0f600bfb0c093",
uri="/dir/index.html",
qop=auth,
nc=00000001,
cnonce="0a4f113b",
response="6629fae49393a05397450978507c4ef1",
opaque="5ccc069c403ebaf9f0171e9517f40e41"
"""
Testify.test "Parsing Authorization header values", (context) ->
context.test "Basic", ->
{scheme, params} = parse("Basic c211cmY6c211cmZ5")
assert.equal scheme, "Basic"
assert.equal params.login, "smurf"
assert.equal params.password, "smurfy"
context.test "params with no spaces", ->
{scheme, params} = parse(spaceless)
assert.equal scheme, "Digest"
assert.deepEqual params, {
username: "Mufasa"
realm: "testrealm@host.com"
nonce: "dcd98b7102dd2f0e8b11d0f600bfb0c093"
uri: "/dir/index.html"
qop: "auth"
nc: "00000001"
cnonce: "0a4f113b"
response: "6629fae49393a05397450978507c4ef1"
opaque: "5ccc069c403ebaf9f0171e9517f40e41"
}
context.test "with spaces", ->
{scheme, params} = parse(spaced)
assert.equal scheme, "Digest"
assert.deepEqual params, {
username: "Mufasa"
realm: "testrealm@host.com"
nonce: "dcd98b7102dd2f0e8b11d0f600bfb0c093"
uri: "/dir/index.html"
qop: "auth"
nc: "00000001"
cnonce: "0a4f113b"
response: "6629fae49393a05397450978507c4ef1"
opaque: "5ccc069c403ebaf9f0171e9517f40e41"
}
context.test "Invalid", ->
assert.throws ->
parse "Smurf "
assert.throws ->
parse "Smurf smurfy"
assert.throws ->
x = parse "Smurf color=blue hat=white"
console.log x
| 140579 | assert = require "assert"
Testify = require "testify"
{parse} = require "../src/authorization"
spaceless = """
Digest username="Mufasa",realm="<EMAIL>",nonce="dcd98b7102dd2f0e8b11d0f600bfb0c093",uri="/dir/index.html",qop=auth,nc=00000001,cnonce="0a4f113b",response="6629fae49393a05397450978507c4ef1",opaque="5ccc069c403ebaf9f0171e9517f40e41"
"""
spaced = """
Digest username="Mufasa",
realm="<EMAIL>",
nonce="dcd98b7102dd2f0e8b11d0f600bfb0c093",
uri="/dir/index.html",
qop=auth,
nc=00000001,
cnonce="0a4f113b",
response="6629fae49393a05397450978507c4ef1",
opaque="5ccc069c403ebaf9f0171e9517f40e41"
"""
Testify.test "Parsing Authorization header values", (context) ->
context.test "Basic", ->
{scheme, params} = parse("Basic c211cmY6c211cmZ5")
assert.equal scheme, "Basic"
assert.equal params.login, "smurf"
assert.equal params.password, "<PASSWORD>"
context.test "params with no spaces", ->
{scheme, params} = parse(spaceless)
assert.equal scheme, "Digest"
assert.deepEqual params, {
username: "Mufasa"
realm: "<EMAIL>"
nonce: "dcd98b7102dd2f0e8b11d0f600bfb0c093"
uri: "/dir/index.html"
qop: "auth"
nc: "00000001"
cnonce: "0a4f113b"
response: "6629fae49393a05397450978507c4ef1"
opaque: "5ccc069c403ebaf9f0171e9517f40e41"
}
context.test "with spaces", ->
{scheme, params} = parse(spaced)
assert.equal scheme, "Digest"
assert.deepEqual params, {
username: "Mufasa"
realm: "<EMAIL>"
nonce: "dcd98b7102dd2f0e8b11d0f600bfb0c093"
uri: "/dir/index.html"
qop: "auth"
nc: "00000001"
cnonce: "0a4f113b"
response: "6629fae49393a05397450978507c4ef1"
opaque: "5ccc069c403ebaf9f0171e9517f40e41"
}
context.test "Invalid", ->
assert.throws ->
parse "Smurf "
assert.throws ->
parse "Smurf smurfy"
assert.throws ->
x = parse "Smurf color=blue hat=white"
console.log x
| true | assert = require "assert"
Testify = require "testify"
{parse} = require "../src/authorization"
spaceless = """
Digest username="Mufasa",realm="PI:EMAIL:<EMAIL>END_PI",nonce="dcd98b7102dd2f0e8b11d0f600bfb0c093",uri="/dir/index.html",qop=auth,nc=00000001,cnonce="0a4f113b",response="6629fae49393a05397450978507c4ef1",opaque="5ccc069c403ebaf9f0171e9517f40e41"
"""
spaced = """
Digest username="Mufasa",
realm="PI:EMAIL:<EMAIL>END_PI",
nonce="dcd98b7102dd2f0e8b11d0f600bfb0c093",
uri="/dir/index.html",
qop=auth,
nc=00000001,
cnonce="0a4f113b",
response="6629fae49393a05397450978507c4ef1",
opaque="5ccc069c403ebaf9f0171e9517f40e41"
"""
Testify.test "Parsing Authorization header values", (context) ->
context.test "Basic", ->
{scheme, params} = parse("Basic c211cmY6c211cmZ5")
assert.equal scheme, "Basic"
assert.equal params.login, "smurf"
assert.equal params.password, "PI:PASSWORD:<PASSWORD>END_PI"
context.test "params with no spaces", ->
{scheme, params} = parse(spaceless)
assert.equal scheme, "Digest"
assert.deepEqual params, {
username: "Mufasa"
realm: "PI:EMAIL:<EMAIL>END_PI"
nonce: "dcd98b7102dd2f0e8b11d0f600bfb0c093"
uri: "/dir/index.html"
qop: "auth"
nc: "00000001"
cnonce: "0a4f113b"
response: "6629fae49393a05397450978507c4ef1"
opaque: "5ccc069c403ebaf9f0171e9517f40e41"
}
context.test "with spaces", ->
{scheme, params} = parse(spaced)
assert.equal scheme, "Digest"
assert.deepEqual params, {
username: "Mufasa"
realm: "PI:EMAIL:<EMAIL>END_PI"
nonce: "dcd98b7102dd2f0e8b11d0f600bfb0c093"
uri: "/dir/index.html"
qop: "auth"
nc: "00000001"
cnonce: "0a4f113b"
response: "6629fae49393a05397450978507c4ef1"
opaque: "5ccc069c403ebaf9f0171e9517f40e41"
}
context.test "Invalid", ->
assert.throws ->
parse "Smurf "
assert.throws ->
parse "Smurf smurfy"
assert.throws ->
x = parse "Smurf color=blue hat=white"
console.log x
|
[
{
"context": " $scope.model = [\n {\n marca: 'Fender'\n nombre: 'Galaxy s7'\n precio: ",
"end": 226,
"score": 0.9967466592788696,
"start": 220,
"tag": "NAME",
"value": "Fender"
},
{
"context": "precio: 400\n }\n {\n marca: 'LeoVergara'\n nombre: 'Brandon Vergara Magaña'\n ",
"end": 328,
"score": 0.9997493624687195,
"start": 318,
"tag": "NAME",
"value": "LeoVergara"
},
{
"context": "\n marca: 'LeoVergara'\n nombre: 'Brandon Vergara Magaña'\n precio: 400\n }\n {\n ",
"end": 371,
"score": 0.9998847246170044,
"start": 349,
"tag": "NAME",
"value": "Brandon Vergara Magaña"
},
{
"context": "precio: 400\n }\n {\n marca: 'Brandon'\n nombre: 'Jugandon a con Angular'\n ",
"end": 440,
"score": 0.999767005443573,
"start": 433,
"tag": "NAME",
"value": "Brandon"
},
{
"context": " {\n marca: 'Brandon'\n nombre: 'Jugandon a con Angular'\n precio: 400\n }\n ",
"end": 469,
"score": 0.9987590312957764,
"start": 461,
"tag": "NAME",
"value": "Jugandon"
}
] | coffeeScripts/controllers/indexController.coffee | LeoVergara1/firstAppAngular | 0 | class IndexController
appDemo = angular.module('appDemo', [])
sizeList = 0
angularController:() ->
appDemo.controller 'InstrumentosListadoCtrl', ($scope) ->
$scope.model = [
{
marca: 'Fender'
nombre: 'Galaxy s7'
precio: 400
}
{
marca: 'LeoVergara'
nombre: 'Brandon Vergara Magaña'
precio: 400
}
{
marca: 'Brandon'
nombre: 'Jugandon a con Angular'
precio: 400
}
]
$scope.entero = 8
$scope.sizeList = $scope.model.length
$scope.cost = 0
$scope.registrar = ->
console.log "Inicia"
if $scope.nombre? and $scope.marca? and $scope.precio?
console.log "Hay nombre"
$scope.model.push
marca: $scope.marca
nombre: $scope.nombre
precio: parseFloat($scope.precio)
else
alert "Completa los datos porfavor"
console.log $scope.nombre
console.log $scope.marca
console.log $scope.precio
$scope.sizeList = $scope.model.length
$scope.cost = 0
for iterator in $scope.model
$scope.cost = $scope.cost + iterator.precio
console.log $scope.model.precio
$scope.remove = (index) ->
console.log index
console.log "Removiendo..."
$scope.model.splice(index, 1)
hello: () ->
console.log("Saludo")
start: () ->
@angularController()
console.log("Start")
new IndexController().start()
| 163675 | class IndexController
appDemo = angular.module('appDemo', [])
sizeList = 0
angularController:() ->
appDemo.controller 'InstrumentosListadoCtrl', ($scope) ->
$scope.model = [
{
marca: '<NAME>'
nombre: 'Galaxy s7'
precio: 400
}
{
marca: '<NAME>'
nombre: '<NAME>'
precio: 400
}
{
marca: '<NAME>'
nombre: '<NAME> a con Angular'
precio: 400
}
]
$scope.entero = 8
$scope.sizeList = $scope.model.length
$scope.cost = 0
$scope.registrar = ->
console.log "Inicia"
if $scope.nombre? and $scope.marca? and $scope.precio?
console.log "Hay nombre"
$scope.model.push
marca: $scope.marca
nombre: $scope.nombre
precio: parseFloat($scope.precio)
else
alert "Completa los datos porfavor"
console.log $scope.nombre
console.log $scope.marca
console.log $scope.precio
$scope.sizeList = $scope.model.length
$scope.cost = 0
for iterator in $scope.model
$scope.cost = $scope.cost + iterator.precio
console.log $scope.model.precio
$scope.remove = (index) ->
console.log index
console.log "Removiendo..."
$scope.model.splice(index, 1)
hello: () ->
console.log("Saludo")
start: () ->
@angularController()
console.log("Start")
new IndexController().start()
| true | class IndexController
appDemo = angular.module('appDemo', [])
sizeList = 0
angularController:() ->
appDemo.controller 'InstrumentosListadoCtrl', ($scope) ->
$scope.model = [
{
marca: 'PI:NAME:<NAME>END_PI'
nombre: 'Galaxy s7'
precio: 400
}
{
marca: 'PI:NAME:<NAME>END_PI'
nombre: 'PI:NAME:<NAME>END_PI'
precio: 400
}
{
marca: 'PI:NAME:<NAME>END_PI'
nombre: 'PI:NAME:<NAME>END_PI a con Angular'
precio: 400
}
]
$scope.entero = 8
$scope.sizeList = $scope.model.length
$scope.cost = 0
$scope.registrar = ->
console.log "Inicia"
if $scope.nombre? and $scope.marca? and $scope.precio?
console.log "Hay nombre"
$scope.model.push
marca: $scope.marca
nombre: $scope.nombre
precio: parseFloat($scope.precio)
else
alert "Completa los datos porfavor"
console.log $scope.nombre
console.log $scope.marca
console.log $scope.precio
$scope.sizeList = $scope.model.length
$scope.cost = 0
for iterator in $scope.model
$scope.cost = $scope.cost + iterator.precio
console.log $scope.model.precio
$scope.remove = (index) ->
console.log index
console.log "Removiendo..."
$scope.model.splice(index, 1)
hello: () ->
console.log("Saludo")
start: () ->
@angularController()
console.log("Start")
new IndexController().start()
|
[
{
"context": "umentBody()\n new spark.components.Input({value: 'fatih@fatihacet.com', cssClass: 'has-text'}).appendToDocumentBody()\n ",
"end": 260,
"score": 0.9998552799224854,
"start": 241,
"tag": "EMAIL",
"value": "fatih@fatihacet.com"
},
{
"context": "umentBody()\n new spark.components.Input({value: 'fatih@fatihacet.com', cssClass: 'success'}).appendToDocumentBody()\n ",
"end": 366,
"score": 0.9997318983078003,
"start": 347,
"tag": "EMAIL",
"value": "fatih@fatihacet.com"
},
{
"context": "umentBody()\n new spark.components.Input({value: 'fatih@fatihacet.', cssClass: 'fail'}).appendToDocumentBody()\n\n n",
"end": 467,
"score": 0.9650071859359741,
"start": 452,
"tag": "EMAIL",
"value": "fatih@fatihacet"
},
{
"context": "umentBody()\n new spark.components.Input({value: 'fatih@fatihacet.com', cssClass: 'big has-text'}).appendToDocumentBody",
"end": 712,
"score": 0.9997613430023193,
"start": 693,
"tag": "EMAIL",
"value": "fatih@fatihacet.com"
},
{
"context": "umentBody()\n new spark.components.Input({value: 'fatih@fatihacet.com', cssClass: 'big success'}).appendToDocumentBody(",
"end": 822,
"score": 0.9998443126678467,
"start": 803,
"tag": "EMAIL",
"value": "fatih@fatihacet.com"
},
{
"context": "umentBody()\n new spark.components.Input({value: 'fatih@fatihacet.', cssClass: 'big fail'}).appendToDocumentBody()\n",
"end": 927,
"score": 0.9726248979568481,
"start": 912,
"tag": "EMAIL",
"value": "fatih@fatihacet"
}
] | src/examples/input/main.coffee | dashersw/spark | 1 | window.addEventListener 'load', ->
new spark.core.View({ tagName: 'h2', template: 'Spark Inputs' }).appendToDocumentBody()
new spark.components.Input({placeholder: 'Email'}).appendToDocumentBody()
new spark.components.Input({value: 'fatih@fatihacet.com', cssClass: 'has-text'}).appendToDocumentBody()
new spark.components.Input({value: 'fatih@fatihacet.com', cssClass: 'success'}).appendToDocumentBody()
new spark.components.Input({value: 'fatih@fatihacet.', cssClass: 'fail'}).appendToDocumentBody()
new spark.core.View().appendToDocumentBody()
new spark.components.Input({placeholder: 'Email', cssClass: 'big'}).appendToDocumentBody()
new spark.components.Input({value: 'fatih@fatihacet.com', cssClass: 'big has-text'}).appendToDocumentBody()
new spark.components.Input({value: 'fatih@fatihacet.com', cssClass: 'big success'}).appendToDocumentBody()
new spark.components.Input({value: 'fatih@fatihacet.', cssClass: 'big fail'}).appendToDocumentBody()
, no
| 122683 | window.addEventListener 'load', ->
new spark.core.View({ tagName: 'h2', template: 'Spark Inputs' }).appendToDocumentBody()
new spark.components.Input({placeholder: 'Email'}).appendToDocumentBody()
new spark.components.Input({value: '<EMAIL>', cssClass: 'has-text'}).appendToDocumentBody()
new spark.components.Input({value: '<EMAIL>', cssClass: 'success'}).appendToDocumentBody()
new spark.components.Input({value: '<EMAIL>.', cssClass: 'fail'}).appendToDocumentBody()
new spark.core.View().appendToDocumentBody()
new spark.components.Input({placeholder: 'Email', cssClass: 'big'}).appendToDocumentBody()
new spark.components.Input({value: '<EMAIL>', cssClass: 'big has-text'}).appendToDocumentBody()
new spark.components.Input({value: '<EMAIL>', cssClass: 'big success'}).appendToDocumentBody()
new spark.components.Input({value: '<EMAIL>.', cssClass: 'big fail'}).appendToDocumentBody()
, no
| true | window.addEventListener 'load', ->
new spark.core.View({ tagName: 'h2', template: 'Spark Inputs' }).appendToDocumentBody()
new spark.components.Input({placeholder: 'Email'}).appendToDocumentBody()
new spark.components.Input({value: 'PI:EMAIL:<EMAIL>END_PI', cssClass: 'has-text'}).appendToDocumentBody()
new spark.components.Input({value: 'PI:EMAIL:<EMAIL>END_PI', cssClass: 'success'}).appendToDocumentBody()
new spark.components.Input({value: 'PI:EMAIL:<EMAIL>END_PI.', cssClass: 'fail'}).appendToDocumentBody()
new spark.core.View().appendToDocumentBody()
new spark.components.Input({placeholder: 'Email', cssClass: 'big'}).appendToDocumentBody()
new spark.components.Input({value: 'PI:EMAIL:<EMAIL>END_PI', cssClass: 'big has-text'}).appendToDocumentBody()
new spark.components.Input({value: 'PI:EMAIL:<EMAIL>END_PI', cssClass: 'big success'}).appendToDocumentBody()
new spark.components.Input({value: 'PI:EMAIL:<EMAIL>END_PI.', cssClass: 'big fail'}).appendToDocumentBody()
, no
|
[
{
"context": " id> reserve - Make a reservation.\n#\n# Author:\n# Shingo Sato <shinsugar@gmail.com>\n\n{ toNumber, head, last, is",
"end": 360,
"score": 0.999883770942688,
"start": 349,
"tag": "NAME",
"value": "Shingo Sato"
},
{
"context": " Make a reservation.\n#\n# Author:\n# Shingo Sato <shinsugar@gmail.com>\n\n{ toNumber, head, last, isNull, isUndefined } =",
"end": 381,
"score": 0.9999237060546875,
"start": 362,
"tag": "EMAIL",
"value": "shinsugar@gmail.com"
}
] | src/fass-reservation.coffee | sugarshin/hubot-fass-reservation | 1 | # Description
# A Hubot script for utilities of FaSS reservation
#
# Configuration:
# N/A
#
# Commands:
# hubot fass list - List salons.
# hubot fass <salon id> waiting - List all waiting.
# hubot fass <salon id> waiting <number> - Start watch the number in waiting.
# hubot fass <salon id> reserve - Make a reservation.
#
# Author:
# Shingo Sato <shinsugar@gmail.com>
{ toNumber, head, last, isNull, isUndefined } = require 'lodash'
cheerio = require 'cheerio'
createPoll = require './utils/create-poll'
getHtml = require './utils/get-html'
salonMap = require './utils/salon-map'
getWaitingResultPageUrl = (salonId) ->
"https://wb.goku.ne.jp/FaSS#{salonId}HtmlResult/WaitingResultPage.htm"
selectors =
waitingOrder: 'body > div > DIV'
outsideHours: ':contains("ただいまの時間は営業時間外です")'
closed: 'body'
###
@param {String} - text
@return {['01', '222']}[]
###
parseWaitingOrderText = (text) ->
text
.split('\n')
.filter((t) -> /^\s+(?:\d{2})\)\s+/.test(t))
.map((t) -> t.trim())
.map((t) -> t.split(') '))
getWaitingOrder = (html) -> parseWaitingOrderText cheerio.load(html)(selectors.waitingOrder).text()
existsSalon = (msg) ->
unless salonMap[msg.match[1].toLowerCase()]
msg.send "I don't know such a salon: `#{msg.match[1]}`. You can check with `hubot fass ls`"
return false
return true
module.exports = (robot) ->
robot.respond /\s*fass\s+l(?:s|ist)\s*$/i, (msg) ->
msg.send Object.keys(salonMap).map((k) -> ["#{salonMap[k]} - #{k}", " e.g., `hubot fass #{k} w`"].join '\n').join '\n\n'
robot.respond /\s*fass\s+([a-z0-9]+)\s+r(?:sv|eserve)\s*$/i, (msg) ->
return unless existsSalon msg
msg.send 'Not implemented yet. Please ask https://sugarshin.net/'
robot.respond /\s*fass\s+([a-z0-9]+)\s+w(?:aiting)?(?:\s+(\d+))?\s*$/i, (msg) ->
return unless existsSalon msg
waitingResultPageUrl = getWaitingResultPageUrl msg.match[1]
getHtml(waitingResultPageUrl)
.then (html) ->
$ = cheerio.load(html)
if $(selectors.outsideHours).length > 0
msg.send '営業時間外です'
return
if isUndefined msg.match[2]
$waitingOrder = $ selectors.waitingOrder
if $waitingOrder.length > 0
msg.send $waitingOrder.text()
return
msg.send $(selectors.closed).text()
return
numberStr = msg.match[2]
waitingOrder = getWaitingOrder html
if toNumber(last(waitingOrder)[1]) < toNumber(numberStr)
msg.send 'その番号では予約されていません'
return
if toNumber(head(waitingOrder)[1]) > toNumber(numberStr)
msg.send 'すでに来店済みです'
return
prevIndex = null
getHtmlPolling = createPoll(
getHtml
(html) ->
currentWaitingOrder = getWaitingOrder html
currentIndex = currentWaitingOrder.findIndex (o) -> o[1] is numberStr
if (currentIndex is -1) or (toNumber(head(currentWaitingOrder)[1]) > toNumber(numberStr))
msg.send '施術を開始したか、予約が取り消されました'
return true
if currentIndex is 0
msg.reply '順番がきました'
return true
if currentIndex is 3 and (isNull(prevIndex) or currentIndex < prevIndex)
msg.reply 'あと 3 人で順番がきます'
else if currentIndex is 5 and (isNull(prevIndex) or currentIndex < prevIndex)
msg.reply 'あと 5 人で順番がきます'
prevIndex = currentIndex
return false
)
msg.send "`#{numberStr}` 番の監視を開始します"
getHtmlPolling(waitingResultPageUrl).catch (err) -> msg.send "エラーが発生しました #{err.toString()}"
.catch (err) -> msg.send "エラーが発生しました #{err.toString()}"
| 214065 | # Description
# A Hubot script for utilities of FaSS reservation
#
# Configuration:
# N/A
#
# Commands:
# hubot fass list - List salons.
# hubot fass <salon id> waiting - List all waiting.
# hubot fass <salon id> waiting <number> - Start watch the number in waiting.
# hubot fass <salon id> reserve - Make a reservation.
#
# Author:
# <NAME> <<EMAIL>>
{ toNumber, head, last, isNull, isUndefined } = require 'lodash'
cheerio = require 'cheerio'
createPoll = require './utils/create-poll'
getHtml = require './utils/get-html'
salonMap = require './utils/salon-map'
getWaitingResultPageUrl = (salonId) ->
"https://wb.goku.ne.jp/FaSS#{salonId}HtmlResult/WaitingResultPage.htm"
selectors =
waitingOrder: 'body > div > DIV'
outsideHours: ':contains("ただいまの時間は営業時間外です")'
closed: 'body'
###
@param {String} - text
@return {['01', '222']}[]
###
parseWaitingOrderText = (text) ->
text
.split('\n')
.filter((t) -> /^\s+(?:\d{2})\)\s+/.test(t))
.map((t) -> t.trim())
.map((t) -> t.split(') '))
getWaitingOrder = (html) -> parseWaitingOrderText cheerio.load(html)(selectors.waitingOrder).text()
existsSalon = (msg) ->
unless salonMap[msg.match[1].toLowerCase()]
msg.send "I don't know such a salon: `#{msg.match[1]}`. You can check with `hubot fass ls`"
return false
return true
module.exports = (robot) ->
robot.respond /\s*fass\s+l(?:s|ist)\s*$/i, (msg) ->
msg.send Object.keys(salonMap).map((k) -> ["#{salonMap[k]} - #{k}", " e.g., `hubot fass #{k} w`"].join '\n').join '\n\n'
robot.respond /\s*fass\s+([a-z0-9]+)\s+r(?:sv|eserve)\s*$/i, (msg) ->
return unless existsSalon msg
msg.send 'Not implemented yet. Please ask https://sugarshin.net/'
robot.respond /\s*fass\s+([a-z0-9]+)\s+w(?:aiting)?(?:\s+(\d+))?\s*$/i, (msg) ->
return unless existsSalon msg
waitingResultPageUrl = getWaitingResultPageUrl msg.match[1]
getHtml(waitingResultPageUrl)
.then (html) ->
$ = cheerio.load(html)
if $(selectors.outsideHours).length > 0
msg.send '営業時間外です'
return
if isUndefined msg.match[2]
$waitingOrder = $ selectors.waitingOrder
if $waitingOrder.length > 0
msg.send $waitingOrder.text()
return
msg.send $(selectors.closed).text()
return
numberStr = msg.match[2]
waitingOrder = getWaitingOrder html
if toNumber(last(waitingOrder)[1]) < toNumber(numberStr)
msg.send 'その番号では予約されていません'
return
if toNumber(head(waitingOrder)[1]) > toNumber(numberStr)
msg.send 'すでに来店済みです'
return
prevIndex = null
getHtmlPolling = createPoll(
getHtml
(html) ->
currentWaitingOrder = getWaitingOrder html
currentIndex = currentWaitingOrder.findIndex (o) -> o[1] is numberStr
if (currentIndex is -1) or (toNumber(head(currentWaitingOrder)[1]) > toNumber(numberStr))
msg.send '施術を開始したか、予約が取り消されました'
return true
if currentIndex is 0
msg.reply '順番がきました'
return true
if currentIndex is 3 and (isNull(prevIndex) or currentIndex < prevIndex)
msg.reply 'あと 3 人で順番がきます'
else if currentIndex is 5 and (isNull(prevIndex) or currentIndex < prevIndex)
msg.reply 'あと 5 人で順番がきます'
prevIndex = currentIndex
return false
)
msg.send "`#{numberStr}` 番の監視を開始します"
getHtmlPolling(waitingResultPageUrl).catch (err) -> msg.send "エラーが発生しました #{err.toString()}"
.catch (err) -> msg.send "エラーが発生しました #{err.toString()}"
| true | # Description
# A Hubot script for utilities of FaSS reservation
#
# Configuration:
# N/A
#
# Commands:
# hubot fass list - List salons.
# hubot fass <salon id> waiting - List all waiting.
# hubot fass <salon id> waiting <number> - Start watch the number in waiting.
# hubot fass <salon id> reserve - Make a reservation.
#
# Author:
# PI:NAME:<NAME>END_PI <PI:EMAIL:<EMAIL>END_PI>
{ toNumber, head, last, isNull, isUndefined } = require 'lodash'
cheerio = require 'cheerio'
createPoll = require './utils/create-poll'
getHtml = require './utils/get-html'
salonMap = require './utils/salon-map'
getWaitingResultPageUrl = (salonId) ->
"https://wb.goku.ne.jp/FaSS#{salonId}HtmlResult/WaitingResultPage.htm"
selectors =
waitingOrder: 'body > div > DIV'
outsideHours: ':contains("ただいまの時間は営業時間外です")'
closed: 'body'
###
@param {String} - text
@return {['01', '222']}[]
###
parseWaitingOrderText = (text) ->
text
.split('\n')
.filter((t) -> /^\s+(?:\d{2})\)\s+/.test(t))
.map((t) -> t.trim())
.map((t) -> t.split(') '))
getWaitingOrder = (html) -> parseWaitingOrderText cheerio.load(html)(selectors.waitingOrder).text()
existsSalon = (msg) ->
unless salonMap[msg.match[1].toLowerCase()]
msg.send "I don't know such a salon: `#{msg.match[1]}`. You can check with `hubot fass ls`"
return false
return true
module.exports = (robot) ->
robot.respond /\s*fass\s+l(?:s|ist)\s*$/i, (msg) ->
msg.send Object.keys(salonMap).map((k) -> ["#{salonMap[k]} - #{k}", " e.g., `hubot fass #{k} w`"].join '\n').join '\n\n'
robot.respond /\s*fass\s+([a-z0-9]+)\s+r(?:sv|eserve)\s*$/i, (msg) ->
return unless existsSalon msg
msg.send 'Not implemented yet. Please ask https://sugarshin.net/'
robot.respond /\s*fass\s+([a-z0-9]+)\s+w(?:aiting)?(?:\s+(\d+))?\s*$/i, (msg) ->
return unless existsSalon msg
waitingResultPageUrl = getWaitingResultPageUrl msg.match[1]
getHtml(waitingResultPageUrl)
.then (html) ->
$ = cheerio.load(html)
if $(selectors.outsideHours).length > 0
msg.send '営業時間外です'
return
if isUndefined msg.match[2]
$waitingOrder = $ selectors.waitingOrder
if $waitingOrder.length > 0
msg.send $waitingOrder.text()
return
msg.send $(selectors.closed).text()
return
numberStr = msg.match[2]
waitingOrder = getWaitingOrder html
if toNumber(last(waitingOrder)[1]) < toNumber(numberStr)
msg.send 'その番号では予約されていません'
return
if toNumber(head(waitingOrder)[1]) > toNumber(numberStr)
msg.send 'すでに来店済みです'
return
prevIndex = null
getHtmlPolling = createPoll(
getHtml
(html) ->
currentWaitingOrder = getWaitingOrder html
currentIndex = currentWaitingOrder.findIndex (o) -> o[1] is numberStr
if (currentIndex is -1) or (toNumber(head(currentWaitingOrder)[1]) > toNumber(numberStr))
msg.send '施術を開始したか、予約が取り消されました'
return true
if currentIndex is 0
msg.reply '順番がきました'
return true
if currentIndex is 3 and (isNull(prevIndex) or currentIndex < prevIndex)
msg.reply 'あと 3 人で順番がきます'
else if currentIndex is 5 and (isNull(prevIndex) or currentIndex < prevIndex)
msg.reply 'あと 5 人で順番がきます'
prevIndex = currentIndex
return false
)
msg.send "`#{numberStr}` 番の監視を開始します"
getHtmlPolling(waitingResultPageUrl).catch (err) -> msg.send "エラーが発生しました #{err.toString()}"
.catch (err) -> msg.send "エラーが発生しました #{err.toString()}"
|
[
{
"context": "accounts: [\n {\n id : \"bd3ec1d3-91b7-4b5a-b6a9-86871f132304\"\n name : \"Personal\"\n ",
"end": 223,
"score": 0.9935199618339539,
"start": 187,
"tag": "KEY",
"value": "bd3ec1d3-91b7-4b5a-b6a9-86871f132304"
},
{
"context": "\n },\n {\n id : \"bd33-91b7-4b5a-b6a9-86871f132304\"\n name : \"work\"\n prov",
"end": 410,
"score": 0.9931016564369202,
"start": 378,
"tag": "KEY",
"value": "bd33-91b7-4b5a-b6a9-86871f132304"
},
{
"context": "\"AWS\"\n accounts: [\n id : \"iv103n\"\n name : \"main\"\n provider",
"end": 1334,
"score": 0.9049140214920044,
"start": 1328,
"tag": "USERNAME",
"value": "iv103n"
},
{
"context": "gine\"\n accounts: [\n id : \"onf49wb\"\n name : \"work\"\n provider",
"end": 2710,
"score": 0.5719433426856995,
"start": 2703,
"tag": "USERNAME",
"value": "onf49wb"
},
{
"context": "con\": \"digital-ocean\",\n# \"serverNickName\": \"Droplet\",\ndollarsPerMo : 5\n# \"credentialFields\": [\n",
"end": 4363,
"score": 0.910758376121521,
"start": 4356,
"tag": "USERNAME",
"value": "Droplet"
},
{
"context": "},\n# \"accounts\": [\n# {\n# \"id\": \"bd3ec1d3-91b7-4b5a-b6a9-86871f132304\",\n# \"name\": \"test-provider-account\",\n# ",
"end": 4893,
"score": 0.995500922203064,
"start": 4857,
"tag": "KEY",
"value": "bd3ec1d3-91b7-4b5a-b6a9-86871f132304"
}
] | stage/shims/app-launch-shim.coffee | nanobox-io/nanobox-dash-ui-app-launch | 0 | module.exports = class DataShim
constructor: () ->
getProviders : () -> [
{
id: 'do'
name : "Digital Ocean"
accounts: [
{
id : "bd3ec1d3-91b7-4b5a-b6a9-86871f132304"
name : "Personal"
provider_id : "do"
default_region : "sfo1"
},
{
id : "bd33-91b7-4b5a-b6a9-86871f132304"
name : "work"
provider_id : "do"
default_region : "am3"
}
]
meta:
icon: "custom"
serverNickName: "Droplet"
dollarsPerMo : 5
specs: [
{metric:"ram", val: "512 MB"}
{metric:"cpu", val: "0.5 Core"}
{metric:"disk",val: "1 GB"}
{metric:"transfer", val: "2 TB"}
]
regions : [
{name: "New York 1", id: "nyc1"}
{name: "New York 2", id: "nyc2"}
{name: "New York 3", id: "nyc3"}
{name: "Amsterdam 2", id: "am2"}
{name: "Amsterdam 3", id: "am3"}
{name: "San Francisco", id: "sfo1"}
{name: "Singapore", id: "s1"}
{name: "London", id: "l1"}
{name: "Frankfurt", id: "f1"}
{name: "Toronto", id: "t1"}
]
},
{
id: 'aws'
name : "AWS"
accounts: [
id : "iv103n"
name : "main"
provider_id : "aws"
default_region : "us-gov-west-1"
]
meta:
icon: "aws"
serverNickName: "EC2 Instance"
dollarsPerMo : 5
specs: [
{metric:"ram", val: "512 MB"}
{metric:"cpu", val: "0.5 Core"}
{metric:"disk",val: "1 GB"}
{metric:"transfer", val: "2 TB"}
]
regions : [
{group:"US East", items:[
{name:"N. Virginia", id:"us-east-1"}
]}
{group:"US West", items:[
{name:"Oregon", id:"us-west-2"}
{name:"N. California", id:"us-west-1"}
{name:"AWS GovCloud", id:"us-gov-west-1"}
]}
{group:"EU", items:[
{name:"Ireland", id:"eu-west-1"}
{name:"Frankfurt", id:"eu-central-1"}
]}
{group:"Asia Pacific", items:[
{name:"Singapore", id:"ap-southeast-1"}
{name:"Tokyo", id:"ap-northeast-1"}
{name:"Seoul", id:"ap-northeast-2"}
{name:"Sydney", id:"ap-southeast-2"}
]}
{group:"South America", items:[
{name:"São Paulo", id:"sa-east-1"}
]}
{group:"China", items:[
{name:"Beijing", id:"cn-north-1"}
]}
]
},
{
id: 'gc'
name : "Google Compute Engine"
accounts: [
id : "onf49wb"
name : "work"
provider_id : "gc"
default_region : "us-central1-a"
]
meta:
icon: "google-compute"
serverNickName: "VM"
dollarsPerMo : 5
specs: [
{metric:"ram", val: "512 MB"}
{metric:"cpu", val: "0.5 Core"}
{metric:"disk",val: "1 GB"}
{metric:"transfer", val: "2 TB"}
]
regions : [
{group:"Easter United States", items:[
{name:"South Carolina - B", id: "us-east1-b"}
{name:"South Carolina - C", id: "us-east1-c"}
{name:"South Carolina - D", id: "us-east1-d"}
]}
{group:"Central United States", items:[
{name:"Iowa - A", id: "us-central1-a"}
{name:"Iowa - B", id: "us-central1-b"}
{name:"Iowa - C", id: "us-central1-c"}
{name:"Iowa - F", id: "us-central1-f"}
]}
{group:"Western Europe", items:[
{name:"Belgium - B", id: "europe-west1-b"}
{name:"Belgium - C", id: "europe-west1-c"}
{name:"Belgium - D", id: "europe-west1-d"}
]}
{group:"East Asia", items:[
{name:"Taiwan - A", id: "asia-east1-a"}
{name:"Taiwan - B", id: "asia-east1-b"}
{name:"Taiwan - C", id: "asia-east1-c"}
]}
]
}
]
# [
# {
# "id": "do",
# "name": "DigitalOcean",
# "regions": [
# {
# "id": "nyc1",
# "name": "New York 1"
# },
# {
# "id": "sfo1",
# "name": "San Francisco 1"
# }
# ],
# "meta": {
# "icon": "digital-ocean",
# "serverNickName": "Droplet",
dollarsPerMo : 5
# "credentialFields": [
# "access_token"
# ],
# "specs": [
# {
# "metric": "memory",
# "val": "512"
# },
# {
# "metric": "vcpus",
# "val": "1"
# },
# {
# "metric": "disk",
# "val": "20"
# },
# {
# "metric": "transfer",
# "val": "1.0"
# }
# ]
# },
# "accounts": [
# {
# "id": "bd3ec1d3-91b7-4b5a-b6a9-86871f132304",
# "name": "test-provider-account",
# "provider_id": "do",
# "default_region": "sfo1"
# }
# ]
# }
# ]
| 42865 | module.exports = class DataShim
constructor: () ->
getProviders : () -> [
{
id: 'do'
name : "Digital Ocean"
accounts: [
{
id : "<KEY>"
name : "Personal"
provider_id : "do"
default_region : "sfo1"
},
{
id : "<KEY>"
name : "work"
provider_id : "do"
default_region : "am3"
}
]
meta:
icon: "custom"
serverNickName: "Droplet"
dollarsPerMo : 5
specs: [
{metric:"ram", val: "512 MB"}
{metric:"cpu", val: "0.5 Core"}
{metric:"disk",val: "1 GB"}
{metric:"transfer", val: "2 TB"}
]
regions : [
{name: "New York 1", id: "nyc1"}
{name: "New York 2", id: "nyc2"}
{name: "New York 3", id: "nyc3"}
{name: "Amsterdam 2", id: "am2"}
{name: "Amsterdam 3", id: "am3"}
{name: "San Francisco", id: "sfo1"}
{name: "Singapore", id: "s1"}
{name: "London", id: "l1"}
{name: "Frankfurt", id: "f1"}
{name: "Toronto", id: "t1"}
]
},
{
id: 'aws'
name : "AWS"
accounts: [
id : "iv103n"
name : "main"
provider_id : "aws"
default_region : "us-gov-west-1"
]
meta:
icon: "aws"
serverNickName: "EC2 Instance"
dollarsPerMo : 5
specs: [
{metric:"ram", val: "512 MB"}
{metric:"cpu", val: "0.5 Core"}
{metric:"disk",val: "1 GB"}
{metric:"transfer", val: "2 TB"}
]
regions : [
{group:"US East", items:[
{name:"N. Virginia", id:"us-east-1"}
]}
{group:"US West", items:[
{name:"Oregon", id:"us-west-2"}
{name:"N. California", id:"us-west-1"}
{name:"AWS GovCloud", id:"us-gov-west-1"}
]}
{group:"EU", items:[
{name:"Ireland", id:"eu-west-1"}
{name:"Frankfurt", id:"eu-central-1"}
]}
{group:"Asia Pacific", items:[
{name:"Singapore", id:"ap-southeast-1"}
{name:"Tokyo", id:"ap-northeast-1"}
{name:"Seoul", id:"ap-northeast-2"}
{name:"Sydney", id:"ap-southeast-2"}
]}
{group:"South America", items:[
{name:"São Paulo", id:"sa-east-1"}
]}
{group:"China", items:[
{name:"Beijing", id:"cn-north-1"}
]}
]
},
{
id: 'gc'
name : "Google Compute Engine"
accounts: [
id : "onf49wb"
name : "work"
provider_id : "gc"
default_region : "us-central1-a"
]
meta:
icon: "google-compute"
serverNickName: "VM"
dollarsPerMo : 5
specs: [
{metric:"ram", val: "512 MB"}
{metric:"cpu", val: "0.5 Core"}
{metric:"disk",val: "1 GB"}
{metric:"transfer", val: "2 TB"}
]
regions : [
{group:"Easter United States", items:[
{name:"South Carolina - B", id: "us-east1-b"}
{name:"South Carolina - C", id: "us-east1-c"}
{name:"South Carolina - D", id: "us-east1-d"}
]}
{group:"Central United States", items:[
{name:"Iowa - A", id: "us-central1-a"}
{name:"Iowa - B", id: "us-central1-b"}
{name:"Iowa - C", id: "us-central1-c"}
{name:"Iowa - F", id: "us-central1-f"}
]}
{group:"Western Europe", items:[
{name:"Belgium - B", id: "europe-west1-b"}
{name:"Belgium - C", id: "europe-west1-c"}
{name:"Belgium - D", id: "europe-west1-d"}
]}
{group:"East Asia", items:[
{name:"Taiwan - A", id: "asia-east1-a"}
{name:"Taiwan - B", id: "asia-east1-b"}
{name:"Taiwan - C", id: "asia-east1-c"}
]}
]
}
]
# [
# {
# "id": "do",
# "name": "DigitalOcean",
# "regions": [
# {
# "id": "nyc1",
# "name": "New York 1"
# },
# {
# "id": "sfo1",
# "name": "San Francisco 1"
# }
# ],
# "meta": {
# "icon": "digital-ocean",
# "serverNickName": "Droplet",
dollarsPerMo : 5
# "credentialFields": [
# "access_token"
# ],
# "specs": [
# {
# "metric": "memory",
# "val": "512"
# },
# {
# "metric": "vcpus",
# "val": "1"
# },
# {
# "metric": "disk",
# "val": "20"
# },
# {
# "metric": "transfer",
# "val": "1.0"
# }
# ]
# },
# "accounts": [
# {
# "id": "<KEY>",
# "name": "test-provider-account",
# "provider_id": "do",
# "default_region": "sfo1"
# }
# ]
# }
# ]
| true | module.exports = class DataShim
constructor: () ->
getProviders : () -> [
{
id: 'do'
name : "Digital Ocean"
accounts: [
{
id : "PI:KEY:<KEY>END_PI"
name : "Personal"
provider_id : "do"
default_region : "sfo1"
},
{
id : "PI:KEY:<KEY>END_PI"
name : "work"
provider_id : "do"
default_region : "am3"
}
]
meta:
icon: "custom"
serverNickName: "Droplet"
dollarsPerMo : 5
specs: [
{metric:"ram", val: "512 MB"}
{metric:"cpu", val: "0.5 Core"}
{metric:"disk",val: "1 GB"}
{metric:"transfer", val: "2 TB"}
]
regions : [
{name: "New York 1", id: "nyc1"}
{name: "New York 2", id: "nyc2"}
{name: "New York 3", id: "nyc3"}
{name: "Amsterdam 2", id: "am2"}
{name: "Amsterdam 3", id: "am3"}
{name: "San Francisco", id: "sfo1"}
{name: "Singapore", id: "s1"}
{name: "London", id: "l1"}
{name: "Frankfurt", id: "f1"}
{name: "Toronto", id: "t1"}
]
},
{
id: 'aws'
name : "AWS"
accounts: [
id : "iv103n"
name : "main"
provider_id : "aws"
default_region : "us-gov-west-1"
]
meta:
icon: "aws"
serverNickName: "EC2 Instance"
dollarsPerMo : 5
specs: [
{metric:"ram", val: "512 MB"}
{metric:"cpu", val: "0.5 Core"}
{metric:"disk",val: "1 GB"}
{metric:"transfer", val: "2 TB"}
]
regions : [
{group:"US East", items:[
{name:"N. Virginia", id:"us-east-1"}
]}
{group:"US West", items:[
{name:"Oregon", id:"us-west-2"}
{name:"N. California", id:"us-west-1"}
{name:"AWS GovCloud", id:"us-gov-west-1"}
]}
{group:"EU", items:[
{name:"Ireland", id:"eu-west-1"}
{name:"Frankfurt", id:"eu-central-1"}
]}
{group:"Asia Pacific", items:[
{name:"Singapore", id:"ap-southeast-1"}
{name:"Tokyo", id:"ap-northeast-1"}
{name:"Seoul", id:"ap-northeast-2"}
{name:"Sydney", id:"ap-southeast-2"}
]}
{group:"South America", items:[
{name:"São Paulo", id:"sa-east-1"}
]}
{group:"China", items:[
{name:"Beijing", id:"cn-north-1"}
]}
]
},
{
id: 'gc'
name : "Google Compute Engine"
accounts: [
id : "onf49wb"
name : "work"
provider_id : "gc"
default_region : "us-central1-a"
]
meta:
icon: "google-compute"
serverNickName: "VM"
dollarsPerMo : 5
specs: [
{metric:"ram", val: "512 MB"}
{metric:"cpu", val: "0.5 Core"}
{metric:"disk",val: "1 GB"}
{metric:"transfer", val: "2 TB"}
]
regions : [
{group:"Easter United States", items:[
{name:"South Carolina - B", id: "us-east1-b"}
{name:"South Carolina - C", id: "us-east1-c"}
{name:"South Carolina - D", id: "us-east1-d"}
]}
{group:"Central United States", items:[
{name:"Iowa - A", id: "us-central1-a"}
{name:"Iowa - B", id: "us-central1-b"}
{name:"Iowa - C", id: "us-central1-c"}
{name:"Iowa - F", id: "us-central1-f"}
]}
{group:"Western Europe", items:[
{name:"Belgium - B", id: "europe-west1-b"}
{name:"Belgium - C", id: "europe-west1-c"}
{name:"Belgium - D", id: "europe-west1-d"}
]}
{group:"East Asia", items:[
{name:"Taiwan - A", id: "asia-east1-a"}
{name:"Taiwan - B", id: "asia-east1-b"}
{name:"Taiwan - C", id: "asia-east1-c"}
]}
]
}
]
# [
# {
# "id": "do",
# "name": "DigitalOcean",
# "regions": [
# {
# "id": "nyc1",
# "name": "New York 1"
# },
# {
# "id": "sfo1",
# "name": "San Francisco 1"
# }
# ],
# "meta": {
# "icon": "digital-ocean",
# "serverNickName": "Droplet",
dollarsPerMo : 5
# "credentialFields": [
# "access_token"
# ],
# "specs": [
# {
# "metric": "memory",
# "val": "512"
# },
# {
# "metric": "vcpus",
# "val": "1"
# },
# {
# "metric": "disk",
# "val": "20"
# },
# {
# "metric": "transfer",
# "val": "1.0"
# }
# ]
# },
# "accounts": [
# {
# "id": "PI:KEY:<KEY>END_PI",
# "name": "test-provider-account",
# "provider_id": "do",
# "default_region": "sfo1"
# }
# ]
# }
# ]
|
[
{
"context": "('.apps.key').toString().trim()\ncatch\n authKey= 'local'\n\ndeploy= (host,sha1,force=no)->\n app= apps[host",
"end": 231,
"score": 0.9942842125892639,
"start": 226,
"tag": "KEY",
"value": "local"
}
] | apps/travis.edgy.black.coffee | 59naga/edgy | 0 | apps= require('yamljs').load 'apps.yml'
fs= require 'fs'
path= require 'path'
pm2= require '../lib/pm2'
Repository= require '../lib/repository'
try
authKey= fs.readFileSync('.apps.key').toString().trim()
catch
authKey= 'local'
deploy= (host,sha1,force=no)->
app= apps[host]
repo= new Repository path.resolve(__dirname,host),app
return repo.q.reject 'host is undefined' if app is undefined
repo.log host,sha1
repo.update sha1,force
.then ->
pm2.connect()
.then ->
pm2.delete host
.then ->
pm2.start {"#{host}":app}
.then ->
repo.q.resolve 'Update successfully'
http= require 'http'
http.createServer (req,res)->
res.writeHead 200,'Content-Type':'text/plain'
body= ''
req.on 'data',(chunk)-> body+= chunk
req.on 'end',->
querystring= require 'querystring'
{host,sha1,key,force}= querystring.parse body
console.log host,sha1,key is authKey,force
return res.end "403 Forbidden" if key isnt authKey
deploy host,sha1,force
.then (result)->
res.statusCode= 200
res.end "200 #{host} #{result}"
.catch (error)->
res.statusCode= 500
res.end "500 ERROR #{error.stack}"
.listen process.env.PORT,->
console.log "Open #{process.env.HOST} > http://localhost:#{process.env.PORT}/"
| 82137 | apps= require('yamljs').load 'apps.yml'
fs= require 'fs'
path= require 'path'
pm2= require '../lib/pm2'
Repository= require '../lib/repository'
try
authKey= fs.readFileSync('.apps.key').toString().trim()
catch
authKey= '<KEY>'
deploy= (host,sha1,force=no)->
app= apps[host]
repo= new Repository path.resolve(__dirname,host),app
return repo.q.reject 'host is undefined' if app is undefined
repo.log host,sha1
repo.update sha1,force
.then ->
pm2.connect()
.then ->
pm2.delete host
.then ->
pm2.start {"#{host}":app}
.then ->
repo.q.resolve 'Update successfully'
http= require 'http'
http.createServer (req,res)->
res.writeHead 200,'Content-Type':'text/plain'
body= ''
req.on 'data',(chunk)-> body+= chunk
req.on 'end',->
querystring= require 'querystring'
{host,sha1,key,force}= querystring.parse body
console.log host,sha1,key is authKey,force
return res.end "403 Forbidden" if key isnt authKey
deploy host,sha1,force
.then (result)->
res.statusCode= 200
res.end "200 #{host} #{result}"
.catch (error)->
res.statusCode= 500
res.end "500 ERROR #{error.stack}"
.listen process.env.PORT,->
console.log "Open #{process.env.HOST} > http://localhost:#{process.env.PORT}/"
| true | apps= require('yamljs').load 'apps.yml'
fs= require 'fs'
path= require 'path'
pm2= require '../lib/pm2'
Repository= require '../lib/repository'
try
authKey= fs.readFileSync('.apps.key').toString().trim()
catch
authKey= 'PI:KEY:<KEY>END_PI'
deploy= (host,sha1,force=no)->
app= apps[host]
repo= new Repository path.resolve(__dirname,host),app
return repo.q.reject 'host is undefined' if app is undefined
repo.log host,sha1
repo.update sha1,force
.then ->
pm2.connect()
.then ->
pm2.delete host
.then ->
pm2.start {"#{host}":app}
.then ->
repo.q.resolve 'Update successfully'
http= require 'http'
http.createServer (req,res)->
res.writeHead 200,'Content-Type':'text/plain'
body= ''
req.on 'data',(chunk)-> body+= chunk
req.on 'end',->
querystring= require 'querystring'
{host,sha1,key,force}= querystring.parse body
console.log host,sha1,key is authKey,force
return res.end "403 Forbidden" if key isnt authKey
deploy host,sha1,force
.then (result)->
res.statusCode= 200
res.end "200 #{host} #{result}"
.catch (error)->
res.statusCode= 500
res.end "500 ERROR #{error.stack}"
.listen process.env.PORT,->
console.log "Open #{process.env.HOST} > http://localhost:#{process.env.PORT}/"
|
[
{
"context": "uired\n#\n# credentials: {\n# id: 'dh37fgj492je',\n# key: 'aoijedoaijsdlaksjdl',\n# ",
"end": 453,
"score": 0.8274643421173096,
"start": 441,
"tag": "KEY",
"value": "dh37fgj492je"
},
{
"context": " id: 'dh37fgj492je',\n# key: 'aoijedoaijsdlaksjdl',\n# algorithm: 'sha256' ",
"end": 494,
"score": 0.9996871948242188,
"start": 475,
"tag": "KEY",
"value": "aoijedoaijsdlaksjdl"
},
{
"context": "uired\n#\n# credentials: {\n# id: 'dh37fgj492je',\n# key: 'aoijedoaijsdlaksjdl',\n# ",
"end": 5734,
"score": 0.8705859780311584,
"start": 5722,
"tag": "USERNAME",
"value": "dh37fgj492je"
},
{
"context": " id: 'dh37fgj492je',\n# key: 'aoijedoaijsdlaksjdl',\n# algorithm: 'sha256' ",
"end": 5775,
"score": 0.9996874928474426,
"start": 5756,
"tag": "KEY",
"value": "aoijedoaijsdlaksjdl"
},
{
"context": "uired\n#\n# credentials: {\n# id: 'dh37fgj492je',\n# key: 'aoijedoaijsdlaksjdl',\n# ",
"end": 7726,
"score": 0.9731862545013428,
"start": 7714,
"tag": "USERNAME",
"value": "dh37fgj492je"
},
{
"context": " id: 'dh37fgj492je',\n# key: 'aoijedoaijsdlaksjdl',\n# algorithm: 'sha256' ",
"end": 7767,
"score": 0.9995792508125305,
"start": 7748,
"tag": "KEY",
"value": "aoijedoaijsdlaksjdl"
}
] | deps/npm/node_modules/request/node_modules/hawk/lib/client.coffee | lxe/io.coffee | 0 | # Load modules
Url = require("url")
Hoek = require("hoek")
Cryptiles = require("cryptiles")
Crypto = require("./crypto")
Utils = require("./utils")
# Declare internals
internals = {}
# Generate an Authorization header for a given request
#
# uri: 'http://example.com/resource?a=b' or object from Url.parse()
# method: HTTP verb (e.g. 'GET', 'POST')
# options: {
#
# // Required
#
# credentials: {
# id: 'dh37fgj492je',
# key: 'aoijedoaijsdlaksjdl',
# algorithm: 'sha256' // 'sha1', 'sha256'
# },
#
# // Optional
#
# ext: 'application-specific', // Application specific data sent via the ext attribute
# timestamp: Date.now(), // A pre-calculated timestamp
# nonce: '2334f34f', // A pre-generated nonce
# localtimeOffsetMsec: 400, // Time offset to sync with server time (ignored if timestamp provided)
# payload: '{"some":"payload"}', // UTF-8 encoded string for body hash generation (ignored if hash provided)
# contentType: 'application/json', // Payload content-type (ignored if hash provided)
# hash: 'U4MKKSmiVxk37JCCrAVIjV=', // Pre-calculated payload hash
# app: '24s23423f34dx', // Oz application id
# dlg: '234sz34tww3sd' // Oz delegated-by application id
# }
#
exports.header = (uri, method, options) ->
result =
field: ""
artifacts: {}
# Validate inputs
if not uri or (typeof uri isnt "string" and typeof uri isnt "object") or not method or typeof method isnt "string" or not options or typeof options isnt "object"
result.err = "Invalid argument type"
return result
# Application time
timestamp = options.timestamp or Math.floor((Utils.now() + (options.localtimeOffsetMsec or 0)) / 1000)
# Validate credentials
credentials = options.credentials
if not credentials or not credentials.id or not credentials.key or not credentials.algorithm
result.err = "Invalid credential object"
return result
if Crypto.algorithms.indexOf(credentials.algorithm) is -1
result.err = "Unknown algorithm"
return result
# Parse URI
uri = Url.parse(uri) if typeof uri is "string"
# Calculate signature
artifacts =
ts: timestamp
nonce: options.nonce or Cryptiles.randomString(6)
method: method
resource: uri.pathname + (uri.search or "") # Maintain trailing '?'
host: uri.hostname
port: uri.port or ((if uri.protocol is "http:" then 80 else 443))
hash: options.hash
ext: options.ext
app: options.app
dlg: options.dlg
result.artifacts = artifacts
# Calculate payload hash
artifacts.hash = Crypto.calculatePayloadHash(options.payload, credentials.algorithm, options.contentType) if not artifacts.hash and options.hasOwnProperty("payload")
mac = Crypto.calculateMac("header", credentials, artifacts)
# Construct header
hasExt = artifacts.ext isnt null and artifacts.ext isnt `undefined` and artifacts.ext isnt "" # Other falsey values allowed
header = "Hawk id=\"" + credentials.id + "\", ts=\"" + artifacts.ts + "\", nonce=\"" + artifacts.nonce + ((if artifacts.hash then "\", hash=\"" + artifacts.hash else "")) + ((if hasExt then "\", ext=\"" + Utils.escapeHeaderAttribute(artifacts.ext) else "")) + "\", mac=\"" + mac + "\""
header += ", app=\"" + artifacts.app + ((if artifacts.dlg then "\", dlg=\"" + artifacts.dlg else "")) + "\"" if artifacts.app
result.field = header
result
# Validate server response
#
# res: node's response object
# artifacts: object recieved from header().artifacts
# options: {
# payload: optional payload received
# required: specifies if a Server-Authorization header is required. Defaults to 'false'
# }
#
exports.authenticate = (res, credentials, artifacts, options) ->
artifacts = Hoek.clone(artifacts)
options = options or {}
if res.headers["www-authenticate"]
# Parse HTTP WWW-Authenticate header
attributes = Utils.parseAuthorizationHeader(res.headers["www-authenticate"], [
"ts"
"tsm"
"error"
])
return false if attributes instanceof Error
# Validate server timestamp (not used to update clock since it is done via the SNPT client)
if attributes.ts
tsm = Crypto.calculateTsMac(attributes.ts, credentials)
return false if tsm isnt attributes.tsm
# Parse HTTP Server-Authorization header
return true if not res.headers["server-authorization"] and not options.required
attributes = Utils.parseAuthorizationHeader(res.headers["server-authorization"], [
"mac"
"ext"
"hash"
])
return false if attributes instanceof Error
artifacts.ext = attributes.ext
artifacts.hash = attributes.hash
mac = Crypto.calculateMac("response", credentials, artifacts)
return false if mac isnt attributes.mac
return true unless options.hasOwnProperty("payload")
return false unless attributes.hash
calculatedHash = Crypto.calculatePayloadHash(options.payload, credentials.algorithm, res.headers["content-type"])
calculatedHash is attributes.hash
# Generate a bewit value for a given URI
#
# * credentials is an object with the following keys: 'id, 'key', 'algorithm'.
# * options is an object with the following optional keys: 'ext', 'localtimeOffsetMsec'
#
#
# uri: 'http://example.com/resource?a=b' or object from Url.parse()
# options: {
#
# // Required
#
# credentials: {
# id: 'dh37fgj492je',
# key: 'aoijedoaijsdlaksjdl',
# algorithm: 'sha256' // 'sha1', 'sha256'
# },
# ttlSec: 60 * 60, // TTL in seconds
#
# // Optional
#
# ext: 'application-specific', // Application specific data sent via the ext attribute
# localtimeOffsetMsec: 400 // Time offset to sync with server time
# };
#
exports.getBewit = (uri, options) ->
# Validate inputs
return "" if not uri or (typeof uri isnt "string" and typeof uri isnt "object") or not options or typeof options isnt "object" or not options.ttlSec
options.ext = ((if options.ext is null or options.ext is `undefined` then "" else options.ext)) # Zero is valid value
# Application time
now = Utils.now() + (options.localtimeOffsetMsec or 0)
# Validate credentials
credentials = options.credentials
return "" if not credentials or not credentials.id or not credentials.key or not credentials.algorithm
return "" if Crypto.algorithms.indexOf(credentials.algorithm) is -1
# Parse URI
uri = Url.parse(uri) if typeof uri is "string"
# Calculate signature
exp = Math.floor(now / 1000) + options.ttlSec
mac = Crypto.calculateMac("bewit", credentials,
ts: exp
nonce: ""
method: "GET"
resource: uri.pathname + (uri.search or "") # Maintain trailing '?'
host: uri.hostname
port: uri.port or ((if uri.protocol is "http:" then 80 else 443))
ext: options.ext
)
# Construct bewit: id\exp\mac\ext
bewit = credentials.id + "\\" + exp + "\\" + mac + "\\" + options.ext
Utils.base64urlEncode bewit
# Generate an authorization string for a message
#
# host: 'example.com',
# port: 8000,
# message: '{"some":"payload"}', // UTF-8 encoded string for body hash generation
# options: {
#
# // Required
#
# credentials: {
# id: 'dh37fgj492je',
# key: 'aoijedoaijsdlaksjdl',
# algorithm: 'sha256' // 'sha1', 'sha256'
# },
#
# // Optional
#
# timestamp: Date.now(), // A pre-calculated timestamp
# nonce: '2334f34f', // A pre-generated nonce
# localtimeOffsetMsec: 400, // Time offset to sync with server time (ignored if timestamp provided)
# }
#
exports.message = (host, port, message, options) ->
# Validate inputs
return null if not host or typeof host isnt "string" or not port or typeof port isnt "number" or message is null or message is `undefined` or typeof message isnt "string" or not options or typeof options isnt "object"
# Application time
timestamp = options.timestamp or Math.floor((Utils.now() + (options.localtimeOffsetMsec or 0)) / 1000)
# Validate credentials
credentials = options.credentials
# Invalid credential object
return null if not credentials or not credentials.id or not credentials.key or not credentials.algorithm
return null if Crypto.algorithms.indexOf(credentials.algorithm) is -1
# Calculate signature
artifacts =
ts: timestamp
nonce: options.nonce or Cryptiles.randomString(6)
host: host
port: port
hash: Crypto.calculatePayloadHash(message, credentials.algorithm)
# Construct authorization
result =
id: credentials.id
ts: artifacts.ts
nonce: artifacts.nonce
hash: artifacts.hash
mac: Crypto.calculateMac("message", credentials, artifacts)
result
| 176132 | # Load modules
Url = require("url")
Hoek = require("hoek")
Cryptiles = require("cryptiles")
Crypto = require("./crypto")
Utils = require("./utils")
# Declare internals
internals = {}
# Generate an Authorization header for a given request
#
# uri: 'http://example.com/resource?a=b' or object from Url.parse()
# method: HTTP verb (e.g. 'GET', 'POST')
# options: {
#
# // Required
#
# credentials: {
# id: '<KEY>',
# key: '<KEY>',
# algorithm: 'sha256' // 'sha1', 'sha256'
# },
#
# // Optional
#
# ext: 'application-specific', // Application specific data sent via the ext attribute
# timestamp: Date.now(), // A pre-calculated timestamp
# nonce: '2334f34f', // A pre-generated nonce
# localtimeOffsetMsec: 400, // Time offset to sync with server time (ignored if timestamp provided)
# payload: '{"some":"payload"}', // UTF-8 encoded string for body hash generation (ignored if hash provided)
# contentType: 'application/json', // Payload content-type (ignored if hash provided)
# hash: 'U4MKKSmiVxk37JCCrAVIjV=', // Pre-calculated payload hash
# app: '24s23423f34dx', // Oz application id
# dlg: '234sz34tww3sd' // Oz delegated-by application id
# }
#
exports.header = (uri, method, options) ->
result =
field: ""
artifacts: {}
# Validate inputs
if not uri or (typeof uri isnt "string" and typeof uri isnt "object") or not method or typeof method isnt "string" or not options or typeof options isnt "object"
result.err = "Invalid argument type"
return result
# Application time
timestamp = options.timestamp or Math.floor((Utils.now() + (options.localtimeOffsetMsec or 0)) / 1000)
# Validate credentials
credentials = options.credentials
if not credentials or not credentials.id or not credentials.key or not credentials.algorithm
result.err = "Invalid credential object"
return result
if Crypto.algorithms.indexOf(credentials.algorithm) is -1
result.err = "Unknown algorithm"
return result
# Parse URI
uri = Url.parse(uri) if typeof uri is "string"
# Calculate signature
artifacts =
ts: timestamp
nonce: options.nonce or Cryptiles.randomString(6)
method: method
resource: uri.pathname + (uri.search or "") # Maintain trailing '?'
host: uri.hostname
port: uri.port or ((if uri.protocol is "http:" then 80 else 443))
hash: options.hash
ext: options.ext
app: options.app
dlg: options.dlg
result.artifacts = artifacts
# Calculate payload hash
artifacts.hash = Crypto.calculatePayloadHash(options.payload, credentials.algorithm, options.contentType) if not artifacts.hash and options.hasOwnProperty("payload")
mac = Crypto.calculateMac("header", credentials, artifacts)
# Construct header
hasExt = artifacts.ext isnt null and artifacts.ext isnt `undefined` and artifacts.ext isnt "" # Other falsey values allowed
header = "Hawk id=\"" + credentials.id + "\", ts=\"" + artifacts.ts + "\", nonce=\"" + artifacts.nonce + ((if artifacts.hash then "\", hash=\"" + artifacts.hash else "")) + ((if hasExt then "\", ext=\"" + Utils.escapeHeaderAttribute(artifacts.ext) else "")) + "\", mac=\"" + mac + "\""
header += ", app=\"" + artifacts.app + ((if artifacts.dlg then "\", dlg=\"" + artifacts.dlg else "")) + "\"" if artifacts.app
result.field = header
result
# Validate server response
#
# res: node's response object
# artifacts: object recieved from header().artifacts
# options: {
# payload: optional payload received
# required: specifies if a Server-Authorization header is required. Defaults to 'false'
# }
#
exports.authenticate = (res, credentials, artifacts, options) ->
artifacts = Hoek.clone(artifacts)
options = options or {}
if res.headers["www-authenticate"]
# Parse HTTP WWW-Authenticate header
attributes = Utils.parseAuthorizationHeader(res.headers["www-authenticate"], [
"ts"
"tsm"
"error"
])
return false if attributes instanceof Error
# Validate server timestamp (not used to update clock since it is done via the SNPT client)
if attributes.ts
tsm = Crypto.calculateTsMac(attributes.ts, credentials)
return false if tsm isnt attributes.tsm
# Parse HTTP Server-Authorization header
return true if not res.headers["server-authorization"] and not options.required
attributes = Utils.parseAuthorizationHeader(res.headers["server-authorization"], [
"mac"
"ext"
"hash"
])
return false if attributes instanceof Error
artifacts.ext = attributes.ext
artifacts.hash = attributes.hash
mac = Crypto.calculateMac("response", credentials, artifacts)
return false if mac isnt attributes.mac
return true unless options.hasOwnProperty("payload")
return false unless attributes.hash
calculatedHash = Crypto.calculatePayloadHash(options.payload, credentials.algorithm, res.headers["content-type"])
calculatedHash is attributes.hash
# Generate a bewit value for a given URI
#
# * credentials is an object with the following keys: 'id, 'key', 'algorithm'.
# * options is an object with the following optional keys: 'ext', 'localtimeOffsetMsec'
#
#
# uri: 'http://example.com/resource?a=b' or object from Url.parse()
# options: {
#
# // Required
#
# credentials: {
# id: 'dh37fgj492je',
# key: '<KEY>',
# algorithm: 'sha256' // 'sha1', 'sha256'
# },
# ttlSec: 60 * 60, // TTL in seconds
#
# // Optional
#
# ext: 'application-specific', // Application specific data sent via the ext attribute
# localtimeOffsetMsec: 400 // Time offset to sync with server time
# };
#
exports.getBewit = (uri, options) ->
# Validate inputs
return "" if not uri or (typeof uri isnt "string" and typeof uri isnt "object") or not options or typeof options isnt "object" or not options.ttlSec
options.ext = ((if options.ext is null or options.ext is `undefined` then "" else options.ext)) # Zero is valid value
# Application time
now = Utils.now() + (options.localtimeOffsetMsec or 0)
# Validate credentials
credentials = options.credentials
return "" if not credentials or not credentials.id or not credentials.key or not credentials.algorithm
return "" if Crypto.algorithms.indexOf(credentials.algorithm) is -1
# Parse URI
uri = Url.parse(uri) if typeof uri is "string"
# Calculate signature
exp = Math.floor(now / 1000) + options.ttlSec
mac = Crypto.calculateMac("bewit", credentials,
ts: exp
nonce: ""
method: "GET"
resource: uri.pathname + (uri.search or "") # Maintain trailing '?'
host: uri.hostname
port: uri.port or ((if uri.protocol is "http:" then 80 else 443))
ext: options.ext
)
# Construct bewit: id\exp\mac\ext
bewit = credentials.id + "\\" + exp + "\\" + mac + "\\" + options.ext
Utils.base64urlEncode bewit
# Generate an authorization string for a message
#
# host: 'example.com',
# port: 8000,
# message: '{"some":"payload"}', // UTF-8 encoded string for body hash generation
# options: {
#
# // Required
#
# credentials: {
# id: 'dh37fgj492je',
# key: '<KEY>',
# algorithm: 'sha256' // 'sha1', 'sha256'
# },
#
# // Optional
#
# timestamp: Date.now(), // A pre-calculated timestamp
# nonce: '2334f34f', // A pre-generated nonce
# localtimeOffsetMsec: 400, // Time offset to sync with server time (ignored if timestamp provided)
# }
#
exports.message = (host, port, message, options) ->
# Validate inputs
return null if not host or typeof host isnt "string" or not port or typeof port isnt "number" or message is null or message is `undefined` or typeof message isnt "string" or not options or typeof options isnt "object"
# Application time
timestamp = options.timestamp or Math.floor((Utils.now() + (options.localtimeOffsetMsec or 0)) / 1000)
# Validate credentials
credentials = options.credentials
# Invalid credential object
return null if not credentials or not credentials.id or not credentials.key or not credentials.algorithm
return null if Crypto.algorithms.indexOf(credentials.algorithm) is -1
# Calculate signature
artifacts =
ts: timestamp
nonce: options.nonce or Cryptiles.randomString(6)
host: host
port: port
hash: Crypto.calculatePayloadHash(message, credentials.algorithm)
# Construct authorization
result =
id: credentials.id
ts: artifacts.ts
nonce: artifacts.nonce
hash: artifacts.hash
mac: Crypto.calculateMac("message", credentials, artifacts)
result
| true | # Load modules
Url = require("url")
Hoek = require("hoek")
Cryptiles = require("cryptiles")
Crypto = require("./crypto")
Utils = require("./utils")
# Declare internals
internals = {}
# Generate an Authorization header for a given request
#
# uri: 'http://example.com/resource?a=b' or object from Url.parse()
# method: HTTP verb (e.g. 'GET', 'POST')
# options: {
#
# // Required
#
# credentials: {
# id: 'PI:KEY:<KEY>END_PI',
# key: 'PI:KEY:<KEY>END_PI',
# algorithm: 'sha256' // 'sha1', 'sha256'
# },
#
# // Optional
#
# ext: 'application-specific', // Application specific data sent via the ext attribute
# timestamp: Date.now(), // A pre-calculated timestamp
# nonce: '2334f34f', // A pre-generated nonce
# localtimeOffsetMsec: 400, // Time offset to sync with server time (ignored if timestamp provided)
# payload: '{"some":"payload"}', // UTF-8 encoded string for body hash generation (ignored if hash provided)
# contentType: 'application/json', // Payload content-type (ignored if hash provided)
# hash: 'U4MKKSmiVxk37JCCrAVIjV=', // Pre-calculated payload hash
# app: '24s23423f34dx', // Oz application id
# dlg: '234sz34tww3sd' // Oz delegated-by application id
# }
#
exports.header = (uri, method, options) ->
result =
field: ""
artifacts: {}
# Validate inputs
if not uri or (typeof uri isnt "string" and typeof uri isnt "object") or not method or typeof method isnt "string" or not options or typeof options isnt "object"
result.err = "Invalid argument type"
return result
# Application time
timestamp = options.timestamp or Math.floor((Utils.now() + (options.localtimeOffsetMsec or 0)) / 1000)
# Validate credentials
credentials = options.credentials
if not credentials or not credentials.id or not credentials.key or not credentials.algorithm
result.err = "Invalid credential object"
return result
if Crypto.algorithms.indexOf(credentials.algorithm) is -1
result.err = "Unknown algorithm"
return result
# Parse URI
uri = Url.parse(uri) if typeof uri is "string"
# Calculate signature
artifacts =
ts: timestamp
nonce: options.nonce or Cryptiles.randomString(6)
method: method
resource: uri.pathname + (uri.search or "") # Maintain trailing '?'
host: uri.hostname
port: uri.port or ((if uri.protocol is "http:" then 80 else 443))
hash: options.hash
ext: options.ext
app: options.app
dlg: options.dlg
result.artifacts = artifacts
# Calculate payload hash
artifacts.hash = Crypto.calculatePayloadHash(options.payload, credentials.algorithm, options.contentType) if not artifacts.hash and options.hasOwnProperty("payload")
mac = Crypto.calculateMac("header", credentials, artifacts)
# Construct header
hasExt = artifacts.ext isnt null and artifacts.ext isnt `undefined` and artifacts.ext isnt "" # Other falsey values allowed
header = "Hawk id=\"" + credentials.id + "\", ts=\"" + artifacts.ts + "\", nonce=\"" + artifacts.nonce + ((if artifacts.hash then "\", hash=\"" + artifacts.hash else "")) + ((if hasExt then "\", ext=\"" + Utils.escapeHeaderAttribute(artifacts.ext) else "")) + "\", mac=\"" + mac + "\""
header += ", app=\"" + artifacts.app + ((if artifacts.dlg then "\", dlg=\"" + artifacts.dlg else "")) + "\"" if artifacts.app
result.field = header
result
# Validate server response
#
# res: node's response object
# artifacts: object recieved from header().artifacts
# options: {
# payload: optional payload received
# required: specifies if a Server-Authorization header is required. Defaults to 'false'
# }
#
exports.authenticate = (res, credentials, artifacts, options) ->
artifacts = Hoek.clone(artifacts)
options = options or {}
if res.headers["www-authenticate"]
# Parse HTTP WWW-Authenticate header
attributes = Utils.parseAuthorizationHeader(res.headers["www-authenticate"], [
"ts"
"tsm"
"error"
])
return false if attributes instanceof Error
# Validate server timestamp (not used to update clock since it is done via the SNPT client)
if attributes.ts
tsm = Crypto.calculateTsMac(attributes.ts, credentials)
return false if tsm isnt attributes.tsm
# Parse HTTP Server-Authorization header
return true if not res.headers["server-authorization"] and not options.required
attributes = Utils.parseAuthorizationHeader(res.headers["server-authorization"], [
"mac"
"ext"
"hash"
])
return false if attributes instanceof Error
artifacts.ext = attributes.ext
artifacts.hash = attributes.hash
mac = Crypto.calculateMac("response", credentials, artifacts)
return false if mac isnt attributes.mac
return true unless options.hasOwnProperty("payload")
return false unless attributes.hash
calculatedHash = Crypto.calculatePayloadHash(options.payload, credentials.algorithm, res.headers["content-type"])
calculatedHash is attributes.hash
# Generate a bewit value for a given URI
#
# * credentials is an object with the following keys: 'id, 'key', 'algorithm'.
# * options is an object with the following optional keys: 'ext', 'localtimeOffsetMsec'
#
#
# uri: 'http://example.com/resource?a=b' or object from Url.parse()
# options: {
#
# // Required
#
# credentials: {
# id: 'dh37fgj492je',
# key: 'PI:KEY:<KEY>END_PI',
# algorithm: 'sha256' // 'sha1', 'sha256'
# },
# ttlSec: 60 * 60, // TTL in seconds
#
# // Optional
#
# ext: 'application-specific', // Application specific data sent via the ext attribute
# localtimeOffsetMsec: 400 // Time offset to sync with server time
# };
#
exports.getBewit = (uri, options) ->
# Validate inputs
return "" if not uri or (typeof uri isnt "string" and typeof uri isnt "object") or not options or typeof options isnt "object" or not options.ttlSec
options.ext = ((if options.ext is null or options.ext is `undefined` then "" else options.ext)) # Zero is valid value
# Application time
now = Utils.now() + (options.localtimeOffsetMsec or 0)
# Validate credentials
credentials = options.credentials
return "" if not credentials or not credentials.id or not credentials.key or not credentials.algorithm
return "" if Crypto.algorithms.indexOf(credentials.algorithm) is -1
# Parse URI
uri = Url.parse(uri) if typeof uri is "string"
# Calculate signature
exp = Math.floor(now / 1000) + options.ttlSec
mac = Crypto.calculateMac("bewit", credentials,
ts: exp
nonce: ""
method: "GET"
resource: uri.pathname + (uri.search or "") # Maintain trailing '?'
host: uri.hostname
port: uri.port or ((if uri.protocol is "http:" then 80 else 443))
ext: options.ext
)
# Construct bewit: id\exp\mac\ext
bewit = credentials.id + "\\" + exp + "\\" + mac + "\\" + options.ext
Utils.base64urlEncode bewit
# Generate an authorization string for a message
#
# host: 'example.com',
# port: 8000,
# message: '{"some":"payload"}', // UTF-8 encoded string for body hash generation
# options: {
#
# // Required
#
# credentials: {
# id: 'dh37fgj492je',
# key: 'PI:KEY:<KEY>END_PI',
# algorithm: 'sha256' // 'sha1', 'sha256'
# },
#
# // Optional
#
# timestamp: Date.now(), // A pre-calculated timestamp
# nonce: '2334f34f', // A pre-generated nonce
# localtimeOffsetMsec: 400, // Time offset to sync with server time (ignored if timestamp provided)
# }
#
exports.message = (host, port, message, options) ->
# Validate inputs
return null if not host or typeof host isnt "string" or not port or typeof port isnt "number" or message is null or message is `undefined` or typeof message isnt "string" or not options or typeof options isnt "object"
# Application time
timestamp = options.timestamp or Math.floor((Utils.now() + (options.localtimeOffsetMsec or 0)) / 1000)
# Validate credentials
credentials = options.credentials
# Invalid credential object
return null if not credentials or not credentials.id or not credentials.key or not credentials.algorithm
return null if Crypto.algorithms.indexOf(credentials.algorithm) is -1
# Calculate signature
artifacts =
ts: timestamp
nonce: options.nonce or Cryptiles.randomString(6)
host: host
port: port
hash: Crypto.calculatePayloadHash(message, credentials.algorithm)
# Construct authorization
result =
id: credentials.id
ts: artifacts.ts
nonce: artifacts.nonce
hash: artifacts.hash
mac: Crypto.calculateMac("message", credentials, artifacts)
result
|
[
{
"context": "the end where element == to object\", ->\n key = 3\n uno =\n equals: -> throw 'do not go here",
"end": 289,
"score": 0.8978615999221802,
"start": 288,
"tag": "KEY",
"value": "3"
}
] | spec/lib/corelib/array/rindex_spec.coffee | hasclass/core-lib | 1 | # Modifying a collection while the contents are being iterated
# gives undefined behavior. See
# http://blade.nagaokaut.ac.jp/cgi-bin/scat.rb/ruby/ruby-core/23633
describe "Array#rindex", ->
it "returns the first index backwards from the end where element == to object", ->
key = 3
uno =
equals: -> throw 'do not go here'
dos =
equals: -> true
tres =
equals: -> false
ary = R [uno, dos, tres]
expect( ary.rindex(key) ).toEqual R(1)
it "returns size-1 if last element == to object", ->
expect( R([2, 1, 3, 2, 5]).rindex(5) ).toEqual R(4)
it "returns 0 if only first element == to object", ->
expect( R([2, 1, 3, 1, 5]).rindex(2) ).toEqual R(0)
it "returns nil if no element == to object", ->
expect( R([1, 1, 3, 2, 1, 3]).rindex(4) ).toEqual null
# it "properly handles empty recursive arrays", ->
# empty = ArraySpecs.empty_recursive_array
# empty.rindex(empty).should == 0
# empty.rindex(1).should be_nil
# it "properly handles recursive arrays", ->
# array = ArraySpecs.recursive_array
# array.rindex(1).should == 0
# array.rindex(array).should == 7
describe 'ruby_version_is "1.8.7"', ->
it "accepts a block instead of an argument", ->
expect( R([4, 2, 1, 5, 1, 3]).rindex (x) -> x < 2 ).toEqual R(4)
it "ignore the block if there is an argument", ->
expect( R([4, 2, 1, 5, 1, 3]).rindex(5, (x) -> x < 2 ) ).toEqual R(3)
xit "rechecks the array size during iteration", ->
ary = R([4, 2, 1, 5, 1, 3])
seen = []
ary.rindex (x) ->
seen.push(x)
ary.clear()
false
expect( seen ).toEqual [3]
describe "given no argument and no block", ->
it "produces an Enumerator", ->
en = R([4, 2, 1, 5, 1, 3]).rindex()
expect( en ).toBeInstanceOf R.Enumerator
expect( en.each (x) -> x < 2 ).toEqual R(4)
| 107463 | # Modifying a collection while the contents are being iterated
# gives undefined behavior. See
# http://blade.nagaokaut.ac.jp/cgi-bin/scat.rb/ruby/ruby-core/23633
describe "Array#rindex", ->
it "returns the first index backwards from the end where element == to object", ->
key = <KEY>
uno =
equals: -> throw 'do not go here'
dos =
equals: -> true
tres =
equals: -> false
ary = R [uno, dos, tres]
expect( ary.rindex(key) ).toEqual R(1)
it "returns size-1 if last element == to object", ->
expect( R([2, 1, 3, 2, 5]).rindex(5) ).toEqual R(4)
it "returns 0 if only first element == to object", ->
expect( R([2, 1, 3, 1, 5]).rindex(2) ).toEqual R(0)
it "returns nil if no element == to object", ->
expect( R([1, 1, 3, 2, 1, 3]).rindex(4) ).toEqual null
# it "properly handles empty recursive arrays", ->
# empty = ArraySpecs.empty_recursive_array
# empty.rindex(empty).should == 0
# empty.rindex(1).should be_nil
# it "properly handles recursive arrays", ->
# array = ArraySpecs.recursive_array
# array.rindex(1).should == 0
# array.rindex(array).should == 7
describe 'ruby_version_is "1.8.7"', ->
it "accepts a block instead of an argument", ->
expect( R([4, 2, 1, 5, 1, 3]).rindex (x) -> x < 2 ).toEqual R(4)
it "ignore the block if there is an argument", ->
expect( R([4, 2, 1, 5, 1, 3]).rindex(5, (x) -> x < 2 ) ).toEqual R(3)
xit "rechecks the array size during iteration", ->
ary = R([4, 2, 1, 5, 1, 3])
seen = []
ary.rindex (x) ->
seen.push(x)
ary.clear()
false
expect( seen ).toEqual [3]
describe "given no argument and no block", ->
it "produces an Enumerator", ->
en = R([4, 2, 1, 5, 1, 3]).rindex()
expect( en ).toBeInstanceOf R.Enumerator
expect( en.each (x) -> x < 2 ).toEqual R(4)
| true | # Modifying a collection while the contents are being iterated
# gives undefined behavior. See
# http://blade.nagaokaut.ac.jp/cgi-bin/scat.rb/ruby/ruby-core/23633
describe "Array#rindex", ->
it "returns the first index backwards from the end where element == to object", ->
key = PI:KEY:<KEY>END_PI
uno =
equals: -> throw 'do not go here'
dos =
equals: -> true
tres =
equals: -> false
ary = R [uno, dos, tres]
expect( ary.rindex(key) ).toEqual R(1)
it "returns size-1 if last element == to object", ->
expect( R([2, 1, 3, 2, 5]).rindex(5) ).toEqual R(4)
it "returns 0 if only first element == to object", ->
expect( R([2, 1, 3, 1, 5]).rindex(2) ).toEqual R(0)
it "returns nil if no element == to object", ->
expect( R([1, 1, 3, 2, 1, 3]).rindex(4) ).toEqual null
# it "properly handles empty recursive arrays", ->
# empty = ArraySpecs.empty_recursive_array
# empty.rindex(empty).should == 0
# empty.rindex(1).should be_nil
# it "properly handles recursive arrays", ->
# array = ArraySpecs.recursive_array
# array.rindex(1).should == 0
# array.rindex(array).should == 7
describe 'ruby_version_is "1.8.7"', ->
it "accepts a block instead of an argument", ->
expect( R([4, 2, 1, 5, 1, 3]).rindex (x) -> x < 2 ).toEqual R(4)
it "ignore the block if there is an argument", ->
expect( R([4, 2, 1, 5, 1, 3]).rindex(5, (x) -> x < 2 ) ).toEqual R(3)
xit "rechecks the array size during iteration", ->
ary = R([4, 2, 1, 5, 1, 3])
seen = []
ary.rindex (x) ->
seen.push(x)
ary.clear()
false
expect( seen ).toEqual [3]
describe "given no argument and no block", ->
it "produces an Enumerator", ->
en = R([4, 2, 1, 5, 1, 3]).rindex()
expect( en ).toBeInstanceOf R.Enumerator
expect( en.each (x) -> x < 2 ).toEqual R(4)
|
[
{
"context": "/neocotic.com/UndoWikipediaBlackout) \r\n# (c) 2012 Alasdair Mercer \r\n# Freely distributable under the MIT license. ",
"end": 100,
"score": 0.9998793005943298,
"start": 85,
"tag": "NAME",
"value": "Alasdair Mercer"
}
] | src/lib/options.coffee | neocotic/UndoWikipediaBlackout | 1 | # [Undo Wikipedia Blackout](http://neocotic.com/UndoWikipediaBlackout)
# (c) 2012 Alasdair Mercer
# Freely distributable under the MIT license.
# For all details and documentation:
# <http://neocotic.com/UndoWikipediaBlackout>
# Private constants
# -----------------
# Source URL of the user feedback widget script.
WIDGET_SOURCE = 'https://widget.uservoice.com/66hVxrEWDUgjuAmIIqPKg.js'
# Private variables
# -----------------
# Indicate whether or not the user feedback feature has been added to the page.
feedbackAdded = no
# Load functions
# --------------
# Bind an event of the specified `type` to the elements included by
# `selector` that, when triggered, modifies the underlying `option` with the
# value returned by `evaluate`.
bindSaveEvent = (selector, type, option, evaluate, callback) ->
log.trace()
$(selector).on type, ->
$this = $ this
key = ''
value = null
store.modify option, (data) ->
key = $this.attr('id').match(new RegExp("^#{option}(\\S*)"))[1]
key = key[0].toLowerCase() + key.substr 1
data[key] = value = evaluate.call $this, key
callback? $this, key, value
# Update the options page with the values from the current settings.
load = ->
log.trace()
$('#analytics').attr 'checked', 'checked' if store.get 'analytics'
loadSaveEvents()
loadDeveloperTools()
# Update the developer tools section of the options page with the current
# settings.
loadDeveloperTools = ->
log.trace()
loadLogger()
# Update the logging section of the options page with the current settings.
loadLogger = ->
log.trace()
logger = store.get 'logger'
$('#loggerEnabled').attr 'checked', 'checked' if logger.enabled
loggerLevel = $ '#loggerLevel'
loggerLevel.find('option').remove()
for level in log.LEVELS
option = $ '<option/>',
text: i18n.get "opt_logger_level_#{level.name}_text"
value: level.value
option.attr 'selected', 'selected' if level.value is logger.level
loggerLevel.append option
# Ensure debug level is selected if configuration currently matches none.
unless loggerLevel.find('option[selected]').length
loggerLevel.find("option[value='#{log.DEBUG}']").attr 'selected',
'selected'
loadLoggerSaveEvents()
# Bind the event handlers required for persisting logging changes.
loadLoggerSaveEvents = ->
log.trace()
bindSaveEvent '#loggerEnabled, #loggerLevel', 'change', 'logger', (key) ->
value = if key is 'level' then @val() else @is ':checked'
log.debug "Changing logging #{key} to '#{value}'"
value
, (jel, key, value) ->
logger = store.get 'logger'
chrome.extension.getBackgroundPage().log.config = log.config = logger
analytics.track 'Logging', 'Changed', key[0].toUpperCase() + key.substr(1),
Number value
# Bind the event handlers required for persisting general changes.
loadSaveEvents = ->
log.trace()
$('#analytics').change ->
enabled = $(this).is ':checked'
log.debug "Changing analytics to '#{enabled}'"
if enabled
store.set 'analytics', yes
chrome.extension.getBackgroundPage().analytics.add()
analytics.add()
analytics.track 'General', 'Changed', 'Analytics', 1
else
analytics.track 'General', 'Changed', 'Analytics', 0
analytics.remove()
chrome.extension.getBackgroundPage().analytics.remove()
store.set 'analytics', no
# Miscellaneous functions
# -----------------------
# Add the user feedback feature to the page.
feedback = ->
unless feedbackAdded
# Temporary workaround for Content Security Policy issues with UserVoice's
# use of inline JavaScript.
# This should be removed if/when it's no longer required.
uvwDialogClose = $ '#uvw-dialog-close[onclick]'
uvwDialogClose.live 'hover', ->
$(this).removeAttr 'onclick'
uvwDialogClose.die 'hover'
$(uvwDialogClose.selector.replace('[onclick]', '')).live 'click', (e) ->
UserVoice.hidePopupWidget()
e.preventDefault()
uvTabLabel = $ '#uvTabLabel[href^="javascript:"]'
uvTabLabel.live 'hover', ->
$(this).removeAttr 'href'
uvTabLabel.die 'hover'
# Continue with normal process of loading Widget.
window.uvOptions = {}
uv = document.createElement 'script'
uv.async = 'async'
uv.src = WIDGET_SOURCE
script = document.getElementsByTagName('script')[0]
script.parentNode.insertBefore uv, script
feedbackAdded = yes
# Options page setup
# ------------------
options = window.options = new class Options extends utils.Class
# Public functions
# ----------------
# Initialize the options page.
# This will involve inserting and configuring the UI elements as well as
# loading the current settings.
init: ->
log.trace()
log.info 'Initializing the options page'
# Add support for analytics if the user hasn't opted out.
analytics.add() if store.get 'analytics'
# Add the user feedback feature to the page.
feedback()
# Begin initialization.
i18n.init()
$('.year-repl').html "#{new Date().getFullYear()}"
# Bind tab selection event to all tabs.
initialTabChange = yes
$('a[tabify]').click ->
target = $(this).attr 'tabify'
nav = $ "#navigation a[tabify='#{target}']"
parent = nav.parent 'li'
unless parent.hasClass 'active'
parent.siblings().removeClass 'active'
parent.addClass 'active'
$(target).show().siblings('.tab').hide()
store.set 'options_active_tab', id = nav.attr 'id'
unless initialTabChange
id = id.match(/(\S*)_nav$/)[1]
id = id[0].toUpperCase() + id.substr 1
log.debug "Changing tab to #{id}"
analytics.track 'Tabs', 'Changed', id
initialTabChange = no
$(document.body).scrollTop 0
# Reflect the persisted tab.
store.init 'options_active_tab', 'general_nav'
optionsActiveTab = store.get 'options_active_tab'
$("##{optionsActiveTab}").click()
log.debug "Initially displaying tab for #{optionsActiveTab}"
# Bind Developer Tools wizard events to their corresponding elements.
$('#tools_nav').click -> $('#tools_wizard').modal 'show'
$('.tools_close_btn').click -> $('#tools_wizard').modal 'hide'
# Ensure that form submissions don't reload the page.
$('form:not([target="_blank"])').submit -> no
# Bind analytical tracking events to key footer buttons and links.
$('footer a[href*="neocotic.com"]').click -> analytics.track 'Footer',
'Clicked', 'Homepage'
$('#donation').submit -> analytics.track 'Footer', 'Clicked', 'Donate'
# Load the current option values.
load()
# Initialize all popovers, tooltips and *go-to* links.
$('[popover]').each ->
$this = $ this
trigger = $this.attr 'data-trigger'
trigger = if trigger? then trigger.trim().toLowerCase() else 'hover'
$this.popover
content: -> i18n.get $this.attr 'popover'
trigger: trigger
if trigger is 'manual'
$this.click -> $this.popover 'toggle'
$('[title]').each ->
$this = $ this
placement = $this.attr 'data-placement'
placement = if placement? then placement.trim().toLowerCase() else 'top'
$this.tooltip placement: placement
$('[data-goto]').click ->
goto = $ $(this).attr 'data-goto'
log.debug "Relocating view to include '#{goto.selector}'"
$(window).scrollTop goto.position()?.top or 0
# Initialize `options` when the DOM is ready.
utils.ready -> options.init() | 52010 | # [Undo Wikipedia Blackout](http://neocotic.com/UndoWikipediaBlackout)
# (c) 2012 <NAME>
# Freely distributable under the MIT license.
# For all details and documentation:
# <http://neocotic.com/UndoWikipediaBlackout>
# Private constants
# -----------------
# Source URL of the user feedback widget script.
WIDGET_SOURCE = 'https://widget.uservoice.com/66hVxrEWDUgjuAmIIqPKg.js'
# Private variables
# -----------------
# Indicate whether or not the user feedback feature has been added to the page.
feedbackAdded = no
# Load functions
# --------------
# Bind an event of the specified `type` to the elements included by
# `selector` that, when triggered, modifies the underlying `option` with the
# value returned by `evaluate`.
bindSaveEvent = (selector, type, option, evaluate, callback) ->
log.trace()
$(selector).on type, ->
$this = $ this
key = ''
value = null
store.modify option, (data) ->
key = $this.attr('id').match(new RegExp("^#{option}(\\S*)"))[1]
key = key[0].toLowerCase() + key.substr 1
data[key] = value = evaluate.call $this, key
callback? $this, key, value
# Update the options page with the values from the current settings.
load = ->
log.trace()
$('#analytics').attr 'checked', 'checked' if store.get 'analytics'
loadSaveEvents()
loadDeveloperTools()
# Update the developer tools section of the options page with the current
# settings.
loadDeveloperTools = ->
log.trace()
loadLogger()
# Update the logging section of the options page with the current settings.
loadLogger = ->
log.trace()
logger = store.get 'logger'
$('#loggerEnabled').attr 'checked', 'checked' if logger.enabled
loggerLevel = $ '#loggerLevel'
loggerLevel.find('option').remove()
for level in log.LEVELS
option = $ '<option/>',
text: i18n.get "opt_logger_level_#{level.name}_text"
value: level.value
option.attr 'selected', 'selected' if level.value is logger.level
loggerLevel.append option
# Ensure debug level is selected if configuration currently matches none.
unless loggerLevel.find('option[selected]').length
loggerLevel.find("option[value='#{log.DEBUG}']").attr 'selected',
'selected'
loadLoggerSaveEvents()
# Bind the event handlers required for persisting logging changes.
loadLoggerSaveEvents = ->
log.trace()
bindSaveEvent '#loggerEnabled, #loggerLevel', 'change', 'logger', (key) ->
value = if key is 'level' then @val() else @is ':checked'
log.debug "Changing logging #{key} to '#{value}'"
value
, (jel, key, value) ->
logger = store.get 'logger'
chrome.extension.getBackgroundPage().log.config = log.config = logger
analytics.track 'Logging', 'Changed', key[0].toUpperCase() + key.substr(1),
Number value
# Bind the event handlers required for persisting general changes.
loadSaveEvents = ->
log.trace()
$('#analytics').change ->
enabled = $(this).is ':checked'
log.debug "Changing analytics to '#{enabled}'"
if enabled
store.set 'analytics', yes
chrome.extension.getBackgroundPage().analytics.add()
analytics.add()
analytics.track 'General', 'Changed', 'Analytics', 1
else
analytics.track 'General', 'Changed', 'Analytics', 0
analytics.remove()
chrome.extension.getBackgroundPage().analytics.remove()
store.set 'analytics', no
# Miscellaneous functions
# -----------------------
# Add the user feedback feature to the page.
feedback = ->
unless feedbackAdded
# Temporary workaround for Content Security Policy issues with UserVoice's
# use of inline JavaScript.
# This should be removed if/when it's no longer required.
uvwDialogClose = $ '#uvw-dialog-close[onclick]'
uvwDialogClose.live 'hover', ->
$(this).removeAttr 'onclick'
uvwDialogClose.die 'hover'
$(uvwDialogClose.selector.replace('[onclick]', '')).live 'click', (e) ->
UserVoice.hidePopupWidget()
e.preventDefault()
uvTabLabel = $ '#uvTabLabel[href^="javascript:"]'
uvTabLabel.live 'hover', ->
$(this).removeAttr 'href'
uvTabLabel.die 'hover'
# Continue with normal process of loading Widget.
window.uvOptions = {}
uv = document.createElement 'script'
uv.async = 'async'
uv.src = WIDGET_SOURCE
script = document.getElementsByTagName('script')[0]
script.parentNode.insertBefore uv, script
feedbackAdded = yes
# Options page setup
# ------------------
options = window.options = new class Options extends utils.Class
# Public functions
# ----------------
# Initialize the options page.
# This will involve inserting and configuring the UI elements as well as
# loading the current settings.
init: ->
log.trace()
log.info 'Initializing the options page'
# Add support for analytics if the user hasn't opted out.
analytics.add() if store.get 'analytics'
# Add the user feedback feature to the page.
feedback()
# Begin initialization.
i18n.init()
$('.year-repl').html "#{new Date().getFullYear()}"
# Bind tab selection event to all tabs.
initialTabChange = yes
$('a[tabify]').click ->
target = $(this).attr 'tabify'
nav = $ "#navigation a[tabify='#{target}']"
parent = nav.parent 'li'
unless parent.hasClass 'active'
parent.siblings().removeClass 'active'
parent.addClass 'active'
$(target).show().siblings('.tab').hide()
store.set 'options_active_tab', id = nav.attr 'id'
unless initialTabChange
id = id.match(/(\S*)_nav$/)[1]
id = id[0].toUpperCase() + id.substr 1
log.debug "Changing tab to #{id}"
analytics.track 'Tabs', 'Changed', id
initialTabChange = no
$(document.body).scrollTop 0
# Reflect the persisted tab.
store.init 'options_active_tab', 'general_nav'
optionsActiveTab = store.get 'options_active_tab'
$("##{optionsActiveTab}").click()
log.debug "Initially displaying tab for #{optionsActiveTab}"
# Bind Developer Tools wizard events to their corresponding elements.
$('#tools_nav').click -> $('#tools_wizard').modal 'show'
$('.tools_close_btn').click -> $('#tools_wizard').modal 'hide'
# Ensure that form submissions don't reload the page.
$('form:not([target="_blank"])').submit -> no
# Bind analytical tracking events to key footer buttons and links.
$('footer a[href*="neocotic.com"]').click -> analytics.track 'Footer',
'Clicked', 'Homepage'
$('#donation').submit -> analytics.track 'Footer', 'Clicked', 'Donate'
# Load the current option values.
load()
# Initialize all popovers, tooltips and *go-to* links.
$('[popover]').each ->
$this = $ this
trigger = $this.attr 'data-trigger'
trigger = if trigger? then trigger.trim().toLowerCase() else 'hover'
$this.popover
content: -> i18n.get $this.attr 'popover'
trigger: trigger
if trigger is 'manual'
$this.click -> $this.popover 'toggle'
$('[title]').each ->
$this = $ this
placement = $this.attr 'data-placement'
placement = if placement? then placement.trim().toLowerCase() else 'top'
$this.tooltip placement: placement
$('[data-goto]').click ->
goto = $ $(this).attr 'data-goto'
log.debug "Relocating view to include '#{goto.selector}'"
$(window).scrollTop goto.position()?.top or 0
# Initialize `options` when the DOM is ready.
utils.ready -> options.init() | true | # [Undo Wikipedia Blackout](http://neocotic.com/UndoWikipediaBlackout)
# (c) 2012 PI:NAME:<NAME>END_PI
# Freely distributable under the MIT license.
# For all details and documentation:
# <http://neocotic.com/UndoWikipediaBlackout>
# Private constants
# -----------------
# Source URL of the user feedback widget script.
WIDGET_SOURCE = 'https://widget.uservoice.com/66hVxrEWDUgjuAmIIqPKg.js'
# Private variables
# -----------------
# Indicate whether or not the user feedback feature has been added to the page.
feedbackAdded = no
# Load functions
# --------------
# Bind an event of the specified `type` to the elements included by
# `selector` that, when triggered, modifies the underlying `option` with the
# value returned by `evaluate`.
bindSaveEvent = (selector, type, option, evaluate, callback) ->
log.trace()
$(selector).on type, ->
$this = $ this
key = ''
value = null
store.modify option, (data) ->
key = $this.attr('id').match(new RegExp("^#{option}(\\S*)"))[1]
key = key[0].toLowerCase() + key.substr 1
data[key] = value = evaluate.call $this, key
callback? $this, key, value
# Update the options page with the values from the current settings.
load = ->
log.trace()
$('#analytics').attr 'checked', 'checked' if store.get 'analytics'
loadSaveEvents()
loadDeveloperTools()
# Update the developer tools section of the options page with the current
# settings.
loadDeveloperTools = ->
log.trace()
loadLogger()
# Update the logging section of the options page with the current settings.
loadLogger = ->
log.trace()
logger = store.get 'logger'
$('#loggerEnabled').attr 'checked', 'checked' if logger.enabled
loggerLevel = $ '#loggerLevel'
loggerLevel.find('option').remove()
for level in log.LEVELS
option = $ '<option/>',
text: i18n.get "opt_logger_level_#{level.name}_text"
value: level.value
option.attr 'selected', 'selected' if level.value is logger.level
loggerLevel.append option
# Ensure debug level is selected if configuration currently matches none.
unless loggerLevel.find('option[selected]').length
loggerLevel.find("option[value='#{log.DEBUG}']").attr 'selected',
'selected'
loadLoggerSaveEvents()
# Bind the event handlers required for persisting logging changes.
loadLoggerSaveEvents = ->
log.trace()
bindSaveEvent '#loggerEnabled, #loggerLevel', 'change', 'logger', (key) ->
value = if key is 'level' then @val() else @is ':checked'
log.debug "Changing logging #{key} to '#{value}'"
value
, (jel, key, value) ->
logger = store.get 'logger'
chrome.extension.getBackgroundPage().log.config = log.config = logger
analytics.track 'Logging', 'Changed', key[0].toUpperCase() + key.substr(1),
Number value
# Bind the event handlers required for persisting general changes.
loadSaveEvents = ->
log.trace()
$('#analytics').change ->
enabled = $(this).is ':checked'
log.debug "Changing analytics to '#{enabled}'"
if enabled
store.set 'analytics', yes
chrome.extension.getBackgroundPage().analytics.add()
analytics.add()
analytics.track 'General', 'Changed', 'Analytics', 1
else
analytics.track 'General', 'Changed', 'Analytics', 0
analytics.remove()
chrome.extension.getBackgroundPage().analytics.remove()
store.set 'analytics', no
# Miscellaneous functions
# -----------------------
# Add the user feedback feature to the page.
feedback = ->
unless feedbackAdded
# Temporary workaround for Content Security Policy issues with UserVoice's
# use of inline JavaScript.
# This should be removed if/when it's no longer required.
uvwDialogClose = $ '#uvw-dialog-close[onclick]'
uvwDialogClose.live 'hover', ->
$(this).removeAttr 'onclick'
uvwDialogClose.die 'hover'
$(uvwDialogClose.selector.replace('[onclick]', '')).live 'click', (e) ->
UserVoice.hidePopupWidget()
e.preventDefault()
uvTabLabel = $ '#uvTabLabel[href^="javascript:"]'
uvTabLabel.live 'hover', ->
$(this).removeAttr 'href'
uvTabLabel.die 'hover'
# Continue with normal process of loading Widget.
window.uvOptions = {}
uv = document.createElement 'script'
uv.async = 'async'
uv.src = WIDGET_SOURCE
script = document.getElementsByTagName('script')[0]
script.parentNode.insertBefore uv, script
feedbackAdded = yes
# Options page setup
# ------------------
options = window.options = new class Options extends utils.Class
# Public functions
# ----------------
# Initialize the options page.
# This will involve inserting and configuring the UI elements as well as
# loading the current settings.
init: ->
log.trace()
log.info 'Initializing the options page'
# Add support for analytics if the user hasn't opted out.
analytics.add() if store.get 'analytics'
# Add the user feedback feature to the page.
feedback()
# Begin initialization.
i18n.init()
$('.year-repl').html "#{new Date().getFullYear()}"
# Bind tab selection event to all tabs.
initialTabChange = yes
$('a[tabify]').click ->
target = $(this).attr 'tabify'
nav = $ "#navigation a[tabify='#{target}']"
parent = nav.parent 'li'
unless parent.hasClass 'active'
parent.siblings().removeClass 'active'
parent.addClass 'active'
$(target).show().siblings('.tab').hide()
store.set 'options_active_tab', id = nav.attr 'id'
unless initialTabChange
id = id.match(/(\S*)_nav$/)[1]
id = id[0].toUpperCase() + id.substr 1
log.debug "Changing tab to #{id}"
analytics.track 'Tabs', 'Changed', id
initialTabChange = no
$(document.body).scrollTop 0
# Reflect the persisted tab.
store.init 'options_active_tab', 'general_nav'
optionsActiveTab = store.get 'options_active_tab'
$("##{optionsActiveTab}").click()
log.debug "Initially displaying tab for #{optionsActiveTab}"
# Bind Developer Tools wizard events to their corresponding elements.
$('#tools_nav').click -> $('#tools_wizard').modal 'show'
$('.tools_close_btn').click -> $('#tools_wizard').modal 'hide'
# Ensure that form submissions don't reload the page.
$('form:not([target="_blank"])').submit -> no
# Bind analytical tracking events to key footer buttons and links.
$('footer a[href*="neocotic.com"]').click -> analytics.track 'Footer',
'Clicked', 'Homepage'
$('#donation').submit -> analytics.track 'Footer', 'Clicked', 'Donate'
# Load the current option values.
load()
# Initialize all popovers, tooltips and *go-to* links.
$('[popover]').each ->
$this = $ this
trigger = $this.attr 'data-trigger'
trigger = if trigger? then trigger.trim().toLowerCase() else 'hover'
$this.popover
content: -> i18n.get $this.attr 'popover'
trigger: trigger
if trigger is 'manual'
$this.click -> $this.popover 'toggle'
$('[title]').each ->
$this = $ this
placement = $this.attr 'data-placement'
placement = if placement? then placement.trim().toLowerCase() else 'top'
$this.tooltip placement: placement
$('[data-goto]').click ->
goto = $ $(this).attr 'data-goto'
log.debug "Relocating view to include '#{goto.selector}'"
$(window).scrollTop goto.position()?.top or 0
# Initialize `options` when the DOM is ready.
utils.ready -> options.init() |
[
{
"context": "out 12000\n\n\t\tbeforeEach ->\n\t\t\t@driver.get 'http://127.0.0.1/'\n\n\t\tit 'has the title of the application in the ",
"end": 400,
"score": 0.7324510812759399,
"start": 391,
"tag": "IP_ADDRESS",
"value": "127.0.0.1"
},
{
"context": "ut 12000\n\n\t\tbeforeEach ->\n\t\t\t@driver.get 'http://127.0.0.1/'\n\n\t\tit 'is the name of the private list after cl",
"end": 1256,
"score": 0.7102668881416321,
"start": 1248,
"tag": "IP_ADDRESS",
"value": "27.0.0.1"
},
{
"context": " 12000\n\n\t\tbeforeEach ->\n\t\t\t@driver.get 'http://127.0.0.1/'\n\n\t\tit 'is the length of the completd items",
"end": 2254,
"score": 0.5693066120147705,
"start": 2254,
"tag": "IP_ADDRESS",
"value": ""
},
{
"context": "2000\n\n\t\tbeforeEach ->\n\t\t\t@driver.get 'http://127.0.0.1/'\n\n\t\tit 'is the length of the completd items = 1",
"end": 2258,
"score": 0.6038933396339417,
"start": 2257,
"tag": "IP_ADDRESS",
"value": "0"
}
] | test/js/totodoo2.coffee | markomanninen/totodoo | 0 | selenium = require 'selenium-webdriver'
chai = require 'chai'
chai.use require 'chai-as-promised'
expect = chai.expect
before ->
@driver = new selenium.Builder()
.withCapabilities(selenium.Capabilities.phantomjs())
.build()
@driver.getWindowHandle()
after ->
@driver.quit()
describe 'Totodoo App', ->
describe 'Init', ->
@timeout 12000
beforeEach ->
@driver.get 'http://127.0.0.1/'
it 'has the title of the application in the window\'s title', (done) ->
expect(@driver.getTitle()).to.eventually.contain 'Totodoo App'
@timeout 4000, done()
it 'is the name of the default list', (done) ->
drvr = @driver
@driver.wait((()-> drvr.executeScript('return document.readyState')), 10000).then ()->
text = drvr.findElement(id: 'listName').getText()
expect(text).to.eventually.equal 'Public list 1'
done()
it 'is the length of the default list items = 2', (done) ->
drvr = @driver
@driver.wait((()-> drvr.executeScript('return document.readyState')), 10000).then ()->
lis = element.all(drvr.findElement(id: 'todo-list').findElements(tagName: 'li'))
expect(lis.count()).to.eventually.equal 2
done()
describe 'List actions', ->
@timeout 12000
beforeEach ->
@driver.get 'http://127.0.0.1/'
it 'is the name of the private list after click', (done) ->
@driver.wait((()-> @driver.executeScript('return document.readyState')), 10000).then ()->
listName = 'Private list 1'
@driver.findElement(linkText: listName).click()
text = @driver.findElement(id: 'listName').getText()
expect(text).to.eventually.equal listName
@timeout 10000, done()
it 'is the name of the public list after change', (done) ->
@driver.wait((()-> @driver.executeScript('return document.readyState')), 10000).then ()->
listName = 'PUBLIC LIST 1'
el = @driver.findElement(id: 'listName')
@driver.executeScript("arguments[0].setAttribute('value', arguments[1])", el, listName)
text = @driver.findElement(id: 'id1').findElement(tagName: 'a').getText()
expect(text).to.eventually.equal listName
@timeout 4000, done()
describe 'Create list', ->
describe 'Delete list', ->
describe 'Item actions', ->
@timeout 12000
beforeEach ->
@driver.get 'http://127.0.0.1/'
it 'is the length of the completd items = 1', (done) ->
@driver.wait((()-> @driver.executeScript('return document.readyState')), 10000).then ()->
@driver.findElement(linkText: 'Completed').click()
lis = @driver.findElement(id: 'todo-list').findElements(tagName: 'li')
expect(lis.size()).to.eventually.equal 1
@timeout 10000, done()
it 'is the length of the active items = 1', (done) ->
@driver.wait((()-> @driver.executeScript('return document.readyState')), 10000).then ()->
@driver.findElement(linkText: 'Active').click()
lis = @driver.findElement(id: 'todo-list').findElements(tagName: 'li')
expect(lis.size()).to.eventually.equal 1
@timeout 10000, done()
describe 'Add item', ->
describe 'Complete item', ->
describe 'Uncomplete item', ->
describe 'Remove item', ->
describe 'Show all items', ->
describe 'Swap completed items', ->
describe 'User actions', ->
| 28630 | selenium = require 'selenium-webdriver'
chai = require 'chai'
chai.use require 'chai-as-promised'
expect = chai.expect
before ->
@driver = new selenium.Builder()
.withCapabilities(selenium.Capabilities.phantomjs())
.build()
@driver.getWindowHandle()
after ->
@driver.quit()
describe 'Totodoo App', ->
describe 'Init', ->
@timeout 12000
beforeEach ->
@driver.get 'http://127.0.0.1/'
it 'has the title of the application in the window\'s title', (done) ->
expect(@driver.getTitle()).to.eventually.contain 'Totodoo App'
@timeout 4000, done()
it 'is the name of the default list', (done) ->
drvr = @driver
@driver.wait((()-> drvr.executeScript('return document.readyState')), 10000).then ()->
text = drvr.findElement(id: 'listName').getText()
expect(text).to.eventually.equal 'Public list 1'
done()
it 'is the length of the default list items = 2', (done) ->
drvr = @driver
@driver.wait((()-> drvr.executeScript('return document.readyState')), 10000).then ()->
lis = element.all(drvr.findElement(id: 'todo-list').findElements(tagName: 'li'))
expect(lis.count()).to.eventually.equal 2
done()
describe 'List actions', ->
@timeout 12000
beforeEach ->
@driver.get 'http://1172.16.17.32/'
it 'is the name of the private list after click', (done) ->
@driver.wait((()-> @driver.executeScript('return document.readyState')), 10000).then ()->
listName = 'Private list 1'
@driver.findElement(linkText: listName).click()
text = @driver.findElement(id: 'listName').getText()
expect(text).to.eventually.equal listName
@timeout 10000, done()
it 'is the name of the public list after change', (done) ->
@driver.wait((()-> @driver.executeScript('return document.readyState')), 10000).then ()->
listName = 'PUBLIC LIST 1'
el = @driver.findElement(id: 'listName')
@driver.executeScript("arguments[0].setAttribute('value', arguments[1])", el, listName)
text = @driver.findElement(id: 'id1').findElement(tagName: 'a').getText()
expect(text).to.eventually.equal listName
@timeout 4000, done()
describe 'Create list', ->
describe 'Delete list', ->
describe 'Item actions', ->
@timeout 12000
beforeEach ->
@driver.get 'http://127.0.0.1/'
it 'is the length of the completd items = 1', (done) ->
@driver.wait((()-> @driver.executeScript('return document.readyState')), 10000).then ()->
@driver.findElement(linkText: 'Completed').click()
lis = @driver.findElement(id: 'todo-list').findElements(tagName: 'li')
expect(lis.size()).to.eventually.equal 1
@timeout 10000, done()
it 'is the length of the active items = 1', (done) ->
@driver.wait((()-> @driver.executeScript('return document.readyState')), 10000).then ()->
@driver.findElement(linkText: 'Active').click()
lis = @driver.findElement(id: 'todo-list').findElements(tagName: 'li')
expect(lis.size()).to.eventually.equal 1
@timeout 10000, done()
describe 'Add item', ->
describe 'Complete item', ->
describe 'Uncomplete item', ->
describe 'Remove item', ->
describe 'Show all items', ->
describe 'Swap completed items', ->
describe 'User actions', ->
| true | selenium = require 'selenium-webdriver'
chai = require 'chai'
chai.use require 'chai-as-promised'
expect = chai.expect
before ->
@driver = new selenium.Builder()
.withCapabilities(selenium.Capabilities.phantomjs())
.build()
@driver.getWindowHandle()
after ->
@driver.quit()
describe 'Totodoo App', ->
describe 'Init', ->
@timeout 12000
beforeEach ->
@driver.get 'http://127.0.0.1/'
it 'has the title of the application in the window\'s title', (done) ->
expect(@driver.getTitle()).to.eventually.contain 'Totodoo App'
@timeout 4000, done()
it 'is the name of the default list', (done) ->
drvr = @driver
@driver.wait((()-> drvr.executeScript('return document.readyState')), 10000).then ()->
text = drvr.findElement(id: 'listName').getText()
expect(text).to.eventually.equal 'Public list 1'
done()
it 'is the length of the default list items = 2', (done) ->
drvr = @driver
@driver.wait((()-> drvr.executeScript('return document.readyState')), 10000).then ()->
lis = element.all(drvr.findElement(id: 'todo-list').findElements(tagName: 'li'))
expect(lis.count()).to.eventually.equal 2
done()
describe 'List actions', ->
@timeout 12000
beforeEach ->
@driver.get 'http://1PI:IP_ADDRESS:172.16.17.32END_PI/'
it 'is the name of the private list after click', (done) ->
@driver.wait((()-> @driver.executeScript('return document.readyState')), 10000).then ()->
listName = 'Private list 1'
@driver.findElement(linkText: listName).click()
text = @driver.findElement(id: 'listName').getText()
expect(text).to.eventually.equal listName
@timeout 10000, done()
it 'is the name of the public list after change', (done) ->
@driver.wait((()-> @driver.executeScript('return document.readyState')), 10000).then ()->
listName = 'PUBLIC LIST 1'
el = @driver.findElement(id: 'listName')
@driver.executeScript("arguments[0].setAttribute('value', arguments[1])", el, listName)
text = @driver.findElement(id: 'id1').findElement(tagName: 'a').getText()
expect(text).to.eventually.equal listName
@timeout 4000, done()
describe 'Create list', ->
describe 'Delete list', ->
describe 'Item actions', ->
@timeout 12000
beforeEach ->
@driver.get 'http://127.0.0.1/'
it 'is the length of the completd items = 1', (done) ->
@driver.wait((()-> @driver.executeScript('return document.readyState')), 10000).then ()->
@driver.findElement(linkText: 'Completed').click()
lis = @driver.findElement(id: 'todo-list').findElements(tagName: 'li')
expect(lis.size()).to.eventually.equal 1
@timeout 10000, done()
it 'is the length of the active items = 1', (done) ->
@driver.wait((()-> @driver.executeScript('return document.readyState')), 10000).then ()->
@driver.findElement(linkText: 'Active').click()
lis = @driver.findElement(id: 'todo-list').findElements(tagName: 'li')
expect(lis.size()).to.eventually.equal 1
@timeout 10000, done()
describe 'Add item', ->
describe 'Complete item', ->
describe 'Uncomplete item', ->
describe 'Remove item', ->
describe 'Show all items', ->
describe 'Swap completed items', ->
describe 'User actions', ->
|
[
{
"context": "###\nCopyright 2016-2017 Balena\n\nLicensed under the Apache License, Version 2.0 (",
"end": 30,
"score": 0.988315224647522,
"start": 24,
"tag": "NAME",
"value": "Balena"
}
] | lib/actions/help.coffee | eternius/otto-cli | 0 | ###
Copyright 2016-2017 Balena
Licensed under the Apache License, Version 2.0 (the "License");
you may not use this file except in compliance with the License.
You may obtain a copy of the License at
http://www.apache.org/licenses/LICENSE-2.0
Unless required by applicable law or agreed to in writing, software
distributed under the License is distributed on an "AS IS" BASIS,
WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
See the License for the specific language governing permissions and
limitations under the License.
###
_ = require('lodash')
capitano = require('capitano')
columnify = require('columnify')
messages = require('../utils/messages')
{ getManualSortCompareFunction } = require('../utils/helpers')
{ exitWithExpectedError } = require('../utils/patterns')
{ getOclifHelpLinePairs } = require('./help_ts')
parse = (object) ->
return _.map object, (item) ->
# Hacky way to determine if an object is
# a function or a command
if item.alias?
signature = item.toString()
else
signature = item.signature.toString()
return [
signature
item.description
]
indent = (text) ->
text = _.map text.split('\n'), (line) ->
return ' ' + line
return text.join('\n')
print = (usageDescriptionPairs) ->
console.log indent columnify _.fromPairs(usageDescriptionPairs),
showHeaders: false
minWidth: 35
manuallySortedPrimaryCommands = [
'help',
'login',
'push',
'logs',
'ssh',
'apps',
'app',
'devices',
'device',
'tunnel',
'preload',
'build',
'deploy',
'join',
'leave',
'local scan',
]
general = (params, options, done) ->
console.log('Usage: balena [COMMAND] [OPTIONS]\n')
console.log(messages.reachingOut)
console.log('\nPrimary commands:\n')
# We do not want the wildcard command
# to be printed in the help screen.
commands = _.reject capitano.state.commands, (command) ->
return command.hidden or command.isWildcard()
groupedCommands = _.groupBy commands, (command) ->
if command.primary
return 'primary'
return 'secondary'
print parse(groupedCommands.primary).sort(getManualSortCompareFunction(
manuallySortedPrimaryCommands,
([signature, description], manualItem) ->
signature == manualItem or signature.startsWith("#{manualItem} ")
))
if options.verbose
console.log('\nAdditional commands:\n')
print parse(groupedCommands.secondary).concat(getOclifHelpLinePairs()).sort()
else
console.log('\nRun `balena help --verbose` to list additional commands')
if not _.isEmpty(capitano.state.globalOptions)
console.log('\nGlobal Options:\n')
print parse(capitano.state.globalOptions).sort()
return done()
command = (params, options, done) ->
capitano.state.getMatchCommand params.command, (error, command) ->
return done(error) if error?
if not command? or command.isWildcard()
exitWithExpectedError("Command not found: #{params.command}")
console.log("Usage: #{command.signature}")
if command.help?
console.log("\n#{command.help}")
else if command.description?
console.log("\n#{_.capitalize(command.description)}")
if not _.isEmpty(command.options)
console.log('\nOptions:\n')
print parse(command.options).sort()
return done()
exports.help =
signature: 'help [command...]'
description: 'show help'
help: '''
Get detailed help for an specific command.
Examples:
$ balena help apps
$ balena help os download
'''
primary: true
options: [
signature: 'verbose'
description: 'show additional commands'
boolean: true
alias: 'v'
]
action: (params, options, done) ->
if params.command?
command(params, options, done)
else
general(params, options, done)
| 19603 | ###
Copyright 2016-2017 <NAME>
Licensed under the Apache License, Version 2.0 (the "License");
you may not use this file except in compliance with the License.
You may obtain a copy of the License at
http://www.apache.org/licenses/LICENSE-2.0
Unless required by applicable law or agreed to in writing, software
distributed under the License is distributed on an "AS IS" BASIS,
WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
See the License for the specific language governing permissions and
limitations under the License.
###
_ = require('lodash')
capitano = require('capitano')
columnify = require('columnify')
messages = require('../utils/messages')
{ getManualSortCompareFunction } = require('../utils/helpers')
{ exitWithExpectedError } = require('../utils/patterns')
{ getOclifHelpLinePairs } = require('./help_ts')
parse = (object) ->
return _.map object, (item) ->
# Hacky way to determine if an object is
# a function or a command
if item.alias?
signature = item.toString()
else
signature = item.signature.toString()
return [
signature
item.description
]
indent = (text) ->
text = _.map text.split('\n'), (line) ->
return ' ' + line
return text.join('\n')
print = (usageDescriptionPairs) ->
console.log indent columnify _.fromPairs(usageDescriptionPairs),
showHeaders: false
minWidth: 35
manuallySortedPrimaryCommands = [
'help',
'login',
'push',
'logs',
'ssh',
'apps',
'app',
'devices',
'device',
'tunnel',
'preload',
'build',
'deploy',
'join',
'leave',
'local scan',
]
general = (params, options, done) ->
console.log('Usage: balena [COMMAND] [OPTIONS]\n')
console.log(messages.reachingOut)
console.log('\nPrimary commands:\n')
# We do not want the wildcard command
# to be printed in the help screen.
commands = _.reject capitano.state.commands, (command) ->
return command.hidden or command.isWildcard()
groupedCommands = _.groupBy commands, (command) ->
if command.primary
return 'primary'
return 'secondary'
print parse(groupedCommands.primary).sort(getManualSortCompareFunction(
manuallySortedPrimaryCommands,
([signature, description], manualItem) ->
signature == manualItem or signature.startsWith("#{manualItem} ")
))
if options.verbose
console.log('\nAdditional commands:\n')
print parse(groupedCommands.secondary).concat(getOclifHelpLinePairs()).sort()
else
console.log('\nRun `balena help --verbose` to list additional commands')
if not _.isEmpty(capitano.state.globalOptions)
console.log('\nGlobal Options:\n')
print parse(capitano.state.globalOptions).sort()
return done()
command = (params, options, done) ->
capitano.state.getMatchCommand params.command, (error, command) ->
return done(error) if error?
if not command? or command.isWildcard()
exitWithExpectedError("Command not found: #{params.command}")
console.log("Usage: #{command.signature}")
if command.help?
console.log("\n#{command.help}")
else if command.description?
console.log("\n#{_.capitalize(command.description)}")
if not _.isEmpty(command.options)
console.log('\nOptions:\n')
print parse(command.options).sort()
return done()
exports.help =
signature: 'help [command...]'
description: 'show help'
help: '''
Get detailed help for an specific command.
Examples:
$ balena help apps
$ balena help os download
'''
primary: true
options: [
signature: 'verbose'
description: 'show additional commands'
boolean: true
alias: 'v'
]
action: (params, options, done) ->
if params.command?
command(params, options, done)
else
general(params, options, done)
| true | ###
Copyright 2016-2017 PI:NAME:<NAME>END_PI
Licensed under the Apache License, Version 2.0 (the "License");
you may not use this file except in compliance with the License.
You may obtain a copy of the License at
http://www.apache.org/licenses/LICENSE-2.0
Unless required by applicable law or agreed to in writing, software
distributed under the License is distributed on an "AS IS" BASIS,
WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
See the License for the specific language governing permissions and
limitations under the License.
###
_ = require('lodash')
capitano = require('capitano')
columnify = require('columnify')
messages = require('../utils/messages')
{ getManualSortCompareFunction } = require('../utils/helpers')
{ exitWithExpectedError } = require('../utils/patterns')
{ getOclifHelpLinePairs } = require('./help_ts')
parse = (object) ->
return _.map object, (item) ->
# Hacky way to determine if an object is
# a function or a command
if item.alias?
signature = item.toString()
else
signature = item.signature.toString()
return [
signature
item.description
]
indent = (text) ->
text = _.map text.split('\n'), (line) ->
return ' ' + line
return text.join('\n')
print = (usageDescriptionPairs) ->
console.log indent columnify _.fromPairs(usageDescriptionPairs),
showHeaders: false
minWidth: 35
manuallySortedPrimaryCommands = [
'help',
'login',
'push',
'logs',
'ssh',
'apps',
'app',
'devices',
'device',
'tunnel',
'preload',
'build',
'deploy',
'join',
'leave',
'local scan',
]
general = (params, options, done) ->
console.log('Usage: balena [COMMAND] [OPTIONS]\n')
console.log(messages.reachingOut)
console.log('\nPrimary commands:\n')
# We do not want the wildcard command
# to be printed in the help screen.
commands = _.reject capitano.state.commands, (command) ->
return command.hidden or command.isWildcard()
groupedCommands = _.groupBy commands, (command) ->
if command.primary
return 'primary'
return 'secondary'
print parse(groupedCommands.primary).sort(getManualSortCompareFunction(
manuallySortedPrimaryCommands,
([signature, description], manualItem) ->
signature == manualItem or signature.startsWith("#{manualItem} ")
))
if options.verbose
console.log('\nAdditional commands:\n')
print parse(groupedCommands.secondary).concat(getOclifHelpLinePairs()).sort()
else
console.log('\nRun `balena help --verbose` to list additional commands')
if not _.isEmpty(capitano.state.globalOptions)
console.log('\nGlobal Options:\n')
print parse(capitano.state.globalOptions).sort()
return done()
command = (params, options, done) ->
capitano.state.getMatchCommand params.command, (error, command) ->
return done(error) if error?
if not command? or command.isWildcard()
exitWithExpectedError("Command not found: #{params.command}")
console.log("Usage: #{command.signature}")
if command.help?
console.log("\n#{command.help}")
else if command.description?
console.log("\n#{_.capitalize(command.description)}")
if not _.isEmpty(command.options)
console.log('\nOptions:\n')
print parse(command.options).sort()
return done()
exports.help =
signature: 'help [command...]'
description: 'show help'
help: '''
Get detailed help for an specific command.
Examples:
$ balena help apps
$ balena help os download
'''
primary: true
options: [
signature: 'verbose'
description: 'show additional commands'
boolean: true
alias: 'v'
]
action: (params, options, done) ->
if params.command?
command(params, options, done)
else
general(params, options, done)
|
[
{
"context": "# Copyright Joyent, Inc. and other Node contributors.\n#\n# Permission",
"end": 18,
"score": 0.9985197186470032,
"start": 12,
"tag": "NAME",
"value": "Joyent"
}
] | test/simple/test-http-should-keep-alive.coffee | lxe/io.coffee | 0 | # Copyright Joyent, Inc. and other Node contributors.
#
# Permission is hereby granted, free of charge, to any person obtaining a
# copy of this software and associated documentation files (the
# "Software"), to deal in the Software without restriction, including
# without limitation the rights to use, copy, modify, merge, publish,
# distribute, sublicense, and/or sell copies of the Software, and to permit
# persons to whom the Software is furnished to do so, subject to the
# following conditions:
#
# The above copyright notice and this permission notice shall be included
# in all copies or substantial portions of the Software.
#
# THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS
# OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF
# MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN
# NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM,
# DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR
# OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE
# USE OR OTHER DEALINGS IN THE SOFTWARE.
common = require("../common")
assert = require("assert")
http = require("http")
net = require("net")
SERVER_RESPONSES = [
"HTTP/1.0 200 ok\r\nContent-Length: 0\r\n\r\n"
"HTTP/1.0 200 ok\r\nContent-Length: 0\r\nConnection: keep-alive\r\n\r\n"
"HTTP/1.0 200 ok\r\nContent-Length: 0\r\nConnection: close\r\n\r\n"
"HTTP/1.1 200 ok\r\nContent-Length: 0\r\n\r\n"
"HTTP/1.1 200 ok\r\nContent-Length: 0\r\nConnection: keep-alive\r\n\r\n"
"HTTP/1.1 200 ok\r\nContent-Length: 0\r\nConnection: close\r\n\r\n"
]
SHOULD_KEEP_ALIVE = [
false # HTTP/1.0, default
true # HTTP/1.0, Connection: keep-alive
false # HTTP/1.0, Connection: close
true # HTTP/1.1, default
true # HTTP/1.1, Connection: keep-alive
false # HTTP/1.1, Connection: close
]
requests = 0
responses = 0
http.globalAgent.maxSockets = 5
server = net.createServer((socket) ->
socket.write SERVER_RESPONSES[requests]
++requests
return
).listen(common.PORT, ->
makeRequest = ->
req = http.get(
port: common.PORT
, (res) ->
assert.equal req.shouldKeepAlive, SHOULD_KEEP_ALIVE[responses], SERVER_RESPONSES[responses] + " should " + ((if SHOULD_KEEP_ALIVE[responses] then "" else "not ")) + "Keep-Alive"
++responses
if responses < SHOULD_KEEP_ALIVE.length
makeRequest()
else
server.close()
res.resume()
return
)
return
makeRequest()
return
)
process.on "exit", ->
assert.equal requests, SERVER_RESPONSES.length
assert.equal responses, SHOULD_KEEP_ALIVE.length
return
| 187091 | # Copyright <NAME>, Inc. and other Node contributors.
#
# Permission is hereby granted, free of charge, to any person obtaining a
# copy of this software and associated documentation files (the
# "Software"), to deal in the Software without restriction, including
# without limitation the rights to use, copy, modify, merge, publish,
# distribute, sublicense, and/or sell copies of the Software, and to permit
# persons to whom the Software is furnished to do so, subject to the
# following conditions:
#
# The above copyright notice and this permission notice shall be included
# in all copies or substantial portions of the Software.
#
# THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS
# OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF
# MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN
# NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM,
# DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR
# OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE
# USE OR OTHER DEALINGS IN THE SOFTWARE.
common = require("../common")
assert = require("assert")
http = require("http")
net = require("net")
SERVER_RESPONSES = [
"HTTP/1.0 200 ok\r\nContent-Length: 0\r\n\r\n"
"HTTP/1.0 200 ok\r\nContent-Length: 0\r\nConnection: keep-alive\r\n\r\n"
"HTTP/1.0 200 ok\r\nContent-Length: 0\r\nConnection: close\r\n\r\n"
"HTTP/1.1 200 ok\r\nContent-Length: 0\r\n\r\n"
"HTTP/1.1 200 ok\r\nContent-Length: 0\r\nConnection: keep-alive\r\n\r\n"
"HTTP/1.1 200 ok\r\nContent-Length: 0\r\nConnection: close\r\n\r\n"
]
SHOULD_KEEP_ALIVE = [
false # HTTP/1.0, default
true # HTTP/1.0, Connection: keep-alive
false # HTTP/1.0, Connection: close
true # HTTP/1.1, default
true # HTTP/1.1, Connection: keep-alive
false # HTTP/1.1, Connection: close
]
requests = 0
responses = 0
http.globalAgent.maxSockets = 5
server = net.createServer((socket) ->
socket.write SERVER_RESPONSES[requests]
++requests
return
).listen(common.PORT, ->
makeRequest = ->
req = http.get(
port: common.PORT
, (res) ->
assert.equal req.shouldKeepAlive, SHOULD_KEEP_ALIVE[responses], SERVER_RESPONSES[responses] + " should " + ((if SHOULD_KEEP_ALIVE[responses] then "" else "not ")) + "Keep-Alive"
++responses
if responses < SHOULD_KEEP_ALIVE.length
makeRequest()
else
server.close()
res.resume()
return
)
return
makeRequest()
return
)
process.on "exit", ->
assert.equal requests, SERVER_RESPONSES.length
assert.equal responses, SHOULD_KEEP_ALIVE.length
return
| true | # Copyright PI:NAME:<NAME>END_PI, Inc. and other Node contributors.
#
# Permission is hereby granted, free of charge, to any person obtaining a
# copy of this software and associated documentation files (the
# "Software"), to deal in the Software without restriction, including
# without limitation the rights to use, copy, modify, merge, publish,
# distribute, sublicense, and/or sell copies of the Software, and to permit
# persons to whom the Software is furnished to do so, subject to the
# following conditions:
#
# The above copyright notice and this permission notice shall be included
# in all copies or substantial portions of the Software.
#
# THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS
# OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF
# MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN
# NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM,
# DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR
# OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE
# USE OR OTHER DEALINGS IN THE SOFTWARE.
common = require("../common")
assert = require("assert")
http = require("http")
net = require("net")
SERVER_RESPONSES = [
"HTTP/1.0 200 ok\r\nContent-Length: 0\r\n\r\n"
"HTTP/1.0 200 ok\r\nContent-Length: 0\r\nConnection: keep-alive\r\n\r\n"
"HTTP/1.0 200 ok\r\nContent-Length: 0\r\nConnection: close\r\n\r\n"
"HTTP/1.1 200 ok\r\nContent-Length: 0\r\n\r\n"
"HTTP/1.1 200 ok\r\nContent-Length: 0\r\nConnection: keep-alive\r\n\r\n"
"HTTP/1.1 200 ok\r\nContent-Length: 0\r\nConnection: close\r\n\r\n"
]
SHOULD_KEEP_ALIVE = [
false # HTTP/1.0, default
true # HTTP/1.0, Connection: keep-alive
false # HTTP/1.0, Connection: close
true # HTTP/1.1, default
true # HTTP/1.1, Connection: keep-alive
false # HTTP/1.1, Connection: close
]
requests = 0
responses = 0
http.globalAgent.maxSockets = 5
server = net.createServer((socket) ->
socket.write SERVER_RESPONSES[requests]
++requests
return
).listen(common.PORT, ->
makeRequest = ->
req = http.get(
port: common.PORT
, (res) ->
assert.equal req.shouldKeepAlive, SHOULD_KEEP_ALIVE[responses], SERVER_RESPONSES[responses] + " should " + ((if SHOULD_KEEP_ALIVE[responses] then "" else "not ")) + "Keep-Alive"
++responses
if responses < SHOULD_KEEP_ALIVE.length
makeRequest()
else
server.close()
res.resume()
return
)
return
makeRequest()
return
)
process.on "exit", ->
assert.equal requests, SERVER_RESPONSES.length
assert.equal responses, SHOULD_KEEP_ALIVE.length
return
|
[
{
"context": "\n $scope.labels = [\n \"Alpha\"\n \"Bravo\"\n \"Charlie\"\n ]\n",
"end": 115,
"score": 0.9989690780639648,
"start": 108,
"tag": "NAME",
"value": "Charlie"
}
] | source/javascripts/angular/controllers/basic.coffee | adambutler/angular-js-for-data-driven-applications | 0 | angular.module('app').controller "BasicCtrl", ($scope) ->
$scope.labels = [
"Alpha"
"Bravo"
"Charlie"
]
| 119724 | angular.module('app').controller "BasicCtrl", ($scope) ->
$scope.labels = [
"Alpha"
"Bravo"
"<NAME>"
]
| true | angular.module('app').controller "BasicCtrl", ($scope) ->
$scope.labels = [
"Alpha"
"Bravo"
"PI:NAME:<NAME>END_PI"
]
|
[
{
"context": "\"nonce\" : \"24-byte nonce for xsalsa\"\n \"key\" : \"this is 32-byte key for xsalsa20\"\n \"ciphertext\" : [ 0x",
"end": 978,
"score": 0.7847883701324463,
"start": 971,
"tag": "KEY",
"value": "this is"
},
{
"context": ": \"24-byte nonce for xsalsa\"\n \"key\" : \"this is 32-byte key for xsalsa20\"\n \"ciphertext\" : [ 0x48,",
"end": 981,
"score": 0.6576611399650574,
"start": 979,
"tag": "KEY",
"value": "32"
},
{
"context": "24-byte nonce for xsalsa\"\n \"key\" : \"this is 32-byte key for xsalsa20\"\n \"ciphertext\" : [ 0x48, 0x48, 0x29, ",
"end": 994,
"score": 0.6720195412635803,
"start": 982,
"tag": "KEY",
"value": "byte key for"
},
{
"context": "e for xsalsa\"\n \"key\" : \"this is 32-byte key for xsalsa20\"\n \"ciphertext\" : [ 0x48, 0x48, 0x29, 0x7f, 0xe",
"end": 1003,
"score": 0.9636411666870117,
"start": 995,
"tag": "KEY",
"value": "xsalsa20"
}
] | test/files/salsa20.iced | CyberFlameGO/triplesec | 274 | data =
key128 : require('../data/salsa20_key128').data
key256 : require('../data/salsa20_key256').data
{Salsa20} = require '../../lib/salsa20'
{WordArray} = require '../../lib/wordarray'
test_case = (T, i, test) ->
key = WordArray.from_hex test.key
iv = WordArray.from_hex test.IV
stream = new Salsa20 key, iv
i = 0
for part in test.stream
if i < part.low
stream.getBytes(part.low - i)
bytes = stream.getBytes(part.hi - part.low + 1)
i = part.hi + 1
T.equal bytes.toString('hex'), part.bytes.toLowerCase(), "Case #{i}: #{test.desc}"
run_tests = (T, which, cb) ->
for test,i in data[which]
test_case T, i, test
cb()
exports.key256 = (T, cb) ->
run_tests T, 'key256', cb
exports.key128 = (T, cb) ->
run_tests T, 'key128', cb
exports.nonce192 = (T, cb) ->
# From here:
# https://code.google.com/p/go/source/browse/salsa20/salsa20_test.go?repo=crypto
#
v =
"nonce" : "24-byte nonce for xsalsa"
"key" : "this is 32-byte key for xsalsa20"
"ciphertext" : [ 0x48, 0x48, 0x29, 0x7f, 0xeb, 0x1f, 0xb5, 0x2f, 0xb6,
0x6d, 0x81, 0x60, 0x9b, 0xd5, 0x47, 0xfa, 0xbc, 0xbe, 0x70,
0x26, 0xed, 0xc8, 0xb5, 0xe5, 0xe4, 0x49, 0xd0, 0x88, 0xbf,
0xa6, 0x9c, 0x08, 0x8f, 0x5d, 0x8d, 0xa1, 0xd7, 0x91, 0x26,
0x7c, 0x2c, 0x19, 0x5a, 0x7f, 0x8c, 0xae, 0x9c, 0x4b, 0x40,
0x50, 0xd0, 0x8c, 0xe6, 0xd3, 0xa1, 0x51, 0xec, 0x26, 0x5f,
0x3a, 0x58, 0xe4, 0x76, 0x48 ]
nonce = WordArray.from_utf8 v.nonce
key = WordArray.from_utf8 v.key
ctext = Buffer.from(v.ciphertext).toString('hex')
stream = new Salsa20 key, nonce
bytes = stream.getBytes(v.ciphertext.length).toString('hex')
T.equal bytes, ctext, "test from salsa20.go"
cb()
exports.test_slicing = (T,cb) ->
v = data.key256[data.key256.length - 1]
key = WordArray.from_hex v.key
iv = WordArray.from_hex v.IV
n = 64
stream = new Salsa20 key, iv
reference = (stream.getBytes().toString('hex') for i in [0...n]).join('')
stream = new Salsa20 key, iv
big = stream.getBytes(n*n).toString('hex')
T.equal big, reference, 'all at once works'
stream = new Salsa20 key, iv
sz = 8
nibbles = (stream.getBytes(sz).toString('hex') for i in [0...(n*64/sz)]).join('')
T.equal big, nibbles, 'works in small nibbles'
stream = new Salsa20 key, iv
odd = (stream.getBytes(7).toString('hex') for i in [0...100]).join('')
T.equal odd, reference[0...(odd.length)], "on odd boundaries of 7"
stream = new Salsa20 key, iv
odd = (stream.getBytes(17).toString('hex') for i in [0...100]).join('')
T.equal odd, reference[0...(odd.length)], "on odd boundaries of 17"
randos = [
[56,207,186,128,22,145,254,246,71,12,102,103,91,204,61,143,146,192,80],
[252,226,56,65,10,74,108,3,153,154,92,230,195,180,124,146,215,180,170],
[202,154,234,221,147,25,114,50,232,160,201,71,146,74,77,153,122,136,241],
[106,120,187,8,144,131,101,195,208,146,113,28,124,203,90,39,126,106,181],
[143,113,158,148,76,135,91,102,175,112,102,189,148,41,155,197,58,101,142],
[5,249,193,54,187,73,62,83,201,127,238,210,118,248,165,112,105,21,136],
[2,218,113,183,85,132,159,132,90,181,89,62,185,175,253,38,15,35,149],
[126,128,107,160,167,17,239,187,106,42,175,97,49,10,229,150,200,236,227],
[224,176,32,105,156,180,238,208,74,24,19,131,29,138,35,244,223,87,232],
[221,254,40,17,232,82,246,126,94,18,122,48,66,2,223,117,85,97,20]
]
for seq in randos
stream = new Salsa20 key, iv
rand = (stream.getBytes(i).toString('hex') for i in seq).join('')
T.equal rand, reference[0...(rand.length)], "on random boundaries"
cb()
| 39598 | data =
key128 : require('../data/salsa20_key128').data
key256 : require('../data/salsa20_key256').data
{Salsa20} = require '../../lib/salsa20'
{WordArray} = require '../../lib/wordarray'
test_case = (T, i, test) ->
key = WordArray.from_hex test.key
iv = WordArray.from_hex test.IV
stream = new Salsa20 key, iv
i = 0
for part in test.stream
if i < part.low
stream.getBytes(part.low - i)
bytes = stream.getBytes(part.hi - part.low + 1)
i = part.hi + 1
T.equal bytes.toString('hex'), part.bytes.toLowerCase(), "Case #{i}: #{test.desc}"
run_tests = (T, which, cb) ->
for test,i in data[which]
test_case T, i, test
cb()
exports.key256 = (T, cb) ->
run_tests T, 'key256', cb
exports.key128 = (T, cb) ->
run_tests T, 'key128', cb
exports.nonce192 = (T, cb) ->
# From here:
# https://code.google.com/p/go/source/browse/salsa20/salsa20_test.go?repo=crypto
#
v =
"nonce" : "24-byte nonce for xsalsa"
"key" : "<KEY> <KEY>-<KEY> <KEY>"
"ciphertext" : [ 0x48, 0x48, 0x29, 0x7f, 0xeb, 0x1f, 0xb5, 0x2f, 0xb6,
0x6d, 0x81, 0x60, 0x9b, 0xd5, 0x47, 0xfa, 0xbc, 0xbe, 0x70,
0x26, 0xed, 0xc8, 0xb5, 0xe5, 0xe4, 0x49, 0xd0, 0x88, 0xbf,
0xa6, 0x9c, 0x08, 0x8f, 0x5d, 0x8d, 0xa1, 0xd7, 0x91, 0x26,
0x7c, 0x2c, 0x19, 0x5a, 0x7f, 0x8c, 0xae, 0x9c, 0x4b, 0x40,
0x50, 0xd0, 0x8c, 0xe6, 0xd3, 0xa1, 0x51, 0xec, 0x26, 0x5f,
0x3a, 0x58, 0xe4, 0x76, 0x48 ]
nonce = WordArray.from_utf8 v.nonce
key = WordArray.from_utf8 v.key
ctext = Buffer.from(v.ciphertext).toString('hex')
stream = new Salsa20 key, nonce
bytes = stream.getBytes(v.ciphertext.length).toString('hex')
T.equal bytes, ctext, "test from salsa20.go"
cb()
exports.test_slicing = (T,cb) ->
v = data.key256[data.key256.length - 1]
key = WordArray.from_hex v.key
iv = WordArray.from_hex v.IV
n = 64
stream = new Salsa20 key, iv
reference = (stream.getBytes().toString('hex') for i in [0...n]).join('')
stream = new Salsa20 key, iv
big = stream.getBytes(n*n).toString('hex')
T.equal big, reference, 'all at once works'
stream = new Salsa20 key, iv
sz = 8
nibbles = (stream.getBytes(sz).toString('hex') for i in [0...(n*64/sz)]).join('')
T.equal big, nibbles, 'works in small nibbles'
stream = new Salsa20 key, iv
odd = (stream.getBytes(7).toString('hex') for i in [0...100]).join('')
T.equal odd, reference[0...(odd.length)], "on odd boundaries of 7"
stream = new Salsa20 key, iv
odd = (stream.getBytes(17).toString('hex') for i in [0...100]).join('')
T.equal odd, reference[0...(odd.length)], "on odd boundaries of 17"
randos = [
[56,207,186,128,22,145,254,246,71,12,102,103,91,204,61,143,146,192,80],
[252,226,56,65,10,74,108,3,153,154,92,230,195,180,124,146,215,180,170],
[202,154,234,221,147,25,114,50,232,160,201,71,146,74,77,153,122,136,241],
[106,120,187,8,144,131,101,195,208,146,113,28,124,203,90,39,126,106,181],
[143,113,158,148,76,135,91,102,175,112,102,189,148,41,155,197,58,101,142],
[5,249,193,54,187,73,62,83,201,127,238,210,118,248,165,112,105,21,136],
[2,218,113,183,85,132,159,132,90,181,89,62,185,175,253,38,15,35,149],
[126,128,107,160,167,17,239,187,106,42,175,97,49,10,229,150,200,236,227],
[224,176,32,105,156,180,238,208,74,24,19,131,29,138,35,244,223,87,232],
[221,254,40,17,232,82,246,126,94,18,122,48,66,2,223,117,85,97,20]
]
for seq in randos
stream = new Salsa20 key, iv
rand = (stream.getBytes(i).toString('hex') for i in seq).join('')
T.equal rand, reference[0...(rand.length)], "on random boundaries"
cb()
| true | data =
key128 : require('../data/salsa20_key128').data
key256 : require('../data/salsa20_key256').data
{Salsa20} = require '../../lib/salsa20'
{WordArray} = require '../../lib/wordarray'
test_case = (T, i, test) ->
key = WordArray.from_hex test.key
iv = WordArray.from_hex test.IV
stream = new Salsa20 key, iv
i = 0
for part in test.stream
if i < part.low
stream.getBytes(part.low - i)
bytes = stream.getBytes(part.hi - part.low + 1)
i = part.hi + 1
T.equal bytes.toString('hex'), part.bytes.toLowerCase(), "Case #{i}: #{test.desc}"
run_tests = (T, which, cb) ->
for test,i in data[which]
test_case T, i, test
cb()
exports.key256 = (T, cb) ->
run_tests T, 'key256', cb
exports.key128 = (T, cb) ->
run_tests T, 'key128', cb
exports.nonce192 = (T, cb) ->
# From here:
# https://code.google.com/p/go/source/browse/salsa20/salsa20_test.go?repo=crypto
#
v =
"nonce" : "24-byte nonce for xsalsa"
"key" : "PI:KEY:<KEY>END_PI PI:KEY:<KEY>END_PI-PI:KEY:<KEY>END_PI PI:KEY:<KEY>END_PI"
"ciphertext" : [ 0x48, 0x48, 0x29, 0x7f, 0xeb, 0x1f, 0xb5, 0x2f, 0xb6,
0x6d, 0x81, 0x60, 0x9b, 0xd5, 0x47, 0xfa, 0xbc, 0xbe, 0x70,
0x26, 0xed, 0xc8, 0xb5, 0xe5, 0xe4, 0x49, 0xd0, 0x88, 0xbf,
0xa6, 0x9c, 0x08, 0x8f, 0x5d, 0x8d, 0xa1, 0xd7, 0x91, 0x26,
0x7c, 0x2c, 0x19, 0x5a, 0x7f, 0x8c, 0xae, 0x9c, 0x4b, 0x40,
0x50, 0xd0, 0x8c, 0xe6, 0xd3, 0xa1, 0x51, 0xec, 0x26, 0x5f,
0x3a, 0x58, 0xe4, 0x76, 0x48 ]
nonce = WordArray.from_utf8 v.nonce
key = WordArray.from_utf8 v.key
ctext = Buffer.from(v.ciphertext).toString('hex')
stream = new Salsa20 key, nonce
bytes = stream.getBytes(v.ciphertext.length).toString('hex')
T.equal bytes, ctext, "test from salsa20.go"
cb()
exports.test_slicing = (T,cb) ->
v = data.key256[data.key256.length - 1]
key = WordArray.from_hex v.key
iv = WordArray.from_hex v.IV
n = 64
stream = new Salsa20 key, iv
reference = (stream.getBytes().toString('hex') for i in [0...n]).join('')
stream = new Salsa20 key, iv
big = stream.getBytes(n*n).toString('hex')
T.equal big, reference, 'all at once works'
stream = new Salsa20 key, iv
sz = 8
nibbles = (stream.getBytes(sz).toString('hex') for i in [0...(n*64/sz)]).join('')
T.equal big, nibbles, 'works in small nibbles'
stream = new Salsa20 key, iv
odd = (stream.getBytes(7).toString('hex') for i in [0...100]).join('')
T.equal odd, reference[0...(odd.length)], "on odd boundaries of 7"
stream = new Salsa20 key, iv
odd = (stream.getBytes(17).toString('hex') for i in [0...100]).join('')
T.equal odd, reference[0...(odd.length)], "on odd boundaries of 17"
randos = [
[56,207,186,128,22,145,254,246,71,12,102,103,91,204,61,143,146,192,80],
[252,226,56,65,10,74,108,3,153,154,92,230,195,180,124,146,215,180,170],
[202,154,234,221,147,25,114,50,232,160,201,71,146,74,77,153,122,136,241],
[106,120,187,8,144,131,101,195,208,146,113,28,124,203,90,39,126,106,181],
[143,113,158,148,76,135,91,102,175,112,102,189,148,41,155,197,58,101,142],
[5,249,193,54,187,73,62,83,201,127,238,210,118,248,165,112,105,21,136],
[2,218,113,183,85,132,159,132,90,181,89,62,185,175,253,38,15,35,149],
[126,128,107,160,167,17,239,187,106,42,175,97,49,10,229,150,200,236,227],
[224,176,32,105,156,180,238,208,74,24,19,131,29,138,35,244,223,87,232],
[221,254,40,17,232,82,246,126,94,18,122,48,66,2,223,117,85,97,20]
]
for seq in randos
stream = new Salsa20 key, iv
rand = (stream.getBytes(i).toString('hex') for i in seq).join('')
T.equal rand, reference[0...(rand.length)], "on random boundaries"
cb()
|
[
{
"context": "ould have a name', ->\n @foo.name.should.equal 'Acute Pharyngitis'\n\n it 'should execute to the defined value set',",
"end": 1019,
"score": 0.9992696642875671,
"start": 1002,
"tag": "NAME",
"value": "Acute Pharyngitis"
},
{
"context": " setup @, data, [], vsets\n\n it 'should find that John is not female', ->\n @ctx.patient = new Patien",
"end": 2355,
"score": 0.9675527215003967,
"start": 2351,
"tag": "NAME",
"value": "John"
},
{
"context": "ec(@ctx).should.be.false()\n\n it 'should find that Sally is female', ->\n @ctx.patient = new PatientSou",
"end": 2510,
"score": 0.9708786010742188,
"start": 2505,
"tag": "NAME",
"value": "Sally"
}
] | Src/coffeescript/cql-execution/test/elm/clinical/test.coffee | MeasureAuthoringTool/clinical_quality_language | 2 | should = require 'should'
setup = require '../../setup'
data = require './data'
vsets = require './valuesets'
{ p1, p2 } = require './patients'
{ PatientSource} = require '../../../lib/cql-patient'
describe 'ValueSetDef', ->
@beforeEach ->
setup @, data, [], vsets
it 'should return a resolved value set when the codeService knows about it', ->
vs = @known.exec(@ctx)
vs.oid.should.equal '2.16.840.1.113883.3.464.1003.101.12.1061'
vs.version.should.equal '20140501'
vs.codes.length.should.equal 3
it 'should execute one-arg to ValueSet with ID', ->
vs = @['unknown One Arg'].exec(@ctx)
vs.oid.should.equal '1.2.3.4.5.6.7.8.9'
should.not.exist vs.version
it 'should execute two-arg to ValueSet with ID and version', ->
vs = @['unknown Two Arg'].exec(@ctx)
vs.oid.should.equal '1.2.3.4.5.6.7.8.9'
vs.version.should.equal '1'
describe 'ValueSetRef', ->
@beforeEach ->
setup @, data
it 'should have a name', ->
@foo.name.should.equal 'Acute Pharyngitis'
it 'should execute to the defined value set', ->
@foo.exec(@ctx).oid.should.equal '2.16.840.1.113883.3.464.1003.101.12.1001'
describe 'InValueSet', ->
@beforeEach ->
setup @, data, [], vsets
it 'should find string code in value set', ->
@string.exec(@ctx).should.be.true()
it 'should find string code in versioned value set', ->
@stringInVersionedValueSet.exec(@ctx).should.be.true()
it 'should find short code in value set', ->
@shortCode.exec(@ctx).should.be.true()
it 'should find medium code in value set', ->
@mediumCode.exec(@ctx).should.be.true()
it 'should find long code in value set', ->
@longCode.exec(@ctx).should.be.true()
it 'should not find string code in value set', ->
@wrongString.exec(@ctx).should.be.false()
it 'should not find string code in versioned value set', ->
@wrongStringInVersionedValueSet.exec(@ctx).should.be.false()
it 'should not find short code in value set', ->
@wrongShortCode.exec(@ctx).should.be.false()
it 'should not find medium code in value set', ->
@wrongMediumCode.exec(@ctx).should.be.false()
it 'should not find long code in value set', ->
@wrongLongCode.exec(@ctx).should.be.false()
describe 'Patient Property In ValueSet', ->
@beforeEach ->
setup @, data, [], vsets
it 'should find that John is not female', ->
@ctx.patient = new PatientSource([ p1 ]).currentPatient()
@isFemale.exec(@ctx).should.be.false()
it 'should find that Sally is female', ->
@ctx.patient = new PatientSource([ p2 ]).currentPatient()
@isFemale.exec(@ctx).should.be.true()
describe 'CodeDef', ->
@beforeEach ->
setup @, data, []
it 'should return a CodeDef', ->
codeDef = @lib.getCode('Tobacco smoking status code')
codeDef.constructor.name.should.equal 'CodeDef'
codeDef.name.should.equal 'Tobacco smoking status code'
it 'should execute to a Code datatype', ->
codeDef = @lib.getCode('Tobacco smoking status code')
code = codeDef.exec(@ctx)
code.code.should.equal('72166-2')
code.system.should.equal('http://loinc.org')
should.not.exist(code.version)
code.display.should.equal('Tobacco smoking status')
describe 'CodeRef', ->
@beforeEach ->
setup @, data
it 'should have a name', ->
@foo.name.should.equal 'Tobacco smoking status code'
it 'should execute to the defined code', ->
code = @foo.exec(@ctx)
code.code.should.equal('72166-2')
code.system.should.equal('http://loinc.org')
should.not.exist(code.version)
code.display.should.equal('Tobacco smoking status')
describe 'ConceptDef', ->
@beforeEach ->
setup @, data, []
it 'should return a ConceptDef', ->
conceptDef = @lib.getConcept('Tobacco smoking status')
conceptDef.constructor.name.should.equal 'ConceptDef'
conceptDef.name.should.equal 'Tobacco smoking status'
it 'should execute to a Concept datatype', ->
conceptDef = @lib.getConcept('Tobacco smoking status')
concept = conceptDef.exec(@ctx)
concept.text.should.equal('Tobacco smoking status')
concept.codes.should.have.length(1)
concept.codes[0].code.should.equal('72166-2')
concept.codes[0].system.should.equal('http://loinc.org')
should.not.exist(concept.codes[0].version)
concept.codes[0].display.should.equal('Tobacco smoking status')
describe 'ConceptRef', ->
@beforeEach ->
setup @, data
it 'should have a name', ->
@foo.name.should.equal 'Tobacco smoking status'
it 'should execute to the defined concept', ->
concept = @foo.exec(@ctx)
concept.text.should.equal('Tobacco smoking status')
concept.codes.should.have.length(1)
concept.codes[0].code.should.equal('72166-2')
concept.codes[0].system.should.equal('http://loinc.org')
should.not.exist(concept.codes[0].version)
concept.codes[0].display.should.equal('Tobacco smoking status')
describe 'CalculateAge', ->
@beforeEach ->
setup @, data, [ p1 ]
# Note, tests are inexact (otherwise test needs to repeat exact logic we're testing)
# p1 birth date is 1980-06-17
@bday = new Date(1980, 5, 17)
@today = new Date()
# according to spec, dates without timezones are in *current* time offset, so need to adjust
offsetDiff = @today.getTimezoneOffset() - @bday.getTimezoneOffset()
@bday.setMinutes(@bday.getMinutes() + offsetDiff)
# this is getting the possible number of months in years with the addtion of an offset
# to get the correct number of months
month_offset = if @today.getMonth() == 5 && @today.getDate() < 17 then 6 else 5
@full_months = ((@today.getFullYear() - 1980) * 12) + (@today.getMonth() - month_offset)
@timediff = @today - @bday # diff in milliseconds
it 'should execute age in years', ->
@years.exec(@ctx).should.equal @full_months // 12
it 'should execute age in months', ->
@months.exec(@ctx).should.equal @full_months
it 'should execute age in days', ->
@days.exec(@ctx).should.equal @timediff // 1000 // 60 // 60 // 24
it 'should execute age in hours', ->
# a little strange since the qicore data model specified birthDate as a date (no time)
@hours.exec(@ctx).should.equal @timediff // 1000 // 60 // 60
it 'should execute age in minutes', ->
# a little strange since the qicore data model specified birthDate as a date (no time)
@minutes.exec(@ctx).should.equal @timediff // 1000 // 60
it 'should execute age in seconds', ->
# a little strange since the qicore data model specified birthDate as a date (no time)
@seconds.exec(@ctx).should.equal @timediff // 1000
describe 'CalculateAgeAt', ->
@beforeEach ->
setup @, data, [ p1 ]
it 'should execute age at 2012 as 31', ->
@ageAt2012.exec(@ctx).should.equal 31
it 'should execute age at 19810216 as 0', ->
@ageAt19810216.exec(@ctx).should.equal 0
it 'should execute age at 1975 as -5', ->
@ageAt19810216.exec(@ctx).should.equal 0
| 125050 | should = require 'should'
setup = require '../../setup'
data = require './data'
vsets = require './valuesets'
{ p1, p2 } = require './patients'
{ PatientSource} = require '../../../lib/cql-patient'
describe 'ValueSetDef', ->
@beforeEach ->
setup @, data, [], vsets
it 'should return a resolved value set when the codeService knows about it', ->
vs = @known.exec(@ctx)
vs.oid.should.equal '2.16.840.1.113883.3.464.1003.101.12.1061'
vs.version.should.equal '20140501'
vs.codes.length.should.equal 3
it 'should execute one-arg to ValueSet with ID', ->
vs = @['unknown One Arg'].exec(@ctx)
vs.oid.should.equal '1.2.3.4.5.6.7.8.9'
should.not.exist vs.version
it 'should execute two-arg to ValueSet with ID and version', ->
vs = @['unknown Two Arg'].exec(@ctx)
vs.oid.should.equal '1.2.3.4.5.6.7.8.9'
vs.version.should.equal '1'
describe 'ValueSetRef', ->
@beforeEach ->
setup @, data
it 'should have a name', ->
@foo.name.should.equal '<NAME>'
it 'should execute to the defined value set', ->
@foo.exec(@ctx).oid.should.equal '2.16.840.1.113883.3.464.1003.101.12.1001'
describe 'InValueSet', ->
@beforeEach ->
setup @, data, [], vsets
it 'should find string code in value set', ->
@string.exec(@ctx).should.be.true()
it 'should find string code in versioned value set', ->
@stringInVersionedValueSet.exec(@ctx).should.be.true()
it 'should find short code in value set', ->
@shortCode.exec(@ctx).should.be.true()
it 'should find medium code in value set', ->
@mediumCode.exec(@ctx).should.be.true()
it 'should find long code in value set', ->
@longCode.exec(@ctx).should.be.true()
it 'should not find string code in value set', ->
@wrongString.exec(@ctx).should.be.false()
it 'should not find string code in versioned value set', ->
@wrongStringInVersionedValueSet.exec(@ctx).should.be.false()
it 'should not find short code in value set', ->
@wrongShortCode.exec(@ctx).should.be.false()
it 'should not find medium code in value set', ->
@wrongMediumCode.exec(@ctx).should.be.false()
it 'should not find long code in value set', ->
@wrongLongCode.exec(@ctx).should.be.false()
describe 'Patient Property In ValueSet', ->
@beforeEach ->
setup @, data, [], vsets
it 'should find that <NAME> is not female', ->
@ctx.patient = new PatientSource([ p1 ]).currentPatient()
@isFemale.exec(@ctx).should.be.false()
it 'should find that <NAME> is female', ->
@ctx.patient = new PatientSource([ p2 ]).currentPatient()
@isFemale.exec(@ctx).should.be.true()
describe 'CodeDef', ->
@beforeEach ->
setup @, data, []
it 'should return a CodeDef', ->
codeDef = @lib.getCode('Tobacco smoking status code')
codeDef.constructor.name.should.equal 'CodeDef'
codeDef.name.should.equal 'Tobacco smoking status code'
it 'should execute to a Code datatype', ->
codeDef = @lib.getCode('Tobacco smoking status code')
code = codeDef.exec(@ctx)
code.code.should.equal('72166-2')
code.system.should.equal('http://loinc.org')
should.not.exist(code.version)
code.display.should.equal('Tobacco smoking status')
describe 'CodeRef', ->
@beforeEach ->
setup @, data
it 'should have a name', ->
@foo.name.should.equal 'Tobacco smoking status code'
it 'should execute to the defined code', ->
code = @foo.exec(@ctx)
code.code.should.equal('72166-2')
code.system.should.equal('http://loinc.org')
should.not.exist(code.version)
code.display.should.equal('Tobacco smoking status')
describe 'ConceptDef', ->
@beforeEach ->
setup @, data, []
it 'should return a ConceptDef', ->
conceptDef = @lib.getConcept('Tobacco smoking status')
conceptDef.constructor.name.should.equal 'ConceptDef'
conceptDef.name.should.equal 'Tobacco smoking status'
it 'should execute to a Concept datatype', ->
conceptDef = @lib.getConcept('Tobacco smoking status')
concept = conceptDef.exec(@ctx)
concept.text.should.equal('Tobacco smoking status')
concept.codes.should.have.length(1)
concept.codes[0].code.should.equal('72166-2')
concept.codes[0].system.should.equal('http://loinc.org')
should.not.exist(concept.codes[0].version)
concept.codes[0].display.should.equal('Tobacco smoking status')
describe 'ConceptRef', ->
@beforeEach ->
setup @, data
it 'should have a name', ->
@foo.name.should.equal 'Tobacco smoking status'
it 'should execute to the defined concept', ->
concept = @foo.exec(@ctx)
concept.text.should.equal('Tobacco smoking status')
concept.codes.should.have.length(1)
concept.codes[0].code.should.equal('72166-2')
concept.codes[0].system.should.equal('http://loinc.org')
should.not.exist(concept.codes[0].version)
concept.codes[0].display.should.equal('Tobacco smoking status')
describe 'CalculateAge', ->
@beforeEach ->
setup @, data, [ p1 ]
# Note, tests are inexact (otherwise test needs to repeat exact logic we're testing)
# p1 birth date is 1980-06-17
@bday = new Date(1980, 5, 17)
@today = new Date()
# according to spec, dates without timezones are in *current* time offset, so need to adjust
offsetDiff = @today.getTimezoneOffset() - @bday.getTimezoneOffset()
@bday.setMinutes(@bday.getMinutes() + offsetDiff)
# this is getting the possible number of months in years with the addtion of an offset
# to get the correct number of months
month_offset = if @today.getMonth() == 5 && @today.getDate() < 17 then 6 else 5
@full_months = ((@today.getFullYear() - 1980) * 12) + (@today.getMonth() - month_offset)
@timediff = @today - @bday # diff in milliseconds
it 'should execute age in years', ->
@years.exec(@ctx).should.equal @full_months // 12
it 'should execute age in months', ->
@months.exec(@ctx).should.equal @full_months
it 'should execute age in days', ->
@days.exec(@ctx).should.equal @timediff // 1000 // 60 // 60 // 24
it 'should execute age in hours', ->
# a little strange since the qicore data model specified birthDate as a date (no time)
@hours.exec(@ctx).should.equal @timediff // 1000 // 60 // 60
it 'should execute age in minutes', ->
# a little strange since the qicore data model specified birthDate as a date (no time)
@minutes.exec(@ctx).should.equal @timediff // 1000 // 60
it 'should execute age in seconds', ->
# a little strange since the qicore data model specified birthDate as a date (no time)
@seconds.exec(@ctx).should.equal @timediff // 1000
describe 'CalculateAgeAt', ->
@beforeEach ->
setup @, data, [ p1 ]
it 'should execute age at 2012 as 31', ->
@ageAt2012.exec(@ctx).should.equal 31
it 'should execute age at 19810216 as 0', ->
@ageAt19810216.exec(@ctx).should.equal 0
it 'should execute age at 1975 as -5', ->
@ageAt19810216.exec(@ctx).should.equal 0
| true | should = require 'should'
setup = require '../../setup'
data = require './data'
vsets = require './valuesets'
{ p1, p2 } = require './patients'
{ PatientSource} = require '../../../lib/cql-patient'
describe 'ValueSetDef', ->
@beforeEach ->
setup @, data, [], vsets
it 'should return a resolved value set when the codeService knows about it', ->
vs = @known.exec(@ctx)
vs.oid.should.equal '2.16.840.1.113883.3.464.1003.101.12.1061'
vs.version.should.equal '20140501'
vs.codes.length.should.equal 3
it 'should execute one-arg to ValueSet with ID', ->
vs = @['unknown One Arg'].exec(@ctx)
vs.oid.should.equal '1.2.3.4.5.6.7.8.9'
should.not.exist vs.version
it 'should execute two-arg to ValueSet with ID and version', ->
vs = @['unknown Two Arg'].exec(@ctx)
vs.oid.should.equal '1.2.3.4.5.6.7.8.9'
vs.version.should.equal '1'
describe 'ValueSetRef', ->
@beforeEach ->
setup @, data
it 'should have a name', ->
@foo.name.should.equal 'PI:NAME:<NAME>END_PI'
it 'should execute to the defined value set', ->
@foo.exec(@ctx).oid.should.equal '2.16.840.1.113883.3.464.1003.101.12.1001'
describe 'InValueSet', ->
@beforeEach ->
setup @, data, [], vsets
it 'should find string code in value set', ->
@string.exec(@ctx).should.be.true()
it 'should find string code in versioned value set', ->
@stringInVersionedValueSet.exec(@ctx).should.be.true()
it 'should find short code in value set', ->
@shortCode.exec(@ctx).should.be.true()
it 'should find medium code in value set', ->
@mediumCode.exec(@ctx).should.be.true()
it 'should find long code in value set', ->
@longCode.exec(@ctx).should.be.true()
it 'should not find string code in value set', ->
@wrongString.exec(@ctx).should.be.false()
it 'should not find string code in versioned value set', ->
@wrongStringInVersionedValueSet.exec(@ctx).should.be.false()
it 'should not find short code in value set', ->
@wrongShortCode.exec(@ctx).should.be.false()
it 'should not find medium code in value set', ->
@wrongMediumCode.exec(@ctx).should.be.false()
it 'should not find long code in value set', ->
@wrongLongCode.exec(@ctx).should.be.false()
describe 'Patient Property In ValueSet', ->
@beforeEach ->
setup @, data, [], vsets
it 'should find that PI:NAME:<NAME>END_PI is not female', ->
@ctx.patient = new PatientSource([ p1 ]).currentPatient()
@isFemale.exec(@ctx).should.be.false()
it 'should find that PI:NAME:<NAME>END_PI is female', ->
@ctx.patient = new PatientSource([ p2 ]).currentPatient()
@isFemale.exec(@ctx).should.be.true()
describe 'CodeDef', ->
@beforeEach ->
setup @, data, []
it 'should return a CodeDef', ->
codeDef = @lib.getCode('Tobacco smoking status code')
codeDef.constructor.name.should.equal 'CodeDef'
codeDef.name.should.equal 'Tobacco smoking status code'
it 'should execute to a Code datatype', ->
codeDef = @lib.getCode('Tobacco smoking status code')
code = codeDef.exec(@ctx)
code.code.should.equal('72166-2')
code.system.should.equal('http://loinc.org')
should.not.exist(code.version)
code.display.should.equal('Tobacco smoking status')
describe 'CodeRef', ->
@beforeEach ->
setup @, data
it 'should have a name', ->
@foo.name.should.equal 'Tobacco smoking status code'
it 'should execute to the defined code', ->
code = @foo.exec(@ctx)
code.code.should.equal('72166-2')
code.system.should.equal('http://loinc.org')
should.not.exist(code.version)
code.display.should.equal('Tobacco smoking status')
describe 'ConceptDef', ->
@beforeEach ->
setup @, data, []
it 'should return a ConceptDef', ->
conceptDef = @lib.getConcept('Tobacco smoking status')
conceptDef.constructor.name.should.equal 'ConceptDef'
conceptDef.name.should.equal 'Tobacco smoking status'
it 'should execute to a Concept datatype', ->
conceptDef = @lib.getConcept('Tobacco smoking status')
concept = conceptDef.exec(@ctx)
concept.text.should.equal('Tobacco smoking status')
concept.codes.should.have.length(1)
concept.codes[0].code.should.equal('72166-2')
concept.codes[0].system.should.equal('http://loinc.org')
should.not.exist(concept.codes[0].version)
concept.codes[0].display.should.equal('Tobacco smoking status')
describe 'ConceptRef', ->
@beforeEach ->
setup @, data
it 'should have a name', ->
@foo.name.should.equal 'Tobacco smoking status'
it 'should execute to the defined concept', ->
concept = @foo.exec(@ctx)
concept.text.should.equal('Tobacco smoking status')
concept.codes.should.have.length(1)
concept.codes[0].code.should.equal('72166-2')
concept.codes[0].system.should.equal('http://loinc.org')
should.not.exist(concept.codes[0].version)
concept.codes[0].display.should.equal('Tobacco smoking status')
describe 'CalculateAge', ->
@beforeEach ->
setup @, data, [ p1 ]
# Note, tests are inexact (otherwise test needs to repeat exact logic we're testing)
# p1 birth date is 1980-06-17
@bday = new Date(1980, 5, 17)
@today = new Date()
# according to spec, dates without timezones are in *current* time offset, so need to adjust
offsetDiff = @today.getTimezoneOffset() - @bday.getTimezoneOffset()
@bday.setMinutes(@bday.getMinutes() + offsetDiff)
# this is getting the possible number of months in years with the addtion of an offset
# to get the correct number of months
month_offset = if @today.getMonth() == 5 && @today.getDate() < 17 then 6 else 5
@full_months = ((@today.getFullYear() - 1980) * 12) + (@today.getMonth() - month_offset)
@timediff = @today - @bday # diff in milliseconds
it 'should execute age in years', ->
@years.exec(@ctx).should.equal @full_months // 12
it 'should execute age in months', ->
@months.exec(@ctx).should.equal @full_months
it 'should execute age in days', ->
@days.exec(@ctx).should.equal @timediff // 1000 // 60 // 60 // 24
it 'should execute age in hours', ->
# a little strange since the qicore data model specified birthDate as a date (no time)
@hours.exec(@ctx).should.equal @timediff // 1000 // 60 // 60
it 'should execute age in minutes', ->
# a little strange since the qicore data model specified birthDate as a date (no time)
@minutes.exec(@ctx).should.equal @timediff // 1000 // 60
it 'should execute age in seconds', ->
# a little strange since the qicore data model specified birthDate as a date (no time)
@seconds.exec(@ctx).should.equal @timediff // 1000
describe 'CalculateAgeAt', ->
@beforeEach ->
setup @, data, [ p1 ]
it 'should execute age at 2012 as 31', ->
@ageAt2012.exec(@ctx).should.equal 31
it 'should execute age at 19810216 as 0', ->
@ageAt19810216.exec(@ctx).should.equal 0
it 'should execute age at 1975 as -5', ->
@ageAt19810216.exec(@ctx).should.equal 0
|
[
{
"context": "ubot ignore me\n#\n# Notes:\n# None\n#\n# Author:\n# Brian Shumate <brian@couchbase.com>\n\nignore = [\n \"http://3.bp.",
"end": 196,
"score": 0.9998812675476074,
"start": 183,
"tag": "NAME",
"value": "Brian Shumate"
},
{
"context": "\n# Notes:\n# None\n#\n# Author:\n# Brian Shumate <brian@couchbase.com>\n\nignore = [\n \"http://3.bp.blogspot.com/-DFLMK7f",
"end": 217,
"score": 0.9999278783798218,
"start": 198,
"tag": "EMAIL",
"value": "brian@couchbase.com"
}
] | files/scripts/ignoreme.coffee | AAROC/the-boss-role | 0 | # Description:
# Displays Venture Bros IGNORE ME! image
#
# Dependencies:
# None
#
# Configuration:
# None
#
# Commands:
# hubot ignore me
#
# Notes:
# None
#
# Author:
# Brian Shumate <brian@couchbase.com>
ignore = [
"http://3.bp.blogspot.com/-DFLMK7ffcJM/Tbjn752gOFI/AAAAAAAAAsk/qa7D5ZdQDgM/s1600/1301856749331.jpg",
"http://venturebrosblog.com/wp-content/uploads/2011/02/venture-bros-ignore-me1.jpg",
"http://memedepot.com/uploads/2000/2159_1272950412470.jpg"
]
module.exports = (robot) ->
robot.hear /ignore me/i, (msg)->
msg.send msg.random ignore
| 12964 | # Description:
# Displays Venture Bros IGNORE ME! image
#
# Dependencies:
# None
#
# Configuration:
# None
#
# Commands:
# hubot ignore me
#
# Notes:
# None
#
# Author:
# <NAME> <<EMAIL>>
ignore = [
"http://3.bp.blogspot.com/-DFLMK7ffcJM/Tbjn752gOFI/AAAAAAAAAsk/qa7D5ZdQDgM/s1600/1301856749331.jpg",
"http://venturebrosblog.com/wp-content/uploads/2011/02/venture-bros-ignore-me1.jpg",
"http://memedepot.com/uploads/2000/2159_1272950412470.jpg"
]
module.exports = (robot) ->
robot.hear /ignore me/i, (msg)->
msg.send msg.random ignore
| true | # Description:
# Displays Venture Bros IGNORE ME! image
#
# Dependencies:
# None
#
# Configuration:
# None
#
# Commands:
# hubot ignore me
#
# Notes:
# None
#
# Author:
# PI:NAME:<NAME>END_PI <PI:EMAIL:<EMAIL>END_PI>
ignore = [
"http://3.bp.blogspot.com/-DFLMK7ffcJM/Tbjn752gOFI/AAAAAAAAAsk/qa7D5ZdQDgM/s1600/1301856749331.jpg",
"http://venturebrosblog.com/wp-content/uploads/2011/02/venture-bros-ignore-me1.jpg",
"http://memedepot.com/uploads/2000/2159_1272950412470.jpg"
]
module.exports = (robot) ->
robot.hear /ignore me/i, (msg)->
msg.send msg.random ignore
|
[
{
"context": "#############\n#\n#\tMoocita collections\n# Created by Markus on 26/10/2015.\n#\n################################",
"end": 99,
"score": 0.9990456700325012,
"start": 93,
"tag": "NAME",
"value": "Markus"
}
] | server/publications/challenge.coffee | agottschalk10/worklearn | 0 | #######################################################
#
# Moocita collections
# Created by Markus on 26/10/2015.
#
#######################################################
#######################################################
# item header
#######################################################
#######################################################
_challenge_fields =
fields:
title: 1
content: 1
material: 1
owner_id: 1
published: 1
num_reviews: 1
#######################################################
# helper
#######################################################
#######################################################
_get_solution_data = (solution_id) ->
solution = Solutions.findOne solution_id
entry = _get_profile_data solution.owner_id, {}
entry.content = solution.content
entry.material = solution.material
entry.published = solution.published
entry = _get_reviews_data solution_id, entry
return entry
#######################################################
_get_reviews_data = (solution_id, entry) ->
filter =
solution_id: solution_id
published: true
options =
fields:
rating: 1
content: 1
owner_id: 1
review_cursor = Reviews.find filter, options
reviews = []
avg = 0
nt = 0
review_cursor.forEach (review) ->
r = _get_profile_data review.owner_id, {}
r = _get_feedback_data review._id, r
r.content = review.content
r.rating = review.rating
reviews.push r
avg += parseInt(r.rating)
nt += 1
avg = if nt then avg / nt else "no reviews yet"
entry["reviews"] = reviews
entry["average_rating"] = avg
return entry
#######################################################
_get_feedback_data = (review_id, entry) ->
filter =
review_id: review_id
published: true
options =
fields:
rating: 1
content: 1
owner_id: 1
feedback_cursor = Feedback.find filter, options
feedback = []
avg = 0
nt = 0
feedback_cursor.forEach (fdb) ->
f = _get_profile_data fdb.owner_id, {}
f.content = fdb.content
f.rating = fdb.rating
feedback.push f
avg += parseInt(f.rating)
nt += 1
avg = if nt then avg / nt else "no reviews yet"
entry["feedback"] = feedback
entry["average_rating"] = avg
return entry
#######################################################
_get_profile_data = (user_id, entry) ->
filter =
owner_id: user_id
profile = Profiles.findOne filter
if profile
entry["name"] = get_profile_name profile, false, false
entry["avatar"] = get_avatar profile
return entry
#######################################################
# challenges
#######################################################
#######################################################
Meteor.publish "challenges", (parameter) ->
pattern =
query: Match.Optional(String)
page: Number
size: Number
check parameter, pattern
user_id = this.userId
filter = filter_visible_documents user_id
crs = find_documents_paged_unprotected Challenges, filter, _challenge_fields, parameter
log_publication "Challenges", crs, filter,
_challenge_fields, "challenges", user_id
return crs
#######################################################
Meteor.publish "my_challenges", (parameter) ->
pattern =
query: Match.Optional(String)
page: Number
size: Number
check parameter, pattern
user_id = this.userId
restrict =
owner_id: user_id
filter = filter_visible_documents user_id, restrict
crs = find_documents_paged_unprotected Challenges, filter, _challenge_fields, parameter
log_publication "Challenges", crs, filter,
_challenge_fields, "my_challenges", user_id
return crs
#######################################################
Meteor.publish "challenge_by_id", (challenge_id) ->
check challenge_id, String
user_id = this.userId
restrict =
_id: challenge_id
published: true
filter = filter_visible_documents user_id, restrict
crs = Challenges.find filter, _challenge_fields
log_publication "Challenges", crs, filter,
_challenge_fields, "challenge_by_id", user_id
return crs
#######################################################
Meteor.publish "my_challenge_by_id", (challenge_id) ->
user_id = this.userId
restrict =
_id:challenge_id
owner_id: user_id
filter = filter_visible_documents user_id, restrict
crs = Challenges.find filter, _challenge_fields
log_publication "Challenges", crs, filter,
_challenge_fields, "my_challenge_by_id", user_id
return crs
#######################################################
Meteor.publish "challenge_summaries", (parameter) ->
pattern =
challenge_id: String
published: Match.Optional(Boolean)
query: Match.Optional(String)
page: Number
size: Number
check parameter, pattern
if parameter.size>50
throw Meteor.Error("Size values larger than 50 are not allowed.")
user_id = this.userId
challenge = Challenges.findOne parameter.challenge_id
if challenge.owner_id != user_id
throw Meteor.Error("Not permitted.")
filter =
challenge_id: parameter.challenge_id
if parameter.published
filter.published = parameter.published
mod =
fields:
content: 1
material: 1
owner_id: 1
published: 1
challenge_id: 1
solution_ids = new Set()
profile_ids = new Set()
##############################################
# retrieving solutions
##############################################
##############################################
solution_cursor = find_documents_paged_unprotected Solutions, filter, mod, parameter
solution_cursor.forEach (solution) ->
solution_ids.add solution._id
profile_ids.add solution.owner_id
##############################################
# retrieving reviews
##############################################
# resetting the filter
solution_ids = Array.from(solution_ids)
filter =
solution_id:
$in: solution_ids
mod =
fields:
rating: 1
content: 1
owner_id: 1
published: 1
challenge_id: 1
solution_id: 1
review_id: 1
owner_id: 1
##############################################
review_cursor = Reviews.find(filter, mod)
review_cursor.forEach (entry) ->
profile_ids.add entry.owner_id
##############################################
# retrieving feedback
##############################################
##############################################
feedback_cursor = Feedback.find(filter, mod)
feedback_cursor.forEach (entry) ->
profile_ids.add entry.owner_id
##############################################
# retrieving profiles
##############################################
# resetting the filter
profile_ids = Array.from(profile_ids)
filter =
owner_id:
$in: profile_ids
mod =
fields:
resume: 1
published: 1
given_name: 1
middle_name: 1
family_name: 1
owner_id: 1
avatar: 1
##############################################
profile_cursor = Profiles.find(filter, mod)
log_publication "Multiple Cursor", null, {},
{}, "challenge_summaries", user_id
return [solution_cursor, review_cursor, feedback_cursor, profile_cursor]
| 213437 | #######################################################
#
# Moocita collections
# Created by <NAME> on 26/10/2015.
#
#######################################################
#######################################################
# item header
#######################################################
#######################################################
_challenge_fields =
fields:
title: 1
content: 1
material: 1
owner_id: 1
published: 1
num_reviews: 1
#######################################################
# helper
#######################################################
#######################################################
_get_solution_data = (solution_id) ->
solution = Solutions.findOne solution_id
entry = _get_profile_data solution.owner_id, {}
entry.content = solution.content
entry.material = solution.material
entry.published = solution.published
entry = _get_reviews_data solution_id, entry
return entry
#######################################################
_get_reviews_data = (solution_id, entry) ->
filter =
solution_id: solution_id
published: true
options =
fields:
rating: 1
content: 1
owner_id: 1
review_cursor = Reviews.find filter, options
reviews = []
avg = 0
nt = 0
review_cursor.forEach (review) ->
r = _get_profile_data review.owner_id, {}
r = _get_feedback_data review._id, r
r.content = review.content
r.rating = review.rating
reviews.push r
avg += parseInt(r.rating)
nt += 1
avg = if nt then avg / nt else "no reviews yet"
entry["reviews"] = reviews
entry["average_rating"] = avg
return entry
#######################################################
_get_feedback_data = (review_id, entry) ->
filter =
review_id: review_id
published: true
options =
fields:
rating: 1
content: 1
owner_id: 1
feedback_cursor = Feedback.find filter, options
feedback = []
avg = 0
nt = 0
feedback_cursor.forEach (fdb) ->
f = _get_profile_data fdb.owner_id, {}
f.content = fdb.content
f.rating = fdb.rating
feedback.push f
avg += parseInt(f.rating)
nt += 1
avg = if nt then avg / nt else "no reviews yet"
entry["feedback"] = feedback
entry["average_rating"] = avg
return entry
#######################################################
_get_profile_data = (user_id, entry) ->
filter =
owner_id: user_id
profile = Profiles.findOne filter
if profile
entry["name"] = get_profile_name profile, false, false
entry["avatar"] = get_avatar profile
return entry
#######################################################
# challenges
#######################################################
#######################################################
Meteor.publish "challenges", (parameter) ->
pattern =
query: Match.Optional(String)
page: Number
size: Number
check parameter, pattern
user_id = this.userId
filter = filter_visible_documents user_id
crs = find_documents_paged_unprotected Challenges, filter, _challenge_fields, parameter
log_publication "Challenges", crs, filter,
_challenge_fields, "challenges", user_id
return crs
#######################################################
Meteor.publish "my_challenges", (parameter) ->
pattern =
query: Match.Optional(String)
page: Number
size: Number
check parameter, pattern
user_id = this.userId
restrict =
owner_id: user_id
filter = filter_visible_documents user_id, restrict
crs = find_documents_paged_unprotected Challenges, filter, _challenge_fields, parameter
log_publication "Challenges", crs, filter,
_challenge_fields, "my_challenges", user_id
return crs
#######################################################
Meteor.publish "challenge_by_id", (challenge_id) ->
check challenge_id, String
user_id = this.userId
restrict =
_id: challenge_id
published: true
filter = filter_visible_documents user_id, restrict
crs = Challenges.find filter, _challenge_fields
log_publication "Challenges", crs, filter,
_challenge_fields, "challenge_by_id", user_id
return crs
#######################################################
Meteor.publish "my_challenge_by_id", (challenge_id) ->
user_id = this.userId
restrict =
_id:challenge_id
owner_id: user_id
filter = filter_visible_documents user_id, restrict
crs = Challenges.find filter, _challenge_fields
log_publication "Challenges", crs, filter,
_challenge_fields, "my_challenge_by_id", user_id
return crs
#######################################################
Meteor.publish "challenge_summaries", (parameter) ->
pattern =
challenge_id: String
published: Match.Optional(Boolean)
query: Match.Optional(String)
page: Number
size: Number
check parameter, pattern
if parameter.size>50
throw Meteor.Error("Size values larger than 50 are not allowed.")
user_id = this.userId
challenge = Challenges.findOne parameter.challenge_id
if challenge.owner_id != user_id
throw Meteor.Error("Not permitted.")
filter =
challenge_id: parameter.challenge_id
if parameter.published
filter.published = parameter.published
mod =
fields:
content: 1
material: 1
owner_id: 1
published: 1
challenge_id: 1
solution_ids = new Set()
profile_ids = new Set()
##############################################
# retrieving solutions
##############################################
##############################################
solution_cursor = find_documents_paged_unprotected Solutions, filter, mod, parameter
solution_cursor.forEach (solution) ->
solution_ids.add solution._id
profile_ids.add solution.owner_id
##############################################
# retrieving reviews
##############################################
# resetting the filter
solution_ids = Array.from(solution_ids)
filter =
solution_id:
$in: solution_ids
mod =
fields:
rating: 1
content: 1
owner_id: 1
published: 1
challenge_id: 1
solution_id: 1
review_id: 1
owner_id: 1
##############################################
review_cursor = Reviews.find(filter, mod)
review_cursor.forEach (entry) ->
profile_ids.add entry.owner_id
##############################################
# retrieving feedback
##############################################
##############################################
feedback_cursor = Feedback.find(filter, mod)
feedback_cursor.forEach (entry) ->
profile_ids.add entry.owner_id
##############################################
# retrieving profiles
##############################################
# resetting the filter
profile_ids = Array.from(profile_ids)
filter =
owner_id:
$in: profile_ids
mod =
fields:
resume: 1
published: 1
given_name: 1
middle_name: 1
family_name: 1
owner_id: 1
avatar: 1
##############################################
profile_cursor = Profiles.find(filter, mod)
log_publication "Multiple Cursor", null, {},
{}, "challenge_summaries", user_id
return [solution_cursor, review_cursor, feedback_cursor, profile_cursor]
| true | #######################################################
#
# Moocita collections
# Created by PI:NAME:<NAME>END_PI on 26/10/2015.
#
#######################################################
#######################################################
# item header
#######################################################
#######################################################
_challenge_fields =
fields:
title: 1
content: 1
material: 1
owner_id: 1
published: 1
num_reviews: 1
#######################################################
# helper
#######################################################
#######################################################
_get_solution_data = (solution_id) ->
solution = Solutions.findOne solution_id
entry = _get_profile_data solution.owner_id, {}
entry.content = solution.content
entry.material = solution.material
entry.published = solution.published
entry = _get_reviews_data solution_id, entry
return entry
#######################################################
_get_reviews_data = (solution_id, entry) ->
filter =
solution_id: solution_id
published: true
options =
fields:
rating: 1
content: 1
owner_id: 1
review_cursor = Reviews.find filter, options
reviews = []
avg = 0
nt = 0
review_cursor.forEach (review) ->
r = _get_profile_data review.owner_id, {}
r = _get_feedback_data review._id, r
r.content = review.content
r.rating = review.rating
reviews.push r
avg += parseInt(r.rating)
nt += 1
avg = if nt then avg / nt else "no reviews yet"
entry["reviews"] = reviews
entry["average_rating"] = avg
return entry
#######################################################
_get_feedback_data = (review_id, entry) ->
filter =
review_id: review_id
published: true
options =
fields:
rating: 1
content: 1
owner_id: 1
feedback_cursor = Feedback.find filter, options
feedback = []
avg = 0
nt = 0
feedback_cursor.forEach (fdb) ->
f = _get_profile_data fdb.owner_id, {}
f.content = fdb.content
f.rating = fdb.rating
feedback.push f
avg += parseInt(f.rating)
nt += 1
avg = if nt then avg / nt else "no reviews yet"
entry["feedback"] = feedback
entry["average_rating"] = avg
return entry
#######################################################
_get_profile_data = (user_id, entry) ->
filter =
owner_id: user_id
profile = Profiles.findOne filter
if profile
entry["name"] = get_profile_name profile, false, false
entry["avatar"] = get_avatar profile
return entry
#######################################################
# challenges
#######################################################
#######################################################
Meteor.publish "challenges", (parameter) ->
pattern =
query: Match.Optional(String)
page: Number
size: Number
check parameter, pattern
user_id = this.userId
filter = filter_visible_documents user_id
crs = find_documents_paged_unprotected Challenges, filter, _challenge_fields, parameter
log_publication "Challenges", crs, filter,
_challenge_fields, "challenges", user_id
return crs
#######################################################
Meteor.publish "my_challenges", (parameter) ->
pattern =
query: Match.Optional(String)
page: Number
size: Number
check parameter, pattern
user_id = this.userId
restrict =
owner_id: user_id
filter = filter_visible_documents user_id, restrict
crs = find_documents_paged_unprotected Challenges, filter, _challenge_fields, parameter
log_publication "Challenges", crs, filter,
_challenge_fields, "my_challenges", user_id
return crs
#######################################################
Meteor.publish "challenge_by_id", (challenge_id) ->
check challenge_id, String
user_id = this.userId
restrict =
_id: challenge_id
published: true
filter = filter_visible_documents user_id, restrict
crs = Challenges.find filter, _challenge_fields
log_publication "Challenges", crs, filter,
_challenge_fields, "challenge_by_id", user_id
return crs
#######################################################
Meteor.publish "my_challenge_by_id", (challenge_id) ->
user_id = this.userId
restrict =
_id:challenge_id
owner_id: user_id
filter = filter_visible_documents user_id, restrict
crs = Challenges.find filter, _challenge_fields
log_publication "Challenges", crs, filter,
_challenge_fields, "my_challenge_by_id", user_id
return crs
#######################################################
Meteor.publish "challenge_summaries", (parameter) ->
pattern =
challenge_id: String
published: Match.Optional(Boolean)
query: Match.Optional(String)
page: Number
size: Number
check parameter, pattern
if parameter.size>50
throw Meteor.Error("Size values larger than 50 are not allowed.")
user_id = this.userId
challenge = Challenges.findOne parameter.challenge_id
if challenge.owner_id != user_id
throw Meteor.Error("Not permitted.")
filter =
challenge_id: parameter.challenge_id
if parameter.published
filter.published = parameter.published
mod =
fields:
content: 1
material: 1
owner_id: 1
published: 1
challenge_id: 1
solution_ids = new Set()
profile_ids = new Set()
##############################################
# retrieving solutions
##############################################
##############################################
solution_cursor = find_documents_paged_unprotected Solutions, filter, mod, parameter
solution_cursor.forEach (solution) ->
solution_ids.add solution._id
profile_ids.add solution.owner_id
##############################################
# retrieving reviews
##############################################
# resetting the filter
solution_ids = Array.from(solution_ids)
filter =
solution_id:
$in: solution_ids
mod =
fields:
rating: 1
content: 1
owner_id: 1
published: 1
challenge_id: 1
solution_id: 1
review_id: 1
owner_id: 1
##############################################
review_cursor = Reviews.find(filter, mod)
review_cursor.forEach (entry) ->
profile_ids.add entry.owner_id
##############################################
# retrieving feedback
##############################################
##############################################
feedback_cursor = Feedback.find(filter, mod)
feedback_cursor.forEach (entry) ->
profile_ids.add entry.owner_id
##############################################
# retrieving profiles
##############################################
# resetting the filter
profile_ids = Array.from(profile_ids)
filter =
owner_id:
$in: profile_ids
mod =
fields:
resume: 1
published: 1
given_name: 1
middle_name: 1
family_name: 1
owner_id: 1
avatar: 1
##############################################
profile_cursor = Profiles.find(filter, mod)
log_publication "Multiple Cursor", null, {},
{}, "challenge_summaries", user_id
return [solution_cursor, review_cursor, feedback_cursor, profile_cursor]
|
[
{
"context": "-4de7-4b7f-9a5e-002b1c5c4a0f\"\n gist:\n token: \"b158678ac60c921d45424b53d41dce1e8459a8ee\"\n kite:\n showWelcomeNotificationOnStartup: fa",
"end": 1331,
"score": 0.9920809268951416,
"start": 1291,
"tag": "KEY",
"value": "b158678ac60c921d45424b53d41dce1e8459a8ee"
}
] | .atom/config.cson | chuckxD/dotfiles | 1 | "*":
"atom-clock":
showUTC: true
"atom-terminal": {}
core:
disabledPackages: [
"sync-settings"
"Sublime-Style-Column-Selection"
"atom-transpose"
"autoclose-html"
"case-keep-replace"
"change-case"
"duplicate-line-or-selection"
"editorconfig"
"multi-cursor"
"es6-javascript"
"terminal-plus"
"atom-ide-debugger-node"
"atom-ide-debugger-python"
"atom-ide-ui"
"ide-json"
"ide-yaml"
"linter-csslint"
"Hydrogen"
"hydrogen-launcher"
"vim-surround"
"atom-react"
"vim-mode-visual-block"
"vim-mode-plus-ex-mode"
"nvim-mode"
"move-cursor-improved"
"vim-mode-clipboard-plus"
"vim-mode-plus-duplicate"
"vim-mode-plus-exchange"
"vim-mode-plus-keymaps-for-tree-view"
"vim-mode-zz"
"vim-mode-plus-replace-with-execution"
"vim-mode-plus-move-selected-text"
"vim-mode-plus-macros"
]
telemetryConsent: "no"
themes: [
"atom-black-ui"
"ir-black-k-syntax"
]
uriHandlerRegistration: "always"
useTreeSitterParsers: false
editor:
fontSize: 12
scrollPastEnd: true
"exception-reporting":
userId: "7167d68a-4de7-4b7f-9a5e-002b1c5c4a0f"
gist:
token: "b158678ac60c921d45424b53d41dce1e8459a8ee"
kite:
showWelcomeNotificationOnStartup: false
linter: {}
"linter-ui-default":
panelHeight: 233.1428985595703
"prettier-atom":
formatOnSaveOptions:
enabled: true
isDisabledIfNoConfigFile: true
isDisabledIfNotInPackageJson: true
respectEslintignore: false
showInStatusBar: true
prettierEslintOptions: {}
useEslint: true
"terminal-plus":
core: {}
style:
theme: "pro"
"tree-view":
hideIgnoredNames: true
hideVcsIgnoredFiles: true
"vim-mode": {}
"vim-mode-plus":
useClipboardAsDefaultRegister: true
welcome:
showOnStartup: false
core:
ignoredNames: [
".git"
".svn"
".DS_Store"
]
"exception-reporting":
userId: "750db657-913b-52ea-512d-dea57c560caf"
metrics:
userId: "6d7958e72f635b2868a2e1b862219e92281e2fb7"
"release-notes":
viewedVersion: "0.69.0"
welcome:
showOnStartup: false
| 189151 | "*":
"atom-clock":
showUTC: true
"atom-terminal": {}
core:
disabledPackages: [
"sync-settings"
"Sublime-Style-Column-Selection"
"atom-transpose"
"autoclose-html"
"case-keep-replace"
"change-case"
"duplicate-line-or-selection"
"editorconfig"
"multi-cursor"
"es6-javascript"
"terminal-plus"
"atom-ide-debugger-node"
"atom-ide-debugger-python"
"atom-ide-ui"
"ide-json"
"ide-yaml"
"linter-csslint"
"Hydrogen"
"hydrogen-launcher"
"vim-surround"
"atom-react"
"vim-mode-visual-block"
"vim-mode-plus-ex-mode"
"nvim-mode"
"move-cursor-improved"
"vim-mode-clipboard-plus"
"vim-mode-plus-duplicate"
"vim-mode-plus-exchange"
"vim-mode-plus-keymaps-for-tree-view"
"vim-mode-zz"
"vim-mode-plus-replace-with-execution"
"vim-mode-plus-move-selected-text"
"vim-mode-plus-macros"
]
telemetryConsent: "no"
themes: [
"atom-black-ui"
"ir-black-k-syntax"
]
uriHandlerRegistration: "always"
useTreeSitterParsers: false
editor:
fontSize: 12
scrollPastEnd: true
"exception-reporting":
userId: "7167d68a-4de7-4b7f-9a5e-002b1c5c4a0f"
gist:
token: "<KEY>"
kite:
showWelcomeNotificationOnStartup: false
linter: {}
"linter-ui-default":
panelHeight: 233.1428985595703
"prettier-atom":
formatOnSaveOptions:
enabled: true
isDisabledIfNoConfigFile: true
isDisabledIfNotInPackageJson: true
respectEslintignore: false
showInStatusBar: true
prettierEslintOptions: {}
useEslint: true
"terminal-plus":
core: {}
style:
theme: "pro"
"tree-view":
hideIgnoredNames: true
hideVcsIgnoredFiles: true
"vim-mode": {}
"vim-mode-plus":
useClipboardAsDefaultRegister: true
welcome:
showOnStartup: false
core:
ignoredNames: [
".git"
".svn"
".DS_Store"
]
"exception-reporting":
userId: "750db657-913b-52ea-512d-dea57c560caf"
metrics:
userId: "6d7958e72f635b2868a2e1b862219e92281e2fb7"
"release-notes":
viewedVersion: "0.69.0"
welcome:
showOnStartup: false
| true | "*":
"atom-clock":
showUTC: true
"atom-terminal": {}
core:
disabledPackages: [
"sync-settings"
"Sublime-Style-Column-Selection"
"atom-transpose"
"autoclose-html"
"case-keep-replace"
"change-case"
"duplicate-line-or-selection"
"editorconfig"
"multi-cursor"
"es6-javascript"
"terminal-plus"
"atom-ide-debugger-node"
"atom-ide-debugger-python"
"atom-ide-ui"
"ide-json"
"ide-yaml"
"linter-csslint"
"Hydrogen"
"hydrogen-launcher"
"vim-surround"
"atom-react"
"vim-mode-visual-block"
"vim-mode-plus-ex-mode"
"nvim-mode"
"move-cursor-improved"
"vim-mode-clipboard-plus"
"vim-mode-plus-duplicate"
"vim-mode-plus-exchange"
"vim-mode-plus-keymaps-for-tree-view"
"vim-mode-zz"
"vim-mode-plus-replace-with-execution"
"vim-mode-plus-move-selected-text"
"vim-mode-plus-macros"
]
telemetryConsent: "no"
themes: [
"atom-black-ui"
"ir-black-k-syntax"
]
uriHandlerRegistration: "always"
useTreeSitterParsers: false
editor:
fontSize: 12
scrollPastEnd: true
"exception-reporting":
userId: "7167d68a-4de7-4b7f-9a5e-002b1c5c4a0f"
gist:
token: "PI:KEY:<KEY>END_PI"
kite:
showWelcomeNotificationOnStartup: false
linter: {}
"linter-ui-default":
panelHeight: 233.1428985595703
"prettier-atom":
formatOnSaveOptions:
enabled: true
isDisabledIfNoConfigFile: true
isDisabledIfNotInPackageJson: true
respectEslintignore: false
showInStatusBar: true
prettierEslintOptions: {}
useEslint: true
"terminal-plus":
core: {}
style:
theme: "pro"
"tree-view":
hideIgnoredNames: true
hideVcsIgnoredFiles: true
"vim-mode": {}
"vim-mode-plus":
useClipboardAsDefaultRegister: true
welcome:
showOnStartup: false
core:
ignoredNames: [
".git"
".svn"
".DS_Store"
]
"exception-reporting":
userId: "750db657-913b-52ea-512d-dea57c560caf"
metrics:
userId: "6d7958e72f635b2868a2e1b862219e92281e2fb7"
"release-notes":
viewedVersion: "0.69.0"
welcome:
showOnStartup: false
|
[
{
"context": "lStore.exists()\n LocalStore.store.first = \"John\"\n $scope.first = LocalStore.store.first\n ",
"end": 625,
"score": 0.9998478293418884,
"start": 621,
"tag": "NAME",
"value": "John"
},
{
"context": "Store.store.first\n LocalStore.set('last', \"Smith\")\n $scope.last = LocalStore.get('last')\n ",
"end": 710,
"score": 0.9996375441551208,
"start": 705,
"tag": "NAME",
"value": "Smith"
}
] | halite/lattice/app/util/appStoreSrvc.coffee | CARFAX/halite | 212 | ###
Persistent Data Service using Web Storage LocalStorage and SessionStorage
Each is given a different factory.
Provides shared global application persistent data
.set applys JSON.stringify to its val so that objects can be stored
.get applys JSON.parse to to its return to inverse set
If the value is a string then the other forms
.store.keystring
.store['keystring']
to get an set values
usage:
mainApp = angular.module("MainApp", [... 'appStoreSrvc'])
mainApp.controller 'MyCtlr', ['$scope', ...,'LocalStore',
($scope,...,LocalStore) ->
if LocalStore.exists()
LocalStore.store.first = "John"
$scope.first = LocalStore.store.first
LocalStore.set('last', "Smith")
$scope.last = LocalStore.get('last')
Simailarly for SessionStore
###
angular.module("appStoreSrvc", [])
.factory "LocalStore",
() ->
servicer =
store: localStorage
exists: () ->
return localStorage?
clear: () ->
return localStorage.clear()
len: () ->
return localStorage.length
key: (index) ->
return localStorage.key(index)
get: (key) ->
return angular.fromJson localStorage.getItem(key)
set: (key,val) ->
return localStorage.setItem key, angular.toJson(val)
remove: (key) ->
return localStorage.removeItem(key)
return servicer
.factory "SessionStore",
() ->
servicer =
store: sessionStorage
exists: () ->
return sessionStorage?
clear: () ->
return sessionStorage.clear()
len: () ->
return sessionStorage.length
key: (index) ->
return sessionStorage.key(index)
get: (key) ->
return angular.fromJson sessionStorage.getItem(key)
set: (key,val) ->
return sessionStorage.setItem key, angular.toJson(val)
remove: (key) ->
return sessionStorage.removeItem(key)
return servicer | 69828 | ###
Persistent Data Service using Web Storage LocalStorage and SessionStorage
Each is given a different factory.
Provides shared global application persistent data
.set applys JSON.stringify to its val so that objects can be stored
.get applys JSON.parse to to its return to inverse set
If the value is a string then the other forms
.store.keystring
.store['keystring']
to get an set values
usage:
mainApp = angular.module("MainApp", [... 'appStoreSrvc'])
mainApp.controller 'MyCtlr', ['$scope', ...,'LocalStore',
($scope,...,LocalStore) ->
if LocalStore.exists()
LocalStore.store.first = "<NAME>"
$scope.first = LocalStore.store.first
LocalStore.set('last', "<NAME>")
$scope.last = LocalStore.get('last')
Simailarly for SessionStore
###
angular.module("appStoreSrvc", [])
.factory "LocalStore",
() ->
servicer =
store: localStorage
exists: () ->
return localStorage?
clear: () ->
return localStorage.clear()
len: () ->
return localStorage.length
key: (index) ->
return localStorage.key(index)
get: (key) ->
return angular.fromJson localStorage.getItem(key)
set: (key,val) ->
return localStorage.setItem key, angular.toJson(val)
remove: (key) ->
return localStorage.removeItem(key)
return servicer
.factory "SessionStore",
() ->
servicer =
store: sessionStorage
exists: () ->
return sessionStorage?
clear: () ->
return sessionStorage.clear()
len: () ->
return sessionStorage.length
key: (index) ->
return sessionStorage.key(index)
get: (key) ->
return angular.fromJson sessionStorage.getItem(key)
set: (key,val) ->
return sessionStorage.setItem key, angular.toJson(val)
remove: (key) ->
return sessionStorage.removeItem(key)
return servicer | true | ###
Persistent Data Service using Web Storage LocalStorage and SessionStorage
Each is given a different factory.
Provides shared global application persistent data
.set applys JSON.stringify to its val so that objects can be stored
.get applys JSON.parse to to its return to inverse set
If the value is a string then the other forms
.store.keystring
.store['keystring']
to get an set values
usage:
mainApp = angular.module("MainApp", [... 'appStoreSrvc'])
mainApp.controller 'MyCtlr', ['$scope', ...,'LocalStore',
($scope,...,LocalStore) ->
if LocalStore.exists()
LocalStore.store.first = "PI:NAME:<NAME>END_PI"
$scope.first = LocalStore.store.first
LocalStore.set('last', "PI:NAME:<NAME>END_PI")
$scope.last = LocalStore.get('last')
Simailarly for SessionStore
###
angular.module("appStoreSrvc", [])
.factory "LocalStore",
() ->
servicer =
store: localStorage
exists: () ->
return localStorage?
clear: () ->
return localStorage.clear()
len: () ->
return localStorage.length
key: (index) ->
return localStorage.key(index)
get: (key) ->
return angular.fromJson localStorage.getItem(key)
set: (key,val) ->
return localStorage.setItem key, angular.toJson(val)
remove: (key) ->
return localStorage.removeItem(key)
return servicer
.factory "SessionStore",
() ->
servicer =
store: sessionStorage
exists: () ->
return sessionStorage?
clear: () ->
return sessionStorage.clear()
len: () ->
return sessionStorage.length
key: (index) ->
return sessionStorage.key(index)
get: (key) ->
return angular.fromJson sessionStorage.getItem(key)
set: (key,val) ->
return sessionStorage.setItem key, angular.toJson(val)
remove: (key) ->
return sessionStorage.removeItem(key)
return servicer |
[
{
"context": "###\n# Copyright (C) 2014 Andrey Antukh <niwi@niwi.be>\n# Copyright (C) 2014 Jesús Espino ",
"end": 38,
"score": 0.99988853931427,
"start": 25,
"tag": "NAME",
"value": "Andrey Antukh"
},
{
"context": "###\n# Copyright (C) 2014 Andrey Antukh <niwi@niwi.be>\n# Copyright (C) 2014 Jesús Espino Garcia <jespin",
"end": 52,
"score": 0.9999317526817322,
"start": 40,
"tag": "EMAIL",
"value": "niwi@niwi.be"
},
{
"context": " Andrey Antukh <niwi@niwi.be>\n# Copyright (C) 2014 Jesús Espino Garcia <jespinog@gmail.com>\n# Copyright (C) 2014 David B",
"end": 94,
"score": 0.9998799562454224,
"start": 75,
"tag": "NAME",
"value": "Jesús Espino Garcia"
},
{
"context": "iwi.be>\n# Copyright (C) 2014 Jesús Espino Garcia <jespinog@gmail.com>\n# Copyright (C) 2014 David Barragán Merino <bame",
"end": 114,
"score": 0.999934732913971,
"start": 96,
"tag": "EMAIL",
"value": "jespinog@gmail.com"
},
{
"context": "o Garcia <jespinog@gmail.com>\n# Copyright (C) 2014 David Barragán Merino <bameda@dbarragan.com>\n#\n# This program is free s",
"end": 158,
"score": 0.9998822808265686,
"start": 137,
"tag": "NAME",
"value": "David Barragán Merino"
},
{
"context": ".com>\n# Copyright (C) 2014 David Barragán Merino <bameda@dbarragan.com>\n#\n# This program is free software: you can redis",
"end": 180,
"score": 0.9999352693557739,
"start": 160,
"tag": "EMAIL",
"value": "bameda@dbarragan.com"
}
] | public/taiga-front/app/coffee/modules/common/components.coffee | mabotech/maboss | 0 | ###
# Copyright (C) 2014 Andrey Antukh <niwi@niwi.be>
# Copyright (C) 2014 Jesús Espino Garcia <jespinog@gmail.com>
# Copyright (C) 2014 David Barragán Merino <bameda@dbarragan.com>
#
# This program is free software: you can redistribute it and/or modify
# it under the terms of the GNU Affero General Public License as
# published by the Free Software Foundation, either version 3 of the
# License, or (at your option) any later version.
#
# This program is distributed in the hope that it will be useful,
# but WITHOUT ANY WARRANTY; without even the implied warranty of
# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
# GNU Affero General Public License for more details.
#
# You should have received a copy of the GNU Affero General Public License
# along with this program. If not, see <http://www.gnu.org/licenses/>.
#
# File: modules/common/components.coffee
###
taiga = @.taiga
bindOnce = @.taiga.bindOnce
module = angular.module("taigaCommon")
#############################################################################
## Date Range Directive (used mainly for sprint date range)
#############################################################################
DateRangeDirective = ->
renderRange = ($el, first, second) ->
initDate = moment(first).format("DD MMM YYYY")
endDate = moment(second).format("DD MMM YYYY")
$el.html("#{initDate}-#{endDate}")
link = ($scope, $el, $attrs) ->
[first, second] = $attrs.tgDateRange.split(",")
bindOnce $scope, first, (valFirst) ->
bindOnce $scope, second, (valSecond) ->
renderRange($el, valFirst, valSecond)
return {link:link}
module.directive("tgDateRange", DateRangeDirective)
#############################################################################
## Date Selector Directive (using pikaday)
#############################################################################
DateSelectorDirective =->
link = ($scope, $el, $attrs, $model) ->
selectedDate = null
$el.picker = new Pikaday({
field: $el[0]
format: "DD MMM YYYY"
onSelect: (date) =>
selectedDate = date
onOpen: =>
$el.picker.setDate(selectedDate) if selectedDate?
})
$scope.$watch $attrs.ngModel, (val) ->
$el.picker.setDate(val) if val?
return {
link: link
require: "ngModel"
}
module.directive("tgDateSelector", DateSelectorDirective)
#############################################################################
## Sprint Progress Bar Directive
#############################################################################
SprintProgressBarDirective = ->
renderProgress = ($el, percentage, visual_percentage) ->
if $el.hasClass(".current-progress")
$el.css("width", "#{percentage}%")
else
$el.find(".current-progress").css("width", "#{visual_percentage}%")
$el.find(".number").html("#{percentage} %")
link = ($scope, $el, $attrs) ->
bindOnce $scope, $attrs.tgSprintProgressbar, (sprint) ->
closedPoints = sprint.closed_points
totalPoints = sprint.total_points
percentage = 0
percentage = Math.round(100 * (closedPoints/totalPoints)) if totalPoints != 0
visual_percentage = 0
#Visual hack for .current-progress bar
visual_percentage = Math.round(98 * (closedPoints/totalPoints)) if totalPoints != 0
renderProgress($el, percentage, visual_percentage)
return {link: link}
module.directive("tgSprintProgressbar", SprintProgressBarDirective)
#############################################################################
## Created-by display directive
#############################################################################
CreatedByDisplayDirective = ->
# Display the owner information (full name and photo) and the date of
# creation of an object (like USs, tasks and issues).
#
# Example:
# div.us-created-by(tg-created-by-display, ng-model="us")
#
# Requirements:
# - model object must have the attributes 'created_date' and
# 'owner'(ng-model)
# - scope.usersById object is required.
template = _.template("""
<div class="user-avatar">
<img src="<%- owner.photo %>" alt="<%- owner.full_name_display %>" />
</div>
<div class="created-by">
<span class="created-title">Created by <%- owner.full_name_display %></span>
<span class="created-date"><%- date %></span>
</div>
""") # TODO: i18n
link = ($scope, $el, $attrs) ->
render = (model) ->
owner = $scope.usersById?[model.owner] or {
full_name_display: "external user"
photo: "/images/unnamed.png"
}
html = template({
owner: owner
date: moment(model.created_date).format("DD MMM YYYY HH:mm")
})
$el.html(html)
bindOnce $scope, $attrs.ngModel, (model) ->
render(model) if model?
$scope.$on "$destroy", ->
$el.off()
return {
link: link
restrict: "EA"
require: "ngModel"
}
module.directive("tgCreatedByDisplay", CreatedByDisplayDirective)
#############################################################################
## Watchers directive
#############################################################################
WatchersDirective = ($rootscope, $confirm, $repo, $qqueue) ->
# You have to include a div with the tg-lb-watchers directive in the page
# where use this directive
#
# TODO: i18n
template = _.template("""
<% if(isEditable){ %>
<div class="watchers-header">
<span class="title">watchers</span>
<a href="" title="Add watcher" class="icon icon-plus add-watcher"></a>
</div>
<% } else if(watchers.length > 0){ %>
<div class="watchers-header">
<span class="title">watchers</span>
</div>
<% }; %>
<% _.each(watchers, function(watcher) { %>
<% if(watcher) { %>
<div class="watcher-single">
<div class="watcher-avatar">
<span class="avatar" href="" title="<%- watcher.full_name_display %>">
<img src="<%- watcher.photo %>" alt="<%- watcher.full_name_display %>">
</span>
</div>
<div class="watcher-name">
<span><%- watcher.full_name_display %></span>
<% if(isEditable){ %>
<a class="icon icon-delete"
data-watcher-id="<%- watcher.id %>" href="" title="delete-watcher">
</a>
<% }; %>
</div>
</div>
<% } %>
<% }); %>
""")
link = ($scope, $el, $attrs, $model) ->
isEditable = ->
return $scope.project?.my_permissions?.indexOf($attrs.requiredPerm) != -1
save = $qqueue.bindAdd (watchers) =>
item = $model.$modelValue.clone()
item.watchers = watchers
$model.$setViewValue(item)
promise = $repo.save($model.$modelValue)
promise.then ->
$confirm.notify("success")
watchers = _.map(watchers, (watcherId) -> $scope.usersById[watcherId])
renderWatchers(watchers)
$rootscope.$broadcast("history:reload")
promise.then null, ->
$model.$modelValue.revert()
deleteWatcher = $qqueue.bindAdd (watcherIds) =>
item = $model.$modelValue.clone()
item.watchers = watcherIds
$model.$setViewValue(item)
promise = $repo.save($model.$modelValue)
promise.then ->
$confirm.notify("success")
watchers = _.map(item.watchers, (watcherId) -> $scope.usersById[watcherId])
renderWatchers(watchers)
$rootscope.$broadcast("history:reload")
promise.then null, ->
item.revert()
$confirm.notify("error")
renderWatchers = (watchers) ->
ctx = {
watchers: watchers
isEditable: isEditable()
}
html = template(ctx)
$el.html(html)
if isEditable() and watchers.length == 0
$el.find(".title").text("Add watchers")
$el.find(".watchers-header").addClass("no-watchers")
$el.on "click", ".icon-delete", (event) ->
event.preventDefault()
return if not isEditable()
target = angular.element(event.currentTarget)
watcherId = target.data("watcher-id")
title = "Delete watcher"
message = $scope.usersById[watcherId].full_name_display
$confirm.askOnDelete(title, message).then (finish) =>
finish()
watcherIds = _.clone($model.$modelValue.watchers, false)
watcherIds = _.pull(watcherIds, watcherId)
deleteWatcher(watcherIds)
$el.on "click", ".add-watcher", (event) ->
event.preventDefault()
return if not isEditable()
$scope.$apply ->
$rootscope.$broadcast("watcher:add", $model.$modelValue)
$scope.$on "watcher:added", (ctx, watcherId) ->
watchers = _.clone($model.$modelValue.watchers, false)
watchers.push(watcherId)
watchers = _.uniq(watchers)
save(watchers)
$scope.$watch $attrs.ngModel, (item) ->
return if not item?
watchers = _.map(item.watchers, (watcherId) -> $scope.usersById[watcherId])
renderWatchers(watchers)
$scope.$on "$destroy", ->
$el.off()
return {link:link, require:"ngModel"}
module.directive("tgWatchers", ["$rootScope", "$tgConfirm", "$tgRepo", "$tgQqueue", WatchersDirective])
#############################################################################
## Assigned to directive
#############################################################################
AssignedToDirective = ($rootscope, $confirm, $repo, $loading, $qqueue) ->
# You have to include a div with the tg-lb-assignedto directive in the page
# where use this directive
#
# TODO: i18n
template = _.template("""
<% if (assignedTo) { %>
<div class="user-avatar">
<img src="<%- assignedTo.photo %>" alt="<%- assignedTo.full_name_display %>" />
</div>
<% } %>
<div class="assigned-to">
<span class="assigned-title">Assigned to</span>
<a href="" title="edit assignment" class="user-assigned <% if(isEditable){ %>editable<% }; %>">
<span class="assigned-name">
<% if (assignedTo) { %>
<%- assignedTo.full_name_display %>
<% } else { %>
Not assigned
<% } %>
</span>
<% if(isEditable){ %><span class="icon icon-arrow-bottom"></span><% }; %>
</a>
<% if (assignedTo!==null && isEditable) { %>
<a href="" title="delete assignment" class="icon icon-delete"></a>
<% } %>
</div>
""") # TODO: i18n
link = ($scope, $el, $attrs, $model) ->
isEditable = ->
return $scope.project?.my_permissions?.indexOf($attrs.requiredPerm) != -1
save = $qqueue.bindAdd (userId) =>
$model.$modelValue.assigned_to = userId
$loading.start($el)
promise = $repo.save($model.$modelValue)
promise.then ->
$loading.finish($el)
$confirm.notify("success")
renderAssignedTo($model.$modelValue)
$rootscope.$broadcast("history:reload")
promise.then null, ->
$model.$modelValue.revert()
$confirm.notify("error")
$loading.finish($el)
return promise
renderAssignedTo = (issue) ->
assignedToId = issue?.assigned_to
assignedTo = if assignedToId? then $scope.usersById[assignedToId] else null
ctx = {
assignedTo: assignedTo
isEditable: isEditable()
}
html = template(ctx)
$el.html(html)
$el.on "click", ".user-assigned", (event) ->
event.preventDefault()
return if not isEditable()
$scope.$apply ->
$rootscope.$broadcast("assigned-to:add", $model.$modelValue)
$el.on "click", ".icon-delete", (event) ->
event.preventDefault()
return if not isEditable()
title = "Are you sure you want to leave it unassigned?" # TODO: i18n
$confirm.ask(title).then (finish) =>
finish()
$model.$modelValue.assigned_to = null
save(null)
$scope.$on "assigned-to:added", (ctx, userId, item) ->
return if item.id != $model.$modelValue.id
save(userId)
$scope.$watch $attrs.ngModel, (instance) ->
renderAssignedTo(instance)
$scope.$on "$destroy", ->
$el.off()
return {
link:link,
require:"ngModel"
}
module.directive("tgAssignedTo", ["$rootScope", "$tgConfirm", "$tgRepo", "$tgLoading", "$tgQqueue", AssignedToDirective])
#############################################################################
## Block Button directive
#############################################################################
BlockButtonDirective = ($rootscope, $loading) ->
template = """
<a href="#" class="button button-gray item-block">Block</a>
<a href="#" class="button button-red item-unblock">Unblock</a>
"""
link = ($scope, $el, $attrs, $model) ->
isEditable = ->
return $scope.project.my_permissions.indexOf("modify_us") != -1
$scope.$watch $attrs.ngModel, (item) ->
return if not item
if isEditable()
$el.find('.item-block').addClass('editable')
if item.is_blocked
$el.find('.item-block').hide()
$el.find('.item-unblock').show()
else
$el.find('.item-block').show()
$el.find('.item-unblock').hide()
$el.on "click", ".item-block", (event) ->
event.preventDefault()
$rootscope.$broadcast("block", $model.$modelValue)
$el.on "click", ".item-unblock", (event) ->
event.preventDefault()
$loading.start($el.find(".item-unblock"))
finish = ->
$loading.finish($el.find(".item-unblock"))
$rootscope.$broadcast("unblock", $model.$modelValue, finish)
$scope.$on "$destroy", ->
$el.off()
return {
link: link
restrict: "EA"
require: "ngModel"
template: template
}
module.directive("tgBlockButton", ["$rootScope", "$tgLoading", BlockButtonDirective])
#############################################################################
## Delete Button directive
#############################################################################
DeleteButtonDirective = ($log, $repo, $confirm, $location) ->
template = """
<a href="" class="button button-red">Delete</a>
""" #TODO: i18n
link = ($scope, $el, $attrs, $model) ->
if not $attrs.onDeleteGoToUrl
return $log.error "DeleteButtonDirective requires on-delete-go-to-url set in scope."
if not $attrs.onDeleteTitle
return $log.error "DeleteButtonDirective requires on-delete-title set in scope."
$el.on "click", ".button", (event) ->
title = $scope.$eval($attrs.onDeleteTitle)
subtitle = $model.$modelValue.subject
$confirm.askOnDelete(title, subtitle).then (finish) =>
promise = $repo.remove($model.$modelValue)
promise.then =>
finish()
url = $scope.$eval($attrs.onDeleteGoToUrl)
$location.path(url)
promise.then null, =>
finish(false)
$confirm.notify("error")
$scope.$on "$destroy", ->
$el.off()
return {
link: link
restrict: "EA"
require: "ngModel"
template: template
}
module.directive("tgDeleteButton", ["$log", "$tgRepo", "$tgConfirm", "$tgLocation", DeleteButtonDirective])
#############################################################################
## Editable subject directive
#############################################################################
EditableSubjectDirective = ($rootscope, $repo, $confirm, $loading, $qqueue) ->
template = """
<div class="view-subject">
{{ item.subject }}
<a class="edit icon icon-edit" href="" title="Edit" />
</div>
<div class="edit-subject">
<input type="text" ng-model="item.subject" data-required="true" data-maxlength="500"/>
<span class="save-container">
<a class="save icon icon-floppy" href="" title="Save" />
</span>
</div>
"""
link = ($scope, $el, $attrs, $model) ->
isEditable = ->
return $scope.project.my_permissions.indexOf($attrs.requiredPerm) != -1
save = $qqueue.bindAdd (subject) =>
$model.$modelValue.subject = subject
$loading.start($el.find('.save-container'))
promise = $repo.save($model.$modelValue)
promise.then ->
$confirm.notify("success")
$rootscope.$broadcast("history:reload")
$el.find('.edit-subject').hide()
$el.find('.view-subject').show()
promise.then null, ->
$confirm.notify("error")
promise.finally ->
$loading.finish($el.find('.save-container'))
return promise
$el.click ->
return if not isEditable()
$el.find('.edit-subject').show()
$el.find('.view-subject').hide()
$el.find('input').focus()
$el.on "click", ".save", ->
subject = $scope.item.subject
save(subject)
$el.on "keyup", "input", (event) ->
if event.keyCode == 13
subject = $scope.item.subject
save(subject)
else if event.keyCode == 27
$scope.$apply () => $model.$modelValue.revert()
$el.find('div.edit-subject').hide()
$el.find('div.view-subject').show()
$el.find('div.edit-subject').hide()
$el.find('div.view-subject span.edit').hide()
$scope.$watch $attrs.ngModel, (value) ->
return if not value
$scope.item = value
if not isEditable()
$el.find('.view-subject .edit').remove()
$scope.$on "$destroy", ->
$el.off()
return {
link: link
restrict: "EA"
require: "ngModel"
template: template
}
module.directive("tgEditableSubject", ["$rootScope", "$tgRepo", "$tgConfirm", "$tgLoading", "$tgQqueue",
EditableSubjectDirective])
#############################################################################
## Editable subject directive
#############################################################################
EditableDescriptionDirective = ($rootscope, $repo, $confirm, $compile, $loading, $selectedText, $qqueue) ->
template = """
<div class="view-description">
<section class="us-content wysiwyg"
tg-bind-html="item.description_html || noDescriptionMsg"></section>
<span class="edit icon icon-edit" href="" title="Edit" />
</div>
<div class="edit-description">
<textarea placeholder="Empty space is so boring... go on be descriptive... A rose by any other name would smell as sweet..."
ng-model="item.description"
tg-markitup="tg-markitup"></textarea>
<a class="help-markdown" href="https://taiga.io/support/taiga-markdown-syntax/" target="_blank" title="Mardown syntax help">
<span class="icon icon-help"></span>
<span>Markdown syntax help</span>
</a>
<span class="save-container">
<a class="save icon icon-floppy" href="" title="Save" />
</span>
</div>
""" # TODO: i18n
noDescriptionMegEditMode = """
<p class="no-description editable">
Empty space is so boring...
go on be descriptive...
A rose by any other name would smell as sweet...
</p>
""" # TODO: i18n
noDescriptionMegReadMode = """
<p class="no-description">
No description yet.
</p>
""" # TODO: i18n
link = ($scope, $el, $attrs, $model) ->
$el.find('.edit-description').hide()
$el.find('.view-description .edit').hide()
isEditable = ->
return $scope.project.my_permissions.indexOf($attrs.requiredPerm) != -1
save = $qqueue.bindAdd (description) =>
$model.$modelValue.description = description
$loading.start($el.find('.save-container'))
promise = $repo.save($model.$modelValue)
promise.then ->
$confirm.notify("success")
$rootscope.$broadcast("history:reload")
$el.find('.edit-description').hide()
$el.find('.view-description').show()
promise.then null, ->
$confirm.notify("error")
promise.finally ->
$loading.finish($el.find('.save-container'))
$el.on "mouseup", ".view-description", (event) ->
# We want to dettect the a inside the div so we use the target and
# not the currentTarget
target = angular.element(event.target)
return if not isEditable()
return if target.is('a')
return if $selectedText.get().length
$el.find('.edit-description').show()
$el.find('.view-description').hide()
$el.find('textarea').focus()
$el.on "click", ".save", ->
description = $scope.item.description
save(description)
$el.on "keydown", "textarea", (event) ->
if event.keyCode == 27
$scope.$apply () => $scope.item.revert()
$el.find('.edit-description').hide()
$el.find('.view-description').show()
$scope.$watch $attrs.ngModel, (value) ->
return if not value
$scope.item = value
if isEditable()
$el.find('.view-description .edit').show()
$el.find('.view-description .us-content').addClass('editable')
$scope.noDescriptionMsg = noDescriptionMegEditMode
else
$scope.noDescriptionMsg = noDescriptionMegReadMode
$scope.$on "$destroy", ->
$el.off()
return {
link: link
restrict: "EA"
require: "ngModel"
template: template
}
module.directive("tgEditableDescription", ["$rootScope", "$tgRepo", "$tgConfirm",
"$compile", "$tgLoading", "$selectedText", "$tgQqueue", EditableDescriptionDirective])
#############################################################################
## Common list directives
#############################################################################
## NOTE: These directives are used in issues and search and are
## completely bindonce, they only serves for visualization of data.
#############################################################################
ListItemIssueStatusDirective = ->
link = ($scope, $el, $attrs) ->
issue = $scope.$eval($attrs.tgListitemIssueStatus)
bindOnce $scope, "issueStatusById", (issueStatusById) ->
$el.html(issueStatusById[issue.status].name)
return {link:link}
ListItemTaskStatusDirective = ->
link = ($scope, $el, $attrs) ->
task = $scope.$eval($attrs.tgListitemTaskStatus)
bindOnce $scope, "taskStatusById", (taskStatusById) ->
$el.html(taskStatusById[task.status].name)
return {link:link}
ListItemUsStatusDirective = ->
link = ($scope, $el, $attrs) ->
us = $scope.$eval($attrs.tgListitemUsStatus)
bindOnce $scope, "usStatusById", (usStatusById) ->
$el.html(usStatusById[us.status].name)
return {link:link}
ListItemAssignedtoDirective = ->
template = _.template("""
<figure class="avatar">
<img src="<%- imgurl %>" alt="<%- name %>"/>
<figcaption><%- name %></figcaption>
</figure>
""")
link = ($scope, $el, $attrs) ->
bindOnce $scope, "membersById", (membersById) ->
item = $scope.$eval($attrs.tgListitemAssignedto)
ctx = {name: "Unassigned", imgurl: "/images/unnamed.png"}
member = membersById[item.assigned_to]
if member
ctx.imgurl = member.photo
ctx.name = member.full_name
$el.html(template(ctx))
return {link:link}
ListItemPriorityDirective = ->
template = """
<div class="level"></div>
"""
link = ($scope, $el, $attrs) ->
render = (priorityById, issue) ->
priority = priorityById[issue.priority]
domNode = $el.find(".level")
domNode.css("background-color", priority.color)
domNode.attr("title", priority.name)
bindOnce $scope, "priorityById", (priorityById) ->
issue = $scope.$eval($attrs.tgListitemPriority)
render(priorityById, issue)
$scope.$watch $attrs.tgListitemPriority, (issue) ->
render($scope.priorityById, issue)
return {
link: link
template: template
}
ListItemSeverityDirective = ->
template = """
<div class="level"></div>
"""
link = ($scope, $el, $attrs) ->
render = (severityById, issue) ->
severity = severityById[issue.severity]
domNode = $el.find(".level")
domNode.css("background-color", severity.color)
domNode.attr("title", severity.name)
bindOnce $scope, "severityById", (severityById) ->
issue = $scope.$eval($attrs.tgListitemSeverity)
render(severityById, issue)
$scope.$watch $attrs.tgListitemSeverity, (issue) ->
render($scope.severityById, issue)
return {
link: link
template: template
}
ListItemTypeDirective = ->
template = """
<div class="level"></div>
"""
link = ($scope, $el, $attrs) ->
render = (issueTypeById, issue) ->
type = issueTypeById[issue.type]
domNode = $el.find(".level")
domNode.css("background-color", type.color)
domNode.attr("title", type.name)
bindOnce $scope, "issueTypeById", (issueTypeById) ->
issue = $scope.$eval($attrs.tgListitemType)
render(issueTypeById, issue)
$scope.$watch $attrs.tgListitemType, (issue) ->
render($scope.issueTypeById, issue)
return {
link: link
template: template
}
#############################################################################
## Progress bar directive
#############################################################################
TgProgressBarDirective = ->
template = _.template("""
<div class="current-progress" style="width: <%- percentage %>%"></div>
""")
render = (el, percentage) ->
el.html(template({percentage: percentage}))
link = ($scope, $el, $attrs) ->
element = angular.element($el)
$scope.$watch $attrs.tgProgressBar, (percentage) ->
percentage = _.max([0 , percentage])
percentage = _.min([100, percentage])
render($el, percentage)
$scope.$on "$destroy", ->
$el.off()
return {link: link}
#############################################################################
## Main title directive
#############################################################################
TgMainTitleDirective = ->
template = _.template("""
<span class="project-name"><%- projectName %></span>
<span class="green"><%- sectionName %></span>
""")
render = (el, projectName, sectionName) ->
el.html(template({
projectName: projectName
sectionName: sectionName
}))
link = ($scope, $el, $attrs) ->
element = angular.element($el)
$scope.$watch "project", (project) ->
render($el, project.name, $scope.sectionName) if project
$scope.$on "project:loaded", (ctx, project) =>
render($el, project.name, $scope.sectionName)
$scope.$on "$destroy", ->
$el.off()
return {link: link}
module.directive("tgListitemType", ListItemTypeDirective)
module.directive("tgListitemIssueStatus", ListItemIssueStatusDirective)
module.directive("tgListitemAssignedto", ListItemAssignedtoDirective)
module.directive("tgListitemPriority", ListItemPriorityDirective)
module.directive("tgListitemSeverity", ListItemSeverityDirective)
module.directive("tgListitemTaskStatus", ListItemTaskStatusDirective)
module.directive("tgListitemUsStatus", ListItemUsStatusDirective)
module.directive("tgProgressBar", TgProgressBarDirective)
module.directive("tgMainTitle", TgMainTitleDirective)
| 138295 | ###
# Copyright (C) 2014 <NAME> <<EMAIL>>
# Copyright (C) 2014 <NAME> <<EMAIL>>
# Copyright (C) 2014 <NAME> <<EMAIL>>
#
# This program is free software: you can redistribute it and/or modify
# it under the terms of the GNU Affero General Public License as
# published by the Free Software Foundation, either version 3 of the
# License, or (at your option) any later version.
#
# This program is distributed in the hope that it will be useful,
# but WITHOUT ANY WARRANTY; without even the implied warranty of
# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
# GNU Affero General Public License for more details.
#
# You should have received a copy of the GNU Affero General Public License
# along with this program. If not, see <http://www.gnu.org/licenses/>.
#
# File: modules/common/components.coffee
###
taiga = @.taiga
bindOnce = @.taiga.bindOnce
module = angular.module("taigaCommon")
#############################################################################
## Date Range Directive (used mainly for sprint date range)
#############################################################################
DateRangeDirective = ->
renderRange = ($el, first, second) ->
initDate = moment(first).format("DD MMM YYYY")
endDate = moment(second).format("DD MMM YYYY")
$el.html("#{initDate}-#{endDate}")
link = ($scope, $el, $attrs) ->
[first, second] = $attrs.tgDateRange.split(",")
bindOnce $scope, first, (valFirst) ->
bindOnce $scope, second, (valSecond) ->
renderRange($el, valFirst, valSecond)
return {link:link}
module.directive("tgDateRange", DateRangeDirective)
#############################################################################
## Date Selector Directive (using pikaday)
#############################################################################
DateSelectorDirective =->
link = ($scope, $el, $attrs, $model) ->
selectedDate = null
$el.picker = new Pikaday({
field: $el[0]
format: "DD MMM YYYY"
onSelect: (date) =>
selectedDate = date
onOpen: =>
$el.picker.setDate(selectedDate) if selectedDate?
})
$scope.$watch $attrs.ngModel, (val) ->
$el.picker.setDate(val) if val?
return {
link: link
require: "ngModel"
}
module.directive("tgDateSelector", DateSelectorDirective)
#############################################################################
## Sprint Progress Bar Directive
#############################################################################
SprintProgressBarDirective = ->
renderProgress = ($el, percentage, visual_percentage) ->
if $el.hasClass(".current-progress")
$el.css("width", "#{percentage}%")
else
$el.find(".current-progress").css("width", "#{visual_percentage}%")
$el.find(".number").html("#{percentage} %")
link = ($scope, $el, $attrs) ->
bindOnce $scope, $attrs.tgSprintProgressbar, (sprint) ->
closedPoints = sprint.closed_points
totalPoints = sprint.total_points
percentage = 0
percentage = Math.round(100 * (closedPoints/totalPoints)) if totalPoints != 0
visual_percentage = 0
#Visual hack for .current-progress bar
visual_percentage = Math.round(98 * (closedPoints/totalPoints)) if totalPoints != 0
renderProgress($el, percentage, visual_percentage)
return {link: link}
module.directive("tgSprintProgressbar", SprintProgressBarDirective)
#############################################################################
## Created-by display directive
#############################################################################
CreatedByDisplayDirective = ->
# Display the owner information (full name and photo) and the date of
# creation of an object (like USs, tasks and issues).
#
# Example:
# div.us-created-by(tg-created-by-display, ng-model="us")
#
# Requirements:
# - model object must have the attributes 'created_date' and
# 'owner'(ng-model)
# - scope.usersById object is required.
template = _.template("""
<div class="user-avatar">
<img src="<%- owner.photo %>" alt="<%- owner.full_name_display %>" />
</div>
<div class="created-by">
<span class="created-title">Created by <%- owner.full_name_display %></span>
<span class="created-date"><%- date %></span>
</div>
""") # TODO: i18n
link = ($scope, $el, $attrs) ->
render = (model) ->
owner = $scope.usersById?[model.owner] or {
full_name_display: "external user"
photo: "/images/unnamed.png"
}
html = template({
owner: owner
date: moment(model.created_date).format("DD MMM YYYY HH:mm")
})
$el.html(html)
bindOnce $scope, $attrs.ngModel, (model) ->
render(model) if model?
$scope.$on "$destroy", ->
$el.off()
return {
link: link
restrict: "EA"
require: "ngModel"
}
module.directive("tgCreatedByDisplay", CreatedByDisplayDirective)
#############################################################################
## Watchers directive
#############################################################################
WatchersDirective = ($rootscope, $confirm, $repo, $qqueue) ->
# You have to include a div with the tg-lb-watchers directive in the page
# where use this directive
#
# TODO: i18n
template = _.template("""
<% if(isEditable){ %>
<div class="watchers-header">
<span class="title">watchers</span>
<a href="" title="Add watcher" class="icon icon-plus add-watcher"></a>
</div>
<% } else if(watchers.length > 0){ %>
<div class="watchers-header">
<span class="title">watchers</span>
</div>
<% }; %>
<% _.each(watchers, function(watcher) { %>
<% if(watcher) { %>
<div class="watcher-single">
<div class="watcher-avatar">
<span class="avatar" href="" title="<%- watcher.full_name_display %>">
<img src="<%- watcher.photo %>" alt="<%- watcher.full_name_display %>">
</span>
</div>
<div class="watcher-name">
<span><%- watcher.full_name_display %></span>
<% if(isEditable){ %>
<a class="icon icon-delete"
data-watcher-id="<%- watcher.id %>" href="" title="delete-watcher">
</a>
<% }; %>
</div>
</div>
<% } %>
<% }); %>
""")
link = ($scope, $el, $attrs, $model) ->
isEditable = ->
return $scope.project?.my_permissions?.indexOf($attrs.requiredPerm) != -1
save = $qqueue.bindAdd (watchers) =>
item = $model.$modelValue.clone()
item.watchers = watchers
$model.$setViewValue(item)
promise = $repo.save($model.$modelValue)
promise.then ->
$confirm.notify("success")
watchers = _.map(watchers, (watcherId) -> $scope.usersById[watcherId])
renderWatchers(watchers)
$rootscope.$broadcast("history:reload")
promise.then null, ->
$model.$modelValue.revert()
deleteWatcher = $qqueue.bindAdd (watcherIds) =>
item = $model.$modelValue.clone()
item.watchers = watcherIds
$model.$setViewValue(item)
promise = $repo.save($model.$modelValue)
promise.then ->
$confirm.notify("success")
watchers = _.map(item.watchers, (watcherId) -> $scope.usersById[watcherId])
renderWatchers(watchers)
$rootscope.$broadcast("history:reload")
promise.then null, ->
item.revert()
$confirm.notify("error")
renderWatchers = (watchers) ->
ctx = {
watchers: watchers
isEditable: isEditable()
}
html = template(ctx)
$el.html(html)
if isEditable() and watchers.length == 0
$el.find(".title").text("Add watchers")
$el.find(".watchers-header").addClass("no-watchers")
$el.on "click", ".icon-delete", (event) ->
event.preventDefault()
return if not isEditable()
target = angular.element(event.currentTarget)
watcherId = target.data("watcher-id")
title = "Delete watcher"
message = $scope.usersById[watcherId].full_name_display
$confirm.askOnDelete(title, message).then (finish) =>
finish()
watcherIds = _.clone($model.$modelValue.watchers, false)
watcherIds = _.pull(watcherIds, watcherId)
deleteWatcher(watcherIds)
$el.on "click", ".add-watcher", (event) ->
event.preventDefault()
return if not isEditable()
$scope.$apply ->
$rootscope.$broadcast("watcher:add", $model.$modelValue)
$scope.$on "watcher:added", (ctx, watcherId) ->
watchers = _.clone($model.$modelValue.watchers, false)
watchers.push(watcherId)
watchers = _.uniq(watchers)
save(watchers)
$scope.$watch $attrs.ngModel, (item) ->
return if not item?
watchers = _.map(item.watchers, (watcherId) -> $scope.usersById[watcherId])
renderWatchers(watchers)
$scope.$on "$destroy", ->
$el.off()
return {link:link, require:"ngModel"}
module.directive("tgWatchers", ["$rootScope", "$tgConfirm", "$tgRepo", "$tgQqueue", WatchersDirective])
#############################################################################
## Assigned to directive
#############################################################################
AssignedToDirective = ($rootscope, $confirm, $repo, $loading, $qqueue) ->
# You have to include a div with the tg-lb-assignedto directive in the page
# where use this directive
#
# TODO: i18n
template = _.template("""
<% if (assignedTo) { %>
<div class="user-avatar">
<img src="<%- assignedTo.photo %>" alt="<%- assignedTo.full_name_display %>" />
</div>
<% } %>
<div class="assigned-to">
<span class="assigned-title">Assigned to</span>
<a href="" title="edit assignment" class="user-assigned <% if(isEditable){ %>editable<% }; %>">
<span class="assigned-name">
<% if (assignedTo) { %>
<%- assignedTo.full_name_display %>
<% } else { %>
Not assigned
<% } %>
</span>
<% if(isEditable){ %><span class="icon icon-arrow-bottom"></span><% }; %>
</a>
<% if (assignedTo!==null && isEditable) { %>
<a href="" title="delete assignment" class="icon icon-delete"></a>
<% } %>
</div>
""") # TODO: i18n
link = ($scope, $el, $attrs, $model) ->
isEditable = ->
return $scope.project?.my_permissions?.indexOf($attrs.requiredPerm) != -1
save = $qqueue.bindAdd (userId) =>
$model.$modelValue.assigned_to = userId
$loading.start($el)
promise = $repo.save($model.$modelValue)
promise.then ->
$loading.finish($el)
$confirm.notify("success")
renderAssignedTo($model.$modelValue)
$rootscope.$broadcast("history:reload")
promise.then null, ->
$model.$modelValue.revert()
$confirm.notify("error")
$loading.finish($el)
return promise
renderAssignedTo = (issue) ->
assignedToId = issue?.assigned_to
assignedTo = if assignedToId? then $scope.usersById[assignedToId] else null
ctx = {
assignedTo: assignedTo
isEditable: isEditable()
}
html = template(ctx)
$el.html(html)
$el.on "click", ".user-assigned", (event) ->
event.preventDefault()
return if not isEditable()
$scope.$apply ->
$rootscope.$broadcast("assigned-to:add", $model.$modelValue)
$el.on "click", ".icon-delete", (event) ->
event.preventDefault()
return if not isEditable()
title = "Are you sure you want to leave it unassigned?" # TODO: i18n
$confirm.ask(title).then (finish) =>
finish()
$model.$modelValue.assigned_to = null
save(null)
$scope.$on "assigned-to:added", (ctx, userId, item) ->
return if item.id != $model.$modelValue.id
save(userId)
$scope.$watch $attrs.ngModel, (instance) ->
renderAssignedTo(instance)
$scope.$on "$destroy", ->
$el.off()
return {
link:link,
require:"ngModel"
}
module.directive("tgAssignedTo", ["$rootScope", "$tgConfirm", "$tgRepo", "$tgLoading", "$tgQqueue", AssignedToDirective])
#############################################################################
## Block Button directive
#############################################################################
BlockButtonDirective = ($rootscope, $loading) ->
template = """
<a href="#" class="button button-gray item-block">Block</a>
<a href="#" class="button button-red item-unblock">Unblock</a>
"""
link = ($scope, $el, $attrs, $model) ->
isEditable = ->
return $scope.project.my_permissions.indexOf("modify_us") != -1
$scope.$watch $attrs.ngModel, (item) ->
return if not item
if isEditable()
$el.find('.item-block').addClass('editable')
if item.is_blocked
$el.find('.item-block').hide()
$el.find('.item-unblock').show()
else
$el.find('.item-block').show()
$el.find('.item-unblock').hide()
$el.on "click", ".item-block", (event) ->
event.preventDefault()
$rootscope.$broadcast("block", $model.$modelValue)
$el.on "click", ".item-unblock", (event) ->
event.preventDefault()
$loading.start($el.find(".item-unblock"))
finish = ->
$loading.finish($el.find(".item-unblock"))
$rootscope.$broadcast("unblock", $model.$modelValue, finish)
$scope.$on "$destroy", ->
$el.off()
return {
link: link
restrict: "EA"
require: "ngModel"
template: template
}
module.directive("tgBlockButton", ["$rootScope", "$tgLoading", BlockButtonDirective])
#############################################################################
## Delete Button directive
#############################################################################
DeleteButtonDirective = ($log, $repo, $confirm, $location) ->
template = """
<a href="" class="button button-red">Delete</a>
""" #TODO: i18n
link = ($scope, $el, $attrs, $model) ->
if not $attrs.onDeleteGoToUrl
return $log.error "DeleteButtonDirective requires on-delete-go-to-url set in scope."
if not $attrs.onDeleteTitle
return $log.error "DeleteButtonDirective requires on-delete-title set in scope."
$el.on "click", ".button", (event) ->
title = $scope.$eval($attrs.onDeleteTitle)
subtitle = $model.$modelValue.subject
$confirm.askOnDelete(title, subtitle).then (finish) =>
promise = $repo.remove($model.$modelValue)
promise.then =>
finish()
url = $scope.$eval($attrs.onDeleteGoToUrl)
$location.path(url)
promise.then null, =>
finish(false)
$confirm.notify("error")
$scope.$on "$destroy", ->
$el.off()
return {
link: link
restrict: "EA"
require: "ngModel"
template: template
}
module.directive("tgDeleteButton", ["$log", "$tgRepo", "$tgConfirm", "$tgLocation", DeleteButtonDirective])
#############################################################################
## Editable subject directive
#############################################################################
EditableSubjectDirective = ($rootscope, $repo, $confirm, $loading, $qqueue) ->
template = """
<div class="view-subject">
{{ item.subject }}
<a class="edit icon icon-edit" href="" title="Edit" />
</div>
<div class="edit-subject">
<input type="text" ng-model="item.subject" data-required="true" data-maxlength="500"/>
<span class="save-container">
<a class="save icon icon-floppy" href="" title="Save" />
</span>
</div>
"""
link = ($scope, $el, $attrs, $model) ->
isEditable = ->
return $scope.project.my_permissions.indexOf($attrs.requiredPerm) != -1
save = $qqueue.bindAdd (subject) =>
$model.$modelValue.subject = subject
$loading.start($el.find('.save-container'))
promise = $repo.save($model.$modelValue)
promise.then ->
$confirm.notify("success")
$rootscope.$broadcast("history:reload")
$el.find('.edit-subject').hide()
$el.find('.view-subject').show()
promise.then null, ->
$confirm.notify("error")
promise.finally ->
$loading.finish($el.find('.save-container'))
return promise
$el.click ->
return if not isEditable()
$el.find('.edit-subject').show()
$el.find('.view-subject').hide()
$el.find('input').focus()
$el.on "click", ".save", ->
subject = $scope.item.subject
save(subject)
$el.on "keyup", "input", (event) ->
if event.keyCode == 13
subject = $scope.item.subject
save(subject)
else if event.keyCode == 27
$scope.$apply () => $model.$modelValue.revert()
$el.find('div.edit-subject').hide()
$el.find('div.view-subject').show()
$el.find('div.edit-subject').hide()
$el.find('div.view-subject span.edit').hide()
$scope.$watch $attrs.ngModel, (value) ->
return if not value
$scope.item = value
if not isEditable()
$el.find('.view-subject .edit').remove()
$scope.$on "$destroy", ->
$el.off()
return {
link: link
restrict: "EA"
require: "ngModel"
template: template
}
module.directive("tgEditableSubject", ["$rootScope", "$tgRepo", "$tgConfirm", "$tgLoading", "$tgQqueue",
EditableSubjectDirective])
#############################################################################
## Editable subject directive
#############################################################################
EditableDescriptionDirective = ($rootscope, $repo, $confirm, $compile, $loading, $selectedText, $qqueue) ->
template = """
<div class="view-description">
<section class="us-content wysiwyg"
tg-bind-html="item.description_html || noDescriptionMsg"></section>
<span class="edit icon icon-edit" href="" title="Edit" />
</div>
<div class="edit-description">
<textarea placeholder="Empty space is so boring... go on be descriptive... A rose by any other name would smell as sweet..."
ng-model="item.description"
tg-markitup="tg-markitup"></textarea>
<a class="help-markdown" href="https://taiga.io/support/taiga-markdown-syntax/" target="_blank" title="Mardown syntax help">
<span class="icon icon-help"></span>
<span>Markdown syntax help</span>
</a>
<span class="save-container">
<a class="save icon icon-floppy" href="" title="Save" />
</span>
</div>
""" # TODO: i18n
noDescriptionMegEditMode = """
<p class="no-description editable">
Empty space is so boring...
go on be descriptive...
A rose by any other name would smell as sweet...
</p>
""" # TODO: i18n
noDescriptionMegReadMode = """
<p class="no-description">
No description yet.
</p>
""" # TODO: i18n
link = ($scope, $el, $attrs, $model) ->
$el.find('.edit-description').hide()
$el.find('.view-description .edit').hide()
isEditable = ->
return $scope.project.my_permissions.indexOf($attrs.requiredPerm) != -1
save = $qqueue.bindAdd (description) =>
$model.$modelValue.description = description
$loading.start($el.find('.save-container'))
promise = $repo.save($model.$modelValue)
promise.then ->
$confirm.notify("success")
$rootscope.$broadcast("history:reload")
$el.find('.edit-description').hide()
$el.find('.view-description').show()
promise.then null, ->
$confirm.notify("error")
promise.finally ->
$loading.finish($el.find('.save-container'))
$el.on "mouseup", ".view-description", (event) ->
# We want to dettect the a inside the div so we use the target and
# not the currentTarget
target = angular.element(event.target)
return if not isEditable()
return if target.is('a')
return if $selectedText.get().length
$el.find('.edit-description').show()
$el.find('.view-description').hide()
$el.find('textarea').focus()
$el.on "click", ".save", ->
description = $scope.item.description
save(description)
$el.on "keydown", "textarea", (event) ->
if event.keyCode == 27
$scope.$apply () => $scope.item.revert()
$el.find('.edit-description').hide()
$el.find('.view-description').show()
$scope.$watch $attrs.ngModel, (value) ->
return if not value
$scope.item = value
if isEditable()
$el.find('.view-description .edit').show()
$el.find('.view-description .us-content').addClass('editable')
$scope.noDescriptionMsg = noDescriptionMegEditMode
else
$scope.noDescriptionMsg = noDescriptionMegReadMode
$scope.$on "$destroy", ->
$el.off()
return {
link: link
restrict: "EA"
require: "ngModel"
template: template
}
module.directive("tgEditableDescription", ["$rootScope", "$tgRepo", "$tgConfirm",
"$compile", "$tgLoading", "$selectedText", "$tgQqueue", EditableDescriptionDirective])
#############################################################################
## Common list directives
#############################################################################
## NOTE: These directives are used in issues and search and are
## completely bindonce, they only serves for visualization of data.
#############################################################################
ListItemIssueStatusDirective = ->
link = ($scope, $el, $attrs) ->
issue = $scope.$eval($attrs.tgListitemIssueStatus)
bindOnce $scope, "issueStatusById", (issueStatusById) ->
$el.html(issueStatusById[issue.status].name)
return {link:link}
ListItemTaskStatusDirective = ->
link = ($scope, $el, $attrs) ->
task = $scope.$eval($attrs.tgListitemTaskStatus)
bindOnce $scope, "taskStatusById", (taskStatusById) ->
$el.html(taskStatusById[task.status].name)
return {link:link}
ListItemUsStatusDirective = ->
link = ($scope, $el, $attrs) ->
us = $scope.$eval($attrs.tgListitemUsStatus)
bindOnce $scope, "usStatusById", (usStatusById) ->
$el.html(usStatusById[us.status].name)
return {link:link}
ListItemAssignedtoDirective = ->
template = _.template("""
<figure class="avatar">
<img src="<%- imgurl %>" alt="<%- name %>"/>
<figcaption><%- name %></figcaption>
</figure>
""")
link = ($scope, $el, $attrs) ->
bindOnce $scope, "membersById", (membersById) ->
item = $scope.$eval($attrs.tgListitemAssignedto)
ctx = {name: "Unassigned", imgurl: "/images/unnamed.png"}
member = membersById[item.assigned_to]
if member
ctx.imgurl = member.photo
ctx.name = member.full_name
$el.html(template(ctx))
return {link:link}
ListItemPriorityDirective = ->
template = """
<div class="level"></div>
"""
link = ($scope, $el, $attrs) ->
render = (priorityById, issue) ->
priority = priorityById[issue.priority]
domNode = $el.find(".level")
domNode.css("background-color", priority.color)
domNode.attr("title", priority.name)
bindOnce $scope, "priorityById", (priorityById) ->
issue = $scope.$eval($attrs.tgListitemPriority)
render(priorityById, issue)
$scope.$watch $attrs.tgListitemPriority, (issue) ->
render($scope.priorityById, issue)
return {
link: link
template: template
}
ListItemSeverityDirective = ->
template = """
<div class="level"></div>
"""
link = ($scope, $el, $attrs) ->
render = (severityById, issue) ->
severity = severityById[issue.severity]
domNode = $el.find(".level")
domNode.css("background-color", severity.color)
domNode.attr("title", severity.name)
bindOnce $scope, "severityById", (severityById) ->
issue = $scope.$eval($attrs.tgListitemSeverity)
render(severityById, issue)
$scope.$watch $attrs.tgListitemSeverity, (issue) ->
render($scope.severityById, issue)
return {
link: link
template: template
}
ListItemTypeDirective = ->
template = """
<div class="level"></div>
"""
link = ($scope, $el, $attrs) ->
render = (issueTypeById, issue) ->
type = issueTypeById[issue.type]
domNode = $el.find(".level")
domNode.css("background-color", type.color)
domNode.attr("title", type.name)
bindOnce $scope, "issueTypeById", (issueTypeById) ->
issue = $scope.$eval($attrs.tgListitemType)
render(issueTypeById, issue)
$scope.$watch $attrs.tgListitemType, (issue) ->
render($scope.issueTypeById, issue)
return {
link: link
template: template
}
#############################################################################
## Progress bar directive
#############################################################################
TgProgressBarDirective = ->
template = _.template("""
<div class="current-progress" style="width: <%- percentage %>%"></div>
""")
render = (el, percentage) ->
el.html(template({percentage: percentage}))
link = ($scope, $el, $attrs) ->
element = angular.element($el)
$scope.$watch $attrs.tgProgressBar, (percentage) ->
percentage = _.max([0 , percentage])
percentage = _.min([100, percentage])
render($el, percentage)
$scope.$on "$destroy", ->
$el.off()
return {link: link}
#############################################################################
## Main title directive
#############################################################################
TgMainTitleDirective = ->
template = _.template("""
<span class="project-name"><%- projectName %></span>
<span class="green"><%- sectionName %></span>
""")
render = (el, projectName, sectionName) ->
el.html(template({
projectName: projectName
sectionName: sectionName
}))
link = ($scope, $el, $attrs) ->
element = angular.element($el)
$scope.$watch "project", (project) ->
render($el, project.name, $scope.sectionName) if project
$scope.$on "project:loaded", (ctx, project) =>
render($el, project.name, $scope.sectionName)
$scope.$on "$destroy", ->
$el.off()
return {link: link}
module.directive("tgListitemType", ListItemTypeDirective)
module.directive("tgListitemIssueStatus", ListItemIssueStatusDirective)
module.directive("tgListitemAssignedto", ListItemAssignedtoDirective)
module.directive("tgListitemPriority", ListItemPriorityDirective)
module.directive("tgListitemSeverity", ListItemSeverityDirective)
module.directive("tgListitemTaskStatus", ListItemTaskStatusDirective)
module.directive("tgListitemUsStatus", ListItemUsStatusDirective)
module.directive("tgProgressBar", TgProgressBarDirective)
module.directive("tgMainTitle", TgMainTitleDirective)
| true | ###
# Copyright (C) 2014 PI:NAME:<NAME>END_PI <PI:EMAIL:<EMAIL>END_PI>
# Copyright (C) 2014 PI:NAME:<NAME>END_PI <PI:EMAIL:<EMAIL>END_PI>
# Copyright (C) 2014 PI:NAME:<NAME>END_PI <PI:EMAIL:<EMAIL>END_PI>
#
# This program is free software: you can redistribute it and/or modify
# it under the terms of the GNU Affero General Public License as
# published by the Free Software Foundation, either version 3 of the
# License, or (at your option) any later version.
#
# This program is distributed in the hope that it will be useful,
# but WITHOUT ANY WARRANTY; without even the implied warranty of
# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
# GNU Affero General Public License for more details.
#
# You should have received a copy of the GNU Affero General Public License
# along with this program. If not, see <http://www.gnu.org/licenses/>.
#
# File: modules/common/components.coffee
###
taiga = @.taiga
bindOnce = @.taiga.bindOnce
module = angular.module("taigaCommon")
#############################################################################
## Date Range Directive (used mainly for sprint date range)
#############################################################################
DateRangeDirective = ->
renderRange = ($el, first, second) ->
initDate = moment(first).format("DD MMM YYYY")
endDate = moment(second).format("DD MMM YYYY")
$el.html("#{initDate}-#{endDate}")
link = ($scope, $el, $attrs) ->
[first, second] = $attrs.tgDateRange.split(",")
bindOnce $scope, first, (valFirst) ->
bindOnce $scope, second, (valSecond) ->
renderRange($el, valFirst, valSecond)
return {link:link}
module.directive("tgDateRange", DateRangeDirective)
#############################################################################
## Date Selector Directive (using pikaday)
#############################################################################
DateSelectorDirective =->
link = ($scope, $el, $attrs, $model) ->
selectedDate = null
$el.picker = new Pikaday({
field: $el[0]
format: "DD MMM YYYY"
onSelect: (date) =>
selectedDate = date
onOpen: =>
$el.picker.setDate(selectedDate) if selectedDate?
})
$scope.$watch $attrs.ngModel, (val) ->
$el.picker.setDate(val) if val?
return {
link: link
require: "ngModel"
}
module.directive("tgDateSelector", DateSelectorDirective)
#############################################################################
## Sprint Progress Bar Directive
#############################################################################
SprintProgressBarDirective = ->
renderProgress = ($el, percentage, visual_percentage) ->
if $el.hasClass(".current-progress")
$el.css("width", "#{percentage}%")
else
$el.find(".current-progress").css("width", "#{visual_percentage}%")
$el.find(".number").html("#{percentage} %")
link = ($scope, $el, $attrs) ->
bindOnce $scope, $attrs.tgSprintProgressbar, (sprint) ->
closedPoints = sprint.closed_points
totalPoints = sprint.total_points
percentage = 0
percentage = Math.round(100 * (closedPoints/totalPoints)) if totalPoints != 0
visual_percentage = 0
#Visual hack for .current-progress bar
visual_percentage = Math.round(98 * (closedPoints/totalPoints)) if totalPoints != 0
renderProgress($el, percentage, visual_percentage)
return {link: link}
module.directive("tgSprintProgressbar", SprintProgressBarDirective)
#############################################################################
## Created-by display directive
#############################################################################
CreatedByDisplayDirective = ->
# Display the owner information (full name and photo) and the date of
# creation of an object (like USs, tasks and issues).
#
# Example:
# div.us-created-by(tg-created-by-display, ng-model="us")
#
# Requirements:
# - model object must have the attributes 'created_date' and
# 'owner'(ng-model)
# - scope.usersById object is required.
template = _.template("""
<div class="user-avatar">
<img src="<%- owner.photo %>" alt="<%- owner.full_name_display %>" />
</div>
<div class="created-by">
<span class="created-title">Created by <%- owner.full_name_display %></span>
<span class="created-date"><%- date %></span>
</div>
""") # TODO: i18n
link = ($scope, $el, $attrs) ->
render = (model) ->
owner = $scope.usersById?[model.owner] or {
full_name_display: "external user"
photo: "/images/unnamed.png"
}
html = template({
owner: owner
date: moment(model.created_date).format("DD MMM YYYY HH:mm")
})
$el.html(html)
bindOnce $scope, $attrs.ngModel, (model) ->
render(model) if model?
$scope.$on "$destroy", ->
$el.off()
return {
link: link
restrict: "EA"
require: "ngModel"
}
module.directive("tgCreatedByDisplay", CreatedByDisplayDirective)
#############################################################################
## Watchers directive
#############################################################################
WatchersDirective = ($rootscope, $confirm, $repo, $qqueue) ->
# You have to include a div with the tg-lb-watchers directive in the page
# where use this directive
#
# TODO: i18n
template = _.template("""
<% if(isEditable){ %>
<div class="watchers-header">
<span class="title">watchers</span>
<a href="" title="Add watcher" class="icon icon-plus add-watcher"></a>
</div>
<% } else if(watchers.length > 0){ %>
<div class="watchers-header">
<span class="title">watchers</span>
</div>
<% }; %>
<% _.each(watchers, function(watcher) { %>
<% if(watcher) { %>
<div class="watcher-single">
<div class="watcher-avatar">
<span class="avatar" href="" title="<%- watcher.full_name_display %>">
<img src="<%- watcher.photo %>" alt="<%- watcher.full_name_display %>">
</span>
</div>
<div class="watcher-name">
<span><%- watcher.full_name_display %></span>
<% if(isEditable){ %>
<a class="icon icon-delete"
data-watcher-id="<%- watcher.id %>" href="" title="delete-watcher">
</a>
<% }; %>
</div>
</div>
<% } %>
<% }); %>
""")
link = ($scope, $el, $attrs, $model) ->
isEditable = ->
return $scope.project?.my_permissions?.indexOf($attrs.requiredPerm) != -1
save = $qqueue.bindAdd (watchers) =>
item = $model.$modelValue.clone()
item.watchers = watchers
$model.$setViewValue(item)
promise = $repo.save($model.$modelValue)
promise.then ->
$confirm.notify("success")
watchers = _.map(watchers, (watcherId) -> $scope.usersById[watcherId])
renderWatchers(watchers)
$rootscope.$broadcast("history:reload")
promise.then null, ->
$model.$modelValue.revert()
deleteWatcher = $qqueue.bindAdd (watcherIds) =>
item = $model.$modelValue.clone()
item.watchers = watcherIds
$model.$setViewValue(item)
promise = $repo.save($model.$modelValue)
promise.then ->
$confirm.notify("success")
watchers = _.map(item.watchers, (watcherId) -> $scope.usersById[watcherId])
renderWatchers(watchers)
$rootscope.$broadcast("history:reload")
promise.then null, ->
item.revert()
$confirm.notify("error")
renderWatchers = (watchers) ->
ctx = {
watchers: watchers
isEditable: isEditable()
}
html = template(ctx)
$el.html(html)
if isEditable() and watchers.length == 0
$el.find(".title").text("Add watchers")
$el.find(".watchers-header").addClass("no-watchers")
$el.on "click", ".icon-delete", (event) ->
event.preventDefault()
return if not isEditable()
target = angular.element(event.currentTarget)
watcherId = target.data("watcher-id")
title = "Delete watcher"
message = $scope.usersById[watcherId].full_name_display
$confirm.askOnDelete(title, message).then (finish) =>
finish()
watcherIds = _.clone($model.$modelValue.watchers, false)
watcherIds = _.pull(watcherIds, watcherId)
deleteWatcher(watcherIds)
$el.on "click", ".add-watcher", (event) ->
event.preventDefault()
return if not isEditable()
$scope.$apply ->
$rootscope.$broadcast("watcher:add", $model.$modelValue)
$scope.$on "watcher:added", (ctx, watcherId) ->
watchers = _.clone($model.$modelValue.watchers, false)
watchers.push(watcherId)
watchers = _.uniq(watchers)
save(watchers)
$scope.$watch $attrs.ngModel, (item) ->
return if not item?
watchers = _.map(item.watchers, (watcherId) -> $scope.usersById[watcherId])
renderWatchers(watchers)
$scope.$on "$destroy", ->
$el.off()
return {link:link, require:"ngModel"}
module.directive("tgWatchers", ["$rootScope", "$tgConfirm", "$tgRepo", "$tgQqueue", WatchersDirective])
#############################################################################
## Assigned to directive
#############################################################################
AssignedToDirective = ($rootscope, $confirm, $repo, $loading, $qqueue) ->
# You have to include a div with the tg-lb-assignedto directive in the page
# where use this directive
#
# TODO: i18n
template = _.template("""
<% if (assignedTo) { %>
<div class="user-avatar">
<img src="<%- assignedTo.photo %>" alt="<%- assignedTo.full_name_display %>" />
</div>
<% } %>
<div class="assigned-to">
<span class="assigned-title">Assigned to</span>
<a href="" title="edit assignment" class="user-assigned <% if(isEditable){ %>editable<% }; %>">
<span class="assigned-name">
<% if (assignedTo) { %>
<%- assignedTo.full_name_display %>
<% } else { %>
Not assigned
<% } %>
</span>
<% if(isEditable){ %><span class="icon icon-arrow-bottom"></span><% }; %>
</a>
<% if (assignedTo!==null && isEditable) { %>
<a href="" title="delete assignment" class="icon icon-delete"></a>
<% } %>
</div>
""") # TODO: i18n
link = ($scope, $el, $attrs, $model) ->
isEditable = ->
return $scope.project?.my_permissions?.indexOf($attrs.requiredPerm) != -1
save = $qqueue.bindAdd (userId) =>
$model.$modelValue.assigned_to = userId
$loading.start($el)
promise = $repo.save($model.$modelValue)
promise.then ->
$loading.finish($el)
$confirm.notify("success")
renderAssignedTo($model.$modelValue)
$rootscope.$broadcast("history:reload")
promise.then null, ->
$model.$modelValue.revert()
$confirm.notify("error")
$loading.finish($el)
return promise
renderAssignedTo = (issue) ->
assignedToId = issue?.assigned_to
assignedTo = if assignedToId? then $scope.usersById[assignedToId] else null
ctx = {
assignedTo: assignedTo
isEditable: isEditable()
}
html = template(ctx)
$el.html(html)
$el.on "click", ".user-assigned", (event) ->
event.preventDefault()
return if not isEditable()
$scope.$apply ->
$rootscope.$broadcast("assigned-to:add", $model.$modelValue)
$el.on "click", ".icon-delete", (event) ->
event.preventDefault()
return if not isEditable()
title = "Are you sure you want to leave it unassigned?" # TODO: i18n
$confirm.ask(title).then (finish) =>
finish()
$model.$modelValue.assigned_to = null
save(null)
$scope.$on "assigned-to:added", (ctx, userId, item) ->
return if item.id != $model.$modelValue.id
save(userId)
$scope.$watch $attrs.ngModel, (instance) ->
renderAssignedTo(instance)
$scope.$on "$destroy", ->
$el.off()
return {
link:link,
require:"ngModel"
}
module.directive("tgAssignedTo", ["$rootScope", "$tgConfirm", "$tgRepo", "$tgLoading", "$tgQqueue", AssignedToDirective])
#############################################################################
## Block Button directive
#############################################################################
BlockButtonDirective = ($rootscope, $loading) ->
template = """
<a href="#" class="button button-gray item-block">Block</a>
<a href="#" class="button button-red item-unblock">Unblock</a>
"""
link = ($scope, $el, $attrs, $model) ->
isEditable = ->
return $scope.project.my_permissions.indexOf("modify_us") != -1
$scope.$watch $attrs.ngModel, (item) ->
return if not item
if isEditable()
$el.find('.item-block').addClass('editable')
if item.is_blocked
$el.find('.item-block').hide()
$el.find('.item-unblock').show()
else
$el.find('.item-block').show()
$el.find('.item-unblock').hide()
$el.on "click", ".item-block", (event) ->
event.preventDefault()
$rootscope.$broadcast("block", $model.$modelValue)
$el.on "click", ".item-unblock", (event) ->
event.preventDefault()
$loading.start($el.find(".item-unblock"))
finish = ->
$loading.finish($el.find(".item-unblock"))
$rootscope.$broadcast("unblock", $model.$modelValue, finish)
$scope.$on "$destroy", ->
$el.off()
return {
link: link
restrict: "EA"
require: "ngModel"
template: template
}
module.directive("tgBlockButton", ["$rootScope", "$tgLoading", BlockButtonDirective])
#############################################################################
## Delete Button directive
#############################################################################
DeleteButtonDirective = ($log, $repo, $confirm, $location) ->
template = """
<a href="" class="button button-red">Delete</a>
""" #TODO: i18n
link = ($scope, $el, $attrs, $model) ->
if not $attrs.onDeleteGoToUrl
return $log.error "DeleteButtonDirective requires on-delete-go-to-url set in scope."
if not $attrs.onDeleteTitle
return $log.error "DeleteButtonDirective requires on-delete-title set in scope."
$el.on "click", ".button", (event) ->
title = $scope.$eval($attrs.onDeleteTitle)
subtitle = $model.$modelValue.subject
$confirm.askOnDelete(title, subtitle).then (finish) =>
promise = $repo.remove($model.$modelValue)
promise.then =>
finish()
url = $scope.$eval($attrs.onDeleteGoToUrl)
$location.path(url)
promise.then null, =>
finish(false)
$confirm.notify("error")
$scope.$on "$destroy", ->
$el.off()
return {
link: link
restrict: "EA"
require: "ngModel"
template: template
}
module.directive("tgDeleteButton", ["$log", "$tgRepo", "$tgConfirm", "$tgLocation", DeleteButtonDirective])
#############################################################################
## Editable subject directive
#############################################################################
EditableSubjectDirective = ($rootscope, $repo, $confirm, $loading, $qqueue) ->
template = """
<div class="view-subject">
{{ item.subject }}
<a class="edit icon icon-edit" href="" title="Edit" />
</div>
<div class="edit-subject">
<input type="text" ng-model="item.subject" data-required="true" data-maxlength="500"/>
<span class="save-container">
<a class="save icon icon-floppy" href="" title="Save" />
</span>
</div>
"""
link = ($scope, $el, $attrs, $model) ->
isEditable = ->
return $scope.project.my_permissions.indexOf($attrs.requiredPerm) != -1
save = $qqueue.bindAdd (subject) =>
$model.$modelValue.subject = subject
$loading.start($el.find('.save-container'))
promise = $repo.save($model.$modelValue)
promise.then ->
$confirm.notify("success")
$rootscope.$broadcast("history:reload")
$el.find('.edit-subject').hide()
$el.find('.view-subject').show()
promise.then null, ->
$confirm.notify("error")
promise.finally ->
$loading.finish($el.find('.save-container'))
return promise
$el.click ->
return if not isEditable()
$el.find('.edit-subject').show()
$el.find('.view-subject').hide()
$el.find('input').focus()
$el.on "click", ".save", ->
subject = $scope.item.subject
save(subject)
$el.on "keyup", "input", (event) ->
if event.keyCode == 13
subject = $scope.item.subject
save(subject)
else if event.keyCode == 27
$scope.$apply () => $model.$modelValue.revert()
$el.find('div.edit-subject').hide()
$el.find('div.view-subject').show()
$el.find('div.edit-subject').hide()
$el.find('div.view-subject span.edit').hide()
$scope.$watch $attrs.ngModel, (value) ->
return if not value
$scope.item = value
if not isEditable()
$el.find('.view-subject .edit').remove()
$scope.$on "$destroy", ->
$el.off()
return {
link: link
restrict: "EA"
require: "ngModel"
template: template
}
module.directive("tgEditableSubject", ["$rootScope", "$tgRepo", "$tgConfirm", "$tgLoading", "$tgQqueue",
EditableSubjectDirective])
#############################################################################
## Editable subject directive
#############################################################################
EditableDescriptionDirective = ($rootscope, $repo, $confirm, $compile, $loading, $selectedText, $qqueue) ->
template = """
<div class="view-description">
<section class="us-content wysiwyg"
tg-bind-html="item.description_html || noDescriptionMsg"></section>
<span class="edit icon icon-edit" href="" title="Edit" />
</div>
<div class="edit-description">
<textarea placeholder="Empty space is so boring... go on be descriptive... A rose by any other name would smell as sweet..."
ng-model="item.description"
tg-markitup="tg-markitup"></textarea>
<a class="help-markdown" href="https://taiga.io/support/taiga-markdown-syntax/" target="_blank" title="Mardown syntax help">
<span class="icon icon-help"></span>
<span>Markdown syntax help</span>
</a>
<span class="save-container">
<a class="save icon icon-floppy" href="" title="Save" />
</span>
</div>
""" # TODO: i18n
noDescriptionMegEditMode = """
<p class="no-description editable">
Empty space is so boring...
go on be descriptive...
A rose by any other name would smell as sweet...
</p>
""" # TODO: i18n
noDescriptionMegReadMode = """
<p class="no-description">
No description yet.
</p>
""" # TODO: i18n
link = ($scope, $el, $attrs, $model) ->
$el.find('.edit-description').hide()
$el.find('.view-description .edit').hide()
isEditable = ->
return $scope.project.my_permissions.indexOf($attrs.requiredPerm) != -1
save = $qqueue.bindAdd (description) =>
$model.$modelValue.description = description
$loading.start($el.find('.save-container'))
promise = $repo.save($model.$modelValue)
promise.then ->
$confirm.notify("success")
$rootscope.$broadcast("history:reload")
$el.find('.edit-description').hide()
$el.find('.view-description').show()
promise.then null, ->
$confirm.notify("error")
promise.finally ->
$loading.finish($el.find('.save-container'))
$el.on "mouseup", ".view-description", (event) ->
# We want to dettect the a inside the div so we use the target and
# not the currentTarget
target = angular.element(event.target)
return if not isEditable()
return if target.is('a')
return if $selectedText.get().length
$el.find('.edit-description').show()
$el.find('.view-description').hide()
$el.find('textarea').focus()
$el.on "click", ".save", ->
description = $scope.item.description
save(description)
$el.on "keydown", "textarea", (event) ->
if event.keyCode == 27
$scope.$apply () => $scope.item.revert()
$el.find('.edit-description').hide()
$el.find('.view-description').show()
$scope.$watch $attrs.ngModel, (value) ->
return if not value
$scope.item = value
if isEditable()
$el.find('.view-description .edit').show()
$el.find('.view-description .us-content').addClass('editable')
$scope.noDescriptionMsg = noDescriptionMegEditMode
else
$scope.noDescriptionMsg = noDescriptionMegReadMode
$scope.$on "$destroy", ->
$el.off()
return {
link: link
restrict: "EA"
require: "ngModel"
template: template
}
module.directive("tgEditableDescription", ["$rootScope", "$tgRepo", "$tgConfirm",
"$compile", "$tgLoading", "$selectedText", "$tgQqueue", EditableDescriptionDirective])
#############################################################################
## Common list directives
#############################################################################
## NOTE: These directives are used in issues and search and are
## completely bindonce, they only serves for visualization of data.
#############################################################################
ListItemIssueStatusDirective = ->
link = ($scope, $el, $attrs) ->
issue = $scope.$eval($attrs.tgListitemIssueStatus)
bindOnce $scope, "issueStatusById", (issueStatusById) ->
$el.html(issueStatusById[issue.status].name)
return {link:link}
ListItemTaskStatusDirective = ->
link = ($scope, $el, $attrs) ->
task = $scope.$eval($attrs.tgListitemTaskStatus)
bindOnce $scope, "taskStatusById", (taskStatusById) ->
$el.html(taskStatusById[task.status].name)
return {link:link}
ListItemUsStatusDirective = ->
link = ($scope, $el, $attrs) ->
us = $scope.$eval($attrs.tgListitemUsStatus)
bindOnce $scope, "usStatusById", (usStatusById) ->
$el.html(usStatusById[us.status].name)
return {link:link}
ListItemAssignedtoDirective = ->
template = _.template("""
<figure class="avatar">
<img src="<%- imgurl %>" alt="<%- name %>"/>
<figcaption><%- name %></figcaption>
</figure>
""")
link = ($scope, $el, $attrs) ->
bindOnce $scope, "membersById", (membersById) ->
item = $scope.$eval($attrs.tgListitemAssignedto)
ctx = {name: "Unassigned", imgurl: "/images/unnamed.png"}
member = membersById[item.assigned_to]
if member
ctx.imgurl = member.photo
ctx.name = member.full_name
$el.html(template(ctx))
return {link:link}
ListItemPriorityDirective = ->
template = """
<div class="level"></div>
"""
link = ($scope, $el, $attrs) ->
render = (priorityById, issue) ->
priority = priorityById[issue.priority]
domNode = $el.find(".level")
domNode.css("background-color", priority.color)
domNode.attr("title", priority.name)
bindOnce $scope, "priorityById", (priorityById) ->
issue = $scope.$eval($attrs.tgListitemPriority)
render(priorityById, issue)
$scope.$watch $attrs.tgListitemPriority, (issue) ->
render($scope.priorityById, issue)
return {
link: link
template: template
}
ListItemSeverityDirective = ->
template = """
<div class="level"></div>
"""
link = ($scope, $el, $attrs) ->
render = (severityById, issue) ->
severity = severityById[issue.severity]
domNode = $el.find(".level")
domNode.css("background-color", severity.color)
domNode.attr("title", severity.name)
bindOnce $scope, "severityById", (severityById) ->
issue = $scope.$eval($attrs.tgListitemSeverity)
render(severityById, issue)
$scope.$watch $attrs.tgListitemSeverity, (issue) ->
render($scope.severityById, issue)
return {
link: link
template: template
}
ListItemTypeDirective = ->
template = """
<div class="level"></div>
"""
link = ($scope, $el, $attrs) ->
render = (issueTypeById, issue) ->
type = issueTypeById[issue.type]
domNode = $el.find(".level")
domNode.css("background-color", type.color)
domNode.attr("title", type.name)
bindOnce $scope, "issueTypeById", (issueTypeById) ->
issue = $scope.$eval($attrs.tgListitemType)
render(issueTypeById, issue)
$scope.$watch $attrs.tgListitemType, (issue) ->
render($scope.issueTypeById, issue)
return {
link: link
template: template
}
#############################################################################
## Progress bar directive
#############################################################################
TgProgressBarDirective = ->
template = _.template("""
<div class="current-progress" style="width: <%- percentage %>%"></div>
""")
render = (el, percentage) ->
el.html(template({percentage: percentage}))
link = ($scope, $el, $attrs) ->
element = angular.element($el)
$scope.$watch $attrs.tgProgressBar, (percentage) ->
percentage = _.max([0 , percentage])
percentage = _.min([100, percentage])
render($el, percentage)
$scope.$on "$destroy", ->
$el.off()
return {link: link}
#############################################################################
## Main title directive
#############################################################################
TgMainTitleDirective = ->
template = _.template("""
<span class="project-name"><%- projectName %></span>
<span class="green"><%- sectionName %></span>
""")
render = (el, projectName, sectionName) ->
el.html(template({
projectName: projectName
sectionName: sectionName
}))
link = ($scope, $el, $attrs) ->
element = angular.element($el)
$scope.$watch "project", (project) ->
render($el, project.name, $scope.sectionName) if project
$scope.$on "project:loaded", (ctx, project) =>
render($el, project.name, $scope.sectionName)
$scope.$on "$destroy", ->
$el.off()
return {link: link}
module.directive("tgListitemType", ListItemTypeDirective)
module.directive("tgListitemIssueStatus", ListItemIssueStatusDirective)
module.directive("tgListitemAssignedto", ListItemAssignedtoDirective)
module.directive("tgListitemPriority", ListItemPriorityDirective)
module.directive("tgListitemSeverity", ListItemSeverityDirective)
module.directive("tgListitemTaskStatus", ListItemTaskStatusDirective)
module.directive("tgListitemUsStatus", ListItemUsStatusDirective)
module.directive("tgProgressBar", TgProgressBarDirective)
module.directive("tgMainTitle", TgMainTitleDirective)
|
[
{
"context": "top|disable>\n# Hubot relay state\n#\n# Author:\n# clicia scarlet <yuyuvn@icloud.com>\n\nmodule.exports = (robot) ->\n",
"end": 621,
"score": 0.99969482421875,
"start": 607,
"tag": "NAME",
"value": "clicia scarlet"
},
{
"context": "Hubot relay state\n#\n# Author:\n# clicia scarlet <yuyuvn@icloud.com>\n\nmodule.exports = (robot) ->\n robot.catchAll (m",
"end": 640,
"score": 0.9999103546142578,
"start": 623,
"tag": "EMAIL",
"value": "yuyuvn@icloud.com"
}
] | src/relay.coffee | yuyuvn/hubot-relay | 0 | # Description:
# Relay message to another chatbox via http
#
# Dependencies:
# "coffee-script": "~1.6"
#
# Configuration:
# RELAY_EVERYTHING - Relay message that didn't call bot name
# RELAY_URL - URL relay to
# RELAY_RESPONSE - Bot will respond even when relay successfully
# RELAY_ENABLE_COMMAND - Support command
# RELAY_ENABLE_RECEIVE - Enable receive relay message
#
# Commands:
# Hubot relay add <url>
# Hubot relay delete <url>
# Hubot relay delete all
# Hubot relay list <url>
# Hubot relay <start|enable>
# Hubot relay <stop|disable>
# Hubot relay state
#
# Author:
# clicia scarlet <yuyuvn@icloud.com>
module.exports = (robot) ->
robot.catchAll (msg) ->
# Message class doesn't have text property so we need to check it before relay
return if !msg.message.text
r = new RegExp "^(?:#{robot.alias}|#{robot.name}) ([^]+)", "i"
matches = msg.message.text.match(r)
if matches != null && matches.length > 1
message = matches[1]
else
return if !process.env.RELAY_EVERYTHING
message = msg.message.text
message = if robot.adapter.removeFormatting then robot.adapter.removeFormatting(message) else message
if process.env.RELAY_ENABLE_COMMAND
return if !robot.brain.get(msg.message.user.name + "_relay_enable")
urls = robot.brain.get(msg.message.user.name + "_relay_url") ||
(if process.env.RELAY_URL then process.env.RELAY_URL.split("|") else null)
msg.send "Relay Error! Use '#{robot.name} relay add <relay_url>' to add relay url" if !urls
else
return if !process.env.RELAY_URL
urls = process.env.RELAY_URL.split "|"
urls.forEach (url) ->
data = JSON.stringify({msg: message})
robot.http(url)
.header('Content-Type', 'application/json')
.post(data) (err, res, body) ->
if err
msg.send "Relay failed :(\n #{err}"
else if process.env.RELAY_RESPONSE
msg.send "Relay completed '#{message}'"
if process.env.RELAY_ENABLE_COMMAND
robot.respond /relay add (.+)/, (msg) ->
url = msg.match[1]
brain_key = msg.message.user.name + "_relay_url"
list = robot.brain.get brain_key
list = [] if !list
list.push url
robot.brain.set brain_key, list
robot.brain.save
msg.send "Added '#{url}' to relay list"
robot.respond /relay delete (.+)/, (msg) ->
return if !process.env.RELAY_ENABLE_COMMAND
url = msg.match[1]
return if url == "all"
brain_key = msg.message.user.name + "_relay_url"
list = robot.brain.get brain_key
if list
index = list.indexOf(url)
list.splice(index, 1) if index >= 0
robot.brain.set brain_key, list
robot.brain.save
msg.send "Deleted '#{url}' from relay list"
robot.respond /relay list/, (msg) ->
return if !process.env.RELAY_ENABLE_COMMAND
urls = robot.brain.get(msg.message.user.name + "_relay_url") || []
msg.send "Relay list:\n" + urls.join("\n")
robot.respond /relay delete all/, (msg) ->
return if !process.env.RELAY_ENABLE_COMMAND
robot.brain.set (msg.message.user.name + "_relay_url"), []
robot.brain.save
msg.send "Deleted all urls from relay list"
robot.respond /relay (start|enable)/, (msg) ->
return if !process.env.RELAY_ENABLE_COMMAND
robot.brain.set (msg.message.user.name + "_relay_enable"), true
robot.brain.save
msg.send "Relay is enabled"
robot.respond /relay (stop|disable)/, (msg) ->
return if !process.env.RELAY_ENABLE_COMMAND
robot.brain.set (msg.message.user.name + "_relay_enable"), false
robot.brain.save
msg.send "Relay is disabled"
robot.respond /relay state/, (msg) ->
return if !process.env.RELAY_ENABLE_COMMAND
state = robot.brain.get (msg.message.user.name + "_relay_enable"), false
state_mes = if state then "enabled" else "disabled"
msg.send "Relay is #{state_mes}"
if process.env.RELAY_ENABLE_RECEIVE
robot.router.post "/hubot/relay/:room", (req, res) ->
room = req.params.room
msg = req.body.msg
robot.messageRoom room, msg
res.send 'OK'
| 22332 | # Description:
# Relay message to another chatbox via http
#
# Dependencies:
# "coffee-script": "~1.6"
#
# Configuration:
# RELAY_EVERYTHING - Relay message that didn't call bot name
# RELAY_URL - URL relay to
# RELAY_RESPONSE - Bot will respond even when relay successfully
# RELAY_ENABLE_COMMAND - Support command
# RELAY_ENABLE_RECEIVE - Enable receive relay message
#
# Commands:
# Hubot relay add <url>
# Hubot relay delete <url>
# Hubot relay delete all
# Hubot relay list <url>
# Hubot relay <start|enable>
# Hubot relay <stop|disable>
# Hubot relay state
#
# Author:
# <NAME> <<EMAIL>>
module.exports = (robot) ->
robot.catchAll (msg) ->
# Message class doesn't have text property so we need to check it before relay
return if !msg.message.text
r = new RegExp "^(?:#{robot.alias}|#{robot.name}) ([^]+)", "i"
matches = msg.message.text.match(r)
if matches != null && matches.length > 1
message = matches[1]
else
return if !process.env.RELAY_EVERYTHING
message = msg.message.text
message = if robot.adapter.removeFormatting then robot.adapter.removeFormatting(message) else message
if process.env.RELAY_ENABLE_COMMAND
return if !robot.brain.get(msg.message.user.name + "_relay_enable")
urls = robot.brain.get(msg.message.user.name + "_relay_url") ||
(if process.env.RELAY_URL then process.env.RELAY_URL.split("|") else null)
msg.send "Relay Error! Use '#{robot.name} relay add <relay_url>' to add relay url" if !urls
else
return if !process.env.RELAY_URL
urls = process.env.RELAY_URL.split "|"
urls.forEach (url) ->
data = JSON.stringify({msg: message})
robot.http(url)
.header('Content-Type', 'application/json')
.post(data) (err, res, body) ->
if err
msg.send "Relay failed :(\n #{err}"
else if process.env.RELAY_RESPONSE
msg.send "Relay completed '#{message}'"
if process.env.RELAY_ENABLE_COMMAND
robot.respond /relay add (.+)/, (msg) ->
url = msg.match[1]
brain_key = msg.message.user.name + "_relay_url"
list = robot.brain.get brain_key
list = [] if !list
list.push url
robot.brain.set brain_key, list
robot.brain.save
msg.send "Added '#{url}' to relay list"
robot.respond /relay delete (.+)/, (msg) ->
return if !process.env.RELAY_ENABLE_COMMAND
url = msg.match[1]
return if url == "all"
brain_key = msg.message.user.name + "_relay_url"
list = robot.brain.get brain_key
if list
index = list.indexOf(url)
list.splice(index, 1) if index >= 0
robot.brain.set brain_key, list
robot.brain.save
msg.send "Deleted '#{url}' from relay list"
robot.respond /relay list/, (msg) ->
return if !process.env.RELAY_ENABLE_COMMAND
urls = robot.brain.get(msg.message.user.name + "_relay_url") || []
msg.send "Relay list:\n" + urls.join("\n")
robot.respond /relay delete all/, (msg) ->
return if !process.env.RELAY_ENABLE_COMMAND
robot.brain.set (msg.message.user.name + "_relay_url"), []
robot.brain.save
msg.send "Deleted all urls from relay list"
robot.respond /relay (start|enable)/, (msg) ->
return if !process.env.RELAY_ENABLE_COMMAND
robot.brain.set (msg.message.user.name + "_relay_enable"), true
robot.brain.save
msg.send "Relay is enabled"
robot.respond /relay (stop|disable)/, (msg) ->
return if !process.env.RELAY_ENABLE_COMMAND
robot.brain.set (msg.message.user.name + "_relay_enable"), false
robot.brain.save
msg.send "Relay is disabled"
robot.respond /relay state/, (msg) ->
return if !process.env.RELAY_ENABLE_COMMAND
state = robot.brain.get (msg.message.user.name + "_relay_enable"), false
state_mes = if state then "enabled" else "disabled"
msg.send "Relay is #{state_mes}"
if process.env.RELAY_ENABLE_RECEIVE
robot.router.post "/hubot/relay/:room", (req, res) ->
room = req.params.room
msg = req.body.msg
robot.messageRoom room, msg
res.send 'OK'
| true | # Description:
# Relay message to another chatbox via http
#
# Dependencies:
# "coffee-script": "~1.6"
#
# Configuration:
# RELAY_EVERYTHING - Relay message that didn't call bot name
# RELAY_URL - URL relay to
# RELAY_RESPONSE - Bot will respond even when relay successfully
# RELAY_ENABLE_COMMAND - Support command
# RELAY_ENABLE_RECEIVE - Enable receive relay message
#
# Commands:
# Hubot relay add <url>
# Hubot relay delete <url>
# Hubot relay delete all
# Hubot relay list <url>
# Hubot relay <start|enable>
# Hubot relay <stop|disable>
# Hubot relay state
#
# Author:
# PI:NAME:<NAME>END_PI <PI:EMAIL:<EMAIL>END_PI>
module.exports = (robot) ->
robot.catchAll (msg) ->
# Message class doesn't have text property so we need to check it before relay
return if !msg.message.text
r = new RegExp "^(?:#{robot.alias}|#{robot.name}) ([^]+)", "i"
matches = msg.message.text.match(r)
if matches != null && matches.length > 1
message = matches[1]
else
return if !process.env.RELAY_EVERYTHING
message = msg.message.text
message = if robot.adapter.removeFormatting then robot.adapter.removeFormatting(message) else message
if process.env.RELAY_ENABLE_COMMAND
return if !robot.brain.get(msg.message.user.name + "_relay_enable")
urls = robot.brain.get(msg.message.user.name + "_relay_url") ||
(if process.env.RELAY_URL then process.env.RELAY_URL.split("|") else null)
msg.send "Relay Error! Use '#{robot.name} relay add <relay_url>' to add relay url" if !urls
else
return if !process.env.RELAY_URL
urls = process.env.RELAY_URL.split "|"
urls.forEach (url) ->
data = JSON.stringify({msg: message})
robot.http(url)
.header('Content-Type', 'application/json')
.post(data) (err, res, body) ->
if err
msg.send "Relay failed :(\n #{err}"
else if process.env.RELAY_RESPONSE
msg.send "Relay completed '#{message}'"
if process.env.RELAY_ENABLE_COMMAND
robot.respond /relay add (.+)/, (msg) ->
url = msg.match[1]
brain_key = msg.message.user.name + "_relay_url"
list = robot.brain.get brain_key
list = [] if !list
list.push url
robot.brain.set brain_key, list
robot.brain.save
msg.send "Added '#{url}' to relay list"
robot.respond /relay delete (.+)/, (msg) ->
return if !process.env.RELAY_ENABLE_COMMAND
url = msg.match[1]
return if url == "all"
brain_key = msg.message.user.name + "_relay_url"
list = robot.brain.get brain_key
if list
index = list.indexOf(url)
list.splice(index, 1) if index >= 0
robot.brain.set brain_key, list
robot.brain.save
msg.send "Deleted '#{url}' from relay list"
robot.respond /relay list/, (msg) ->
return if !process.env.RELAY_ENABLE_COMMAND
urls = robot.brain.get(msg.message.user.name + "_relay_url") || []
msg.send "Relay list:\n" + urls.join("\n")
robot.respond /relay delete all/, (msg) ->
return if !process.env.RELAY_ENABLE_COMMAND
robot.brain.set (msg.message.user.name + "_relay_url"), []
robot.brain.save
msg.send "Deleted all urls from relay list"
robot.respond /relay (start|enable)/, (msg) ->
return if !process.env.RELAY_ENABLE_COMMAND
robot.brain.set (msg.message.user.name + "_relay_enable"), true
robot.brain.save
msg.send "Relay is enabled"
robot.respond /relay (stop|disable)/, (msg) ->
return if !process.env.RELAY_ENABLE_COMMAND
robot.brain.set (msg.message.user.name + "_relay_enable"), false
robot.brain.save
msg.send "Relay is disabled"
robot.respond /relay state/, (msg) ->
return if !process.env.RELAY_ENABLE_COMMAND
state = robot.brain.get (msg.message.user.name + "_relay_enable"), false
state_mes = if state then "enabled" else "disabled"
msg.send "Relay is #{state_mes}"
if process.env.RELAY_ENABLE_RECEIVE
robot.router.post "/hubot/relay/:room", (req, res) ->
room = req.params.room
msg = req.body.msg
robot.messageRoom room, msg
res.send 'OK'
|
[
{
"context": ", value) ->\n d = new Date(value.time)\n key = \"#{d.getFullYear()}-#{d.getMonth() + 1}-#{d.getDate()}\"\n arr[key] = [] unless arr[key]\n arr[key].pu",
"end": 1109,
"score": 0.7758246660232544,
"start": 1054,
"tag": "KEY",
"value": "\"#{d.getFullYear()}-#{d.getMonth() + 1}-#{d.getDate()}\""
}
] | src/iced/archivist.iced | stampery/trailbot-vault | 0 | app = document.app
vault = document.vault
archivist = ->
@after 'initialize', ->
vault.on 'synced', @globalArchive
@globalArchive = =>
window.mkdir "archive"
app.settings.watchers.forEach @watcherArchive
@watcherArchive = (watcher) =>
for path, file of watcher.settings.files
@fileArchive path, file, watcher.events
@fileArchive = (path, file, events) =>
if events[path]
events[path].sort @sortBy
limit = @getLimit file.archive || 30
# index of the first event older than the limit
indexOlder = undefined
for i, ev of events[path]
if ev.ref < limit
indexOlder = i
break
if indexOlder
archivable = events[path].slice indexOlder
events[path] = events[path].slice 0, indexOlder
app.save()
archivable = archivable.reduce @groupByDay, []
for date, lines of archivable
@writeToFile "#{@getBaseName path}-#{date}", lines.join "\n"
@groupByDay = (arr, value) ->
d = new Date(value.time)
key = "#{d.getFullYear()}-#{d.getMonth() + 1}-#{d.getDate()}"
arr[key] = [] unless arr[key]
arr[key].push JSON.stringify value
arr
@writeToFile = (prefix, txt) ->
window.fs.writeFile "archive/#{prefix}-archive", txt, (err) ->
if err
console.log "Error creating the archiving file #{prefix} #{err}"
else
console.log "Archive for date #{prefix} succesfully saved"
@sortBy = (a, b, field = "ref") ->
if a[field] < b[field]
return 1
if a[field] > b[field]
return -1
return 0
# current date minus the number of days , return epoch
@getLimit = (days) ->
now = new Date()
limit = new Date()
limit.setDate(now.getDate() - (days))
limit.setHours(23)
limit.setMinutes(59)
limit.setSeconds(59)
Date.parse limit
@getBaseName = (path) ->
path.split(/[\\/]/).reverse()[0].split(".")[0]
Archivist = flight.component archivist
Archivist.attachTo document
module.exports = Archivist
| 32630 | app = document.app
vault = document.vault
archivist = ->
@after 'initialize', ->
vault.on 'synced', @globalArchive
@globalArchive = =>
window.mkdir "archive"
app.settings.watchers.forEach @watcherArchive
@watcherArchive = (watcher) =>
for path, file of watcher.settings.files
@fileArchive path, file, watcher.events
@fileArchive = (path, file, events) =>
if events[path]
events[path].sort @sortBy
limit = @getLimit file.archive || 30
# index of the first event older than the limit
indexOlder = undefined
for i, ev of events[path]
if ev.ref < limit
indexOlder = i
break
if indexOlder
archivable = events[path].slice indexOlder
events[path] = events[path].slice 0, indexOlder
app.save()
archivable = archivable.reduce @groupByDay, []
for date, lines of archivable
@writeToFile "#{@getBaseName path}-#{date}", lines.join "\n"
@groupByDay = (arr, value) ->
d = new Date(value.time)
key = <KEY>
arr[key] = [] unless arr[key]
arr[key].push JSON.stringify value
arr
@writeToFile = (prefix, txt) ->
window.fs.writeFile "archive/#{prefix}-archive", txt, (err) ->
if err
console.log "Error creating the archiving file #{prefix} #{err}"
else
console.log "Archive for date #{prefix} succesfully saved"
@sortBy = (a, b, field = "ref") ->
if a[field] < b[field]
return 1
if a[field] > b[field]
return -1
return 0
# current date minus the number of days , return epoch
@getLimit = (days) ->
now = new Date()
limit = new Date()
limit.setDate(now.getDate() - (days))
limit.setHours(23)
limit.setMinutes(59)
limit.setSeconds(59)
Date.parse limit
@getBaseName = (path) ->
path.split(/[\\/]/).reverse()[0].split(".")[0]
Archivist = flight.component archivist
Archivist.attachTo document
module.exports = Archivist
| true | app = document.app
vault = document.vault
archivist = ->
@after 'initialize', ->
vault.on 'synced', @globalArchive
@globalArchive = =>
window.mkdir "archive"
app.settings.watchers.forEach @watcherArchive
@watcherArchive = (watcher) =>
for path, file of watcher.settings.files
@fileArchive path, file, watcher.events
@fileArchive = (path, file, events) =>
if events[path]
events[path].sort @sortBy
limit = @getLimit file.archive || 30
# index of the first event older than the limit
indexOlder = undefined
for i, ev of events[path]
if ev.ref < limit
indexOlder = i
break
if indexOlder
archivable = events[path].slice indexOlder
events[path] = events[path].slice 0, indexOlder
app.save()
archivable = archivable.reduce @groupByDay, []
for date, lines of archivable
@writeToFile "#{@getBaseName path}-#{date}", lines.join "\n"
@groupByDay = (arr, value) ->
d = new Date(value.time)
key = PI:KEY:<KEY>END_PI
arr[key] = [] unless arr[key]
arr[key].push JSON.stringify value
arr
@writeToFile = (prefix, txt) ->
window.fs.writeFile "archive/#{prefix}-archive", txt, (err) ->
if err
console.log "Error creating the archiving file #{prefix} #{err}"
else
console.log "Archive for date #{prefix} succesfully saved"
@sortBy = (a, b, field = "ref") ->
if a[field] < b[field]
return 1
if a[field] > b[field]
return -1
return 0
# current date minus the number of days , return epoch
@getLimit = (days) ->
now = new Date()
limit = new Date()
limit.setDate(now.getDate() - (days))
limit.setHours(23)
limit.setMinutes(59)
limit.setSeconds(59)
Date.parse limit
@getBaseName = (path) ->
path.split(/[\\/]/).reverse()[0].split(".")[0]
Archivist = flight.component archivist
Archivist.attachTo document
module.exports = Archivist
|
[
{
"context": ".then (element) =>\n return element.sendKeys('admin@example.com')\n .then =>\n return @driver.findElement(@",
"end": 489,
"score": 0.9998733401298523,
"start": 472,
"tag": "EMAIL",
"value": "admin@example.com"
},
{
"context": ".then (element) =>\n return element.sendKeys('admin')\n .then =>\n return @driver.findElement(@",
"end": 831,
"score": 0.9307329654693604,
"start": 826,
"tag": "USERNAME",
"value": "admin"
}
] | features/step_definitions/authentication_steps.coffee | grappendorf/caretaker-webapp | 0 | module.exports = ->
@World = require('webapp-tester').World
@When /^I am authenticated as adminiatrator$/, (next) ->
@driver.visit('#').then =>
return @driver.findElement(@webdriver.By.xpath("//label[normalize-space()='Email']"))
.then (element) =>
return element.getAttribute('id')
.then (id) =>
return @driver.findElement(@webdriver.By.xpath("//input[@aria-labelledby='#{id}']"))
.then (element) =>
return element.sendKeys('admin@example.com')
.then =>
return @driver.findElement(@webdriver.By.xpath("//label[normalize-space()='Password']"))
.then (element) =>
return element.getAttribute('id')
.then (id) =>
return @driver.findElement(@webdriver.By.xpath("//input[@aria-labelledby='#{id}']"))
.then (element) =>
return element.sendKeys('admin')
.then =>
return @driver.findElement(@webdriver.By.xpath("//*[normalize-space()='Sign in']"))
.then (element) =>
return element.click()
.then =>
next()
, (x) =>
next.fail x
| 127250 | module.exports = ->
@World = require('webapp-tester').World
@When /^I am authenticated as adminiatrator$/, (next) ->
@driver.visit('#').then =>
return @driver.findElement(@webdriver.By.xpath("//label[normalize-space()='Email']"))
.then (element) =>
return element.getAttribute('id')
.then (id) =>
return @driver.findElement(@webdriver.By.xpath("//input[@aria-labelledby='#{id}']"))
.then (element) =>
return element.sendKeys('<EMAIL>')
.then =>
return @driver.findElement(@webdriver.By.xpath("//label[normalize-space()='Password']"))
.then (element) =>
return element.getAttribute('id')
.then (id) =>
return @driver.findElement(@webdriver.By.xpath("//input[@aria-labelledby='#{id}']"))
.then (element) =>
return element.sendKeys('admin')
.then =>
return @driver.findElement(@webdriver.By.xpath("//*[normalize-space()='Sign in']"))
.then (element) =>
return element.click()
.then =>
next()
, (x) =>
next.fail x
| true | module.exports = ->
@World = require('webapp-tester').World
@When /^I am authenticated as adminiatrator$/, (next) ->
@driver.visit('#').then =>
return @driver.findElement(@webdriver.By.xpath("//label[normalize-space()='Email']"))
.then (element) =>
return element.getAttribute('id')
.then (id) =>
return @driver.findElement(@webdriver.By.xpath("//input[@aria-labelledby='#{id}']"))
.then (element) =>
return element.sendKeys('PI:EMAIL:<EMAIL>END_PI')
.then =>
return @driver.findElement(@webdriver.By.xpath("//label[normalize-space()='Password']"))
.then (element) =>
return element.getAttribute('id')
.then (id) =>
return @driver.findElement(@webdriver.By.xpath("//input[@aria-labelledby='#{id}']"))
.then (element) =>
return element.sendKeys('admin')
.then =>
return @driver.findElement(@webdriver.By.xpath("//*[normalize-space()='Sign in']"))
.then (element) =>
return element.click()
.then =>
next()
, (x) =>
next.fail x
|
[
{
"context": "\n - on enter should validation fire by default??? Sinan - 6/6/2012\n\n###\n\n\nKDInputView = require './inpu",
"end": 64,
"score": 0.6342931389808655,
"start": 61,
"tag": "NAME",
"value": "Sin"
}
] | src/components/inputs/hitenterinputview.coffee | burakcan/kd | 0 | ###
todo:
- on enter should validation fire by default??? Sinan - 6/6/2012
###
KDInputView = require './inputview.coffee'
module.exports = class KDHitEnterInputView extends KDInputView
constructor:(options = {}, data)->
options.type or= "textarea"
options.button or= null
options.showButton ?= no
options.label or= null
options.placeholder or= ""
options.callback or= null
options.togglerPartials or= ["quick update disabled","quick update enabled"]
super options,data
@setClass "hitenterview"
@button = @getOptions().button ? null
@enableEnterKey()
@setToggler() if options.label?
@disableEnterKey() if @getOptions().showButton
@on "ValidationPassed", =>
@blur()
@getOptions().callback?.call @,@getValue()
enableEnterKey:->
@setClass "active"
@hideButton() if @button
@inputEnterToggler.$().html(@getOptions().togglerPartials[1]) if @inputEnterToggler?
@enterKeyEnabled = yes
disableEnterKey:->
@unsetClass "active"
@showButton() if @button
@inputEnterToggler.$().html(@getOptions().togglerPartials[0]) if @inputEnterToggler?
@enterKeyEnabled = no
setToggler:->
o = @getOptions()
@inputEnterToggler = new KDCustomHTMLView
tagName : "a"
cssClass : "hitenterview-toggle"
partial : if o.showButton then o.togglerPartials[0] else o.togglerPartials[1]
click : @bound "toggleEnterKey"
@inputLabel.addSubView @inputEnterToggler
hideButton:-> @button.hide()
showButton:-> @button.show()
toggleEnterKey:->
if @enterKeyEnabled then @disableEnterKey() else @enableEnterKey()
keyDown:(event)->
if event.which is 13 and (event.altKey or event.shiftKey) isnt true and @enterKeyEnabled
@emit "EnterPerformed"
@validate()
no
else if event.which is 27 # escape
@emit "EscapePerformed" | 59507 | ###
todo:
- on enter should validation fire by default??? <NAME>an - 6/6/2012
###
KDInputView = require './inputview.coffee'
module.exports = class KDHitEnterInputView extends KDInputView
constructor:(options = {}, data)->
options.type or= "textarea"
options.button or= null
options.showButton ?= no
options.label or= null
options.placeholder or= ""
options.callback or= null
options.togglerPartials or= ["quick update disabled","quick update enabled"]
super options,data
@setClass "hitenterview"
@button = @getOptions().button ? null
@enableEnterKey()
@setToggler() if options.label?
@disableEnterKey() if @getOptions().showButton
@on "ValidationPassed", =>
@blur()
@getOptions().callback?.call @,@getValue()
enableEnterKey:->
@setClass "active"
@hideButton() if @button
@inputEnterToggler.$().html(@getOptions().togglerPartials[1]) if @inputEnterToggler?
@enterKeyEnabled = yes
disableEnterKey:->
@unsetClass "active"
@showButton() if @button
@inputEnterToggler.$().html(@getOptions().togglerPartials[0]) if @inputEnterToggler?
@enterKeyEnabled = no
setToggler:->
o = @getOptions()
@inputEnterToggler = new KDCustomHTMLView
tagName : "a"
cssClass : "hitenterview-toggle"
partial : if o.showButton then o.togglerPartials[0] else o.togglerPartials[1]
click : @bound "toggleEnterKey"
@inputLabel.addSubView @inputEnterToggler
hideButton:-> @button.hide()
showButton:-> @button.show()
toggleEnterKey:->
if @enterKeyEnabled then @disableEnterKey() else @enableEnterKey()
keyDown:(event)->
if event.which is 13 and (event.altKey or event.shiftKey) isnt true and @enterKeyEnabled
@emit "EnterPerformed"
@validate()
no
else if event.which is 27 # escape
@emit "EscapePerformed" | true | ###
todo:
- on enter should validation fire by default??? PI:NAME:<NAME>END_PIan - 6/6/2012
###
KDInputView = require './inputview.coffee'
module.exports = class KDHitEnterInputView extends KDInputView
constructor:(options = {}, data)->
options.type or= "textarea"
options.button or= null
options.showButton ?= no
options.label or= null
options.placeholder or= ""
options.callback or= null
options.togglerPartials or= ["quick update disabled","quick update enabled"]
super options,data
@setClass "hitenterview"
@button = @getOptions().button ? null
@enableEnterKey()
@setToggler() if options.label?
@disableEnterKey() if @getOptions().showButton
@on "ValidationPassed", =>
@blur()
@getOptions().callback?.call @,@getValue()
enableEnterKey:->
@setClass "active"
@hideButton() if @button
@inputEnterToggler.$().html(@getOptions().togglerPartials[1]) if @inputEnterToggler?
@enterKeyEnabled = yes
disableEnterKey:->
@unsetClass "active"
@showButton() if @button
@inputEnterToggler.$().html(@getOptions().togglerPartials[0]) if @inputEnterToggler?
@enterKeyEnabled = no
setToggler:->
o = @getOptions()
@inputEnterToggler = new KDCustomHTMLView
tagName : "a"
cssClass : "hitenterview-toggle"
partial : if o.showButton then o.togglerPartials[0] else o.togglerPartials[1]
click : @bound "toggleEnterKey"
@inputLabel.addSubView @inputEnterToggler
hideButton:-> @button.hide()
showButton:-> @button.show()
toggleEnterKey:->
if @enterKeyEnabled then @disableEnterKey() else @enableEnterKey()
keyDown:(event)->
if event.which is 13 and (event.altKey or event.shiftKey) isnt true and @enterKeyEnabled
@emit "EnterPerformed"
@validate()
no
else if event.which is 27 # escape
@emit "EscapePerformed" |
[
{
"context": "# Author: Thinh Pham\n# Email: nhim175@gmail.com\n\nScorpion = require '.",
"end": 20,
"score": 0.999853253364563,
"start": 10,
"tag": "NAME",
"value": "Thinh Pham"
},
{
"context": "# Author: Thinh Pham\n# Email: nhim175@gmail.com\n\nScorpion = require './scorpion.coffee'\n\nclass Bo",
"end": 47,
"score": 0.9999228715896606,
"start": 30,
"tag": "EMAIL",
"value": "nhim175@gmail.com"
}
] | src/lib/boss.coffee | nhim175/scorpionsmasher | 0 | # Author: Thinh Pham
# Email: nhim175@gmail.com
Scorpion = require './scorpion.coffee'
class Boss extends Scorpion
runFrames: Phaser.Animation.generateFrameNames('b', 1, 5, '.png', 0)
dieFrames: ['b6.png']
speed: 5
bonus: 5
health: 10
module.exports = Boss | 68158 | # Author: <NAME>
# Email: <EMAIL>
Scorpion = require './scorpion.coffee'
class Boss extends Scorpion
runFrames: Phaser.Animation.generateFrameNames('b', 1, 5, '.png', 0)
dieFrames: ['b6.png']
speed: 5
bonus: 5
health: 10
module.exports = Boss | true | # Author: PI:NAME:<NAME>END_PI
# Email: PI:EMAIL:<EMAIL>END_PI
Scorpion = require './scorpion.coffee'
class Boss extends Scorpion
runFrames: Phaser.Animation.generateFrameNames('b', 1, 5, '.png', 0)
dieFrames: ['b6.png']
speed: 5
bonus: 5
health: 10
module.exports = Boss |
[
{
"context": "###\nCopyright (c) 2013, Alexander Cherniuk <ts33kr@gmail.com>\nAll rights reserved.\n\nRedistri",
"end": 42,
"score": 0.9998464584350586,
"start": 24,
"tag": "NAME",
"value": "Alexander Cherniuk"
},
{
"context": "###\nCopyright (c) 2013, Alexander Cherniuk <ts33kr@gmail.com>\nAll rights reserved.\n\nRedistribution and use in ",
"end": 60,
"score": 0.9999295473098755,
"start": 44,
"tag": "EMAIL",
"value": "ts33kr@gmail.com"
}
] | library/gearbox/navigate.coffee | ts33kr/granite | 6 | ###
Copyright (c) 2013, Alexander Cherniuk <ts33kr@gmail.com>
All rights reserved.
Redistribution and use in source and binary forms, with or without
modification, are permitted provided that the following conditions are met:
1. Redistributions of source code must retain the above copyright notice, this
list of conditions and the following disclaimer.
2. Redistributions in binary form must reproduce the above copyright notice,
this list of conditions and the following disclaimer in the documentation
and/or other materials provided with the distribution.
THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" AND
ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED
WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE
DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR CONTRIBUTORS BE LIABLE FOR
ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES
(INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES;
LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND
ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT
(INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS
SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE.
###
_ = require "lodash"
assert = require "assert"
asciify = require "asciify"
connect = require "connect"
request = require "request"
logger = require "winston"
colors = require "colors"
async = require "async"
nconf = require "nconf"
https = require "https"
http = require "http"
util = require "util"
{external} = require "../membrane/remote"
{Barebones} = require "../membrane/skeleton"
{Preflight} = require "../membrane/preflight"
# This abstract compound provides the hash navigation functionality.
# It is basically and advanced hash router to be deployed to client
# site. It is well fitted within the framework architecture and is
# the fusion of the server and client site environments, exposing a
# convenient server API that that defined the client routing logic.
module.exports.Navigate = class Navigate extends Preflight
# This is a marker that indicates to some internal subsystems
# that this class has to be considered abstract and therefore
# can not be treated as a complete class implementation. This
# mainly is used to exclude or account for abstract classes.
# Once inherited from, the inheritee is not abstract anymore.
@abstract yes
# This block here defines a set of Bower dependencies that are
# required by the client site part of the code that constitutes
# this service or compound. Dependencies can be restricted to a
# certain version and also they can have customized entrypoint.
# Refer to `BowerSupport` class implementation for information.
@bower "crossroads.js", "dist/crossroads.min.js"
@bower "hasher#1.1.4", "dist/js/hasher.min.js"
# Mount the supplied implementation as the hash location route
# hanlder. The implementation is assumed to be the client site
# coded and therefore is automatically externalized by use of
# `external` tool and the gets transferred to a client by the
# usual mechanisms defined in the `Screenplay` implementation.
@mount: (xendpoint, xoptions, ximplement) ->
endpoint = _.find(arguments, _.isString) or 0
implement = _.find(arguments, _.isFunction) or 0
options = _.find(arguments, _.isPlainObject) or {}
m = "Mounting client site navigation path %s to %s"
assert identify = try @identify().underline or null
assert _.isString(endpoint), "got invalid endpoint"
assert _.isFunction(implement), "no implementation"
assert not implement.remote?, "is already external"
assert /[\w\/-_]+/.test(endpoint), "dirty endpoint"
assert _.isFunction externed = external implement
assert _.isObject externed.remote.meta ?= Object()
assert ptr = endpoint: endpoint, options: options
assert _.isString uid = _.uniqueId "__hash_nav_mnt_"
assert _.isFunction this.prototype[uid] = externed
logger.silly m.grey, endpoint.underline, identify
_.extend externed.remote.meta, ptr; externed
# This is an external autocall routine that when invoked on the
# client site - it creates, initializes, and sets up the hashing
# navigation solution. This is a subsystem that features fully
# fledged router for the hash (#) style navigation within single
# page-ish environment. Should be used in the top level service!
navigation: @autocall z: +103, ->
router = "no crossroads router is detected"
attaching = "no hasher library has been found"
assert m = "Install hashing navigation at %s"
assert _.isObject(hasher or null), attaching
assert _.isObject(crossroads or null), router
e = "Mounting frontend endpoint %s to %s method"
assert crossroads.ignoreState = yes # multiparse
logger.info m.magenta, @service.magenta.underline
parser = (landed, old) -> crossroads.parse landed
begin = _.find @, (x) -> x?.meta?.options?.default
hasher.setHash begin.meta.endpoint if begin?.meta
assert _.isObject hasher.initialized.add parser
assert _.isObject hasher.changed.add parser
setupAndExecute = (fx) -> hasher.init(); fx
setupAndExecute _.forIn this, (value, name) ->
return unless _.isFunction value or null
return unless value?.meta?.endpoint or 0
assert endpoint = try value.meta.endpoint
assert method = try name.toString().bold
logger.debug e, endpoint.underline, method
crossroads.addRoute endpoint, value
| 203356 | ###
Copyright (c) 2013, <NAME> <<EMAIL>>
All rights reserved.
Redistribution and use in source and binary forms, with or without
modification, are permitted provided that the following conditions are met:
1. Redistributions of source code must retain the above copyright notice, this
list of conditions and the following disclaimer.
2. Redistributions in binary form must reproduce the above copyright notice,
this list of conditions and the following disclaimer in the documentation
and/or other materials provided with the distribution.
THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" AND
ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED
WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE
DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR CONTRIBUTORS BE LIABLE FOR
ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES
(INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES;
LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND
ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT
(INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS
SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE.
###
_ = require "lodash"
assert = require "assert"
asciify = require "asciify"
connect = require "connect"
request = require "request"
logger = require "winston"
colors = require "colors"
async = require "async"
nconf = require "nconf"
https = require "https"
http = require "http"
util = require "util"
{external} = require "../membrane/remote"
{Barebones} = require "../membrane/skeleton"
{Preflight} = require "../membrane/preflight"
# This abstract compound provides the hash navigation functionality.
# It is basically and advanced hash router to be deployed to client
# site. It is well fitted within the framework architecture and is
# the fusion of the server and client site environments, exposing a
# convenient server API that that defined the client routing logic.
module.exports.Navigate = class Navigate extends Preflight
# This is a marker that indicates to some internal subsystems
# that this class has to be considered abstract and therefore
# can not be treated as a complete class implementation. This
# mainly is used to exclude or account for abstract classes.
# Once inherited from, the inheritee is not abstract anymore.
@abstract yes
# This block here defines a set of Bower dependencies that are
# required by the client site part of the code that constitutes
# this service or compound. Dependencies can be restricted to a
# certain version and also they can have customized entrypoint.
# Refer to `BowerSupport` class implementation for information.
@bower "crossroads.js", "dist/crossroads.min.js"
@bower "hasher#1.1.4", "dist/js/hasher.min.js"
# Mount the supplied implementation as the hash location route
# hanlder. The implementation is assumed to be the client site
# coded and therefore is automatically externalized by use of
# `external` tool and the gets transferred to a client by the
# usual mechanisms defined in the `Screenplay` implementation.
@mount: (xendpoint, xoptions, ximplement) ->
endpoint = _.find(arguments, _.isString) or 0
implement = _.find(arguments, _.isFunction) or 0
options = _.find(arguments, _.isPlainObject) or {}
m = "Mounting client site navigation path %s to %s"
assert identify = try @identify().underline or null
assert _.isString(endpoint), "got invalid endpoint"
assert _.isFunction(implement), "no implementation"
assert not implement.remote?, "is already external"
assert /[\w\/-_]+/.test(endpoint), "dirty endpoint"
assert _.isFunction externed = external implement
assert _.isObject externed.remote.meta ?= Object()
assert ptr = endpoint: endpoint, options: options
assert _.isString uid = _.uniqueId "__hash_nav_mnt_"
assert _.isFunction this.prototype[uid] = externed
logger.silly m.grey, endpoint.underline, identify
_.extend externed.remote.meta, ptr; externed
# This is an external autocall routine that when invoked on the
# client site - it creates, initializes, and sets up the hashing
# navigation solution. This is a subsystem that features fully
# fledged router for the hash (#) style navigation within single
# page-ish environment. Should be used in the top level service!
navigation: @autocall z: +103, ->
router = "no crossroads router is detected"
attaching = "no hasher library has been found"
assert m = "Install hashing navigation at %s"
assert _.isObject(hasher or null), attaching
assert _.isObject(crossroads or null), router
e = "Mounting frontend endpoint %s to %s method"
assert crossroads.ignoreState = yes # multiparse
logger.info m.magenta, @service.magenta.underline
parser = (landed, old) -> crossroads.parse landed
begin = _.find @, (x) -> x?.meta?.options?.default
hasher.setHash begin.meta.endpoint if begin?.meta
assert _.isObject hasher.initialized.add parser
assert _.isObject hasher.changed.add parser
setupAndExecute = (fx) -> hasher.init(); fx
setupAndExecute _.forIn this, (value, name) ->
return unless _.isFunction value or null
return unless value?.meta?.endpoint or 0
assert endpoint = try value.meta.endpoint
assert method = try name.toString().bold
logger.debug e, endpoint.underline, method
crossroads.addRoute endpoint, value
| true | ###
Copyright (c) 2013, PI:NAME:<NAME>END_PI <PI:EMAIL:<EMAIL>END_PI>
All rights reserved.
Redistribution and use in source and binary forms, with or without
modification, are permitted provided that the following conditions are met:
1. Redistributions of source code must retain the above copyright notice, this
list of conditions and the following disclaimer.
2. Redistributions in binary form must reproduce the above copyright notice,
this list of conditions and the following disclaimer in the documentation
and/or other materials provided with the distribution.
THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" AND
ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED
WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE
DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR CONTRIBUTORS BE LIABLE FOR
ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES
(INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES;
LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND
ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT
(INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS
SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE.
###
_ = require "lodash"
assert = require "assert"
asciify = require "asciify"
connect = require "connect"
request = require "request"
logger = require "winston"
colors = require "colors"
async = require "async"
nconf = require "nconf"
https = require "https"
http = require "http"
util = require "util"
{external} = require "../membrane/remote"
{Barebones} = require "../membrane/skeleton"
{Preflight} = require "../membrane/preflight"
# This abstract compound provides the hash navigation functionality.
# It is basically and advanced hash router to be deployed to client
# site. It is well fitted within the framework architecture and is
# the fusion of the server and client site environments, exposing a
# convenient server API that that defined the client routing logic.
module.exports.Navigate = class Navigate extends Preflight
# This is a marker that indicates to some internal subsystems
# that this class has to be considered abstract and therefore
# can not be treated as a complete class implementation. This
# mainly is used to exclude or account for abstract classes.
# Once inherited from, the inheritee is not abstract anymore.
@abstract yes
# This block here defines a set of Bower dependencies that are
# required by the client site part of the code that constitutes
# this service or compound. Dependencies can be restricted to a
# certain version and also they can have customized entrypoint.
# Refer to `BowerSupport` class implementation for information.
@bower "crossroads.js", "dist/crossroads.min.js"
@bower "hasher#1.1.4", "dist/js/hasher.min.js"
# Mount the supplied implementation as the hash location route
# hanlder. The implementation is assumed to be the client site
# coded and therefore is automatically externalized by use of
# `external` tool and the gets transferred to a client by the
# usual mechanisms defined in the `Screenplay` implementation.
@mount: (xendpoint, xoptions, ximplement) ->
endpoint = _.find(arguments, _.isString) or 0
implement = _.find(arguments, _.isFunction) or 0
options = _.find(arguments, _.isPlainObject) or {}
m = "Mounting client site navigation path %s to %s"
assert identify = try @identify().underline or null
assert _.isString(endpoint), "got invalid endpoint"
assert _.isFunction(implement), "no implementation"
assert not implement.remote?, "is already external"
assert /[\w\/-_]+/.test(endpoint), "dirty endpoint"
assert _.isFunction externed = external implement
assert _.isObject externed.remote.meta ?= Object()
assert ptr = endpoint: endpoint, options: options
assert _.isString uid = _.uniqueId "__hash_nav_mnt_"
assert _.isFunction this.prototype[uid] = externed
logger.silly m.grey, endpoint.underline, identify
_.extend externed.remote.meta, ptr; externed
# This is an external autocall routine that when invoked on the
# client site - it creates, initializes, and sets up the hashing
# navigation solution. This is a subsystem that features fully
# fledged router for the hash (#) style navigation within single
# page-ish environment. Should be used in the top level service!
navigation: @autocall z: +103, ->
router = "no crossroads router is detected"
attaching = "no hasher library has been found"
assert m = "Install hashing navigation at %s"
assert _.isObject(hasher or null), attaching
assert _.isObject(crossroads or null), router
e = "Mounting frontend endpoint %s to %s method"
assert crossroads.ignoreState = yes # multiparse
logger.info m.magenta, @service.magenta.underline
parser = (landed, old) -> crossroads.parse landed
begin = _.find @, (x) -> x?.meta?.options?.default
hasher.setHash begin.meta.endpoint if begin?.meta
assert _.isObject hasher.initialized.add parser
assert _.isObject hasher.changed.add parser
setupAndExecute = (fx) -> hasher.init(); fx
setupAndExecute _.forIn this, (value, name) ->
return unless _.isFunction value or null
return unless value?.meta?.endpoint or 0
assert endpoint = try value.meta.endpoint
assert method = try name.toString().bold
logger.debug e, endpoint.underline, method
crossroads.addRoute endpoint, value
|
[
{
"context": "nt_in_cents: 999\n\t\taccount:\n\t\t\taccount_code: \"user-123\"\n\t\t\t\ndescribe \"SubscriptionHandler\", ->\n\n\tbeforeE",
"end": 471,
"score": 0.8762991428375244,
"start": 468,
"tag": "KEY",
"value": "123"
},
{
"context": "ecurlySubscriptions[\"subscription-123-active\"]\n\t\t@User = {}\n\t\t@user =\n\t\t\t_id: @user_id = \"user_id_here_\"",
"end": 830,
"score": 0.5335913896560669,
"start": 826,
"tag": "USERNAME",
"value": "User"
},
{
"context": "iptions[\"subscription-123-active\"]\n\t\t@User = {}\n\t\t@user =\n\t\t\t_id: @user_id = \"user_id_here_\"\n\t\t@subscript",
"end": 843,
"score": 0.5113010406494141,
"start": 838,
"tag": "USERNAME",
"value": "@user"
},
{
"context": "{}\n\t\t@user =\n\t\t\t_id: @user_id = \"user_id_here_\"\n\t\t@subscription = \n\t\t\trecurlySubscription_id: @activeRecurlySubsc",
"end": 896,
"score": 0.6678273677825928,
"start": 883,
"tag": "USERNAME",
"value": "@subscription"
},
{
"context": "ubscription_id: @activeRecurlySubscription.uuid\n\t\t@RecurlyWrapper = \n\t\t\tgetSubscription: sinon.stub().callsArgWith(",
"end": 976,
"score": 0.834668755531311,
"start": 961,
"tag": "USERNAME",
"value": "@RecurlyWrapper"
},
{
"context": "h(3, null, @activeRecurlySubscription)\n\n\t\t@DropboxHandler =\n\t\t\tunlinkAccount:sinon.stub().callsArgWith(1)\n\n",
"end": 1406,
"score": 0.5458938479423523,
"start": 1399,
"tag": "USERNAME",
"value": "Handler"
},
{
"context": "\t\t\tunlinkAccount:sinon.stub().callsArgWith(1)\n\n\t\t@SubscriptionUpdater = \n\t\t\tsyncSubscription: sinon.stub().callsArgWith",
"end": 1478,
"score": 0.8152714967727661,
"start": 1459,
"tag": "USERNAME",
"value": "SubscriptionUpdater"
},
{
"context": "tFreeTrial: sinon.stub().callsArgWith(1)\n\n\t\t@LimitationsManager =\n\t\t\tuserHasV2Subscription: sinon.stub()\n\n",
"end": 1595,
"score": 0.5305210947990417,
"start": 1589,
"tag": "USERNAME",
"value": "ations"
},
{
"context": "relatex\": @Settings\n\t\t\t'../../models/User': User:@User\n\t\t\t'./SubscriptionUpdater': @SubscriptionUpdater\n",
"end": 1925,
"score": 0.5039998292922974,
"start": 1921,
"tag": "USERNAME",
"value": "User"
},
{
"context": ":\"123\"\n\t\t\t\tnumber:\"12345\"\n\t\t\t@recurly_token_id = \"45555666\"\n\t\t\t@SubscriptionHandler.validateNoSubscri",
"end": 2504,
"score": 0.5286152362823486,
"start": 2503,
"tag": "KEY",
"value": "4"
},
{
"context": "\"123\"\n\t\t\t\tnumber:\"12345\"\n\t\t\t@recurly_token_id = \"45555666\"\n\t\t\t@SubscriptionHandler.validateNoSubscriptionIn",
"end": 2511,
"score": 0.7166553139686584,
"start": 2504,
"tag": "PASSWORD",
"value": "5555666"
},
{
"context": "ach ->\n\t\t\t\t@SubscriptionHandler.createSubscription(@user, @subscriptionDetails, @recurly_token_id, @callba",
"end": 2700,
"score": 0.9101478457450867,
"start": 2695,
"tag": "USERNAME",
"value": "@user"
},
{
"context": "\t\t\t@RecurlyWrapper.createSubscription.calledWith(@user, @subscriptionDetails, @recurly_token_id).should.",
"end": 2870,
"score": 0.8479141592979431,
"start": 2866,
"tag": "USERNAME",
"value": "user"
},
{
"context": "lse)\n\t\t\t\t@SubscriptionHandler.createSubscription(@user, @subscriptionDetails, @recurly_token_id, @callba",
"end": 3459,
"score": 0.8182054758071899,
"start": 3455,
"tag": "USERNAME",
"value": "user"
},
{
"context": "tion)\n\t\t\t\t\t@SubscriptionHandler.updateSubscription(@user, @plan_code, null, done)\n\n\t\t\t\tit \"should update t",
"end": 3956,
"score": 0.966968297958374,
"start": 3951,
"tag": "USERNAME",
"value": "@user"
},
{
"context": "false)\n\t\t\t\t@SubscriptionHandler.updateSubscription(@user, @plan_code, null, done)\n\n\t\t\tit \"should redirect ",
"end": 4925,
"score": 0.9846317768096924,
"start": 4920,
"tag": "USERNAME",
"value": "@user"
},
{
"context": "ption)\n\t\t\t\t@SubscriptionHandler.updateSubscription(@user, @plan_code, @coupon_code, done)\n\n\t\t\tit \"should g",
"end": 5409,
"score": 0.9819983243942261,
"start": 5404,
"tag": "USERNAME",
"value": "@user"
}
] | test/unit/coffee/Subscription/SubscriptionHandlerTests.coffee | davidmehren/web-sharelatex | 1 | SandboxedModule = require('sandboxed-module')
should = require('chai').should()
sinon = require 'sinon'
querystring = require 'querystring'
modulePath = "../../../../app/js/Features/Subscription/SubscriptionHandler"
mockRecurlySubscriptions =
"subscription-123-active":
uuid: "subscription-123-active"
plan:
name: "Gold"
plan_code: "gold"
current_period_ends_at: new Date()
state: "active"
unit_amount_in_cents: 999
account:
account_code: "user-123"
describe "SubscriptionHandler", ->
beforeEach ->
@Settings =
plans : [{
planCode: "collaborator"
name: "Collaborator"
features:
collaborators: -1
versioning: true
}]
defaultPlanCode :
collaborators: 0
versioning: false
@activeRecurlySubscription = mockRecurlySubscriptions["subscription-123-active"]
@User = {}
@user =
_id: @user_id = "user_id_here_"
@subscription =
recurlySubscription_id: @activeRecurlySubscription.uuid
@RecurlyWrapper =
getSubscription: sinon.stub().callsArgWith(2, null, @activeRecurlySubscription)
updateSubscription: sinon.stub().callsArgWith(2, null, @activeRecurlySubscription)
cancelSubscription: sinon.stub().callsArgWith(1)
reactivateSubscription: sinon.stub().callsArgWith(1)
redeemCoupon:sinon.stub().callsArgWith(2)
createSubscription: sinon.stub().callsArgWith(3, null, @activeRecurlySubscription)
@DropboxHandler =
unlinkAccount:sinon.stub().callsArgWith(1)
@SubscriptionUpdater =
syncSubscription: sinon.stub().callsArgWith(2)
startFreeTrial: sinon.stub().callsArgWith(1)
@LimitationsManager =
userHasV2Subscription: sinon.stub()
@EmailHandler =
sendEmail:sinon.stub()
@AnalyticsManager =
recordEvent:sinon.stub()
@SubscriptionHandler = SandboxedModule.require modulePath, requires:
"./RecurlyWrapper": @RecurlyWrapper
"settings-sharelatex": @Settings
'../../models/User': User:@User
'./SubscriptionUpdater': @SubscriptionUpdater
"logger-sharelatex":{log:->}
'./LimitationsManager':@LimitationsManager
"../Email/EmailHandler":@EmailHandler
"../Dropbox/DropboxHandler":@DropboxHandler
"../../infrastructure/Events": @Events = {emit: sinon.stub()}
"../Analytics/AnalyticsManager": @AnalyticsManager
@SubscriptionHandler.syncSubscriptionToUser = sinon.stub().callsArgWith(2)
describe "createSubscription", ->
beforeEach ->
@callback = sinon.stub()
@subscriptionDetails =
cvv:"123"
number:"12345"
@recurly_token_id = "45555666"
@SubscriptionHandler.validateNoSubscriptionInRecurly = sinon.stub().yields(null, true)
describe "successfully", ->
beforeEach ->
@SubscriptionHandler.createSubscription(@user, @subscriptionDetails, @recurly_token_id, @callback)
it "should create the subscription with the wrapper", ->
@RecurlyWrapper.createSubscription.calledWith(@user, @subscriptionDetails, @recurly_token_id).should.equal true
it "should sync the subscription to the user", ->
@SubscriptionUpdater.syncSubscription.calledOnce.should.equal true
@SubscriptionUpdater.syncSubscription.args[0][0].should.deep.equal @activeRecurlySubscription
@SubscriptionUpdater.syncSubscription.args[0][1].should.deep.equal @user._id
describe "when there is already a subscription in Recurly", ->
beforeEach ->
@SubscriptionHandler.validateNoSubscriptionInRecurly = sinon.stub().yields(null, false)
@SubscriptionHandler.createSubscription(@user, @subscriptionDetails, @recurly_token_id, @callback)
it "should return an error", ->
@callback.calledWith(new Error("user already has subscription in recurly"))
describe "updateSubscription", ->
describe "with a user with a subscription", ->
describe "with a valid plan code", ->
beforeEach (done) ->
@plan_code = "collaborator"
@LimitationsManager.userHasV2Subscription.callsArgWith(1, null, true, @subscription)
@SubscriptionHandler.updateSubscription(@user, @plan_code, null, done)
it "should update the subscription", ->
@RecurlyWrapper.updateSubscription.calledWith(@subscription.recurlySubscription_id).should.equal true
updateOptions = @RecurlyWrapper.updateSubscription.args[0][1]
updateOptions.plan_code.should.equal @plan_code
it "should update immediately", ->
updateOptions = @RecurlyWrapper.updateSubscription.args[0][1]
updateOptions.timeframe.should.equal "now"
it "should sync the new subscription to the user", ->
@SubscriptionUpdater.syncSubscription.calledOnce.should.equal true
@SubscriptionUpdater.syncSubscription.args[0][0].should.deep.equal @activeRecurlySubscription
@SubscriptionUpdater.syncSubscription.args[0][1].should.deep.equal @user._id
describe "with a user without a subscription", ->
beforeEach (done) ->
@LimitationsManager.userHasV2Subscription.callsArgWith(1, null, false)
@SubscriptionHandler.updateSubscription(@user, @plan_code, null, done)
it "should redirect to the subscription dashboard", ->
@RecurlyWrapper.updateSubscription.called.should.equal false
@SubscriptionHandler.syncSubscriptionToUser.called.should.equal false
describe "with a coupon code", ->
beforeEach (done) ->
@plan_code = "collaborator"
@coupon_code = "1231312"
@LimitationsManager.userHasV2Subscription.callsArgWith(1, null, true, @subscription)
@SubscriptionHandler.updateSubscription(@user, @plan_code, @coupon_code, done)
it "should get the users account", ->
@RecurlyWrapper.getSubscription.calledWith(@activeRecurlySubscription.uuid).should.equal true
it "should redeme the coupon", (done)->
@RecurlyWrapper.redeemCoupon.calledWith(@activeRecurlySubscription.account.account_code, @coupon_code).should.equal true
done()
it "should update the subscription", ->
@RecurlyWrapper.updateSubscription.calledWith(@subscription.recurlySubscription_id).should.equal true
updateOptions = @RecurlyWrapper.updateSubscription.args[0][1]
updateOptions.plan_code.should.equal @plan_code
describe "cancelSubscription", ->
describe "with a user without a subscription", ->
beforeEach (done) ->
@LimitationsManager.userHasV2Subscription.callsArgWith(1, null, false, @subscription)
@SubscriptionHandler.cancelSubscription @user, done
it "should redirect to the subscription dashboard", ->
@RecurlyWrapper.cancelSubscription.called.should.equal false
describe "with a user with a subscription", ->
beforeEach (done) ->
@LimitationsManager.userHasV2Subscription.callsArgWith(1, null, true, @subscription)
@SubscriptionHandler.cancelSubscription @user, done
it "should cancel the subscription", ->
@RecurlyWrapper.cancelSubscription.called.should.equal true
@RecurlyWrapper.cancelSubscription.calledWith(@subscription.recurlySubscription_id).should.equal true
it "should trigger the cancel subscription event", ->
@Events.emit.calledWith("cancelSubscription", @user._id).should.equal true
describe "reactiveRecurlySubscription", ->
describe "with a user without a subscription", ->
beforeEach (done) ->
@LimitationsManager.userHasV2Subscription.callsArgWith(1, null, false, @subscription)
@SubscriptionHandler.reactivateSubscription @user, done
it "should redirect to the subscription dashboard", ->
@RecurlyWrapper.reactivateSubscription.called.should.equal false
describe "with a user with a subscription", ->
beforeEach (done) ->
@LimitationsManager.userHasV2Subscription.callsArgWith(1, null, true, @subscription)
@SubscriptionHandler.reactivateSubscription @user, done
it "should reactivate the subscription", ->
@RecurlyWrapper.reactivateSubscription.called.should.equal true
@RecurlyWrapper.reactivateSubscription.calledWith(@subscription.recurlySubscription_id).should.equal true
describe "recurlyCallback", ->
describe "with an actionable request", ->
beforeEach (done) ->
@user.id = @activeRecurlySubscription.account.account_code
@User.findById = (userId, callback) =>
userId.should.equal @user.id
callback null, @user
@SubscriptionHandler.recurlyCallback(@activeRecurlySubscription, done)
it "should request the affected subscription from the API", ->
@RecurlyWrapper.getSubscription.calledWith(@activeRecurlySubscription.uuid).should.equal true
it "should request the account details of the subscription", ->
options = @RecurlyWrapper.getSubscription.args[0][1]
options.includeAccount.should.equal true
it "should sync the subscription to the user", ->
@SubscriptionUpdater.syncSubscription.calledOnce.should.equal true
@SubscriptionUpdater.syncSubscription.args[0][0].should.deep.equal @activeRecurlySubscription
@SubscriptionUpdater.syncSubscription.args[0][1].should.deep.equal @user._id
describe "validateNoSubscriptionInRecurly", ->
beforeEach ->
@subscriptions = []
@RecurlyWrapper.listAccountActiveSubscriptions = sinon.stub().yields(null, @subscriptions)
@SubscriptionUpdater.syncSubscription = sinon.stub().yields()
@callback = sinon.stub()
describe "with no subscription in recurly", ->
beforeEach ->
@subscriptions.push @subscription = { "mock": "subscription" }
@SubscriptionHandler.validateNoSubscriptionInRecurly @user_id, @callback
it "should call RecurlyWrapper.listAccountActiveSubscriptions with the user id", ->
@RecurlyWrapper.listAccountActiveSubscriptions
.calledWith(@user_id)
.should.equal true
it "should sync the subscription", ->
@SubscriptionUpdater.syncSubscription
.calledWith(@subscription, @user_id)
.should.equal true
it "should call the callback with valid == false", ->
@callback.calledWith(null, false).should.equal true
describe "with a subscription in recurly", ->
beforeEach ->
@SubscriptionHandler.validateNoSubscriptionInRecurly @user_id, @callback
it "should not sync the subscription", ->
@SubscriptionUpdater.syncSubscription
.called
.should.equal false
it "should call the callback with valid == true", ->
@callback.calledWith(null, true).should.equal true
| 136753 | SandboxedModule = require('sandboxed-module')
should = require('chai').should()
sinon = require 'sinon'
querystring = require 'querystring'
modulePath = "../../../../app/js/Features/Subscription/SubscriptionHandler"
mockRecurlySubscriptions =
"subscription-123-active":
uuid: "subscription-123-active"
plan:
name: "Gold"
plan_code: "gold"
current_period_ends_at: new Date()
state: "active"
unit_amount_in_cents: 999
account:
account_code: "user-<KEY>"
describe "SubscriptionHandler", ->
beforeEach ->
@Settings =
plans : [{
planCode: "collaborator"
name: "Collaborator"
features:
collaborators: -1
versioning: true
}]
defaultPlanCode :
collaborators: 0
versioning: false
@activeRecurlySubscription = mockRecurlySubscriptions["subscription-123-active"]
@User = {}
@user =
_id: @user_id = "user_id_here_"
@subscription =
recurlySubscription_id: @activeRecurlySubscription.uuid
@RecurlyWrapper =
getSubscription: sinon.stub().callsArgWith(2, null, @activeRecurlySubscription)
updateSubscription: sinon.stub().callsArgWith(2, null, @activeRecurlySubscription)
cancelSubscription: sinon.stub().callsArgWith(1)
reactivateSubscription: sinon.stub().callsArgWith(1)
redeemCoupon:sinon.stub().callsArgWith(2)
createSubscription: sinon.stub().callsArgWith(3, null, @activeRecurlySubscription)
@DropboxHandler =
unlinkAccount:sinon.stub().callsArgWith(1)
@SubscriptionUpdater =
syncSubscription: sinon.stub().callsArgWith(2)
startFreeTrial: sinon.stub().callsArgWith(1)
@LimitationsManager =
userHasV2Subscription: sinon.stub()
@EmailHandler =
sendEmail:sinon.stub()
@AnalyticsManager =
recordEvent:sinon.stub()
@SubscriptionHandler = SandboxedModule.require modulePath, requires:
"./RecurlyWrapper": @RecurlyWrapper
"settings-sharelatex": @Settings
'../../models/User': User:@User
'./SubscriptionUpdater': @SubscriptionUpdater
"logger-sharelatex":{log:->}
'./LimitationsManager':@LimitationsManager
"../Email/EmailHandler":@EmailHandler
"../Dropbox/DropboxHandler":@DropboxHandler
"../../infrastructure/Events": @Events = {emit: sinon.stub()}
"../Analytics/AnalyticsManager": @AnalyticsManager
@SubscriptionHandler.syncSubscriptionToUser = sinon.stub().callsArgWith(2)
describe "createSubscription", ->
beforeEach ->
@callback = sinon.stub()
@subscriptionDetails =
cvv:"123"
number:"12345"
@recurly_token_id = "<KEY> <PASSWORD>"
@SubscriptionHandler.validateNoSubscriptionInRecurly = sinon.stub().yields(null, true)
describe "successfully", ->
beforeEach ->
@SubscriptionHandler.createSubscription(@user, @subscriptionDetails, @recurly_token_id, @callback)
it "should create the subscription with the wrapper", ->
@RecurlyWrapper.createSubscription.calledWith(@user, @subscriptionDetails, @recurly_token_id).should.equal true
it "should sync the subscription to the user", ->
@SubscriptionUpdater.syncSubscription.calledOnce.should.equal true
@SubscriptionUpdater.syncSubscription.args[0][0].should.deep.equal @activeRecurlySubscription
@SubscriptionUpdater.syncSubscription.args[0][1].should.deep.equal @user._id
describe "when there is already a subscription in Recurly", ->
beforeEach ->
@SubscriptionHandler.validateNoSubscriptionInRecurly = sinon.stub().yields(null, false)
@SubscriptionHandler.createSubscription(@user, @subscriptionDetails, @recurly_token_id, @callback)
it "should return an error", ->
@callback.calledWith(new Error("user already has subscription in recurly"))
describe "updateSubscription", ->
describe "with a user with a subscription", ->
describe "with a valid plan code", ->
beforeEach (done) ->
@plan_code = "collaborator"
@LimitationsManager.userHasV2Subscription.callsArgWith(1, null, true, @subscription)
@SubscriptionHandler.updateSubscription(@user, @plan_code, null, done)
it "should update the subscription", ->
@RecurlyWrapper.updateSubscription.calledWith(@subscription.recurlySubscription_id).should.equal true
updateOptions = @RecurlyWrapper.updateSubscription.args[0][1]
updateOptions.plan_code.should.equal @plan_code
it "should update immediately", ->
updateOptions = @RecurlyWrapper.updateSubscription.args[0][1]
updateOptions.timeframe.should.equal "now"
it "should sync the new subscription to the user", ->
@SubscriptionUpdater.syncSubscription.calledOnce.should.equal true
@SubscriptionUpdater.syncSubscription.args[0][0].should.deep.equal @activeRecurlySubscription
@SubscriptionUpdater.syncSubscription.args[0][1].should.deep.equal @user._id
describe "with a user without a subscription", ->
beforeEach (done) ->
@LimitationsManager.userHasV2Subscription.callsArgWith(1, null, false)
@SubscriptionHandler.updateSubscription(@user, @plan_code, null, done)
it "should redirect to the subscription dashboard", ->
@RecurlyWrapper.updateSubscription.called.should.equal false
@SubscriptionHandler.syncSubscriptionToUser.called.should.equal false
describe "with a coupon code", ->
beforeEach (done) ->
@plan_code = "collaborator"
@coupon_code = "1231312"
@LimitationsManager.userHasV2Subscription.callsArgWith(1, null, true, @subscription)
@SubscriptionHandler.updateSubscription(@user, @plan_code, @coupon_code, done)
it "should get the users account", ->
@RecurlyWrapper.getSubscription.calledWith(@activeRecurlySubscription.uuid).should.equal true
it "should redeme the coupon", (done)->
@RecurlyWrapper.redeemCoupon.calledWith(@activeRecurlySubscription.account.account_code, @coupon_code).should.equal true
done()
it "should update the subscription", ->
@RecurlyWrapper.updateSubscription.calledWith(@subscription.recurlySubscription_id).should.equal true
updateOptions = @RecurlyWrapper.updateSubscription.args[0][1]
updateOptions.plan_code.should.equal @plan_code
describe "cancelSubscription", ->
describe "with a user without a subscription", ->
beforeEach (done) ->
@LimitationsManager.userHasV2Subscription.callsArgWith(1, null, false, @subscription)
@SubscriptionHandler.cancelSubscription @user, done
it "should redirect to the subscription dashboard", ->
@RecurlyWrapper.cancelSubscription.called.should.equal false
describe "with a user with a subscription", ->
beforeEach (done) ->
@LimitationsManager.userHasV2Subscription.callsArgWith(1, null, true, @subscription)
@SubscriptionHandler.cancelSubscription @user, done
it "should cancel the subscription", ->
@RecurlyWrapper.cancelSubscription.called.should.equal true
@RecurlyWrapper.cancelSubscription.calledWith(@subscription.recurlySubscription_id).should.equal true
it "should trigger the cancel subscription event", ->
@Events.emit.calledWith("cancelSubscription", @user._id).should.equal true
describe "reactiveRecurlySubscription", ->
describe "with a user without a subscription", ->
beforeEach (done) ->
@LimitationsManager.userHasV2Subscription.callsArgWith(1, null, false, @subscription)
@SubscriptionHandler.reactivateSubscription @user, done
it "should redirect to the subscription dashboard", ->
@RecurlyWrapper.reactivateSubscription.called.should.equal false
describe "with a user with a subscription", ->
beforeEach (done) ->
@LimitationsManager.userHasV2Subscription.callsArgWith(1, null, true, @subscription)
@SubscriptionHandler.reactivateSubscription @user, done
it "should reactivate the subscription", ->
@RecurlyWrapper.reactivateSubscription.called.should.equal true
@RecurlyWrapper.reactivateSubscription.calledWith(@subscription.recurlySubscription_id).should.equal true
describe "recurlyCallback", ->
describe "with an actionable request", ->
beforeEach (done) ->
@user.id = @activeRecurlySubscription.account.account_code
@User.findById = (userId, callback) =>
userId.should.equal @user.id
callback null, @user
@SubscriptionHandler.recurlyCallback(@activeRecurlySubscription, done)
it "should request the affected subscription from the API", ->
@RecurlyWrapper.getSubscription.calledWith(@activeRecurlySubscription.uuid).should.equal true
it "should request the account details of the subscription", ->
options = @RecurlyWrapper.getSubscription.args[0][1]
options.includeAccount.should.equal true
it "should sync the subscription to the user", ->
@SubscriptionUpdater.syncSubscription.calledOnce.should.equal true
@SubscriptionUpdater.syncSubscription.args[0][0].should.deep.equal @activeRecurlySubscription
@SubscriptionUpdater.syncSubscription.args[0][1].should.deep.equal @user._id
describe "validateNoSubscriptionInRecurly", ->
beforeEach ->
@subscriptions = []
@RecurlyWrapper.listAccountActiveSubscriptions = sinon.stub().yields(null, @subscriptions)
@SubscriptionUpdater.syncSubscription = sinon.stub().yields()
@callback = sinon.stub()
describe "with no subscription in recurly", ->
beforeEach ->
@subscriptions.push @subscription = { "mock": "subscription" }
@SubscriptionHandler.validateNoSubscriptionInRecurly @user_id, @callback
it "should call RecurlyWrapper.listAccountActiveSubscriptions with the user id", ->
@RecurlyWrapper.listAccountActiveSubscriptions
.calledWith(@user_id)
.should.equal true
it "should sync the subscription", ->
@SubscriptionUpdater.syncSubscription
.calledWith(@subscription, @user_id)
.should.equal true
it "should call the callback with valid == false", ->
@callback.calledWith(null, false).should.equal true
describe "with a subscription in recurly", ->
beforeEach ->
@SubscriptionHandler.validateNoSubscriptionInRecurly @user_id, @callback
it "should not sync the subscription", ->
@SubscriptionUpdater.syncSubscription
.called
.should.equal false
it "should call the callback with valid == true", ->
@callback.calledWith(null, true).should.equal true
| true | SandboxedModule = require('sandboxed-module')
should = require('chai').should()
sinon = require 'sinon'
querystring = require 'querystring'
modulePath = "../../../../app/js/Features/Subscription/SubscriptionHandler"
mockRecurlySubscriptions =
"subscription-123-active":
uuid: "subscription-123-active"
plan:
name: "Gold"
plan_code: "gold"
current_period_ends_at: new Date()
state: "active"
unit_amount_in_cents: 999
account:
account_code: "user-PI:KEY:<KEY>END_PI"
describe "SubscriptionHandler", ->
beforeEach ->
@Settings =
plans : [{
planCode: "collaborator"
name: "Collaborator"
features:
collaborators: -1
versioning: true
}]
defaultPlanCode :
collaborators: 0
versioning: false
@activeRecurlySubscription = mockRecurlySubscriptions["subscription-123-active"]
@User = {}
@user =
_id: @user_id = "user_id_here_"
@subscription =
recurlySubscription_id: @activeRecurlySubscription.uuid
@RecurlyWrapper =
getSubscription: sinon.stub().callsArgWith(2, null, @activeRecurlySubscription)
updateSubscription: sinon.stub().callsArgWith(2, null, @activeRecurlySubscription)
cancelSubscription: sinon.stub().callsArgWith(1)
reactivateSubscription: sinon.stub().callsArgWith(1)
redeemCoupon:sinon.stub().callsArgWith(2)
createSubscription: sinon.stub().callsArgWith(3, null, @activeRecurlySubscription)
@DropboxHandler =
unlinkAccount:sinon.stub().callsArgWith(1)
@SubscriptionUpdater =
syncSubscription: sinon.stub().callsArgWith(2)
startFreeTrial: sinon.stub().callsArgWith(1)
@LimitationsManager =
userHasV2Subscription: sinon.stub()
@EmailHandler =
sendEmail:sinon.stub()
@AnalyticsManager =
recordEvent:sinon.stub()
@SubscriptionHandler = SandboxedModule.require modulePath, requires:
"./RecurlyWrapper": @RecurlyWrapper
"settings-sharelatex": @Settings
'../../models/User': User:@User
'./SubscriptionUpdater': @SubscriptionUpdater
"logger-sharelatex":{log:->}
'./LimitationsManager':@LimitationsManager
"../Email/EmailHandler":@EmailHandler
"../Dropbox/DropboxHandler":@DropboxHandler
"../../infrastructure/Events": @Events = {emit: sinon.stub()}
"../Analytics/AnalyticsManager": @AnalyticsManager
@SubscriptionHandler.syncSubscriptionToUser = sinon.stub().callsArgWith(2)
describe "createSubscription", ->
beforeEach ->
@callback = sinon.stub()
@subscriptionDetails =
cvv:"123"
number:"12345"
@recurly_token_id = "PI:KEY:<KEY>END_PI PI:PASSWORD:<PASSWORD>END_PI"
@SubscriptionHandler.validateNoSubscriptionInRecurly = sinon.stub().yields(null, true)
describe "successfully", ->
beforeEach ->
@SubscriptionHandler.createSubscription(@user, @subscriptionDetails, @recurly_token_id, @callback)
it "should create the subscription with the wrapper", ->
@RecurlyWrapper.createSubscription.calledWith(@user, @subscriptionDetails, @recurly_token_id).should.equal true
it "should sync the subscription to the user", ->
@SubscriptionUpdater.syncSubscription.calledOnce.should.equal true
@SubscriptionUpdater.syncSubscription.args[0][0].should.deep.equal @activeRecurlySubscription
@SubscriptionUpdater.syncSubscription.args[0][1].should.deep.equal @user._id
describe "when there is already a subscription in Recurly", ->
beforeEach ->
@SubscriptionHandler.validateNoSubscriptionInRecurly = sinon.stub().yields(null, false)
@SubscriptionHandler.createSubscription(@user, @subscriptionDetails, @recurly_token_id, @callback)
it "should return an error", ->
@callback.calledWith(new Error("user already has subscription in recurly"))
describe "updateSubscription", ->
describe "with a user with a subscription", ->
describe "with a valid plan code", ->
beforeEach (done) ->
@plan_code = "collaborator"
@LimitationsManager.userHasV2Subscription.callsArgWith(1, null, true, @subscription)
@SubscriptionHandler.updateSubscription(@user, @plan_code, null, done)
it "should update the subscription", ->
@RecurlyWrapper.updateSubscription.calledWith(@subscription.recurlySubscription_id).should.equal true
updateOptions = @RecurlyWrapper.updateSubscription.args[0][1]
updateOptions.plan_code.should.equal @plan_code
it "should update immediately", ->
updateOptions = @RecurlyWrapper.updateSubscription.args[0][1]
updateOptions.timeframe.should.equal "now"
it "should sync the new subscription to the user", ->
@SubscriptionUpdater.syncSubscription.calledOnce.should.equal true
@SubscriptionUpdater.syncSubscription.args[0][0].should.deep.equal @activeRecurlySubscription
@SubscriptionUpdater.syncSubscription.args[0][1].should.deep.equal @user._id
describe "with a user without a subscription", ->
beforeEach (done) ->
@LimitationsManager.userHasV2Subscription.callsArgWith(1, null, false)
@SubscriptionHandler.updateSubscription(@user, @plan_code, null, done)
it "should redirect to the subscription dashboard", ->
@RecurlyWrapper.updateSubscription.called.should.equal false
@SubscriptionHandler.syncSubscriptionToUser.called.should.equal false
describe "with a coupon code", ->
beforeEach (done) ->
@plan_code = "collaborator"
@coupon_code = "1231312"
@LimitationsManager.userHasV2Subscription.callsArgWith(1, null, true, @subscription)
@SubscriptionHandler.updateSubscription(@user, @plan_code, @coupon_code, done)
it "should get the users account", ->
@RecurlyWrapper.getSubscription.calledWith(@activeRecurlySubscription.uuid).should.equal true
it "should redeme the coupon", (done)->
@RecurlyWrapper.redeemCoupon.calledWith(@activeRecurlySubscription.account.account_code, @coupon_code).should.equal true
done()
it "should update the subscription", ->
@RecurlyWrapper.updateSubscription.calledWith(@subscription.recurlySubscription_id).should.equal true
updateOptions = @RecurlyWrapper.updateSubscription.args[0][1]
updateOptions.plan_code.should.equal @plan_code
describe "cancelSubscription", ->
describe "with a user without a subscription", ->
beforeEach (done) ->
@LimitationsManager.userHasV2Subscription.callsArgWith(1, null, false, @subscription)
@SubscriptionHandler.cancelSubscription @user, done
it "should redirect to the subscription dashboard", ->
@RecurlyWrapper.cancelSubscription.called.should.equal false
describe "with a user with a subscription", ->
beforeEach (done) ->
@LimitationsManager.userHasV2Subscription.callsArgWith(1, null, true, @subscription)
@SubscriptionHandler.cancelSubscription @user, done
it "should cancel the subscription", ->
@RecurlyWrapper.cancelSubscription.called.should.equal true
@RecurlyWrapper.cancelSubscription.calledWith(@subscription.recurlySubscription_id).should.equal true
it "should trigger the cancel subscription event", ->
@Events.emit.calledWith("cancelSubscription", @user._id).should.equal true
describe "reactiveRecurlySubscription", ->
describe "with a user without a subscription", ->
beforeEach (done) ->
@LimitationsManager.userHasV2Subscription.callsArgWith(1, null, false, @subscription)
@SubscriptionHandler.reactivateSubscription @user, done
it "should redirect to the subscription dashboard", ->
@RecurlyWrapper.reactivateSubscription.called.should.equal false
describe "with a user with a subscription", ->
beforeEach (done) ->
@LimitationsManager.userHasV2Subscription.callsArgWith(1, null, true, @subscription)
@SubscriptionHandler.reactivateSubscription @user, done
it "should reactivate the subscription", ->
@RecurlyWrapper.reactivateSubscription.called.should.equal true
@RecurlyWrapper.reactivateSubscription.calledWith(@subscription.recurlySubscription_id).should.equal true
describe "recurlyCallback", ->
describe "with an actionable request", ->
beforeEach (done) ->
@user.id = @activeRecurlySubscription.account.account_code
@User.findById = (userId, callback) =>
userId.should.equal @user.id
callback null, @user
@SubscriptionHandler.recurlyCallback(@activeRecurlySubscription, done)
it "should request the affected subscription from the API", ->
@RecurlyWrapper.getSubscription.calledWith(@activeRecurlySubscription.uuid).should.equal true
it "should request the account details of the subscription", ->
options = @RecurlyWrapper.getSubscription.args[0][1]
options.includeAccount.should.equal true
it "should sync the subscription to the user", ->
@SubscriptionUpdater.syncSubscription.calledOnce.should.equal true
@SubscriptionUpdater.syncSubscription.args[0][0].should.deep.equal @activeRecurlySubscription
@SubscriptionUpdater.syncSubscription.args[0][1].should.deep.equal @user._id
describe "validateNoSubscriptionInRecurly", ->
beforeEach ->
@subscriptions = []
@RecurlyWrapper.listAccountActiveSubscriptions = sinon.stub().yields(null, @subscriptions)
@SubscriptionUpdater.syncSubscription = sinon.stub().yields()
@callback = sinon.stub()
describe "with no subscription in recurly", ->
beforeEach ->
@subscriptions.push @subscription = { "mock": "subscription" }
@SubscriptionHandler.validateNoSubscriptionInRecurly @user_id, @callback
it "should call RecurlyWrapper.listAccountActiveSubscriptions with the user id", ->
@RecurlyWrapper.listAccountActiveSubscriptions
.calledWith(@user_id)
.should.equal true
it "should sync the subscription", ->
@SubscriptionUpdater.syncSubscription
.calledWith(@subscription, @user_id)
.should.equal true
it "should call the callback with valid == false", ->
@callback.calledWith(null, false).should.equal true
describe "with a subscription in recurly", ->
beforeEach ->
@SubscriptionHandler.validateNoSubscriptionInRecurly @user_id, @callback
it "should not sync the subscription", ->
@SubscriptionUpdater.syncSubscription
.called
.should.equal false
it "should call the callback with valid == true", ->
@callback.calledWith(null, true).should.equal true
|
[
{
"context": "### ^\nBSD 3-Clause License\n\nCopyright (c) 2017, Stephan Jorek\nAll rights reserved.\n\nRedistribution and use in s",
"end": 61,
"score": 0.9998396635055542,
"start": 48,
"tag": "NAME",
"value": "Stephan Jorek"
}
] | src/misc/gulp/gulp-jison.coffee | sjorek/goatee-script.js | 0 | ### ^
BSD 3-Clause License
Copyright (c) 2017, Stephan Jorek
All rights reserved.
Redistribution and use in source and binary forms, with or without
modification, are permitted provided that the following conditions are met:
* Redistributions of source code must retain the above copyright notice, this
list of conditions and the following disclaimer.
* Redistributions in binary form must reproduce the above copyright notice,
this list of conditions and the following disclaimer in the documentation
and/or other materials provided with the distribution.
* Neither the name of the copyright holder nor the names of its
contributors may be used to endorse or promote products derived from
this software without specific prior written permission.
THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS"
AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE
IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE
DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE LIABLE
FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL
DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR
SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER
CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY,
OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE
OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE.
###
fs = require('fs')
path = require('path')
map = require 'map-stream'
util = require('gulp-util')
PluginError = util.PluginError
cli = require('jison/lib/cli')
###
# # Gulp Jison
# ------------
#
###
PLUGIN_NAME = 'gulp-jison'
module.exports = (options) ->
# getting raw files
lex = null
if options.lexfile?
lex = fs.readFileSync path.normalize(options.lexfile), 'utf8'
processFile = (file, options) ->
opts = {}
opts[key] = value for own key, value of options if options?
opts.file = file.path
raw = file.contents.toString()
# making best guess at json mode
opts.json = path.extname(opts.file) is '.json' unless opts.json
# setting output file name and module name based on input file name
# if they aren't specified.
name = path.basename(opts.outfile ? opts.file).replace /\..*$/g, ''
opts.outfile = "#{name}.js" unless opts.outfile?
if not opts.moduleName? and name
opts.moduleName = name.replace /-\w/g, (match) ->
match.charAt(1).toUpperCase()
grammar = cli.processGrammars raw, lex, opts.json
cli.generateParserString opts, grammar
jison = (file, cb) ->
contents = processFile(file, options)
return cb contents if contents instanceof Error
file.contents = new Buffer contents
file.path = util.replaceExtension '.js'
callback null, file
map jison
| 147181 | ### ^
BSD 3-Clause License
Copyright (c) 2017, <NAME>
All rights reserved.
Redistribution and use in source and binary forms, with or without
modification, are permitted provided that the following conditions are met:
* Redistributions of source code must retain the above copyright notice, this
list of conditions and the following disclaimer.
* Redistributions in binary form must reproduce the above copyright notice,
this list of conditions and the following disclaimer in the documentation
and/or other materials provided with the distribution.
* Neither the name of the copyright holder nor the names of its
contributors may be used to endorse or promote products derived from
this software without specific prior written permission.
THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS"
AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE
IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE
DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE LIABLE
FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL
DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR
SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER
CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY,
OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE
OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE.
###
fs = require('fs')
path = require('path')
map = require 'map-stream'
util = require('gulp-util')
PluginError = util.PluginError
cli = require('jison/lib/cli')
###
# # Gulp Jison
# ------------
#
###
PLUGIN_NAME = 'gulp-jison'
module.exports = (options) ->
# getting raw files
lex = null
if options.lexfile?
lex = fs.readFileSync path.normalize(options.lexfile), 'utf8'
processFile = (file, options) ->
opts = {}
opts[key] = value for own key, value of options if options?
opts.file = file.path
raw = file.contents.toString()
# making best guess at json mode
opts.json = path.extname(opts.file) is '.json' unless opts.json
# setting output file name and module name based on input file name
# if they aren't specified.
name = path.basename(opts.outfile ? opts.file).replace /\..*$/g, ''
opts.outfile = "#{name}.js" unless opts.outfile?
if not opts.moduleName? and name
opts.moduleName = name.replace /-\w/g, (match) ->
match.charAt(1).toUpperCase()
grammar = cli.processGrammars raw, lex, opts.json
cli.generateParserString opts, grammar
jison = (file, cb) ->
contents = processFile(file, options)
return cb contents if contents instanceof Error
file.contents = new Buffer contents
file.path = util.replaceExtension '.js'
callback null, file
map jison
| true | ### ^
BSD 3-Clause License
Copyright (c) 2017, PI:NAME:<NAME>END_PI
All rights reserved.
Redistribution and use in source and binary forms, with or without
modification, are permitted provided that the following conditions are met:
* Redistributions of source code must retain the above copyright notice, this
list of conditions and the following disclaimer.
* Redistributions in binary form must reproduce the above copyright notice,
this list of conditions and the following disclaimer in the documentation
and/or other materials provided with the distribution.
* Neither the name of the copyright holder nor the names of its
contributors may be used to endorse or promote products derived from
this software without specific prior written permission.
THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS"
AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE
IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE
DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE LIABLE
FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL
DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR
SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER
CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY,
OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE
OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE.
###
fs = require('fs')
path = require('path')
map = require 'map-stream'
util = require('gulp-util')
PluginError = util.PluginError
cli = require('jison/lib/cli')
###
# # Gulp Jison
# ------------
#
###
PLUGIN_NAME = 'gulp-jison'
module.exports = (options) ->
# getting raw files
lex = null
if options.lexfile?
lex = fs.readFileSync path.normalize(options.lexfile), 'utf8'
processFile = (file, options) ->
opts = {}
opts[key] = value for own key, value of options if options?
opts.file = file.path
raw = file.contents.toString()
# making best guess at json mode
opts.json = path.extname(opts.file) is '.json' unless opts.json
# setting output file name and module name based on input file name
# if they aren't specified.
name = path.basename(opts.outfile ? opts.file).replace /\..*$/g, ''
opts.outfile = "#{name}.js" unless opts.outfile?
if not opts.moduleName? and name
opts.moduleName = name.replace /-\w/g, (match) ->
match.charAt(1).toUpperCase()
grammar = cli.processGrammars raw, lex, opts.json
cli.generateParserString opts, grammar
jison = (file, cb) ->
contents = processFile(file, options)
return cb contents if contents instanceof Error
file.contents = new Buffer contents
file.path = util.replaceExtension '.js'
callback null, file
map jison
|
[
{
"context": "eenTea_\", temp: \"75 - 80\", time: 90},\n {name: \"oolong\", title: \"_OolongTea_\", temp: \"80 - 85\", time: 15",
"end": 243,
"score": 0.5822856426239014,
"start": 237,
"tag": "NAME",
"value": "oolong"
},
{
"context": "\"_BlackTea_\", temp: \"99\", time: 150},\n {name: \"herbal\", title: \"_HerbalTea_\", temp: \"99\", time: 300},\n ",
"end": 380,
"score": 0.555867612361908,
"start": 374,
"tag": "NAME",
"value": "herbal"
},
{
"context": "99\", time: 480}\n]\n\nwindow.degrees = [\n {name: \"celsius\", title: \"Celsius\", symbol: \"C\", formula: (val) -",
"end": 534,
"score": 0.9862699508666992,
"start": 527,
"tag": "NAME",
"value": "celsius"
},
{
"context": "\nwindow.degrees = [\n {name: \"celsius\", title: \"Celsius\", symbol: \"C\", formula: (val) -> return val},\n ",
"end": 552,
"score": 0.957033634185791,
"start": 545,
"tag": "NAME",
"value": "Celsius"
},
{
"context": ": \"C\", formula: (val) -> return val},\n {name: \"fahrenheit\", title: \"Fahrenheit\", symbol: \"F\", formula: (val",
"end": 621,
"score": 0.9795145988464355,
"start": 611,
"tag": "NAME",
"value": "fahrenheit"
},
{
"context": " -> return val},\n {name: \"fahrenheit\", title: \"Fahrenheit\", symbol: \"F\", formula: (val) -> return val * 9 /",
"end": 642,
"score": 0.9701744318008423,
"start": 632,
"tag": "NAME",
"value": "Fahrenheit"
},
{
"context": "a: (val) -> return val * 9 / 5 + 32},\n {name: \"kelvin\", title: \"Kelvin\", symbol: \"K\", formula: (val) ->",
"end": 720,
"score": 0.9961973428726196,
"start": 714,
"tag": "NAME",
"value": "kelvin"
},
{
"context": "n val * 9 / 5 + 32},\n {name: \"kelvin\", title: \"Kelvin\", symbol: \"K\", formula: (val) -> return val + 273",
"end": 737,
"score": 0.9980292320251465,
"start": 731,
"tag": "NAME",
"value": "Kelvin"
},
{
"context": "rmula: (val) -> return val + 273.15},\n {name: \"reaumur\", title: \"Réaumur\", symbol: \"Ré\", formula: (val) ",
"end": 812,
"score": 0.9837172627449036,
"start": 805,
"tag": "NAME",
"value": "reaumur"
},
{
"context": "turn val + 273.15},\n {name: \"reaumur\", title: \"Réaumur\", symbol: \"Ré\", formula: (val) -> return val * 4 ",
"end": 830,
"score": 0.9959245920181274,
"start": 823,
"tag": "NAME",
"value": "Réaumur"
},
{
"context": "ormula: (val) -> return val * 4 / 5},\n {name: \"rankine\", title: \"Rankine\", symbol: \"R\", formula: (val) -",
"end": 905,
"score": 0.9825836420059204,
"start": 898,
"tag": "NAME",
"value": "rankine"
},
{
"context": "eturn val * 4 / 5},\n {name: \"rankine\", title: \"Rankine\", symbol: \"R\", formula: (val) -> return (val + 27",
"end": 923,
"score": 0.9464186429977417,
"start": 916,
"tag": "NAME",
"value": "Rankine"
},
{
"context": "l) -> return (val + 273.15) * 9 / 5},\n {name: \"delisle\", title: \"Delisle\", symbol: \"De\", formula: (val) ",
"end": 1008,
"score": 0.9469351768493652,
"start": 1001,
"tag": "NAME",
"value": "delisle"
},
{
"context": "+ 273.15) * 9 / 5},\n {name: \"delisle\", title: \"Delisle\", symbol: \"De\", formula: (val) -> return (100 - v",
"end": 1026,
"score": 0.960004985332489,
"start": 1019,
"tag": "NAME",
"value": "Delisle"
},
{
"context": "(val) -> return (100 - val) * 3 / 2},\n {name: \"romer\", title: \"Rømer\", symbol: \"Rø\", formula: (val) ->",
"end": 1107,
"score": 0.9845827221870422,
"start": 1102,
"tag": "NAME",
"value": "romer"
},
{
"context": "(100 - val) * 3 / 2},\n {name: \"romer\", title: \"Rømer\", symbol: \"Rø\", formula: (val) -> return val * 21",
"end": 1123,
"score": 0.9948479533195496,
"start": 1118,
"tag": "NAME",
"value": "Rømer"
}
] | coffee/teas.coffee | rain0r/Tea-clock | 14 | window.teas = [
{name: "white", title: "_WhiteTea_", temp: "65 - 70", time: 90},
{name: "yellow", title: "_YellowTea_", temp: "70 - 75", time: 90},
{name: "green", title: "_GreenTea_", temp: "75 - 80", time: 90},
{name: "oolong", title: "_OolongTea_", temp: "80 - 85", time: 150},
{name: "black", title: "_BlackTea_", temp: "99", time: 150},
{name: "herbal", title: "_HerbalTea_", temp: "99", time: 300},
{name: "fruit", title: "_FruitTea_", temp: "99", time: 480}
]
window.degrees = [
{name: "celsius", title: "Celsius", symbol: "C", formula: (val) -> return val},
{name: "fahrenheit", title: "Fahrenheit", symbol: "F", formula: (val) -> return val * 9 / 5 + 32},
{name: "kelvin", title: "Kelvin", symbol: "K", formula: (val) -> return val + 273.15},
{name: "reaumur", title: "Réaumur", symbol: "Ré", formula: (val) -> return val * 4 / 5},
{name: "rankine", title: "Rankine", symbol: "R", formula: (val) -> return (val + 273.15) * 9 / 5},
{name: "delisle", title: "Delisle", symbol: "De", formula: (val) -> return (100 - val) * 3 / 2},
{name: "romer", title: "Rømer", symbol: "Rø", formula: (val) -> return val * 21 / 40 + 7.5}
]
window.notificationTemplate = {title: "_AppTitle_", body: "_NotificationMessage_" }
| 181148 | window.teas = [
{name: "white", title: "_WhiteTea_", temp: "65 - 70", time: 90},
{name: "yellow", title: "_YellowTea_", temp: "70 - 75", time: 90},
{name: "green", title: "_GreenTea_", temp: "75 - 80", time: 90},
{name: "<NAME>", title: "_OolongTea_", temp: "80 - 85", time: 150},
{name: "black", title: "_BlackTea_", temp: "99", time: 150},
{name: "<NAME>", title: "_HerbalTea_", temp: "99", time: 300},
{name: "fruit", title: "_FruitTea_", temp: "99", time: 480}
]
window.degrees = [
{name: "<NAME>", title: "<NAME>", symbol: "C", formula: (val) -> return val},
{name: "<NAME>", title: "<NAME>", symbol: "F", formula: (val) -> return val * 9 / 5 + 32},
{name: "<NAME>", title: "<NAME>", symbol: "K", formula: (val) -> return val + 273.15},
{name: "<NAME>", title: "<NAME>", symbol: "Ré", formula: (val) -> return val * 4 / 5},
{name: "<NAME>", title: "<NAME>", symbol: "R", formula: (val) -> return (val + 273.15) * 9 / 5},
{name: "<NAME>", title: "<NAME>", symbol: "De", formula: (val) -> return (100 - val) * 3 / 2},
{name: "<NAME>", title: "<NAME>", symbol: "Rø", formula: (val) -> return val * 21 / 40 + 7.5}
]
window.notificationTemplate = {title: "_AppTitle_", body: "_NotificationMessage_" }
| true | window.teas = [
{name: "white", title: "_WhiteTea_", temp: "65 - 70", time: 90},
{name: "yellow", title: "_YellowTea_", temp: "70 - 75", time: 90},
{name: "green", title: "_GreenTea_", temp: "75 - 80", time: 90},
{name: "PI:NAME:<NAME>END_PI", title: "_OolongTea_", temp: "80 - 85", time: 150},
{name: "black", title: "_BlackTea_", temp: "99", time: 150},
{name: "PI:NAME:<NAME>END_PI", title: "_HerbalTea_", temp: "99", time: 300},
{name: "fruit", title: "_FruitTea_", temp: "99", time: 480}
]
window.degrees = [
{name: "PI:NAME:<NAME>END_PI", title: "PI:NAME:<NAME>END_PI", symbol: "C", formula: (val) -> return val},
{name: "PI:NAME:<NAME>END_PI", title: "PI:NAME:<NAME>END_PI", symbol: "F", formula: (val) -> return val * 9 / 5 + 32},
{name: "PI:NAME:<NAME>END_PI", title: "PI:NAME:<NAME>END_PI", symbol: "K", formula: (val) -> return val + 273.15},
{name: "PI:NAME:<NAME>END_PI", title: "PI:NAME:<NAME>END_PI", symbol: "Ré", formula: (val) -> return val * 4 / 5},
{name: "PI:NAME:<NAME>END_PI", title: "PI:NAME:<NAME>END_PI", symbol: "R", formula: (val) -> return (val + 273.15) * 9 / 5},
{name: "PI:NAME:<NAME>END_PI", title: "PI:NAME:<NAME>END_PI", symbol: "De", formula: (val) -> return (100 - val) * 3 / 2},
{name: "PI:NAME:<NAME>END_PI", title: "PI:NAME:<NAME>END_PI", symbol: "Rø", formula: (val) -> return val * 21 / 40 + 7.5}
]
window.notificationTemplate = {title: "_AppTitle_", body: "_NotificationMessage_" }
|
[
{
"context": "e': process.env.MAIL_USERNAME\n 'mail_password': process.env.MAIL_PASSWORD\n 'mongo_db': process.env.MONGODB or 'mong",
"end": 1555,
"score": 0.9891115427017212,
"start": 1530,
"tag": "PASSWORD",
"value": "process.env.MAIL_PASSWORD"
},
{
"context": "mongo_db': process.env.MONGODB or 'mongodb://192.168.99.100:27017/mean-coffee-starter'\n 'redis_host': p",
"end": 1625,
"score": 0.9997555613517761,
"start": 1611,
"tag": "IP_ADDRESS",
"value": "192.168.99.100"
},
{
"context": "'\n 'redis_host': process.env.REDISHOST or '192.168.99.100'\n 'redis_port': process.env.REDISPORT or 63",
"end": 1715,
"score": 0.9997111558914185,
"start": 1701,
"tag": "IP_ADDRESS",
"value": "192.168.99.100"
}
] | config/globals.coffee | crueber/mean-coffee-starter | 0 |
path = require "path"
Emitter = require('events').EventEmitter
###
# Application Globals Setup
###
module.exports = (app) ->
global.app = app
global._ = require 'lodash'
global.moment = require 'moment'
global.logger = require('./logger')()
global.events = new Emitter()
global.empty_fn = -> null
global.constant = {}
global.constant.one_ms = 1
global.constant.one_second = constant.one_ms * 1000
global.constant.one_minute = constant.one_second * 60
global.constant.one_hour = constant.one_minute * 60
global.constant.one_day = constant.one_hour * 24
global.constant.one_week = constant.one_hour * 7
global.constant.one_month = constant.one_day * 30 # approx
global.constant.one_year = constant.one_week * 52 # approx
global.constant.one_byte = 1
global.constant.one_kb = 1024 * global.constant.one_byte
global.constant.one_mb = 1024 * global.constant.one_kb
global.constant.one_gb = 1024 * global.constant.one_mb
application_globals =
'dev': app.get('env') isnt 'production'
'views': path.join(__dirname, "/../views")
'view engine': 'jade'
'title': 'MEAN Coffee Baseline'
'port': process.env.PORT
'sessionSecret': process.env.SESSION_SECRET
'mail_host': process.env.MAIL_HOST
'mail_port': process.env.MAIL_PORT
'mail_username': process.env.MAIL_USERNAME
'mail_password': process.env.MAIL_PASSWORD
'mongo_db': process.env.MONGODB or 'mongodb://192.168.99.100:27017/mean-coffee-starter'
'redis_host': process.env.REDISHOST or '192.168.99.100'
'redis_port': process.env.REDISPORT or 6379
# 'redis_auth': process.env.REDISAUTH
# 'redis_opts': {}
# 'postgres_db': process.env.POSTGRESDB
app.set key, value for key, value of application_globals
app.locals.title = application_globals['title']
app.locals.dev = application_globals['dev']
| 185007 |
path = require "path"
Emitter = require('events').EventEmitter
###
# Application Globals Setup
###
module.exports = (app) ->
global.app = app
global._ = require 'lodash'
global.moment = require 'moment'
global.logger = require('./logger')()
global.events = new Emitter()
global.empty_fn = -> null
global.constant = {}
global.constant.one_ms = 1
global.constant.one_second = constant.one_ms * 1000
global.constant.one_minute = constant.one_second * 60
global.constant.one_hour = constant.one_minute * 60
global.constant.one_day = constant.one_hour * 24
global.constant.one_week = constant.one_hour * 7
global.constant.one_month = constant.one_day * 30 # approx
global.constant.one_year = constant.one_week * 52 # approx
global.constant.one_byte = 1
global.constant.one_kb = 1024 * global.constant.one_byte
global.constant.one_mb = 1024 * global.constant.one_kb
global.constant.one_gb = 1024 * global.constant.one_mb
application_globals =
'dev': app.get('env') isnt 'production'
'views': path.join(__dirname, "/../views")
'view engine': 'jade'
'title': 'MEAN Coffee Baseline'
'port': process.env.PORT
'sessionSecret': process.env.SESSION_SECRET
'mail_host': process.env.MAIL_HOST
'mail_port': process.env.MAIL_PORT
'mail_username': process.env.MAIL_USERNAME
'mail_password': <PASSWORD>
'mongo_db': process.env.MONGODB or 'mongodb://192.168.99.100:27017/mean-coffee-starter'
'redis_host': process.env.REDISHOST or '192.168.99.100'
'redis_port': process.env.REDISPORT or 6379
# 'redis_auth': process.env.REDISAUTH
# 'redis_opts': {}
# 'postgres_db': process.env.POSTGRESDB
app.set key, value for key, value of application_globals
app.locals.title = application_globals['title']
app.locals.dev = application_globals['dev']
| true |
path = require "path"
Emitter = require('events').EventEmitter
###
# Application Globals Setup
###
module.exports = (app) ->
global.app = app
global._ = require 'lodash'
global.moment = require 'moment'
global.logger = require('./logger')()
global.events = new Emitter()
global.empty_fn = -> null
global.constant = {}
global.constant.one_ms = 1
global.constant.one_second = constant.one_ms * 1000
global.constant.one_minute = constant.one_second * 60
global.constant.one_hour = constant.one_minute * 60
global.constant.one_day = constant.one_hour * 24
global.constant.one_week = constant.one_hour * 7
global.constant.one_month = constant.one_day * 30 # approx
global.constant.one_year = constant.one_week * 52 # approx
global.constant.one_byte = 1
global.constant.one_kb = 1024 * global.constant.one_byte
global.constant.one_mb = 1024 * global.constant.one_kb
global.constant.one_gb = 1024 * global.constant.one_mb
application_globals =
'dev': app.get('env') isnt 'production'
'views': path.join(__dirname, "/../views")
'view engine': 'jade'
'title': 'MEAN Coffee Baseline'
'port': process.env.PORT
'sessionSecret': process.env.SESSION_SECRET
'mail_host': process.env.MAIL_HOST
'mail_port': process.env.MAIL_PORT
'mail_username': process.env.MAIL_USERNAME
'mail_password': PI:PASSWORD:<PASSWORD>END_PI
'mongo_db': process.env.MONGODB or 'mongodb://192.168.99.100:27017/mean-coffee-starter'
'redis_host': process.env.REDISHOST or '192.168.99.100'
'redis_port': process.env.REDISPORT or 6379
# 'redis_auth': process.env.REDISAUTH
# 'redis_opts': {}
# 'postgres_db': process.env.POSTGRESDB
app.set key, value for key, value of application_globals
app.locals.title = application_globals['title']
app.locals.dev = application_globals['dev']
|
[
{
"context": "port}\"\n\n Accounts.emailTemplates.from = \"CoLabs <no-reply@CoLabs.biz>\"\n Accounts.emailTemplates.siteName = \"CoLabs\"\n ",
"end": 850,
"score": 0.99989914894104,
"start": 831,
"tag": "EMAIL",
"value": "no-reply@CoLabs.biz"
},
{
"context": ".verifyEmail.text = (user, url) ->\n \"Welcome, #{user.username}!\n \n Clicking on the following lin",
"end": 1084,
"score": 0.8408426642417908,
"start": 1080,
"tag": "USERNAME",
"value": "user"
},
{
"context": "fyEmail.text = (user, url) ->\n \"Welcome, #{user.username}!\n \n Clicking on the following link will ve",
"end": 1093,
"score": 0.9219821691513062,
"start": 1085,
"tag": "USERNAME",
"value": "username"
}
] | app/server/init.coffee | eribeiro9/CoLabs | 0 | ###
# TODO: Google Analytics
process.env.METEOR_SETTINGS = {
public: {
ga: {
account: "UA-65362043-1"
}
}
}
###
if Meteor.settings?.env?
rootUrl = ''
if Meteor.settings.env.type isnt 'development'
{port, rootUrl, mongoUrl, bindIp, velocity} = Meteor.settings.env
process.env.VELOCITY = velocity or 0
process.env.PORT = port
process.env.ROOT_URL = rootUrl
process.env.MONGO_URL = mongoUrl
process.env.BIND_IP = bindIp
else
do Logger.enable
{velocity} = Meteor.settings.env
process.env.VELOCITY = velocity or 0
smtp = Meteor.settings.smtp
(smtp[prop] = encodeURIComponent val) for prop, val of smtp
process.env.MAIL_URL =
"smtp://#{smtp.username}:#{smtp.password}@#{smtp.server}:#{smtp.port}"
Accounts.emailTemplates.from = "CoLabs <no-reply@CoLabs.biz>"
Accounts.emailTemplates.siteName = "CoLabs"
Accounts.emailTemplates.verifyEmail.subject = (user) ->
"Confirm Your Email Address at CoLabs"
Accounts.emailTemplates.verifyEmail.text = (user, url) ->
"Welcome, #{user.username}!
Clicking on the following link will verify your email address: #{
rootUrl + "#/" + (url.split '/#/').pop()
}.
After verifying, you will unlock the full capabilities of interacting with users and projects!
Sincerely,
The CoLabs Community"
| 102303 | ###
# TODO: Google Analytics
process.env.METEOR_SETTINGS = {
public: {
ga: {
account: "UA-65362043-1"
}
}
}
###
if Meteor.settings?.env?
rootUrl = ''
if Meteor.settings.env.type isnt 'development'
{port, rootUrl, mongoUrl, bindIp, velocity} = Meteor.settings.env
process.env.VELOCITY = velocity or 0
process.env.PORT = port
process.env.ROOT_URL = rootUrl
process.env.MONGO_URL = mongoUrl
process.env.BIND_IP = bindIp
else
do Logger.enable
{velocity} = Meteor.settings.env
process.env.VELOCITY = velocity or 0
smtp = Meteor.settings.smtp
(smtp[prop] = encodeURIComponent val) for prop, val of smtp
process.env.MAIL_URL =
"smtp://#{smtp.username}:#{smtp.password}@#{smtp.server}:#{smtp.port}"
Accounts.emailTemplates.from = "CoLabs <<EMAIL>>"
Accounts.emailTemplates.siteName = "CoLabs"
Accounts.emailTemplates.verifyEmail.subject = (user) ->
"Confirm Your Email Address at CoLabs"
Accounts.emailTemplates.verifyEmail.text = (user, url) ->
"Welcome, #{user.username}!
Clicking on the following link will verify your email address: #{
rootUrl + "#/" + (url.split '/#/').pop()
}.
After verifying, you will unlock the full capabilities of interacting with users and projects!
Sincerely,
The CoLabs Community"
| true | ###
# TODO: Google Analytics
process.env.METEOR_SETTINGS = {
public: {
ga: {
account: "UA-65362043-1"
}
}
}
###
if Meteor.settings?.env?
rootUrl = ''
if Meteor.settings.env.type isnt 'development'
{port, rootUrl, mongoUrl, bindIp, velocity} = Meteor.settings.env
process.env.VELOCITY = velocity or 0
process.env.PORT = port
process.env.ROOT_URL = rootUrl
process.env.MONGO_URL = mongoUrl
process.env.BIND_IP = bindIp
else
do Logger.enable
{velocity} = Meteor.settings.env
process.env.VELOCITY = velocity or 0
smtp = Meteor.settings.smtp
(smtp[prop] = encodeURIComponent val) for prop, val of smtp
process.env.MAIL_URL =
"smtp://#{smtp.username}:#{smtp.password}@#{smtp.server}:#{smtp.port}"
Accounts.emailTemplates.from = "CoLabs <PI:EMAIL:<EMAIL>END_PI>"
Accounts.emailTemplates.siteName = "CoLabs"
Accounts.emailTemplates.verifyEmail.subject = (user) ->
"Confirm Your Email Address at CoLabs"
Accounts.emailTemplates.verifyEmail.text = (user, url) ->
"Welcome, #{user.username}!
Clicking on the following link will verify your email address: #{
rootUrl + "#/" + (url.split '/#/').pop()
}.
After verifying, you will unlock the full capabilities of interacting with users and projects!
Sincerely,
The CoLabs Community"
|
[
{
"context": " @database.devices.insert uuid: 'uuid1', token: 'token1', configureWhitelist: ['*'], done\n\n beforeEac",
"end": 554,
"score": 0.6817396879196167,
"start": 549,
"tag": "KEY",
"value": "token"
},
{
"context": "tabase.devices.insert uuid: 'uuid1', token: 'token1', configureWhitelist: ['*'], done\n\n beforeEach",
"end": 555,
"score": 0.6519724130630493,
"start": 554,
"tag": "PASSWORD",
"value": "1"
},
{
"context": " @database.devices.insert uuid: 'uuid2', token: 'token2', configureWhitelist: [], done\n\n describe 'wh",
"end": 736,
"score": 0.5759169459342957,
"start": 731,
"tag": "KEY",
"value": "token"
},
{
"context": "tabase.devices.insert uuid: 'uuid2', token: 'token2', configureWhitelist: [], done\n\n describe 'whe",
"end": 737,
"score": 0.8311790227890015,
"start": 736,
"tag": "PASSWORD",
"value": "2"
}
] | test/lib/deleteSubscriptionIfAuthorized-spec.coffee | CESARBR/knot-cloud-source | 4 | _ = require 'lodash'
TestDatabase = require '../test-database'
describe 'deleteSubscriptionIfAuthorized', ->
beforeEach ->
@sut = require '../../lib/deleteSubscriptionIfAuthorized'
beforeEach (done) ->
TestDatabase.open (error, database) =>
@database = database
@dependencies = database: @database
done error
describe 'when there is a closed device and an open device', ->
beforeEach (done) ->
@open_device = uuid: 'uuid1', configureWhitelist: ['*']
@database.devices.insert uuid: 'uuid1', token: 'token1', configureWhitelist: ['*'], done
beforeEach (done) ->
@closed_device = uuid: 'uuid2', configureWhitelist: []
@database.devices.insert uuid: 'uuid2', token: 'token2', configureWhitelist: [], done
describe 'when the devices are subscribed to each other', ->
beforeEach (done) ->
@database.subscriptions.insert subscriberUuid: @open_device.uuid, emitterUuid: @closed_device.uuid, type: 'event', done
beforeEach (done) ->
@database.subscriptions.insert subscriberUuid: @closed_device.uuid, emitterUuid: @open_device.uuid, type: 'event', done
describe 'when the open device tries to remove a subscription from itself to the closed device', ->
beforeEach (done) ->
params = {
uuid: @open_device.uuid
targetUuid: @closed_device.uuid
type: 'event'
}
@dependencies.getDevice = sinon.stub().yields null, @open_device
@sut @open_device, params, done, @dependencies
it 'should remove exactly one subscription from the database', (done) ->
@database.subscriptions.count {}, (error, subscriptionCount) =>
return done error if error?
expect(subscriptionCount).to.equal 1
done()
describe 'when someone else tries to remove the subscription from the closed device to the open device', ->
beforeEach (done) ->
@other_device = {uuid: 'uuid3'}
params = {
uuid: @closed_device.uuid
targetUuid: @open_device.uuid
type: 'event'
}
@dependencies.getDevice = sinon.stub().yields null, @closed_device
storeError = (@error) => done()
@sut @other_device, params, storeError, @dependencies
it 'should remove no subscriptions from the database', (done) ->
@database.subscriptions.count {}, (error, subscriptionCount) =>
return done error if error?
expect(subscriptionCount).to.equal 2
done()
it 'should yield an error', ->
expect(@error).to.be.an.instanceOf Error
expect(@error.message).to.deep.equal 'Insufficient permissions to remove subscription on behalf of that device'
| 5061 | _ = require 'lodash'
TestDatabase = require '../test-database'
describe 'deleteSubscriptionIfAuthorized', ->
beforeEach ->
@sut = require '../../lib/deleteSubscriptionIfAuthorized'
beforeEach (done) ->
TestDatabase.open (error, database) =>
@database = database
@dependencies = database: @database
done error
describe 'when there is a closed device and an open device', ->
beforeEach (done) ->
@open_device = uuid: 'uuid1', configureWhitelist: ['*']
@database.devices.insert uuid: 'uuid1', token: '<KEY> <PASSWORD>', configureWhitelist: ['*'], done
beforeEach (done) ->
@closed_device = uuid: 'uuid2', configureWhitelist: []
@database.devices.insert uuid: 'uuid2', token: '<KEY> <PASSWORD>', configureWhitelist: [], done
describe 'when the devices are subscribed to each other', ->
beforeEach (done) ->
@database.subscriptions.insert subscriberUuid: @open_device.uuid, emitterUuid: @closed_device.uuid, type: 'event', done
beforeEach (done) ->
@database.subscriptions.insert subscriberUuid: @closed_device.uuid, emitterUuid: @open_device.uuid, type: 'event', done
describe 'when the open device tries to remove a subscription from itself to the closed device', ->
beforeEach (done) ->
params = {
uuid: @open_device.uuid
targetUuid: @closed_device.uuid
type: 'event'
}
@dependencies.getDevice = sinon.stub().yields null, @open_device
@sut @open_device, params, done, @dependencies
it 'should remove exactly one subscription from the database', (done) ->
@database.subscriptions.count {}, (error, subscriptionCount) =>
return done error if error?
expect(subscriptionCount).to.equal 1
done()
describe 'when someone else tries to remove the subscription from the closed device to the open device', ->
beforeEach (done) ->
@other_device = {uuid: 'uuid3'}
params = {
uuid: @closed_device.uuid
targetUuid: @open_device.uuid
type: 'event'
}
@dependencies.getDevice = sinon.stub().yields null, @closed_device
storeError = (@error) => done()
@sut @other_device, params, storeError, @dependencies
it 'should remove no subscriptions from the database', (done) ->
@database.subscriptions.count {}, (error, subscriptionCount) =>
return done error if error?
expect(subscriptionCount).to.equal 2
done()
it 'should yield an error', ->
expect(@error).to.be.an.instanceOf Error
expect(@error.message).to.deep.equal 'Insufficient permissions to remove subscription on behalf of that device'
| true | _ = require 'lodash'
TestDatabase = require '../test-database'
describe 'deleteSubscriptionIfAuthorized', ->
beforeEach ->
@sut = require '../../lib/deleteSubscriptionIfAuthorized'
beforeEach (done) ->
TestDatabase.open (error, database) =>
@database = database
@dependencies = database: @database
done error
describe 'when there is a closed device and an open device', ->
beforeEach (done) ->
@open_device = uuid: 'uuid1', configureWhitelist: ['*']
@database.devices.insert uuid: 'uuid1', token: 'PI:KEY:<KEY>END_PI PI:PASSWORD:<PASSWORD>END_PI', configureWhitelist: ['*'], done
beforeEach (done) ->
@closed_device = uuid: 'uuid2', configureWhitelist: []
@database.devices.insert uuid: 'uuid2', token: 'PI:KEY:<KEY>END_PI PI:PASSWORD:<PASSWORD>END_PI', configureWhitelist: [], done
describe 'when the devices are subscribed to each other', ->
beforeEach (done) ->
@database.subscriptions.insert subscriberUuid: @open_device.uuid, emitterUuid: @closed_device.uuid, type: 'event', done
beforeEach (done) ->
@database.subscriptions.insert subscriberUuid: @closed_device.uuid, emitterUuid: @open_device.uuid, type: 'event', done
describe 'when the open device tries to remove a subscription from itself to the closed device', ->
beforeEach (done) ->
params = {
uuid: @open_device.uuid
targetUuid: @closed_device.uuid
type: 'event'
}
@dependencies.getDevice = sinon.stub().yields null, @open_device
@sut @open_device, params, done, @dependencies
it 'should remove exactly one subscription from the database', (done) ->
@database.subscriptions.count {}, (error, subscriptionCount) =>
return done error if error?
expect(subscriptionCount).to.equal 1
done()
describe 'when someone else tries to remove the subscription from the closed device to the open device', ->
beforeEach (done) ->
@other_device = {uuid: 'uuid3'}
params = {
uuid: @closed_device.uuid
targetUuid: @open_device.uuid
type: 'event'
}
@dependencies.getDevice = sinon.stub().yields null, @closed_device
storeError = (@error) => done()
@sut @other_device, params, storeError, @dependencies
it 'should remove no subscriptions from the database', (done) ->
@database.subscriptions.count {}, (error, subscriptionCount) =>
return done error if error?
expect(subscriptionCount).to.equal 2
done()
it 'should yield an error', ->
expect(@error).to.be.an.instanceOf Error
expect(@error.message).to.deep.equal 'Insufficient permissions to remove subscription on behalf of that device'
|
[
{
"context": "window.Furatto =\n name: 'Furatto'\n version: '1.0.0'\n\n$('.alert .close').each ->",
"end": 31,
"score": 0.5823742151260376,
"start": 27,
"tag": "NAME",
"value": "urat"
}
] | coffee/furatto.coffee | IcaliaLabs/furatto | 133 | window.Furatto =
name: 'Furatto'
version: '1.0.0'
$('.alert .close').each ->
$(@).click (e) ->
e.preventDefault()
$(@).parent().fadeOut()
| 16866 | window.Furatto =
name: 'F<NAME>to'
version: '1.0.0'
$('.alert .close').each ->
$(@).click (e) ->
e.preventDefault()
$(@).parent().fadeOut()
| true | window.Furatto =
name: 'FPI:NAME:<NAME>END_PIto'
version: '1.0.0'
$('.alert .close').each ->
$(@).click (e) ->
e.preventDefault()
$(@).parent().fadeOut()
|
[
{
"context": "text: this\n data:\n name: name\n success: (data) ->\n @l",
"end": 4718,
"score": 0.9973024725914001,
"start": 4714,
"tag": "NAME",
"value": "name"
}
] | samples/scala/zentasks/app/assets/javascripts/main.coffee | adriaanm/playframework | 22 | # -----------------------------------------------
# MAIN
# -----------------------------------------------
# DISCLAMER :
# If you're used to Backbone.js, you may be
# confused by the absence of models, but the goal
# of this sample is to demonstrate some features
# of Play including the template engine.
# I'm not using client-side templating nor models
# for this purpose, and I do not recommend this
# behavior for real life projects.
# -----------------------------------------------
# Just a log helper
log = (args...) ->
console.log.apply console, args if console.log?
# ------------------------------- DROP DOWN MENUS
$(".options dt, .users dt").live "click", (e) ->
e.preventDefault()
if $(e.target).parent().hasClass("opened")
$(e.target).parent().removeClass("opened")
else
$(e.target).parent().addClass("opened")
$(document).one "click", ->
$(e.target).parent().removeClass("opened")
false
# --------------------------------- EDIT IN PLACE
$.fn.editInPlace = (method, options...) ->
this.each ->
methods =
# public methods
init: (options) ->
valid = (e) =>
newValue = @input.val()
options.onChange.call(options.context, newValue)
cancel = (e) =>
@el.show()
@input.hide()
@el = $(this).dblclick(methods.edit)
@input = $("<input type='text' />")
.insertBefore(@el)
.keyup (e) ->
switch(e.keyCode)
# Enter key
when 13 then $(this).blur()
# Escape key
when 27 then cancel(e)
.blur(valid)
.hide()
edit: ->
@input
.val(@el.text())
.show()
.focus()
.select()
@el.hide()
close: (newName) ->
@el.text(newName).show()
@input.hide()
# jQuery approach: http://docs.jquery.com/Plugins/Authoring
if ( methods[method] )
return methods[ method ].apply(this, options)
else if (typeof method == 'object')
return methods.init.call(this, method)
else
$.error("Method " + method + " does not exist.")
# ---------------------------------------- DRAWER
class Drawer extends Backbone.View
initialize: ->
$("#newGroup").click @addGroup
# HTML is our model
@el.children("li").each (i,group) ->
new Group
el: $(group)
$("li",group).each (i,project) ->
new Project
el: $(project)
addGroup: ->
jsRoutes.controllers.Projects.addGroup().ajax
success: (data) ->
_view = new Group
el: $(data).appendTo("#projects")
_view.el.find(".groupName").editInPlace("edit")
error: (err) ->
# TODO: Deal with
# ---------------------------------------- GROUPS
class Group extends Backbone.View
events:
"click .toggle" : "toggle"
"click .newProject" : "newProject"
"click .deleteGroup" : "deleteGroup"
initialize: ->
@id = @el.attr("data-group")
@name = $(".groupName", @el).editInPlace
context: this
onChange: @renameGroup
newProject: (e) ->
e.preventDefault()
@el.removeClass("closed")
jsRoutes.controllers.Projects.add().ajax
context: this
data:
group: @el.attr("data-group")
success: (tpl) ->
_list = $("ul",@el)
_view = new Project
el: $(tpl).appendTo(_list)
_view.el.find(".name").editInPlace("edit")
error: (err) ->
$.error("Error: " + err)
deleteGroup: (e) ->
e.preventDefault()
false if (!confirm "Remove group and projects inside?")
id = @el.attr("data-group-id")
@loading(true)
jsRoutes.controllers.Projects.deleteGroup(@id).ajax
context: this
success: ->
@el.remove()
@loading(false)
error: (err) ->
@loading(false)
$.error("Error: " + err)
renameGroup: (name) =>
@loading(true)
jsRoutes.controllers.Projects.renameGroup(@id).ajax
context: this
data:
name: name
success: (data) ->
@loading(false)
@name.editInPlace("close", data)
@el.attr("data-group", data)
@id = @el.attr("data-group")
error: (err) ->
@loading(false)
$.error("Error: " + err)
toggle: (e) ->
e.preventDefault()
@el.toggleClass("closed")
false
loading: (display) ->
if (display)
@el.children(".options").hide()
@el.children(".loader").show()
else
@el.children(".options").show()
@el.children(".loader").hide()
# --------------------------------------- PROJECT
class Project extends Backbone.View
events:
"click .delete" : "deleteProject"
initialize: ->
@id = @el.attr("data-project")
@name = $(".name", @el).editInPlace
context: this
onChange: @renameProject
renameProject: (name) ->
@loading(true)
jsRoutes.controllers.Projects.rename(@id).ajax
context: this
data:
name: name
success: (data) ->
@loading(false)
@name.editInPlace("close", data)
error: (err) ->
@loading(false)
$.error("Error: " + err)
deleteProject: (e) ->
e.preventDefault()
@loading(true)
jsRoutes.controllers.Projects.delete(@id).ajax
context: this
success: ->
@el.remove()
@loading(false)
error: (err) ->
@loading(false)
$.error("Error: " + err)
false
loading: (display) ->
if (display)
@el.children(".delete").hide()
@el.children(".loader").show()
else
@el.children(".delete").show()
@el.children(".loader").hide()
# ---------------------------------------- ROUTER
class AppRouter extends Backbone.Router
initialize: ->
@currentApp = new Tasks
el: $("#main")
routes:
"" : "index"
"/projects/:project/tasks" : "tasks"
index: ->
# show dashboard
$("#main").load "/ #main"
tasks: (project) ->
# load project || display app
currentApp = @currentApp
$("#main").load "/projects/" + project + "/tasks", (tpl) ->
currentApp.render(project)
# ----------------------------------------- TASKS
class Tasks extends Backbone.View
events:
"click .newFolder" : "newFolder"
"click .list .action" : "removeUser"
"click .addUserList .action" : "addUser"
render: (project) ->
@project = project
# HTML is our model
@folders = $.map $(".folder", @el), (folder) =>
new TaskFolder
el: $(folder)
project: @project
newFolder: (e) ->
e.preventDefault()
jsRoutes.controllers.Tasks.addFolder(@project).ajax
context: this
success: (tpl) ->
newFolder = new TaskFolder
el: $(tpl).insertBefore(".newFolder")
project: @project
newFolder.el.find("header > h3").editInPlace("edit")
error: (err) ->
$.error("Error: " + err)
false
removeUser: (e) ->
e.preventDefault()
jsRoutes.controllers.Projects.removeUser(@project).ajax
context: this
data:
user: $(e.target).parent().data('user-id')
success: ->
$(e.target).parent().appendTo(".addUserList")
error: (err) ->
$.error("Error: " + err)
false
addUser: (e) ->
e.preventDefault()
jsRoutes.controllers.Projects.addUser(@project).ajax
context: this
data:
user: $(e.target).parent().data('user-id')
success: ->
$(e.target).parent().appendTo(".users .list")
error: (err) ->
$.error("Error: " + err)
false
# ---------------------------------- TASKS FOLDER
class TaskFolder extends Backbone.View
events:
"click .deleteCompleteTasks" : "deleteCompleteTasks"
"click .deleteAllTasks" : "deleteAllTasks"
"click .deleteFolder" : "deleteFolder"
"change header>input" : "toggleAll"
"submit .addTask" : "newTask"
initialize: (options) =>
@project = options.project
@tasks = $.map $(".list li",@el), (item)=>
newTask = new TaskItem
el: $(item)
folder: @
newTask.bind("change", @refreshCount)
newTask.bind("delete", @deleteTask)
@counter = @el.find(".counter")
@id = @el.attr("data-folder-id")
@name = $("header > h3", @el).editInPlace
context: this
onChange: @renameFolder
@refreshCount()
newTask: (e) =>
e.preventDefault()
$(document).focus() # temporary disable form
form = $(e.target)
taskBody = $("input[name=taskBody]", form).val()
url = form.attr("action")
jsRoutes.controllers.Tasks.add(@project, @id).ajax
url: url
type: "POST"
context: this
data:
title: $("input[name=taskBody]", form).val()
dueDate: $("input[name=dueDate]", form).val()
assignedTo: $("input[name=assignedTo]", form).val()
success: (tpl) ->
newTask = new TaskItem(el: $(tpl), folder: @)
@el.find("ul").append(newTask.el)
@tasks.push(newTask)
form.find("input[type=text]").val("").first().focus()
error: (err) ->
alert "Something went wrong:" + err
false
renameFolder: (name) =>
@loading(true)
jsRoutes.controllers.Tasks.renameFolder(@project, @id).ajax
context: this
data:
name: name
success: (data) ->
@loading(false)
@name.editInPlace("close", data)
@el.attr("data-folder-id", data)
@id = @el.attr("data-folder-id")
error: (err) ->
@loading(false)
$.error("Error: " + err)
deleteCompleteTasks: (e) =>
e.preventDefault()
$.each @tasks, (i, item) ->
item.deleteTask() if item.el.find(".done:checked").length > 0
true
false
deleteAllTasks: (e) =>
e.preventDefault()
$.each @tasks, (i, item)->
item.deleteTask()
true
false
deleteFolder: (e) =>
e.preventDefault()
@el.remove()
false
toggleAll: (e) =>
val = $(e.target).is(":checked")
$.each @tasks, (i, item) ->
item.toggle(val)
true
refreshCount: =>
count = @tasks.filter((item)->
item.el.find(".done:checked").length == 0
).length
@counter.text(count)
deleteTask: (task) =>
@tasks = _.without @tasks, tasks
@refreshCount()
loading: (display) ->
if (display)
@el.find("header .options").hide()
@el.find("header .loader").show()
else
@el.find("header .options").show()
@el.find("header .loader").hide()
# ------------------------------------- TASK ITEM
class TaskItem extends Backbone.View
events:
"change .done" : "onToggle"
"click .deleteTask" : "deleteTask"
"dblclick h4" : "editTask"
initialize: (options) ->
@check = @el.find(".done")
@id = @el.attr("data-task-id")
@folder = options.folder
deleteTask: (e) =>
e.preventDefault() if e?
@loading(false)
jsRoutes.controllers.Tasks.delete(@id).ajax
context: this
data:
name: name
success: (data) ->
@loading(false)
@el.remove()
@trigger("delete", @)
error: (err) ->
@loading(false)
$.error("Error: " + err)
false
editTask: (e) =>
e.preventDefault()
# TODO
alert "not implemented yet."
false
toggle: (val) =>
@loading(true)
jsRoutes.controllers.Tasks.update(@id).ajax
context: this
data:
done: val
success: (data) ->
@loading(false)
@check.attr("checked",val)
@trigger("change", @)
error: (err) ->
@loading(false)
$.error("Error: " + err)
onToggle: (e) =>
e.preventDefault()
val = @check.is(":checked")
log val
@toggle(val)
false
loading: (display) ->
if (display)
@el.find(".delete").hide()
@el.find(".loader").show()
else
@el.find(".delete").show()
@el.find(".loader").hide()
# ------------------------------------- INIT APP
$ -> # document is ready!
app = new AppRouter()
drawer = new Drawer el: $("#projects")
Backbone.history.start
pushHistory: true
| 141328 | # -----------------------------------------------
# MAIN
# -----------------------------------------------
# DISCLAMER :
# If you're used to Backbone.js, you may be
# confused by the absence of models, but the goal
# of this sample is to demonstrate some features
# of Play including the template engine.
# I'm not using client-side templating nor models
# for this purpose, and I do not recommend this
# behavior for real life projects.
# -----------------------------------------------
# Just a log helper
log = (args...) ->
console.log.apply console, args if console.log?
# ------------------------------- DROP DOWN MENUS
$(".options dt, .users dt").live "click", (e) ->
e.preventDefault()
if $(e.target).parent().hasClass("opened")
$(e.target).parent().removeClass("opened")
else
$(e.target).parent().addClass("opened")
$(document).one "click", ->
$(e.target).parent().removeClass("opened")
false
# --------------------------------- EDIT IN PLACE
$.fn.editInPlace = (method, options...) ->
this.each ->
methods =
# public methods
init: (options) ->
valid = (e) =>
newValue = @input.val()
options.onChange.call(options.context, newValue)
cancel = (e) =>
@el.show()
@input.hide()
@el = $(this).dblclick(methods.edit)
@input = $("<input type='text' />")
.insertBefore(@el)
.keyup (e) ->
switch(e.keyCode)
# Enter key
when 13 then $(this).blur()
# Escape key
when 27 then cancel(e)
.blur(valid)
.hide()
edit: ->
@input
.val(@el.text())
.show()
.focus()
.select()
@el.hide()
close: (newName) ->
@el.text(newName).show()
@input.hide()
# jQuery approach: http://docs.jquery.com/Plugins/Authoring
if ( methods[method] )
return methods[ method ].apply(this, options)
else if (typeof method == 'object')
return methods.init.call(this, method)
else
$.error("Method " + method + " does not exist.")
# ---------------------------------------- DRAWER
class Drawer extends Backbone.View
initialize: ->
$("#newGroup").click @addGroup
# HTML is our model
@el.children("li").each (i,group) ->
new Group
el: $(group)
$("li",group).each (i,project) ->
new Project
el: $(project)
addGroup: ->
jsRoutes.controllers.Projects.addGroup().ajax
success: (data) ->
_view = new Group
el: $(data).appendTo("#projects")
_view.el.find(".groupName").editInPlace("edit")
error: (err) ->
# TODO: Deal with
# ---------------------------------------- GROUPS
class Group extends Backbone.View
events:
"click .toggle" : "toggle"
"click .newProject" : "newProject"
"click .deleteGroup" : "deleteGroup"
initialize: ->
@id = @el.attr("data-group")
@name = $(".groupName", @el).editInPlace
context: this
onChange: @renameGroup
newProject: (e) ->
e.preventDefault()
@el.removeClass("closed")
jsRoutes.controllers.Projects.add().ajax
context: this
data:
group: @el.attr("data-group")
success: (tpl) ->
_list = $("ul",@el)
_view = new Project
el: $(tpl).appendTo(_list)
_view.el.find(".name").editInPlace("edit")
error: (err) ->
$.error("Error: " + err)
deleteGroup: (e) ->
e.preventDefault()
false if (!confirm "Remove group and projects inside?")
id = @el.attr("data-group-id")
@loading(true)
jsRoutes.controllers.Projects.deleteGroup(@id).ajax
context: this
success: ->
@el.remove()
@loading(false)
error: (err) ->
@loading(false)
$.error("Error: " + err)
renameGroup: (name) =>
@loading(true)
jsRoutes.controllers.Projects.renameGroup(@id).ajax
context: this
data:
name: <NAME>
success: (data) ->
@loading(false)
@name.editInPlace("close", data)
@el.attr("data-group", data)
@id = @el.attr("data-group")
error: (err) ->
@loading(false)
$.error("Error: " + err)
toggle: (e) ->
e.preventDefault()
@el.toggleClass("closed")
false
loading: (display) ->
if (display)
@el.children(".options").hide()
@el.children(".loader").show()
else
@el.children(".options").show()
@el.children(".loader").hide()
# --------------------------------------- PROJECT
class Project extends Backbone.View
events:
"click .delete" : "deleteProject"
initialize: ->
@id = @el.attr("data-project")
@name = $(".name", @el).editInPlace
context: this
onChange: @renameProject
renameProject: (name) ->
@loading(true)
jsRoutes.controllers.Projects.rename(@id).ajax
context: this
data:
name: name
success: (data) ->
@loading(false)
@name.editInPlace("close", data)
error: (err) ->
@loading(false)
$.error("Error: " + err)
deleteProject: (e) ->
e.preventDefault()
@loading(true)
jsRoutes.controllers.Projects.delete(@id).ajax
context: this
success: ->
@el.remove()
@loading(false)
error: (err) ->
@loading(false)
$.error("Error: " + err)
false
loading: (display) ->
if (display)
@el.children(".delete").hide()
@el.children(".loader").show()
else
@el.children(".delete").show()
@el.children(".loader").hide()
# ---------------------------------------- ROUTER
class AppRouter extends Backbone.Router
initialize: ->
@currentApp = new Tasks
el: $("#main")
routes:
"" : "index"
"/projects/:project/tasks" : "tasks"
index: ->
# show dashboard
$("#main").load "/ #main"
tasks: (project) ->
# load project || display app
currentApp = @currentApp
$("#main").load "/projects/" + project + "/tasks", (tpl) ->
currentApp.render(project)
# ----------------------------------------- TASKS
class Tasks extends Backbone.View
events:
"click .newFolder" : "newFolder"
"click .list .action" : "removeUser"
"click .addUserList .action" : "addUser"
render: (project) ->
@project = project
# HTML is our model
@folders = $.map $(".folder", @el), (folder) =>
new TaskFolder
el: $(folder)
project: @project
newFolder: (e) ->
e.preventDefault()
jsRoutes.controllers.Tasks.addFolder(@project).ajax
context: this
success: (tpl) ->
newFolder = new TaskFolder
el: $(tpl).insertBefore(".newFolder")
project: @project
newFolder.el.find("header > h3").editInPlace("edit")
error: (err) ->
$.error("Error: " + err)
false
removeUser: (e) ->
e.preventDefault()
jsRoutes.controllers.Projects.removeUser(@project).ajax
context: this
data:
user: $(e.target).parent().data('user-id')
success: ->
$(e.target).parent().appendTo(".addUserList")
error: (err) ->
$.error("Error: " + err)
false
addUser: (e) ->
e.preventDefault()
jsRoutes.controllers.Projects.addUser(@project).ajax
context: this
data:
user: $(e.target).parent().data('user-id')
success: ->
$(e.target).parent().appendTo(".users .list")
error: (err) ->
$.error("Error: " + err)
false
# ---------------------------------- TASKS FOLDER
class TaskFolder extends Backbone.View
events:
"click .deleteCompleteTasks" : "deleteCompleteTasks"
"click .deleteAllTasks" : "deleteAllTasks"
"click .deleteFolder" : "deleteFolder"
"change header>input" : "toggleAll"
"submit .addTask" : "newTask"
initialize: (options) =>
@project = options.project
@tasks = $.map $(".list li",@el), (item)=>
newTask = new TaskItem
el: $(item)
folder: @
newTask.bind("change", @refreshCount)
newTask.bind("delete", @deleteTask)
@counter = @el.find(".counter")
@id = @el.attr("data-folder-id")
@name = $("header > h3", @el).editInPlace
context: this
onChange: @renameFolder
@refreshCount()
newTask: (e) =>
e.preventDefault()
$(document).focus() # temporary disable form
form = $(e.target)
taskBody = $("input[name=taskBody]", form).val()
url = form.attr("action")
jsRoutes.controllers.Tasks.add(@project, @id).ajax
url: url
type: "POST"
context: this
data:
title: $("input[name=taskBody]", form).val()
dueDate: $("input[name=dueDate]", form).val()
assignedTo: $("input[name=assignedTo]", form).val()
success: (tpl) ->
newTask = new TaskItem(el: $(tpl), folder: @)
@el.find("ul").append(newTask.el)
@tasks.push(newTask)
form.find("input[type=text]").val("").first().focus()
error: (err) ->
alert "Something went wrong:" + err
false
renameFolder: (name) =>
@loading(true)
jsRoutes.controllers.Tasks.renameFolder(@project, @id).ajax
context: this
data:
name: name
success: (data) ->
@loading(false)
@name.editInPlace("close", data)
@el.attr("data-folder-id", data)
@id = @el.attr("data-folder-id")
error: (err) ->
@loading(false)
$.error("Error: " + err)
deleteCompleteTasks: (e) =>
e.preventDefault()
$.each @tasks, (i, item) ->
item.deleteTask() if item.el.find(".done:checked").length > 0
true
false
deleteAllTasks: (e) =>
e.preventDefault()
$.each @tasks, (i, item)->
item.deleteTask()
true
false
deleteFolder: (e) =>
e.preventDefault()
@el.remove()
false
toggleAll: (e) =>
val = $(e.target).is(":checked")
$.each @tasks, (i, item) ->
item.toggle(val)
true
refreshCount: =>
count = @tasks.filter((item)->
item.el.find(".done:checked").length == 0
).length
@counter.text(count)
deleteTask: (task) =>
@tasks = _.without @tasks, tasks
@refreshCount()
loading: (display) ->
if (display)
@el.find("header .options").hide()
@el.find("header .loader").show()
else
@el.find("header .options").show()
@el.find("header .loader").hide()
# ------------------------------------- TASK ITEM
class TaskItem extends Backbone.View
events:
"change .done" : "onToggle"
"click .deleteTask" : "deleteTask"
"dblclick h4" : "editTask"
initialize: (options) ->
@check = @el.find(".done")
@id = @el.attr("data-task-id")
@folder = options.folder
deleteTask: (e) =>
e.preventDefault() if e?
@loading(false)
jsRoutes.controllers.Tasks.delete(@id).ajax
context: this
data:
name: name
success: (data) ->
@loading(false)
@el.remove()
@trigger("delete", @)
error: (err) ->
@loading(false)
$.error("Error: " + err)
false
editTask: (e) =>
e.preventDefault()
# TODO
alert "not implemented yet."
false
toggle: (val) =>
@loading(true)
jsRoutes.controllers.Tasks.update(@id).ajax
context: this
data:
done: val
success: (data) ->
@loading(false)
@check.attr("checked",val)
@trigger("change", @)
error: (err) ->
@loading(false)
$.error("Error: " + err)
onToggle: (e) =>
e.preventDefault()
val = @check.is(":checked")
log val
@toggle(val)
false
loading: (display) ->
if (display)
@el.find(".delete").hide()
@el.find(".loader").show()
else
@el.find(".delete").show()
@el.find(".loader").hide()
# ------------------------------------- INIT APP
$ -> # document is ready!
app = new AppRouter()
drawer = new Drawer el: $("#projects")
Backbone.history.start
pushHistory: true
| true | # -----------------------------------------------
# MAIN
# -----------------------------------------------
# DISCLAMER :
# If you're used to Backbone.js, you may be
# confused by the absence of models, but the goal
# of this sample is to demonstrate some features
# of Play including the template engine.
# I'm not using client-side templating nor models
# for this purpose, and I do not recommend this
# behavior for real life projects.
# -----------------------------------------------
# Just a log helper
log = (args...) ->
console.log.apply console, args if console.log?
# ------------------------------- DROP DOWN MENUS
$(".options dt, .users dt").live "click", (e) ->
e.preventDefault()
if $(e.target).parent().hasClass("opened")
$(e.target).parent().removeClass("opened")
else
$(e.target).parent().addClass("opened")
$(document).one "click", ->
$(e.target).parent().removeClass("opened")
false
# --------------------------------- EDIT IN PLACE
$.fn.editInPlace = (method, options...) ->
this.each ->
methods =
# public methods
init: (options) ->
valid = (e) =>
newValue = @input.val()
options.onChange.call(options.context, newValue)
cancel = (e) =>
@el.show()
@input.hide()
@el = $(this).dblclick(methods.edit)
@input = $("<input type='text' />")
.insertBefore(@el)
.keyup (e) ->
switch(e.keyCode)
# Enter key
when 13 then $(this).blur()
# Escape key
when 27 then cancel(e)
.blur(valid)
.hide()
edit: ->
@input
.val(@el.text())
.show()
.focus()
.select()
@el.hide()
close: (newName) ->
@el.text(newName).show()
@input.hide()
# jQuery approach: http://docs.jquery.com/Plugins/Authoring
if ( methods[method] )
return methods[ method ].apply(this, options)
else if (typeof method == 'object')
return methods.init.call(this, method)
else
$.error("Method " + method + " does not exist.")
# ---------------------------------------- DRAWER
class Drawer extends Backbone.View
initialize: ->
$("#newGroup").click @addGroup
# HTML is our model
@el.children("li").each (i,group) ->
new Group
el: $(group)
$("li",group).each (i,project) ->
new Project
el: $(project)
addGroup: ->
jsRoutes.controllers.Projects.addGroup().ajax
success: (data) ->
_view = new Group
el: $(data).appendTo("#projects")
_view.el.find(".groupName").editInPlace("edit")
error: (err) ->
# TODO: Deal with
# ---------------------------------------- GROUPS
class Group extends Backbone.View
events:
"click .toggle" : "toggle"
"click .newProject" : "newProject"
"click .deleteGroup" : "deleteGroup"
initialize: ->
@id = @el.attr("data-group")
@name = $(".groupName", @el).editInPlace
context: this
onChange: @renameGroup
newProject: (e) ->
e.preventDefault()
@el.removeClass("closed")
jsRoutes.controllers.Projects.add().ajax
context: this
data:
group: @el.attr("data-group")
success: (tpl) ->
_list = $("ul",@el)
_view = new Project
el: $(tpl).appendTo(_list)
_view.el.find(".name").editInPlace("edit")
error: (err) ->
$.error("Error: " + err)
deleteGroup: (e) ->
e.preventDefault()
false if (!confirm "Remove group and projects inside?")
id = @el.attr("data-group-id")
@loading(true)
jsRoutes.controllers.Projects.deleteGroup(@id).ajax
context: this
success: ->
@el.remove()
@loading(false)
error: (err) ->
@loading(false)
$.error("Error: " + err)
renameGroup: (name) =>
@loading(true)
jsRoutes.controllers.Projects.renameGroup(@id).ajax
context: this
data:
name: PI:NAME:<NAME>END_PI
success: (data) ->
@loading(false)
@name.editInPlace("close", data)
@el.attr("data-group", data)
@id = @el.attr("data-group")
error: (err) ->
@loading(false)
$.error("Error: " + err)
toggle: (e) ->
e.preventDefault()
@el.toggleClass("closed")
false
loading: (display) ->
if (display)
@el.children(".options").hide()
@el.children(".loader").show()
else
@el.children(".options").show()
@el.children(".loader").hide()
# --------------------------------------- PROJECT
class Project extends Backbone.View
events:
"click .delete" : "deleteProject"
initialize: ->
@id = @el.attr("data-project")
@name = $(".name", @el).editInPlace
context: this
onChange: @renameProject
renameProject: (name) ->
@loading(true)
jsRoutes.controllers.Projects.rename(@id).ajax
context: this
data:
name: name
success: (data) ->
@loading(false)
@name.editInPlace("close", data)
error: (err) ->
@loading(false)
$.error("Error: " + err)
deleteProject: (e) ->
e.preventDefault()
@loading(true)
jsRoutes.controllers.Projects.delete(@id).ajax
context: this
success: ->
@el.remove()
@loading(false)
error: (err) ->
@loading(false)
$.error("Error: " + err)
false
loading: (display) ->
if (display)
@el.children(".delete").hide()
@el.children(".loader").show()
else
@el.children(".delete").show()
@el.children(".loader").hide()
# ---------------------------------------- ROUTER
class AppRouter extends Backbone.Router
initialize: ->
@currentApp = new Tasks
el: $("#main")
routes:
"" : "index"
"/projects/:project/tasks" : "tasks"
index: ->
# show dashboard
$("#main").load "/ #main"
tasks: (project) ->
# load project || display app
currentApp = @currentApp
$("#main").load "/projects/" + project + "/tasks", (tpl) ->
currentApp.render(project)
# ----------------------------------------- TASKS
class Tasks extends Backbone.View
events:
"click .newFolder" : "newFolder"
"click .list .action" : "removeUser"
"click .addUserList .action" : "addUser"
render: (project) ->
@project = project
# HTML is our model
@folders = $.map $(".folder", @el), (folder) =>
new TaskFolder
el: $(folder)
project: @project
newFolder: (e) ->
e.preventDefault()
jsRoutes.controllers.Tasks.addFolder(@project).ajax
context: this
success: (tpl) ->
newFolder = new TaskFolder
el: $(tpl).insertBefore(".newFolder")
project: @project
newFolder.el.find("header > h3").editInPlace("edit")
error: (err) ->
$.error("Error: " + err)
false
removeUser: (e) ->
e.preventDefault()
jsRoutes.controllers.Projects.removeUser(@project).ajax
context: this
data:
user: $(e.target).parent().data('user-id')
success: ->
$(e.target).parent().appendTo(".addUserList")
error: (err) ->
$.error("Error: " + err)
false
addUser: (e) ->
e.preventDefault()
jsRoutes.controllers.Projects.addUser(@project).ajax
context: this
data:
user: $(e.target).parent().data('user-id')
success: ->
$(e.target).parent().appendTo(".users .list")
error: (err) ->
$.error("Error: " + err)
false
# ---------------------------------- TASKS FOLDER
class TaskFolder extends Backbone.View
events:
"click .deleteCompleteTasks" : "deleteCompleteTasks"
"click .deleteAllTasks" : "deleteAllTasks"
"click .deleteFolder" : "deleteFolder"
"change header>input" : "toggleAll"
"submit .addTask" : "newTask"
initialize: (options) =>
@project = options.project
@tasks = $.map $(".list li",@el), (item)=>
newTask = new TaskItem
el: $(item)
folder: @
newTask.bind("change", @refreshCount)
newTask.bind("delete", @deleteTask)
@counter = @el.find(".counter")
@id = @el.attr("data-folder-id")
@name = $("header > h3", @el).editInPlace
context: this
onChange: @renameFolder
@refreshCount()
newTask: (e) =>
e.preventDefault()
$(document).focus() # temporary disable form
form = $(e.target)
taskBody = $("input[name=taskBody]", form).val()
url = form.attr("action")
jsRoutes.controllers.Tasks.add(@project, @id).ajax
url: url
type: "POST"
context: this
data:
title: $("input[name=taskBody]", form).val()
dueDate: $("input[name=dueDate]", form).val()
assignedTo: $("input[name=assignedTo]", form).val()
success: (tpl) ->
newTask = new TaskItem(el: $(tpl), folder: @)
@el.find("ul").append(newTask.el)
@tasks.push(newTask)
form.find("input[type=text]").val("").first().focus()
error: (err) ->
alert "Something went wrong:" + err
false
renameFolder: (name) =>
@loading(true)
jsRoutes.controllers.Tasks.renameFolder(@project, @id).ajax
context: this
data:
name: name
success: (data) ->
@loading(false)
@name.editInPlace("close", data)
@el.attr("data-folder-id", data)
@id = @el.attr("data-folder-id")
error: (err) ->
@loading(false)
$.error("Error: " + err)
deleteCompleteTasks: (e) =>
e.preventDefault()
$.each @tasks, (i, item) ->
item.deleteTask() if item.el.find(".done:checked").length > 0
true
false
deleteAllTasks: (e) =>
e.preventDefault()
$.each @tasks, (i, item)->
item.deleteTask()
true
false
deleteFolder: (e) =>
e.preventDefault()
@el.remove()
false
toggleAll: (e) =>
val = $(e.target).is(":checked")
$.each @tasks, (i, item) ->
item.toggle(val)
true
refreshCount: =>
count = @tasks.filter((item)->
item.el.find(".done:checked").length == 0
).length
@counter.text(count)
deleteTask: (task) =>
@tasks = _.without @tasks, tasks
@refreshCount()
loading: (display) ->
if (display)
@el.find("header .options").hide()
@el.find("header .loader").show()
else
@el.find("header .options").show()
@el.find("header .loader").hide()
# ------------------------------------- TASK ITEM
class TaskItem extends Backbone.View
events:
"change .done" : "onToggle"
"click .deleteTask" : "deleteTask"
"dblclick h4" : "editTask"
initialize: (options) ->
@check = @el.find(".done")
@id = @el.attr("data-task-id")
@folder = options.folder
deleteTask: (e) =>
e.preventDefault() if e?
@loading(false)
jsRoutes.controllers.Tasks.delete(@id).ajax
context: this
data:
name: name
success: (data) ->
@loading(false)
@el.remove()
@trigger("delete", @)
error: (err) ->
@loading(false)
$.error("Error: " + err)
false
editTask: (e) =>
e.preventDefault()
# TODO
alert "not implemented yet."
false
toggle: (val) =>
@loading(true)
jsRoutes.controllers.Tasks.update(@id).ajax
context: this
data:
done: val
success: (data) ->
@loading(false)
@check.attr("checked",val)
@trigger("change", @)
error: (err) ->
@loading(false)
$.error("Error: " + err)
onToggle: (e) =>
e.preventDefault()
val = @check.is(":checked")
log val
@toggle(val)
false
loading: (display) ->
if (display)
@el.find(".delete").hide()
@el.find(".loader").show()
else
@el.find(".delete").show()
@el.find(".loader").hide()
# ------------------------------------- INIT APP
$ -> # document is ready!
app = new AppRouter()
drawer = new Drawer el: $("#projects")
Backbone.history.start
pushHistory: true
|
[
{
"context": "\" \n else if d.name is \"Storage\"\n return \"assets/i",
"end": 17504,
"score": 0.8343694806098938,
"start": 17497,
"tag": "NAME",
"value": "Storage"
}
] | v2.5/src/app/controllers/rsaController.coffee | sharonlucong/compass-intel-rsa-dist | 0 | define(['./baseController'], ()->
'use strict';
angular.module('compass.controllers')
.controller 'rsaCtrl', ['$scope', 'rsaService','$timeout', 'rsaFactory', '$rootScope'
($scope, rsaService, $timeout, rsaFactory, $rootScope) ->
$scope.selectPod = (podid) ->
$scope.showRacks = false
$scope.type = ""
$scope.noRacks = false
$scope.show = false
$scope.showPieChart = false
$scope.podID = podid
rsaFactory.setPodId(podid)
$scope.podpromisecompleted = false
rsaService.getPodRacks($scope, podid).then(->
$scope.podpromisecompleted = true
if !$scope.racks[0]
$scope.noRacks = true
else
$scope.rackid = $scope.racks[0].id
$scope.noRacks = false
$rootScope.$broadcast('setActiveTab', $scope.rackid)
rsaService.getRackDrawers($scope, $scope.racks[0].id)
rsaService.getRackThermalZones($scope, $scope.racks[0].id)
rsaService.getRackPowerZones($scope, $scope.racks[0].id)
rsaService.getAllChartsData($scope, $scope.racks[0].id).then(->
$scope.showPieChart = true
))
$timeout(()->
if !$scope.racks[0]
$scope.showRacks = false
$scope.noRacks = true
else
$scope.showRacks = true
$scope.noRacks = false
, 3000)
#initialization
rsaService.getRSAManagers($scope).then(->
$scope.selectPod(1)
$scope.rackid = 1
)
]
.controller 'rackCtrl', ['$scope', 'rsaService','rsaFactory', '$timeout'
($scope, rsaService, rsaFactory, $timeout) ->
tabClasses = []
$scope.pieStorageData = [
{key: "One",y: 3},
{key: "Two",y: 7}
]
$scope.pieCPUData = [
{key: "One",y: 4},
{key: "Two",y: 6}
]
$scope.pieMemoryData = [
{key: "One",y: 5},
{key: "Two",y: 5}
]
$scope.getTabClass = (tabNum) ->
return tabClasses[tabNum]
$scope.getTabPaneClass = (tabNum) ->
return "tab-pane " + tabClasses[tabNum]
#initialization
tabClasses[1] = "active"
$scope.getTabClass(1)
$scope.getTabPaneClass(1)
$scope.showRackDetails = true
$scope.$on('setActiveTab', (event, arg)->
$scope.setActiveTab(arg)
)
$scope.setActiveTab = (tabNum) ->
$scope.type = ""
$scope.showRackDetails = false
$scope.show = false
$scope.showPieChart = false
$scope.rackid = tabNum
rsaService.getRackDrawers($scope, tabNum)
rsaService.getRackThermalZones($scope, tabNum)
rsaService.getRackPowerZones($scope, tabNum)
rsaService.getAllChartsData($scope, tabNum).then(->
$scope.showPieChart = true
)
tabClasses = []
tabClasses[tabNum] = "active"
$timeout(()->
$scope.showRackDetails = true
, 3000)
$scope.width = 500
$scope.height = 500
$scope.pieColor = ['#6898ce', '#73b9e6']
$scope.xFunction = ()->
return (d)->
return d.key
$scope.yFunction = ()->
return (d)->
return d.y
$scope.descriptionFunction = ()->
return (d)->
return d.key
$scope.colors = () ->
return $scope.pieColor
$scope.show = false
$scope.showChart = (showType, id)->
$scope.isFinishLoading = false
$scope.type = showType
$scope.show = !$scope.show
if $scope.show is false
$scope.$apply()
if showType is "drawer"
$scope.drawerid = id
else if showType is "thermal"
$scope.thermalid = id
else if showType is "power"
$scope.powerid = id
]
.controller 'chartCtrl', ['$scope','rsaService', '$timeout', 'rsaFactory', '$window'
($scope, rsaService, $timeout, rsaFactory, $window) ->
$scope.render = (data) ->
d3.selectAll('.chart').selectAll("*").remove()
svg = d3.selectAll('.chart')
.append("svg")
.attr("width", '650px')
.style("margin-left", '130px')
w = 650;
h = 600;
x = d3.scale.linear().range([0, w])
y = d3.scale.linear().range([0, h])
color = d3.scale.ordinal().range(["#0D3A6E", "#045A8D", "#0570B0","#3690C0", "#74A9CF","#4586B6","#68A9D4"])
vis = svg.attr("height", h)
partition = d3.layout.partition()
.value((d)->
return d.size
)
kx = w / data.dx
ky = h / 1
dataset = []
clickChild = false
click = (d) ->
if !d.children
return
if !d.parent and !clickChild
$scope.$parent.showChart()
clickChild = true
if !d.parent
clickChild = false
if d.y then kx = (w-40) / (1-d.y) else kx = w/(1-d.y)
ky = h / d.dx
if d.y then l=40 else l=0
x.domain([d.y, 1]).range([l, w])
y.domain([d.x, d.x + d.dx])
if d3.event.altKey then dur = 7500 else dur = 750
t = g.transition()
.duration(dur)
.attr("transform", (d)->
return "translate(" + x(d.y) + "," + y(d.x) + ")"
)
t.select("rect")
.attr("width", d.dy * kx)
.attr("height", (d)->
return d.dx * ky
)
t.selectAll("image")
.style("opacity", (d)->
if d.dx*ky >37
return 1
else
return 0
)
t.selectAll("text")
.attr("dy", (d)->
if d.dx*ky > 50
if d.name is "Processors"
return "1em"
else if d.name is "Memories"
return "2%"
else
return ".35em"
else
return ".35em"
)
.style("opacity", (d)->
if d.dx*ky > 30
return 1
else
return 0
)
d3.selectAll('.helper').remove()
g.append('foreignObject')
.attr('x', 10)
.attr('y', (d)->
if d.name in ["Processors","Memories"]
return 80
else
return 20
)
.attr('width', (d)->
if d.name in ["Processors","Memories"]
return 200
else
return 180
)
.attr('height', (d)->
if d.name in ["Processors","Memories"]
if d.dx*ky > 30
return 300
if !d.children
if d.dx * ky > 30
return 100
)
.attr('class','helper')
.append("xhtml:div")
.style("opacity", (d)->
if !d.children
if d.dx * ky > 50
return 1
else
return 0
else
if d.dx*ky > 130
return 1
else
return 0
)
.html((d,i)->
str = ""
if !d.children
if d.details
if d.details.component_uuid
str = "<div style='color:white;font-size:12px'><span>"+"uuid: </span><p>" + d.details.component_uuid+"</p></div>"
if d.name in ["Processors", "Memories"]
if d.children[0]
for commonkey, commonval of d.children[0].details
if commonkey in ["processor_model", "processor_family", "processor_architecture", "processor_manufacture", "processor_cores", "processor_frequency", "memory_module_type", "memory_module_capacity"]
str += "<div style='color:white; font-size:12px;'>"+ commonkey+ ": "+ commonval+"</div>"
return str
)
.on("mouseover", (d)->
if !d.parent
d3.select(this)
.style("fill", "#048D7E")
if !d.children
xPos = 0
yPos = 0
dataset = []
dataset.push("name: " + d.name)
for key of d.details
if d.details.hasOwnProperty(key)
dataset.push(key + ": " + d.details[key])
d3.select('#tooltip')
.style("top", 200 + "px")
.select("#tooltip ul")
.selectAll("li")
.data(dataset)
.enter()
.append("li")
.text((dt)->
return dt
)
d3.select("#tooltip").classed("hidden", false)
)
d3.event.stopPropagation()
g = vis.selectAll("g")
.data(partition.nodes(data))
.enter().append("g")
.attr("transform", (d)->
return "translate(" + x(d.y) + "," + y(d.x) + ")"
)
.on("click", click)
kx = w / data.dx
ky = h / 1
g.append("rect")
.attr("width", data.dy * kx)
.attr("height", (d)->
return d.dx * ky
)
.attr("rx", 5)
.attr("ry", 5)
.style("fill", (d,i)->
if d.children
return color(d.name)
else
return d.parent.name
)
.attr("class", (d)->
if d.children
return "parent"
else
return "child"
)
.on("mouseover", (d)->
if !d.parent
d3.select(this)
.style("fill", "#048D7E")
if !d.children
xPos = 0
yPos = 0
dataset = []
dataset.push("name: " + d.name)
for key of d.details
if d.details.hasOwnProperty(key)
dataset.push(key + ": " + d.details[key])
d3.select('#tooltip')
.style("top", 200 + "px")
.select("#tooltip ul")
.selectAll("li")
.data(dataset)
.enter()
.append("li")
.text((dt)->
return dt
)
d3.select("#tooltip").classed("hidden", false)
)
.on("mouseout", (d)->
if !d.parent
d3.select(this)
.style("fill", "#0D3A6E")
d3.selectAll("#tooltip li").remove()
d3.select("#tooltip").classed("hidden", true)
)
g.append("image")
.attr("xlink:href", (d)->
if !d.name
return ""
else if d.name is "Processors"
return "assets/img/processor_icon.png"
else if d.name is "Memories"
return "assets/img/memory_icon.png"
else if d.name.match(/Disc-([0-9]|[1-9][0-9])/)
return "assets/img/storage_icon.png"
else if d.name.match(/Thermal\sZone\s([0-9]|[1-9][0-9])/)
return "assets/img/thermal_icon.png"
else if d.name.match(/Power\sZone\s([0-9]|[1-9][0-9])/)
return "assets/img/power_icon.png"
else if d.name is "Storage"
return "assets/img/storage_icon.png"
else if !d.child
if d.name.match(/fan\s([0-9]|[1-9][0-9])/)
return "assets/img/fan_icon.png"
else if d.name.match(/psu\s([0-9]|[1-9][0-9])/)
return "assets/img/powerunit_icon.png"
else
return ""
else
return ""
)
.attr("transform", (d)->
if !d.name
return "translate(0,0)"
if d.name.match(/Power\sZone\s([0-9]|[1-9][0-9])/) or d.name.match(/Thermal\sZone\s([0-9]|[1-9][0-9])/)
return "translate(8," + d.dx * ky / 2.2 + ")"
else
return "translate(8," + d.dx * ky / 3 + ")"
)
.attr("width", (d)->
if d.name is "Memories" or "Processors" or "Storage"
return 30
else
return 40
)
.attr("height", (d)->
if d.name is "Memories" or "Processors" or "Storage"
return 30
else
return 40
)
.style("opacity", (d)->
if d.dx * ky > 37
return 1
else
return 0
)
g.append("text")
.attr("transform", (d)->
return "translate(60," + d.dx * ky / 2 + ")"
)
.attr("dy", ".35em")
.attr("fill", "white")
.style("opacity", (d)->
if d.dx * ky > 12
return 1
else
return 0
)
.text((d)->
if !d.parent
return d.name + " " + "\u21D0"
else
return d.name
)
if $scope.$parent.type is "drawer"
rsaService.getRackDrawerDetails($scope, $scope.$parent.drawerid).then(->
$scope.$parent.isFinishLoading = true
return $scope.render($scope.drawerData))
else if $scope.$parent.type is "power"
rsaService.getRackPowerZonesSupplyUnits($scope, $scope.$parent.rackid, $scope.$parent.powerid).then(->
return $scope.render($scope.powerData))
else if $scope.$parent.type is "thermal"
rsaService.getRackThermalZonesFans($scope, $scope.$parent.rackid, $scope.$parent.thermalid).then(->
return $scope.render($scope.thermalData))
]
)
| 10335 | define(['./baseController'], ()->
'use strict';
angular.module('compass.controllers')
.controller 'rsaCtrl', ['$scope', 'rsaService','$timeout', 'rsaFactory', '$rootScope'
($scope, rsaService, $timeout, rsaFactory, $rootScope) ->
$scope.selectPod = (podid) ->
$scope.showRacks = false
$scope.type = ""
$scope.noRacks = false
$scope.show = false
$scope.showPieChart = false
$scope.podID = podid
rsaFactory.setPodId(podid)
$scope.podpromisecompleted = false
rsaService.getPodRacks($scope, podid).then(->
$scope.podpromisecompleted = true
if !$scope.racks[0]
$scope.noRacks = true
else
$scope.rackid = $scope.racks[0].id
$scope.noRacks = false
$rootScope.$broadcast('setActiveTab', $scope.rackid)
rsaService.getRackDrawers($scope, $scope.racks[0].id)
rsaService.getRackThermalZones($scope, $scope.racks[0].id)
rsaService.getRackPowerZones($scope, $scope.racks[0].id)
rsaService.getAllChartsData($scope, $scope.racks[0].id).then(->
$scope.showPieChart = true
))
$timeout(()->
if !$scope.racks[0]
$scope.showRacks = false
$scope.noRacks = true
else
$scope.showRacks = true
$scope.noRacks = false
, 3000)
#initialization
rsaService.getRSAManagers($scope).then(->
$scope.selectPod(1)
$scope.rackid = 1
)
]
.controller 'rackCtrl', ['$scope', 'rsaService','rsaFactory', '$timeout'
($scope, rsaService, rsaFactory, $timeout) ->
tabClasses = []
$scope.pieStorageData = [
{key: "One",y: 3},
{key: "Two",y: 7}
]
$scope.pieCPUData = [
{key: "One",y: 4},
{key: "Two",y: 6}
]
$scope.pieMemoryData = [
{key: "One",y: 5},
{key: "Two",y: 5}
]
$scope.getTabClass = (tabNum) ->
return tabClasses[tabNum]
$scope.getTabPaneClass = (tabNum) ->
return "tab-pane " + tabClasses[tabNum]
#initialization
tabClasses[1] = "active"
$scope.getTabClass(1)
$scope.getTabPaneClass(1)
$scope.showRackDetails = true
$scope.$on('setActiveTab', (event, arg)->
$scope.setActiveTab(arg)
)
$scope.setActiveTab = (tabNum) ->
$scope.type = ""
$scope.showRackDetails = false
$scope.show = false
$scope.showPieChart = false
$scope.rackid = tabNum
rsaService.getRackDrawers($scope, tabNum)
rsaService.getRackThermalZones($scope, tabNum)
rsaService.getRackPowerZones($scope, tabNum)
rsaService.getAllChartsData($scope, tabNum).then(->
$scope.showPieChart = true
)
tabClasses = []
tabClasses[tabNum] = "active"
$timeout(()->
$scope.showRackDetails = true
, 3000)
$scope.width = 500
$scope.height = 500
$scope.pieColor = ['#6898ce', '#73b9e6']
$scope.xFunction = ()->
return (d)->
return d.key
$scope.yFunction = ()->
return (d)->
return d.y
$scope.descriptionFunction = ()->
return (d)->
return d.key
$scope.colors = () ->
return $scope.pieColor
$scope.show = false
$scope.showChart = (showType, id)->
$scope.isFinishLoading = false
$scope.type = showType
$scope.show = !$scope.show
if $scope.show is false
$scope.$apply()
if showType is "drawer"
$scope.drawerid = id
else if showType is "thermal"
$scope.thermalid = id
else if showType is "power"
$scope.powerid = id
]
.controller 'chartCtrl', ['$scope','rsaService', '$timeout', 'rsaFactory', '$window'
($scope, rsaService, $timeout, rsaFactory, $window) ->
$scope.render = (data) ->
d3.selectAll('.chart').selectAll("*").remove()
svg = d3.selectAll('.chart')
.append("svg")
.attr("width", '650px')
.style("margin-left", '130px')
w = 650;
h = 600;
x = d3.scale.linear().range([0, w])
y = d3.scale.linear().range([0, h])
color = d3.scale.ordinal().range(["#0D3A6E", "#045A8D", "#0570B0","#3690C0", "#74A9CF","#4586B6","#68A9D4"])
vis = svg.attr("height", h)
partition = d3.layout.partition()
.value((d)->
return d.size
)
kx = w / data.dx
ky = h / 1
dataset = []
clickChild = false
click = (d) ->
if !d.children
return
if !d.parent and !clickChild
$scope.$parent.showChart()
clickChild = true
if !d.parent
clickChild = false
if d.y then kx = (w-40) / (1-d.y) else kx = w/(1-d.y)
ky = h / d.dx
if d.y then l=40 else l=0
x.domain([d.y, 1]).range([l, w])
y.domain([d.x, d.x + d.dx])
if d3.event.altKey then dur = 7500 else dur = 750
t = g.transition()
.duration(dur)
.attr("transform", (d)->
return "translate(" + x(d.y) + "," + y(d.x) + ")"
)
t.select("rect")
.attr("width", d.dy * kx)
.attr("height", (d)->
return d.dx * ky
)
t.selectAll("image")
.style("opacity", (d)->
if d.dx*ky >37
return 1
else
return 0
)
t.selectAll("text")
.attr("dy", (d)->
if d.dx*ky > 50
if d.name is "Processors"
return "1em"
else if d.name is "Memories"
return "2%"
else
return ".35em"
else
return ".35em"
)
.style("opacity", (d)->
if d.dx*ky > 30
return 1
else
return 0
)
d3.selectAll('.helper').remove()
g.append('foreignObject')
.attr('x', 10)
.attr('y', (d)->
if d.name in ["Processors","Memories"]
return 80
else
return 20
)
.attr('width', (d)->
if d.name in ["Processors","Memories"]
return 200
else
return 180
)
.attr('height', (d)->
if d.name in ["Processors","Memories"]
if d.dx*ky > 30
return 300
if !d.children
if d.dx * ky > 30
return 100
)
.attr('class','helper')
.append("xhtml:div")
.style("opacity", (d)->
if !d.children
if d.dx * ky > 50
return 1
else
return 0
else
if d.dx*ky > 130
return 1
else
return 0
)
.html((d,i)->
str = ""
if !d.children
if d.details
if d.details.component_uuid
str = "<div style='color:white;font-size:12px'><span>"+"uuid: </span><p>" + d.details.component_uuid+"</p></div>"
if d.name in ["Processors", "Memories"]
if d.children[0]
for commonkey, commonval of d.children[0].details
if commonkey in ["processor_model", "processor_family", "processor_architecture", "processor_manufacture", "processor_cores", "processor_frequency", "memory_module_type", "memory_module_capacity"]
str += "<div style='color:white; font-size:12px;'>"+ commonkey+ ": "+ commonval+"</div>"
return str
)
.on("mouseover", (d)->
if !d.parent
d3.select(this)
.style("fill", "#048D7E")
if !d.children
xPos = 0
yPos = 0
dataset = []
dataset.push("name: " + d.name)
for key of d.details
if d.details.hasOwnProperty(key)
dataset.push(key + ": " + d.details[key])
d3.select('#tooltip')
.style("top", 200 + "px")
.select("#tooltip ul")
.selectAll("li")
.data(dataset)
.enter()
.append("li")
.text((dt)->
return dt
)
d3.select("#tooltip").classed("hidden", false)
)
d3.event.stopPropagation()
g = vis.selectAll("g")
.data(partition.nodes(data))
.enter().append("g")
.attr("transform", (d)->
return "translate(" + x(d.y) + "," + y(d.x) + ")"
)
.on("click", click)
kx = w / data.dx
ky = h / 1
g.append("rect")
.attr("width", data.dy * kx)
.attr("height", (d)->
return d.dx * ky
)
.attr("rx", 5)
.attr("ry", 5)
.style("fill", (d,i)->
if d.children
return color(d.name)
else
return d.parent.name
)
.attr("class", (d)->
if d.children
return "parent"
else
return "child"
)
.on("mouseover", (d)->
if !d.parent
d3.select(this)
.style("fill", "#048D7E")
if !d.children
xPos = 0
yPos = 0
dataset = []
dataset.push("name: " + d.name)
for key of d.details
if d.details.hasOwnProperty(key)
dataset.push(key + ": " + d.details[key])
d3.select('#tooltip')
.style("top", 200 + "px")
.select("#tooltip ul")
.selectAll("li")
.data(dataset)
.enter()
.append("li")
.text((dt)->
return dt
)
d3.select("#tooltip").classed("hidden", false)
)
.on("mouseout", (d)->
if !d.parent
d3.select(this)
.style("fill", "#0D3A6E")
d3.selectAll("#tooltip li").remove()
d3.select("#tooltip").classed("hidden", true)
)
g.append("image")
.attr("xlink:href", (d)->
if !d.name
return ""
else if d.name is "Processors"
return "assets/img/processor_icon.png"
else if d.name is "Memories"
return "assets/img/memory_icon.png"
else if d.name.match(/Disc-([0-9]|[1-9][0-9])/)
return "assets/img/storage_icon.png"
else if d.name.match(/Thermal\sZone\s([0-9]|[1-9][0-9])/)
return "assets/img/thermal_icon.png"
else if d.name.match(/Power\sZone\s([0-9]|[1-9][0-9])/)
return "assets/img/power_icon.png"
else if d.name is "<NAME>"
return "assets/img/storage_icon.png"
else if !d.child
if d.name.match(/fan\s([0-9]|[1-9][0-9])/)
return "assets/img/fan_icon.png"
else if d.name.match(/psu\s([0-9]|[1-9][0-9])/)
return "assets/img/powerunit_icon.png"
else
return ""
else
return ""
)
.attr("transform", (d)->
if !d.name
return "translate(0,0)"
if d.name.match(/Power\sZone\s([0-9]|[1-9][0-9])/) or d.name.match(/Thermal\sZone\s([0-9]|[1-9][0-9])/)
return "translate(8," + d.dx * ky / 2.2 + ")"
else
return "translate(8," + d.dx * ky / 3 + ")"
)
.attr("width", (d)->
if d.name is "Memories" or "Processors" or "Storage"
return 30
else
return 40
)
.attr("height", (d)->
if d.name is "Memories" or "Processors" or "Storage"
return 30
else
return 40
)
.style("opacity", (d)->
if d.dx * ky > 37
return 1
else
return 0
)
g.append("text")
.attr("transform", (d)->
return "translate(60," + d.dx * ky / 2 + ")"
)
.attr("dy", ".35em")
.attr("fill", "white")
.style("opacity", (d)->
if d.dx * ky > 12
return 1
else
return 0
)
.text((d)->
if !d.parent
return d.name + " " + "\u21D0"
else
return d.name
)
if $scope.$parent.type is "drawer"
rsaService.getRackDrawerDetails($scope, $scope.$parent.drawerid).then(->
$scope.$parent.isFinishLoading = true
return $scope.render($scope.drawerData))
else if $scope.$parent.type is "power"
rsaService.getRackPowerZonesSupplyUnits($scope, $scope.$parent.rackid, $scope.$parent.powerid).then(->
return $scope.render($scope.powerData))
else if $scope.$parent.type is "thermal"
rsaService.getRackThermalZonesFans($scope, $scope.$parent.rackid, $scope.$parent.thermalid).then(->
return $scope.render($scope.thermalData))
]
)
| true | define(['./baseController'], ()->
'use strict';
angular.module('compass.controllers')
.controller 'rsaCtrl', ['$scope', 'rsaService','$timeout', 'rsaFactory', '$rootScope'
($scope, rsaService, $timeout, rsaFactory, $rootScope) ->
$scope.selectPod = (podid) ->
$scope.showRacks = false
$scope.type = ""
$scope.noRacks = false
$scope.show = false
$scope.showPieChart = false
$scope.podID = podid
rsaFactory.setPodId(podid)
$scope.podpromisecompleted = false
rsaService.getPodRacks($scope, podid).then(->
$scope.podpromisecompleted = true
if !$scope.racks[0]
$scope.noRacks = true
else
$scope.rackid = $scope.racks[0].id
$scope.noRacks = false
$rootScope.$broadcast('setActiveTab', $scope.rackid)
rsaService.getRackDrawers($scope, $scope.racks[0].id)
rsaService.getRackThermalZones($scope, $scope.racks[0].id)
rsaService.getRackPowerZones($scope, $scope.racks[0].id)
rsaService.getAllChartsData($scope, $scope.racks[0].id).then(->
$scope.showPieChart = true
))
$timeout(()->
if !$scope.racks[0]
$scope.showRacks = false
$scope.noRacks = true
else
$scope.showRacks = true
$scope.noRacks = false
, 3000)
#initialization
rsaService.getRSAManagers($scope).then(->
$scope.selectPod(1)
$scope.rackid = 1
)
]
.controller 'rackCtrl', ['$scope', 'rsaService','rsaFactory', '$timeout'
($scope, rsaService, rsaFactory, $timeout) ->
tabClasses = []
$scope.pieStorageData = [
{key: "One",y: 3},
{key: "Two",y: 7}
]
$scope.pieCPUData = [
{key: "One",y: 4},
{key: "Two",y: 6}
]
$scope.pieMemoryData = [
{key: "One",y: 5},
{key: "Two",y: 5}
]
$scope.getTabClass = (tabNum) ->
return tabClasses[tabNum]
$scope.getTabPaneClass = (tabNum) ->
return "tab-pane " + tabClasses[tabNum]
#initialization
tabClasses[1] = "active"
$scope.getTabClass(1)
$scope.getTabPaneClass(1)
$scope.showRackDetails = true
$scope.$on('setActiveTab', (event, arg)->
$scope.setActiveTab(arg)
)
$scope.setActiveTab = (tabNum) ->
$scope.type = ""
$scope.showRackDetails = false
$scope.show = false
$scope.showPieChart = false
$scope.rackid = tabNum
rsaService.getRackDrawers($scope, tabNum)
rsaService.getRackThermalZones($scope, tabNum)
rsaService.getRackPowerZones($scope, tabNum)
rsaService.getAllChartsData($scope, tabNum).then(->
$scope.showPieChart = true
)
tabClasses = []
tabClasses[tabNum] = "active"
$timeout(()->
$scope.showRackDetails = true
, 3000)
$scope.width = 500
$scope.height = 500
$scope.pieColor = ['#6898ce', '#73b9e6']
$scope.xFunction = ()->
return (d)->
return d.key
$scope.yFunction = ()->
return (d)->
return d.y
$scope.descriptionFunction = ()->
return (d)->
return d.key
$scope.colors = () ->
return $scope.pieColor
$scope.show = false
$scope.showChart = (showType, id)->
$scope.isFinishLoading = false
$scope.type = showType
$scope.show = !$scope.show
if $scope.show is false
$scope.$apply()
if showType is "drawer"
$scope.drawerid = id
else if showType is "thermal"
$scope.thermalid = id
else if showType is "power"
$scope.powerid = id
]
.controller 'chartCtrl', ['$scope','rsaService', '$timeout', 'rsaFactory', '$window'
($scope, rsaService, $timeout, rsaFactory, $window) ->
$scope.render = (data) ->
d3.selectAll('.chart').selectAll("*").remove()
svg = d3.selectAll('.chart')
.append("svg")
.attr("width", '650px')
.style("margin-left", '130px')
w = 650;
h = 600;
x = d3.scale.linear().range([0, w])
y = d3.scale.linear().range([0, h])
color = d3.scale.ordinal().range(["#0D3A6E", "#045A8D", "#0570B0","#3690C0", "#74A9CF","#4586B6","#68A9D4"])
vis = svg.attr("height", h)
partition = d3.layout.partition()
.value((d)->
return d.size
)
kx = w / data.dx
ky = h / 1
dataset = []
clickChild = false
click = (d) ->
if !d.children
return
if !d.parent and !clickChild
$scope.$parent.showChart()
clickChild = true
if !d.parent
clickChild = false
if d.y then kx = (w-40) / (1-d.y) else kx = w/(1-d.y)
ky = h / d.dx
if d.y then l=40 else l=0
x.domain([d.y, 1]).range([l, w])
y.domain([d.x, d.x + d.dx])
if d3.event.altKey then dur = 7500 else dur = 750
t = g.transition()
.duration(dur)
.attr("transform", (d)->
return "translate(" + x(d.y) + "," + y(d.x) + ")"
)
t.select("rect")
.attr("width", d.dy * kx)
.attr("height", (d)->
return d.dx * ky
)
t.selectAll("image")
.style("opacity", (d)->
if d.dx*ky >37
return 1
else
return 0
)
t.selectAll("text")
.attr("dy", (d)->
if d.dx*ky > 50
if d.name is "Processors"
return "1em"
else if d.name is "Memories"
return "2%"
else
return ".35em"
else
return ".35em"
)
.style("opacity", (d)->
if d.dx*ky > 30
return 1
else
return 0
)
d3.selectAll('.helper').remove()
g.append('foreignObject')
.attr('x', 10)
.attr('y', (d)->
if d.name in ["Processors","Memories"]
return 80
else
return 20
)
.attr('width', (d)->
if d.name in ["Processors","Memories"]
return 200
else
return 180
)
.attr('height', (d)->
if d.name in ["Processors","Memories"]
if d.dx*ky > 30
return 300
if !d.children
if d.dx * ky > 30
return 100
)
.attr('class','helper')
.append("xhtml:div")
.style("opacity", (d)->
if !d.children
if d.dx * ky > 50
return 1
else
return 0
else
if d.dx*ky > 130
return 1
else
return 0
)
.html((d,i)->
str = ""
if !d.children
if d.details
if d.details.component_uuid
str = "<div style='color:white;font-size:12px'><span>"+"uuid: </span><p>" + d.details.component_uuid+"</p></div>"
if d.name in ["Processors", "Memories"]
if d.children[0]
for commonkey, commonval of d.children[0].details
if commonkey in ["processor_model", "processor_family", "processor_architecture", "processor_manufacture", "processor_cores", "processor_frequency", "memory_module_type", "memory_module_capacity"]
str += "<div style='color:white; font-size:12px;'>"+ commonkey+ ": "+ commonval+"</div>"
return str
)
.on("mouseover", (d)->
if !d.parent
d3.select(this)
.style("fill", "#048D7E")
if !d.children
xPos = 0
yPos = 0
dataset = []
dataset.push("name: " + d.name)
for key of d.details
if d.details.hasOwnProperty(key)
dataset.push(key + ": " + d.details[key])
d3.select('#tooltip')
.style("top", 200 + "px")
.select("#tooltip ul")
.selectAll("li")
.data(dataset)
.enter()
.append("li")
.text((dt)->
return dt
)
d3.select("#tooltip").classed("hidden", false)
)
d3.event.stopPropagation()
g = vis.selectAll("g")
.data(partition.nodes(data))
.enter().append("g")
.attr("transform", (d)->
return "translate(" + x(d.y) + "," + y(d.x) + ")"
)
.on("click", click)
kx = w / data.dx
ky = h / 1
g.append("rect")
.attr("width", data.dy * kx)
.attr("height", (d)->
return d.dx * ky
)
.attr("rx", 5)
.attr("ry", 5)
.style("fill", (d,i)->
if d.children
return color(d.name)
else
return d.parent.name
)
.attr("class", (d)->
if d.children
return "parent"
else
return "child"
)
.on("mouseover", (d)->
if !d.parent
d3.select(this)
.style("fill", "#048D7E")
if !d.children
xPos = 0
yPos = 0
dataset = []
dataset.push("name: " + d.name)
for key of d.details
if d.details.hasOwnProperty(key)
dataset.push(key + ": " + d.details[key])
d3.select('#tooltip')
.style("top", 200 + "px")
.select("#tooltip ul")
.selectAll("li")
.data(dataset)
.enter()
.append("li")
.text((dt)->
return dt
)
d3.select("#tooltip").classed("hidden", false)
)
.on("mouseout", (d)->
if !d.parent
d3.select(this)
.style("fill", "#0D3A6E")
d3.selectAll("#tooltip li").remove()
d3.select("#tooltip").classed("hidden", true)
)
g.append("image")
.attr("xlink:href", (d)->
if !d.name
return ""
else if d.name is "Processors"
return "assets/img/processor_icon.png"
else if d.name is "Memories"
return "assets/img/memory_icon.png"
else if d.name.match(/Disc-([0-9]|[1-9][0-9])/)
return "assets/img/storage_icon.png"
else if d.name.match(/Thermal\sZone\s([0-9]|[1-9][0-9])/)
return "assets/img/thermal_icon.png"
else if d.name.match(/Power\sZone\s([0-9]|[1-9][0-9])/)
return "assets/img/power_icon.png"
else if d.name is "PI:NAME:<NAME>END_PI"
return "assets/img/storage_icon.png"
else if !d.child
if d.name.match(/fan\s([0-9]|[1-9][0-9])/)
return "assets/img/fan_icon.png"
else if d.name.match(/psu\s([0-9]|[1-9][0-9])/)
return "assets/img/powerunit_icon.png"
else
return ""
else
return ""
)
.attr("transform", (d)->
if !d.name
return "translate(0,0)"
if d.name.match(/Power\sZone\s([0-9]|[1-9][0-9])/) or d.name.match(/Thermal\sZone\s([0-9]|[1-9][0-9])/)
return "translate(8," + d.dx * ky / 2.2 + ")"
else
return "translate(8," + d.dx * ky / 3 + ")"
)
.attr("width", (d)->
if d.name is "Memories" or "Processors" or "Storage"
return 30
else
return 40
)
.attr("height", (d)->
if d.name is "Memories" or "Processors" or "Storage"
return 30
else
return 40
)
.style("opacity", (d)->
if d.dx * ky > 37
return 1
else
return 0
)
g.append("text")
.attr("transform", (d)->
return "translate(60," + d.dx * ky / 2 + ")"
)
.attr("dy", ".35em")
.attr("fill", "white")
.style("opacity", (d)->
if d.dx * ky > 12
return 1
else
return 0
)
.text((d)->
if !d.parent
return d.name + " " + "\u21D0"
else
return d.name
)
if $scope.$parent.type is "drawer"
rsaService.getRackDrawerDetails($scope, $scope.$parent.drawerid).then(->
$scope.$parent.isFinishLoading = true
return $scope.render($scope.drawerData))
else if $scope.$parent.type is "power"
rsaService.getRackPowerZonesSupplyUnits($scope, $scope.$parent.rackid, $scope.$parent.powerid).then(->
return $scope.render($scope.powerData))
else if $scope.$parent.type is "thermal"
rsaService.getRackThermalZonesFans($scope, $scope.$parent.rackid, $scope.$parent.thermalid).then(->
return $scope.render($scope.thermalData))
]
)
|
[
{
"context": "data structure based on a Red-Black Tree\n @author Mads Hartmann Jensen (mads379@gmail.com)\n###\n\nmugs.provide('mugs.TreeS",
"end": 131,
"score": 0.9998659491539001,
"start": 111,
"tag": "NAME",
"value": "Mads Hartmann Jensen"
},
{
"context": " a Red-Black Tree\n @author Mads Hartmann Jensen (mads379@gmail.com)\n###\n\nmugs.provide('mugs.TreeSet')\n\nmugs.require(",
"end": 150,
"score": 0.9999312162399292,
"start": 133,
"tag": "EMAIL",
"value": "mads379@gmail.com"
}
] | src/TreeSet.coffee | mads-hartmann/mugs | 1 | ###*
@fileoverview Contains the implementation of the Set data structure based on a Red-Black Tree
@author Mads Hartmann Jensen (mads379@gmail.com)
###
mugs.provide('mugs.TreeSet')
mugs.require('mugs.RedBlackLeaf')
mugs.require('mugs.RedBlackNode')
mugs.require("mugs.Indexed")
###*
mugs.TreeSet provides the implementation of the abstract data type Set based on a Red Black Tree. The
TreeSet contains the following operations
<pre>
insert(key,value) O(log n)
get(index) O(n) (TODO: can be greatly improved)
remove(index) O(log n)
keys() O(n)
values() O(n)
isEmpty() O(1)
forEach(f) O(n*O(f))
update O(n)
removeAt O(n)
first O(1)
last O(n)
head O(1)
tail O(log n)
foldLeft(seed)(f) O(n*O(f))
foldRight(seed)(f) O(n*O(f))
</pre>
@public
@augments mugs.Indexed
@class mugs.TreeSet provides the implementation of the abstract data type Set based on a Red Black Tree
@param items An array of items to construct the LLRBSet from
@param comparator A comparator function that can compare the keys (optional). Will use a
default comparator if no comparator is given. The default one uses the
< and > operators.
###
mugs.TreeSet = (items,comparator) ->
treeUnderConstruction = new mugs.RedBlackLeaf(mugs.RedBlack.BLACK,comparator)
if items instanceof Array and items.length > 0
for item in items
treeUnderConstruction = treeUnderConstruction.insert(item, item)
this.tree = treeUnderConstruction
else
this.tree = new mugs.RedBlackLeaf(mugs.RedBlack.BLACK)
this.tree.comparator = comparator if comparator?
this
mugs.TreeSet.prototype = new mugs.Indexed()
###*
The elements of the set
@return {List} A list containing all the element of the set
###
mugs.TreeSet.prototype.values = () ->
this.tree.values()
###*
Used to construct a TreeMap from mugs.RedBlackTree. This is intended
for internal use only. Would've marked it private if I could.
@private
###
mugs.TreeSet.prototype.buildFromTree = (tree) ->
set = new mugs.TreeSet([], this.comparator)
set.tree = tree
set
###
---------------------------------------------------------------------------------------------
Collection prototype
---------------------------------------------------------------------------------------------
###
###*
@private
###
mugs.TreeSet.prototype.buildFromArray = (arr) ->
new mugs.TreeSet(arr, this.comparator)
###*
Applies function 'f' on each value in the set. This return nothing and is only invoked
for the side-effects of f.
@param f The unary function to apply on each element in the set.
@see mugs.Collection
###
mugs.TreeSet.prototype.forEach = ( f ) ->
# the tree that the set is based on stores key-value pair on each node so we only
# have to apply the function on the key and then just return that value.
q = (kv) ->
newValue = f(kv.key)
{ key: newValue, value: newValue }
this.tree.inorderTraversal( q )
###*
Checks if the collection is empty
@return true if the collection is empty, otherwise false
###
mugs.TreeSet.prototype.isEmpty = () ->
this.tree.isEmpty()
###*
Tests if the set contains the element
@param element The element to check for
###
mugs.TreeSet.prototype.contains = ( element ) ->
this.tree.containsKey( element )
###
---------------------------------------------------------------------------------------------
Extensible interface
---------------------------------------------------------------------------------------------
###
###*
Insert an element in the set. If the set already contains an element equal to the given value,
it is replaced with the new value.
@param item The element to insert into the set
###
mugs.TreeSet.prototype.insert = ( item ) ->
this.buildFromTree(this.tree.insert(item,item))
###*
Delete an element from the set
@param item The element to remove from the set
###
mugs.TreeSet.prototype.remove = ( item ) ->
this.buildFromTree(this.tree.remove(item))
###
---------------------------------------------------------------------------------------------
Indexed interface
---------------------------------------------------------------------------------------------
###
###*
Returns an mugs.Option with the value at the given index if it exists, otherwise mugs.None
@param index The index of the item to get.
@return An mugs.Option with the value at the given index if it exists, otherwise mugs.None
###
mugs.TreeSet.prototype.get = ( index ) ->
this.tree.atIndex(index)
###*
Update the value at a given index.
@param index The index of the item to update
@param item The new item to store at the given index
@return A new collection with the value at the given index updated.
###
mugs.TreeSet.prototype.update = (index, item) ->
itm = this.get(index)
this.buildFromTree(this.tree.insert(itm,item))
###*
Returns a new collection without the item at the given index
@param index the index of the item to remove from the collection.
@return A new collection without the item at the given index
###
mugs.TreeSet.prototype.removeAt = (index) ->
itm = this.get(index).get()
this.buildFromTree(this.tree.remove(itm))
###*
Return the first item in the collection wrapped in mugs.Some if the collection is non-empty,
otherwise a mugs.None.
@return The first item in the collection wrapped in mugs.Some if the collection is non-empty,
otherwise a mugs.None.
###
mugs.TreeSet.prototype.first = () ->
this.get(0)
###*
Return the tail of the collection.
@return The tail of the collection
###
mugs.TreeSet.prototype.tail = () ->
this.removeAt(0)
###*
Return the last item in the collection wrapped in mugs.Some if the collection is non-empty,
otherwise a mugs.None.
@return The last item in the collection wrapped in mugs.Some if the collection is non-empty,
otherwise a mugs.None.
###
mugs.TreeSet.prototype.last = () ->
this.get(this.size()-1)
###*
Return the head of the collection wrapped in mugs.Some if the collection is non-empty,
otherwise a mugs.None. Is the equivalent to first.
@return The head of the collection wrapped in mugs.Some if the collection is non-empty,
otherwise a mugs.None.
###
mugs.TreeSet.prototype.head = () ->
this.get(0).get()
###*
Applies a binary operator on all items of this collection going left to right and ending with the
seed value. This is a curried function that takes a seed value which returns a function that
takes a function which will then be applied to the items. The function is binary where
the first parameter is the value of the fold so far and the second is the current item.
@param {*} seed The value to use when the collection is empty
@return {function(function(*, *):*):*} A function which takes a binary function
###
mugs.TreeSet.prototype.foldLeft = (seed) -> (f) =>
this.tree.values().foldLeft(seed)(f)
###*
Applies a binary operator on all items of this collection going right to left and ending with the
seed value. This is a curried function that takes a seed value which returns a function that
takes a function which will then be applied to the items. The function is binary where
the first parameter is the value of the fold so far and the second is the current item.
@param {*} seed The value to use when the collection is empty
@return {function(function(*, *):*):*} A function which takes a binary function
###
mugs.TreeSet.prototype.foldRight = (seed) -> (f) =>
this.tree.values().foldRight(seed)(f)
| 173723 | ###*
@fileoverview Contains the implementation of the Set data structure based on a Red-Black Tree
@author <NAME> (<EMAIL>)
###
mugs.provide('mugs.TreeSet')
mugs.require('mugs.RedBlackLeaf')
mugs.require('mugs.RedBlackNode')
mugs.require("mugs.Indexed")
###*
mugs.TreeSet provides the implementation of the abstract data type Set based on a Red Black Tree. The
TreeSet contains the following operations
<pre>
insert(key,value) O(log n)
get(index) O(n) (TODO: can be greatly improved)
remove(index) O(log n)
keys() O(n)
values() O(n)
isEmpty() O(1)
forEach(f) O(n*O(f))
update O(n)
removeAt O(n)
first O(1)
last O(n)
head O(1)
tail O(log n)
foldLeft(seed)(f) O(n*O(f))
foldRight(seed)(f) O(n*O(f))
</pre>
@public
@augments mugs.Indexed
@class mugs.TreeSet provides the implementation of the abstract data type Set based on a Red Black Tree
@param items An array of items to construct the LLRBSet from
@param comparator A comparator function that can compare the keys (optional). Will use a
default comparator if no comparator is given. The default one uses the
< and > operators.
###
mugs.TreeSet = (items,comparator) ->
treeUnderConstruction = new mugs.RedBlackLeaf(mugs.RedBlack.BLACK,comparator)
if items instanceof Array and items.length > 0
for item in items
treeUnderConstruction = treeUnderConstruction.insert(item, item)
this.tree = treeUnderConstruction
else
this.tree = new mugs.RedBlackLeaf(mugs.RedBlack.BLACK)
this.tree.comparator = comparator if comparator?
this
mugs.TreeSet.prototype = new mugs.Indexed()
###*
The elements of the set
@return {List} A list containing all the element of the set
###
mugs.TreeSet.prototype.values = () ->
this.tree.values()
###*
Used to construct a TreeMap from mugs.RedBlackTree. This is intended
for internal use only. Would've marked it private if I could.
@private
###
mugs.TreeSet.prototype.buildFromTree = (tree) ->
set = new mugs.TreeSet([], this.comparator)
set.tree = tree
set
###
---------------------------------------------------------------------------------------------
Collection prototype
---------------------------------------------------------------------------------------------
###
###*
@private
###
mugs.TreeSet.prototype.buildFromArray = (arr) ->
new mugs.TreeSet(arr, this.comparator)
###*
Applies function 'f' on each value in the set. This return nothing and is only invoked
for the side-effects of f.
@param f The unary function to apply on each element in the set.
@see mugs.Collection
###
mugs.TreeSet.prototype.forEach = ( f ) ->
# the tree that the set is based on stores key-value pair on each node so we only
# have to apply the function on the key and then just return that value.
q = (kv) ->
newValue = f(kv.key)
{ key: newValue, value: newValue }
this.tree.inorderTraversal( q )
###*
Checks if the collection is empty
@return true if the collection is empty, otherwise false
###
mugs.TreeSet.prototype.isEmpty = () ->
this.tree.isEmpty()
###*
Tests if the set contains the element
@param element The element to check for
###
mugs.TreeSet.prototype.contains = ( element ) ->
this.tree.containsKey( element )
###
---------------------------------------------------------------------------------------------
Extensible interface
---------------------------------------------------------------------------------------------
###
###*
Insert an element in the set. If the set already contains an element equal to the given value,
it is replaced with the new value.
@param item The element to insert into the set
###
mugs.TreeSet.prototype.insert = ( item ) ->
this.buildFromTree(this.tree.insert(item,item))
###*
Delete an element from the set
@param item The element to remove from the set
###
mugs.TreeSet.prototype.remove = ( item ) ->
this.buildFromTree(this.tree.remove(item))
###
---------------------------------------------------------------------------------------------
Indexed interface
---------------------------------------------------------------------------------------------
###
###*
Returns an mugs.Option with the value at the given index if it exists, otherwise mugs.None
@param index The index of the item to get.
@return An mugs.Option with the value at the given index if it exists, otherwise mugs.None
###
mugs.TreeSet.prototype.get = ( index ) ->
this.tree.atIndex(index)
###*
Update the value at a given index.
@param index The index of the item to update
@param item The new item to store at the given index
@return A new collection with the value at the given index updated.
###
mugs.TreeSet.prototype.update = (index, item) ->
itm = this.get(index)
this.buildFromTree(this.tree.insert(itm,item))
###*
Returns a new collection without the item at the given index
@param index the index of the item to remove from the collection.
@return A new collection without the item at the given index
###
mugs.TreeSet.prototype.removeAt = (index) ->
itm = this.get(index).get()
this.buildFromTree(this.tree.remove(itm))
###*
Return the first item in the collection wrapped in mugs.Some if the collection is non-empty,
otherwise a mugs.None.
@return The first item in the collection wrapped in mugs.Some if the collection is non-empty,
otherwise a mugs.None.
###
mugs.TreeSet.prototype.first = () ->
this.get(0)
###*
Return the tail of the collection.
@return The tail of the collection
###
mugs.TreeSet.prototype.tail = () ->
this.removeAt(0)
###*
Return the last item in the collection wrapped in mugs.Some if the collection is non-empty,
otherwise a mugs.None.
@return The last item in the collection wrapped in mugs.Some if the collection is non-empty,
otherwise a mugs.None.
###
mugs.TreeSet.prototype.last = () ->
this.get(this.size()-1)
###*
Return the head of the collection wrapped in mugs.Some if the collection is non-empty,
otherwise a mugs.None. Is the equivalent to first.
@return The head of the collection wrapped in mugs.Some if the collection is non-empty,
otherwise a mugs.None.
###
mugs.TreeSet.prototype.head = () ->
this.get(0).get()
###*
Applies a binary operator on all items of this collection going left to right and ending with the
seed value. This is a curried function that takes a seed value which returns a function that
takes a function which will then be applied to the items. The function is binary where
the first parameter is the value of the fold so far and the second is the current item.
@param {*} seed The value to use when the collection is empty
@return {function(function(*, *):*):*} A function which takes a binary function
###
mugs.TreeSet.prototype.foldLeft = (seed) -> (f) =>
this.tree.values().foldLeft(seed)(f)
###*
Applies a binary operator on all items of this collection going right to left and ending with the
seed value. This is a curried function that takes a seed value which returns a function that
takes a function which will then be applied to the items. The function is binary where
the first parameter is the value of the fold so far and the second is the current item.
@param {*} seed The value to use when the collection is empty
@return {function(function(*, *):*):*} A function which takes a binary function
###
mugs.TreeSet.prototype.foldRight = (seed) -> (f) =>
this.tree.values().foldRight(seed)(f)
| true | ###*
@fileoverview Contains the implementation of the Set data structure based on a Red-Black Tree
@author PI:NAME:<NAME>END_PI (PI:EMAIL:<EMAIL>END_PI)
###
mugs.provide('mugs.TreeSet')
mugs.require('mugs.RedBlackLeaf')
mugs.require('mugs.RedBlackNode')
mugs.require("mugs.Indexed")
###*
mugs.TreeSet provides the implementation of the abstract data type Set based on a Red Black Tree. The
TreeSet contains the following operations
<pre>
insert(key,value) O(log n)
get(index) O(n) (TODO: can be greatly improved)
remove(index) O(log n)
keys() O(n)
values() O(n)
isEmpty() O(1)
forEach(f) O(n*O(f))
update O(n)
removeAt O(n)
first O(1)
last O(n)
head O(1)
tail O(log n)
foldLeft(seed)(f) O(n*O(f))
foldRight(seed)(f) O(n*O(f))
</pre>
@public
@augments mugs.Indexed
@class mugs.TreeSet provides the implementation of the abstract data type Set based on a Red Black Tree
@param items An array of items to construct the LLRBSet from
@param comparator A comparator function that can compare the keys (optional). Will use a
default comparator if no comparator is given. The default one uses the
< and > operators.
###
mugs.TreeSet = (items,comparator) ->
treeUnderConstruction = new mugs.RedBlackLeaf(mugs.RedBlack.BLACK,comparator)
if items instanceof Array and items.length > 0
for item in items
treeUnderConstruction = treeUnderConstruction.insert(item, item)
this.tree = treeUnderConstruction
else
this.tree = new mugs.RedBlackLeaf(mugs.RedBlack.BLACK)
this.tree.comparator = comparator if comparator?
this
mugs.TreeSet.prototype = new mugs.Indexed()
###*
The elements of the set
@return {List} A list containing all the element of the set
###
mugs.TreeSet.prototype.values = () ->
this.tree.values()
###*
Used to construct a TreeMap from mugs.RedBlackTree. This is intended
for internal use only. Would've marked it private if I could.
@private
###
mugs.TreeSet.prototype.buildFromTree = (tree) ->
set = new mugs.TreeSet([], this.comparator)
set.tree = tree
set
###
---------------------------------------------------------------------------------------------
Collection prototype
---------------------------------------------------------------------------------------------
###
###*
@private
###
mugs.TreeSet.prototype.buildFromArray = (arr) ->
new mugs.TreeSet(arr, this.comparator)
###*
Applies function 'f' on each value in the set. This return nothing and is only invoked
for the side-effects of f.
@param f The unary function to apply on each element in the set.
@see mugs.Collection
###
mugs.TreeSet.prototype.forEach = ( f ) ->
# the tree that the set is based on stores key-value pair on each node so we only
# have to apply the function on the key and then just return that value.
q = (kv) ->
newValue = f(kv.key)
{ key: newValue, value: newValue }
this.tree.inorderTraversal( q )
###*
Checks if the collection is empty
@return true if the collection is empty, otherwise false
###
mugs.TreeSet.prototype.isEmpty = () ->
this.tree.isEmpty()
###*
Tests if the set contains the element
@param element The element to check for
###
mugs.TreeSet.prototype.contains = ( element ) ->
this.tree.containsKey( element )
###
---------------------------------------------------------------------------------------------
Extensible interface
---------------------------------------------------------------------------------------------
###
###*
Insert an element in the set. If the set already contains an element equal to the given value,
it is replaced with the new value.
@param item The element to insert into the set
###
mugs.TreeSet.prototype.insert = ( item ) ->
this.buildFromTree(this.tree.insert(item,item))
###*
Delete an element from the set
@param item The element to remove from the set
###
mugs.TreeSet.prototype.remove = ( item ) ->
this.buildFromTree(this.tree.remove(item))
###
---------------------------------------------------------------------------------------------
Indexed interface
---------------------------------------------------------------------------------------------
###
###*
Returns an mugs.Option with the value at the given index if it exists, otherwise mugs.None
@param index The index of the item to get.
@return An mugs.Option with the value at the given index if it exists, otherwise mugs.None
###
mugs.TreeSet.prototype.get = ( index ) ->
this.tree.atIndex(index)
###*
Update the value at a given index.
@param index The index of the item to update
@param item The new item to store at the given index
@return A new collection with the value at the given index updated.
###
mugs.TreeSet.prototype.update = (index, item) ->
itm = this.get(index)
this.buildFromTree(this.tree.insert(itm,item))
###*
Returns a new collection without the item at the given index
@param index the index of the item to remove from the collection.
@return A new collection without the item at the given index
###
mugs.TreeSet.prototype.removeAt = (index) ->
itm = this.get(index).get()
this.buildFromTree(this.tree.remove(itm))
###*
Return the first item in the collection wrapped in mugs.Some if the collection is non-empty,
otherwise a mugs.None.
@return The first item in the collection wrapped in mugs.Some if the collection is non-empty,
otherwise a mugs.None.
###
mugs.TreeSet.prototype.first = () ->
this.get(0)
###*
Return the tail of the collection.
@return The tail of the collection
###
mugs.TreeSet.prototype.tail = () ->
this.removeAt(0)
###*
Return the last item in the collection wrapped in mugs.Some if the collection is non-empty,
otherwise a mugs.None.
@return The last item in the collection wrapped in mugs.Some if the collection is non-empty,
otherwise a mugs.None.
###
mugs.TreeSet.prototype.last = () ->
this.get(this.size()-1)
###*
Return the head of the collection wrapped in mugs.Some if the collection is non-empty,
otherwise a mugs.None. Is the equivalent to first.
@return The head of the collection wrapped in mugs.Some if the collection is non-empty,
otherwise a mugs.None.
###
mugs.TreeSet.prototype.head = () ->
this.get(0).get()
###*
Applies a binary operator on all items of this collection going left to right and ending with the
seed value. This is a curried function that takes a seed value which returns a function that
takes a function which will then be applied to the items. The function is binary where
the first parameter is the value of the fold so far and the second is the current item.
@param {*} seed The value to use when the collection is empty
@return {function(function(*, *):*):*} A function which takes a binary function
###
mugs.TreeSet.prototype.foldLeft = (seed) -> (f) =>
this.tree.values().foldLeft(seed)(f)
###*
Applies a binary operator on all items of this collection going right to left and ending with the
seed value. This is a curried function that takes a seed value which returns a function that
takes a function which will then be applied to the items. The function is binary where
the first parameter is the value of the fold so far and the second is the current item.
@param {*} seed The value to use when the collection is empty
@return {function(function(*, *):*):*} A function which takes a binary function
###
mugs.TreeSet.prototype.foldRight = (seed) -> (f) =>
this.tree.values().foldRight(seed)(f)
|
[
{
"context": "before ->\n @skip() if __globalTest.offline\n\n [Alice, Bob] = [null, null]\n # run this one as blocking",
"end": 597,
"score": 0.9982975125312805,
"start": 592,
"tag": "NAME",
"value": "Alice"
},
{
"context": " ->\n @skip() if __globalTest.offline\n\n [Alice, Bob] = [null, null]\n # run this one as blocking asyn",
"end": 602,
"score": 0.9971160888671875,
"start": 599,
"tag": "NAME",
"value": "Bob"
},
{
"context": "sts\n it 'get Server Token', ->\n\n MailBox.new('Alice').then (ret)->\n Alice = ret\n MailBox.ne",
"end": 749,
"score": 0.9995631575584412,
"start": 744,
"tag": "NAME",
"value": "Alice"
},
{
"context": "', ->\n\n MailBox.new('Alice').then (ret)->\n Alice = ret\n MailBox.new('Bob').then (ret)->\n ",
"end": 776,
"score": 0.9995189905166626,
"start": 771,
"tag": "NAME",
"value": "Alice"
},
{
"context": "then (ret)->\n Alice = ret\n MailBox.new('Bob').then (ret)->\n Bob = ret\n\n r = new",
"end": 805,
"score": 0.9995959401130676,
"start": 802,
"tag": "NAME",
"value": "Bob"
},
{
"context": " ret\n MailBox.new('Bob').then (ret)->\n Bob = ret\n\n r = new Relay(__globalTest.host)\n ",
"end": 832,
"score": 0.9990566372871399,
"start": 829,
"tag": "NAME",
"value": "Bob"
},
{
"context": "r.openConnection()\n\n it 'clear mailboxes', ->\n Alice.selfDestruct(true).then ->\n Bob.selfDestruct",
"end": 2224,
"score": 0.7592359781265259,
"start": 2219,
"tag": "NAME",
"value": "Alice"
},
{
"context": "es', ->\n Alice.selfDestruct(true).then ->\n Bob.selfDestruct(true)\n",
"end": 2261,
"score": 0.7861824631690979,
"start": 2258,
"tag": "NAME",
"value": "Bob"
}
] | tests/specs/05.relay.coffee | vault12/glow | 14 | # Copyright (c) 2015 Vault12, Inc.
# MIT License https://opensource.org/licenses/MIT
__CRYPTO_DEBUG = true # Expose #theglow objects as window globals
expect = require('chai').expect
Config = require 'config'
MailBox = require 'mailbox'
Nacl = require 'nacl'
Relay = require 'relay'
Utils = require 'utils'
# ----- Communication Relay: Start session -----
describe 'Relay Session', ->
return unless window.__globalTest.runTests['relay session']
@slow(window.__globalTest.slow)
@timeout(window.__globalTest.timeouts.long)
before ->
@skip() if __globalTest.offline
[Alice, Bob] = [null, null]
# run this one as blocking async to see if the relay is online for the tests
it 'get Server Token', ->
MailBox.new('Alice').then (ret)->
Alice = ret
MailBox.new('Bob').then (ret)->
Bob = ret
r = new Relay(__globalTest.host)
tm = Config.RELAY_TOKEN_TIMEOUT
Config.RELAY_TOKEN_TIMEOUT = 2
r.getServerToken().then ->
unless r.relayToken
window.__globalTest.offline = true
console.log "Local server offline: start relay at #{r.url}"
r.online.should.be.false
r.relayToken.should.not.be.null
r.clientToken.should.not.be.null
expect(r.relayKey).is.null
Utils.delay Config.RELAY_TOKEN_TIMEOUT + 5, ->
Config.RELAY_TOKEN_TIMEOUT = tm
r.online.should.be.false
expect(r.relayToken).is.null
expect(r.clientToken).is.null
it 'get session key', ->
r = new Relay(__globalTest.host)
r.openConnection().then ->
r.online.should.be.true
r.relayToken.should.not.be.null
r.clientToken.should.not.be.null
r.relayKey.should.not.be.null
it 'prove mailbox :hpk', ->
r = new Relay(__globalTest.host)
r.openConnection().then ->
r.connectMailbox(Alice).then ->
expect(Alice.sessionKeys).not.empty
it 'emits token timeout event', ->
rt = Config.RELAY_TOKEN_TIMEOUT
Config.RELAY_TOKEN_TIMEOUT = 10
r = new Relay(__globalTest.host)
r.on 'relaytokentimeout', ->
Config.RELAY_TOKEN_TIMEOUT = rt
r.openConnection()
it 'clear mailboxes', ->
Alice.selfDestruct(true).then ->
Bob.selfDestruct(true)
| 49183 | # Copyright (c) 2015 Vault12, Inc.
# MIT License https://opensource.org/licenses/MIT
__CRYPTO_DEBUG = true # Expose #theglow objects as window globals
expect = require('chai').expect
Config = require 'config'
MailBox = require 'mailbox'
Nacl = require 'nacl'
Relay = require 'relay'
Utils = require 'utils'
# ----- Communication Relay: Start session -----
describe 'Relay Session', ->
return unless window.__globalTest.runTests['relay session']
@slow(window.__globalTest.slow)
@timeout(window.__globalTest.timeouts.long)
before ->
@skip() if __globalTest.offline
[<NAME>, <NAME>] = [null, null]
# run this one as blocking async to see if the relay is online for the tests
it 'get Server Token', ->
MailBox.new('<NAME>').then (ret)->
<NAME> = ret
MailBox.new('<NAME>').then (ret)->
<NAME> = ret
r = new Relay(__globalTest.host)
tm = Config.RELAY_TOKEN_TIMEOUT
Config.RELAY_TOKEN_TIMEOUT = 2
r.getServerToken().then ->
unless r.relayToken
window.__globalTest.offline = true
console.log "Local server offline: start relay at #{r.url}"
r.online.should.be.false
r.relayToken.should.not.be.null
r.clientToken.should.not.be.null
expect(r.relayKey).is.null
Utils.delay Config.RELAY_TOKEN_TIMEOUT + 5, ->
Config.RELAY_TOKEN_TIMEOUT = tm
r.online.should.be.false
expect(r.relayToken).is.null
expect(r.clientToken).is.null
it 'get session key', ->
r = new Relay(__globalTest.host)
r.openConnection().then ->
r.online.should.be.true
r.relayToken.should.not.be.null
r.clientToken.should.not.be.null
r.relayKey.should.not.be.null
it 'prove mailbox :hpk', ->
r = new Relay(__globalTest.host)
r.openConnection().then ->
r.connectMailbox(Alice).then ->
expect(Alice.sessionKeys).not.empty
it 'emits token timeout event', ->
rt = Config.RELAY_TOKEN_TIMEOUT
Config.RELAY_TOKEN_TIMEOUT = 10
r = new Relay(__globalTest.host)
r.on 'relaytokentimeout', ->
Config.RELAY_TOKEN_TIMEOUT = rt
r.openConnection()
it 'clear mailboxes', ->
<NAME>.selfDestruct(true).then ->
<NAME>.selfDestruct(true)
| true | # Copyright (c) 2015 Vault12, Inc.
# MIT License https://opensource.org/licenses/MIT
__CRYPTO_DEBUG = true # Expose #theglow objects as window globals
expect = require('chai').expect
Config = require 'config'
MailBox = require 'mailbox'
Nacl = require 'nacl'
Relay = require 'relay'
Utils = require 'utils'
# ----- Communication Relay: Start session -----
describe 'Relay Session', ->
return unless window.__globalTest.runTests['relay session']
@slow(window.__globalTest.slow)
@timeout(window.__globalTest.timeouts.long)
before ->
@skip() if __globalTest.offline
[PI:NAME:<NAME>END_PI, PI:NAME:<NAME>END_PI] = [null, null]
# run this one as blocking async to see if the relay is online for the tests
it 'get Server Token', ->
MailBox.new('PI:NAME:<NAME>END_PI').then (ret)->
PI:NAME:<NAME>END_PI = ret
MailBox.new('PI:NAME:<NAME>END_PI').then (ret)->
PI:NAME:<NAME>END_PI = ret
r = new Relay(__globalTest.host)
tm = Config.RELAY_TOKEN_TIMEOUT
Config.RELAY_TOKEN_TIMEOUT = 2
r.getServerToken().then ->
unless r.relayToken
window.__globalTest.offline = true
console.log "Local server offline: start relay at #{r.url}"
r.online.should.be.false
r.relayToken.should.not.be.null
r.clientToken.should.not.be.null
expect(r.relayKey).is.null
Utils.delay Config.RELAY_TOKEN_TIMEOUT + 5, ->
Config.RELAY_TOKEN_TIMEOUT = tm
r.online.should.be.false
expect(r.relayToken).is.null
expect(r.clientToken).is.null
it 'get session key', ->
r = new Relay(__globalTest.host)
r.openConnection().then ->
r.online.should.be.true
r.relayToken.should.not.be.null
r.clientToken.should.not.be.null
r.relayKey.should.not.be.null
it 'prove mailbox :hpk', ->
r = new Relay(__globalTest.host)
r.openConnection().then ->
r.connectMailbox(Alice).then ->
expect(Alice.sessionKeys).not.empty
it 'emits token timeout event', ->
rt = Config.RELAY_TOKEN_TIMEOUT
Config.RELAY_TOKEN_TIMEOUT = 10
r = new Relay(__globalTest.host)
r.on 'relaytokentimeout', ->
Config.RELAY_TOKEN_TIMEOUT = rt
r.openConnection()
it 'clear mailboxes', ->
PI:NAME:<NAME>END_PI.selfDestruct(true).then ->
PI:NAME:<NAME>END_PI.selfDestruct(true)
|
[
{
"context": "window.nameData = [\n 'Bill Stevens',\n 'Bob Johnson',\n 'Steve Smith',\n 'Kevin Smit",
"end": 35,
"score": 0.9998796582221985,
"start": 23,
"tag": "NAME",
"value": "Bill Stevens"
},
{
"context": "window.nameData = [\n 'Bill Stevens',\n 'Bob Johnson',\n 'Steve Smith',\n 'Kevin Smith',\n 'Barry O\\'D",
"end": 52,
"score": 0.9998807907104492,
"start": 41,
"tag": "NAME",
"value": "Bob Johnson"
},
{
"context": "ameData = [\n 'Bill Stevens',\n 'Bob Johnson',\n 'Steve Smith',\n 'Kevin Smith',\n 'Barry O\\'Donnell',\n 'Kate ",
"end": 69,
"score": 0.9998624920845032,
"start": 58,
"tag": "NAME",
"value": "Steve Smith"
},
{
"context": "ll Stevens',\n 'Bob Johnson',\n 'Steve Smith',\n 'Kevin Smith',\n 'Barry O\\'Donnell',\n 'Kate Vera',\n 'Kelly M",
"end": 86,
"score": 0.9998669624328613,
"start": 75,
"tag": "NAME",
"value": "Kevin Smith"
},
{
"context": "ob Johnson',\n 'Steve Smith',\n 'Kevin Smith',\n 'Barry O\\'Donnell',\n 'Kate Vera',\n 'Kelly Mars',\n 'Susan Child',",
"end": 108,
"score": 0.9998863935470581,
"start": 92,
"tag": "NAME",
"value": "Barry O\\'Donnell"
},
{
"context": "Smith',\n 'Kevin Smith',\n 'Barry O\\'Donnell',\n 'Kate Vera',\n 'Kelly Mars',\n 'Susan Child',\n 'Karen Moore",
"end": 123,
"score": 0.9998910427093506,
"start": 114,
"tag": "NAME",
"value": "Kate Vera"
},
{
"context": "n Smith',\n 'Barry O\\'Donnell',\n 'Kate Vera',\n 'Kelly Mars',\n 'Susan Child',\n 'Karen Moore',\n 'Natalie Re",
"end": 139,
"score": 0.9998812675476074,
"start": 129,
"tag": "NAME",
"value": "Kelly Mars"
},
{
"context": "ry O\\'Donnell',\n 'Kate Vera',\n 'Kelly Mars',\n 'Susan Child',\n 'Karen Moore',\n 'Natalie Reynolds'\n]\nwindow.",
"end": 156,
"score": 0.9998855590820312,
"start": 145,
"tag": "NAME",
"value": "Susan Child"
},
{
"context": " 'Kate Vera',\n 'Kelly Mars',\n 'Susan Child',\n 'Karen Moore',\n 'Natalie Reynolds'\n]\nwindow.nameAndLocationDa",
"end": 173,
"score": 0.9998904466629028,
"start": 162,
"tag": "NAME",
"value": "Karen Moore"
},
{
"context": "Kelly Mars',\n 'Susan Child',\n 'Karen Moore',\n 'Natalie Reynolds'\n]\nwindow.nameAndLocationData = [\n {name: 'Bill ",
"end": 195,
"score": 0.9999001622200012,
"start": 179,
"tag": "NAME",
"value": "Natalie Reynolds"
},
{
"context": "nolds'\n]\nwindow.nameAndLocationData = [\n {name: 'Bill Stevens', location: 'New York'},\n {name: 'Bob Johnson', ",
"end": 252,
"score": 0.9998767971992493,
"start": 240,
"tag": "NAME",
"value": "Bill Stevens"
},
{
"context": " 'Bill Stevens', location: 'New York'},\n {name: 'Bob Johnson', location: 'London'},\n {name: 'Steve Smith', lo",
"end": 299,
"score": 0.9998648166656494,
"start": 288,
"tag": "NAME",
"value": "Bob Johnson"
},
{
"context": "me: 'Bob Johnson', location: 'London'},\n {name: 'Steve Smith', location: 'Cairo'},\n {name: 'Kevin Smith', loc",
"end": 344,
"score": 0.9998629689216614,
"start": 333,
"tag": "NAME",
"value": "Steve Smith"
},
{
"context": "ame: 'Steve Smith', location: 'Cairo'},\n {name: 'Kevin Smith', location: 'Moscow'},\n {name: 'Barry O\\'Donnell",
"end": 388,
"score": 0.9998674392700195,
"start": 377,
"tag": "NAME",
"value": "Kevin Smith"
},
{
"context": "me: 'Kevin Smith', location: 'Moscow'},\n {name: 'Barry O\\'Donnell', location: 'Tokyo'},\n {name: 'Kate Vera', locat",
"end": 438,
"score": 0.9998689293861389,
"start": 422,
"tag": "NAME",
"value": "Barry O\\'Donnell"
},
{
"context": "'Barry O\\'Donnell', location: 'Tokyo'},\n {name: 'Kate Vera', location: 'Paris'},\n {name: 'Kelly Mars', loca",
"end": 480,
"score": 0.9998661279678345,
"start": 471,
"tag": "NAME",
"value": "Kate Vera"
},
{
"context": "{name: 'Kate Vera', location: 'Paris'},\n {name: 'Kelly Mars', location: 'Barcelona'},\n {name: 'Susan Child',",
"end": 523,
"score": 0.9998792409896851,
"start": 513,
"tag": "NAME",
"value": "Kelly Mars"
},
{
"context": ": 'Kelly Mars', location: 'Barcelona'},\n {name: 'Susan Child', location: 'Sardinia'},\n {name: 'Karen Moore', ",
"end": 571,
"score": 0.9998626708984375,
"start": 560,
"tag": "NAME",
"value": "Susan Child"
},
{
"context": ": 'Susan Child', location: 'Sardinia'},\n {name: 'Karen Moore', location: 'Los Angeles'},\n {name: 'Natalie Rey",
"end": 618,
"score": 0.9998876452445984,
"start": 607,
"tag": "NAME",
"value": "Karen Moore"
},
{
"context": "Karen Moore', location: 'Los Angeles'},\n {name: 'Natalie Reynolds', location: 'Brazil'}\n]",
"end": 673,
"score": 0.9998936057090759,
"start": 657,
"tag": "NAME",
"value": "Natalie Reynolds"
}
] | docs/content/examples/auto-complete/examples/data.coffee | p-koscielniak/hexagonjs | 61 | window.nameData = [
'Bill Stevens',
'Bob Johnson',
'Steve Smith',
'Kevin Smith',
'Barry O\'Donnell',
'Kate Vera',
'Kelly Mars',
'Susan Child',
'Karen Moore',
'Natalie Reynolds'
]
window.nameAndLocationData = [
{name: 'Bill Stevens', location: 'New York'},
{name: 'Bob Johnson', location: 'London'},
{name: 'Steve Smith', location: 'Cairo'},
{name: 'Kevin Smith', location: 'Moscow'},
{name: 'Barry O\'Donnell', location: 'Tokyo'},
{name: 'Kate Vera', location: 'Paris'},
{name: 'Kelly Mars', location: 'Barcelona'},
{name: 'Susan Child', location: 'Sardinia'},
{name: 'Karen Moore', location: 'Los Angeles'},
{name: 'Natalie Reynolds', location: 'Brazil'}
] | 107205 | window.nameData = [
'<NAME>',
'<NAME>',
'<NAME>',
'<NAME>',
'<NAME>',
'<NAME>',
'<NAME>',
'<NAME>',
'<NAME>',
'<NAME>'
]
window.nameAndLocationData = [
{name: '<NAME>', location: 'New York'},
{name: '<NAME>', location: 'London'},
{name: '<NAME>', location: 'Cairo'},
{name: '<NAME>', location: 'Moscow'},
{name: '<NAME>', location: 'Tokyo'},
{name: '<NAME>', location: 'Paris'},
{name: '<NAME>', location: 'Barcelona'},
{name: '<NAME>', location: 'Sardinia'},
{name: '<NAME>', location: 'Los Angeles'},
{name: '<NAME>', location: 'Brazil'}
] | true | window.nameData = [
'PI:NAME:<NAME>END_PI',
'PI:NAME:<NAME>END_PI',
'PI:NAME:<NAME>END_PI',
'PI:NAME:<NAME>END_PI',
'PI:NAME:<NAME>END_PI',
'PI:NAME:<NAME>END_PI',
'PI:NAME:<NAME>END_PI',
'PI:NAME:<NAME>END_PI',
'PI:NAME:<NAME>END_PI',
'PI:NAME:<NAME>END_PI'
]
window.nameAndLocationData = [
{name: 'PI:NAME:<NAME>END_PI', location: 'New York'},
{name: 'PI:NAME:<NAME>END_PI', location: 'London'},
{name: 'PI:NAME:<NAME>END_PI', location: 'Cairo'},
{name: 'PI:NAME:<NAME>END_PI', location: 'Moscow'},
{name: 'PI:NAME:<NAME>END_PI', location: 'Tokyo'},
{name: 'PI:NAME:<NAME>END_PI', location: 'Paris'},
{name: 'PI:NAME:<NAME>END_PI', location: 'Barcelona'},
{name: 'PI:NAME:<NAME>END_PI', location: 'Sardinia'},
{name: 'PI:NAME:<NAME>END_PI', location: 'Los Angeles'},
{name: 'PI:NAME:<NAME>END_PI', location: 'Brazil'}
] |
[
{
"context": ": false # see https://github.com/markdown-it/markdown-it/blob/master/lib/rules_core/replacemen",
"end": 4968,
"score": 0.9408020973205566,
"start": 4966,
"tag": "USERNAME",
"value": "it"
},
{
"context": "........\n e = { d..., }\n e.$key = '^rawtext'\n e.syntax = null\n delete e",
"end": 7233,
"score": 0.7888504266738892,
"start": 7231,
"tag": "KEY",
"value": "'^"
},
{
"context": ".....\n e = { d..., }\n e.$key = '^rawtext'\n e.syntax = null\n delete e.atrs\n ",
"end": 7240,
"score": 0.9537687301635742,
"start": 7233,
"tag": "KEY",
"value": "rawtext"
},
{
"context": "en, ref, code, message ) ->\n token.$key = '^error'\n token.origin = 'htmlish'\n token.code ",
"end": 15568,
"score": 0.8338679075241089,
"start": 15563,
"tag": "KEY",
"value": "error"
}
] | src/htmlish-parser.coffee | loveencounterflow/dbay-mirage | 0 |
'use strict'
############################################################################################################
CND = require 'cnd'
rpr = CND.rpr
badge = 'DBAY-MIRAGE/HTMLISH-PARSER'
debug = CND.get_logger 'debug', badge
warn = CND.get_logger 'warn', badge
info = CND.get_logger 'info', badge
urge = CND.get_logger 'urge', badge
help = CND.get_logger 'help', badge
whisper = CND.get_logger 'whisper', badge
echo = CND.echo.bind CND
#...........................................................................................................
types = new ( require 'intertype' ).Intertype()
{ isa
type_of
validate
validate_list_of } = types.export()
GUY = require 'guy'
_HTMLISH = ( require 'paragate/lib/htmlish.grammar' ).new_grammar { bare: true, }
{ lets
freeze
thaw } = GUY.lft
TIMETUNNEL = require 'timetunnel'
{ Moonriver } = require 'moonriver'
{ $ } = Moonriver
#===========================================================================================================
### TAINT use more relaxed syntax for names ###
# G: grouped
# O: optional
xncr = {}
xncr.nameG = ( /// (?<name> [a-z][a-z0-9]* ) /// ).source
xncr.nameOG = ( /// (?: (?<csg> (?: [a-z][a-z0-9]* ) ) | ) /// ).source
xncr.hexG = ( /// (?: x (?<hex> [a-fA-F0-9]+ ) ) /// ).source
xncr.decG = ( /// (?<dec> [ 0-9]+ ) /// ).source
xncr.matcher = /// ^ & #{xncr.nameG} ; | & #{xncr.nameOG} \# (?: #{xncr.hexG} | #{xncr.decG} ) ; $ ///
xncr.splitter = /// ( & [^\s;]+ ; ) ///
#===========================================================================================================
class @Htmlish
#---------------------------------------------------------------------------------------------------------
@C: GUY.lft.freeze
xncr: xncr
# #---------------------------------------------------------------------------------------------------------
# constructor: ->
# return undefined
#---------------------------------------------------------------------------------------------------------
_tunnel: ( text ) ->
### TAINT do not reconstruct tunnel for each call ###
# guards = 'äöüßp'
# guards = '①②③④⑤'
guards = '¥₽₨฿₮'
intalph = '0123456789'
tnl = new TIMETUNNEL.Timetunnel { guards, intalph, }
tnl.add_tunnel TIMETUNNEL.tunnels.keep_backslash
# tnl.add_tunnel TIMETUNNEL.tunnels.remove_backslash
text = tnl.hide text
return { text, reveal: ( tnl.reveal.bind tnl ), }
#---------------------------------------------------------------------------------------------------------
_entity_token_from_match: ( d, start, stop, match ) ->
g = match.groups
R = { d..., }
R.$key = '^entity'
R.text = match[ 0 ]
R.start = start
R.stop = stop
if g.name?
R.type = 'named'
R.name = g.name
else
R.type = if g.csg? then 'xncr' else 'ncr'
R.csg = g.csg if g.csg?
R.$value = parseInt g.hex ? g.dec, ( if g.hex? then 16 else 10 )
return R
#---------------------------------------------------------------------------------------------------------
_text_token_from_part: ( d, start, stop, part ) ->
R = { d..., }
R.text = part
R.start = start
R.stop = stop
return R
#=========================================================================================================
#
#---------------------------------------------------------------------------------------------------------
$tunnel: ( tunnel_wrap ) -> ( text, send ) =>
{ text
reveal } = @_tunnel text
tunnel_wrap.reveal = reveal
send text
return null
#---------------------------------------------------------------------------------------------------------
$reveal_tunneled_text: ( tunnel_wrap ) -> ( d, send ) =>
return send d unless ( d.$key is '^text' ) or ( d.$key is '^rawtext' )
d.text = tunnel_wrap.reveal d.text
send d
#---------------------------------------------------------------------------------------------------------
$transpile_markdownish: ->
mdit_cfg =
html: true # Enable HTML tags in source
xhtmlOut: false # Use '/' to close single tags (<br />).
breaks: false # Convert '\n' in paragraphs into <br>
langPrefix: 'language-' # CSS language prefix for fenced blocks.
linkify: false # Autoconvert URL-like text to links
typographer: false # see https://github.com/markdown-it/markdown-it/blob/master/lib/rules_core/replacements.js
quotes: '“”‘’' # '„“‚‘' for German, ['«\xA0', '\xA0»', '‹\xA0', '\xA0›'] for French
highlight: null # function (/*str, lang*/) { return ''; }
# md = ( require 'markdown-it' ) 'zero'
md = ( require 'markdown-it' ) mdit_cfg
md.enable 'emphasis'
# md.enable 'autolink'
md.enable 'backticks'
md.disable 'entity'
# md.enable 'escape'
# md.enable 'html_inline'
# md.enable 'image'
md.enable 'link'
# md.enable 'newline'
# md.enable 'text'
# md.enable 'balance_pairs'
# md.enable 'text_collapse'
md.disable 'smartquotes'
return ( text, send ) =>
text = md.renderInline text
### TAINT didn't find a way to keep markdown-it from escaping `<`, `&`; as a hotfix, undo these: ###
text = text.replace /</g, '<'
text = text.replace /&/g, '&'
send text
#---------------------------------------------------------------------------------------------------------
$parse_htmlish: -> ( text, send ) => send d for d in thaw _HTMLISH.parse text
#---------------------------------------------------------------------------------------------------------
$add_location: -> ( d, send ) =>
[ lnr
col ] = d.$vnr ? [ null, null, ]
d.delta_lnr = lnr - 1
d.col = col
send d
#---------------------------------------------------------------------------------------------------------
$set_syntax_on_otag: ( tag_catalog ) -> ( d, send ) =>
return send d unless ( d.$key is '<tag' )
d.syntax = tag_catalog[ d.name ]?.syntax ? 'html'
send d
#---------------------------------------------------------------------------------------------------------
$convert_nonhtml_syntax: ->
wait_for_name = null
return ( d, send ) =>
if wait_for_name?
#...................................................................................................
if ( d.$key is '>tag' ) and ( d.name is wait_for_name )
wait_for_name = null
return send d
#...................................................................................................
e = { d..., }
e.$key = '^rawtext'
e.syntax = null
delete e.atrs
return send e
#.....................................................................................................
if ( d.$key is '<tag' ) and ( d.syntax isnt 'html' )
wait_for_name = d.name
#.....................................................................................................
send d
#---------------------------------------------------------------------------------------------------------
$set_syntax_on_other_tokens: ( tag_catalog ) ->
stack = [ 'html', ]
return ( d, send ) =>
if ( d.$key is '<tag' ) then stack.push d.syntax ? 'html'
else if ( d.$key is '>tag' ) then stack.pop()
d.syntax = stack[ stack.length - 1 ] ? 'html'
send d
#---------------------------------------------------------------------------------------------------------
$parse_ncrs: ->
xncr_matcher = @constructor.C.xncr.matcher
xncr_splitter = @constructor.C.xncr.splitter
return ( d, send ) =>
return send d unless ( d.$key is '^text' )
parts = d.text.split xncr_splitter
return send d unless parts.length > 1
is_entity = true
start = 0
#.....................................................................................................
for part in parts
is_entity = not is_entity
continue if part is ''
stop = start + part.length
#...................................................................................................
if is_entity and ( match = part.match xncr_matcher )?
send @_entity_token_from_match d, start, stop, match
else
send @_text_token_from_part d, start, stop, part
#...................................................................................................
start = stop
return null
#---------------------------------------------------------------------------------------------------------
$complain_about_bareachrs: -> ( d, send ) =>
return send d unless ( d.$key is '^text' )
#.....................................................................................................
if ( d.$key is '^text' )
if ( /(?<!\\)[<&]/.test d.text )
@_as_error d, '^ð1^', 'bareachrs', "bare active characters"
#.....................................................................................................
send d
#---------------------------------------------------------------------------------------------------------
$remove_backslashes: -> ( d, send ) =>
return send d unless ( d.$key is '^text' )
d.text = d.text.replace /\\</g, '<' ### TAINT conflicts with NCR parsing ###
d.text = d.text.replace /\\&/g, '&' ### TAINT conflicts with NCR parsing ###
d.text = d.text.replace /\\\n/ugs, '' ### replace escaped newlines with empty string ###
d.text = d.text.replace /\\(.)/ugs, '$1' ### obliterate remaining backslashes (exc. escaped ones) ###
send d
#---------------------------------------------------------------------------------------------------------
$treat_xws_in_opening_tags: -> ( d, send ) =>
return send d unless ( d.$key is '<tag' )
if ( d.type is 'otag' ) and ( /^<\s+/.test d.text )
@_as_error d, '^ð1^', 'xtraows', "extraneous whitespace before tag name"
send d
#---------------------------------------------------------------------------------------------------------
$treat_xws_in_closing_tags: -> ( d, send ) =>
return send d unless ( d.$key is '>tag' )
if ( d.type is 'ctag' ) and ( ( /^<\s*\/\s+/.test d.text ) or ( /^<\s+\/\s*/.test d.text ) )
@_as_error d, '^ð2^', 'xtracws', "extraneous whitespace in closing tag"
send d
#---------------------------------------------------------------------------------------------------------
$validate_paired_tags: ->
stack = []
return ( d, send ) =>
if ( d.$key is '<tag' )
stack.push d
send d
#.....................................................................................................
else if ( d.$key is '>tag' )
#...................................................................................................
if stack.length is 0
return send @_as_error d, '^ð2^', 'xtractag', "extraneous closing tag </#{d.name}>"
#...................................................................................................
matching_d = stack.pop()
if d.name?
if ( d.name != matching_d.name )
return send @_as_error d, '^ð2^', 'nomatch', "expected </#{matching_d.name}>, got </#{d.name}>"
#...................................................................................................
else
d.name = matching_d.name
send d
#.....................................................................................................
else
send d
#.....................................................................................................
return null
#---------------------------------------------------------------------------------------------------------
$relabel_rawtexts: -> ( d, send ) ->
d.$key = '^text' if d.$key is '^rawtext'
send d
#---------------------------------------------------------------------------------------------------------
$consolidate_texts: ->
last = Symbol 'last'
# prv_was_text = false
send = null
collector = []
#.......................................................................................................
flush = ->
# prv_was_text = false
return if collector.length is 0
d = collector[ 0 ]
if collector.length > 1
d.text = ( e.text for e in collector ).join ''
d.stop = collector[ collector.length - 1 ].stop
send d
collector.length = 0
#.......................................................................................................
return $ { last, }, ( d, _send ) ->
send = _send
return flush() if d is last
unless d.$key is '^text'
flush()
return send d
collector.push d
#---------------------------------------------------------------------------------------------------------
$split_lines: -> ( d, send ) =>
return send d unless ( d.$key is '^text' )
return send d unless ( lines = d.text.split '\n' ).length > 1
e = d
### TAINT makes `start`, `stop` invalid (but are thery still needed?) ###
for line, idx in lines
e = { e..., }
e.oln += idx
e.col = 1 unless idx is 0
e.text = line
send e
return null
#---------------------------------------------------------------------------------------------------------
parse: ( text, tag_catalog = null ) ->
### TAINT use `cfg` pattern ###
### TAINT do not reconstruct pipeline on each run ###
tunnel_wrap = {}
R = []
mr = new Moonriver()
#-------------------------------------------------------------------------------------------------------
mr.push [ text, ]
mr.push @$tunnel tunnel_wrap
mr.push @$transpile_markdownish()
# mr.push ( text ) -> info '^394^', rpr text
mr.push @$parse_htmlish()
mr.push @$add_location()
mr.push @$set_syntax_on_otag tag_catalog if tag_catalog?
mr.push @$convert_nonhtml_syntax() if tag_catalog?
mr.push @$set_syntax_on_other_tokens tag_catalog if tag_catalog?
mr.push @$parse_ncrs()
mr.push @$complain_about_bareachrs()
mr.push @$reveal_tunneled_text tunnel_wrap
mr.push @$remove_backslashes()
mr.push @$treat_xws_in_opening_tags()
mr.push @$treat_xws_in_closing_tags()
mr.push @$validate_paired_tags()
mr.push @$relabel_rawtexts()
# mr.push @$consolidate_texts()
# mr.push @$split_lines()
mr.push ( d ) -> R.push d
mr.drive()
return R
#---------------------------------------------------------------------------------------------------------
_as_error: ( token, ref, code, message ) ->
token.$key = '^error'
token.origin = 'htmlish'
token.code = code
token.message = message
token.$ = ref
return token
#-----------------------------------------------------------------------------------------------------------
@HTMLISH = HTMLISH = new @Htmlish()
| 28064 |
'use strict'
############################################################################################################
CND = require 'cnd'
rpr = CND.rpr
badge = 'DBAY-MIRAGE/HTMLISH-PARSER'
debug = CND.get_logger 'debug', badge
warn = CND.get_logger 'warn', badge
info = CND.get_logger 'info', badge
urge = CND.get_logger 'urge', badge
help = CND.get_logger 'help', badge
whisper = CND.get_logger 'whisper', badge
echo = CND.echo.bind CND
#...........................................................................................................
types = new ( require 'intertype' ).Intertype()
{ isa
type_of
validate
validate_list_of } = types.export()
GUY = require 'guy'
_HTMLISH = ( require 'paragate/lib/htmlish.grammar' ).new_grammar { bare: true, }
{ lets
freeze
thaw } = GUY.lft
TIMETUNNEL = require 'timetunnel'
{ Moonriver } = require 'moonriver'
{ $ } = Moonriver
#===========================================================================================================
### TAINT use more relaxed syntax for names ###
# G: grouped
# O: optional
xncr = {}
xncr.nameG = ( /// (?<name> [a-z][a-z0-9]* ) /// ).source
xncr.nameOG = ( /// (?: (?<csg> (?: [a-z][a-z0-9]* ) ) | ) /// ).source
xncr.hexG = ( /// (?: x (?<hex> [a-fA-F0-9]+ ) ) /// ).source
xncr.decG = ( /// (?<dec> [ 0-9]+ ) /// ).source
xncr.matcher = /// ^ & #{xncr.nameG} ; | & #{xncr.nameOG} \# (?: #{xncr.hexG} | #{xncr.decG} ) ; $ ///
xncr.splitter = /// ( & [^\s;]+ ; ) ///
#===========================================================================================================
class @Htmlish
#---------------------------------------------------------------------------------------------------------
@C: GUY.lft.freeze
xncr: xncr
# #---------------------------------------------------------------------------------------------------------
# constructor: ->
# return undefined
#---------------------------------------------------------------------------------------------------------
_tunnel: ( text ) ->
### TAINT do not reconstruct tunnel for each call ###
# guards = 'äöüßp'
# guards = '①②③④⑤'
guards = '¥₽₨฿₮'
intalph = '0123456789'
tnl = new TIMETUNNEL.Timetunnel { guards, intalph, }
tnl.add_tunnel TIMETUNNEL.tunnels.keep_backslash
# tnl.add_tunnel TIMETUNNEL.tunnels.remove_backslash
text = tnl.hide text
return { text, reveal: ( tnl.reveal.bind tnl ), }
#---------------------------------------------------------------------------------------------------------
_entity_token_from_match: ( d, start, stop, match ) ->
g = match.groups
R = { d..., }
R.$key = '^entity'
R.text = match[ 0 ]
R.start = start
R.stop = stop
if g.name?
R.type = 'named'
R.name = g.name
else
R.type = if g.csg? then 'xncr' else 'ncr'
R.csg = g.csg if g.csg?
R.$value = parseInt g.hex ? g.dec, ( if g.hex? then 16 else 10 )
return R
#---------------------------------------------------------------------------------------------------------
_text_token_from_part: ( d, start, stop, part ) ->
R = { d..., }
R.text = part
R.start = start
R.stop = stop
return R
#=========================================================================================================
#
#---------------------------------------------------------------------------------------------------------
$tunnel: ( tunnel_wrap ) -> ( text, send ) =>
{ text
reveal } = @_tunnel text
tunnel_wrap.reveal = reveal
send text
return null
#---------------------------------------------------------------------------------------------------------
$reveal_tunneled_text: ( tunnel_wrap ) -> ( d, send ) =>
return send d unless ( d.$key is '^text' ) or ( d.$key is '^rawtext' )
d.text = tunnel_wrap.reveal d.text
send d
#---------------------------------------------------------------------------------------------------------
$transpile_markdownish: ->
mdit_cfg =
html: true # Enable HTML tags in source
xhtmlOut: false # Use '/' to close single tags (<br />).
breaks: false # Convert '\n' in paragraphs into <br>
langPrefix: 'language-' # CSS language prefix for fenced blocks.
linkify: false # Autoconvert URL-like text to links
typographer: false # see https://github.com/markdown-it/markdown-it/blob/master/lib/rules_core/replacements.js
quotes: '“”‘’' # '„“‚‘' for German, ['«\xA0', '\xA0»', '‹\xA0', '\xA0›'] for French
highlight: null # function (/*str, lang*/) { return ''; }
# md = ( require 'markdown-it' ) 'zero'
md = ( require 'markdown-it' ) mdit_cfg
md.enable 'emphasis'
# md.enable 'autolink'
md.enable 'backticks'
md.disable 'entity'
# md.enable 'escape'
# md.enable 'html_inline'
# md.enable 'image'
md.enable 'link'
# md.enable 'newline'
# md.enable 'text'
# md.enable 'balance_pairs'
# md.enable 'text_collapse'
md.disable 'smartquotes'
return ( text, send ) =>
text = md.renderInline text
### TAINT didn't find a way to keep markdown-it from escaping `<`, `&`; as a hotfix, undo these: ###
text = text.replace /</g, '<'
text = text.replace /&/g, '&'
send text
#---------------------------------------------------------------------------------------------------------
$parse_htmlish: -> ( text, send ) => send d for d in thaw _HTMLISH.parse text
#---------------------------------------------------------------------------------------------------------
$add_location: -> ( d, send ) =>
[ lnr
col ] = d.$vnr ? [ null, null, ]
d.delta_lnr = lnr - 1
d.col = col
send d
#---------------------------------------------------------------------------------------------------------
$set_syntax_on_otag: ( tag_catalog ) -> ( d, send ) =>
return send d unless ( d.$key is '<tag' )
d.syntax = tag_catalog[ d.name ]?.syntax ? 'html'
send d
#---------------------------------------------------------------------------------------------------------
$convert_nonhtml_syntax: ->
wait_for_name = null
return ( d, send ) =>
if wait_for_name?
#...................................................................................................
if ( d.$key is '>tag' ) and ( d.name is wait_for_name )
wait_for_name = null
return send d
#...................................................................................................
e = { d..., }
e.$key = <KEY> <KEY>'
e.syntax = null
delete e.atrs
return send e
#.....................................................................................................
if ( d.$key is '<tag' ) and ( d.syntax isnt 'html' )
wait_for_name = d.name
#.....................................................................................................
send d
#---------------------------------------------------------------------------------------------------------
$set_syntax_on_other_tokens: ( tag_catalog ) ->
stack = [ 'html', ]
return ( d, send ) =>
if ( d.$key is '<tag' ) then stack.push d.syntax ? 'html'
else if ( d.$key is '>tag' ) then stack.pop()
d.syntax = stack[ stack.length - 1 ] ? 'html'
send d
#---------------------------------------------------------------------------------------------------------
$parse_ncrs: ->
xncr_matcher = @constructor.C.xncr.matcher
xncr_splitter = @constructor.C.xncr.splitter
return ( d, send ) =>
return send d unless ( d.$key is '^text' )
parts = d.text.split xncr_splitter
return send d unless parts.length > 1
is_entity = true
start = 0
#.....................................................................................................
for part in parts
is_entity = not is_entity
continue if part is ''
stop = start + part.length
#...................................................................................................
if is_entity and ( match = part.match xncr_matcher )?
send @_entity_token_from_match d, start, stop, match
else
send @_text_token_from_part d, start, stop, part
#...................................................................................................
start = stop
return null
#---------------------------------------------------------------------------------------------------------
$complain_about_bareachrs: -> ( d, send ) =>
return send d unless ( d.$key is '^text' )
#.....................................................................................................
if ( d.$key is '^text' )
if ( /(?<!\\)[<&]/.test d.text )
@_as_error d, '^ð1^', 'bareachrs', "bare active characters"
#.....................................................................................................
send d
#---------------------------------------------------------------------------------------------------------
$remove_backslashes: -> ( d, send ) =>
return send d unless ( d.$key is '^text' )
d.text = d.text.replace /\\</g, '<' ### TAINT conflicts with NCR parsing ###
d.text = d.text.replace /\\&/g, '&' ### TAINT conflicts with NCR parsing ###
d.text = d.text.replace /\\\n/ugs, '' ### replace escaped newlines with empty string ###
d.text = d.text.replace /\\(.)/ugs, '$1' ### obliterate remaining backslashes (exc. escaped ones) ###
send d
#---------------------------------------------------------------------------------------------------------
$treat_xws_in_opening_tags: -> ( d, send ) =>
return send d unless ( d.$key is '<tag' )
if ( d.type is 'otag' ) and ( /^<\s+/.test d.text )
@_as_error d, '^ð1^', 'xtraows', "extraneous whitespace before tag name"
send d
#---------------------------------------------------------------------------------------------------------
$treat_xws_in_closing_tags: -> ( d, send ) =>
return send d unless ( d.$key is '>tag' )
if ( d.type is 'ctag' ) and ( ( /^<\s*\/\s+/.test d.text ) or ( /^<\s+\/\s*/.test d.text ) )
@_as_error d, '^ð2^', 'xtracws', "extraneous whitespace in closing tag"
send d
#---------------------------------------------------------------------------------------------------------
$validate_paired_tags: ->
stack = []
return ( d, send ) =>
if ( d.$key is '<tag' )
stack.push d
send d
#.....................................................................................................
else if ( d.$key is '>tag' )
#...................................................................................................
if stack.length is 0
return send @_as_error d, '^ð2^', 'xtractag', "extraneous closing tag </#{d.name}>"
#...................................................................................................
matching_d = stack.pop()
if d.name?
if ( d.name != matching_d.name )
return send @_as_error d, '^ð2^', 'nomatch', "expected </#{matching_d.name}>, got </#{d.name}>"
#...................................................................................................
else
d.name = matching_d.name
send d
#.....................................................................................................
else
send d
#.....................................................................................................
return null
#---------------------------------------------------------------------------------------------------------
$relabel_rawtexts: -> ( d, send ) ->
d.$key = '^text' if d.$key is '^rawtext'
send d
#---------------------------------------------------------------------------------------------------------
$consolidate_texts: ->
last = Symbol 'last'
# prv_was_text = false
send = null
collector = []
#.......................................................................................................
flush = ->
# prv_was_text = false
return if collector.length is 0
d = collector[ 0 ]
if collector.length > 1
d.text = ( e.text for e in collector ).join ''
d.stop = collector[ collector.length - 1 ].stop
send d
collector.length = 0
#.......................................................................................................
return $ { last, }, ( d, _send ) ->
send = _send
return flush() if d is last
unless d.$key is '^text'
flush()
return send d
collector.push d
#---------------------------------------------------------------------------------------------------------
$split_lines: -> ( d, send ) =>
return send d unless ( d.$key is '^text' )
return send d unless ( lines = d.text.split '\n' ).length > 1
e = d
### TAINT makes `start`, `stop` invalid (but are thery still needed?) ###
for line, idx in lines
e = { e..., }
e.oln += idx
e.col = 1 unless idx is 0
e.text = line
send e
return null
#---------------------------------------------------------------------------------------------------------
parse: ( text, tag_catalog = null ) ->
### TAINT use `cfg` pattern ###
### TAINT do not reconstruct pipeline on each run ###
tunnel_wrap = {}
R = []
mr = new Moonriver()
#-------------------------------------------------------------------------------------------------------
mr.push [ text, ]
mr.push @$tunnel tunnel_wrap
mr.push @$transpile_markdownish()
# mr.push ( text ) -> info '^394^', rpr text
mr.push @$parse_htmlish()
mr.push @$add_location()
mr.push @$set_syntax_on_otag tag_catalog if tag_catalog?
mr.push @$convert_nonhtml_syntax() if tag_catalog?
mr.push @$set_syntax_on_other_tokens tag_catalog if tag_catalog?
mr.push @$parse_ncrs()
mr.push @$complain_about_bareachrs()
mr.push @$reveal_tunneled_text tunnel_wrap
mr.push @$remove_backslashes()
mr.push @$treat_xws_in_opening_tags()
mr.push @$treat_xws_in_closing_tags()
mr.push @$validate_paired_tags()
mr.push @$relabel_rawtexts()
# mr.push @$consolidate_texts()
# mr.push @$split_lines()
mr.push ( d ) -> R.push d
mr.drive()
return R
#---------------------------------------------------------------------------------------------------------
_as_error: ( token, ref, code, message ) ->
token.$key = '^<KEY>'
token.origin = 'htmlish'
token.code = code
token.message = message
token.$ = ref
return token
#-----------------------------------------------------------------------------------------------------------
@HTMLISH = HTMLISH = new @Htmlish()
| true |
'use strict'
############################################################################################################
CND = require 'cnd'
rpr = CND.rpr
badge = 'DBAY-MIRAGE/HTMLISH-PARSER'
debug = CND.get_logger 'debug', badge
warn = CND.get_logger 'warn', badge
info = CND.get_logger 'info', badge
urge = CND.get_logger 'urge', badge
help = CND.get_logger 'help', badge
whisper = CND.get_logger 'whisper', badge
echo = CND.echo.bind CND
#...........................................................................................................
types = new ( require 'intertype' ).Intertype()
{ isa
type_of
validate
validate_list_of } = types.export()
GUY = require 'guy'
_HTMLISH = ( require 'paragate/lib/htmlish.grammar' ).new_grammar { bare: true, }
{ lets
freeze
thaw } = GUY.lft
TIMETUNNEL = require 'timetunnel'
{ Moonriver } = require 'moonriver'
{ $ } = Moonriver
#===========================================================================================================
### TAINT use more relaxed syntax for names ###
# G: grouped
# O: optional
xncr = {}
xncr.nameG = ( /// (?<name> [a-z][a-z0-9]* ) /// ).source
xncr.nameOG = ( /// (?: (?<csg> (?: [a-z][a-z0-9]* ) ) | ) /// ).source
xncr.hexG = ( /// (?: x (?<hex> [a-fA-F0-9]+ ) ) /// ).source
xncr.decG = ( /// (?<dec> [ 0-9]+ ) /// ).source
xncr.matcher = /// ^ & #{xncr.nameG} ; | & #{xncr.nameOG} \# (?: #{xncr.hexG} | #{xncr.decG} ) ; $ ///
xncr.splitter = /// ( & [^\s;]+ ; ) ///
#===========================================================================================================
class @Htmlish
#---------------------------------------------------------------------------------------------------------
@C: GUY.lft.freeze
xncr: xncr
# #---------------------------------------------------------------------------------------------------------
# constructor: ->
# return undefined
#---------------------------------------------------------------------------------------------------------
_tunnel: ( text ) ->
### TAINT do not reconstruct tunnel for each call ###
# guards = 'äöüßp'
# guards = '①②③④⑤'
guards = '¥₽₨฿₮'
intalph = '0123456789'
tnl = new TIMETUNNEL.Timetunnel { guards, intalph, }
tnl.add_tunnel TIMETUNNEL.tunnels.keep_backslash
# tnl.add_tunnel TIMETUNNEL.tunnels.remove_backslash
text = tnl.hide text
return { text, reveal: ( tnl.reveal.bind tnl ), }
#---------------------------------------------------------------------------------------------------------
_entity_token_from_match: ( d, start, stop, match ) ->
g = match.groups
R = { d..., }
R.$key = '^entity'
R.text = match[ 0 ]
R.start = start
R.stop = stop
if g.name?
R.type = 'named'
R.name = g.name
else
R.type = if g.csg? then 'xncr' else 'ncr'
R.csg = g.csg if g.csg?
R.$value = parseInt g.hex ? g.dec, ( if g.hex? then 16 else 10 )
return R
#---------------------------------------------------------------------------------------------------------
_text_token_from_part: ( d, start, stop, part ) ->
R = { d..., }
R.text = part
R.start = start
R.stop = stop
return R
#=========================================================================================================
#
#---------------------------------------------------------------------------------------------------------
$tunnel: ( tunnel_wrap ) -> ( text, send ) =>
{ text
reveal } = @_tunnel text
tunnel_wrap.reveal = reveal
send text
return null
#---------------------------------------------------------------------------------------------------------
$reveal_tunneled_text: ( tunnel_wrap ) -> ( d, send ) =>
return send d unless ( d.$key is '^text' ) or ( d.$key is '^rawtext' )
d.text = tunnel_wrap.reveal d.text
send d
#---------------------------------------------------------------------------------------------------------
$transpile_markdownish: ->
mdit_cfg =
html: true # Enable HTML tags in source
xhtmlOut: false # Use '/' to close single tags (<br />).
breaks: false # Convert '\n' in paragraphs into <br>
langPrefix: 'language-' # CSS language prefix for fenced blocks.
linkify: false # Autoconvert URL-like text to links
typographer: false # see https://github.com/markdown-it/markdown-it/blob/master/lib/rules_core/replacements.js
quotes: '“”‘’' # '„“‚‘' for German, ['«\xA0', '\xA0»', '‹\xA0', '\xA0›'] for French
highlight: null # function (/*str, lang*/) { return ''; }
# md = ( require 'markdown-it' ) 'zero'
md = ( require 'markdown-it' ) mdit_cfg
md.enable 'emphasis'
# md.enable 'autolink'
md.enable 'backticks'
md.disable 'entity'
# md.enable 'escape'
# md.enable 'html_inline'
# md.enable 'image'
md.enable 'link'
# md.enable 'newline'
# md.enable 'text'
# md.enable 'balance_pairs'
# md.enable 'text_collapse'
md.disable 'smartquotes'
return ( text, send ) =>
text = md.renderInline text
### TAINT didn't find a way to keep markdown-it from escaping `<`, `&`; as a hotfix, undo these: ###
text = text.replace /</g, '<'
text = text.replace /&/g, '&'
send text
#---------------------------------------------------------------------------------------------------------
$parse_htmlish: -> ( text, send ) => send d for d in thaw _HTMLISH.parse text
#---------------------------------------------------------------------------------------------------------
$add_location: -> ( d, send ) =>
[ lnr
col ] = d.$vnr ? [ null, null, ]
d.delta_lnr = lnr - 1
d.col = col
send d
#---------------------------------------------------------------------------------------------------------
$set_syntax_on_otag: ( tag_catalog ) -> ( d, send ) =>
return send d unless ( d.$key is '<tag' )
d.syntax = tag_catalog[ d.name ]?.syntax ? 'html'
send d
#---------------------------------------------------------------------------------------------------------
$convert_nonhtml_syntax: ->
wait_for_name = null
return ( d, send ) =>
if wait_for_name?
#...................................................................................................
if ( d.$key is '>tag' ) and ( d.name is wait_for_name )
wait_for_name = null
return send d
#...................................................................................................
e = { d..., }
e.$key = PI:KEY:<KEY>END_PI PI:KEY:<KEY>END_PI'
e.syntax = null
delete e.atrs
return send e
#.....................................................................................................
if ( d.$key is '<tag' ) and ( d.syntax isnt 'html' )
wait_for_name = d.name
#.....................................................................................................
send d
#---------------------------------------------------------------------------------------------------------
$set_syntax_on_other_tokens: ( tag_catalog ) ->
stack = [ 'html', ]
return ( d, send ) =>
if ( d.$key is '<tag' ) then stack.push d.syntax ? 'html'
else if ( d.$key is '>tag' ) then stack.pop()
d.syntax = stack[ stack.length - 1 ] ? 'html'
send d
#---------------------------------------------------------------------------------------------------------
$parse_ncrs: ->
xncr_matcher = @constructor.C.xncr.matcher
xncr_splitter = @constructor.C.xncr.splitter
return ( d, send ) =>
return send d unless ( d.$key is '^text' )
parts = d.text.split xncr_splitter
return send d unless parts.length > 1
is_entity = true
start = 0
#.....................................................................................................
for part in parts
is_entity = not is_entity
continue if part is ''
stop = start + part.length
#...................................................................................................
if is_entity and ( match = part.match xncr_matcher )?
send @_entity_token_from_match d, start, stop, match
else
send @_text_token_from_part d, start, stop, part
#...................................................................................................
start = stop
return null
#---------------------------------------------------------------------------------------------------------
$complain_about_bareachrs: -> ( d, send ) =>
return send d unless ( d.$key is '^text' )
#.....................................................................................................
if ( d.$key is '^text' )
if ( /(?<!\\)[<&]/.test d.text )
@_as_error d, '^ð1^', 'bareachrs', "bare active characters"
#.....................................................................................................
send d
#---------------------------------------------------------------------------------------------------------
$remove_backslashes: -> ( d, send ) =>
return send d unless ( d.$key is '^text' )
d.text = d.text.replace /\\</g, '<' ### TAINT conflicts with NCR parsing ###
d.text = d.text.replace /\\&/g, '&' ### TAINT conflicts with NCR parsing ###
d.text = d.text.replace /\\\n/ugs, '' ### replace escaped newlines with empty string ###
d.text = d.text.replace /\\(.)/ugs, '$1' ### obliterate remaining backslashes (exc. escaped ones) ###
send d
#---------------------------------------------------------------------------------------------------------
$treat_xws_in_opening_tags: -> ( d, send ) =>
return send d unless ( d.$key is '<tag' )
if ( d.type is 'otag' ) and ( /^<\s+/.test d.text )
@_as_error d, '^ð1^', 'xtraows', "extraneous whitespace before tag name"
send d
#---------------------------------------------------------------------------------------------------------
$treat_xws_in_closing_tags: -> ( d, send ) =>
return send d unless ( d.$key is '>tag' )
if ( d.type is 'ctag' ) and ( ( /^<\s*\/\s+/.test d.text ) or ( /^<\s+\/\s*/.test d.text ) )
@_as_error d, '^ð2^', 'xtracws', "extraneous whitespace in closing tag"
send d
#---------------------------------------------------------------------------------------------------------
$validate_paired_tags: ->
stack = []
return ( d, send ) =>
if ( d.$key is '<tag' )
stack.push d
send d
#.....................................................................................................
else if ( d.$key is '>tag' )
#...................................................................................................
if stack.length is 0
return send @_as_error d, '^ð2^', 'xtractag', "extraneous closing tag </#{d.name}>"
#...................................................................................................
matching_d = stack.pop()
if d.name?
if ( d.name != matching_d.name )
return send @_as_error d, '^ð2^', 'nomatch', "expected </#{matching_d.name}>, got </#{d.name}>"
#...................................................................................................
else
d.name = matching_d.name
send d
#.....................................................................................................
else
send d
#.....................................................................................................
return null
#---------------------------------------------------------------------------------------------------------
$relabel_rawtexts: -> ( d, send ) ->
d.$key = '^text' if d.$key is '^rawtext'
send d
#---------------------------------------------------------------------------------------------------------
$consolidate_texts: ->
last = Symbol 'last'
# prv_was_text = false
send = null
collector = []
#.......................................................................................................
flush = ->
# prv_was_text = false
return if collector.length is 0
d = collector[ 0 ]
if collector.length > 1
d.text = ( e.text for e in collector ).join ''
d.stop = collector[ collector.length - 1 ].stop
send d
collector.length = 0
#.......................................................................................................
return $ { last, }, ( d, _send ) ->
send = _send
return flush() if d is last
unless d.$key is '^text'
flush()
return send d
collector.push d
#---------------------------------------------------------------------------------------------------------
$split_lines: -> ( d, send ) =>
return send d unless ( d.$key is '^text' )
return send d unless ( lines = d.text.split '\n' ).length > 1
e = d
### TAINT makes `start`, `stop` invalid (but are thery still needed?) ###
for line, idx in lines
e = { e..., }
e.oln += idx
e.col = 1 unless idx is 0
e.text = line
send e
return null
#---------------------------------------------------------------------------------------------------------
parse: ( text, tag_catalog = null ) ->
### TAINT use `cfg` pattern ###
### TAINT do not reconstruct pipeline on each run ###
tunnel_wrap = {}
R = []
mr = new Moonriver()
#-------------------------------------------------------------------------------------------------------
mr.push [ text, ]
mr.push @$tunnel tunnel_wrap
mr.push @$transpile_markdownish()
# mr.push ( text ) -> info '^394^', rpr text
mr.push @$parse_htmlish()
mr.push @$add_location()
mr.push @$set_syntax_on_otag tag_catalog if tag_catalog?
mr.push @$convert_nonhtml_syntax() if tag_catalog?
mr.push @$set_syntax_on_other_tokens tag_catalog if tag_catalog?
mr.push @$parse_ncrs()
mr.push @$complain_about_bareachrs()
mr.push @$reveal_tunneled_text tunnel_wrap
mr.push @$remove_backslashes()
mr.push @$treat_xws_in_opening_tags()
mr.push @$treat_xws_in_closing_tags()
mr.push @$validate_paired_tags()
mr.push @$relabel_rawtexts()
# mr.push @$consolidate_texts()
# mr.push @$split_lines()
mr.push ( d ) -> R.push d
mr.drive()
return R
#---------------------------------------------------------------------------------------------------------
_as_error: ( token, ref, code, message ) ->
token.$key = '^PI:KEY:<KEY>END_PI'
token.origin = 'htmlish'
token.code = code
token.message = message
token.$ = ref
return token
#-----------------------------------------------------------------------------------------------------------
@HTMLISH = HTMLISH = new @Htmlish()
|
[
{
"context": "##! Extrascore (requires jQuery and Underscore) by Casey Foster (caseywebdev.com) ###\n\n# Check dependencies\nif no",
"end": 64,
"score": 0.9998811483383179,
"start": 52,
"tag": "NAME",
"value": "Casey Foster"
},
{
"context": "uires jQuery and Underscore) by Casey Foster (caseywebdev.com) ###\n\n# Check dependencies\nif not Extrascore?",
"end": 77,
"score": 0.6550595164299011,
"start": 70,
"tag": "EMAIL",
"value": "ywebdev"
},
{
"context": "uery and Underscore) by Casey Foster (caseywebdev.com) ###\n\n# Check dependencies\nif not Extrascore? and",
"end": 81,
"score": 0.742404580116272,
"start": 78,
"tag": "EMAIL",
"value": "com"
}
] | vendor/assets/javascripts/extrascore.coffee | sucram1/cuddly-potato111trtr | 2 | ###! Extrascore (requires jQuery and Underscore) by Casey Foster (caseywebdev.com) ###
# Check dependencies
if not Extrascore? and jQuery? and _?
# Use the jQuery shortcut
$ = jQuery
# Define the Extrascore object
window.Extrascore =
# Mixins for Underscore
Mixins:
# Mass method call for every child of obj
mass: (obj, key, args...) ->
for __, val of obj
val?[key]? args...
# Initialize an object by calling init on children and then assigning the load method to jQuery's DOM ready call
# This is a special _.mass() function
init: (obj) ->
# Call on jQuery's DOM ready call
load = (obj) ->
_.mass obj, 'load'
dom obj
$('body').on 'DOMSubtreeModified', (e) -> dom obj, e unless obj._extrascoreDomLocked
# Call on every DOMSubtreeModified event (use carefully, doesn't work in Opera *shocking*)
dom = (obj, e) ->
obj._extrascoreDomLocked = true
_.mass obj, 'dom', e
delete obj._extrascoreDomLocked
# Call `init()` on all children of obj if the method exists
_.mass obj, 'init'
$ -> load obj
# Clean a string for use in a URL or query
clean: (str, opt = {}) ->
opt = _.extend
delimiter: ' '
alphanumeric: false
downcase: false
, opt
str = str+''
str = str.toLowerCase() if opt.downcase
str = str.replace(/'/g, '').replace(/[^\w\s]|_/g, ' ') if opt.alphanumeric
$.trim(str.replace /\s+/g, ' ').replace /\s/g, opt.delimiter
# Shortcut for _.clean str, delimiter: '-', alphanumeric: true, downcase: true
urlize: (str, delimiter = '-') ->
_.clean str, delimiter: delimiter, alphanumeric: true, downcase: true
# This sucker comes in handy
startsWith: (str, start) ->
str = '' + str
start = '' + start
return start.length <= str.length and str.substr(0, start.length) is start
# This guy too
endsWith: (str, end) ->
str = '' + str
end = '' + end
return end.length <= str.length and str.substr(str.length-end.length) is end
# Sort an object by key for iteration
sortByKey: (obj) ->
newObj = {}
_.chain(obj)
.map((val, key) -> [key, val])
.sortBy((val) -> val[0])
.each (val) -> newObj[val[0]] = val[1]
newObj
# A quick zip to the top of the page, or optionally to an integer or jQuery object specified by `val`
scrollTo: (val = 0, duration, callback) ->
if val instanceof $
val = val.offset().top
$(if $.browser.webkit then document.body else document.documentElement).animate scrollTop: val, duration, callback
# Get a full URL from a relative url
url: (path = '', protocol = location.protocol) ->
# Append a colon to the protocol if necessary
protocol += ':' unless _.endsWith protocol, ':'
# See if it's already a URL
unless path.match /^\w+:/
# See if it's a URL looking for a protocol
if _.startsWith path, '//'
path = location.protocol + path
# See if it's relative to the domain root
else if _.startsWith path, '/'
path = "#{location.protocol}//#{location.host + path}"
# Otherwise it must be relative to the current location
else
path = location.href + path
# Swap the protocols if necessary
path.replace location.protocol, protocol
# The reverse of _.url()
relativeUrl: (path = '') -> _.url(path).replace /^\w+:\/\/[^/]+/, ''
# Sometimes it's handy to know the size of the scrollbars in a browser
scrollbarSize: (dimension = 'width') ->
$out = $('<div><div/></div>')
.appendTo('body')
.css
position: 'fixed'
overflow: 'hidden'
left: -50
top: -50
width: 50
height: 50
$in = $out.find('> div').css height: '100%'
d1 = $in[dimension]()
$out.css overflow: 'scroll'
d2 = $in[dimension]()
$out.remove()
d1-d2
# Does the element have a scrollbar?
hasScrollbar: ($obj) ->
style = $obj.attr 'style'
d1 = $obj.width()
d2 = $obj.css(overflow: 'hidden').width()
if style?
$obj.attr style: style
else
$obj.removeAttr 'style'
d1 isnt d2
# Break a query up into components if colons are used, otherwise just return the cleaned string
parseQuery: (str, downcase = true) ->
str = _.clean str, downcase: downcase
colon = _.compact str.replace(/^:+|:+$/g, '').split ':'
if colon.length > 1
colon = _.map colon, (str) -> $.trim(str).match /(?:^|^(.*)\s)(\S*)$/
terms = {}
_.each colon, (match, i) ->
if i < colon.length - 1
terms[match[2]] = colon[i + 1][1]
else
prev = colon[i - 1][2]
terms[prev] = (if terms[prev] then terms[prev]+' ' else '')+match[2]
return terms
str
# Ghetto nextTick
nextTick: (fn) -> setTimeout fn, 0
# Extensions for Underscore (more of individual classes using Underscore for the namespace then actual extentions)
Extensions:
# Placeholder for lame browsers
Placeholder:
# After the DOM is loaded
load: ->
# Hijack jQuery's .val() so it will return an empty string if Placeholder says it should
$.fn._val = $.fn.val
$.fn.val = (str) ->
if str?
$(@).each -> $(@)._val str
else
if $(@).data 'placeholderEmpty' then '' else $(@)._val()
# Check for new inputs or textareas than need to be initialized with Placeholder
dom: ->
$('.js-placeholder, .js-placeholder-password').each ->
$t = $ @
if $t.data('placeholderHtml')? and not $t.data('placeholderEmpty')?
password = $t.hasClass 'js-placeholder-password'
placeholder = $t.data 'placeholderHtml'
$t[0].type = 'password' if password
unless password and $.browser.msie and $.browser.version.split('.') < 9
if not $t.val() or $t.val() is placeholder
$t.data placeholderEmpty: true
$t.val placeholder
$t[0].type = 'text' if password
else
$t.data placeholderEmpty: false
$t.attr
placeholder: placeholder
title: placeholder
$t.focus(->
$t.val '' if $t.data 'placeholderEmpty'
if password
$t[0].type = 'password'
$t.attr placeholder: placeholder
$t.data placeholderEmpty: false
).blur ->
if $t.val()
$t.data placeholderEmpty: false
else
$t.val placeholder
$t.data placeholderEmpty: true
$t[0].type = 'text' if password
# Multipurpose PopUp
PopUp:
# Duration and Fade duration default, feel free to change
DURATION: 0
FADE_DURATION: 250
# Build the PopUp element
build: ->
# Shortcut
o = _.PopUp;
unless $('#js-pop-up-container').length
# Until 'display: box' becomes more widely available, we're stuck with table/table-cell
$('body').append o.$container =
$('<div><div><div><div/></div></div></div>')
.attr(
id: 'js-pop-up-container'
).css
display: 'none'
position: 'fixed'
zIndex: 999999
left: 0
top: 0
width: '100%'
height: '100%'
opacity: 0
overflow: 'auto'
o.hide()
o.$container.find('> div')
.attr(
id: 'js-pop-up-table'
).css
display: 'table'
width: '100%'
height: '100%'
o.$container.find('> div > div')
.attr(
id: 'js-pop-up-table-cell'
).css
display: 'table-cell'
textAlign: 'center'
verticalAlign: 'middle'
o.$div =
o.$container.find('> div > div > div')
.attr(
id: 'js-pop-up'
).css
display: 'inline-block'
position: 'relative'
o.$container.on 'click', -> o.$div.find('.js-pop-up-outside').click()
o.$div
.on('click', false)
.on 'click', '.js-pop-up-hide', o.hide
$(document).keydown (e) ->
if o.$container.css('display') is 'block' and not $('body :focus').length
switch e.keyCode
when 13 then o.$div.find('.js-pop-up-enter').click()
when 27 then o.$div.find('.js-pop-up-esc').click()
else return true
false
# Fade the PopUp out
hide: (fadeDuration) ->
o = _.PopUp
if o.$container?
o.$container
.stop()
.animate
opacity: 0
, (if isNaN(fadeDuration) then o.fadeDuration else fadeDuration)
, ->
o.$container.css display: 'none'
if o.saveBodyStyle?
$('body').attr style: o.saveBodyStyle
else
$('body').removeAttr 'style'
o.saveBodyStyle = null
# Show the PopUp with the given `html`, optionally for a 'duration', with a 'callback', and/or with a 'fadeDuration'
show: (html, opt = {}) ->
o = _.PopUp
# Build the PopUp element
o.build()
opt = _.extend
duration: o.DURATION
callback: null
fadeDuration: o.FADE_DURATION
, opt
o.saveBodyStyle = $('body').attr 'style' unless o.$container.css('display') is 'block'
$('body').css marginRight: _.scrollbarSize() if _.hasScrollbar $ 'body'
$('body').css overflow: 'hidden'
$('body :focus').blur()
o.fadeDuration = opt.fadeDuration
o.$div.html html
o.$container
.stop()
.css(
display: 'block')
.animate
opacity: 1
, opt.fadeDuration
clearTimeout o.timeout if o.timeout?
o.timeout = setTimeout ->
o.hide()
opt.callback?()
, opt.duration if opt.duration
# Search (as you type)
Search:
# Check for Search objects to be initialized
dom: ->
$('.js-search').each ->
$search = $ @
unless $search.data('searchCache')?
o = _.Search
$search.data
searchCache: []
searchId: 0
searchAjax: {}
searchLastQ: null
searchPage: 0
searchHoldHover: false
search$Q: $search.find '.js-search-q'
search$Results: $search.find '.js-search-results'
$q = $search.data 'search$Q'
$results = $search.data 'search$Results'
o.query $search if $q.is ':focus'
$search.hover(->
$search.data searchHover: true
, ->
$search.data searchHover: false
$results.css display: 'none' unless $q.is(':focus') or $search.data 'searchHoldHover'
).mouseover ->
$search.data searchHoldHover: false
$q.blur(-> _.nextTick -> $results.css display: 'none' unless $search.data 'searchHover')
.focus(-> $search.data searchHoldHover: false)
.keydown((e) ->
switch e.keyCode
when 13 then $search.find('.js-search-selected').click()
when 38 then o.select $search, 'prev'
when 40 then o.select $search, 'next'
when 27
if $q.val() is ''
$q.blur()
_.nextTick ->
o.query $search
else
_.nextTick ->
$q.val ''
o.query $search
else
_.nextTick -> o.query $search if $q.is ':focus'
return true
false
).on 'focus keyup change', ->
o.query $search
$results.on 'mouseenter click', '.js-search-result', (e) ->
$t = $ @
$results.find('.js-search-result.js-search-selected').removeClass 'js-search-selected'
$t.addClass 'js-search-selected'
if e.type is 'click'
if $t.hasClass 'js-search-prev'
o.page $search, $search.data('searchPage') - 1, true
$search.data searchHoldHover: true
else if $t.hasClass 'js-search-next'
o.page $search, $search.data('searchPage') + 1
$search.data searchHoldHover: true
else if $t.hasClass 'js-search-submit'
$t.parents('form').submit()
if $t.hasClass 'js-search-hide'
$q.blur()
$results.css display: 'none'
# Change the current search results page
page: ($searches, n, prev) ->
$searches.each ->
$search = $ @
$results = $search.data 'search$Results'
n = Math.min $results.find('.js-search-page').length - 1, Math.max n, 0
$results.find('.js-search-selected').removeClass 'js-search-selected'
$results.find('.js-search-page')
.css(display: 'none')
.eq(n)
.removeAttr('style')
.find('.js-search-result:not(.js-search-prev):not(.js-search-next)')[if prev then 'last' else 'first']()
.addClass 'js-search-selected'
$search.data 'searchPage', n
# Send the value of q to the correct search function and return the result to the correct callback
query: ($searches, urlN = 1) ->
$searches.each ->
o = _.Search
$search = $ @
$results = $search.data 'search$Results'
$q = $search.data 'search$Q'
callback = eval $search.data 'searchCallback'
q = _.clean $q.val(), downcase: true
t = new Date().getTime()
$results.css display: 'block'
unless q or $search.data('js-search-empty')?
$results.css(display: 'none').empty()
$search.removeClass 'js-search-loading'
else if q isnt $search.data('searchLastQ') or urlN > 1
callback $search
clearTimeout $search.data 'searchTimeout'
$search.data('searchAjax').abort?()
if $search.data('searchCache')["#{urlN}_" + q]?
callback $search, $search.data('searchCache')["#{urlN}_" + q], urlN
$search.removeClass 'js-search-loading'
o.query $search, urlN + 1 if $search.data("searchUrl#{urlN+1}")?
else
$search.addClass('js-search-loading').data 'searchTimeout',
setTimeout ->
handleData = (data) ->
$search.data('searchCache')["#{urlN}_" + q] = data
if check is $search.data('searchId') and (_.clean($q.val()) or $search.data('js-search-empty')?)
$search.removeClass 'js-search-loading'
callback $search, data, urlN
o.query $search, urlN + 1 if $search.data "searchUrl#{urlN+1}"
check = $search.data(searchId: $search.data('searchId') + 1).data 'searchId'
if $search.data('searchJs')?
handleData eval($search.data 'searchJs')(q)
else if $search.data('searchUrl')?
$search.data searchAjax: $.getJSON($search.data("searchUrl#{if urlN is 1 then '' else urlN}"), q: q, handleData)
, $search.data('searchDelay') ? 0
$search.data 'searchLastQ', q
# Select the next or previous in a list of results
select: ($searches, dir) ->
$searches.each ->
o = _.Search
$search = $ @
$page = $search.find('.js-search-page').eq $search.data 'searchPage'
$page.find('.js-search-result')[if dir is 'prev' then 'first' else 'last']().addClass 'js-search-selected' unless $page.find('.js-search-selected').removeClass('js-search-selected')[dir]().addClass('js-search-selected').length
if $page.find('.js-search-result.js-search-selected.js-search-prev').length
o.page $search, $search.data('searchPage') - 1, true
else if $page.find('.js-search-result.js-search-selected.js-search-next').length
o.page $search, $search.data('searchPage') + 1
# Yay tooltips!
Tooltip:
# Store mouse coordinates
mouse:
x: 0
y: 0
# Set mousemove on document to track coordinates
load: ->
o = _.Tooltip
$('body').mousemove((e) ->
o.mouse =
x: e.pageX
y: e.pageY
$('.js-tooltip').each ->
$t = $ @
$t.data('tooltip$Div').css o.position($t).home if $t.data('tooltip$Div')? and $t.data('tooltipMouse')?
).on('mouseenter', '.js-tooltip:not([data-tooltip-no-hover])', ->
$t = $ @
o.show $t
$t.data tooltipHover: true
).on('mouseleave', '.js-tooltip:not([data-tooltip-no-hover])', ->
$t = $ @
$t.data tooltipHover: false
o.hide $t
).on('focus', 'input.js-tooltip:not([data-tooltip-no-focus]), textarea.js-tooltip:not([data-tooltip-no-focus])', ->
o.show $ @
).on('blur', 'input.js-tooltip:not([data-tooltip-no-focus]), textarea.js-tooltip:not([data-tooltip-no-focus])', ->
o.hide $ @
)
# Get the current tooltip$Div for an item or create a new one and return that
divFor: ($t) ->
o = _.Tooltip
unless $t.data 'tooltip$Div'
$t.parent().css position: 'relative' if $t.parent().css position: 'static'
$t.data tooltipHoverable: null if $t.data('tooltipMouse')?
$t.data _.extend
tooltipPosition: 'top'
tooltipOffset: 0
tooltipDuration: 0
, $t.data()
$div = $('<div><div/></div>')
.addClass("tooltip #{$t.data('tooltipPosition')}")
.css
display: 'none'
position: 'absolute'
zIndex: 999999;
$div
.find('> div')
.html($t.data 'tooltipHtml')
.css
position: 'relative'
$t
.data(tooltip$Div: $div)
.parent()
.append $div
position = o.position $t
$div
.css(position.home)
.find('> div')
.css _.extend {opacity: 0}, position.away
# If the tooltip is 'hoverable' (aka it should stay while the mouse is over the tooltip itself)
if $t.data('tooltipHoverable')?
$div.hover ->
_.Tooltip.show $t
$t.data tooltipHoverableHover: true
, ->
$t.data tooltipHoverableHover: false
_.Tooltip.hide $t
else
# Otherwise turn off interaction with the mouse
$div.css
pointerEvents: 'none'
'-webkit-user-select': 'none'
'-moz-user-select': 'none'
userSelect: 'none'
$t.data 'tooltip$Div'
# Show the tooltip if it's not already visible
show: ($t) ->
o = _.Tooltip
$div = o.divFor $t
unless (not $t.data('tooltipNoHover')? and $t.data 'tooltipHover') or
(not $t.data('tooltipNoFocus')? and $t.is 'input:focus, textarea:focus') or
$t.data 'tooltipHoverableHover'
position = o.position $t
$div
.appendTo($t.parent())
.css(_.extend {display: 'block'}, position.home)
.find('> div')
.stop()
.animate
opacity: 1
top: 0
left: 0
, $t.data 'tooltipDuration'
# Hide the tooltip if it's not already hidden
hide: ($t) ->
o = _.Tooltip
if $div = $t.data 'tooltip$Div'
unless (not $t.data('tooltipNoHover')? and $t.data 'tooltipHover') or
(not $t.data('tooltipNoFocus')? and $t.is 'input:focus, textarea:focus') or
$t.data 'tooltipHoverableHover'
position = o.position $t
$div
.css(position.home)
.find('> div')
.stop()
.animate _.extend({opacity: 0}, position.away),
duration: $t.data 'tooltipDuration'
complete: ->
$t.data tooltip$Div: null
$(@).parent().remove()
# Method for getting the correct CSS position data for a tooltip
position: ($t) ->
o = _.Tooltip
$div = $t.data 'tooltip$Div'
$parent = $t.parent()
offset = $t.data 'tooltipOffset'
divWidth = $div.outerWidth()
divHeight = $div.outerHeight()
parentScrollLeft = $parent.scrollLeft()
parentScrollTop = $parent.scrollTop()
if $t.data('tooltipMouse')?
tLeft = o.mouse.x - $t.parent().offset().left + parentScrollLeft
tTop = o.mouse.y - $t.parent().offset().top + parentScrollTop
tWidth = tHeight = 0
else
tPosition = $t.position()
tLeft = tPosition.left + parentScrollLeft + parseInt $t.css 'marginLeft'
tTop = tPosition.top + parentScrollTop + parseInt $t.css 'marginTop'
tWidth = $t.outerWidth()
tHeight = $t.outerHeight()
home =
left: tLeft
top: tTop
away = {}
switch $t.data('tooltipPosition')
when 'top'
home.left += (tWidth - divWidth)/2
home.top -= divHeight
away.top = -offset
when 'right'
home.left += tWidth
home.top += (tHeight - divHeight)/2
away.left = offset
when 'bottom'
home.left += (tWidth - divWidth)/2
home.top += tHeight
away.top = offset
when 'left'
home.left -= divWidth
home.top += (tHeight - divHeight)/2
away.left = -offset
{home: home, away: away}
# Use this to correct the tooltip content and positioning between events if necessary
correct: ($t) ->
o = _.Tooltip
$div = $t.data 'tooltip$Div'
if $div
if $t.css('display') is 'none'
$t.mouseleave().blur()
else
$div.find('> div').html($t.data 'tooltipHtml')
$div.css _.Tooltip.position($t).home
# Use this to remove a tooltip
remove: ($t) ->
$t
.data(
tooltipHover: false
tooltipHoverableHover: false
).removeClass('js-tooltip')
.data('tooltip$Div')?.remove()
# State manager
State:
# Header to send with the XHR
HEADER: 'X-Chromeless'
xhr: {}
cache: {}
# The attributes below are optional and can be set at runtime as needed
# When true, forces State to reload the page on the next request.
# refresh: false
# Specify data to send with the XHR request
data : {}
load: ->
o = _.State
if history.state?
history.replaceState true, null
$(window).on 'popstate', (e) ->
if e.originalEvent.state?
o.push location.href
else
history.replaceState true, null
$("body").on 'click', '.js-state', ->
$t = $ @
o.push (if $t.data 'stateUrl' then $t.data 'stateUrl' else $t.attr 'href'), $t.data 'stateProtocol'
false
updateCache: (url, obj) ->
o = _.State
if o.cache[url]?
_.extend o.cache[url], obj
else
o.cache[url] = obj
push: (url, protocol = location.protocol) ->
o = _.State
url = _.url url, protocol
if history.pushState? and not o.refresh and not _.State.data[url]?.refresh and _.startsWith url, location.protocol
o.xhr.abort?()
o.clear o.cache[url], url
if o.cache[url]? and o.cache[url].cache isnt false
o.change url
else
o.before o.cache[url], url
o.xhr = $.ajax url,
data: o.data
success: (data) ->
valid = null
selectors = {}
$(data.replace /<(\/)?script>/gi, '<!--$1state-script-->').each ->
$t = $ @
unless $t[0] instanceof Text
if (s = $t.attr 'id') or $t.is 'title'
selectors[s and "##{s}" or 'title'] = $t.html().replace /<!--(\/)?state-script-->/g, '<$1script>'
valid = true if s
else unless valid?
valid = false
url = selectors['#chromeless-request-url'] if selectors['#chromeless-request-url']? and selectors['#chromeless-request-url'] isnt url
if valid
o.updateCache url, selectors
o.after o.cache[url], url
o.change url
else
location.assign url
beforeSend: (xhr) -> xhr.setRequestHeader o.HEADER, 1
error: -> location.assign url
else
location.assign url
change: (url) ->
o = _.State
history[if o.cache[url].replace then 'replaceState' else 'pushState'] true, null, url if location.href isnt url
o.parse o.cache[url], url
clear: ->
before: ->
after: ->
parse: ->
# Load images only when they're on the page or about to be on it
Lazy:
# Default tolerance, can be overidden here or with data-tolerance='xxx'
TOLERANCE: 100
# After the DOM is ready
load: ->
o = _.Lazy
$(window).on 'scroll resize', o.dom
# Check for new lazy images
dom: ->
# Wait for the browser to position the element on the page before checking its coordinates
_.nextTick ->
$('img.js-lazy').each ->
$t = $ @
visible = _.reduce $t.parents(), (memo, parent) ->
memo and $(parent).css('display') isnt 'none' and $(parent).css('visibility') isnt 'hidden'
, true
if visible and $(window).scrollTop() + $(window).outerHeight() >= $t.offset().top - ($t.data('lazyTolerance') ? _.Lazy.TOLERANCE)
url = $t.data 'lazyUrl'
$t.removeClass('js-lazy').attr 'src', url
# Everyone's favorite cheat code
Konami: (callback, onlyOnce = false, code = '38,38,40,40,37,39,37,39,66,65,13', touchCode = 'up,up,down,down,left,right,left,right,tap,tap,tap') ->
keysPressed = []
touchEvents = []
tap = false
startX = startY = dX = dY = 0
keyDownEvent = (e) ->
keysPressed.push e.keyCode
if _.endsWith keysPressed + '', code
$(document).off 'keydown', keyDownEvent if onlyOnce
keysPressed = []
e.preventDefault()
callback()
touchStartEvent = (e) ->
e = e.originalEvent
if e.touches.length is 1
touch = e.touches[0]
{screenX: startX, screenY: startY} = touch
tap = tracking = true
touchMoveEvent = (e) ->
e = e.originalEvent
if e.touches.length is 1 and tap
touch = e.touches[0]
dX = touch.screenX - startX
dY = touch.screenY - startY
rightLeft = if dX > 0 then 'right' else 'left'
downUp = if dY > 0 then 'down' else 'up'
val = if Math.abs(dX) > Math.abs dY then rightLeft else downUp
touchEvents.push val
tap = false
checkEvents e
touchEndEvent = (e) ->
e = e.originalEvent
if e.touches.length is 0 and tap
touchEvents.push 'tap'
checkEvents e
checkEvents = (e) ->
if _.endsWith touchEvents + '', touchCode
if onlyOnce
$(document).off 'touchmove', touchMoveEvent
$(document).off 'touchend', touchEndEvent
touchEvents = []
e.preventDefault()
callback()
$(document).on 'keydown', keyDownEvent
$(document).on 'touchstart', touchStartEvent
$(document).on 'touchmove', touchMoveEvent
$(document).on 'touchend', touchEndEvent
# Making Cookie management easy on you
Cookie: (name, val, opt = {}) ->
if typeof name is 'object'
_.Cookie n, v, val for n, v of name
else if typeof name is 'string' and val isnt undefined
opt.expires = -1 if val is null
val ||= ''
params = []
params.push "; Expires=#{if opt.expires.toGMTString? then opt.expires.toGMTString() else new Date(new Date().getTime()+opt.expires*1000*60*60*24).toGMTString()}" if opt.expires
params.push "; Path=#{opt.path}" if opt.path
params.push "; Domain=#{opt.domain}" if opt.domain
params.push '; HttpOnly' if opt.httpOnly
params.push '; Secure' if opt.secure
document.cookie = "#{encodeURIComponent name}=#{encodeURIComponent val}#{params.join ''}"
else
cookies = {}
if document.cookie
_.each decodeURIComponent(document.cookie).split(/\s*;\s*/), (cookie) ->
{1: n, 2: v} = /^([^=]*)\s*=\s*(.*)$/.exec cookie
if typeof name is 'string' and name is n
return v
else if not name?
cookies[n] = v
if not name then cookies else null
# Mixin the Extrascore Mixins
_.mixin Extrascore.Mixins
# Extend the Extrascore Extensions
_.extend _, Extrascore.Extensions
# Initialize the Extrascore Extensions
_.init Extrascore.Extensions
| 188882 | ###! Extrascore (requires jQuery and Underscore) by <NAME> (case<EMAIL>.<EMAIL>) ###
# Check dependencies
if not Extrascore? and jQuery? and _?
# Use the jQuery shortcut
$ = jQuery
# Define the Extrascore object
window.Extrascore =
# Mixins for Underscore
Mixins:
# Mass method call for every child of obj
mass: (obj, key, args...) ->
for __, val of obj
val?[key]? args...
# Initialize an object by calling init on children and then assigning the load method to jQuery's DOM ready call
# This is a special _.mass() function
init: (obj) ->
# Call on jQuery's DOM ready call
load = (obj) ->
_.mass obj, 'load'
dom obj
$('body').on 'DOMSubtreeModified', (e) -> dom obj, e unless obj._extrascoreDomLocked
# Call on every DOMSubtreeModified event (use carefully, doesn't work in Opera *shocking*)
dom = (obj, e) ->
obj._extrascoreDomLocked = true
_.mass obj, 'dom', e
delete obj._extrascoreDomLocked
# Call `init()` on all children of obj if the method exists
_.mass obj, 'init'
$ -> load obj
# Clean a string for use in a URL or query
clean: (str, opt = {}) ->
opt = _.extend
delimiter: ' '
alphanumeric: false
downcase: false
, opt
str = str+''
str = str.toLowerCase() if opt.downcase
str = str.replace(/'/g, '').replace(/[^\w\s]|_/g, ' ') if opt.alphanumeric
$.trim(str.replace /\s+/g, ' ').replace /\s/g, opt.delimiter
# Shortcut for _.clean str, delimiter: '-', alphanumeric: true, downcase: true
urlize: (str, delimiter = '-') ->
_.clean str, delimiter: delimiter, alphanumeric: true, downcase: true
# This sucker comes in handy
startsWith: (str, start) ->
str = '' + str
start = '' + start
return start.length <= str.length and str.substr(0, start.length) is start
# This guy too
endsWith: (str, end) ->
str = '' + str
end = '' + end
return end.length <= str.length and str.substr(str.length-end.length) is end
# Sort an object by key for iteration
sortByKey: (obj) ->
newObj = {}
_.chain(obj)
.map((val, key) -> [key, val])
.sortBy((val) -> val[0])
.each (val) -> newObj[val[0]] = val[1]
newObj
# A quick zip to the top of the page, or optionally to an integer or jQuery object specified by `val`
scrollTo: (val = 0, duration, callback) ->
if val instanceof $
val = val.offset().top
$(if $.browser.webkit then document.body else document.documentElement).animate scrollTop: val, duration, callback
# Get a full URL from a relative url
url: (path = '', protocol = location.protocol) ->
# Append a colon to the protocol if necessary
protocol += ':' unless _.endsWith protocol, ':'
# See if it's already a URL
unless path.match /^\w+:/
# See if it's a URL looking for a protocol
if _.startsWith path, '//'
path = location.protocol + path
# See if it's relative to the domain root
else if _.startsWith path, '/'
path = "#{location.protocol}//#{location.host + path}"
# Otherwise it must be relative to the current location
else
path = location.href + path
# Swap the protocols if necessary
path.replace location.protocol, protocol
# The reverse of _.url()
relativeUrl: (path = '') -> _.url(path).replace /^\w+:\/\/[^/]+/, ''
# Sometimes it's handy to know the size of the scrollbars in a browser
scrollbarSize: (dimension = 'width') ->
$out = $('<div><div/></div>')
.appendTo('body')
.css
position: 'fixed'
overflow: 'hidden'
left: -50
top: -50
width: 50
height: 50
$in = $out.find('> div').css height: '100%'
d1 = $in[dimension]()
$out.css overflow: 'scroll'
d2 = $in[dimension]()
$out.remove()
d1-d2
# Does the element have a scrollbar?
hasScrollbar: ($obj) ->
style = $obj.attr 'style'
d1 = $obj.width()
d2 = $obj.css(overflow: 'hidden').width()
if style?
$obj.attr style: style
else
$obj.removeAttr 'style'
d1 isnt d2
# Break a query up into components if colons are used, otherwise just return the cleaned string
parseQuery: (str, downcase = true) ->
str = _.clean str, downcase: downcase
colon = _.compact str.replace(/^:+|:+$/g, '').split ':'
if colon.length > 1
colon = _.map colon, (str) -> $.trim(str).match /(?:^|^(.*)\s)(\S*)$/
terms = {}
_.each colon, (match, i) ->
if i < colon.length - 1
terms[match[2]] = colon[i + 1][1]
else
prev = colon[i - 1][2]
terms[prev] = (if terms[prev] then terms[prev]+' ' else '')+match[2]
return terms
str
# Ghetto nextTick
nextTick: (fn) -> setTimeout fn, 0
# Extensions for Underscore (more of individual classes using Underscore for the namespace then actual extentions)
Extensions:
# Placeholder for lame browsers
Placeholder:
# After the DOM is loaded
load: ->
# Hijack jQuery's .val() so it will return an empty string if Placeholder says it should
$.fn._val = $.fn.val
$.fn.val = (str) ->
if str?
$(@).each -> $(@)._val str
else
if $(@).data 'placeholderEmpty' then '' else $(@)._val()
# Check for new inputs or textareas than need to be initialized with Placeholder
dom: ->
$('.js-placeholder, .js-placeholder-password').each ->
$t = $ @
if $t.data('placeholderHtml')? and not $t.data('placeholderEmpty')?
password = $t.hasClass 'js-placeholder-password'
placeholder = $t.data 'placeholderHtml'
$t[0].type = 'password' if password
unless password and $.browser.msie and $.browser.version.split('.') < 9
if not $t.val() or $t.val() is placeholder
$t.data placeholderEmpty: true
$t.val placeholder
$t[0].type = 'text' if password
else
$t.data placeholderEmpty: false
$t.attr
placeholder: placeholder
title: placeholder
$t.focus(->
$t.val '' if $t.data 'placeholderEmpty'
if password
$t[0].type = 'password'
$t.attr placeholder: placeholder
$t.data placeholderEmpty: false
).blur ->
if $t.val()
$t.data placeholderEmpty: false
else
$t.val placeholder
$t.data placeholderEmpty: true
$t[0].type = 'text' if password
# Multipurpose PopUp
PopUp:
# Duration and Fade duration default, feel free to change
DURATION: 0
FADE_DURATION: 250
# Build the PopUp element
build: ->
# Shortcut
o = _.PopUp;
unless $('#js-pop-up-container').length
# Until 'display: box' becomes more widely available, we're stuck with table/table-cell
$('body').append o.$container =
$('<div><div><div><div/></div></div></div>')
.attr(
id: 'js-pop-up-container'
).css
display: 'none'
position: 'fixed'
zIndex: 999999
left: 0
top: 0
width: '100%'
height: '100%'
opacity: 0
overflow: 'auto'
o.hide()
o.$container.find('> div')
.attr(
id: 'js-pop-up-table'
).css
display: 'table'
width: '100%'
height: '100%'
o.$container.find('> div > div')
.attr(
id: 'js-pop-up-table-cell'
).css
display: 'table-cell'
textAlign: 'center'
verticalAlign: 'middle'
o.$div =
o.$container.find('> div > div > div')
.attr(
id: 'js-pop-up'
).css
display: 'inline-block'
position: 'relative'
o.$container.on 'click', -> o.$div.find('.js-pop-up-outside').click()
o.$div
.on('click', false)
.on 'click', '.js-pop-up-hide', o.hide
$(document).keydown (e) ->
if o.$container.css('display') is 'block' and not $('body :focus').length
switch e.keyCode
when 13 then o.$div.find('.js-pop-up-enter').click()
when 27 then o.$div.find('.js-pop-up-esc').click()
else return true
false
# Fade the PopUp out
hide: (fadeDuration) ->
o = _.PopUp
if o.$container?
o.$container
.stop()
.animate
opacity: 0
, (if isNaN(fadeDuration) then o.fadeDuration else fadeDuration)
, ->
o.$container.css display: 'none'
if o.saveBodyStyle?
$('body').attr style: o.saveBodyStyle
else
$('body').removeAttr 'style'
o.saveBodyStyle = null
# Show the PopUp with the given `html`, optionally for a 'duration', with a 'callback', and/or with a 'fadeDuration'
show: (html, opt = {}) ->
o = _.PopUp
# Build the PopUp element
o.build()
opt = _.extend
duration: o.DURATION
callback: null
fadeDuration: o.FADE_DURATION
, opt
o.saveBodyStyle = $('body').attr 'style' unless o.$container.css('display') is 'block'
$('body').css marginRight: _.scrollbarSize() if _.hasScrollbar $ 'body'
$('body').css overflow: 'hidden'
$('body :focus').blur()
o.fadeDuration = opt.fadeDuration
o.$div.html html
o.$container
.stop()
.css(
display: 'block')
.animate
opacity: 1
, opt.fadeDuration
clearTimeout o.timeout if o.timeout?
o.timeout = setTimeout ->
o.hide()
opt.callback?()
, opt.duration if opt.duration
# Search (as you type)
Search:
# Check for Search objects to be initialized
dom: ->
$('.js-search').each ->
$search = $ @
unless $search.data('searchCache')?
o = _.Search
$search.data
searchCache: []
searchId: 0
searchAjax: {}
searchLastQ: null
searchPage: 0
searchHoldHover: false
search$Q: $search.find '.js-search-q'
search$Results: $search.find '.js-search-results'
$q = $search.data 'search$Q'
$results = $search.data 'search$Results'
o.query $search if $q.is ':focus'
$search.hover(->
$search.data searchHover: true
, ->
$search.data searchHover: false
$results.css display: 'none' unless $q.is(':focus') or $search.data 'searchHoldHover'
).mouseover ->
$search.data searchHoldHover: false
$q.blur(-> _.nextTick -> $results.css display: 'none' unless $search.data 'searchHover')
.focus(-> $search.data searchHoldHover: false)
.keydown((e) ->
switch e.keyCode
when 13 then $search.find('.js-search-selected').click()
when 38 then o.select $search, 'prev'
when 40 then o.select $search, 'next'
when 27
if $q.val() is ''
$q.blur()
_.nextTick ->
o.query $search
else
_.nextTick ->
$q.val ''
o.query $search
else
_.nextTick -> o.query $search if $q.is ':focus'
return true
false
).on 'focus keyup change', ->
o.query $search
$results.on 'mouseenter click', '.js-search-result', (e) ->
$t = $ @
$results.find('.js-search-result.js-search-selected').removeClass 'js-search-selected'
$t.addClass 'js-search-selected'
if e.type is 'click'
if $t.hasClass 'js-search-prev'
o.page $search, $search.data('searchPage') - 1, true
$search.data searchHoldHover: true
else if $t.hasClass 'js-search-next'
o.page $search, $search.data('searchPage') + 1
$search.data searchHoldHover: true
else if $t.hasClass 'js-search-submit'
$t.parents('form').submit()
if $t.hasClass 'js-search-hide'
$q.blur()
$results.css display: 'none'
# Change the current search results page
page: ($searches, n, prev) ->
$searches.each ->
$search = $ @
$results = $search.data 'search$Results'
n = Math.min $results.find('.js-search-page').length - 1, Math.max n, 0
$results.find('.js-search-selected').removeClass 'js-search-selected'
$results.find('.js-search-page')
.css(display: 'none')
.eq(n)
.removeAttr('style')
.find('.js-search-result:not(.js-search-prev):not(.js-search-next)')[if prev then 'last' else 'first']()
.addClass 'js-search-selected'
$search.data 'searchPage', n
# Send the value of q to the correct search function and return the result to the correct callback
query: ($searches, urlN = 1) ->
$searches.each ->
o = _.Search
$search = $ @
$results = $search.data 'search$Results'
$q = $search.data 'search$Q'
callback = eval $search.data 'searchCallback'
q = _.clean $q.val(), downcase: true
t = new Date().getTime()
$results.css display: 'block'
unless q or $search.data('js-search-empty')?
$results.css(display: 'none').empty()
$search.removeClass 'js-search-loading'
else if q isnt $search.data('searchLastQ') or urlN > 1
callback $search
clearTimeout $search.data 'searchTimeout'
$search.data('searchAjax').abort?()
if $search.data('searchCache')["#{urlN}_" + q]?
callback $search, $search.data('searchCache')["#{urlN}_" + q], urlN
$search.removeClass 'js-search-loading'
o.query $search, urlN + 1 if $search.data("searchUrl#{urlN+1}")?
else
$search.addClass('js-search-loading').data 'searchTimeout',
setTimeout ->
handleData = (data) ->
$search.data('searchCache')["#{urlN}_" + q] = data
if check is $search.data('searchId') and (_.clean($q.val()) or $search.data('js-search-empty')?)
$search.removeClass 'js-search-loading'
callback $search, data, urlN
o.query $search, urlN + 1 if $search.data "searchUrl#{urlN+1}"
check = $search.data(searchId: $search.data('searchId') + 1).data 'searchId'
if $search.data('searchJs')?
handleData eval($search.data 'searchJs')(q)
else if $search.data('searchUrl')?
$search.data searchAjax: $.getJSON($search.data("searchUrl#{if urlN is 1 then '' else urlN}"), q: q, handleData)
, $search.data('searchDelay') ? 0
$search.data 'searchLastQ', q
# Select the next or previous in a list of results
select: ($searches, dir) ->
$searches.each ->
o = _.Search
$search = $ @
$page = $search.find('.js-search-page').eq $search.data 'searchPage'
$page.find('.js-search-result')[if dir is 'prev' then 'first' else 'last']().addClass 'js-search-selected' unless $page.find('.js-search-selected').removeClass('js-search-selected')[dir]().addClass('js-search-selected').length
if $page.find('.js-search-result.js-search-selected.js-search-prev').length
o.page $search, $search.data('searchPage') - 1, true
else if $page.find('.js-search-result.js-search-selected.js-search-next').length
o.page $search, $search.data('searchPage') + 1
# Yay tooltips!
Tooltip:
# Store mouse coordinates
mouse:
x: 0
y: 0
# Set mousemove on document to track coordinates
load: ->
o = _.Tooltip
$('body').mousemove((e) ->
o.mouse =
x: e.pageX
y: e.pageY
$('.js-tooltip').each ->
$t = $ @
$t.data('tooltip$Div').css o.position($t).home if $t.data('tooltip$Div')? and $t.data('tooltipMouse')?
).on('mouseenter', '.js-tooltip:not([data-tooltip-no-hover])', ->
$t = $ @
o.show $t
$t.data tooltipHover: true
).on('mouseleave', '.js-tooltip:not([data-tooltip-no-hover])', ->
$t = $ @
$t.data tooltipHover: false
o.hide $t
).on('focus', 'input.js-tooltip:not([data-tooltip-no-focus]), textarea.js-tooltip:not([data-tooltip-no-focus])', ->
o.show $ @
).on('blur', 'input.js-tooltip:not([data-tooltip-no-focus]), textarea.js-tooltip:not([data-tooltip-no-focus])', ->
o.hide $ @
)
# Get the current tooltip$Div for an item or create a new one and return that
divFor: ($t) ->
o = _.Tooltip
unless $t.data 'tooltip$Div'
$t.parent().css position: 'relative' if $t.parent().css position: 'static'
$t.data tooltipHoverable: null if $t.data('tooltipMouse')?
$t.data _.extend
tooltipPosition: 'top'
tooltipOffset: 0
tooltipDuration: 0
, $t.data()
$div = $('<div><div/></div>')
.addClass("tooltip #{$t.data('tooltipPosition')}")
.css
display: 'none'
position: 'absolute'
zIndex: 999999;
$div
.find('> div')
.html($t.data 'tooltipHtml')
.css
position: 'relative'
$t
.data(tooltip$Div: $div)
.parent()
.append $div
position = o.position $t
$div
.css(position.home)
.find('> div')
.css _.extend {opacity: 0}, position.away
# If the tooltip is 'hoverable' (aka it should stay while the mouse is over the tooltip itself)
if $t.data('tooltipHoverable')?
$div.hover ->
_.Tooltip.show $t
$t.data tooltipHoverableHover: true
, ->
$t.data tooltipHoverableHover: false
_.Tooltip.hide $t
else
# Otherwise turn off interaction with the mouse
$div.css
pointerEvents: 'none'
'-webkit-user-select': 'none'
'-moz-user-select': 'none'
userSelect: 'none'
$t.data 'tooltip$Div'
# Show the tooltip if it's not already visible
show: ($t) ->
o = _.Tooltip
$div = o.divFor $t
unless (not $t.data('tooltipNoHover')? and $t.data 'tooltipHover') or
(not $t.data('tooltipNoFocus')? and $t.is 'input:focus, textarea:focus') or
$t.data 'tooltipHoverableHover'
position = o.position $t
$div
.appendTo($t.parent())
.css(_.extend {display: 'block'}, position.home)
.find('> div')
.stop()
.animate
opacity: 1
top: 0
left: 0
, $t.data 'tooltipDuration'
# Hide the tooltip if it's not already hidden
hide: ($t) ->
o = _.Tooltip
if $div = $t.data 'tooltip$Div'
unless (not $t.data('tooltipNoHover')? and $t.data 'tooltipHover') or
(not $t.data('tooltipNoFocus')? and $t.is 'input:focus, textarea:focus') or
$t.data 'tooltipHoverableHover'
position = o.position $t
$div
.css(position.home)
.find('> div')
.stop()
.animate _.extend({opacity: 0}, position.away),
duration: $t.data 'tooltipDuration'
complete: ->
$t.data tooltip$Div: null
$(@).parent().remove()
# Method for getting the correct CSS position data for a tooltip
position: ($t) ->
o = _.Tooltip
$div = $t.data 'tooltip$Div'
$parent = $t.parent()
offset = $t.data 'tooltipOffset'
divWidth = $div.outerWidth()
divHeight = $div.outerHeight()
parentScrollLeft = $parent.scrollLeft()
parentScrollTop = $parent.scrollTop()
if $t.data('tooltipMouse')?
tLeft = o.mouse.x - $t.parent().offset().left + parentScrollLeft
tTop = o.mouse.y - $t.parent().offset().top + parentScrollTop
tWidth = tHeight = 0
else
tPosition = $t.position()
tLeft = tPosition.left + parentScrollLeft + parseInt $t.css 'marginLeft'
tTop = tPosition.top + parentScrollTop + parseInt $t.css 'marginTop'
tWidth = $t.outerWidth()
tHeight = $t.outerHeight()
home =
left: tLeft
top: tTop
away = {}
switch $t.data('tooltipPosition')
when 'top'
home.left += (tWidth - divWidth)/2
home.top -= divHeight
away.top = -offset
when 'right'
home.left += tWidth
home.top += (tHeight - divHeight)/2
away.left = offset
when 'bottom'
home.left += (tWidth - divWidth)/2
home.top += tHeight
away.top = offset
when 'left'
home.left -= divWidth
home.top += (tHeight - divHeight)/2
away.left = -offset
{home: home, away: away}
# Use this to correct the tooltip content and positioning between events if necessary
correct: ($t) ->
o = _.Tooltip
$div = $t.data 'tooltip$Div'
if $div
if $t.css('display') is 'none'
$t.mouseleave().blur()
else
$div.find('> div').html($t.data 'tooltipHtml')
$div.css _.Tooltip.position($t).home
# Use this to remove a tooltip
remove: ($t) ->
$t
.data(
tooltipHover: false
tooltipHoverableHover: false
).removeClass('js-tooltip')
.data('tooltip$Div')?.remove()
# State manager
State:
# Header to send with the XHR
HEADER: 'X-Chromeless'
xhr: {}
cache: {}
# The attributes below are optional and can be set at runtime as needed
# When true, forces State to reload the page on the next request.
# refresh: false
# Specify data to send with the XHR request
data : {}
load: ->
o = _.State
if history.state?
history.replaceState true, null
$(window).on 'popstate', (e) ->
if e.originalEvent.state?
o.push location.href
else
history.replaceState true, null
$("body").on 'click', '.js-state', ->
$t = $ @
o.push (if $t.data 'stateUrl' then $t.data 'stateUrl' else $t.attr 'href'), $t.data 'stateProtocol'
false
updateCache: (url, obj) ->
o = _.State
if o.cache[url]?
_.extend o.cache[url], obj
else
o.cache[url] = obj
push: (url, protocol = location.protocol) ->
o = _.State
url = _.url url, protocol
if history.pushState? and not o.refresh and not _.State.data[url]?.refresh and _.startsWith url, location.protocol
o.xhr.abort?()
o.clear o.cache[url], url
if o.cache[url]? and o.cache[url].cache isnt false
o.change url
else
o.before o.cache[url], url
o.xhr = $.ajax url,
data: o.data
success: (data) ->
valid = null
selectors = {}
$(data.replace /<(\/)?script>/gi, '<!--$1state-script-->').each ->
$t = $ @
unless $t[0] instanceof Text
if (s = $t.attr 'id') or $t.is 'title'
selectors[s and "##{s}" or 'title'] = $t.html().replace /<!--(\/)?state-script-->/g, '<$1script>'
valid = true if s
else unless valid?
valid = false
url = selectors['#chromeless-request-url'] if selectors['#chromeless-request-url']? and selectors['#chromeless-request-url'] isnt url
if valid
o.updateCache url, selectors
o.after o.cache[url], url
o.change url
else
location.assign url
beforeSend: (xhr) -> xhr.setRequestHeader o.HEADER, 1
error: -> location.assign url
else
location.assign url
change: (url) ->
o = _.State
history[if o.cache[url].replace then 'replaceState' else 'pushState'] true, null, url if location.href isnt url
o.parse o.cache[url], url
clear: ->
before: ->
after: ->
parse: ->
# Load images only when they're on the page or about to be on it
Lazy:
# Default tolerance, can be overidden here or with data-tolerance='xxx'
TOLERANCE: 100
# After the DOM is ready
load: ->
o = _.Lazy
$(window).on 'scroll resize', o.dom
# Check for new lazy images
dom: ->
# Wait for the browser to position the element on the page before checking its coordinates
_.nextTick ->
$('img.js-lazy').each ->
$t = $ @
visible = _.reduce $t.parents(), (memo, parent) ->
memo and $(parent).css('display') isnt 'none' and $(parent).css('visibility') isnt 'hidden'
, true
if visible and $(window).scrollTop() + $(window).outerHeight() >= $t.offset().top - ($t.data('lazyTolerance') ? _.Lazy.TOLERANCE)
url = $t.data 'lazyUrl'
$t.removeClass('js-lazy').attr 'src', url
# Everyone's favorite cheat code
Konami: (callback, onlyOnce = false, code = '38,38,40,40,37,39,37,39,66,65,13', touchCode = 'up,up,down,down,left,right,left,right,tap,tap,tap') ->
keysPressed = []
touchEvents = []
tap = false
startX = startY = dX = dY = 0
keyDownEvent = (e) ->
keysPressed.push e.keyCode
if _.endsWith keysPressed + '', code
$(document).off 'keydown', keyDownEvent if onlyOnce
keysPressed = []
e.preventDefault()
callback()
touchStartEvent = (e) ->
e = e.originalEvent
if e.touches.length is 1
touch = e.touches[0]
{screenX: startX, screenY: startY} = touch
tap = tracking = true
touchMoveEvent = (e) ->
e = e.originalEvent
if e.touches.length is 1 and tap
touch = e.touches[0]
dX = touch.screenX - startX
dY = touch.screenY - startY
rightLeft = if dX > 0 then 'right' else 'left'
downUp = if dY > 0 then 'down' else 'up'
val = if Math.abs(dX) > Math.abs dY then rightLeft else downUp
touchEvents.push val
tap = false
checkEvents e
touchEndEvent = (e) ->
e = e.originalEvent
if e.touches.length is 0 and tap
touchEvents.push 'tap'
checkEvents e
checkEvents = (e) ->
if _.endsWith touchEvents + '', touchCode
if onlyOnce
$(document).off 'touchmove', touchMoveEvent
$(document).off 'touchend', touchEndEvent
touchEvents = []
e.preventDefault()
callback()
$(document).on 'keydown', keyDownEvent
$(document).on 'touchstart', touchStartEvent
$(document).on 'touchmove', touchMoveEvent
$(document).on 'touchend', touchEndEvent
# Making Cookie management easy on you
Cookie: (name, val, opt = {}) ->
if typeof name is 'object'
_.Cookie n, v, val for n, v of name
else if typeof name is 'string' and val isnt undefined
opt.expires = -1 if val is null
val ||= ''
params = []
params.push "; Expires=#{if opt.expires.toGMTString? then opt.expires.toGMTString() else new Date(new Date().getTime()+opt.expires*1000*60*60*24).toGMTString()}" if opt.expires
params.push "; Path=#{opt.path}" if opt.path
params.push "; Domain=#{opt.domain}" if opt.domain
params.push '; HttpOnly' if opt.httpOnly
params.push '; Secure' if opt.secure
document.cookie = "#{encodeURIComponent name}=#{encodeURIComponent val}#{params.join ''}"
else
cookies = {}
if document.cookie
_.each decodeURIComponent(document.cookie).split(/\s*;\s*/), (cookie) ->
{1: n, 2: v} = /^([^=]*)\s*=\s*(.*)$/.exec cookie
if typeof name is 'string' and name is n
return v
else if not name?
cookies[n] = v
if not name then cookies else null
# Mixin the Extrascore Mixins
_.mixin Extrascore.Mixins
# Extend the Extrascore Extensions
_.extend _, Extrascore.Extensions
# Initialize the Extrascore Extensions
_.init Extrascore.Extensions
| true | ###! Extrascore (requires jQuery and Underscore) by PI:NAME:<NAME>END_PI (casePI:EMAIL:<EMAIL>END_PI.PI:EMAIL:<EMAIL>END_PI) ###
# Check dependencies
if not Extrascore? and jQuery? and _?
# Use the jQuery shortcut
$ = jQuery
# Define the Extrascore object
window.Extrascore =
# Mixins for Underscore
Mixins:
# Mass method call for every child of obj
mass: (obj, key, args...) ->
for __, val of obj
val?[key]? args...
# Initialize an object by calling init on children and then assigning the load method to jQuery's DOM ready call
# This is a special _.mass() function
init: (obj) ->
# Call on jQuery's DOM ready call
load = (obj) ->
_.mass obj, 'load'
dom obj
$('body').on 'DOMSubtreeModified', (e) -> dom obj, e unless obj._extrascoreDomLocked
# Call on every DOMSubtreeModified event (use carefully, doesn't work in Opera *shocking*)
dom = (obj, e) ->
obj._extrascoreDomLocked = true
_.mass obj, 'dom', e
delete obj._extrascoreDomLocked
# Call `init()` on all children of obj if the method exists
_.mass obj, 'init'
$ -> load obj
# Clean a string for use in a URL or query
clean: (str, opt = {}) ->
opt = _.extend
delimiter: ' '
alphanumeric: false
downcase: false
, opt
str = str+''
str = str.toLowerCase() if opt.downcase
str = str.replace(/'/g, '').replace(/[^\w\s]|_/g, ' ') if opt.alphanumeric
$.trim(str.replace /\s+/g, ' ').replace /\s/g, opt.delimiter
# Shortcut for _.clean str, delimiter: '-', alphanumeric: true, downcase: true
urlize: (str, delimiter = '-') ->
_.clean str, delimiter: delimiter, alphanumeric: true, downcase: true
# This sucker comes in handy
startsWith: (str, start) ->
str = '' + str
start = '' + start
return start.length <= str.length and str.substr(0, start.length) is start
# This guy too
endsWith: (str, end) ->
str = '' + str
end = '' + end
return end.length <= str.length and str.substr(str.length-end.length) is end
# Sort an object by key for iteration
sortByKey: (obj) ->
newObj = {}
_.chain(obj)
.map((val, key) -> [key, val])
.sortBy((val) -> val[0])
.each (val) -> newObj[val[0]] = val[1]
newObj
# A quick zip to the top of the page, or optionally to an integer or jQuery object specified by `val`
scrollTo: (val = 0, duration, callback) ->
if val instanceof $
val = val.offset().top
$(if $.browser.webkit then document.body else document.documentElement).animate scrollTop: val, duration, callback
# Get a full URL from a relative url
url: (path = '', protocol = location.protocol) ->
# Append a colon to the protocol if necessary
protocol += ':' unless _.endsWith protocol, ':'
# See if it's already a URL
unless path.match /^\w+:/
# See if it's a URL looking for a protocol
if _.startsWith path, '//'
path = location.protocol + path
# See if it's relative to the domain root
else if _.startsWith path, '/'
path = "#{location.protocol}//#{location.host + path}"
# Otherwise it must be relative to the current location
else
path = location.href + path
# Swap the protocols if necessary
path.replace location.protocol, protocol
# The reverse of _.url()
relativeUrl: (path = '') -> _.url(path).replace /^\w+:\/\/[^/]+/, ''
# Sometimes it's handy to know the size of the scrollbars in a browser
scrollbarSize: (dimension = 'width') ->
$out = $('<div><div/></div>')
.appendTo('body')
.css
position: 'fixed'
overflow: 'hidden'
left: -50
top: -50
width: 50
height: 50
$in = $out.find('> div').css height: '100%'
d1 = $in[dimension]()
$out.css overflow: 'scroll'
d2 = $in[dimension]()
$out.remove()
d1-d2
# Does the element have a scrollbar?
hasScrollbar: ($obj) ->
style = $obj.attr 'style'
d1 = $obj.width()
d2 = $obj.css(overflow: 'hidden').width()
if style?
$obj.attr style: style
else
$obj.removeAttr 'style'
d1 isnt d2
# Break a query up into components if colons are used, otherwise just return the cleaned string
parseQuery: (str, downcase = true) ->
str = _.clean str, downcase: downcase
colon = _.compact str.replace(/^:+|:+$/g, '').split ':'
if colon.length > 1
colon = _.map colon, (str) -> $.trim(str).match /(?:^|^(.*)\s)(\S*)$/
terms = {}
_.each colon, (match, i) ->
if i < colon.length - 1
terms[match[2]] = colon[i + 1][1]
else
prev = colon[i - 1][2]
terms[prev] = (if terms[prev] then terms[prev]+' ' else '')+match[2]
return terms
str
# Ghetto nextTick
nextTick: (fn) -> setTimeout fn, 0
# Extensions for Underscore (more of individual classes using Underscore for the namespace then actual extentions)
Extensions:
# Placeholder for lame browsers
Placeholder:
# After the DOM is loaded
load: ->
# Hijack jQuery's .val() so it will return an empty string if Placeholder says it should
$.fn._val = $.fn.val
$.fn.val = (str) ->
if str?
$(@).each -> $(@)._val str
else
if $(@).data 'placeholderEmpty' then '' else $(@)._val()
# Check for new inputs or textareas than need to be initialized with Placeholder
dom: ->
$('.js-placeholder, .js-placeholder-password').each ->
$t = $ @
if $t.data('placeholderHtml')? and not $t.data('placeholderEmpty')?
password = $t.hasClass 'js-placeholder-password'
placeholder = $t.data 'placeholderHtml'
$t[0].type = 'password' if password
unless password and $.browser.msie and $.browser.version.split('.') < 9
if not $t.val() or $t.val() is placeholder
$t.data placeholderEmpty: true
$t.val placeholder
$t[0].type = 'text' if password
else
$t.data placeholderEmpty: false
$t.attr
placeholder: placeholder
title: placeholder
$t.focus(->
$t.val '' if $t.data 'placeholderEmpty'
if password
$t[0].type = 'password'
$t.attr placeholder: placeholder
$t.data placeholderEmpty: false
).blur ->
if $t.val()
$t.data placeholderEmpty: false
else
$t.val placeholder
$t.data placeholderEmpty: true
$t[0].type = 'text' if password
# Multipurpose PopUp
PopUp:
# Duration and Fade duration default, feel free to change
DURATION: 0
FADE_DURATION: 250
# Build the PopUp element
build: ->
# Shortcut
o = _.PopUp;
unless $('#js-pop-up-container').length
# Until 'display: box' becomes more widely available, we're stuck with table/table-cell
$('body').append o.$container =
$('<div><div><div><div/></div></div></div>')
.attr(
id: 'js-pop-up-container'
).css
display: 'none'
position: 'fixed'
zIndex: 999999
left: 0
top: 0
width: '100%'
height: '100%'
opacity: 0
overflow: 'auto'
o.hide()
o.$container.find('> div')
.attr(
id: 'js-pop-up-table'
).css
display: 'table'
width: '100%'
height: '100%'
o.$container.find('> div > div')
.attr(
id: 'js-pop-up-table-cell'
).css
display: 'table-cell'
textAlign: 'center'
verticalAlign: 'middle'
o.$div =
o.$container.find('> div > div > div')
.attr(
id: 'js-pop-up'
).css
display: 'inline-block'
position: 'relative'
o.$container.on 'click', -> o.$div.find('.js-pop-up-outside').click()
o.$div
.on('click', false)
.on 'click', '.js-pop-up-hide', o.hide
$(document).keydown (e) ->
if o.$container.css('display') is 'block' and not $('body :focus').length
switch e.keyCode
when 13 then o.$div.find('.js-pop-up-enter').click()
when 27 then o.$div.find('.js-pop-up-esc').click()
else return true
false
# Fade the PopUp out
hide: (fadeDuration) ->
o = _.PopUp
if o.$container?
o.$container
.stop()
.animate
opacity: 0
, (if isNaN(fadeDuration) then o.fadeDuration else fadeDuration)
, ->
o.$container.css display: 'none'
if o.saveBodyStyle?
$('body').attr style: o.saveBodyStyle
else
$('body').removeAttr 'style'
o.saveBodyStyle = null
# Show the PopUp with the given `html`, optionally for a 'duration', with a 'callback', and/or with a 'fadeDuration'
show: (html, opt = {}) ->
o = _.PopUp
# Build the PopUp element
o.build()
opt = _.extend
duration: o.DURATION
callback: null
fadeDuration: o.FADE_DURATION
, opt
o.saveBodyStyle = $('body').attr 'style' unless o.$container.css('display') is 'block'
$('body').css marginRight: _.scrollbarSize() if _.hasScrollbar $ 'body'
$('body').css overflow: 'hidden'
$('body :focus').blur()
o.fadeDuration = opt.fadeDuration
o.$div.html html
o.$container
.stop()
.css(
display: 'block')
.animate
opacity: 1
, opt.fadeDuration
clearTimeout o.timeout if o.timeout?
o.timeout = setTimeout ->
o.hide()
opt.callback?()
, opt.duration if opt.duration
# Search (as you type)
Search:
# Check for Search objects to be initialized
dom: ->
$('.js-search').each ->
$search = $ @
unless $search.data('searchCache')?
o = _.Search
$search.data
searchCache: []
searchId: 0
searchAjax: {}
searchLastQ: null
searchPage: 0
searchHoldHover: false
search$Q: $search.find '.js-search-q'
search$Results: $search.find '.js-search-results'
$q = $search.data 'search$Q'
$results = $search.data 'search$Results'
o.query $search if $q.is ':focus'
$search.hover(->
$search.data searchHover: true
, ->
$search.data searchHover: false
$results.css display: 'none' unless $q.is(':focus') or $search.data 'searchHoldHover'
).mouseover ->
$search.data searchHoldHover: false
$q.blur(-> _.nextTick -> $results.css display: 'none' unless $search.data 'searchHover')
.focus(-> $search.data searchHoldHover: false)
.keydown((e) ->
switch e.keyCode
when 13 then $search.find('.js-search-selected').click()
when 38 then o.select $search, 'prev'
when 40 then o.select $search, 'next'
when 27
if $q.val() is ''
$q.blur()
_.nextTick ->
o.query $search
else
_.nextTick ->
$q.val ''
o.query $search
else
_.nextTick -> o.query $search if $q.is ':focus'
return true
false
).on 'focus keyup change', ->
o.query $search
$results.on 'mouseenter click', '.js-search-result', (e) ->
$t = $ @
$results.find('.js-search-result.js-search-selected').removeClass 'js-search-selected'
$t.addClass 'js-search-selected'
if e.type is 'click'
if $t.hasClass 'js-search-prev'
o.page $search, $search.data('searchPage') - 1, true
$search.data searchHoldHover: true
else if $t.hasClass 'js-search-next'
o.page $search, $search.data('searchPage') + 1
$search.data searchHoldHover: true
else if $t.hasClass 'js-search-submit'
$t.parents('form').submit()
if $t.hasClass 'js-search-hide'
$q.blur()
$results.css display: 'none'
# Change the current search results page
page: ($searches, n, prev) ->
$searches.each ->
$search = $ @
$results = $search.data 'search$Results'
n = Math.min $results.find('.js-search-page').length - 1, Math.max n, 0
$results.find('.js-search-selected').removeClass 'js-search-selected'
$results.find('.js-search-page')
.css(display: 'none')
.eq(n)
.removeAttr('style')
.find('.js-search-result:not(.js-search-prev):not(.js-search-next)')[if prev then 'last' else 'first']()
.addClass 'js-search-selected'
$search.data 'searchPage', n
# Send the value of q to the correct search function and return the result to the correct callback
query: ($searches, urlN = 1) ->
$searches.each ->
o = _.Search
$search = $ @
$results = $search.data 'search$Results'
$q = $search.data 'search$Q'
callback = eval $search.data 'searchCallback'
q = _.clean $q.val(), downcase: true
t = new Date().getTime()
$results.css display: 'block'
unless q or $search.data('js-search-empty')?
$results.css(display: 'none').empty()
$search.removeClass 'js-search-loading'
else if q isnt $search.data('searchLastQ') or urlN > 1
callback $search
clearTimeout $search.data 'searchTimeout'
$search.data('searchAjax').abort?()
if $search.data('searchCache')["#{urlN}_" + q]?
callback $search, $search.data('searchCache')["#{urlN}_" + q], urlN
$search.removeClass 'js-search-loading'
o.query $search, urlN + 1 if $search.data("searchUrl#{urlN+1}")?
else
$search.addClass('js-search-loading').data 'searchTimeout',
setTimeout ->
handleData = (data) ->
$search.data('searchCache')["#{urlN}_" + q] = data
if check is $search.data('searchId') and (_.clean($q.val()) or $search.data('js-search-empty')?)
$search.removeClass 'js-search-loading'
callback $search, data, urlN
o.query $search, urlN + 1 if $search.data "searchUrl#{urlN+1}"
check = $search.data(searchId: $search.data('searchId') + 1).data 'searchId'
if $search.data('searchJs')?
handleData eval($search.data 'searchJs')(q)
else if $search.data('searchUrl')?
$search.data searchAjax: $.getJSON($search.data("searchUrl#{if urlN is 1 then '' else urlN}"), q: q, handleData)
, $search.data('searchDelay') ? 0
$search.data 'searchLastQ', q
# Select the next or previous in a list of results
select: ($searches, dir) ->
$searches.each ->
o = _.Search
$search = $ @
$page = $search.find('.js-search-page').eq $search.data 'searchPage'
$page.find('.js-search-result')[if dir is 'prev' then 'first' else 'last']().addClass 'js-search-selected' unless $page.find('.js-search-selected').removeClass('js-search-selected')[dir]().addClass('js-search-selected').length
if $page.find('.js-search-result.js-search-selected.js-search-prev').length
o.page $search, $search.data('searchPage') - 1, true
else if $page.find('.js-search-result.js-search-selected.js-search-next').length
o.page $search, $search.data('searchPage') + 1
# Yay tooltips!
Tooltip:
# Store mouse coordinates
mouse:
x: 0
y: 0
# Set mousemove on document to track coordinates
load: ->
o = _.Tooltip
$('body').mousemove((e) ->
o.mouse =
x: e.pageX
y: e.pageY
$('.js-tooltip').each ->
$t = $ @
$t.data('tooltip$Div').css o.position($t).home if $t.data('tooltip$Div')? and $t.data('tooltipMouse')?
).on('mouseenter', '.js-tooltip:not([data-tooltip-no-hover])', ->
$t = $ @
o.show $t
$t.data tooltipHover: true
).on('mouseleave', '.js-tooltip:not([data-tooltip-no-hover])', ->
$t = $ @
$t.data tooltipHover: false
o.hide $t
).on('focus', 'input.js-tooltip:not([data-tooltip-no-focus]), textarea.js-tooltip:not([data-tooltip-no-focus])', ->
o.show $ @
).on('blur', 'input.js-tooltip:not([data-tooltip-no-focus]), textarea.js-tooltip:not([data-tooltip-no-focus])', ->
o.hide $ @
)
# Get the current tooltip$Div for an item or create a new one and return that
divFor: ($t) ->
o = _.Tooltip
unless $t.data 'tooltip$Div'
$t.parent().css position: 'relative' if $t.parent().css position: 'static'
$t.data tooltipHoverable: null if $t.data('tooltipMouse')?
$t.data _.extend
tooltipPosition: 'top'
tooltipOffset: 0
tooltipDuration: 0
, $t.data()
$div = $('<div><div/></div>')
.addClass("tooltip #{$t.data('tooltipPosition')}")
.css
display: 'none'
position: 'absolute'
zIndex: 999999;
$div
.find('> div')
.html($t.data 'tooltipHtml')
.css
position: 'relative'
$t
.data(tooltip$Div: $div)
.parent()
.append $div
position = o.position $t
$div
.css(position.home)
.find('> div')
.css _.extend {opacity: 0}, position.away
# If the tooltip is 'hoverable' (aka it should stay while the mouse is over the tooltip itself)
if $t.data('tooltipHoverable')?
$div.hover ->
_.Tooltip.show $t
$t.data tooltipHoverableHover: true
, ->
$t.data tooltipHoverableHover: false
_.Tooltip.hide $t
else
# Otherwise turn off interaction with the mouse
$div.css
pointerEvents: 'none'
'-webkit-user-select': 'none'
'-moz-user-select': 'none'
userSelect: 'none'
$t.data 'tooltip$Div'
# Show the tooltip if it's not already visible
show: ($t) ->
o = _.Tooltip
$div = o.divFor $t
unless (not $t.data('tooltipNoHover')? and $t.data 'tooltipHover') or
(not $t.data('tooltipNoFocus')? and $t.is 'input:focus, textarea:focus') or
$t.data 'tooltipHoverableHover'
position = o.position $t
$div
.appendTo($t.parent())
.css(_.extend {display: 'block'}, position.home)
.find('> div')
.stop()
.animate
opacity: 1
top: 0
left: 0
, $t.data 'tooltipDuration'
# Hide the tooltip if it's not already hidden
hide: ($t) ->
o = _.Tooltip
if $div = $t.data 'tooltip$Div'
unless (not $t.data('tooltipNoHover')? and $t.data 'tooltipHover') or
(not $t.data('tooltipNoFocus')? and $t.is 'input:focus, textarea:focus') or
$t.data 'tooltipHoverableHover'
position = o.position $t
$div
.css(position.home)
.find('> div')
.stop()
.animate _.extend({opacity: 0}, position.away),
duration: $t.data 'tooltipDuration'
complete: ->
$t.data tooltip$Div: null
$(@).parent().remove()
# Method for getting the correct CSS position data for a tooltip
position: ($t) ->
o = _.Tooltip
$div = $t.data 'tooltip$Div'
$parent = $t.parent()
offset = $t.data 'tooltipOffset'
divWidth = $div.outerWidth()
divHeight = $div.outerHeight()
parentScrollLeft = $parent.scrollLeft()
parentScrollTop = $parent.scrollTop()
if $t.data('tooltipMouse')?
tLeft = o.mouse.x - $t.parent().offset().left + parentScrollLeft
tTop = o.mouse.y - $t.parent().offset().top + parentScrollTop
tWidth = tHeight = 0
else
tPosition = $t.position()
tLeft = tPosition.left + parentScrollLeft + parseInt $t.css 'marginLeft'
tTop = tPosition.top + parentScrollTop + parseInt $t.css 'marginTop'
tWidth = $t.outerWidth()
tHeight = $t.outerHeight()
home =
left: tLeft
top: tTop
away = {}
switch $t.data('tooltipPosition')
when 'top'
home.left += (tWidth - divWidth)/2
home.top -= divHeight
away.top = -offset
when 'right'
home.left += tWidth
home.top += (tHeight - divHeight)/2
away.left = offset
when 'bottom'
home.left += (tWidth - divWidth)/2
home.top += tHeight
away.top = offset
when 'left'
home.left -= divWidth
home.top += (tHeight - divHeight)/2
away.left = -offset
{home: home, away: away}
# Use this to correct the tooltip content and positioning between events if necessary
correct: ($t) ->
o = _.Tooltip
$div = $t.data 'tooltip$Div'
if $div
if $t.css('display') is 'none'
$t.mouseleave().blur()
else
$div.find('> div').html($t.data 'tooltipHtml')
$div.css _.Tooltip.position($t).home
# Use this to remove a tooltip
remove: ($t) ->
$t
.data(
tooltipHover: false
tooltipHoverableHover: false
).removeClass('js-tooltip')
.data('tooltip$Div')?.remove()
# State manager
State:
# Header to send with the XHR
HEADER: 'X-Chromeless'
xhr: {}
cache: {}
# The attributes below are optional and can be set at runtime as needed
# When true, forces State to reload the page on the next request.
# refresh: false
# Specify data to send with the XHR request
data : {}
load: ->
o = _.State
if history.state?
history.replaceState true, null
$(window).on 'popstate', (e) ->
if e.originalEvent.state?
o.push location.href
else
history.replaceState true, null
$("body").on 'click', '.js-state', ->
$t = $ @
o.push (if $t.data 'stateUrl' then $t.data 'stateUrl' else $t.attr 'href'), $t.data 'stateProtocol'
false
updateCache: (url, obj) ->
o = _.State
if o.cache[url]?
_.extend o.cache[url], obj
else
o.cache[url] = obj
push: (url, protocol = location.protocol) ->
o = _.State
url = _.url url, protocol
if history.pushState? and not o.refresh and not _.State.data[url]?.refresh and _.startsWith url, location.protocol
o.xhr.abort?()
o.clear o.cache[url], url
if o.cache[url]? and o.cache[url].cache isnt false
o.change url
else
o.before o.cache[url], url
o.xhr = $.ajax url,
data: o.data
success: (data) ->
valid = null
selectors = {}
$(data.replace /<(\/)?script>/gi, '<!--$1state-script-->').each ->
$t = $ @
unless $t[0] instanceof Text
if (s = $t.attr 'id') or $t.is 'title'
selectors[s and "##{s}" or 'title'] = $t.html().replace /<!--(\/)?state-script-->/g, '<$1script>'
valid = true if s
else unless valid?
valid = false
url = selectors['#chromeless-request-url'] if selectors['#chromeless-request-url']? and selectors['#chromeless-request-url'] isnt url
if valid
o.updateCache url, selectors
o.after o.cache[url], url
o.change url
else
location.assign url
beforeSend: (xhr) -> xhr.setRequestHeader o.HEADER, 1
error: -> location.assign url
else
location.assign url
change: (url) ->
o = _.State
history[if o.cache[url].replace then 'replaceState' else 'pushState'] true, null, url if location.href isnt url
o.parse o.cache[url], url
clear: ->
before: ->
after: ->
parse: ->
# Load images only when they're on the page or about to be on it
Lazy:
# Default tolerance, can be overidden here or with data-tolerance='xxx'
TOLERANCE: 100
# After the DOM is ready
load: ->
o = _.Lazy
$(window).on 'scroll resize', o.dom
# Check for new lazy images
dom: ->
# Wait for the browser to position the element on the page before checking its coordinates
_.nextTick ->
$('img.js-lazy').each ->
$t = $ @
visible = _.reduce $t.parents(), (memo, parent) ->
memo and $(parent).css('display') isnt 'none' and $(parent).css('visibility') isnt 'hidden'
, true
if visible and $(window).scrollTop() + $(window).outerHeight() >= $t.offset().top - ($t.data('lazyTolerance') ? _.Lazy.TOLERANCE)
url = $t.data 'lazyUrl'
$t.removeClass('js-lazy').attr 'src', url
# Everyone's favorite cheat code
Konami: (callback, onlyOnce = false, code = '38,38,40,40,37,39,37,39,66,65,13', touchCode = 'up,up,down,down,left,right,left,right,tap,tap,tap') ->
keysPressed = []
touchEvents = []
tap = false
startX = startY = dX = dY = 0
keyDownEvent = (e) ->
keysPressed.push e.keyCode
if _.endsWith keysPressed + '', code
$(document).off 'keydown', keyDownEvent if onlyOnce
keysPressed = []
e.preventDefault()
callback()
touchStartEvent = (e) ->
e = e.originalEvent
if e.touches.length is 1
touch = e.touches[0]
{screenX: startX, screenY: startY} = touch
tap = tracking = true
touchMoveEvent = (e) ->
e = e.originalEvent
if e.touches.length is 1 and tap
touch = e.touches[0]
dX = touch.screenX - startX
dY = touch.screenY - startY
rightLeft = if dX > 0 then 'right' else 'left'
downUp = if dY > 0 then 'down' else 'up'
val = if Math.abs(dX) > Math.abs dY then rightLeft else downUp
touchEvents.push val
tap = false
checkEvents e
touchEndEvent = (e) ->
e = e.originalEvent
if e.touches.length is 0 and tap
touchEvents.push 'tap'
checkEvents e
checkEvents = (e) ->
if _.endsWith touchEvents + '', touchCode
if onlyOnce
$(document).off 'touchmove', touchMoveEvent
$(document).off 'touchend', touchEndEvent
touchEvents = []
e.preventDefault()
callback()
$(document).on 'keydown', keyDownEvent
$(document).on 'touchstart', touchStartEvent
$(document).on 'touchmove', touchMoveEvent
$(document).on 'touchend', touchEndEvent
# Making Cookie management easy on you
Cookie: (name, val, opt = {}) ->
if typeof name is 'object'
_.Cookie n, v, val for n, v of name
else if typeof name is 'string' and val isnt undefined
opt.expires = -1 if val is null
val ||= ''
params = []
params.push "; Expires=#{if opt.expires.toGMTString? then opt.expires.toGMTString() else new Date(new Date().getTime()+opt.expires*1000*60*60*24).toGMTString()}" if opt.expires
params.push "; Path=#{opt.path}" if opt.path
params.push "; Domain=#{opt.domain}" if opt.domain
params.push '; HttpOnly' if opt.httpOnly
params.push '; Secure' if opt.secure
document.cookie = "#{encodeURIComponent name}=#{encodeURIComponent val}#{params.join ''}"
else
cookies = {}
if document.cookie
_.each decodeURIComponent(document.cookie).split(/\s*;\s*/), (cookie) ->
{1: n, 2: v} = /^([^=]*)\s*=\s*(.*)$/.exec cookie
if typeof name is 'string' and name is n
return v
else if not name?
cookies[n] = v
if not name then cookies else null
# Mixin the Extrascore Mixins
_.mixin Extrascore.Mixins
# Extend the Extrascore Extensions
_.extend _, Extrascore.Extensions
# Initialize the Extrascore Extensions
_.init Extrascore.Extensions
|
[
{
"context": "# Author: Josh Bass\n\nReact = require(\"react\");\nmathjs = require(\"math",
"end": 19,
"score": 0.9998729228973389,
"start": 10,
"tag": "NAME",
"value": "Josh Bass"
}
] | src/client/components/orders/OrderView.coffee | jbass86/Aroma | 0 | # Author: Josh Bass
React = require("react");
mathjs = require("mathjs");
CreateOrder = require("./OrderCreate.coffee");
OrderTable = require("./OrderTable.coffee");
Filters = require("client/components/filters/FiltersView.coffee");
require("./res/styles/orders.scss")
module.exports = React.createClass
getInitialState: ->
@filter_types = [{key: "order_date", name: "Order Date", type: "date"}];
{};
componentDidMount: ->
render: ->
<div className="common-view">
<div className="section-title">
Orders
</div>
<CreateOrder customerUpdate={@updateOrder} order_model={@props.order_model} />
<Filters filterTypes={@filter_types} applyFilters={@applyFilters} name="order_filters" />
<OrderTable />
</div>
updateOrder: ->
| 225314 | # Author: <NAME>
React = require("react");
mathjs = require("mathjs");
CreateOrder = require("./OrderCreate.coffee");
OrderTable = require("./OrderTable.coffee");
Filters = require("client/components/filters/FiltersView.coffee");
require("./res/styles/orders.scss")
module.exports = React.createClass
getInitialState: ->
@filter_types = [{key: "order_date", name: "Order Date", type: "date"}];
{};
componentDidMount: ->
render: ->
<div className="common-view">
<div className="section-title">
Orders
</div>
<CreateOrder customerUpdate={@updateOrder} order_model={@props.order_model} />
<Filters filterTypes={@filter_types} applyFilters={@applyFilters} name="order_filters" />
<OrderTable />
</div>
updateOrder: ->
| true | # Author: PI:NAME:<NAME>END_PI
React = require("react");
mathjs = require("mathjs");
CreateOrder = require("./OrderCreate.coffee");
OrderTable = require("./OrderTable.coffee");
Filters = require("client/components/filters/FiltersView.coffee");
require("./res/styles/orders.scss")
module.exports = React.createClass
getInitialState: ->
@filter_types = [{key: "order_date", name: "Order Date", type: "date"}];
{};
componentDidMount: ->
render: ->
<div className="common-view">
<div className="section-title">
Orders
</div>
<CreateOrder customerUpdate={@updateOrder} order_model={@props.order_model} />
<Filters filterTypes={@filter_types} applyFilters={@applyFilters} name="order_filters" />
<OrderTable />
</div>
updateOrder: ->
|
[
{
"context": "# **Author:** Peter Urbak<br/>\n# **Version:** 2013-02-12\n\nroot = exports ? ",
"end": 25,
"score": 0.9998563528060913,
"start": 14,
"tag": "NAME",
"value": "Peter Urbak"
}
] | client_src/constants.coffee | dragonwasrobot/gesture-recognition | 2 | # **Author:** Peter Urbak<br/>
# **Version:** 2013-02-12
root = exports ? window
# `App.Constants` contains application-wide constants.
# This class should not be instantiated.
class App.Constants
# ## Constants
@OBJECT_ADD: "object:add"
@OBJECT_UPDATE: "object:update"
@OBJECT_REMOVE: "object:remove"
@CURSOR_ADD: "cursor:add"
@CURSOR_UPDATE: "cursor:update"
@CURSOR_REMOVE: "cursor:remove"
@FINGER_SINGLE_TAP: "finger:single-tap"
@FINGER_DOUBLE_TAP: "finger:double-tap"
@FINGER_FLICK: "finger:flick"
@FINGER_HOLD_FLICK: "finger:hold-flick"
@OBJECT_SHAKE: "object:shake"
# ## Constructors
constructor: () -> # So this is a hack
throw new Error("App.Constants should not be instantiated"); | 2027 | # **Author:** <NAME><br/>
# **Version:** 2013-02-12
root = exports ? window
# `App.Constants` contains application-wide constants.
# This class should not be instantiated.
class App.Constants
# ## Constants
@OBJECT_ADD: "object:add"
@OBJECT_UPDATE: "object:update"
@OBJECT_REMOVE: "object:remove"
@CURSOR_ADD: "cursor:add"
@CURSOR_UPDATE: "cursor:update"
@CURSOR_REMOVE: "cursor:remove"
@FINGER_SINGLE_TAP: "finger:single-tap"
@FINGER_DOUBLE_TAP: "finger:double-tap"
@FINGER_FLICK: "finger:flick"
@FINGER_HOLD_FLICK: "finger:hold-flick"
@OBJECT_SHAKE: "object:shake"
# ## Constructors
constructor: () -> # So this is a hack
throw new Error("App.Constants should not be instantiated"); | true | # **Author:** PI:NAME:<NAME>END_PI<br/>
# **Version:** 2013-02-12
root = exports ? window
# `App.Constants` contains application-wide constants.
# This class should not be instantiated.
class App.Constants
# ## Constants
@OBJECT_ADD: "object:add"
@OBJECT_UPDATE: "object:update"
@OBJECT_REMOVE: "object:remove"
@CURSOR_ADD: "cursor:add"
@CURSOR_UPDATE: "cursor:update"
@CURSOR_REMOVE: "cursor:remove"
@FINGER_SINGLE_TAP: "finger:single-tap"
@FINGER_DOUBLE_TAP: "finger:double-tap"
@FINGER_FLICK: "finger:flick"
@FINGER_HOLD_FLICK: "finger:hold-flick"
@OBJECT_SHAKE: "object:shake"
# ## Constructors
constructor: () -> # So this is a hack
throw new Error("App.Constants should not be instantiated"); |
[
{
"context": "SnippetsDisabled: []\n projectHome: \"C:\\\\Users\\\\Jordan\\\\Desktop\\\\code\"\n telemetryConsent: \"limited\"\n ",
"end": 195,
"score": 0.7401601076126099,
"start": 189,
"tag": "NAME",
"value": "Jordan"
}
] | editors/atom/config/config.cson | jdtaylor7/workflow | 2 | "*":
"autocomplete-plus":
enableAutoActivation: false
core:
packagesWithKeymapsDisabled: [
"latex"
]
packagesWithSnippetsDisabled: []
projectHome: "C:\\Users\\Jordan\\Desktop\\code"
telemetryConsent: "limited"
themes: [
"one-dark-ui"
"base16-tomorrow-dark-theme"
]
uriHandlerRegistration: "never"
useTreeSitterParsers: false
editor:
fontSize: 15
scrollPastEnd: true
showIndentGuide: true
tabLength: 4
"exception-reporting":
userId: "4e5d60eb-0f0c-4006-9b96-ae2fdf889161"
github: {}
latex:
buildOnSave: true
opener: "pdf-view"
texPath: "$PATH"
latextools:
viewer: "pdf-view"
win32:
distro: "texlive"
"pdf-view": {}
pigments:
markerType: "native-dot"
script:
stopOnRerun: true
"tree-view":
hideIgnoredNames: true
hideVcsIgnoredFiles: true
welcome:
showOnStartup: false
| 136521 | "*":
"autocomplete-plus":
enableAutoActivation: false
core:
packagesWithKeymapsDisabled: [
"latex"
]
packagesWithSnippetsDisabled: []
projectHome: "C:\\Users\\<NAME>\\Desktop\\code"
telemetryConsent: "limited"
themes: [
"one-dark-ui"
"base16-tomorrow-dark-theme"
]
uriHandlerRegistration: "never"
useTreeSitterParsers: false
editor:
fontSize: 15
scrollPastEnd: true
showIndentGuide: true
tabLength: 4
"exception-reporting":
userId: "4e5d60eb-0f0c-4006-9b96-ae2fdf889161"
github: {}
latex:
buildOnSave: true
opener: "pdf-view"
texPath: "$PATH"
latextools:
viewer: "pdf-view"
win32:
distro: "texlive"
"pdf-view": {}
pigments:
markerType: "native-dot"
script:
stopOnRerun: true
"tree-view":
hideIgnoredNames: true
hideVcsIgnoredFiles: true
welcome:
showOnStartup: false
| true | "*":
"autocomplete-plus":
enableAutoActivation: false
core:
packagesWithKeymapsDisabled: [
"latex"
]
packagesWithSnippetsDisabled: []
projectHome: "C:\\Users\\PI:NAME:<NAME>END_PI\\Desktop\\code"
telemetryConsent: "limited"
themes: [
"one-dark-ui"
"base16-tomorrow-dark-theme"
]
uriHandlerRegistration: "never"
useTreeSitterParsers: false
editor:
fontSize: 15
scrollPastEnd: true
showIndentGuide: true
tabLength: 4
"exception-reporting":
userId: "4e5d60eb-0f0c-4006-9b96-ae2fdf889161"
github: {}
latex:
buildOnSave: true
opener: "pdf-view"
texPath: "$PATH"
latextools:
viewer: "pdf-view"
win32:
distro: "texlive"
"pdf-view": {}
pigments:
markerType: "native-dot"
script:
stopOnRerun: true
"tree-view":
hideIgnoredNames: true
hideVcsIgnoredFiles: true
welcome:
showOnStartup: false
|
[
{
"context": "omponent: HeroShowsCarousel, options: { partner: @partner, maxNumberOfShows: 10 } }\n { name: 'about'",
"end": 2066,
"score": 0.728005588054657,
"start": 2059,
"tag": "USERNAME",
"value": "partner"
},
{
"context": ": 'news', component: NewsView, options: { partner: @partner }, title: 'News' }\n {\n name: 'sho",
"end": 2241,
"score": 0.6830226182937622,
"start": 2233,
"tag": "USERNAME",
"value": "@partner"
},
{
"context": "Carousel\n options:\n partner: @partner\n collection: new PartnerShows\n ",
"end": 2389,
"score": 0.8218295574188232,
"start": 2382,
"tag": "USERNAME",
"value": "partner"
},
{
"context": " fetchOptions: [\n { partner_id: @partner.get('_id'), status: 'current', at_a_fair: false, ",
"end": 2495,
"score": 0.7270315885543823,
"start": 2487,
"tag": "USERNAME",
"value": "@partner"
},
{
"context": " 9, sort: 'start_at' }\n { partner_id: @partner.get('_id'), status: 'closed', at_a_fair: f",
"end": 2619,
"score": 0.4910435378551483,
"start": 2619,
"tag": "USERNAME",
"value": ""
},
{
"context": "ef()}/shows\"\n }\n {\n name: 'fair-booths'\n component: FixedCellsCountCarou",
"end": 2885,
"score": 0.47321817278862,
"start": 2881,
"tag": "NAME",
"value": "fair"
},
{
"context": "}/shows\"\n }\n {\n name: 'fair-booths'\n component: FixedCellsCountCarousel\n ",
"end": 2892,
"score": 0.6113682389259338,
"start": 2886,
"tag": "USERNAME",
"value": "booths"
},
{
"context": "ntCarousel\n options:\n partner: @partner\n collection: new PartnerShows\n ",
"end": 2987,
"score": 0.8052468299865723,
"start": 2979,
"tag": "USERNAME",
"value": "@partner"
},
{
"context": " fetchOptions: [\n { partner_id: @partner.get('_id'), status: 'current', at_a_fair: ",
"end": 3084,
"score": 0.6674432158470154,
"start": 3084,
"tag": "USERNAME",
"value": ""
},
{
"context": " component: ArtistsGridView, options: { partner: @partner }, title: undefined, viewAll: undefined }\n ",
"end": 3544,
"score": 0.8162428736686707,
"start": 3537,
"tag": "USERNAME",
"value": "partner"
},
{
"context": "ntCarousel\n options:\n partner: @partner\n collection: new Articles\n ",
"end": 3717,
"score": 0.8226586580276489,
"start": 3709,
"tag": "USERNAME",
"value": "@partner"
},
{
"context": "', component: ArtistsGridView, options: { partner: @partner } }\n { name: 'locations', title: 'Location",
"end": 14464,
"score": 0.9632208347320557,
"start": 14456,
"tag": "USERNAME",
"value": "@partner"
},
{
"context": "ations', component: undefined, options: { partner: @partner } }\n ]\n",
"end": 14568,
"score": 0.9234285354614258,
"start": 14560,
"tag": "USERNAME",
"value": "@partner"
}
] | src/desktop/apps/partner2/test/client/overview_layout_factory.coffee | kanaabe/force | 1 | _ = require 'underscore'
sinon = require 'sinon'
rewire = require 'rewire'
Backbone = require 'backbone'
Artworks = require '../../../../collections/artworks.coffee'
PartnerShows = require '../../../../collections/partner_shows.coffee'
Articles = require '../../../../collections/articles.coffee'
Profile = require '../../../../models/profile.coffee'
Partner = require '../../../../models/partner.coffee'
{ resolve } = require 'path'
{ fabricate } = require 'antigravity'
factory = rewire '../../client/overview_layout_factory.coffee'
factory.__set__ 'HeroShowsCarousel', HeroShowsCarousel = sinon.stub()
factory.__set__ 'HeroArtworksCarousel', HeroArtworksCarousel = sinon.stub()
factory.__set__ 'ArtistsListView', ArtistsListView = sinon.stub()
factory.__set__ 'ArtistsGridView', ArtistsGridView = sinon.stub()
factory.__set__ 'aboutTemplate', aboutTemplate = sinon.stub().returns '<article></article>'
factory.__set__ 'NewsView', NewsView = sinon.stub()
factory.__set__ 'FixedCellsCountCarousel', FixedCellsCountCarousel = sinon.stub()
factory.__set__ 'showsTemplate', showsTemplate = sinon.stub().returns '<article></article>'
factory.__set__ 'fairBoothsTemplate', fairBoothsTemplate = sinon.stub().returns '<article></article>'
factory.__set__ 'articlesTemplate', articlesTemplate = sinon.stub().returns '<article></article>'
factory.__set__ 'ShowsGrid', ShowsGrid = sinon.stub()
factory.__set__ 'LocationsView', LocationsView = sinon.stub()
describe 'overview_layout_factory', ->
describe 'gallery_three', ->
beforeEach ->
@profile = new Profile fabricate 'partner_profile', full_bio: 'full_bil'
@partner = new Partner fabricate 'partner', profile_layout: 'gallery_three', display_artists_section: true
it 'returns modules properly for profile_banner_display: "Shows", profile_artists_layout: "Grid"', ->
@partner.set profile_banner_display: 'Shows'
@partner.set profile_artists_layout: 'Grid'
factory(@partner, @profile).should.eql [
{ name: 'hero', component: HeroShowsCarousel, options: { partner: @partner, maxNumberOfShows: 10 } }
{ name: 'about', template: '<article></article>', title: 'About' }
{ name: 'news', component: NewsView, options: { partner: @partner }, title: 'News' }
{
name: 'shows',
component: FixedCellsCountCarousel
options:
partner: @partner
collection: new PartnerShows
fetchOptions: [
{ partner_id: @partner.get('_id'), status: 'current', at_a_fair: false, displayable: true, size: 9, sort: 'start_at' }
{ partner_id: @partner.get('_id'), status: 'closed', at_a_fair: false, displayable: true, size: 9, sort: '-end_at' }
]
template: showsTemplate
title: 'Shows'
viewAll: "#{@partner.href()}/shows"
}
{
name: 'fair-booths'
component: FixedCellsCountCarousel
options:
partner: @partner
collection: new PartnerShows
fetchOptions: [
{ partner_id: @partner.get('_id'), status: 'current', at_a_fair: true, displayable: true, size: 9, sort: 'start_at' }
{ partner_id: @partner.get('_id'), status: 'closed', at_a_fair: true, displayable: true, size: 9, sort: '-end_at' }
]
template: fairBoothsTemplate
title: 'Fair Booths'
viewAll: "#{@partner.href()}/shows"
}
{ name: 'artists', component: ArtistsGridView, options: { partner: @partner }, title: undefined, viewAll: undefined }
{
name: 'articles'
component: FixedCellsCountCarousel
options:
partner: @partner
collection: new Articles
fetchOptions: partner_id: @partner.get('_id'), published: true, limit: 9, sort: '-published_at'
template: articlesTemplate
title: 'Articles'
viewAll: "#{@partner.href()}/articles"
}
]
it 'returns modules properly for profile_banner_display: "Artworks", profile_artists_layout: "List"', ->
@partner.set profile_banner_display: 'Artworks'
@partner.set profile_artists_layout: 'List'
factory(@partner, @profile).should.eql [
{ name: 'hero', component: HeroArtworksCarousel, options: { partner: @partner } }
{ name: 'about', template: '<article></article>', title: 'About' }
{ name: 'news', component: NewsView, options: { partner: @partner }, title: 'News' }
{
name: 'shows',
component: FixedCellsCountCarousel
options:
partner: @partner
collection: new PartnerShows
fetchOptions: [
{ partner_id: @partner.get('_id'), status: 'current', at_a_fair: false, displayable: true, size: 9, sort: 'start_at' }
{ partner_id: @partner.get('_id'), status: 'closed', at_a_fair: false, displayable: true, size: 9, sort: '-end_at' }
]
template: showsTemplate
title: 'Shows'
viewAll: "#{@partner.href()}/shows"
}
{
name: 'fair-booths'
component: FixedCellsCountCarousel
options:
partner: @partner
collection: new PartnerShows
fetchOptions: [
{ partner_id: @partner.get('_id'), status: 'current', at_a_fair: true, displayable: true, size: 9, sort: 'start_at' }
{ partner_id: @partner.get('_id'), status: 'closed', at_a_fair: true, displayable: true, size: 9, sort: '-end_at' }
]
template: fairBoothsTemplate
title: 'Fair Booths'
viewAll: "#{@partner.href()}/shows"
}
{ name: 'artists', component: ArtistsListView, options: { partner: @partner }, title: 'Artists', viewAll: "#{@partner.href()}/artists" }
{
name: 'articles'
component: FixedCellsCountCarousel
options:
partner: @partner
collection: new Articles
fetchOptions: partner_id: @partner.get('_id'), published: true, limit: 9, sort: '-published_at'
template: articlesTemplate
title: 'Articles'
viewAll: "#{@partner.href()}/articles"
}
]
describe 'gallery_two', ->
beforeEach ->
@profile = new Profile fabricate 'partner_profile', full_bio: 'full bio here'
@partner = new Partner fabricate 'partner', profile_layout: 'gallery_two', display_artists_section: true
it 'returns modules properly for profile_banner_display: "Shows", profile_artists_layout: "Grid"', ->
@partner.set profile_banner_display: 'Shows'
@partner.set profile_artists_layout: 'Grid'
factory(@partner, @profile).should.eql [
{ name: 'hero', component: HeroShowsCarousel, options: { partner: @partner, maxNumberOfShows: 2 } }
{ name: 'about', template: '<article></article>', title: 'About' }
{ name: 'news', component: NewsView, options: { partner: @partner }, title: 'News' }
{
name: 'shows',
component: FixedCellsCountCarousel
options:
partner: @partner
collection: new PartnerShows
fetchOptions: [
{ partner_id: @partner.get('_id'), status: 'current', at_a_fair: false, displayable: true, size: 9, sort: 'start_at' }
{ partner_id: @partner.get('_id'), status: 'closed', at_a_fair: false, displayable: true, size: 9, sort: '-end_at' }
]
template: showsTemplate
title: 'Shows'
viewAll: "#{@partner.href()}/shows"
}
{
name: 'fair-booths'
component: FixedCellsCountCarousel
options:
partner: @partner
collection: new PartnerShows
fetchOptions: [
{ partner_id: @partner.get('_id'), status: 'current', at_a_fair: true, displayable: true, size: 9, sort: 'start_at' }
{ partner_id: @partner.get('_id'), status: 'closed', at_a_fair: true, displayable: true, size: 9, sort: '-end_at' }
]
template: fairBoothsTemplate
title: 'Fair Booths'
viewAll: "#{@partner.href()}/shows"
}
{ name: 'artists', component: ArtistsGridView, options: { partner: @partner }, title: undefined, viewAll: undefined }
{
name: 'articles'
component: FixedCellsCountCarousel
options:
partner: @partner
collection: new Articles
fetchOptions: partner_id: @partner.get('_id'), published: true, limit: 9, sort: '-published_at'
template: articlesTemplate
title: 'Articles'
viewAll: "#{@partner.href()}/articles"
}
]
it 'returns modules properly for profile_banner_display: "Artworks", profile_artists_layout: "List"', ->
@partner.set profile_banner_display: 'Artworks'
@partner.set profile_artists_layout: 'List'
factory(@partner, @profile).should.eql [
{ name: 'hero', component: HeroArtworksCarousel, options: { partner: @partner } }
{ name: 'about', template: '<article></article>', title: 'About' }
{ name: 'news', component: NewsView, options: { partner: @partner }, title: 'News' }
{
name: 'shows',
component: FixedCellsCountCarousel
options:
partner: @partner
collection: new PartnerShows
fetchOptions: [
{ partner_id: @partner.get('_id'), status: 'current', at_a_fair: false, displayable: true, size: 9, sort: 'start_at' }
{ partner_id: @partner.get('_id'), status: 'closed', at_a_fair: false, displayable: true, size: 9, sort: '-end_at' }
]
template: showsTemplate
title: 'Shows'
viewAll: "#{@partner.href()}/shows"
}
{
name: 'fair-booths'
component: FixedCellsCountCarousel
options:
partner: @partner
collection: new PartnerShows
fetchOptions: [
{ partner_id: @partner.get('_id'), status: 'current', at_a_fair: true, displayable: true, size: 9, sort: 'start_at' }
{ partner_id: @partner.get('_id'), status: 'closed', at_a_fair: true, displayable: true, size: 9, sort: '-end_at' }
]
template: fairBoothsTemplate
title: 'Fair Booths'
viewAll: "#{@partner.href()}/shows"
}
{ name: 'artists', component: ArtistsListView, options: { partner: @partner }, title: 'Artists', viewAll: "#{@partner.href()}/artists" }
{
name: 'articles'
component: FixedCellsCountCarousel
options:
partner: @partner
collection: new Articles
fetchOptions: partner_id: @partner.get('_id'), published: true, limit: 9, sort: '-published_at'
template: articlesTemplate
title: 'Articles'
viewAll: "#{@partner.href()}/articles"
}
]
it 'does not return the "Artists" module when display_artists_section is false', ->
@partner.set display_artists_section: false
modules = factory(@partner, @profile)
modules.should.containDeep [{ name: 'artists', component: undefined }]
describe 'gallery_one', ->
beforeEach ->
@profile = new Profile fabricate 'partner_profile', full_bio: 'full bio here'
@partner = new Partner fabricate 'partner', profile_layout: 'gallery_one'
it 'returns modules properly', ->
factory(@partner, @profile).should.eql [
{ name: 'hero', component: HeroShowsCarousel, options: { partner: @partner, maxNumberOfShows: 1 } }
{ name: 'about', template: '<article></article>', title: 'About' }
{
name: 'shows',
component: FixedCellsCountCarousel
options:
partner: @partner
collection: new PartnerShows
fetchOptions: [
{ partner_id: @partner.get('_id'), status: 'current', at_a_fair: false, displayable: true, size: 9, sort: 'start_at' }
{ partner_id: @partner.get('_id'), status: 'closed', at_a_fair: false, displayable: true, size: 9, sort: '-end_at' }
]
template: showsTemplate
title: 'Shows'
viewAll: "#{@partner.href()}/shows"
}
{
name: 'fair-booths'
component: FixedCellsCountCarousel
options:
partner: @partner
collection: new PartnerShows
fetchOptions: [
{ partner_id: @partner.get('_id'), status: 'current', at_a_fair: true, displayable: true, size: 9, sort: 'start_at' }
{ partner_id: @partner.get('_id'), status: 'closed', at_a_fair: true, displayable: true, size: 9, sort: '-end_at' }
]
template: fairBoothsTemplate
title: 'Fair Booths'
viewAll: "#{@partner.href()}/shows"
}
{ name: 'artists', component: ArtistsGridView, options: partner: @partner }
]
describe 'gallery_default', ->
beforeEach ->
@profile = new Profile fabricate 'partner_profile', full_bio: 'full bio here'
@partner = new Partner fabricate 'partner', profile_layout: 'gallery_default', claimed: false
it 'returns modules without artists for fair partners', ->
factory(@partner, @profile).should.eql [
{
name: 'shows'
component: ShowsGrid
options:
partner: @partner
isCombined: true
numberOfFeatured: 0
numberOfShows: 6
seeAll: false
heading: 'Shows & Fair Booths'
}
{ name: 'artists', component: undefined, options: { partner: @partner } }
{ name: 'locations', title: 'Locations', component: LocationsView, options: { partner: @partner } }
]
it 'returns modules properly otherwise', ->
@partner = new Partner fabricate 'partner', profile_layout: 'gallery_default', claimed: true
factory(@partner, @profile).should.eql [
{
name: 'shows'
component: ShowsGrid
options:
partner: @partner
isCombined: true
numberOfFeatured: 1
numberOfShows: 6
seeAll: true
heading: undefined
}
{ name: 'artists', component: ArtistsGridView, options: { partner: @partner } }
{ name: 'locations', title: 'Locations', component: undefined, options: { partner: @partner } }
]
| 59893 | _ = require 'underscore'
sinon = require 'sinon'
rewire = require 'rewire'
Backbone = require 'backbone'
Artworks = require '../../../../collections/artworks.coffee'
PartnerShows = require '../../../../collections/partner_shows.coffee'
Articles = require '../../../../collections/articles.coffee'
Profile = require '../../../../models/profile.coffee'
Partner = require '../../../../models/partner.coffee'
{ resolve } = require 'path'
{ fabricate } = require 'antigravity'
factory = rewire '../../client/overview_layout_factory.coffee'
factory.__set__ 'HeroShowsCarousel', HeroShowsCarousel = sinon.stub()
factory.__set__ 'HeroArtworksCarousel', HeroArtworksCarousel = sinon.stub()
factory.__set__ 'ArtistsListView', ArtistsListView = sinon.stub()
factory.__set__ 'ArtistsGridView', ArtistsGridView = sinon.stub()
factory.__set__ 'aboutTemplate', aboutTemplate = sinon.stub().returns '<article></article>'
factory.__set__ 'NewsView', NewsView = sinon.stub()
factory.__set__ 'FixedCellsCountCarousel', FixedCellsCountCarousel = sinon.stub()
factory.__set__ 'showsTemplate', showsTemplate = sinon.stub().returns '<article></article>'
factory.__set__ 'fairBoothsTemplate', fairBoothsTemplate = sinon.stub().returns '<article></article>'
factory.__set__ 'articlesTemplate', articlesTemplate = sinon.stub().returns '<article></article>'
factory.__set__ 'ShowsGrid', ShowsGrid = sinon.stub()
factory.__set__ 'LocationsView', LocationsView = sinon.stub()
describe 'overview_layout_factory', ->
describe 'gallery_three', ->
beforeEach ->
@profile = new Profile fabricate 'partner_profile', full_bio: 'full_bil'
@partner = new Partner fabricate 'partner', profile_layout: 'gallery_three', display_artists_section: true
it 'returns modules properly for profile_banner_display: "Shows", profile_artists_layout: "Grid"', ->
@partner.set profile_banner_display: 'Shows'
@partner.set profile_artists_layout: 'Grid'
factory(@partner, @profile).should.eql [
{ name: 'hero', component: HeroShowsCarousel, options: { partner: @partner, maxNumberOfShows: 10 } }
{ name: 'about', template: '<article></article>', title: 'About' }
{ name: 'news', component: NewsView, options: { partner: @partner }, title: 'News' }
{
name: 'shows',
component: FixedCellsCountCarousel
options:
partner: @partner
collection: new PartnerShows
fetchOptions: [
{ partner_id: @partner.get('_id'), status: 'current', at_a_fair: false, displayable: true, size: 9, sort: 'start_at' }
{ partner_id: @partner.get('_id'), status: 'closed', at_a_fair: false, displayable: true, size: 9, sort: '-end_at' }
]
template: showsTemplate
title: 'Shows'
viewAll: "#{@partner.href()}/shows"
}
{
name: '<NAME>-booths'
component: FixedCellsCountCarousel
options:
partner: @partner
collection: new PartnerShows
fetchOptions: [
{ partner_id: @partner.get('_id'), status: 'current', at_a_fair: true, displayable: true, size: 9, sort: 'start_at' }
{ partner_id: @partner.get('_id'), status: 'closed', at_a_fair: true, displayable: true, size: 9, sort: '-end_at' }
]
template: fairBoothsTemplate
title: 'Fair Booths'
viewAll: "#{@partner.href()}/shows"
}
{ name: 'artists', component: ArtistsGridView, options: { partner: @partner }, title: undefined, viewAll: undefined }
{
name: 'articles'
component: FixedCellsCountCarousel
options:
partner: @partner
collection: new Articles
fetchOptions: partner_id: @partner.get('_id'), published: true, limit: 9, sort: '-published_at'
template: articlesTemplate
title: 'Articles'
viewAll: "#{@partner.href()}/articles"
}
]
it 'returns modules properly for profile_banner_display: "Artworks", profile_artists_layout: "List"', ->
@partner.set profile_banner_display: 'Artworks'
@partner.set profile_artists_layout: 'List'
factory(@partner, @profile).should.eql [
{ name: 'hero', component: HeroArtworksCarousel, options: { partner: @partner } }
{ name: 'about', template: '<article></article>', title: 'About' }
{ name: 'news', component: NewsView, options: { partner: @partner }, title: 'News' }
{
name: 'shows',
component: FixedCellsCountCarousel
options:
partner: @partner
collection: new PartnerShows
fetchOptions: [
{ partner_id: @partner.get('_id'), status: 'current', at_a_fair: false, displayable: true, size: 9, sort: 'start_at' }
{ partner_id: @partner.get('_id'), status: 'closed', at_a_fair: false, displayable: true, size: 9, sort: '-end_at' }
]
template: showsTemplate
title: 'Shows'
viewAll: "#{@partner.href()}/shows"
}
{
name: 'fair-booths'
component: FixedCellsCountCarousel
options:
partner: @partner
collection: new PartnerShows
fetchOptions: [
{ partner_id: @partner.get('_id'), status: 'current', at_a_fair: true, displayable: true, size: 9, sort: 'start_at' }
{ partner_id: @partner.get('_id'), status: 'closed', at_a_fair: true, displayable: true, size: 9, sort: '-end_at' }
]
template: fairBoothsTemplate
title: 'Fair Booths'
viewAll: "#{@partner.href()}/shows"
}
{ name: 'artists', component: ArtistsListView, options: { partner: @partner }, title: 'Artists', viewAll: "#{@partner.href()}/artists" }
{
name: 'articles'
component: FixedCellsCountCarousel
options:
partner: @partner
collection: new Articles
fetchOptions: partner_id: @partner.get('_id'), published: true, limit: 9, sort: '-published_at'
template: articlesTemplate
title: 'Articles'
viewAll: "#{@partner.href()}/articles"
}
]
describe 'gallery_two', ->
beforeEach ->
@profile = new Profile fabricate 'partner_profile', full_bio: 'full bio here'
@partner = new Partner fabricate 'partner', profile_layout: 'gallery_two', display_artists_section: true
it 'returns modules properly for profile_banner_display: "Shows", profile_artists_layout: "Grid"', ->
@partner.set profile_banner_display: 'Shows'
@partner.set profile_artists_layout: 'Grid'
factory(@partner, @profile).should.eql [
{ name: 'hero', component: HeroShowsCarousel, options: { partner: @partner, maxNumberOfShows: 2 } }
{ name: 'about', template: '<article></article>', title: 'About' }
{ name: 'news', component: NewsView, options: { partner: @partner }, title: 'News' }
{
name: 'shows',
component: FixedCellsCountCarousel
options:
partner: @partner
collection: new PartnerShows
fetchOptions: [
{ partner_id: @partner.get('_id'), status: 'current', at_a_fair: false, displayable: true, size: 9, sort: 'start_at' }
{ partner_id: @partner.get('_id'), status: 'closed', at_a_fair: false, displayable: true, size: 9, sort: '-end_at' }
]
template: showsTemplate
title: 'Shows'
viewAll: "#{@partner.href()}/shows"
}
{
name: 'fair-booths'
component: FixedCellsCountCarousel
options:
partner: @partner
collection: new PartnerShows
fetchOptions: [
{ partner_id: @partner.get('_id'), status: 'current', at_a_fair: true, displayable: true, size: 9, sort: 'start_at' }
{ partner_id: @partner.get('_id'), status: 'closed', at_a_fair: true, displayable: true, size: 9, sort: '-end_at' }
]
template: fairBoothsTemplate
title: 'Fair Booths'
viewAll: "#{@partner.href()}/shows"
}
{ name: 'artists', component: ArtistsGridView, options: { partner: @partner }, title: undefined, viewAll: undefined }
{
name: 'articles'
component: FixedCellsCountCarousel
options:
partner: @partner
collection: new Articles
fetchOptions: partner_id: @partner.get('_id'), published: true, limit: 9, sort: '-published_at'
template: articlesTemplate
title: 'Articles'
viewAll: "#{@partner.href()}/articles"
}
]
it 'returns modules properly for profile_banner_display: "Artworks", profile_artists_layout: "List"', ->
@partner.set profile_banner_display: 'Artworks'
@partner.set profile_artists_layout: 'List'
factory(@partner, @profile).should.eql [
{ name: 'hero', component: HeroArtworksCarousel, options: { partner: @partner } }
{ name: 'about', template: '<article></article>', title: 'About' }
{ name: 'news', component: NewsView, options: { partner: @partner }, title: 'News' }
{
name: 'shows',
component: FixedCellsCountCarousel
options:
partner: @partner
collection: new PartnerShows
fetchOptions: [
{ partner_id: @partner.get('_id'), status: 'current', at_a_fair: false, displayable: true, size: 9, sort: 'start_at' }
{ partner_id: @partner.get('_id'), status: 'closed', at_a_fair: false, displayable: true, size: 9, sort: '-end_at' }
]
template: showsTemplate
title: 'Shows'
viewAll: "#{@partner.href()}/shows"
}
{
name: 'fair-booths'
component: FixedCellsCountCarousel
options:
partner: @partner
collection: new PartnerShows
fetchOptions: [
{ partner_id: @partner.get('_id'), status: 'current', at_a_fair: true, displayable: true, size: 9, sort: 'start_at' }
{ partner_id: @partner.get('_id'), status: 'closed', at_a_fair: true, displayable: true, size: 9, sort: '-end_at' }
]
template: fairBoothsTemplate
title: 'Fair Booths'
viewAll: "#{@partner.href()}/shows"
}
{ name: 'artists', component: ArtistsListView, options: { partner: @partner }, title: 'Artists', viewAll: "#{@partner.href()}/artists" }
{
name: 'articles'
component: FixedCellsCountCarousel
options:
partner: @partner
collection: new Articles
fetchOptions: partner_id: @partner.get('_id'), published: true, limit: 9, sort: '-published_at'
template: articlesTemplate
title: 'Articles'
viewAll: "#{@partner.href()}/articles"
}
]
it 'does not return the "Artists" module when display_artists_section is false', ->
@partner.set display_artists_section: false
modules = factory(@partner, @profile)
modules.should.containDeep [{ name: 'artists', component: undefined }]
describe 'gallery_one', ->
beforeEach ->
@profile = new Profile fabricate 'partner_profile', full_bio: 'full bio here'
@partner = new Partner fabricate 'partner', profile_layout: 'gallery_one'
it 'returns modules properly', ->
factory(@partner, @profile).should.eql [
{ name: 'hero', component: HeroShowsCarousel, options: { partner: @partner, maxNumberOfShows: 1 } }
{ name: 'about', template: '<article></article>', title: 'About' }
{
name: 'shows',
component: FixedCellsCountCarousel
options:
partner: @partner
collection: new PartnerShows
fetchOptions: [
{ partner_id: @partner.get('_id'), status: 'current', at_a_fair: false, displayable: true, size: 9, sort: 'start_at' }
{ partner_id: @partner.get('_id'), status: 'closed', at_a_fair: false, displayable: true, size: 9, sort: '-end_at' }
]
template: showsTemplate
title: 'Shows'
viewAll: "#{@partner.href()}/shows"
}
{
name: 'fair-booths'
component: FixedCellsCountCarousel
options:
partner: @partner
collection: new PartnerShows
fetchOptions: [
{ partner_id: @partner.get('_id'), status: 'current', at_a_fair: true, displayable: true, size: 9, sort: 'start_at' }
{ partner_id: @partner.get('_id'), status: 'closed', at_a_fair: true, displayable: true, size: 9, sort: '-end_at' }
]
template: fairBoothsTemplate
title: 'Fair Booths'
viewAll: "#{@partner.href()}/shows"
}
{ name: 'artists', component: ArtistsGridView, options: partner: @partner }
]
describe 'gallery_default', ->
beforeEach ->
@profile = new Profile fabricate 'partner_profile', full_bio: 'full bio here'
@partner = new Partner fabricate 'partner', profile_layout: 'gallery_default', claimed: false
it 'returns modules without artists for fair partners', ->
factory(@partner, @profile).should.eql [
{
name: 'shows'
component: ShowsGrid
options:
partner: @partner
isCombined: true
numberOfFeatured: 0
numberOfShows: 6
seeAll: false
heading: 'Shows & Fair Booths'
}
{ name: 'artists', component: undefined, options: { partner: @partner } }
{ name: 'locations', title: 'Locations', component: LocationsView, options: { partner: @partner } }
]
it 'returns modules properly otherwise', ->
@partner = new Partner fabricate 'partner', profile_layout: 'gallery_default', claimed: true
factory(@partner, @profile).should.eql [
{
name: 'shows'
component: ShowsGrid
options:
partner: @partner
isCombined: true
numberOfFeatured: 1
numberOfShows: 6
seeAll: true
heading: undefined
}
{ name: 'artists', component: ArtistsGridView, options: { partner: @partner } }
{ name: 'locations', title: 'Locations', component: undefined, options: { partner: @partner } }
]
| true | _ = require 'underscore'
sinon = require 'sinon'
rewire = require 'rewire'
Backbone = require 'backbone'
Artworks = require '../../../../collections/artworks.coffee'
PartnerShows = require '../../../../collections/partner_shows.coffee'
Articles = require '../../../../collections/articles.coffee'
Profile = require '../../../../models/profile.coffee'
Partner = require '../../../../models/partner.coffee'
{ resolve } = require 'path'
{ fabricate } = require 'antigravity'
factory = rewire '../../client/overview_layout_factory.coffee'
factory.__set__ 'HeroShowsCarousel', HeroShowsCarousel = sinon.stub()
factory.__set__ 'HeroArtworksCarousel', HeroArtworksCarousel = sinon.stub()
factory.__set__ 'ArtistsListView', ArtistsListView = sinon.stub()
factory.__set__ 'ArtistsGridView', ArtistsGridView = sinon.stub()
factory.__set__ 'aboutTemplate', aboutTemplate = sinon.stub().returns '<article></article>'
factory.__set__ 'NewsView', NewsView = sinon.stub()
factory.__set__ 'FixedCellsCountCarousel', FixedCellsCountCarousel = sinon.stub()
factory.__set__ 'showsTemplate', showsTemplate = sinon.stub().returns '<article></article>'
factory.__set__ 'fairBoothsTemplate', fairBoothsTemplate = sinon.stub().returns '<article></article>'
factory.__set__ 'articlesTemplate', articlesTemplate = sinon.stub().returns '<article></article>'
factory.__set__ 'ShowsGrid', ShowsGrid = sinon.stub()
factory.__set__ 'LocationsView', LocationsView = sinon.stub()
describe 'overview_layout_factory', ->
describe 'gallery_three', ->
beforeEach ->
@profile = new Profile fabricate 'partner_profile', full_bio: 'full_bil'
@partner = new Partner fabricate 'partner', profile_layout: 'gallery_three', display_artists_section: true
it 'returns modules properly for profile_banner_display: "Shows", profile_artists_layout: "Grid"', ->
@partner.set profile_banner_display: 'Shows'
@partner.set profile_artists_layout: 'Grid'
factory(@partner, @profile).should.eql [
{ name: 'hero', component: HeroShowsCarousel, options: { partner: @partner, maxNumberOfShows: 10 } }
{ name: 'about', template: '<article></article>', title: 'About' }
{ name: 'news', component: NewsView, options: { partner: @partner }, title: 'News' }
{
name: 'shows',
component: FixedCellsCountCarousel
options:
partner: @partner
collection: new PartnerShows
fetchOptions: [
{ partner_id: @partner.get('_id'), status: 'current', at_a_fair: false, displayable: true, size: 9, sort: 'start_at' }
{ partner_id: @partner.get('_id'), status: 'closed', at_a_fair: false, displayable: true, size: 9, sort: '-end_at' }
]
template: showsTemplate
title: 'Shows'
viewAll: "#{@partner.href()}/shows"
}
{
name: 'PI:NAME:<NAME>END_PI-booths'
component: FixedCellsCountCarousel
options:
partner: @partner
collection: new PartnerShows
fetchOptions: [
{ partner_id: @partner.get('_id'), status: 'current', at_a_fair: true, displayable: true, size: 9, sort: 'start_at' }
{ partner_id: @partner.get('_id'), status: 'closed', at_a_fair: true, displayable: true, size: 9, sort: '-end_at' }
]
template: fairBoothsTemplate
title: 'Fair Booths'
viewAll: "#{@partner.href()}/shows"
}
{ name: 'artists', component: ArtistsGridView, options: { partner: @partner }, title: undefined, viewAll: undefined }
{
name: 'articles'
component: FixedCellsCountCarousel
options:
partner: @partner
collection: new Articles
fetchOptions: partner_id: @partner.get('_id'), published: true, limit: 9, sort: '-published_at'
template: articlesTemplate
title: 'Articles'
viewAll: "#{@partner.href()}/articles"
}
]
it 'returns modules properly for profile_banner_display: "Artworks", profile_artists_layout: "List"', ->
@partner.set profile_banner_display: 'Artworks'
@partner.set profile_artists_layout: 'List'
factory(@partner, @profile).should.eql [
{ name: 'hero', component: HeroArtworksCarousel, options: { partner: @partner } }
{ name: 'about', template: '<article></article>', title: 'About' }
{ name: 'news', component: NewsView, options: { partner: @partner }, title: 'News' }
{
name: 'shows',
component: FixedCellsCountCarousel
options:
partner: @partner
collection: new PartnerShows
fetchOptions: [
{ partner_id: @partner.get('_id'), status: 'current', at_a_fair: false, displayable: true, size: 9, sort: 'start_at' }
{ partner_id: @partner.get('_id'), status: 'closed', at_a_fair: false, displayable: true, size: 9, sort: '-end_at' }
]
template: showsTemplate
title: 'Shows'
viewAll: "#{@partner.href()}/shows"
}
{
name: 'fair-booths'
component: FixedCellsCountCarousel
options:
partner: @partner
collection: new PartnerShows
fetchOptions: [
{ partner_id: @partner.get('_id'), status: 'current', at_a_fair: true, displayable: true, size: 9, sort: 'start_at' }
{ partner_id: @partner.get('_id'), status: 'closed', at_a_fair: true, displayable: true, size: 9, sort: '-end_at' }
]
template: fairBoothsTemplate
title: 'Fair Booths'
viewAll: "#{@partner.href()}/shows"
}
{ name: 'artists', component: ArtistsListView, options: { partner: @partner }, title: 'Artists', viewAll: "#{@partner.href()}/artists" }
{
name: 'articles'
component: FixedCellsCountCarousel
options:
partner: @partner
collection: new Articles
fetchOptions: partner_id: @partner.get('_id'), published: true, limit: 9, sort: '-published_at'
template: articlesTemplate
title: 'Articles'
viewAll: "#{@partner.href()}/articles"
}
]
describe 'gallery_two', ->
beforeEach ->
@profile = new Profile fabricate 'partner_profile', full_bio: 'full bio here'
@partner = new Partner fabricate 'partner', profile_layout: 'gallery_two', display_artists_section: true
it 'returns modules properly for profile_banner_display: "Shows", profile_artists_layout: "Grid"', ->
@partner.set profile_banner_display: 'Shows'
@partner.set profile_artists_layout: 'Grid'
factory(@partner, @profile).should.eql [
{ name: 'hero', component: HeroShowsCarousel, options: { partner: @partner, maxNumberOfShows: 2 } }
{ name: 'about', template: '<article></article>', title: 'About' }
{ name: 'news', component: NewsView, options: { partner: @partner }, title: 'News' }
{
name: 'shows',
component: FixedCellsCountCarousel
options:
partner: @partner
collection: new PartnerShows
fetchOptions: [
{ partner_id: @partner.get('_id'), status: 'current', at_a_fair: false, displayable: true, size: 9, sort: 'start_at' }
{ partner_id: @partner.get('_id'), status: 'closed', at_a_fair: false, displayable: true, size: 9, sort: '-end_at' }
]
template: showsTemplate
title: 'Shows'
viewAll: "#{@partner.href()}/shows"
}
{
name: 'fair-booths'
component: FixedCellsCountCarousel
options:
partner: @partner
collection: new PartnerShows
fetchOptions: [
{ partner_id: @partner.get('_id'), status: 'current', at_a_fair: true, displayable: true, size: 9, sort: 'start_at' }
{ partner_id: @partner.get('_id'), status: 'closed', at_a_fair: true, displayable: true, size: 9, sort: '-end_at' }
]
template: fairBoothsTemplate
title: 'Fair Booths'
viewAll: "#{@partner.href()}/shows"
}
{ name: 'artists', component: ArtistsGridView, options: { partner: @partner }, title: undefined, viewAll: undefined }
{
name: 'articles'
component: FixedCellsCountCarousel
options:
partner: @partner
collection: new Articles
fetchOptions: partner_id: @partner.get('_id'), published: true, limit: 9, sort: '-published_at'
template: articlesTemplate
title: 'Articles'
viewAll: "#{@partner.href()}/articles"
}
]
it 'returns modules properly for profile_banner_display: "Artworks", profile_artists_layout: "List"', ->
@partner.set profile_banner_display: 'Artworks'
@partner.set profile_artists_layout: 'List'
factory(@partner, @profile).should.eql [
{ name: 'hero', component: HeroArtworksCarousel, options: { partner: @partner } }
{ name: 'about', template: '<article></article>', title: 'About' }
{ name: 'news', component: NewsView, options: { partner: @partner }, title: 'News' }
{
name: 'shows',
component: FixedCellsCountCarousel
options:
partner: @partner
collection: new PartnerShows
fetchOptions: [
{ partner_id: @partner.get('_id'), status: 'current', at_a_fair: false, displayable: true, size: 9, sort: 'start_at' }
{ partner_id: @partner.get('_id'), status: 'closed', at_a_fair: false, displayable: true, size: 9, sort: '-end_at' }
]
template: showsTemplate
title: 'Shows'
viewAll: "#{@partner.href()}/shows"
}
{
name: 'fair-booths'
component: FixedCellsCountCarousel
options:
partner: @partner
collection: new PartnerShows
fetchOptions: [
{ partner_id: @partner.get('_id'), status: 'current', at_a_fair: true, displayable: true, size: 9, sort: 'start_at' }
{ partner_id: @partner.get('_id'), status: 'closed', at_a_fair: true, displayable: true, size: 9, sort: '-end_at' }
]
template: fairBoothsTemplate
title: 'Fair Booths'
viewAll: "#{@partner.href()}/shows"
}
{ name: 'artists', component: ArtistsListView, options: { partner: @partner }, title: 'Artists', viewAll: "#{@partner.href()}/artists" }
{
name: 'articles'
component: FixedCellsCountCarousel
options:
partner: @partner
collection: new Articles
fetchOptions: partner_id: @partner.get('_id'), published: true, limit: 9, sort: '-published_at'
template: articlesTemplate
title: 'Articles'
viewAll: "#{@partner.href()}/articles"
}
]
it 'does not return the "Artists" module when display_artists_section is false', ->
@partner.set display_artists_section: false
modules = factory(@partner, @profile)
modules.should.containDeep [{ name: 'artists', component: undefined }]
describe 'gallery_one', ->
beforeEach ->
@profile = new Profile fabricate 'partner_profile', full_bio: 'full bio here'
@partner = new Partner fabricate 'partner', profile_layout: 'gallery_one'
it 'returns modules properly', ->
factory(@partner, @profile).should.eql [
{ name: 'hero', component: HeroShowsCarousel, options: { partner: @partner, maxNumberOfShows: 1 } }
{ name: 'about', template: '<article></article>', title: 'About' }
{
name: 'shows',
component: FixedCellsCountCarousel
options:
partner: @partner
collection: new PartnerShows
fetchOptions: [
{ partner_id: @partner.get('_id'), status: 'current', at_a_fair: false, displayable: true, size: 9, sort: 'start_at' }
{ partner_id: @partner.get('_id'), status: 'closed', at_a_fair: false, displayable: true, size: 9, sort: '-end_at' }
]
template: showsTemplate
title: 'Shows'
viewAll: "#{@partner.href()}/shows"
}
{
name: 'fair-booths'
component: FixedCellsCountCarousel
options:
partner: @partner
collection: new PartnerShows
fetchOptions: [
{ partner_id: @partner.get('_id'), status: 'current', at_a_fair: true, displayable: true, size: 9, sort: 'start_at' }
{ partner_id: @partner.get('_id'), status: 'closed', at_a_fair: true, displayable: true, size: 9, sort: '-end_at' }
]
template: fairBoothsTemplate
title: 'Fair Booths'
viewAll: "#{@partner.href()}/shows"
}
{ name: 'artists', component: ArtistsGridView, options: partner: @partner }
]
describe 'gallery_default', ->
beforeEach ->
@profile = new Profile fabricate 'partner_profile', full_bio: 'full bio here'
@partner = new Partner fabricate 'partner', profile_layout: 'gallery_default', claimed: false
it 'returns modules without artists for fair partners', ->
factory(@partner, @profile).should.eql [
{
name: 'shows'
component: ShowsGrid
options:
partner: @partner
isCombined: true
numberOfFeatured: 0
numberOfShows: 6
seeAll: false
heading: 'Shows & Fair Booths'
}
{ name: 'artists', component: undefined, options: { partner: @partner } }
{ name: 'locations', title: 'Locations', component: LocationsView, options: { partner: @partner } }
]
it 'returns modules properly otherwise', ->
@partner = new Partner fabricate 'partner', profile_layout: 'gallery_default', claimed: true
factory(@partner, @profile).should.eql [
{
name: 'shows'
component: ShowsGrid
options:
partner: @partner
isCombined: true
numberOfFeatured: 1
numberOfShows: 6
seeAll: true
heading: undefined
}
{ name: 'artists', component: ArtistsGridView, options: { partner: @partner } }
{ name: 'locations', title: 'Locations', component: undefined, options: { partner: @partner } }
]
|
[
{
"context": "Things = [{\n \"id\": 1,\n \"body\": \"Geppetto, a poor old wood carver, was making a puppet from",
"end": 452,
"score": 0.9273120760917664,
"start": 444,
"tag": "NAME",
"value": "Geppetto"
},
{
"context": "y,” he said to the puppet, “and I shall call you ‘Pinocchio’.” He worked for hours, carefully carving each de",
"end": 603,
"score": 0.9540944695472717,
"start": 594,
"tag": "NAME",
"value": "Pinocchio"
},
{
"context": "lded, “Stop that at once !” “I won’t stop !” cried Pinocchio.\",\n \"comments\": [\n {\n ",
"end": 829,
"score": 0.5607642531394958,
"start": 824,
"tag": "NAME",
"value": "Pinoc"
},
{
"context": "he puppet. “You’ve given me a mouth to talk with.” Pinocchio rose to his feet and danced on the table top. “Lo",
"end": 1129,
"score": 0.7024406790733337,
"start": 1120,
"tag": "NAME",
"value": "Pinocchio"
},
{
"context": "\n {\n \"id\": 3,\n \"body\": \"“Pinocchio, this is not the time to dance,” Geppetto explain",
"end": 1428,
"score": 0.8182205557823181,
"start": 1419,
"tag": "NAME",
"value": "Pinocchio"
},
{
"context": "t Master. Then he noticed how much the crowd liked Pinocchio. He did not say anything and let Pinocchio ",
"end": 1910,
"score": 0.6639575958251953,
"start": 1907,
"tag": "NAME",
"value": "Pin"
},
{
"context": " earned five copper coins,” the Puppet Master told Pinocchio.\",\n \"comments\": [\n {\n ",
"end": 2033,
"score": 0.5599355101585388,
"start": 2030,
"tag": "NAME",
"value": "Pin"
}
] | app/scripts/controllers/post.coffee | djbuen/matchmove | 0 | 'use strict'
###*
# @ngdoc function
# @name angularSlickApp.controller:PostCtrl
# @description
# # PostCtrl
# Controller of the angularSlickApp
###
angular.module('slick')
.controller 'PostCtrl', ($scope, $cookies, $cookieStore, $routeParams) ->
console.log($routeParams)
$scope.post_id = $routeParams.id
$scope.post_body = ""
$scope.comment_body = ""
$scope.awesomeThings = [{
"id": 1,
"body": "Geppetto, a poor old wood carver, was making a puppet from a tree branch. “You shall be my little boy,” he said to the puppet, “and I shall call you ‘Pinocchio’.” He worked for hours, carefully carving each detail. When he reached the mouth, the puppet started making faces at Geppetto. “Stop that, you naughty boy,” Geppetto scolded, “Stop that at once !” “I won’t stop !” cried Pinocchio.",
"comments": [
{
"id": 1,
"comment": "Ohh poor boy pinocchio...."
}
]
},
{
"id": 2,
"body": "“Of course I can, silly,” said the puppet. “You’ve given me a mouth to talk with.” Pinocchio rose to his feet and danced on the table top. “Look what I can do !” he squealed.",
"comments": [
{
"id": 1,
"comment": "Pinocchio tries to rationalize"
}
]
},
{
"id": 3,
"body": "“Pinocchio, this is not the time to dance,” Geppetto explained. “You must get a good night’s rest. Tomorrow you will start going to school with the real boys. You will learn many things, including how to behave.”",
"comments": [
{
"id": 1,
"comment": "That's right!"
}
]
},
{
"id": 4,
"body": "“Get off my stage,” roared the Puppet Master. Then he noticed how much the crowd liked Pinocchio. He did not say anything and let Pinocchio stay. “Here, you’ve earned five copper coins,” the Puppet Master told Pinocchio.",
"comments": [
{
"id": 1,
"comment": "Earned it!"
}
]
}
]
$scope.posts = {}
i=0
while i < $scope.awesomeThings.length
$scope.posts[$scope.awesomeThings[i].id] = $scope.awesomeThings[i]
i++
console.log($scope.posts)
$scope.addPost = (body)->
last = $scope.awesomeThings.length
console.log($scope.awesomeThings[last-1].id)
$scope.awesomeThings.push({post_id: $scope.awesomeThings[last-1].id + 1, body: body, comments: []})
$cookieStore.put('test', $scope.awesomeThings);
x = $cookieStore.get('test')
console.log(x)
$scope.addComment = (comments) ->
console.log(comments)
console.log($scope.comment_body)
comments.push({comment: $scope.comment_body})
| 123216 | 'use strict'
###*
# @ngdoc function
# @name angularSlickApp.controller:PostCtrl
# @description
# # PostCtrl
# Controller of the angularSlickApp
###
angular.module('slick')
.controller 'PostCtrl', ($scope, $cookies, $cookieStore, $routeParams) ->
console.log($routeParams)
$scope.post_id = $routeParams.id
$scope.post_body = ""
$scope.comment_body = ""
$scope.awesomeThings = [{
"id": 1,
"body": "<NAME>, a poor old wood carver, was making a puppet from a tree branch. “You shall be my little boy,” he said to the puppet, “and I shall call you ‘<NAME>’.” He worked for hours, carefully carving each detail. When he reached the mouth, the puppet started making faces at Geppetto. “Stop that, you naughty boy,” Geppetto scolded, “Stop that at once !” “I won’t stop !” cried <NAME>chio.",
"comments": [
{
"id": 1,
"comment": "Ohh poor boy pinocchio...."
}
]
},
{
"id": 2,
"body": "“Of course I can, silly,” said the puppet. “You’ve given me a mouth to talk with.” <NAME> rose to his feet and danced on the table top. “Look what I can do !” he squealed.",
"comments": [
{
"id": 1,
"comment": "Pinocchio tries to rationalize"
}
]
},
{
"id": 3,
"body": "“<NAME>, this is not the time to dance,” Geppetto explained. “You must get a good night’s rest. Tomorrow you will start going to school with the real boys. You will learn many things, including how to behave.”",
"comments": [
{
"id": 1,
"comment": "That's right!"
}
]
},
{
"id": 4,
"body": "“Get off my stage,” roared the Puppet Master. Then he noticed how much the crowd liked <NAME>occhio. He did not say anything and let Pinocchio stay. “Here, you’ve earned five copper coins,” the Puppet Master told <NAME>occhio.",
"comments": [
{
"id": 1,
"comment": "Earned it!"
}
]
}
]
$scope.posts = {}
i=0
while i < $scope.awesomeThings.length
$scope.posts[$scope.awesomeThings[i].id] = $scope.awesomeThings[i]
i++
console.log($scope.posts)
$scope.addPost = (body)->
last = $scope.awesomeThings.length
console.log($scope.awesomeThings[last-1].id)
$scope.awesomeThings.push({post_id: $scope.awesomeThings[last-1].id + 1, body: body, comments: []})
$cookieStore.put('test', $scope.awesomeThings);
x = $cookieStore.get('test')
console.log(x)
$scope.addComment = (comments) ->
console.log(comments)
console.log($scope.comment_body)
comments.push({comment: $scope.comment_body})
| true | 'use strict'
###*
# @ngdoc function
# @name angularSlickApp.controller:PostCtrl
# @description
# # PostCtrl
# Controller of the angularSlickApp
###
angular.module('slick')
.controller 'PostCtrl', ($scope, $cookies, $cookieStore, $routeParams) ->
console.log($routeParams)
$scope.post_id = $routeParams.id
$scope.post_body = ""
$scope.comment_body = ""
$scope.awesomeThings = [{
"id": 1,
"body": "PI:NAME:<NAME>END_PI, a poor old wood carver, was making a puppet from a tree branch. “You shall be my little boy,” he said to the puppet, “and I shall call you ‘PI:NAME:<NAME>END_PI’.” He worked for hours, carefully carving each detail. When he reached the mouth, the puppet started making faces at Geppetto. “Stop that, you naughty boy,” Geppetto scolded, “Stop that at once !” “I won’t stop !” cried PI:NAME:<NAME>END_PIchio.",
"comments": [
{
"id": 1,
"comment": "Ohh poor boy pinocchio...."
}
]
},
{
"id": 2,
"body": "“Of course I can, silly,” said the puppet. “You’ve given me a mouth to talk with.” PI:NAME:<NAME>END_PI rose to his feet and danced on the table top. “Look what I can do !” he squealed.",
"comments": [
{
"id": 1,
"comment": "Pinocchio tries to rationalize"
}
]
},
{
"id": 3,
"body": "“PI:NAME:<NAME>END_PI, this is not the time to dance,” Geppetto explained. “You must get a good night’s rest. Tomorrow you will start going to school with the real boys. You will learn many things, including how to behave.”",
"comments": [
{
"id": 1,
"comment": "That's right!"
}
]
},
{
"id": 4,
"body": "“Get off my stage,” roared the Puppet Master. Then he noticed how much the crowd liked PI:NAME:<NAME>END_PIocchio. He did not say anything and let Pinocchio stay. “Here, you’ve earned five copper coins,” the Puppet Master told PI:NAME:<NAME>END_PIocchio.",
"comments": [
{
"id": 1,
"comment": "Earned it!"
}
]
}
]
$scope.posts = {}
i=0
while i < $scope.awesomeThings.length
$scope.posts[$scope.awesomeThings[i].id] = $scope.awesomeThings[i]
i++
console.log($scope.posts)
$scope.addPost = (body)->
last = $scope.awesomeThings.length
console.log($scope.awesomeThings[last-1].id)
$scope.awesomeThings.push({post_id: $scope.awesomeThings[last-1].id + 1, body: body, comments: []})
$cookieStore.put('test', $scope.awesomeThings);
x = $cookieStore.get('test')
console.log(x)
$scope.addComment = (comments) ->
console.log(comments)
console.log($scope.comment_body)
comments.push({comment: $scope.comment_body})
|
[
{
"context": "'name\\' | join \\', \\'\"></div>',\n posts: [\n Batman\n name: 'one'\n comments: 10\n , Ba",
"end": 4548,
"score": 0.8016042709350586,
"start": 4542,
"tag": "NAME",
"value": "Batman"
},
{
"context": "</div>',\n posts: [\n Batman\n name: 'one'\n comments: 10\n , Batman\n name: ",
"end": 4567,
"score": 0.8758162260055542,
"start": 4564,
"tag": "NAME",
"value": "one"
},
{
"context": "man\n name: 'one'\n comments: 10\n , Batman\n name: 'two'\n comments: 20\n ]",
"end": 4599,
"score": 0.6585772037506104,
"start": 4596,
"tag": "NAME",
"value": "Bat"
},
{
"context": "\n comments: 10\n , Batman\n name: 'two'\n comments: 20\n ]\n , (node) ->\n equ",
"end": 4621,
"score": 0.9465779662132263,
"start": 4618,
"tag": "NAME",
"value": "two"
}
] | tests/batman/view/filter_execution_test.coffee | nickjs/batman | 1 | helpers = if typeof require is 'undefined' then window.viewHelpers else require './view_helper'
QUnit.module 'Batman.View filter execution'
asyncTest 'get', 1, ->
context = Batman
foo: new Batman.Hash({bar: "qux"})
helpers.render '<div data-bind="foo | get \'bar\'"></div>', context, (node) ->
equals node.html(), "qux"
QUnit.start()
asyncTest 'get dotted syntax', 1, ->
context = Batman
foo: new Batman.Hash({bar: "qux"})
helpers.render '<div data-bind="foo.bar"></div>', context, (node) ->
equals node.html(), "qux"
QUnit.start()
asyncTest 'get short syntax', 1, ->
context = Batman
foo: new Batman.Hash({bar: "qux"})
helpers.render '<div data-bind="foo[\'bar\']"></div>', context, (node) ->
equals node.html(), "qux"
QUnit.start()
asyncTest 'get short syntax with looked-up key', 1, ->
context = Batman
key: 'bar'
foo: new Batman.Hash({bar: "qux"})
helpers.render '<div data-bind="foo[key]"></div>', context, (node) ->
equals node.html(), "qux"
QUnit.start()
asyncTest 'get short syntax with complex key', 1, ->
context = Batman
complex: { key: 'bar'}
foo: new Batman.Hash({bar: "qux"})
helpers.render '<div data-bind="foo[complex.key]"></div>', context, (node) ->
equals node.html(), "qux"
QUnit.start()
asyncTest 'get short syntax with chained dot lookup', 1, ->
context = Batman
key: 'bar'
foo: new Batman.Hash({bar: { baz: "qux" }})
helpers.render '<div data-bind="foo[key].baz"></div>', context, (node) ->
equals node.html(), "qux"
QUnit.start()
asyncTest 'get chained short syntax', 1, ->
context = Batman
foo: new Batman.Hash({bar: {baz: "qux"}})
helpers.render '<div data-bind="foo[\'bar\'][\'baz\']"></div>', context, (node) ->
equals node.html(), "qux"
QUnit.start()
asyncTest 'hideously complex chain of property lookups', 1, ->
context = Batman
ss: { ee: 'c' }
a: new Batman.Hash
b:
c:
d:
e:
f:
g:
h: 'value'
helpers.render '<div data-bind="a.b[ss.ee].d[\'e\'][\'f\'].g.h"></div>', context, (node) ->
equals node.html(), "value"
QUnit.start()
asyncTest 'hideously complex chain of property lookups with filters', 1, ->
context = Batman
ss: { ee: 'c' }
a: new Batman.Hash
b:
c:
d:
e:
f:
g:
h: 'value'
spyOn Batman.Filters, 'spy'
helpers.render '<div data-bind="a.b[ss.ee].d[\'e\'][\'f\'].g.h | spy"></div>', context, (node) ->
equal Batman.Filters.spy.lastCallArguments[0], 'value'
delete Batman.Filters.spy
QUnit.start()
asyncTest 'truncate', 2, ->
helpers.render '<div data-bind="foo | truncate 5"></div>',
foo: 'your mother was a hampster'
, (node) ->
equals node.html(), "yo..."
helpers.render '<div data-bind="foo.bar | truncate 5, \'\'"></div>',
foo: Batman
bar: 'your mother was a hampster'
, (node) ->
equals node.html(), "your "
QUnit.start()
asyncTest 'prepend', 1, ->
helpers.render '<div data-bind="foo | prepend \'special-\'"></div>',
foo: 'bar'
, (node) ->
equals node.html(), "special-bar"
QUnit.start()
asyncTest 'append', 1, ->
helpers.render '<div data-bind="foo | append \'-special\'"></div>',
foo: 'bar'
, (node) ->
equals node.html(), "bar-special"
QUnit.start()
asyncTest 'downcase', 1, ->
helpers.render '<div data-bind="foo | downcase"></div>',
foo: 'BAR'
, (node) ->
equals node.html(), "bar"
QUnit.start()
asyncTest 'upcase', 1, ->
helpers.render '<div data-bind="foo | upcase"></div>',
foo: 'bar'
, (node) ->
equals node.html(), "BAR"
QUnit.start()
asyncTest 'join', 2, ->
helpers.render '<div data-bind="foo | join"></div>',
foo: ['a', 'b', 'c']
, (node) ->
equals node.html(), "abc"
helpers.render '<div data-bind="foo | join \'|\'"></div>',
foo: ['a', 'b', 'c']
, (node) ->
equals node.html(), "a|b|c"
QUnit.start()
asyncTest 'sort', 1, ->
helpers.render '<div data-bind="foo | sort | join"></div>',
foo: ['b', 'c', 'a', '1']
, (node) ->
equals node.html(), "1abc"
QUnit.start()
asyncTest 'not', 1, ->
helpers.render '<div data-showif="foo | not"></div>',
foo: true
, (node) ->
equals node[0].style.display, "none"
QUnit.start()
asyncTest 'map', 1, ->
helpers.render '<div data-bind="posts | map \'name\' | join \', \'"></div>',
posts: [
Batman
name: 'one'
comments: 10
, Batman
name: 'two'
comments: 20
]
, (node) ->
equals node.html(), "one, two"
QUnit.start()
asyncTest 'map with a numeric key', 1, ->
helpers.render '<div data-bind="counts | map 1 | join \', \'"></div>',
counts: [
[1, 2, 3]
[4, 5, 6]
]
, (node) ->
equals node.html(), "2, 5"
QUnit.start()
asyncTest 'map over a set', 1, ->
helpers.render '<div data-bind="posts | map \'name\' | join \', \'"></div>',
posts: new Batman.Set(
Batman
name: 'one'
comments: 10
, Batman
name: 'two'
comments: 20
)
, (node) ->
equals node.html(), "one, two"
QUnit.start()
asyncTest 'meta', 2, ->
context = Batman
foo: Batman
meta:
get: spy = createSpy().whichReturns("something")
helpers.render '<div data-bind="foo | meta \'bar\'"></div>', context, (node) ->
equals node.html(), "something"
deepEqual spy.lastCallArguments, ['bar']
QUnit.start()
asyncTest 'meta binding to a hash', 2, ->
context = Batman
foo: new Batman.Hash(bar: "qux")
helpers.render '<div data-bind="foo | meta \'length\'"></div>', context, (node) ->
equals node.html(), "1"
context.get('foo').set('corge', 'test')
delay =>
equals node.html(), "2"
QUnit.module "Batman.View filter value and parameter parsing"
setup: ->
Batman.Filters['test'] = @spy = createSpy().whichReturns("testValue")
teardown: ->
delete Batman.Filters.test
asyncTest "should parse one segment keypaths as values", ->
helpers.render '<div data-bind="foo | test"></div>', Batman(foo: "bar"), (node) =>
equals node.html(), "testValue"
deepEqual @spy.lastCallArguments, ["bar"]
QUnit.start()
asyncTest "should parse many segment keypaths as values", ->
helpers.render '<div data-bind="foo.bar | test"></div>', Batman(foo: Batman(bar: "baz")), (node) =>
equals node.html(), "testValue"
deepEqual @spy.lastCallArguments, ["baz"]
QUnit.start()
asyncTest "should parse one segment keypaths as arguments", ->
helpers.render '<div data-bind="1 | test foo"></div>', Batman(foo: "bar"), (node) =>
equals node.html(), "testValue"
deepEqual @spy.lastCallArguments, [1, "bar"]
QUnit.start()
asyncTest "should parse one segment keypaths as arguments anywhere in the list of arguments", ->
helpers.render '<div data-bind="1 | test foo, 2, bar, 3, baz"></div>', Batman(foo: "a", bar: "b", baz: "c"), (node) =>
equals node.html(), "testValue"
deepEqual @spy.lastCallArguments, [1, "a", 2, "b", 3, "c"]
QUnit.start()
asyncTest "should parse one segment keypaths as arguments anywhere in the list of arguments", ->
helpers.render '<div data-bind="1 | test qux.foo, 2, qux.bar, 3, qux.baz"></div>', Batman(qux: Batman(foo: "a", bar: "b", baz: "c")), (node) =>
equals node.html(), "testValue"
deepEqual @spy.lastCallArguments, [1, "a", 2, "b", 3, "c"]
QUnit.start()
asyncTest "should parse many segment keypaths as arguments", ->
helpers.render '<div data-bind="1 | test foo.bar"></div>', Batman(foo: Batman(bar: "baz")), (node) =>
equals node.html(), "testValue"
deepEqual @spy.lastCallArguments, [1, "baz"]
QUnit.start()
asyncTest "should parse keypaths containing true as arguments", ->
helpers.render '<div data-bind="1 | test true.bar"></div>', Batman("true": Batman(bar: "baz")), (node) =>
deepEqual @spy.lastCallArguments, [1, "baz"]
helpers.render '<div data-bind="1 | test truesay.bar"></div>', Batman(truesay: Batman(bar: "baz")), (node) =>
deepEqual @spy.lastCallArguments, [1, "baz"]
QUnit.start()
asyncTest "should parse keypaths containing false as arguments", ->
helpers.render '<div data-bind="1 | test false.bar"></div>', Batman("false": Batman(bar: "baz")), (node) =>
deepEqual @spy.lastCallArguments, [1, "baz"]
helpers.render '<div data-bind="1 | test falsified.bar"></div>', Batman(falsified: Batman(bar: "baz")), (node) =>
deepEqual @spy.lastCallArguments, [1, "baz"]
QUnit.start()
asyncTest "should not parse true or false as a keypath", ->
helpers.render '<div data-bind="1 | test true"></div>', Batman("true": Batman(bar: "baz")), (node) =>
equals node.html(), "testValue"
deepEqual @spy.lastCallArguments, [1, true]
helpers.render '<div data-bind="1 | test false"></div>', Batman(truesay: Batman(bar: "baz")), (node) =>
equals node.html(), "testValue"
deepEqual @spy.lastCallArguments, [1, false]
QUnit.start()
QUnit.module "Batman.View user defined filter execution"
asyncTest 'should render a user defined filter', 3, ->
Batman.Filters['test'] = spy = createSpy().whichReturns("testValue")
ctx = Batman
foo: 'bar'
bar: 'baz'
helpers.render '<div data-bind="foo | test 1, \'baz\'"></div>', ctx, (node) ->
equals node.html(), "testValue"
equals spy.lastCallContext, ctx
deepEqual spy.lastCallArguments, ['bar', 1, 'baz']
delete Batman.Filters.test
QUnit.start()
| 85288 | helpers = if typeof require is 'undefined' then window.viewHelpers else require './view_helper'
QUnit.module 'Batman.View filter execution'
asyncTest 'get', 1, ->
context = Batman
foo: new Batman.Hash({bar: "qux"})
helpers.render '<div data-bind="foo | get \'bar\'"></div>', context, (node) ->
equals node.html(), "qux"
QUnit.start()
asyncTest 'get dotted syntax', 1, ->
context = Batman
foo: new Batman.Hash({bar: "qux"})
helpers.render '<div data-bind="foo.bar"></div>', context, (node) ->
equals node.html(), "qux"
QUnit.start()
asyncTest 'get short syntax', 1, ->
context = Batman
foo: new Batman.Hash({bar: "qux"})
helpers.render '<div data-bind="foo[\'bar\']"></div>', context, (node) ->
equals node.html(), "qux"
QUnit.start()
asyncTest 'get short syntax with looked-up key', 1, ->
context = Batman
key: 'bar'
foo: new Batman.Hash({bar: "qux"})
helpers.render '<div data-bind="foo[key]"></div>', context, (node) ->
equals node.html(), "qux"
QUnit.start()
asyncTest 'get short syntax with complex key', 1, ->
context = Batman
complex: { key: 'bar'}
foo: new Batman.Hash({bar: "qux"})
helpers.render '<div data-bind="foo[complex.key]"></div>', context, (node) ->
equals node.html(), "qux"
QUnit.start()
asyncTest 'get short syntax with chained dot lookup', 1, ->
context = Batman
key: 'bar'
foo: new Batman.Hash({bar: { baz: "qux" }})
helpers.render '<div data-bind="foo[key].baz"></div>', context, (node) ->
equals node.html(), "qux"
QUnit.start()
asyncTest 'get chained short syntax', 1, ->
context = Batman
foo: new Batman.Hash({bar: {baz: "qux"}})
helpers.render '<div data-bind="foo[\'bar\'][\'baz\']"></div>', context, (node) ->
equals node.html(), "qux"
QUnit.start()
asyncTest 'hideously complex chain of property lookups', 1, ->
context = Batman
ss: { ee: 'c' }
a: new Batman.Hash
b:
c:
d:
e:
f:
g:
h: 'value'
helpers.render '<div data-bind="a.b[ss.ee].d[\'e\'][\'f\'].g.h"></div>', context, (node) ->
equals node.html(), "value"
QUnit.start()
asyncTest 'hideously complex chain of property lookups with filters', 1, ->
context = Batman
ss: { ee: 'c' }
a: new Batman.Hash
b:
c:
d:
e:
f:
g:
h: 'value'
spyOn Batman.Filters, 'spy'
helpers.render '<div data-bind="a.b[ss.ee].d[\'e\'][\'f\'].g.h | spy"></div>', context, (node) ->
equal Batman.Filters.spy.lastCallArguments[0], 'value'
delete Batman.Filters.spy
QUnit.start()
asyncTest 'truncate', 2, ->
helpers.render '<div data-bind="foo | truncate 5"></div>',
foo: 'your mother was a hampster'
, (node) ->
equals node.html(), "yo..."
helpers.render '<div data-bind="foo.bar | truncate 5, \'\'"></div>',
foo: Batman
bar: 'your mother was a hampster'
, (node) ->
equals node.html(), "your "
QUnit.start()
asyncTest 'prepend', 1, ->
helpers.render '<div data-bind="foo | prepend \'special-\'"></div>',
foo: 'bar'
, (node) ->
equals node.html(), "special-bar"
QUnit.start()
asyncTest 'append', 1, ->
helpers.render '<div data-bind="foo | append \'-special\'"></div>',
foo: 'bar'
, (node) ->
equals node.html(), "bar-special"
QUnit.start()
asyncTest 'downcase', 1, ->
helpers.render '<div data-bind="foo | downcase"></div>',
foo: 'BAR'
, (node) ->
equals node.html(), "bar"
QUnit.start()
asyncTest 'upcase', 1, ->
helpers.render '<div data-bind="foo | upcase"></div>',
foo: 'bar'
, (node) ->
equals node.html(), "BAR"
QUnit.start()
asyncTest 'join', 2, ->
helpers.render '<div data-bind="foo | join"></div>',
foo: ['a', 'b', 'c']
, (node) ->
equals node.html(), "abc"
helpers.render '<div data-bind="foo | join \'|\'"></div>',
foo: ['a', 'b', 'c']
, (node) ->
equals node.html(), "a|b|c"
QUnit.start()
asyncTest 'sort', 1, ->
helpers.render '<div data-bind="foo | sort | join"></div>',
foo: ['b', 'c', 'a', '1']
, (node) ->
equals node.html(), "1abc"
QUnit.start()
asyncTest 'not', 1, ->
helpers.render '<div data-showif="foo | not"></div>',
foo: true
, (node) ->
equals node[0].style.display, "none"
QUnit.start()
asyncTest 'map', 1, ->
helpers.render '<div data-bind="posts | map \'name\' | join \', \'"></div>',
posts: [
<NAME>
name: '<NAME>'
comments: 10
, <NAME>man
name: '<NAME>'
comments: 20
]
, (node) ->
equals node.html(), "one, two"
QUnit.start()
asyncTest 'map with a numeric key', 1, ->
helpers.render '<div data-bind="counts | map 1 | join \', \'"></div>',
counts: [
[1, 2, 3]
[4, 5, 6]
]
, (node) ->
equals node.html(), "2, 5"
QUnit.start()
asyncTest 'map over a set', 1, ->
helpers.render '<div data-bind="posts | map \'name\' | join \', \'"></div>',
posts: new Batman.Set(
Batman
name: 'one'
comments: 10
, Batman
name: 'two'
comments: 20
)
, (node) ->
equals node.html(), "one, two"
QUnit.start()
asyncTest 'meta', 2, ->
context = Batman
foo: Batman
meta:
get: spy = createSpy().whichReturns("something")
helpers.render '<div data-bind="foo | meta \'bar\'"></div>', context, (node) ->
equals node.html(), "something"
deepEqual spy.lastCallArguments, ['bar']
QUnit.start()
asyncTest 'meta binding to a hash', 2, ->
context = Batman
foo: new Batman.Hash(bar: "qux")
helpers.render '<div data-bind="foo | meta \'length\'"></div>', context, (node) ->
equals node.html(), "1"
context.get('foo').set('corge', 'test')
delay =>
equals node.html(), "2"
QUnit.module "Batman.View filter value and parameter parsing"
setup: ->
Batman.Filters['test'] = @spy = createSpy().whichReturns("testValue")
teardown: ->
delete Batman.Filters.test
asyncTest "should parse one segment keypaths as values", ->
helpers.render '<div data-bind="foo | test"></div>', Batman(foo: "bar"), (node) =>
equals node.html(), "testValue"
deepEqual @spy.lastCallArguments, ["bar"]
QUnit.start()
asyncTest "should parse many segment keypaths as values", ->
helpers.render '<div data-bind="foo.bar | test"></div>', Batman(foo: Batman(bar: "baz")), (node) =>
equals node.html(), "testValue"
deepEqual @spy.lastCallArguments, ["baz"]
QUnit.start()
asyncTest "should parse one segment keypaths as arguments", ->
helpers.render '<div data-bind="1 | test foo"></div>', Batman(foo: "bar"), (node) =>
equals node.html(), "testValue"
deepEqual @spy.lastCallArguments, [1, "bar"]
QUnit.start()
asyncTest "should parse one segment keypaths as arguments anywhere in the list of arguments", ->
helpers.render '<div data-bind="1 | test foo, 2, bar, 3, baz"></div>', Batman(foo: "a", bar: "b", baz: "c"), (node) =>
equals node.html(), "testValue"
deepEqual @spy.lastCallArguments, [1, "a", 2, "b", 3, "c"]
QUnit.start()
asyncTest "should parse one segment keypaths as arguments anywhere in the list of arguments", ->
helpers.render '<div data-bind="1 | test qux.foo, 2, qux.bar, 3, qux.baz"></div>', Batman(qux: Batman(foo: "a", bar: "b", baz: "c")), (node) =>
equals node.html(), "testValue"
deepEqual @spy.lastCallArguments, [1, "a", 2, "b", 3, "c"]
QUnit.start()
asyncTest "should parse many segment keypaths as arguments", ->
helpers.render '<div data-bind="1 | test foo.bar"></div>', Batman(foo: Batman(bar: "baz")), (node) =>
equals node.html(), "testValue"
deepEqual @spy.lastCallArguments, [1, "baz"]
QUnit.start()
asyncTest "should parse keypaths containing true as arguments", ->
helpers.render '<div data-bind="1 | test true.bar"></div>', Batman("true": Batman(bar: "baz")), (node) =>
deepEqual @spy.lastCallArguments, [1, "baz"]
helpers.render '<div data-bind="1 | test truesay.bar"></div>', Batman(truesay: Batman(bar: "baz")), (node) =>
deepEqual @spy.lastCallArguments, [1, "baz"]
QUnit.start()
asyncTest "should parse keypaths containing false as arguments", ->
helpers.render '<div data-bind="1 | test false.bar"></div>', Batman("false": Batman(bar: "baz")), (node) =>
deepEqual @spy.lastCallArguments, [1, "baz"]
helpers.render '<div data-bind="1 | test falsified.bar"></div>', Batman(falsified: Batman(bar: "baz")), (node) =>
deepEqual @spy.lastCallArguments, [1, "baz"]
QUnit.start()
asyncTest "should not parse true or false as a keypath", ->
helpers.render '<div data-bind="1 | test true"></div>', Batman("true": Batman(bar: "baz")), (node) =>
equals node.html(), "testValue"
deepEqual @spy.lastCallArguments, [1, true]
helpers.render '<div data-bind="1 | test false"></div>', Batman(truesay: Batman(bar: "baz")), (node) =>
equals node.html(), "testValue"
deepEqual @spy.lastCallArguments, [1, false]
QUnit.start()
QUnit.module "Batman.View user defined filter execution"
asyncTest 'should render a user defined filter', 3, ->
Batman.Filters['test'] = spy = createSpy().whichReturns("testValue")
ctx = Batman
foo: 'bar'
bar: 'baz'
helpers.render '<div data-bind="foo | test 1, \'baz\'"></div>', ctx, (node) ->
equals node.html(), "testValue"
equals spy.lastCallContext, ctx
deepEqual spy.lastCallArguments, ['bar', 1, 'baz']
delete Batman.Filters.test
QUnit.start()
| true | helpers = if typeof require is 'undefined' then window.viewHelpers else require './view_helper'
QUnit.module 'Batman.View filter execution'
asyncTest 'get', 1, ->
context = Batman
foo: new Batman.Hash({bar: "qux"})
helpers.render '<div data-bind="foo | get \'bar\'"></div>', context, (node) ->
equals node.html(), "qux"
QUnit.start()
asyncTest 'get dotted syntax', 1, ->
context = Batman
foo: new Batman.Hash({bar: "qux"})
helpers.render '<div data-bind="foo.bar"></div>', context, (node) ->
equals node.html(), "qux"
QUnit.start()
asyncTest 'get short syntax', 1, ->
context = Batman
foo: new Batman.Hash({bar: "qux"})
helpers.render '<div data-bind="foo[\'bar\']"></div>', context, (node) ->
equals node.html(), "qux"
QUnit.start()
asyncTest 'get short syntax with looked-up key', 1, ->
context = Batman
key: 'bar'
foo: new Batman.Hash({bar: "qux"})
helpers.render '<div data-bind="foo[key]"></div>', context, (node) ->
equals node.html(), "qux"
QUnit.start()
asyncTest 'get short syntax with complex key', 1, ->
context = Batman
complex: { key: 'bar'}
foo: new Batman.Hash({bar: "qux"})
helpers.render '<div data-bind="foo[complex.key]"></div>', context, (node) ->
equals node.html(), "qux"
QUnit.start()
asyncTest 'get short syntax with chained dot lookup', 1, ->
context = Batman
key: 'bar'
foo: new Batman.Hash({bar: { baz: "qux" }})
helpers.render '<div data-bind="foo[key].baz"></div>', context, (node) ->
equals node.html(), "qux"
QUnit.start()
asyncTest 'get chained short syntax', 1, ->
context = Batman
foo: new Batman.Hash({bar: {baz: "qux"}})
helpers.render '<div data-bind="foo[\'bar\'][\'baz\']"></div>', context, (node) ->
equals node.html(), "qux"
QUnit.start()
asyncTest 'hideously complex chain of property lookups', 1, ->
context = Batman
ss: { ee: 'c' }
a: new Batman.Hash
b:
c:
d:
e:
f:
g:
h: 'value'
helpers.render '<div data-bind="a.b[ss.ee].d[\'e\'][\'f\'].g.h"></div>', context, (node) ->
equals node.html(), "value"
QUnit.start()
asyncTest 'hideously complex chain of property lookups with filters', 1, ->
context = Batman
ss: { ee: 'c' }
a: new Batman.Hash
b:
c:
d:
e:
f:
g:
h: 'value'
spyOn Batman.Filters, 'spy'
helpers.render '<div data-bind="a.b[ss.ee].d[\'e\'][\'f\'].g.h | spy"></div>', context, (node) ->
equal Batman.Filters.spy.lastCallArguments[0], 'value'
delete Batman.Filters.spy
QUnit.start()
asyncTest 'truncate', 2, ->
helpers.render '<div data-bind="foo | truncate 5"></div>',
foo: 'your mother was a hampster'
, (node) ->
equals node.html(), "yo..."
helpers.render '<div data-bind="foo.bar | truncate 5, \'\'"></div>',
foo: Batman
bar: 'your mother was a hampster'
, (node) ->
equals node.html(), "your "
QUnit.start()
asyncTest 'prepend', 1, ->
helpers.render '<div data-bind="foo | prepend \'special-\'"></div>',
foo: 'bar'
, (node) ->
equals node.html(), "special-bar"
QUnit.start()
asyncTest 'append', 1, ->
helpers.render '<div data-bind="foo | append \'-special\'"></div>',
foo: 'bar'
, (node) ->
equals node.html(), "bar-special"
QUnit.start()
asyncTest 'downcase', 1, ->
helpers.render '<div data-bind="foo | downcase"></div>',
foo: 'BAR'
, (node) ->
equals node.html(), "bar"
QUnit.start()
asyncTest 'upcase', 1, ->
helpers.render '<div data-bind="foo | upcase"></div>',
foo: 'bar'
, (node) ->
equals node.html(), "BAR"
QUnit.start()
asyncTest 'join', 2, ->
helpers.render '<div data-bind="foo | join"></div>',
foo: ['a', 'b', 'c']
, (node) ->
equals node.html(), "abc"
helpers.render '<div data-bind="foo | join \'|\'"></div>',
foo: ['a', 'b', 'c']
, (node) ->
equals node.html(), "a|b|c"
QUnit.start()
asyncTest 'sort', 1, ->
helpers.render '<div data-bind="foo | sort | join"></div>',
foo: ['b', 'c', 'a', '1']
, (node) ->
equals node.html(), "1abc"
QUnit.start()
asyncTest 'not', 1, ->
helpers.render '<div data-showif="foo | not"></div>',
foo: true
, (node) ->
equals node[0].style.display, "none"
QUnit.start()
asyncTest 'map', 1, ->
helpers.render '<div data-bind="posts | map \'name\' | join \', \'"></div>',
posts: [
PI:NAME:<NAME>END_PI
name: 'PI:NAME:<NAME>END_PI'
comments: 10
, PI:NAME:<NAME>END_PIman
name: 'PI:NAME:<NAME>END_PI'
comments: 20
]
, (node) ->
equals node.html(), "one, two"
QUnit.start()
asyncTest 'map with a numeric key', 1, ->
helpers.render '<div data-bind="counts | map 1 | join \', \'"></div>',
counts: [
[1, 2, 3]
[4, 5, 6]
]
, (node) ->
equals node.html(), "2, 5"
QUnit.start()
asyncTest 'map over a set', 1, ->
helpers.render '<div data-bind="posts | map \'name\' | join \', \'"></div>',
posts: new Batman.Set(
Batman
name: 'one'
comments: 10
, Batman
name: 'two'
comments: 20
)
, (node) ->
equals node.html(), "one, two"
QUnit.start()
asyncTest 'meta', 2, ->
context = Batman
foo: Batman
meta:
get: spy = createSpy().whichReturns("something")
helpers.render '<div data-bind="foo | meta \'bar\'"></div>', context, (node) ->
equals node.html(), "something"
deepEqual spy.lastCallArguments, ['bar']
QUnit.start()
asyncTest 'meta binding to a hash', 2, ->
context = Batman
foo: new Batman.Hash(bar: "qux")
helpers.render '<div data-bind="foo | meta \'length\'"></div>', context, (node) ->
equals node.html(), "1"
context.get('foo').set('corge', 'test')
delay =>
equals node.html(), "2"
QUnit.module "Batman.View filter value and parameter parsing"
setup: ->
Batman.Filters['test'] = @spy = createSpy().whichReturns("testValue")
teardown: ->
delete Batman.Filters.test
asyncTest "should parse one segment keypaths as values", ->
helpers.render '<div data-bind="foo | test"></div>', Batman(foo: "bar"), (node) =>
equals node.html(), "testValue"
deepEqual @spy.lastCallArguments, ["bar"]
QUnit.start()
asyncTest "should parse many segment keypaths as values", ->
helpers.render '<div data-bind="foo.bar | test"></div>', Batman(foo: Batman(bar: "baz")), (node) =>
equals node.html(), "testValue"
deepEqual @spy.lastCallArguments, ["baz"]
QUnit.start()
asyncTest "should parse one segment keypaths as arguments", ->
helpers.render '<div data-bind="1 | test foo"></div>', Batman(foo: "bar"), (node) =>
equals node.html(), "testValue"
deepEqual @spy.lastCallArguments, [1, "bar"]
QUnit.start()
asyncTest "should parse one segment keypaths as arguments anywhere in the list of arguments", ->
helpers.render '<div data-bind="1 | test foo, 2, bar, 3, baz"></div>', Batman(foo: "a", bar: "b", baz: "c"), (node) =>
equals node.html(), "testValue"
deepEqual @spy.lastCallArguments, [1, "a", 2, "b", 3, "c"]
QUnit.start()
asyncTest "should parse one segment keypaths as arguments anywhere in the list of arguments", ->
helpers.render '<div data-bind="1 | test qux.foo, 2, qux.bar, 3, qux.baz"></div>', Batman(qux: Batman(foo: "a", bar: "b", baz: "c")), (node) =>
equals node.html(), "testValue"
deepEqual @spy.lastCallArguments, [1, "a", 2, "b", 3, "c"]
QUnit.start()
asyncTest "should parse many segment keypaths as arguments", ->
helpers.render '<div data-bind="1 | test foo.bar"></div>', Batman(foo: Batman(bar: "baz")), (node) =>
equals node.html(), "testValue"
deepEqual @spy.lastCallArguments, [1, "baz"]
QUnit.start()
asyncTest "should parse keypaths containing true as arguments", ->
helpers.render '<div data-bind="1 | test true.bar"></div>', Batman("true": Batman(bar: "baz")), (node) =>
deepEqual @spy.lastCallArguments, [1, "baz"]
helpers.render '<div data-bind="1 | test truesay.bar"></div>', Batman(truesay: Batman(bar: "baz")), (node) =>
deepEqual @spy.lastCallArguments, [1, "baz"]
QUnit.start()
asyncTest "should parse keypaths containing false as arguments", ->
helpers.render '<div data-bind="1 | test false.bar"></div>', Batman("false": Batman(bar: "baz")), (node) =>
deepEqual @spy.lastCallArguments, [1, "baz"]
helpers.render '<div data-bind="1 | test falsified.bar"></div>', Batman(falsified: Batman(bar: "baz")), (node) =>
deepEqual @spy.lastCallArguments, [1, "baz"]
QUnit.start()
asyncTest "should not parse true or false as a keypath", ->
helpers.render '<div data-bind="1 | test true"></div>', Batman("true": Batman(bar: "baz")), (node) =>
equals node.html(), "testValue"
deepEqual @spy.lastCallArguments, [1, true]
helpers.render '<div data-bind="1 | test false"></div>', Batman(truesay: Batman(bar: "baz")), (node) =>
equals node.html(), "testValue"
deepEqual @spy.lastCallArguments, [1, false]
QUnit.start()
QUnit.module "Batman.View user defined filter execution"
asyncTest 'should render a user defined filter', 3, ->
Batman.Filters['test'] = spy = createSpy().whichReturns("testValue")
ctx = Batman
foo: 'bar'
bar: 'baz'
helpers.render '<div data-bind="foo | test 1, \'baz\'"></div>', ctx, (node) ->
equals node.html(), "testValue"
equals spy.lastCallContext, ctx
deepEqual spy.lastCallArguments, ['bar', 1, 'baz']
delete Batman.Filters.test
QUnit.start()
|
[
{
"context": "# /*\n# * mqtt-methods\n# * https://github.com/boomfly/mqtt-methods\n# * https://github.com/wolfeidau/mq",
"end": 54,
"score": 0.999508261680603,
"start": 47,
"tag": "USERNAME",
"value": "boomfly"
},
{
"context": ".com/boomfly/mqtt-methods\n# * https://github.com/wolfeidau/mqtt-rpc\n# *\n# * Copyright (c) 2013 Mark Wolfe\n",
"end": 101,
"score": 0.9996946454048157,
"start": 92,
"tag": "USERNAME",
"value": "wolfeidau"
},
{
"context": "om/wolfeidau/mqtt-rpc\n# *\n# * Copyright (c) 2013 Mark Wolfe\n# * Licensed under the MIT license.\n# */\nimport",
"end": 150,
"score": 0.9998719692230225,
"start": 140,
"tag": "NAME",
"value": "Mark Wolfe"
}
] | lib/client.coffee | boomfly/mqtt-methods | 0 | # /*
# * mqtt-methods
# * https://github.com/boomfly/mqtt-methods
# * https://github.com/wolfeidau/mqtt-rpc
# *
# * Copyright (c) 2013 Mark Wolfe
# * Licensed under the MIT license.
# */
import crypto from 'crypto'
import mqtt from 'mqtt'
import mqttrouter from 'mqtt-router'
import codecs from './codecs.js'
import Debug from 'debug'
debug = Debug('mqtt-methods:client')
export default class Client
constructor: (mqttclient) ->
# default to JSON codec
@codec = codecs.byName('json')
@mqttclient = mqttclient or mqtt.createClient()
@router = mqttrouter.wrap(mqttclient)
@inFlight = {}
_generator: () -> crypto.randomBytes(5).readUInt32BE(0).toString(16)
_handleResponse: (topic, message) =>
msg = @codec.decode(message)
id = msg._correlationId
debug('handleResponse', topic, id, 'message', message)
debug('inflight', @inFlight[id])
if id and @inFlight[id]
@inFlight[id].cb(msg.err, msg.data)
delete @inFlight[id]
_sendMessage: (topic, message, cb) ->
id = @_generator()
debug('sendMessage', topic, id, message)
@inFlight[id] = {cb: cb}
message._correlationId = id
@mqttclient.publish(topic, @codec.encode(message))
callRemote: (prefix, name, args, cb) ->
replyTopic = prefix + '/' + name + '/reply'
requestTopic = prefix + '/' + name + '/request'
@router.subscribe(replyTopic, @_handleResponse)
debug('callRemote', 'subscribe', replyTopic)
@_sendMessage(requestTopic, args, cb)
format: (format) ->
@codec = codecs.byName(format)
| 17662 | # /*
# * mqtt-methods
# * https://github.com/boomfly/mqtt-methods
# * https://github.com/wolfeidau/mqtt-rpc
# *
# * Copyright (c) 2013 <NAME>
# * Licensed under the MIT license.
# */
import crypto from 'crypto'
import mqtt from 'mqtt'
import mqttrouter from 'mqtt-router'
import codecs from './codecs.js'
import Debug from 'debug'
debug = Debug('mqtt-methods:client')
export default class Client
constructor: (mqttclient) ->
# default to JSON codec
@codec = codecs.byName('json')
@mqttclient = mqttclient or mqtt.createClient()
@router = mqttrouter.wrap(mqttclient)
@inFlight = {}
_generator: () -> crypto.randomBytes(5).readUInt32BE(0).toString(16)
_handleResponse: (topic, message) =>
msg = @codec.decode(message)
id = msg._correlationId
debug('handleResponse', topic, id, 'message', message)
debug('inflight', @inFlight[id])
if id and @inFlight[id]
@inFlight[id].cb(msg.err, msg.data)
delete @inFlight[id]
_sendMessage: (topic, message, cb) ->
id = @_generator()
debug('sendMessage', topic, id, message)
@inFlight[id] = {cb: cb}
message._correlationId = id
@mqttclient.publish(topic, @codec.encode(message))
callRemote: (prefix, name, args, cb) ->
replyTopic = prefix + '/' + name + '/reply'
requestTopic = prefix + '/' + name + '/request'
@router.subscribe(replyTopic, @_handleResponse)
debug('callRemote', 'subscribe', replyTopic)
@_sendMessage(requestTopic, args, cb)
format: (format) ->
@codec = codecs.byName(format)
| true | # /*
# * mqtt-methods
# * https://github.com/boomfly/mqtt-methods
# * https://github.com/wolfeidau/mqtt-rpc
# *
# * Copyright (c) 2013 PI:NAME:<NAME>END_PI
# * Licensed under the MIT license.
# */
import crypto from 'crypto'
import mqtt from 'mqtt'
import mqttrouter from 'mqtt-router'
import codecs from './codecs.js'
import Debug from 'debug'
debug = Debug('mqtt-methods:client')
export default class Client
constructor: (mqttclient) ->
# default to JSON codec
@codec = codecs.byName('json')
@mqttclient = mqttclient or mqtt.createClient()
@router = mqttrouter.wrap(mqttclient)
@inFlight = {}
_generator: () -> crypto.randomBytes(5).readUInt32BE(0).toString(16)
_handleResponse: (topic, message) =>
msg = @codec.decode(message)
id = msg._correlationId
debug('handleResponse', topic, id, 'message', message)
debug('inflight', @inFlight[id])
if id and @inFlight[id]
@inFlight[id].cb(msg.err, msg.data)
delete @inFlight[id]
_sendMessage: (topic, message, cb) ->
id = @_generator()
debug('sendMessage', topic, id, message)
@inFlight[id] = {cb: cb}
message._correlationId = id
@mqttclient.publish(topic, @codec.encode(message))
callRemote: (prefix, name, args, cb) ->
replyTopic = prefix + '/' + name + '/reply'
requestTopic = prefix + '/' + name + '/request'
@router.subscribe(replyTopic, @_handleResponse)
debug('callRemote', 'subscribe', replyTopic)
@_sendMessage(requestTopic, args, cb)
format: (format) ->
@codec = codecs.byName(format)
|
[
{
"context": "key: 'superscript'\n\npatterns: [\n # Matches superscript\n #\n # Exa",
"end": 17,
"score": 0.9828454256057739,
"start": 6,
"tag": "KEY",
"value": "superscript"
}
] | grammars/repositories/inlines/superscript-grammar.cson | andrewcarver/atom-language-asciidoc | 45 | key: 'superscript'
patterns: [
# Matches superscript
#
# Examples
#
# ^superscript^
#
name: 'markup.superscript.asciidoc'
match: '(?<!\\\\)(\\[.+?\\])?((\\^)(\\S+?)(\\^))'
captures:
1: name: 'markup.meta.super.attribute-list.asciidoc'
2: name: 'markup.super.superscript.asciidoc'
3: name: 'punctuation.definition.asciidoc'
5: name: 'punctuation.definition.asciidoc'
]
| 199849 | key: '<KEY>'
patterns: [
# Matches superscript
#
# Examples
#
# ^superscript^
#
name: 'markup.superscript.asciidoc'
match: '(?<!\\\\)(\\[.+?\\])?((\\^)(\\S+?)(\\^))'
captures:
1: name: 'markup.meta.super.attribute-list.asciidoc'
2: name: 'markup.super.superscript.asciidoc'
3: name: 'punctuation.definition.asciidoc'
5: name: 'punctuation.definition.asciidoc'
]
| true | key: 'PI:KEY:<KEY>END_PI'
patterns: [
# Matches superscript
#
# Examples
#
# ^superscript^
#
name: 'markup.superscript.asciidoc'
match: '(?<!\\\\)(\\[.+?\\])?((\\^)(\\S+?)(\\^))'
captures:
1: name: 'markup.meta.super.attribute-list.asciidoc'
2: name: 'markup.super.superscript.asciidoc'
3: name: 'punctuation.definition.asciidoc'
5: name: 'punctuation.definition.asciidoc'
]
|
[
{
"context": "based on jQuery Cookie plugin\n# Copyright (c) 2010 Klaus Hartl (stilbuero.de)\n# Dual licensed under the MIT and ",
"end": 244,
"score": 0.9998771548271179,
"start": 233,
"tag": "NAME",
"value": "Klaus Hartl"
}
] | bootstrap-tour.coffee | thebyrd/bootstrap-tour | 1 | # bootstrap-tour.js v0.0.2
# Copyright 2012 Gild, Inc.
#
# Free to use under the MIT license.
# http://www.opensource.org/licenses/mit-license.php
# References jQuery
$ = jQuery
# based on jQuery Cookie plugin
# Copyright (c) 2010 Klaus Hartl (stilbuero.de)
# Dual licensed under the MIT and GPL licenses:
# http://www.opensource.org/licenses/mit-license.php
# http://www.gnu.org/licenses/gpl.html
cookie = (key, value, options) ->
if arguments.length > 1 and String(value) isnt "[object Object]"
options = jQuery.extend({}, options)
options.expires = -1 unless value?
if typeof options.expires is "number"
days = options.expires
t = options.expires = new Date()
t.setDate t.getDate() + days
value = String(value)
return (document.cookie = [ encodeURIComponent(key), "=", (if options.raw then value else encodeURIComponent(value)), (if options.expires then "; expires=" + options.expires.toUTCString() else ""), (if options.path then "; path=" + options.path else ""), (if options.domain then "; domain=" + options.domain else ""), (if options.secure then "; secure" else "") ].join(""))
options = value or {}
result = undefined
decode = (if options.raw then (s) ->
s
else decodeURIComponent)
return (if (result = new RegExp("(?:^|; )" + encodeURIComponent(key) + "=([^;]*)").exec(document.cookie)) then decode(result[1]) else null)
# Adds plugin object to jQuery
$.fn.extend {}=
featureTour: (options) ->
# Default settings
settings =
tipContent: '#featureTourTipContent' # What is the ID of the <ol> you put the content in
cookieMonster: false # true or false to control whether cookies are used
cookieName: 'bootstrapFeatureTour' # Name the cookie you'll use
cookieDomain: false # Will this cookie be attached to a domain, ie. '.mydomain.com'
postRideCallback: $.noop # A method to call once the tour closes
postStepCallback: $.noop # A method to call after each step
nextOnClose: false # If cookies are enabled, increment the current step on close
debug: false
# Merge default settings with options.
settings = $.extend settings, options
# Simple logger.
log = (msg) ->
console?.log('[bootstrap-tour]', msg) if settings.debug
# returns current step stored in the cookie, or `1` if cookie disabled, no
# cookie or invalid cookie value
currentStep = ->
return 1 unless settings.cookieMonster?
current_cookie = cookie(settings.cookieName)
# start from step 1 if there's no cookie set
return 1 unless current_cookie?
try
return parseInt(current_cookie)
catch e
# start from step 1 if there cookie is invalid
return 1
setCookieStep = (step) ->
cookie(settings.cookieName, "#{step}", { expires: 365, domain: settings.cookieDomain }) if settings.cookieMonster
return @each () ->
$tipContent = $(settings.tipContent).first()
unless $tipContent?
log "can't find tipContent from selector: #{settings.tipContent}"
$tips = $tipContent.find('li')
first_step = currentStep()
log "first step: #{first_step}"
if first_step > $tips.length
log 'tour already completed, skipping'
return
$tips.each (idx) ->
# skip steps until we reach the first one
if idx < (first_step - 1)
log "skipping step: #{idx + 1}"
return
$li = $(@)
tip_data = $li.data()
return unless (target = tip_data['target'])?
return unless ($target = $(target).first())?
$target.popover
trigger: 'manual'
title: if tip_data['title']? then "#{tip_data['title']} <a class=\"tour-tip-close close\" data-touridx=\"#{idx + 1}\">×</a>" else null
content: "<p>#{$li.html()}</p><p style=\"text-align: right\"><a href=\"#\" class=\"tour-tip-next btn btn-success\" data-touridx=\"#{idx + 1}\">#{if (idx + 1) < $tips.length then 'Next <i class="icon-chevron-right icon-white"></i>' else '<i class="icon-ok icon-white"></i> Done'}</a></p>"
placement: tip_data['placement'] || 'right'
# save the target element in the tip node
$li.data('target', $target)
# show the first tip
$target.popover('show') if idx == (first_step - 1)
# handle the close button
$('a.tour-tip-close').live 'click', ->
current_step = $(@).data('touridx')
$(settings.tipContent).first().find("li:nth-child(#{current_step})").data('target').popover('hide')
setCookieStep(current_step + 1) if settings.nextOnClose
# handle the next and done buttons
$('a.tour-tip-next').live 'click', ->
current_step = $(@).data('touridx')
log "current step: #{current_step}"
$(settings.tipContent).first().find("li:nth-child(#{current_step})").data('target').popover('hide')
settings.postStepCallback($(@).data('touridx')) if settings.postStepCallback != $.noop
next_tip = $(settings.tipContent).first().find("li:nth-child(#{current_step + 1})")?.data('target')
setCookieStep(current_step + 1)
if next_tip?
next_tip_id = '#' + next_tip.attr('id');
targetOffset = $(next_tip_id).offset().top - 300;
$('html, body').animate({scrollTop: targetOffset}, 1000)
next_tip.popover('show')
return false #so that href will get ignored
else
# last tip
settings.postRideCallback() if settings.postRideCallback != $.noop
| 220802 | # bootstrap-tour.js v0.0.2
# Copyright 2012 Gild, Inc.
#
# Free to use under the MIT license.
# http://www.opensource.org/licenses/mit-license.php
# References jQuery
$ = jQuery
# based on jQuery Cookie plugin
# Copyright (c) 2010 <NAME> (stilbuero.de)
# Dual licensed under the MIT and GPL licenses:
# http://www.opensource.org/licenses/mit-license.php
# http://www.gnu.org/licenses/gpl.html
cookie = (key, value, options) ->
if arguments.length > 1 and String(value) isnt "[object Object]"
options = jQuery.extend({}, options)
options.expires = -1 unless value?
if typeof options.expires is "number"
days = options.expires
t = options.expires = new Date()
t.setDate t.getDate() + days
value = String(value)
return (document.cookie = [ encodeURIComponent(key), "=", (if options.raw then value else encodeURIComponent(value)), (if options.expires then "; expires=" + options.expires.toUTCString() else ""), (if options.path then "; path=" + options.path else ""), (if options.domain then "; domain=" + options.domain else ""), (if options.secure then "; secure" else "") ].join(""))
options = value or {}
result = undefined
decode = (if options.raw then (s) ->
s
else decodeURIComponent)
return (if (result = new RegExp("(?:^|; )" + encodeURIComponent(key) + "=([^;]*)").exec(document.cookie)) then decode(result[1]) else null)
# Adds plugin object to jQuery
$.fn.extend {}=
featureTour: (options) ->
# Default settings
settings =
tipContent: '#featureTourTipContent' # What is the ID of the <ol> you put the content in
cookieMonster: false # true or false to control whether cookies are used
cookieName: 'bootstrapFeatureTour' # Name the cookie you'll use
cookieDomain: false # Will this cookie be attached to a domain, ie. '.mydomain.com'
postRideCallback: $.noop # A method to call once the tour closes
postStepCallback: $.noop # A method to call after each step
nextOnClose: false # If cookies are enabled, increment the current step on close
debug: false
# Merge default settings with options.
settings = $.extend settings, options
# Simple logger.
log = (msg) ->
console?.log('[bootstrap-tour]', msg) if settings.debug
# returns current step stored in the cookie, or `1` if cookie disabled, no
# cookie or invalid cookie value
currentStep = ->
return 1 unless settings.cookieMonster?
current_cookie = cookie(settings.cookieName)
# start from step 1 if there's no cookie set
return 1 unless current_cookie?
try
return parseInt(current_cookie)
catch e
# start from step 1 if there cookie is invalid
return 1
setCookieStep = (step) ->
cookie(settings.cookieName, "#{step}", { expires: 365, domain: settings.cookieDomain }) if settings.cookieMonster
return @each () ->
$tipContent = $(settings.tipContent).first()
unless $tipContent?
log "can't find tipContent from selector: #{settings.tipContent}"
$tips = $tipContent.find('li')
first_step = currentStep()
log "first step: #{first_step}"
if first_step > $tips.length
log 'tour already completed, skipping'
return
$tips.each (idx) ->
# skip steps until we reach the first one
if idx < (first_step - 1)
log "skipping step: #{idx + 1}"
return
$li = $(@)
tip_data = $li.data()
return unless (target = tip_data['target'])?
return unless ($target = $(target).first())?
$target.popover
trigger: 'manual'
title: if tip_data['title']? then "#{tip_data['title']} <a class=\"tour-tip-close close\" data-touridx=\"#{idx + 1}\">×</a>" else null
content: "<p>#{$li.html()}</p><p style=\"text-align: right\"><a href=\"#\" class=\"tour-tip-next btn btn-success\" data-touridx=\"#{idx + 1}\">#{if (idx + 1) < $tips.length then 'Next <i class="icon-chevron-right icon-white"></i>' else '<i class="icon-ok icon-white"></i> Done'}</a></p>"
placement: tip_data['placement'] || 'right'
# save the target element in the tip node
$li.data('target', $target)
# show the first tip
$target.popover('show') if idx == (first_step - 1)
# handle the close button
$('a.tour-tip-close').live 'click', ->
current_step = $(@).data('touridx')
$(settings.tipContent).first().find("li:nth-child(#{current_step})").data('target').popover('hide')
setCookieStep(current_step + 1) if settings.nextOnClose
# handle the next and done buttons
$('a.tour-tip-next').live 'click', ->
current_step = $(@).data('touridx')
log "current step: #{current_step}"
$(settings.tipContent).first().find("li:nth-child(#{current_step})").data('target').popover('hide')
settings.postStepCallback($(@).data('touridx')) if settings.postStepCallback != $.noop
next_tip = $(settings.tipContent).first().find("li:nth-child(#{current_step + 1})")?.data('target')
setCookieStep(current_step + 1)
if next_tip?
next_tip_id = '#' + next_tip.attr('id');
targetOffset = $(next_tip_id).offset().top - 300;
$('html, body').animate({scrollTop: targetOffset}, 1000)
next_tip.popover('show')
return false #so that href will get ignored
else
# last tip
settings.postRideCallback() if settings.postRideCallback != $.noop
| true | # bootstrap-tour.js v0.0.2
# Copyright 2012 Gild, Inc.
#
# Free to use under the MIT license.
# http://www.opensource.org/licenses/mit-license.php
# References jQuery
$ = jQuery
# based on jQuery Cookie plugin
# Copyright (c) 2010 PI:NAME:<NAME>END_PI (stilbuero.de)
# Dual licensed under the MIT and GPL licenses:
# http://www.opensource.org/licenses/mit-license.php
# http://www.gnu.org/licenses/gpl.html
cookie = (key, value, options) ->
if arguments.length > 1 and String(value) isnt "[object Object]"
options = jQuery.extend({}, options)
options.expires = -1 unless value?
if typeof options.expires is "number"
days = options.expires
t = options.expires = new Date()
t.setDate t.getDate() + days
value = String(value)
return (document.cookie = [ encodeURIComponent(key), "=", (if options.raw then value else encodeURIComponent(value)), (if options.expires then "; expires=" + options.expires.toUTCString() else ""), (if options.path then "; path=" + options.path else ""), (if options.domain then "; domain=" + options.domain else ""), (if options.secure then "; secure" else "") ].join(""))
options = value or {}
result = undefined
decode = (if options.raw then (s) ->
s
else decodeURIComponent)
return (if (result = new RegExp("(?:^|; )" + encodeURIComponent(key) + "=([^;]*)").exec(document.cookie)) then decode(result[1]) else null)
# Adds plugin object to jQuery
$.fn.extend {}=
featureTour: (options) ->
# Default settings
settings =
tipContent: '#featureTourTipContent' # What is the ID of the <ol> you put the content in
cookieMonster: false # true or false to control whether cookies are used
cookieName: 'bootstrapFeatureTour' # Name the cookie you'll use
cookieDomain: false # Will this cookie be attached to a domain, ie. '.mydomain.com'
postRideCallback: $.noop # A method to call once the tour closes
postStepCallback: $.noop # A method to call after each step
nextOnClose: false # If cookies are enabled, increment the current step on close
debug: false
# Merge default settings with options.
settings = $.extend settings, options
# Simple logger.
log = (msg) ->
console?.log('[bootstrap-tour]', msg) if settings.debug
# returns current step stored in the cookie, or `1` if cookie disabled, no
# cookie or invalid cookie value
currentStep = ->
return 1 unless settings.cookieMonster?
current_cookie = cookie(settings.cookieName)
# start from step 1 if there's no cookie set
return 1 unless current_cookie?
try
return parseInt(current_cookie)
catch e
# start from step 1 if there cookie is invalid
return 1
setCookieStep = (step) ->
cookie(settings.cookieName, "#{step}", { expires: 365, domain: settings.cookieDomain }) if settings.cookieMonster
return @each () ->
$tipContent = $(settings.tipContent).first()
unless $tipContent?
log "can't find tipContent from selector: #{settings.tipContent}"
$tips = $tipContent.find('li')
first_step = currentStep()
log "first step: #{first_step}"
if first_step > $tips.length
log 'tour already completed, skipping'
return
$tips.each (idx) ->
# skip steps until we reach the first one
if idx < (first_step - 1)
log "skipping step: #{idx + 1}"
return
$li = $(@)
tip_data = $li.data()
return unless (target = tip_data['target'])?
return unless ($target = $(target).first())?
$target.popover
trigger: 'manual'
title: if tip_data['title']? then "#{tip_data['title']} <a class=\"tour-tip-close close\" data-touridx=\"#{idx + 1}\">×</a>" else null
content: "<p>#{$li.html()}</p><p style=\"text-align: right\"><a href=\"#\" class=\"tour-tip-next btn btn-success\" data-touridx=\"#{idx + 1}\">#{if (idx + 1) < $tips.length then 'Next <i class="icon-chevron-right icon-white"></i>' else '<i class="icon-ok icon-white"></i> Done'}</a></p>"
placement: tip_data['placement'] || 'right'
# save the target element in the tip node
$li.data('target', $target)
# show the first tip
$target.popover('show') if idx == (first_step - 1)
# handle the close button
$('a.tour-tip-close').live 'click', ->
current_step = $(@).data('touridx')
$(settings.tipContent).first().find("li:nth-child(#{current_step})").data('target').popover('hide')
setCookieStep(current_step + 1) if settings.nextOnClose
# handle the next and done buttons
$('a.tour-tip-next').live 'click', ->
current_step = $(@).data('touridx')
log "current step: #{current_step}"
$(settings.tipContent).first().find("li:nth-child(#{current_step})").data('target').popover('hide')
settings.postStepCallback($(@).data('touridx')) if settings.postStepCallback != $.noop
next_tip = $(settings.tipContent).first().find("li:nth-child(#{current_step + 1})")?.data('target')
setCookieStep(current_step + 1)
if next_tip?
next_tip_id = '#' + next_tip.attr('id');
targetOffset = $(next_tip_id).offset().top - 300;
$('html, body').animate({scrollTop: targetOffset}, 1000)
next_tip.popover('show')
return false #so that href will get ignored
else
# last tip
settings.postRideCallback() if settings.postRideCallback != $.noop
|
[
{
"context": " id: \"answer\"\n keys: ['1', '2', '3']\n correct: if @trial.number is",
"end": 2075,
"score": 0.6612785458564758,
"start": 2074,
"tag": "KEY",
"value": "2"
},
{
"context": " id: \"answer\"\n keys: ['1', '2', '3']\n correct: if @trial.number is 1 th",
"end": 2080,
"score": 0.6788144111633301,
"start": 2079,
"tag": "KEY",
"value": "3"
}
] | examples/word_stroop/runner.coffee | bbuchsbaum/psycloud | 0 |
factorSet =
condition:
levels: ["congruent", "incongruent", "neutral"]
wordItems = ["and", "that", "how", "where", "the", "which"]
numberItems = ["one", "two", "three"]
numbers = [1,2,3]
numberMap = { 1: "one", 2: "two", 3: "three"}
fnode = Psy.FactorSetNode.build(factorSet)
# create 5 blocks of trials with 5 complete replications per block
@trials = fnode.trialList(5, 5)
@trials = @trials.bind (record) ->
number = Psy.oneOf(numbers)
ret =
word: Psy.match record.condition,
congruent: numberMap[number]
incongruent: numberMap[Psy.sample(numbers.exclude(number), 1)[0]]
neutral: Psy.sample(wordItems, 1)[0]
number: number
ret.text = Psy.rep(ret.word, ret.number).join(" ")
ret
@trials.shuffle()
@context = Psy.createContext()
window.display =
Display:
Prelude:
Events:
1:
Markdown: """
Welcome to the Experiment!
==========================
This a simple task.
Press any key to continue
-------------------------
"""
Next:
AnyKey: ""
Block:
Start: ->
console.log("START BLOCK")
Text:
position: "center"
origin: "center"
content: ["Get Ready for Block #{@blockNumber}!", "Press Space Bar to start"]
Next:
SpaceKey: ""
End: ->
console.log("END BLOCK")
Text:
position: "center"
origin: "center"
content: ["End of Block #{@blockNumber}", "Press any key to continue"]
Next:
AnyKey: ""
Trial: ->
Background:
Blank:
fill: "gray"
CanvasBorder:
stroke: "black"
Events:
1:
FixationCross:
fill: "black"
Next:
Timeout:
duration: 1000
2:
Text:
position: "center"
origin: "center"
content: @trial.text
Next:
KeyPress:
id: "answer"
keys: ['1', '2', '3']
correct: if @trial.number is 1 then '1' else if @trial.number is 2 then '2' else '3'
timeout: 2500
Feedback: ->
console.log("Feedback this", this)
Blank:
fill: if @answer.accuracy then "green" else "red"
opacity: .1
Next:
Timeout:
duration: 200
#Coda:
# Events:
# 1:
# Text:
# position: "center"
# origin: "center"
# content: "The End"
# fontSize: 200
#
# Next:
# Timeout: duration: 5000
pres = new Psy.Presenter(trials, display.Display, context)
pres.start()
| 184958 |
factorSet =
condition:
levels: ["congruent", "incongruent", "neutral"]
wordItems = ["and", "that", "how", "where", "the", "which"]
numberItems = ["one", "two", "three"]
numbers = [1,2,3]
numberMap = { 1: "one", 2: "two", 3: "three"}
fnode = Psy.FactorSetNode.build(factorSet)
# create 5 blocks of trials with 5 complete replications per block
@trials = fnode.trialList(5, 5)
@trials = @trials.bind (record) ->
number = Psy.oneOf(numbers)
ret =
word: Psy.match record.condition,
congruent: numberMap[number]
incongruent: numberMap[Psy.sample(numbers.exclude(number), 1)[0]]
neutral: Psy.sample(wordItems, 1)[0]
number: number
ret.text = Psy.rep(ret.word, ret.number).join(" ")
ret
@trials.shuffle()
@context = Psy.createContext()
window.display =
Display:
Prelude:
Events:
1:
Markdown: """
Welcome to the Experiment!
==========================
This a simple task.
Press any key to continue
-------------------------
"""
Next:
AnyKey: ""
Block:
Start: ->
console.log("START BLOCK")
Text:
position: "center"
origin: "center"
content: ["Get Ready for Block #{@blockNumber}!", "Press Space Bar to start"]
Next:
SpaceKey: ""
End: ->
console.log("END BLOCK")
Text:
position: "center"
origin: "center"
content: ["End of Block #{@blockNumber}", "Press any key to continue"]
Next:
AnyKey: ""
Trial: ->
Background:
Blank:
fill: "gray"
CanvasBorder:
stroke: "black"
Events:
1:
FixationCross:
fill: "black"
Next:
Timeout:
duration: 1000
2:
Text:
position: "center"
origin: "center"
content: @trial.text
Next:
KeyPress:
id: "answer"
keys: ['1', '<KEY>', '<KEY>']
correct: if @trial.number is 1 then '1' else if @trial.number is 2 then '2' else '3'
timeout: 2500
Feedback: ->
console.log("Feedback this", this)
Blank:
fill: if @answer.accuracy then "green" else "red"
opacity: .1
Next:
Timeout:
duration: 200
#Coda:
# Events:
# 1:
# Text:
# position: "center"
# origin: "center"
# content: "The End"
# fontSize: 200
#
# Next:
# Timeout: duration: 5000
pres = new Psy.Presenter(trials, display.Display, context)
pres.start()
| true |
factorSet =
condition:
levels: ["congruent", "incongruent", "neutral"]
wordItems = ["and", "that", "how", "where", "the", "which"]
numberItems = ["one", "two", "three"]
numbers = [1,2,3]
numberMap = { 1: "one", 2: "two", 3: "three"}
fnode = Psy.FactorSetNode.build(factorSet)
# create 5 blocks of trials with 5 complete replications per block
@trials = fnode.trialList(5, 5)
@trials = @trials.bind (record) ->
number = Psy.oneOf(numbers)
ret =
word: Psy.match record.condition,
congruent: numberMap[number]
incongruent: numberMap[Psy.sample(numbers.exclude(number), 1)[0]]
neutral: Psy.sample(wordItems, 1)[0]
number: number
ret.text = Psy.rep(ret.word, ret.number).join(" ")
ret
@trials.shuffle()
@context = Psy.createContext()
window.display =
Display:
Prelude:
Events:
1:
Markdown: """
Welcome to the Experiment!
==========================
This a simple task.
Press any key to continue
-------------------------
"""
Next:
AnyKey: ""
Block:
Start: ->
console.log("START BLOCK")
Text:
position: "center"
origin: "center"
content: ["Get Ready for Block #{@blockNumber}!", "Press Space Bar to start"]
Next:
SpaceKey: ""
End: ->
console.log("END BLOCK")
Text:
position: "center"
origin: "center"
content: ["End of Block #{@blockNumber}", "Press any key to continue"]
Next:
AnyKey: ""
Trial: ->
Background:
Blank:
fill: "gray"
CanvasBorder:
stroke: "black"
Events:
1:
FixationCross:
fill: "black"
Next:
Timeout:
duration: 1000
2:
Text:
position: "center"
origin: "center"
content: @trial.text
Next:
KeyPress:
id: "answer"
keys: ['1', 'PI:KEY:<KEY>END_PI', 'PI:KEY:<KEY>END_PI']
correct: if @trial.number is 1 then '1' else if @trial.number is 2 then '2' else '3'
timeout: 2500
Feedback: ->
console.log("Feedback this", this)
Blank:
fill: if @answer.accuracy then "green" else "red"
opacity: .1
Next:
Timeout:
duration: 200
#Coda:
# Events:
# 1:
# Text:
# position: "center"
# origin: "center"
# content: "The End"
# fontSize: 200
#
# Next:
# Timeout: duration: 5000
pres = new Psy.Presenter(trials, display.Display, context)
pres.start()
|
[
{
"context": "rd \"colour\" correctly.\n#\n# jColour is written by [Aaron Russell](http://aaronrussell.co.uk),\n# the [source code f",
"end": 373,
"score": 0.9999039173126221,
"start": 360,
"tag": "NAME",
"value": "Aaron Russell"
},
{
"context": "# the [source code for jColour](http://github.com/aaronrussell/jcolour) is available on Github and\n# is released",
"end": 465,
"score": 0.9885700345039368,
"start": 453,
"tag": "USERNAME",
"value": "aaronrussell"
},
{
"context": "load the minified version](https://raw.github.com/aaronrussell/jcolour/master/build/jColour.min.js) (8kb)\n# * [D",
"end": 688,
"score": 0.8587359189987183,
"start": 676,
"tag": "USERNAME",
"value": "aaronrussell"
},
{
"context": "wnload the fatter version](https://raw.github.com/aaronrussell/jcolour/master/build/jColour.js) (14kb)\n\n#### Cre",
"end": 801,
"score": 0.977077841758728,
"start": 789,
"tag": "USERNAME",
"value": "aaronrussell"
},
{
"context": "l]\n\n\n\n#### Copyright\n#\n# Copyright (c) 2010-2011 [Aaron Russell](http://aaronrussell.co.uk).\n# Licensed under the",
"end": 22762,
"score": 0.9997377395629883,
"start": 22749,
"tag": "NAME",
"value": "Aaron Russell"
}
] | data/coffeescript/9da947b3d452bdb6b48eac1739a633d6_jColour.coffee | maxim5/code-inspector | 5 | # **jColour** is a JavaScript colour manipulation library written in [CoffeeScript](http://coffeescript.org).
# jColour is inspired heavily by the [SASS](http://sass-lang.com)/[Compass](http://compass-style.org)
# colour manipulation functions.
#
# jColour is also the first ever colour library to spell the word "colour" correctly.
#
# jColour is written by [Aaron Russell](http://aaronrussell.co.uk),
# the [source code for jColour](http://github.com/aaronrussell/jcolour) is available on Github and
# is released under the [MIT license](http://www.opensource.org/licenses/mit-license.php).
#### Download jColour
# * [Download the minified version](https://raw.github.com/aaronrussell/jcolour/master/build/jColour.min.js) (8kb)
# * [Download the fatter version](https://raw.github.com/aaronrussell/jcolour/master/build/jColour.js) (14kb)
#### Creating a jColour object
# The jColour class can be used in the browser or in your CommonJS projects.
#
root = exports ? this
class root.jColour
# Create a new jColour object by passing a colour string. jColour will parse a string in any of
# the following formats: [recognised colour name](http://www.w3.org/TR/SVG/types.html#ColorKeywords),
# hexidecimal, rgb/a, hsl/a. For example, all the following statements work:
#
# c = new jColour('red');
# c = new jColour('#f00');
# c = new jColour('#ff0000');
# c = new jColour('rgb(255,0,0)');
# c = new jColour('rgba(255,0,0,1)');
# c = new jColour('hsl(0,100,100)');
# c = new jColour('hsla(0,100,100,1)');
#
# Internally, colours are represented in both RGB and HSL. Any colour adjustments result in
# both representaions being recalculated. The alpha channel of a colour is stored independent
# it's RGB or HSL representation. If no alpha value is supplied, it defaults to 1.
#
constructor: (col = '#ffffff') ->
col = colourNames[col] if col.toLowerCase() of colourNames
if hex = col.match /^#?([a-f0-9]{3})$/i
h1 = hex[1].substring(0,1)
h2 = hex[1].substring(1,2)
h3 = hex[1].substring(2,3)
col = "##{h1+h1+h2+h2+h3+h3}"
if hex = col.match /^#?([a-f0-9]{6,8})$/i
@red = parseInt hex[1].substring(0,2), 16
@green = parseInt hex[1].substring(2,4), 16
@blue = parseInt hex[1].substring(4,6), 16
@alpha = if hex[1].substring(6,8) then parseInt(hex[1].substring(6,8), 16) / 255 else 1
rgbToHsl this
else if rgb = col.match /^rgba?\(\s*(\d+)[,\s]*(\d+)[,\s]*(\d+)[,\s]*([\.\d]+)?\s*\)$/i
@red = parseInt rgb[1]
@green = parseInt rgb[2]
@blue = parseInt rgb[3]
@alpha = if rgb[4] then rgb[4] else 1
rgbToHsl this
else if hsl = col.match /^hsla?\(\s*(\d+)[,\s]*(\d+)[,\s]*(\d+)[,\s]*([\.\d]+)?\s*\)$/i
@hue = parseInt hsl[1]
@saturation = parseInt hsl[2]
@lightness = parseInt hsl[3]
@alpha = if hsl[4] then hsl[4] else 1
hslToRgb this
else
throw 'Invalid colour string.'
#### Accessing colour representations
# At any time, a jColour object can return a string of any of it's colour represenations.
##### `hex(show_alpha = false)`
#
# To return the hexidecimal value of the colour use the `hex()` method. By default, any alpha
# value of the jColour object will be ignored. However, in specialist cases you may want a
# hexdecimal representation of the alpha channel, in which case pass `true` to the method.
#
# c.hex(); # -> '#ff0000'
#
hex: (showAlpha = false) ->
hex = if showAlpha && @alpha < 1
"##{hexify @red}#{hexify @green}#{hexify @blue}#{hexify @alpha * 255}"
else
"##{hexify @red}#{hexify @green}#{hexify @blue}"
hex.toLowerCase()
##### `rgb()`
#
# Returns the RGB value of the colour. If the jColour object's alpha channel is anything but 1,
# the returned representation will be RGBA.
#
# c.rgb(); # -> 'rgb(255,0,0)'
#
rgb: ->
if @alpha == 1
"rgb(#{Math.round @red}, #{Math.round @green}, #{Math.round @blue})"
else
"rgba(#{Math.round @red}, #{Math.round @green}, #{Math.round @blue}, #{Math.round(@alpha * 100) / 100})"
##### `hsl()`
#
# Returns the HSL value of the colour. If the jColour object's alpha channel is anything but 1,
# the returned representation will be HSLA.
#
# c.hsl(); # -> 'hsl(0,100,100)'
#
hsl: ->
if @alpha == 1
"hsl(#{Math.round @hue}, #{Math.round @saturation}, #{Math.round @lightness})"
else
"hsla(#{Math.round @hue}, #{Math.round @saturation}, #{Math.round @lightness}, #{Math.round(@alpha * 100) / 100})"
##### `toS()`
#
# Returns the name of the colour if it is a recognised colour keyworld. Alternatively, the hex
# code will be returned.
#
toS: ->
for key, value of colourNames
return key if @hex() == value.toLowerCase()
@hex()
#### Manipulating colours
# A jColour object can be manipulated using a range of colour manipulation methods. Each method
# makes the required adjustment to the colour representations and updates the jColour object.
# This allows the "chaining" of methods, for example:
#
# c = new jColour('#ff0000');
# c.adjustHue(20).darken(10).transparentize(25).rgb(); # -> 'rgba(204, 68, 0, 0.75)'
#
# Most of the colour manipulation methods allow colour values to be manipulated relatively
# (eg. 50 + 10 = 60) or scaled by a percentage (eg. 50 + 10% = 55). The name of the method should
# make it obvious as to what calculation you should expect.
##### `lighten(amount)`
#
# Makes the colour lighter. Takes an amount between 0 and 100 which makes a relative adjustment
# (increase) to the current lightness.
#
# c.lighten(25);
#
lighten: (amount) ->
@lightness += amount
hslToRgb this
##### `lightenPercent(percent)`
#
# Also makes the colour lighter. This method should also be passed a value between 0 and 100, but
# in this case the lightness is *scaled* up relative to it's current value.
#
# c.lightenPercent(25);
#
lightenPercent: (percent) ->
@lightness += (@lightness / 100) * percent
hslToRgb this
##### `darken(amount)`
#
# Makes the colour darker. Takes an amount between 0 and 100 which makes a relative adjustment
# (decrease) to the current lightness.
#
# c.darken(25);
#
darken: (amount) ->
@lightness -= amount
hslToRgb this
##### `darkenPercent(percent)`
#
# Also makes the colour darker. This method should also be passed a value between 0 and 100, but
# in this case the lightness is *scaled* down relative to it's current value.
#
# c.darkenPercent(25);
#
darkenPercent: (percent) ->
@lightness -= (@lightness / 100) * percent
hslToRgb this
##### `saturate(amount)`
#
# Makes the colour more saturated. Takes an amount between 0 and 100 which makes a relative
# adjustment (increase) to the current saturation.
#
# c.saturate(25);
#
saturate: (amount) ->
@saturation += amount
hslToRgb this
##### `saturatePercent(percent)`
#
# Also makes the colour more saturated. This method should also be passed a value between 0 and
# 100, but in this case the saturation is *scaled* up relative to it's current value.
#
# c.saturatePercent(25);
#
saturatePercent: (percent) ->
@saturation += (@saturation / 100) * percent
hslToRgb this
##### `desaturate(amount)`
#
# Makes the colour less saturated. Takes an amount between 0 and 100 which makes a relative
# adjustment (decrease) to the current saturation.
#
# c.desaturate(25);
#
desaturate: (amount) ->
@saturation -= amount
hslToRgb this
##### `desaturatePercent(percent)`
#
# Also makes the colour less saturated. This method should also be passed a value between 0 and
# 100, but in this case the saturation is *scaled* down relative to it's current value.
#
# c.desaturatePercent(25);
#
desaturatePercent: (percent) ->
@saturation -= (@saturation / 100) * percent
hslToRgb this
##### `greyscale()`
#
# Converts the color to greyscale. This is identical to `desaturate(100)`. Can also use the alias, `grayscale()`.
#
# c.greyscale();
#
greyscale: ->
@saturation = 0
hslToRgb this
grayscale: -> @greyscale()
##### `adjustHue(degrees)`
#
# Changes the hue of the colour whilst retaining the lightness and saturation. This method should
# be passed a number of degrees (usually between -360 and 360) and makes a relative adjustment to
# the current hue.
#
# c.adjustHue(45);
#
adjustHue: (degrees) ->
@hue += degrees
hslToRgb this
##### `complement()`
#
# Returns the complement of the current colour. This is identical to `adjustHue(180)`.
#
# c.complement();
#
complement: ->
@hue += 180
hslToRgb this
##### `opacify(amount)`
#
# Makes the colour more opaque. Takes an amount between 0 and 1 which makes a relative
# adjustment (increase) to the current alpha channel.
#
# c.opacify(0.25);
#
opacify: (amount) ->
@alpha += amount
@alpha = minMax @alpha, 0, 1
this
##### `transparentize(amount)`
#
# Makes the colour more transparent. Takes an amount between 0 and 100 which makes a relative
# adjustment (decrease) to the current alpha channel.
#
# c.transparentize(0.25);
#
transparentize: (amount) ->
@alpha -= amount
@alpha = minMax @alpha, 0, 1
this
##### `invert()`
#
# Returns the inverse (negative) of the color. The red, green, and blue values are inverted, while
# the opacity is left alone.
#
# c.invert();
#
invert: ->
for color in ['red', 'green', 'blue']
@[color] = 255 - @[color]
rgbToHsl this
##### `adjustColour(params = {})`
#
# Makes a relative adjustment to one or more properties of the colour. Takes an object with the
# properties of red, green, blue, hue, saturation, lightness and alpha. All properties are
# optional and you can't specify both RGB and HSL properties at the same time.
#
# Red, green and blue propeties should have a value between -255 and 255. The hue property should
# have a value between -360 and 360. The saturation and lightness properties should have a value
# between -100 and 100. The alpha property should have a value between 0 and 1. All values will
# make a relative adjustment to their current value.
#
# c.adjustColour({
# red: 25,
# green: -30,
# alpha: -0.25
# })
# c.adjustColour({
# hue: 120,
# lightness: 25,
# saturation: -10
# })
#
adjustColour: (params = {}) ->
kind = throwIfIncompatible params
for key of params
@[key] += params[key] if key in properties
if kind[0] then rgbToHsl this else hslToRgb this
##### `scaleColour(params = {})`
#
# Makes a scaled adjustment to one or more properties of the colour. Takes an object with the
# properties of red, green, blue, saturation, lightness and alpha. Note that you can't scale the
# hue value. All properties are optional and you can't specify both RGB and HSL properties at the
# same time.
#
# All properties should have a value between -100 and 100. The property will be scaled up or down
# relative to it's current value.
#
# c.scaleColour({
# red: 25,
# green: -15
# })
# c.scaleColour({
# lightness: 25,
# saturation: -10
# })
#
scaleColour: (params = {}) ->
kind = throwIfIncompatible params
for key of params
@[key] += (@[key] / 100) * params[key] if key in properties and key isnt 'hue'
if kind[0] then rgbToHsl this else hslToRgb this
##### `changeColour(params = {})`
#
# Changes one or more properties of the colour to the absolute value provided. Takes an object
# with the properties of red, green, blue, hue, saturation, lightness and alpha. All properties
# are optional and you can't specify both RGB and HSL properties at the same time.
#
# Red, green and blue propeties should have a value between 0 and 255. The hue property should
# have a value between 0 and 360. The saturation and lightness properties should have a value
# between 0 and 100. The alpha property should have a value between 0 and 1. All properties will
# be set to the new value.
#
# c.changeColour({
# red: 255,
# green: 0,
# blue: 0
# })
# c.changeColour({
# hue: 0,
# lightness: 100,
# saturation: 100
# })
#
changeColour: (params = {}) ->
kind = throwIfIncompatible params
for key of params
@[key] = params[key] if key in properties
if kind[0] then rgbToHsl this else hslToRgb this
##### `mixWith(colour, weight = 50)`
#
# Mixes the colour with another 'mix' colour. The mix colour can be passed as either a jColour
# object or a string. Each of the RGB components are averaged, optionally weighted with a given
# percentage. The opacity of the colours is also considered when weighting the components.
#
# The weight specifies the weight of the mix. The default, 50%, means half the original colour
# and half the mix colour will be used. A weight of 25% means the a quarter of the mix colour
# will be mixed with three quarters of the original colour.
#
# red = new jColour('#ff0000');
# red.mixWith('#ffffff', 75).rgb(); # -> 'rgb(255, 191, 191)'
#
mixWith: (colour, weight = 50) ->
colour = new jColour(colour) unless colour instanceof jColour
p = weight / 100
w = p * 2 - 1
a = colour.alpha - @alpha
w1 = ((if w * a == -1 then w else (w + a) / (1 + w * a)) + 1) / 2
w2 = 1 - w1
@red = (colour.red * w1) + (@red * w2)
@green = (colour.green * w1) + (@green * w2)
@blue = (colour.blue * w1) + (@blue * w2)
@alpha = (colour.alpha * p) + (@alpha * (1-p))
rgbToHsl this
#### Private properties
# This properties array is useful to have around.
#
properties = ['red', 'green', 'blue', 'hue', 'saturation', 'lightness', 'alpha']
# A mahoosive list of recognised colour keyword names as defined at
# [http://www.w3.org/TR/SVG/types.html#ColorKeywords](http://www.w3.org/TR/SVG/types.html#ColorKeywords)
#
colourNames =
aliceblue: '#F0F8FF'
antiquewhite: '#FAEBD7'
aqua: '#00FFFF'
aquamarine: '#7FFFD4'
azure: '#F0FFFF'
beige: '#F5F5DC'
bisque: '#FFE4C4'
black: '#000000'
blanchedalmond: '#FFEBCD'
blue: '#0000FF'
blueviolet: '#8A2BE2'
brown: '#A52A2A'
burlywood: '#DEB887'
cadetblue: '#5F9EA0'
chartreuse: '#7FFF00'
chocolate: '#D2691E'
coral: '#FF7F50'
cornflowerblue: '#6495ED'
cornsilk: '#FFF8DC'
crimson: '#DC143C'
cyan: '#00FFFF'
darkblue: '#00008B'
darkcyan: '#008B8B'
darkgoldenrod: '#B8860B'
darkgray: '#A9A9A9'
darkgreen: '#006400'
darkgrey: '#A9A9A9'
darkkhaki: '#BDB76B'
darkmagenta: '#8B008B'
darkolivegreen: '#556B2F'
darkorange: '#FF8C00'
darkorchid: '#9932CC'
darkred: '#8B0000'
darksalmon: '#E9967A'
darkseagreen: '#8FBC8F'
darkslateblue: '#483D8B'
darkslategray: '#2F4F4F'
darkslategrey: '#2F4F4F'
darkturquoise: '#00CED1'
darkviolet: '#9400D3'
deeppink: '#FF1493'
deepskyblue: '#00BFFF'
dimgray: '#696969'
dimgrey: '#696969'
dodgerblue: '#1E90FF'
firebrick: '#B22222'
floralwhite: '#FFFAF0'
forestgreen: '#228B22'
fuchsia: '#FF00FF'
gainsboro: '#DCDCDC'
ghostwhite: '#F8F8FF'
gold: '#FFD700'
goldenrod: '#DAA520'
gray: '#808080'
green: '#008000'
greenyellow: '#ADFF2F'
grey: '#808080'
honeydew: '#F0FFF0'
hotpink: '#FF69B4'
indianred: '#CD5C5C'
indigo: '#4B0082'
ivory: '#FFFFF0'
khaki: '#F0E68C'
lavender: '#E6E6FA'
lavenderblush: '#FFF0F5'
lawngreen: '#7CFC00'
lemonchiffon: '#FFFACD'
lightblue: '#ADD8E6'
lightcoral: '#F08080'
lightcyan: '#E0FFFF'
lightgoldenrodyellow: '#FAFAD2'
lightgray: '#D3D3D3'
lightgreen: '#90EE90'
lightgrey: '#D3D3D3'
lightpink: '#FFB6C1'
lightsalmon: '#FFA07A'
lightseagreen: '#20B2AA'
lightskyblue: '#87CEFA'
lightslategray: '#778899'
lightslategrey: '#778899'
lightsteelblue: '#B0C4DE'
lightyellow: '#FFFFE0'
lime: '#00FF00'
limegreen: '#32CD32'
linen: '#FAF0E6'
magenta: '#FF00FF'
maroon: '#800000'
mediumaquamarine: '#66CDAA'
mediumblue: '#0000CD'
mediumorchid: '#BA55D3'
mediumpurple: '#9370DB'
mediumseagreen: '#3CB371'
mediumslateblue: '#7B68EE'
mediumspringgreen: '#00FA9A'
mediumturquoise: '#48D1CC'
mediumvioletred: '#C71585'
midnightblue: '#191970'
mintcream: '#F5FFFA'
mistyrose: '#FFE4E1'
moccasin: '#FFE4B5'
navajowhite: '#FFDEAD'
navy: '#000080'
oldlace: '#FDF5E6'
olive: '#808000'
olivedrab: '#6B8E23'
orange: '#FFA500'
orangered: '#FF4500'
orchid: '#DA70D6'
palegoldenrod: '#EEE8AA'
palegreen: '#98FB98'
paleturquoise: '#AFEEEE'
palevioletred: '#DB7093'
papayawhip: '#FFEFD5'
peachpuff: '#FFDAB9'
peru: '#CD853F'
pink: '#FFC0CB'
plum: '#DDA0DD'
powderblue: '#B0E0E6'
purple: '#800080'
red: '#FF0000'
rosybrown: '#BC8F8F'
royalblue: '#4169E1'
saddlebrown: '#8B4513'
salmon: '#FA8072'
sandybrown: '#F4A460'
seagreen: '#2E8B57'
seashell: '#FFF5EE'
sienna: '#A0522D'
silver: '#C0C0C0'
skyblue: '#87CEEB'
slateblue: '#6A5ACD'
slategray: '#708090'
slategrey: '#708090'
snow: '#FFFAFA'
springgreen: '#00FF7F'
steelblue: '#4682B4'
tan: '#D2B48C'
teal: '#008080'
thistle: '#D8BFD8'
tomato: '#FF6347'
turquoise: '#40E0D0'
violet: '#EE82EE'
wheat: '#F5DEB3'
white: '#FFFFFF'
whitesmoke: '#F5F5F5'
yellow: '#FFFF00'
yellowgreen: '#9ACD32'
#### Private helper methods
#
# The following methods are all used internally and are not accessible from outside the jColour object.
#
##### `rgbToHsl(c)`
#
# Converts the RGB representation to a HSL representation.
#
rgbToHsl = (c) ->
c.red = minMax c.red, 0, 255
c.green = minMax c.green, 0, 255
c.blue = minMax c.blue, 0, 255
c.alpha = minMax c.alpha, 0, 1
r = c.red / 255
g = c.green / 255
b = c.blue / 255
max = Math.max r, g, b
min = Math.min r, g, b
d = max - min
h = switch max
when min then 0
when r then 60 * (g - b) / d
when g then 60 * (b - r) / d + 120
when b then 60 * (r - g) / d + 240
l = (max + min) / 2
s = if max == min
0
else if l < 0.5
d / (2 * l)
else
d / (2 - 2 * l)
c.hue = h % 360
c.saturation = s * 100
c.lightness = l * 100
c
##### `hslToRgb(c)`
#
# Converts the HSL representation to a RGB representation.
#
hslToRgb = (c) ->
c.hue -= Math.floor(c.hue/360)*360 if c.hue >= 360
c.hue -= Math.ceil(c.hue/360)*360 if c.hue < 0
c.saturation = minMax c.saturation, 0, 100
c.lightness = minMax c.lightness, 0, 100
c.alpha = minMax c.alpha, 0, 1
h = c.hue / 360
s = c.saturation / 100
l = c.lightness / 100
m2 = if l < 0.5 then l * (s + 1) else l + s - (l * s)
m1 = l * 2 - m2
r = hueToRgb m1, m2, h + 1/3
g = hueToRgb m1, m2, h
b = hueToRgb m1, m2, h - 1/3
c.red = r * 255
c.green = g * 255
c.blue = b * 255
c
##### `hueToRgb(p, q, t)`
#
# Algorithm for converting hue to each of the red, green and blue properties.
#
hueToRgb = (m1, m2, h) ->
h += 1 if h < 0
h -= 1 if h > 1
return m1 + (m2 - m1) * h * 6 if h * 6 < 1
return m2 if h * 2 < 1
return m1 + (m2 - m1) * (2/3 - h) * 6 if h * 3 < 2
m1
##### `hexify(n = '00')`
#
# Algorithm for converting each of the RGB colour channels to it's hex value.
#
hexify = (n = '00') ->
n = parseInt n
return '00' if n == 0 or isNaN n
n = Math.round minMax(n, 0, 255)
"0123456789ABCDEF".charAt((n-n%16)/16) + "0123456789ABCDEF".charAt(n%16)
##### `minMax(i, min, max)`
#
# Helper method to clip a provided number between a minimum and maximum value.
#
minMax = (i, min, max) ->
Math.min Math.max(i, min), max
##### `throwIfIncompatible(params)`
#
# Throws an error if incompatible colour properties are provided.
#
throwIfIncompatible = (params) ->
rgb = hsl = false
for key of params
rgb = true if key in ['red', 'green', 'blue']
hsl = true if key in ['hue', 'saturation', 'luminosity']
if rgb and hsl
throw 'Cannot change both RGB and HSL properties.'
[rgb, hsl]
#### Copyright
#
# Copyright (c) 2010-2011 [Aaron Russell](http://aaronrussell.co.uk).
# Licensed under the [MIT license](http://www.opensource.org/licenses/mit-license.php).
| 16719 | # **jColour** is a JavaScript colour manipulation library written in [CoffeeScript](http://coffeescript.org).
# jColour is inspired heavily by the [SASS](http://sass-lang.com)/[Compass](http://compass-style.org)
# colour manipulation functions.
#
# jColour is also the first ever colour library to spell the word "colour" correctly.
#
# jColour is written by [<NAME>](http://aaronrussell.co.uk),
# the [source code for jColour](http://github.com/aaronrussell/jcolour) is available on Github and
# is released under the [MIT license](http://www.opensource.org/licenses/mit-license.php).
#### Download jColour
# * [Download the minified version](https://raw.github.com/aaronrussell/jcolour/master/build/jColour.min.js) (8kb)
# * [Download the fatter version](https://raw.github.com/aaronrussell/jcolour/master/build/jColour.js) (14kb)
#### Creating a jColour object
# The jColour class can be used in the browser or in your CommonJS projects.
#
root = exports ? this
class root.jColour
# Create a new jColour object by passing a colour string. jColour will parse a string in any of
# the following formats: [recognised colour name](http://www.w3.org/TR/SVG/types.html#ColorKeywords),
# hexidecimal, rgb/a, hsl/a. For example, all the following statements work:
#
# c = new jColour('red');
# c = new jColour('#f00');
# c = new jColour('#ff0000');
# c = new jColour('rgb(255,0,0)');
# c = new jColour('rgba(255,0,0,1)');
# c = new jColour('hsl(0,100,100)');
# c = new jColour('hsla(0,100,100,1)');
#
# Internally, colours are represented in both RGB and HSL. Any colour adjustments result in
# both representaions being recalculated. The alpha channel of a colour is stored independent
# it's RGB or HSL representation. If no alpha value is supplied, it defaults to 1.
#
constructor: (col = '#ffffff') ->
col = colourNames[col] if col.toLowerCase() of colourNames
if hex = col.match /^#?([a-f0-9]{3})$/i
h1 = hex[1].substring(0,1)
h2 = hex[1].substring(1,2)
h3 = hex[1].substring(2,3)
col = "##{h1+h1+h2+h2+h3+h3}"
if hex = col.match /^#?([a-f0-9]{6,8})$/i
@red = parseInt hex[1].substring(0,2), 16
@green = parseInt hex[1].substring(2,4), 16
@blue = parseInt hex[1].substring(4,6), 16
@alpha = if hex[1].substring(6,8) then parseInt(hex[1].substring(6,8), 16) / 255 else 1
rgbToHsl this
else if rgb = col.match /^rgba?\(\s*(\d+)[,\s]*(\d+)[,\s]*(\d+)[,\s]*([\.\d]+)?\s*\)$/i
@red = parseInt rgb[1]
@green = parseInt rgb[2]
@blue = parseInt rgb[3]
@alpha = if rgb[4] then rgb[4] else 1
rgbToHsl this
else if hsl = col.match /^hsla?\(\s*(\d+)[,\s]*(\d+)[,\s]*(\d+)[,\s]*([\.\d]+)?\s*\)$/i
@hue = parseInt hsl[1]
@saturation = parseInt hsl[2]
@lightness = parseInt hsl[3]
@alpha = if hsl[4] then hsl[4] else 1
hslToRgb this
else
throw 'Invalid colour string.'
#### Accessing colour representations
# At any time, a jColour object can return a string of any of it's colour represenations.
##### `hex(show_alpha = false)`
#
# To return the hexidecimal value of the colour use the `hex()` method. By default, any alpha
# value of the jColour object will be ignored. However, in specialist cases you may want a
# hexdecimal representation of the alpha channel, in which case pass `true` to the method.
#
# c.hex(); # -> '#ff0000'
#
hex: (showAlpha = false) ->
hex = if showAlpha && @alpha < 1
"##{hexify @red}#{hexify @green}#{hexify @blue}#{hexify @alpha * 255}"
else
"##{hexify @red}#{hexify @green}#{hexify @blue}"
hex.toLowerCase()
##### `rgb()`
#
# Returns the RGB value of the colour. If the jColour object's alpha channel is anything but 1,
# the returned representation will be RGBA.
#
# c.rgb(); # -> 'rgb(255,0,0)'
#
rgb: ->
if @alpha == 1
"rgb(#{Math.round @red}, #{Math.round @green}, #{Math.round @blue})"
else
"rgba(#{Math.round @red}, #{Math.round @green}, #{Math.round @blue}, #{Math.round(@alpha * 100) / 100})"
##### `hsl()`
#
# Returns the HSL value of the colour. If the jColour object's alpha channel is anything but 1,
# the returned representation will be HSLA.
#
# c.hsl(); # -> 'hsl(0,100,100)'
#
hsl: ->
if @alpha == 1
"hsl(#{Math.round @hue}, #{Math.round @saturation}, #{Math.round @lightness})"
else
"hsla(#{Math.round @hue}, #{Math.round @saturation}, #{Math.round @lightness}, #{Math.round(@alpha * 100) / 100})"
##### `toS()`
#
# Returns the name of the colour if it is a recognised colour keyworld. Alternatively, the hex
# code will be returned.
#
toS: ->
for key, value of colourNames
return key if @hex() == value.toLowerCase()
@hex()
#### Manipulating colours
# A jColour object can be manipulated using a range of colour manipulation methods. Each method
# makes the required adjustment to the colour representations and updates the jColour object.
# This allows the "chaining" of methods, for example:
#
# c = new jColour('#ff0000');
# c.adjustHue(20).darken(10).transparentize(25).rgb(); # -> 'rgba(204, 68, 0, 0.75)'
#
# Most of the colour manipulation methods allow colour values to be manipulated relatively
# (eg. 50 + 10 = 60) or scaled by a percentage (eg. 50 + 10% = 55). The name of the method should
# make it obvious as to what calculation you should expect.
##### `lighten(amount)`
#
# Makes the colour lighter. Takes an amount between 0 and 100 which makes a relative adjustment
# (increase) to the current lightness.
#
# c.lighten(25);
#
lighten: (amount) ->
@lightness += amount
hslToRgb this
##### `lightenPercent(percent)`
#
# Also makes the colour lighter. This method should also be passed a value between 0 and 100, but
# in this case the lightness is *scaled* up relative to it's current value.
#
# c.lightenPercent(25);
#
lightenPercent: (percent) ->
@lightness += (@lightness / 100) * percent
hslToRgb this
##### `darken(amount)`
#
# Makes the colour darker. Takes an amount between 0 and 100 which makes a relative adjustment
# (decrease) to the current lightness.
#
# c.darken(25);
#
darken: (amount) ->
@lightness -= amount
hslToRgb this
##### `darkenPercent(percent)`
#
# Also makes the colour darker. This method should also be passed a value between 0 and 100, but
# in this case the lightness is *scaled* down relative to it's current value.
#
# c.darkenPercent(25);
#
darkenPercent: (percent) ->
@lightness -= (@lightness / 100) * percent
hslToRgb this
##### `saturate(amount)`
#
# Makes the colour more saturated. Takes an amount between 0 and 100 which makes a relative
# adjustment (increase) to the current saturation.
#
# c.saturate(25);
#
saturate: (amount) ->
@saturation += amount
hslToRgb this
##### `saturatePercent(percent)`
#
# Also makes the colour more saturated. This method should also be passed a value between 0 and
# 100, but in this case the saturation is *scaled* up relative to it's current value.
#
# c.saturatePercent(25);
#
saturatePercent: (percent) ->
@saturation += (@saturation / 100) * percent
hslToRgb this
##### `desaturate(amount)`
#
# Makes the colour less saturated. Takes an amount between 0 and 100 which makes a relative
# adjustment (decrease) to the current saturation.
#
# c.desaturate(25);
#
desaturate: (amount) ->
@saturation -= amount
hslToRgb this
##### `desaturatePercent(percent)`
#
# Also makes the colour less saturated. This method should also be passed a value between 0 and
# 100, but in this case the saturation is *scaled* down relative to it's current value.
#
# c.desaturatePercent(25);
#
desaturatePercent: (percent) ->
@saturation -= (@saturation / 100) * percent
hslToRgb this
##### `greyscale()`
#
# Converts the color to greyscale. This is identical to `desaturate(100)`. Can also use the alias, `grayscale()`.
#
# c.greyscale();
#
greyscale: ->
@saturation = 0
hslToRgb this
grayscale: -> @greyscale()
##### `adjustHue(degrees)`
#
# Changes the hue of the colour whilst retaining the lightness and saturation. This method should
# be passed a number of degrees (usually between -360 and 360) and makes a relative adjustment to
# the current hue.
#
# c.adjustHue(45);
#
adjustHue: (degrees) ->
@hue += degrees
hslToRgb this
##### `complement()`
#
# Returns the complement of the current colour. This is identical to `adjustHue(180)`.
#
# c.complement();
#
complement: ->
@hue += 180
hslToRgb this
##### `opacify(amount)`
#
# Makes the colour more opaque. Takes an amount between 0 and 1 which makes a relative
# adjustment (increase) to the current alpha channel.
#
# c.opacify(0.25);
#
opacify: (amount) ->
@alpha += amount
@alpha = minMax @alpha, 0, 1
this
##### `transparentize(amount)`
#
# Makes the colour more transparent. Takes an amount between 0 and 100 which makes a relative
# adjustment (decrease) to the current alpha channel.
#
# c.transparentize(0.25);
#
transparentize: (amount) ->
@alpha -= amount
@alpha = minMax @alpha, 0, 1
this
##### `invert()`
#
# Returns the inverse (negative) of the color. The red, green, and blue values are inverted, while
# the opacity is left alone.
#
# c.invert();
#
invert: ->
for color in ['red', 'green', 'blue']
@[color] = 255 - @[color]
rgbToHsl this
##### `adjustColour(params = {})`
#
# Makes a relative adjustment to one or more properties of the colour. Takes an object with the
# properties of red, green, blue, hue, saturation, lightness and alpha. All properties are
# optional and you can't specify both RGB and HSL properties at the same time.
#
# Red, green and blue propeties should have a value between -255 and 255. The hue property should
# have a value between -360 and 360. The saturation and lightness properties should have a value
# between -100 and 100. The alpha property should have a value between 0 and 1. All values will
# make a relative adjustment to their current value.
#
# c.adjustColour({
# red: 25,
# green: -30,
# alpha: -0.25
# })
# c.adjustColour({
# hue: 120,
# lightness: 25,
# saturation: -10
# })
#
adjustColour: (params = {}) ->
kind = throwIfIncompatible params
for key of params
@[key] += params[key] if key in properties
if kind[0] then rgbToHsl this else hslToRgb this
##### `scaleColour(params = {})`
#
# Makes a scaled adjustment to one or more properties of the colour. Takes an object with the
# properties of red, green, blue, saturation, lightness and alpha. Note that you can't scale the
# hue value. All properties are optional and you can't specify both RGB and HSL properties at the
# same time.
#
# All properties should have a value between -100 and 100. The property will be scaled up or down
# relative to it's current value.
#
# c.scaleColour({
# red: 25,
# green: -15
# })
# c.scaleColour({
# lightness: 25,
# saturation: -10
# })
#
scaleColour: (params = {}) ->
kind = throwIfIncompatible params
for key of params
@[key] += (@[key] / 100) * params[key] if key in properties and key isnt 'hue'
if kind[0] then rgbToHsl this else hslToRgb this
##### `changeColour(params = {})`
#
# Changes one or more properties of the colour to the absolute value provided. Takes an object
# with the properties of red, green, blue, hue, saturation, lightness and alpha. All properties
# are optional and you can't specify both RGB and HSL properties at the same time.
#
# Red, green and blue propeties should have a value between 0 and 255. The hue property should
# have a value between 0 and 360. The saturation and lightness properties should have a value
# between 0 and 100. The alpha property should have a value between 0 and 1. All properties will
# be set to the new value.
#
# c.changeColour({
# red: 255,
# green: 0,
# blue: 0
# })
# c.changeColour({
# hue: 0,
# lightness: 100,
# saturation: 100
# })
#
changeColour: (params = {}) ->
kind = throwIfIncompatible params
for key of params
@[key] = params[key] if key in properties
if kind[0] then rgbToHsl this else hslToRgb this
##### `mixWith(colour, weight = 50)`
#
# Mixes the colour with another 'mix' colour. The mix colour can be passed as either a jColour
# object or a string. Each of the RGB components are averaged, optionally weighted with a given
# percentage. The opacity of the colours is also considered when weighting the components.
#
# The weight specifies the weight of the mix. The default, 50%, means half the original colour
# and half the mix colour will be used. A weight of 25% means the a quarter of the mix colour
# will be mixed with three quarters of the original colour.
#
# red = new jColour('#ff0000');
# red.mixWith('#ffffff', 75).rgb(); # -> 'rgb(255, 191, 191)'
#
mixWith: (colour, weight = 50) ->
colour = new jColour(colour) unless colour instanceof jColour
p = weight / 100
w = p * 2 - 1
a = colour.alpha - @alpha
w1 = ((if w * a == -1 then w else (w + a) / (1 + w * a)) + 1) / 2
w2 = 1 - w1
@red = (colour.red * w1) + (@red * w2)
@green = (colour.green * w1) + (@green * w2)
@blue = (colour.blue * w1) + (@blue * w2)
@alpha = (colour.alpha * p) + (@alpha * (1-p))
rgbToHsl this
#### Private properties
# This properties array is useful to have around.
#
properties = ['red', 'green', 'blue', 'hue', 'saturation', 'lightness', 'alpha']
# A mahoosive list of recognised colour keyword names as defined at
# [http://www.w3.org/TR/SVG/types.html#ColorKeywords](http://www.w3.org/TR/SVG/types.html#ColorKeywords)
#
colourNames =
aliceblue: '#F0F8FF'
antiquewhite: '#FAEBD7'
aqua: '#00FFFF'
aquamarine: '#7FFFD4'
azure: '#F0FFFF'
beige: '#F5F5DC'
bisque: '#FFE4C4'
black: '#000000'
blanchedalmond: '#FFEBCD'
blue: '#0000FF'
blueviolet: '#8A2BE2'
brown: '#A52A2A'
burlywood: '#DEB887'
cadetblue: '#5F9EA0'
chartreuse: '#7FFF00'
chocolate: '#D2691E'
coral: '#FF7F50'
cornflowerblue: '#6495ED'
cornsilk: '#FFF8DC'
crimson: '#DC143C'
cyan: '#00FFFF'
darkblue: '#00008B'
darkcyan: '#008B8B'
darkgoldenrod: '#B8860B'
darkgray: '#A9A9A9'
darkgreen: '#006400'
darkgrey: '#A9A9A9'
darkkhaki: '#BDB76B'
darkmagenta: '#8B008B'
darkolivegreen: '#556B2F'
darkorange: '#FF8C00'
darkorchid: '#9932CC'
darkred: '#8B0000'
darksalmon: '#E9967A'
darkseagreen: '#8FBC8F'
darkslateblue: '#483D8B'
darkslategray: '#2F4F4F'
darkslategrey: '#2F4F4F'
darkturquoise: '#00CED1'
darkviolet: '#9400D3'
deeppink: '#FF1493'
deepskyblue: '#00BFFF'
dimgray: '#696969'
dimgrey: '#696969'
dodgerblue: '#1E90FF'
firebrick: '#B22222'
floralwhite: '#FFFAF0'
forestgreen: '#228B22'
fuchsia: '#FF00FF'
gainsboro: '#DCDCDC'
ghostwhite: '#F8F8FF'
gold: '#FFD700'
goldenrod: '#DAA520'
gray: '#808080'
green: '#008000'
greenyellow: '#ADFF2F'
grey: '#808080'
honeydew: '#F0FFF0'
hotpink: '#FF69B4'
indianred: '#CD5C5C'
indigo: '#4B0082'
ivory: '#FFFFF0'
khaki: '#F0E68C'
lavender: '#E6E6FA'
lavenderblush: '#FFF0F5'
lawngreen: '#7CFC00'
lemonchiffon: '#FFFACD'
lightblue: '#ADD8E6'
lightcoral: '#F08080'
lightcyan: '#E0FFFF'
lightgoldenrodyellow: '#FAFAD2'
lightgray: '#D3D3D3'
lightgreen: '#90EE90'
lightgrey: '#D3D3D3'
lightpink: '#FFB6C1'
lightsalmon: '#FFA07A'
lightseagreen: '#20B2AA'
lightskyblue: '#87CEFA'
lightslategray: '#778899'
lightslategrey: '#778899'
lightsteelblue: '#B0C4DE'
lightyellow: '#FFFFE0'
lime: '#00FF00'
limegreen: '#32CD32'
linen: '#FAF0E6'
magenta: '#FF00FF'
maroon: '#800000'
mediumaquamarine: '#66CDAA'
mediumblue: '#0000CD'
mediumorchid: '#BA55D3'
mediumpurple: '#9370DB'
mediumseagreen: '#3CB371'
mediumslateblue: '#7B68EE'
mediumspringgreen: '#00FA9A'
mediumturquoise: '#48D1CC'
mediumvioletred: '#C71585'
midnightblue: '#191970'
mintcream: '#F5FFFA'
mistyrose: '#FFE4E1'
moccasin: '#FFE4B5'
navajowhite: '#FFDEAD'
navy: '#000080'
oldlace: '#FDF5E6'
olive: '#808000'
olivedrab: '#6B8E23'
orange: '#FFA500'
orangered: '#FF4500'
orchid: '#DA70D6'
palegoldenrod: '#EEE8AA'
palegreen: '#98FB98'
paleturquoise: '#AFEEEE'
palevioletred: '#DB7093'
papayawhip: '#FFEFD5'
peachpuff: '#FFDAB9'
peru: '#CD853F'
pink: '#FFC0CB'
plum: '#DDA0DD'
powderblue: '#B0E0E6'
purple: '#800080'
red: '#FF0000'
rosybrown: '#BC8F8F'
royalblue: '#4169E1'
saddlebrown: '#8B4513'
salmon: '#FA8072'
sandybrown: '#F4A460'
seagreen: '#2E8B57'
seashell: '#FFF5EE'
sienna: '#A0522D'
silver: '#C0C0C0'
skyblue: '#87CEEB'
slateblue: '#6A5ACD'
slategray: '#708090'
slategrey: '#708090'
snow: '#FFFAFA'
springgreen: '#00FF7F'
steelblue: '#4682B4'
tan: '#D2B48C'
teal: '#008080'
thistle: '#D8BFD8'
tomato: '#FF6347'
turquoise: '#40E0D0'
violet: '#EE82EE'
wheat: '#F5DEB3'
white: '#FFFFFF'
whitesmoke: '#F5F5F5'
yellow: '#FFFF00'
yellowgreen: '#9ACD32'
#### Private helper methods
#
# The following methods are all used internally and are not accessible from outside the jColour object.
#
##### `rgbToHsl(c)`
#
# Converts the RGB representation to a HSL representation.
#
rgbToHsl = (c) ->
c.red = minMax c.red, 0, 255
c.green = minMax c.green, 0, 255
c.blue = minMax c.blue, 0, 255
c.alpha = minMax c.alpha, 0, 1
r = c.red / 255
g = c.green / 255
b = c.blue / 255
max = Math.max r, g, b
min = Math.min r, g, b
d = max - min
h = switch max
when min then 0
when r then 60 * (g - b) / d
when g then 60 * (b - r) / d + 120
when b then 60 * (r - g) / d + 240
l = (max + min) / 2
s = if max == min
0
else if l < 0.5
d / (2 * l)
else
d / (2 - 2 * l)
c.hue = h % 360
c.saturation = s * 100
c.lightness = l * 100
c
##### `hslToRgb(c)`
#
# Converts the HSL representation to a RGB representation.
#
hslToRgb = (c) ->
c.hue -= Math.floor(c.hue/360)*360 if c.hue >= 360
c.hue -= Math.ceil(c.hue/360)*360 if c.hue < 0
c.saturation = minMax c.saturation, 0, 100
c.lightness = minMax c.lightness, 0, 100
c.alpha = minMax c.alpha, 0, 1
h = c.hue / 360
s = c.saturation / 100
l = c.lightness / 100
m2 = if l < 0.5 then l * (s + 1) else l + s - (l * s)
m1 = l * 2 - m2
r = hueToRgb m1, m2, h + 1/3
g = hueToRgb m1, m2, h
b = hueToRgb m1, m2, h - 1/3
c.red = r * 255
c.green = g * 255
c.blue = b * 255
c
##### `hueToRgb(p, q, t)`
#
# Algorithm for converting hue to each of the red, green and blue properties.
#
hueToRgb = (m1, m2, h) ->
h += 1 if h < 0
h -= 1 if h > 1
return m1 + (m2 - m1) * h * 6 if h * 6 < 1
return m2 if h * 2 < 1
return m1 + (m2 - m1) * (2/3 - h) * 6 if h * 3 < 2
m1
##### `hexify(n = '00')`
#
# Algorithm for converting each of the RGB colour channels to it's hex value.
#
hexify = (n = '00') ->
n = parseInt n
return '00' if n == 0 or isNaN n
n = Math.round minMax(n, 0, 255)
"0123456789ABCDEF".charAt((n-n%16)/16) + "0123456789ABCDEF".charAt(n%16)
##### `minMax(i, min, max)`
#
# Helper method to clip a provided number between a minimum and maximum value.
#
minMax = (i, min, max) ->
Math.min Math.max(i, min), max
##### `throwIfIncompatible(params)`
#
# Throws an error if incompatible colour properties are provided.
#
throwIfIncompatible = (params) ->
rgb = hsl = false
for key of params
rgb = true if key in ['red', 'green', 'blue']
hsl = true if key in ['hue', 'saturation', 'luminosity']
if rgb and hsl
throw 'Cannot change both RGB and HSL properties.'
[rgb, hsl]
#### Copyright
#
# Copyright (c) 2010-2011 [<NAME>](http://aaronrussell.co.uk).
# Licensed under the [MIT license](http://www.opensource.org/licenses/mit-license.php).
| true | # **jColour** is a JavaScript colour manipulation library written in [CoffeeScript](http://coffeescript.org).
# jColour is inspired heavily by the [SASS](http://sass-lang.com)/[Compass](http://compass-style.org)
# colour manipulation functions.
#
# jColour is also the first ever colour library to spell the word "colour" correctly.
#
# jColour is written by [PI:NAME:<NAME>END_PI](http://aaronrussell.co.uk),
# the [source code for jColour](http://github.com/aaronrussell/jcolour) is available on Github and
# is released under the [MIT license](http://www.opensource.org/licenses/mit-license.php).
#### Download jColour
# * [Download the minified version](https://raw.github.com/aaronrussell/jcolour/master/build/jColour.min.js) (8kb)
# * [Download the fatter version](https://raw.github.com/aaronrussell/jcolour/master/build/jColour.js) (14kb)
#### Creating a jColour object
# The jColour class can be used in the browser or in your CommonJS projects.
#
root = exports ? this
class root.jColour
# Create a new jColour object by passing a colour string. jColour will parse a string in any of
# the following formats: [recognised colour name](http://www.w3.org/TR/SVG/types.html#ColorKeywords),
# hexidecimal, rgb/a, hsl/a. For example, all the following statements work:
#
# c = new jColour('red');
# c = new jColour('#f00');
# c = new jColour('#ff0000');
# c = new jColour('rgb(255,0,0)');
# c = new jColour('rgba(255,0,0,1)');
# c = new jColour('hsl(0,100,100)');
# c = new jColour('hsla(0,100,100,1)');
#
# Internally, colours are represented in both RGB and HSL. Any colour adjustments result in
# both representaions being recalculated. The alpha channel of a colour is stored independent
# it's RGB or HSL representation. If no alpha value is supplied, it defaults to 1.
#
constructor: (col = '#ffffff') ->
col = colourNames[col] if col.toLowerCase() of colourNames
if hex = col.match /^#?([a-f0-9]{3})$/i
h1 = hex[1].substring(0,1)
h2 = hex[1].substring(1,2)
h3 = hex[1].substring(2,3)
col = "##{h1+h1+h2+h2+h3+h3}"
if hex = col.match /^#?([a-f0-9]{6,8})$/i
@red = parseInt hex[1].substring(0,2), 16
@green = parseInt hex[1].substring(2,4), 16
@blue = parseInt hex[1].substring(4,6), 16
@alpha = if hex[1].substring(6,8) then parseInt(hex[1].substring(6,8), 16) / 255 else 1
rgbToHsl this
else if rgb = col.match /^rgba?\(\s*(\d+)[,\s]*(\d+)[,\s]*(\d+)[,\s]*([\.\d]+)?\s*\)$/i
@red = parseInt rgb[1]
@green = parseInt rgb[2]
@blue = parseInt rgb[3]
@alpha = if rgb[4] then rgb[4] else 1
rgbToHsl this
else if hsl = col.match /^hsla?\(\s*(\d+)[,\s]*(\d+)[,\s]*(\d+)[,\s]*([\.\d]+)?\s*\)$/i
@hue = parseInt hsl[1]
@saturation = parseInt hsl[2]
@lightness = parseInt hsl[3]
@alpha = if hsl[4] then hsl[4] else 1
hslToRgb this
else
throw 'Invalid colour string.'
#### Accessing colour representations
# At any time, a jColour object can return a string of any of it's colour represenations.
##### `hex(show_alpha = false)`
#
# To return the hexidecimal value of the colour use the `hex()` method. By default, any alpha
# value of the jColour object will be ignored. However, in specialist cases you may want a
# hexdecimal representation of the alpha channel, in which case pass `true` to the method.
#
# c.hex(); # -> '#ff0000'
#
hex: (showAlpha = false) ->
hex = if showAlpha && @alpha < 1
"##{hexify @red}#{hexify @green}#{hexify @blue}#{hexify @alpha * 255}"
else
"##{hexify @red}#{hexify @green}#{hexify @blue}"
hex.toLowerCase()
##### `rgb()`
#
# Returns the RGB value of the colour. If the jColour object's alpha channel is anything but 1,
# the returned representation will be RGBA.
#
# c.rgb(); # -> 'rgb(255,0,0)'
#
rgb: ->
if @alpha == 1
"rgb(#{Math.round @red}, #{Math.round @green}, #{Math.round @blue})"
else
"rgba(#{Math.round @red}, #{Math.round @green}, #{Math.round @blue}, #{Math.round(@alpha * 100) / 100})"
##### `hsl()`
#
# Returns the HSL value of the colour. If the jColour object's alpha channel is anything but 1,
# the returned representation will be HSLA.
#
# c.hsl(); # -> 'hsl(0,100,100)'
#
hsl: ->
if @alpha == 1
"hsl(#{Math.round @hue}, #{Math.round @saturation}, #{Math.round @lightness})"
else
"hsla(#{Math.round @hue}, #{Math.round @saturation}, #{Math.round @lightness}, #{Math.round(@alpha * 100) / 100})"
##### `toS()`
#
# Returns the name of the colour if it is a recognised colour keyworld. Alternatively, the hex
# code will be returned.
#
toS: ->
for key, value of colourNames
return key if @hex() == value.toLowerCase()
@hex()
#### Manipulating colours
# A jColour object can be manipulated using a range of colour manipulation methods. Each method
# makes the required adjustment to the colour representations and updates the jColour object.
# This allows the "chaining" of methods, for example:
#
# c = new jColour('#ff0000');
# c.adjustHue(20).darken(10).transparentize(25).rgb(); # -> 'rgba(204, 68, 0, 0.75)'
#
# Most of the colour manipulation methods allow colour values to be manipulated relatively
# (eg. 50 + 10 = 60) or scaled by a percentage (eg. 50 + 10% = 55). The name of the method should
# make it obvious as to what calculation you should expect.
##### `lighten(amount)`
#
# Makes the colour lighter. Takes an amount between 0 and 100 which makes a relative adjustment
# (increase) to the current lightness.
#
# c.lighten(25);
#
lighten: (amount) ->
@lightness += amount
hslToRgb this
##### `lightenPercent(percent)`
#
# Also makes the colour lighter. This method should also be passed a value between 0 and 100, but
# in this case the lightness is *scaled* up relative to it's current value.
#
# c.lightenPercent(25);
#
lightenPercent: (percent) ->
@lightness += (@lightness / 100) * percent
hslToRgb this
##### `darken(amount)`
#
# Makes the colour darker. Takes an amount between 0 and 100 which makes a relative adjustment
# (decrease) to the current lightness.
#
# c.darken(25);
#
darken: (amount) ->
@lightness -= amount
hslToRgb this
##### `darkenPercent(percent)`
#
# Also makes the colour darker. This method should also be passed a value between 0 and 100, but
# in this case the lightness is *scaled* down relative to it's current value.
#
# c.darkenPercent(25);
#
darkenPercent: (percent) ->
@lightness -= (@lightness / 100) * percent
hslToRgb this
##### `saturate(amount)`
#
# Makes the colour more saturated. Takes an amount between 0 and 100 which makes a relative
# adjustment (increase) to the current saturation.
#
# c.saturate(25);
#
saturate: (amount) ->
@saturation += amount
hslToRgb this
##### `saturatePercent(percent)`
#
# Also makes the colour more saturated. This method should also be passed a value between 0 and
# 100, but in this case the saturation is *scaled* up relative to it's current value.
#
# c.saturatePercent(25);
#
saturatePercent: (percent) ->
@saturation += (@saturation / 100) * percent
hslToRgb this
##### `desaturate(amount)`
#
# Makes the colour less saturated. Takes an amount between 0 and 100 which makes a relative
# adjustment (decrease) to the current saturation.
#
# c.desaturate(25);
#
desaturate: (amount) ->
@saturation -= amount
hslToRgb this
##### `desaturatePercent(percent)`
#
# Also makes the colour less saturated. This method should also be passed a value between 0 and
# 100, but in this case the saturation is *scaled* down relative to it's current value.
#
# c.desaturatePercent(25);
#
desaturatePercent: (percent) ->
@saturation -= (@saturation / 100) * percent
hslToRgb this
##### `greyscale()`
#
# Converts the color to greyscale. This is identical to `desaturate(100)`. Can also use the alias, `grayscale()`.
#
# c.greyscale();
#
greyscale: ->
@saturation = 0
hslToRgb this
grayscale: -> @greyscale()
##### `adjustHue(degrees)`
#
# Changes the hue of the colour whilst retaining the lightness and saturation. This method should
# be passed a number of degrees (usually between -360 and 360) and makes a relative adjustment to
# the current hue.
#
# c.adjustHue(45);
#
adjustHue: (degrees) ->
@hue += degrees
hslToRgb this
##### `complement()`
#
# Returns the complement of the current colour. This is identical to `adjustHue(180)`.
#
# c.complement();
#
complement: ->
@hue += 180
hslToRgb this
##### `opacify(amount)`
#
# Makes the colour more opaque. Takes an amount between 0 and 1 which makes a relative
# adjustment (increase) to the current alpha channel.
#
# c.opacify(0.25);
#
opacify: (amount) ->
@alpha += amount
@alpha = minMax @alpha, 0, 1
this
##### `transparentize(amount)`
#
# Makes the colour more transparent. Takes an amount between 0 and 100 which makes a relative
# adjustment (decrease) to the current alpha channel.
#
# c.transparentize(0.25);
#
transparentize: (amount) ->
@alpha -= amount
@alpha = minMax @alpha, 0, 1
this
##### `invert()`
#
# Returns the inverse (negative) of the color. The red, green, and blue values are inverted, while
# the opacity is left alone.
#
# c.invert();
#
invert: ->
for color in ['red', 'green', 'blue']
@[color] = 255 - @[color]
rgbToHsl this
##### `adjustColour(params = {})`
#
# Makes a relative adjustment to one or more properties of the colour. Takes an object with the
# properties of red, green, blue, hue, saturation, lightness and alpha. All properties are
# optional and you can't specify both RGB and HSL properties at the same time.
#
# Red, green and blue propeties should have a value between -255 and 255. The hue property should
# have a value between -360 and 360. The saturation and lightness properties should have a value
# between -100 and 100. The alpha property should have a value between 0 and 1. All values will
# make a relative adjustment to their current value.
#
# c.adjustColour({
# red: 25,
# green: -30,
# alpha: -0.25
# })
# c.adjustColour({
# hue: 120,
# lightness: 25,
# saturation: -10
# })
#
adjustColour: (params = {}) ->
kind = throwIfIncompatible params
for key of params
@[key] += params[key] if key in properties
if kind[0] then rgbToHsl this else hslToRgb this
##### `scaleColour(params = {})`
#
# Makes a scaled adjustment to one or more properties of the colour. Takes an object with the
# properties of red, green, blue, saturation, lightness and alpha. Note that you can't scale the
# hue value. All properties are optional and you can't specify both RGB and HSL properties at the
# same time.
#
# All properties should have a value between -100 and 100. The property will be scaled up or down
# relative to it's current value.
#
# c.scaleColour({
# red: 25,
# green: -15
# })
# c.scaleColour({
# lightness: 25,
# saturation: -10
# })
#
scaleColour: (params = {}) ->
kind = throwIfIncompatible params
for key of params
@[key] += (@[key] / 100) * params[key] if key in properties and key isnt 'hue'
if kind[0] then rgbToHsl this else hslToRgb this
##### `changeColour(params = {})`
#
# Changes one or more properties of the colour to the absolute value provided. Takes an object
# with the properties of red, green, blue, hue, saturation, lightness and alpha. All properties
# are optional and you can't specify both RGB and HSL properties at the same time.
#
# Red, green and blue propeties should have a value between 0 and 255. The hue property should
# have a value between 0 and 360. The saturation and lightness properties should have a value
# between 0 and 100. The alpha property should have a value between 0 and 1. All properties will
# be set to the new value.
#
# c.changeColour({
# red: 255,
# green: 0,
# blue: 0
# })
# c.changeColour({
# hue: 0,
# lightness: 100,
# saturation: 100
# })
#
changeColour: (params = {}) ->
kind = throwIfIncompatible params
for key of params
@[key] = params[key] if key in properties
if kind[0] then rgbToHsl this else hslToRgb this
##### `mixWith(colour, weight = 50)`
#
# Mixes the colour with another 'mix' colour. The mix colour can be passed as either a jColour
# object or a string. Each of the RGB components are averaged, optionally weighted with a given
# percentage. The opacity of the colours is also considered when weighting the components.
#
# The weight specifies the weight of the mix. The default, 50%, means half the original colour
# and half the mix colour will be used. A weight of 25% means the a quarter of the mix colour
# will be mixed with three quarters of the original colour.
#
# red = new jColour('#ff0000');
# red.mixWith('#ffffff', 75).rgb(); # -> 'rgb(255, 191, 191)'
#
mixWith: (colour, weight = 50) ->
colour = new jColour(colour) unless colour instanceof jColour
p = weight / 100
w = p * 2 - 1
a = colour.alpha - @alpha
w1 = ((if w * a == -1 then w else (w + a) / (1 + w * a)) + 1) / 2
w2 = 1 - w1
@red = (colour.red * w1) + (@red * w2)
@green = (colour.green * w1) + (@green * w2)
@blue = (colour.blue * w1) + (@blue * w2)
@alpha = (colour.alpha * p) + (@alpha * (1-p))
rgbToHsl this
#### Private properties
# This properties array is useful to have around.
#
properties = ['red', 'green', 'blue', 'hue', 'saturation', 'lightness', 'alpha']
# A mahoosive list of recognised colour keyword names as defined at
# [http://www.w3.org/TR/SVG/types.html#ColorKeywords](http://www.w3.org/TR/SVG/types.html#ColorKeywords)
#
colourNames =
aliceblue: '#F0F8FF'
antiquewhite: '#FAEBD7'
aqua: '#00FFFF'
aquamarine: '#7FFFD4'
azure: '#F0FFFF'
beige: '#F5F5DC'
bisque: '#FFE4C4'
black: '#000000'
blanchedalmond: '#FFEBCD'
blue: '#0000FF'
blueviolet: '#8A2BE2'
brown: '#A52A2A'
burlywood: '#DEB887'
cadetblue: '#5F9EA0'
chartreuse: '#7FFF00'
chocolate: '#D2691E'
coral: '#FF7F50'
cornflowerblue: '#6495ED'
cornsilk: '#FFF8DC'
crimson: '#DC143C'
cyan: '#00FFFF'
darkblue: '#00008B'
darkcyan: '#008B8B'
darkgoldenrod: '#B8860B'
darkgray: '#A9A9A9'
darkgreen: '#006400'
darkgrey: '#A9A9A9'
darkkhaki: '#BDB76B'
darkmagenta: '#8B008B'
darkolivegreen: '#556B2F'
darkorange: '#FF8C00'
darkorchid: '#9932CC'
darkred: '#8B0000'
darksalmon: '#E9967A'
darkseagreen: '#8FBC8F'
darkslateblue: '#483D8B'
darkslategray: '#2F4F4F'
darkslategrey: '#2F4F4F'
darkturquoise: '#00CED1'
darkviolet: '#9400D3'
deeppink: '#FF1493'
deepskyblue: '#00BFFF'
dimgray: '#696969'
dimgrey: '#696969'
dodgerblue: '#1E90FF'
firebrick: '#B22222'
floralwhite: '#FFFAF0'
forestgreen: '#228B22'
fuchsia: '#FF00FF'
gainsboro: '#DCDCDC'
ghostwhite: '#F8F8FF'
gold: '#FFD700'
goldenrod: '#DAA520'
gray: '#808080'
green: '#008000'
greenyellow: '#ADFF2F'
grey: '#808080'
honeydew: '#F0FFF0'
hotpink: '#FF69B4'
indianred: '#CD5C5C'
indigo: '#4B0082'
ivory: '#FFFFF0'
khaki: '#F0E68C'
lavender: '#E6E6FA'
lavenderblush: '#FFF0F5'
lawngreen: '#7CFC00'
lemonchiffon: '#FFFACD'
lightblue: '#ADD8E6'
lightcoral: '#F08080'
lightcyan: '#E0FFFF'
lightgoldenrodyellow: '#FAFAD2'
lightgray: '#D3D3D3'
lightgreen: '#90EE90'
lightgrey: '#D3D3D3'
lightpink: '#FFB6C1'
lightsalmon: '#FFA07A'
lightseagreen: '#20B2AA'
lightskyblue: '#87CEFA'
lightslategray: '#778899'
lightslategrey: '#778899'
lightsteelblue: '#B0C4DE'
lightyellow: '#FFFFE0'
lime: '#00FF00'
limegreen: '#32CD32'
linen: '#FAF0E6'
magenta: '#FF00FF'
maroon: '#800000'
mediumaquamarine: '#66CDAA'
mediumblue: '#0000CD'
mediumorchid: '#BA55D3'
mediumpurple: '#9370DB'
mediumseagreen: '#3CB371'
mediumslateblue: '#7B68EE'
mediumspringgreen: '#00FA9A'
mediumturquoise: '#48D1CC'
mediumvioletred: '#C71585'
midnightblue: '#191970'
mintcream: '#F5FFFA'
mistyrose: '#FFE4E1'
moccasin: '#FFE4B5'
navajowhite: '#FFDEAD'
navy: '#000080'
oldlace: '#FDF5E6'
olive: '#808000'
olivedrab: '#6B8E23'
orange: '#FFA500'
orangered: '#FF4500'
orchid: '#DA70D6'
palegoldenrod: '#EEE8AA'
palegreen: '#98FB98'
paleturquoise: '#AFEEEE'
palevioletred: '#DB7093'
papayawhip: '#FFEFD5'
peachpuff: '#FFDAB9'
peru: '#CD853F'
pink: '#FFC0CB'
plum: '#DDA0DD'
powderblue: '#B0E0E6'
purple: '#800080'
red: '#FF0000'
rosybrown: '#BC8F8F'
royalblue: '#4169E1'
saddlebrown: '#8B4513'
salmon: '#FA8072'
sandybrown: '#F4A460'
seagreen: '#2E8B57'
seashell: '#FFF5EE'
sienna: '#A0522D'
silver: '#C0C0C0'
skyblue: '#87CEEB'
slateblue: '#6A5ACD'
slategray: '#708090'
slategrey: '#708090'
snow: '#FFFAFA'
springgreen: '#00FF7F'
steelblue: '#4682B4'
tan: '#D2B48C'
teal: '#008080'
thistle: '#D8BFD8'
tomato: '#FF6347'
turquoise: '#40E0D0'
violet: '#EE82EE'
wheat: '#F5DEB3'
white: '#FFFFFF'
whitesmoke: '#F5F5F5'
yellow: '#FFFF00'
yellowgreen: '#9ACD32'
#### Private helper methods
#
# The following methods are all used internally and are not accessible from outside the jColour object.
#
##### `rgbToHsl(c)`
#
# Converts the RGB representation to a HSL representation.
#
rgbToHsl = (c) ->
c.red = minMax c.red, 0, 255
c.green = minMax c.green, 0, 255
c.blue = minMax c.blue, 0, 255
c.alpha = minMax c.alpha, 0, 1
r = c.red / 255
g = c.green / 255
b = c.blue / 255
max = Math.max r, g, b
min = Math.min r, g, b
d = max - min
h = switch max
when min then 0
when r then 60 * (g - b) / d
when g then 60 * (b - r) / d + 120
when b then 60 * (r - g) / d + 240
l = (max + min) / 2
s = if max == min
0
else if l < 0.5
d / (2 * l)
else
d / (2 - 2 * l)
c.hue = h % 360
c.saturation = s * 100
c.lightness = l * 100
c
##### `hslToRgb(c)`
#
# Converts the HSL representation to a RGB representation.
#
hslToRgb = (c) ->
c.hue -= Math.floor(c.hue/360)*360 if c.hue >= 360
c.hue -= Math.ceil(c.hue/360)*360 if c.hue < 0
c.saturation = minMax c.saturation, 0, 100
c.lightness = minMax c.lightness, 0, 100
c.alpha = minMax c.alpha, 0, 1
h = c.hue / 360
s = c.saturation / 100
l = c.lightness / 100
m2 = if l < 0.5 then l * (s + 1) else l + s - (l * s)
m1 = l * 2 - m2
r = hueToRgb m1, m2, h + 1/3
g = hueToRgb m1, m2, h
b = hueToRgb m1, m2, h - 1/3
c.red = r * 255
c.green = g * 255
c.blue = b * 255
c
##### `hueToRgb(p, q, t)`
#
# Algorithm for converting hue to each of the red, green and blue properties.
#
hueToRgb = (m1, m2, h) ->
h += 1 if h < 0
h -= 1 if h > 1
return m1 + (m2 - m1) * h * 6 if h * 6 < 1
return m2 if h * 2 < 1
return m1 + (m2 - m1) * (2/3 - h) * 6 if h * 3 < 2
m1
##### `hexify(n = '00')`
#
# Algorithm for converting each of the RGB colour channels to it's hex value.
#
hexify = (n = '00') ->
n = parseInt n
return '00' if n == 0 or isNaN n
n = Math.round minMax(n, 0, 255)
"0123456789ABCDEF".charAt((n-n%16)/16) + "0123456789ABCDEF".charAt(n%16)
##### `minMax(i, min, max)`
#
# Helper method to clip a provided number between a minimum and maximum value.
#
minMax = (i, min, max) ->
Math.min Math.max(i, min), max
##### `throwIfIncompatible(params)`
#
# Throws an error if incompatible colour properties are provided.
#
throwIfIncompatible = (params) ->
rgb = hsl = false
for key of params
rgb = true if key in ['red', 'green', 'blue']
hsl = true if key in ['hue', 'saturation', 'luminosity']
if rgb and hsl
throw 'Cannot change both RGB and HSL properties.'
[rgb, hsl]
#### Copyright
#
# Copyright (c) 2010-2011 [PI:NAME:<NAME>END_PI](http://aaronrussell.co.uk).
# Licensed under the [MIT license](http://www.opensource.org/licenses/mit-license.php).
|
[
{
"context": "m: ({gameKey, userAgent} = {}) =>\n gameKey ?= 'freeroam'\n userAgent ?= navigator?.userAgent\n\n isApp",
"end": 2101,
"score": 0.9989674687385559,
"start": 2093,
"tag": "KEY",
"value": "freeroam"
}
] | src/services/environment.coffee | FreeRoamApp/free-roam | 14 | _includes = require 'lodash/includes'
config = require '../config'
class Environment
isMobile: ({userAgent} = {}) ->
userAgent ?= navigator?.userAgent
///
Mobile
| iP(hone|od|ad)
| Android
| BlackBerry
| IEMobile
| Kindle
| NetFront
| Silk-Accelerated
| (hpw|web)OS
| Fennec
| Minimo
| Opera\ M(obi|ini)
| Blazer
| Dolfin
| Dolphin
| Skyfire
| Zune
///.test userAgent
isFacebook: ->
window? and window.name.indexOf('canvas_fb') isnt -1
isTwitch: ->
window?.Twitch
isScreenshotter: ({userAgent} = {}) ->
userAgent ?= navigator?.userAgent
_includes userAgent, 'SCREENSHOTTER'
isAndroid: ({userAgent} = {}) ->
userAgent ?= navigator?.userAgent
_includes userAgent, 'Android'
isIos: ({userAgent} = {}) ->
userAgent ?= navigator?.userAgent
Boolean userAgent?.match /iP(hone|od|ad)/g
isNativeApp: (gameKey, {userAgent} = {}) ->
userAgent ?= navigator?.userAgent
Boolean gameKey and
_includes(userAgent?.toLowerCase(), " #{gameKey}/")
isMainApp: (gameKey, {userAgent} = {}) ->
userAgent ?= navigator?.userAgent
Boolean gameKey and
_includes(userAgent?.toLowerCase(), " #{gameKey}/#{gameKey}")
isGroupApp: (groupAppKey, {userAgent} = {}) ->
userAgent ?= navigator?.userAgent
Boolean groupAppKey and
_includes(userAgent?.toLowerCase(), " freeroam/#{groupAppKey}/")
getAppKey: ({userAgent} = {}) ->
userAgent ?= navigator?.userAgent
matches = userAgent.match /freeroam\/([a-zA-Z0-9-]+)/
matches?[1] or 'browser'
getChromeVerison: ({userAgent} = {}) ->
userAgent ?= navigator?.userAgent
matches = userAgent.match /Chrome\/(.+?)\./
version = parseInt matches?[1]
if isNaN version
false
else
version
getAppVersion: (gameKey, {userAgent} = {}) ->
userAgent ?= navigator?.userAgent
regex = new RegExp("(#{gameKey})\/(?:[a-zA-Z0-9]+/)?([0-9\.]+)")
matches = userAgent.match(regex)
matches?[2]
getPlatform: ({gameKey, userAgent} = {}) =>
gameKey ?= 'freeroam'
userAgent ?= navigator?.userAgent
isApp = @isNativeApp gameKey, {userAgent}
if @isFacebook() then 'facebook'
else if @isTwitch() then 'twitch'
else if isApp and @isIos(gameKey, {userAgent}) then 'ios'
else if isApp and @isAndroid({userAgent}) then 'android'
else 'web'
module.exports = new Environment()
| 215862 | _includes = require 'lodash/includes'
config = require '../config'
class Environment
isMobile: ({userAgent} = {}) ->
userAgent ?= navigator?.userAgent
///
Mobile
| iP(hone|od|ad)
| Android
| BlackBerry
| IEMobile
| Kindle
| NetFront
| Silk-Accelerated
| (hpw|web)OS
| Fennec
| Minimo
| Opera\ M(obi|ini)
| Blazer
| Dolfin
| Dolphin
| Skyfire
| Zune
///.test userAgent
isFacebook: ->
window? and window.name.indexOf('canvas_fb') isnt -1
isTwitch: ->
window?.Twitch
isScreenshotter: ({userAgent} = {}) ->
userAgent ?= navigator?.userAgent
_includes userAgent, 'SCREENSHOTTER'
isAndroid: ({userAgent} = {}) ->
userAgent ?= navigator?.userAgent
_includes userAgent, 'Android'
isIos: ({userAgent} = {}) ->
userAgent ?= navigator?.userAgent
Boolean userAgent?.match /iP(hone|od|ad)/g
isNativeApp: (gameKey, {userAgent} = {}) ->
userAgent ?= navigator?.userAgent
Boolean gameKey and
_includes(userAgent?.toLowerCase(), " #{gameKey}/")
isMainApp: (gameKey, {userAgent} = {}) ->
userAgent ?= navigator?.userAgent
Boolean gameKey and
_includes(userAgent?.toLowerCase(), " #{gameKey}/#{gameKey}")
isGroupApp: (groupAppKey, {userAgent} = {}) ->
userAgent ?= navigator?.userAgent
Boolean groupAppKey and
_includes(userAgent?.toLowerCase(), " freeroam/#{groupAppKey}/")
getAppKey: ({userAgent} = {}) ->
userAgent ?= navigator?.userAgent
matches = userAgent.match /freeroam\/([a-zA-Z0-9-]+)/
matches?[1] or 'browser'
getChromeVerison: ({userAgent} = {}) ->
userAgent ?= navigator?.userAgent
matches = userAgent.match /Chrome\/(.+?)\./
version = parseInt matches?[1]
if isNaN version
false
else
version
getAppVersion: (gameKey, {userAgent} = {}) ->
userAgent ?= navigator?.userAgent
regex = new RegExp("(#{gameKey})\/(?:[a-zA-Z0-9]+/)?([0-9\.]+)")
matches = userAgent.match(regex)
matches?[2]
getPlatform: ({gameKey, userAgent} = {}) =>
gameKey ?= '<KEY>'
userAgent ?= navigator?.userAgent
isApp = @isNativeApp gameKey, {userAgent}
if @isFacebook() then 'facebook'
else if @isTwitch() then 'twitch'
else if isApp and @isIos(gameKey, {userAgent}) then 'ios'
else if isApp and @isAndroid({userAgent}) then 'android'
else 'web'
module.exports = new Environment()
| true | _includes = require 'lodash/includes'
config = require '../config'
class Environment
isMobile: ({userAgent} = {}) ->
userAgent ?= navigator?.userAgent
///
Mobile
| iP(hone|od|ad)
| Android
| BlackBerry
| IEMobile
| Kindle
| NetFront
| Silk-Accelerated
| (hpw|web)OS
| Fennec
| Minimo
| Opera\ M(obi|ini)
| Blazer
| Dolfin
| Dolphin
| Skyfire
| Zune
///.test userAgent
isFacebook: ->
window? and window.name.indexOf('canvas_fb') isnt -1
isTwitch: ->
window?.Twitch
isScreenshotter: ({userAgent} = {}) ->
userAgent ?= navigator?.userAgent
_includes userAgent, 'SCREENSHOTTER'
isAndroid: ({userAgent} = {}) ->
userAgent ?= navigator?.userAgent
_includes userAgent, 'Android'
isIos: ({userAgent} = {}) ->
userAgent ?= navigator?.userAgent
Boolean userAgent?.match /iP(hone|od|ad)/g
isNativeApp: (gameKey, {userAgent} = {}) ->
userAgent ?= navigator?.userAgent
Boolean gameKey and
_includes(userAgent?.toLowerCase(), " #{gameKey}/")
isMainApp: (gameKey, {userAgent} = {}) ->
userAgent ?= navigator?.userAgent
Boolean gameKey and
_includes(userAgent?.toLowerCase(), " #{gameKey}/#{gameKey}")
isGroupApp: (groupAppKey, {userAgent} = {}) ->
userAgent ?= navigator?.userAgent
Boolean groupAppKey and
_includes(userAgent?.toLowerCase(), " freeroam/#{groupAppKey}/")
getAppKey: ({userAgent} = {}) ->
userAgent ?= navigator?.userAgent
matches = userAgent.match /freeroam\/([a-zA-Z0-9-]+)/
matches?[1] or 'browser'
getChromeVerison: ({userAgent} = {}) ->
userAgent ?= navigator?.userAgent
matches = userAgent.match /Chrome\/(.+?)\./
version = parseInt matches?[1]
if isNaN version
false
else
version
getAppVersion: (gameKey, {userAgent} = {}) ->
userAgent ?= navigator?.userAgent
regex = new RegExp("(#{gameKey})\/(?:[a-zA-Z0-9]+/)?([0-9\.]+)")
matches = userAgent.match(regex)
matches?[2]
getPlatform: ({gameKey, userAgent} = {}) =>
gameKey ?= 'PI:KEY:<KEY>END_PI'
userAgent ?= navigator?.userAgent
isApp = @isNativeApp gameKey, {userAgent}
if @isFacebook() then 'facebook'
else if @isTwitch() then 'twitch'
else if isApp and @isIos(gameKey, {userAgent}) then 'ios'
else if isApp and @isAndroid({userAgent}) then 'android'
else 'web'
module.exports = new Environment()
|
[
{
"context": "3nd3} and chain A;')\n cmd.do('run ${3:/Users/blaine-mooers/Scripts/PyMOLScripts/msms_pymol.py};')\n cmd.",
"end": 13799,
"score": 0.9934656620025635,
"start": 13786,
"tag": "USERNAME",
"value": "blaine-mooers"
},
{
"context": "ells in all directions. This script was written by Thomas Holder.':\n 'prefix': 'sc222'\n 'body': '''\n cm",
"end": 19242,
"score": 0.9997041821479797,
"start": 19229,
"tag": "NAME",
"value": "Thomas Holder"
},
{
"context": "\n 'body': '''\n cmd.do('https://github.com/MooersLab/pymolsnips/blob/master/README.md')\n \n $",
"end": 39387,
"score": 0.9149256348609924,
"start": 39378,
"tag": "USERNAME",
"value": "MooersLab"
},
{
"context": " cmd.do(' The ipymol module was developed by Carlos Hernandez:')\n cmd.do(' ')\n cmd.do(' https:/",
"end": 53175,
"score": 0.9998868107795715,
"start": 53159,
"tag": "NAME",
"value": "Carlos Hernandez"
},
{
"context": "d.do(' ')\n cmd.do(' https://github.com/cxhernandez/ipymol')\n cmd.do(' ')\n cmd.do(' T",
"end": 53248,
"score": 0.9992146492004395,
"start": 53237,
"tag": "USERNAME",
"value": "cxhernandez"
},
{
"context": "ip install git+pip install git+https://github.com/cxhernandez/ipymol.git@2a30d6ec1588434e6f0f72a1d572444f89ff53",
"end": 53862,
"score": 0.9993327260017395,
"start": 53851,
"tag": "USERNAME",
"value": "cxhernandez"
},
{
"context": ")\n cmd.do(' Copyright:')\n cmd.do(' Blaine Mooers and the OU Board of Regents')\n cmd.do(' U",
"end": 55324,
"score": 0.9998312592506409,
"start": 55311,
"tag": "NAME",
"value": "Blaine Mooers"
},
{
"context": ")\n cmd.do(' Copyright:')\n cmd.do(' Blaine Mooers and the OU Board of Regents')\n cmd.do(' U",
"end": 61025,
"score": 0.999821662902832,
"start": 61012,
"tag": "NAME",
"value": "Blaine Mooers"
},
{
"context": "ochem.queensu.ca/~rlc/work/pymol/draw_links.py] by Robert Campbell.':\n 'prefix': 'drawLinks'\n 'body': '''\n ",
"end": 65331,
"score": 0.999781608581543,
"start": 65316,
"tag": "NAME",
"value": "Robert Campbell"
},
{
"context": "iochem.queensu.ca/~rlc/work/pymol/draw_links.py by Robert Campbell')\n cmd.do('# To connect the alpha carbons of",
"end": 65501,
"score": 0.9997487664222717,
"start": 65486,
"tag": "NAME",
"value": "Robert Campbell"
},
{
"context": "ep)')\n \n ${0}\n '''\n 'OptiAlign.py by Jason Vertree modified for aligning multiple RNA structures.':\n",
"end": 67971,
"score": 0.9998780488967896,
"start": 67958,
"tag": "NAME",
"value": "Jason Vertree"
},
{
"context": "1978.')\n cmd.do('#')\n cmd.do('# @AUTHOR: Jason Vertrees')\n cmd.do('# @COPYRIGHT: Jason Vertrees (C),",
"end": 68455,
"score": 0.9998912811279297,
"start": 68441,
"tag": "NAME",
"value": "Jason Vertrees"
},
{
"context": "THOR: Jason Vertrees')\n cmd.do('# @COPYRIGHT: Jason Vertrees (C), 2005-2007')\n cmd.do('# @LICENSE: Releas",
"end": 68500,
"score": 0.9998868703842163,
"start": 68486,
"tag": "NAME",
"value": "Jason Vertrees"
},
{
"context": ")\n cmd.do('# Jan. 29, 2020 ')\n cmd.do('# Blaine Mooers, PhD')\n cmd.do('# Univ. of Oklahoma Health S",
"end": 69755,
"score": 0.999865710735321,
"start": 69742,
"tag": "NAME",
"value": "Blaine Mooers"
},
{
"context": " files with a common file stem. The is a script by Robert Campbell that updated for Python3.':\n 'prefix': 'loadMa",
"end": 75869,
"score": 0.9997851848602295,
"start": 75854,
"tag": "NAME",
"value": "Robert Campbell"
},
{
"context": " 'body': '''\n cmd.do('# Copyright (c) 2004 Robert L. Campbell')\n cmd.do('#')\n cmd.do('# Modified for ",
"end": 75997,
"score": 0.9998868703842163,
"start": 75979,
"tag": "NAME",
"value": "Robert L. Campbell"
},
{
"context": ")\n cmd.do('# Jan. 29, 2020 ')\n cmd.do('# Blaine Mooers, PhD')\n cmd.do('# Univ. of Oklahoma Health S",
"end": 76129,
"score": 0.9998777508735657,
"start": 76116,
"tag": "NAME",
"value": "Blaine Mooers"
},
{
"context": "cartoons after loading the dssr_block.py script by Thomas Holder.':\n 'prefix': 'dssrBlock'\n 'body': '''\n ",
"end": 78603,
"score": 0.9937956929206848,
"start": 78590,
"tag": "NAME",
"value": "Thomas Holder"
},
{
"context": "d blocks after loading the dssr_block.py script by Thomas Holder. The x3dna-dssr executable needs to be in the PAT",
"end": 79015,
"score": 0.9470787048339844,
"start": 79002,
"tag": "NAME",
"value": "Thomas Holder"
},
{
"context": " example after loading the dssr_block.py script by Thomas Holder. The x3dna-dssr executable needs to be in the PAT",
"end": 79326,
"score": 0.9997780323028564,
"start": 79313,
"tag": "NAME",
"value": "Thomas Holder"
},
{
"context": "coloring after loading the dssr_block.py script by Thomas Holder. The x3dna-dssr executable needs to be in the PAT",
"end": 79659,
"score": 0.9997830390930176,
"start": 79646,
"tag": "NAME",
"value": "Thomas Holder"
},
{
"context": "Print a list of protein--ligand distances. Code by Dan Kulp. Updated for Python3.':\n 'prefix': 'listLigand",
"end": 90075,
"score": 0.9998392462730408,
"start": 90067,
"tag": "NAME",
"value": "Dan Kulp"
},
{
"context": ")\n cmd.do('Adapted and updated from script by Dan Kulp posted here')\n cmd.do('https://sourceforge.n",
"end": 90374,
"score": 0.9997597336769104,
"start": 90366,
"tag": "NAME",
"value": "Dan Kulp"
},
{
"context": "o(' ')\n cmd.do(' Pymol script copyright Matthew O'Meara and Xavier Ambroggio 2007')\n cmd.do(' ')\n",
"end": 94533,
"score": 0.9998845458030701,
"start": 94518,
"tag": "NAME",
"value": "Matthew O'Meara"
},
{
"context": "do(' Pymol script copyright Matthew O'Meara and Xavier Ambroggio 2007')\n cmd.do(' ')\n cmd.do(' Und",
"end": 94554,
"score": 0.9998793601989746,
"start": 94538,
"tag": "NAME",
"value": "Xavier Ambroggio"
},
{
"context": ".do(' Updated 15 June 2020 ')\n cmd.do(' Blaine Mooers')\n cmd.do(' ')\n cmd.do(' Notes:')",
"end": 94940,
"score": 0.999858558177948,
"start": 94927,
"tag": "NAME",
"value": "Blaine Mooers"
}
] | atompymolpysnips/pymolpysnippets.cson | MooersLab/pymolpysnips | 0 | '.source.python':
'Ambient occlussion.':
'prefix': 'ao'
'body': '''
cmd.do('set_color oxygen, [1.0,0.4,0.4];')
cmd.do('set_color nitrogen, [0.5,0.5,1.0];')
cmd.do('remove solvent;')
cmd.do('as spheres;')
cmd.do('util.cbaw;')
cmd.do('bg white;')
cmd.do('set light_count,10;')
cmd.do('set spec_count,1;')
cmd.do('set shininess, 10;')
cmd.do('set specular,0.25;')
cmd.do('set ambient,0;')
cmd.do('set direct,0;')
cmd.do('set reflect,1.5;')
cmd.do('set ray_shadow_decay_factor, 0.1;')
cmd.do('set ray_shadow_decay_range, 2;')
cmd.do('unset depth_cue;')
cmd.do('ray;')
${0}
'''
'Set ellipsoid color.':
'prefix': 'ellipcol'
'body': '''
cmd.do('set ellipsoid_color, ${1:color};')
cmd.do('${0}')
${0}
'''
'set distance labels to display 2 decimals':
'prefix': 'sigdist'
'body': '''
cmd.do('set label_distance_digits, ${1:2};')
${0}
'''
'Set angle labels to display 2 decimals places':
'prefix': 'sigang'
'body': '''
cmd.do('set label_angle_digits, ${1:2};')
${0}
'''
'Ball and stick representation. ':
'prefix': 'bs'
'body': '''
cmd.do('show sticks;')
cmd.do('set stick_radius, 0.12;')
cmd.do('set stick_ball, on;')
cmd.do('set stick_ball_ratio, 1.9;')
cmd.do('show nb_spheres;')
cmd.do('set nb_spheres_size=0.33;')
${0}
'''
'Base-stacking figure.':
'prefix': 'stack'
'body': '''
cmd.do('delete all;')
cmd.do('fetch ${1:4PCO}, type=pdb,async=0;')
cmd.do('select ${2:G2G3}, ( ((resi ${3:2} or resi ${4:3}) and chain A) or ((resi ${5:8} or resi ${6:9}) and chain B) );')
cmd.do('hide everything, element h; ')
cmd.do('remove not ${2:G2G3};')
cmd.do('bg_color white;')
cmd.do('show sticks;')
cmd.do('set stick_radius=0.14;')
cmd.do('set stick_ball, on; ')
cmd.do('set stick_ball_ratio,1.9;')
cmd.do('set_view (-0.75,0.09,0.66,-0.2,0.92,-0.35,-0.64,-0.39,-0.67,-0.0,-0.0,-43.7,7. 24,9.55,11.78,29.46,57.91,-20.0);')
cmd.do('hide everything, element H;')
cmd.do('select carbon1, element C and (resi ${4:3} or resi ${5:8}); ')
cmd.do('# select lower base pair;')
cmd.do('select carbon2, element C and (resi ${3:2} or resi ${6:9});')
cmd.do('#select upper base pair;')
cmd.do('color gray70,carbon1;')
cmd.do('color gray10,carbon2;')
cmd.do('space cmyk;')
cmd.do('distance hbond1,/${1:4PCO}//B/U`9/N3,/${1:4PCO}//A/G`2/O6;')
cmd.do('distance hbond2,/${1:4PCO}//B/U`9/O2,/${1:4PCO}//A/G`2/N1;')
cmd.do('distance hbond3,/${1:4PCO}//A/U`3/N3,/${1:4PCO}//B/G`8/O6;')
cmd.do('distance hbond4,/${1:4PCO}//A/U`3/O2,/${1:4PCO}//B/G`8/N1;')
cmd.do('color black, hbond1;')
cmd.do('color black, hbond2;')
cmd.do('color gray70, hbond3;')
cmd.do('color gray70, hbond4;')
cmd.do('show nb_spheres;')
cmd.do('set nb_spheres_size, 0.35;')
cmd.do('hide labels;')
cmd.do('ray 1600,1000;')
cmd.do('png ${1:4PCO}.png')
${0}
'''
'Biological unit.':
'prefix': 'bu'
'body': '''
cmd.do('run ~/Scripts/PyMOLScripts/quat.py; quat')
${0}
'''
'Valence bond. ':
'prefix': 'doubleBond'
'body': '''
cmd.do('set valence, 1; ')
cmd.do('set valence_mode, 1;')
${0}
'''
'Color blindness.':
'prefix': 'cblind'
'body': '''
cmd.do('run ~/Pymol-script-repo/colorblindfriendly.py;')
cmd.do('as cartoon;')
cmd.do('color cb_red, ss H;')
cmd.do('color cb_yellow,ss S;')
cmd.do('color cb_green, ss L+;')
${0}
'''
'Center pi.':
'prefix': 'centerpi'
'body': '''
cmd.do('pseudoatom pi_cent,/${1:3nd3}/${2:A}/${3:U`15}/cg+cz;')
cmd.do('dist pi_cent////ps1, b/${4:U`15}/${5:aaa};')
${0}
'''
'Color ribbon H red, strand yellow, loop green.':
'prefix': 'cribbon'
'body': '''
cmd.do('as cartoon;')
cmd.do('color red, ss H;')
cmd.do('color yellow,ss S;')
cmd.do('color green, ss L+;')
${0}
'''
'Colored spheres.':
'prefix': 'cspheres'
'body': '''
cmd.do('as spheres;')
cmd.do('color gray30, chain ${1:A};')
cmd.do('color white, chain ${2:B};')
cmd.do('color green, name CL;')
cmd.do('color brown, resn NAG;')
cmd.do('color red, resi 381;')
cmd.do('remove solvent;')
cmd.do('unset specular;')
cmd.do('set ray_trace_gain, 0;')
cmd.do('set ray_trace_mode, 3;')
cmd.do('bg_color white;')
cmd.do('set ray_trace_color, black;')
cmd.do('unset depth_cue;')
${0}
'''
'Coordinate covalent bonds to metals and H-bonds friom RNA.':
'prefix': 'coordinate'
'body': '''
cmd.do('viewport 900,600;')
cmd.do('fetch 3nd4, type=pdb, async=0;')
cmd.do('run ~/Scripts/PyMOLScripts/quat.py;')
cmd.do('quat 3nd4;')
cmd.do('show sticks;')
cmd.do('set stick_radius=0.125;')
cmd.do('hide everything, name H*;')
cmd.do('bg_color white;')
cmd.do('create coorCov, (3nd4_1 and (resi 19 or resi 119 or resi 219 or resi 319 or resi 419 or resi 519 or (resi 3 and name N7)));')
cmd.do('bond (coorCov//A/NA`19/NA),(coorCov//A/A`3/N7);')
cmd.do('bond (coorCov//A/NA`19/NA),(coorCov//A/HOH`119/O);')
cmd.do('bond (coorCov//A/NA`19/NA),(coorCov//A/HOH`219/O);')
cmd.do('bond (coorCov//A/NA`19/NA),(coorCov//A/HOH`319/O);')
cmd.do('bond (coorCov//A/NA`19/NA),(coorCov//A/HOH`519/O);')
cmd.do('distance (3nd4_1 and chain Aand resi 19 and name NA), (3nd4_1 and chain A and resi 519);')
cmd.do('distance (3nd4_1 and chain A and resi 19 and name NA), (3nd4_1 and chain A and resi 419);')
cmd.do('distance (3nd4_1 and chain A and resi 19 and name NA), (3nd4_1 and chain A and resi 319);')
cmd.do('distance (3nd4_1 and chain A and resi 19 and name NA), (3nd4_1 and chain A and resi 219);')
cmd.do('show nb_spheres; ')
cmd.do('set nb_spheres_size, .35;')
cmd.do('distance hbond1,/3nd4_1/1/A/HOH`119/O, /3nd4_1/1/A/A`3/OP2;')
cmd.do('distance hbond2,/3nd4_1/1/A/HOH`319/O, /3nd4_1/1/A/A`3/OP2;')
cmd.do('distance hbond3,/3nd4_1/1/A/HOH`91/O,/3nd4_1/1/A/HOH`119/O;')
cmd.do('distance hbond4,/3nd4_1/1/A/G`4/N7,/3nd4_1/1/A/HOH`91/O;')
cmd.do('distance hbond5,/3nd4_1/1/A/G`4/O6, /3nd4_1/1/A/HOH`419/O;')
cmd.do('distance hbond6,/3nd4_1/1/A/HOH`91/O,/3nd4_1/1/A/G`4/OP2;')
cmd.do('distance hbond7,/3nd4_1/1/A/HOH`319/O,/3nd4_1/1/A/G`2/OP2;')
cmd.do('distance hbond9,/3nd4_1/1/A/HOH`419/O,/3nd4_2/2/A/HOH`74/O;')
cmd.do('distance hbond10,/3nd4_2/2/A/C`15/O2,/3nd4_1/1/A/G`2/N2;')
cmd.do('distance hbond11, /3nd4_2/2/A/C`15/N3,/3nd4_1/1/A/G`2/N1;')
cmd.do('distance hbond12,/3nd4_2/2/A/C`15/N4,/3nd4_1/1/A/G`2/O6;')
cmd.do('distance hbond13, /3nd4_2/2/A/U`14/N3,/3nd4_1/1/A/A`3/N1;')
cmd.do('distance hbond14,3nd4_2/2/A/U`14/O4,/3nd4_1/1/A/A`3/N6;')
cmd.do('distance hbond15, /3nd4_2/2/A/C`13/N4,/3nd4_1/1/A/G`4/O6;')
cmd.do(' distance hbond16,/3nd4_2/2/A/C`13/N3, /3nd4_1/1/A/G`4/N1;')
cmd.do('distance hbond17, /3nd4_1/1/A/G`4/N2,/3nd4_2/2/A/C`13/O2;')
cmd.do('distance hbond18,/3nd4_1/1/A/G`2/N2,/3nd4_2/2/A/C`15/O2;')
cmd.do('distance hbond19,/3nd4_1/1/A/HOH`91/O,/3nd4_1/1/A/G`4/OP2; ')
cmd.do('set depth_cue=0;')
cmd.do('set ray_trace_fog=0;')
cmd.do('set dash_color, black;')
cmd.do('set label_font_id, 5;')
cmd.do('set label_size, 36;')
cmd.do('set label_position, (0.5, 1.0, 2.0);')
cmd.do('set label_color, black;')
cmd.do('set dash_gap, 0.2;')
cmd.do('set dash_width, 2.0;')
cmd.do('set dash_length, 0.2;')
cmd.do('set label_color, black;')
cmd.do('set dash_gap, 0.2;')
cmd.do('set dash_width, 2.0;')
cmd.do('set dash_length, 0.2;')
cmd.do('select carbon, element C;')
cmd.do('color yellow, carbon;')
cmd.do('disable carbon;')
cmd.do('set_view(-0.9,0.34,-0.26,0.33,0.18,-0.93,-0.27,-0.92,-0.28,-0.07,-0.23,-27.83,8.63,19.85,13.2,16.0,31.63,-20.0)')
${0}
'''
'H-bond distances.':
'prefix': 'distance'
'body': '''
cmd.do('distance ${1:dist3}, ${2:/rcsb074137//B/IOD`605/I`B}, ${3:/rcsb074137//B/IOD`605/I`A}')
${0}
'''
'Draw H-bonds. ':
'prefix': 'drawHbonds'
'body': '''
cmd.do('hide everything, hydrogens')
cmd.do('hide labels')
cmd.do('set dash_color, ${1:black}${2:yelow} ')
cmd.do('set dash_gap, 0.4')
cmd.do('set dash_radius, 0.08')
${0}
'''
'Carved isomesh representation of electron density. ':
'prefix': 'carvedIsomesh'
'body': '''
cmd.do('delete all;')
cmd.do('fetch ${1:4dgr}, async=0;')
cmd.do('fetch ${1:4dgr}, type=2fofc,async=0;')
cmd.do('select ${2:LongGlycan}, resi ${3:469:477};')
cmd.do('orient ${2:LongGlycan};')
cmd.do('remove not ${2:LongGlycan};')
cmd.do('remove name H*;')
cmd.do('isomesh 2fofcmap, ${1:4dgr}_2fofc, 1, ${2:LongGlycan}, carve = 1.8;')
cmd.do('color density, 2fofcmap; ')
cmd.do('show sticks;')
cmd.do('show spheres;')
cmd.do('set stick_radius, .07;')
cmd.do('set sphere_scale, .19;')
cmd.do('set sphere_scale, .13, elem H;')
cmd.do('set bg_rgb=[1, 1, 1];')
cmd.do('set stick_quality, 50;')
cmd.do('set sphere_quality, 4;')
cmd.do('color gray85, elem C;')
cmd.do('color red, elem O;')
cmd.do('color slate, elem N;')
cmd.do('color gray98, elem H;')
cmd.do('set stick_color, gray50;')
cmd.do('set ray_trace_mode, 1;')
cmd.do('set ray_texture, 2;')
cmd.do('set antialias, 3;')
cmd.do('set ambient, 0.5;')
cmd.do('set spec_count, 5;')
cmd.do('set shininess, 50;')
cmd.do('set specular, 1;')
cmd.do('set reflect, .1;')
cmd.do('set dash_gap, 0;')
cmd.do('set dash_color, black;')
cmd.do('set dash_gap, .15;')
cmd.do('set dash_length, .05;')
cmd.do('set dash_round_ends, 0;')
cmd.do('set dash_radius, .05;')
cmd.do('set_view (0.34,-0.72,0.61,0.8,0.56,0.22,-0.51,0.4,0.77,0.0,0.0,-81.31,44.64,-9.02,58.62,65.34,97.28,-20.0);')
cmd.do('preset.ball_and_stick("all",mode=1);')
cmd.do('draw;')
${0}
'''
'Fetch 2FoFc map as an isomesh.':
'prefix': 'fetch2FoFcIsomesh'
'body': '''
cmd.do('fetch ${1:3nd4}_2fofc, type=2fofc, async=0;')
cmd.do('isomesh 2fofcmap, ${1:3nd4_2fofc}, 1, ${2:LongGlycan}, carve = 1.8;')
${0}
'''
'Fetch cif file.':
'prefix': 'fetchCIF'
'body': '''
cmd.do('fetch ${1:3nd4}, type=cif, async=0;')
${0}
'''
'Fetch fofc map.':
'prefix': 'fetchFoFc'
'body': '''
cmd.do('fetch ${1:3nd4}, type=fofc, async=0;')
${0}
'''
'Filled rings in nucleic acids. ':
'prefix': 'filledRing'
'body': '''
cmd.do('show sticks;set cartoon_ring_mode, 3;')
cmd.do('set cartoon_ring_finder, 1;')
cmd.do('set cartoon_ladder_mode, 1;')
cmd.do('set cartoon_nucleic_acid_mode, 4;')
cmd.do('set cartoon_ring_transparency, 0.5;')
cmd.do('as cartoon;')
${0}
'''
'Get coordinates. ':
'prefix': 'getCoordinates'
'body': '''
cmd.do('print cmd.get_atom_coords('${1:/4PCO//B/G`8/OP2}');')
${0}
'''
'H-bond dashes.':
'prefix': 'hbonddash'
'body': '''
cmd.do('hide everything, hydrogens;')
cmd.do('hide labels;')
cmd.do('set dash_color, black; ')
cmd.do('set dash_gap, 0.4;')
cmd.do('set dash_radius, 0.08;')
${0}
'''
'Hbond setup. ':
'prefix': 'hbond'
'body': '''
cmd.do('hide labels;')
cmd.do('set dash_color, black ;')
cmd.do('set dash_length, ${1:0.15};')
cmd.do('set dash_gap, ${2:0.35};')
cmd.do('set dash_width, ${3:3.0};')
${0}
'''
'Hide alt loc.':
'prefix': 'hidealtloc'
'body': '''
cmd.do('select altconf, alt ${1:b} # select B alternative locators;')
cmd.do('hide everything, altconf # hide alt B locators;')
${0}
'''
'Label CA atom with single-letter residue name and residue number.':
'prefix': 'labelResnResi'
'body': '''
cmd.do('label name ca, '%s%s' %(one_letter[${1:resn}],${2:resi});')
${0}
'''
'Label SS. ':
'prefix': 'labelSS'
'body': '''
cmd.do('alter ${1:}, ss='%1';')
cmd.do('label (%2),'%3';')
${0}
'''
'Load PDB ball-and-stick.':
'prefix': 'loadPDBbs'
'body': '''
cmd.do('fetch ${1:3nd3},name=${1:3nd3}, type=pdb, async=0')
cmd.do('hide (name H*);')
cmd.do('hide lines;')
cmd.do('show sticks;')
cmd.do('set stick_radius, ${2:1.2};')
cmd.do('set nb_sphere_radius, ${3:0.35};')
cmd.do('orient;')
${0}
'''
'Load PDB nb spheres. ':
'prefix': 'loadPDBnb'
'body': '''
cmd.do('fetch ${1:3nd3},name=${1:3nd3}, type=pdb, async=0;')
cmd.do('orient;')
cmd.do('set stick_radius, ${2:1.2};')
cmd.do('hide (name H*);')
cmd.do('set nb_sphere_size, ${3:0.35};')
cmd.do('set nb_spheres_quality, ${4:1};')
cmd.do('show nb_spheres;')
${0}
'''
'Measure surface area. ':
'prefix': 'ms'
'body': '''
cmd.do('fetch ${1:3nd3},name=${1:3nd3}, type=pdb, async=0')
cmd.do('select ${2:temp}, ${3:3nd3} and chain A;')
cmd.do('run ${3:/Users/blaine-mooers/Scripts/PyMOLScripts/msms_pymol.py};')
cmd.do('calc_msms_area ${2:temp};')
${0}
'''
'Molscript ribbons.':
'prefix': 'molscriptRibbon'
'body': '''
cmd.do('set cartoon_highlight_color, grey;')
cmd.do('show cartoon;')
cmd.do('set cartoon_flat_sheets, 0;')
cmd.do('set cartoon_smooth_loops, 0;')
cmd.do('set cartoon_fancy_helices, 1;')
${0}
'''
'One letter amino acid. ':
'prefix': 'oneLetter'
'body': '''
cmd.do('one_leVer%={'VAL':'V',%'ILE':'I',%'LEU':'L',%'GLU':'E',%'GLN':'Q','ASP':'D',%')
cmd.do(''ASN':'N',%'HIS':'H',%'TRP':'W',%'PHE':'F',%'TYR':'Y',%'ARG':'R',%'LYS':'K',%')
cmd.do(''SER':'S',%'THR':'T',%'MET':'M',%'ALA':'A',%'GLY':'G',%'PRO':'P',%'CYS':'C'}%')
${0}
'''
'Print Fasta from PDB file. ':
'prefix': 'fasta'
'body': '''
cmd.do('print cmd.get_fastastr('all')')
${0}
'''
'Position label with pseudoatom. ':
'prefix': 'pseudolabel'
'body': '''
cmd.do('pseudoatom ${1:forLabel};')
cmd.do('label ${1:forLabel}, '%0';')
cmd.do('set label_color, ${2:red};')
${0}
'''
'Rotate about axis.':
'prefix': 'rotate'
'body': '''
cmd.do('rotate ${1:x}, ${2:45}, ${3:pept};')
${0}
'''
'Stereo draw.':
'prefix': 'stereoDraw'
'body': '''
cmd.do('stereo walleye; ')
cmd.do('set ray_shadow, off; ')
cmd.do('#draw 3200,2000;')
cmd.do('draw ${1:1600,1000}; ')
cmd.do('png ${2:aaa}.png')
cmd.do('${0}')
${0}
'''
'Stereo ray.':
'prefix': 'stereoRay'
'body': '''
cmd.do('stereo; ')
cmd.do('set ray_shadow, off;')
cmd.do('ray ${1:2400,1200};')
cmd.do('png ${2:aaa}.png;')
${0}
'''
'Three electron density as Isomesh. ':
'prefix': 'threeMapsIsomesh'
'body': '''
cmd.do('load ${1:4dgr}.pdb')
cmd.do('# Make sure to rename map file so that ')
cmd.do('# the root filename differs from pdb root filename')
cmd.do('load ${1:4dgr}_2fofc.ccp4, 2fofc;')
cmd.do('load ${1:4dgr}_fofc.ccp4, fofc;')
cmd.do('select ${2:glycan}, resid 200 or (resid 469:477);')
cmd.do('isomesh ${3:mesh1}, 2fofc, 1.0, ${2:glycan};')
cmd.do('color density, ${3:mesh1};')
cmd.do('isomesh ${4:mesh2}, fofc, 3.0, ${2:glycan};')
cmd.do('color green, ${4:mesh2};')
cmd.do('isomesh ${5:mesh3}, fofc, -3.0, ${2:glycan};')
cmd.do('color red, ${5:mesh3};')
${0}
'''
'Turn about axis. ':
'prefix': 'turnAboutAxis'
'body': '''
cmd.do('turn ${1:x},${2:90};')
${0}
'''
'Volume ramp.':
'prefix': 'volumeRamp'
'body': '''
cmd.do('cmd.volume_ramp_new('ramp_magenta', [0.01, 1.00, 0.00, 1.00, 0.00, 4.01, 1.00, 0.00, 1.00, 0.10, 4.99, 1.00, 0.00, 1.00, 0.50,])')
${0}
'''
'Set radius of ball used to make solvent accessible surface.':
'prefix': 'solventRadius'
'body': '''
cmd.do('set solvent_radius, ${1:1.55};')
${0}
'''
'Scale the radius and color of atoms as spheres by property in the B-value column.':
'prefix': 'scaleRadiusColor'
'body': '''
cmd.do('bg_color white;')
cmd.do('hide everything;')
cmd.do('show spheres;')
cmd.do('set stick_radius = 0.1;')
cmd.do('hide everything, HET;')
cmd.do('show spheres, HET;')
cmd.do('set sphere_quality=3;')
cmd.do('show sticks, resi $1{1102};')
cmd.do('from pymol import stored;')
cmd.do('# set the stored array equal to the b−values or use your own values; ')
cmd.do('stored.bb = [ ];')
cmd.do('iterate all, stored.bb.append(b);')
cmd.do('# execute a python−block;')
cmd.do('python;')
cmd.do('# scale the b−values;')
cmd.do('M = max(stored.bb);')
cmd.do('scaledBB = map(lambda x: float (x/M), stored.bb);')
cmd.do('count = 0;')
cmd.do('# set the sphere radii independently;')
cmd.do('#[(cmd.set("sphere_scale", x ,"ID %s"%count); count = count + 1) for x in scaledBB]')
cmd.do('for x in scaledBB:')
cmd.do(' cmd.set("sphere_scale", x ,"ID %s"%count)')
cmd.do(' count = count + 1')
cmd.do('python end')
cmd.do('spectrum b, selection=${2:4gdx};')
cmd.do('space cmyk;')
cmd.do('set specular_intensity , 0.25;')
${0}
'''
'Return settings in rounded format.':
'prefix': 'rv'
'body': '''
cmd.do('run roundview.py;')
${0}
'''
'Save png flle with timestamp':
'prefix': 'spng'
'body': '''
cmd.do('python;')
cmd.do('import datetime;')
cmd.do('from pymol import cmd; ')
cmd.do('DT =datetime.datetime.now().strftime("yr%Ymo%mday%dhr%Hmin%M");')
cmd.do('s = str(DT); ')
cmd.do('cmd.save(stemName+s+".png"); ')
cmd.do('end python;')
${0}
'''
'Save pse flle with timestamp':
'prefix': 'spse'
'body': '''
cmd.do('python;')
cmd.do('import datetime;')
cmd.do('from pymol import cmd; ')
cmd.do('DT =datetime.datetime.now().strftime("yr%Ymo%mday%dhr%Hmin%M");')
cmd.do('s = str(DT); ')
cmd.do('cmd.save(stemName+s+".pse"); ')
cmd.do('end python;')
${0}
'''
'Run supercell script to generate three cells in all directions. This script was written by Thomas Holder.':
'prefix': 'sc222'
'body': '''
cmd.do('run ${1:$HOME/Scripts/PyMOLscripts/supercell.py};')
cmd.do('supercell 2, 2, 2, , orange, supercell2, 1;')
${0}
'''
'The pearl effect is made with two spheres with the outer sphere being transparent.':
'prefix': 'pearl'
'body': '''
cmd.do('create ${1:sodium2}, ${2:sodium1};')
cmd.do('set sphere_transparency, 0.4, ${1:sodium2};')
cmd.do('set sphere_scale, 1.05, ${1:sodium2};')
cmd.do('ray;')
${0}
'''
'Blur the background atoms.':
'prefix': 'fog'
'body': '''
cmd.do('set fog, 0;')
${0}
'''
'Remove waters from molecular object.':
'prefix': 'rmwater'
'body': '''
cmd.do('remove resn HOH;')
${0}
'''
'Set color name to a RGB code.':
'prefix': 'setcolor'
'body': '''
cmd.do('set_color ${1:bark}, [${2:0.1, ${3:0.1}, ${4:0.1}];')
cmd.do('color ${1:bark}, ${5:protein};')
${0}
'''
'Duplicate object.':
'prefix': 'duplicateObject'
'body': '''
cmd.do('create ${1:t4l}, ${2:1lw9};')
${0}
'''
'Select a chain. ':
'prefix': 'selectChain'
'body': '''
cmd.do('select rna, chain B;')
${0}
'''
'Select residues by name.':
'prefix': 'selectResidues'
'body': '''
cmd.do('select aromatic, resn phe+tyr+trp;')
${0}
'''
'Select residues by a range of numbers.':
'prefix': 'selectResi'
'body': '''
cmd.do('select ${!:se}; resi ${2:1-100};')
${0}
'''
'Select atoms by element.':
'prefix': 'selectElement'
'body': '''
cmd.do('select ${1:oxygen}, elem ${2:O}')
${0}
'''
'Select atoms by name.':
'prefix': 'selectName'
'body': '''
cmd.do('select ${1:oxygen2}, name ${2:O2}')
${0}
'''
'Select atoms by alpha helices.':
'prefix': 'selectHelices'
'body': '''
cmd.do('select ${1:helices}, ss h; ')
${0}
'''
'Select atoms by beta strands.':
'prefix': 'selectStrands'
'body': '''
cmd.do('select ${1:strands}, ss s; ')
${0}
'''
'Select atoms by beta loops.':
'prefix': 'selectLoops'
'body': '''
cmd.do('select ${1:loops}, ss l;')
${0}
'''
'Select all nitrogen atom in a selelction except from lysine.':
'prefix': 'selectAllBut'
'body': '''
cmd.do('select ${1:select1}, elem ${2:N} and chain ${3:A} and not resn ${4:LYS};')
${0}
'''
'Select atoms within a radius around a ligand.':
'prefix': 'selectAtomsAround'
'body': '''
cmd.do('select ${1:nearby}, resn ${2:drug} around ${3:5};')
${0}
'''
'Select residues within a radius around a ligand.':
'prefix': 'selectResiduesAround'
'body': '''
cmd.do('select ${1:nearby}, br. resn ${2:drug} around ${3:5};')
${0}
'''
'Undo a selection.':
'prefix': 'undoSelection'
'body': '''
cmd.do('disable ${1:sele}; ')
${0}
'''
'Load a pdb file in the current directory.':
'prefix': 'loadPDBfile'
'body': '''
cmd.do('load ${1:my.pdb};')
${0}
'''
'Save a png file of current scene to the current directory.':
'prefix': 'savePNG'
'body': '''
cmd.do('png ${1:saveMe.png};')
${0}
'''
'Set the ring mode to a value between 0 and 6 in cartoons of nucleic acids.':
'prefix': 'ringMode'
'body': '''
cmd.do('show cartoon, ${1:rna}; set cartoon_ring_mode, ${2:3};')
${0}
'''
'In cartoons, hide the backbone atoms of selected residues when showing then as sticks.':
'prefix': 'sidehChainHelper'
'body': '''
cmd.do('set cartoon_side_chain_helper, on;')
${0}
'''
'Create a new object from part of an existing object.':
'prefix': 'extractPartObj'
'body': '''
cmd.do('extract new_obj, chain A;')
${0}
'''
'Create a putty cartoon.':
'prefix': 'puttyCartoon'
'body': '''
cmd.do('show cartoon;')
cmd.do('cartoon putty;')
cmd.do('unset cartoon_smooth_loops;')
cmd.do('unset cartoon_flat_sheets;')
${0}
'''
'Trun off magenta squares on current selection.':
'prefix': 'hideSelection'
'body': '''
cmd.do('indicate none')
${0}
'''
'Turn on discrete colors between secondary structure elements.':
'prefix': 'discreteCartoonColoring'
'body': '''
cmd.do('set cartoon_discrete_colors, on;')
${0}
'''
'Display all symmetry mates in one unit cell. Uses supercell.py in $HOME/Scripts/PyMOLscripts/.':
'prefix': 'sc111'
'body': '''
cmd.do('run $HOME/Scripts/PyMOLscripts/supercell.py;')
cmd.do('supercell 1, 1, 1, , orange, supercell1, 1;')
${0}
'''
'Display SAXS envelope':
'prefix': 'saxsEnvelope'
'body': '''
cmd.do('alter ${1:refine_A_Ave_SM_015_0_370-374-0r}, vdw=3.0;')
cmd.do('set solvent_radius = 3.0;')
${0}
'''
'Set additional path for PyMOL to search on startup':
'prefix': 'setpath'
'body': '''
cmd.do('os.environ["PATH"] += os.pathsep +${1: '/Applications/ATSAS/bin'};')
${0}
'''
'Set path for location to save fetched pdb files. ':
'prefix': 'fetchPath'
'body': '''
cmd.do('set fetch_path, ${1:/Users/blaine/pdbFiles};')
${0}
'''
'Set antialias to get smooth edges':
'prefix': 'antialias'
'body': '''
cmd.do('set antialias, 1;')
${0}
'''
'Print list of active pymolrc files.':
'prefix': 'lspymolrc'
'body': '''
cmd.do('print invocation.options.deferred;')
${0}
'''
'Set number of decimals places to show in distance labels. ':
'prefix': 'sigDigits'
'body': '''
cmd.do('set label_distance_digits, ${1:2};')
cmd.do('set label_angle_digits, ${2:2};')
${0}
'''
'Label the CA atoms with the Ala333 style format':
'prefix': 'labelCAs'
'body': '''
cmd.do('label name CA,"%s%s" % (resn,resi);')
${0}
'''
'Label waters HOH.':
'prefix': 'labelWatersHOH'
'body': '''
cmd.do('label resn HOH ,"%s%s" % (resn,resi);')
${0}
'''
'Label waters W.':
'prefix': 'labelWatersW'
'body': '''
cmd.do('label resn HOH ,"W%s" % (resi);')
${0}
'''
'Find hbonds around a residue.':
'prefix': 'findHbonds'
'body': '''
cmd.do('remove element h; distance hbonds, all, all, 3.2, mode=2;')
${0}
'''
'Print the B-factors of a residue. ':
'prefix': 'printBs'
'body': '''
cmd.do('remove element h; iterate resi %{1:133}, print resi, name,b;')
${0}
'''
'Label the main chain atoms by resn,resi,atom name.':
'prefix': 'labelMainChain'
'body': '''
cmd.do('label name n+c+o+ca,"%s%s%s" % (resn,resi,name);')
${0}
'''
'Print B factors of part B of a residue.':
'prefix': 'printBspartB'
'body': '''
cmd.do('iterate resi %{1:38} and altloc %{2:B}, print resi, name, alt, b;')
${0}
'''
'Print B--factors for a residue with the B-factors rounded off to two decimal places.':
'prefix': 'printBs2digits'
'body': '''
cmd.do('iterate (resi %{1:133}), print(name + " %.2f" % b);')
${0}
'''
'Write the command reference to html file in the present working directory. ':
'prefix': 'writeCommandReference2HTML'
'body': '''
cmd.do('cmd.write_html_ref('pymol-command-ref.html');')
${0}
'''
'Average the B-factors by using a regular list as opposed to a stored list in PyMOL. Edit the selection as needed.':
'prefix': 'averageB'
'body': '''
cmd.do('"""Uses a regular list as opposed to PyMOL's stored list. Edit the selection as needed."""')
cmd.do('Bfactors = []; ')
cmd.do('iterate (resi ${1:133}), Bfactors.append(b);')
cmd.do('print("Sum = ", "%.2f" % (sum(Bfactors)));')
cmd.do('print("Number of atoms = ", len(Bfactors));')
cmd.do('print( 'Average B =' , "%.2f" % ( sum(Bfactors)/float(len(Bfactors))));')
${0}
'''
'AveBResiX, prints the resiude number and the average bfactor. ':
'prefix': 'aveB4resiX'
'body': '''
cmd.do('""""AveBResiX, prints the resiude number and the average bfactor. ')
cmd.do('Uses reduce and lambda, builtin Python functional porgramming functions. ')
cmd.do('Note that you need to convert the length of the list of Bfactors from an integer to a float before division into the sum. ')
cmd.do('"""')
cmd.do('Bfactors = [];')
cmd.do('iterate (resi ${1:133}), Bfactors.append(b);')
cmd.do('print( "Average B-factor of residue ", %{1:133} , " = ", "%.2f" %(reduce(lambda x, y: x + y, Bfactors) / float(len(Bfactors))) )')
${0}
'''
'Print name and b-factor for a residue.':
'prefix': 'printNameB4ResiX'
'body': '''
cmd.do('Bfac_dict = { 'Bfactors3' : [] };cmd.iterate("(resi 133)","Bfactors3.append((name, b))", space=Bfac_dict); for i,j in Bfac_dict['Bfactors3']: print("%s %.2f" % (i,j));')
${0}
'''
'Print resn, resi, atom name, and b-factor. ':
'prefix': 'printResiResnNameB4ResiX'
'body': '''
cmd.do('Bfac_dict = { 'Bfactors3' : [] };cmd.iterate("(resi 133)","Bfactors3.append((resn,resi,name, b))", space=Bfac_dict); for i,j,k,l in Bfac_dict['Bfactors3']: print("%s %s %s %.2f" % (i,j,k,l));')
${0}
'''
'Print name and b-factor for a residue or residue range (e.g. 81:120). The noH variant.':
'prefix': 'printResiResnNameB4ResiXNoH'
'body': '''
cmd.do('Bfac_dict = { 'Bfactors3' : [] };cmd.iterate("(resi 133 and not elem H)","Bfactors3.append((resn,resi,name, b))", space=Bfac_dict); for i,j,k,l in Bfac_dict['Bfactors3']: print("%s %s %s %.2f" % (i,j,k,l));')
${0}
'''
'Make the background of the internal gui transparent to expand viewport.':
'prefix': 'internalGUImode2 '
'body': '''
cmd.do('internal_gui_mode=2;')
${0}
'''
'Set the width of the internal gui.
':
'prefix': 'internalGUIwidth'
'body': '''
cmd.do('internal_gui_width=%{1:20};')
${0}
'''
'Print document string of a function.':
'prefix': 'printDoc'
'body': '''
cmd.do('print ${1:my_func}.__doc__;')
${0}
'''
'List all snips by tab trigger and description':
'prefix': 'lsSnips'
'body': '''
cmd.do('"""Tab trigger Description')
cmd.do('--------------------------- --------------------------------------------------------------------------------------------------------------------------------------------------------------------')
cmd.do('antialias Set antialias to get smooth edges')
cmd.do('ao Ambient occlussion.')
cmd.do('aveB4resiX AveBResiX, prints the resiude number and the average bfactor.')
cmd.do(' Uses reduce and lambda, builtin Python functional porgramming functions.')
cmd.do(' Note that you need to convert the length of the list of Bfactors from an integer to a float before division into the sum.')
cmd.do('averageB Uses a regular list as opposed to PyMOL's stored list. Edit the selection as needed.')
cmd.do('bs Ball and stick representation.')
cmd.do('bu Biological unit.')
cmd.do('carvedDensity Carved electron density.')
cmd.do('cblind Color blindness.')
cmd.do('centerpi Center pi.')
cmd.do('coordinate Coordinate covalent bonds to metals and H-bonds friom RNA.')
cmd.do('cribbon Color ribbon H red, strand yellow, loop green.')
cmd.do('cspheres Colored spheres.')
cmd.do('discreteCartoonColoring Turn on discrete colors between secondary structure elements.')
cmd.do('distance H-bond distances.')
cmd.do('doubleBond Valence bond.')
cmd.do('drawHbonds Draw H-bonds.')
cmd.do('duplicateObject Duplicate object.')
cmd.do('ellipcol Set ellipsoid color.')
cmd.do('extractPartObj Create a new object from part of an existing object.')
cmd.do('fasta Print Fasta from PDB file.')
cmd.do('fetch2FoFc Fetch 2FoFc map.')
cmd.do('fetchCIF Fetch cif file.')
cmd.do('fetchFoFc Fetch fofc map.')
cmd.do('fetchPath Set path for location to save fetched pdb files.')
cmd.do('filledRing Filled rings in nucleic acids.')
cmd.do('findHbonds Find hbonds around a residue.')
cmd.do('fog Blur the background atoms.')
cmd.do('getCoordinates Get coordinates.')
cmd.do('hbond Hbond setup.')
cmd.do('hbonddash H-bond dashes.')
cmd.do('hideSelection Trun off magenta squares on current selection.')
cmd.do('hidealtloc Hide alt loc.')
cmd.do('internalGUImode2 Makes the background of the internal gui transparent with the viewport extended into this region of the gui. This may be a useful mode for workshops.')
cmd.do('internalGUIwidth Set the width of the internal gui.')
cmd.do('labelCAs Label the CA atoms with the Ala333 style format')
cmd.do('labelMainChain Label the main chain atoms by resn,resi,atom name.')
cmd.do('labelResnResi Label CA atom with residue name and residue number.')
cmd.do('labelSS Label SS.')
cmd.do('labelWatersHOH Label waters HOH.')
cmd.do('labelWatersW Label waters W.')
cmd.do('loadPDBbs Load PDB ball-and-stick.')
cmd.do('loadPDBfile Load a pdb file in the current directory.')
cmd.do('loadPDBnb Load PDB nb spheres.')
cmd.do('lsSnips List all snips by tab trigger and description')
cmd.do('lspymolrc Print list of active pymolrc files.')
cmd.do('molscriptRibbon Molscript ribbons.')
cmd.do('ms Measure surface area.')
cmd.do('oneLetter One letter amino acid.')
cmd.do('pearl The pearl effect is made with two spheres with the outer sphere being transparent.')
cmd.do('printBs Print the B-factors of a residue.')
cmd.do('printBs2digits Print B-values for a residue with the B's rounded off to two decimal places.')
cmd.do('printBspartB Print B factors of part B of a rsidues.')
cmd.do('printDoc Print document string of a function.')
cmd.do('printNameB4ResiX Print name and b-factor for a rsidue. You can change this to a named selection or a residue range ( e.g., resi 133:155). Use the noH variant if H atoms are present.')
cmd.do('printResiResnNameB4ResiX Print resn, resi, atom name, and b-factor.')
cmd.do('printResiResnNameB4ResiXNoH Print name and b-factor for a rsidue. You can change this to a named selection or a residue range ( e.g., resi 133:155). The noH variant.')
cmd.do('pseudolabel Position label with pseudoatom.')
cmd.do('puttyCartoon Create a putty cartoon.')
cmd.do('ringMode Set the ring mode to a value between 0 and 6 in cartoons of nucleic acids.')
cmd.do('rmwater Remove waters from molecular object.')
cmd.do('rotate Rotate about axis.')
cmd.do('rv Return settings in rounded format.')
cmd.do('savePNG Save a png file of current scene to the current directory.')
cmd.do('saxsEnvelope Display SAXS envelope')
cmd.do('sc111 Display all symmetry mates in one unit cell. Asumes supercell.py (sse PyMOL Wiki) is in $HOME/Scripts/PyMOLscripts/.')
cmd.do('sc222 Run Tom Holder's supercell script to generate three cells in all directions.')
cmd.do('scaleRadiusColor Scale the radius and color of atoms as spheres by property in the B-value column.')
cmd.do('selectAllBut Select all nitrogen atom in a selelction except from lysine.')
cmd.do('selectAtomsAround Select atoms within a radius around a ligand.')
cmd.do('selectChain Select a chain.')
cmd.do('selectElement Select atoms by elemnt.')
cmd.do('selectHelices Select atoms by alpha helices.')
cmd.do('selectLoops Select atoms by beta loops.')
cmd.do('selectName Select atoms by name.')
cmd.do('selectResi Select residues by a range of numbers.')
cmd.do('selectResidues Select residues by name.')
cmd.do('selectResiduesAround Select residues within a radius around a ligand.')
cmd.do('selectStrands Select atoms by beta strands.')
cmd.do('setcolor Set color name to a RGB code.')
cmd.do('setpath Set additional path for PyMOL to search on startup')
cmd.do('sidehChainHelper In cartoons, hide the backbone atoms of selected residues when showing then as sticks.')
cmd.do('sigDigits Set number of decimals places to show in distance labels.')
cmd.do('sigang Set angle labels to display 2 decimals places')
cmd.do('sigdist set distance labels to display 2 decimals')
cmd.do('solventRadius Set radius of ball used to make solvent accessible surface.')
cmd.do('spng Save png flle with timestamp')
cmd.do('spse Save pse flle with timestamp')
cmd.do('stack Base-stacking figure.')
cmd.do('stereoDraw Stereo draw.')
cmd.do('stereoRay Stereo ray.')
cmd.do('threeMaps Three electron density.')
cmd.do('turnAboutAxis Turn about axis.')
cmd.do('undoSelection Undo a selection.')
cmd.do('volumeRamp Volume ramp.')
cmd.do('writeCommandReference2HTML Write the command reference to html file in the present working directory."""')
${0}
'''
'Asp70-His31 salt-bridge from T4 lysozyme. ':
'prefix': 'his31asp70'
'body': '''
cmd.do('fetch 1lw9, async=0; ')
cmd.do('zoom (resi 31 or resi 70); ')
cmd.do('preset.technical(selection='all'); ')
cmd.do('bg_color gray70; ')
cmd.do('clip slab, 7,(resi 31 or resi 70);')
cmd.do('rock;')
${0}
'''
'triple water pentagon.':
'prefix': 'waterTriple'
'body': '''
cmd.do('fetch 1lw9, async=0; ')
cmd.do('zoom resi 313; ')
cmd.do('preset.technical(selection='all', mode=1);')
${0}
'''
'Make selection of ligand atoms.':
'prefix': 'ligandSelect'
'body': '''
cmd.do('select substrates, organic;')
${0}
'''
'Print url of README.md file of the pymolsnips repository.':
'prefix': 'github'
'body': '''
cmd.do('https://github.com/MooersLab/pymolsnips/blob/master/README.md')
${0}
'''
'Set dihedral labels to display 2 decimals places to the right of the decimal point.':
'prefix': 'sigdihedral'
'body': '''
cmd.do('set label_dihedral_digits, ${1:2};')
${0}
'''
'Select state 1 from a model with multiple states.':
'prefix': 'stateOne'
'body': '''
cmd.do('cmd.create('newobject', 'oldobject', '1', '1');')
${0}
'''
'Display all symmetry mates in two unit cells along the c axis. Uses supercell.py in $HOME/Scripts/PyMOLscripts/.':
'prefix': 'sc112'
'body': '''
cmd.do('run $HOME/${1:Scripts/PyMOLscripts/supercell.py};')
cmd.do('supercell 1, 1, 1, , ${2:orange}, ${3:supercell1}, 1;')
${0}
'''
'Display all symmetry mates in three unit cels along c. Uses supercell.py in $HOME/Scripts/PyMOLscripts/.':
'prefix': 'sc113'
'body': '''
cmd.do('run $HOME/${1:Scripts/PyMOLscripts/supercell.py};')
cmd.do('supercell 1, 1, 1, , ${2:orange}, ${3:supercell1}, 1;')
${0}
'''
'Display all symmetry mates three three unit cells along a. Uses supercell.py in $HOME/Scripts/PyMOLscripts/.':
'prefix': 'sc311'
'body': '''
cmd.do('run $HOME/${1:Scripts/PyMOLscripts/supercell.py};')
cmd.do('supercell 1, 1, 1, , ${2:orange}, ${3:supercell1}, 1;')
${0}
'''
'Display all symmetry mates in three unit cells along b. Uses supercell.py in $HOME/Scripts/PyMOLscripts/.':
'prefix': 'sc131'
'body': '''
cmd.do('run $HOME/${1:Scripts/PyMOLscripts/supercell.py};')
cmd.do('supercell 1, 1, 1, , ${2:orange}, ${3:supercell1}, 1;')
${0}
'''
'Display all symmetry mates in two unit cell along a. Uses supercell.py in $HOME/Scripts/PyMOLscripts/.':
'prefix': 'sc211'
'body': '''
cmd.do('run $HOME/${1:Scripts/PyMOLscripts/supercell.py};')
cmd.do('supercell 1, 1, 1, , ${2:orange}, ${3:supercell1}, 1;')
${0}
'''
'Display all symmetry mates in two unit cells along the b axis. Uses supercell.py in $HOME/Scripts/PyMOLscripts/.':
'prefix': 'sc121'
'body': '''
cmd.do('run $HOME/Scripts/PyMOLscripts/supercell.py;')
cmd.do('supercell 1, 1, 1, , ${2:orange}, ${3:supercell1}, 1;')
${0}
'''
'Display all symmetry mates in a 1 x 2 x 2 array of unit cells. Uses supercell.py in $HOME/Scripts/PyMOLscripts/.':
'prefix': 'sc122'
'body': '''
cmd.do('run $HOME/Scripts/PyMOLscripts/supercell.py')
cmd.do('supercell 1, 1, 1, , ${2:orange}, ${3:supercell1}, 1;')
${0}
'''
'Display all symmetry mates in 2 x 2 x 1 array of unit cells. Uses supercell.py in $HOME/Scripts/PyMOLscripts/.':
'prefix': 'sc221'
'body': '''
cmd.do('run $HOME/Scripts/PyMOLscripts/supercell.py;')
cmd.do('supercell 1, 1, 1, , ${2:orange}, ${3:supercell1}, 1;')
${0}
'''
'Display all symmetry mates in a 2 x 1 x 2 arrays of unit cells. Uses supercell.py in $HOME/Scripts/PyMOLscripts/.':
'prefix': 'sc212'
'body': '''
cmd.do('run $HOME/Scripts/PyMOLscripts/supercell.py;')
cmd.do('supercell 1, 1, 1, , ${2:orange}, ${3:supercell1}, 1;')
${0}
'''
'Display all symmetry mates in 1 x 3 x 3 array of unit cell. Uses supercell.py in $HOME/Scripts/PyMOLscripts/.':
'prefix': 'sc133'
'body': '''
cmd.do('run $HOME/Scripts/PyMOLscripts/supercell.py;')
cmd.do('supercell 1, 1, 1, , ${2:orange}, ${3:supercell1}, 1;')
${0}
'''
'Display all symmetry mates in a 3 x 1 x 3 array of unit cells. Uses supercell.py in $HOME/Scripts/PyMOLscripts/.':
'prefix': 'sc313'
'body': '''
cmd.do('run $HOME/Scripts/PyMOLscripts/supercell.py;')
cmd.do('supercell 1, 1, 1, , ${2:orange}, ${3:supercell1}, 1;')
${0}
'''
'Display all symmetry mates in 3 x 3 x 1 array of unit cells. Uses supercell.py in $HOME/Scripts/PyMOLscripts/.':
'prefix': 'sc331'
'body': '''
cmd.do('run $HOME/Scripts/PyMOLscripts/supercell.py;')
cmd.do('supercell 1, 1, 1, , ${2:orange}, ${3:supercell1}, 1;')
${0}
'''
'Display all symmetry mates in a 2 x 3 x 3 array of unit cells. Uses supercell.py in $HOME/Scripts/PyMOLscripts/.':
'prefix': 'sc233'
'body': '''
cmd.do('run $HOME/Scripts/PyMOLscripts/supercell.py;')
cmd.do('supercell 1, 1, 1, , ${2:orange}, ${3:supercell1}, 1;')
${0}
'''
'Display all symmetry mates in a 3 x 2 x 3 array of unit cells. Uses supercell.py in $HOME/Scripts/PyMOLscripts/.':
'prefix': 'sc323'
'body': '''
cmd.do('run $HOME/Scripts/PyMOLscripts/supercell.py;')
cmd.do('supercell 1, 1, 1, , ${2:orange}, ${3:supercell1}, 1;')
${0}
'''
'Display all symmetry mates in 3 x 3 x 2 array of unit cells. Uses supercell.py in $HOME/Scripts/PyMOLscripts/.':
'prefix': 'sc332'
'body': '''
cmd.do('run $HOME/Scripts/PyMOLscripts/supercell.py;')
cmd.do('supercell 1, 1, 1, , ${2:orange}, ${3:supercell1}, 1;')
${0}
'''
'Display all symmetry mates in 3 x 3 x 3 array of unit cells. Uses supercell.py in $HOME/Scripts/PyMOLscripts/.':
'prefix': 'sc333'
'body': '''
cmd.do('run $HOME/Scripts/PyMOLscripts/supercell.py;')
cmd.do('supercell 1, 1, 1, , ${2:orange}, ${3:supercell1}, 1;')
${0}
'''
'Display all symmetry mates in four unit cells stacked long c-axis. Uses supercell.py in $HOME/Scripts/PyMOLscripts/.':
'prefix': 'sc114'
'body': '''
cmd.do('run $HOME/Scripts/PyMOLscripts/supercell.py;')
cmd.do('supercell 1, 1, 1, , ${2:orange}, ${3:supercell1}, 1;')
${0}
'''
'Display all symmetry mates in four unit cells stacked long b-axis. Uses supercell.py in $HOME/Scripts/PyMOLscripts/.':
'prefix': 'sc141'
'body': '''
cmd.do('run $HOME/Scripts/PyMOLscripts/supercell.py;')
cmd.do('supercell 1, 1, 1, , ${2:orange}, ${3:supercell1}, 1;')
${0}
'''
'Display all symmetry mates in four unit cells stacked long a-axis. Uses supercell.py in $HOME/Scripts/PyMOLscripts/.':
'prefix': 'sc411'
'body': '''
cmd.do('run $HOME/Scripts/PyMOLscripts/supercell.py;')
cmd.do('supercell 1, 1, 1, , ${2:orange}, ${3:supercell1}, 1;')
${0}
'''
'Save aln flle with timestamp':
'prefix': 'saln'
'body': '''
cmd.do('python;')
cmd.do('import datetime;')
cmd.do('from pymol import cmd;')
cmd.do('DT =datetime.datetime.now().strftime("yr%Ymo%mday%dhr%Hmin%M");')
cmd.do('s = str(DT);')
cmd.do('cmd.save(stemName+s+".aln");')
cmd.do('end python;')
${0}
'''
'Save electron density map flle with timestamp':
'prefix': 'sccp4'
'body': '''
cmd.do('python;')
cmd.do('import datetime;')
cmd.do('from pymol import cmd; ')
cmd.do('DT =datetime.datetime.now().strftime("yr%Ymo%mday%dhr%Hmin%M");')
cmd.do('s = str(DT); ')
cmd.do('cmd.save(stemName+s+".ccp4"); ')
cmd.do('end python;')
${0}
'''
'Save dae flle with timestamp':
'prefix': 'sdae'
'body': '''
cmd.do('python;')
cmd.do('import datetime;')
cmd.do('from pymol import cmd; ')
cmd.do('DT =datetime.datetime.now().strftime("yr%Ymo%mday%dhr%Hmin%M");')
cmd.do('s = str(DT); ')
cmd.do('cmd.save(stemName+s+".dae"); ')
cmd.do('end python;')
${0}
'''
'Carved isosurface representation of electron density. ':
'prefix': 'carvedIsosurface'
'body': '''
cmd.do('delete all;')
cmd.do('fetch ${1:4dgr}, async=0;')
cmd.do('fetch ${1:4dgr}, type=2fofc,async=0;')
cmd.do('select ${2:LongGlycan}, resi ${3:469:477};')
cmd.do('orient ${2:LongGlycan};')
cmd.do('remove not ${2:LongGlycan};')
cmd.do('remove name H*;')
cmd.do('isosurface 2fofcmap, ${1:4dgr}_2fofc, 1, ${2:LongGlycan}, carve = 1.8;')
cmd.do('color density, 2fofcmap; ')
cmd.do('show sticks;')
cmd.do('show spheres;')
cmd.do('set stick_radius, .07;')
cmd.do('set sphere_scale, .19;')
cmd.do('set sphere_scale, .13, elem H;')
cmd.do('set bg_rgb=[1, 1, 1];')
cmd.do('set stick_quality, 50;')
cmd.do('set sphere_quality, 4;')
cmd.do('color gray85, elem C;')
cmd.do('color red, elem O;')
cmd.do('color slate, elem N;')
cmd.do('color gray98, elem H;')
cmd.do('set stick_color, gray50;')
cmd.do('set ray_trace_mode, 1;')
cmd.do('set ray_texture, 2;')
cmd.do('set antialias, 3;')
cmd.do('set ambient, 0.5;')
cmd.do('set spec_count, 5;')
cmd.do('set shininess, 50;')
cmd.do('set specular, 1;')
cmd.do('set reflect, .1;')
cmd.do('set dash_gap, 0;')
cmd.do('set dash_color, black;')
cmd.do('set dash_gap, .15;')
cmd.do('set dash_length, .05;')
cmd.do('set dash_round_ends, 0;')
cmd.do('set dash_radius, .05;')
cmd.do('set_view (0.34,-0.72,0.61,0.8,0.56,0.22,-0.51,0.4,0.77,0.0,0.0,-81.31,44.64,-9.02,58.62,65.34,97.28,-20.0);')
cmd.do('preset.ball_and_stick("all",mode=1);')
cmd.do('draw;')
${0}
'''
'Fetch 2FoFc map as an isosurface.':
'prefix': 'fetch2FoFcIsosurface'
'body': '''
cmd.do('fetch ${1:3nd4}_2fofc, type=2fofc, async=0;')
cmd.do('isosurface 2fofcmap, ${1:3nd4}_2fofc, 1, ${2:LongGlycan}, carve = 1.8;')
${0}
'''
'Three electron density as isosurface. ':
'prefix': 'threeMapsIsosurface'
'body': '''
cmd.do('load ${1:4dgr}.pdb')
cmd.do('# Make sure to rename map file so that ')
cmd.do('# the root filename differs from pdb root filename')
cmd.do('load ${1:4dgr}_2fofc.ccp4, 2fofc;')
cmd.do('load ${1:4dgr}_fofc.ccp4, fofc;')
cmd.do('select ${2:glycan}, resid 200 or (resid 469:477);')
cmd.do('isosurface ${3:mesh1}, 2fofc, 1.0, ${2:glycan};')
cmd.do('color density, ${3:mesh1};')
cmd.do('isosurface ${4:mesh2}, fofc, 3.0, ${2:glycan};')
cmd.do('color green, ${4:mesh2};')
cmd.do('isosurface ${5:mesh3}, fofc, -3.0, ${2:glycan};')
cmd.do('color red, ${5:mesh3};')
${0}
'''
'Carved volume representation of electron density. ':
'prefix': 'carvedVolume'
'body': '''
cmd.do('delete all;')
cmd.do('fetch ${1:4dgr}, async=0;')
cmd.do('fetch ${1:4dgr}, type=2fofc,async=0;')
cmd.do('select ${2:LongGlycan}, resi ${3:469:477};')
cmd.do('orient ${2:LongGlycan};')
cmd.do('remove not ${2:LongGlycan};')
cmd.do('remove name H*;')
cmd.do('surface 2fofcmap, ${1:4dgr}_2fofc, 1, ${2:LongGlycan}, carve = 1.8;')
cmd.do('color density, 2fofcmap; ')
cmd.do('show sticks;')
cmd.do('show spheres;')
cmd.do('set stick_radius, .07;')
cmd.do('set sphere_scale, .19;')
cmd.do('set sphere_scale, .13, elem H;')
cmd.do('set bg_rgb=[1, 1, 1];')
cmd.do('set stick_quality, 50;')
cmd.do('set sphere_quality, 4;')
cmd.do('color gray85, elem C;')
cmd.do('color red, elem O;')
cmd.do('color slate, elem N;')
cmd.do('color gray98, elem H;')
cmd.do('set stick_color, gray50;')
cmd.do('set ray_trace_mode, 1;')
cmd.do('set ray_texture, 2;')
cmd.do('set antialias, 3;')
cmd.do('set ambient, 0.5;')
cmd.do('set spec_count, 5;')
cmd.do('set shininess, 50;')
cmd.do('set specular, 1;')
cmd.do('set reflect, .1;')
cmd.do('set dash_gap, 0;')
cmd.do('set dash_color, black;')
cmd.do('set dash_gap, .15;')
cmd.do('set dash_length, .05;')
cmd.do('set dash_round_ends, 0;')
cmd.do('set dash_radius, .05;')
cmd.do('set_view (0.34,-0.72,0.61,0.8,0.56,0.22,-0.51,0.4,0.77,0.0,0.0,-81.31,44.64,-9.02,58.62,65.34,97.28,-20.0);')
cmd.do('preset.ball_and_stick("all",mode=1);')
cmd.do('draw;')
${0}
'''
'Fetch 2FoFc map as a volume.':
'prefix': 'fetch2FoFcVolume'
'body': '''
cmd.do('fetch ${1:3nd4}, type=2fofc, async=0;')
cmd.do('volume 2fofcmap, ${1:3nd4}_2fofc, 1, ${2:LongGlycan}, carve = 1.8;')
${0}
'''
'Three electron density as volumes. ':
'prefix': 'threeMapsVolume'
'body': '''
cmd.do('load ${1:4dgr}.pdb')
cmd.do('# Make sure to rename map file so that ')
cmd.do('# the root filename differs from pdb root filename')
cmd.do('load ${1:4dgr}_2fofc.ccp4, 2fofc;')
cmd.do('load ${1:4dgr}_fofc.ccp4, fofc;')
cmd.do('select ${2:glycan}, resid 200 or (resid 469:477);')
cmd.do('volume ${3:mesh1}, 2fofc, 1.0, ${2:glycan};')
cmd.do('color density, ${3:mesh1};')
cmd.do('volume ${4:mesh2}, fofc, 3.0, ${2:glycan};')
cmd.do('color green, ${4:mesh2};')
cmd.do('volume ${5:mesh3}, fofc, -3.0, ${2:glycan};')
cmd.do('color red, ${5:mesh3};')
${0}
'''
'Return settings in rounded format while running PyMOL via the RCP server ipymol in a jupuyter notebook. This is a modified version of the roundview.py script.':
'prefix': 'rvi'
'body': '''
cmd.do('def rvj(StoredView=0, decimal_places=2, outname="roundedview.txt"):')
cmd.do(' """')
cmd.do(' rvj() is a modification of the the rv() function (aka the roundview.py) ')
cmd.do(' so that it can run in Jupyter notebooks with the ipymol.viewer. ')
cmd.do(' A set_view string is printed to the noteobook in a format that is ready ')
cmd.do(' for reuse. ')
cmd.do(' ')
cmd.do(' The ipymol module was developed by Carlos Hernandez:')
cmd.do(' ')
cmd.do(' https://github.com/cxhernandez/ipymol')
cmd.do(' ')
cmd.do(' The pre-requisites for installing ipymol are as follows:')
cmd.do(' ')
cmd.do(' 1. Make a jupyter notebook kernel for Python interpreter inside of ')
cmd.do(' the Schrodinger PyMOL. See the PyMOL Snippets GitHub Page for ')
cmd.do(' a description of how to make one.')
cmd.do(' 2. Install the following build of ipymol at the PyMOL prompt.')
cmd.do(' You need to log into your GitHub account first.')
cmd.do(' ')
cmd.do(' pip install git+pip install git+https://github.com/cxhernandez/ipymol.git@2a30d6ec1588434e6f0f72a1d572444f89ff535b')
cmd.do(' ')
cmd.do(' 3. Make a bash alias to this PyMOL app file.')
cmd.do(' ')
cmd.do(' 4. Launch the jupyter notebook and select the pymol.python kernel.')
cmd.do(' ')
cmd.do(' 5. Open a terminal instance from the File pulldown in jupyter notebook.')
cmd.do(' ')
cmd.do(' 6. Enter `pymol -Rq` to launch an interactive instance of PyMOL.')
cmd.do(' ')
cmd.do(' 7. Enter the following code to load ipymol and conmect to PyMOL')
cmd.do(' ')
cmd.do(' from ipymol import viewer as ipv')
cmd.do(' ipv.start() # Start PyMOL RPC server')
cmd.do(' ')
cmd.do(' Now you can change the scene manually and send the display as static ')
cmd.do(' image to a cell in the jupyter notebook.')
cmd.do(' ')
cmd.do(' It is assumed that the viewer class of the ipymol moduel has been ')
cmd.do(' imported as ipv. ')
cmd.do(' ')
cmd.do(' I made the following modifications of roundview.py.')
cmd.do(' The cmd.get_view was replaced with ipv.get_view.')
cmd.do(' The cmd.extend was replaced with ipv.extend.')
cmd.do(' The myRoundedList was returned for further processing.')
cmd.do(' ')
cmd.do(' MIT License')
cmd.do(' ')
cmd.do(' Copyright:')
cmd.do(' Blaine Mooers and the OU Board of Regents')
cmd.do(' Uniersity of Oklahoma Health Sciences Center')
cmd.do(' Oklahoma City, OK 73104')
cmd.do(' ')
cmd.do(' 29 April 2020')
cmd.do(' ')
cmd.do(' """')
cmd.do(' ')
cmd.do(' ')
cmd.do(' StoredView = int(StoredView)')
cmd.do(' decimal_places = int(decimal_places)')
cmd.do(' ')
cmd.do(' #call the get_view function')
cmd.do(' ')
cmd.do(' m = ipv.get_view(StoredView)')
cmd.do(' ')
cmd.do(' ')
cmd.do(' #Make a list of the elements in the orientation matrix.')
cmd.do(' ')
cmd.do(' myList = [m[0], m[1], m[2], m[3], m[4], m[5], m[6],m[7], m[8], m[9],')
cmd.do(' m[10], m[11], m[12], m[13], m[14],m[15], m[16], m[17]]')
cmd.do(' ')
cmd.do(' #Round off the matrix elements to two decimal places (two fractional places)')
cmd.do(' #This rounding approach solved the problem of unwanted')
cmd.do(' #whitespaces when I tried to use a string format statement')
cmd.do(' ')
cmd.do(' myRoundedList = [round(elem, decimal_places) for elem in myList]')
cmd.do(' ')
cmd.do(' #x is the string template for the output. The whitespace is required')
cmd.do(' #between the "set_view" and "("')
cmd.do(' ')
cmd.do(' x = 'set_view ({0},{1},{2},{3},{4},{5},{6},{7},{8},{9},{10},{11},{12},{13},{14},{15},{16},{17});'')
cmd.do(' ')
cmd.do(' # Print to the command history window.')
cmd.do(' print(x.format(*myRoundedList))')
cmd.do(' ')
cmd.do(' #Write to a text file.')
cmd.do(' myFile = open("roundedview.txt", "a")')
cmd.do(' myFile.write(x.format(*myRoundedList) + "")')
cmd.do(' myFile.close()')
cmd.do(' return myRoundedList')
cmd.do('ipv.extend("rv", rv)')
${0}
'''
'Demo of the use of the RPC server with a drug compound via rdkit.':
'prefix': 'rdkrpcChem'
'body': '''
cmd.do('import os;')
cmd.do('import rdkit;')
cmd.do('from rdkit import Chem;')
cmd.do('from rdkit.Chem import AllChem;')
cmd.do('from rdkit.Chem import PyMol;')
cmd.do('')
cmd.do('s = PyMOL.MolViewer();')
cmd.do('mol = Chem.MolFromSmiles \')
cmd.do(' ('CCOCCn1c(C2CC[NH+](CCc3ccc(C(C)(C)C(=O)[O-])cc3)CC2)nc2ccccc21');')
cmd.do('mol = AllChem.AddHs(mol);')
cmd.do('AllChem.EmbedMolecule(mol);')
cmd.do('AllChem.MMFFOptimizeMolecule(mol);')
cmd.do('s.ShowMol(mol, name = 'bilastine', showOnly = False);')
cmd.do('s.Zoom('bilastine');')
cmd.do('s.SetDisplayStyle('bilastine', 'sticks');')
cmd.do('s.GetPNG(preDelay=5);')
${0}
'''
'A kernel.json file for runnig PyMOL python interpreter in the Jupyter notebook. ':
'prefix': 'kernel'
'body': '''
cmd.do('framerule=2pt,')
cmd.do('framesep=2mm,')
cmd.do('framesep=2mm,')
cmd.do('breaklines=True,')
cmd.do('baselinestretch=1.2')
cmd.do(']{bash}')
cmd.do('{')
cmd.do(' "argv": [')
cmd.do(' "/Applications/PyMOL.app/Contents/bin/python",')
cmd.do(' "-m",')
cmd.do(' "ipykernel_launcher",')
cmd.do(' "-f",')
cmd.do(' "{connection_file}"')
cmd.do(' ],')
cmd.do(' "display_name": "pymol.python",')
cmd.do(' "language": "python"')
cmd.do('}')
${0}
'''
'Demo of the use of the RPC server with a protein via rdkit.':
'prefix': 'rdkrpcProtein'
'body': '''
cmd.do('from rdkit.Chem import PyMol;')
cmd.do('')
cmd.do('Usage=""""Start pymol from command line with -R flag.')
cmd.do('Select the pymol.python kernel in Jupyter notebook. """;')
cmd.do('')
cmd.do('s = PyMol.MolViewer();')
cmd.do('du = s.server.do;')
cmd.do('du('rein; bg_color white; fetch 1lw9, type=pdb, async=0, show;nb_spheres; set_view (0.46,-0.28,-0.84,0.74,-0.41,0.54,-0.49,-0.87,0.02,0.0,0.0,\')
cmd.do(' -155.16,35.13,11.48,9.72,122.33,187.99,-20.0);');')
cmd.do('s.GetPNG(preDelay=3);')
cmd.do('du('png T4L600dpi.png, dpi=600');')
${0}
'''
'Code to start the RPC server with ipymol.':
'prefix': 'ipymolStart'
'body': '''
cmd.do('# Start pymol in terminal with pymol -R;')
cmd.do('# Select pymol.python as kernel in juptyer;')
cmd.do('from ipymol import viewer as ipv;')
cmd.do('ipv.start() # Start PyMOL RPC server;')
${0}
'''
'Demo of the use of the RPC server with a protein via ipymol.':
'prefix': 'ipymolProtein'
'body': '''
cmd.do('# Start pymol in terminal with pymol -R;')
cmd.do('# Select pymol.python as kernel in juptyer;')
cmd.do('from ipymol import viewer as ipv;')
cmd.do('ipv.start() # Start PyMOL RPC server;')
cmd.do('')
cmd.do('ipv.do('fetch 1lw9');')
cmd.do('ipv.do('rv');')
cmd.do('# The double parentheses are required when set_view is run this way.;')
cmd.do('ipv.set_view((-0.13,-0.4,-0.91,0.89,-0.45,0.07,-0.44,-0.8,0.41,0.0,0.0,-182.47,35.13,11.48,9.72,149.64,215.3,-20.0));')
cmd.do('ipv.do('AOD');')
cmd.do('ipv.png('testipymolT4L.png');')
${0}
'''
'Return settings in rounded format while running PyMOL via the RCP server rdkit in a jupyter notebook. This is a modified version of the roundview.py script.':
'prefix': 'rvr'
'body': '''
cmd.do('def rvr(StoredView=0, decimal_places=2, outname="roundedview.txt"):')
cmd.do(' """MIT License')
cmd.do(' Copyright:')
cmd.do(' Blaine Mooers and the OU Board of Regents')
cmd.do(' University of Oklahoma Health Sciences Center')
cmd.do(' Oklahoma City, OK 73104')
cmd.do(' 30 April 2020')
cmd.do(' ')
cmd.do(' First run the following:')
cmd.do(' ')
cmd.do(' from rdkit.Chem import PyMol')
cmd.do(' s = PyMol.MolViewer()')
cmd.do(' du = s.server.do')
cmd.do('')
cmd.do(' """')
cmd.do(' StoredView = int(StoredView) decimal_places = int(decimal_places)')
cmd.do(' #call the get_view function')
cmd.do(' m = s.get_view(StoredView)')
cmd.do(' #Make a list of the elements in the orientation matrix.')
cmd.do(' myList = [m[0], m[1], m[2], m[3], m[4], m[5], m[6],m[7], m[8], m[9], ')
cmd.do(' m[10], m[11], m[12], m[13], m[14],m[15], m[16], m[17]]')
cmd.do(' #Round off the matrix elements to two decimal places (two fractional places)')
cmd.do(' #This rounding approach solved the problem of unwanted')
cmd.do(' #whitespaces when I tried to use a string format statement')
cmd.do(' myRoundedList = [round(elem, decimal_places) for elem in myList]')
cmd.do(' #x is the string template for the output. The whitespace is required')
cmd.do(' #between the "set_view" and "("')
cmd.do(' x = 'set_view ({0},{1},{2},{3},{4},{5},{6},{7},{8},{9},{10},{11},{12},{13},{14},{15},{16},{17});'')
cmd.do(' # Print to the command history window.')
cmd.do(' print(x.format(*myRoundedList))')
cmd.do(' #Write to a text file.')
cmd.do(' myFile = open("roundedview.txt", "a") myFile.write(x.format(*myRoundedList) + "") myFile.close()')
cmd.do(' return myRoundedList')
cmd.do('du.extend("rvr", rvr)')
${0}
'''
'Return to the command history window the docstrings for all of the functions in the cmd module.':
'prefix': 'cmddocs'
'body': '''
cmd.do('[help(i) for i in dir(cmd)];')
${0}
'''
'Return to the command history window the docstrings for all of the functions in a module.':
'prefix': 'pymoldocs'
'body': '''
cmd.do('[help(i) for i in dir(pymol)];')
${0}
'''
'Print the number of residues in a protein.':
'prefix': 'numResiProtein'
'body': '''
cmd.do('sel = 'polymer.protein'; print(len(set([(i.chain, i.resi, i.resn) for i in cmd.get_model(sel).atom])));')
${0}
'''
'Print the number of residues in chain A of a protein.':
'prefix': 'numResiProteinChainA'
'body': '''
cmd.do('sel = 'chain A and polymer.protein'; print(len(set([(i.chain, i.resi, i.resn) for i in cmd.get_model(sel).atom])));')
${0}
'''
'Print the number of residues in a nulceic acid (all chains).':
'prefix': 'numResiNucleic'
'body': '''
cmd.do('sel = 'polymer.nucleic'; print(len(set([(i.resi, i.resn) for i in cmd.get_model(sel).atom])));')
${0}
'''
'Print the number of residues in a nulceic acid chain.':
'prefix': 'numResiNucleicChainA'
'body': '''
cmd.do('sel = 'chain A and polymer.nucleic'; print(len(set([(i.resi, i.resn) for i in cmd.get_model(sel).atom])));')
${0}
'''
'Create bonds between phosphorous and O3* atoms in a low resolution DNA structure that is 80 base pairs long.':
'prefix': 'brokenNucleicBackbone'
'body': '''
cmd.do('[cmd.bond(f"/5fur//E/{i}/O3'", f"/5fur//E/{i+1}/P") for i in range(${1:1}, ${2:80})]; ')
cmd.do('[cmd.bond(f"/5fur//F/{i}/O3'", f"/5fur//F/{i+1}/P") for i in range(${3:81}, ${3:160})];')
${0}
'''
'To change stick color and radius for the bond between atom 2 and 3, use the set_bond command.
':
'prefix': 'oneBondThicknessColor'
'body': '''
cmd.do('# To change stick color and radius for the bond between atom 2 and 3;')
cmd.do('set_bond stick_color, ${1:yellow}, index 2, index 3;')
cmd.do('set_bond stick_radius, ${2:0.2}, index 2, index 3;')
${0}
'''
'Connect the alpha carbons of residue 1 with 10, 6 with 16, 7 with 17 and 8 with 18. Note that this example requires the draw_links.py [http://pldserver1.biochem.queensu.ca/~rlc/work/pymol/draw_links.py] by Robert Campbell.':
'prefix': 'drawLinks'
'body': '''
cmd.do('# Requires draw_links.py http://pldserver1.biochem.queensu.ca/~rlc/work/pymol/draw_links.py by Robert Campbell')
cmd.do('# To connect the alpha carbons of residue 1 with 10, 6 with 16, 7 with 17 and 8 with 18.')
cmd.do('draw_links ${1:mol1} & chain ${2:A} & name ${3:CA} & resi ${4:1+6+7+8}, ${5:mol1} & chain ${6:A}& name ${7:CA} & resi ${8:10+16+17+18} ')
${0}
'''
'Print the path to the currently used PyMOL binary.':
'prefix': 'printPath'
'body': '''
cmd.do('# Print the path to the current used PyMOL binary.')
cmd.do('print pymol.__path__')
${0}
'''
'Turn on the ligand valence.':
'prefix': 'setLigandValenceOn'
'body': '''
cmd.do('#Set on the valence of the ligand only')
cmd.do('set valence, on, resn ${1:RZS}; set valence, off, not resn ${2:RZS}')
${0}
'''
'Return the docustring for the preset submodule. The command help preset fails to return anything. The command help(pymol.preset) has the same effect as help(preset).':
'prefix': 'presetDocs'
'body': '''
cmd.do('help(preset)')
${0}
'''
'Return the docustring for the help submodule. The command help help is more concise.':
'prefix': 'helpDocs'
'body': '''
cmd.do('help(help)')
${0}
'''
'The amber trajectories have to be loaded into the same object.':
'prefix': 'loadAmberTrajs'
'body': '''
cmd.do('load file.top, protein;')
cmd.do('load file.rst, protein')
${0}
'''
'Saves multiple objects into multiple files using an optional prefix name.':
'prefix': 'saveSep'
'body': '''
cmd.do('from pymol import cmd')
cmd.do('import glob')
cmd.do('import re')
cmd.do('')
cmd.do('def saveSep(prefix=''):')
cmd.do(' """')
cmd.do(' save_sep <prefix>')
cmd.do('')
cmd.do(' saves multiple objects into multiple files using an optional prefix name.')
cmd.do('')
cmd.do(' e.g. save_sep prefix')
cmd.do(' """')
cmd.do(' obj_list = cmd.get_names("all")')
cmd.do('')
cmd.do(' if obj_list:')
cmd.do(' for i in range(len(obj_list)):')
cmd.do(' obj_name = "%s%s.pdb" % (prefix, obj_list[i])')
cmd.do(' cmd.save(obj_name, obj_list[i])')
cmd.do(' print("Saving %s" % obj_name)')
cmd.do(' else:')
cmd.do(' print("No objects found")')
cmd.do(' ')
cmd.do('cmd.extend('saveSep',saveSep)')
${0}
'''
'OptiAlign.py by Jason Vertree modified for aligning multiple RNA structures.':
'prefix': 'optAlignRNA'
'body': '''
cmd.do('#!python')
cmd.do(' ')
cmd.do('##############################################################################')
cmd.do('#')
cmd.do('# @SUMMARY: -- QKabsch.py. A python implementation of the optimal superposition')
cmd.do('# of two sets of vectors as proposed by Kabsch 1976 & 1978.')
cmd.do('#')
cmd.do('# @AUTHOR: Jason Vertrees')
cmd.do('# @COPYRIGHT: Jason Vertrees (C), 2005-2007')
cmd.do('# @LICENSE: Released under GPL:')
cmd.do('# This program is free software; you can redistribute it and/or modify')
cmd.do('# it under the terms of the GNU General Public License as published by')
cmd.do('# the Free Software Foundation; either version 2 of the License, or')
cmd.do('# (at your option) any later version.')
cmd.do('# This program is distributed in the hope that it will be useful, but WITHOUT')
cmd.do('# ANY WARRANTY; without even the implied warranty of MERCHANTABILITY or FITNESS')
cmd.do('# FOR A PARTICULAR PURPOSE. See the GNU General Public License for more details.')
cmd.do('#')
cmd.do('# You should have received a copy of the GNU General Public License along with')
cmd.do('# this program; if not, write to the Free Software Foundation, Inc., 51 Franklin')
cmd.do('# Street, Fifth Floor, Boston, MA 02110-1301, USA ')
cmd.do('#')
cmd.do('# DATE : 2007-01-01')
cmd.do('# REV : 2')
cmd.do('# REQUIREMENTS: numpy')
cmd.do('#')
cmd.do('#')
cmd.do('# Modified optAlign.py to use C1' carbon atoms of RNA for alignment.')
cmd.do('# Jan. 29, 2020 ')
cmd.do('# Blaine Mooers, PhD')
cmd.do('# Univ. of Oklahoma Health Sciences Center')
cmd.do('#')
cmd.do('#############################################################################')
cmd.do('from array import *')
cmd.do(' ')
cmd.do('# system stuff')
cmd.do('import os')
cmd.do('import copy')
cmd.do(' ')
cmd.do('# pretty printing')
cmd.do('import pprint')
cmd.do(' ')
cmd.do('# for importing as a plugin into PyMol')
cmd.do('from pymol import cmd')
cmd.do('from pymol import stored')
cmd.do('from pymol import selector')
cmd.do(' ')
cmd.do('# using numpy for linear algebra')
cmd.do('import numpy')
cmd.do(' ')
cmd.do('def optAlignRNA( sel1, sel2 ):')
cmd.do(' """')
cmd.do(' optAlignRNA performs the Kabsch alignment algorithm upon the C1' carbons of two selections.')
cmd.do(' Example: optAlignRNA 1JU7 and i. 1-16 and n. C1', 1CLL and i. 4-146 and n. C1'')
cmd.do(' ')
cmd.do(' Two RMSDs are returned. One comes from the Kabsch algorithm and the other from')
cmd.do(' PyMOL based upon your selections.')
cmd.do(' ')
cmd.do(' This function can be run in a for loop to fit multiple structures with a common prefix name:')
cmd.do(' ')
cmd.do(' for x in cmd.get_names(): optAlignRNA(x, "1JU7_0001")')
cmd.do(' ')
cmd.do(' or get the rmsds for all combinations, do the following:')
cmd.do(' ')
cmd.do(' [[optAlignRNA(x, y) for x in cmd.get_names()] for y in cmd.get_names()]')
cmd.do('')
cmd.do(' """')
cmd.do(' cmd.reset()')
cmd.do(' ')
cmd.do(' # make the lists for holding coordinates')
cmd.do(' # partial lists')
cmd.do(' stored.sel1 = []')
cmd.do(' stored.sel2 = []')
cmd.do(' # full lists')
cmd.do(' stored.mol1 = []')
cmd.do(' stored.mol2 = []')
cmd.do(' ')
cmd.do(' # -- CUT HERE')
cmd.do(' sel1 += " and N. C1'"')
cmd.do(' sel2 += " and N. C1'"')
cmd.do(' # -- CUT HERE')
cmd.do(' ')
cmd.do(' # Get the selected coordinates. We')
cmd.do(' # align these coords.')
cmd.do(' cmd.iterate_state(1, selector.process(sel1), "stored.sel1.append([x,y,z])")')
cmd.do(' cmd.iterate_state(1, selector.process(sel2), "stored.sel2.append([x,y,z])")')
cmd.do(' ')
cmd.do(' # get molecule name')
cmd.do(' mol1 = cmd.identify(sel1,1)[0][0]')
cmd.do(' mol2 = cmd.identify(sel2,1)[0][0]')
cmd.do(' ')
cmd.do(' # Get all molecule coords. We do this because')
cmd.do(' # we have to rotate the whole molcule, not just')
cmd.do(' # the aligned selection')
cmd.do(' cmd.iterate_state(1, mol1, "stored.mol1.append([x,y,z])")')
cmd.do(' cmd.iterate_state(1, mol2, "stored.mol2.append([x,y,z])")')
cmd.do(' ')
cmd.do(' # check for consistency')
cmd.do(' assert len(stored.sel1) == len(stored.sel2)')
cmd.do(' L = len(stored.sel1)')
cmd.do(' assert L > 0')
cmd.do(' ')
cmd.do(' # must alway center the two proteins to avoid')
cmd.do(' # affine transformations. Center the two proteins')
cmd.do(' # to their selections.')
cmd.do(' COM1 = numpy.sum(stored.sel1,axis=0) / float(L)')
cmd.do(' COM2 = numpy.sum(stored.sel2,axis=0) / float(L)')
cmd.do(' stored.sel1 -= COM1')
cmd.do(' stored.sel2 -= COM2')
cmd.do(' ')
cmd.do(' # Initial residual, see Kabsch.')
cmd.do(' E0 = numpy.sum( numpy.sum(stored.sel1 * stored.sel1,axis=0),axis=0) + numpy.sum( numpy.sum(stored.sel2 * stored.sel2,axis=0),axis=0)')
cmd.do(' ')
cmd.do(' #')
cmd.do(' # This beautiful step provides the answer. V and Wt are the orthonormal')
cmd.do(' # bases that when multiplied by each other give us the rotation matrix, U.')
cmd.do(' # S, (Sigma, from SVD) provides us with the error! Isn't SVD great!')
cmd.do(' V, S, Wt = numpy.linalg.svd( numpy.dot( numpy.transpose(stored.sel2), stored.sel1))')
cmd.do(' ')
cmd.do(' # we already have our solution, in the results from SVD.')
cmd.do(' # we just need to check for reflections and then produce')
cmd.do(' # the rotation. V and Wt are orthonormal, so their det's')
cmd.do(' # are +/-1.')
cmd.do(' reflect = float(str(float(numpy.linalg.det(V) * numpy.linalg.det(Wt))))')
cmd.do(' ')
cmd.do(' if reflect == -1.0:')
cmd.do(' S[-1] = -S[-1]')
cmd.do(' V[:,-1] = -V[:,-1]')
cmd.do(' ')
cmd.do(' RMSD = E0 - (2.0 * sum(S))')
cmd.do(' RMSD = numpy.sqrt(abs(RMSD / L))')
cmd.do(' ')
cmd.do(' #U is simply V*Wt')
cmd.do(' U = numpy.dot(V, Wt)')
cmd.do(' ')
cmd.do(' # rotate and translate the molecule')
cmd.do(' stored.sel2 = numpy.dot((stored.mol2 - COM2), U)')
cmd.do(' stored.sel2 = stored.sel2.tolist()')
cmd.do(' # center the molecule')
cmd.do(' stored.sel1 = stored.mol1 - COM1')
cmd.do(' stored.sel1 = stored.sel1.tolist()')
cmd.do(' ')
cmd.do(' # let PyMol know about the changes to the coordinates')
cmd.do(' cmd.alter_state(1,mol1,"(x,y,z)=stored.sel1.pop(0)")')
cmd.do(' cmd.alter_state(1,mol2,"(x,y,z)=stored.sel2.pop(0)")')
cmd.do(' ')
cmd.do(' #print("Moved: %s Reference: %s RMSD = %f" % mol1, mol2, RMSD)')
cmd.do(' print("% s, % s,% 5.3f" % (mol1, mol2, RMSD))')
cmd.do(' ')
cmd.do(' # make the alignment OBVIOUS')
cmd.do(' cmd.hide('everything')')
cmd.do(' cmd.show('ribbon', sel1 + ' or ' + sel2)')
cmd.do(' cmd.color('gray70', mol1 )')
cmd.do(' cmd.color('magenta', mol2 )')
cmd.do(' cmd.color('red', 'visible')')
cmd.do(' cmd.show('ribbon', 'not visible')')
cmd.do(' cmd.center('visible')')
cmd.do(' cmd.orient()')
cmd.do(' cmd.zoom('visible')')
cmd.do(' ')
cmd.do('cmd.extend("optAlignRNA", optAlignRNA)')
${0}
'''
'Load into PyMOL multiple files with a common file stem. The is a script by Robert Campbell that updated for Python3.':
'prefix': 'loadManyFiles'
'body': '''
cmd.do('# Copyright (c) 2004 Robert L. Campbell')
cmd.do('#')
cmd.do('# Modified for use with Python3.')
cmd.do('# Jan. 29, 2020 ')
cmd.do('# Blaine Mooers, PhD')
cmd.do('# Univ. of Oklahoma Health Sciences Center')
cmd.do('#')
cmd.do('#')
cmd.do('from pymol import cmd')
cmd.do('import glob')
cmd.do('')
cmd.do('def loadFiles(files):')
cmd.do(' """')
cmd.do(' load_files <files>')
cmd.do('')
cmd.do(' loads multiple files (using filename globbing)')
cmd.do(' into a multiple objects named as the files are (e.g. collection of')
cmd.do(' downloaded PDB files).')
cmd.do('')
cmd.do(' e.g. load_files prot_*.pdb')
cmd.do(' """')
cmd.do(' file_list = glob.glob(files)')
cmd.do(' if file_list:')
cmd.do(' file_list.sort()')
cmd.do(' for i in file_list:')
cmd.do(' #obj_name = i.replace('.pdb','')')
cmd.do(' #cmd.load(file_list[i],obj_name)')
cmd.do(' cmd.load(i)')
cmd.do(' else:')
cmd.do(' print("No files found for pattern %s" % files)')
cmd.do('')
cmd.do('cmd.extend('loadFiles',loadFiles)')
${0}
'''
'These are the instructions for loading and aligning multiple files.':
'prefix': 'loadAndAlignManyFiles'
'body': '''
cmd.do('To load a bunch of related files from inside PyMOL all at once:')
cmd.do('')
cmd.do('run loadFiles.py')
cmd.do('loadFiles refine_*.pdb')
cmd.do('')
cmd.do('')
cmd.do('To align all of the loaded RNA structures in all possible combinations by their C1' carbon atoms:')
cmd.do('')
cmd.do('run optAlignRNA.py')
cmd.do('[[optAlignRNA(x, y) for x in cmd.get_names()] for y in cmd.get_names()]')
cmd.do('')
cmd.do('(Yes, that construct is a list comprehension inside a list comprehension!)')
cmd.do('')
cmd.do('To save a multiple models in a file to separate pdb files,')
cmd.do('')
cmd.do('run saveSep.py')
cmd.do('saveSep ')
cmd.do('or ')
cmd.do('saveSep prefix')
${0}
'''
'This is a two-fold nested list comprehension for any all parwise operation on the currently loaded objects. Replace optAlginRNA with any other function that operations on a pair of structrures.':
'prefix': 'allPairs'
'body': '''
cmd.do('[[${1:optAlignRNA}(x, y) for x in cmd.get_names()] for y in cmd.get_names()]')
${0}
'''
'Combining DSSR block representation with regular PyMOL cartoons after loading the dssr_block.py script by Thomas Holder.':
'prefix': 'dssrBlock'
'body': '''
cmd.do('fetch 1ehz, async=0;')
cmd.do('as cartoon;')
cmd.do('set cartoon_ladder_radius, 0.1;')
cmd.do('set cartoon_ladder_color, gray;')
cmd.do('set cartoon_nucleic_acid_mode, 1;')
cmd.do('dssr_block')
${0}
'''
'DSSR block representation with fused blocks after loading the dssr_block.py script by Thomas Holder. The x3dna-dssr executable needs to be in the PATH.':
'prefix': 'dssrBlock'
'body': '''
cmd.do('fetch 1ehz, async=0;')
cmd.do('dssr_block block_file=wc')
${0}
'''
'DSSR block representation for a multi-state example after loading the dssr_block.py script by Thomas Holder. The x3dna-dssr executable needs to be in the PATH.':
'prefix': 'dssrBlock'
'body': '''
cmd.do('fetch 2n2d, async=0;')
cmd.do('dssr_block 2n2d, 0;')
cmd.do('set all_states;')
${0}
'''
'DSSR block representation with custom coloring after loading the dssr_block.py script by Thomas Holder. The x3dna-dssr executable needs to be in the PATH.':
'prefix': 'dssrBlock'
'body': '''
cmd.do('fetch 1msy, async=0;')
cmd.do('dssr_block block_color=N red | minor 0.9 | major yellow;')
${0}
'''
'Settings for nucliec acid cartoon.':
'prefix': 'nucleicAcidCartoon'
'body': '''
cmd.do('set cartoon_ladder_color, ${1:density};')
cmd.do('set cartoon_ladder_radius, ${2:0.2};')
cmd.do('set cartoon_nucleic_acid_color, ${3:red};')
cmd.do('set cartoon_ring_mode, ${4:2};')
${0}
'''
'Coloring two strand differently of a double helix makes it easier to for the viewer to distinguish the two strands. The set command as the syntax of setting_name [, setting_value [, selection [,state ]]] . In this case, the selection has to be global, object, object-state, or per-atom settings. It cannot be a named selection. This is a weak spot in PyMOL. Coloring two strand differently of a double helix makes it easier to for the viewer to distinguish the two strands. Many double-stranded helices have one strand in the asymmetric unit. The second strand is in the biological unit. The coordinates for the second strand are in the pdb1 file type at the PDB. The second strand is in the second state, which is equivalent to the second model in the pdb file. The strands are labeled chain A and B (via the cartoon_nucliec_acid_color setting). The bases are colored differently too (via the cartoon_ladder_color setting).
':
'prefix': 'nucleicAcidCartoon2Strands'
'body': '''
cmd.do('# There is not support for applying different settings to different selections.')
cmd.do('# Instead, this can be done for different objects.')
cmd.do('# Coloring two strand differently of a double helix makes it easier to for the viewer to distinguish the two strands.')
cmd.do('# The set command as the syntax of setting_name [, setting_value [, selection [,state ]]]')
cmd.do('# In this case, the selection has to be global, object, object-state, or per-atom settings.')
cmd.do('# It cannot be a named selection.')
cmd.do('# Coloring two strand differently of a double helix makes it easier to for the viewer to distinguish the two strands.')
cmd.do('# Many double-stranded helices have one strand in the asymmetric unit.')
cmd.do('# The second strand is in the biological unit.;')
cmd.do('# The coordinates for the second strand are in the pdb1 file type at the PDB.;')
cmd.do('# The second strand is in the second state, which is equivalent to the second model in the pdb file.;')
cmd.do('# The strands are labeled chain A and B (via the cartoon_nucliec_acid_color setting).;')
cmd.do('# The bases are colored differently too (via the cartoon_ladder_color setting).;')
cmd.do('fetch ${1:3nd3}, ${2:3nd3}, type=${3:pdb1};')
cmd.do('set all_states, on;')
cmd.do('create chA, ${2:3nd3}, 1, 1;')
cmd.do('create chB, ${2:3nd3}, 2, 1;')
cmd.do('# colors only the backbone;')
cmd.do('set cartoon_nucleic_acid_color, ${4:magenta}, chA;')
cmd.do('set cartoon_nucleic_acid_color, ${5:orange}, chB;')
cmd.do('# color the bases;')
cmd.do('set cartoon_ladder_color, ${6:density}, chA;')
cmd.do('set cartoon_ladder_color, ${7:yellow}, chB;')
${0}
'''
'This code colors by the nucleotides by base seqence. It can be applied to any nucleic acid. It could make a good shortcut.':
'prefix': 'nucleicAcidColorbySequence'
'body': '''
cmd.do('select rna_A, resn A;')
cmd.do('select rna_C, resn C;')
cmd.do('select rna_G, resn G;')
cmd.do('select rna_U, resn U;')
cmd.do('select dna_T, resn T;')
cmd.do('color ${1:yellow}, rna_A;')
cmd.do('color ${2:red}, rna_C; ')
cmd.do('color ${3:gray40}, rna_G;')
cmd.do('color ${4:palecyan}, rna_U;')
cmd.do('color ${5:brown}, dna_T;')
${0}
'''
'This code colors by the nucleotides by base seqence. It can be applied to any nucleic acid. It is dervied from the CR shortcut. The backcone is shown as a flatten ribbon.':
'prefix': 'nucleicAcidFlatRibbonColorbySequence'
'body': '''
cmd.do('bg_color white;')
cmd.do('set cartoon_oval_length, ${1:1.85};')
cmd.do('set cartoon_oval_width, ${2:0.5};')
cmd.do('cartoon oval;')
cmd.do('set cartoon_ring_mode, ${3:3};')
cmd.do('# set the color of the backbone oval;')
cmd.do('set cartoon_nucleic_acid_color, ${4:blue};')
cmd.do('select rna_A, resn A;')
cmd.do('select rna_C, resn C;')
cmd.do('select rna_G, resn G;')
cmd.do('select rna_U, resn U;')
cmd.do('select dna_T, resn T;')
cmd.do('color ${5:yellow}, rna_A;')
cmd.do('color ${6:red}, rna_C; ')
cmd.do('color ${7:gray40}, rna_G;')
cmd.do('color ${8:palecyan}, rna_U;')
cmd.do('color ${9:brown}, dna_T;')
cmd.do('as cartoon;')
${0}
'''
'The code provides a cartoon of the loaded nucleic acid that has the ladder rungs replaced by filled rings that are colored by atom type. The code can be applied to any nucleic acid. It is derived from the FR shortuct.':
'prefix': 'nucleicAcidCartoonFilledRings'
'body': '''
cmd.do('bg_color white;')
cmd.do('show sticks;')
cmd.do('set cartoon_ring_mode, 3;')
cmd.do('set cartoon_ring_finder, 1;')
cmd.do('set cartoon_ladder_mode, 1;')
cmd.do('set cartoon_nucleic_acid_mode, 4;')
cmd.do('set cartoon_ring_transparency, 0.5;')
cmd.do('as cartoon;')
${0}
'''
'This code make as standard base stacking diagram with ball and stick representation. ':
'prefix': 'basePairStacking'
'body': '''
cmd.do('delete all;')
cmd.do('fetch 4PCO, type=pdb, async=0;')
cmd.do('select G2G3, ( ((resi 2 or resi 3) and chain A) or ((resi 8 or resi 9) and chain B));')
cmd.do('remove not G2G3;')
cmd.do('bg_color white;')
cmd.do('show sticks;')
cmd.do('set stick_radius=0.14;')
cmd.do('set stick_ball, on; ')
cmd.do('set stick_ball_ratio,1.9;')
cmd.do('set_view (-0.75,0.09,0.66,-0.2,0.92,-0.35,-0.64,-0.39,-0.67,-0.0,-0.0,-43.7,7.24,9.55,11.78,29.46,57.91,-20.0);')
cmd.do('remove name H*;')
cmd.do('select carbon1, element C and (resi 3 or resi 8) ')
cmd.do('# select lower base pair;')
cmd.do('select carbon2, element C and (resi 2 or resi 9) ')
cmd.do('#select upper base pair;')
cmd.do('color gray70, carbon1;')
cmd.do('color gray10, carbon2;')
cmd.do('show sticks;')
cmd.do('space cmyk;')
cmd.do('distance hbond1, /4PCO//B/U`9/N3,/4PCO//A/G`2/O6;')
cmd.do('distance hbond2, /4PCO//B/U`9/O2,/4PCO//A/G`2/N1;')
cmd.do('distance hbond3, /4PCO//A/U`3/N3,/4PCO//B/G`8/O6;')
cmd.do('distance hbond4, /4PCO//A/U`3/O2,/4PCO//B/G`8/N1;')
cmd.do('color black, hbond1;')
cmd.do('color black, hbond2;')
cmd.do('color gray70, hbond3;')
cmd.do('color gray70, hbond4;')
cmd.do('show nb_spheres;')
cmd.do('set nb_spheres_size, 0.35;')
cmd.do('hide labels;')
cmd.do('ray 1600,1000;')
cmd.do('png 4PCO.png;')
${0}
'''
'This code colors by the nucleotides by base seqence. The backcone is shown as a flatten ribbon with rolled edges that give the dumbell effect. The code can be applied to any nucleic acid. The code is dervied from the CR and DU shortcuts. ':
'prefix': 'nucleicAcidDumbellCartoonColorbySequence'
'body': '''
cmd.do('bg_color white;')
cmd.do('set cartoon_oval_length, ${1:1.85}')
cmd.do('set cartoon_oval_width, ${2:0.5}')
cmd.do('cartoon oval;')
cmd.do('cartoon dumbbell;')
cmd.do('set cartoon_dumbbell_width, 0.2;')
cmd.do('set cartoon_dumbbell_radius, 0.4;')
cmd.do('set cartoon_ring_mode, ${3:3};')
cmd.do('# set the color of the backbone oval')
cmd.do('set cartoon_nucleic_acid_color, ${4:blue};')
cmd.do('select rna_A, resn A;')
cmd.do('select rna_C, resn C;')
cmd.do('select rna_G, resn G;')
cmd.do('select rna_U, resn U;')
cmd.do('select dna_T, resn T;')
cmd.do('color ${5:yellow}, rna_A;')
cmd.do('color ${6:red}, rna_C; ')
cmd.do('color ${7:gray40}, rna_G;')
cmd.do('color ${8:palecyan}, rna_U;')
cmd.do('color ${9:brown}, dna_T;')
cmd.do('as cartoon;')
${0}
'''
'Set keyboard shortcut by mapping F1 to stereo.':
'prefix': 'stereokb'
'body': '''
cmd.do('cmd.set_key('F1',lambda:cmd.stereo({'on':0,'off':1}[cmd.get('stereo')]));')
${0}
'''
'Print to the screen the settings and their current parameter values.':
'prefix': 'listSettings2'
'body': '''
cmd.do('list = setting.get_name_list();[print("%s => %s" % (name, setting.get_setting_text(name))) for name in list];')
${0}
'''
'Print to the screen the settings and their current parameter values. This is the more compact version.':
'prefix': 'listSettings'
'body': '''
cmd.do('[print("%s => %s" % (name, setting.get_setting_text(name))) for name in setting.get_name_list()];')
${0}
'''
'Print to the screen as labels that 21 font ids in their corresponding fonts in a grid. Each label is an object and appears in the internal gui. You can turn on and off the display of specific fonts.':
'prefix': 'displayFonts'
'body': '''
cmd.do('python;')
cmd.do('from pymol import cmd;')
cmd.do('for i in range(1,21):')
cmd.do(' name = 'label%d' % i;')
cmd.do(' cmd.pseudoatom(name, label='label font id %d' % i, pos=(0,0,0));')
cmd.do(' cmd.set('label_font_id', i, name);')
cmd.do('cmd.set('label_size', 50);')
cmd.do('cmd.set('grid_mode');')
cmd.do('python end;')
${0}
'''
'Print to disk a list of H-bond pairs and this H-bond length.':
'prefix': 'listHBonds'
'body': '''
cmd.do('Finish latter. See file listHBonds.py.;')
${0}
'''
'Create a list of objects in the internal gui and print this list to the screen.':
'prefix': 'listObjects'
'body': '''
cmd.do('objList = cmd.get_names("objects");print(objList);')
${0}
'''
'Print a list of protein--ligand distances. Code by Dan Kulp. Updated for Python3.':
'prefix': 'listLigandProteinDistances'
'body': '''
cmd.do('from pymol import cmd')
cmd.do('"""')
cmd.do('Find all distances betwen all ligand atoms and all protein atoms. ')
cmd.do('')
cmd.do('Adapted and updated from script by Dan Kulp posted here')
cmd.do('https://sourceforge.net/p/pymol/mailman/message/10097804/')
cmd.do('')
cmd.do('There are probably better solutions like finding just the ')
cmd.do('distances to proein atoms within a certain distance from ')
cmd.do('the ligand.')
cmd.do('')
cmd.do('Due to the nested for loops, this script is takes several second')
cmd.do('to run on a medium-sized human protein. This script is a ')
cmd.do('good candidate for vectorization. ')
cmd.do('')
cmd.do('It is also a good candiate for becoming a function and a shortcut. ')
cmd.do('')
cmd.do('"""')
cmd.do('')
cmd.do('# customize these lines to your protein.')
cmd.do('cmd.fetch("6NEC")')
cmd.do('cmd.select("prot","not resn XIN and not resn HOH and not chain C")')
cmd.do('cmd.select("lig", "resn XIN and not chain C")')
cmd.do('')
cmd.do('dist_list = {}')
cmd.do('pro_atoms = cmd.get_model("prot")')
cmd.do('lig_atoms = cmd.get_model("lig")')
cmd.do('')
cmd.do('for l_at in lig_atoms.atom:')
cmd.do(' for p_at in pro_atoms.atom:')
cmd.do(' dist_list[str(l_at.resn) +')
cmd.do(' ":" +')
cmd.do(' str(l_at.resi) +')
cmd.do(' " " +')
cmd.do(' l_at.name +')
cmd.do(' " ---- " + ')
cmd.do(' str(p_at.resn) +')
cmd.do(' ":" +')
cmd.do(' str(p_at.resi) +')
cmd.do(' " " +')
cmd.do(' p_at.name] = cmd.dist("foo", ')
cmd.do(' "index " +')
cmd.do(' str(l_at.index),"index " + str(p_at.index))')
cmd.do(' cmd.delete("foo")')
cmd.do('print("List of all pairwise ligand--protein atom-atom distances:")')
cmd.do('# [print("Distance of " + d + " is " + str(dist_list[d])) for d in dist_list.keys()]')
cmd.do('')
cmd.do('# More compact print statement. Need an f-string format statement.')
cmd.do('[print( d + " " + str(dist_list[d])) for d in dist_list.keys()]')
${0}
'''
'This code shows that cartoon backbone tube as 65% transparent. It hides the rungs of the cartoon. It shows all of the non-H atoms are sticks. The motivation is to have the cartoon highlight the backbone without dominanting the scene.':
'prefix': 'nucleicAcidBackboneTubesSticks'
'body': '''
cmd.do('set bg_rgb, white;')
cmd.do('hide everything, all;')
cmd.do('show cartoon, ${1:3nd3};')
cmd.do('set cartoon_sampling,1;')
cmd.do('set cartoon_tube_radius, 0.5;')
cmd.do('set cartoon_ladder_mode, 0;')
cmd.do('set cartoon_transparency, ${2:0.65};')
cmd.do('set stick_radius ${3:0.12};')
cmd.do('show sticks;')
cmd.do('hide sticks, element H;')
${0}
'''
'The code expands the asymmetric unit. It like the generate symmetry mates command but it provides more control over the prefix name of the symmetry mates and the addition of unique segment identifiers for each symmetry mate. The usage: symexp prefix, object, (selection), cutoff, segidFlag. The cutoff is in Angstroms. The segidFlag set to 1 will add unique segids. For related functions, see SC***.':
'prefix': 'symexp'
'body': '''
cmd.do('symexp ${1:symm}, ${2:3fa0}, (${2:3fa0}), ${3:20},${4:1};')
${0}
'''
'Adds the function draw_axis(). Could be useful for the adding a symmery axis, a ncs axis, or scale bar to a scene.':
'prefix': 'addAxis'
'body': '''
cmd.do('from pymol.cgo import * # get constants')
cmd.do('from pymol import cmd')
cmd.do('')
cmd.do('import math')
cmd.do('')
cmd.do('class Counter:')
cmd.do(' """')
cmd.do(' draw_line')
cmd.do(' source https://www.pymolwiki.org/index.php/Symmetry_Axis')
cmd.do(' ')
cmd.do(' Pymol script copyright Matthew O'Meara and Xavier Ambroggio 2007')
cmd.do(' ')
cmd.do(' Under GNU Free Documentation License 1.2')
cmd.do(' ')
cmd.do(' Example:')
cmd.do(' ')
cmd.do(' draw_axis(x=18.232, y=17.150, z=9.488,i=-.226639, j=0.708772, k=-.668039, r=1, b=0, g=0, width=1, length=100)')
cmd.do(' ')
cmd.do(' Updated 15 June 2020 ')
cmd.do(' Blaine Mooers')
cmd.do(' ')
cmd.do(' Notes:')
cmd.do(' 1) Could be useful for the adding a symmery axis, a ncs axis, or scale bar to a scene.')
cmd.do(' 2) The postion (xyz) is the middle of the line, not one end as expected for a vector.')
cmd.do(' 3) Another example: draw_axis(x=0, y=0, z=0,i=0, j=0, k=1, r=1, b=0, g=0, width=300, length=96) ')
cmd.do(' 4) Changed print statement to Python3 print function.')
cmd.do(' 5) Replaced cmd.extend() with function generator.')
cmd.do(' """')
cmd.do(' def __init__(self):')
cmd.do(' self.state = 1')
cmd.do('counter = Counter()')
cmd.do('')
cmd.do('@cmd.extend')
cmd.do('def draw_axis(x=None, y=None, z=None, i=None, j=None, k=None, length=20.0, r=1.0, g=1.0, b=1.0, width=1.0 ):')
cmd.do(' if x == None or y == None or z == None or i == None or j == None or k== None :')
cmd.do(' print('Usage: draw_axis x,y,z, i,k,j, length, r,g,b, width')')
cmd.do(' print('draw a line centered at (x,y,z) with the direction vector (i,j,k)')')
cmd.do(' print('length, color (r,g,b), and width arguments are optional')')
cmd.do('# print 'For a fun example of the command, run draw_axis_example'')
cmd.do(' else :')
cmd.do(' x,y,z = float(x), float(y), float(z)')
cmd.do(' i,j,k = float(i), float(j), float(k)')
cmd.do(' r,g,b = float(r), float(g), float(b)')
cmd.do(' width = float(width)')
cmd.do(' length = float(length) / 2.0')
cmd.do('')
cmd.do(' x1,y1,z1 = (x+i*length,y+j*length,z+k*length)')
cmd.do(' x2,y2,z2 = (x-i*length,y-j*length,z-k*length)')
cmd.do('')
cmd.do(' obj = [')
cmd.do(' LINEWIDTH, width,')
cmd.do(' BEGIN, LINES,')
cmd.do('')
cmd.do(' COLOR, r, g, b,')
cmd.do(' VERTEX, x1, y1, z1,')
cmd.do(' VERTEX, x2, y2, z2,')
cmd.do('')
cmd.do(' END')
cmd.do(' ]')
cmd.do('')
cmd.do(' cmd.load_cgo(obj,'axis'+str(counter.state))')
cmd.do(' counter.state += 1')
${0}
'''
'Wait unitl all current commands have been executed. A timeout ensures that that command ecentually returns.':
'prefix': 'synch'
'body': '''
cmd.do('cmd.sync(timeout=${1:1.0},poll=${2:0.05});')
${0}
'''
'Add or substract a residue number offset.':
'prefix': 'renumResi'
'body': '''
cmd.do('alter ${1:3fa0}, resi=str(int(resi)+${2:100});sort;')
${0}
'''
'Add or substract a atom number offset.':
'prefix': 'renumAtoms'
'body': '''
cmd.do('alter {$1:3fa0}, ID=ID+${2:100};')
cmd.do('sort;')
${0}
'''
'Rename a chain. ':
'prefix': 'renameChain'
'body': '''
cmd.do('alter ${1:3fa0} and chain ${2:A}, chain=${3:"C"};')
cmd.do('sort;')
${0}
'''
'Print the atom number2 of a residue.':
'prefix': 'printAtomNumbers'
'body': '''
cmd.do('iterate (resi 1), print(name + " %i5" % ID);')
${0}
'''
'Print the atom names of a residue.':
'prefix': 'printAtomNames'
'body': '''
cmd.do('iterate (resi ${1:101}), print(name);')
${0}
'''
'Print the bfactors of a residue.':
'prefix': 'printBfactors'
'body': '''
cmd.do('iterate (resi ${1:101}), print(name + " %.2f" % b);')
${0}
'''
'Print the van Der Waals radii of the atoms in of a residue.':
'prefix': 'printVDWradii'
'body': '''
cmd.do('iterate (resi ${1:101}), print(name + " %.2f" % vdw);')
${0}
'''
'Print the coordinates of the atoms in a residue.':
'prefix': 'printCoordinates'
'body': '''
cmd.do('stored.coords = []; ')
cmd.do('iterate_state 1, (resi ${1:101}), stored.coords.append([x,y,z]); ')
cmd.do('[print(i) for i in stored.coords];')
${0}
'''
'Print the atom names and coordinates of the atoms in a residue.':
'prefix': 'printNamesCoordinates'
'body': '''
cmd.do('stored.names = []; iterate_state 1, (resi ${1:101}), stored.names.append([name]); ')
cmd.do('stored.coords = []; iterate_state 1, (resi ${1:101})), stored.coords.append([x,y,z]); ')
cmd.do('[print(i,j) for i,j in zip(stored.names, stored.coords)];')
${0}
'''
'Print the atom names as tuples and coordinates of the atoms in a residue as a list.':
'prefix': 'printNamesCoordinates'
'body': '''
cmd.do('stored.coords = []; iterate_state 1, (resi ${1:101}), stored.coords.append([x,y,z]); ')
cmd.do('stored.names = []; iterate_state 1, (resi ${1:101}), stored.names.append([name]);')
cmd.do('stored.names3 = [tuple(i) for i in stored.names];')
cmd.do('[print(i,j) for i,j in(zip(stored.names3, stored.coords)];')
${0}
'''
'Source block template in org-mode with emacs-jupyter package. ':
'prefix': 'emacsjupyterSourceBlock'
'body': '''
cmd.do('#+BEGIN_SRC jupyter-python :session py :kernel pymol.python :exports both :results raw drawer ')
cmd.do('from pymol import cmd')
cmd.do('cmd.do("reinitialize")')
cmd.do('cmd.bg_color("white")')
cmd.do('cmd.do("fetch 6VXX")')
cmd.do('cmd.do("zoom (resi 614 and chain A)")')
cmd.do('cmd.label(selection="chain A and resi 614 and name CB", expression="'%s-%s' % (resn,resi)")')
cmd.do('cmd.do("set label_color, black; set label_size, 48")')
cmd.do('cmd.do("set stick_radius, 0.12")')
cmd.do('cmd.do("hide cartoon; show sticks")')
cmd.do('cmd.do("set ray_shadows, 0")')
cmd.do('cmd.do("draw")')
cmd.do('cmd.do("png /Users/blaine/D614Gipython3.png, 600, 360, dpi=600")')
cmd.do('from IPython.display import Image')
cmd.do('from IPython.core.display import HTML')
cmd.do('PATH = "/Users/blaine/"')
cmd.do('Image(filename = PATH + "D614Gipython3.png", width=600, unconfined=True)')
cmd.do('#+END_SRC')
cmd.do('')
cmd.do('#+RESULTS:')
cmd.do('$0')
${0}
'''
'Source block template in org-mode with ob-ipython package. ':
'prefix': 'obipythonSourceBlock'
'body': '''
cmd.do('#+BEGIN_SRC ipython :session py :kernel pymol.python :exports both :results raw drawer ')
cmd.do('from pymol import cmd')
cmd.do('cmd.do("reinitialize")')
cmd.do('cmd.bg_color("white")')
cmd.do('cmd.do("fetch 6VXX")')
cmd.do('cmd.do("zoom (resi 614 and chain A)")')
cmd.do('cmd.label(selection="chain A and resi 614 and name CB", expression="'%s-%s' % (resn,resi)")')
cmd.do('cmd.do("set label_color, black; set label_size, 48")')
cmd.do('cmd.do("set stick_radius, 0.12")')
cmd.do('cmd.do("hide cartoon; show sticks")')
cmd.do('cmd.do("set ray_shadows, 0")')
cmd.do('cmd.do("draw")')
cmd.do('cmd.do("png /Users/blaine/D614Gipython3.png, 600, 360, dpi=600")')
cmd.do('from IPython.display import Image')
cmd.do('from IPython.core.display import HTML')
cmd.do('PATH = "/Users/blaine/"')
cmd.do('Image(filename = PATH + "D614Gipython3.png", width=600, unconfined=True)')
cmd.do('#+END_SRC')
cmd.do('')
cmd.do('#+RESULTS:')
${0}
'''
| 191726 | '.source.python':
'Ambient occlussion.':
'prefix': 'ao'
'body': '''
cmd.do('set_color oxygen, [1.0,0.4,0.4];')
cmd.do('set_color nitrogen, [0.5,0.5,1.0];')
cmd.do('remove solvent;')
cmd.do('as spheres;')
cmd.do('util.cbaw;')
cmd.do('bg white;')
cmd.do('set light_count,10;')
cmd.do('set spec_count,1;')
cmd.do('set shininess, 10;')
cmd.do('set specular,0.25;')
cmd.do('set ambient,0;')
cmd.do('set direct,0;')
cmd.do('set reflect,1.5;')
cmd.do('set ray_shadow_decay_factor, 0.1;')
cmd.do('set ray_shadow_decay_range, 2;')
cmd.do('unset depth_cue;')
cmd.do('ray;')
${0}
'''
'Set ellipsoid color.':
'prefix': 'ellipcol'
'body': '''
cmd.do('set ellipsoid_color, ${1:color};')
cmd.do('${0}')
${0}
'''
'set distance labels to display 2 decimals':
'prefix': 'sigdist'
'body': '''
cmd.do('set label_distance_digits, ${1:2};')
${0}
'''
'Set angle labels to display 2 decimals places':
'prefix': 'sigang'
'body': '''
cmd.do('set label_angle_digits, ${1:2};')
${0}
'''
'Ball and stick representation. ':
'prefix': 'bs'
'body': '''
cmd.do('show sticks;')
cmd.do('set stick_radius, 0.12;')
cmd.do('set stick_ball, on;')
cmd.do('set stick_ball_ratio, 1.9;')
cmd.do('show nb_spheres;')
cmd.do('set nb_spheres_size=0.33;')
${0}
'''
'Base-stacking figure.':
'prefix': 'stack'
'body': '''
cmd.do('delete all;')
cmd.do('fetch ${1:4PCO}, type=pdb,async=0;')
cmd.do('select ${2:G2G3}, ( ((resi ${3:2} or resi ${4:3}) and chain A) or ((resi ${5:8} or resi ${6:9}) and chain B) );')
cmd.do('hide everything, element h; ')
cmd.do('remove not ${2:G2G3};')
cmd.do('bg_color white;')
cmd.do('show sticks;')
cmd.do('set stick_radius=0.14;')
cmd.do('set stick_ball, on; ')
cmd.do('set stick_ball_ratio,1.9;')
cmd.do('set_view (-0.75,0.09,0.66,-0.2,0.92,-0.35,-0.64,-0.39,-0.67,-0.0,-0.0,-43.7,7. 24,9.55,11.78,29.46,57.91,-20.0);')
cmd.do('hide everything, element H;')
cmd.do('select carbon1, element C and (resi ${4:3} or resi ${5:8}); ')
cmd.do('# select lower base pair;')
cmd.do('select carbon2, element C and (resi ${3:2} or resi ${6:9});')
cmd.do('#select upper base pair;')
cmd.do('color gray70,carbon1;')
cmd.do('color gray10,carbon2;')
cmd.do('space cmyk;')
cmd.do('distance hbond1,/${1:4PCO}//B/U`9/N3,/${1:4PCO}//A/G`2/O6;')
cmd.do('distance hbond2,/${1:4PCO}//B/U`9/O2,/${1:4PCO}//A/G`2/N1;')
cmd.do('distance hbond3,/${1:4PCO}//A/U`3/N3,/${1:4PCO}//B/G`8/O6;')
cmd.do('distance hbond4,/${1:4PCO}//A/U`3/O2,/${1:4PCO}//B/G`8/N1;')
cmd.do('color black, hbond1;')
cmd.do('color black, hbond2;')
cmd.do('color gray70, hbond3;')
cmd.do('color gray70, hbond4;')
cmd.do('show nb_spheres;')
cmd.do('set nb_spheres_size, 0.35;')
cmd.do('hide labels;')
cmd.do('ray 1600,1000;')
cmd.do('png ${1:4PCO}.png')
${0}
'''
'Biological unit.':
'prefix': 'bu'
'body': '''
cmd.do('run ~/Scripts/PyMOLScripts/quat.py; quat')
${0}
'''
'Valence bond. ':
'prefix': 'doubleBond'
'body': '''
cmd.do('set valence, 1; ')
cmd.do('set valence_mode, 1;')
${0}
'''
'Color blindness.':
'prefix': 'cblind'
'body': '''
cmd.do('run ~/Pymol-script-repo/colorblindfriendly.py;')
cmd.do('as cartoon;')
cmd.do('color cb_red, ss H;')
cmd.do('color cb_yellow,ss S;')
cmd.do('color cb_green, ss L+;')
${0}
'''
'Center pi.':
'prefix': 'centerpi'
'body': '''
cmd.do('pseudoatom pi_cent,/${1:3nd3}/${2:A}/${3:U`15}/cg+cz;')
cmd.do('dist pi_cent////ps1, b/${4:U`15}/${5:aaa};')
${0}
'''
'Color ribbon H red, strand yellow, loop green.':
'prefix': 'cribbon'
'body': '''
cmd.do('as cartoon;')
cmd.do('color red, ss H;')
cmd.do('color yellow,ss S;')
cmd.do('color green, ss L+;')
${0}
'''
'Colored spheres.':
'prefix': 'cspheres'
'body': '''
cmd.do('as spheres;')
cmd.do('color gray30, chain ${1:A};')
cmd.do('color white, chain ${2:B};')
cmd.do('color green, name CL;')
cmd.do('color brown, resn NAG;')
cmd.do('color red, resi 381;')
cmd.do('remove solvent;')
cmd.do('unset specular;')
cmd.do('set ray_trace_gain, 0;')
cmd.do('set ray_trace_mode, 3;')
cmd.do('bg_color white;')
cmd.do('set ray_trace_color, black;')
cmd.do('unset depth_cue;')
${0}
'''
'Coordinate covalent bonds to metals and H-bonds friom RNA.':
'prefix': 'coordinate'
'body': '''
cmd.do('viewport 900,600;')
cmd.do('fetch 3nd4, type=pdb, async=0;')
cmd.do('run ~/Scripts/PyMOLScripts/quat.py;')
cmd.do('quat 3nd4;')
cmd.do('show sticks;')
cmd.do('set stick_radius=0.125;')
cmd.do('hide everything, name H*;')
cmd.do('bg_color white;')
cmd.do('create coorCov, (3nd4_1 and (resi 19 or resi 119 or resi 219 or resi 319 or resi 419 or resi 519 or (resi 3 and name N7)));')
cmd.do('bond (coorCov//A/NA`19/NA),(coorCov//A/A`3/N7);')
cmd.do('bond (coorCov//A/NA`19/NA),(coorCov//A/HOH`119/O);')
cmd.do('bond (coorCov//A/NA`19/NA),(coorCov//A/HOH`219/O);')
cmd.do('bond (coorCov//A/NA`19/NA),(coorCov//A/HOH`319/O);')
cmd.do('bond (coorCov//A/NA`19/NA),(coorCov//A/HOH`519/O);')
cmd.do('distance (3nd4_1 and chain Aand resi 19 and name NA), (3nd4_1 and chain A and resi 519);')
cmd.do('distance (3nd4_1 and chain A and resi 19 and name NA), (3nd4_1 and chain A and resi 419);')
cmd.do('distance (3nd4_1 and chain A and resi 19 and name NA), (3nd4_1 and chain A and resi 319);')
cmd.do('distance (3nd4_1 and chain A and resi 19 and name NA), (3nd4_1 and chain A and resi 219);')
cmd.do('show nb_spheres; ')
cmd.do('set nb_spheres_size, .35;')
cmd.do('distance hbond1,/3nd4_1/1/A/HOH`119/O, /3nd4_1/1/A/A`3/OP2;')
cmd.do('distance hbond2,/3nd4_1/1/A/HOH`319/O, /3nd4_1/1/A/A`3/OP2;')
cmd.do('distance hbond3,/3nd4_1/1/A/HOH`91/O,/3nd4_1/1/A/HOH`119/O;')
cmd.do('distance hbond4,/3nd4_1/1/A/G`4/N7,/3nd4_1/1/A/HOH`91/O;')
cmd.do('distance hbond5,/3nd4_1/1/A/G`4/O6, /3nd4_1/1/A/HOH`419/O;')
cmd.do('distance hbond6,/3nd4_1/1/A/HOH`91/O,/3nd4_1/1/A/G`4/OP2;')
cmd.do('distance hbond7,/3nd4_1/1/A/HOH`319/O,/3nd4_1/1/A/G`2/OP2;')
cmd.do('distance hbond9,/3nd4_1/1/A/HOH`419/O,/3nd4_2/2/A/HOH`74/O;')
cmd.do('distance hbond10,/3nd4_2/2/A/C`15/O2,/3nd4_1/1/A/G`2/N2;')
cmd.do('distance hbond11, /3nd4_2/2/A/C`15/N3,/3nd4_1/1/A/G`2/N1;')
cmd.do('distance hbond12,/3nd4_2/2/A/C`15/N4,/3nd4_1/1/A/G`2/O6;')
cmd.do('distance hbond13, /3nd4_2/2/A/U`14/N3,/3nd4_1/1/A/A`3/N1;')
cmd.do('distance hbond14,3nd4_2/2/A/U`14/O4,/3nd4_1/1/A/A`3/N6;')
cmd.do('distance hbond15, /3nd4_2/2/A/C`13/N4,/3nd4_1/1/A/G`4/O6;')
cmd.do(' distance hbond16,/3nd4_2/2/A/C`13/N3, /3nd4_1/1/A/G`4/N1;')
cmd.do('distance hbond17, /3nd4_1/1/A/G`4/N2,/3nd4_2/2/A/C`13/O2;')
cmd.do('distance hbond18,/3nd4_1/1/A/G`2/N2,/3nd4_2/2/A/C`15/O2;')
cmd.do('distance hbond19,/3nd4_1/1/A/HOH`91/O,/3nd4_1/1/A/G`4/OP2; ')
cmd.do('set depth_cue=0;')
cmd.do('set ray_trace_fog=0;')
cmd.do('set dash_color, black;')
cmd.do('set label_font_id, 5;')
cmd.do('set label_size, 36;')
cmd.do('set label_position, (0.5, 1.0, 2.0);')
cmd.do('set label_color, black;')
cmd.do('set dash_gap, 0.2;')
cmd.do('set dash_width, 2.0;')
cmd.do('set dash_length, 0.2;')
cmd.do('set label_color, black;')
cmd.do('set dash_gap, 0.2;')
cmd.do('set dash_width, 2.0;')
cmd.do('set dash_length, 0.2;')
cmd.do('select carbon, element C;')
cmd.do('color yellow, carbon;')
cmd.do('disable carbon;')
cmd.do('set_view(-0.9,0.34,-0.26,0.33,0.18,-0.93,-0.27,-0.92,-0.28,-0.07,-0.23,-27.83,8.63,19.85,13.2,16.0,31.63,-20.0)')
${0}
'''
'H-bond distances.':
'prefix': 'distance'
'body': '''
cmd.do('distance ${1:dist3}, ${2:/rcsb074137//B/IOD`605/I`B}, ${3:/rcsb074137//B/IOD`605/I`A}')
${0}
'''
'Draw H-bonds. ':
'prefix': 'drawHbonds'
'body': '''
cmd.do('hide everything, hydrogens')
cmd.do('hide labels')
cmd.do('set dash_color, ${1:black}${2:yelow} ')
cmd.do('set dash_gap, 0.4')
cmd.do('set dash_radius, 0.08')
${0}
'''
'Carved isomesh representation of electron density. ':
'prefix': 'carvedIsomesh'
'body': '''
cmd.do('delete all;')
cmd.do('fetch ${1:4dgr}, async=0;')
cmd.do('fetch ${1:4dgr}, type=2fofc,async=0;')
cmd.do('select ${2:LongGlycan}, resi ${3:469:477};')
cmd.do('orient ${2:LongGlycan};')
cmd.do('remove not ${2:LongGlycan};')
cmd.do('remove name H*;')
cmd.do('isomesh 2fofcmap, ${1:4dgr}_2fofc, 1, ${2:LongGlycan}, carve = 1.8;')
cmd.do('color density, 2fofcmap; ')
cmd.do('show sticks;')
cmd.do('show spheres;')
cmd.do('set stick_radius, .07;')
cmd.do('set sphere_scale, .19;')
cmd.do('set sphere_scale, .13, elem H;')
cmd.do('set bg_rgb=[1, 1, 1];')
cmd.do('set stick_quality, 50;')
cmd.do('set sphere_quality, 4;')
cmd.do('color gray85, elem C;')
cmd.do('color red, elem O;')
cmd.do('color slate, elem N;')
cmd.do('color gray98, elem H;')
cmd.do('set stick_color, gray50;')
cmd.do('set ray_trace_mode, 1;')
cmd.do('set ray_texture, 2;')
cmd.do('set antialias, 3;')
cmd.do('set ambient, 0.5;')
cmd.do('set spec_count, 5;')
cmd.do('set shininess, 50;')
cmd.do('set specular, 1;')
cmd.do('set reflect, .1;')
cmd.do('set dash_gap, 0;')
cmd.do('set dash_color, black;')
cmd.do('set dash_gap, .15;')
cmd.do('set dash_length, .05;')
cmd.do('set dash_round_ends, 0;')
cmd.do('set dash_radius, .05;')
cmd.do('set_view (0.34,-0.72,0.61,0.8,0.56,0.22,-0.51,0.4,0.77,0.0,0.0,-81.31,44.64,-9.02,58.62,65.34,97.28,-20.0);')
cmd.do('preset.ball_and_stick("all",mode=1);')
cmd.do('draw;')
${0}
'''
'Fetch 2FoFc map as an isomesh.':
'prefix': 'fetch2FoFcIsomesh'
'body': '''
cmd.do('fetch ${1:3nd4}_2fofc, type=2fofc, async=0;')
cmd.do('isomesh 2fofcmap, ${1:3nd4_2fofc}, 1, ${2:LongGlycan}, carve = 1.8;')
${0}
'''
'Fetch cif file.':
'prefix': 'fetchCIF'
'body': '''
cmd.do('fetch ${1:3nd4}, type=cif, async=0;')
${0}
'''
'Fetch fofc map.':
'prefix': 'fetchFoFc'
'body': '''
cmd.do('fetch ${1:3nd4}, type=fofc, async=0;')
${0}
'''
'Filled rings in nucleic acids. ':
'prefix': 'filledRing'
'body': '''
cmd.do('show sticks;set cartoon_ring_mode, 3;')
cmd.do('set cartoon_ring_finder, 1;')
cmd.do('set cartoon_ladder_mode, 1;')
cmd.do('set cartoon_nucleic_acid_mode, 4;')
cmd.do('set cartoon_ring_transparency, 0.5;')
cmd.do('as cartoon;')
${0}
'''
'Get coordinates. ':
'prefix': 'getCoordinates'
'body': '''
cmd.do('print cmd.get_atom_coords('${1:/4PCO//B/G`8/OP2}');')
${0}
'''
'H-bond dashes.':
'prefix': 'hbonddash'
'body': '''
cmd.do('hide everything, hydrogens;')
cmd.do('hide labels;')
cmd.do('set dash_color, black; ')
cmd.do('set dash_gap, 0.4;')
cmd.do('set dash_radius, 0.08;')
${0}
'''
'Hbond setup. ':
'prefix': 'hbond'
'body': '''
cmd.do('hide labels;')
cmd.do('set dash_color, black ;')
cmd.do('set dash_length, ${1:0.15};')
cmd.do('set dash_gap, ${2:0.35};')
cmd.do('set dash_width, ${3:3.0};')
${0}
'''
'Hide alt loc.':
'prefix': 'hidealtloc'
'body': '''
cmd.do('select altconf, alt ${1:b} # select B alternative locators;')
cmd.do('hide everything, altconf # hide alt B locators;')
${0}
'''
'Label CA atom with single-letter residue name and residue number.':
'prefix': 'labelResnResi'
'body': '''
cmd.do('label name ca, '%s%s' %(one_letter[${1:resn}],${2:resi});')
${0}
'''
'Label SS. ':
'prefix': 'labelSS'
'body': '''
cmd.do('alter ${1:}, ss='%1';')
cmd.do('label (%2),'%3';')
${0}
'''
'Load PDB ball-and-stick.':
'prefix': 'loadPDBbs'
'body': '''
cmd.do('fetch ${1:3nd3},name=${1:3nd3}, type=pdb, async=0')
cmd.do('hide (name H*);')
cmd.do('hide lines;')
cmd.do('show sticks;')
cmd.do('set stick_radius, ${2:1.2};')
cmd.do('set nb_sphere_radius, ${3:0.35};')
cmd.do('orient;')
${0}
'''
'Load PDB nb spheres. ':
'prefix': 'loadPDBnb'
'body': '''
cmd.do('fetch ${1:3nd3},name=${1:3nd3}, type=pdb, async=0;')
cmd.do('orient;')
cmd.do('set stick_radius, ${2:1.2};')
cmd.do('hide (name H*);')
cmd.do('set nb_sphere_size, ${3:0.35};')
cmd.do('set nb_spheres_quality, ${4:1};')
cmd.do('show nb_spheres;')
${0}
'''
'Measure surface area. ':
'prefix': 'ms'
'body': '''
cmd.do('fetch ${1:3nd3},name=${1:3nd3}, type=pdb, async=0')
cmd.do('select ${2:temp}, ${3:3nd3} and chain A;')
cmd.do('run ${3:/Users/blaine-mooers/Scripts/PyMOLScripts/msms_pymol.py};')
cmd.do('calc_msms_area ${2:temp};')
${0}
'''
'Molscript ribbons.':
'prefix': 'molscriptRibbon'
'body': '''
cmd.do('set cartoon_highlight_color, grey;')
cmd.do('show cartoon;')
cmd.do('set cartoon_flat_sheets, 0;')
cmd.do('set cartoon_smooth_loops, 0;')
cmd.do('set cartoon_fancy_helices, 1;')
${0}
'''
'One letter amino acid. ':
'prefix': 'oneLetter'
'body': '''
cmd.do('one_leVer%={'VAL':'V',%'ILE':'I',%'LEU':'L',%'GLU':'E',%'GLN':'Q','ASP':'D',%')
cmd.do(''ASN':'N',%'HIS':'H',%'TRP':'W',%'PHE':'F',%'TYR':'Y',%'ARG':'R',%'LYS':'K',%')
cmd.do(''SER':'S',%'THR':'T',%'MET':'M',%'ALA':'A',%'GLY':'G',%'PRO':'P',%'CYS':'C'}%')
${0}
'''
'Print Fasta from PDB file. ':
'prefix': 'fasta'
'body': '''
cmd.do('print cmd.get_fastastr('all')')
${0}
'''
'Position label with pseudoatom. ':
'prefix': 'pseudolabel'
'body': '''
cmd.do('pseudoatom ${1:forLabel};')
cmd.do('label ${1:forLabel}, '%0';')
cmd.do('set label_color, ${2:red};')
${0}
'''
'Rotate about axis.':
'prefix': 'rotate'
'body': '''
cmd.do('rotate ${1:x}, ${2:45}, ${3:pept};')
${0}
'''
'Stereo draw.':
'prefix': 'stereoDraw'
'body': '''
cmd.do('stereo walleye; ')
cmd.do('set ray_shadow, off; ')
cmd.do('#draw 3200,2000;')
cmd.do('draw ${1:1600,1000}; ')
cmd.do('png ${2:aaa}.png')
cmd.do('${0}')
${0}
'''
'Stereo ray.':
'prefix': 'stereoRay'
'body': '''
cmd.do('stereo; ')
cmd.do('set ray_shadow, off;')
cmd.do('ray ${1:2400,1200};')
cmd.do('png ${2:aaa}.png;')
${0}
'''
'Three electron density as Isomesh. ':
'prefix': 'threeMapsIsomesh'
'body': '''
cmd.do('load ${1:4dgr}.pdb')
cmd.do('# Make sure to rename map file so that ')
cmd.do('# the root filename differs from pdb root filename')
cmd.do('load ${1:4dgr}_2fofc.ccp4, 2fofc;')
cmd.do('load ${1:4dgr}_fofc.ccp4, fofc;')
cmd.do('select ${2:glycan}, resid 200 or (resid 469:477);')
cmd.do('isomesh ${3:mesh1}, 2fofc, 1.0, ${2:glycan};')
cmd.do('color density, ${3:mesh1};')
cmd.do('isomesh ${4:mesh2}, fofc, 3.0, ${2:glycan};')
cmd.do('color green, ${4:mesh2};')
cmd.do('isomesh ${5:mesh3}, fofc, -3.0, ${2:glycan};')
cmd.do('color red, ${5:mesh3};')
${0}
'''
'Turn about axis. ':
'prefix': 'turnAboutAxis'
'body': '''
cmd.do('turn ${1:x},${2:90};')
${0}
'''
'Volume ramp.':
'prefix': 'volumeRamp'
'body': '''
cmd.do('cmd.volume_ramp_new('ramp_magenta', [0.01, 1.00, 0.00, 1.00, 0.00, 4.01, 1.00, 0.00, 1.00, 0.10, 4.99, 1.00, 0.00, 1.00, 0.50,])')
${0}
'''
'Set radius of ball used to make solvent accessible surface.':
'prefix': 'solventRadius'
'body': '''
cmd.do('set solvent_radius, ${1:1.55};')
${0}
'''
'Scale the radius and color of atoms as spheres by property in the B-value column.':
'prefix': 'scaleRadiusColor'
'body': '''
cmd.do('bg_color white;')
cmd.do('hide everything;')
cmd.do('show spheres;')
cmd.do('set stick_radius = 0.1;')
cmd.do('hide everything, HET;')
cmd.do('show spheres, HET;')
cmd.do('set sphere_quality=3;')
cmd.do('show sticks, resi $1{1102};')
cmd.do('from pymol import stored;')
cmd.do('# set the stored array equal to the b−values or use your own values; ')
cmd.do('stored.bb = [ ];')
cmd.do('iterate all, stored.bb.append(b);')
cmd.do('# execute a python−block;')
cmd.do('python;')
cmd.do('# scale the b−values;')
cmd.do('M = max(stored.bb);')
cmd.do('scaledBB = map(lambda x: float (x/M), stored.bb);')
cmd.do('count = 0;')
cmd.do('# set the sphere radii independently;')
cmd.do('#[(cmd.set("sphere_scale", x ,"ID %s"%count); count = count + 1) for x in scaledBB]')
cmd.do('for x in scaledBB:')
cmd.do(' cmd.set("sphere_scale", x ,"ID %s"%count)')
cmd.do(' count = count + 1')
cmd.do('python end')
cmd.do('spectrum b, selection=${2:4gdx};')
cmd.do('space cmyk;')
cmd.do('set specular_intensity , 0.25;')
${0}
'''
'Return settings in rounded format.':
'prefix': 'rv'
'body': '''
cmd.do('run roundview.py;')
${0}
'''
'Save png flle with timestamp':
'prefix': 'spng'
'body': '''
cmd.do('python;')
cmd.do('import datetime;')
cmd.do('from pymol import cmd; ')
cmd.do('DT =datetime.datetime.now().strftime("yr%Ymo%mday%dhr%Hmin%M");')
cmd.do('s = str(DT); ')
cmd.do('cmd.save(stemName+s+".png"); ')
cmd.do('end python;')
${0}
'''
'Save pse flle with timestamp':
'prefix': 'spse'
'body': '''
cmd.do('python;')
cmd.do('import datetime;')
cmd.do('from pymol import cmd; ')
cmd.do('DT =datetime.datetime.now().strftime("yr%Ymo%mday%dhr%Hmin%M");')
cmd.do('s = str(DT); ')
cmd.do('cmd.save(stemName+s+".pse"); ')
cmd.do('end python;')
${0}
'''
'Run supercell script to generate three cells in all directions. This script was written by <NAME>.':
'prefix': 'sc222'
'body': '''
cmd.do('run ${1:$HOME/Scripts/PyMOLscripts/supercell.py};')
cmd.do('supercell 2, 2, 2, , orange, supercell2, 1;')
${0}
'''
'The pearl effect is made with two spheres with the outer sphere being transparent.':
'prefix': 'pearl'
'body': '''
cmd.do('create ${1:sodium2}, ${2:sodium1};')
cmd.do('set sphere_transparency, 0.4, ${1:sodium2};')
cmd.do('set sphere_scale, 1.05, ${1:sodium2};')
cmd.do('ray;')
${0}
'''
'Blur the background atoms.':
'prefix': 'fog'
'body': '''
cmd.do('set fog, 0;')
${0}
'''
'Remove waters from molecular object.':
'prefix': 'rmwater'
'body': '''
cmd.do('remove resn HOH;')
${0}
'''
'Set color name to a RGB code.':
'prefix': 'setcolor'
'body': '''
cmd.do('set_color ${1:bark}, [${2:0.1, ${3:0.1}, ${4:0.1}];')
cmd.do('color ${1:bark}, ${5:protein};')
${0}
'''
'Duplicate object.':
'prefix': 'duplicateObject'
'body': '''
cmd.do('create ${1:t4l}, ${2:1lw9};')
${0}
'''
'Select a chain. ':
'prefix': 'selectChain'
'body': '''
cmd.do('select rna, chain B;')
${0}
'''
'Select residues by name.':
'prefix': 'selectResidues'
'body': '''
cmd.do('select aromatic, resn phe+tyr+trp;')
${0}
'''
'Select residues by a range of numbers.':
'prefix': 'selectResi'
'body': '''
cmd.do('select ${!:se}; resi ${2:1-100};')
${0}
'''
'Select atoms by element.':
'prefix': 'selectElement'
'body': '''
cmd.do('select ${1:oxygen}, elem ${2:O}')
${0}
'''
'Select atoms by name.':
'prefix': 'selectName'
'body': '''
cmd.do('select ${1:oxygen2}, name ${2:O2}')
${0}
'''
'Select atoms by alpha helices.':
'prefix': 'selectHelices'
'body': '''
cmd.do('select ${1:helices}, ss h; ')
${0}
'''
'Select atoms by beta strands.':
'prefix': 'selectStrands'
'body': '''
cmd.do('select ${1:strands}, ss s; ')
${0}
'''
'Select atoms by beta loops.':
'prefix': 'selectLoops'
'body': '''
cmd.do('select ${1:loops}, ss l;')
${0}
'''
'Select all nitrogen atom in a selelction except from lysine.':
'prefix': 'selectAllBut'
'body': '''
cmd.do('select ${1:select1}, elem ${2:N} and chain ${3:A} and not resn ${4:LYS};')
${0}
'''
'Select atoms within a radius around a ligand.':
'prefix': 'selectAtomsAround'
'body': '''
cmd.do('select ${1:nearby}, resn ${2:drug} around ${3:5};')
${0}
'''
'Select residues within a radius around a ligand.':
'prefix': 'selectResiduesAround'
'body': '''
cmd.do('select ${1:nearby}, br. resn ${2:drug} around ${3:5};')
${0}
'''
'Undo a selection.':
'prefix': 'undoSelection'
'body': '''
cmd.do('disable ${1:sele}; ')
${0}
'''
'Load a pdb file in the current directory.':
'prefix': 'loadPDBfile'
'body': '''
cmd.do('load ${1:my.pdb};')
${0}
'''
'Save a png file of current scene to the current directory.':
'prefix': 'savePNG'
'body': '''
cmd.do('png ${1:saveMe.png};')
${0}
'''
'Set the ring mode to a value between 0 and 6 in cartoons of nucleic acids.':
'prefix': 'ringMode'
'body': '''
cmd.do('show cartoon, ${1:rna}; set cartoon_ring_mode, ${2:3};')
${0}
'''
'In cartoons, hide the backbone atoms of selected residues when showing then as sticks.':
'prefix': 'sidehChainHelper'
'body': '''
cmd.do('set cartoon_side_chain_helper, on;')
${0}
'''
'Create a new object from part of an existing object.':
'prefix': 'extractPartObj'
'body': '''
cmd.do('extract new_obj, chain A;')
${0}
'''
'Create a putty cartoon.':
'prefix': 'puttyCartoon'
'body': '''
cmd.do('show cartoon;')
cmd.do('cartoon putty;')
cmd.do('unset cartoon_smooth_loops;')
cmd.do('unset cartoon_flat_sheets;')
${0}
'''
'Trun off magenta squares on current selection.':
'prefix': 'hideSelection'
'body': '''
cmd.do('indicate none')
${0}
'''
'Turn on discrete colors between secondary structure elements.':
'prefix': 'discreteCartoonColoring'
'body': '''
cmd.do('set cartoon_discrete_colors, on;')
${0}
'''
'Display all symmetry mates in one unit cell. Uses supercell.py in $HOME/Scripts/PyMOLscripts/.':
'prefix': 'sc111'
'body': '''
cmd.do('run $HOME/Scripts/PyMOLscripts/supercell.py;')
cmd.do('supercell 1, 1, 1, , orange, supercell1, 1;')
${0}
'''
'Display SAXS envelope':
'prefix': 'saxsEnvelope'
'body': '''
cmd.do('alter ${1:refine_A_Ave_SM_015_0_370-374-0r}, vdw=3.0;')
cmd.do('set solvent_radius = 3.0;')
${0}
'''
'Set additional path for PyMOL to search on startup':
'prefix': 'setpath'
'body': '''
cmd.do('os.environ["PATH"] += os.pathsep +${1: '/Applications/ATSAS/bin'};')
${0}
'''
'Set path for location to save fetched pdb files. ':
'prefix': 'fetchPath'
'body': '''
cmd.do('set fetch_path, ${1:/Users/blaine/pdbFiles};')
${0}
'''
'Set antialias to get smooth edges':
'prefix': 'antialias'
'body': '''
cmd.do('set antialias, 1;')
${0}
'''
'Print list of active pymolrc files.':
'prefix': 'lspymolrc'
'body': '''
cmd.do('print invocation.options.deferred;')
${0}
'''
'Set number of decimals places to show in distance labels. ':
'prefix': 'sigDigits'
'body': '''
cmd.do('set label_distance_digits, ${1:2};')
cmd.do('set label_angle_digits, ${2:2};')
${0}
'''
'Label the CA atoms with the Ala333 style format':
'prefix': 'labelCAs'
'body': '''
cmd.do('label name CA,"%s%s" % (resn,resi);')
${0}
'''
'Label waters HOH.':
'prefix': 'labelWatersHOH'
'body': '''
cmd.do('label resn HOH ,"%s%s" % (resn,resi);')
${0}
'''
'Label waters W.':
'prefix': 'labelWatersW'
'body': '''
cmd.do('label resn HOH ,"W%s" % (resi);')
${0}
'''
'Find hbonds around a residue.':
'prefix': 'findHbonds'
'body': '''
cmd.do('remove element h; distance hbonds, all, all, 3.2, mode=2;')
${0}
'''
'Print the B-factors of a residue. ':
'prefix': 'printBs'
'body': '''
cmd.do('remove element h; iterate resi %{1:133}, print resi, name,b;')
${0}
'''
'Label the main chain atoms by resn,resi,atom name.':
'prefix': 'labelMainChain'
'body': '''
cmd.do('label name n+c+o+ca,"%s%s%s" % (resn,resi,name);')
${0}
'''
'Print B factors of part B of a residue.':
'prefix': 'printBspartB'
'body': '''
cmd.do('iterate resi %{1:38} and altloc %{2:B}, print resi, name, alt, b;')
${0}
'''
'Print B--factors for a residue with the B-factors rounded off to two decimal places.':
'prefix': 'printBs2digits'
'body': '''
cmd.do('iterate (resi %{1:133}), print(name + " %.2f" % b);')
${0}
'''
'Write the command reference to html file in the present working directory. ':
'prefix': 'writeCommandReference2HTML'
'body': '''
cmd.do('cmd.write_html_ref('pymol-command-ref.html');')
${0}
'''
'Average the B-factors by using a regular list as opposed to a stored list in PyMOL. Edit the selection as needed.':
'prefix': 'averageB'
'body': '''
cmd.do('"""Uses a regular list as opposed to PyMOL's stored list. Edit the selection as needed."""')
cmd.do('Bfactors = []; ')
cmd.do('iterate (resi ${1:133}), Bfactors.append(b);')
cmd.do('print("Sum = ", "%.2f" % (sum(Bfactors)));')
cmd.do('print("Number of atoms = ", len(Bfactors));')
cmd.do('print( 'Average B =' , "%.2f" % ( sum(Bfactors)/float(len(Bfactors))));')
${0}
'''
'AveBResiX, prints the resiude number and the average bfactor. ':
'prefix': 'aveB4resiX'
'body': '''
cmd.do('""""AveBResiX, prints the resiude number and the average bfactor. ')
cmd.do('Uses reduce and lambda, builtin Python functional porgramming functions. ')
cmd.do('Note that you need to convert the length of the list of Bfactors from an integer to a float before division into the sum. ')
cmd.do('"""')
cmd.do('Bfactors = [];')
cmd.do('iterate (resi ${1:133}), Bfactors.append(b);')
cmd.do('print( "Average B-factor of residue ", %{1:133} , " = ", "%.2f" %(reduce(lambda x, y: x + y, Bfactors) / float(len(Bfactors))) )')
${0}
'''
'Print name and b-factor for a residue.':
'prefix': 'printNameB4ResiX'
'body': '''
cmd.do('Bfac_dict = { 'Bfactors3' : [] };cmd.iterate("(resi 133)","Bfactors3.append((name, b))", space=Bfac_dict); for i,j in Bfac_dict['Bfactors3']: print("%s %.2f" % (i,j));')
${0}
'''
'Print resn, resi, atom name, and b-factor. ':
'prefix': 'printResiResnNameB4ResiX'
'body': '''
cmd.do('Bfac_dict = { 'Bfactors3' : [] };cmd.iterate("(resi 133)","Bfactors3.append((resn,resi,name, b))", space=Bfac_dict); for i,j,k,l in Bfac_dict['Bfactors3']: print("%s %s %s %.2f" % (i,j,k,l));')
${0}
'''
'Print name and b-factor for a residue or residue range (e.g. 81:120). The noH variant.':
'prefix': 'printResiResnNameB4ResiXNoH'
'body': '''
cmd.do('Bfac_dict = { 'Bfactors3' : [] };cmd.iterate("(resi 133 and not elem H)","Bfactors3.append((resn,resi,name, b))", space=Bfac_dict); for i,j,k,l in Bfac_dict['Bfactors3']: print("%s %s %s %.2f" % (i,j,k,l));')
${0}
'''
'Make the background of the internal gui transparent to expand viewport.':
'prefix': 'internalGUImode2 '
'body': '''
cmd.do('internal_gui_mode=2;')
${0}
'''
'Set the width of the internal gui.
':
'prefix': 'internalGUIwidth'
'body': '''
cmd.do('internal_gui_width=%{1:20};')
${0}
'''
'Print document string of a function.':
'prefix': 'printDoc'
'body': '''
cmd.do('print ${1:my_func}.__doc__;')
${0}
'''
'List all snips by tab trigger and description':
'prefix': 'lsSnips'
'body': '''
cmd.do('"""Tab trigger Description')
cmd.do('--------------------------- --------------------------------------------------------------------------------------------------------------------------------------------------------------------')
cmd.do('antialias Set antialias to get smooth edges')
cmd.do('ao Ambient occlussion.')
cmd.do('aveB4resiX AveBResiX, prints the resiude number and the average bfactor.')
cmd.do(' Uses reduce and lambda, builtin Python functional porgramming functions.')
cmd.do(' Note that you need to convert the length of the list of Bfactors from an integer to a float before division into the sum.')
cmd.do('averageB Uses a regular list as opposed to PyMOL's stored list. Edit the selection as needed.')
cmd.do('bs Ball and stick representation.')
cmd.do('bu Biological unit.')
cmd.do('carvedDensity Carved electron density.')
cmd.do('cblind Color blindness.')
cmd.do('centerpi Center pi.')
cmd.do('coordinate Coordinate covalent bonds to metals and H-bonds friom RNA.')
cmd.do('cribbon Color ribbon H red, strand yellow, loop green.')
cmd.do('cspheres Colored spheres.')
cmd.do('discreteCartoonColoring Turn on discrete colors between secondary structure elements.')
cmd.do('distance H-bond distances.')
cmd.do('doubleBond Valence bond.')
cmd.do('drawHbonds Draw H-bonds.')
cmd.do('duplicateObject Duplicate object.')
cmd.do('ellipcol Set ellipsoid color.')
cmd.do('extractPartObj Create a new object from part of an existing object.')
cmd.do('fasta Print Fasta from PDB file.')
cmd.do('fetch2FoFc Fetch 2FoFc map.')
cmd.do('fetchCIF Fetch cif file.')
cmd.do('fetchFoFc Fetch fofc map.')
cmd.do('fetchPath Set path for location to save fetched pdb files.')
cmd.do('filledRing Filled rings in nucleic acids.')
cmd.do('findHbonds Find hbonds around a residue.')
cmd.do('fog Blur the background atoms.')
cmd.do('getCoordinates Get coordinates.')
cmd.do('hbond Hbond setup.')
cmd.do('hbonddash H-bond dashes.')
cmd.do('hideSelection Trun off magenta squares on current selection.')
cmd.do('hidealtloc Hide alt loc.')
cmd.do('internalGUImode2 Makes the background of the internal gui transparent with the viewport extended into this region of the gui. This may be a useful mode for workshops.')
cmd.do('internalGUIwidth Set the width of the internal gui.')
cmd.do('labelCAs Label the CA atoms with the Ala333 style format')
cmd.do('labelMainChain Label the main chain atoms by resn,resi,atom name.')
cmd.do('labelResnResi Label CA atom with residue name and residue number.')
cmd.do('labelSS Label SS.')
cmd.do('labelWatersHOH Label waters HOH.')
cmd.do('labelWatersW Label waters W.')
cmd.do('loadPDBbs Load PDB ball-and-stick.')
cmd.do('loadPDBfile Load a pdb file in the current directory.')
cmd.do('loadPDBnb Load PDB nb spheres.')
cmd.do('lsSnips List all snips by tab trigger and description')
cmd.do('lspymolrc Print list of active pymolrc files.')
cmd.do('molscriptRibbon Molscript ribbons.')
cmd.do('ms Measure surface area.')
cmd.do('oneLetter One letter amino acid.')
cmd.do('pearl The pearl effect is made with two spheres with the outer sphere being transparent.')
cmd.do('printBs Print the B-factors of a residue.')
cmd.do('printBs2digits Print B-values for a residue with the B's rounded off to two decimal places.')
cmd.do('printBspartB Print B factors of part B of a rsidues.')
cmd.do('printDoc Print document string of a function.')
cmd.do('printNameB4ResiX Print name and b-factor for a rsidue. You can change this to a named selection or a residue range ( e.g., resi 133:155). Use the noH variant if H atoms are present.')
cmd.do('printResiResnNameB4ResiX Print resn, resi, atom name, and b-factor.')
cmd.do('printResiResnNameB4ResiXNoH Print name and b-factor for a rsidue. You can change this to a named selection or a residue range ( e.g., resi 133:155). The noH variant.')
cmd.do('pseudolabel Position label with pseudoatom.')
cmd.do('puttyCartoon Create a putty cartoon.')
cmd.do('ringMode Set the ring mode to a value between 0 and 6 in cartoons of nucleic acids.')
cmd.do('rmwater Remove waters from molecular object.')
cmd.do('rotate Rotate about axis.')
cmd.do('rv Return settings in rounded format.')
cmd.do('savePNG Save a png file of current scene to the current directory.')
cmd.do('saxsEnvelope Display SAXS envelope')
cmd.do('sc111 Display all symmetry mates in one unit cell. Asumes supercell.py (sse PyMOL Wiki) is in $HOME/Scripts/PyMOLscripts/.')
cmd.do('sc222 Run Tom Holder's supercell script to generate three cells in all directions.')
cmd.do('scaleRadiusColor Scale the radius and color of atoms as spheres by property in the B-value column.')
cmd.do('selectAllBut Select all nitrogen atom in a selelction except from lysine.')
cmd.do('selectAtomsAround Select atoms within a radius around a ligand.')
cmd.do('selectChain Select a chain.')
cmd.do('selectElement Select atoms by elemnt.')
cmd.do('selectHelices Select atoms by alpha helices.')
cmd.do('selectLoops Select atoms by beta loops.')
cmd.do('selectName Select atoms by name.')
cmd.do('selectResi Select residues by a range of numbers.')
cmd.do('selectResidues Select residues by name.')
cmd.do('selectResiduesAround Select residues within a radius around a ligand.')
cmd.do('selectStrands Select atoms by beta strands.')
cmd.do('setcolor Set color name to a RGB code.')
cmd.do('setpath Set additional path for PyMOL to search on startup')
cmd.do('sidehChainHelper In cartoons, hide the backbone atoms of selected residues when showing then as sticks.')
cmd.do('sigDigits Set number of decimals places to show in distance labels.')
cmd.do('sigang Set angle labels to display 2 decimals places')
cmd.do('sigdist set distance labels to display 2 decimals')
cmd.do('solventRadius Set radius of ball used to make solvent accessible surface.')
cmd.do('spng Save png flle with timestamp')
cmd.do('spse Save pse flle with timestamp')
cmd.do('stack Base-stacking figure.')
cmd.do('stereoDraw Stereo draw.')
cmd.do('stereoRay Stereo ray.')
cmd.do('threeMaps Three electron density.')
cmd.do('turnAboutAxis Turn about axis.')
cmd.do('undoSelection Undo a selection.')
cmd.do('volumeRamp Volume ramp.')
cmd.do('writeCommandReference2HTML Write the command reference to html file in the present working directory."""')
${0}
'''
'Asp70-His31 salt-bridge from T4 lysozyme. ':
'prefix': 'his31asp70'
'body': '''
cmd.do('fetch 1lw9, async=0; ')
cmd.do('zoom (resi 31 or resi 70); ')
cmd.do('preset.technical(selection='all'); ')
cmd.do('bg_color gray70; ')
cmd.do('clip slab, 7,(resi 31 or resi 70);')
cmd.do('rock;')
${0}
'''
'triple water pentagon.':
'prefix': 'waterTriple'
'body': '''
cmd.do('fetch 1lw9, async=0; ')
cmd.do('zoom resi 313; ')
cmd.do('preset.technical(selection='all', mode=1);')
${0}
'''
'Make selection of ligand atoms.':
'prefix': 'ligandSelect'
'body': '''
cmd.do('select substrates, organic;')
${0}
'''
'Print url of README.md file of the pymolsnips repository.':
'prefix': 'github'
'body': '''
cmd.do('https://github.com/MooersLab/pymolsnips/blob/master/README.md')
${0}
'''
'Set dihedral labels to display 2 decimals places to the right of the decimal point.':
'prefix': 'sigdihedral'
'body': '''
cmd.do('set label_dihedral_digits, ${1:2};')
${0}
'''
'Select state 1 from a model with multiple states.':
'prefix': 'stateOne'
'body': '''
cmd.do('cmd.create('newobject', 'oldobject', '1', '1');')
${0}
'''
'Display all symmetry mates in two unit cells along the c axis. Uses supercell.py in $HOME/Scripts/PyMOLscripts/.':
'prefix': 'sc112'
'body': '''
cmd.do('run $HOME/${1:Scripts/PyMOLscripts/supercell.py};')
cmd.do('supercell 1, 1, 1, , ${2:orange}, ${3:supercell1}, 1;')
${0}
'''
'Display all symmetry mates in three unit cels along c. Uses supercell.py in $HOME/Scripts/PyMOLscripts/.':
'prefix': 'sc113'
'body': '''
cmd.do('run $HOME/${1:Scripts/PyMOLscripts/supercell.py};')
cmd.do('supercell 1, 1, 1, , ${2:orange}, ${3:supercell1}, 1;')
${0}
'''
'Display all symmetry mates three three unit cells along a. Uses supercell.py in $HOME/Scripts/PyMOLscripts/.':
'prefix': 'sc311'
'body': '''
cmd.do('run $HOME/${1:Scripts/PyMOLscripts/supercell.py};')
cmd.do('supercell 1, 1, 1, , ${2:orange}, ${3:supercell1}, 1;')
${0}
'''
'Display all symmetry mates in three unit cells along b. Uses supercell.py in $HOME/Scripts/PyMOLscripts/.':
'prefix': 'sc131'
'body': '''
cmd.do('run $HOME/${1:Scripts/PyMOLscripts/supercell.py};')
cmd.do('supercell 1, 1, 1, , ${2:orange}, ${3:supercell1}, 1;')
${0}
'''
'Display all symmetry mates in two unit cell along a. Uses supercell.py in $HOME/Scripts/PyMOLscripts/.':
'prefix': 'sc211'
'body': '''
cmd.do('run $HOME/${1:Scripts/PyMOLscripts/supercell.py};')
cmd.do('supercell 1, 1, 1, , ${2:orange}, ${3:supercell1}, 1;')
${0}
'''
'Display all symmetry mates in two unit cells along the b axis. Uses supercell.py in $HOME/Scripts/PyMOLscripts/.':
'prefix': 'sc121'
'body': '''
cmd.do('run $HOME/Scripts/PyMOLscripts/supercell.py;')
cmd.do('supercell 1, 1, 1, , ${2:orange}, ${3:supercell1}, 1;')
${0}
'''
'Display all symmetry mates in a 1 x 2 x 2 array of unit cells. Uses supercell.py in $HOME/Scripts/PyMOLscripts/.':
'prefix': 'sc122'
'body': '''
cmd.do('run $HOME/Scripts/PyMOLscripts/supercell.py')
cmd.do('supercell 1, 1, 1, , ${2:orange}, ${3:supercell1}, 1;')
${0}
'''
'Display all symmetry mates in 2 x 2 x 1 array of unit cells. Uses supercell.py in $HOME/Scripts/PyMOLscripts/.':
'prefix': 'sc221'
'body': '''
cmd.do('run $HOME/Scripts/PyMOLscripts/supercell.py;')
cmd.do('supercell 1, 1, 1, , ${2:orange}, ${3:supercell1}, 1;')
${0}
'''
'Display all symmetry mates in a 2 x 1 x 2 arrays of unit cells. Uses supercell.py in $HOME/Scripts/PyMOLscripts/.':
'prefix': 'sc212'
'body': '''
cmd.do('run $HOME/Scripts/PyMOLscripts/supercell.py;')
cmd.do('supercell 1, 1, 1, , ${2:orange}, ${3:supercell1}, 1;')
${0}
'''
'Display all symmetry mates in 1 x 3 x 3 array of unit cell. Uses supercell.py in $HOME/Scripts/PyMOLscripts/.':
'prefix': 'sc133'
'body': '''
cmd.do('run $HOME/Scripts/PyMOLscripts/supercell.py;')
cmd.do('supercell 1, 1, 1, , ${2:orange}, ${3:supercell1}, 1;')
${0}
'''
'Display all symmetry mates in a 3 x 1 x 3 array of unit cells. Uses supercell.py in $HOME/Scripts/PyMOLscripts/.':
'prefix': 'sc313'
'body': '''
cmd.do('run $HOME/Scripts/PyMOLscripts/supercell.py;')
cmd.do('supercell 1, 1, 1, , ${2:orange}, ${3:supercell1}, 1;')
${0}
'''
'Display all symmetry mates in 3 x 3 x 1 array of unit cells. Uses supercell.py in $HOME/Scripts/PyMOLscripts/.':
'prefix': 'sc331'
'body': '''
cmd.do('run $HOME/Scripts/PyMOLscripts/supercell.py;')
cmd.do('supercell 1, 1, 1, , ${2:orange}, ${3:supercell1}, 1;')
${0}
'''
'Display all symmetry mates in a 2 x 3 x 3 array of unit cells. Uses supercell.py in $HOME/Scripts/PyMOLscripts/.':
'prefix': 'sc233'
'body': '''
cmd.do('run $HOME/Scripts/PyMOLscripts/supercell.py;')
cmd.do('supercell 1, 1, 1, , ${2:orange}, ${3:supercell1}, 1;')
${0}
'''
'Display all symmetry mates in a 3 x 2 x 3 array of unit cells. Uses supercell.py in $HOME/Scripts/PyMOLscripts/.':
'prefix': 'sc323'
'body': '''
cmd.do('run $HOME/Scripts/PyMOLscripts/supercell.py;')
cmd.do('supercell 1, 1, 1, , ${2:orange}, ${3:supercell1}, 1;')
${0}
'''
'Display all symmetry mates in 3 x 3 x 2 array of unit cells. Uses supercell.py in $HOME/Scripts/PyMOLscripts/.':
'prefix': 'sc332'
'body': '''
cmd.do('run $HOME/Scripts/PyMOLscripts/supercell.py;')
cmd.do('supercell 1, 1, 1, , ${2:orange}, ${3:supercell1}, 1;')
${0}
'''
'Display all symmetry mates in 3 x 3 x 3 array of unit cells. Uses supercell.py in $HOME/Scripts/PyMOLscripts/.':
'prefix': 'sc333'
'body': '''
cmd.do('run $HOME/Scripts/PyMOLscripts/supercell.py;')
cmd.do('supercell 1, 1, 1, , ${2:orange}, ${3:supercell1}, 1;')
${0}
'''
'Display all symmetry mates in four unit cells stacked long c-axis. Uses supercell.py in $HOME/Scripts/PyMOLscripts/.':
'prefix': 'sc114'
'body': '''
cmd.do('run $HOME/Scripts/PyMOLscripts/supercell.py;')
cmd.do('supercell 1, 1, 1, , ${2:orange}, ${3:supercell1}, 1;')
${0}
'''
'Display all symmetry mates in four unit cells stacked long b-axis. Uses supercell.py in $HOME/Scripts/PyMOLscripts/.':
'prefix': 'sc141'
'body': '''
cmd.do('run $HOME/Scripts/PyMOLscripts/supercell.py;')
cmd.do('supercell 1, 1, 1, , ${2:orange}, ${3:supercell1}, 1;')
${0}
'''
'Display all symmetry mates in four unit cells stacked long a-axis. Uses supercell.py in $HOME/Scripts/PyMOLscripts/.':
'prefix': 'sc411'
'body': '''
cmd.do('run $HOME/Scripts/PyMOLscripts/supercell.py;')
cmd.do('supercell 1, 1, 1, , ${2:orange}, ${3:supercell1}, 1;')
${0}
'''
'Save aln flle with timestamp':
'prefix': 'saln'
'body': '''
cmd.do('python;')
cmd.do('import datetime;')
cmd.do('from pymol import cmd;')
cmd.do('DT =datetime.datetime.now().strftime("yr%Ymo%mday%dhr%Hmin%M");')
cmd.do('s = str(DT);')
cmd.do('cmd.save(stemName+s+".aln");')
cmd.do('end python;')
${0}
'''
'Save electron density map flle with timestamp':
'prefix': 'sccp4'
'body': '''
cmd.do('python;')
cmd.do('import datetime;')
cmd.do('from pymol import cmd; ')
cmd.do('DT =datetime.datetime.now().strftime("yr%Ymo%mday%dhr%Hmin%M");')
cmd.do('s = str(DT); ')
cmd.do('cmd.save(stemName+s+".ccp4"); ')
cmd.do('end python;')
${0}
'''
'Save dae flle with timestamp':
'prefix': 'sdae'
'body': '''
cmd.do('python;')
cmd.do('import datetime;')
cmd.do('from pymol import cmd; ')
cmd.do('DT =datetime.datetime.now().strftime("yr%Ymo%mday%dhr%Hmin%M");')
cmd.do('s = str(DT); ')
cmd.do('cmd.save(stemName+s+".dae"); ')
cmd.do('end python;')
${0}
'''
'Carved isosurface representation of electron density. ':
'prefix': 'carvedIsosurface'
'body': '''
cmd.do('delete all;')
cmd.do('fetch ${1:4dgr}, async=0;')
cmd.do('fetch ${1:4dgr}, type=2fofc,async=0;')
cmd.do('select ${2:LongGlycan}, resi ${3:469:477};')
cmd.do('orient ${2:LongGlycan};')
cmd.do('remove not ${2:LongGlycan};')
cmd.do('remove name H*;')
cmd.do('isosurface 2fofcmap, ${1:4dgr}_2fofc, 1, ${2:LongGlycan}, carve = 1.8;')
cmd.do('color density, 2fofcmap; ')
cmd.do('show sticks;')
cmd.do('show spheres;')
cmd.do('set stick_radius, .07;')
cmd.do('set sphere_scale, .19;')
cmd.do('set sphere_scale, .13, elem H;')
cmd.do('set bg_rgb=[1, 1, 1];')
cmd.do('set stick_quality, 50;')
cmd.do('set sphere_quality, 4;')
cmd.do('color gray85, elem C;')
cmd.do('color red, elem O;')
cmd.do('color slate, elem N;')
cmd.do('color gray98, elem H;')
cmd.do('set stick_color, gray50;')
cmd.do('set ray_trace_mode, 1;')
cmd.do('set ray_texture, 2;')
cmd.do('set antialias, 3;')
cmd.do('set ambient, 0.5;')
cmd.do('set spec_count, 5;')
cmd.do('set shininess, 50;')
cmd.do('set specular, 1;')
cmd.do('set reflect, .1;')
cmd.do('set dash_gap, 0;')
cmd.do('set dash_color, black;')
cmd.do('set dash_gap, .15;')
cmd.do('set dash_length, .05;')
cmd.do('set dash_round_ends, 0;')
cmd.do('set dash_radius, .05;')
cmd.do('set_view (0.34,-0.72,0.61,0.8,0.56,0.22,-0.51,0.4,0.77,0.0,0.0,-81.31,44.64,-9.02,58.62,65.34,97.28,-20.0);')
cmd.do('preset.ball_and_stick("all",mode=1);')
cmd.do('draw;')
${0}
'''
'Fetch 2FoFc map as an isosurface.':
'prefix': 'fetch2FoFcIsosurface'
'body': '''
cmd.do('fetch ${1:3nd4}_2fofc, type=2fofc, async=0;')
cmd.do('isosurface 2fofcmap, ${1:3nd4}_2fofc, 1, ${2:LongGlycan}, carve = 1.8;')
${0}
'''
'Three electron density as isosurface. ':
'prefix': 'threeMapsIsosurface'
'body': '''
cmd.do('load ${1:4dgr}.pdb')
cmd.do('# Make sure to rename map file so that ')
cmd.do('# the root filename differs from pdb root filename')
cmd.do('load ${1:4dgr}_2fofc.ccp4, 2fofc;')
cmd.do('load ${1:4dgr}_fofc.ccp4, fofc;')
cmd.do('select ${2:glycan}, resid 200 or (resid 469:477);')
cmd.do('isosurface ${3:mesh1}, 2fofc, 1.0, ${2:glycan};')
cmd.do('color density, ${3:mesh1};')
cmd.do('isosurface ${4:mesh2}, fofc, 3.0, ${2:glycan};')
cmd.do('color green, ${4:mesh2};')
cmd.do('isosurface ${5:mesh3}, fofc, -3.0, ${2:glycan};')
cmd.do('color red, ${5:mesh3};')
${0}
'''
'Carved volume representation of electron density. ':
'prefix': 'carvedVolume'
'body': '''
cmd.do('delete all;')
cmd.do('fetch ${1:4dgr}, async=0;')
cmd.do('fetch ${1:4dgr}, type=2fofc,async=0;')
cmd.do('select ${2:LongGlycan}, resi ${3:469:477};')
cmd.do('orient ${2:LongGlycan};')
cmd.do('remove not ${2:LongGlycan};')
cmd.do('remove name H*;')
cmd.do('surface 2fofcmap, ${1:4dgr}_2fofc, 1, ${2:LongGlycan}, carve = 1.8;')
cmd.do('color density, 2fofcmap; ')
cmd.do('show sticks;')
cmd.do('show spheres;')
cmd.do('set stick_radius, .07;')
cmd.do('set sphere_scale, .19;')
cmd.do('set sphere_scale, .13, elem H;')
cmd.do('set bg_rgb=[1, 1, 1];')
cmd.do('set stick_quality, 50;')
cmd.do('set sphere_quality, 4;')
cmd.do('color gray85, elem C;')
cmd.do('color red, elem O;')
cmd.do('color slate, elem N;')
cmd.do('color gray98, elem H;')
cmd.do('set stick_color, gray50;')
cmd.do('set ray_trace_mode, 1;')
cmd.do('set ray_texture, 2;')
cmd.do('set antialias, 3;')
cmd.do('set ambient, 0.5;')
cmd.do('set spec_count, 5;')
cmd.do('set shininess, 50;')
cmd.do('set specular, 1;')
cmd.do('set reflect, .1;')
cmd.do('set dash_gap, 0;')
cmd.do('set dash_color, black;')
cmd.do('set dash_gap, .15;')
cmd.do('set dash_length, .05;')
cmd.do('set dash_round_ends, 0;')
cmd.do('set dash_radius, .05;')
cmd.do('set_view (0.34,-0.72,0.61,0.8,0.56,0.22,-0.51,0.4,0.77,0.0,0.0,-81.31,44.64,-9.02,58.62,65.34,97.28,-20.0);')
cmd.do('preset.ball_and_stick("all",mode=1);')
cmd.do('draw;')
${0}
'''
'Fetch 2FoFc map as a volume.':
'prefix': 'fetch2FoFcVolume'
'body': '''
cmd.do('fetch ${1:3nd4}, type=2fofc, async=0;')
cmd.do('volume 2fofcmap, ${1:3nd4}_2fofc, 1, ${2:LongGlycan}, carve = 1.8;')
${0}
'''
'Three electron density as volumes. ':
'prefix': 'threeMapsVolume'
'body': '''
cmd.do('load ${1:4dgr}.pdb')
cmd.do('# Make sure to rename map file so that ')
cmd.do('# the root filename differs from pdb root filename')
cmd.do('load ${1:4dgr}_2fofc.ccp4, 2fofc;')
cmd.do('load ${1:4dgr}_fofc.ccp4, fofc;')
cmd.do('select ${2:glycan}, resid 200 or (resid 469:477);')
cmd.do('volume ${3:mesh1}, 2fofc, 1.0, ${2:glycan};')
cmd.do('color density, ${3:mesh1};')
cmd.do('volume ${4:mesh2}, fofc, 3.0, ${2:glycan};')
cmd.do('color green, ${4:mesh2};')
cmd.do('volume ${5:mesh3}, fofc, -3.0, ${2:glycan};')
cmd.do('color red, ${5:mesh3};')
${0}
'''
'Return settings in rounded format while running PyMOL via the RCP server ipymol in a jupuyter notebook. This is a modified version of the roundview.py script.':
'prefix': 'rvi'
'body': '''
cmd.do('def rvj(StoredView=0, decimal_places=2, outname="roundedview.txt"):')
cmd.do(' """')
cmd.do(' rvj() is a modification of the the rv() function (aka the roundview.py) ')
cmd.do(' so that it can run in Jupyter notebooks with the ipymol.viewer. ')
cmd.do(' A set_view string is printed to the noteobook in a format that is ready ')
cmd.do(' for reuse. ')
cmd.do(' ')
cmd.do(' The ipymol module was developed by <NAME>:')
cmd.do(' ')
cmd.do(' https://github.com/cxhernandez/ipymol')
cmd.do(' ')
cmd.do(' The pre-requisites for installing ipymol are as follows:')
cmd.do(' ')
cmd.do(' 1. Make a jupyter notebook kernel for Python interpreter inside of ')
cmd.do(' the Schrodinger PyMOL. See the PyMOL Snippets GitHub Page for ')
cmd.do(' a description of how to make one.')
cmd.do(' 2. Install the following build of ipymol at the PyMOL prompt.')
cmd.do(' You need to log into your GitHub account first.')
cmd.do(' ')
cmd.do(' pip install git+pip install git+https://github.com/cxhernandez/ipymol.git@2a30d6ec1588434e6f0f72a1d572444f89ff535b')
cmd.do(' ')
cmd.do(' 3. Make a bash alias to this PyMOL app file.')
cmd.do(' ')
cmd.do(' 4. Launch the jupyter notebook and select the pymol.python kernel.')
cmd.do(' ')
cmd.do(' 5. Open a terminal instance from the File pulldown in jupyter notebook.')
cmd.do(' ')
cmd.do(' 6. Enter `pymol -Rq` to launch an interactive instance of PyMOL.')
cmd.do(' ')
cmd.do(' 7. Enter the following code to load ipymol and conmect to PyMOL')
cmd.do(' ')
cmd.do(' from ipymol import viewer as ipv')
cmd.do(' ipv.start() # Start PyMOL RPC server')
cmd.do(' ')
cmd.do(' Now you can change the scene manually and send the display as static ')
cmd.do(' image to a cell in the jupyter notebook.')
cmd.do(' ')
cmd.do(' It is assumed that the viewer class of the ipymol moduel has been ')
cmd.do(' imported as ipv. ')
cmd.do(' ')
cmd.do(' I made the following modifications of roundview.py.')
cmd.do(' The cmd.get_view was replaced with ipv.get_view.')
cmd.do(' The cmd.extend was replaced with ipv.extend.')
cmd.do(' The myRoundedList was returned for further processing.')
cmd.do(' ')
cmd.do(' MIT License')
cmd.do(' ')
cmd.do(' Copyright:')
cmd.do(' <NAME> and the OU Board of Regents')
cmd.do(' Uniersity of Oklahoma Health Sciences Center')
cmd.do(' Oklahoma City, OK 73104')
cmd.do(' ')
cmd.do(' 29 April 2020')
cmd.do(' ')
cmd.do(' """')
cmd.do(' ')
cmd.do(' ')
cmd.do(' StoredView = int(StoredView)')
cmd.do(' decimal_places = int(decimal_places)')
cmd.do(' ')
cmd.do(' #call the get_view function')
cmd.do(' ')
cmd.do(' m = ipv.get_view(StoredView)')
cmd.do(' ')
cmd.do(' ')
cmd.do(' #Make a list of the elements in the orientation matrix.')
cmd.do(' ')
cmd.do(' myList = [m[0], m[1], m[2], m[3], m[4], m[5], m[6],m[7], m[8], m[9],')
cmd.do(' m[10], m[11], m[12], m[13], m[14],m[15], m[16], m[17]]')
cmd.do(' ')
cmd.do(' #Round off the matrix elements to two decimal places (two fractional places)')
cmd.do(' #This rounding approach solved the problem of unwanted')
cmd.do(' #whitespaces when I tried to use a string format statement')
cmd.do(' ')
cmd.do(' myRoundedList = [round(elem, decimal_places) for elem in myList]')
cmd.do(' ')
cmd.do(' #x is the string template for the output. The whitespace is required')
cmd.do(' #between the "set_view" and "("')
cmd.do(' ')
cmd.do(' x = 'set_view ({0},{1},{2},{3},{4},{5},{6},{7},{8},{9},{10},{11},{12},{13},{14},{15},{16},{17});'')
cmd.do(' ')
cmd.do(' # Print to the command history window.')
cmd.do(' print(x.format(*myRoundedList))')
cmd.do(' ')
cmd.do(' #Write to a text file.')
cmd.do(' myFile = open("roundedview.txt", "a")')
cmd.do(' myFile.write(x.format(*myRoundedList) + "")')
cmd.do(' myFile.close()')
cmd.do(' return myRoundedList')
cmd.do('ipv.extend("rv", rv)')
${0}
'''
'Demo of the use of the RPC server with a drug compound via rdkit.':
'prefix': 'rdkrpcChem'
'body': '''
cmd.do('import os;')
cmd.do('import rdkit;')
cmd.do('from rdkit import Chem;')
cmd.do('from rdkit.Chem import AllChem;')
cmd.do('from rdkit.Chem import PyMol;')
cmd.do('')
cmd.do('s = PyMOL.MolViewer();')
cmd.do('mol = Chem.MolFromSmiles \')
cmd.do(' ('CCOCCn1c(C2CC[NH+](CCc3ccc(C(C)(C)C(=O)[O-])cc3)CC2)nc2ccccc21');')
cmd.do('mol = AllChem.AddHs(mol);')
cmd.do('AllChem.EmbedMolecule(mol);')
cmd.do('AllChem.MMFFOptimizeMolecule(mol);')
cmd.do('s.ShowMol(mol, name = 'bilastine', showOnly = False);')
cmd.do('s.Zoom('bilastine');')
cmd.do('s.SetDisplayStyle('bilastine', 'sticks');')
cmd.do('s.GetPNG(preDelay=5);')
${0}
'''
'A kernel.json file for runnig PyMOL python interpreter in the Jupyter notebook. ':
'prefix': 'kernel'
'body': '''
cmd.do('framerule=2pt,')
cmd.do('framesep=2mm,')
cmd.do('framesep=2mm,')
cmd.do('breaklines=True,')
cmd.do('baselinestretch=1.2')
cmd.do(']{bash}')
cmd.do('{')
cmd.do(' "argv": [')
cmd.do(' "/Applications/PyMOL.app/Contents/bin/python",')
cmd.do(' "-m",')
cmd.do(' "ipykernel_launcher",')
cmd.do(' "-f",')
cmd.do(' "{connection_file}"')
cmd.do(' ],')
cmd.do(' "display_name": "pymol.python",')
cmd.do(' "language": "python"')
cmd.do('}')
${0}
'''
'Demo of the use of the RPC server with a protein via rdkit.':
'prefix': 'rdkrpcProtein'
'body': '''
cmd.do('from rdkit.Chem import PyMol;')
cmd.do('')
cmd.do('Usage=""""Start pymol from command line with -R flag.')
cmd.do('Select the pymol.python kernel in Jupyter notebook. """;')
cmd.do('')
cmd.do('s = PyMol.MolViewer();')
cmd.do('du = s.server.do;')
cmd.do('du('rein; bg_color white; fetch 1lw9, type=pdb, async=0, show;nb_spheres; set_view (0.46,-0.28,-0.84,0.74,-0.41,0.54,-0.49,-0.87,0.02,0.0,0.0,\')
cmd.do(' -155.16,35.13,11.48,9.72,122.33,187.99,-20.0);');')
cmd.do('s.GetPNG(preDelay=3);')
cmd.do('du('png T4L600dpi.png, dpi=600');')
${0}
'''
'Code to start the RPC server with ipymol.':
'prefix': 'ipymolStart'
'body': '''
cmd.do('# Start pymol in terminal with pymol -R;')
cmd.do('# Select pymol.python as kernel in juptyer;')
cmd.do('from ipymol import viewer as ipv;')
cmd.do('ipv.start() # Start PyMOL RPC server;')
${0}
'''
'Demo of the use of the RPC server with a protein via ipymol.':
'prefix': 'ipymolProtein'
'body': '''
cmd.do('# Start pymol in terminal with pymol -R;')
cmd.do('# Select pymol.python as kernel in juptyer;')
cmd.do('from ipymol import viewer as ipv;')
cmd.do('ipv.start() # Start PyMOL RPC server;')
cmd.do('')
cmd.do('ipv.do('fetch 1lw9');')
cmd.do('ipv.do('rv');')
cmd.do('# The double parentheses are required when set_view is run this way.;')
cmd.do('ipv.set_view((-0.13,-0.4,-0.91,0.89,-0.45,0.07,-0.44,-0.8,0.41,0.0,0.0,-182.47,35.13,11.48,9.72,149.64,215.3,-20.0));')
cmd.do('ipv.do('AOD');')
cmd.do('ipv.png('testipymolT4L.png');')
${0}
'''
'Return settings in rounded format while running PyMOL via the RCP server rdkit in a jupyter notebook. This is a modified version of the roundview.py script.':
'prefix': 'rvr'
'body': '''
cmd.do('def rvr(StoredView=0, decimal_places=2, outname="roundedview.txt"):')
cmd.do(' """MIT License')
cmd.do(' Copyright:')
cmd.do(' <NAME> and the OU Board of Regents')
cmd.do(' University of Oklahoma Health Sciences Center')
cmd.do(' Oklahoma City, OK 73104')
cmd.do(' 30 April 2020')
cmd.do(' ')
cmd.do(' First run the following:')
cmd.do(' ')
cmd.do(' from rdkit.Chem import PyMol')
cmd.do(' s = PyMol.MolViewer()')
cmd.do(' du = s.server.do')
cmd.do('')
cmd.do(' """')
cmd.do(' StoredView = int(StoredView) decimal_places = int(decimal_places)')
cmd.do(' #call the get_view function')
cmd.do(' m = s.get_view(StoredView)')
cmd.do(' #Make a list of the elements in the orientation matrix.')
cmd.do(' myList = [m[0], m[1], m[2], m[3], m[4], m[5], m[6],m[7], m[8], m[9], ')
cmd.do(' m[10], m[11], m[12], m[13], m[14],m[15], m[16], m[17]]')
cmd.do(' #Round off the matrix elements to two decimal places (two fractional places)')
cmd.do(' #This rounding approach solved the problem of unwanted')
cmd.do(' #whitespaces when I tried to use a string format statement')
cmd.do(' myRoundedList = [round(elem, decimal_places) for elem in myList]')
cmd.do(' #x is the string template for the output. The whitespace is required')
cmd.do(' #between the "set_view" and "("')
cmd.do(' x = 'set_view ({0},{1},{2},{3},{4},{5},{6},{7},{8},{9},{10},{11},{12},{13},{14},{15},{16},{17});'')
cmd.do(' # Print to the command history window.')
cmd.do(' print(x.format(*myRoundedList))')
cmd.do(' #Write to a text file.')
cmd.do(' myFile = open("roundedview.txt", "a") myFile.write(x.format(*myRoundedList) + "") myFile.close()')
cmd.do(' return myRoundedList')
cmd.do('du.extend("rvr", rvr)')
${0}
'''
'Return to the command history window the docstrings for all of the functions in the cmd module.':
'prefix': 'cmddocs'
'body': '''
cmd.do('[help(i) for i in dir(cmd)];')
${0}
'''
'Return to the command history window the docstrings for all of the functions in a module.':
'prefix': 'pymoldocs'
'body': '''
cmd.do('[help(i) for i in dir(pymol)];')
${0}
'''
'Print the number of residues in a protein.':
'prefix': 'numResiProtein'
'body': '''
cmd.do('sel = 'polymer.protein'; print(len(set([(i.chain, i.resi, i.resn) for i in cmd.get_model(sel).atom])));')
${0}
'''
'Print the number of residues in chain A of a protein.':
'prefix': 'numResiProteinChainA'
'body': '''
cmd.do('sel = 'chain A and polymer.protein'; print(len(set([(i.chain, i.resi, i.resn) for i in cmd.get_model(sel).atom])));')
${0}
'''
'Print the number of residues in a nulceic acid (all chains).':
'prefix': 'numResiNucleic'
'body': '''
cmd.do('sel = 'polymer.nucleic'; print(len(set([(i.resi, i.resn) for i in cmd.get_model(sel).atom])));')
${0}
'''
'Print the number of residues in a nulceic acid chain.':
'prefix': 'numResiNucleicChainA'
'body': '''
cmd.do('sel = 'chain A and polymer.nucleic'; print(len(set([(i.resi, i.resn) for i in cmd.get_model(sel).atom])));')
${0}
'''
'Create bonds between phosphorous and O3* atoms in a low resolution DNA structure that is 80 base pairs long.':
'prefix': 'brokenNucleicBackbone'
'body': '''
cmd.do('[cmd.bond(f"/5fur//E/{i}/O3'", f"/5fur//E/{i+1}/P") for i in range(${1:1}, ${2:80})]; ')
cmd.do('[cmd.bond(f"/5fur//F/{i}/O3'", f"/5fur//F/{i+1}/P") for i in range(${3:81}, ${3:160})];')
${0}
'''
'To change stick color and radius for the bond between atom 2 and 3, use the set_bond command.
':
'prefix': 'oneBondThicknessColor'
'body': '''
cmd.do('# To change stick color and radius for the bond between atom 2 and 3;')
cmd.do('set_bond stick_color, ${1:yellow}, index 2, index 3;')
cmd.do('set_bond stick_radius, ${2:0.2}, index 2, index 3;')
${0}
'''
'Connect the alpha carbons of residue 1 with 10, 6 with 16, 7 with 17 and 8 with 18. Note that this example requires the draw_links.py [http://pldserver1.biochem.queensu.ca/~rlc/work/pymol/draw_links.py] by <NAME>.':
'prefix': 'drawLinks'
'body': '''
cmd.do('# Requires draw_links.py http://pldserver1.biochem.queensu.ca/~rlc/work/pymol/draw_links.py by <NAME>')
cmd.do('# To connect the alpha carbons of residue 1 with 10, 6 with 16, 7 with 17 and 8 with 18.')
cmd.do('draw_links ${1:mol1} & chain ${2:A} & name ${3:CA} & resi ${4:1+6+7+8}, ${5:mol1} & chain ${6:A}& name ${7:CA} & resi ${8:10+16+17+18} ')
${0}
'''
'Print the path to the currently used PyMOL binary.':
'prefix': 'printPath'
'body': '''
cmd.do('# Print the path to the current used PyMOL binary.')
cmd.do('print pymol.__path__')
${0}
'''
'Turn on the ligand valence.':
'prefix': 'setLigandValenceOn'
'body': '''
cmd.do('#Set on the valence of the ligand only')
cmd.do('set valence, on, resn ${1:RZS}; set valence, off, not resn ${2:RZS}')
${0}
'''
'Return the docustring for the preset submodule. The command help preset fails to return anything. The command help(pymol.preset) has the same effect as help(preset).':
'prefix': 'presetDocs'
'body': '''
cmd.do('help(preset)')
${0}
'''
'Return the docustring for the help submodule. The command help help is more concise.':
'prefix': 'helpDocs'
'body': '''
cmd.do('help(help)')
${0}
'''
'The amber trajectories have to be loaded into the same object.':
'prefix': 'loadAmberTrajs'
'body': '''
cmd.do('load file.top, protein;')
cmd.do('load file.rst, protein')
${0}
'''
'Saves multiple objects into multiple files using an optional prefix name.':
'prefix': 'saveSep'
'body': '''
cmd.do('from pymol import cmd')
cmd.do('import glob')
cmd.do('import re')
cmd.do('')
cmd.do('def saveSep(prefix=''):')
cmd.do(' """')
cmd.do(' save_sep <prefix>')
cmd.do('')
cmd.do(' saves multiple objects into multiple files using an optional prefix name.')
cmd.do('')
cmd.do(' e.g. save_sep prefix')
cmd.do(' """')
cmd.do(' obj_list = cmd.get_names("all")')
cmd.do('')
cmd.do(' if obj_list:')
cmd.do(' for i in range(len(obj_list)):')
cmd.do(' obj_name = "%s%s.pdb" % (prefix, obj_list[i])')
cmd.do(' cmd.save(obj_name, obj_list[i])')
cmd.do(' print("Saving %s" % obj_name)')
cmd.do(' else:')
cmd.do(' print("No objects found")')
cmd.do(' ')
cmd.do('cmd.extend('saveSep',saveSep)')
${0}
'''
'OptiAlign.py by <NAME> modified for aligning multiple RNA structures.':
'prefix': 'optAlignRNA'
'body': '''
cmd.do('#!python')
cmd.do(' ')
cmd.do('##############################################################################')
cmd.do('#')
cmd.do('# @SUMMARY: -- QKabsch.py. A python implementation of the optimal superposition')
cmd.do('# of two sets of vectors as proposed by Kabsch 1976 & 1978.')
cmd.do('#')
cmd.do('# @AUTHOR: <NAME>')
cmd.do('# @COPYRIGHT: <NAME> (C), 2005-2007')
cmd.do('# @LICENSE: Released under GPL:')
cmd.do('# This program is free software; you can redistribute it and/or modify')
cmd.do('# it under the terms of the GNU General Public License as published by')
cmd.do('# the Free Software Foundation; either version 2 of the License, or')
cmd.do('# (at your option) any later version.')
cmd.do('# This program is distributed in the hope that it will be useful, but WITHOUT')
cmd.do('# ANY WARRANTY; without even the implied warranty of MERCHANTABILITY or FITNESS')
cmd.do('# FOR A PARTICULAR PURPOSE. See the GNU General Public License for more details.')
cmd.do('#')
cmd.do('# You should have received a copy of the GNU General Public License along with')
cmd.do('# this program; if not, write to the Free Software Foundation, Inc., 51 Franklin')
cmd.do('# Street, Fifth Floor, Boston, MA 02110-1301, USA ')
cmd.do('#')
cmd.do('# DATE : 2007-01-01')
cmd.do('# REV : 2')
cmd.do('# REQUIREMENTS: numpy')
cmd.do('#')
cmd.do('#')
cmd.do('# Modified optAlign.py to use C1' carbon atoms of RNA for alignment.')
cmd.do('# Jan. 29, 2020 ')
cmd.do('# <NAME>, PhD')
cmd.do('# Univ. of Oklahoma Health Sciences Center')
cmd.do('#')
cmd.do('#############################################################################')
cmd.do('from array import *')
cmd.do(' ')
cmd.do('# system stuff')
cmd.do('import os')
cmd.do('import copy')
cmd.do(' ')
cmd.do('# pretty printing')
cmd.do('import pprint')
cmd.do(' ')
cmd.do('# for importing as a plugin into PyMol')
cmd.do('from pymol import cmd')
cmd.do('from pymol import stored')
cmd.do('from pymol import selector')
cmd.do(' ')
cmd.do('# using numpy for linear algebra')
cmd.do('import numpy')
cmd.do(' ')
cmd.do('def optAlignRNA( sel1, sel2 ):')
cmd.do(' """')
cmd.do(' optAlignRNA performs the Kabsch alignment algorithm upon the C1' carbons of two selections.')
cmd.do(' Example: optAlignRNA 1JU7 and i. 1-16 and n. C1', 1CLL and i. 4-146 and n. C1'')
cmd.do(' ')
cmd.do(' Two RMSDs are returned. One comes from the Kabsch algorithm and the other from')
cmd.do(' PyMOL based upon your selections.')
cmd.do(' ')
cmd.do(' This function can be run in a for loop to fit multiple structures with a common prefix name:')
cmd.do(' ')
cmd.do(' for x in cmd.get_names(): optAlignRNA(x, "1JU7_0001")')
cmd.do(' ')
cmd.do(' or get the rmsds for all combinations, do the following:')
cmd.do(' ')
cmd.do(' [[optAlignRNA(x, y) for x in cmd.get_names()] for y in cmd.get_names()]')
cmd.do('')
cmd.do(' """')
cmd.do(' cmd.reset()')
cmd.do(' ')
cmd.do(' # make the lists for holding coordinates')
cmd.do(' # partial lists')
cmd.do(' stored.sel1 = []')
cmd.do(' stored.sel2 = []')
cmd.do(' # full lists')
cmd.do(' stored.mol1 = []')
cmd.do(' stored.mol2 = []')
cmd.do(' ')
cmd.do(' # -- CUT HERE')
cmd.do(' sel1 += " and N. C1'"')
cmd.do(' sel2 += " and N. C1'"')
cmd.do(' # -- CUT HERE')
cmd.do(' ')
cmd.do(' # Get the selected coordinates. We')
cmd.do(' # align these coords.')
cmd.do(' cmd.iterate_state(1, selector.process(sel1), "stored.sel1.append([x,y,z])")')
cmd.do(' cmd.iterate_state(1, selector.process(sel2), "stored.sel2.append([x,y,z])")')
cmd.do(' ')
cmd.do(' # get molecule name')
cmd.do(' mol1 = cmd.identify(sel1,1)[0][0]')
cmd.do(' mol2 = cmd.identify(sel2,1)[0][0]')
cmd.do(' ')
cmd.do(' # Get all molecule coords. We do this because')
cmd.do(' # we have to rotate the whole molcule, not just')
cmd.do(' # the aligned selection')
cmd.do(' cmd.iterate_state(1, mol1, "stored.mol1.append([x,y,z])")')
cmd.do(' cmd.iterate_state(1, mol2, "stored.mol2.append([x,y,z])")')
cmd.do(' ')
cmd.do(' # check for consistency')
cmd.do(' assert len(stored.sel1) == len(stored.sel2)')
cmd.do(' L = len(stored.sel1)')
cmd.do(' assert L > 0')
cmd.do(' ')
cmd.do(' # must alway center the two proteins to avoid')
cmd.do(' # affine transformations. Center the two proteins')
cmd.do(' # to their selections.')
cmd.do(' COM1 = numpy.sum(stored.sel1,axis=0) / float(L)')
cmd.do(' COM2 = numpy.sum(stored.sel2,axis=0) / float(L)')
cmd.do(' stored.sel1 -= COM1')
cmd.do(' stored.sel2 -= COM2')
cmd.do(' ')
cmd.do(' # Initial residual, see Kabsch.')
cmd.do(' E0 = numpy.sum( numpy.sum(stored.sel1 * stored.sel1,axis=0),axis=0) + numpy.sum( numpy.sum(stored.sel2 * stored.sel2,axis=0),axis=0)')
cmd.do(' ')
cmd.do(' #')
cmd.do(' # This beautiful step provides the answer. V and Wt are the orthonormal')
cmd.do(' # bases that when multiplied by each other give us the rotation matrix, U.')
cmd.do(' # S, (Sigma, from SVD) provides us with the error! Isn't SVD great!')
cmd.do(' V, S, Wt = numpy.linalg.svd( numpy.dot( numpy.transpose(stored.sel2), stored.sel1))')
cmd.do(' ')
cmd.do(' # we already have our solution, in the results from SVD.')
cmd.do(' # we just need to check for reflections and then produce')
cmd.do(' # the rotation. V and Wt are orthonormal, so their det's')
cmd.do(' # are +/-1.')
cmd.do(' reflect = float(str(float(numpy.linalg.det(V) * numpy.linalg.det(Wt))))')
cmd.do(' ')
cmd.do(' if reflect == -1.0:')
cmd.do(' S[-1] = -S[-1]')
cmd.do(' V[:,-1] = -V[:,-1]')
cmd.do(' ')
cmd.do(' RMSD = E0 - (2.0 * sum(S))')
cmd.do(' RMSD = numpy.sqrt(abs(RMSD / L))')
cmd.do(' ')
cmd.do(' #U is simply V*Wt')
cmd.do(' U = numpy.dot(V, Wt)')
cmd.do(' ')
cmd.do(' # rotate and translate the molecule')
cmd.do(' stored.sel2 = numpy.dot((stored.mol2 - COM2), U)')
cmd.do(' stored.sel2 = stored.sel2.tolist()')
cmd.do(' # center the molecule')
cmd.do(' stored.sel1 = stored.mol1 - COM1')
cmd.do(' stored.sel1 = stored.sel1.tolist()')
cmd.do(' ')
cmd.do(' # let PyMol know about the changes to the coordinates')
cmd.do(' cmd.alter_state(1,mol1,"(x,y,z)=stored.sel1.pop(0)")')
cmd.do(' cmd.alter_state(1,mol2,"(x,y,z)=stored.sel2.pop(0)")')
cmd.do(' ')
cmd.do(' #print("Moved: %s Reference: %s RMSD = %f" % mol1, mol2, RMSD)')
cmd.do(' print("% s, % s,% 5.3f" % (mol1, mol2, RMSD))')
cmd.do(' ')
cmd.do(' # make the alignment OBVIOUS')
cmd.do(' cmd.hide('everything')')
cmd.do(' cmd.show('ribbon', sel1 + ' or ' + sel2)')
cmd.do(' cmd.color('gray70', mol1 )')
cmd.do(' cmd.color('magenta', mol2 )')
cmd.do(' cmd.color('red', 'visible')')
cmd.do(' cmd.show('ribbon', 'not visible')')
cmd.do(' cmd.center('visible')')
cmd.do(' cmd.orient()')
cmd.do(' cmd.zoom('visible')')
cmd.do(' ')
cmd.do('cmd.extend("optAlignRNA", optAlignRNA)')
${0}
'''
'Load into PyMOL multiple files with a common file stem. The is a script by <NAME> that updated for Python3.':
'prefix': 'loadManyFiles'
'body': '''
cmd.do('# Copyright (c) 2004 <NAME>')
cmd.do('#')
cmd.do('# Modified for use with Python3.')
cmd.do('# Jan. 29, 2020 ')
cmd.do('# <NAME>, PhD')
cmd.do('# Univ. of Oklahoma Health Sciences Center')
cmd.do('#')
cmd.do('#')
cmd.do('from pymol import cmd')
cmd.do('import glob')
cmd.do('')
cmd.do('def loadFiles(files):')
cmd.do(' """')
cmd.do(' load_files <files>')
cmd.do('')
cmd.do(' loads multiple files (using filename globbing)')
cmd.do(' into a multiple objects named as the files are (e.g. collection of')
cmd.do(' downloaded PDB files).')
cmd.do('')
cmd.do(' e.g. load_files prot_*.pdb')
cmd.do(' """')
cmd.do(' file_list = glob.glob(files)')
cmd.do(' if file_list:')
cmd.do(' file_list.sort()')
cmd.do(' for i in file_list:')
cmd.do(' #obj_name = i.replace('.pdb','')')
cmd.do(' #cmd.load(file_list[i],obj_name)')
cmd.do(' cmd.load(i)')
cmd.do(' else:')
cmd.do(' print("No files found for pattern %s" % files)')
cmd.do('')
cmd.do('cmd.extend('loadFiles',loadFiles)')
${0}
'''
'These are the instructions for loading and aligning multiple files.':
'prefix': 'loadAndAlignManyFiles'
'body': '''
cmd.do('To load a bunch of related files from inside PyMOL all at once:')
cmd.do('')
cmd.do('run loadFiles.py')
cmd.do('loadFiles refine_*.pdb')
cmd.do('')
cmd.do('')
cmd.do('To align all of the loaded RNA structures in all possible combinations by their C1' carbon atoms:')
cmd.do('')
cmd.do('run optAlignRNA.py')
cmd.do('[[optAlignRNA(x, y) for x in cmd.get_names()] for y in cmd.get_names()]')
cmd.do('')
cmd.do('(Yes, that construct is a list comprehension inside a list comprehension!)')
cmd.do('')
cmd.do('To save a multiple models in a file to separate pdb files,')
cmd.do('')
cmd.do('run saveSep.py')
cmd.do('saveSep ')
cmd.do('or ')
cmd.do('saveSep prefix')
${0}
'''
'This is a two-fold nested list comprehension for any all parwise operation on the currently loaded objects. Replace optAlginRNA with any other function that operations on a pair of structrures.':
'prefix': 'allPairs'
'body': '''
cmd.do('[[${1:optAlignRNA}(x, y) for x in cmd.get_names()] for y in cmd.get_names()]')
${0}
'''
'Combining DSSR block representation with regular PyMOL cartoons after loading the dssr_block.py script by <NAME>.':
'prefix': 'dssrBlock'
'body': '''
cmd.do('fetch 1ehz, async=0;')
cmd.do('as cartoon;')
cmd.do('set cartoon_ladder_radius, 0.1;')
cmd.do('set cartoon_ladder_color, gray;')
cmd.do('set cartoon_nucleic_acid_mode, 1;')
cmd.do('dssr_block')
${0}
'''
'DSSR block representation with fused blocks after loading the dssr_block.py script by <NAME>. The x3dna-dssr executable needs to be in the PATH.':
'prefix': 'dssrBlock'
'body': '''
cmd.do('fetch 1ehz, async=0;')
cmd.do('dssr_block block_file=wc')
${0}
'''
'DSSR block representation for a multi-state example after loading the dssr_block.py script by <NAME>. The x3dna-dssr executable needs to be in the PATH.':
'prefix': 'dssrBlock'
'body': '''
cmd.do('fetch 2n2d, async=0;')
cmd.do('dssr_block 2n2d, 0;')
cmd.do('set all_states;')
${0}
'''
'DSSR block representation with custom coloring after loading the dssr_block.py script by <NAME>. The x3dna-dssr executable needs to be in the PATH.':
'prefix': 'dssrBlock'
'body': '''
cmd.do('fetch 1msy, async=0;')
cmd.do('dssr_block block_color=N red | minor 0.9 | major yellow;')
${0}
'''
'Settings for nucliec acid cartoon.':
'prefix': 'nucleicAcidCartoon'
'body': '''
cmd.do('set cartoon_ladder_color, ${1:density};')
cmd.do('set cartoon_ladder_radius, ${2:0.2};')
cmd.do('set cartoon_nucleic_acid_color, ${3:red};')
cmd.do('set cartoon_ring_mode, ${4:2};')
${0}
'''
'Coloring two strand differently of a double helix makes it easier to for the viewer to distinguish the two strands. The set command as the syntax of setting_name [, setting_value [, selection [,state ]]] . In this case, the selection has to be global, object, object-state, or per-atom settings. It cannot be a named selection. This is a weak spot in PyMOL. Coloring two strand differently of a double helix makes it easier to for the viewer to distinguish the two strands. Many double-stranded helices have one strand in the asymmetric unit. The second strand is in the biological unit. The coordinates for the second strand are in the pdb1 file type at the PDB. The second strand is in the second state, which is equivalent to the second model in the pdb file. The strands are labeled chain A and B (via the cartoon_nucliec_acid_color setting). The bases are colored differently too (via the cartoon_ladder_color setting).
':
'prefix': 'nucleicAcidCartoon2Strands'
'body': '''
cmd.do('# There is not support for applying different settings to different selections.')
cmd.do('# Instead, this can be done for different objects.')
cmd.do('# Coloring two strand differently of a double helix makes it easier to for the viewer to distinguish the two strands.')
cmd.do('# The set command as the syntax of setting_name [, setting_value [, selection [,state ]]]')
cmd.do('# In this case, the selection has to be global, object, object-state, or per-atom settings.')
cmd.do('# It cannot be a named selection.')
cmd.do('# Coloring two strand differently of a double helix makes it easier to for the viewer to distinguish the two strands.')
cmd.do('# Many double-stranded helices have one strand in the asymmetric unit.')
cmd.do('# The second strand is in the biological unit.;')
cmd.do('# The coordinates for the second strand are in the pdb1 file type at the PDB.;')
cmd.do('# The second strand is in the second state, which is equivalent to the second model in the pdb file.;')
cmd.do('# The strands are labeled chain A and B (via the cartoon_nucliec_acid_color setting).;')
cmd.do('# The bases are colored differently too (via the cartoon_ladder_color setting).;')
cmd.do('fetch ${1:3nd3}, ${2:3nd3}, type=${3:pdb1};')
cmd.do('set all_states, on;')
cmd.do('create chA, ${2:3nd3}, 1, 1;')
cmd.do('create chB, ${2:3nd3}, 2, 1;')
cmd.do('# colors only the backbone;')
cmd.do('set cartoon_nucleic_acid_color, ${4:magenta}, chA;')
cmd.do('set cartoon_nucleic_acid_color, ${5:orange}, chB;')
cmd.do('# color the bases;')
cmd.do('set cartoon_ladder_color, ${6:density}, chA;')
cmd.do('set cartoon_ladder_color, ${7:yellow}, chB;')
${0}
'''
'This code colors by the nucleotides by base seqence. It can be applied to any nucleic acid. It could make a good shortcut.':
'prefix': 'nucleicAcidColorbySequence'
'body': '''
cmd.do('select rna_A, resn A;')
cmd.do('select rna_C, resn C;')
cmd.do('select rna_G, resn G;')
cmd.do('select rna_U, resn U;')
cmd.do('select dna_T, resn T;')
cmd.do('color ${1:yellow}, rna_A;')
cmd.do('color ${2:red}, rna_C; ')
cmd.do('color ${3:gray40}, rna_G;')
cmd.do('color ${4:palecyan}, rna_U;')
cmd.do('color ${5:brown}, dna_T;')
${0}
'''
'This code colors by the nucleotides by base seqence. It can be applied to any nucleic acid. It is dervied from the CR shortcut. The backcone is shown as a flatten ribbon.':
'prefix': 'nucleicAcidFlatRibbonColorbySequence'
'body': '''
cmd.do('bg_color white;')
cmd.do('set cartoon_oval_length, ${1:1.85};')
cmd.do('set cartoon_oval_width, ${2:0.5};')
cmd.do('cartoon oval;')
cmd.do('set cartoon_ring_mode, ${3:3};')
cmd.do('# set the color of the backbone oval;')
cmd.do('set cartoon_nucleic_acid_color, ${4:blue};')
cmd.do('select rna_A, resn A;')
cmd.do('select rna_C, resn C;')
cmd.do('select rna_G, resn G;')
cmd.do('select rna_U, resn U;')
cmd.do('select dna_T, resn T;')
cmd.do('color ${5:yellow}, rna_A;')
cmd.do('color ${6:red}, rna_C; ')
cmd.do('color ${7:gray40}, rna_G;')
cmd.do('color ${8:palecyan}, rna_U;')
cmd.do('color ${9:brown}, dna_T;')
cmd.do('as cartoon;')
${0}
'''
'The code provides a cartoon of the loaded nucleic acid that has the ladder rungs replaced by filled rings that are colored by atom type. The code can be applied to any nucleic acid. It is derived from the FR shortuct.':
'prefix': 'nucleicAcidCartoonFilledRings'
'body': '''
cmd.do('bg_color white;')
cmd.do('show sticks;')
cmd.do('set cartoon_ring_mode, 3;')
cmd.do('set cartoon_ring_finder, 1;')
cmd.do('set cartoon_ladder_mode, 1;')
cmd.do('set cartoon_nucleic_acid_mode, 4;')
cmd.do('set cartoon_ring_transparency, 0.5;')
cmd.do('as cartoon;')
${0}
'''
'This code make as standard base stacking diagram with ball and stick representation. ':
'prefix': 'basePairStacking'
'body': '''
cmd.do('delete all;')
cmd.do('fetch 4PCO, type=pdb, async=0;')
cmd.do('select G2G3, ( ((resi 2 or resi 3) and chain A) or ((resi 8 or resi 9) and chain B));')
cmd.do('remove not G2G3;')
cmd.do('bg_color white;')
cmd.do('show sticks;')
cmd.do('set stick_radius=0.14;')
cmd.do('set stick_ball, on; ')
cmd.do('set stick_ball_ratio,1.9;')
cmd.do('set_view (-0.75,0.09,0.66,-0.2,0.92,-0.35,-0.64,-0.39,-0.67,-0.0,-0.0,-43.7,7.24,9.55,11.78,29.46,57.91,-20.0);')
cmd.do('remove name H*;')
cmd.do('select carbon1, element C and (resi 3 or resi 8) ')
cmd.do('# select lower base pair;')
cmd.do('select carbon2, element C and (resi 2 or resi 9) ')
cmd.do('#select upper base pair;')
cmd.do('color gray70, carbon1;')
cmd.do('color gray10, carbon2;')
cmd.do('show sticks;')
cmd.do('space cmyk;')
cmd.do('distance hbond1, /4PCO//B/U`9/N3,/4PCO//A/G`2/O6;')
cmd.do('distance hbond2, /4PCO//B/U`9/O2,/4PCO//A/G`2/N1;')
cmd.do('distance hbond3, /4PCO//A/U`3/N3,/4PCO//B/G`8/O6;')
cmd.do('distance hbond4, /4PCO//A/U`3/O2,/4PCO//B/G`8/N1;')
cmd.do('color black, hbond1;')
cmd.do('color black, hbond2;')
cmd.do('color gray70, hbond3;')
cmd.do('color gray70, hbond4;')
cmd.do('show nb_spheres;')
cmd.do('set nb_spheres_size, 0.35;')
cmd.do('hide labels;')
cmd.do('ray 1600,1000;')
cmd.do('png 4PCO.png;')
${0}
'''
'This code colors by the nucleotides by base seqence. The backcone is shown as a flatten ribbon with rolled edges that give the dumbell effect. The code can be applied to any nucleic acid. The code is dervied from the CR and DU shortcuts. ':
'prefix': 'nucleicAcidDumbellCartoonColorbySequence'
'body': '''
cmd.do('bg_color white;')
cmd.do('set cartoon_oval_length, ${1:1.85}')
cmd.do('set cartoon_oval_width, ${2:0.5}')
cmd.do('cartoon oval;')
cmd.do('cartoon dumbbell;')
cmd.do('set cartoon_dumbbell_width, 0.2;')
cmd.do('set cartoon_dumbbell_radius, 0.4;')
cmd.do('set cartoon_ring_mode, ${3:3};')
cmd.do('# set the color of the backbone oval')
cmd.do('set cartoon_nucleic_acid_color, ${4:blue};')
cmd.do('select rna_A, resn A;')
cmd.do('select rna_C, resn C;')
cmd.do('select rna_G, resn G;')
cmd.do('select rna_U, resn U;')
cmd.do('select dna_T, resn T;')
cmd.do('color ${5:yellow}, rna_A;')
cmd.do('color ${6:red}, rna_C; ')
cmd.do('color ${7:gray40}, rna_G;')
cmd.do('color ${8:palecyan}, rna_U;')
cmd.do('color ${9:brown}, dna_T;')
cmd.do('as cartoon;')
${0}
'''
'Set keyboard shortcut by mapping F1 to stereo.':
'prefix': 'stereokb'
'body': '''
cmd.do('cmd.set_key('F1',lambda:cmd.stereo({'on':0,'off':1}[cmd.get('stereo')]));')
${0}
'''
'Print to the screen the settings and their current parameter values.':
'prefix': 'listSettings2'
'body': '''
cmd.do('list = setting.get_name_list();[print("%s => %s" % (name, setting.get_setting_text(name))) for name in list];')
${0}
'''
'Print to the screen the settings and their current parameter values. This is the more compact version.':
'prefix': 'listSettings'
'body': '''
cmd.do('[print("%s => %s" % (name, setting.get_setting_text(name))) for name in setting.get_name_list()];')
${0}
'''
'Print to the screen as labels that 21 font ids in their corresponding fonts in a grid. Each label is an object and appears in the internal gui. You can turn on and off the display of specific fonts.':
'prefix': 'displayFonts'
'body': '''
cmd.do('python;')
cmd.do('from pymol import cmd;')
cmd.do('for i in range(1,21):')
cmd.do(' name = 'label%d' % i;')
cmd.do(' cmd.pseudoatom(name, label='label font id %d' % i, pos=(0,0,0));')
cmd.do(' cmd.set('label_font_id', i, name);')
cmd.do('cmd.set('label_size', 50);')
cmd.do('cmd.set('grid_mode');')
cmd.do('python end;')
${0}
'''
'Print to disk a list of H-bond pairs and this H-bond length.':
'prefix': 'listHBonds'
'body': '''
cmd.do('Finish latter. See file listHBonds.py.;')
${0}
'''
'Create a list of objects in the internal gui and print this list to the screen.':
'prefix': 'listObjects'
'body': '''
cmd.do('objList = cmd.get_names("objects");print(objList);')
${0}
'''
'Print a list of protein--ligand distances. Code by <NAME>. Updated for Python3.':
'prefix': 'listLigandProteinDistances'
'body': '''
cmd.do('from pymol import cmd')
cmd.do('"""')
cmd.do('Find all distances betwen all ligand atoms and all protein atoms. ')
cmd.do('')
cmd.do('Adapted and updated from script by <NAME> posted here')
cmd.do('https://sourceforge.net/p/pymol/mailman/message/10097804/')
cmd.do('')
cmd.do('There are probably better solutions like finding just the ')
cmd.do('distances to proein atoms within a certain distance from ')
cmd.do('the ligand.')
cmd.do('')
cmd.do('Due to the nested for loops, this script is takes several second')
cmd.do('to run on a medium-sized human protein. This script is a ')
cmd.do('good candidate for vectorization. ')
cmd.do('')
cmd.do('It is also a good candiate for becoming a function and a shortcut. ')
cmd.do('')
cmd.do('"""')
cmd.do('')
cmd.do('# customize these lines to your protein.')
cmd.do('cmd.fetch("6NEC")')
cmd.do('cmd.select("prot","not resn XIN and not resn HOH and not chain C")')
cmd.do('cmd.select("lig", "resn XIN and not chain C")')
cmd.do('')
cmd.do('dist_list = {}')
cmd.do('pro_atoms = cmd.get_model("prot")')
cmd.do('lig_atoms = cmd.get_model("lig")')
cmd.do('')
cmd.do('for l_at in lig_atoms.atom:')
cmd.do(' for p_at in pro_atoms.atom:')
cmd.do(' dist_list[str(l_at.resn) +')
cmd.do(' ":" +')
cmd.do(' str(l_at.resi) +')
cmd.do(' " " +')
cmd.do(' l_at.name +')
cmd.do(' " ---- " + ')
cmd.do(' str(p_at.resn) +')
cmd.do(' ":" +')
cmd.do(' str(p_at.resi) +')
cmd.do(' " " +')
cmd.do(' p_at.name] = cmd.dist("foo", ')
cmd.do(' "index " +')
cmd.do(' str(l_at.index),"index " + str(p_at.index))')
cmd.do(' cmd.delete("foo")')
cmd.do('print("List of all pairwise ligand--protein atom-atom distances:")')
cmd.do('# [print("Distance of " + d + " is " + str(dist_list[d])) for d in dist_list.keys()]')
cmd.do('')
cmd.do('# More compact print statement. Need an f-string format statement.')
cmd.do('[print( d + " " + str(dist_list[d])) for d in dist_list.keys()]')
${0}
'''
'This code shows that cartoon backbone tube as 65% transparent. It hides the rungs of the cartoon. It shows all of the non-H atoms are sticks. The motivation is to have the cartoon highlight the backbone without dominanting the scene.':
'prefix': 'nucleicAcidBackboneTubesSticks'
'body': '''
cmd.do('set bg_rgb, white;')
cmd.do('hide everything, all;')
cmd.do('show cartoon, ${1:3nd3};')
cmd.do('set cartoon_sampling,1;')
cmd.do('set cartoon_tube_radius, 0.5;')
cmd.do('set cartoon_ladder_mode, 0;')
cmd.do('set cartoon_transparency, ${2:0.65};')
cmd.do('set stick_radius ${3:0.12};')
cmd.do('show sticks;')
cmd.do('hide sticks, element H;')
${0}
'''
'The code expands the asymmetric unit. It like the generate symmetry mates command but it provides more control over the prefix name of the symmetry mates and the addition of unique segment identifiers for each symmetry mate. The usage: symexp prefix, object, (selection), cutoff, segidFlag. The cutoff is in Angstroms. The segidFlag set to 1 will add unique segids. For related functions, see SC***.':
'prefix': 'symexp'
'body': '''
cmd.do('symexp ${1:symm}, ${2:3fa0}, (${2:3fa0}), ${3:20},${4:1};')
${0}
'''
'Adds the function draw_axis(). Could be useful for the adding a symmery axis, a ncs axis, or scale bar to a scene.':
'prefix': 'addAxis'
'body': '''
cmd.do('from pymol.cgo import * # get constants')
cmd.do('from pymol import cmd')
cmd.do('')
cmd.do('import math')
cmd.do('')
cmd.do('class Counter:')
cmd.do(' """')
cmd.do(' draw_line')
cmd.do(' source https://www.pymolwiki.org/index.php/Symmetry_Axis')
cmd.do(' ')
cmd.do(' Pymol script copyright <NAME> and <NAME> 2007')
cmd.do(' ')
cmd.do(' Under GNU Free Documentation License 1.2')
cmd.do(' ')
cmd.do(' Example:')
cmd.do(' ')
cmd.do(' draw_axis(x=18.232, y=17.150, z=9.488,i=-.226639, j=0.708772, k=-.668039, r=1, b=0, g=0, width=1, length=100)')
cmd.do(' ')
cmd.do(' Updated 15 June 2020 ')
cmd.do(' <NAME>')
cmd.do(' ')
cmd.do(' Notes:')
cmd.do(' 1) Could be useful for the adding a symmery axis, a ncs axis, or scale bar to a scene.')
cmd.do(' 2) The postion (xyz) is the middle of the line, not one end as expected for a vector.')
cmd.do(' 3) Another example: draw_axis(x=0, y=0, z=0,i=0, j=0, k=1, r=1, b=0, g=0, width=300, length=96) ')
cmd.do(' 4) Changed print statement to Python3 print function.')
cmd.do(' 5) Replaced cmd.extend() with function generator.')
cmd.do(' """')
cmd.do(' def __init__(self):')
cmd.do(' self.state = 1')
cmd.do('counter = Counter()')
cmd.do('')
cmd.do('@cmd.extend')
cmd.do('def draw_axis(x=None, y=None, z=None, i=None, j=None, k=None, length=20.0, r=1.0, g=1.0, b=1.0, width=1.0 ):')
cmd.do(' if x == None or y == None or z == None or i == None or j == None or k== None :')
cmd.do(' print('Usage: draw_axis x,y,z, i,k,j, length, r,g,b, width')')
cmd.do(' print('draw a line centered at (x,y,z) with the direction vector (i,j,k)')')
cmd.do(' print('length, color (r,g,b), and width arguments are optional')')
cmd.do('# print 'For a fun example of the command, run draw_axis_example'')
cmd.do(' else :')
cmd.do(' x,y,z = float(x), float(y), float(z)')
cmd.do(' i,j,k = float(i), float(j), float(k)')
cmd.do(' r,g,b = float(r), float(g), float(b)')
cmd.do(' width = float(width)')
cmd.do(' length = float(length) / 2.0')
cmd.do('')
cmd.do(' x1,y1,z1 = (x+i*length,y+j*length,z+k*length)')
cmd.do(' x2,y2,z2 = (x-i*length,y-j*length,z-k*length)')
cmd.do('')
cmd.do(' obj = [')
cmd.do(' LINEWIDTH, width,')
cmd.do(' BEGIN, LINES,')
cmd.do('')
cmd.do(' COLOR, r, g, b,')
cmd.do(' VERTEX, x1, y1, z1,')
cmd.do(' VERTEX, x2, y2, z2,')
cmd.do('')
cmd.do(' END')
cmd.do(' ]')
cmd.do('')
cmd.do(' cmd.load_cgo(obj,'axis'+str(counter.state))')
cmd.do(' counter.state += 1')
${0}
'''
'Wait unitl all current commands have been executed. A timeout ensures that that command ecentually returns.':
'prefix': 'synch'
'body': '''
cmd.do('cmd.sync(timeout=${1:1.0},poll=${2:0.05});')
${0}
'''
'Add or substract a residue number offset.':
'prefix': 'renumResi'
'body': '''
cmd.do('alter ${1:3fa0}, resi=str(int(resi)+${2:100});sort;')
${0}
'''
'Add or substract a atom number offset.':
'prefix': 'renumAtoms'
'body': '''
cmd.do('alter {$1:3fa0}, ID=ID+${2:100};')
cmd.do('sort;')
${0}
'''
'Rename a chain. ':
'prefix': 'renameChain'
'body': '''
cmd.do('alter ${1:3fa0} and chain ${2:A}, chain=${3:"C"};')
cmd.do('sort;')
${0}
'''
'Print the atom number2 of a residue.':
'prefix': 'printAtomNumbers'
'body': '''
cmd.do('iterate (resi 1), print(name + " %i5" % ID);')
${0}
'''
'Print the atom names of a residue.':
'prefix': 'printAtomNames'
'body': '''
cmd.do('iterate (resi ${1:101}), print(name);')
${0}
'''
'Print the bfactors of a residue.':
'prefix': 'printBfactors'
'body': '''
cmd.do('iterate (resi ${1:101}), print(name + " %.2f" % b);')
${0}
'''
'Print the van Der Waals radii of the atoms in of a residue.':
'prefix': 'printVDWradii'
'body': '''
cmd.do('iterate (resi ${1:101}), print(name + " %.2f" % vdw);')
${0}
'''
'Print the coordinates of the atoms in a residue.':
'prefix': 'printCoordinates'
'body': '''
cmd.do('stored.coords = []; ')
cmd.do('iterate_state 1, (resi ${1:101}), stored.coords.append([x,y,z]); ')
cmd.do('[print(i) for i in stored.coords];')
${0}
'''
'Print the atom names and coordinates of the atoms in a residue.':
'prefix': 'printNamesCoordinates'
'body': '''
cmd.do('stored.names = []; iterate_state 1, (resi ${1:101}), stored.names.append([name]); ')
cmd.do('stored.coords = []; iterate_state 1, (resi ${1:101})), stored.coords.append([x,y,z]); ')
cmd.do('[print(i,j) for i,j in zip(stored.names, stored.coords)];')
${0}
'''
'Print the atom names as tuples and coordinates of the atoms in a residue as a list.':
'prefix': 'printNamesCoordinates'
'body': '''
cmd.do('stored.coords = []; iterate_state 1, (resi ${1:101}), stored.coords.append([x,y,z]); ')
cmd.do('stored.names = []; iterate_state 1, (resi ${1:101}), stored.names.append([name]);')
cmd.do('stored.names3 = [tuple(i) for i in stored.names];')
cmd.do('[print(i,j) for i,j in(zip(stored.names3, stored.coords)];')
${0}
'''
'Source block template in org-mode with emacs-jupyter package. ':
'prefix': 'emacsjupyterSourceBlock'
'body': '''
cmd.do('#+BEGIN_SRC jupyter-python :session py :kernel pymol.python :exports both :results raw drawer ')
cmd.do('from pymol import cmd')
cmd.do('cmd.do("reinitialize")')
cmd.do('cmd.bg_color("white")')
cmd.do('cmd.do("fetch 6VXX")')
cmd.do('cmd.do("zoom (resi 614 and chain A)")')
cmd.do('cmd.label(selection="chain A and resi 614 and name CB", expression="'%s-%s' % (resn,resi)")')
cmd.do('cmd.do("set label_color, black; set label_size, 48")')
cmd.do('cmd.do("set stick_radius, 0.12")')
cmd.do('cmd.do("hide cartoon; show sticks")')
cmd.do('cmd.do("set ray_shadows, 0")')
cmd.do('cmd.do("draw")')
cmd.do('cmd.do("png /Users/blaine/D614Gipython3.png, 600, 360, dpi=600")')
cmd.do('from IPython.display import Image')
cmd.do('from IPython.core.display import HTML')
cmd.do('PATH = "/Users/blaine/"')
cmd.do('Image(filename = PATH + "D614Gipython3.png", width=600, unconfined=True)')
cmd.do('#+END_SRC')
cmd.do('')
cmd.do('#+RESULTS:')
cmd.do('$0')
${0}
'''
'Source block template in org-mode with ob-ipython package. ':
'prefix': 'obipythonSourceBlock'
'body': '''
cmd.do('#+BEGIN_SRC ipython :session py :kernel pymol.python :exports both :results raw drawer ')
cmd.do('from pymol import cmd')
cmd.do('cmd.do("reinitialize")')
cmd.do('cmd.bg_color("white")')
cmd.do('cmd.do("fetch 6VXX")')
cmd.do('cmd.do("zoom (resi 614 and chain A)")')
cmd.do('cmd.label(selection="chain A and resi 614 and name CB", expression="'%s-%s' % (resn,resi)")')
cmd.do('cmd.do("set label_color, black; set label_size, 48")')
cmd.do('cmd.do("set stick_radius, 0.12")')
cmd.do('cmd.do("hide cartoon; show sticks")')
cmd.do('cmd.do("set ray_shadows, 0")')
cmd.do('cmd.do("draw")')
cmd.do('cmd.do("png /Users/blaine/D614Gipython3.png, 600, 360, dpi=600")')
cmd.do('from IPython.display import Image')
cmd.do('from IPython.core.display import HTML')
cmd.do('PATH = "/Users/blaine/"')
cmd.do('Image(filename = PATH + "D614Gipython3.png", width=600, unconfined=True)')
cmd.do('#+END_SRC')
cmd.do('')
cmd.do('#+RESULTS:')
${0}
'''
| true | '.source.python':
'Ambient occlussion.':
'prefix': 'ao'
'body': '''
cmd.do('set_color oxygen, [1.0,0.4,0.4];')
cmd.do('set_color nitrogen, [0.5,0.5,1.0];')
cmd.do('remove solvent;')
cmd.do('as spheres;')
cmd.do('util.cbaw;')
cmd.do('bg white;')
cmd.do('set light_count,10;')
cmd.do('set spec_count,1;')
cmd.do('set shininess, 10;')
cmd.do('set specular,0.25;')
cmd.do('set ambient,0;')
cmd.do('set direct,0;')
cmd.do('set reflect,1.5;')
cmd.do('set ray_shadow_decay_factor, 0.1;')
cmd.do('set ray_shadow_decay_range, 2;')
cmd.do('unset depth_cue;')
cmd.do('ray;')
${0}
'''
'Set ellipsoid color.':
'prefix': 'ellipcol'
'body': '''
cmd.do('set ellipsoid_color, ${1:color};')
cmd.do('${0}')
${0}
'''
'set distance labels to display 2 decimals':
'prefix': 'sigdist'
'body': '''
cmd.do('set label_distance_digits, ${1:2};')
${0}
'''
'Set angle labels to display 2 decimals places':
'prefix': 'sigang'
'body': '''
cmd.do('set label_angle_digits, ${1:2};')
${0}
'''
'Ball and stick representation. ':
'prefix': 'bs'
'body': '''
cmd.do('show sticks;')
cmd.do('set stick_radius, 0.12;')
cmd.do('set stick_ball, on;')
cmd.do('set stick_ball_ratio, 1.9;')
cmd.do('show nb_spheres;')
cmd.do('set nb_spheres_size=0.33;')
${0}
'''
'Base-stacking figure.':
'prefix': 'stack'
'body': '''
cmd.do('delete all;')
cmd.do('fetch ${1:4PCO}, type=pdb,async=0;')
cmd.do('select ${2:G2G3}, ( ((resi ${3:2} or resi ${4:3}) and chain A) or ((resi ${5:8} or resi ${6:9}) and chain B) );')
cmd.do('hide everything, element h; ')
cmd.do('remove not ${2:G2G3};')
cmd.do('bg_color white;')
cmd.do('show sticks;')
cmd.do('set stick_radius=0.14;')
cmd.do('set stick_ball, on; ')
cmd.do('set stick_ball_ratio,1.9;')
cmd.do('set_view (-0.75,0.09,0.66,-0.2,0.92,-0.35,-0.64,-0.39,-0.67,-0.0,-0.0,-43.7,7. 24,9.55,11.78,29.46,57.91,-20.0);')
cmd.do('hide everything, element H;')
cmd.do('select carbon1, element C and (resi ${4:3} or resi ${5:8}); ')
cmd.do('# select lower base pair;')
cmd.do('select carbon2, element C and (resi ${3:2} or resi ${6:9});')
cmd.do('#select upper base pair;')
cmd.do('color gray70,carbon1;')
cmd.do('color gray10,carbon2;')
cmd.do('space cmyk;')
cmd.do('distance hbond1,/${1:4PCO}//B/U`9/N3,/${1:4PCO}//A/G`2/O6;')
cmd.do('distance hbond2,/${1:4PCO}//B/U`9/O2,/${1:4PCO}//A/G`2/N1;')
cmd.do('distance hbond3,/${1:4PCO}//A/U`3/N3,/${1:4PCO}//B/G`8/O6;')
cmd.do('distance hbond4,/${1:4PCO}//A/U`3/O2,/${1:4PCO}//B/G`8/N1;')
cmd.do('color black, hbond1;')
cmd.do('color black, hbond2;')
cmd.do('color gray70, hbond3;')
cmd.do('color gray70, hbond4;')
cmd.do('show nb_spheres;')
cmd.do('set nb_spheres_size, 0.35;')
cmd.do('hide labels;')
cmd.do('ray 1600,1000;')
cmd.do('png ${1:4PCO}.png')
${0}
'''
'Biological unit.':
'prefix': 'bu'
'body': '''
cmd.do('run ~/Scripts/PyMOLScripts/quat.py; quat')
${0}
'''
'Valence bond. ':
'prefix': 'doubleBond'
'body': '''
cmd.do('set valence, 1; ')
cmd.do('set valence_mode, 1;')
${0}
'''
'Color blindness.':
'prefix': 'cblind'
'body': '''
cmd.do('run ~/Pymol-script-repo/colorblindfriendly.py;')
cmd.do('as cartoon;')
cmd.do('color cb_red, ss H;')
cmd.do('color cb_yellow,ss S;')
cmd.do('color cb_green, ss L+;')
${0}
'''
'Center pi.':
'prefix': 'centerpi'
'body': '''
cmd.do('pseudoatom pi_cent,/${1:3nd3}/${2:A}/${3:U`15}/cg+cz;')
cmd.do('dist pi_cent////ps1, b/${4:U`15}/${5:aaa};')
${0}
'''
'Color ribbon H red, strand yellow, loop green.':
'prefix': 'cribbon'
'body': '''
cmd.do('as cartoon;')
cmd.do('color red, ss H;')
cmd.do('color yellow,ss S;')
cmd.do('color green, ss L+;')
${0}
'''
'Colored spheres.':
'prefix': 'cspheres'
'body': '''
cmd.do('as spheres;')
cmd.do('color gray30, chain ${1:A};')
cmd.do('color white, chain ${2:B};')
cmd.do('color green, name CL;')
cmd.do('color brown, resn NAG;')
cmd.do('color red, resi 381;')
cmd.do('remove solvent;')
cmd.do('unset specular;')
cmd.do('set ray_trace_gain, 0;')
cmd.do('set ray_trace_mode, 3;')
cmd.do('bg_color white;')
cmd.do('set ray_trace_color, black;')
cmd.do('unset depth_cue;')
${0}
'''
'Coordinate covalent bonds to metals and H-bonds friom RNA.':
'prefix': 'coordinate'
'body': '''
cmd.do('viewport 900,600;')
cmd.do('fetch 3nd4, type=pdb, async=0;')
cmd.do('run ~/Scripts/PyMOLScripts/quat.py;')
cmd.do('quat 3nd4;')
cmd.do('show sticks;')
cmd.do('set stick_radius=0.125;')
cmd.do('hide everything, name H*;')
cmd.do('bg_color white;')
cmd.do('create coorCov, (3nd4_1 and (resi 19 or resi 119 or resi 219 or resi 319 or resi 419 or resi 519 or (resi 3 and name N7)));')
cmd.do('bond (coorCov//A/NA`19/NA),(coorCov//A/A`3/N7);')
cmd.do('bond (coorCov//A/NA`19/NA),(coorCov//A/HOH`119/O);')
cmd.do('bond (coorCov//A/NA`19/NA),(coorCov//A/HOH`219/O);')
cmd.do('bond (coorCov//A/NA`19/NA),(coorCov//A/HOH`319/O);')
cmd.do('bond (coorCov//A/NA`19/NA),(coorCov//A/HOH`519/O);')
cmd.do('distance (3nd4_1 and chain Aand resi 19 and name NA), (3nd4_1 and chain A and resi 519);')
cmd.do('distance (3nd4_1 and chain A and resi 19 and name NA), (3nd4_1 and chain A and resi 419);')
cmd.do('distance (3nd4_1 and chain A and resi 19 and name NA), (3nd4_1 and chain A and resi 319);')
cmd.do('distance (3nd4_1 and chain A and resi 19 and name NA), (3nd4_1 and chain A and resi 219);')
cmd.do('show nb_spheres; ')
cmd.do('set nb_spheres_size, .35;')
cmd.do('distance hbond1,/3nd4_1/1/A/HOH`119/O, /3nd4_1/1/A/A`3/OP2;')
cmd.do('distance hbond2,/3nd4_1/1/A/HOH`319/O, /3nd4_1/1/A/A`3/OP2;')
cmd.do('distance hbond3,/3nd4_1/1/A/HOH`91/O,/3nd4_1/1/A/HOH`119/O;')
cmd.do('distance hbond4,/3nd4_1/1/A/G`4/N7,/3nd4_1/1/A/HOH`91/O;')
cmd.do('distance hbond5,/3nd4_1/1/A/G`4/O6, /3nd4_1/1/A/HOH`419/O;')
cmd.do('distance hbond6,/3nd4_1/1/A/HOH`91/O,/3nd4_1/1/A/G`4/OP2;')
cmd.do('distance hbond7,/3nd4_1/1/A/HOH`319/O,/3nd4_1/1/A/G`2/OP2;')
cmd.do('distance hbond9,/3nd4_1/1/A/HOH`419/O,/3nd4_2/2/A/HOH`74/O;')
cmd.do('distance hbond10,/3nd4_2/2/A/C`15/O2,/3nd4_1/1/A/G`2/N2;')
cmd.do('distance hbond11, /3nd4_2/2/A/C`15/N3,/3nd4_1/1/A/G`2/N1;')
cmd.do('distance hbond12,/3nd4_2/2/A/C`15/N4,/3nd4_1/1/A/G`2/O6;')
cmd.do('distance hbond13, /3nd4_2/2/A/U`14/N3,/3nd4_1/1/A/A`3/N1;')
cmd.do('distance hbond14,3nd4_2/2/A/U`14/O4,/3nd4_1/1/A/A`3/N6;')
cmd.do('distance hbond15, /3nd4_2/2/A/C`13/N4,/3nd4_1/1/A/G`4/O6;')
cmd.do(' distance hbond16,/3nd4_2/2/A/C`13/N3, /3nd4_1/1/A/G`4/N1;')
cmd.do('distance hbond17, /3nd4_1/1/A/G`4/N2,/3nd4_2/2/A/C`13/O2;')
cmd.do('distance hbond18,/3nd4_1/1/A/G`2/N2,/3nd4_2/2/A/C`15/O2;')
cmd.do('distance hbond19,/3nd4_1/1/A/HOH`91/O,/3nd4_1/1/A/G`4/OP2; ')
cmd.do('set depth_cue=0;')
cmd.do('set ray_trace_fog=0;')
cmd.do('set dash_color, black;')
cmd.do('set label_font_id, 5;')
cmd.do('set label_size, 36;')
cmd.do('set label_position, (0.5, 1.0, 2.0);')
cmd.do('set label_color, black;')
cmd.do('set dash_gap, 0.2;')
cmd.do('set dash_width, 2.0;')
cmd.do('set dash_length, 0.2;')
cmd.do('set label_color, black;')
cmd.do('set dash_gap, 0.2;')
cmd.do('set dash_width, 2.0;')
cmd.do('set dash_length, 0.2;')
cmd.do('select carbon, element C;')
cmd.do('color yellow, carbon;')
cmd.do('disable carbon;')
cmd.do('set_view(-0.9,0.34,-0.26,0.33,0.18,-0.93,-0.27,-0.92,-0.28,-0.07,-0.23,-27.83,8.63,19.85,13.2,16.0,31.63,-20.0)')
${0}
'''
'H-bond distances.':
'prefix': 'distance'
'body': '''
cmd.do('distance ${1:dist3}, ${2:/rcsb074137//B/IOD`605/I`B}, ${3:/rcsb074137//B/IOD`605/I`A}')
${0}
'''
'Draw H-bonds. ':
'prefix': 'drawHbonds'
'body': '''
cmd.do('hide everything, hydrogens')
cmd.do('hide labels')
cmd.do('set dash_color, ${1:black}${2:yelow} ')
cmd.do('set dash_gap, 0.4')
cmd.do('set dash_radius, 0.08')
${0}
'''
'Carved isomesh representation of electron density. ':
'prefix': 'carvedIsomesh'
'body': '''
cmd.do('delete all;')
cmd.do('fetch ${1:4dgr}, async=0;')
cmd.do('fetch ${1:4dgr}, type=2fofc,async=0;')
cmd.do('select ${2:LongGlycan}, resi ${3:469:477};')
cmd.do('orient ${2:LongGlycan};')
cmd.do('remove not ${2:LongGlycan};')
cmd.do('remove name H*;')
cmd.do('isomesh 2fofcmap, ${1:4dgr}_2fofc, 1, ${2:LongGlycan}, carve = 1.8;')
cmd.do('color density, 2fofcmap; ')
cmd.do('show sticks;')
cmd.do('show spheres;')
cmd.do('set stick_radius, .07;')
cmd.do('set sphere_scale, .19;')
cmd.do('set sphere_scale, .13, elem H;')
cmd.do('set bg_rgb=[1, 1, 1];')
cmd.do('set stick_quality, 50;')
cmd.do('set sphere_quality, 4;')
cmd.do('color gray85, elem C;')
cmd.do('color red, elem O;')
cmd.do('color slate, elem N;')
cmd.do('color gray98, elem H;')
cmd.do('set stick_color, gray50;')
cmd.do('set ray_trace_mode, 1;')
cmd.do('set ray_texture, 2;')
cmd.do('set antialias, 3;')
cmd.do('set ambient, 0.5;')
cmd.do('set spec_count, 5;')
cmd.do('set shininess, 50;')
cmd.do('set specular, 1;')
cmd.do('set reflect, .1;')
cmd.do('set dash_gap, 0;')
cmd.do('set dash_color, black;')
cmd.do('set dash_gap, .15;')
cmd.do('set dash_length, .05;')
cmd.do('set dash_round_ends, 0;')
cmd.do('set dash_radius, .05;')
cmd.do('set_view (0.34,-0.72,0.61,0.8,0.56,0.22,-0.51,0.4,0.77,0.0,0.0,-81.31,44.64,-9.02,58.62,65.34,97.28,-20.0);')
cmd.do('preset.ball_and_stick("all",mode=1);')
cmd.do('draw;')
${0}
'''
'Fetch 2FoFc map as an isomesh.':
'prefix': 'fetch2FoFcIsomesh'
'body': '''
cmd.do('fetch ${1:3nd4}_2fofc, type=2fofc, async=0;')
cmd.do('isomesh 2fofcmap, ${1:3nd4_2fofc}, 1, ${2:LongGlycan}, carve = 1.8;')
${0}
'''
'Fetch cif file.':
'prefix': 'fetchCIF'
'body': '''
cmd.do('fetch ${1:3nd4}, type=cif, async=0;')
${0}
'''
'Fetch fofc map.':
'prefix': 'fetchFoFc'
'body': '''
cmd.do('fetch ${1:3nd4}, type=fofc, async=0;')
${0}
'''
'Filled rings in nucleic acids. ':
'prefix': 'filledRing'
'body': '''
cmd.do('show sticks;set cartoon_ring_mode, 3;')
cmd.do('set cartoon_ring_finder, 1;')
cmd.do('set cartoon_ladder_mode, 1;')
cmd.do('set cartoon_nucleic_acid_mode, 4;')
cmd.do('set cartoon_ring_transparency, 0.5;')
cmd.do('as cartoon;')
${0}
'''
'Get coordinates. ':
'prefix': 'getCoordinates'
'body': '''
cmd.do('print cmd.get_atom_coords('${1:/4PCO//B/G`8/OP2}');')
${0}
'''
'H-bond dashes.':
'prefix': 'hbonddash'
'body': '''
cmd.do('hide everything, hydrogens;')
cmd.do('hide labels;')
cmd.do('set dash_color, black; ')
cmd.do('set dash_gap, 0.4;')
cmd.do('set dash_radius, 0.08;')
${0}
'''
'Hbond setup. ':
'prefix': 'hbond'
'body': '''
cmd.do('hide labels;')
cmd.do('set dash_color, black ;')
cmd.do('set dash_length, ${1:0.15};')
cmd.do('set dash_gap, ${2:0.35};')
cmd.do('set dash_width, ${3:3.0};')
${0}
'''
'Hide alt loc.':
'prefix': 'hidealtloc'
'body': '''
cmd.do('select altconf, alt ${1:b} # select B alternative locators;')
cmd.do('hide everything, altconf # hide alt B locators;')
${0}
'''
'Label CA atom with single-letter residue name and residue number.':
'prefix': 'labelResnResi'
'body': '''
cmd.do('label name ca, '%s%s' %(one_letter[${1:resn}],${2:resi});')
${0}
'''
'Label SS. ':
'prefix': 'labelSS'
'body': '''
cmd.do('alter ${1:}, ss='%1';')
cmd.do('label (%2),'%3';')
${0}
'''
'Load PDB ball-and-stick.':
'prefix': 'loadPDBbs'
'body': '''
cmd.do('fetch ${1:3nd3},name=${1:3nd3}, type=pdb, async=0')
cmd.do('hide (name H*);')
cmd.do('hide lines;')
cmd.do('show sticks;')
cmd.do('set stick_radius, ${2:1.2};')
cmd.do('set nb_sphere_radius, ${3:0.35};')
cmd.do('orient;')
${0}
'''
'Load PDB nb spheres. ':
'prefix': 'loadPDBnb'
'body': '''
cmd.do('fetch ${1:3nd3},name=${1:3nd3}, type=pdb, async=0;')
cmd.do('orient;')
cmd.do('set stick_radius, ${2:1.2};')
cmd.do('hide (name H*);')
cmd.do('set nb_sphere_size, ${3:0.35};')
cmd.do('set nb_spheres_quality, ${4:1};')
cmd.do('show nb_spheres;')
${0}
'''
'Measure surface area. ':
'prefix': 'ms'
'body': '''
cmd.do('fetch ${1:3nd3},name=${1:3nd3}, type=pdb, async=0')
cmd.do('select ${2:temp}, ${3:3nd3} and chain A;')
cmd.do('run ${3:/Users/blaine-mooers/Scripts/PyMOLScripts/msms_pymol.py};')
cmd.do('calc_msms_area ${2:temp};')
${0}
'''
'Molscript ribbons.':
'prefix': 'molscriptRibbon'
'body': '''
cmd.do('set cartoon_highlight_color, grey;')
cmd.do('show cartoon;')
cmd.do('set cartoon_flat_sheets, 0;')
cmd.do('set cartoon_smooth_loops, 0;')
cmd.do('set cartoon_fancy_helices, 1;')
${0}
'''
'One letter amino acid. ':
'prefix': 'oneLetter'
'body': '''
cmd.do('one_leVer%={'VAL':'V',%'ILE':'I',%'LEU':'L',%'GLU':'E',%'GLN':'Q','ASP':'D',%')
cmd.do(''ASN':'N',%'HIS':'H',%'TRP':'W',%'PHE':'F',%'TYR':'Y',%'ARG':'R',%'LYS':'K',%')
cmd.do(''SER':'S',%'THR':'T',%'MET':'M',%'ALA':'A',%'GLY':'G',%'PRO':'P',%'CYS':'C'}%')
${0}
'''
'Print Fasta from PDB file. ':
'prefix': 'fasta'
'body': '''
cmd.do('print cmd.get_fastastr('all')')
${0}
'''
'Position label with pseudoatom. ':
'prefix': 'pseudolabel'
'body': '''
cmd.do('pseudoatom ${1:forLabel};')
cmd.do('label ${1:forLabel}, '%0';')
cmd.do('set label_color, ${2:red};')
${0}
'''
'Rotate about axis.':
'prefix': 'rotate'
'body': '''
cmd.do('rotate ${1:x}, ${2:45}, ${3:pept};')
${0}
'''
'Stereo draw.':
'prefix': 'stereoDraw'
'body': '''
cmd.do('stereo walleye; ')
cmd.do('set ray_shadow, off; ')
cmd.do('#draw 3200,2000;')
cmd.do('draw ${1:1600,1000}; ')
cmd.do('png ${2:aaa}.png')
cmd.do('${0}')
${0}
'''
'Stereo ray.':
'prefix': 'stereoRay'
'body': '''
cmd.do('stereo; ')
cmd.do('set ray_shadow, off;')
cmd.do('ray ${1:2400,1200};')
cmd.do('png ${2:aaa}.png;')
${0}
'''
'Three electron density as Isomesh. ':
'prefix': 'threeMapsIsomesh'
'body': '''
cmd.do('load ${1:4dgr}.pdb')
cmd.do('# Make sure to rename map file so that ')
cmd.do('# the root filename differs from pdb root filename')
cmd.do('load ${1:4dgr}_2fofc.ccp4, 2fofc;')
cmd.do('load ${1:4dgr}_fofc.ccp4, fofc;')
cmd.do('select ${2:glycan}, resid 200 or (resid 469:477);')
cmd.do('isomesh ${3:mesh1}, 2fofc, 1.0, ${2:glycan};')
cmd.do('color density, ${3:mesh1};')
cmd.do('isomesh ${4:mesh2}, fofc, 3.0, ${2:glycan};')
cmd.do('color green, ${4:mesh2};')
cmd.do('isomesh ${5:mesh3}, fofc, -3.0, ${2:glycan};')
cmd.do('color red, ${5:mesh3};')
${0}
'''
'Turn about axis. ':
'prefix': 'turnAboutAxis'
'body': '''
cmd.do('turn ${1:x},${2:90};')
${0}
'''
'Volume ramp.':
'prefix': 'volumeRamp'
'body': '''
cmd.do('cmd.volume_ramp_new('ramp_magenta', [0.01, 1.00, 0.00, 1.00, 0.00, 4.01, 1.00, 0.00, 1.00, 0.10, 4.99, 1.00, 0.00, 1.00, 0.50,])')
${0}
'''
'Set radius of ball used to make solvent accessible surface.':
'prefix': 'solventRadius'
'body': '''
cmd.do('set solvent_radius, ${1:1.55};')
${0}
'''
'Scale the radius and color of atoms as spheres by property in the B-value column.':
'prefix': 'scaleRadiusColor'
'body': '''
cmd.do('bg_color white;')
cmd.do('hide everything;')
cmd.do('show spheres;')
cmd.do('set stick_radius = 0.1;')
cmd.do('hide everything, HET;')
cmd.do('show spheres, HET;')
cmd.do('set sphere_quality=3;')
cmd.do('show sticks, resi $1{1102};')
cmd.do('from pymol import stored;')
cmd.do('# set the stored array equal to the b−values or use your own values; ')
cmd.do('stored.bb = [ ];')
cmd.do('iterate all, stored.bb.append(b);')
cmd.do('# execute a python−block;')
cmd.do('python;')
cmd.do('# scale the b−values;')
cmd.do('M = max(stored.bb);')
cmd.do('scaledBB = map(lambda x: float (x/M), stored.bb);')
cmd.do('count = 0;')
cmd.do('# set the sphere radii independently;')
cmd.do('#[(cmd.set("sphere_scale", x ,"ID %s"%count); count = count + 1) for x in scaledBB]')
cmd.do('for x in scaledBB:')
cmd.do(' cmd.set("sphere_scale", x ,"ID %s"%count)')
cmd.do(' count = count + 1')
cmd.do('python end')
cmd.do('spectrum b, selection=${2:4gdx};')
cmd.do('space cmyk;')
cmd.do('set specular_intensity , 0.25;')
${0}
'''
'Return settings in rounded format.':
'prefix': 'rv'
'body': '''
cmd.do('run roundview.py;')
${0}
'''
'Save png flle with timestamp':
'prefix': 'spng'
'body': '''
cmd.do('python;')
cmd.do('import datetime;')
cmd.do('from pymol import cmd; ')
cmd.do('DT =datetime.datetime.now().strftime("yr%Ymo%mday%dhr%Hmin%M");')
cmd.do('s = str(DT); ')
cmd.do('cmd.save(stemName+s+".png"); ')
cmd.do('end python;')
${0}
'''
'Save pse flle with timestamp':
'prefix': 'spse'
'body': '''
cmd.do('python;')
cmd.do('import datetime;')
cmd.do('from pymol import cmd; ')
cmd.do('DT =datetime.datetime.now().strftime("yr%Ymo%mday%dhr%Hmin%M");')
cmd.do('s = str(DT); ')
cmd.do('cmd.save(stemName+s+".pse"); ')
cmd.do('end python;')
${0}
'''
'Run supercell script to generate three cells in all directions. This script was written by PI:NAME:<NAME>END_PI.':
'prefix': 'sc222'
'body': '''
cmd.do('run ${1:$HOME/Scripts/PyMOLscripts/supercell.py};')
cmd.do('supercell 2, 2, 2, , orange, supercell2, 1;')
${0}
'''
'The pearl effect is made with two spheres with the outer sphere being transparent.':
'prefix': 'pearl'
'body': '''
cmd.do('create ${1:sodium2}, ${2:sodium1};')
cmd.do('set sphere_transparency, 0.4, ${1:sodium2};')
cmd.do('set sphere_scale, 1.05, ${1:sodium2};')
cmd.do('ray;')
${0}
'''
'Blur the background atoms.':
'prefix': 'fog'
'body': '''
cmd.do('set fog, 0;')
${0}
'''
'Remove waters from molecular object.':
'prefix': 'rmwater'
'body': '''
cmd.do('remove resn HOH;')
${0}
'''
'Set color name to a RGB code.':
'prefix': 'setcolor'
'body': '''
cmd.do('set_color ${1:bark}, [${2:0.1, ${3:0.1}, ${4:0.1}];')
cmd.do('color ${1:bark}, ${5:protein};')
${0}
'''
'Duplicate object.':
'prefix': 'duplicateObject'
'body': '''
cmd.do('create ${1:t4l}, ${2:1lw9};')
${0}
'''
'Select a chain. ':
'prefix': 'selectChain'
'body': '''
cmd.do('select rna, chain B;')
${0}
'''
'Select residues by name.':
'prefix': 'selectResidues'
'body': '''
cmd.do('select aromatic, resn phe+tyr+trp;')
${0}
'''
'Select residues by a range of numbers.':
'prefix': 'selectResi'
'body': '''
cmd.do('select ${!:se}; resi ${2:1-100};')
${0}
'''
'Select atoms by element.':
'prefix': 'selectElement'
'body': '''
cmd.do('select ${1:oxygen}, elem ${2:O}')
${0}
'''
'Select atoms by name.':
'prefix': 'selectName'
'body': '''
cmd.do('select ${1:oxygen2}, name ${2:O2}')
${0}
'''
'Select atoms by alpha helices.':
'prefix': 'selectHelices'
'body': '''
cmd.do('select ${1:helices}, ss h; ')
${0}
'''
'Select atoms by beta strands.':
'prefix': 'selectStrands'
'body': '''
cmd.do('select ${1:strands}, ss s; ')
${0}
'''
'Select atoms by beta loops.':
'prefix': 'selectLoops'
'body': '''
cmd.do('select ${1:loops}, ss l;')
${0}
'''
'Select all nitrogen atom in a selelction except from lysine.':
'prefix': 'selectAllBut'
'body': '''
cmd.do('select ${1:select1}, elem ${2:N} and chain ${3:A} and not resn ${4:LYS};')
${0}
'''
'Select atoms within a radius around a ligand.':
'prefix': 'selectAtomsAround'
'body': '''
cmd.do('select ${1:nearby}, resn ${2:drug} around ${3:5};')
${0}
'''
'Select residues within a radius around a ligand.':
'prefix': 'selectResiduesAround'
'body': '''
cmd.do('select ${1:nearby}, br. resn ${2:drug} around ${3:5};')
${0}
'''
'Undo a selection.':
'prefix': 'undoSelection'
'body': '''
cmd.do('disable ${1:sele}; ')
${0}
'''
'Load a pdb file in the current directory.':
'prefix': 'loadPDBfile'
'body': '''
cmd.do('load ${1:my.pdb};')
${0}
'''
'Save a png file of current scene to the current directory.':
'prefix': 'savePNG'
'body': '''
cmd.do('png ${1:saveMe.png};')
${0}
'''
'Set the ring mode to a value between 0 and 6 in cartoons of nucleic acids.':
'prefix': 'ringMode'
'body': '''
cmd.do('show cartoon, ${1:rna}; set cartoon_ring_mode, ${2:3};')
${0}
'''
'In cartoons, hide the backbone atoms of selected residues when showing then as sticks.':
'prefix': 'sidehChainHelper'
'body': '''
cmd.do('set cartoon_side_chain_helper, on;')
${0}
'''
'Create a new object from part of an existing object.':
'prefix': 'extractPartObj'
'body': '''
cmd.do('extract new_obj, chain A;')
${0}
'''
'Create a putty cartoon.':
'prefix': 'puttyCartoon'
'body': '''
cmd.do('show cartoon;')
cmd.do('cartoon putty;')
cmd.do('unset cartoon_smooth_loops;')
cmd.do('unset cartoon_flat_sheets;')
${0}
'''
'Trun off magenta squares on current selection.':
'prefix': 'hideSelection'
'body': '''
cmd.do('indicate none')
${0}
'''
'Turn on discrete colors between secondary structure elements.':
'prefix': 'discreteCartoonColoring'
'body': '''
cmd.do('set cartoon_discrete_colors, on;')
${0}
'''
'Display all symmetry mates in one unit cell. Uses supercell.py in $HOME/Scripts/PyMOLscripts/.':
'prefix': 'sc111'
'body': '''
cmd.do('run $HOME/Scripts/PyMOLscripts/supercell.py;')
cmd.do('supercell 1, 1, 1, , orange, supercell1, 1;')
${0}
'''
'Display SAXS envelope':
'prefix': 'saxsEnvelope'
'body': '''
cmd.do('alter ${1:refine_A_Ave_SM_015_0_370-374-0r}, vdw=3.0;')
cmd.do('set solvent_radius = 3.0;')
${0}
'''
'Set additional path for PyMOL to search on startup':
'prefix': 'setpath'
'body': '''
cmd.do('os.environ["PATH"] += os.pathsep +${1: '/Applications/ATSAS/bin'};')
${0}
'''
'Set path for location to save fetched pdb files. ':
'prefix': 'fetchPath'
'body': '''
cmd.do('set fetch_path, ${1:/Users/blaine/pdbFiles};')
${0}
'''
'Set antialias to get smooth edges':
'prefix': 'antialias'
'body': '''
cmd.do('set antialias, 1;')
${0}
'''
'Print list of active pymolrc files.':
'prefix': 'lspymolrc'
'body': '''
cmd.do('print invocation.options.deferred;')
${0}
'''
'Set number of decimals places to show in distance labels. ':
'prefix': 'sigDigits'
'body': '''
cmd.do('set label_distance_digits, ${1:2};')
cmd.do('set label_angle_digits, ${2:2};')
${0}
'''
'Label the CA atoms with the Ala333 style format':
'prefix': 'labelCAs'
'body': '''
cmd.do('label name CA,"%s%s" % (resn,resi);')
${0}
'''
'Label waters HOH.':
'prefix': 'labelWatersHOH'
'body': '''
cmd.do('label resn HOH ,"%s%s" % (resn,resi);')
${0}
'''
'Label waters W.':
'prefix': 'labelWatersW'
'body': '''
cmd.do('label resn HOH ,"W%s" % (resi);')
${0}
'''
'Find hbonds around a residue.':
'prefix': 'findHbonds'
'body': '''
cmd.do('remove element h; distance hbonds, all, all, 3.2, mode=2;')
${0}
'''
'Print the B-factors of a residue. ':
'prefix': 'printBs'
'body': '''
cmd.do('remove element h; iterate resi %{1:133}, print resi, name,b;')
${0}
'''
'Label the main chain atoms by resn,resi,atom name.':
'prefix': 'labelMainChain'
'body': '''
cmd.do('label name n+c+o+ca,"%s%s%s" % (resn,resi,name);')
${0}
'''
'Print B factors of part B of a residue.':
'prefix': 'printBspartB'
'body': '''
cmd.do('iterate resi %{1:38} and altloc %{2:B}, print resi, name, alt, b;')
${0}
'''
'Print B--factors for a residue with the B-factors rounded off to two decimal places.':
'prefix': 'printBs2digits'
'body': '''
cmd.do('iterate (resi %{1:133}), print(name + " %.2f" % b);')
${0}
'''
'Write the command reference to html file in the present working directory. ':
'prefix': 'writeCommandReference2HTML'
'body': '''
cmd.do('cmd.write_html_ref('pymol-command-ref.html');')
${0}
'''
'Average the B-factors by using a regular list as opposed to a stored list in PyMOL. Edit the selection as needed.':
'prefix': 'averageB'
'body': '''
cmd.do('"""Uses a regular list as opposed to PyMOL's stored list. Edit the selection as needed."""')
cmd.do('Bfactors = []; ')
cmd.do('iterate (resi ${1:133}), Bfactors.append(b);')
cmd.do('print("Sum = ", "%.2f" % (sum(Bfactors)));')
cmd.do('print("Number of atoms = ", len(Bfactors));')
cmd.do('print( 'Average B =' , "%.2f" % ( sum(Bfactors)/float(len(Bfactors))));')
${0}
'''
'AveBResiX, prints the resiude number and the average bfactor. ':
'prefix': 'aveB4resiX'
'body': '''
cmd.do('""""AveBResiX, prints the resiude number and the average bfactor. ')
cmd.do('Uses reduce and lambda, builtin Python functional porgramming functions. ')
cmd.do('Note that you need to convert the length of the list of Bfactors from an integer to a float before division into the sum. ')
cmd.do('"""')
cmd.do('Bfactors = [];')
cmd.do('iterate (resi ${1:133}), Bfactors.append(b);')
cmd.do('print( "Average B-factor of residue ", %{1:133} , " = ", "%.2f" %(reduce(lambda x, y: x + y, Bfactors) / float(len(Bfactors))) )')
${0}
'''
'Print name and b-factor for a residue.':
'prefix': 'printNameB4ResiX'
'body': '''
cmd.do('Bfac_dict = { 'Bfactors3' : [] };cmd.iterate("(resi 133)","Bfactors3.append((name, b))", space=Bfac_dict); for i,j in Bfac_dict['Bfactors3']: print("%s %.2f" % (i,j));')
${0}
'''
'Print resn, resi, atom name, and b-factor. ':
'prefix': 'printResiResnNameB4ResiX'
'body': '''
cmd.do('Bfac_dict = { 'Bfactors3' : [] };cmd.iterate("(resi 133)","Bfactors3.append((resn,resi,name, b))", space=Bfac_dict); for i,j,k,l in Bfac_dict['Bfactors3']: print("%s %s %s %.2f" % (i,j,k,l));')
${0}
'''
'Print name and b-factor for a residue or residue range (e.g. 81:120). The noH variant.':
'prefix': 'printResiResnNameB4ResiXNoH'
'body': '''
cmd.do('Bfac_dict = { 'Bfactors3' : [] };cmd.iterate("(resi 133 and not elem H)","Bfactors3.append((resn,resi,name, b))", space=Bfac_dict); for i,j,k,l in Bfac_dict['Bfactors3']: print("%s %s %s %.2f" % (i,j,k,l));')
${0}
'''
'Make the background of the internal gui transparent to expand viewport.':
'prefix': 'internalGUImode2 '
'body': '''
cmd.do('internal_gui_mode=2;')
${0}
'''
'Set the width of the internal gui.
':
'prefix': 'internalGUIwidth'
'body': '''
cmd.do('internal_gui_width=%{1:20};')
${0}
'''
'Print document string of a function.':
'prefix': 'printDoc'
'body': '''
cmd.do('print ${1:my_func}.__doc__;')
${0}
'''
'List all snips by tab trigger and description':
'prefix': 'lsSnips'
'body': '''
cmd.do('"""Tab trigger Description')
cmd.do('--------------------------- --------------------------------------------------------------------------------------------------------------------------------------------------------------------')
cmd.do('antialias Set antialias to get smooth edges')
cmd.do('ao Ambient occlussion.')
cmd.do('aveB4resiX AveBResiX, prints the resiude number and the average bfactor.')
cmd.do(' Uses reduce and lambda, builtin Python functional porgramming functions.')
cmd.do(' Note that you need to convert the length of the list of Bfactors from an integer to a float before division into the sum.')
cmd.do('averageB Uses a regular list as opposed to PyMOL's stored list. Edit the selection as needed.')
cmd.do('bs Ball and stick representation.')
cmd.do('bu Biological unit.')
cmd.do('carvedDensity Carved electron density.')
cmd.do('cblind Color blindness.')
cmd.do('centerpi Center pi.')
cmd.do('coordinate Coordinate covalent bonds to metals and H-bonds friom RNA.')
cmd.do('cribbon Color ribbon H red, strand yellow, loop green.')
cmd.do('cspheres Colored spheres.')
cmd.do('discreteCartoonColoring Turn on discrete colors between secondary structure elements.')
cmd.do('distance H-bond distances.')
cmd.do('doubleBond Valence bond.')
cmd.do('drawHbonds Draw H-bonds.')
cmd.do('duplicateObject Duplicate object.')
cmd.do('ellipcol Set ellipsoid color.')
cmd.do('extractPartObj Create a new object from part of an existing object.')
cmd.do('fasta Print Fasta from PDB file.')
cmd.do('fetch2FoFc Fetch 2FoFc map.')
cmd.do('fetchCIF Fetch cif file.')
cmd.do('fetchFoFc Fetch fofc map.')
cmd.do('fetchPath Set path for location to save fetched pdb files.')
cmd.do('filledRing Filled rings in nucleic acids.')
cmd.do('findHbonds Find hbonds around a residue.')
cmd.do('fog Blur the background atoms.')
cmd.do('getCoordinates Get coordinates.')
cmd.do('hbond Hbond setup.')
cmd.do('hbonddash H-bond dashes.')
cmd.do('hideSelection Trun off magenta squares on current selection.')
cmd.do('hidealtloc Hide alt loc.')
cmd.do('internalGUImode2 Makes the background of the internal gui transparent with the viewport extended into this region of the gui. This may be a useful mode for workshops.')
cmd.do('internalGUIwidth Set the width of the internal gui.')
cmd.do('labelCAs Label the CA atoms with the Ala333 style format')
cmd.do('labelMainChain Label the main chain atoms by resn,resi,atom name.')
cmd.do('labelResnResi Label CA atom with residue name and residue number.')
cmd.do('labelSS Label SS.')
cmd.do('labelWatersHOH Label waters HOH.')
cmd.do('labelWatersW Label waters W.')
cmd.do('loadPDBbs Load PDB ball-and-stick.')
cmd.do('loadPDBfile Load a pdb file in the current directory.')
cmd.do('loadPDBnb Load PDB nb spheres.')
cmd.do('lsSnips List all snips by tab trigger and description')
cmd.do('lspymolrc Print list of active pymolrc files.')
cmd.do('molscriptRibbon Molscript ribbons.')
cmd.do('ms Measure surface area.')
cmd.do('oneLetter One letter amino acid.')
cmd.do('pearl The pearl effect is made with two spheres with the outer sphere being transparent.')
cmd.do('printBs Print the B-factors of a residue.')
cmd.do('printBs2digits Print B-values for a residue with the B's rounded off to two decimal places.')
cmd.do('printBspartB Print B factors of part B of a rsidues.')
cmd.do('printDoc Print document string of a function.')
cmd.do('printNameB4ResiX Print name and b-factor for a rsidue. You can change this to a named selection or a residue range ( e.g., resi 133:155). Use the noH variant if H atoms are present.')
cmd.do('printResiResnNameB4ResiX Print resn, resi, atom name, and b-factor.')
cmd.do('printResiResnNameB4ResiXNoH Print name and b-factor for a rsidue. You can change this to a named selection or a residue range ( e.g., resi 133:155). The noH variant.')
cmd.do('pseudolabel Position label with pseudoatom.')
cmd.do('puttyCartoon Create a putty cartoon.')
cmd.do('ringMode Set the ring mode to a value between 0 and 6 in cartoons of nucleic acids.')
cmd.do('rmwater Remove waters from molecular object.')
cmd.do('rotate Rotate about axis.')
cmd.do('rv Return settings in rounded format.')
cmd.do('savePNG Save a png file of current scene to the current directory.')
cmd.do('saxsEnvelope Display SAXS envelope')
cmd.do('sc111 Display all symmetry mates in one unit cell. Asumes supercell.py (sse PyMOL Wiki) is in $HOME/Scripts/PyMOLscripts/.')
cmd.do('sc222 Run Tom Holder's supercell script to generate three cells in all directions.')
cmd.do('scaleRadiusColor Scale the radius and color of atoms as spheres by property in the B-value column.')
cmd.do('selectAllBut Select all nitrogen atom in a selelction except from lysine.')
cmd.do('selectAtomsAround Select atoms within a radius around a ligand.')
cmd.do('selectChain Select a chain.')
cmd.do('selectElement Select atoms by elemnt.')
cmd.do('selectHelices Select atoms by alpha helices.')
cmd.do('selectLoops Select atoms by beta loops.')
cmd.do('selectName Select atoms by name.')
cmd.do('selectResi Select residues by a range of numbers.')
cmd.do('selectResidues Select residues by name.')
cmd.do('selectResiduesAround Select residues within a radius around a ligand.')
cmd.do('selectStrands Select atoms by beta strands.')
cmd.do('setcolor Set color name to a RGB code.')
cmd.do('setpath Set additional path for PyMOL to search on startup')
cmd.do('sidehChainHelper In cartoons, hide the backbone atoms of selected residues when showing then as sticks.')
cmd.do('sigDigits Set number of decimals places to show in distance labels.')
cmd.do('sigang Set angle labels to display 2 decimals places')
cmd.do('sigdist set distance labels to display 2 decimals')
cmd.do('solventRadius Set radius of ball used to make solvent accessible surface.')
cmd.do('spng Save png flle with timestamp')
cmd.do('spse Save pse flle with timestamp')
cmd.do('stack Base-stacking figure.')
cmd.do('stereoDraw Stereo draw.')
cmd.do('stereoRay Stereo ray.')
cmd.do('threeMaps Three electron density.')
cmd.do('turnAboutAxis Turn about axis.')
cmd.do('undoSelection Undo a selection.')
cmd.do('volumeRamp Volume ramp.')
cmd.do('writeCommandReference2HTML Write the command reference to html file in the present working directory."""')
${0}
'''
'Asp70-His31 salt-bridge from T4 lysozyme. ':
'prefix': 'his31asp70'
'body': '''
cmd.do('fetch 1lw9, async=0; ')
cmd.do('zoom (resi 31 or resi 70); ')
cmd.do('preset.technical(selection='all'); ')
cmd.do('bg_color gray70; ')
cmd.do('clip slab, 7,(resi 31 or resi 70);')
cmd.do('rock;')
${0}
'''
'triple water pentagon.':
'prefix': 'waterTriple'
'body': '''
cmd.do('fetch 1lw9, async=0; ')
cmd.do('zoom resi 313; ')
cmd.do('preset.technical(selection='all', mode=1);')
${0}
'''
'Make selection of ligand atoms.':
'prefix': 'ligandSelect'
'body': '''
cmd.do('select substrates, organic;')
${0}
'''
'Print url of README.md file of the pymolsnips repository.':
'prefix': 'github'
'body': '''
cmd.do('https://github.com/MooersLab/pymolsnips/blob/master/README.md')
${0}
'''
'Set dihedral labels to display 2 decimals places to the right of the decimal point.':
'prefix': 'sigdihedral'
'body': '''
cmd.do('set label_dihedral_digits, ${1:2};')
${0}
'''
'Select state 1 from a model with multiple states.':
'prefix': 'stateOne'
'body': '''
cmd.do('cmd.create('newobject', 'oldobject', '1', '1');')
${0}
'''
'Display all symmetry mates in two unit cells along the c axis. Uses supercell.py in $HOME/Scripts/PyMOLscripts/.':
'prefix': 'sc112'
'body': '''
cmd.do('run $HOME/${1:Scripts/PyMOLscripts/supercell.py};')
cmd.do('supercell 1, 1, 1, , ${2:orange}, ${3:supercell1}, 1;')
${0}
'''
'Display all symmetry mates in three unit cels along c. Uses supercell.py in $HOME/Scripts/PyMOLscripts/.':
'prefix': 'sc113'
'body': '''
cmd.do('run $HOME/${1:Scripts/PyMOLscripts/supercell.py};')
cmd.do('supercell 1, 1, 1, , ${2:orange}, ${3:supercell1}, 1;')
${0}
'''
'Display all symmetry mates three three unit cells along a. Uses supercell.py in $HOME/Scripts/PyMOLscripts/.':
'prefix': 'sc311'
'body': '''
cmd.do('run $HOME/${1:Scripts/PyMOLscripts/supercell.py};')
cmd.do('supercell 1, 1, 1, , ${2:orange}, ${3:supercell1}, 1;')
${0}
'''
'Display all symmetry mates in three unit cells along b. Uses supercell.py in $HOME/Scripts/PyMOLscripts/.':
'prefix': 'sc131'
'body': '''
cmd.do('run $HOME/${1:Scripts/PyMOLscripts/supercell.py};')
cmd.do('supercell 1, 1, 1, , ${2:orange}, ${3:supercell1}, 1;')
${0}
'''
'Display all symmetry mates in two unit cell along a. Uses supercell.py in $HOME/Scripts/PyMOLscripts/.':
'prefix': 'sc211'
'body': '''
cmd.do('run $HOME/${1:Scripts/PyMOLscripts/supercell.py};')
cmd.do('supercell 1, 1, 1, , ${2:orange}, ${3:supercell1}, 1;')
${0}
'''
'Display all symmetry mates in two unit cells along the b axis. Uses supercell.py in $HOME/Scripts/PyMOLscripts/.':
'prefix': 'sc121'
'body': '''
cmd.do('run $HOME/Scripts/PyMOLscripts/supercell.py;')
cmd.do('supercell 1, 1, 1, , ${2:orange}, ${3:supercell1}, 1;')
${0}
'''
'Display all symmetry mates in a 1 x 2 x 2 array of unit cells. Uses supercell.py in $HOME/Scripts/PyMOLscripts/.':
'prefix': 'sc122'
'body': '''
cmd.do('run $HOME/Scripts/PyMOLscripts/supercell.py')
cmd.do('supercell 1, 1, 1, , ${2:orange}, ${3:supercell1}, 1;')
${0}
'''
'Display all symmetry mates in 2 x 2 x 1 array of unit cells. Uses supercell.py in $HOME/Scripts/PyMOLscripts/.':
'prefix': 'sc221'
'body': '''
cmd.do('run $HOME/Scripts/PyMOLscripts/supercell.py;')
cmd.do('supercell 1, 1, 1, , ${2:orange}, ${3:supercell1}, 1;')
${0}
'''
'Display all symmetry mates in a 2 x 1 x 2 arrays of unit cells. Uses supercell.py in $HOME/Scripts/PyMOLscripts/.':
'prefix': 'sc212'
'body': '''
cmd.do('run $HOME/Scripts/PyMOLscripts/supercell.py;')
cmd.do('supercell 1, 1, 1, , ${2:orange}, ${3:supercell1}, 1;')
${0}
'''
'Display all symmetry mates in 1 x 3 x 3 array of unit cell. Uses supercell.py in $HOME/Scripts/PyMOLscripts/.':
'prefix': 'sc133'
'body': '''
cmd.do('run $HOME/Scripts/PyMOLscripts/supercell.py;')
cmd.do('supercell 1, 1, 1, , ${2:orange}, ${3:supercell1}, 1;')
${0}
'''
'Display all symmetry mates in a 3 x 1 x 3 array of unit cells. Uses supercell.py in $HOME/Scripts/PyMOLscripts/.':
'prefix': 'sc313'
'body': '''
cmd.do('run $HOME/Scripts/PyMOLscripts/supercell.py;')
cmd.do('supercell 1, 1, 1, , ${2:orange}, ${3:supercell1}, 1;')
${0}
'''
'Display all symmetry mates in 3 x 3 x 1 array of unit cells. Uses supercell.py in $HOME/Scripts/PyMOLscripts/.':
'prefix': 'sc331'
'body': '''
cmd.do('run $HOME/Scripts/PyMOLscripts/supercell.py;')
cmd.do('supercell 1, 1, 1, , ${2:orange}, ${3:supercell1}, 1;')
${0}
'''
'Display all symmetry mates in a 2 x 3 x 3 array of unit cells. Uses supercell.py in $HOME/Scripts/PyMOLscripts/.':
'prefix': 'sc233'
'body': '''
cmd.do('run $HOME/Scripts/PyMOLscripts/supercell.py;')
cmd.do('supercell 1, 1, 1, , ${2:orange}, ${3:supercell1}, 1;')
${0}
'''
'Display all symmetry mates in a 3 x 2 x 3 array of unit cells. Uses supercell.py in $HOME/Scripts/PyMOLscripts/.':
'prefix': 'sc323'
'body': '''
cmd.do('run $HOME/Scripts/PyMOLscripts/supercell.py;')
cmd.do('supercell 1, 1, 1, , ${2:orange}, ${3:supercell1}, 1;')
${0}
'''
'Display all symmetry mates in 3 x 3 x 2 array of unit cells. Uses supercell.py in $HOME/Scripts/PyMOLscripts/.':
'prefix': 'sc332'
'body': '''
cmd.do('run $HOME/Scripts/PyMOLscripts/supercell.py;')
cmd.do('supercell 1, 1, 1, , ${2:orange}, ${3:supercell1}, 1;')
${0}
'''
'Display all symmetry mates in 3 x 3 x 3 array of unit cells. Uses supercell.py in $HOME/Scripts/PyMOLscripts/.':
'prefix': 'sc333'
'body': '''
cmd.do('run $HOME/Scripts/PyMOLscripts/supercell.py;')
cmd.do('supercell 1, 1, 1, , ${2:orange}, ${3:supercell1}, 1;')
${0}
'''
'Display all symmetry mates in four unit cells stacked long c-axis. Uses supercell.py in $HOME/Scripts/PyMOLscripts/.':
'prefix': 'sc114'
'body': '''
cmd.do('run $HOME/Scripts/PyMOLscripts/supercell.py;')
cmd.do('supercell 1, 1, 1, , ${2:orange}, ${3:supercell1}, 1;')
${0}
'''
'Display all symmetry mates in four unit cells stacked long b-axis. Uses supercell.py in $HOME/Scripts/PyMOLscripts/.':
'prefix': 'sc141'
'body': '''
cmd.do('run $HOME/Scripts/PyMOLscripts/supercell.py;')
cmd.do('supercell 1, 1, 1, , ${2:orange}, ${3:supercell1}, 1;')
${0}
'''
'Display all symmetry mates in four unit cells stacked long a-axis. Uses supercell.py in $HOME/Scripts/PyMOLscripts/.':
'prefix': 'sc411'
'body': '''
cmd.do('run $HOME/Scripts/PyMOLscripts/supercell.py;')
cmd.do('supercell 1, 1, 1, , ${2:orange}, ${3:supercell1}, 1;')
${0}
'''
'Save aln flle with timestamp':
'prefix': 'saln'
'body': '''
cmd.do('python;')
cmd.do('import datetime;')
cmd.do('from pymol import cmd;')
cmd.do('DT =datetime.datetime.now().strftime("yr%Ymo%mday%dhr%Hmin%M");')
cmd.do('s = str(DT);')
cmd.do('cmd.save(stemName+s+".aln");')
cmd.do('end python;')
${0}
'''
'Save electron density map flle with timestamp':
'prefix': 'sccp4'
'body': '''
cmd.do('python;')
cmd.do('import datetime;')
cmd.do('from pymol import cmd; ')
cmd.do('DT =datetime.datetime.now().strftime("yr%Ymo%mday%dhr%Hmin%M");')
cmd.do('s = str(DT); ')
cmd.do('cmd.save(stemName+s+".ccp4"); ')
cmd.do('end python;')
${0}
'''
'Save dae flle with timestamp':
'prefix': 'sdae'
'body': '''
cmd.do('python;')
cmd.do('import datetime;')
cmd.do('from pymol import cmd; ')
cmd.do('DT =datetime.datetime.now().strftime("yr%Ymo%mday%dhr%Hmin%M");')
cmd.do('s = str(DT); ')
cmd.do('cmd.save(stemName+s+".dae"); ')
cmd.do('end python;')
${0}
'''
'Carved isosurface representation of electron density. ':
'prefix': 'carvedIsosurface'
'body': '''
cmd.do('delete all;')
cmd.do('fetch ${1:4dgr}, async=0;')
cmd.do('fetch ${1:4dgr}, type=2fofc,async=0;')
cmd.do('select ${2:LongGlycan}, resi ${3:469:477};')
cmd.do('orient ${2:LongGlycan};')
cmd.do('remove not ${2:LongGlycan};')
cmd.do('remove name H*;')
cmd.do('isosurface 2fofcmap, ${1:4dgr}_2fofc, 1, ${2:LongGlycan}, carve = 1.8;')
cmd.do('color density, 2fofcmap; ')
cmd.do('show sticks;')
cmd.do('show spheres;')
cmd.do('set stick_radius, .07;')
cmd.do('set sphere_scale, .19;')
cmd.do('set sphere_scale, .13, elem H;')
cmd.do('set bg_rgb=[1, 1, 1];')
cmd.do('set stick_quality, 50;')
cmd.do('set sphere_quality, 4;')
cmd.do('color gray85, elem C;')
cmd.do('color red, elem O;')
cmd.do('color slate, elem N;')
cmd.do('color gray98, elem H;')
cmd.do('set stick_color, gray50;')
cmd.do('set ray_trace_mode, 1;')
cmd.do('set ray_texture, 2;')
cmd.do('set antialias, 3;')
cmd.do('set ambient, 0.5;')
cmd.do('set spec_count, 5;')
cmd.do('set shininess, 50;')
cmd.do('set specular, 1;')
cmd.do('set reflect, .1;')
cmd.do('set dash_gap, 0;')
cmd.do('set dash_color, black;')
cmd.do('set dash_gap, .15;')
cmd.do('set dash_length, .05;')
cmd.do('set dash_round_ends, 0;')
cmd.do('set dash_radius, .05;')
cmd.do('set_view (0.34,-0.72,0.61,0.8,0.56,0.22,-0.51,0.4,0.77,0.0,0.0,-81.31,44.64,-9.02,58.62,65.34,97.28,-20.0);')
cmd.do('preset.ball_and_stick("all",mode=1);')
cmd.do('draw;')
${0}
'''
'Fetch 2FoFc map as an isosurface.':
'prefix': 'fetch2FoFcIsosurface'
'body': '''
cmd.do('fetch ${1:3nd4}_2fofc, type=2fofc, async=0;')
cmd.do('isosurface 2fofcmap, ${1:3nd4}_2fofc, 1, ${2:LongGlycan}, carve = 1.8;')
${0}
'''
'Three electron density as isosurface. ':
'prefix': 'threeMapsIsosurface'
'body': '''
cmd.do('load ${1:4dgr}.pdb')
cmd.do('# Make sure to rename map file so that ')
cmd.do('# the root filename differs from pdb root filename')
cmd.do('load ${1:4dgr}_2fofc.ccp4, 2fofc;')
cmd.do('load ${1:4dgr}_fofc.ccp4, fofc;')
cmd.do('select ${2:glycan}, resid 200 or (resid 469:477);')
cmd.do('isosurface ${3:mesh1}, 2fofc, 1.0, ${2:glycan};')
cmd.do('color density, ${3:mesh1};')
cmd.do('isosurface ${4:mesh2}, fofc, 3.0, ${2:glycan};')
cmd.do('color green, ${4:mesh2};')
cmd.do('isosurface ${5:mesh3}, fofc, -3.0, ${2:glycan};')
cmd.do('color red, ${5:mesh3};')
${0}
'''
'Carved volume representation of electron density. ':
'prefix': 'carvedVolume'
'body': '''
cmd.do('delete all;')
cmd.do('fetch ${1:4dgr}, async=0;')
cmd.do('fetch ${1:4dgr}, type=2fofc,async=0;')
cmd.do('select ${2:LongGlycan}, resi ${3:469:477};')
cmd.do('orient ${2:LongGlycan};')
cmd.do('remove not ${2:LongGlycan};')
cmd.do('remove name H*;')
cmd.do('surface 2fofcmap, ${1:4dgr}_2fofc, 1, ${2:LongGlycan}, carve = 1.8;')
cmd.do('color density, 2fofcmap; ')
cmd.do('show sticks;')
cmd.do('show spheres;')
cmd.do('set stick_radius, .07;')
cmd.do('set sphere_scale, .19;')
cmd.do('set sphere_scale, .13, elem H;')
cmd.do('set bg_rgb=[1, 1, 1];')
cmd.do('set stick_quality, 50;')
cmd.do('set sphere_quality, 4;')
cmd.do('color gray85, elem C;')
cmd.do('color red, elem O;')
cmd.do('color slate, elem N;')
cmd.do('color gray98, elem H;')
cmd.do('set stick_color, gray50;')
cmd.do('set ray_trace_mode, 1;')
cmd.do('set ray_texture, 2;')
cmd.do('set antialias, 3;')
cmd.do('set ambient, 0.5;')
cmd.do('set spec_count, 5;')
cmd.do('set shininess, 50;')
cmd.do('set specular, 1;')
cmd.do('set reflect, .1;')
cmd.do('set dash_gap, 0;')
cmd.do('set dash_color, black;')
cmd.do('set dash_gap, .15;')
cmd.do('set dash_length, .05;')
cmd.do('set dash_round_ends, 0;')
cmd.do('set dash_radius, .05;')
cmd.do('set_view (0.34,-0.72,0.61,0.8,0.56,0.22,-0.51,0.4,0.77,0.0,0.0,-81.31,44.64,-9.02,58.62,65.34,97.28,-20.0);')
cmd.do('preset.ball_and_stick("all",mode=1);')
cmd.do('draw;')
${0}
'''
'Fetch 2FoFc map as a volume.':
'prefix': 'fetch2FoFcVolume'
'body': '''
cmd.do('fetch ${1:3nd4}, type=2fofc, async=0;')
cmd.do('volume 2fofcmap, ${1:3nd4}_2fofc, 1, ${2:LongGlycan}, carve = 1.8;')
${0}
'''
'Three electron density as volumes. ':
'prefix': 'threeMapsVolume'
'body': '''
cmd.do('load ${1:4dgr}.pdb')
cmd.do('# Make sure to rename map file so that ')
cmd.do('# the root filename differs from pdb root filename')
cmd.do('load ${1:4dgr}_2fofc.ccp4, 2fofc;')
cmd.do('load ${1:4dgr}_fofc.ccp4, fofc;')
cmd.do('select ${2:glycan}, resid 200 or (resid 469:477);')
cmd.do('volume ${3:mesh1}, 2fofc, 1.0, ${2:glycan};')
cmd.do('color density, ${3:mesh1};')
cmd.do('volume ${4:mesh2}, fofc, 3.0, ${2:glycan};')
cmd.do('color green, ${4:mesh2};')
cmd.do('volume ${5:mesh3}, fofc, -3.0, ${2:glycan};')
cmd.do('color red, ${5:mesh3};')
${0}
'''
'Return settings in rounded format while running PyMOL via the RCP server ipymol in a jupuyter notebook. This is a modified version of the roundview.py script.':
'prefix': 'rvi'
'body': '''
cmd.do('def rvj(StoredView=0, decimal_places=2, outname="roundedview.txt"):')
cmd.do(' """')
cmd.do(' rvj() is a modification of the the rv() function (aka the roundview.py) ')
cmd.do(' so that it can run in Jupyter notebooks with the ipymol.viewer. ')
cmd.do(' A set_view string is printed to the noteobook in a format that is ready ')
cmd.do(' for reuse. ')
cmd.do(' ')
cmd.do(' The ipymol module was developed by PI:NAME:<NAME>END_PI:')
cmd.do(' ')
cmd.do(' https://github.com/cxhernandez/ipymol')
cmd.do(' ')
cmd.do(' The pre-requisites for installing ipymol are as follows:')
cmd.do(' ')
cmd.do(' 1. Make a jupyter notebook kernel for Python interpreter inside of ')
cmd.do(' the Schrodinger PyMOL. See the PyMOL Snippets GitHub Page for ')
cmd.do(' a description of how to make one.')
cmd.do(' 2. Install the following build of ipymol at the PyMOL prompt.')
cmd.do(' You need to log into your GitHub account first.')
cmd.do(' ')
cmd.do(' pip install git+pip install git+https://github.com/cxhernandez/ipymol.git@2a30d6ec1588434e6f0f72a1d572444f89ff535b')
cmd.do(' ')
cmd.do(' 3. Make a bash alias to this PyMOL app file.')
cmd.do(' ')
cmd.do(' 4. Launch the jupyter notebook and select the pymol.python kernel.')
cmd.do(' ')
cmd.do(' 5. Open a terminal instance from the File pulldown in jupyter notebook.')
cmd.do(' ')
cmd.do(' 6. Enter `pymol -Rq` to launch an interactive instance of PyMOL.')
cmd.do(' ')
cmd.do(' 7. Enter the following code to load ipymol and conmect to PyMOL')
cmd.do(' ')
cmd.do(' from ipymol import viewer as ipv')
cmd.do(' ipv.start() # Start PyMOL RPC server')
cmd.do(' ')
cmd.do(' Now you can change the scene manually and send the display as static ')
cmd.do(' image to a cell in the jupyter notebook.')
cmd.do(' ')
cmd.do(' It is assumed that the viewer class of the ipymol moduel has been ')
cmd.do(' imported as ipv. ')
cmd.do(' ')
cmd.do(' I made the following modifications of roundview.py.')
cmd.do(' The cmd.get_view was replaced with ipv.get_view.')
cmd.do(' The cmd.extend was replaced with ipv.extend.')
cmd.do(' The myRoundedList was returned for further processing.')
cmd.do(' ')
cmd.do(' MIT License')
cmd.do(' ')
cmd.do(' Copyright:')
cmd.do(' PI:NAME:<NAME>END_PI and the OU Board of Regents')
cmd.do(' Uniersity of Oklahoma Health Sciences Center')
cmd.do(' Oklahoma City, OK 73104')
cmd.do(' ')
cmd.do(' 29 April 2020')
cmd.do(' ')
cmd.do(' """')
cmd.do(' ')
cmd.do(' ')
cmd.do(' StoredView = int(StoredView)')
cmd.do(' decimal_places = int(decimal_places)')
cmd.do(' ')
cmd.do(' #call the get_view function')
cmd.do(' ')
cmd.do(' m = ipv.get_view(StoredView)')
cmd.do(' ')
cmd.do(' ')
cmd.do(' #Make a list of the elements in the orientation matrix.')
cmd.do(' ')
cmd.do(' myList = [m[0], m[1], m[2], m[3], m[4], m[5], m[6],m[7], m[8], m[9],')
cmd.do(' m[10], m[11], m[12], m[13], m[14],m[15], m[16], m[17]]')
cmd.do(' ')
cmd.do(' #Round off the matrix elements to two decimal places (two fractional places)')
cmd.do(' #This rounding approach solved the problem of unwanted')
cmd.do(' #whitespaces when I tried to use a string format statement')
cmd.do(' ')
cmd.do(' myRoundedList = [round(elem, decimal_places) for elem in myList]')
cmd.do(' ')
cmd.do(' #x is the string template for the output. The whitespace is required')
cmd.do(' #between the "set_view" and "("')
cmd.do(' ')
cmd.do(' x = 'set_view ({0},{1},{2},{3},{4},{5},{6},{7},{8},{9},{10},{11},{12},{13},{14},{15},{16},{17});'')
cmd.do(' ')
cmd.do(' # Print to the command history window.')
cmd.do(' print(x.format(*myRoundedList))')
cmd.do(' ')
cmd.do(' #Write to a text file.')
cmd.do(' myFile = open("roundedview.txt", "a")')
cmd.do(' myFile.write(x.format(*myRoundedList) + "")')
cmd.do(' myFile.close()')
cmd.do(' return myRoundedList')
cmd.do('ipv.extend("rv", rv)')
${0}
'''
'Demo of the use of the RPC server with a drug compound via rdkit.':
'prefix': 'rdkrpcChem'
'body': '''
cmd.do('import os;')
cmd.do('import rdkit;')
cmd.do('from rdkit import Chem;')
cmd.do('from rdkit.Chem import AllChem;')
cmd.do('from rdkit.Chem import PyMol;')
cmd.do('')
cmd.do('s = PyMOL.MolViewer();')
cmd.do('mol = Chem.MolFromSmiles \')
cmd.do(' ('CCOCCn1c(C2CC[NH+](CCc3ccc(C(C)(C)C(=O)[O-])cc3)CC2)nc2ccccc21');')
cmd.do('mol = AllChem.AddHs(mol);')
cmd.do('AllChem.EmbedMolecule(mol);')
cmd.do('AllChem.MMFFOptimizeMolecule(mol);')
cmd.do('s.ShowMol(mol, name = 'bilastine', showOnly = False);')
cmd.do('s.Zoom('bilastine');')
cmd.do('s.SetDisplayStyle('bilastine', 'sticks');')
cmd.do('s.GetPNG(preDelay=5);')
${0}
'''
'A kernel.json file for runnig PyMOL python interpreter in the Jupyter notebook. ':
'prefix': 'kernel'
'body': '''
cmd.do('framerule=2pt,')
cmd.do('framesep=2mm,')
cmd.do('framesep=2mm,')
cmd.do('breaklines=True,')
cmd.do('baselinestretch=1.2')
cmd.do(']{bash}')
cmd.do('{')
cmd.do(' "argv": [')
cmd.do(' "/Applications/PyMOL.app/Contents/bin/python",')
cmd.do(' "-m",')
cmd.do(' "ipykernel_launcher",')
cmd.do(' "-f",')
cmd.do(' "{connection_file}"')
cmd.do(' ],')
cmd.do(' "display_name": "pymol.python",')
cmd.do(' "language": "python"')
cmd.do('}')
${0}
'''
'Demo of the use of the RPC server with a protein via rdkit.':
'prefix': 'rdkrpcProtein'
'body': '''
cmd.do('from rdkit.Chem import PyMol;')
cmd.do('')
cmd.do('Usage=""""Start pymol from command line with -R flag.')
cmd.do('Select the pymol.python kernel in Jupyter notebook. """;')
cmd.do('')
cmd.do('s = PyMol.MolViewer();')
cmd.do('du = s.server.do;')
cmd.do('du('rein; bg_color white; fetch 1lw9, type=pdb, async=0, show;nb_spheres; set_view (0.46,-0.28,-0.84,0.74,-0.41,0.54,-0.49,-0.87,0.02,0.0,0.0,\')
cmd.do(' -155.16,35.13,11.48,9.72,122.33,187.99,-20.0);');')
cmd.do('s.GetPNG(preDelay=3);')
cmd.do('du('png T4L600dpi.png, dpi=600');')
${0}
'''
'Code to start the RPC server with ipymol.':
'prefix': 'ipymolStart'
'body': '''
cmd.do('# Start pymol in terminal with pymol -R;')
cmd.do('# Select pymol.python as kernel in juptyer;')
cmd.do('from ipymol import viewer as ipv;')
cmd.do('ipv.start() # Start PyMOL RPC server;')
${0}
'''
'Demo of the use of the RPC server with a protein via ipymol.':
'prefix': 'ipymolProtein'
'body': '''
cmd.do('# Start pymol in terminal with pymol -R;')
cmd.do('# Select pymol.python as kernel in juptyer;')
cmd.do('from ipymol import viewer as ipv;')
cmd.do('ipv.start() # Start PyMOL RPC server;')
cmd.do('')
cmd.do('ipv.do('fetch 1lw9');')
cmd.do('ipv.do('rv');')
cmd.do('# The double parentheses are required when set_view is run this way.;')
cmd.do('ipv.set_view((-0.13,-0.4,-0.91,0.89,-0.45,0.07,-0.44,-0.8,0.41,0.0,0.0,-182.47,35.13,11.48,9.72,149.64,215.3,-20.0));')
cmd.do('ipv.do('AOD');')
cmd.do('ipv.png('testipymolT4L.png');')
${0}
'''
'Return settings in rounded format while running PyMOL via the RCP server rdkit in a jupyter notebook. This is a modified version of the roundview.py script.':
'prefix': 'rvr'
'body': '''
cmd.do('def rvr(StoredView=0, decimal_places=2, outname="roundedview.txt"):')
cmd.do(' """MIT License')
cmd.do(' Copyright:')
cmd.do(' PI:NAME:<NAME>END_PI and the OU Board of Regents')
cmd.do(' University of Oklahoma Health Sciences Center')
cmd.do(' Oklahoma City, OK 73104')
cmd.do(' 30 April 2020')
cmd.do(' ')
cmd.do(' First run the following:')
cmd.do(' ')
cmd.do(' from rdkit.Chem import PyMol')
cmd.do(' s = PyMol.MolViewer()')
cmd.do(' du = s.server.do')
cmd.do('')
cmd.do(' """')
cmd.do(' StoredView = int(StoredView) decimal_places = int(decimal_places)')
cmd.do(' #call the get_view function')
cmd.do(' m = s.get_view(StoredView)')
cmd.do(' #Make a list of the elements in the orientation matrix.')
cmd.do(' myList = [m[0], m[1], m[2], m[3], m[4], m[5], m[6],m[7], m[8], m[9], ')
cmd.do(' m[10], m[11], m[12], m[13], m[14],m[15], m[16], m[17]]')
cmd.do(' #Round off the matrix elements to two decimal places (two fractional places)')
cmd.do(' #This rounding approach solved the problem of unwanted')
cmd.do(' #whitespaces when I tried to use a string format statement')
cmd.do(' myRoundedList = [round(elem, decimal_places) for elem in myList]')
cmd.do(' #x is the string template for the output. The whitespace is required')
cmd.do(' #between the "set_view" and "("')
cmd.do(' x = 'set_view ({0},{1},{2},{3},{4},{5},{6},{7},{8},{9},{10},{11},{12},{13},{14},{15},{16},{17});'')
cmd.do(' # Print to the command history window.')
cmd.do(' print(x.format(*myRoundedList))')
cmd.do(' #Write to a text file.')
cmd.do(' myFile = open("roundedview.txt", "a") myFile.write(x.format(*myRoundedList) + "") myFile.close()')
cmd.do(' return myRoundedList')
cmd.do('du.extend("rvr", rvr)')
${0}
'''
'Return to the command history window the docstrings for all of the functions in the cmd module.':
'prefix': 'cmddocs'
'body': '''
cmd.do('[help(i) for i in dir(cmd)];')
${0}
'''
'Return to the command history window the docstrings for all of the functions in a module.':
'prefix': 'pymoldocs'
'body': '''
cmd.do('[help(i) for i in dir(pymol)];')
${0}
'''
'Print the number of residues in a protein.':
'prefix': 'numResiProtein'
'body': '''
cmd.do('sel = 'polymer.protein'; print(len(set([(i.chain, i.resi, i.resn) for i in cmd.get_model(sel).atom])));')
${0}
'''
'Print the number of residues in chain A of a protein.':
'prefix': 'numResiProteinChainA'
'body': '''
cmd.do('sel = 'chain A and polymer.protein'; print(len(set([(i.chain, i.resi, i.resn) for i in cmd.get_model(sel).atom])));')
${0}
'''
'Print the number of residues in a nulceic acid (all chains).':
'prefix': 'numResiNucleic'
'body': '''
cmd.do('sel = 'polymer.nucleic'; print(len(set([(i.resi, i.resn) for i in cmd.get_model(sel).atom])));')
${0}
'''
'Print the number of residues in a nulceic acid chain.':
'prefix': 'numResiNucleicChainA'
'body': '''
cmd.do('sel = 'chain A and polymer.nucleic'; print(len(set([(i.resi, i.resn) for i in cmd.get_model(sel).atom])));')
${0}
'''
'Create bonds between phosphorous and O3* atoms in a low resolution DNA structure that is 80 base pairs long.':
'prefix': 'brokenNucleicBackbone'
'body': '''
cmd.do('[cmd.bond(f"/5fur//E/{i}/O3'", f"/5fur//E/{i+1}/P") for i in range(${1:1}, ${2:80})]; ')
cmd.do('[cmd.bond(f"/5fur//F/{i}/O3'", f"/5fur//F/{i+1}/P") for i in range(${3:81}, ${3:160})];')
${0}
'''
'To change stick color and radius for the bond between atom 2 and 3, use the set_bond command.
':
'prefix': 'oneBondThicknessColor'
'body': '''
cmd.do('# To change stick color and radius for the bond between atom 2 and 3;')
cmd.do('set_bond stick_color, ${1:yellow}, index 2, index 3;')
cmd.do('set_bond stick_radius, ${2:0.2}, index 2, index 3;')
${0}
'''
'Connect the alpha carbons of residue 1 with 10, 6 with 16, 7 with 17 and 8 with 18. Note that this example requires the draw_links.py [http://pldserver1.biochem.queensu.ca/~rlc/work/pymol/draw_links.py] by PI:NAME:<NAME>END_PI.':
'prefix': 'drawLinks'
'body': '''
cmd.do('# Requires draw_links.py http://pldserver1.biochem.queensu.ca/~rlc/work/pymol/draw_links.py by PI:NAME:<NAME>END_PI')
cmd.do('# To connect the alpha carbons of residue 1 with 10, 6 with 16, 7 with 17 and 8 with 18.')
cmd.do('draw_links ${1:mol1} & chain ${2:A} & name ${3:CA} & resi ${4:1+6+7+8}, ${5:mol1} & chain ${6:A}& name ${7:CA} & resi ${8:10+16+17+18} ')
${0}
'''
'Print the path to the currently used PyMOL binary.':
'prefix': 'printPath'
'body': '''
cmd.do('# Print the path to the current used PyMOL binary.')
cmd.do('print pymol.__path__')
${0}
'''
'Turn on the ligand valence.':
'prefix': 'setLigandValenceOn'
'body': '''
cmd.do('#Set on the valence of the ligand only')
cmd.do('set valence, on, resn ${1:RZS}; set valence, off, not resn ${2:RZS}')
${0}
'''
'Return the docustring for the preset submodule. The command help preset fails to return anything. The command help(pymol.preset) has the same effect as help(preset).':
'prefix': 'presetDocs'
'body': '''
cmd.do('help(preset)')
${0}
'''
'Return the docustring for the help submodule. The command help help is more concise.':
'prefix': 'helpDocs'
'body': '''
cmd.do('help(help)')
${0}
'''
'The amber trajectories have to be loaded into the same object.':
'prefix': 'loadAmberTrajs'
'body': '''
cmd.do('load file.top, protein;')
cmd.do('load file.rst, protein')
${0}
'''
'Saves multiple objects into multiple files using an optional prefix name.':
'prefix': 'saveSep'
'body': '''
cmd.do('from pymol import cmd')
cmd.do('import glob')
cmd.do('import re')
cmd.do('')
cmd.do('def saveSep(prefix=''):')
cmd.do(' """')
cmd.do(' save_sep <prefix>')
cmd.do('')
cmd.do(' saves multiple objects into multiple files using an optional prefix name.')
cmd.do('')
cmd.do(' e.g. save_sep prefix')
cmd.do(' """')
cmd.do(' obj_list = cmd.get_names("all")')
cmd.do('')
cmd.do(' if obj_list:')
cmd.do(' for i in range(len(obj_list)):')
cmd.do(' obj_name = "%s%s.pdb" % (prefix, obj_list[i])')
cmd.do(' cmd.save(obj_name, obj_list[i])')
cmd.do(' print("Saving %s" % obj_name)')
cmd.do(' else:')
cmd.do(' print("No objects found")')
cmd.do(' ')
cmd.do('cmd.extend('saveSep',saveSep)')
${0}
'''
'OptiAlign.py by PI:NAME:<NAME>END_PI modified for aligning multiple RNA structures.':
'prefix': 'optAlignRNA'
'body': '''
cmd.do('#!python')
cmd.do(' ')
cmd.do('##############################################################################')
cmd.do('#')
cmd.do('# @SUMMARY: -- QKabsch.py. A python implementation of the optimal superposition')
cmd.do('# of two sets of vectors as proposed by Kabsch 1976 & 1978.')
cmd.do('#')
cmd.do('# @AUTHOR: PI:NAME:<NAME>END_PI')
cmd.do('# @COPYRIGHT: PI:NAME:<NAME>END_PI (C), 2005-2007')
cmd.do('# @LICENSE: Released under GPL:')
cmd.do('# This program is free software; you can redistribute it and/or modify')
cmd.do('# it under the terms of the GNU General Public License as published by')
cmd.do('# the Free Software Foundation; either version 2 of the License, or')
cmd.do('# (at your option) any later version.')
cmd.do('# This program is distributed in the hope that it will be useful, but WITHOUT')
cmd.do('# ANY WARRANTY; without even the implied warranty of MERCHANTABILITY or FITNESS')
cmd.do('# FOR A PARTICULAR PURPOSE. See the GNU General Public License for more details.')
cmd.do('#')
cmd.do('# You should have received a copy of the GNU General Public License along with')
cmd.do('# this program; if not, write to the Free Software Foundation, Inc., 51 Franklin')
cmd.do('# Street, Fifth Floor, Boston, MA 02110-1301, USA ')
cmd.do('#')
cmd.do('# DATE : 2007-01-01')
cmd.do('# REV : 2')
cmd.do('# REQUIREMENTS: numpy')
cmd.do('#')
cmd.do('#')
cmd.do('# Modified optAlign.py to use C1' carbon atoms of RNA for alignment.')
cmd.do('# Jan. 29, 2020 ')
cmd.do('# PI:NAME:<NAME>END_PI, PhD')
cmd.do('# Univ. of Oklahoma Health Sciences Center')
cmd.do('#')
cmd.do('#############################################################################')
cmd.do('from array import *')
cmd.do(' ')
cmd.do('# system stuff')
cmd.do('import os')
cmd.do('import copy')
cmd.do(' ')
cmd.do('# pretty printing')
cmd.do('import pprint')
cmd.do(' ')
cmd.do('# for importing as a plugin into PyMol')
cmd.do('from pymol import cmd')
cmd.do('from pymol import stored')
cmd.do('from pymol import selector')
cmd.do(' ')
cmd.do('# using numpy for linear algebra')
cmd.do('import numpy')
cmd.do(' ')
cmd.do('def optAlignRNA( sel1, sel2 ):')
cmd.do(' """')
cmd.do(' optAlignRNA performs the Kabsch alignment algorithm upon the C1' carbons of two selections.')
cmd.do(' Example: optAlignRNA 1JU7 and i. 1-16 and n. C1', 1CLL and i. 4-146 and n. C1'')
cmd.do(' ')
cmd.do(' Two RMSDs are returned. One comes from the Kabsch algorithm and the other from')
cmd.do(' PyMOL based upon your selections.')
cmd.do(' ')
cmd.do(' This function can be run in a for loop to fit multiple structures with a common prefix name:')
cmd.do(' ')
cmd.do(' for x in cmd.get_names(): optAlignRNA(x, "1JU7_0001")')
cmd.do(' ')
cmd.do(' or get the rmsds for all combinations, do the following:')
cmd.do(' ')
cmd.do(' [[optAlignRNA(x, y) for x in cmd.get_names()] for y in cmd.get_names()]')
cmd.do('')
cmd.do(' """')
cmd.do(' cmd.reset()')
cmd.do(' ')
cmd.do(' # make the lists for holding coordinates')
cmd.do(' # partial lists')
cmd.do(' stored.sel1 = []')
cmd.do(' stored.sel2 = []')
cmd.do(' # full lists')
cmd.do(' stored.mol1 = []')
cmd.do(' stored.mol2 = []')
cmd.do(' ')
cmd.do(' # -- CUT HERE')
cmd.do(' sel1 += " and N. C1'"')
cmd.do(' sel2 += " and N. C1'"')
cmd.do(' # -- CUT HERE')
cmd.do(' ')
cmd.do(' # Get the selected coordinates. We')
cmd.do(' # align these coords.')
cmd.do(' cmd.iterate_state(1, selector.process(sel1), "stored.sel1.append([x,y,z])")')
cmd.do(' cmd.iterate_state(1, selector.process(sel2), "stored.sel2.append([x,y,z])")')
cmd.do(' ')
cmd.do(' # get molecule name')
cmd.do(' mol1 = cmd.identify(sel1,1)[0][0]')
cmd.do(' mol2 = cmd.identify(sel2,1)[0][0]')
cmd.do(' ')
cmd.do(' # Get all molecule coords. We do this because')
cmd.do(' # we have to rotate the whole molcule, not just')
cmd.do(' # the aligned selection')
cmd.do(' cmd.iterate_state(1, mol1, "stored.mol1.append([x,y,z])")')
cmd.do(' cmd.iterate_state(1, mol2, "stored.mol2.append([x,y,z])")')
cmd.do(' ')
cmd.do(' # check for consistency')
cmd.do(' assert len(stored.sel1) == len(stored.sel2)')
cmd.do(' L = len(stored.sel1)')
cmd.do(' assert L > 0')
cmd.do(' ')
cmd.do(' # must alway center the two proteins to avoid')
cmd.do(' # affine transformations. Center the two proteins')
cmd.do(' # to their selections.')
cmd.do(' COM1 = numpy.sum(stored.sel1,axis=0) / float(L)')
cmd.do(' COM2 = numpy.sum(stored.sel2,axis=0) / float(L)')
cmd.do(' stored.sel1 -= COM1')
cmd.do(' stored.sel2 -= COM2')
cmd.do(' ')
cmd.do(' # Initial residual, see Kabsch.')
cmd.do(' E0 = numpy.sum( numpy.sum(stored.sel1 * stored.sel1,axis=0),axis=0) + numpy.sum( numpy.sum(stored.sel2 * stored.sel2,axis=0),axis=0)')
cmd.do(' ')
cmd.do(' #')
cmd.do(' # This beautiful step provides the answer. V and Wt are the orthonormal')
cmd.do(' # bases that when multiplied by each other give us the rotation matrix, U.')
cmd.do(' # S, (Sigma, from SVD) provides us with the error! Isn't SVD great!')
cmd.do(' V, S, Wt = numpy.linalg.svd( numpy.dot( numpy.transpose(stored.sel2), stored.sel1))')
cmd.do(' ')
cmd.do(' # we already have our solution, in the results from SVD.')
cmd.do(' # we just need to check for reflections and then produce')
cmd.do(' # the rotation. V and Wt are orthonormal, so their det's')
cmd.do(' # are +/-1.')
cmd.do(' reflect = float(str(float(numpy.linalg.det(V) * numpy.linalg.det(Wt))))')
cmd.do(' ')
cmd.do(' if reflect == -1.0:')
cmd.do(' S[-1] = -S[-1]')
cmd.do(' V[:,-1] = -V[:,-1]')
cmd.do(' ')
cmd.do(' RMSD = E0 - (2.0 * sum(S))')
cmd.do(' RMSD = numpy.sqrt(abs(RMSD / L))')
cmd.do(' ')
cmd.do(' #U is simply V*Wt')
cmd.do(' U = numpy.dot(V, Wt)')
cmd.do(' ')
cmd.do(' # rotate and translate the molecule')
cmd.do(' stored.sel2 = numpy.dot((stored.mol2 - COM2), U)')
cmd.do(' stored.sel2 = stored.sel2.tolist()')
cmd.do(' # center the molecule')
cmd.do(' stored.sel1 = stored.mol1 - COM1')
cmd.do(' stored.sel1 = stored.sel1.tolist()')
cmd.do(' ')
cmd.do(' # let PyMol know about the changes to the coordinates')
cmd.do(' cmd.alter_state(1,mol1,"(x,y,z)=stored.sel1.pop(0)")')
cmd.do(' cmd.alter_state(1,mol2,"(x,y,z)=stored.sel2.pop(0)")')
cmd.do(' ')
cmd.do(' #print("Moved: %s Reference: %s RMSD = %f" % mol1, mol2, RMSD)')
cmd.do(' print("% s, % s,% 5.3f" % (mol1, mol2, RMSD))')
cmd.do(' ')
cmd.do(' # make the alignment OBVIOUS')
cmd.do(' cmd.hide('everything')')
cmd.do(' cmd.show('ribbon', sel1 + ' or ' + sel2)')
cmd.do(' cmd.color('gray70', mol1 )')
cmd.do(' cmd.color('magenta', mol2 )')
cmd.do(' cmd.color('red', 'visible')')
cmd.do(' cmd.show('ribbon', 'not visible')')
cmd.do(' cmd.center('visible')')
cmd.do(' cmd.orient()')
cmd.do(' cmd.zoom('visible')')
cmd.do(' ')
cmd.do('cmd.extend("optAlignRNA", optAlignRNA)')
${0}
'''
'Load into PyMOL multiple files with a common file stem. The is a script by PI:NAME:<NAME>END_PI that updated for Python3.':
'prefix': 'loadManyFiles'
'body': '''
cmd.do('# Copyright (c) 2004 PI:NAME:<NAME>END_PI')
cmd.do('#')
cmd.do('# Modified for use with Python3.')
cmd.do('# Jan. 29, 2020 ')
cmd.do('# PI:NAME:<NAME>END_PI, PhD')
cmd.do('# Univ. of Oklahoma Health Sciences Center')
cmd.do('#')
cmd.do('#')
cmd.do('from pymol import cmd')
cmd.do('import glob')
cmd.do('')
cmd.do('def loadFiles(files):')
cmd.do(' """')
cmd.do(' load_files <files>')
cmd.do('')
cmd.do(' loads multiple files (using filename globbing)')
cmd.do(' into a multiple objects named as the files are (e.g. collection of')
cmd.do(' downloaded PDB files).')
cmd.do('')
cmd.do(' e.g. load_files prot_*.pdb')
cmd.do(' """')
cmd.do(' file_list = glob.glob(files)')
cmd.do(' if file_list:')
cmd.do(' file_list.sort()')
cmd.do(' for i in file_list:')
cmd.do(' #obj_name = i.replace('.pdb','')')
cmd.do(' #cmd.load(file_list[i],obj_name)')
cmd.do(' cmd.load(i)')
cmd.do(' else:')
cmd.do(' print("No files found for pattern %s" % files)')
cmd.do('')
cmd.do('cmd.extend('loadFiles',loadFiles)')
${0}
'''
'These are the instructions for loading and aligning multiple files.':
'prefix': 'loadAndAlignManyFiles'
'body': '''
cmd.do('To load a bunch of related files from inside PyMOL all at once:')
cmd.do('')
cmd.do('run loadFiles.py')
cmd.do('loadFiles refine_*.pdb')
cmd.do('')
cmd.do('')
cmd.do('To align all of the loaded RNA structures in all possible combinations by their C1' carbon atoms:')
cmd.do('')
cmd.do('run optAlignRNA.py')
cmd.do('[[optAlignRNA(x, y) for x in cmd.get_names()] for y in cmd.get_names()]')
cmd.do('')
cmd.do('(Yes, that construct is a list comprehension inside a list comprehension!)')
cmd.do('')
cmd.do('To save a multiple models in a file to separate pdb files,')
cmd.do('')
cmd.do('run saveSep.py')
cmd.do('saveSep ')
cmd.do('or ')
cmd.do('saveSep prefix')
${0}
'''
'This is a two-fold nested list comprehension for any all parwise operation on the currently loaded objects. Replace optAlginRNA with any other function that operations on a pair of structrures.':
'prefix': 'allPairs'
'body': '''
cmd.do('[[${1:optAlignRNA}(x, y) for x in cmd.get_names()] for y in cmd.get_names()]')
${0}
'''
'Combining DSSR block representation with regular PyMOL cartoons after loading the dssr_block.py script by PI:NAME:<NAME>END_PI.':
'prefix': 'dssrBlock'
'body': '''
cmd.do('fetch 1ehz, async=0;')
cmd.do('as cartoon;')
cmd.do('set cartoon_ladder_radius, 0.1;')
cmd.do('set cartoon_ladder_color, gray;')
cmd.do('set cartoon_nucleic_acid_mode, 1;')
cmd.do('dssr_block')
${0}
'''
'DSSR block representation with fused blocks after loading the dssr_block.py script by PI:NAME:<NAME>END_PI. The x3dna-dssr executable needs to be in the PATH.':
'prefix': 'dssrBlock'
'body': '''
cmd.do('fetch 1ehz, async=0;')
cmd.do('dssr_block block_file=wc')
${0}
'''
'DSSR block representation for a multi-state example after loading the dssr_block.py script by PI:NAME:<NAME>END_PI. The x3dna-dssr executable needs to be in the PATH.':
'prefix': 'dssrBlock'
'body': '''
cmd.do('fetch 2n2d, async=0;')
cmd.do('dssr_block 2n2d, 0;')
cmd.do('set all_states;')
${0}
'''
'DSSR block representation with custom coloring after loading the dssr_block.py script by PI:NAME:<NAME>END_PI. The x3dna-dssr executable needs to be in the PATH.':
'prefix': 'dssrBlock'
'body': '''
cmd.do('fetch 1msy, async=0;')
cmd.do('dssr_block block_color=N red | minor 0.9 | major yellow;')
${0}
'''
'Settings for nucliec acid cartoon.':
'prefix': 'nucleicAcidCartoon'
'body': '''
cmd.do('set cartoon_ladder_color, ${1:density};')
cmd.do('set cartoon_ladder_radius, ${2:0.2};')
cmd.do('set cartoon_nucleic_acid_color, ${3:red};')
cmd.do('set cartoon_ring_mode, ${4:2};')
${0}
'''
'Coloring two strand differently of a double helix makes it easier to for the viewer to distinguish the two strands. The set command as the syntax of setting_name [, setting_value [, selection [,state ]]] . In this case, the selection has to be global, object, object-state, or per-atom settings. It cannot be a named selection. This is a weak spot in PyMOL. Coloring two strand differently of a double helix makes it easier to for the viewer to distinguish the two strands. Many double-stranded helices have one strand in the asymmetric unit. The second strand is in the biological unit. The coordinates for the second strand are in the pdb1 file type at the PDB. The second strand is in the second state, which is equivalent to the second model in the pdb file. The strands are labeled chain A and B (via the cartoon_nucliec_acid_color setting). The bases are colored differently too (via the cartoon_ladder_color setting).
':
'prefix': 'nucleicAcidCartoon2Strands'
'body': '''
cmd.do('# There is not support for applying different settings to different selections.')
cmd.do('# Instead, this can be done for different objects.')
cmd.do('# Coloring two strand differently of a double helix makes it easier to for the viewer to distinguish the two strands.')
cmd.do('# The set command as the syntax of setting_name [, setting_value [, selection [,state ]]]')
cmd.do('# In this case, the selection has to be global, object, object-state, or per-atom settings.')
cmd.do('# It cannot be a named selection.')
cmd.do('# Coloring two strand differently of a double helix makes it easier to for the viewer to distinguish the two strands.')
cmd.do('# Many double-stranded helices have one strand in the asymmetric unit.')
cmd.do('# The second strand is in the biological unit.;')
cmd.do('# The coordinates for the second strand are in the pdb1 file type at the PDB.;')
cmd.do('# The second strand is in the second state, which is equivalent to the second model in the pdb file.;')
cmd.do('# The strands are labeled chain A and B (via the cartoon_nucliec_acid_color setting).;')
cmd.do('# The bases are colored differently too (via the cartoon_ladder_color setting).;')
cmd.do('fetch ${1:3nd3}, ${2:3nd3}, type=${3:pdb1};')
cmd.do('set all_states, on;')
cmd.do('create chA, ${2:3nd3}, 1, 1;')
cmd.do('create chB, ${2:3nd3}, 2, 1;')
cmd.do('# colors only the backbone;')
cmd.do('set cartoon_nucleic_acid_color, ${4:magenta}, chA;')
cmd.do('set cartoon_nucleic_acid_color, ${5:orange}, chB;')
cmd.do('# color the bases;')
cmd.do('set cartoon_ladder_color, ${6:density}, chA;')
cmd.do('set cartoon_ladder_color, ${7:yellow}, chB;')
${0}
'''
'This code colors by the nucleotides by base seqence. It can be applied to any nucleic acid. It could make a good shortcut.':
'prefix': 'nucleicAcidColorbySequence'
'body': '''
cmd.do('select rna_A, resn A;')
cmd.do('select rna_C, resn C;')
cmd.do('select rna_G, resn G;')
cmd.do('select rna_U, resn U;')
cmd.do('select dna_T, resn T;')
cmd.do('color ${1:yellow}, rna_A;')
cmd.do('color ${2:red}, rna_C; ')
cmd.do('color ${3:gray40}, rna_G;')
cmd.do('color ${4:palecyan}, rna_U;')
cmd.do('color ${5:brown}, dna_T;')
${0}
'''
'This code colors by the nucleotides by base seqence. It can be applied to any nucleic acid. It is dervied from the CR shortcut. The backcone is shown as a flatten ribbon.':
'prefix': 'nucleicAcidFlatRibbonColorbySequence'
'body': '''
cmd.do('bg_color white;')
cmd.do('set cartoon_oval_length, ${1:1.85};')
cmd.do('set cartoon_oval_width, ${2:0.5};')
cmd.do('cartoon oval;')
cmd.do('set cartoon_ring_mode, ${3:3};')
cmd.do('# set the color of the backbone oval;')
cmd.do('set cartoon_nucleic_acid_color, ${4:blue};')
cmd.do('select rna_A, resn A;')
cmd.do('select rna_C, resn C;')
cmd.do('select rna_G, resn G;')
cmd.do('select rna_U, resn U;')
cmd.do('select dna_T, resn T;')
cmd.do('color ${5:yellow}, rna_A;')
cmd.do('color ${6:red}, rna_C; ')
cmd.do('color ${7:gray40}, rna_G;')
cmd.do('color ${8:palecyan}, rna_U;')
cmd.do('color ${9:brown}, dna_T;')
cmd.do('as cartoon;')
${0}
'''
'The code provides a cartoon of the loaded nucleic acid that has the ladder rungs replaced by filled rings that are colored by atom type. The code can be applied to any nucleic acid. It is derived from the FR shortuct.':
'prefix': 'nucleicAcidCartoonFilledRings'
'body': '''
cmd.do('bg_color white;')
cmd.do('show sticks;')
cmd.do('set cartoon_ring_mode, 3;')
cmd.do('set cartoon_ring_finder, 1;')
cmd.do('set cartoon_ladder_mode, 1;')
cmd.do('set cartoon_nucleic_acid_mode, 4;')
cmd.do('set cartoon_ring_transparency, 0.5;')
cmd.do('as cartoon;')
${0}
'''
'This code make as standard base stacking diagram with ball and stick representation. ':
'prefix': 'basePairStacking'
'body': '''
cmd.do('delete all;')
cmd.do('fetch 4PCO, type=pdb, async=0;')
cmd.do('select G2G3, ( ((resi 2 or resi 3) and chain A) or ((resi 8 or resi 9) and chain B));')
cmd.do('remove not G2G3;')
cmd.do('bg_color white;')
cmd.do('show sticks;')
cmd.do('set stick_radius=0.14;')
cmd.do('set stick_ball, on; ')
cmd.do('set stick_ball_ratio,1.9;')
cmd.do('set_view (-0.75,0.09,0.66,-0.2,0.92,-0.35,-0.64,-0.39,-0.67,-0.0,-0.0,-43.7,7.24,9.55,11.78,29.46,57.91,-20.0);')
cmd.do('remove name H*;')
cmd.do('select carbon1, element C and (resi 3 or resi 8) ')
cmd.do('# select lower base pair;')
cmd.do('select carbon2, element C and (resi 2 or resi 9) ')
cmd.do('#select upper base pair;')
cmd.do('color gray70, carbon1;')
cmd.do('color gray10, carbon2;')
cmd.do('show sticks;')
cmd.do('space cmyk;')
cmd.do('distance hbond1, /4PCO//B/U`9/N3,/4PCO//A/G`2/O6;')
cmd.do('distance hbond2, /4PCO//B/U`9/O2,/4PCO//A/G`2/N1;')
cmd.do('distance hbond3, /4PCO//A/U`3/N3,/4PCO//B/G`8/O6;')
cmd.do('distance hbond4, /4PCO//A/U`3/O2,/4PCO//B/G`8/N1;')
cmd.do('color black, hbond1;')
cmd.do('color black, hbond2;')
cmd.do('color gray70, hbond3;')
cmd.do('color gray70, hbond4;')
cmd.do('show nb_spheres;')
cmd.do('set nb_spheres_size, 0.35;')
cmd.do('hide labels;')
cmd.do('ray 1600,1000;')
cmd.do('png 4PCO.png;')
${0}
'''
'This code colors by the nucleotides by base seqence. The backcone is shown as a flatten ribbon with rolled edges that give the dumbell effect. The code can be applied to any nucleic acid. The code is dervied from the CR and DU shortcuts. ':
'prefix': 'nucleicAcidDumbellCartoonColorbySequence'
'body': '''
cmd.do('bg_color white;')
cmd.do('set cartoon_oval_length, ${1:1.85}')
cmd.do('set cartoon_oval_width, ${2:0.5}')
cmd.do('cartoon oval;')
cmd.do('cartoon dumbbell;')
cmd.do('set cartoon_dumbbell_width, 0.2;')
cmd.do('set cartoon_dumbbell_radius, 0.4;')
cmd.do('set cartoon_ring_mode, ${3:3};')
cmd.do('# set the color of the backbone oval')
cmd.do('set cartoon_nucleic_acid_color, ${4:blue};')
cmd.do('select rna_A, resn A;')
cmd.do('select rna_C, resn C;')
cmd.do('select rna_G, resn G;')
cmd.do('select rna_U, resn U;')
cmd.do('select dna_T, resn T;')
cmd.do('color ${5:yellow}, rna_A;')
cmd.do('color ${6:red}, rna_C; ')
cmd.do('color ${7:gray40}, rna_G;')
cmd.do('color ${8:palecyan}, rna_U;')
cmd.do('color ${9:brown}, dna_T;')
cmd.do('as cartoon;')
${0}
'''
'Set keyboard shortcut by mapping F1 to stereo.':
'prefix': 'stereokb'
'body': '''
cmd.do('cmd.set_key('F1',lambda:cmd.stereo({'on':0,'off':1}[cmd.get('stereo')]));')
${0}
'''
'Print to the screen the settings and their current parameter values.':
'prefix': 'listSettings2'
'body': '''
cmd.do('list = setting.get_name_list();[print("%s => %s" % (name, setting.get_setting_text(name))) for name in list];')
${0}
'''
'Print to the screen the settings and their current parameter values. This is the more compact version.':
'prefix': 'listSettings'
'body': '''
cmd.do('[print("%s => %s" % (name, setting.get_setting_text(name))) for name in setting.get_name_list()];')
${0}
'''
'Print to the screen as labels that 21 font ids in their corresponding fonts in a grid. Each label is an object and appears in the internal gui. You can turn on and off the display of specific fonts.':
'prefix': 'displayFonts'
'body': '''
cmd.do('python;')
cmd.do('from pymol import cmd;')
cmd.do('for i in range(1,21):')
cmd.do(' name = 'label%d' % i;')
cmd.do(' cmd.pseudoatom(name, label='label font id %d' % i, pos=(0,0,0));')
cmd.do(' cmd.set('label_font_id', i, name);')
cmd.do('cmd.set('label_size', 50);')
cmd.do('cmd.set('grid_mode');')
cmd.do('python end;')
${0}
'''
'Print to disk a list of H-bond pairs and this H-bond length.':
'prefix': 'listHBonds'
'body': '''
cmd.do('Finish latter. See file listHBonds.py.;')
${0}
'''
'Create a list of objects in the internal gui and print this list to the screen.':
'prefix': 'listObjects'
'body': '''
cmd.do('objList = cmd.get_names("objects");print(objList);')
${0}
'''
'Print a list of protein--ligand distances. Code by PI:NAME:<NAME>END_PI. Updated for Python3.':
'prefix': 'listLigandProteinDistances'
'body': '''
cmd.do('from pymol import cmd')
cmd.do('"""')
cmd.do('Find all distances betwen all ligand atoms and all protein atoms. ')
cmd.do('')
cmd.do('Adapted and updated from script by PI:NAME:<NAME>END_PI posted here')
cmd.do('https://sourceforge.net/p/pymol/mailman/message/10097804/')
cmd.do('')
cmd.do('There are probably better solutions like finding just the ')
cmd.do('distances to proein atoms within a certain distance from ')
cmd.do('the ligand.')
cmd.do('')
cmd.do('Due to the nested for loops, this script is takes several second')
cmd.do('to run on a medium-sized human protein. This script is a ')
cmd.do('good candidate for vectorization. ')
cmd.do('')
cmd.do('It is also a good candiate for becoming a function and a shortcut. ')
cmd.do('')
cmd.do('"""')
cmd.do('')
cmd.do('# customize these lines to your protein.')
cmd.do('cmd.fetch("6NEC")')
cmd.do('cmd.select("prot","not resn XIN and not resn HOH and not chain C")')
cmd.do('cmd.select("lig", "resn XIN and not chain C")')
cmd.do('')
cmd.do('dist_list = {}')
cmd.do('pro_atoms = cmd.get_model("prot")')
cmd.do('lig_atoms = cmd.get_model("lig")')
cmd.do('')
cmd.do('for l_at in lig_atoms.atom:')
cmd.do(' for p_at in pro_atoms.atom:')
cmd.do(' dist_list[str(l_at.resn) +')
cmd.do(' ":" +')
cmd.do(' str(l_at.resi) +')
cmd.do(' " " +')
cmd.do(' l_at.name +')
cmd.do(' " ---- " + ')
cmd.do(' str(p_at.resn) +')
cmd.do(' ":" +')
cmd.do(' str(p_at.resi) +')
cmd.do(' " " +')
cmd.do(' p_at.name] = cmd.dist("foo", ')
cmd.do(' "index " +')
cmd.do(' str(l_at.index),"index " + str(p_at.index))')
cmd.do(' cmd.delete("foo")')
cmd.do('print("List of all pairwise ligand--protein atom-atom distances:")')
cmd.do('# [print("Distance of " + d + " is " + str(dist_list[d])) for d in dist_list.keys()]')
cmd.do('')
cmd.do('# More compact print statement. Need an f-string format statement.')
cmd.do('[print( d + " " + str(dist_list[d])) for d in dist_list.keys()]')
${0}
'''
'This code shows that cartoon backbone tube as 65% transparent. It hides the rungs of the cartoon. It shows all of the non-H atoms are sticks. The motivation is to have the cartoon highlight the backbone without dominanting the scene.':
'prefix': 'nucleicAcidBackboneTubesSticks'
'body': '''
cmd.do('set bg_rgb, white;')
cmd.do('hide everything, all;')
cmd.do('show cartoon, ${1:3nd3};')
cmd.do('set cartoon_sampling,1;')
cmd.do('set cartoon_tube_radius, 0.5;')
cmd.do('set cartoon_ladder_mode, 0;')
cmd.do('set cartoon_transparency, ${2:0.65};')
cmd.do('set stick_radius ${3:0.12};')
cmd.do('show sticks;')
cmd.do('hide sticks, element H;')
${0}
'''
'The code expands the asymmetric unit. It like the generate symmetry mates command but it provides more control over the prefix name of the symmetry mates and the addition of unique segment identifiers for each symmetry mate. The usage: symexp prefix, object, (selection), cutoff, segidFlag. The cutoff is in Angstroms. The segidFlag set to 1 will add unique segids. For related functions, see SC***.':
'prefix': 'symexp'
'body': '''
cmd.do('symexp ${1:symm}, ${2:3fa0}, (${2:3fa0}), ${3:20},${4:1};')
${0}
'''
'Adds the function draw_axis(). Could be useful for the adding a symmery axis, a ncs axis, or scale bar to a scene.':
'prefix': 'addAxis'
'body': '''
cmd.do('from pymol.cgo import * # get constants')
cmd.do('from pymol import cmd')
cmd.do('')
cmd.do('import math')
cmd.do('')
cmd.do('class Counter:')
cmd.do(' """')
cmd.do(' draw_line')
cmd.do(' source https://www.pymolwiki.org/index.php/Symmetry_Axis')
cmd.do(' ')
cmd.do(' Pymol script copyright PI:NAME:<NAME>END_PI and PI:NAME:<NAME>END_PI 2007')
cmd.do(' ')
cmd.do(' Under GNU Free Documentation License 1.2')
cmd.do(' ')
cmd.do(' Example:')
cmd.do(' ')
cmd.do(' draw_axis(x=18.232, y=17.150, z=9.488,i=-.226639, j=0.708772, k=-.668039, r=1, b=0, g=0, width=1, length=100)')
cmd.do(' ')
cmd.do(' Updated 15 June 2020 ')
cmd.do(' PI:NAME:<NAME>END_PI')
cmd.do(' ')
cmd.do(' Notes:')
cmd.do(' 1) Could be useful for the adding a symmery axis, a ncs axis, or scale bar to a scene.')
cmd.do(' 2) The postion (xyz) is the middle of the line, not one end as expected for a vector.')
cmd.do(' 3) Another example: draw_axis(x=0, y=0, z=0,i=0, j=0, k=1, r=1, b=0, g=0, width=300, length=96) ')
cmd.do(' 4) Changed print statement to Python3 print function.')
cmd.do(' 5) Replaced cmd.extend() with function generator.')
cmd.do(' """')
cmd.do(' def __init__(self):')
cmd.do(' self.state = 1')
cmd.do('counter = Counter()')
cmd.do('')
cmd.do('@cmd.extend')
cmd.do('def draw_axis(x=None, y=None, z=None, i=None, j=None, k=None, length=20.0, r=1.0, g=1.0, b=1.0, width=1.0 ):')
cmd.do(' if x == None or y == None or z == None or i == None or j == None or k== None :')
cmd.do(' print('Usage: draw_axis x,y,z, i,k,j, length, r,g,b, width')')
cmd.do(' print('draw a line centered at (x,y,z) with the direction vector (i,j,k)')')
cmd.do(' print('length, color (r,g,b), and width arguments are optional')')
cmd.do('# print 'For a fun example of the command, run draw_axis_example'')
cmd.do(' else :')
cmd.do(' x,y,z = float(x), float(y), float(z)')
cmd.do(' i,j,k = float(i), float(j), float(k)')
cmd.do(' r,g,b = float(r), float(g), float(b)')
cmd.do(' width = float(width)')
cmd.do(' length = float(length) / 2.0')
cmd.do('')
cmd.do(' x1,y1,z1 = (x+i*length,y+j*length,z+k*length)')
cmd.do(' x2,y2,z2 = (x-i*length,y-j*length,z-k*length)')
cmd.do('')
cmd.do(' obj = [')
cmd.do(' LINEWIDTH, width,')
cmd.do(' BEGIN, LINES,')
cmd.do('')
cmd.do(' COLOR, r, g, b,')
cmd.do(' VERTEX, x1, y1, z1,')
cmd.do(' VERTEX, x2, y2, z2,')
cmd.do('')
cmd.do(' END')
cmd.do(' ]')
cmd.do('')
cmd.do(' cmd.load_cgo(obj,'axis'+str(counter.state))')
cmd.do(' counter.state += 1')
${0}
'''
'Wait unitl all current commands have been executed. A timeout ensures that that command ecentually returns.':
'prefix': 'synch'
'body': '''
cmd.do('cmd.sync(timeout=${1:1.0},poll=${2:0.05});')
${0}
'''
'Add or substract a residue number offset.':
'prefix': 'renumResi'
'body': '''
cmd.do('alter ${1:3fa0}, resi=str(int(resi)+${2:100});sort;')
${0}
'''
'Add or substract a atom number offset.':
'prefix': 'renumAtoms'
'body': '''
cmd.do('alter {$1:3fa0}, ID=ID+${2:100};')
cmd.do('sort;')
${0}
'''
'Rename a chain. ':
'prefix': 'renameChain'
'body': '''
cmd.do('alter ${1:3fa0} and chain ${2:A}, chain=${3:"C"};')
cmd.do('sort;')
${0}
'''
'Print the atom number2 of a residue.':
'prefix': 'printAtomNumbers'
'body': '''
cmd.do('iterate (resi 1), print(name + " %i5" % ID);')
${0}
'''
'Print the atom names of a residue.':
'prefix': 'printAtomNames'
'body': '''
cmd.do('iterate (resi ${1:101}), print(name);')
${0}
'''
'Print the bfactors of a residue.':
'prefix': 'printBfactors'
'body': '''
cmd.do('iterate (resi ${1:101}), print(name + " %.2f" % b);')
${0}
'''
'Print the van Der Waals radii of the atoms in of a residue.':
'prefix': 'printVDWradii'
'body': '''
cmd.do('iterate (resi ${1:101}), print(name + " %.2f" % vdw);')
${0}
'''
'Print the coordinates of the atoms in a residue.':
'prefix': 'printCoordinates'
'body': '''
cmd.do('stored.coords = []; ')
cmd.do('iterate_state 1, (resi ${1:101}), stored.coords.append([x,y,z]); ')
cmd.do('[print(i) for i in stored.coords];')
${0}
'''
'Print the atom names and coordinates of the atoms in a residue.':
'prefix': 'printNamesCoordinates'
'body': '''
cmd.do('stored.names = []; iterate_state 1, (resi ${1:101}), stored.names.append([name]); ')
cmd.do('stored.coords = []; iterate_state 1, (resi ${1:101})), stored.coords.append([x,y,z]); ')
cmd.do('[print(i,j) for i,j in zip(stored.names, stored.coords)];')
${0}
'''
'Print the atom names as tuples and coordinates of the atoms in a residue as a list.':
'prefix': 'printNamesCoordinates'
'body': '''
cmd.do('stored.coords = []; iterate_state 1, (resi ${1:101}), stored.coords.append([x,y,z]); ')
cmd.do('stored.names = []; iterate_state 1, (resi ${1:101}), stored.names.append([name]);')
cmd.do('stored.names3 = [tuple(i) for i in stored.names];')
cmd.do('[print(i,j) for i,j in(zip(stored.names3, stored.coords)];')
${0}
'''
'Source block template in org-mode with emacs-jupyter package. ':
'prefix': 'emacsjupyterSourceBlock'
'body': '''
cmd.do('#+BEGIN_SRC jupyter-python :session py :kernel pymol.python :exports both :results raw drawer ')
cmd.do('from pymol import cmd')
cmd.do('cmd.do("reinitialize")')
cmd.do('cmd.bg_color("white")')
cmd.do('cmd.do("fetch 6VXX")')
cmd.do('cmd.do("zoom (resi 614 and chain A)")')
cmd.do('cmd.label(selection="chain A and resi 614 and name CB", expression="'%s-%s' % (resn,resi)")')
cmd.do('cmd.do("set label_color, black; set label_size, 48")')
cmd.do('cmd.do("set stick_radius, 0.12")')
cmd.do('cmd.do("hide cartoon; show sticks")')
cmd.do('cmd.do("set ray_shadows, 0")')
cmd.do('cmd.do("draw")')
cmd.do('cmd.do("png /Users/blaine/D614Gipython3.png, 600, 360, dpi=600")')
cmd.do('from IPython.display import Image')
cmd.do('from IPython.core.display import HTML')
cmd.do('PATH = "/Users/blaine/"')
cmd.do('Image(filename = PATH + "D614Gipython3.png", width=600, unconfined=True)')
cmd.do('#+END_SRC')
cmd.do('')
cmd.do('#+RESULTS:')
cmd.do('$0')
${0}
'''
'Source block template in org-mode with ob-ipython package. ':
'prefix': 'obipythonSourceBlock'
'body': '''
cmd.do('#+BEGIN_SRC ipython :session py :kernel pymol.python :exports both :results raw drawer ')
cmd.do('from pymol import cmd')
cmd.do('cmd.do("reinitialize")')
cmd.do('cmd.bg_color("white")')
cmd.do('cmd.do("fetch 6VXX")')
cmd.do('cmd.do("zoom (resi 614 and chain A)")')
cmd.do('cmd.label(selection="chain A and resi 614 and name CB", expression="'%s-%s' % (resn,resi)")')
cmd.do('cmd.do("set label_color, black; set label_size, 48")')
cmd.do('cmd.do("set stick_radius, 0.12")')
cmd.do('cmd.do("hide cartoon; show sticks")')
cmd.do('cmd.do("set ray_shadows, 0")')
cmd.do('cmd.do("draw")')
cmd.do('cmd.do("png /Users/blaine/D614Gipython3.png, 600, 360, dpi=600")')
cmd.do('from IPython.display import Image')
cmd.do('from IPython.core.display import HTML')
cmd.do('PATH = "/Users/blaine/"')
cmd.do('Image(filename = PATH + "D614Gipython3.png", width=600, unconfined=True)')
cmd.do('#+END_SRC')
cmd.do('')
cmd.do('#+RESULTS:')
${0}
'''
|
[
{
"context": "erson details', ->\n it 'can fetch details about Adel Qalieh', (done) ->\n @directory.personDetails '4ad00",
"end": 361,
"score": 0.999812126159668,
"start": 350,
"tag": "NAME",
"value": "Adel Qalieh"
},
{
"context": " result.result_data[0].list_name.should.equal \"QALIEH, ADEL \"\n done()\n\n describe 'Search', ->\n it ",
"end": 519,
"score": 0.9989638924598694,
"start": 507,
"tag": "NAME",
"value": "QALIEH, ADEL"
},
{
"context": "()\n\n describe 'Search', ->\n it 'can search for Alex Wissmann', (done) ->\n @directory.search {last_name: '",
"end": 598,
"score": 0.9998127818107605,
"start": 585,
"tag": "NAME",
"value": "Alex Wissmann"
},
{
"context": "', (done) ->\n @directory.search {last_name: 'Wissmann'}, (result) ->\n result.result_data.should.",
"end": 656,
"score": 0.9998368620872498,
"start": 648,
"tag": "NAME",
"value": "Wissmann"
},
{
"context": " result.result_data[0].list_name.should.equal \"WISSMANN, ALEXANDER R\"\n done()\n",
"end": 785,
"score": 0.9941070079803467,
"start": 777,
"tag": "NAME",
"value": "WISSMANN"
},
{
"context": "t.result_data[0].list_name.should.equal \"WISSMANN, ALEXANDER R\"\n done()\n",
"end": 798,
"score": 0.912183403968811,
"start": 787,
"tag": "NAME",
"value": "ALEXANDER R"
}
] | test/directory.coffee | pennlabs/penn-sdk-node | 1 | should = require "should"
api = require "../lib"
Directory = api.Directory
API_USERNAME = process.env.DIRECTORY_API_USERNAME || ""
API_PASSWORD = process.env.DIRECTORY_API_PASSWORD || ""
describe 'Directory', ->
before ->
@directory = new Directory(API_USERNAME, API_PASSWORD)
describe 'Person details', ->
it 'can fetch details about Adel Qalieh', (done) ->
@directory.personDetails '4ad00e45edffd2ec2180673dabf4aace', (result) ->
result.result_data[0].list_name.should.equal "QALIEH, ADEL "
done()
describe 'Search', ->
it 'can search for Alex Wissmann', (done) ->
@directory.search {last_name: 'Wissmann'}, (result) ->
result.result_data.should.have.lengthOf(1)
result.result_data[0].list_name.should.equal "WISSMANN, ALEXANDER R"
done()
| 101578 | should = require "should"
api = require "../lib"
Directory = api.Directory
API_USERNAME = process.env.DIRECTORY_API_USERNAME || ""
API_PASSWORD = process.env.DIRECTORY_API_PASSWORD || ""
describe 'Directory', ->
before ->
@directory = new Directory(API_USERNAME, API_PASSWORD)
describe 'Person details', ->
it 'can fetch details about <NAME>', (done) ->
@directory.personDetails '4ad00e45edffd2ec2180673dabf4aace', (result) ->
result.result_data[0].list_name.should.equal "<NAME> "
done()
describe 'Search', ->
it 'can search for <NAME>', (done) ->
@directory.search {last_name: '<NAME>'}, (result) ->
result.result_data.should.have.lengthOf(1)
result.result_data[0].list_name.should.equal "<NAME>, <NAME>"
done()
| true | should = require "should"
api = require "../lib"
Directory = api.Directory
API_USERNAME = process.env.DIRECTORY_API_USERNAME || ""
API_PASSWORD = process.env.DIRECTORY_API_PASSWORD || ""
describe 'Directory', ->
before ->
@directory = new Directory(API_USERNAME, API_PASSWORD)
describe 'Person details', ->
it 'can fetch details about PI:NAME:<NAME>END_PI', (done) ->
@directory.personDetails '4ad00e45edffd2ec2180673dabf4aace', (result) ->
result.result_data[0].list_name.should.equal "PI:NAME:<NAME>END_PI "
done()
describe 'Search', ->
it 'can search for PI:NAME:<NAME>END_PI', (done) ->
@directory.search {last_name: 'PI:NAME:<NAME>END_PI'}, (result) ->
result.result_data.should.have.lengthOf(1)
result.result_data[0].list_name.should.equal "PI:NAME:<NAME>END_PI, PI:NAME:<NAME>END_PI"
done()
|
[
{
"context": "_id: _id\n permissions: []\n email: _id+'@email.com'\n anonymous: false\n name: _.string.huma",
"end": 1231,
"score": 0.996084988117218,
"start": 1222,
"tag": "EMAIL",
"value": "email.com"
},
{
"context": "elCompleteAchievement()\n user = sources.user or @makeUser()\n attrs = _.extend({}, {\n _id,\n \"ac",
"end": 3871,
"score": 0.9394157528877258,
"start": 3862,
"tag": "USERNAME",
"value": "@makeUser"
},
{
"context": " _id\n properties: {\n firstName: 'Mr'\n lastName: 'Professorson'\n name: '",
"end": 5274,
"score": 0.999545693397522,
"start": 5272,
"tag": "NAME",
"value": "Mr"
},
{
"context": "ies: {\n firstName: 'Mr'\n lastName: 'Professorson'\n name: 'Mr Professorson'\n email: '",
"end": 5307,
"score": 0.999657928943634,
"start": 5295,
"tag": "NAME",
"value": "Professorson"
},
{
"context": "'\n lastName: 'Professorson'\n name: 'Mr Professorson'\n email: 'an@email.com'\n phoneNumbe",
"end": 5339,
"score": 0.9874976277351379,
"start": 5324,
"tag": "NAME",
"value": "Mr Professorson"
},
{
"context": "'\n name: 'Mr Professorson'\n email: 'an@email.com'\n phoneNumber: '555-555-5555'\n orga",
"end": 5369,
"score": 0.9999210238456726,
"start": 5357,
"tag": "EMAIL",
"value": "an@email.com"
}
] | test/app/factories.coffee | adamcsillag/codecombat | 1 | Level = require 'models/Level'
Course = require 'models/Course'
Courses = require 'collections/Courses'
User = require 'models/User'
Classroom = require 'models/Classroom'
LevelSession = require 'models/LevelSession'
CourseInstance = require 'models/CourseInstance'
Achievement = require 'models/Achievement'
EarnedAchievement = require 'models/EarnedAchievement'
ThangType = require 'models/ThangType'
Users = require 'collections/Users'
Prepaid = require 'models/Prepaid'
module.exports = {
makeCourse: (attrs, sources={}) ->
_id = _.uniqueId('course_')
attrs = _.extend({}, {
_id: _id
name: _.string.humanize(_id)
}, attrs)
attrs.campaignID ?= sources.campaign?.id or _.uniqueId('campaign_')
return new Course(attrs)
makeLevel: (attrs) ->
_id = _.uniqueId('level_')
attrs = _.extend({}, {
_id: _id
name: _.string.humanize(_id)
original: _id+'_original'
version:
major: 0
minor: 0
isLatestMajor: true
isLatestMinor: true
}, attrs)
return new Level(attrs)
makeUser: (attrs, sources={}) ->
_id = _.uniqueId('user_')
attrs = _.extend({
_id: _id
permissions: []
email: _id+'@email.com'
anonymous: false
name: _.string.humanize(_id)
}, attrs)
if sources.prepaid and not attrs.coursePrepaid
attrs.coursePrepaid = sources.prepaid.pick('_id', 'startDate', 'endDate')
return new User(attrs)
makeClassroom: (attrs, sources={}) ->
levels = sources.levels or [] # array of Levels collections
courses = sources.courses or new Courses()
members = sources.members or new Users()
_id = _.uniqueId('classroom_')
attrs = _.extend({}, {
_id: _id,
name: _.string.humanize(_id)
aceConfig: { language: 'python' }
}, attrs)
# populate courses
if not attrs.courses
courses = sources.courses or new Courses()
attrs.courses = (course.pick('_id') for course in courses.models)
# populate levels
for [courseAttrs, levels] in _.zip(attrs.courses, levels)
break if not courseAttrs
course ?= @makeCourse()
levels ?= new Levels()
courseAttrs.levels = (level.pick('_id', 'slug', 'name', 'original', 'type') for level in levels.models)
# populate members
if not attrs.members
members = members or new Users()
attrs.members = (member.id for member in members.models)
return new Classroom(attrs)
makeLevelSession: (attrs, sources={}) ->
level = sources.level or @makeLevel()
creator = sources.creator or @makeUser()
attrs = _.extend({}, {
level:
original: level.get('original'),
creator: creator.id,
}, attrs)
return new LevelSession(attrs)
makeCourseInstance: (attrs, sources={}) ->
_id = _.uniqueId('course_instance_')
course = sources.course or @makeCourse()
classroom = sources.classroom or @makeClassroom()
owner = sources.owner or @makeUser()
members = sources.members or new Users()
attrs = _.extend({}, {
_id
courseID: course.id
classroomID: classroom.id
ownerID: owner.id
members: members.pluck('_id')
}, attrs)
return new CourseInstance(attrs)
makeLevelCompleteAchievement: (attrs, sources={}) ->
_id = _.uniqueId('achievement_')
level = sources.level or @makeLevel()
attrs = _.extend({}, {
_id
name: _.string.humanize(_id)
query: {
'state.complete': true,
'level.original': level.get('original')
}
rewards: { gems: 10 }
worth: 20
}, attrs)
return new Achievement(attrs)
makeEarnedAchievement: (attrs, sources={}) ->
_id = _.uniqueId('earned_achievement_')
achievement = sources.achievement or @makeLevelCompleteAchievement()
user = sources.user or @makeUser()
attrs = _.extend({}, {
_id,
"achievement": achievement.id,
"user": user.id,
"earnedRewards": _.clone(achievement.get('rewards')),
"earnedPoints": achievement.get('worth'),
"achievementName": achievement.get('name'),
"notified": true
}, attrs)
return new EarnedAchievement(attrs)
makeThangType: (attrs) ->
_id = _.uniqueId('thang_type_')
attrs = _.extend({}, {
_id
name: _.string.humanize(_id)
}, attrs)
return new ThangType(attrs)
makePayment: (attrs, sources={}) ->
_id = _.uniqueId('payment_')
attrs = _.extend({}, {
_id
}, attrs)
return new ThangType(attrs)
makePrepaid: (attrs, sources={}) ->
_id = _.uniqueId('prepaid_')
attrs = _.extend({}, {
_id
type: 'course'
maxRedeemers: 10
endDate: moment().add(1, 'month').toISOString()
startDate: moment().subtract(1, 'month').toISOString()
}, attrs)
if not attrs.redeemers
redeemers = sources.redeemers or new Users()
attrs.redeemers = ({
userID: redeemer.id
date: moment().subtract(1, 'month').toISOString()
} for redeemer in redeemers.models)
return new Prepaid(attrs)
makeTrialRequest: (attrs, sources={}) ->
_id = _.uniqueId('trial_request_')
attrs = _.extend({}, {
_id
properties: {
firstName: 'Mr'
lastName: 'Professorson'
name: 'Mr Professorson'
email: 'an@email.com'
phoneNumber: '555-555-5555'
organization: 'Greendale'
}
}, attrs)
}
| 73645 | Level = require 'models/Level'
Course = require 'models/Course'
Courses = require 'collections/Courses'
User = require 'models/User'
Classroom = require 'models/Classroom'
LevelSession = require 'models/LevelSession'
CourseInstance = require 'models/CourseInstance'
Achievement = require 'models/Achievement'
EarnedAchievement = require 'models/EarnedAchievement'
ThangType = require 'models/ThangType'
Users = require 'collections/Users'
Prepaid = require 'models/Prepaid'
module.exports = {
makeCourse: (attrs, sources={}) ->
_id = _.uniqueId('course_')
attrs = _.extend({}, {
_id: _id
name: _.string.humanize(_id)
}, attrs)
attrs.campaignID ?= sources.campaign?.id or _.uniqueId('campaign_')
return new Course(attrs)
makeLevel: (attrs) ->
_id = _.uniqueId('level_')
attrs = _.extend({}, {
_id: _id
name: _.string.humanize(_id)
original: _id+'_original'
version:
major: 0
minor: 0
isLatestMajor: true
isLatestMinor: true
}, attrs)
return new Level(attrs)
makeUser: (attrs, sources={}) ->
_id = _.uniqueId('user_')
attrs = _.extend({
_id: _id
permissions: []
email: _id+'@<EMAIL>'
anonymous: false
name: _.string.humanize(_id)
}, attrs)
if sources.prepaid and not attrs.coursePrepaid
attrs.coursePrepaid = sources.prepaid.pick('_id', 'startDate', 'endDate')
return new User(attrs)
makeClassroom: (attrs, sources={}) ->
levels = sources.levels or [] # array of Levels collections
courses = sources.courses or new Courses()
members = sources.members or new Users()
_id = _.uniqueId('classroom_')
attrs = _.extend({}, {
_id: _id,
name: _.string.humanize(_id)
aceConfig: { language: 'python' }
}, attrs)
# populate courses
if not attrs.courses
courses = sources.courses or new Courses()
attrs.courses = (course.pick('_id') for course in courses.models)
# populate levels
for [courseAttrs, levels] in _.zip(attrs.courses, levels)
break if not courseAttrs
course ?= @makeCourse()
levels ?= new Levels()
courseAttrs.levels = (level.pick('_id', 'slug', 'name', 'original', 'type') for level in levels.models)
# populate members
if not attrs.members
members = members or new Users()
attrs.members = (member.id for member in members.models)
return new Classroom(attrs)
makeLevelSession: (attrs, sources={}) ->
level = sources.level or @makeLevel()
creator = sources.creator or @makeUser()
attrs = _.extend({}, {
level:
original: level.get('original'),
creator: creator.id,
}, attrs)
return new LevelSession(attrs)
makeCourseInstance: (attrs, sources={}) ->
_id = _.uniqueId('course_instance_')
course = sources.course or @makeCourse()
classroom = sources.classroom or @makeClassroom()
owner = sources.owner or @makeUser()
members = sources.members or new Users()
attrs = _.extend({}, {
_id
courseID: course.id
classroomID: classroom.id
ownerID: owner.id
members: members.pluck('_id')
}, attrs)
return new CourseInstance(attrs)
makeLevelCompleteAchievement: (attrs, sources={}) ->
_id = _.uniqueId('achievement_')
level = sources.level or @makeLevel()
attrs = _.extend({}, {
_id
name: _.string.humanize(_id)
query: {
'state.complete': true,
'level.original': level.get('original')
}
rewards: { gems: 10 }
worth: 20
}, attrs)
return new Achievement(attrs)
makeEarnedAchievement: (attrs, sources={}) ->
_id = _.uniqueId('earned_achievement_')
achievement = sources.achievement or @makeLevelCompleteAchievement()
user = sources.user or @makeUser()
attrs = _.extend({}, {
_id,
"achievement": achievement.id,
"user": user.id,
"earnedRewards": _.clone(achievement.get('rewards')),
"earnedPoints": achievement.get('worth'),
"achievementName": achievement.get('name'),
"notified": true
}, attrs)
return new EarnedAchievement(attrs)
makeThangType: (attrs) ->
_id = _.uniqueId('thang_type_')
attrs = _.extend({}, {
_id
name: _.string.humanize(_id)
}, attrs)
return new ThangType(attrs)
makePayment: (attrs, sources={}) ->
_id = _.uniqueId('payment_')
attrs = _.extend({}, {
_id
}, attrs)
return new ThangType(attrs)
makePrepaid: (attrs, sources={}) ->
_id = _.uniqueId('prepaid_')
attrs = _.extend({}, {
_id
type: 'course'
maxRedeemers: 10
endDate: moment().add(1, 'month').toISOString()
startDate: moment().subtract(1, 'month').toISOString()
}, attrs)
if not attrs.redeemers
redeemers = sources.redeemers or new Users()
attrs.redeemers = ({
userID: redeemer.id
date: moment().subtract(1, 'month').toISOString()
} for redeemer in redeemers.models)
return new Prepaid(attrs)
makeTrialRequest: (attrs, sources={}) ->
_id = _.uniqueId('trial_request_')
attrs = _.extend({}, {
_id
properties: {
firstName: '<NAME>'
lastName: '<NAME>'
name: '<NAME>'
email: '<EMAIL>'
phoneNumber: '555-555-5555'
organization: 'Greendale'
}
}, attrs)
}
| true | Level = require 'models/Level'
Course = require 'models/Course'
Courses = require 'collections/Courses'
User = require 'models/User'
Classroom = require 'models/Classroom'
LevelSession = require 'models/LevelSession'
CourseInstance = require 'models/CourseInstance'
Achievement = require 'models/Achievement'
EarnedAchievement = require 'models/EarnedAchievement'
ThangType = require 'models/ThangType'
Users = require 'collections/Users'
Prepaid = require 'models/Prepaid'
module.exports = {
makeCourse: (attrs, sources={}) ->
_id = _.uniqueId('course_')
attrs = _.extend({}, {
_id: _id
name: _.string.humanize(_id)
}, attrs)
attrs.campaignID ?= sources.campaign?.id or _.uniqueId('campaign_')
return new Course(attrs)
makeLevel: (attrs) ->
_id = _.uniqueId('level_')
attrs = _.extend({}, {
_id: _id
name: _.string.humanize(_id)
original: _id+'_original'
version:
major: 0
minor: 0
isLatestMajor: true
isLatestMinor: true
}, attrs)
return new Level(attrs)
makeUser: (attrs, sources={}) ->
_id = _.uniqueId('user_')
attrs = _.extend({
_id: _id
permissions: []
email: _id+'@PI:EMAIL:<EMAIL>END_PI'
anonymous: false
name: _.string.humanize(_id)
}, attrs)
if sources.prepaid and not attrs.coursePrepaid
attrs.coursePrepaid = sources.prepaid.pick('_id', 'startDate', 'endDate')
return new User(attrs)
makeClassroom: (attrs, sources={}) ->
levels = sources.levels or [] # array of Levels collections
courses = sources.courses or new Courses()
members = sources.members or new Users()
_id = _.uniqueId('classroom_')
attrs = _.extend({}, {
_id: _id,
name: _.string.humanize(_id)
aceConfig: { language: 'python' }
}, attrs)
# populate courses
if not attrs.courses
courses = sources.courses or new Courses()
attrs.courses = (course.pick('_id') for course in courses.models)
# populate levels
for [courseAttrs, levels] in _.zip(attrs.courses, levels)
break if not courseAttrs
course ?= @makeCourse()
levels ?= new Levels()
courseAttrs.levels = (level.pick('_id', 'slug', 'name', 'original', 'type') for level in levels.models)
# populate members
if not attrs.members
members = members or new Users()
attrs.members = (member.id for member in members.models)
return new Classroom(attrs)
makeLevelSession: (attrs, sources={}) ->
level = sources.level or @makeLevel()
creator = sources.creator or @makeUser()
attrs = _.extend({}, {
level:
original: level.get('original'),
creator: creator.id,
}, attrs)
return new LevelSession(attrs)
makeCourseInstance: (attrs, sources={}) ->
_id = _.uniqueId('course_instance_')
course = sources.course or @makeCourse()
classroom = sources.classroom or @makeClassroom()
owner = sources.owner or @makeUser()
members = sources.members or new Users()
attrs = _.extend({}, {
_id
courseID: course.id
classroomID: classroom.id
ownerID: owner.id
members: members.pluck('_id')
}, attrs)
return new CourseInstance(attrs)
makeLevelCompleteAchievement: (attrs, sources={}) ->
_id = _.uniqueId('achievement_')
level = sources.level or @makeLevel()
attrs = _.extend({}, {
_id
name: _.string.humanize(_id)
query: {
'state.complete': true,
'level.original': level.get('original')
}
rewards: { gems: 10 }
worth: 20
}, attrs)
return new Achievement(attrs)
makeEarnedAchievement: (attrs, sources={}) ->
_id = _.uniqueId('earned_achievement_')
achievement = sources.achievement or @makeLevelCompleteAchievement()
user = sources.user or @makeUser()
attrs = _.extend({}, {
_id,
"achievement": achievement.id,
"user": user.id,
"earnedRewards": _.clone(achievement.get('rewards')),
"earnedPoints": achievement.get('worth'),
"achievementName": achievement.get('name'),
"notified": true
}, attrs)
return new EarnedAchievement(attrs)
makeThangType: (attrs) ->
_id = _.uniqueId('thang_type_')
attrs = _.extend({}, {
_id
name: _.string.humanize(_id)
}, attrs)
return new ThangType(attrs)
makePayment: (attrs, sources={}) ->
_id = _.uniqueId('payment_')
attrs = _.extend({}, {
_id
}, attrs)
return new ThangType(attrs)
makePrepaid: (attrs, sources={}) ->
_id = _.uniqueId('prepaid_')
attrs = _.extend({}, {
_id
type: 'course'
maxRedeemers: 10
endDate: moment().add(1, 'month').toISOString()
startDate: moment().subtract(1, 'month').toISOString()
}, attrs)
if not attrs.redeemers
redeemers = sources.redeemers or new Users()
attrs.redeemers = ({
userID: redeemer.id
date: moment().subtract(1, 'month').toISOString()
} for redeemer in redeemers.models)
return new Prepaid(attrs)
makeTrialRequest: (attrs, sources={}) ->
_id = _.uniqueId('trial_request_')
attrs = _.extend({}, {
_id
properties: {
firstName: 'PI:NAME:<NAME>END_PI'
lastName: 'PI:NAME:<NAME>END_PI'
name: 'PI:NAME:<NAME>END_PI'
email: 'PI:EMAIL:<EMAIL>END_PI'
phoneNumber: '555-555-5555'
organization: 'Greendale'
}
}, attrs)
}
|
[
{
"context": "rl: 'http://localhost:5000'\n token:\n secret: 'IhoiUHyu6gt5HJHhjhhGfddsESEWsfgHJjhhjFDdsseseRDSTDfgghhjHJljklkjuiuyyUYUtytrRERerererERerererRTGHghj'\n",
"end": 287,
"score": 0.9997702240943909,
"start": 187,
"tag": "KEY",
"value": "IhoiUHyu6gt5HJHhjhhGfddsESEWsfgHJjhhjFDdsseseRDSTDfgghhjHJljklkjuiuyyUYUtytrRERerererERerererRTGHghj"
}
] | server/config/development.coffee | stevelacy/claru | 0 | {join} = require 'path'
module.exports =
database: 'mongodb://localhost:27017/claru'
name: 'Claru'
port: 5000
title: 'Claru'
url: 'http://localhost:5000'
token:
secret: 'IhoiUHyu6gt5HJHhjhhGfddsESEWsfgHJjhhjFDdsseseRDSTDfgghhjHJljklkjuiuyyUYUtytrRERerererERerererRTGHghj'
| 210236 | {join} = require 'path'
module.exports =
database: 'mongodb://localhost:27017/claru'
name: 'Claru'
port: 5000
title: 'Claru'
url: 'http://localhost:5000'
token:
secret: '<KEY>'
| true | {join} = require 'path'
module.exports =
database: 'mongodb://localhost:27017/claru'
name: 'Claru'
port: 5000
title: 'Claru'
url: 'http://localhost:5000'
token:
secret: 'PI:KEY:<KEY>END_PI'
|
[
{
"context": "ut fields', ->\n @template.should.containEql 'Spaeth'\n @template.should.containEql 'Craig'\n ",
"end": 591,
"score": 0.9990925192832947,
"start": 585,
"tag": "NAME",
"value": "Spaeth"
},
{
"context": "inEql 'Spaeth'\n @template.should.containEql 'Craig'\n @template.should.containEql 'craigspaeth@g",
"end": 633,
"score": 0.9987009763717651,
"start": 628,
"tag": "NAME",
"value": "Craig"
},
{
"context": "ainEql 'Craig'\n @template.should.containEql 'craigspaeth@gmail.com'\n\n describe 'for a logged out user', ->\n befo",
"end": 691,
"score": 0.9999220967292786,
"start": 670,
"tag": "EMAIL",
"value": "craigspaeth@gmail.com"
}
] | apps/gallery_insights/test/template.coffee | l2succes/force | 1 | jade = require 'jade'
path = require 'path'
fs = require 'fs'
{ fabricate } = require 'antigravity'
render = (templateName) ->
filename = path.resolve __dirname, "../templates/#{templateName}.jade"
jade.compile(
fs.readFileSync(filename),
{ filename: filename }
)
describe 'Gallery Insights Form', ->
describe 'for a logged in user', ->
beforeEach ->
@template = render('index')(
sd: { CURRENT_USER: fabricate 'user' }
asset: (->)
)
it 'displays their email address and name in input fields', ->
@template.should.containEql 'Spaeth'
@template.should.containEql 'Craig'
@template.should.containEql 'craigspaeth@gmail.com'
describe 'for a logged out user', ->
beforeEach ->
@template = render('index')(
sd: { }
asset: (->)
)
it 'displays empty inputs', ->
@template.should.containEql '<input id="EMAIL" type="email" name="EMAIL" required value=""'
@template.should.containEql '<input id="FNAME" type="text" name="FNAME" value=""'
@template.should.containEql '<input id="LNAME" type="text" name="LNAME" value=""'
| 225578 | jade = require 'jade'
path = require 'path'
fs = require 'fs'
{ fabricate } = require 'antigravity'
render = (templateName) ->
filename = path.resolve __dirname, "../templates/#{templateName}.jade"
jade.compile(
fs.readFileSync(filename),
{ filename: filename }
)
describe 'Gallery Insights Form', ->
describe 'for a logged in user', ->
beforeEach ->
@template = render('index')(
sd: { CURRENT_USER: fabricate 'user' }
asset: (->)
)
it 'displays their email address and name in input fields', ->
@template.should.containEql '<NAME>'
@template.should.containEql '<NAME>'
@template.should.containEql '<EMAIL>'
describe 'for a logged out user', ->
beforeEach ->
@template = render('index')(
sd: { }
asset: (->)
)
it 'displays empty inputs', ->
@template.should.containEql '<input id="EMAIL" type="email" name="EMAIL" required value=""'
@template.should.containEql '<input id="FNAME" type="text" name="FNAME" value=""'
@template.should.containEql '<input id="LNAME" type="text" name="LNAME" value=""'
| true | jade = require 'jade'
path = require 'path'
fs = require 'fs'
{ fabricate } = require 'antigravity'
render = (templateName) ->
filename = path.resolve __dirname, "../templates/#{templateName}.jade"
jade.compile(
fs.readFileSync(filename),
{ filename: filename }
)
describe 'Gallery Insights Form', ->
describe 'for a logged in user', ->
beforeEach ->
@template = render('index')(
sd: { CURRENT_USER: fabricate 'user' }
asset: (->)
)
it 'displays their email address and name in input fields', ->
@template.should.containEql 'PI:NAME:<NAME>END_PI'
@template.should.containEql 'PI:NAME:<NAME>END_PI'
@template.should.containEql 'PI:EMAIL:<EMAIL>END_PI'
describe 'for a logged out user', ->
beforeEach ->
@template = render('index')(
sd: { }
asset: (->)
)
it 'displays empty inputs', ->
@template.should.containEql '<input id="EMAIL" type="email" name="EMAIL" required value=""'
@template.should.containEql '<input id="FNAME" type="text" name="FNAME" value=""'
@template.should.containEql '<input id="LNAME" type="text" name="LNAME" value=""'
|
[
{
"context": " password [String]\n #\n autoPassword = -> chance.hash()\n\n # Login to Kinvey with the given credent",
"end": 3184,
"score": 0.8707464337348938,
"start": 3173,
"tag": "PASSWORD",
"value": "chance.hash"
},
{
"context": "username, password\n login({ username: username, password: password })\n else\n ",
"end": 4454,
"score": 0.9987399578094482,
"start": 4446,
"tag": "USERNAME",
"value": "username"
},
{
"context": " login({ username: username, password: password })\n else\n logger.info 'No",
"end": 4474,
"score": 0.9988369345664978,
"start": 4466,
"tag": "PASSWORD",
"value": "password"
},
{
"context": " try\n autoAccount username: autoUsername(), password: autoPassword()\n cat",
"end": 4778,
"score": 0.8419302701950073,
"start": 4766,
"tag": "USERNAME",
"value": "autoUsername"
}
] | lib/authorize_kinvey.coffee | logankoester/backbone-datarouter | 1 | # This custom authorizer should be injected into a Route to authorize
# a user with the Kinvey service.
#
# Initializes the current user and triggers a route event when finished.
# This event might be any of:
#
# * 'allow:user'
# * 'allow:guest'
# * 'allow:created'
# * 'allow:offline'
# * 'deny:user'
# * 'deny:guest'
# * 'deny:offline'
# * 'deny:error'
#
# A nonspecific 'deny' or 'allow' route event is also triggered.
#
# Add the following options to your route instance:
#
# * kinvey [Object] Options hash to be passed into Kinvey.init()
# * allowOffline [Boolean] Set true to resolve if the network is unreachable but a cached user exists.
# * allowGuest [Boolean] Set true to resolve if no user is logged in.
# * userClass [Function<Backbone.Model>] Your Kinvey User model.
# * autoAccount [Boolean] If true, attempt to generate an account if online with no cached user.
#
# @param route [Object] A route object to authorize.
# @return promise [Promise] A promise to resolve upon authorization, or reject if access is denied.
#
# @note To use autoAccount you will need "chance" on your global scope.
# @see http://chancejs.com/#dice
#
define [
'kinvey',
'chance'
], (Kinvey) ->
(route) ->
$.Deferred (deferred) ->
# Inherit the route's logging function, if any
if route && route.options && route.options.logger
logger = route.options.logger
else
logger = console
# Trigger a 'allow' route event and resolve the deferred.
# Also triggers a custom route event if passed as the first parameter.
#
# @param event [String] A custom route event to trigger
#
allow = (event) ->
route.trigger event, route
route.trigger 'allow', route
deferred.resolve()
# Trigger the 'deny' route event and reject the deferred.
# Also triggers a custom route event if passed as the first parameter.
#
# @param event [String] A custom route event to trigger
#
deny = (event) ->
route.trigger event, route
route.trigger 'deny', route
deferred.reject()
# Attempt to generate an account if online with no cached user.
#
# @param credentials [Object] An object containing username and password (string) properties.
#
autoAccount = (credentials) ->
logger.info 'Creating new autogenerated account', credentials
user.save credentials,
success: (model, response, options) ->
logger.info 'Account created successfully', response
allow 'allow:created'
error: (model, xhr, options) ->
logger.error 'Failed to create account', xhr
route.pushError xhr
deny 'deny:error'
# Return a username for the automatically generated user.
# Attempts to read a uuid from the device (as in Cordova
# environments), otherwise generate a random guid.
#
# @return username [String]
#
autoUsername = -> chance.guid()
# Generate and return a secure password (a 40char hex hash)
#
# @return password [String]
#
autoPassword = -> chance.hash()
# Login to Kinvey with the given credentials
#
# @param credentials [Object] An object containing username and password (string) properties.
#
login = (credentials) ->
user.login(credentials).then ->
if user.isLoggedIn()
allow 'allow:user'
else
deny 'deny:user'
, (error) ->
logger.error 'Failed to login with credentials', error
route.pushError error
deny 'deny:error'
# Ensure Kinvey is in online mode and then initialize it.
#
# If not logged in, attempt to log in with cached credentials.
#
# Otherwise either generate an account or deny, depending on route options.
#
online = ->
Kinvey.Sync.online()
Kinvey.init(route.options.kinvey).then (activeUser) =>
if activeUser
logger.info 'Already logged in', activeUser
allow 'allow:user'
else
cache = Kinvey.Backbone.User.accountCache
username = cache.getUsername()
password = cache.getPassword()
if username && password
logger.info 'Logging in with cached credentials', username, password
login({ username: username, password: password })
else
logger.info 'Not logged in, no cached credentials'
if route.options.allowGuest
allow 'allow:guest'
else
if route.options.autoAccount
try
autoAccount username: autoUsername(), password: autoPassword()
catch error
logger.trace(error)
deny 'deny:guest'
else
deny 'deny:guest'
, (error) =>
logger.error 'Kinvey init error', error
route.pushError error
deny 'deny:error'
# Ensure Kinvey is in offline mode, and deny if allowOffline is disabled.
#
# Otherwise, check for an active user.
#
offline = ->
Kinvey.Sync.offline()
if route.options.allowOffline
options = _.clone(route.options.kinvey)
options.online = false
Kinvey.init(options).then (activeUser) =>
if Kinvey.Backbone.getActiveUser()
allow 'allow:offline'
else
if route.options.allowGuest
allow 'allow:guest'
else
deny 'deny:guest'
, (error) =>
logger.error 'Kinvey init error', error
route.pushError error
deny 'deny:error'
else
deny 'deny:offline'
user = new Kinvey.Backbone.User
if route.options.online() then online() else offline()
.promise()
| 188135 | # This custom authorizer should be injected into a Route to authorize
# a user with the Kinvey service.
#
# Initializes the current user and triggers a route event when finished.
# This event might be any of:
#
# * 'allow:user'
# * 'allow:guest'
# * 'allow:created'
# * 'allow:offline'
# * 'deny:user'
# * 'deny:guest'
# * 'deny:offline'
# * 'deny:error'
#
# A nonspecific 'deny' or 'allow' route event is also triggered.
#
# Add the following options to your route instance:
#
# * kinvey [Object] Options hash to be passed into Kinvey.init()
# * allowOffline [Boolean] Set true to resolve if the network is unreachable but a cached user exists.
# * allowGuest [Boolean] Set true to resolve if no user is logged in.
# * userClass [Function<Backbone.Model>] Your Kinvey User model.
# * autoAccount [Boolean] If true, attempt to generate an account if online with no cached user.
#
# @param route [Object] A route object to authorize.
# @return promise [Promise] A promise to resolve upon authorization, or reject if access is denied.
#
# @note To use autoAccount you will need "chance" on your global scope.
# @see http://chancejs.com/#dice
#
define [
'kinvey',
'chance'
], (Kinvey) ->
(route) ->
$.Deferred (deferred) ->
# Inherit the route's logging function, if any
if route && route.options && route.options.logger
logger = route.options.logger
else
logger = console
# Trigger a 'allow' route event and resolve the deferred.
# Also triggers a custom route event if passed as the first parameter.
#
# @param event [String] A custom route event to trigger
#
allow = (event) ->
route.trigger event, route
route.trigger 'allow', route
deferred.resolve()
# Trigger the 'deny' route event and reject the deferred.
# Also triggers a custom route event if passed as the first parameter.
#
# @param event [String] A custom route event to trigger
#
deny = (event) ->
route.trigger event, route
route.trigger 'deny', route
deferred.reject()
# Attempt to generate an account if online with no cached user.
#
# @param credentials [Object] An object containing username and password (string) properties.
#
autoAccount = (credentials) ->
logger.info 'Creating new autogenerated account', credentials
user.save credentials,
success: (model, response, options) ->
logger.info 'Account created successfully', response
allow 'allow:created'
error: (model, xhr, options) ->
logger.error 'Failed to create account', xhr
route.pushError xhr
deny 'deny:error'
# Return a username for the automatically generated user.
# Attempts to read a uuid from the device (as in Cordova
# environments), otherwise generate a random guid.
#
# @return username [String]
#
autoUsername = -> chance.guid()
# Generate and return a secure password (a 40char hex hash)
#
# @return password [String]
#
autoPassword = -> <PASSWORD>()
# Login to Kinvey with the given credentials
#
# @param credentials [Object] An object containing username and password (string) properties.
#
login = (credentials) ->
user.login(credentials).then ->
if user.isLoggedIn()
allow 'allow:user'
else
deny 'deny:user'
, (error) ->
logger.error 'Failed to login with credentials', error
route.pushError error
deny 'deny:error'
# Ensure Kinvey is in online mode and then initialize it.
#
# If not logged in, attempt to log in with cached credentials.
#
# Otherwise either generate an account or deny, depending on route options.
#
online = ->
Kinvey.Sync.online()
Kinvey.init(route.options.kinvey).then (activeUser) =>
if activeUser
logger.info 'Already logged in', activeUser
allow 'allow:user'
else
cache = Kinvey.Backbone.User.accountCache
username = cache.getUsername()
password = cache.getPassword()
if username && password
logger.info 'Logging in with cached credentials', username, password
login({ username: username, password: <PASSWORD> })
else
logger.info 'Not logged in, no cached credentials'
if route.options.allowGuest
allow 'allow:guest'
else
if route.options.autoAccount
try
autoAccount username: autoUsername(), password: autoPassword()
catch error
logger.trace(error)
deny 'deny:guest'
else
deny 'deny:guest'
, (error) =>
logger.error 'Kinvey init error', error
route.pushError error
deny 'deny:error'
# Ensure Kinvey is in offline mode, and deny if allowOffline is disabled.
#
# Otherwise, check for an active user.
#
offline = ->
Kinvey.Sync.offline()
if route.options.allowOffline
options = _.clone(route.options.kinvey)
options.online = false
Kinvey.init(options).then (activeUser) =>
if Kinvey.Backbone.getActiveUser()
allow 'allow:offline'
else
if route.options.allowGuest
allow 'allow:guest'
else
deny 'deny:guest'
, (error) =>
logger.error 'Kinvey init error', error
route.pushError error
deny 'deny:error'
else
deny 'deny:offline'
user = new Kinvey.Backbone.User
if route.options.online() then online() else offline()
.promise()
| true | # This custom authorizer should be injected into a Route to authorize
# a user with the Kinvey service.
#
# Initializes the current user and triggers a route event when finished.
# This event might be any of:
#
# * 'allow:user'
# * 'allow:guest'
# * 'allow:created'
# * 'allow:offline'
# * 'deny:user'
# * 'deny:guest'
# * 'deny:offline'
# * 'deny:error'
#
# A nonspecific 'deny' or 'allow' route event is also triggered.
#
# Add the following options to your route instance:
#
# * kinvey [Object] Options hash to be passed into Kinvey.init()
# * allowOffline [Boolean] Set true to resolve if the network is unreachable but a cached user exists.
# * allowGuest [Boolean] Set true to resolve if no user is logged in.
# * userClass [Function<Backbone.Model>] Your Kinvey User model.
# * autoAccount [Boolean] If true, attempt to generate an account if online with no cached user.
#
# @param route [Object] A route object to authorize.
# @return promise [Promise] A promise to resolve upon authorization, or reject if access is denied.
#
# @note To use autoAccount you will need "chance" on your global scope.
# @see http://chancejs.com/#dice
#
define [
'kinvey',
'chance'
], (Kinvey) ->
(route) ->
$.Deferred (deferred) ->
# Inherit the route's logging function, if any
if route && route.options && route.options.logger
logger = route.options.logger
else
logger = console
# Trigger a 'allow' route event and resolve the deferred.
# Also triggers a custom route event if passed as the first parameter.
#
# @param event [String] A custom route event to trigger
#
allow = (event) ->
route.trigger event, route
route.trigger 'allow', route
deferred.resolve()
# Trigger the 'deny' route event and reject the deferred.
# Also triggers a custom route event if passed as the first parameter.
#
# @param event [String] A custom route event to trigger
#
deny = (event) ->
route.trigger event, route
route.trigger 'deny', route
deferred.reject()
# Attempt to generate an account if online with no cached user.
#
# @param credentials [Object] An object containing username and password (string) properties.
#
autoAccount = (credentials) ->
logger.info 'Creating new autogenerated account', credentials
user.save credentials,
success: (model, response, options) ->
logger.info 'Account created successfully', response
allow 'allow:created'
error: (model, xhr, options) ->
logger.error 'Failed to create account', xhr
route.pushError xhr
deny 'deny:error'
# Return a username for the automatically generated user.
# Attempts to read a uuid from the device (as in Cordova
# environments), otherwise generate a random guid.
#
# @return username [String]
#
autoUsername = -> chance.guid()
# Generate and return a secure password (a 40char hex hash)
#
# @return password [String]
#
autoPassword = -> PI:PASSWORD:<PASSWORD>END_PI()
# Login to Kinvey with the given credentials
#
# @param credentials [Object] An object containing username and password (string) properties.
#
login = (credentials) ->
user.login(credentials).then ->
if user.isLoggedIn()
allow 'allow:user'
else
deny 'deny:user'
, (error) ->
logger.error 'Failed to login with credentials', error
route.pushError error
deny 'deny:error'
# Ensure Kinvey is in online mode and then initialize it.
#
# If not logged in, attempt to log in with cached credentials.
#
# Otherwise either generate an account or deny, depending on route options.
#
online = ->
Kinvey.Sync.online()
Kinvey.init(route.options.kinvey).then (activeUser) =>
if activeUser
logger.info 'Already logged in', activeUser
allow 'allow:user'
else
cache = Kinvey.Backbone.User.accountCache
username = cache.getUsername()
password = cache.getPassword()
if username && password
logger.info 'Logging in with cached credentials', username, password
login({ username: username, password: PI:PASSWORD:<PASSWORD>END_PI })
else
logger.info 'Not logged in, no cached credentials'
if route.options.allowGuest
allow 'allow:guest'
else
if route.options.autoAccount
try
autoAccount username: autoUsername(), password: autoPassword()
catch error
logger.trace(error)
deny 'deny:guest'
else
deny 'deny:guest'
, (error) =>
logger.error 'Kinvey init error', error
route.pushError error
deny 'deny:error'
# Ensure Kinvey is in offline mode, and deny if allowOffline is disabled.
#
# Otherwise, check for an active user.
#
offline = ->
Kinvey.Sync.offline()
if route.options.allowOffline
options = _.clone(route.options.kinvey)
options.online = false
Kinvey.init(options).then (activeUser) =>
if Kinvey.Backbone.getActiveUser()
allow 'allow:offline'
else
if route.options.allowGuest
allow 'allow:guest'
else
deny 'deny:guest'
, (error) =>
logger.error 'Kinvey init error', error
route.pushError error
deny 'deny:error'
else
deny 'deny:offline'
user = new Kinvey.Backbone.User
if route.options.online() then online() else offline()
.promise()
|
[
{
"context": " 1 # always 1st\n\t\t\tshow: true\n\t\t\tdisplayNameEng: 'Mt. Gox'\n\t\t\tgeo: \"JP\" # ISO 3166-1\n\t\t\tdefaultCurrenc",
"end": 369,
"score": 0.5069279670715332,
"start": 367,
"tag": "NAME",
"value": "Mt"
},
{
"context": "y/ticker_fast' # REST api - https://bitbucket.org/nitrous/mtgox-api\n\t\t\t\trateLimit: 1005\n\t\t\tfetched:\n\t\t\t\tini",
"end": 669,
"score": 0.9979249835014343,
"start": 662,
"tag": "USERNAME",
"value": "nitrous"
},
{
"context": "ce'\n\t\t\torder: 2\n\t\t\tshow: true\n\t\t\tdisplayNameEng: 'BTC-e'\n\t\t\tgeo: 'BG'\n\t\t\tdefaultCurrency: 'USD'\n\t\t\twebsit",
"end": 1754,
"score": 0.7344043850898743,
"start": 1749,
"tag": "NAME",
"value": "BTC-e"
},
{
"context": "tched:\n\t\t\t\tinitialized: false\n\t\tbitfinex:\n\t\t\tid: 'bitfinex'\n\t\t\torder: 6\n\t\t\tshow: true\n\t\t\tdisplayNameEng: 'Bi",
"end": 2651,
"score": 0.9926396012306213,
"start": 2643,
"tag": "USERNAME",
"value": "bitfinex"
},
{
"context": "ex'\n\t\t\torder: 6\n\t\t\tshow: true\n\t\t\tdisplayNameEng: 'Bitfinex'\n\t\t\tgeo: 'HK'\n\t\t\tdefaultCurrency: 'HKD'\n\t\t\twebsit",
"end": 2707,
"score": 0.5870943069458008,
"start": 2699,
"tag": "USERNAME",
"value": "Bitfinex"
}
] | public/js/app-data.coffee | rayshan/CoinArb | 3 | #fetched =
# current:
# last: null
# spread: null
# volume: null
# updateTime: null
# error: null
# previous:
# last: null
# spread: null
# volume: null
# updateTime: null
# error: null
angular.module('CaApp').factory 'exchangeSvc', () ->
data =
mtgox:
id: 'mtgox' # based on bitcoinaverage
order: 1 # always 1st
show: true
displayNameEng: 'Mt. Gox'
geo: "JP" # ISO 3166-1
defaultCurrency: 'USD'
website: 'https://mtgox.com/'
api:
# type: 'ws'
# uri: 'http://socketio.mtgox.com:80/mtgox?Currency=USD'
type: 'REST'
uri: 'https://data.mtgox.com/api/2/BTCUSD/money/ticker_fast' # REST api - https://bitbucket.org/nitrous/mtgox-api
rateLimit: 1005
fetched:
initialized: false
btcchina:
id: 'btcchina'
order: 3
show: true
displayNameEng: 'BTC China'
displayNameLocal: '比特币中国'
defaultCurrency: 'CNY'
website: 'https://btcchina.com'
api:
type: 'REST'
uri: 'https://data.btcchina.com/data/ticker'
rateLimit: 1000 * 5
fetched:
initialized: false
localbitcoins:
id: 'localbitcoins'
order: 4
show: true
displayNameEng: 'LocalBitcoins'
defaultCurrency: 'USD'
website: 'https://localbitcoins.com'
api:
type: 'REST'
# uri: 'https://api.bitcoinaverage.com/exchanges/USD' # appears to pull avg_3h
# uri: 'https://localbitcoins.com/bitcoinaverage/ticker-all-currencies/' # no CORS
uri: 'https://query.yahooapis.com/v1/public/yql?q=select%20*%20from%20json%20where%20url%20%3D%20%22https%3A%2F%2Flocalbitcoins.com%2Fbitcoinaverage%2Fticker-all-currencies%2F%22&format=json&callback='
# yql
rateLimit: 1000 * 5
fetched:
initialized: false
btce:
id: 'btce'
order: 2
show: true
displayNameEng: 'BTC-e'
geo: 'BG'
defaultCurrency: 'USD'
website: 'https://btc-e.com/'
api:
type: 'REST'
# uri: 'https://api.bitcoinaverage.com/exchanges/USD'
# uri: 'https://btc-e.com/api/2/btc_usd/ticker' # no CORS no JSONP
uri: 'https://query.yahooapis.com/v1/public/yql?q=select%20*%20from%20json%20where%20url%20%3D%20%22https%3A%2F%2Fbtc-e.com%2Fapi%2F2%2Fbtc_usd%2Fticker%22&format=json&callback='
# yql, no diagnostics
rateLimit: 1000 * 5 # yql public 2k requests / hr
fetched:
initialized: false
bitstamp:
id: 'bitstamp'
order: 5
show: true
displayNameEng: 'Bitstamp'
geo: 'GB'
defaultCurrency: 'GBP'
website: 'https://www.bitstamp.net/'
api:
type: 'REST'
uri: 'https://api.bitcoinaverage.com/exchanges/USD'
# no cors, 403 when pulled via yql
rateLimit: 1001 * 60
fetched:
initialized: false
bitfinex:
id: 'bitfinex'
order: 6
show: true
displayNameEng: 'Bitfinex'
geo: 'HK'
defaultCurrency: 'HKD'
website: 'https://www.bitfinex.com/'
api:
type: 'REST'
# uri: 'https://api.bitcoinaverage.com/exchanges/USD'
uri: 'https://query.yahooapis.com/v1/public/yql?q=select%20*%20from%20json%20where%20url%20%3D%20%22https%3A%2F%2Fapi.bitfinex.com%2Fv1%2Fticker%2Fbtcusd%22&format=json&callback='
rateLimit: 1000 * 5
fetched:
initialized: false
data: data | 29101 | #fetched =
# current:
# last: null
# spread: null
# volume: null
# updateTime: null
# error: null
# previous:
# last: null
# spread: null
# volume: null
# updateTime: null
# error: null
angular.module('CaApp').factory 'exchangeSvc', () ->
data =
mtgox:
id: 'mtgox' # based on bitcoinaverage
order: 1 # always 1st
show: true
displayNameEng: '<NAME>. Gox'
geo: "JP" # ISO 3166-1
defaultCurrency: 'USD'
website: 'https://mtgox.com/'
api:
# type: 'ws'
# uri: 'http://socketio.mtgox.com:80/mtgox?Currency=USD'
type: 'REST'
uri: 'https://data.mtgox.com/api/2/BTCUSD/money/ticker_fast' # REST api - https://bitbucket.org/nitrous/mtgox-api
rateLimit: 1005
fetched:
initialized: false
btcchina:
id: 'btcchina'
order: 3
show: true
displayNameEng: 'BTC China'
displayNameLocal: '比特币中国'
defaultCurrency: 'CNY'
website: 'https://btcchina.com'
api:
type: 'REST'
uri: 'https://data.btcchina.com/data/ticker'
rateLimit: 1000 * 5
fetched:
initialized: false
localbitcoins:
id: 'localbitcoins'
order: 4
show: true
displayNameEng: 'LocalBitcoins'
defaultCurrency: 'USD'
website: 'https://localbitcoins.com'
api:
type: 'REST'
# uri: 'https://api.bitcoinaverage.com/exchanges/USD' # appears to pull avg_3h
# uri: 'https://localbitcoins.com/bitcoinaverage/ticker-all-currencies/' # no CORS
uri: 'https://query.yahooapis.com/v1/public/yql?q=select%20*%20from%20json%20where%20url%20%3D%20%22https%3A%2F%2Flocalbitcoins.com%2Fbitcoinaverage%2Fticker-all-currencies%2F%22&format=json&callback='
# yql
rateLimit: 1000 * 5
fetched:
initialized: false
btce:
id: 'btce'
order: 2
show: true
displayNameEng: '<NAME>'
geo: 'BG'
defaultCurrency: 'USD'
website: 'https://btc-e.com/'
api:
type: 'REST'
# uri: 'https://api.bitcoinaverage.com/exchanges/USD'
# uri: 'https://btc-e.com/api/2/btc_usd/ticker' # no CORS no JSONP
uri: 'https://query.yahooapis.com/v1/public/yql?q=select%20*%20from%20json%20where%20url%20%3D%20%22https%3A%2F%2Fbtc-e.com%2Fapi%2F2%2Fbtc_usd%2Fticker%22&format=json&callback='
# yql, no diagnostics
rateLimit: 1000 * 5 # yql public 2k requests / hr
fetched:
initialized: false
bitstamp:
id: 'bitstamp'
order: 5
show: true
displayNameEng: 'Bitstamp'
geo: 'GB'
defaultCurrency: 'GBP'
website: 'https://www.bitstamp.net/'
api:
type: 'REST'
uri: 'https://api.bitcoinaverage.com/exchanges/USD'
# no cors, 403 when pulled via yql
rateLimit: 1001 * 60
fetched:
initialized: false
bitfinex:
id: 'bitfinex'
order: 6
show: true
displayNameEng: 'Bitfinex'
geo: 'HK'
defaultCurrency: 'HKD'
website: 'https://www.bitfinex.com/'
api:
type: 'REST'
# uri: 'https://api.bitcoinaverage.com/exchanges/USD'
uri: 'https://query.yahooapis.com/v1/public/yql?q=select%20*%20from%20json%20where%20url%20%3D%20%22https%3A%2F%2Fapi.bitfinex.com%2Fv1%2Fticker%2Fbtcusd%22&format=json&callback='
rateLimit: 1000 * 5
fetched:
initialized: false
data: data | true | #fetched =
# current:
# last: null
# spread: null
# volume: null
# updateTime: null
# error: null
# previous:
# last: null
# spread: null
# volume: null
# updateTime: null
# error: null
angular.module('CaApp').factory 'exchangeSvc', () ->
data =
mtgox:
id: 'mtgox' # based on bitcoinaverage
order: 1 # always 1st
show: true
displayNameEng: 'PI:NAME:<NAME>END_PI. Gox'
geo: "JP" # ISO 3166-1
defaultCurrency: 'USD'
website: 'https://mtgox.com/'
api:
# type: 'ws'
# uri: 'http://socketio.mtgox.com:80/mtgox?Currency=USD'
type: 'REST'
uri: 'https://data.mtgox.com/api/2/BTCUSD/money/ticker_fast' # REST api - https://bitbucket.org/nitrous/mtgox-api
rateLimit: 1005
fetched:
initialized: false
btcchina:
id: 'btcchina'
order: 3
show: true
displayNameEng: 'BTC China'
displayNameLocal: '比特币中国'
defaultCurrency: 'CNY'
website: 'https://btcchina.com'
api:
type: 'REST'
uri: 'https://data.btcchina.com/data/ticker'
rateLimit: 1000 * 5
fetched:
initialized: false
localbitcoins:
id: 'localbitcoins'
order: 4
show: true
displayNameEng: 'LocalBitcoins'
defaultCurrency: 'USD'
website: 'https://localbitcoins.com'
api:
type: 'REST'
# uri: 'https://api.bitcoinaverage.com/exchanges/USD' # appears to pull avg_3h
# uri: 'https://localbitcoins.com/bitcoinaverage/ticker-all-currencies/' # no CORS
uri: 'https://query.yahooapis.com/v1/public/yql?q=select%20*%20from%20json%20where%20url%20%3D%20%22https%3A%2F%2Flocalbitcoins.com%2Fbitcoinaverage%2Fticker-all-currencies%2F%22&format=json&callback='
# yql
rateLimit: 1000 * 5
fetched:
initialized: false
btce:
id: 'btce'
order: 2
show: true
displayNameEng: 'PI:NAME:<NAME>END_PI'
geo: 'BG'
defaultCurrency: 'USD'
website: 'https://btc-e.com/'
api:
type: 'REST'
# uri: 'https://api.bitcoinaverage.com/exchanges/USD'
# uri: 'https://btc-e.com/api/2/btc_usd/ticker' # no CORS no JSONP
uri: 'https://query.yahooapis.com/v1/public/yql?q=select%20*%20from%20json%20where%20url%20%3D%20%22https%3A%2F%2Fbtc-e.com%2Fapi%2F2%2Fbtc_usd%2Fticker%22&format=json&callback='
# yql, no diagnostics
rateLimit: 1000 * 5 # yql public 2k requests / hr
fetched:
initialized: false
bitstamp:
id: 'bitstamp'
order: 5
show: true
displayNameEng: 'Bitstamp'
geo: 'GB'
defaultCurrency: 'GBP'
website: 'https://www.bitstamp.net/'
api:
type: 'REST'
uri: 'https://api.bitcoinaverage.com/exchanges/USD'
# no cors, 403 when pulled via yql
rateLimit: 1001 * 60
fetched:
initialized: false
bitfinex:
id: 'bitfinex'
order: 6
show: true
displayNameEng: 'Bitfinex'
geo: 'HK'
defaultCurrency: 'HKD'
website: 'https://www.bitfinex.com/'
api:
type: 'REST'
# uri: 'https://api.bitcoinaverage.com/exchanges/USD'
uri: 'https://query.yahooapis.com/v1/public/yql?q=select%20*%20from%20json%20where%20url%20%3D%20%22https%3A%2F%2Fapi.bitfinex.com%2Fv1%2Fticker%2Fbtcusd%22&format=json&callback='
rateLimit: 1000 * 5
fetched:
initialized: false
data: data |
[
{
"context": " {\n type: 'text'\n body: '<p>Bob Olsen</p>'\n }\n ]\n contributing_a",
"end": 3063,
"score": 0.9997871518135071,
"start": 3054,
"tag": "NAME",
"value": "Bob Olsen"
},
{
"context": " artists: [{\n name: \"Govinda Sah 'Azad'\",\n slug: \"govinda-sah-aza",
"end": 4075,
"score": 0.9996369481086731,
"start": 4064,
"tag": "NAME",
"value": "Govinda Sah"
},
{
"context": "artists: [{\n name: \"Govinda Sah 'Azad'\",\n slug: \"govinda-sah-azad\"\n ",
"end": 4081,
"score": 0.859329104423523,
"start": 4077,
"tag": "NAME",
"value": "Azad"
},
{
"context": " },\n {\n name: \"Andy Warhol\",\n slug: \"andy-warhol\"\n ",
"end": 4201,
"score": 0.9997174739837646,
"start": 4190,
"tag": "NAME",
"value": "Andy Warhol"
},
{
"context": "ame: \"Andy Warhol\",\n slug: \"andy-warhol\"\n }]\n },{\n ",
"end": 4237,
"score": 0.580159068107605,
"start": 4234,
"tag": "USERNAME",
"value": "war"
},
{
"context": "ql '/october-gallery'\n html.should.containEql \"Govinda Sah 'Azad'\"\n html.should.containEql \"Andy Warhol\"\n",
"end": 4859,
"score": 0.9872739911079407,
"start": 4848,
"tag": "NAME",
"value": "Govinda Sah"
},
{
"context": "gallery'\n html.should.containEql \"Govinda Sah 'Azad'\"\n html.should.containEql \"Andy Warhol\"\n ht",
"end": 4865,
"score": 0.7372286319732666,
"start": 4861,
"tag": "NAME",
"value": "Azad"
},
{
"context": " \"Govinda Sah 'Azad'\"\n html.should.containEql \"Andy Warhol\"\n html.should.containEql '<p>Some cool art fro",
"end": 4907,
"score": 0.9957647919654846,
"start": 4896,
"tag": "NAME",
"value": "Andy Warhol"
}
] | src/desktop/components/article/test/templates.coffee | kanaabe/force | 1 | _ = require 'underscore'
_s = require 'underscore.string'
cheerio = require 'cheerio'
embed = require 'particle'
path = require 'path'
jade = require 'jade'
fs = require 'fs'
moment = require 'moment'
markdown = require '../../../components/util/markdown'
Article = require '../../../models/article'
Articles = require '../../../collections/articles'
fixtures = require '../../../test/helpers/fixtures.coffee'
render = (templateName) ->
filename = path.resolve __dirname, "../templates/#{templateName}.jade"
jade.compile(
fs.readFileSync(filename),
{ filename: filename }
)
describe 'article show template', ->
it 'renders sectionless articles', ->
html = render('index')
article: new Article title: 'hi', sections: [], section_ids: [], contributing_authors: []
footerArticles: new Articles
crop: (url) -> url
resize: (u) -> u
moment: moment
sd: {}
asset: ->
html.should.containEql 'hi'
it 'renders hero section with static image', ->
html = render('index')
article: new Article
title: 'hi'
sections: []
contributing_authors: []
hero_section:
type: 'image'
url: 'http://image.jpg'
footerArticles: new Articles
crop: (url) -> url
resize: (u) -> u
moment: moment
sd: {}
asset: ->
_s: _s
html.should.containEql '<img src="http://image.jpg"'
html.should.containEql 'class="article-large-format-image"'
it 'renders hero section with multiple images', ->
html = render('index')
article: new Article
title: 'hi'
sections: []
contributing_authors: []
hero_section:
type: 'image_collection'
images: [
{
type: 'image'
url: 'http://image1.jpg'
}
{
type: 'image'
url: 'http://image2.jpg'
}
]
footerArticles: new Articles
crop: (url) -> url
resize: (u) -> u
moment: moment
sd: {}
asset: ->
_s: _s
html.should.containEql '<img src="http://image1.jpg"'
html.should.containEql '<img src="http://image2.jpg"'
html.should.containEql 'class="article-large-format-image"'
it 'renders hero section with video', ->
html = render('index')
article: new Article
title: 'hi'
sections: []
contributing_authors: []
hero_section:
type: 'video'
url: 'https://www.youtube.com/watch?v=Bv_5Zv5c-Ts'
footerArticles: new Articles
crop: (url) -> url
resize: (u) -> u
moment: moment
sd: {}
asset: ->
embed: embed
html.should.containEql '<iframe src="//www.youtube.com/embed/Bv_5Zv5c-Ts'
html.should.containEql 'class="article-large-format-video-container"'
it 'can optionally exclude share buttons', ->
html = render('index')
article: new Article
title: 'hi'
sections: [
{
type: 'text'
body: '<p>Bob Olsen</p>'
}
]
contributing_authors: []
footerArticles: new Articles
hideShare: true
crop: (url) -> url
resize: (u) -> u
moment: moment
sd: {}
asset: ->
html.should.not.containEql 'share'
it 'renders image collections', ->
html = render('index')
article: new Article
title: 'hi'
sections: [
{
type: 'image_collection',
layout: 'overflow_fillwidth',
images: [
{
type: 'artwork'
id: '5321b73dc9dc2458c4000196'
slug: "govinda-sah-azad-in-between-1",
date: "2015",
title: "In Between",
image: "https://d32dm0rphc51dk.cloudfront.net/zjr8iMxGUQAVU83wi_oXaQ/larger.jpg",
partner: {
name: "October Gallery",
slug: "october-gallery"
},
artists: [{
name: "Govinda Sah 'Azad'",
slug: "govinda-sah-azad"
},
{
name: "Andy Warhol",
slug: "andy-warhol"
}]
},{
type: 'image'
url: "http://artsy.net/image.jpg",
caption: "<p>Some cool art from 2015</p>",
}
]
}
]
contributing_authors: []
footerArticles: new Articles
crop: (url) -> url
resize: (u) -> u
moment: moment
sd: {}
asset: ->
_s: _s
html.should.containEql '/artwork/govinda-sah-azad-in-between-1'
html.should.containEql 'http://artsy.net/image.jpg'
html.should.containEql '/october-gallery'
html.should.containEql "Govinda Sah 'Azad'"
html.should.containEql "Andy Warhol"
html.should.containEql '<p>Some cool art from 2015</p>'
| 157657 | _ = require 'underscore'
_s = require 'underscore.string'
cheerio = require 'cheerio'
embed = require 'particle'
path = require 'path'
jade = require 'jade'
fs = require 'fs'
moment = require 'moment'
markdown = require '../../../components/util/markdown'
Article = require '../../../models/article'
Articles = require '../../../collections/articles'
fixtures = require '../../../test/helpers/fixtures.coffee'
render = (templateName) ->
filename = path.resolve __dirname, "../templates/#{templateName}.jade"
jade.compile(
fs.readFileSync(filename),
{ filename: filename }
)
describe 'article show template', ->
it 'renders sectionless articles', ->
html = render('index')
article: new Article title: 'hi', sections: [], section_ids: [], contributing_authors: []
footerArticles: new Articles
crop: (url) -> url
resize: (u) -> u
moment: moment
sd: {}
asset: ->
html.should.containEql 'hi'
it 'renders hero section with static image', ->
html = render('index')
article: new Article
title: 'hi'
sections: []
contributing_authors: []
hero_section:
type: 'image'
url: 'http://image.jpg'
footerArticles: new Articles
crop: (url) -> url
resize: (u) -> u
moment: moment
sd: {}
asset: ->
_s: _s
html.should.containEql '<img src="http://image.jpg"'
html.should.containEql 'class="article-large-format-image"'
it 'renders hero section with multiple images', ->
html = render('index')
article: new Article
title: 'hi'
sections: []
contributing_authors: []
hero_section:
type: 'image_collection'
images: [
{
type: 'image'
url: 'http://image1.jpg'
}
{
type: 'image'
url: 'http://image2.jpg'
}
]
footerArticles: new Articles
crop: (url) -> url
resize: (u) -> u
moment: moment
sd: {}
asset: ->
_s: _s
html.should.containEql '<img src="http://image1.jpg"'
html.should.containEql '<img src="http://image2.jpg"'
html.should.containEql 'class="article-large-format-image"'
it 'renders hero section with video', ->
html = render('index')
article: new Article
title: 'hi'
sections: []
contributing_authors: []
hero_section:
type: 'video'
url: 'https://www.youtube.com/watch?v=Bv_5Zv5c-Ts'
footerArticles: new Articles
crop: (url) -> url
resize: (u) -> u
moment: moment
sd: {}
asset: ->
embed: embed
html.should.containEql '<iframe src="//www.youtube.com/embed/Bv_5Zv5c-Ts'
html.should.containEql 'class="article-large-format-video-container"'
it 'can optionally exclude share buttons', ->
html = render('index')
article: new Article
title: 'hi'
sections: [
{
type: 'text'
body: '<p><NAME></p>'
}
]
contributing_authors: []
footerArticles: new Articles
hideShare: true
crop: (url) -> url
resize: (u) -> u
moment: moment
sd: {}
asset: ->
html.should.not.containEql 'share'
it 'renders image collections', ->
html = render('index')
article: new Article
title: 'hi'
sections: [
{
type: 'image_collection',
layout: 'overflow_fillwidth',
images: [
{
type: 'artwork'
id: '5321b73dc9dc2458c4000196'
slug: "govinda-sah-azad-in-between-1",
date: "2015",
title: "In Between",
image: "https://d32dm0rphc51dk.cloudfront.net/zjr8iMxGUQAVU83wi_oXaQ/larger.jpg",
partner: {
name: "October Gallery",
slug: "october-gallery"
},
artists: [{
name: "<NAME> '<NAME>'",
slug: "govinda-sah-azad"
},
{
name: "<NAME>",
slug: "andy-warhol"
}]
},{
type: 'image'
url: "http://artsy.net/image.jpg",
caption: "<p>Some cool art from 2015</p>",
}
]
}
]
contributing_authors: []
footerArticles: new Articles
crop: (url) -> url
resize: (u) -> u
moment: moment
sd: {}
asset: ->
_s: _s
html.should.containEql '/artwork/govinda-sah-azad-in-between-1'
html.should.containEql 'http://artsy.net/image.jpg'
html.should.containEql '/october-gallery'
html.should.containEql "<NAME> '<NAME>'"
html.should.containEql "<NAME>"
html.should.containEql '<p>Some cool art from 2015</p>'
| true | _ = require 'underscore'
_s = require 'underscore.string'
cheerio = require 'cheerio'
embed = require 'particle'
path = require 'path'
jade = require 'jade'
fs = require 'fs'
moment = require 'moment'
markdown = require '../../../components/util/markdown'
Article = require '../../../models/article'
Articles = require '../../../collections/articles'
fixtures = require '../../../test/helpers/fixtures.coffee'
render = (templateName) ->
filename = path.resolve __dirname, "../templates/#{templateName}.jade"
jade.compile(
fs.readFileSync(filename),
{ filename: filename }
)
describe 'article show template', ->
it 'renders sectionless articles', ->
html = render('index')
article: new Article title: 'hi', sections: [], section_ids: [], contributing_authors: []
footerArticles: new Articles
crop: (url) -> url
resize: (u) -> u
moment: moment
sd: {}
asset: ->
html.should.containEql 'hi'
it 'renders hero section with static image', ->
html = render('index')
article: new Article
title: 'hi'
sections: []
contributing_authors: []
hero_section:
type: 'image'
url: 'http://image.jpg'
footerArticles: new Articles
crop: (url) -> url
resize: (u) -> u
moment: moment
sd: {}
asset: ->
_s: _s
html.should.containEql '<img src="http://image.jpg"'
html.should.containEql 'class="article-large-format-image"'
it 'renders hero section with multiple images', ->
html = render('index')
article: new Article
title: 'hi'
sections: []
contributing_authors: []
hero_section:
type: 'image_collection'
images: [
{
type: 'image'
url: 'http://image1.jpg'
}
{
type: 'image'
url: 'http://image2.jpg'
}
]
footerArticles: new Articles
crop: (url) -> url
resize: (u) -> u
moment: moment
sd: {}
asset: ->
_s: _s
html.should.containEql '<img src="http://image1.jpg"'
html.should.containEql '<img src="http://image2.jpg"'
html.should.containEql 'class="article-large-format-image"'
it 'renders hero section with video', ->
html = render('index')
article: new Article
title: 'hi'
sections: []
contributing_authors: []
hero_section:
type: 'video'
url: 'https://www.youtube.com/watch?v=Bv_5Zv5c-Ts'
footerArticles: new Articles
crop: (url) -> url
resize: (u) -> u
moment: moment
sd: {}
asset: ->
embed: embed
html.should.containEql '<iframe src="//www.youtube.com/embed/Bv_5Zv5c-Ts'
html.should.containEql 'class="article-large-format-video-container"'
it 'can optionally exclude share buttons', ->
html = render('index')
article: new Article
title: 'hi'
sections: [
{
type: 'text'
body: '<p>PI:NAME:<NAME>END_PI</p>'
}
]
contributing_authors: []
footerArticles: new Articles
hideShare: true
crop: (url) -> url
resize: (u) -> u
moment: moment
sd: {}
asset: ->
html.should.not.containEql 'share'
it 'renders image collections', ->
html = render('index')
article: new Article
title: 'hi'
sections: [
{
type: 'image_collection',
layout: 'overflow_fillwidth',
images: [
{
type: 'artwork'
id: '5321b73dc9dc2458c4000196'
slug: "govinda-sah-azad-in-between-1",
date: "2015",
title: "In Between",
image: "https://d32dm0rphc51dk.cloudfront.net/zjr8iMxGUQAVU83wi_oXaQ/larger.jpg",
partner: {
name: "October Gallery",
slug: "october-gallery"
},
artists: [{
name: "PI:NAME:<NAME>END_PI 'PI:NAME:<NAME>END_PI'",
slug: "govinda-sah-azad"
},
{
name: "PI:NAME:<NAME>END_PI",
slug: "andy-warhol"
}]
},{
type: 'image'
url: "http://artsy.net/image.jpg",
caption: "<p>Some cool art from 2015</p>",
}
]
}
]
contributing_authors: []
footerArticles: new Articles
crop: (url) -> url
resize: (u) -> u
moment: moment
sd: {}
asset: ->
_s: _s
html.should.containEql '/artwork/govinda-sah-azad-in-between-1'
html.should.containEql 'http://artsy.net/image.jpg'
html.should.containEql '/october-gallery'
html.should.containEql "PI:NAME:<NAME>END_PI 'PI:NAME:<NAME>END_PI'"
html.should.containEql "PI:NAME:<NAME>END_PI"
html.should.containEql '<p>Some cool art from 2015</p>'
|
[
{
"context": "###\n * https://github.com/jkuetemeier/gulp-tasks-common\n *\n * Copyright (c) 2014 Jörg K",
"end": 37,
"score": 0.9983522295951843,
"start": 26,
"tag": "USERNAME",
"value": "jkuetemeier"
},
{
"context": "temeier/gulp-tasks-common\n *\n * Copyright (c) 2014 Jörg Kütemeier\n * Licensed under the MIT license.\n###\n\nmodule.ex",
"end": 95,
"score": 0.9998857975006104,
"start": 81,
"tag": "NAME",
"value": "Jörg Kütemeier"
}
] | test/tools/requireuncached.coffee | kuetemeier/gulp-tasks-common | 0 | ###
* https://github.com/jkuetemeier/gulp-tasks-common
*
* Copyright (c) 2014 Jörg Kütemeier
* Licensed under the MIT license.
###
module.exports = (module) ->
delete require.cache[require.resolve(module)]
return require module
| 89941 | ###
* https://github.com/jkuetemeier/gulp-tasks-common
*
* Copyright (c) 2014 <NAME>
* Licensed under the MIT license.
###
module.exports = (module) ->
delete require.cache[require.resolve(module)]
return require module
| true | ###
* https://github.com/jkuetemeier/gulp-tasks-common
*
* Copyright (c) 2014 PI:NAME:<NAME>END_PI
* Licensed under the MIT license.
###
module.exports = (module) ->
delete require.cache[require.resolve(module)]
return require module
|
[
{
"context": "9036/ to try it out\n##\n## the password for test is asdf ;-)\n##\n##\n\ntry\n __SECRET = floyd.tools.files.r",
"end": 384,
"score": 0.9915915727615356,
"start": 380,
"tag": "PASSWORD",
"value": "asdf"
},
{
"context": "T\n ##\n\n ##\n id: 'test'\n\n ## this method will be protected by",
"end": 2044,
"score": 0.5662358403205872,
"start": 2040,
"tag": "USERNAME",
"value": "test"
}
] | examples/auth/app.coffee | nero-networks/floyd | 0 | ##
## auth demo...
##
## to run this demo successfull the following conditions must be met:
##
## 1. the private folder must be user/group readonly
## try `chmod -R o-rwx ./private` (also done via floyd build)
##
## 2. the whole thing must be started as root
## try `sudo floyd start`
##
##
## navigate to http://locathost:9036/ to try it out
##
## the password for test is asdf ;-)
##
##
try
__SECRET = floyd.tools.files.read './private/secret.txt'
catch e
console.warn e.message
module.exports =
new floyd.Config 'config.gui.server', 'config.dnode.server',
UID: 33
GID: 33
##
data:
port: 9036
debug: true ## bloated scripts and html but faster startup
rewrite:
'^/((index.html)|(boot.js))?$': '/login/$1'
## some sanity checks on boot and on start.
## and loggings to point you with your nose into ;-)
booted: ()->
if process.getuid() isnt 0
@logger.error new Error 'FATAL: you are not root! run sudo floyd start'
##
started: ->
if _secret = floyd.tools.files.exists './private/secret.txt'
@logger.error new Error 'FATAL: the file ./private/secret.txt is readable'
if _users = floyd.tools.files.exists './private/users.data'
@logger.error new Error 'FATAL: the file ./private/users.data is readable', if _secret then 'too!' else ''
if !_secret && !_users
@logger.info 'SUCCESS: userdata and secret are protected propperly.'
children: [
##
## configure the users DB to readonly from file ./private/users.data
##
##
id: 'users'
##
data:
readonly: true, debug: false, type: 'file', path: './private', name: 'users'
,
##
## add the backend client for protected access to __SECRET
##
##
id: 'test'
## this method will be protected by the following permissionset
secret: (fn)->
fn null, __SECRET
##
permissions: ## the permissionset to be used by Controllable._permitAccess
## only users with the role tester may access the method secret
secret:
roles: 'tester'
,
##
## define a gui context for /login/ (rewritten from "/")
##
type: 'gui.HttpContext'
##
data:
route: '/login/'
file: '/index.html'
##
remote:
##
type: 'dnode.Bridge'
##
children: [
##
id: 'login'
##
type: 'LoginForm'
,
##
type: 'gui.ViewContext'
##
template: ->
button style:'display: none', 'click for secret'
##
running: ->
@identity.on 'login', ()=>
@__root.removeAttr 'style'
##
wiring: ->
@identity.on 'logout', ()=>
@__root.hide()
@__root.click =>
@lookup 'test', @identity, (err, test)->
test.secret (err, secret)->
return alert(err.message) if err
alert secret
]
]
| 130787 | ##
## auth demo...
##
## to run this demo successfull the following conditions must be met:
##
## 1. the private folder must be user/group readonly
## try `chmod -R o-rwx ./private` (also done via floyd build)
##
## 2. the whole thing must be started as root
## try `sudo floyd start`
##
##
## navigate to http://locathost:9036/ to try it out
##
## the password for test is <PASSWORD> ;-)
##
##
try
__SECRET = floyd.tools.files.read './private/secret.txt'
catch e
console.warn e.message
module.exports =
new floyd.Config 'config.gui.server', 'config.dnode.server',
UID: 33
GID: 33
##
data:
port: 9036
debug: true ## bloated scripts and html but faster startup
rewrite:
'^/((index.html)|(boot.js))?$': '/login/$1'
## some sanity checks on boot and on start.
## and loggings to point you with your nose into ;-)
booted: ()->
if process.getuid() isnt 0
@logger.error new Error 'FATAL: you are not root! run sudo floyd start'
##
started: ->
if _secret = floyd.tools.files.exists './private/secret.txt'
@logger.error new Error 'FATAL: the file ./private/secret.txt is readable'
if _users = floyd.tools.files.exists './private/users.data'
@logger.error new Error 'FATAL: the file ./private/users.data is readable', if _secret then 'too!' else ''
if !_secret && !_users
@logger.info 'SUCCESS: userdata and secret are protected propperly.'
children: [
##
## configure the users DB to readonly from file ./private/users.data
##
##
id: 'users'
##
data:
readonly: true, debug: false, type: 'file', path: './private', name: 'users'
,
##
## add the backend client for protected access to __SECRET
##
##
id: 'test'
## this method will be protected by the following permissionset
secret: (fn)->
fn null, __SECRET
##
permissions: ## the permissionset to be used by Controllable._permitAccess
## only users with the role tester may access the method secret
secret:
roles: 'tester'
,
##
## define a gui context for /login/ (rewritten from "/")
##
type: 'gui.HttpContext'
##
data:
route: '/login/'
file: '/index.html'
##
remote:
##
type: 'dnode.Bridge'
##
children: [
##
id: 'login'
##
type: 'LoginForm'
,
##
type: 'gui.ViewContext'
##
template: ->
button style:'display: none', 'click for secret'
##
running: ->
@identity.on 'login', ()=>
@__root.removeAttr 'style'
##
wiring: ->
@identity.on 'logout', ()=>
@__root.hide()
@__root.click =>
@lookup 'test', @identity, (err, test)->
test.secret (err, secret)->
return alert(err.message) if err
alert secret
]
]
| true | ##
## auth demo...
##
## to run this demo successfull the following conditions must be met:
##
## 1. the private folder must be user/group readonly
## try `chmod -R o-rwx ./private` (also done via floyd build)
##
## 2. the whole thing must be started as root
## try `sudo floyd start`
##
##
## navigate to http://locathost:9036/ to try it out
##
## the password for test is PI:PASSWORD:<PASSWORD>END_PI ;-)
##
##
try
__SECRET = floyd.tools.files.read './private/secret.txt'
catch e
console.warn e.message
module.exports =
new floyd.Config 'config.gui.server', 'config.dnode.server',
UID: 33
GID: 33
##
data:
port: 9036
debug: true ## bloated scripts and html but faster startup
rewrite:
'^/((index.html)|(boot.js))?$': '/login/$1'
## some sanity checks on boot and on start.
## and loggings to point you with your nose into ;-)
booted: ()->
if process.getuid() isnt 0
@logger.error new Error 'FATAL: you are not root! run sudo floyd start'
##
started: ->
if _secret = floyd.tools.files.exists './private/secret.txt'
@logger.error new Error 'FATAL: the file ./private/secret.txt is readable'
if _users = floyd.tools.files.exists './private/users.data'
@logger.error new Error 'FATAL: the file ./private/users.data is readable', if _secret then 'too!' else ''
if !_secret && !_users
@logger.info 'SUCCESS: userdata and secret are protected propperly.'
children: [
##
## configure the users DB to readonly from file ./private/users.data
##
##
id: 'users'
##
data:
readonly: true, debug: false, type: 'file', path: './private', name: 'users'
,
##
## add the backend client for protected access to __SECRET
##
##
id: 'test'
## this method will be protected by the following permissionset
secret: (fn)->
fn null, __SECRET
##
permissions: ## the permissionset to be used by Controllable._permitAccess
## only users with the role tester may access the method secret
secret:
roles: 'tester'
,
##
## define a gui context for /login/ (rewritten from "/")
##
type: 'gui.HttpContext'
##
data:
route: '/login/'
file: '/index.html'
##
remote:
##
type: 'dnode.Bridge'
##
children: [
##
id: 'login'
##
type: 'LoginForm'
,
##
type: 'gui.ViewContext'
##
template: ->
button style:'display: none', 'click for secret'
##
running: ->
@identity.on 'login', ()=>
@__root.removeAttr 'style'
##
wiring: ->
@identity.on 'logout', ()=>
@__root.hide()
@__root.click =>
@lookup 'test', @identity, (err, test)->
test.secret (err, secret)->
return alert(err.message) if err
alert secret
]
]
|
[
{
"context": "ions module unit tests\n#\n# Copyright (C) 2011-2013 Nikolay Nemshilov\n#\n{Test,should} = require('lovely')\n\nTest.set \"/m",
"end": 97,
"score": 0.9998873472213745,
"start": 80,
"tag": "NAME",
"value": "Nikolay Nemshilov"
}
] | stl/dom/test/element/manipulation_test.coffee | lovely-io/lovely.io-stl | 2 | #
# The Element dom-manipulations module unit tests
#
# Copyright (C) 2011-2013 Nikolay Nemshilov
#
{Test,should} = require('lovely')
Test.set "/manipulations.html": """
<html>
<head>
<script src="/core.js"></script>
<script src="/dom.js"></script>
</head>
<body>
<div id="test"></div>
</body>
</html>
"""
describe "Element Manipulations", ->
$ = element = window = document = null
beforeEach Test.load '/manipulations.html', (dom, win)->
$ = dom
window = win
document = win.document
element = new $.Element(document.getElementById('test'))
describe "#clone()", ->
it "should clone content and attributes", ->
element._.innerHTML = "bla <b>bla</b> bla"
clone = element.clone()
clone._.innerHTML.should.eql element._.innerHTML
clone._.id.should.eql element._.id
it "should create a new instance of Element", ->
element.clone().should.be.instanceOf $.Element
it "should attach a new dom-element in it", ->
element.clone()._.should.not.equal element._
describe "#clear()", ->
it "should remove all the child elements", ->
element._.innerHTML = 'some <b>content</b>'
element.clear()
element._.innerHTML.should.equal ''
it "should return the element itself back", ->
element.clear().should.equal element
describe "#empty()", ->
it "should say 'true' for an empty element", ->
element._.innerHTML = ''
element.empty().should.be.true
it "should say 'true' for an element with spaces only", ->
element._.innerHTML = " \n\t\n "
element.empty().should.be.true
it "should say 'false' for an element with actual content", ->
element._.innerHTML = '0'
element.empty().should.be.false
describe "#html()", ->
it "should return the element's innerHTML", ->
element._.innerHTML = 'some <b>content</b>'
element.html().should.equal 'some <b>content</b>'
describe "#html('content')", ->
it "should assign the new content", ->
element.html('some <b>new</b> content')
element._.innerHTML.should.equal 'some <b>new</b> content'
it "should return element itself back", ->
element.html('boo hoo').should.equal element
describe "#text()", ->
it "should return the element's content as a text", ->
element._.innerHTML = 'some <b>inner <u>text</u></b>'
element.text().should.equal 'some inner text'
it "should convert HTML escapees into normal chars", ->
element._.innerHTML = 'Beevis & Butthead'
element.text().should.equal 'Beevis & Butthead'
describe "#text('content')", ->
it "should assign the text and escape special chars", ->
element.text('<b>Beevis</b> & <u>Butthead</u>')
element._.innerHTML.should.equal '<b>Beevis</b> & <u>Butthead</u>'
it "should return the element itself back", ->
element.text('boo hoo').should.equal element
describe "#remove()", ->
it "should remove the element out of it's parent element", ->
dummy = new $.Element('div', html: 'dummy')
element._.innerHTML = ''
element._.appendChild(dummy._)
dummy.remove()
element._.innerHTML.should.equal ''
it "should return the element itself back", ->
element.remove().should.equal element
describe "#replace('some content')", ->
it "should replace itself with a given content", ->
dummy = new $.Element('div', html: 'dummy')
element.clear()._.appendChild(dummy._)
result = dummy.replace('some text')
element._.innerHTML.should.equal 'some text'
result.should.equal dummy
describe "#update(...)", ->
it "should replace all the element's content", ->
element._.innerHTML = 'old content'
element.update('new content')
element._.innerHTML.should.equal 'new content'
it "should accept dom-wrappers as an argument", ->
dummy = new $.Element('div', html: 'dummy')
element.update(dummy)
element._.innerHTML.should.equal '<div>dummy</div>'
it "should accept raw dom-elements", ->
dummy = new $.Element('div', html: 'dummy')
element.update(dummy._)
element._.innerHTML.should.equal '<div>dummy</div>'
it "should accept arrays of elements", ->
dummy = new $.Element('div', html: 'dummy')
element.update([dummy])
element._.innerHTML.should.equal '<div>dummy</div>'
it "should accept numbers as values", ->
element.update 888
element._.innerHTML.should.equal '888'
it "should eval any embedded scripts", ->
element.update """
bla bla bla
<script>var test1 = 'test-1'</script>
trololo
<script type="text/javascript">
var test2 = 'test-2';
</script>
it """
window.test1.should.equal 'test-1'
window.test2.should.equal 'test-2'
it "should cut out all the scripts when it updates an element", ->
element.update """
bla bla bla
<script>
//<![CDATA[
Lovely(['dom'], function($) {
$('#opinions a.add').emit('click');
});
//]]>
</script>
"""
element._.innerHTML.should.equal """
bla bla bla
"""
it "should return the element itself back", ->
element.update('text').should.equal element
describe "#append(item, item, item)", ->
it "should append elements to the end", ->
dummy = new $.Element('div', html: 'dummy')
element._.innerHTML = '<b>boo</b>'
element.append dummy, new $.Element('div', html: 'new')
element._.innerHTML.should.equal '<b>boo</b><div>dummy</div><div>new</div>'
it "should append strings to the end", ->
element._.innerHTML = '<b>boo</b>'
element.append '<i>eee</i>', '<u>uuu</u>'
element._.innerHTML.should.equal '<b>boo</b><i>eee</i><u>uuu</u>'
describe "#insertTo(...)", ->
it "should insert it into the specified elements", ->
dummy = new $.Element('div', html: 'dummy')
element._.innerHTML = ''
dummy.insertTo(element)
element._.innerHTML.should.equal '<div>dummy</div>'
it "should insert it into raw dom-elements", ->
dummy = new $.Element('div', html: 'dummy')
element._.innerHTML = ''
dummy.insertTo(element._)
element._.innerHTML.should.equal '<div>dummy</div>'
it "should insert it into elements by '#element-id'", ->
dummy = new $.Element('div', html: 'dummy')
element._.innerHTML = ''
dummy.insertTo('#test')
element._.innerHTML.should.equal '<div>dummy</div>'
it "should return the element itself back", ->
dummy = new $.Element('div', html: 'dummy')
dummy.insertTo('#test').should.be.equal dummy
describe "#insert(...)", ->
it "should insert dom-wrappers", ->
dummy = new $.Element('div', html: 'dummy')
element.clear().insert(dummy)
element._.innerHTML.should.equal '<div>dummy</div>'
it "should insert raw dom-elements", ->
dummy = new $.Element('div', html: 'dummy')
element.clear().insert(dummy)
element._.innerHTML.should.equal '<div>dummy</div>'
it "should insert arrays of elements", ->
dummy = new $.Element('div', html: 'dummy')
element.clear().insert([dummy])
element._.innerHTML.should.equal '<div>dummy</div>'
it "should insert plain html content", ->
element.clear().insert('<b>dummy</b>')
element._.innerHTML.should.equal '<b>dummy</b>'
it "should insert numerical data", ->
element.clear().insert 4.44
element._.innerHTML.should.equal '4.44'
it "should return element itself back", ->
element.insert('something').should.equal element
it "should allow insert on top of the elements", ->
dummy = new $.Element('div', html: 'dummy')
element._.innerHTML = "<b>boo</b>"
element.insert(dummy, 'top')
element._.innerHTML.should.equal '<div>dummy</div><b>boo</b>'
it "should allow to insert an element before another", ->
dummy = new $.Element('div', html: 'dummy')
element.clear().insert(dummy)
dummy.insert(new $.Element('b', html: 'boo'), 'before')
element._.innerHTML.should.equal '<b>boo</b><div>dummy</div>'
it "should allow to insert things after the element", ->
dummy = new $.Element('div', html: 'dummy')
element.clear().insert(dummy)
dummy.insert(new $.Element('b', html: 'boo'), 'after')
element._.innerHTML.should.equal '<div>dummy</div><b>boo</b>'
it "should allow to insert things instead of the element", ->
dummy = new $.Element('div', html: 'dummy')
element.clear().insert(dummy)
dummy.insert(new $.Element('b', html: 'boo'), 'instead')
element._.innerHTML.should.equal '<b>boo</b>'
| 36023 | #
# The Element dom-manipulations module unit tests
#
# Copyright (C) 2011-2013 <NAME>
#
{Test,should} = require('lovely')
Test.set "/manipulations.html": """
<html>
<head>
<script src="/core.js"></script>
<script src="/dom.js"></script>
</head>
<body>
<div id="test"></div>
</body>
</html>
"""
describe "Element Manipulations", ->
$ = element = window = document = null
beforeEach Test.load '/manipulations.html', (dom, win)->
$ = dom
window = win
document = win.document
element = new $.Element(document.getElementById('test'))
describe "#clone()", ->
it "should clone content and attributes", ->
element._.innerHTML = "bla <b>bla</b> bla"
clone = element.clone()
clone._.innerHTML.should.eql element._.innerHTML
clone._.id.should.eql element._.id
it "should create a new instance of Element", ->
element.clone().should.be.instanceOf $.Element
it "should attach a new dom-element in it", ->
element.clone()._.should.not.equal element._
describe "#clear()", ->
it "should remove all the child elements", ->
element._.innerHTML = 'some <b>content</b>'
element.clear()
element._.innerHTML.should.equal ''
it "should return the element itself back", ->
element.clear().should.equal element
describe "#empty()", ->
it "should say 'true' for an empty element", ->
element._.innerHTML = ''
element.empty().should.be.true
it "should say 'true' for an element with spaces only", ->
element._.innerHTML = " \n\t\n "
element.empty().should.be.true
it "should say 'false' for an element with actual content", ->
element._.innerHTML = '0'
element.empty().should.be.false
describe "#html()", ->
it "should return the element's innerHTML", ->
element._.innerHTML = 'some <b>content</b>'
element.html().should.equal 'some <b>content</b>'
describe "#html('content')", ->
it "should assign the new content", ->
element.html('some <b>new</b> content')
element._.innerHTML.should.equal 'some <b>new</b> content'
it "should return element itself back", ->
element.html('boo hoo').should.equal element
describe "#text()", ->
it "should return the element's content as a text", ->
element._.innerHTML = 'some <b>inner <u>text</u></b>'
element.text().should.equal 'some inner text'
it "should convert HTML escapees into normal chars", ->
element._.innerHTML = 'Beevis & Butthead'
element.text().should.equal 'Beevis & Butthead'
describe "#text('content')", ->
it "should assign the text and escape special chars", ->
element.text('<b>Beevis</b> & <u>Butthead</u>')
element._.innerHTML.should.equal '<b>Beevis</b> & <u>Butthead</u>'
it "should return the element itself back", ->
element.text('boo hoo').should.equal element
describe "#remove()", ->
it "should remove the element out of it's parent element", ->
dummy = new $.Element('div', html: 'dummy')
element._.innerHTML = ''
element._.appendChild(dummy._)
dummy.remove()
element._.innerHTML.should.equal ''
it "should return the element itself back", ->
element.remove().should.equal element
describe "#replace('some content')", ->
it "should replace itself with a given content", ->
dummy = new $.Element('div', html: 'dummy')
element.clear()._.appendChild(dummy._)
result = dummy.replace('some text')
element._.innerHTML.should.equal 'some text'
result.should.equal dummy
describe "#update(...)", ->
it "should replace all the element's content", ->
element._.innerHTML = 'old content'
element.update('new content')
element._.innerHTML.should.equal 'new content'
it "should accept dom-wrappers as an argument", ->
dummy = new $.Element('div', html: 'dummy')
element.update(dummy)
element._.innerHTML.should.equal '<div>dummy</div>'
it "should accept raw dom-elements", ->
dummy = new $.Element('div', html: 'dummy')
element.update(dummy._)
element._.innerHTML.should.equal '<div>dummy</div>'
it "should accept arrays of elements", ->
dummy = new $.Element('div', html: 'dummy')
element.update([dummy])
element._.innerHTML.should.equal '<div>dummy</div>'
it "should accept numbers as values", ->
element.update 888
element._.innerHTML.should.equal '888'
it "should eval any embedded scripts", ->
element.update """
bla bla bla
<script>var test1 = 'test-1'</script>
trololo
<script type="text/javascript">
var test2 = 'test-2';
</script>
it """
window.test1.should.equal 'test-1'
window.test2.should.equal 'test-2'
it "should cut out all the scripts when it updates an element", ->
element.update """
bla bla bla
<script>
//<![CDATA[
Lovely(['dom'], function($) {
$('#opinions a.add').emit('click');
});
//]]>
</script>
"""
element._.innerHTML.should.equal """
bla bla bla
"""
it "should return the element itself back", ->
element.update('text').should.equal element
describe "#append(item, item, item)", ->
it "should append elements to the end", ->
dummy = new $.Element('div', html: 'dummy')
element._.innerHTML = '<b>boo</b>'
element.append dummy, new $.Element('div', html: 'new')
element._.innerHTML.should.equal '<b>boo</b><div>dummy</div><div>new</div>'
it "should append strings to the end", ->
element._.innerHTML = '<b>boo</b>'
element.append '<i>eee</i>', '<u>uuu</u>'
element._.innerHTML.should.equal '<b>boo</b><i>eee</i><u>uuu</u>'
describe "#insertTo(...)", ->
it "should insert it into the specified elements", ->
dummy = new $.Element('div', html: 'dummy')
element._.innerHTML = ''
dummy.insertTo(element)
element._.innerHTML.should.equal '<div>dummy</div>'
it "should insert it into raw dom-elements", ->
dummy = new $.Element('div', html: 'dummy')
element._.innerHTML = ''
dummy.insertTo(element._)
element._.innerHTML.should.equal '<div>dummy</div>'
it "should insert it into elements by '#element-id'", ->
dummy = new $.Element('div', html: 'dummy')
element._.innerHTML = ''
dummy.insertTo('#test')
element._.innerHTML.should.equal '<div>dummy</div>'
it "should return the element itself back", ->
dummy = new $.Element('div', html: 'dummy')
dummy.insertTo('#test').should.be.equal dummy
describe "#insert(...)", ->
it "should insert dom-wrappers", ->
dummy = new $.Element('div', html: 'dummy')
element.clear().insert(dummy)
element._.innerHTML.should.equal '<div>dummy</div>'
it "should insert raw dom-elements", ->
dummy = new $.Element('div', html: 'dummy')
element.clear().insert(dummy)
element._.innerHTML.should.equal '<div>dummy</div>'
it "should insert arrays of elements", ->
dummy = new $.Element('div', html: 'dummy')
element.clear().insert([dummy])
element._.innerHTML.should.equal '<div>dummy</div>'
it "should insert plain html content", ->
element.clear().insert('<b>dummy</b>')
element._.innerHTML.should.equal '<b>dummy</b>'
it "should insert numerical data", ->
element.clear().insert 4.44
element._.innerHTML.should.equal '4.44'
it "should return element itself back", ->
element.insert('something').should.equal element
it "should allow insert on top of the elements", ->
dummy = new $.Element('div', html: 'dummy')
element._.innerHTML = "<b>boo</b>"
element.insert(dummy, 'top')
element._.innerHTML.should.equal '<div>dummy</div><b>boo</b>'
it "should allow to insert an element before another", ->
dummy = new $.Element('div', html: 'dummy')
element.clear().insert(dummy)
dummy.insert(new $.Element('b', html: 'boo'), 'before')
element._.innerHTML.should.equal '<b>boo</b><div>dummy</div>'
it "should allow to insert things after the element", ->
dummy = new $.Element('div', html: 'dummy')
element.clear().insert(dummy)
dummy.insert(new $.Element('b', html: 'boo'), 'after')
element._.innerHTML.should.equal '<div>dummy</div><b>boo</b>'
it "should allow to insert things instead of the element", ->
dummy = new $.Element('div', html: 'dummy')
element.clear().insert(dummy)
dummy.insert(new $.Element('b', html: 'boo'), 'instead')
element._.innerHTML.should.equal '<b>boo</b>'
| true | #
# The Element dom-manipulations module unit tests
#
# Copyright (C) 2011-2013 PI:NAME:<NAME>END_PI
#
{Test,should} = require('lovely')
Test.set "/manipulations.html": """
<html>
<head>
<script src="/core.js"></script>
<script src="/dom.js"></script>
</head>
<body>
<div id="test"></div>
</body>
</html>
"""
describe "Element Manipulations", ->
$ = element = window = document = null
beforeEach Test.load '/manipulations.html', (dom, win)->
$ = dom
window = win
document = win.document
element = new $.Element(document.getElementById('test'))
describe "#clone()", ->
it "should clone content and attributes", ->
element._.innerHTML = "bla <b>bla</b> bla"
clone = element.clone()
clone._.innerHTML.should.eql element._.innerHTML
clone._.id.should.eql element._.id
it "should create a new instance of Element", ->
element.clone().should.be.instanceOf $.Element
it "should attach a new dom-element in it", ->
element.clone()._.should.not.equal element._
describe "#clear()", ->
it "should remove all the child elements", ->
element._.innerHTML = 'some <b>content</b>'
element.clear()
element._.innerHTML.should.equal ''
it "should return the element itself back", ->
element.clear().should.equal element
describe "#empty()", ->
it "should say 'true' for an empty element", ->
element._.innerHTML = ''
element.empty().should.be.true
it "should say 'true' for an element with spaces only", ->
element._.innerHTML = " \n\t\n "
element.empty().should.be.true
it "should say 'false' for an element with actual content", ->
element._.innerHTML = '0'
element.empty().should.be.false
describe "#html()", ->
it "should return the element's innerHTML", ->
element._.innerHTML = 'some <b>content</b>'
element.html().should.equal 'some <b>content</b>'
describe "#html('content')", ->
it "should assign the new content", ->
element.html('some <b>new</b> content')
element._.innerHTML.should.equal 'some <b>new</b> content'
it "should return element itself back", ->
element.html('boo hoo').should.equal element
describe "#text()", ->
it "should return the element's content as a text", ->
element._.innerHTML = 'some <b>inner <u>text</u></b>'
element.text().should.equal 'some inner text'
it "should convert HTML escapees into normal chars", ->
element._.innerHTML = 'Beevis & Butthead'
element.text().should.equal 'Beevis & Butthead'
describe "#text('content')", ->
it "should assign the text and escape special chars", ->
element.text('<b>Beevis</b> & <u>Butthead</u>')
element._.innerHTML.should.equal '<b>Beevis</b> & <u>Butthead</u>'
it "should return the element itself back", ->
element.text('boo hoo').should.equal element
describe "#remove()", ->
it "should remove the element out of it's parent element", ->
dummy = new $.Element('div', html: 'dummy')
element._.innerHTML = ''
element._.appendChild(dummy._)
dummy.remove()
element._.innerHTML.should.equal ''
it "should return the element itself back", ->
element.remove().should.equal element
describe "#replace('some content')", ->
it "should replace itself with a given content", ->
dummy = new $.Element('div', html: 'dummy')
element.clear()._.appendChild(dummy._)
result = dummy.replace('some text')
element._.innerHTML.should.equal 'some text'
result.should.equal dummy
describe "#update(...)", ->
it "should replace all the element's content", ->
element._.innerHTML = 'old content'
element.update('new content')
element._.innerHTML.should.equal 'new content'
it "should accept dom-wrappers as an argument", ->
dummy = new $.Element('div', html: 'dummy')
element.update(dummy)
element._.innerHTML.should.equal '<div>dummy</div>'
it "should accept raw dom-elements", ->
dummy = new $.Element('div', html: 'dummy')
element.update(dummy._)
element._.innerHTML.should.equal '<div>dummy</div>'
it "should accept arrays of elements", ->
dummy = new $.Element('div', html: 'dummy')
element.update([dummy])
element._.innerHTML.should.equal '<div>dummy</div>'
it "should accept numbers as values", ->
element.update 888
element._.innerHTML.should.equal '888'
it "should eval any embedded scripts", ->
element.update """
bla bla bla
<script>var test1 = 'test-1'</script>
trololo
<script type="text/javascript">
var test2 = 'test-2';
</script>
it """
window.test1.should.equal 'test-1'
window.test2.should.equal 'test-2'
it "should cut out all the scripts when it updates an element", ->
element.update """
bla bla bla
<script>
//<![CDATA[
Lovely(['dom'], function($) {
$('#opinions a.add').emit('click');
});
//]]>
</script>
"""
element._.innerHTML.should.equal """
bla bla bla
"""
it "should return the element itself back", ->
element.update('text').should.equal element
describe "#append(item, item, item)", ->
it "should append elements to the end", ->
dummy = new $.Element('div', html: 'dummy')
element._.innerHTML = '<b>boo</b>'
element.append dummy, new $.Element('div', html: 'new')
element._.innerHTML.should.equal '<b>boo</b><div>dummy</div><div>new</div>'
it "should append strings to the end", ->
element._.innerHTML = '<b>boo</b>'
element.append '<i>eee</i>', '<u>uuu</u>'
element._.innerHTML.should.equal '<b>boo</b><i>eee</i><u>uuu</u>'
describe "#insertTo(...)", ->
it "should insert it into the specified elements", ->
dummy = new $.Element('div', html: 'dummy')
element._.innerHTML = ''
dummy.insertTo(element)
element._.innerHTML.should.equal '<div>dummy</div>'
it "should insert it into raw dom-elements", ->
dummy = new $.Element('div', html: 'dummy')
element._.innerHTML = ''
dummy.insertTo(element._)
element._.innerHTML.should.equal '<div>dummy</div>'
it "should insert it into elements by '#element-id'", ->
dummy = new $.Element('div', html: 'dummy')
element._.innerHTML = ''
dummy.insertTo('#test')
element._.innerHTML.should.equal '<div>dummy</div>'
it "should return the element itself back", ->
dummy = new $.Element('div', html: 'dummy')
dummy.insertTo('#test').should.be.equal dummy
describe "#insert(...)", ->
it "should insert dom-wrappers", ->
dummy = new $.Element('div', html: 'dummy')
element.clear().insert(dummy)
element._.innerHTML.should.equal '<div>dummy</div>'
it "should insert raw dom-elements", ->
dummy = new $.Element('div', html: 'dummy')
element.clear().insert(dummy)
element._.innerHTML.should.equal '<div>dummy</div>'
it "should insert arrays of elements", ->
dummy = new $.Element('div', html: 'dummy')
element.clear().insert([dummy])
element._.innerHTML.should.equal '<div>dummy</div>'
it "should insert plain html content", ->
element.clear().insert('<b>dummy</b>')
element._.innerHTML.should.equal '<b>dummy</b>'
it "should insert numerical data", ->
element.clear().insert 4.44
element._.innerHTML.should.equal '4.44'
it "should return element itself back", ->
element.insert('something').should.equal element
it "should allow insert on top of the elements", ->
dummy = new $.Element('div', html: 'dummy')
element._.innerHTML = "<b>boo</b>"
element.insert(dummy, 'top')
element._.innerHTML.should.equal '<div>dummy</div><b>boo</b>'
it "should allow to insert an element before another", ->
dummy = new $.Element('div', html: 'dummy')
element.clear().insert(dummy)
dummy.insert(new $.Element('b', html: 'boo'), 'before')
element._.innerHTML.should.equal '<b>boo</b><div>dummy</div>'
it "should allow to insert things after the element", ->
dummy = new $.Element('div', html: 'dummy')
element.clear().insert(dummy)
dummy.insert(new $.Element('b', html: 'boo'), 'after')
element._.innerHTML.should.equal '<div>dummy</div><b>boo</b>'
it "should allow to insert things instead of the element", ->
dummy = new $.Element('div', html: 'dummy')
element.clear().insert(dummy)
dummy.insert(new $.Element('b', html: 'boo'), 'instead')
element._.innerHTML.should.equal '<b>boo</b>'
|
[
{
"context": " =\n region: 'fakeRegion'\n accessKeyId: 'fakeAccessKeyId'\n secretAccessKey: 'fakeSecretAccessKey'\n ",
"end": 903,
"score": 0.9601938724517822,
"start": 888,
"tag": "KEY",
"value": "fakeAccessKeyId"
},
{
"context": "sKeyId: 'fakeAccessKeyId'\n secretAccessKey: 'fakeSecretAccessKey'\n domain: 'fakeDomain'\n name: 'fakeWork",
"end": 948,
"score": 0.9690998196601868,
"start": 929,
"tag": "KEY",
"value": "fakeSecretAccessKey"
},
{
"context": "\n beforeEach ->\n expectedToken = 'fakeToken'\n\n expectedInput =\n someKey: ",
"end": 6924,
"score": 0.9014980792999268,
"start": 6915,
"tag": "KEY",
"value": "fakeToken"
}
] | test/fulfillmentWorker.unit.coffee | balihoo/node-fulfillment-worker | 0 | 'use strict'
assert = require 'assert'
aws = require 'aws-sdk'
sinon = require 'sinon'
Promise = require 'bluebird'
FulfillmentWorker = require '../lib/fulfillmentWorker'
activityStatus = require '../lib/activityStatus'
error = require '../lib/error'
mockDynamoDB = require './mocks/mockDynamoDB'
mockSWF = require './mocks/mockSWF'
mockSQS = require './mocks/mockSQS'
config = undefined
testRequiresConfigParameter = (config, propName) ->
delete config[propName]
try
new FulfillmentWorker config
assert.fail 'Expected a ConfigurationMissingError.'
catch err
assert err instanceof error.ConfigurationMissingError
assert.deepEqual err.missingProperties, [propName]
return
fakeLogger =
log: ->
info: ->
debug: ->
warn: ->
error: ->
describe 'FulfillmentWorker unit tests', ->
beforeEach ->
config =
region: 'fakeRegion'
accessKeyId: 'fakeAccessKeyId'
secretAccessKey: 'fakeSecretAccessKey'
domain: 'fakeDomain'
name: 'fakeWorkerName'
version: 'fakeWorkerVersion'
defaultTaskHeartbeatTimeout: 4000
defaultTaskScheduleToCloseTimeout: 400
defaultTaskScheduleToStartTimeout: 700
defaultTaskStartToCloseTimeout: 4700
workerStatusQueueName: "workerStatusTestQueue"
updateIntervalMs: 1000
parameterSchema: {}
resultSchema: {}
logger: fakeLogger
describe 'constructor', ->
beforeEach ->
sinon.stub aws, 'SQS', mockSQS
afterEach ->
aws.SQS.restore()
it 'Requires a config', ->
try
new FulfillmentWorker()
assert.fail 'Expected a ConfigurationMustBeObjectError.'
catch err
assert err instanceof error.ConfigurationMustBeObjectError
assert.strictEqual err.suppliedType, 'undefined'
it 'Requires that the config be an object', ->
try
new FulfillmentWorker('not an object')
assert.fail 'Expected a ConfigurationMustBeObjectError.'
catch err
assert err instanceof error.ConfigurationMustBeObjectError
assert.strictEqual err.suppliedType, 'string'
it 'Requires config.region', ->
testRequiresConfigParameter config, 'region'
it 'Requires config.domain', ->
testRequiresConfigParameter config, 'domain'
it 'Requires config.workerName', ->
testRequiresConfigParameter config, 'name'
it 'Requires config.workerVersion', ->
testRequiresConfigParameter config, 'version'
context 'When a logger is supplied', ->
it 'Uses the supplied logger', ->
worker = new FulfillmentWorker config
assert.strictEqual worker.logger, fakeLogger
context 'When a logger is not supplied', ->
it 'Uses console', ->
delete config.logger
worker = new FulfillmentWorker config
assert.strictEqual worker.logger, console
it 'Adds an API version to config', ->
new FulfillmentWorker(config)
assert.ok config.apiVersion
assert typeof config.apiVersion is 'string'
it 'Creates an instance ID', ->
worker = new FulfillmentWorker(config)
assert.ok worker.uuid
assert typeof worker.uuid is 'string'
it 'Creates an AWS SWF instance', ->
sinon.stub aws, 'SWF', mockSWF
worker = new FulfillmentWorker(config)
expectedConfig =
accessKeyId: config.accessKeyId
secretAccessKey: config.secretAccessKey
apiVersion: config.apiVersion
region: config.region
params:
domain: config.domain
name: config.name
version: config.version
assert aws.SWF.calledOnce
assert.deepEqual expectedConfig, worker.swfAdapter.swf.config
aws.SWF.restore()
describe 'workAsync', ->
worker = null
beforeEach ->
sinon.stub aws, 'DynamoDB', mockDynamoDB
sinon.stub aws, 'SWF', mockSWF
sinon.stub aws, 'SQS', mockSQS
worker = new FulfillmentWorker(config)
context 'prior to polling for work', ->
it 'checks for an existing ActivityType', (done) ->
expectedParams =
activityType:
name: config.name
version: config.version
worker.swfAdapter.swf.pollForActivityTask = ->
assert worker.swfAdapter.swf.describeActivityType.calledOnce
assert worker.swfAdapter.swf.describeActivityType.calledWith expectedParams
worker.stop()
.then ->
done()
worker.workAsync -> {}
context 'when the activity type is not found', ->
it 'registers the activity type', (done) ->
expectedParams =
defaultTaskHeartbeatTimeout: config.defaultTaskHeartbeatTimeout
defaultTaskScheduleToCloseTimeout: config.defaultTaskScheduleToCloseTimeout
defaultTaskScheduleToStartTimeout: config.defaultTaskScheduleToStartTimeout
defaultTaskStartToCloseTimeout: config.defaultTaskStartToCloseTimeout
worker.swfAdapter.swf.describeActivityType = sinon.spy ->
err = Error('Loud noises!')
err.cause =
code: 'UnknownResourceFault'
throw err
worker.swfAdapter.swf.pollForActivityTask = ->
assert worker.swfAdapter.swf.registerActivityType.calledOnce
assert worker.swfAdapter.swf.registerActivityType.calledWith expectedParams
worker.stop()
.then ->
done()
worker.workAsync -> {}
context 'when an error other than UnknownResourceFault occurs', ->
it 'rejects the promise with the error', (done) ->
fakeError = new Error('Loud noises!')
worker.swfAdapter.swf.describeActivityType = sinon.spy ->
throw fakeError
promise = worker.workAsync -> {}
promise
.catch (err) ->
assert.strictEqual fakeError, err
done()
context 'when polling for work', ->
it 'uses worker name + version as the task list', (done) ->
expectedParams =
taskList:
name: config.name + config.version
worker.swfAdapter.swf.pollForActivityTask = sinon.spy (params) ->
assert.deepEqual(expectedParams, params)
worker.stop()
.then ->
done()
worker.workAsync -> {}
context 'when there is no work to be done', ->
it 'polls again', (done) ->
callCount = 0
worker.swfAdapter.swf.pollForActivityTask = (params, callback) ->
callCount++
if callCount == 2
worker.stop()
.then ->
done()
callback null, {}
worker.workAsync -> {}
context 'when there is work to be done', ->
expectedInput = null
expectedToken = null
expectedResult = null
expectedSwfResult = null
err = null
beforeEach ->
expectedToken = 'fakeToken'
expectedInput =
someKey: 'someValue'
anotherKey:
aSubKey: 1
expectedResult =
something: 'weeeee!'
somethingElse: 5
expectedSwfResult =
status: activityStatus.success
result: expectedResult
fakeTask =
taskToken: expectedToken
input: JSON.stringify expectedInput
errorDetails = 'Some extra error details'
err = new Error('Loud noises!')
err.details = errorDetails
worker.swfAdapter.swf.pollForActivityTask = (params, callback) ->
callback null, fakeTask
it 'invokes the provided worker function with the task input', (done) ->
worker.workAsync (input) ->
assert.deepEqual expectedInput, input
worker.stop()
.then ->
done()
context 'when the worker function returns a result', ->
it 'returns the result to simple workflow', (done) ->
worker.swfAdapter.swf.respondActivityTaskCompleted = (params) ->
assert.strictEqual expectedToken, params.taskToken
assert.strictEqual params.result, JSON.stringify expectedSwfResult
worker.stop()
.then ->
done()
worker.workAsync ->
return expectedResult
context 'when the worker function returns a promise that resolves', ->
it 'returns the result to simple workflow', (done) ->
worker.swfAdapter.swf.respondActivityTaskCompleted = (params) ->
assert.strictEqual params.taskToken, expectedToken
assert.strictEqual params.result, JSON.stringify expectedSwfResult
worker.stop()
.then ->
done()
worker.workAsync ->
return Promise.resolve expectedResult
context 'when the worker function returns a promise that rejects', ->
it 'fails the task and logs the details of the failure', (done) ->
sinon.stub fakeLogger, 'error', (e) ->
assert.strictEqual e, err
assert.strictEqual err.workerName, config.name
assert.strictEqual err.workerVersion, config.version
expectedSwfResult =
taskToken: expectedToken
reason: ''
details: JSON.stringify
status: activityStatus.error
notes: []
reason: err.message
result: err.message
trace: err.stack.split "\n"
worker.swfAdapter.swf.respondActivityTaskFailed = (params) ->
assert.deepEqual params, expectedSwfResult
worker.stop()
.then ->
assert fakeLogger.error.calledOnce
fakeLogger.error.restore()
done()
worker.workAsync ->
return Promise.reject err
context 'when the worker function returns a promise that rejects with a FailTaskError', ->
it 'fails the task', (done) ->
failTaskError = new error.FailTaskError err.message, err.details, err.stack
expectedSwfResult =
taskToken: expectedToken
reason: ''
details: JSON.stringify
status: activityStatus.fatal
notes: []
reason: err.message
result: err.message
trace: err.stack.split "\n"
worker.swfAdapter.swf.respondActivityTaskFailed = (params) ->
assert.deepEqual params, expectedSwfResult
worker.stop()
.then ->
done()
worker.workAsync ->
return Promise.reject failTaskError
context 'when the worker returns a promise which rejects with a CancelTaskError', ->
it 'cancels the task', (done) ->
cancelTaskError = new error.CancelTaskError err.message, err.details, err.stack
expectedSwfResult =
taskToken: expectedToken
details: JSON.stringify
status: activityStatus.defer
notes: []
reason: err.message
result: err.message
trace: []
worker.swfAdapter.swf.respondActivityTaskCanceled = (params) ->
assert.deepEqual params, expectedSwfResult
worker.stop()
.then ->
done()
worker.workAsync ->
return Promise.reject cancelTaskError
context 'when the worker function throws an error', ->
it 'fails the task', (done) ->
expectedSwfResult =
taskToken: expectedToken
reason: ''
details: JSON.stringify
status: activityStatus.error
notes: []
reason: err.message
result: err.message
trace: err.stack.split "\n"
worker.swfAdapter.swf.respondActivityTaskFailed = (params) ->
assert.deepEqual params, expectedSwfResult
worker.stop()
.then ->
done()
worker.workAsync ->
throw err
context 'when the worker function throws a FailTaskError', ->
it 'fails the task', (done) ->
failTaskError = new error.FailTaskError err.message, err.details, err.stack
expectedSwfResult =
taskToken: expectedToken
reason: ''
details: JSON.stringify
status: activityStatus.fatal
notes: []
reason: err.message
result: err.message
trace: err.stack.split "\n"
worker.swfAdapter.swf.respondActivityTaskFailed = (params) ->
assert.deepEqual params, expectedSwfResult
worker.stop()
.then ->
done()
worker.workAsync ->
throw failTaskError
context 'when the worker function throws a CancelTaskError', ->
it 'cancels the task', (done) ->
cancelTaskError = new error.CancelTaskError err.message, err.details
expectedSwfResult =
taskToken: expectedToken
details: JSON.stringify
status: activityStatus.defer
notes: []
reason: err.message
result: err.message
trace: []
worker.swfAdapter.swf.respondActivityTaskCanceled = (params) ->
assert.deepEqual params, expectedSwfResult
worker.stop()
.then ->
done()
worker.workAsync ->
throw cancelTaskError
afterEach ->
aws.DynamoDB.restore()
aws.SWF.restore()
aws.SQS.restore()
| 73552 | 'use strict'
assert = require 'assert'
aws = require 'aws-sdk'
sinon = require 'sinon'
Promise = require 'bluebird'
FulfillmentWorker = require '../lib/fulfillmentWorker'
activityStatus = require '../lib/activityStatus'
error = require '../lib/error'
mockDynamoDB = require './mocks/mockDynamoDB'
mockSWF = require './mocks/mockSWF'
mockSQS = require './mocks/mockSQS'
config = undefined
testRequiresConfigParameter = (config, propName) ->
delete config[propName]
try
new FulfillmentWorker config
assert.fail 'Expected a ConfigurationMissingError.'
catch err
assert err instanceof error.ConfigurationMissingError
assert.deepEqual err.missingProperties, [propName]
return
fakeLogger =
log: ->
info: ->
debug: ->
warn: ->
error: ->
describe 'FulfillmentWorker unit tests', ->
beforeEach ->
config =
region: 'fakeRegion'
accessKeyId: '<KEY>'
secretAccessKey: '<KEY>'
domain: 'fakeDomain'
name: 'fakeWorkerName'
version: 'fakeWorkerVersion'
defaultTaskHeartbeatTimeout: 4000
defaultTaskScheduleToCloseTimeout: 400
defaultTaskScheduleToStartTimeout: 700
defaultTaskStartToCloseTimeout: 4700
workerStatusQueueName: "workerStatusTestQueue"
updateIntervalMs: 1000
parameterSchema: {}
resultSchema: {}
logger: fakeLogger
describe 'constructor', ->
beforeEach ->
sinon.stub aws, 'SQS', mockSQS
afterEach ->
aws.SQS.restore()
it 'Requires a config', ->
try
new FulfillmentWorker()
assert.fail 'Expected a ConfigurationMustBeObjectError.'
catch err
assert err instanceof error.ConfigurationMustBeObjectError
assert.strictEqual err.suppliedType, 'undefined'
it 'Requires that the config be an object', ->
try
new FulfillmentWorker('not an object')
assert.fail 'Expected a ConfigurationMustBeObjectError.'
catch err
assert err instanceof error.ConfigurationMustBeObjectError
assert.strictEqual err.suppliedType, 'string'
it 'Requires config.region', ->
testRequiresConfigParameter config, 'region'
it 'Requires config.domain', ->
testRequiresConfigParameter config, 'domain'
it 'Requires config.workerName', ->
testRequiresConfigParameter config, 'name'
it 'Requires config.workerVersion', ->
testRequiresConfigParameter config, 'version'
context 'When a logger is supplied', ->
it 'Uses the supplied logger', ->
worker = new FulfillmentWorker config
assert.strictEqual worker.logger, fakeLogger
context 'When a logger is not supplied', ->
it 'Uses console', ->
delete config.logger
worker = new FulfillmentWorker config
assert.strictEqual worker.logger, console
it 'Adds an API version to config', ->
new FulfillmentWorker(config)
assert.ok config.apiVersion
assert typeof config.apiVersion is 'string'
it 'Creates an instance ID', ->
worker = new FulfillmentWorker(config)
assert.ok worker.uuid
assert typeof worker.uuid is 'string'
it 'Creates an AWS SWF instance', ->
sinon.stub aws, 'SWF', mockSWF
worker = new FulfillmentWorker(config)
expectedConfig =
accessKeyId: config.accessKeyId
secretAccessKey: config.secretAccessKey
apiVersion: config.apiVersion
region: config.region
params:
domain: config.domain
name: config.name
version: config.version
assert aws.SWF.calledOnce
assert.deepEqual expectedConfig, worker.swfAdapter.swf.config
aws.SWF.restore()
describe 'workAsync', ->
worker = null
beforeEach ->
sinon.stub aws, 'DynamoDB', mockDynamoDB
sinon.stub aws, 'SWF', mockSWF
sinon.stub aws, 'SQS', mockSQS
worker = new FulfillmentWorker(config)
context 'prior to polling for work', ->
it 'checks for an existing ActivityType', (done) ->
expectedParams =
activityType:
name: config.name
version: config.version
worker.swfAdapter.swf.pollForActivityTask = ->
assert worker.swfAdapter.swf.describeActivityType.calledOnce
assert worker.swfAdapter.swf.describeActivityType.calledWith expectedParams
worker.stop()
.then ->
done()
worker.workAsync -> {}
context 'when the activity type is not found', ->
it 'registers the activity type', (done) ->
expectedParams =
defaultTaskHeartbeatTimeout: config.defaultTaskHeartbeatTimeout
defaultTaskScheduleToCloseTimeout: config.defaultTaskScheduleToCloseTimeout
defaultTaskScheduleToStartTimeout: config.defaultTaskScheduleToStartTimeout
defaultTaskStartToCloseTimeout: config.defaultTaskStartToCloseTimeout
worker.swfAdapter.swf.describeActivityType = sinon.spy ->
err = Error('Loud noises!')
err.cause =
code: 'UnknownResourceFault'
throw err
worker.swfAdapter.swf.pollForActivityTask = ->
assert worker.swfAdapter.swf.registerActivityType.calledOnce
assert worker.swfAdapter.swf.registerActivityType.calledWith expectedParams
worker.stop()
.then ->
done()
worker.workAsync -> {}
context 'when an error other than UnknownResourceFault occurs', ->
it 'rejects the promise with the error', (done) ->
fakeError = new Error('Loud noises!')
worker.swfAdapter.swf.describeActivityType = sinon.spy ->
throw fakeError
promise = worker.workAsync -> {}
promise
.catch (err) ->
assert.strictEqual fakeError, err
done()
context 'when polling for work', ->
it 'uses worker name + version as the task list', (done) ->
expectedParams =
taskList:
name: config.name + config.version
worker.swfAdapter.swf.pollForActivityTask = sinon.spy (params) ->
assert.deepEqual(expectedParams, params)
worker.stop()
.then ->
done()
worker.workAsync -> {}
context 'when there is no work to be done', ->
it 'polls again', (done) ->
callCount = 0
worker.swfAdapter.swf.pollForActivityTask = (params, callback) ->
callCount++
if callCount == 2
worker.stop()
.then ->
done()
callback null, {}
worker.workAsync -> {}
context 'when there is work to be done', ->
expectedInput = null
expectedToken = null
expectedResult = null
expectedSwfResult = null
err = null
beforeEach ->
expectedToken = '<KEY>'
expectedInput =
someKey: 'someValue'
anotherKey:
aSubKey: 1
expectedResult =
something: 'weeeee!'
somethingElse: 5
expectedSwfResult =
status: activityStatus.success
result: expectedResult
fakeTask =
taskToken: expectedToken
input: JSON.stringify expectedInput
errorDetails = 'Some extra error details'
err = new Error('Loud noises!')
err.details = errorDetails
worker.swfAdapter.swf.pollForActivityTask = (params, callback) ->
callback null, fakeTask
it 'invokes the provided worker function with the task input', (done) ->
worker.workAsync (input) ->
assert.deepEqual expectedInput, input
worker.stop()
.then ->
done()
context 'when the worker function returns a result', ->
it 'returns the result to simple workflow', (done) ->
worker.swfAdapter.swf.respondActivityTaskCompleted = (params) ->
assert.strictEqual expectedToken, params.taskToken
assert.strictEqual params.result, JSON.stringify expectedSwfResult
worker.stop()
.then ->
done()
worker.workAsync ->
return expectedResult
context 'when the worker function returns a promise that resolves', ->
it 'returns the result to simple workflow', (done) ->
worker.swfAdapter.swf.respondActivityTaskCompleted = (params) ->
assert.strictEqual params.taskToken, expectedToken
assert.strictEqual params.result, JSON.stringify expectedSwfResult
worker.stop()
.then ->
done()
worker.workAsync ->
return Promise.resolve expectedResult
context 'when the worker function returns a promise that rejects', ->
it 'fails the task and logs the details of the failure', (done) ->
sinon.stub fakeLogger, 'error', (e) ->
assert.strictEqual e, err
assert.strictEqual err.workerName, config.name
assert.strictEqual err.workerVersion, config.version
expectedSwfResult =
taskToken: expectedToken
reason: ''
details: JSON.stringify
status: activityStatus.error
notes: []
reason: err.message
result: err.message
trace: err.stack.split "\n"
worker.swfAdapter.swf.respondActivityTaskFailed = (params) ->
assert.deepEqual params, expectedSwfResult
worker.stop()
.then ->
assert fakeLogger.error.calledOnce
fakeLogger.error.restore()
done()
worker.workAsync ->
return Promise.reject err
context 'when the worker function returns a promise that rejects with a FailTaskError', ->
it 'fails the task', (done) ->
failTaskError = new error.FailTaskError err.message, err.details, err.stack
expectedSwfResult =
taskToken: expectedToken
reason: ''
details: JSON.stringify
status: activityStatus.fatal
notes: []
reason: err.message
result: err.message
trace: err.stack.split "\n"
worker.swfAdapter.swf.respondActivityTaskFailed = (params) ->
assert.deepEqual params, expectedSwfResult
worker.stop()
.then ->
done()
worker.workAsync ->
return Promise.reject failTaskError
context 'when the worker returns a promise which rejects with a CancelTaskError', ->
it 'cancels the task', (done) ->
cancelTaskError = new error.CancelTaskError err.message, err.details, err.stack
expectedSwfResult =
taskToken: expectedToken
details: JSON.stringify
status: activityStatus.defer
notes: []
reason: err.message
result: err.message
trace: []
worker.swfAdapter.swf.respondActivityTaskCanceled = (params) ->
assert.deepEqual params, expectedSwfResult
worker.stop()
.then ->
done()
worker.workAsync ->
return Promise.reject cancelTaskError
context 'when the worker function throws an error', ->
it 'fails the task', (done) ->
expectedSwfResult =
taskToken: expectedToken
reason: ''
details: JSON.stringify
status: activityStatus.error
notes: []
reason: err.message
result: err.message
trace: err.stack.split "\n"
worker.swfAdapter.swf.respondActivityTaskFailed = (params) ->
assert.deepEqual params, expectedSwfResult
worker.stop()
.then ->
done()
worker.workAsync ->
throw err
context 'when the worker function throws a FailTaskError', ->
it 'fails the task', (done) ->
failTaskError = new error.FailTaskError err.message, err.details, err.stack
expectedSwfResult =
taskToken: expectedToken
reason: ''
details: JSON.stringify
status: activityStatus.fatal
notes: []
reason: err.message
result: err.message
trace: err.stack.split "\n"
worker.swfAdapter.swf.respondActivityTaskFailed = (params) ->
assert.deepEqual params, expectedSwfResult
worker.stop()
.then ->
done()
worker.workAsync ->
throw failTaskError
context 'when the worker function throws a CancelTaskError', ->
it 'cancels the task', (done) ->
cancelTaskError = new error.CancelTaskError err.message, err.details
expectedSwfResult =
taskToken: expectedToken
details: JSON.stringify
status: activityStatus.defer
notes: []
reason: err.message
result: err.message
trace: []
worker.swfAdapter.swf.respondActivityTaskCanceled = (params) ->
assert.deepEqual params, expectedSwfResult
worker.stop()
.then ->
done()
worker.workAsync ->
throw cancelTaskError
afterEach ->
aws.DynamoDB.restore()
aws.SWF.restore()
aws.SQS.restore()
| true | 'use strict'
assert = require 'assert'
aws = require 'aws-sdk'
sinon = require 'sinon'
Promise = require 'bluebird'
FulfillmentWorker = require '../lib/fulfillmentWorker'
activityStatus = require '../lib/activityStatus'
error = require '../lib/error'
mockDynamoDB = require './mocks/mockDynamoDB'
mockSWF = require './mocks/mockSWF'
mockSQS = require './mocks/mockSQS'
config = undefined
testRequiresConfigParameter = (config, propName) ->
delete config[propName]
try
new FulfillmentWorker config
assert.fail 'Expected a ConfigurationMissingError.'
catch err
assert err instanceof error.ConfigurationMissingError
assert.deepEqual err.missingProperties, [propName]
return
fakeLogger =
log: ->
info: ->
debug: ->
warn: ->
error: ->
describe 'FulfillmentWorker unit tests', ->
beforeEach ->
config =
region: 'fakeRegion'
accessKeyId: 'PI:KEY:<KEY>END_PI'
secretAccessKey: 'PI:KEY:<KEY>END_PI'
domain: 'fakeDomain'
name: 'fakeWorkerName'
version: 'fakeWorkerVersion'
defaultTaskHeartbeatTimeout: 4000
defaultTaskScheduleToCloseTimeout: 400
defaultTaskScheduleToStartTimeout: 700
defaultTaskStartToCloseTimeout: 4700
workerStatusQueueName: "workerStatusTestQueue"
updateIntervalMs: 1000
parameterSchema: {}
resultSchema: {}
logger: fakeLogger
describe 'constructor', ->
beforeEach ->
sinon.stub aws, 'SQS', mockSQS
afterEach ->
aws.SQS.restore()
it 'Requires a config', ->
try
new FulfillmentWorker()
assert.fail 'Expected a ConfigurationMustBeObjectError.'
catch err
assert err instanceof error.ConfigurationMustBeObjectError
assert.strictEqual err.suppliedType, 'undefined'
it 'Requires that the config be an object', ->
try
new FulfillmentWorker('not an object')
assert.fail 'Expected a ConfigurationMustBeObjectError.'
catch err
assert err instanceof error.ConfigurationMustBeObjectError
assert.strictEqual err.suppliedType, 'string'
it 'Requires config.region', ->
testRequiresConfigParameter config, 'region'
it 'Requires config.domain', ->
testRequiresConfigParameter config, 'domain'
it 'Requires config.workerName', ->
testRequiresConfigParameter config, 'name'
it 'Requires config.workerVersion', ->
testRequiresConfigParameter config, 'version'
context 'When a logger is supplied', ->
it 'Uses the supplied logger', ->
worker = new FulfillmentWorker config
assert.strictEqual worker.logger, fakeLogger
context 'When a logger is not supplied', ->
it 'Uses console', ->
delete config.logger
worker = new FulfillmentWorker config
assert.strictEqual worker.logger, console
it 'Adds an API version to config', ->
new FulfillmentWorker(config)
assert.ok config.apiVersion
assert typeof config.apiVersion is 'string'
it 'Creates an instance ID', ->
worker = new FulfillmentWorker(config)
assert.ok worker.uuid
assert typeof worker.uuid is 'string'
it 'Creates an AWS SWF instance', ->
sinon.stub aws, 'SWF', mockSWF
worker = new FulfillmentWorker(config)
expectedConfig =
accessKeyId: config.accessKeyId
secretAccessKey: config.secretAccessKey
apiVersion: config.apiVersion
region: config.region
params:
domain: config.domain
name: config.name
version: config.version
assert aws.SWF.calledOnce
assert.deepEqual expectedConfig, worker.swfAdapter.swf.config
aws.SWF.restore()
describe 'workAsync', ->
worker = null
beforeEach ->
sinon.stub aws, 'DynamoDB', mockDynamoDB
sinon.stub aws, 'SWF', mockSWF
sinon.stub aws, 'SQS', mockSQS
worker = new FulfillmentWorker(config)
context 'prior to polling for work', ->
it 'checks for an existing ActivityType', (done) ->
expectedParams =
activityType:
name: config.name
version: config.version
worker.swfAdapter.swf.pollForActivityTask = ->
assert worker.swfAdapter.swf.describeActivityType.calledOnce
assert worker.swfAdapter.swf.describeActivityType.calledWith expectedParams
worker.stop()
.then ->
done()
worker.workAsync -> {}
context 'when the activity type is not found', ->
it 'registers the activity type', (done) ->
expectedParams =
defaultTaskHeartbeatTimeout: config.defaultTaskHeartbeatTimeout
defaultTaskScheduleToCloseTimeout: config.defaultTaskScheduleToCloseTimeout
defaultTaskScheduleToStartTimeout: config.defaultTaskScheduleToStartTimeout
defaultTaskStartToCloseTimeout: config.defaultTaskStartToCloseTimeout
worker.swfAdapter.swf.describeActivityType = sinon.spy ->
err = Error('Loud noises!')
err.cause =
code: 'UnknownResourceFault'
throw err
worker.swfAdapter.swf.pollForActivityTask = ->
assert worker.swfAdapter.swf.registerActivityType.calledOnce
assert worker.swfAdapter.swf.registerActivityType.calledWith expectedParams
worker.stop()
.then ->
done()
worker.workAsync -> {}
context 'when an error other than UnknownResourceFault occurs', ->
it 'rejects the promise with the error', (done) ->
fakeError = new Error('Loud noises!')
worker.swfAdapter.swf.describeActivityType = sinon.spy ->
throw fakeError
promise = worker.workAsync -> {}
promise
.catch (err) ->
assert.strictEqual fakeError, err
done()
context 'when polling for work', ->
it 'uses worker name + version as the task list', (done) ->
expectedParams =
taskList:
name: config.name + config.version
worker.swfAdapter.swf.pollForActivityTask = sinon.spy (params) ->
assert.deepEqual(expectedParams, params)
worker.stop()
.then ->
done()
worker.workAsync -> {}
context 'when there is no work to be done', ->
it 'polls again', (done) ->
callCount = 0
worker.swfAdapter.swf.pollForActivityTask = (params, callback) ->
callCount++
if callCount == 2
worker.stop()
.then ->
done()
callback null, {}
worker.workAsync -> {}
context 'when there is work to be done', ->
expectedInput = null
expectedToken = null
expectedResult = null
expectedSwfResult = null
err = null
beforeEach ->
expectedToken = 'PI:KEY:<KEY>END_PI'
expectedInput =
someKey: 'someValue'
anotherKey:
aSubKey: 1
expectedResult =
something: 'weeeee!'
somethingElse: 5
expectedSwfResult =
status: activityStatus.success
result: expectedResult
fakeTask =
taskToken: expectedToken
input: JSON.stringify expectedInput
errorDetails = 'Some extra error details'
err = new Error('Loud noises!')
err.details = errorDetails
worker.swfAdapter.swf.pollForActivityTask = (params, callback) ->
callback null, fakeTask
it 'invokes the provided worker function with the task input', (done) ->
worker.workAsync (input) ->
assert.deepEqual expectedInput, input
worker.stop()
.then ->
done()
context 'when the worker function returns a result', ->
it 'returns the result to simple workflow', (done) ->
worker.swfAdapter.swf.respondActivityTaskCompleted = (params) ->
assert.strictEqual expectedToken, params.taskToken
assert.strictEqual params.result, JSON.stringify expectedSwfResult
worker.stop()
.then ->
done()
worker.workAsync ->
return expectedResult
context 'when the worker function returns a promise that resolves', ->
it 'returns the result to simple workflow', (done) ->
worker.swfAdapter.swf.respondActivityTaskCompleted = (params) ->
assert.strictEqual params.taskToken, expectedToken
assert.strictEqual params.result, JSON.stringify expectedSwfResult
worker.stop()
.then ->
done()
worker.workAsync ->
return Promise.resolve expectedResult
context 'when the worker function returns a promise that rejects', ->
it 'fails the task and logs the details of the failure', (done) ->
sinon.stub fakeLogger, 'error', (e) ->
assert.strictEqual e, err
assert.strictEqual err.workerName, config.name
assert.strictEqual err.workerVersion, config.version
expectedSwfResult =
taskToken: expectedToken
reason: ''
details: JSON.stringify
status: activityStatus.error
notes: []
reason: err.message
result: err.message
trace: err.stack.split "\n"
worker.swfAdapter.swf.respondActivityTaskFailed = (params) ->
assert.deepEqual params, expectedSwfResult
worker.stop()
.then ->
assert fakeLogger.error.calledOnce
fakeLogger.error.restore()
done()
worker.workAsync ->
return Promise.reject err
context 'when the worker function returns a promise that rejects with a FailTaskError', ->
it 'fails the task', (done) ->
failTaskError = new error.FailTaskError err.message, err.details, err.stack
expectedSwfResult =
taskToken: expectedToken
reason: ''
details: JSON.stringify
status: activityStatus.fatal
notes: []
reason: err.message
result: err.message
trace: err.stack.split "\n"
worker.swfAdapter.swf.respondActivityTaskFailed = (params) ->
assert.deepEqual params, expectedSwfResult
worker.stop()
.then ->
done()
worker.workAsync ->
return Promise.reject failTaskError
context 'when the worker returns a promise which rejects with a CancelTaskError', ->
it 'cancels the task', (done) ->
cancelTaskError = new error.CancelTaskError err.message, err.details, err.stack
expectedSwfResult =
taskToken: expectedToken
details: JSON.stringify
status: activityStatus.defer
notes: []
reason: err.message
result: err.message
trace: []
worker.swfAdapter.swf.respondActivityTaskCanceled = (params) ->
assert.deepEqual params, expectedSwfResult
worker.stop()
.then ->
done()
worker.workAsync ->
return Promise.reject cancelTaskError
context 'when the worker function throws an error', ->
it 'fails the task', (done) ->
expectedSwfResult =
taskToken: expectedToken
reason: ''
details: JSON.stringify
status: activityStatus.error
notes: []
reason: err.message
result: err.message
trace: err.stack.split "\n"
worker.swfAdapter.swf.respondActivityTaskFailed = (params) ->
assert.deepEqual params, expectedSwfResult
worker.stop()
.then ->
done()
worker.workAsync ->
throw err
context 'when the worker function throws a FailTaskError', ->
it 'fails the task', (done) ->
failTaskError = new error.FailTaskError err.message, err.details, err.stack
expectedSwfResult =
taskToken: expectedToken
reason: ''
details: JSON.stringify
status: activityStatus.fatal
notes: []
reason: err.message
result: err.message
trace: err.stack.split "\n"
worker.swfAdapter.swf.respondActivityTaskFailed = (params) ->
assert.deepEqual params, expectedSwfResult
worker.stop()
.then ->
done()
worker.workAsync ->
throw failTaskError
context 'when the worker function throws a CancelTaskError', ->
it 'cancels the task', (done) ->
cancelTaskError = new error.CancelTaskError err.message, err.details
expectedSwfResult =
taskToken: expectedToken
details: JSON.stringify
status: activityStatus.defer
notes: []
reason: err.message
result: err.message
trace: []
worker.swfAdapter.swf.respondActivityTaskCanceled = (params) ->
assert.deepEqual params, expectedSwfResult
worker.stop()
.then ->
done()
worker.workAsync ->
throw cancelTaskError
afterEach ->
aws.DynamoDB.restore()
aws.SWF.restore()
aws.SQS.restore()
|
[
{
"context": "ow).scrollTop(scrollKeys[i])\n\t\t\t)(i)\n\t\tkeyMap[\"Cmd-D\"] = \"download\"\n\t\tkeyMap[\"Shift-Cmd-N\"] = \"findNex",
"end": 1216,
"score": 0.9422038793563843,
"start": 1215,
"tag": "KEY",
"value": "D"
},
{
"context": "llTop(scrollKeys[i])\n\t\t\t)(i)\n\t\tkeyMap[\"Cmd-D\"] = \"download\"\n\t\tkeyMap[\"Shift-Cmd-N\"] = \"findNext\"\n\t\tkeyMap[\"S",
"end": 1230,
"score": 0.5586075186729431,
"start": 1222,
"tag": "KEY",
"value": "download"
},
{
"context": "\n\t\t\t)(i)\n\t\tkeyMap[\"Cmd-D\"] = \"download\"\n\t\tkeyMap[\"Shift-Cmd-N\"] = \"findNext\"\n\t\tkeyMap[\"Shift-Cmd-P\"] = \"findPre",
"end": 1253,
"score": 0.9218398332595825,
"start": 1242,
"tag": "KEY",
"value": "Shift-Cmd-N"
},
{
"context": "[\"Cmd-D\"] = \"download\"\n\t\tkeyMap[\"Shift-Cmd-N\"] = \"findNext\"\n\t\tkeyMap[\"Shift-Cmd-P\"] = \"findPrev\"\n\t\tkeyMap[\"S",
"end": 1267,
"score": 0.7890831828117371,
"start": 1259,
"tag": "KEY",
"value": "findNext"
},
{
"context": "d\"\n\t\tkeyMap[\"Shift-Cmd-N\"] = \"findNext\"\n\t\tkeyMap[\"Shift-Cmd-P\"] = \"findPrev\"\n\t\tkeyMap[\"Shift-Cmd-R\"] = \"replace",
"end": 1290,
"score": 0.9462603330612183,
"start": 1279,
"tag": "KEY",
"value": "Shift-Cmd-P"
},
{
"context": "t-Cmd-N\"] = \"findNext\"\n\t\tkeyMap[\"Shift-Cmd-P\"] = \"findPrev\"\n\t\tkeyMap[\"Shift-Cmd-R\"] = \"replace\"\n\t\tkeyMap[\"Sh",
"end": 1304,
"score": 0.810263991355896,
"start": 1296,
"tag": "KEY",
"value": "findPrev"
},
{
"context": "t\"\n\t\tkeyMap[\"Shift-Cmd-P\"] = \"findPrev\"\n\t\tkeyMap[\"Shift-Cmd-R\"] = \"replace\"\n\t\tkeyMap[\"Shift-Cmd-/\"] = -> consol",
"end": 1327,
"score": 0.9584356546401978,
"start": 1316,
"tag": "KEY",
"value": "Shift-Cmd-R"
},
{
"context": "t-Cmd-P\"] = \"findPrev\"\n\t\tkeyMap[\"Shift-Cmd-R\"] = \"replace\"\n\t\tkeyMap[\"Shift-Cmd-/\"] = -> console.log keyMap\n",
"end": 1340,
"score": 0.7321354150772095,
"start": 1333,
"tag": "KEY",
"value": "replace"
},
{
"context": "\tkeyMap[\"Shift-Cmd-R\"] = \"replace\"\n\t\tkeyMap[\"Shift-Cmd-/\"] = -> console.log keyMap\n\t\t\n\t\tCodeMirror.command",
"end": 1363,
"score": 0.9424033761024475,
"start": 1358,
"tag": "KEY",
"value": "Cmd-/"
}
] | reflection.coffee | mwmessin/Reflection | 3 | $ -> $.get "reflection.coffee", (reflection) -> new class
constructor: ->
state = localStorage.getItem("state")
@editor = CodeMirror(document.body,
lineNumbers: true
autofocus: true
value: state or reflection
onCursorActivity: => @editor.matchHighlight "CodeMirror-matchhighlight"
onChange: @reflect
)
@width = 80
@windowHeight = $(window).height()
@height = Math.max(@windowHeight, @editor.lineCount())
@canvas = $("<canvas>")
.attr('id', 'scroll')
.attr("width", @width)
.attr("height", @height)
.appendTo(".CodeMirror")
@context = @canvas[0].getContext("2d")
@frame = {@data} = @context.createImageData(@width, @height)
scrollTop = $(window).scrollTop()
@top = @editor.coordsChar(x: null, y: scrollTop).line
@bottom = @editor.coordsChar(x: null, y: scrollTop + @windowHeight).line + 1
@reflect()
scrollKeys = []
keyMap = CodeMirror.keyMap["default"]
for i in [0..9]
((i) ->
keyMap["Shift-Ctrl-" + i] = ->
console.log i + ": " + $(window).scrollTop()
scrollKeys[i] = $(window).scrollTop()
keyMap["Ctrl-" + i] = ->
console.log i + "> " + scrollKeys[i]
$(window).scrollTop(scrollKeys[i])
)(i)
keyMap["Cmd-D"] = "download"
keyMap["Shift-Cmd-N"] = "findNext"
keyMap["Shift-Cmd-P"] = "findPrev"
keyMap["Shift-Cmd-R"] = "replace"
keyMap["Shift-Cmd-/"] = -> console.log keyMap
CodeMirror.commands.save = => localStorage.setItem("state", @editor.getValue())
CodeMirror.commands.download = => @downloadAs("name.coffee")
@dragging = false
@down = false
$(window)
.scroll(@scroll)
.resize(@resize)
.mousedown( => @down = true)
.mousemove( => @dragging = true if @down)
.mouseleave( => @down = @dragging = false)
.mouseup( => @down = @dragging = false)
@canvas
.mouseup(({clientY}) => if not @dragging then @scrollTo(clientY))
.mousemove(({clientY}) => if @dragging then @scrollTo(clientY))
$(document.body).append("<footer><code>MWM</code></footer>")
reflect: (editor, change) =>
t0 = (+new Date)
@lines = @editor.lineCount()
@codeHeight = $(".CodeMirror").height()
if not change
x = col = 0
y = 0
end = @lines
else
x = col = change.from.ch
y = change.from.line
linesChanged = change.to.line + 1 - y
if linesChanged is change.text.length
end = y + linesChanged + 1
else
end = Math.max(@lines, y + linesChanged + 1)
while y < end
line = @editor.getLine(y)
while col < @width
ch = line?.charAt(col)
if ch
if /\t/.test(ch)
if @top < y < @bottom
@setPixel x, y, 200, 225, 255, 125
@setPixel x + 1, y, 200, 225, 255, 125
else
@setPixel x, y, 0, 0, 0, 0
@setPixel x + 1, y, 0, 0, 0, 0
++x
else if /\s/.test(ch)
if @top < y < @bottom
@setPixel x, y, 200, 225, 255, 125
else
@setPixel x, y, 0, 0, 0, 0
else
token = @editor.getTokenAt(line: y, ch: col + 1).className
switch token
when "operator", "keyword" then @setPixel x, y, 0, 0, 255, @charAlpha(ch)
when "number" then @setPixel x, y, 255, 0, 0, 255
when "punctuation" then @setPixel x, y, 150, 150, 150, 255
when "string" then @setPixel x, y, 136, 85, 0, @charAlpha(ch)
when "string-2" then @setPixel x, y, 136, 0, 255, @charAlpha(ch)
when "comment" then @setPixel x, y, 0, 128, 0, @charAlpha(ch)
when "variable" then @setPixel x, y, 50, 50, 50, @charAlpha(ch)
when "atom" then @setPixel x, y, 50, 25, 150, @charAlpha(ch)
else @setPixel x, y, 0, 0, 0, 255
else
if @top < y < @bottom
@setPixel x, y, 200, 225, 255, 125
else
@setPixel x, y, 0, 0, 0, 0
++x
++col
col = x = 0
++y
@context.putImageData(@frame, 0, 0)
console.log (+new Date) - t0 + "ms", 'reflect'
scroll: =>
t0 = (+new Date)
top = @top
bottom = @bottom
@scrollTop = $(window).scrollTop()
@top = @editor.coordsChar(x: null, y: @scrollTop).line
@bottom = @editor.coordsChar(x: null, y: @scrollTop + @windowHeight).line + 1
heightLines = @bottom - @top
y = Math.min(top, @top)
end = Math.max(bottom, @bottom)
while y < end
x = col = 0
while x < @width
ch = @editor.getLine(y)?.charAt(col)
if ch and /\t/.test(ch)
if @top < y < @bottom
@setPixel x, y, 200, 225, 255, 125
@setPixel x + 1, y, 200, 225, 255, 125
else
@setPixel x, y, 0, 0, 0, 0
@setPixel x + 1, y, 0, 0, 0, 0
++x
else if not ch or /\s/.test(ch)
if @top < y < @bottom
@setPixel x, y, 200, 225, 255, 125
else
@setPixel x, y, 255, 255, 255, 125
++x
++col
++y
@context.putImageData @frame, 0, 0
if @lines > @windowHeight
@offset = -(@top / (@lines - heightLines) * (@lines - @windowHeight)) | 0
$("#scroll").css('top', @offset + 'px')
#console.log (+new Date) - t0 + "ms", 'scroll'
scrollTo: (y) ->
y -= 20
if @lines > @windowHeight
top = y / @windowHeight * @codeHeight | 0
else
top = @editor.charCoords(
line: Math.max(0, y)
ch: 0
).y
$(window).scrollTop(top)
resize: =>
@windowHeight = $(window).height()
if (@windowHeight > @lines)
@height = @windowHeight
@canvas = $("#scroll").attr("height", @height)
@context = @canvas[0].getContext("2d")
@frame = {@data} = @context.createImageData(@width, @height)
@bottom = @editor.coordsChar(x: null, y: @scrollTop + @windowHeight).line + 1
downloadAs: (name) ->
raw = @editor.getValue()
window.webkitRequestFileSystem(window.TEMPORARY, 1024 * 1024, (fs) ->
console.log('webkitRequestFileSystem')
fs.root.getFile(name, {create: true}, (fileEntry) ->
fileEntry.createWriter((fileWriter) ->
builder = new WebKitBlobBuilder()
builder.append(raw)
fileWriter.onwriteend = -> location.href = fileEntry.toURL()
fileWriter.write(builder.getBlob())
, ->)
, ->)
, (e) -> console.error(e))
charAlpha: (ch) ->
if /[._'"\-]/.test(ch)
150
else if /[flyg]/.test(ch)
225
else if /[a-z]/.test(ch)
200
else
255
setPixel: (x, y, r, g, b, a) ->
index = (x + y * @width) * 4
@data[index + 0] = r
@data[index + 1] = g
@data[index + 2] = b
@data[index + 3] = a
| 112043 | $ -> $.get "reflection.coffee", (reflection) -> new class
constructor: ->
state = localStorage.getItem("state")
@editor = CodeMirror(document.body,
lineNumbers: true
autofocus: true
value: state or reflection
onCursorActivity: => @editor.matchHighlight "CodeMirror-matchhighlight"
onChange: @reflect
)
@width = 80
@windowHeight = $(window).height()
@height = Math.max(@windowHeight, @editor.lineCount())
@canvas = $("<canvas>")
.attr('id', 'scroll')
.attr("width", @width)
.attr("height", @height)
.appendTo(".CodeMirror")
@context = @canvas[0].getContext("2d")
@frame = {@data} = @context.createImageData(@width, @height)
scrollTop = $(window).scrollTop()
@top = @editor.coordsChar(x: null, y: scrollTop).line
@bottom = @editor.coordsChar(x: null, y: scrollTop + @windowHeight).line + 1
@reflect()
scrollKeys = []
keyMap = CodeMirror.keyMap["default"]
for i in [0..9]
((i) ->
keyMap["Shift-Ctrl-" + i] = ->
console.log i + ": " + $(window).scrollTop()
scrollKeys[i] = $(window).scrollTop()
keyMap["Ctrl-" + i] = ->
console.log i + "> " + scrollKeys[i]
$(window).scrollTop(scrollKeys[i])
)(i)
keyMap["Cmd-<KEY>"] = "<KEY>"
keyMap["<KEY>"] = "<KEY>"
keyMap["<KEY>"] = "<KEY>"
keyMap["<KEY>"] = "<KEY>"
keyMap["Shift-<KEY>"] = -> console.log keyMap
CodeMirror.commands.save = => localStorage.setItem("state", @editor.getValue())
CodeMirror.commands.download = => @downloadAs("name.coffee")
@dragging = false
@down = false
$(window)
.scroll(@scroll)
.resize(@resize)
.mousedown( => @down = true)
.mousemove( => @dragging = true if @down)
.mouseleave( => @down = @dragging = false)
.mouseup( => @down = @dragging = false)
@canvas
.mouseup(({clientY}) => if not @dragging then @scrollTo(clientY))
.mousemove(({clientY}) => if @dragging then @scrollTo(clientY))
$(document.body).append("<footer><code>MWM</code></footer>")
reflect: (editor, change) =>
t0 = (+new Date)
@lines = @editor.lineCount()
@codeHeight = $(".CodeMirror").height()
if not change
x = col = 0
y = 0
end = @lines
else
x = col = change.from.ch
y = change.from.line
linesChanged = change.to.line + 1 - y
if linesChanged is change.text.length
end = y + linesChanged + 1
else
end = Math.max(@lines, y + linesChanged + 1)
while y < end
line = @editor.getLine(y)
while col < @width
ch = line?.charAt(col)
if ch
if /\t/.test(ch)
if @top < y < @bottom
@setPixel x, y, 200, 225, 255, 125
@setPixel x + 1, y, 200, 225, 255, 125
else
@setPixel x, y, 0, 0, 0, 0
@setPixel x + 1, y, 0, 0, 0, 0
++x
else if /\s/.test(ch)
if @top < y < @bottom
@setPixel x, y, 200, 225, 255, 125
else
@setPixel x, y, 0, 0, 0, 0
else
token = @editor.getTokenAt(line: y, ch: col + 1).className
switch token
when "operator", "keyword" then @setPixel x, y, 0, 0, 255, @charAlpha(ch)
when "number" then @setPixel x, y, 255, 0, 0, 255
when "punctuation" then @setPixel x, y, 150, 150, 150, 255
when "string" then @setPixel x, y, 136, 85, 0, @charAlpha(ch)
when "string-2" then @setPixel x, y, 136, 0, 255, @charAlpha(ch)
when "comment" then @setPixel x, y, 0, 128, 0, @charAlpha(ch)
when "variable" then @setPixel x, y, 50, 50, 50, @charAlpha(ch)
when "atom" then @setPixel x, y, 50, 25, 150, @charAlpha(ch)
else @setPixel x, y, 0, 0, 0, 255
else
if @top < y < @bottom
@setPixel x, y, 200, 225, 255, 125
else
@setPixel x, y, 0, 0, 0, 0
++x
++col
col = x = 0
++y
@context.putImageData(@frame, 0, 0)
console.log (+new Date) - t0 + "ms", 'reflect'
scroll: =>
t0 = (+new Date)
top = @top
bottom = @bottom
@scrollTop = $(window).scrollTop()
@top = @editor.coordsChar(x: null, y: @scrollTop).line
@bottom = @editor.coordsChar(x: null, y: @scrollTop + @windowHeight).line + 1
heightLines = @bottom - @top
y = Math.min(top, @top)
end = Math.max(bottom, @bottom)
while y < end
x = col = 0
while x < @width
ch = @editor.getLine(y)?.charAt(col)
if ch and /\t/.test(ch)
if @top < y < @bottom
@setPixel x, y, 200, 225, 255, 125
@setPixel x + 1, y, 200, 225, 255, 125
else
@setPixel x, y, 0, 0, 0, 0
@setPixel x + 1, y, 0, 0, 0, 0
++x
else if not ch or /\s/.test(ch)
if @top < y < @bottom
@setPixel x, y, 200, 225, 255, 125
else
@setPixel x, y, 255, 255, 255, 125
++x
++col
++y
@context.putImageData @frame, 0, 0
if @lines > @windowHeight
@offset = -(@top / (@lines - heightLines) * (@lines - @windowHeight)) | 0
$("#scroll").css('top', @offset + 'px')
#console.log (+new Date) - t0 + "ms", 'scroll'
scrollTo: (y) ->
y -= 20
if @lines > @windowHeight
top = y / @windowHeight * @codeHeight | 0
else
top = @editor.charCoords(
line: Math.max(0, y)
ch: 0
).y
$(window).scrollTop(top)
resize: =>
@windowHeight = $(window).height()
if (@windowHeight > @lines)
@height = @windowHeight
@canvas = $("#scroll").attr("height", @height)
@context = @canvas[0].getContext("2d")
@frame = {@data} = @context.createImageData(@width, @height)
@bottom = @editor.coordsChar(x: null, y: @scrollTop + @windowHeight).line + 1
downloadAs: (name) ->
raw = @editor.getValue()
window.webkitRequestFileSystem(window.TEMPORARY, 1024 * 1024, (fs) ->
console.log('webkitRequestFileSystem')
fs.root.getFile(name, {create: true}, (fileEntry) ->
fileEntry.createWriter((fileWriter) ->
builder = new WebKitBlobBuilder()
builder.append(raw)
fileWriter.onwriteend = -> location.href = fileEntry.toURL()
fileWriter.write(builder.getBlob())
, ->)
, ->)
, (e) -> console.error(e))
charAlpha: (ch) ->
if /[._'"\-]/.test(ch)
150
else if /[flyg]/.test(ch)
225
else if /[a-z]/.test(ch)
200
else
255
setPixel: (x, y, r, g, b, a) ->
index = (x + y * @width) * 4
@data[index + 0] = r
@data[index + 1] = g
@data[index + 2] = b
@data[index + 3] = a
| true | $ -> $.get "reflection.coffee", (reflection) -> new class
constructor: ->
state = localStorage.getItem("state")
@editor = CodeMirror(document.body,
lineNumbers: true
autofocus: true
value: state or reflection
onCursorActivity: => @editor.matchHighlight "CodeMirror-matchhighlight"
onChange: @reflect
)
@width = 80
@windowHeight = $(window).height()
@height = Math.max(@windowHeight, @editor.lineCount())
@canvas = $("<canvas>")
.attr('id', 'scroll')
.attr("width", @width)
.attr("height", @height)
.appendTo(".CodeMirror")
@context = @canvas[0].getContext("2d")
@frame = {@data} = @context.createImageData(@width, @height)
scrollTop = $(window).scrollTop()
@top = @editor.coordsChar(x: null, y: scrollTop).line
@bottom = @editor.coordsChar(x: null, y: scrollTop + @windowHeight).line + 1
@reflect()
scrollKeys = []
keyMap = CodeMirror.keyMap["default"]
for i in [0..9]
((i) ->
keyMap["Shift-Ctrl-" + i] = ->
console.log i + ": " + $(window).scrollTop()
scrollKeys[i] = $(window).scrollTop()
keyMap["Ctrl-" + i] = ->
console.log i + "> " + scrollKeys[i]
$(window).scrollTop(scrollKeys[i])
)(i)
keyMap["Cmd-PI:KEY:<KEY>END_PI"] = "PI:KEY:<KEY>END_PI"
keyMap["PI:KEY:<KEY>END_PI"] = "PI:KEY:<KEY>END_PI"
keyMap["PI:KEY:<KEY>END_PI"] = "PI:KEY:<KEY>END_PI"
keyMap["PI:KEY:<KEY>END_PI"] = "PI:KEY:<KEY>END_PI"
keyMap["Shift-PI:KEY:<KEY>END_PI"] = -> console.log keyMap
CodeMirror.commands.save = => localStorage.setItem("state", @editor.getValue())
CodeMirror.commands.download = => @downloadAs("name.coffee")
@dragging = false
@down = false
$(window)
.scroll(@scroll)
.resize(@resize)
.mousedown( => @down = true)
.mousemove( => @dragging = true if @down)
.mouseleave( => @down = @dragging = false)
.mouseup( => @down = @dragging = false)
@canvas
.mouseup(({clientY}) => if not @dragging then @scrollTo(clientY))
.mousemove(({clientY}) => if @dragging then @scrollTo(clientY))
$(document.body).append("<footer><code>MWM</code></footer>")
reflect: (editor, change) =>
t0 = (+new Date)
@lines = @editor.lineCount()
@codeHeight = $(".CodeMirror").height()
if not change
x = col = 0
y = 0
end = @lines
else
x = col = change.from.ch
y = change.from.line
linesChanged = change.to.line + 1 - y
if linesChanged is change.text.length
end = y + linesChanged + 1
else
end = Math.max(@lines, y + linesChanged + 1)
while y < end
line = @editor.getLine(y)
while col < @width
ch = line?.charAt(col)
if ch
if /\t/.test(ch)
if @top < y < @bottom
@setPixel x, y, 200, 225, 255, 125
@setPixel x + 1, y, 200, 225, 255, 125
else
@setPixel x, y, 0, 0, 0, 0
@setPixel x + 1, y, 0, 0, 0, 0
++x
else if /\s/.test(ch)
if @top < y < @bottom
@setPixel x, y, 200, 225, 255, 125
else
@setPixel x, y, 0, 0, 0, 0
else
token = @editor.getTokenAt(line: y, ch: col + 1).className
switch token
when "operator", "keyword" then @setPixel x, y, 0, 0, 255, @charAlpha(ch)
when "number" then @setPixel x, y, 255, 0, 0, 255
when "punctuation" then @setPixel x, y, 150, 150, 150, 255
when "string" then @setPixel x, y, 136, 85, 0, @charAlpha(ch)
when "string-2" then @setPixel x, y, 136, 0, 255, @charAlpha(ch)
when "comment" then @setPixel x, y, 0, 128, 0, @charAlpha(ch)
when "variable" then @setPixel x, y, 50, 50, 50, @charAlpha(ch)
when "atom" then @setPixel x, y, 50, 25, 150, @charAlpha(ch)
else @setPixel x, y, 0, 0, 0, 255
else
if @top < y < @bottom
@setPixel x, y, 200, 225, 255, 125
else
@setPixel x, y, 0, 0, 0, 0
++x
++col
col = x = 0
++y
@context.putImageData(@frame, 0, 0)
console.log (+new Date) - t0 + "ms", 'reflect'
scroll: =>
t0 = (+new Date)
top = @top
bottom = @bottom
@scrollTop = $(window).scrollTop()
@top = @editor.coordsChar(x: null, y: @scrollTop).line
@bottom = @editor.coordsChar(x: null, y: @scrollTop + @windowHeight).line + 1
heightLines = @bottom - @top
y = Math.min(top, @top)
end = Math.max(bottom, @bottom)
while y < end
x = col = 0
while x < @width
ch = @editor.getLine(y)?.charAt(col)
if ch and /\t/.test(ch)
if @top < y < @bottom
@setPixel x, y, 200, 225, 255, 125
@setPixel x + 1, y, 200, 225, 255, 125
else
@setPixel x, y, 0, 0, 0, 0
@setPixel x + 1, y, 0, 0, 0, 0
++x
else if not ch or /\s/.test(ch)
if @top < y < @bottom
@setPixel x, y, 200, 225, 255, 125
else
@setPixel x, y, 255, 255, 255, 125
++x
++col
++y
@context.putImageData @frame, 0, 0
if @lines > @windowHeight
@offset = -(@top / (@lines - heightLines) * (@lines - @windowHeight)) | 0
$("#scroll").css('top', @offset + 'px')
#console.log (+new Date) - t0 + "ms", 'scroll'
scrollTo: (y) ->
y -= 20
if @lines > @windowHeight
top = y / @windowHeight * @codeHeight | 0
else
top = @editor.charCoords(
line: Math.max(0, y)
ch: 0
).y
$(window).scrollTop(top)
resize: =>
@windowHeight = $(window).height()
if (@windowHeight > @lines)
@height = @windowHeight
@canvas = $("#scroll").attr("height", @height)
@context = @canvas[0].getContext("2d")
@frame = {@data} = @context.createImageData(@width, @height)
@bottom = @editor.coordsChar(x: null, y: @scrollTop + @windowHeight).line + 1
downloadAs: (name) ->
raw = @editor.getValue()
window.webkitRequestFileSystem(window.TEMPORARY, 1024 * 1024, (fs) ->
console.log('webkitRequestFileSystem')
fs.root.getFile(name, {create: true}, (fileEntry) ->
fileEntry.createWriter((fileWriter) ->
builder = new WebKitBlobBuilder()
builder.append(raw)
fileWriter.onwriteend = -> location.href = fileEntry.toURL()
fileWriter.write(builder.getBlob())
, ->)
, ->)
, (e) -> console.error(e))
charAlpha: (ch) ->
if /[._'"\-]/.test(ch)
150
else if /[flyg]/.test(ch)
225
else if /[a-z]/.test(ch)
200
else
255
setPixel: (x, y, r, g, b, a) ->
index = (x + y * @width) * 4
@data[index + 0] = r
@data[index + 1] = g
@data[index + 2] = b
@data[index + 3] = a
|
[
{
"context": "j\"\n and: \"i\"\n back: \"powrót\"\n changePassword: \"Zmień hasło\"\n choosePassword: \"Wybierz hasło\"\n clickAgree: ",
"end": 118,
"score": 0.9829081296920776,
"start": 107,
"tag": "PASSWORD",
"value": "Zmień hasło"
},
{
"context": "createAccount: \"Utwórz konto\"\n currentPassword: \"Aktualne hasło\"\n dontHaveAnAccount: \"Nie masz konta?\"\n email: ",
"end": 311,
"score": 0.9774507284164429,
"start": 297,
"tag": "PASSWORD",
"value": "Aktualne hasło"
},
{
"context": "ail z linkiem do zmiany hasła\"\n forgotPassword: \"Zapomniałeś hasła?\"\n ifYouAlreadyHaveAnAccount: \"Jeżeli już masz k",
"end": 494,
"score": 0.9241305589675903,
"start": 477,
"tag": "PASSWORD",
"value": "Zapomniałeś hasła"
},
{
"context": "nAccount: \"Jeżeli już masz konto\"\n newPassword: \"Nowe hasło\"\n newPasswordAgain: \"Nowe hasło (powtórz)\"\n opt",
"end": 576,
"score": 0.9317856431007385,
"start": 566,
"tag": "PASSWORD",
"value": "Nowe hasło"
},
{
"context": "\n newPassword: \"Nowe hasło\"\n newPasswordAgain: \"Nowe hasło (powtórz)\"\n optional: \"Nieobowiązkowe\"\n O",
"end": 603,
"score": 0.6152303218841553,
"start": 599,
"tag": "PASSWORD",
"value": "Nowe"
},
{
"context": "tional: \"Nieobowiązkowe\"\n OR: \"LUB\"\n password: \"Hasło\"\n passwordAgain: \"Hasło (powtórz)\"\n privacyPoli",
"end": 680,
"score": 0.9844026565551758,
"start": 675,
"tag": "PASSWORD",
"value": "Hasło"
},
{
"context": " OR: \"LUB\"\n password: \"Hasło\"\n passwordAgain: \"Hasło (powtórz)\"\n privacyPolicy: \"polityką prywatności",
"end": 705,
"score": 0.7589215040206909,
"start": 700,
"tag": "PASSWORD",
"value": "Hasło"
},
{
"context": " password: \"Hasło\"\n passwordAgain: \"Hasło (powtórz)\"\n privacyPolicy: \"polityką prywatności\"\n remov",
"end": 714,
"score": 0.6347823143005371,
"start": 712,
"tag": "PASSWORD",
"value": "rz"
},
{
"context": "\"\n remove: \"usuń\"\n resetYourPassword: \"Ustaw nowe hasło\"\n setPassword: \"Ustaw hasło\"\n sign: \"Podpisz\"",
"end": 810,
"score": 0.676573634147644,
"start": 805,
"tag": "PASSWORD",
"value": "e has"
},
{
"context": "tYourPassword: \"Ustaw nowe hasło\"\n setPassword: \"Ustaw hasło\"\n sign: \"Podpisz\"\n signIn: \"Zaloguj się\"\n sign",
"end": 841,
"score": 0.9707826375961304,
"start": 830,
"tag": "PASSWORD",
"value": "Ustaw hasło"
},
{
"context": "ami korzystania z serwisu\"\n updateYourPassword: \"Zaktualizuj swoje hasło\"\n username: \"Nazwa użytkownika\"\n ",
"end": 1139,
"score": 0.656294584274292,
"start": 1130,
"tag": "PASSWORD",
"value": "Zaktualiz"
},
{
"context": "ia z serwisu\"\n updateYourPassword: \"Zaktualizuj swoje hasło\"\n username: \"Nazwa użytkownika\"\n username",
"end": 1147,
"score": 0.6955412030220032,
"start": 1143,
"tag": "PASSWORD",
"value": "woje"
},
{
"context": "rPassword: \"Zaktualizuj swoje hasło\"\n username: \"Nazwa użytkownika\"\n usernameOrEmail: \"Nazwa użytkownika lub email\"",
"end": 1185,
"score": 0.9770551919937134,
"start": 1168,
"tag": "USERNAME",
"value": "Nazwa użytkownika"
},
{
"context": "username: \"Nazwa użytkownika\"\n usernameOrEmail: \"Nazwa użytkownika lub email\"\n with: \"z\"\n \n info:\n emailSent: ",
"end": 1224,
"score": 0.8158191442489624,
"start": 1207,
"tag": "USERNAME",
"value": "Nazwa użytkownika"
},
{
"context": "\"Adres email zweryfikowany\"\n passwordChanged: \"Hasło zmienione\"\n passwordReset: \"Hasło wyzerowane\"\n \n err",
"end": 1380,
"score": 0.9854170680046082,
"start": 1365,
"tag": "PASSWORD",
"value": "Hasło zmienione"
},
{
"context": "ordChanged: \"Hasło zmienione\"\n passwordReset: \"Hasło wyzerowane\"\n \n error:\n emailRequired: \"Wymagany jest ",
"end": 1418,
"score": 0.9834068417549133,
"start": 1402,
"tag": "PASSWORD",
"value": "Hasło wyzerowane"
},
{
"context": " usernameIsEmail: \"Adres email nie może być nazwą użytkownika.\"\n usernameRequired: \"Wymagana jest nazwa użyt",
"end": 1927,
"score": 0.9225306510925293,
"start": 1916,
"tag": "NAME",
"value": "użytkownika"
},
{
"context": "wnika.\"\n usernameRequired: \"Wymagana jest nazwa użytkownika.\"\n\n accounts:\n\n #---- accounts-base\n ",
"end": 1984,
"score": 0.9073421955108643,
"start": 1973,
"tag": "NAME",
"value": "użytkownika"
},
{
"context": " \"User validation failed\": \"Niepoprawna nazwa użytkownika\"\n \"Username already exists.\": \"Nazwa użytkow",
"end": 2629,
"score": 0.9516417980194092,
"start": 2618,
"tag": "NAME",
"value": "użytkownika"
},
{
"context": "\n \"Username already exists.\": \"Nazwa użytkownika już istnieje.\"\n \"You are not logged in.\": \"N",
"end": 2683,
"score": 0.8360850811004639,
"start": 2680,
"tag": "NAME",
"value": "ika"
},
{
"context": "-- accounts-password\n \"Incorrect password\": \"Niepoprawne hasło\"\n \"Invalid email\": \"Błędny adres email\"\n ",
"end": 3302,
"score": 0.9987913966178894,
"start": 3285,
"tag": "PASSWORD",
"value": "Niepoprawne hasło"
},
{
"context": "t a username or email\": \"Wymagane ustawienie nazwy użytkownika lub adresu email\"\n \"old password format\": \"s",
"end": 3478,
"score": 0.6995809674263,
"start": 3467,
"tag": "NAME",
"value": "użytkownika"
}
] | t9n/pl.coffee | tnedich/meteor-accounts-t9n | 0 | #Language: Polish
#Translators: pwldp
pl =
add: "dodaj"
and: "i"
back: "powrót"
changePassword: "Zmień hasło"
choosePassword: "Wybierz hasło"
clickAgree: "Klikając na Zarejestruj się zgadzasz się z naszą"
configure: "Konfiguruj"
createAccount: "Utwórz konto"
currentPassword: "Aktualne hasło"
dontHaveAnAccount: "Nie masz konta?"
email: "Email"
emailAddress: "Adres email"
emailResetLink: "Wyślij email z linkiem do zmiany hasła"
forgotPassword: "Zapomniałeś hasła?"
ifYouAlreadyHaveAnAccount: "Jeżeli już masz konto"
newPassword: "Nowe hasło"
newPasswordAgain: "Nowe hasło (powtórz)"
optional: "Nieobowiązkowe"
OR: "LUB"
password: "Hasło"
passwordAgain: "Hasło (powtórz)"
privacyPolicy: "polityką prywatności"
remove: "usuń"
resetYourPassword: "Ustaw nowe hasło"
setPassword: "Ustaw hasło"
sign: "Podpisz"
signIn: "Zaloguj się"
signin: "zaloguj się"
signOut: "Wyloguj się"
signUp: "Zarejestruj się"
signupCode: "Kod rejestracji"
signUpWithYourEmailAddress: "Zarejestruj się używając adresu email"
terms: "warunkami korzystania z serwisu"
updateYourPassword: "Zaktualizuj swoje hasło"
username: "Nazwa użytkownika"
usernameOrEmail: "Nazwa użytkownika lub email"
with: "z"
info:
emailSent: "Adres email wysłany"
emailVerified: "Adres email zweryfikowany"
passwordChanged: "Hasło zmienione"
passwordReset: "Hasło wyzerowane"
error:
emailRequired: "Wymagany jest adres email."
minChar: "7 znaków to minimalna długość hasła."
pwdsDontMatch: "Hasła są różne"
pwOneDigit: "Hasło musi zawierać przynajmniej jedną cyfrę."
pwOneLetter: "Hasło musi zawierać 1 literę."
signInRequired: "Musisz być zalogowany, aby to zrobić."
signupCodeIncorrect: "Kod rejestracji jest nieprawidłowy."
signupCodeRequired: "Wymagany jest kod rejestracji."
usernameIsEmail: "Adres email nie może być nazwą użytkownika."
usernameRequired: "Wymagana jest nazwa użytkownika."
accounts:
#---- accounts-base
#"@" + domain + " email required":
#"A login handler should return a result or undefined":
"Email already exists.": "Adres email już istnieje."
"Email doesn't match the criteria.": "Adres email nie spełnia kryteriów."
"Invalid login token": "Błędny token logowania"
"Login forbidden": "Logowanie zabronione"
#"Service " + options.service + " already configured":
"Service unknown": "Nieznana usługa"
"Unrecognized options for login request": "Nieznane parametry w żądaniu logowania."
"User validation failed": "Niepoprawna nazwa użytkownika"
"Username already exists.": "Nazwa użytkownika już istnieje."
"You are not logged in.": "Nie jesteś zalogowany."
"You've been logged out by the server. Please log in again.": "Zostałeś wylogowane przez serwer. Zaloguj się ponownie."
"Your session has expired. Please log in again.": "Twoja sesja wygasła. Zaloguj się ponownie."
#---- accounts-oauth
"No matching login attempt found": "Nie dopasowano danych logowania."
#---- accounts-password-client
"Password is old. Please reset your password.": "Hasło jest stare. Proszę wyzerować hasło."
#---- accounts-password
"Incorrect password": "Niepoprawne hasło"
"Invalid email": "Błędny adres email"
"Must be logged in": "Musisz być zalogowany"
"Need to set a username or email": "Wymagane ustawienie nazwy użytkownika lub adresu email"
"old password format": "stary format hasła"
"Password may not be empty": "Hasło nie może być puste"
"Signups forbidden": "Rejestracja zabroniona"
"Token expired": "Token wygasł"
"Token has invalid email address": "Token ma niewłaściwy adres email"
"User has no password set": "Użytkownik nie ma ustawionego hasła"
"User not found": "Nie znaleziono użytkownika"
"Verify email link expired": "Link weryfikacyjny wygasł"
"Verify email link is for unknown address": "Link weryfikacyjny jest dla nieznanego adresu"
#---- match
"Match failed": "Błędne dopasowanie"
#---- Misc...
"Unknown error": "Nieznany błąd"
T9n.map "pl", pl
| 102910 | #Language: Polish
#Translators: pwldp
pl =
add: "dodaj"
and: "i"
back: "powrót"
changePassword: "<PASSWORD>"
choosePassword: "Wybierz hasło"
clickAgree: "Klikając na Zarejestruj się zgadzasz się z naszą"
configure: "Konfiguruj"
createAccount: "Utwórz konto"
currentPassword: "<PASSWORD>"
dontHaveAnAccount: "Nie masz konta?"
email: "Email"
emailAddress: "Adres email"
emailResetLink: "Wyślij email z linkiem do zmiany hasła"
forgotPassword: "<PASSWORD>?"
ifYouAlreadyHaveAnAccount: "Jeżeli już masz konto"
newPassword: "<PASSWORD>"
newPasswordAgain: "<PASSWORD> hasło (powtórz)"
optional: "Nieobowiązkowe"
OR: "LUB"
password: "<PASSWORD>"
passwordAgain: "<PASSWORD> (powtó<PASSWORD>)"
privacyPolicy: "polityką prywatności"
remove: "usuń"
resetYourPassword: "Ustaw now<PASSWORD>ło"
setPassword: "<PASSWORD>"
sign: "Podpisz"
signIn: "Zaloguj się"
signin: "zaloguj się"
signOut: "Wyloguj się"
signUp: "Zarejestruj się"
signupCode: "Kod rejestracji"
signUpWithYourEmailAddress: "Zarejestruj się używając adresu email"
terms: "warunkami korzystania z serwisu"
updateYourPassword: "<PASSWORD>uj s<PASSWORD> hasło"
username: "Nazwa użytkownika"
usernameOrEmail: "Nazwa użytkownika lub email"
with: "z"
info:
emailSent: "Adres email wysłany"
emailVerified: "Adres email zweryfikowany"
passwordChanged: "<PASSWORD>"
passwordReset: "<PASSWORD>"
error:
emailRequired: "Wymagany jest adres email."
minChar: "7 znaków to minimalna długość hasła."
pwdsDontMatch: "Hasła są różne"
pwOneDigit: "Hasło musi zawierać przynajmniej jedną cyfrę."
pwOneLetter: "Hasło musi zawierać 1 literę."
signInRequired: "Musisz być zalogowany, aby to zrobić."
signupCodeIncorrect: "Kod rejestracji jest nieprawidłowy."
signupCodeRequired: "Wymagany jest kod rejestracji."
usernameIsEmail: "Adres email nie może być nazwą <NAME>."
usernameRequired: "Wymagana jest nazwa <NAME>."
accounts:
#---- accounts-base
#"@" + domain + " email required":
#"A login handler should return a result or undefined":
"Email already exists.": "Adres email już istnieje."
"Email doesn't match the criteria.": "Adres email nie spełnia kryteriów."
"Invalid login token": "Błędny token logowania"
"Login forbidden": "Logowanie zabronione"
#"Service " + options.service + " already configured":
"Service unknown": "Nieznana usługa"
"Unrecognized options for login request": "Nieznane parametry w żądaniu logowania."
"User validation failed": "Niepoprawna nazwa <NAME>"
"Username already exists.": "Nazwa użytkown<NAME> już istnieje."
"You are not logged in.": "Nie jesteś zalogowany."
"You've been logged out by the server. Please log in again.": "Zostałeś wylogowane przez serwer. Zaloguj się ponownie."
"Your session has expired. Please log in again.": "Twoja sesja wygasła. Zaloguj się ponownie."
#---- accounts-oauth
"No matching login attempt found": "Nie dopasowano danych logowania."
#---- accounts-password-client
"Password is old. Please reset your password.": "Hasło jest stare. Proszę wyzerować hasło."
#---- accounts-password
"Incorrect password": "<PASSWORD>"
"Invalid email": "Błędny adres email"
"Must be logged in": "Musisz być zalogowany"
"Need to set a username or email": "Wymagane ustawienie nazwy <NAME> lub adresu email"
"old password format": "stary format hasła"
"Password may not be empty": "Hasło nie może być puste"
"Signups forbidden": "Rejestracja zabroniona"
"Token expired": "Token wygasł"
"Token has invalid email address": "Token ma niewłaściwy adres email"
"User has no password set": "Użytkownik nie ma ustawionego hasła"
"User not found": "Nie znaleziono użytkownika"
"Verify email link expired": "Link weryfikacyjny wygasł"
"Verify email link is for unknown address": "Link weryfikacyjny jest dla nieznanego adresu"
#---- match
"Match failed": "Błędne dopasowanie"
#---- Misc...
"Unknown error": "Nieznany błąd"
T9n.map "pl", pl
| true | #Language: Polish
#Translators: pwldp
pl =
add: "dodaj"
and: "i"
back: "powrót"
changePassword: "PI:PASSWORD:<PASSWORD>END_PI"
choosePassword: "Wybierz hasło"
clickAgree: "Klikając na Zarejestruj się zgadzasz się z naszą"
configure: "Konfiguruj"
createAccount: "Utwórz konto"
currentPassword: "PI:PASSWORD:<PASSWORD>END_PI"
dontHaveAnAccount: "Nie masz konta?"
email: "Email"
emailAddress: "Adres email"
emailResetLink: "Wyślij email z linkiem do zmiany hasła"
forgotPassword: "PI:PASSWORD:<PASSWORD>END_PI?"
ifYouAlreadyHaveAnAccount: "Jeżeli już masz konto"
newPassword: "PI:PASSWORD:<PASSWORD>END_PI"
newPasswordAgain: "PI:PASSWORD:<PASSWORD>END_PI hasło (powtórz)"
optional: "Nieobowiązkowe"
OR: "LUB"
password: "PI:PASSWORD:<PASSWORD>END_PI"
passwordAgain: "PI:PASSWORD:<PASSWORD>END_PI (powtóPI:PASSWORD:<PASSWORD>END_PI)"
privacyPolicy: "polityką prywatności"
remove: "usuń"
resetYourPassword: "Ustaw nowPI:PASSWORD:<PASSWORD>END_PIło"
setPassword: "PI:PASSWORD:<PASSWORD>END_PI"
sign: "Podpisz"
signIn: "Zaloguj się"
signin: "zaloguj się"
signOut: "Wyloguj się"
signUp: "Zarejestruj się"
signupCode: "Kod rejestracji"
signUpWithYourEmailAddress: "Zarejestruj się używając adresu email"
terms: "warunkami korzystania z serwisu"
updateYourPassword: "PI:PASSWORD:<PASSWORD>END_PIuj sPI:PASSWORD:<PASSWORD>END_PI hasło"
username: "Nazwa użytkownika"
usernameOrEmail: "Nazwa użytkownika lub email"
with: "z"
info:
emailSent: "Adres email wysłany"
emailVerified: "Adres email zweryfikowany"
passwordChanged: "PI:PASSWORD:<PASSWORD>END_PI"
passwordReset: "PI:PASSWORD:<PASSWORD>END_PI"
error:
emailRequired: "Wymagany jest adres email."
minChar: "7 znaków to minimalna długość hasła."
pwdsDontMatch: "Hasła są różne"
pwOneDigit: "Hasło musi zawierać przynajmniej jedną cyfrę."
pwOneLetter: "Hasło musi zawierać 1 literę."
signInRequired: "Musisz być zalogowany, aby to zrobić."
signupCodeIncorrect: "Kod rejestracji jest nieprawidłowy."
signupCodeRequired: "Wymagany jest kod rejestracji."
usernameIsEmail: "Adres email nie może być nazwą PI:NAME:<NAME>END_PI."
usernameRequired: "Wymagana jest nazwa PI:NAME:<NAME>END_PI."
accounts:
#---- accounts-base
#"@" + domain + " email required":
#"A login handler should return a result or undefined":
"Email already exists.": "Adres email już istnieje."
"Email doesn't match the criteria.": "Adres email nie spełnia kryteriów."
"Invalid login token": "Błędny token logowania"
"Login forbidden": "Logowanie zabronione"
#"Service " + options.service + " already configured":
"Service unknown": "Nieznana usługa"
"Unrecognized options for login request": "Nieznane parametry w żądaniu logowania."
"User validation failed": "Niepoprawna nazwa PI:NAME:<NAME>END_PI"
"Username already exists.": "Nazwa użytkownPI:NAME:<NAME>END_PI już istnieje."
"You are not logged in.": "Nie jesteś zalogowany."
"You've been logged out by the server. Please log in again.": "Zostałeś wylogowane przez serwer. Zaloguj się ponownie."
"Your session has expired. Please log in again.": "Twoja sesja wygasła. Zaloguj się ponownie."
#---- accounts-oauth
"No matching login attempt found": "Nie dopasowano danych logowania."
#---- accounts-password-client
"Password is old. Please reset your password.": "Hasło jest stare. Proszę wyzerować hasło."
#---- accounts-password
"Incorrect password": "PI:PASSWORD:<PASSWORD>END_PI"
"Invalid email": "Błędny adres email"
"Must be logged in": "Musisz być zalogowany"
"Need to set a username or email": "Wymagane ustawienie nazwy PI:NAME:<NAME>END_PI lub adresu email"
"old password format": "stary format hasła"
"Password may not be empty": "Hasło nie może być puste"
"Signups forbidden": "Rejestracja zabroniona"
"Token expired": "Token wygasł"
"Token has invalid email address": "Token ma niewłaściwy adres email"
"User has no password set": "Użytkownik nie ma ustawionego hasła"
"User not found": "Nie znaleziono użytkownika"
"Verify email link expired": "Link weryfikacyjny wygasł"
"Verify email link is for unknown address": "Link weryfikacyjny jest dla nieznanego adresu"
#---- match
"Match failed": "Błędne dopasowanie"
#---- Misc...
"Unknown error": "Nieznany błąd"
T9n.map "pl", pl
|
[
{
"context": "#####################################\n# Created by Jordan Robert Dobson on 05 OCT 2015\n# Updated by Jordan Robert Dobson ",
"end": 117,
"score": 0.9998868107795715,
"start": 97,
"tag": "NAME",
"value": "Jordan Robert Dobson"
},
{
"context": "y Jordan Robert Dobson on 05 OCT 2015\n# Updated by Jordan Robert Dobson on 14 SEP 2016\n#\n# Use to add font files and refe",
"end": 166,
"score": 0.999883234500885,
"start": 146,
"tag": "NAME",
"value": "Jordan Robert Dobson"
}
] | FontFace.coffee | Seattle-Framer/modules-Seattle | 12 | ###################################################################################
# Created by Jordan Robert Dobson on 05 OCT 2015
# Updated by Jordan Robert Dobson on 14 SEP 2016
#
# Use to add font files and reference them in your CSS style settings.
#
# To Get Started...
#
# 1. Place the FontFace.coffee file in Framer Studio modules directory
#
# 2. In your project include:
# {FontFace} = require "FontFace"
#
# 3. To add a font face:
# gotham = new FontFace name: "Gotham", file: "Gotham.ttf", weight: 400
#
# 4. It checks that the font was loaded. Errors can be suppressed like so...
# gotham = new FontFace name: "Gotham", file: "Gotham.ttf", hideErrors: true
#
###################################################################################
class exports.FontFace
TEST =
face: "monospace"
text: "foo"
time: .01
maxLoadAttempts: 200
hideErrorMessages: true
TEST.style =
width: "auto"
fontSize: "150px"
fontFamily: TEST.face
TEST.layer = new Layer
name: ".FontFace Tester"
width: 0
height: 1
maxX: -(Screen.width)
visible: false
html: TEST.text
style: TEST.style
# SETUP FOR EVERY INSTANCE
constructor: (options) ->
@name = @file = @testLayer = @isLoaded = @loadFailed = @loadAttempts = @originalSize = @hideErrors = null
if options?
@name = options.name or null
@file = options.file or null
@weight = options.weight or 400
@style = options.style or "normal"
return missingArgumentError() unless @name? and @file?
@testLayer = TEST.layer.copy()
@testLayer.style = TEST.style
@testLayer.maxX = -(Screen.width)
@testLayer.visible = true
@isLoaded = false
@loadFailed = false
@loadAttempts = 0
@hideErrors = options.hideErrors
return addFontFace @
##############################################################################
# Private Helper Methods #####################################################
addFontFace = (self) ->
# Create our Element & Node
styleTag = document.createElement 'style'
faceCSS = document.createTextNode """
@font-face {
font-family:"#{self.name }";
src: url("#{self.file }") format("truetype");
font-weight: #{self.weight};
font-style: #{self.style };
}"""
# Add the Element & Node to the document
styleTag.appendChild faceCSS
document.head.appendChild styleTag
# Test out the Font to see if it changed
testNewFace self.name, self
##############################################################################
removeTestLayer = (self) ->
self.testLayer.destroy()
self.testLayer = null
##############################################################################
testNewFace = (name, self) ->
initialWidth = self.testLayer._element.getBoundingClientRect().width
# Check to see if it's ready yet
if initialWidth is 0
if self.hideErrors is false or TEST.hideErrorMessages is false
print "Load testing failed. Attempting again."
return Utils.delay TEST.time, -> testNewFace name, self
self.loadAttempts++
if self.originalSize is null
self.originalSize = initialWidth
self.testLayer.style = fontFamily: "#{name}, #{TEST.face}"
widthUpdate = self.testLayer._element.getBoundingClientRect().width
if self.originalSize is widthUpdate
# If we can attempt to check again... Do it
if self.loadAttempts < TEST.maxLoadAttempts
return Utils.delay TEST.time, -> testNewFace name, self
print "⚠️ Failed loading FontFace: #{name} #{self.weight}" unless self.hideErrors
console.log "⚠️ Failed loading FontFace: #{name} #{self.weight}"
self.isLoaded = false
self.loadFailed = true
loadTestingFileError self unless self.hideErrors
return
else
print "LOADED: #{name} #{self.weight}" unless self.hideErrors is false or TEST.hideErrorMessages
console.log "FONT FACE - LOADED: #{name} #{self.weight}"
self.isLoaded = true
self.loadFailed = false
removeTestLayer self
return name
##############################################################################
# Error Handler Methods ######################################################
missingArgumentError = ->
error """<b>FontFace</b> Missing Name and/or File: See Console"""
console.error """
Error: You must pass name & file properites when creating a new FontFace. \n
Example: myFace = new FontFace name:\"Gotham\", file:\"gotham.ttf\" \n"""
loadTestingFileError = (self) ->
error """<b>FontFace</b> Loading Error: See Console"""
console.error """
Error: Couldn't detect the font: \"#{self.name}\" and file: \"#{self.file}\" was loaded. \n
Either the file couldn't be found or your browser doesn't support the file type that was provided. \n
Suppress this message by adding \"hideErrors: true\" when creating a new FontFace. \n"""
error = (message) ->
Framer.Extras.ErrorDisplay.enable()
throw Error message
| 196191 | ###################################################################################
# Created by <NAME> on 05 OCT 2015
# Updated by <NAME> on 14 SEP 2016
#
# Use to add font files and reference them in your CSS style settings.
#
# To Get Started...
#
# 1. Place the FontFace.coffee file in Framer Studio modules directory
#
# 2. In your project include:
# {FontFace} = require "FontFace"
#
# 3. To add a font face:
# gotham = new FontFace name: "Gotham", file: "Gotham.ttf", weight: 400
#
# 4. It checks that the font was loaded. Errors can be suppressed like so...
# gotham = new FontFace name: "Gotham", file: "Gotham.ttf", hideErrors: true
#
###################################################################################
class exports.FontFace
TEST =
face: "monospace"
text: "foo"
time: .01
maxLoadAttempts: 200
hideErrorMessages: true
TEST.style =
width: "auto"
fontSize: "150px"
fontFamily: TEST.face
TEST.layer = new Layer
name: ".FontFace Tester"
width: 0
height: 1
maxX: -(Screen.width)
visible: false
html: TEST.text
style: TEST.style
# SETUP FOR EVERY INSTANCE
constructor: (options) ->
@name = @file = @testLayer = @isLoaded = @loadFailed = @loadAttempts = @originalSize = @hideErrors = null
if options?
@name = options.name or null
@file = options.file or null
@weight = options.weight or 400
@style = options.style or "normal"
return missingArgumentError() unless @name? and @file?
@testLayer = TEST.layer.copy()
@testLayer.style = TEST.style
@testLayer.maxX = -(Screen.width)
@testLayer.visible = true
@isLoaded = false
@loadFailed = false
@loadAttempts = 0
@hideErrors = options.hideErrors
return addFontFace @
##############################################################################
# Private Helper Methods #####################################################
addFontFace = (self) ->
# Create our Element & Node
styleTag = document.createElement 'style'
faceCSS = document.createTextNode """
@font-face {
font-family:"#{self.name }";
src: url("#{self.file }") format("truetype");
font-weight: #{self.weight};
font-style: #{self.style };
}"""
# Add the Element & Node to the document
styleTag.appendChild faceCSS
document.head.appendChild styleTag
# Test out the Font to see if it changed
testNewFace self.name, self
##############################################################################
removeTestLayer = (self) ->
self.testLayer.destroy()
self.testLayer = null
##############################################################################
testNewFace = (name, self) ->
initialWidth = self.testLayer._element.getBoundingClientRect().width
# Check to see if it's ready yet
if initialWidth is 0
if self.hideErrors is false or TEST.hideErrorMessages is false
print "Load testing failed. Attempting again."
return Utils.delay TEST.time, -> testNewFace name, self
self.loadAttempts++
if self.originalSize is null
self.originalSize = initialWidth
self.testLayer.style = fontFamily: "#{name}, #{TEST.face}"
widthUpdate = self.testLayer._element.getBoundingClientRect().width
if self.originalSize is widthUpdate
# If we can attempt to check again... Do it
if self.loadAttempts < TEST.maxLoadAttempts
return Utils.delay TEST.time, -> testNewFace name, self
print "⚠️ Failed loading FontFace: #{name} #{self.weight}" unless self.hideErrors
console.log "⚠️ Failed loading FontFace: #{name} #{self.weight}"
self.isLoaded = false
self.loadFailed = true
loadTestingFileError self unless self.hideErrors
return
else
print "LOADED: #{name} #{self.weight}" unless self.hideErrors is false or TEST.hideErrorMessages
console.log "FONT FACE - LOADED: #{name} #{self.weight}"
self.isLoaded = true
self.loadFailed = false
removeTestLayer self
return name
##############################################################################
# Error Handler Methods ######################################################
missingArgumentError = ->
error """<b>FontFace</b> Missing Name and/or File: See Console"""
console.error """
Error: You must pass name & file properites when creating a new FontFace. \n
Example: myFace = new FontFace name:\"Gotham\", file:\"gotham.ttf\" \n"""
loadTestingFileError = (self) ->
error """<b>FontFace</b> Loading Error: See Console"""
console.error """
Error: Couldn't detect the font: \"#{self.name}\" and file: \"#{self.file}\" was loaded. \n
Either the file couldn't be found or your browser doesn't support the file type that was provided. \n
Suppress this message by adding \"hideErrors: true\" when creating a new FontFace. \n"""
error = (message) ->
Framer.Extras.ErrorDisplay.enable()
throw Error message
| true | ###################################################################################
# Created by PI:NAME:<NAME>END_PI on 05 OCT 2015
# Updated by PI:NAME:<NAME>END_PI on 14 SEP 2016
#
# Use to add font files and reference them in your CSS style settings.
#
# To Get Started...
#
# 1. Place the FontFace.coffee file in Framer Studio modules directory
#
# 2. In your project include:
# {FontFace} = require "FontFace"
#
# 3. To add a font face:
# gotham = new FontFace name: "Gotham", file: "Gotham.ttf", weight: 400
#
# 4. It checks that the font was loaded. Errors can be suppressed like so...
# gotham = new FontFace name: "Gotham", file: "Gotham.ttf", hideErrors: true
#
###################################################################################
class exports.FontFace
TEST =
face: "monospace"
text: "foo"
time: .01
maxLoadAttempts: 200
hideErrorMessages: true
TEST.style =
width: "auto"
fontSize: "150px"
fontFamily: TEST.face
TEST.layer = new Layer
name: ".FontFace Tester"
width: 0
height: 1
maxX: -(Screen.width)
visible: false
html: TEST.text
style: TEST.style
# SETUP FOR EVERY INSTANCE
constructor: (options) ->
@name = @file = @testLayer = @isLoaded = @loadFailed = @loadAttempts = @originalSize = @hideErrors = null
if options?
@name = options.name or null
@file = options.file or null
@weight = options.weight or 400
@style = options.style or "normal"
return missingArgumentError() unless @name? and @file?
@testLayer = TEST.layer.copy()
@testLayer.style = TEST.style
@testLayer.maxX = -(Screen.width)
@testLayer.visible = true
@isLoaded = false
@loadFailed = false
@loadAttempts = 0
@hideErrors = options.hideErrors
return addFontFace @
##############################################################################
# Private Helper Methods #####################################################
addFontFace = (self) ->
# Create our Element & Node
styleTag = document.createElement 'style'
faceCSS = document.createTextNode """
@font-face {
font-family:"#{self.name }";
src: url("#{self.file }") format("truetype");
font-weight: #{self.weight};
font-style: #{self.style };
}"""
# Add the Element & Node to the document
styleTag.appendChild faceCSS
document.head.appendChild styleTag
# Test out the Font to see if it changed
testNewFace self.name, self
##############################################################################
removeTestLayer = (self) ->
self.testLayer.destroy()
self.testLayer = null
##############################################################################
testNewFace = (name, self) ->
initialWidth = self.testLayer._element.getBoundingClientRect().width
# Check to see if it's ready yet
if initialWidth is 0
if self.hideErrors is false or TEST.hideErrorMessages is false
print "Load testing failed. Attempting again."
return Utils.delay TEST.time, -> testNewFace name, self
self.loadAttempts++
if self.originalSize is null
self.originalSize = initialWidth
self.testLayer.style = fontFamily: "#{name}, #{TEST.face}"
widthUpdate = self.testLayer._element.getBoundingClientRect().width
if self.originalSize is widthUpdate
# If we can attempt to check again... Do it
if self.loadAttempts < TEST.maxLoadAttempts
return Utils.delay TEST.time, -> testNewFace name, self
print "⚠️ Failed loading FontFace: #{name} #{self.weight}" unless self.hideErrors
console.log "⚠️ Failed loading FontFace: #{name} #{self.weight}"
self.isLoaded = false
self.loadFailed = true
loadTestingFileError self unless self.hideErrors
return
else
print "LOADED: #{name} #{self.weight}" unless self.hideErrors is false or TEST.hideErrorMessages
console.log "FONT FACE - LOADED: #{name} #{self.weight}"
self.isLoaded = true
self.loadFailed = false
removeTestLayer self
return name
##############################################################################
# Error Handler Methods ######################################################
missingArgumentError = ->
error """<b>FontFace</b> Missing Name and/or File: See Console"""
console.error """
Error: You must pass name & file properites when creating a new FontFace. \n
Example: myFace = new FontFace name:\"Gotham\", file:\"gotham.ttf\" \n"""
loadTestingFileError = (self) ->
error """<b>FontFace</b> Loading Error: See Console"""
console.error """
Error: Couldn't detect the font: \"#{self.name}\" and file: \"#{self.file}\" was loaded. \n
Either the file couldn't be found or your browser doesn't support the file type that was provided. \n
Suppress this message by adding \"hideErrors: true\" when creating a new FontFace. \n"""
error = (message) ->
Framer.Extras.ErrorDisplay.enable()
throw Error message
|
[
{
"context": "\nC = ModelInterface.Attribute\n\n# **Epic props** to rythos42 for saving me having to research and type all thi",
"end": 140,
"score": 0.9993699789047241,
"start": 132,
"tag": "USERNAME",
"value": "rythos42"
},
{
"context": " research and type all this!\n# https://github.com/rythos42/MalifauxModels-Web/blob/master/js/app/Mappers/Mod",
"end": 222,
"score": 0.9996730089187622,
"start": 214,
"tag": "USERNAME",
"value": "rythos42"
},
{
"context": "/Mappers/ModelList.js\n\nModelList = [\n new Model('Lady Justice', [C.Guild], [C.Master, C.Living, C.GuildMarshal,",
"end": 322,
"score": 0.9034483432769775,
"start": 310,
"tag": "NAME",
"value": "Lady Justice"
},
{
"context": "ildMarshal, C.Wave1], undefined, 4),\n new Model('Sonnia Criid', [C.Guild], [C.Master, C.Living, C.WitchHunter, ",
"end": 423,
"score": 0.9718247652053833,
"start": 411,
"tag": "NAME",
"value": "Sonnia Criid"
},
{
"context": "itchHunter, C.Wave1], undefined, 3),\n new Model('Perdita Ortega', [C.Guild], [C.Master, C.Living, C.Family, C.Wav",
"end": 525,
"score": 0.9990918636322021,
"start": 511,
"tag": "NAME",
"value": "Perdita Ortega"
},
{
"context": ", C.Family, C.Wave1], undefined, 2),\n new Model('Franscisco Ortega', [C.Guild], [C.Henchman, C.Living, C.Family, C.W",
"end": 625,
"score": 0.9995667338371277,
"start": 608,
"tag": "NAME",
"value": "Franscisco Ortega"
},
{
"context": "C.Living, C.Family, C.Wave1], 8, 5),\n new Model('Samael Hopkins', [C.Guild], [C.Henchman, C.Living, C.WitchHunter",
"end": 716,
"score": 0.9996457695960999,
"start": 702,
"tag": "NAME",
"value": "Samael Hopkins"
},
{
"context": "C.WitchHunter, C.Wave1], 9, 4),\n new Model('The Judge', [C.Guild], [C.Henchman, C.Living, C.Rare1, C.Gu",
"end": 807,
"score": 0.5835471153259277,
"start": 803,
"tag": "NAME",
"value": "udge"
},
{
"context": "Purifying Flame', [C.Guild], [C.Peon, C.TotemFor('Sonnia Criid'), C.Spirit, C.Wave1], 3),\n new Model('Enslaved ",
"end": 1066,
"score": 0.8607693910598755,
"start": 1054,
"tag": "NAME",
"value": "Sonnia Criid"
},
{
"context": "slaved Nephilim', [C.Guild], [C.Peon, C.TotemFor('Perdita Ortega'), C.Nephilim, C.Wave1], 3),\n new Model('Governo",
"end": 1173,
"score": 0.8487486839294434,
"start": 1159,
"tag": "NAME",
"value": "Perdita Ortega"
},
{
"context": "Living, C.WitchHunter, C.Wave1], 5),\n new Model('Nino Ortega', [C.Guild], [C.Enforcer, C.Living, C.Rare1, C.Fa",
"end": 1961,
"score": 0.9998370409011841,
"start": 1950,
"tag": "NAME",
"value": "Nino Ortega"
},
{
"context": "ng, C.Rare1, C.Family, C.Wave1], 7),\n new Model('Papa Loco', [C.Guild], [C.Enforcer, C.Living, C.Rare1, C.Fa",
"end": 2053,
"score": 0.9473727345466614,
"start": 2044,
"tag": "NAME",
"value": "Papa Loco"
},
{
"context": "C.Family, C.Tormented, C.Wave1], 7),\n new Model('Santiago Ortega', [C.Guild], [C.Enforcer, C.Living, C.Rare1, C.Fa",
"end": 2164,
"score": 0.9998202323913574,
"start": 2149,
"tag": "NAME",
"value": "Santiago Ortega"
},
{
"context": " C.Rare1, C.Family, C.Wave1], 7),\n \n new Model('C. Hoffman', [C.Guild], [C.Master, C.Living, C.Construct, C.",
"end": 2260,
"score": 0.9998346567153931,
"start": 2250,
"tag": "NAME",
"value": "C. Hoffman"
},
{
"context": "uct, C.Msu, C.Wave2], undefined, 3),\n new Model('Ryle', [C.Guild], [C.Henchman, C.Construct, C.Rare1, C",
"end": 2357,
"score": 0.9969162940979004,
"start": 2353,
"tag": "NAME",
"value": "Ryle"
},
{
"context": "nt', [C.Guild], [C.Peon, C.Construct, C.TotemFor('C. Hoffman'), C.Wave2], 2),\n new Model('Guardian', [C.Guild",
"end": 2522,
"score": 0.995398998260498,
"start": 2512,
"tag": "NAME",
"value": "C. Hoffman"
},
{
"context": "otemFor('C. Hoffman'), C.Wave2], 2),\n new Model('Guardian', [C.Guild], [C.Minion, C.Construct, C.Wave2], 8)",
"end": 2561,
"score": 0.9767652750015259,
"start": 2553,
"tag": "NAME",
"value": "Guardian"
},
{
"context": "C.Minion, C.Construct, C.Wave2], 8),\n new Model('Lucius', [C.Guild, C.Neverborn], [C.Master, C.Living, C.",
"end": 2632,
"score": 0.9992274641990662,
"start": 2626,
"tag": "NAME",
"value": "Lucius"
},
{
"context": "g, C.Mimic, C.Wave2], undefined, 4),\n new Model('Captain Dashel', [C.Guild], [C.Henchman, C.Living, C.Rare1, C.Gu",
"end": 2741,
"score": 0.9953445196151733,
"start": 2727,
"tag": "NAME",
"value": "Captain Dashel"
},
{
"context": "ild, C.Neverborn], [C.Peon, C.Living, C.TotemFor('Lucius'), C.Wave2], 2),\n new Model('Abuela Ortega', [C.",
"end": 2904,
"score": 0.9982028007507324,
"start": 2898,
"tag": "NAME",
"value": "Lucius"
},
{
"context": " C.TotemFor('Lucius'), C.Wave2], 2),\n new Model('Abuela Ortega', [C.Guild], [C.Enforcer, C.Living, C.Rare1, C.Fa",
"end": 2948,
"score": 0.999437153339386,
"start": 2935,
"tag": "NAME",
"value": "Abuela Ortega"
},
{
"context": " C.Rare2, C.Guardsman, C.Wave2], 6),\n new Model('Hunter', [C.Guild], [C.Minion, C.Construct, C.Rare2, C.W",
"end": 3250,
"score": 0.9031147360801697,
"start": 3244,
"tag": "NAME",
"value": "Hunter"
},
{
"context": "Living, C.Wave1], undefined, 3),\n new Model('McMourning', [C.Resurrectionist, C.Guild], [C.Master, C.Livi",
"end": 4453,
"score": 0.5637755990028381,
"start": 4447,
"tag": "NAME",
"value": "urning"
},
{
"context": ", C.Living, C.Wave1], undefined, 4),\n new Model('Nicodem', [C.Resurrectionist], [C.Master, C.Living, C.Wav",
"end": 4552,
"score": 0.7567930221557617,
"start": 4545,
"tag": "NAME",
"value": "Nicodem"
},
{
"context": ", C.Living, C.Wave1], undefined, 3),\n new Model('Madam Sybelle', [C.Resurrectionist], [C.Henchman, C.Undead, C.R",
"end": 4648,
"score": 0.9998332858085632,
"start": 4635,
"tag": "NAME",
"value": "Madam Sybelle"
},
{
"context": " C.Undead, C.Rare1, C.Wave1], 8, 5),\n new Model('Sebastian', [C.Resurrectionist], [C.Henchman, C.Living, C.R",
"end": 4743,
"score": 0.999398410320282,
"start": 4734,
"tag": "NAME",
"value": "Sebastian"
},
{
"context": "1, C.Horror, C.Spirit, C.Wave2], 2),\n new Model('Kirai Ankoku', [C.Resurrectionist], [C.Master, C.Living, C.Wav",
"end": 6821,
"score": 0.9093265533447266,
"start": 6809,
"tag": "NAME",
"value": "Kirai Ankoku"
},
{
"context": "i Ankoku'), C.Spirit, C.Wave2], 4),\n new Model('Datsue Ba', [C.Resurrectionist], [C.Henchman, C.Undead",
"end": 7200,
"score": 0.5286519527435303,
"start": 7197,
"tag": "NAME",
"value": "ats"
},
{
"context": " C.Spirit, C.Retainer, C.Wave2], 5),\n new Model('Shikome', [C.Resurrectionist], [C.Minion, C.Undead, C.Rar",
"end": 7681,
"score": 0.6072567105293274,
"start": 7674,
"tag": "NAME",
"value": "Shikome"
},
{
"context": "C.Spirit, C.Tormented, C.Wave2], 6),\n new Model('Jaakuna Ubume', [C.Resurrectionist], [C.Enforcer, C.",
"end": 8088,
"score": 0.529625654220581,
"start": 8086,
"tag": "NAME",
"value": "Ja"
},
{
"context": "er, C.Living, C.Rare1, C.Wave2], 7),\n new Model('Carrion Effigy', [C.Resurrectionist], [C.Minion, C.Construct, C.",
"end": 8298,
"score": 0.9978618621826172,
"start": 8284,
"tag": "NAME",
"value": "Carrion Effigy"
},
{
"context": "1, C.Puppet, C.Effigy, C.Wave2], 4),\n new Model('Ashigaru', [C.Resurrectionist], [C.Minion, C.Undead, C.Ret",
"end": 8410,
"score": 0.9812080264091492,
"start": 8402,
"tag": "NAME",
"value": "Ashigaru"
},
{
"context": " C.Undead, C.Retainer, C.Wave2], 5),\n new Model('Philip and the Nanny', [C.Resurrectionist], [C.Henchman, C.U",
"end": 8504,
"score": 0.8383582234382629,
"start": 8494,
"tag": "NAME",
"value": "Philip and"
},
{
"context": "etainer, C.Wave2], 5),\n new Model('Philip and the Nanny', [C.Resurrectionist], [C.Henchman, C.Undead, C.R",
"end": 8514,
"score": 0.9935756921768188,
"start": 8509,
"tag": "NAME",
"value": "Nanny"
},
{
"context": "C.Horror, C.Wave2], 8, 5),\n new Model('Student of Sinew', [C.Resurrectionist], [C.Minion, C.Construct, C.",
"end": 8636,
"score": 0.91214919090271,
"start": 8631,
"tag": "NAME",
"value": "Sinew"
},
{
"context": " C.Academic, C.Wave2], 7),\n new Model('Student of Steel', [C.Resurrectionist], [C.Minion, C.Construct, C.",
"end": 8759,
"score": 0.8028450012207031,
"start": 8754,
"tag": "NAME",
"value": "Steel"
},
{
"context": " C.Academic, C.Wave2], 7),\n new Model('Student of Viscera', [C.Resurrectionist], [C.Minion, C.Construct, C.",
"end": 8884,
"score": 0.9336612820625305,
"start": 8877,
"tag": "NAME",
"value": "Viscera"
},
{
"context": "Horror, C.Academic, C.Wave2], 8),\n new Model('The Valedictorian', [C.Resurrectionist], [C.Henchman, C",
"end": 8996,
"score": 0.5868222713470459,
"start": 8995,
"tag": "NAME",
"value": "V"
},
{
"context": ", C.Academic, C.Wave2], 8),\n new Model('The Valedictorian', [C.Resurrectionist], [C.Henchman, C.Construct, ",
"end": 9008,
"score": 0.5907509922981262,
"start": 9000,
"tag": "NAME",
"value": "ictorian"
},
{
"context": "ademic, C.Wave2], 10, 3),\n \n new Model('Rasputina', [C.Arcanist], [C.Master, C.Living, C.Wave1], un",
"end": 9150,
"score": 0.9995496273040771,
"start": 9141,
"tag": "NAME",
"value": "Rasputina"
},
{
"context": ", C.Living, C.Wave1], undefined, 3),\n new Model('Marcus', [C.Arcanist], [C.Master, C.Living, C.Beast, C.W",
"end": 9232,
"score": 0.9995995163917542,
"start": 9226,
"tag": "NAME",
"value": "Marcus"
},
{
"context": "g, C.Beast, C.Wave1], undefined, 4),\n new Model('Ramos', [C.Arcanist], [C.Master, C.Living, C.Construct,",
"end": 9322,
"score": 0.9992985725402832,
"start": 9317,
"tag": "NAME",
"value": "Ramos"
},
{
"context": "uct, C.Msu, C.Wave1], undefined, 3),\n new Model('Myranda', [C.Arcanist], [C.Henchman, C.Living, C.Rare1, C",
"end": 9425,
"score": 0.9893739223480225,
"start": 9418,
"tag": "NAME",
"value": "Myranda"
},
{
"context": ", C.Rare1, C.Beast, C.Wave1], 8, 5),\n new Model('Joss', [C.Arcanist], [C.Henchman, C.Living, C.Construc",
"end": 9517,
"score": 0.9973593354225159,
"start": 9513,
"tag": "NAME",
"value": "Joss"
},
{
"context": "t, C.Rare1, C.Msu, C.Wave1], 10, 3),\n new Model('Cojo', [C.Arcanist], [C.Enforcer, C.Living, C.Rare1, C",
"end": 9621,
"score": 0.9977504014968872,
"start": 9617,
"tag": "NAME",
"value": "Cojo"
},
{
"context": ", C.Rare1, C.Beast, C.Wave1], 8),\n new Model('Ice Golem', [C.Arcanist], [C.Enforcer, C.Construct, C.Wave1",
"end": 9715,
"score": 0.6275904178619385,
"start": 9710,
"tag": "NAME",
"value": "Golem"
},
{
"context": "nforcer, C.Construct, C.Wave1], 10),\n new Model('Wendigo', [C.Arcanist], [C.Minion, C.Living, C.TotemFor('",
"end": 9793,
"score": 0.9978496432304382,
"start": 9786,
"tag": "NAME",
"value": "Wendigo"
},
{
"context": "TotemFor('Rasputina'), C.Wave1], 3),\n new Model('Jackalope', [C.Arcanist], [C.Peon, C.Living, C.TotemFor('Ma",
"end": 9892,
"score": 0.9988810420036316,
"start": 9883,
"tag": "NAME",
"value": "Jackalope"
},
{
"context": "pe', [C.Arcanist], [C.Peon, C.Living, C.TotemFor('Marcus'), C.Beast, C.Wave1], 2),\n new Model('Brass Arac",
"end": 9946,
"score": 0.9952355027198792,
"start": 9940,
"tag": "NAME",
"value": "Marcus"
},
{
"context": "or('Marcus'), C.Beast, C.Wave1], 2),\n new Model('Brass Arachnid', [C.Arcanist], [C.Peon, C.Construct, C.TotemFor(",
"end": 10000,
"score": 0.7937206029891968,
"start": 9986,
"tag": "NAME",
"value": "Brass Arachnid"
},
{
"context": ", [C.Arcanist], [C.Peon, C.Construct, C.TotemFor('Ramos'), C.Msu, C.Wave1], 4),\n new Model('Essence of P",
"end": 10056,
"score": 0.9337799549102783,
"start": 10051,
"tag": "NAME",
"value": "Ramos"
},
{
"context": ", C.Totem, C.Spirit, C.Wave1], 3),\n new Model('December Acolyte', [C.Arcanist], [C.Minion, C.Living, C.Wave1], 7)",
"end": 10198,
"score": 0.8499085307121277,
"start": 10184,
"tag": "NAME",
"value": "cember Acolyte"
},
{
"context": " [C.Peon, C.Construct, C.Wave1], 4),\n new Model('Hoarcat Pride', [C.Arcanist], [C.Minion, C.Living, C.Beast, C.S",
"end": 10359,
"score": 0.761517345905304,
"start": 10346,
"tag": "NAME",
"value": "Hoarcat Pride"
},
{
"context": "ing, C.Beast, C.Swarm, C.Wave1], 5),\n new Model('Howard Langston', [C.Arcanist], [C.Enforcer, C.Construct, C.Livin",
"end": 10457,
"score": 0.9984899163246155,
"start": 10442,
"tag": "NAME",
"value": "Howard Langston"
},
{
"context": "min, C.Msu, C.Foundry, C.Wave1], 4),\n new Model('Moleman', [C.Arcanist], [C.Minion, C.Living, C.Beast, C.W",
"end": 10753,
"score": 0.9224985241889954,
"start": 10746,
"tag": "NAME",
"value": "Moleman"
},
{
"context": "te Du Bois'), C.Rare3, C.Wave2], 2),\n new Model('Cassandra', [C.Arcanist], [C.Henchman, C.Living, C.Rare1, C",
"end": 11845,
"score": 0.9907881617546082,
"start": 11836,
"tag": "NAME",
"value": "Cassandra"
},
{
"context": ".Rare1, C.Showgirl, C.Wave2], 8, 5),\n new Model('Coryphee', [C.Arcanist], [C.Minion, C.Construct, C.Rare2, ",
"end": 11944,
"score": 0.9922540783882141,
"start": 11936,
"tag": "NAME",
"value": "Coryphee"
},
{
"context": " C.Showgirl, C.Puppet, C.Wave2], 7),\n new Model('Coryphee Duet', [C.Arcanist], [C.Enforcer, C.Construct, C.Showg",
"end": 12056,
"score": 0.970779538154602,
"start": 12043,
"tag": "NAME",
"value": "Coryphee Duet"
},
{
"context": " C.Showgirl, C.Puppet, C.Wave2], 0),\n new Model('Performer', [C.Arcanist], [C.Minion, C.Living, C.Mercenary,",
"end": 12157,
"score": 0.8983749151229858,
"start": 12148,
"tag": "NAME",
"value": "Performer"
},
{
"context": "Mercenary, C.Showgirl, C.Wave2], 5),\n new Model('Mannequin', [C.Arcanist], [C.Peon, C.Construct, C.Showgirl,",
"end": 12256,
"score": 0.9914964437484741,
"start": 12247,
"tag": "NAME",
"value": "Mannequin"
},
{
"context": " C.Showgirl, C.Puppet, C.Wave2], 4),\n new Model('Kaeris', [C.Arcanist], [C.Master, C.Living, C.Msu, C.Wav",
"end": 12350,
"score": 0.9918391108512878,
"start": 12344,
"tag": "NAME",
"value": "Kaeris"
},
{
"context": "mFor('Kaeris'), C.Msu, C.Wave2], 2),\n new Model('Gunsmith', [C.Arcanist], [C.Minion, C.Living, C.Msu, C.Wav",
"end": 12650,
"score": 0.9916446208953857,
"start": 12642,
"tag": "NAME",
"value": "Gunsmith"
},
{
"context": "ct, C.Rare1, C.Msu, C.Wave2], 3),\n \n new Model('Lilith', ['Neverborn'], [C.Master, C.Living, C.Nephilim,",
"end": 14143,
"score": 0.8414816856384277,
"start": 14137,
"tag": "NAME",
"value": "Lilith"
},
{
"context": "C.Nephilim, C.Wave1], undefined, 4),\n new Model('Pandora', ['Neverborn'], [C.Master, C.Living, C.Woe, C.Wa",
"end": 14239,
"score": 0.7451474070549011,
"start": 14232,
"tag": "NAME",
"value": "Pandora"
},
{
"context": "ing, C.Woe, C.Wave1], undefined, 3),\n new Model('Zoraida', ['Neverborn', C.Gremlin], [C.Master, C.Living, ",
"end": 14330,
"score": 0.6900224685668945,
"start": 14323,
"tag": "NAME",
"value": "Zoraida"
},
{
"context": "Swampfiend, C.Wave1], undefined, 4),\n new Model('Barbaros', ['Neverborn'], [C.Henchman, C.Living, C.Rare1, ",
"end": 14440,
"score": 0.8018297553062439,
"start": 14432,
"tag": "NAME",
"value": "Barbaros"
},
{
"context": "Rare1, C.Nephilim, C.Wave1], 10, 3),\n new Model('Candy', ['Neverborn'], [C.Henchman, C.Living, C.Rare1, ",
"end": 14538,
"score": 0.9796656370162964,
"start": 14533,
"tag": "NAME",
"value": "Candy"
},
{
"context": "C.Mimic, C.Lost, C.Wave1], 9, 4),\n new Model('Bad Juju', ['Neverborn'], [C.Henchman, C.Rare1, C.Swampfie",
"end": 14650,
"score": 0.6803867220878601,
"start": 14646,
"tag": "NAME",
"value": "Juju"
},
{
"context": "are1, C.Swampfiend, C.Wave1], 8, 5),\n new Model('Cherub', ['Neverborn'], [C.Peon, C.Living, C.TotemFor('L",
"end": 14740,
"score": 0.9592485427856445,
"start": 14734,
"tag": "NAME",
"value": "Cherub"
},
{
"context": "ra'), C.Woe, C.Spirit, C.Wave1], 5),\n new Model('Voodoo Doll', ['Neverborn', C.Gremlin], [C.Peon, C.Construct,",
"end": 14956,
"score": 0.8599982261657715,
"start": 14945,
"tag": "NAME",
"value": "Voodoo Doll"
},
{
"context": ".Rare3, C.Nightmare, C.Wave2], 2),\n new Model('Alp', [C.Neverborn], [C.Peon, C.Nightmare, C.Wave2], ",
"end": 16430,
"score": 0.8498632311820984,
"start": 16429,
"tag": "NAME",
"value": "p"
},
{
"context": " [C.Peon, C.Nightmare, C.Wave2], 3),\n new Model('Coppelius', [C.Neverborn], [C.Enforcer, C.Rare1, C.Nightmar",
"end": 16506,
"score": 0.8640411496162415,
"start": 16497,
"tag": "NAME",
"value": "Coppelius"
},
{
"context": " C.Rare1, C.Nightmare, C.Wave2], 8),\n new Model('Lelu', [C.Neverborn], [C.Enforcer, C.Rare1, C.Nightmar",
"end": 16590,
"score": 0.9450175762176514,
"start": 16586,
"tag": "NAME",
"value": "Lelu"
},
{
"context": "re, C.Nephilim, C.Woe, C.Wave2], 7),\n new Model('Lilitu', [C.Neverborn], [C.Enforcer, C.Rare1, C.Nightmar",
"end": 16695,
"score": 0.9483709931373596,
"start": 16689,
"tag": "NAME",
"value": "Lilitu"
},
{
"context": ", C.Rare2, C.Nephilim, C.Wave2], 7),\n new Model('Nekima', [C.Neverborn], [C.Henchman, C.Living, C.Rare1, ",
"end": 17102,
"score": 0.8395368456840515,
"start": 17096,
"tag": "NAME",
"value": "Nekima"
},
{
"context": "Rare1, C.Nephilim, C.Wave2], 13, 0),\n new Model('Collodi', [C.Neverborn], [C.Master, C.Construct, C.Puppet",
"end": 17202,
"score": 0.9895763397216797,
"start": 17195,
"tag": "NAME",
"value": "Collodi"
},
{
"context": ", C.Puppet, C.Wave2], undefined, 3),\n new Model('Marionette', [C.Neverborn], [C.Minion, C.Construct, C.TotemF",
"end": 17302,
"score": 0.9416907429695129,
"start": 17292,
"tag": "NAME",
"value": "Marionette"
},
{
"context": "Rare1, C.Horseman, C.Wave2], 12),\n \n new Model('Von Schill', [C.Outcast], [C.Master, C.Living, C.Freikorps, ",
"end": 18469,
"score": 0.9995572566986084,
"start": 18459,
"tag": "NAME",
"value": "Von Schill"
},
{
"context": ".Freikorps, C.Wave1], undefined, 1),\n new Model('Tara', [C.Outcast, C.Resurrectionist], [C.Master, C.Un",
"end": 18561,
"score": 0.9985678195953369,
"start": 18557,
"tag": "NAME",
"value": "Tara"
},
{
"context": ", C.Sister, C.Wave1], undefined, 1),\n new Model('Hannah', [C.Outcast], [C.Henchman, C.Living, C.Rare1, C.",
"end": 18763,
"score": 0.9995551109313965,
"start": 18757,
"tag": "NAME",
"value": "Hannah"
},
{
"context": " C.Rare1, C.Sister, C.Wave1], 0, 3),\n new Model('Taelor', [C.Outcast], [C.Henchman, C.Living, C.Mercenary",
"end": 19062,
"score": 0.9995377063751221,
"start": 19056,
"tag": "NAME",
"value": "Taelor"
},
{
"context": "', [C.Outcast], [C.Peon, C.Construct, C.TotemFor('Von Schill'), C.Wave1], 3),\n new Model('Karina', [C.Outcast",
"end": 19225,
"score": 0.9948580265045166,
"start": 19215,
"tag": "NAME",
"value": "Von Schill"
},
{
"context": "otemFor('Von Schill'), C.Wave1], 3),\n new Model('Karina', [C.Outcast, C.Resurrectionist], [C.Enforcer, C.",
"end": 19262,
"score": 0.9996087551116943,
"start": 19256,
"tag": "NAME",
"value": "Karina"
},
{
"context": "urrectionist], [C.Enforcer, C.Living, C.TotemFor('Tara'), C.Wave1], 5),\n new Model('Student of Conflict",
"end": 19336,
"score": 0.9822431802749634,
"start": 19332,
"tag": "NAME",
"value": "Tara"
},
{
"context": ", C.Mercenary, C.Lost, C.Wave1], 2),\n new Model('Bishop', [C.Outcast], [C.Enforcer, C.Living, C.Mercenary",
"end": 19592,
"score": 0.9931150078773499,
"start": 19586,
"tag": "NAME",
"value": "Bishop"
},
{
"context": "C.Mercenary, C.Rare1, C.Wave1], 10),\n new Model('Convict Gunslinger', [C.Outcast], [C.Enforcer, C.Living, C.Mercenary",
"end": 19699,
"score": 0.9989827275276184,
"start": 19681,
"tag": "NAME",
"value": "Convict Gunslinger"
},
{
"context": "Mercenary, C.Rare2, C.Wave1], 7),\n new Model('Desperate Mercenary', [C.Outcast], [C.Minion, C.Living, C.Mer",
"end": 19798,
"score": 0.6378806233406067,
"start": 19790,
"tag": "NAME",
"value": "perate M"
},
{
"context": "ercenary, C.Freikorps, C.Wave1], 8),\n new Model('Freikorpsman', [C.Outcast], [C.Living, C.Minion, C.Mercenary, ",
"end": 20007,
"score": 0.9983938932418823,
"start": 19995,
"tag": "NAME",
"value": "Freikorpsman"
},
{
"context": "ercenary, C.Freikorps, C.Wave1], 5),\n new Model('Hans', [C.Outcast], [C.Enforcer, C.Living, C.Mercenary",
"end": 20101,
"score": 0.9995152950286865,
"start": 20097,
"tag": "NAME",
"value": "Hans"
},
{
"context": " C.Mercenary, C.Rare1, C.Wave1], 8),\n new Model('Johan', [C.Outcast], [C.Enforcer, C.Living, C.Mercenary",
"end": 20194,
"score": 0.9996359944343567,
"start": 20189,
"tag": "NAME",
"value": "Johan"
},
{
"context": "enary, C.Rare1, C.Msu, C.Wave1], 6),\n new Model('Killjoy', [C.Outcast], [C.Enforcer, C.Undead, C.Mercenary",
"end": 20296,
"score": 0.7809256315231323,
"start": 20289,
"tag": "NAME",
"value": "Killjoy"
},
{
"context": "y, C.Rare1, C.Horror, C.Wave1], 12),\n new Model('Ronin', [C.Outcast], [C.Minion, C.Living, C.Mercenary, ",
"end": 20400,
"score": 0.9992157816886902,
"start": 20395,
"tag": "NAME",
"value": "Ronin"
},
{
"context": "ving, C.Mercenary, C.Wave1], 6),\n new Model('Void Wretch', [C.Outcast], [C.Minion, C.Wave1], 4),\n \n new ",
"end": 20488,
"score": 0.9757195711135864,
"start": 20482,
"tag": "NAME",
"value": "Wretch"
},
{
"context": "utcast], [C.Minion, C.Wave1], 4),\n \n new Model('Jack Daw', [C.Outcast], [C.Master, C.Undead, C.Tormented, ",
"end": 20553,
"score": 0.9996321797370911,
"start": 20545,
"tag": "NAME",
"value": "Jack Daw"
},
{
"context": "C.Undead, C.Tormented, C.Wave2], 5),\n new Model('Montresor', [C.Outcast], [C.Henchman, C.Undead, C.Rare1, C.",
"end": 20757,
"score": 0.9995575547218323,
"start": 20748,
"tag": "NAME",
"value": "Montresor"
},
{
"context": "Rare1, C.Tormented, C.Wave2], 9, 4),\n new Model('Lady Ligeia', [C.Outcast], [C.Peon, C.TotemFor('Jack Daw'), C",
"end": 20859,
"score": 0.9997329711914062,
"start": 20848,
"tag": "NAME",
"value": "Lady Ligeia"
},
{
"context": "('Lady Ligeia', [C.Outcast], [C.Peon, C.TotemFor('Jack Daw'), C.Tormented, C.Spirit, C.Wave2], 4),\n new Mod",
"end": 20904,
"score": 0.9997820854187012,
"start": 20896,
"tag": "NAME",
"value": "Jack Daw"
},
{
"context": "C.Tormented, C.Spirit, C.Wave2], 4),\n new Model('Hamelin', [C.Outcast], [C.Master, C.Tyrant, C.Nihilist, C",
"end": 20965,
"score": 0.9996984601020813,
"start": 20958,
"tag": "NAME",
"value": "Hamelin"
},
{
"context": "C.Nihilist, C.Wave2], undefined, 1),\n new Model('Nix', [C.Outcast], [C.Henchman, C.Rare1, C.Nihilist, ",
"end": 21055,
"score": 0.9981197714805603,
"start": 21052,
"tag": "NAME",
"value": "Nix"
},
{
"context": ", C.Rare2, C.Nihilist, C.Wave2], 6),\n new Model('Malifaux Rat', [C.Outcast], [C.Peon, C.Vermin, C.Wave2]",
"end": 21346,
"score": 0.6590205430984497,
"start": 21341,
"tag": "NAME",
"value": "Malif"
},
{
"context": "2, C.Nihilist, C.Wave2], 6),\n new Model('Malifaux Rat', [C.Outcast], [C.Peon, C.Vermin, C.Wave2], 2),\n ",
"end": 21353,
"score": 0.7661603689193726,
"start": 21350,
"tag": "NAME",
"value": "Rat"
},
{
"context": "len', [C.Outcast], [C.Peon, C.Living, C.TotemFor('Hamelin'), C.Rare3, C.Nihilist, C.Lost, C.Wave2], 2),\n n",
"end": 21560,
"score": 0.9990790486335754,
"start": 21553,
"tag": "NAME",
"value": "Hamelin"
},
{
"context": ", C.Living, C.Wave2], undefined, 2),\n new Model('Rusty Alyce', [C.Outcast], [C.Henchman, C.Living, C.Rare1, C.",
"end": 22891,
"score": 0.9996590614318848,
"start": 22880,
"tag": "NAME",
"value": "Rusty Alyce"
},
{
"context": "C.Living, C.Rare1, C.Wave2], 10, 3),\n new Model('Hollow Waif', [C.Outcast], [C.Peon, C.Undead, C.TotemFor('Lev",
"end": 22981,
"score": 0.8997901082038879,
"start": 22970,
"tag": "NAME",
"value": "Hollow Waif"
},
{
"context": ", C.Rare1, C.Wave2], 13),\n \n new Model('Som\\'er Teeth Jones', [C.Gremlin], [C.Master, C.Living, C.Gremlin, C.",
"end": 23301,
"score": 0.9997552037239075,
"start": 23282,
"tag": "NAME",
"value": "Som\\'er Teeth Jones"
},
{
"context": " C.Gremlin, C.Wave1], undefined, 4),\n new Model('Ophelia LaCroix', [C.Gremlin], [C.Master, C.Living, C.Gremlin, C.",
"end": 23402,
"score": 0.9998494386672974,
"start": 23387,
"tag": "NAME",
"value": "Ophelia LaCroix"
},
{
"context": ", C.TriChi, C.Wave1], undefined, 3),\n new Model('Francois LaCroix', [C.Gremlin], [C.Henchman, C.Living, C.Rare1, C.",
"end": 23636,
"score": 0.9998404383659363,
"start": 23620,
"tag": "NAME",
"value": "Francois LaCroix"
},
{
"context": "Gremlin, C.TriChi, C.Wave1], 10, 3),\n new Model('Lenny', [C.Gremlin], [C.Enforcer, C.Living, C.Rare1, C.",
"end": 23844,
"score": 0.9997773170471191,
"start": 23839,
"tag": "NAME",
"value": "Lenny"
},
{
"context": "t, C.Rare1, C.TriChi, C.Wave1], 10),\n new Model('Skeeter', [C.Gremlin], [C.Peon, C.Living, C.TotemFor('Som",
"end": 24039,
"score": 0.970268964767456,
"start": 24032,
"tag": "NAME",
"value": "Skeeter"
},
{
"context": "er', [C.Gremlin], [C.Peon, C.Living, C.TotemFor('Som\\'er Teeth Jones'), C.Wave1], 2),\n new Model('Young LaCroix', [C.",
"end": 24105,
"score": 0.9038834571838379,
"start": 24087,
"tag": "NAME",
"value": "om\\'er Teeth Jones"
},
{
"context": "Som\\'er Teeth Jones'), C.Wave1], 2),\n new Model('Young LaCroix', [C.Gremlin], [C.Peon, C.Living, C.TotemFor('Oph",
"end": 24149,
"score": 0.9760370254516602,
"start": 24136,
"tag": "NAME",
"value": "Young LaCroix"
},
{
"context": "x', [C.Gremlin], [C.Peon, C.Living, C.TotemFor('Ophelia LaCroix'), C.Gremlin, C.Kin, C.Wave1], 2),\n new Model('A",
"end": 24211,
"score": 0.9282469749450684,
"start": 24198,
"tag": "NAME",
"value": "helia LaCroix"
},
{
"context": "x'), C.Gremlin, C.Kin, C.Wave1], 2),\n new Model('Apprentice Wesley', [C.Gremlin], [C.Minion, C.Living, C.TotemFor('T",
"end": 24277,
"score": 0.9611866474151611,
"start": 24260,
"tag": "NAME",
"value": "Apprentice Wesley"
},
{
"context": ".Gremlin, C.TriChi, C.Wave1], 3),\n new Model('Bayou Gremlin', [C.Gremlin], [C.Minion, C.Living, C.Gremlin, C.",
"end": 24405,
"score": 0.7375435829162598,
"start": 24395,
"tag": "NAME",
"value": "ou Gremlin"
},
{
"context": "re1, C.Gremlin, C.Kin, C.Wave1], 6),\n new Model('Rami LaCroix', [C.Gremlin], [C.Enforcer, C.Living, C.Rare1, C.",
"end": 25146,
"score": 0.9996886253356934,
"start": 25134,
"tag": "NAME",
"value": "Rami LaCroix"
},
{
"context": "re1, C.Gremlin, C.Kin, C.Wave1], 7),\n new Model('Raphael LaCroix', [C.Gremlin], [C.Enforcer, C.Living, C.Rare1, C.",
"end": 25254,
"score": 0.9998344779014587,
"start": 25239,
"tag": "NAME",
"value": "Raphael LaCroix"
},
{
"context": ", C.Gremlin, C.Kin, C.Wave1], 7),\n \n new Model('Ulix', [C.Gremlin], [C.Master, C.Living, C.Gremlin, C.",
"end": 25354,
"score": 0.9934245347976685,
"start": 25350,
"tag": "NAME",
"value": "Ulix"
},
{
"context": "ope', [C.Gremlin], [C.Peon, C.Living, C.TotemFor('Ulix'), C.Hound, C.Wave2], 2),\n new Model('The Sow', ",
"end": 25499,
"score": 0.9768962860107422,
"start": 25495,
"tag": "NAME",
"value": "Ulix"
},
{
"context": "ndead, C.Rare6, C.Pig, C.Wave2], 2),\n new Model('Gremlin Taxidermist', [C.Gremlin], [C.Enforcer, C.Living, C.Rare2, C.",
"end": 25939,
"score": 0.8897926807403564,
"start": 25920,
"tag": "NAME",
"value": "Gremlin Taxidermist"
},
{
"context": "g, C.Rare2, C.Gremlin, C.Wave2], 7),\n new Model('Mah Tucket', [C.Gremlin], [C.Master, C.Living, C.Gremlin, C.",
"end": 26035,
"score": 0.9900223016738892,
"start": 26025,
"tag": "NAME",
"value": "Mah Tucket"
},
{
"context": "h Tucket'), C.Gremlin, C.Wave2], 4),\n new Model('Trixiebelle', [C.Gremlin], [C.Henchman, C.Living, C.Rare1, C.",
"end": 26246,
"score": 0.9815554618835449,
"start": 26235,
"tag": "NAME",
"value": "Trixiebelle"
},
{
"context": "C.Rare1, C.Gremlin, C.Wave2], 8, 5),\n new Model('Bayou Bushwhacker', [C.Gremlin], [C.Minion, C.Living, C.Rare3, C.Gr",
"end": 26352,
"score": 0.9580777287483215,
"start": 26335,
"tag": "NAME",
"value": "Bayou Bushwhacker"
},
{
"context": "g, C.Rare3, C.Gremlin, C.Wave2], 6),\n new Model('McTavish', [C.Gremlin], [C.Henchman, C.Living, C.Mercenary",
"end": 26444,
"score": 0.9989438056945801,
"start": 26436,
"tag": "NAME",
"value": "McTavish"
},
{
"context": "re1, C.Swampfiend, C.Wave2], 10, 3),\n new Model('Mancha Roja', [C.Gremlin], [C.Henchman, C.Living, C.Rare1, C.",
"end": 26561,
"score": 0.9998717308044434,
"start": 26550,
"tag": "NAME",
"value": "Mancha Roja"
},
{
"context": ".Rare1, C.Gremlin, C.Wave2], 10, 3),\n new Model('Burt Jebsen', [C.Gremlin], [C.Enforcer, C.Living, C.Mercenary",
"end": 26662,
"score": 0.9998748898506165,
"start": 26651,
"tag": "NAME",
"value": "Burt Jebsen"
},
{
"context": "y, C.Rare1, C.Gremlin, C.Wave2], 7),\n new Model('Gracie', [C.Gremlin], [C.Enforcer, C.Living, C.Mercenary",
"end": 26767,
"score": 0.9980290532112122,
"start": 26761,
"tag": "NAME",
"value": "Gracie"
},
{
"context": "nary, C.Rare1, C.Pig, C.Wave2], 10),\n new Model('Merris LaCroix', [C.Gremlin], [C.Enforcer, C.Living, C.Rare1, C.",
"end": 26877,
"score": 0.999701201915741,
"start": 26863,
"tag": "NAME",
"value": "Merris LaCroix"
},
{
"context": "1, C.Puppet, C.Effigy, C.Wave2], 4),\n new Model('Wong', [C.Gremlin], [C.Master, C.Living, C.Gremlin, C.",
"end": 27185,
"score": 0.5855576992034912,
"start": 27181,
"tag": "NAME",
"value": "Wong"
},
{
"context": ", C.Living, C.Gremlin, C.Wave2], 5),\n new Model('Bayou Gator', [C.Gremlin], [C.Minion, C.Living, C.Swampfiend,",
"end": 27491,
"score": 0.9986798167228699,
"start": 27480,
"tag": "NAME",
"value": "Bayou Gator"
},
{
"context": ".Living, C.Swampfiend, C.Wave2], 5),\n new Model('Sammy LaCroix', [C.Gremlin], [C.Henchman, C.Living, C.Rare1, C.",
"end": 27582,
"score": 0.9998847842216492,
"start": 27569,
"tag": "NAME",
"value": "Sammy LaCroix"
},
{
"context": ", C.Gremlin, C.Kin, C.Wave2], 7, 6),\n new Model('Old Cranky', [C.Gremlin], [C.Peon, C.Living, C.Totem, C.Grem",
"end": 27688,
"score": 0.9753745198249817,
"start": 27678,
"tag": "NAME",
"value": "Old Cranky"
},
{
"context": " C.Gremlin, C.Wave2], 4),\n \n new Model('Misaki', [C.TenThunders, C.Outcast], [C.Master, C.Living",
"end": 27787,
"score": 0.9994818568229675,
"start": 27781,
"tag": "NAME",
"value": "Misaki"
},
{
"context": "astBlossom, C.Wave1], undefined, 2),\n new Model('Mei Feng', [C.TenThunders, C.Arcanist], [C.Master, C.Livin",
"end": 27900,
"score": 0.9997265338897705,
"start": 27892,
"tag": "NAME",
"value": "Mei Feng"
},
{
"context": " C.Foundry, C.Wave1], undefined, 3),\n new Model('Jakob Lynch', [C.TenThunders, C.Neverborn], [C.Master, C.Livi",
"end": 28013,
"score": 0.9998593330383301,
"start": 28002,
"tag": "NAME",
"value": "Jakob Lynch"
},
{
"context": "C.Darkened, C.Wave1], undefined, 1),\n new Model('Ototo', [C.TenThunders], [C.Henchman, C.Living, C.Rare1",
"end": 28122,
"score": 0.9995888471603394,
"start": 28117,
"tag": "NAME",
"value": "Ototo"
},
{
"context": "e1, C.LastBlossom, C.Wave1], 10, 3),\n new Model('Kang', [C.TenThunders], [C.Henchman, C.Living, C.Rare1",
"end": 28224,
"score": 0.9983848333358765,
"start": 28220,
"tag": "NAME",
"value": "Kang"
},
{
"context": "C.Rare1, C.Foundry, C.Wave1], 9, 4),\n new Model('Yamaziko', [C.TenThunders], [C.Henchman, C.Living, C.Rare1",
"end": 28325,
"score": 0.9957351088523865,
"start": 28317,
"tag": "NAME",
"value": "Yamaziko"
},
{
"context": "re1, C.LastBlossom, C.Wave1], 7, 6),\n new Model('Shang', [C.TenThunders, C.Outcast], [C.Peon, C.Living, ",
"end": 28427,
"score": 0.9914309978485107,
"start": 28422,
"tag": "NAME",
"value": "Shang"
},
{
"context": "nders, C.Outcast], [C.Peon, C.Living, C.TotemFor('Misaki'), C.Wave1], 3),\n new Model('Emberling', [C.TenT",
"end": 28495,
"score": 0.9664175510406494,
"start": 28489,
"tag": "NAME",
"value": "Misaki"
},
{
"context": " C.TotemFor('Misaki'), C.Wave1], 3),\n new Model('Emberling', [C.TenThunders, C.Arcanist], [C.Minion, C.Totem",
"end": 28535,
"score": 0.990279495716095,
"start": 28526,
"tag": "NAME",
"value": "Emberling"
},
{
"context": ".TenThunders, C.Arcanist], [C.Minion, C.TotemFor('Mei Feng'), C.Spirit, C.Wave1], 3),\n new Model('Hungering",
"end": 28598,
"score": 0.9949764609336853,
"start": 28590,
"tag": "NAME",
"value": "Mei Feng"
},
{
"context": "nThunders, C.Neverborn], [C.Henchman, C.TotemFor('Jakob Lynch'), C.Rare1, C.Spirit, C.Darkened, C.Wave1], 0, 5)",
"end": 28726,
"score": 0.9997664093971252,
"start": 28715,
"tag": "NAME",
"value": "Jakob Lynch"
},
{
"context": "pirit, C.Darkened, C.Wave1], 0, 5),\n new Model('Dawn Serpent', [C.TenThunders], [C.Minion, C.Living, C.Rare1, ",
"end": 28803,
"score": 0.764665424823761,
"start": 28792,
"tag": "NAME",
"value": "awn Serpent"
},
{
"context": "ng, C.Rare1, C.Beast, C.Wave1], 10),\n new Model('Fuhatsu', [C.TenThunders], [C.Henchman, C.Living, C.Rare1",
"end": 28897,
"score": 0.9937620759010315,
"start": 28890,
"tag": "NAME",
"value": "Fuhatsu"
},
{
"context": "on, C.Living, C.Rare3, C.Wave1], 4),\n new Model('Oiran', [C.TenThunders], [C.Minion, C.Living, C.Mercena",
"end": 29079,
"score": 0.9924125671386719,
"start": 29074,
"tag": "NAME",
"value": "Oiran"
},
{
"context": ", [C.Minion, C.Living, C.Wave1], 7),\n new Model('Torakage', [C.TenThunders], [C.Minion, C.Living, C.Mercena",
"end": 29502,
"score": 0.98880535364151,
"start": 29494,
"tag": "NAME",
"value": "Torakage"
},
{
"context": "cenary, C.LastBlossom, C.Wave1], 6),\n new Model('Samurai', [C.TenThunders], [C.Enforcer, C.Living, C.Wave1",
"end": 29605,
"score": 0.9956839680671692,
"start": 29598,
"tag": "NAME",
"value": "Samurai"
},
{
"context": "Enforcer, C.Living, C.Wave1], 8),\n \n new Model('Lucas McCabe', [C.TenThunders, C.Guild], [C.Master, C.Living, ",
"end": 29690,
"score": 0.9977504014968872,
"start": 29678,
"tag": "NAME",
"value": "Lucas McCabe"
},
{
"context": "BlackSheep, C.Wave2], undefined, 2),\n new Model('Dismounted McCabe', [C.TenThunders, C.Guild], [C.Master, C.Living, ",
"end": 29809,
"score": 0.9648586511611938,
"start": 29792,
"tag": "NAME",
"value": "Dismounted McCabe"
},
{
"context": "BlackSheep, C.Wave2], undefined, 0),\n new Model('Sidir Alchibal', [C.TenThunders, C.Guild], [C.Henchman, C.Living",
"end": 29925,
"score": 0.9989327788352966,
"start": 29911,
"tag": "NAME",
"value": "Sidir Alchibal"
},
{
"context": "are1, C.BlackSheep, C.Wave2], 9, 4),\n new Model('Luna', [C.TenThunders, C.Guild], [C.Minion, C.Living, ",
"end": 30034,
"score": 0.9882854223251343,
"start": 30030,
"tag": "NAME",
"value": "Luna"
},
{
"context": "nders, C.Guild], [C.Minion, C.Living, C.TotemFor('Lucas McCabe'), C.Beast, C.Hound, C.Wave2], 4),\n new Model('W",
"end": 30108,
"score": 0.9604222178459167,
"start": 30096,
"tag": "NAME",
"value": "Lucas McCabe"
},
{
"context": "e'), C.Beast, C.Hound, C.Wave2], 4),\n new Model('Wastrel', [C.TenThunders, C.Guild], [C.Minion, C.Living, ",
"end": 30164,
"score": 0.9883993268013,
"start": 30157,
"tag": "NAME",
"value": "Wastrel"
},
{
"context": ".Living, C.BlackSheep, C.Wave2], 4),\n new Model('Yan Lo', [C.TenThunders, C.Resurrectionist], [C.Master, ",
"end": 30261,
"score": 0.9774314761161804,
"start": 30255,
"tag": "NAME",
"value": "Yan Lo"
},
{
"context": ".Ancestor, C.Wave2], undefined, 4),\n new Model('Soul Porter', [C.TenThunders, C.Resurrectionist], [C.Peon, ",
"end": 30380,
"score": 0.5884225368499756,
"start": 30372,
"tag": "NAME",
"value": "oul Port"
},
{
"context": "r('Yan Lo'), C.Spirit, C.Wave2], 3),\n new Model('Chiaki the Niece', [C.TenThunders, C.Resurrectionist], [C.En",
"end": 30499,
"score": 0.6608421206474304,
"start": 30489,
"tag": "NAME",
"value": "Chiaki the"
},
{
"context": "C.Minion, C.Living, C.Wave2], 5),\n new Model('Mr. Graves', [C.TenThunders, C.Neverborn], [C.Enforcer, C.Li",
"end": 31118,
"score": 0.9202146530151367,
"start": 31112,
"tag": "NAME",
"value": "Graves"
},
{
"context": ".Darkened, C.Mimic, C.Wave2], 8),\n new Model('Mr. Tannen', [C.TenThunders, C.Neverborn], [C.Enforcer, C.Li",
"end": 31253,
"score": 0.9791402816772461,
"start": 31247,
"tag": "NAME",
"value": "Tannen"
},
{
"context": " C.Living, C.Rare1, C.Wave2], 9, 4),\n new Model('Shenlong', [C.TenThunders], [C.Master, C.Living, C.Tyrant,",
"end": 31685,
"score": 0.8352381587028503,
"start": 31677,
"tag": "NAME",
"value": "Shenlong"
},
{
"context": ", [C.TenThunders], [C.Peon, C.Living, C.TotemFor('Shenlong'), C.Rare2, C.Wave2], 2),\n new Model('Fermented ",
"end": 31840,
"score": 0.6556376814842224,
"start": 31832,
"tag": "NAME",
"value": "Shenlong"
},
{
"context": "irit, C.Oni, C.Wave2], 4),\n new Model('Katanaka Sniper', [C.TenThunders], [C.Minion, C.Living, C.Rare",
"end": 32346,
"score": 0.7403373122215271,
"start": 32344,
"tag": "NAME",
"value": "ni"
},
{
"context": "n, C.BlackSheep, C.Wave3], 7, 6),\n new Model('Dr. Grimwell', [C.Guild], [C.Henchman, C.Living, C.Mercenary, ",
"end": 32653,
"score": 0.9941067695617676,
"start": 32645,
"tag": "NAME",
"value": "Grimwell"
},
{
"context": "ercenary, C.Rare1, C.Wave3], 9, 4),\n new Model('Sloth', [C.Resurrectionist], [C.Enforcer, C.Undead, C",
"end": 33513,
"score": 0.5143094062805176,
"start": 33511,
"tag": "NAME",
"value": "lo"
},
{
"context": "er, C.Living, C.Rare1, C.Wave3], 7),\n new Model('Hayreddin', [C.Resurrectionist], [C.Enforcer, C.Living, C.R",
"end": 33766,
"score": 0.9810889959335327,
"start": 33757,
"tag": "NAME",
"value": "Hayreddin"
},
{
"context": ", [C.Minion, C.Oni, C.Wave3], 6),\n new Model('Jorogumo', [C.TenThunders], [C.Minion, C.Oni, C.LastBloss",
"end": 36711,
"score": 0.579882025718689,
"start": 36707,
"tag": "NAME",
"value": "ogum"
},
{
"context": "Oni, C.LastBlossom, C.Wave3], 9),\n \n new Model('Nellie Cochrane', [C.Guild], [C.Master, C.Living, C.Journalist, C",
"end": 36810,
"score": 0.9930815696716309,
"start": 36795,
"tag": "NAME",
"value": "Nellie Cochrane"
},
{
"context": "ss', [C.Guild], [C.Peon, C.Construct, C.TotemFor('Nellie Cochrane'), C.Journalist, C.Wave4], 3),\n new Model('Phion",
"end": 36978,
"score": 0.8891021609306335,
"start": 36963,
"tag": "NAME",
"value": "Nellie Cochrane"
},
{
"context": "hrane'), C.Journalist, C.Wave4], 3),\n new Model('Phiona Gage', [C.Guild], [C.Henchman, C.Living, C.Rare1, C.Jo",
"end": 37034,
"score": 0.996955394744873,
"start": 37023,
"tag": "NAME",
"value": "Phiona Gage"
},
{
"context": "Rare2, C.GuildMarshal, C.Wave4], 7),\n new Model('Witchling Thrall', [C.Guild], [C.Minion, C.Living, C.WitchHunter, ",
"end": 37444,
"score": 0.6864361763000488,
"start": 37428,
"tag": "NAME",
"value": "Witchling Thrall"
},
{
"context": "ing, C.WitchHunter, C.Wave4], 9),\n \n new Model('Reva', [C.Resurrectionist], [C.Master, C.Living, C.Rev",
"end": 37528,
"score": 0.8937450647354126,
"start": 37524,
"tag": "NAME",
"value": "Reva"
},
{
"context": "C.Revenant, C.Wave4], undefined, 4),\n new Model('Corpse Candle', [C.Resurrectionist], [C.Peon, C.Undead, C.Totem",
"end": 37636,
"score": 0.5615026950836182,
"start": 37623,
"tag": "NAME",
"value": "Corpse Candle"
},
{
"context": " C.Spirit, C.Revenant, C.Wave4], 2),\n new Model('Vincent St. Clair', [C.Resurrectionist], [C.Henchman, C.Living, C.R",
"end": 37765,
"score": 0.9650882482528687,
"start": 37748,
"tag": "NAME",
"value": "Vincent St. Clair"
},
{
"context": ".Rare1, C.Revenant, C.Wave4], 8, 5),\n new Model('Archie', [C.Resurrectionist], [C.Henchman, C.Undead, C.R",
"end": 37869,
"score": 0.9780369400978088,
"start": 37863,
"tag": "NAME",
"value": "Archie"
},
{
"context": "1, C.Horror, C.Wave4], 13, 0),\n new Model('Shieldbearer', [C.Resurrectionist], [C.Minion, C.Living, C.Rev",
"end": 37978,
"score": 0.5743445158004761,
"start": 37972,
"tag": "NAME",
"value": "bearer"
},
{
"context": " C.Living, C.Revenant, C.Wave4], 6),\n new Model('Draugr', [C.Resurrectionist], [C.Minion, C.Undead, C.Rev",
"end": 38068,
"score": 0.9290618896484375,
"start": 38062,
"tag": "NAME",
"value": "Draugr"
},
{
"context": " C.Revenant, C.Horror, C.Wave4], 8),\n new Model('Goryo', [C.Resurrectionist], [C.Minion, C.Spirit, C.Ret",
"end": 38167,
"score": 0.9645007252693176,
"start": 38162,
"tag": "NAME",
"value": "Goryo"
},
{
"context": "Spirit, C.Retainer, C.Wave4], 7),\n \n new Model('Sandeep Desai', [C.Arcanist], [C.Master, C.Living, C.Academic, ",
"end": 38267,
"score": 0.9991756677627563,
"start": 38254,
"tag": "NAME",
"value": "Sandeep Desai"
},
{
"context": "pse Candle', [C.Arcanist], [C.Minion, C.TotemFor('Sandeep Desai'), C.Rare1, C.Gamin, C.Wave4], 8),\n new Model('K",
"end": 38421,
"score": 0.999836802482605,
"start": 38408,
"tag": "NAME",
"value": "Sandeep Desai"
},
{
"context": "i'), C.Rare1, C.Gamin, C.Wave4], 8),\n new Model('Kudra', [C.Arcanist], [C.Henchman, C.Living, C.Rare1, C",
"end": 38475,
"score": 0.9991604685783386,
"start": 38470,
"tag": "NAME",
"value": "Kudra"
},
{
"context": ".Rare1, C.Academic, C.Wave4], 7, 6),\n new Model('Amina Naidu', [C.Arcanist], [C.Henchman, C.Living, C.Rare1, C",
"end": 38577,
"score": 0.9998459815979004,
"start": 38566,
"tag": "NAME",
"value": "Amina Naidu"
},
{
"context": " C.Msu, C.Academic, C.Wave4], 9, 4),\n new Model('Carlos Vasquez', [C.Arcanist], [C.Henchman, C.Living, C.Rare1, C",
"end": 38689,
"score": 0.9998407363891602,
"start": 38675,
"tag": "NAME",
"value": "Carlos Vasquez"
},
{
"context": ".Rare1, C.Showgirl, C.Wave4], 9, 4),\n new Model('Poison Gamin', [C.Arcanist], [C.Minion, C.Construct, C.Gamin, ",
"end": 38792,
"score": 0.997647225856781,
"start": 38780,
"tag": "NAME",
"value": "Poison Gamin"
},
{
"context": "uct, C.Gamin, C.Beast, C.Wave4], 5),\n new Model('Shastar Vidiya Guard', [C.Arcanist], [C.Enforcer, C.Living, C.Msu, C.A",
"end": 38898,
"score": 0.9941629767417908,
"start": 38878,
"tag": "NAME",
"value": "Shastar Vidiya Guard"
},
{
"context": " C.Msu, C.Academic, C.Wave4], 8),\n \n new Model('Titania', [C.Neverborn], [C.Master, C.Undead, C.Fae, C.Wa",
"end": 38994,
"score": 0.9934207797050476,
"start": 38987,
"tag": "NAME",
"value": "Titania"
},
{
"context": "C.Fae, C.Wave4], undefined, 4),\n new Model('The Gorare', [C.Neverborn], [C.Peon, C.Living, C.TotemFor('T",
"end": 39088,
"score": 0.858554482460022,
"start": 39083,
"tag": "NAME",
"value": "orare"
},
{
"context": "For('Titania'), C.Fae, C.Wave4], 3),\n new Model('Aeslin', [C.Neverborn], [C.Henchman, C.Undead, C.Rare1, ",
"end": 39188,
"score": 0.9996945261955261,
"start": 39182,
"tag": "NAME",
"value": "Aeslin"
},
{
"context": "ndead, C.Rare1, C.Fae, C.Wave4], 7),\n new Model('Bandersnatch', [C.Neverborn], [C.Minion, C.Living, C.Rare1",
"end": 39555,
"score": 0.5293363928794861,
"start": 39547,
"tag": "NAME",
"value": "Bandersn"
},
{
"context": "ad, C.Fae, C.Beast, C.Wave4], 8),\n \n new Model('Parker Barrows', [C.Outcast], [C.Master, C.Living, C.Bandit, C.W",
"end": 39877,
"score": 0.9949286580085754,
"start": 39863,
"tag": "NAME",
"value": "Parker Barrows"
},
{
"context": ", C.Bandit, C.Wave4], undefined, 4),\n new Model('Doc Mitchell', [C.Outcast], [C.Minion, C.Living, C.TotemFor('P",
"end": 39974,
"score": 0.9972309470176697,
"start": 39962,
"tag": "NAME",
"value": "Doc Mitchell"
},
{
"context": "l', [C.Outcast], [C.Minion, C.Living, C.TotemFor('Parker Barrows'), C.Wave4], 3),\n new Model('Mad Dog Brackett', ",
"end": 40037,
"score": 0.9912627935409546,
"start": 40023,
"tag": "NAME",
"value": "Parker Barrows"
},
{
"context": " C.Rare1, C.Bandit, C.Wave4], 9, 4),\n new Model('Aionus', [C.Outcast], [C.Henchman, C.Mercenary, C.Rare1,",
"end": 40178,
"score": 0.9474957585334778,
"start": 40172,
"tag": "NAME",
"value": "Aionus"
},
{
"context": "ercenary, C.Rare1, C.Wave4], 12, 1),\n new Model('Bandido', [C.Outcast], [C.Minion, C.Living, C.Bandit, C.W",
"end": 40267,
"score": 0.9841746687889099,
"start": 40260,
"tag": "NAME",
"value": "Bandido"
},
{
"context": "C.Bandit, C.Tormented, C.Wave4], 6),\n new Model('Wokou Raider', [C.Outcast], [C.Minion, C.Living, C.Bandit, C.L",
"end": 40452,
"score": 0.9710159301757812,
"start": 40440,
"tag": "NAME",
"value": "Wokou Raider"
},
{
"context": "dit, C.LastBlossom, C.Wave4], 8),\n \n new Model('Zipp', [C.Gremlin], [C.Master, C.Living, C.Gremlin, C.",
"end": 40548,
"score": 0.9950243234634399,
"start": 40544,
"tag": "NAME",
"value": "Zipp"
},
{
"context": ".SkyPirate, C.Wave4], undefined, 4),\n new Model('Earl Burns', [C.Gremlin], [C.Minion, C.Living, C.TotemFor('Z",
"end": 40657,
"score": 0.9630207419395447,
"start": 40647,
"tag": "NAME",
"value": "Earl Burns"
},
{
"context": "s', [C.Gremlin], [C.Minion, C.Living, C.TotemFor('Zipp'), C.Wave4], 3),\n new Model('The First Mate', [C",
"end": 40710,
"score": 0.9285041689872742,
"start": 40706,
"tag": "NAME",
"value": "Zipp"
},
{
"context": "fiend, C.SkyPirate, C.Wave4], 9, 4),\n new Model('Iron Skeeter', [C.Gremlin], [C.Enforcer, C.Living, C.Construct",
"end": 40872,
"score": 0.9783704876899719,
"start": 40860,
"tag": "NAME",
"value": "Iron Skeeter"
},
{
"context": ".Gremlin, C.SkyPirate, C.Wave4], 6),\n new Model('Akaname', [C.Gremlin, C.TenThunders], [C.Minion, C.Rare3,",
"end": 40982,
"score": 0.8379404544830322,
"start": 40975,
"tag": "NAME",
"value": "Akaname"
},
{
"context": "are3, C.Oni, C.TriChi, C.Wave4], 4),\n new Model('Banjonista', [C.Gremlin], [C.Minion, C.Living, C.Gremlin, C.",
"end": 41087,
"score": 0.9421666264533997,
"start": 41077,
"tag": "NAME",
"value": "Banjonista"
},
{
"context": "C.Rare2, C.Gremlin, C.Wave4], 7),\n \n new Model('Asami Tanaka', [C.TenThunders], [C.Master, C.Living, C.Oni, C.",
"end": 41273,
"score": 0.9508346319198608,
"start": 41261,
"tag": "NAME",
"value": "Asami Tanaka"
},
{
"context": "ing, C.Oni, C.Wave4], undefined, 3),\n new Model('Amanjaku', [C.TenThunders], [C.Peon, C.TotemFor('Asami Tan",
"end": 41367,
"score": 0.9747380018234253,
"start": 41359,
"tag": "NAME",
"value": "Amanjaku"
},
{
"context": "'Amanjaku', [C.TenThunders], [C.Peon, C.TotemFor('Asami Tanaka'), C.Oni, C.Wave4], 3),\n new Model('Ohaguro Bett",
"end": 41420,
"score": 0.8752321004867554,
"start": 41408,
"tag": "NAME",
"value": "Asami Tanaka"
},
{
"context": "Asami Tanaka'), C.Oni, C.Wave4], 3),\n new Model('Ohaguro Bettari', [C.TenThunders], [C.Henchman, C.Rare1, C.Oni, C",
"end": 41473,
"score": 0.9949657917022705,
"start": 41458,
"tag": "NAME",
"value": "Ohaguro Bettari"
},
{
"context": "uct, C.Rare3, C.Mimic, C.Wave4], 5),\n new Model('Sun Quiang', [C.TenThunders], [C.Enforcer, C.Rare1, C.Living",
"end": 41739,
"score": 0.9988642334938049,
"start": 41729,
"tag": "NAME",
"value": "Sun Quiang"
}
] | proto/data/ModelList.coffee | AppSynergy/malifaux-crew-explorer | 0 | import ModelInterface from './ModelInterface.coffee'
Model = ModelInterface.Model
C = ModelInterface.Attribute
# **Epic props** to rythos42 for saving me having to research and type all this!
# https://github.com/rythos42/MalifauxModels-Web/blob/master/js/app/Mappers/ModelList.js
ModelList = [
new Model('Lady Justice', [C.Guild], [C.Master, C.Living, C.GuildMarshal, C.Wave1], undefined, 4),
new Model('Sonnia Criid', [C.Guild], [C.Master, C.Living, C.WitchHunter, C.Wave1], undefined, 3),
new Model('Perdita Ortega', [C.Guild], [C.Master, C.Living, C.Family, C.Wave1], undefined, 2),
new Model('Franscisco Ortega', [C.Guild], [C.Henchman, C.Living, C.Family, C.Wave1], 8, 5),
new Model('Samael Hopkins', [C.Guild], [C.Henchman, C.Living, C.WitchHunter, C.Wave1], 9, 4),
new Model('The Judge', [C.Guild], [C.Henchman, C.Living, C.Rare1, C.GuildMarshal, C.Wave1], 9, 4),
new Model('Scales of Justice', [C.Guild], [C.Peon, C.Living, C.TotemFor('Lady Justice'), C.Wave1], 3),
new Model('Purifying Flame', [C.Guild], [C.Peon, C.TotemFor('Sonnia Criid'), C.Spirit, C.Wave1], 3),
new Model('Enslaved Nephilim', [C.Guild], [C.Peon, C.TotemFor('Perdita Ortega'), C.Nephilim, C.Wave1], 3),
new Model('Governor\'s Proxy', [C.Guild], [C.Peon, C.Totem, C.Living, C.Wave1], 3),
new Model('Death Marshal', [C.Guild], [C.Minion, C.Living, C.GuildMarshal, C.Wave1], 6),
new Model('Executioner', [C.Guild], [C.Enforcer, C.Living, C.Rare2, C.Wave1], 9),
new Model('Guild Austringer', [C.Guild], [C.Minion, C.Living, C.Rare2, C.Guardsman, C.Wave1], 6),
new Model('Guild Guard', [C.Guild], [C.Minion, C.Living, C.Guardsman, C.Wave1], 4),
new Model('Peacekeeper', [C.Guild], [C.Enforcer, C.Construct, C.Rare1, C.Wave1], 11),
new Model('The Lone Marshal', [C.Guild], [C.Enforcer, C.Living, C.Rare1, C.GuildMarshal, C.Wave1], 8),
new Model('Witchling Stalker', [C.Guild], [C.Minion, C.Living, C.WitchHunter, C.Wave1], 5),
new Model('Nino Ortega', [C.Guild], [C.Enforcer, C.Living, C.Rare1, C.Family, C.Wave1], 7),
new Model('Papa Loco', [C.Guild], [C.Enforcer, C.Living, C.Rare1, C.Family, C.Tormented, C.Wave1], 7),
new Model('Santiago Ortega', [C.Guild], [C.Enforcer, C.Living, C.Rare1, C.Family, C.Wave1], 7),
new Model('C. Hoffman', [C.Guild], [C.Master, C.Living, C.Construct, C.Msu, C.Wave2], undefined, 3),
new Model('Ryle', [C.Guild], [C.Henchman, C.Construct, C.Rare1, C.Msu, C.Wave2], 10, 3),
new Model('Mechanical Attendant', [C.Guild], [C.Peon, C.Construct, C.TotemFor('C. Hoffman'), C.Wave2], 2),
new Model('Guardian', [C.Guild], [C.Minion, C.Construct, C.Wave2], 8),
new Model('Lucius', [C.Guild, C.Neverborn], [C.Master, C.Living, C.Mimic, C.Wave2], undefined, 4),
new Model('Captain Dashel', [C.Guild], [C.Henchman, C.Living, C.Rare1, C.Guardsman, C.Wave2], 9, 4),
new Model('The Scribe', [C.Guild, C.Neverborn], [C.Peon, C.Living, C.TotemFor('Lucius'), C.Wave2], 2),
new Model('Abuela Ortega', [C.Guild], [C.Enforcer, C.Living, C.Rare1, C.Family, C.Wave2], 7),
new Model('Guild Hound', [C.Guild], [C.Minion, C.Living, C.Rare4, C.Beast, C.Hound, C.Guardsman, C.Wave2], 3),
new Model('Guard Sergeant', [C.Guild], [C.Enforcer, C.Living, C.Rare2, C.Guardsman, C.Wave2], 6),
new Model('Hunter', [C.Guild], [C.Minion, C.Construct, C.Rare2, C.Wave2], 7),
new Model('Guild Lawyer', [C.Guild], [C.Minion, C.Living, C.Rare2, C.Mimic, C.Wave2], 6),
new Model('Watcher', [C.Guild], [C.Minion, C.Construct, C.Wave2], 4),
new Model('Exorcist', [C.Guild], [C.Enforcer, C.Living, C.Rare2, C.GuildMarshal, C.Wave2], 7),
new Model('Pistolero De Latigo', [C.Guild], [C.Minion, C.Living, C.Family, C.Wave2], 5),
new Model('Pale Rider', [C.Guild], [C.Enforcer, C.Undead, C.Rare1, C.Horseman, C.Wave2], 12),
new Model('Warden', [C.Guild], [C.Minion, C.Construct, C.Guardsman, C.Wave2], 6),
new Model('Witchling Handler', [C.Guild], [C.Enforcer, C.Living, C.WitchHunter, C.Wave2], 8),
new Model('Brutal Effigy', [C.Guild], [C.Minion, C.Construct, C.Puppet, C.Effigy, C.Rare1, C.Wave2], 4),
new Model('Guild Rifleman', [C.Guild], [C.Minion, C.Living, C.Rare3, C.Guardsman, C.Wave2], 5),
new Model('Clockwork Trap', [C.Guild, C.TenThunders], [C.Peon, C.Rare4, C.Wave2], 2),
new Model('Guild Pathfinder', [C.Guild, C.TenThunders], [C.Minion, C.Living, C.Guardsman, C.Wave2], 6),
new Model('Seamus', [C.Resurrectionist], [C.Master, C.Living, C.Wave1], undefined, 3),
new Model('McMourning', [C.Resurrectionist, C.Guild], [C.Master, C.Living, C.Wave1], undefined, 4),
new Model('Nicodem', [C.Resurrectionist], [C.Master, C.Living, C.Wave1], undefined, 3),
new Model('Madam Sybelle', [C.Resurrectionist], [C.Henchman, C.Undead, C.Rare1, C.Wave1], 8, 5),
new Model('Sebastian', [C.Resurrectionist], [C.Henchman, C.Living, C.Rare1, C.Wave1], 7, 6),
new Model('Mortimer', [C.Resurrectionist], [C.Henchman, C.Living, C.Rare1, C.Wave1], 9, 4),
new Model('Copycat Killer', [C.Resurrectionist], [C.Peon, C.Living, C.TotemFor('Seamus'), C.Wave1], 3),
new Model('Zombie Chihuahua', [C.Resurrectionist], [C.Peon, C.Undead, C.TotemFor('McMourning'), C.Beast, C.Wave1], 2),
new Model('Vulture', [C.Resurrectionist], [C.Peon, C.Living, C.TotemFor('Nicodem'), C.Beast, C.Wave1], 3),
new Model('Graveyard Spirit', [C.Resurrectionist], [C.Peon, C.Totem, C.Spirit, C.Wave1], 3),
new Model('Bete Noire', [C.Resurrectionist], [C.Enforcer, C.Undead, C.Rare1, C.Wave1], 8),
new Model('Canine Remains', [C.Resurrectionist], [C.Minion, C.Undead, C.Beast, C.Hound, C.Wave1], 4),
new Model('Crooked Man', [C.Resurrectionist], [C.Minion, C.Undead, C.Tormented, C.Wave1], 5),
new Model('Flesh Construct', [C.Resurrectionist], [C.Minion, C.Undead, C.Construct, C.Wave1], 6),
new Model('Mindless Zombie', [C.Resurrectionist], [C.Peon, C.Undead, C.Wave1], 2),
new Model('Necropunk', [C.Resurrectionist], [C.Minion, C.Undead, C.Construct, C.Wave1], 5),
new Model('Nurse', [C.Resurrectionist], [C.Minion, C.Living, C.Tormented, C.Wave1], 5),
new Model('Punk Zombie', [C.Resurrectionist], [C.Minion, C.Undead, C.Horror, C.Wave1], 7),
new Model('Rotten Belle', [C.Resurrectionist], [C.Minion, C.Undead, C.Belle, C.Wave1], 5),
new Model('The Hanged', [C.Resurrectionist], [C.Minion, C.Undead, C.Rare2, C.Spirit, C.Tormented, C.Wave1], 9),
new Model('Molly Squidpiddge', [C.Resurrectionist], [C.Master, C.Undead, C.Belle, C.Horror, C.Wave2], undefined, 3),
new Model('Rogue Necromancy', [C.Resurrectionist], [C.Enforcer, C.Undead, C.Construct, C.Beast, C.Horror, C.Wave2], 10),
new Model('Guild Autopsy', [C.Resurrectionist], [C.Minion, C.Undead, C.Horror, C.Wave2], 4),
new Model('Necrotic Machine', [C.Resurrectionist], [C.Minion, C.Construct, C.TotemFor('Molly Squidpiddge'), C.Rare1, C.Horror, C.Spirit, C.Wave2], 2),
new Model('Kirai Ankoku', [C.Resurrectionist], [C.Master, C.Living, C.Wave2], undefined, 3),
new Model('Ikiryo', [C.Resurrectionist], [C.Enforcer, C.Rare1, C.Spirit, C.Wave2], 0),
new Model('Seishin', [C.Resurrectionist], [C.Peon, C.Rare5, C.Spirit, C.Wave2], 0),
new Model('Lost Love', [C.Resurrectionist], [C.Peon, C.Undead, C.TotemFor('Kirai Ankoku'), C.Spirit, C.Wave2], 4),
new Model('Datsue Ba', [C.Resurrectionist], [C.Henchman, C.Undead, C.Rare1, C.Spirit, C.Wave2], 8, 5),
new Model('Dead Rider', [C.Resurrectionist], [C.Enforcer, C.Undead, C.Rare1, C.Horseman, C.Wave2], 12),
new Model('Gaki', [C.Resurrectionist], [C.Minion, C.Spirit, C.Wave2], 4),
new Model('Night Terror', [C.Resurrectionist], [C.Minion, C.Rare4, C.Beast, C.Spirit, C.Wave2], 3),
new Model('Onryo', [C.Resurrectionist], [C.Minion, C.Spirit, C.Retainer, C.Wave2], 5),
new Model('Shikome', [C.Resurrectionist], [C.Minion, C.Undead, C.Rare2, C.Beast, C.Spirit, C.Wave2], 8),
new Model('Crooligan', [C.Resurrectionist], [C.Minion, C.Undead, C.Horror, C.Lost, C.Wave2], 4),
new Model('Dead Doxy', [C.Resurrectionist], [C.Minion, C.Undead, C.Belle, C.Wave2], 6),
new Model('The Drowned', [C.Resurrectionist], [C.Minion, C.Undead, C.Horror, C.Spirit, C.Tormented, C.Wave2], 6),
new Model('Jaakuna Ubume', [C.Resurrectionist], [C.Enforcer, C.Spirit, C.Tormented, C.Rare1, C.Wave2], 6),
new Model('Rafkin', [C.Resurrectionist], [C.Enforcer, C.Living, C.Rare1, C.Wave2], 7),
new Model('Carrion Effigy', [C.Resurrectionist], [C.Minion, C.Construct, C.Rare1, C.Puppet, C.Effigy, C.Wave2], 4),
new Model('Ashigaru', [C.Resurrectionist], [C.Minion, C.Undead, C.Retainer, C.Wave2], 5),
new Model('Philip and the Nanny', [C.Resurrectionist], [C.Henchman, C.Undead, C.Rare1, C.Spirit, C.Horror, C.Wave2], 8, 5),
new Model('Student of Sinew', [C.Resurrectionist], [C.Minion, C.Construct, C.Undead, C.Horror, C.Academic, C.Wave2], 7),
new Model('Student of Steel', [C.Resurrectionist], [C.Minion, C.Construct, C.Undead, C.Horror, C.Academic, C.Wave2], 7),
new Model('Student of Viscera', [C.Resurrectionist], [C.Minion, C.Construct, C.Undead, C.Horror, C.Academic, C.Wave2], 8),
new Model('The Valedictorian', [C.Resurrectionist], [C.Henchman, C.Construct, C.Undead, C.Rare1, C.Horror, C.Academic, C.Wave2], 10, 3),
new Model('Rasputina', [C.Arcanist], [C.Master, C.Living, C.Wave1], undefined, 3),
new Model('Marcus', [C.Arcanist], [C.Master, C.Living, C.Beast, C.Wave1], undefined, 4),
new Model('Ramos', [C.Arcanist], [C.Master, C.Living, C.Construct, C.Msu, C.Wave1], undefined, 3),
new Model('Myranda', [C.Arcanist], [C.Henchman, C.Living, C.Rare1, C.Beast, C.Wave1], 8, 5),
new Model('Joss', [C.Arcanist], [C.Henchman, C.Living, C.Construct, C.Rare1, C.Msu, C.Wave1], 10, 3),
new Model('Cojo', [C.Arcanist], [C.Enforcer, C.Living, C.Rare1, C.Beast, C.Wave1], 8),
new Model('Ice Golem', [C.Arcanist], [C.Enforcer, C.Construct, C.Wave1], 10),
new Model('Wendigo', [C.Arcanist], [C.Minion, C.Living, C.TotemFor('Rasputina'), C.Wave1], 3),
new Model('Jackalope', [C.Arcanist], [C.Peon, C.Living, C.TotemFor('Marcus'), C.Beast, C.Wave1], 2),
new Model('Brass Arachnid', [C.Arcanist], [C.Peon, C.Construct, C.TotemFor('Ramos'), C.Msu, C.Wave1], 4),
new Model('Essence of Power', [C.Arcanist], [C.Peon, C.Totem, C.Spirit, C.Wave1], 3),
new Model('December Acolyte', [C.Arcanist], [C.Minion, C.Living, C.Wave1], 7),
new Model('Electric Creation', [C.Arcanist], [C.Peon, C.Construct, C.Wave1], 4),
new Model('Hoarcat Pride', [C.Arcanist], [C.Minion, C.Living, C.Beast, C.Swarm, C.Wave1], 5),
new Model('Howard Langston', [C.Arcanist], [C.Enforcer, C.Construct, C.Living, C.Rare1, C.Msu, C.Wave1], 12),
new Model('Ice Gamin', [C.Arcanist], [C.Minion, C.Construct, C.Gamin, C.Wave1], 4),
new Model('Metal Gamin', [C.Arcanist], [C.Minion, C.Construct, C.Gamin, C.Msu, C.Foundry, C.Wave1], 4),
new Model('Moleman', [C.Arcanist], [C.Minion, C.Living, C.Beast, C.Wave1], 4),
new Model('Rail Golem', [C.Arcanist], [C.Enforcer, C.Construct, C.Rare1, C.Foundry, C.Wave1], 11),
new Model('Razorspine Rattler', [C.Arcanist], [C.Minion, C.Living, C.Beast, C.Wave1], 7),
new Model('Sabertooth Cerberus', [C.Arcanist], [C.Enforcer, C.Living, C.Beast, C.Wave1], 9),
new Model('Steam Arachnid', [C.Arcanist], [C.Minion, C.Construct, C.Msu, C.Wave1], 4),
new Model('Steam Arachnid Swarm', [C.Arcanist], [C.Minion, C.Construct, C.Swarm, C.Msu, C.Wave1], 8),
new Model('Ironsides', [C.Arcanist], [C.Master, C.Living, C.Msu, C.Wave2], undefined, 5),
new Model('Oxfordian Mage', [C.Arcanist], [C.Enforcer, C.Living, C.Rare3, C.Academic, C.Msu, C.Wave2], 6),
new Model('Mouse', [C.Arcanist], [C.Peon, C.Living, C.TotemFor('Ironsides'), C.Msu, C.Wave2], 4),
new Model('Colette Du Bois', [C.Arcanist], [C.Master, C.Living, C.Showgirl, C.Wave2], undefined, 2),
new Model('Mechanical Dove', [C.Arcanist], [C.Peon, C.Construct, C.TotemFor('Colette Du Bois'), C.Rare3, C.Wave2], 2),
new Model('Cassandra', [C.Arcanist], [C.Henchman, C.Living, C.Rare1, C.Showgirl, C.Wave2], 8, 5),
new Model('Coryphee', [C.Arcanist], [C.Minion, C.Construct, C.Rare2, C.Showgirl, C.Puppet, C.Wave2], 7),
new Model('Coryphee Duet', [C.Arcanist], [C.Enforcer, C.Construct, C.Showgirl, C.Puppet, C.Wave2], 0),
new Model('Performer', [C.Arcanist], [C.Minion, C.Living, C.Mercenary, C.Showgirl, C.Wave2], 5),
new Model('Mannequin', [C.Arcanist], [C.Peon, C.Construct, C.Showgirl, C.Puppet, C.Wave2], 4),
new Model('Kaeris', [C.Arcanist], [C.Master, C.Living, C.Msu, C.Wave2], undefined, 4),
new Model('The Firestarter', [C.Arcanist], [C.Henchman, C.Living, C.Rare1, C.Msu, C.Wave2], 7, 6),
new Model('Eternal Flame', [C.Arcanist], [C.Peon, C.Construct, C.TotemFor('Kaeris'), C.Msu, C.Wave2], 2),
new Model('Gunsmith', [C.Arcanist], [C.Minion, C.Living, C.Msu, C.Wave2], 7),
new Model('Large Arachnid', [C.Arcanist], [C.Minion, C.Construct, C.Msu, C.Wave2], 6),
new Model('Malifaux Raptor', [C.Arcanist], [C.Peon, C.Living, C.Rare3, C.Beast, C.Wave2], 3),
new Model('Mechanical Rider', [C.Arcanist], [C.Enforcer, C.Construct, C.Rare1, C.Horseman, C.Wave2], 12),
new Model('Silent One', [C.Arcanist], [C.Minion, C.Living, C.Wave2], 6),
new Model('Snow Storm', [C.Arcanist], [C.Henchman, C.Rare1, C.Spirit, C.Wave2], 11, 2),
new Model('Soulstone Miner', [C.Arcanist], [C.Minion, C.Construct, C.Msu, C.Wave2], 6),
new Model('The Captain', [C.Arcanist], [C.Henchman, C.Living, C.Rare1, C.Msu, C.Wave2], 10, 3),
new Model('Angelica', [C.Arcanist], [C.Enforcer, C.Living, C.Rare1, C.Showgirl, C.Wave2], 6),
new Model('Blessed of December', [C.Arcanist], [C.Enforcer, C.Living, C.Rare1, C.Beast, C.Wave2], 9),
new Model('Fire Gamin', [C.Arcanist], [C.Minion, C.Construct, C.Gamin, C.Wave2], 4),
new Model('Slate Ridge Mauler', [C.Arcanist], [C.Minion, C.Living, C.Beast, C.Wave2], 8),
new Model('Union Miner', [C.Arcanist], [C.Minion, C.Living, C.Msu, C.Wave2], 5),
new Model('Willie', [C.Arcanist], [C.Minion, C.Living, C.Rare1, C.Msu, C.Foundry, C.Wave2], 6),
new Model('Arcane Effigy', [C.Arcanist], [C.Minion, C.Construct, C.Rare1, C.Puppet, C.Effigy, C.Wave2], 4),
new Model('Mobile Toolkit', [C.Arcanist], [C.Peon, C.Construct, C.Rare1, C.Msu, C.Wave2], 3),
new Model('Lilith', ['Neverborn'], [C.Master, C.Living, C.Nephilim, C.Wave1], undefined, 4),
new Model('Pandora', ['Neverborn'], [C.Master, C.Living, C.Woe, C.Wave1], undefined, 3),
new Model('Zoraida', ['Neverborn', C.Gremlin], [C.Master, C.Living, C.Swampfiend, C.Wave1], undefined, 4),
new Model('Barbaros', ['Neverborn'], [C.Henchman, C.Living, C.Rare1, C.Nephilim, C.Wave1], 10, 3),
new Model('Candy', ['Neverborn'], [C.Henchman, C.Living, C.Rare1, C.Woe, C.Mimic, C.Lost, C.Wave1], 9, 4),
new Model('Bad Juju', ['Neverborn'], [C.Henchman, C.Rare1, C.Swampfiend, C.Wave1], 8, 5),
new Model('Cherub', ['Neverborn'], [C.Peon, C.Living, C.TotemFor('Lilith'), C.Nephilim, C.Wave1], 3),
new Model('Poltergeist', ['Neverborn'], [C.Minion, C.TotemFor('Pandora'), C.Woe, C.Spirit, C.Wave1], 5),
new Model('Voodoo Doll', ['Neverborn', C.Gremlin], [C.Peon, C.Construct, C.TotemFor('Zoraida'), C.Puppet, C.Wave1], 3),
new Model('Primordial Magic', ['Neverborn'], [C.Peon, C.Totem, C.Spirit, C.Wave1], 2),
new Model('Baby Kade', ['Neverborn'], [C.Enforcer, C.Living, C.Rare1, C.Woe, C.Lost, C.Wave1], 7),
new Model('Teddy', ['Neverborn'], [C.Enforcer, C.Construct, C.Nightmare, C.Wave1], 11),
new Model('Beckoner', ['Neverborn'], [C.Minion, C.Living, C.Rare2, C.Brilliance, C.Darkened, C.Mimic, C.Wave1], 7),
new Model('Doppleganger', ['Neverborn'], [C.Enforcer, C.Living, C.Rare1, C.Woe, C.Mimic, C.Wave1], 7),
new Model('Mature Nephilim', ['Neverborn'], [C.Enforcer, C.Living, C.Nephilim, C.Wave1], 11),
new Model('Silurid', ['Neverborn'], [C.Minion, C.Living, C.Beast, C.Swampfiend, C.Wave1], 7),
new Model('Sorrow', ['Neverborn'], [C.Minion, C.Woe, C.Spirit, C.Wave1], 5),
new Model('Terror Tot', ['Neverborn'], [C.Minion, C.Living, C.Nephilim, C.Wave1], 4),
new Model('Waldgeist', ['Neverborn'], [C.Minion, C.Living, C.Beast, C.Swampfiend, C.Wave1], 6),
new Model('Young Nephilim', ['Neverborn'], [C.Minion, C.Living, C.Nephilim, C.Wave1], 6),
new Model('The Dreamer', [C.Neverborn], [C.Master, C.Spirit, C.Wave2], undefined, 3),
new Model('Lord Chompy Bits', [C.Neverborn], [C.Henchman, C.Rare1, C.Nightmare, C.Tyrant, C.Wave2], 0),
new Model('Daydream', [C.Neverborn], [C.Peon, C.TotemFor('The Dreamer'), C.Rare3, C.Nightmare, C.Wave2], 2),
new Model('Alp', [C.Neverborn], [C.Peon, C.Nightmare, C.Wave2], 3),
new Model('Coppelius', [C.Neverborn], [C.Enforcer, C.Rare1, C.Nightmare, C.Wave2], 8),
new Model('Lelu', [C.Neverborn], [C.Enforcer, C.Rare1, C.Nightmare, C.Nephilim, C.Woe, C.Wave2], 7),
new Model('Lilitu', [C.Neverborn], [C.Enforcer, C.Rare1, C.Nightmare, C.Nephilim, C.Woe, C.Wave2], 7),
new Model('Insidious Madness', [C.Neverborn], [C.Minion, C.Rare3, C.Nightmare, C.Woe, C.Wave2], 5),
new Model('Widow Weaver', [C.Neverborn], [C.Henchman, C.Rare1, C.Nightmare, C.Wave2], 8, 5),
new Model('Black Blood Shaman', [C.Neverborn], [C.Minion, C.Living, C.Rare2, C.Nephilim, C.Wave2], 7),
new Model('Nekima', [C.Neverborn], [C.Henchman, C.Living, C.Rare1, C.Nephilim, C.Wave2], 13, 0),
new Model('Collodi', [C.Neverborn], [C.Master, C.Construct, C.Puppet, C.Wave2], undefined, 3),
new Model('Marionette', [C.Neverborn], [C.Minion, C.Construct, C.TotemFor('Collodi'), C.Rare4, C.Puppet, C.Wave2], 3),
new Model('Stitched Together', [C.Neverborn], [C.Minion, C.Construct, C.Nightmare, C.Puppet, C.Darkened, C.Wave2], 6),
new Model('Wicked Doll', [C.Neverborn], [C.Minion, C.Construct, C.Puppet, C.Wave2], 4),
new Model('Vasilisa', [C.Neverborn], [C.Henchman, C.Construct, C.Rare1, C.Puppet, C.Wave2], 9, 4),
new Model('Iggy', [C.Neverborn], [C.Enforcer, C.Living, C.Rare1, C.Woe, C.Lost, C.Wave2], 5),
new Model('Spawn Mother', [C.Neverborn], [C.Henchman, C.Living, C.Rare1, C.Swampfiend, C.Beast, C.Wave2], 9, 4),
new Model('Gupps', [C.Neverborn], [C.Minion, C.Living, C.Swampfiend, C.Beast, C.Swarm, C.Wave2], 4),
new Model('Tuco', [C.Neverborn], [C.Enforcer, C.Living, C.Rare1, C.Nephilim, C.Wave2], 7),
new Model('Mysterious Effigy', [C.Neverborn], [C.Minion, C.Construct, C.Rare1, C.Puppet, C.Effigy, C.Wave2], 4),
new Model('The Depleted', [C.Neverborn], [C.Minion, C.Living, C.Brilliance, C.Darkened, C.Wave2], 4),
new Model('Hooded Rider', [C.Neverborn], [C.Enforcer, C.Construct, C.Rare1, C.Horseman, C.Wave2], 12),
new Model('Von Schill', [C.Outcast], [C.Master, C.Living, C.Freikorps, C.Wave1], undefined, 1),
new Model('Tara', [C.Outcast, C.Resurrectionist], [C.Master, C.Undead, C.Wave1], undefined, 4),
new Model('Viktoria of Ashes', [C.Outcast], [C.Master, C.Living, C.Sister, C.Wave1], undefined, 1),
new Model('Hannah', [C.Outcast], [C.Henchman, C.Living, C.Rare1, C.Mercenary, C.Freikorps, C.Wave1], 10, 3),
new Model('The Nothing Beast', [C.Outcast], [C.Enforcer, C.Rare1, C.Wave1], 10),
new Model('Viktoria of Blood', [C.Outcast], [C.Henchman, C.Living, C.Rare1, C.Sister, C.Wave1], 0, 3),
new Model('Taelor', [C.Outcast], [C.Henchman, C.Living, C.Mercenary, C.Rare1, C.Wave1], 10, 3),
new Model('Steam Trunk', [C.Outcast], [C.Peon, C.Construct, C.TotemFor('Von Schill'), C.Wave1], 3),
new Model('Karina', [C.Outcast, C.Resurrectionist], [C.Enforcer, C.Living, C.TotemFor('Tara'), C.Wave1], 5),
new Model('Student of Conflict', [C.Outcast], [C.Peon, C.Living, C.Totem, C.Mercenary, C.Sister, C.Wave1], 4),
new Model('Malifaux Child', [C.Outcast], [C.Peon, C.Living, C.Totem, C.Mercenary, C.Lost, C.Wave1], 2),
new Model('Bishop', [C.Outcast], [C.Enforcer, C.Living, C.Mercenary, C.Rare1, C.Wave1], 10),
new Model('Convict Gunslinger', [C.Outcast], [C.Enforcer, C.Living, C.Mercenary, C.Rare2, C.Wave1], 7),
new Model('Desperate Mercenary', [C.Outcast], [C.Minion, C.Living, C.Mercenary, C.Wave1], 4),
new Model('Freikorps Specialist', [C.Outcast], [C.Living, C.Enforcer, C.Mercenary, C.Freikorps, C.Wave1], 8),
new Model('Freikorpsman', [C.Outcast], [C.Living, C.Minion, C.Mercenary, C.Freikorps, C.Wave1], 5),
new Model('Hans', [C.Outcast], [C.Enforcer, C.Living, C.Mercenary, C.Rare1, C.Wave1], 8),
new Model('Johan', [C.Outcast], [C.Enforcer, C.Living, C.Mercenary, C.Rare1, C.Msu, C.Wave1], 6),
new Model('Killjoy', [C.Outcast], [C.Enforcer, C.Undead, C.Mercenary, C.Rare1, C.Horror, C.Wave1], 12),
new Model('Ronin', [C.Outcast], [C.Minion, C.Living, C.Mercenary, C.Wave1], 6),
new Model('Void Wretch', [C.Outcast], [C.Minion, C.Wave1], 4),
new Model('Jack Daw', [C.Outcast], [C.Master, C.Undead, C.Tormented, C.Spirit, C.Cursed, C.Wave2], undefined, 2),
new Model('The Guilty', [C.Outcast], [C.Minion, C.Undead, C.Tormented, C.Wave2], 5),
new Model('Montresor', [C.Outcast], [C.Henchman, C.Undead, C.Rare1, C.Tormented, C.Wave2], 9, 4),
new Model('Lady Ligeia', [C.Outcast], [C.Peon, C.TotemFor('Jack Daw'), C.Tormented, C.Spirit, C.Wave2], 4),
new Model('Hamelin', [C.Outcast], [C.Master, C.Tyrant, C.Nihilist, C.Wave2], undefined, 1),
new Model('Nix', [C.Outcast], [C.Henchman, C.Rare1, C.Nihilist, C.Spirit, C.Wave2], 8, 5),
new Model('Obediant Wretch', [C.Outcast], [C.Minion, C.Living, C.Rare1, C.Nihilist, C.Wave2], 4),
new Model('Rat Catcher', [C.Outcast], [C.Minion, C.Living, C.Rare2, C.Nihilist, C.Wave2], 6),
new Model('Malifaux Rat', [C.Outcast], [C.Peon, C.Vermin, C.Wave2], 2),
new Model('Rat King', [C.Outcast], [C.Minion, C.Vermin, C.Swarm, C.Wave2], 8),
new Model('The Stolen', [C.Outcast], [C.Peon, C.Living, C.TotemFor('Hamelin'), C.Rare3, C.Nihilist, C.Lost, C.Wave2], 2),
new Model('Ashes and Dust', [C.Outcast], [C.Enforcer, C.Construct, C.Undead, C.Rare1, C.Wave2], 13),
new Model('Ashen Core', [C.Outcast], [C.Enforcer, C.Construct, C.Undead, C.Rare1, C.Wave2], 0),
new Model('Dust Storm', [C.Outcast], [C.Enforcer, C.Construct, C.Undead, C.Rare1, C.Wave2], 6),
new Model('Freikorps Librarian', [C.Outcast], [C.Enforcer, C.Living, C.Mercenary, C.Academic, C.Freikorps, C.Wave2], 7),
new Model('Freikorps Trapper', [C.Outcast], [C.Minion, C.Living, C.Mercenary, C.Rare2, C.Freikorps, C.Wave2], 6),
new Model('Lazarus', [C.Outcast], [C.Enforcer, C.Construct, C.Mercenary, C.Rare1, C.Freikorps, C.Wave2], 10),
new Model('Sue', [C.Outcast], [C.Enforcer, C.Living, C.Mercenary, C.Rare1, C.Wave2], 8),
new Model('Hodgepodge Effigy', [C.Outcast], [C.Minion, C.Construct, C.Rare1, C.Puppet, C.Effigy, C.Wave2], 4),
new Model('Ama No Zako', [C.Outcast, C.TenThunders], [C.Henchman, C.Mercenary, C.Rare1, C.Oni, C.Wave2], 9, 4),
new Model('Strongarm Suit', [C.Outcast], [C.Enforcer, C.Living, C.Mercenary, C.Rare1, C.Freikorps, C.Wave2], 10),
new Model('Vanessa', [C.Outcast], [C.Enforcer, C.Living, C.Rare1, C.Sister, C.Wave2], 8),
new Model('Leveticus', [C.Outcast], [C.Master, C.Living, C.Wave2], undefined, 2),
new Model('Rusty Alyce', [C.Outcast], [C.Henchman, C.Living, C.Rare1, C.Wave2], 10, 3),
new Model('Hollow Waif', [C.Outcast], [C.Peon, C.Undead, C.TotemFor('Leveticus'), C.Rare3, C.Wave2], 0),
new Model('Abomination', [C.Outcast], [C.Minion, C.Construct, C.Undead, C.Wave2], 4),
new Model('Desolation Engine', [C.Outcast], [C.Enforcer, C.Undead, C.Construct, C.Rare1, C.Wave2], 13),
new Model('Som\'er Teeth Jones', [C.Gremlin], [C.Master, C.Living, C.Gremlin, C.Wave1], undefined, 4),
new Model('Ophelia LaCroix', [C.Gremlin], [C.Master, C.Living, C.Gremlin, C.Kin, C.Wave1], undefined, 3),
new Model('The Brewmaster', [C.Gremlin, C.TenThunders], [C.Master, C.Living, C.Gremlin, C.TriChi, C.Wave1], undefined, 3),
new Model('Francois LaCroix', [C.Gremlin], [C.Henchman, C.Living, C.Rare1, C.Gremlin, C.Kin, C.Wave1], 7, 6),
new Model('Fingers', [C.Gremlin], [C.Henchman, C.Living, C.Rare1, C.Gremlin, C.TriChi, C.Wave1], 10, 3),
new Model('Lenny', [C.Gremlin], [C.Enforcer, C.Living, C.Rare1, C.Gremlin, C.Wave1], 9),
new Model('Whiskey Golem', [C.Gremlin], [C.Enforcer, C.Construct, C.Rare1, C.TriChi, C.Wave1], 10),
new Model('Skeeter', [C.Gremlin], [C.Peon, C.Living, C.TotemFor('Som\'er Teeth Jones'), C.Wave1], 2),
new Model('Young LaCroix', [C.Gremlin], [C.Peon, C.Living, C.TotemFor('Ophelia LaCroix'), C.Gremlin, C.Kin, C.Wave1], 2),
new Model('Apprentice Wesley', [C.Gremlin], [C.Minion, C.Living, C.TotemFor('The Brewmaster'), C.Gremlin, C.TriChi, C.Wave1], 3),
new Model('Bayou Gremlin', [C.Gremlin], [C.Minion, C.Living, C.Gremlin, C.Wave1], 3),
new Model('Hog Whisperer', [C.Gremlin], [C.Minion, C.Living, C.Mercenary, C.Gremlin, C.Wave1], 5),
new Model('Moon Shinobi', [C.Gremlin], [C.Minion, C.Living, C.Gremlin, C.TriChi, C.Wave1], 6),
new Model('Pigapult', [C.Gremlin], [C.Peon, C.Construct, C.Rare1, C.Gremlin, C.Wave1], 8),
new Model('Piglet', [C.Gremlin], [C.Minion, C.Living, C.Beast, C.Pig, C.Wave1], 4),
new Model('Slop Hauler', [C.Gremlin], [C.Minion, C.Living, C.Gremlin, C.Wave1], 5),
new Model('War Pig', [C.Gremlin], [C.Minion, C.Living, C.Beast, C.Pig, C.Wave1], 9),
new Model('Pere Ravage', [C.Gremlin], [C.Enforcer, C.Living, C.Rare1, C.Gremlin, C.Kin, C.Wave1], 6),
new Model('Rami LaCroix', [C.Gremlin], [C.Enforcer, C.Living, C.Rare1, C.Gremlin, C.Kin, C.Wave1], 7),
new Model('Raphael LaCroix', [C.Gremlin], [C.Enforcer, C.Living, C.Rare1, C.Gremlin, C.Kin, C.Wave1], 7),
new Model('Ulix', [C.Gremlin], [C.Master, C.Living, C.Gremlin, C.Wave2], undefined, 4),
new Model('Penelope', [C.Gremlin], [C.Peon, C.Living, C.TotemFor('Ulix'), C.Hound, C.Wave2], 2),
new Model('The Sow', [C.Gremlin], [C.Minion, C.Living, C.Rare1, C.Beast, C.Pig, C.Wave2], 8),
new Model('Old Major', [C.Gremlin], [C.Henchman, C.Living, C.Rare1, C.Pig, C.Wave2], 9, 4),
new Model('Rooster Rider', [C.Gremlin], [C.Minion, C.Living, C.Gremlin, C.Rooster, C.Wave2], 6),
new Model('Stuffed Piglet', [C.Gremlin], [C.Peon, C.Undead, C.Rare6, C.Pig, C.Wave2], 2),
new Model('Gremlin Taxidermist', [C.Gremlin], [C.Enforcer, C.Living, C.Rare2, C.Gremlin, C.Wave2], 7),
new Model('Mah Tucket', [C.Gremlin], [C.Master, C.Living, C.Gremlin, C.Wave2], undefined, 4),
new Model('The Little Lass', [C.Gremlin], [C.Peon, C.Living, C.TotemFor('Mah Tucket'), C.Gremlin, C.Wave2], 4),
new Model('Trixiebelle', [C.Gremlin], [C.Henchman, C.Living, C.Rare1, C.Gremlin, C.Wave2], 8, 5),
new Model('Bayou Bushwhacker', [C.Gremlin], [C.Minion, C.Living, C.Rare3, C.Gremlin, C.Wave2], 6),
new Model('McTavish', [C.Gremlin], [C.Henchman, C.Living, C.Mercenary, C.Rare1, C.Swampfiend, C.Wave2], 10, 3),
new Model('Mancha Roja', [C.Gremlin], [C.Henchman, C.Living, C.Rare1, C.Gremlin, C.Wave2], 10, 3),
new Model('Burt Jebsen', [C.Gremlin], [C.Enforcer, C.Living, C.Mercenary, C.Rare1, C.Gremlin, C.Wave2], 7),
new Model('Gracie', [C.Gremlin], [C.Enforcer, C.Living, C.Mercenary, C.Rare1, C.Pig, C.Wave2], 10),
new Model('Merris LaCroix', [C.Gremlin], [C.Enforcer, C.Living, C.Rare1, C.Gremlin, C.Kin, C.Wave2], 6),
new Model('Wild Boar', [C.Gremlin], [C.Minion, C.Living, C.Beast, C.Pig, C.Swampfiend, C.Wave2], 6),
new Model('Lucky Effigy', [C.Gremlin], [C.Minion, C.Construct, C.Rare1, C.Puppet, C.Effigy, C.Wave2], 4),
new Model('Wong', [C.Gremlin], [C.Master, C.Living, C.Gremlin, C.Wave2], undefined, 3),
new Model('Lovely Assistant', [C.Gremlin], [C.Peon, C.Living, C.TotemFor('Wong'), C.Gremlin, C.Showgirl, C.Wave2], 3),
new Model('Lightning Bug', [C.Gremlin], [C.Minion, C.Living, C.Gremlin, C.Wave2], 5),
new Model('Bayou Gator', [C.Gremlin], [C.Minion, C.Living, C.Swampfiend, C.Wave2], 5),
new Model('Sammy LaCroix', [C.Gremlin], [C.Henchman, C.Living, C.Rare1, C.Gremlin, C.Kin, C.Wave2], 7, 6),
new Model('Old Cranky', [C.Gremlin], [C.Peon, C.Living, C.Totem, C.Gremlin, C.Wave2], 4),
new Model('Misaki', [C.TenThunders, C.Outcast], [C.Master, C.Living, C.LastBlossom, C.Wave1], undefined, 2),
new Model('Mei Feng', [C.TenThunders, C.Arcanist], [C.Master, C.Living, C.Foundry, C.Wave1], undefined, 3),
new Model('Jakob Lynch', [C.TenThunders, C.Neverborn], [C.Master, C.Living, C.Darkened, C.Wave1], undefined, 1),
new Model('Ototo', [C.TenThunders], [C.Henchman, C.Living, C.Rare1, C.LastBlossom, C.Wave1], 10, 3),
new Model('Kang', [C.TenThunders], [C.Henchman, C.Living, C.Rare1, C.Foundry, C.Wave1], 9, 4),
new Model('Yamaziko', [C.TenThunders], [C.Henchman, C.Living, C.Rare1, C.LastBlossom, C.Wave1], 7, 6),
new Model('Shang', [C.TenThunders, C.Outcast], [C.Peon, C.Living, C.TotemFor('Misaki'), C.Wave1], 3),
new Model('Emberling', [C.TenThunders, C.Arcanist], [C.Minion, C.TotemFor('Mei Feng'), C.Spirit, C.Wave1], 3),
new Model('Hungering Darkness', [C.TenThunders, C.Neverborn], [C.Henchman, C.TotemFor('Jakob Lynch'), C.Rare1, C.Spirit, C.Darkened, C.Wave1], 0, 5),
new Model('Dawn Serpent', [C.TenThunders], [C.Minion, C.Living, C.Rare1, C.Beast, C.Wave1], 10),
new Model('Fuhatsu', [C.TenThunders], [C.Henchman, C.Living, C.Rare1, C.Wave1], 10, 3),
new Model('Monk of Low River', [C.TenThunders], [C.Minion, C.Living, C.Rare3, C.Wave1], 4),
new Model('Oiran', [C.TenThunders], [C.Minion, C.Living, C.Mercenary, C.LastBlossom, C.Showgirl, C.Wave1], 5),
new Model('Rail Worker', [C.TenThunders, C.Arcanist], [C.Minion, C.Living, C.Construct, C.Foundry, C.Wave1], 5),
new Model('The Illuminated', [C.TenThunders, C.Neverborn], [C.Minion, C.Living, C.Brilliance, C.Wave1], 7),
new Model('Thunder Archer', [C.TenThunders], [C.Minion, C.Living, C.Wave1], 7),
new Model('Torakage', [C.TenThunders], [C.Minion, C.Living, C.Mercenary, C.LastBlossom, C.Wave1], 6),
new Model('Samurai', [C.TenThunders], [C.Enforcer, C.Living, C.Wave1], 8),
new Model('Lucas McCabe', [C.TenThunders, C.Guild], [C.Master, C.Living, C.BlackSheep, C.Wave2], undefined, 2),
new Model('Dismounted McCabe', [C.TenThunders, C.Guild], [C.Master, C.Living, C.BlackSheep, C.Wave2], undefined, 0),
new Model('Sidir Alchibal', [C.TenThunders, C.Guild], [C.Henchman, C.Living, C.Rare1, C.BlackSheep, C.Wave2], 9, 4),
new Model('Luna', [C.TenThunders, C.Guild], [C.Minion, C.Living, C.TotemFor('Lucas McCabe'), C.Beast, C.Hound, C.Wave2], 4),
new Model('Wastrel', [C.TenThunders, C.Guild], [C.Minion, C.Living, C.BlackSheep, C.Wave2], 4),
new Model('Yan Lo', [C.TenThunders, C.Resurrectionist], [C.Master, C.Living, C.Ancestor, C.Wave2], undefined, 4),
new Model('Soul Porter', [C.TenThunders, C.Resurrectionist], [C.Peon, C.TotemFor('Yan Lo'), C.Spirit, C.Wave2], 3),
new Model('Chiaki the Niece', [C.TenThunders, C.Resurrectionist], [C.Enforcer, C.Living, C.Rare1, C.Ancestor, C.Wave2], 6),
new Model('Izamu the Armor', [C.TenThunders, C.Resurrectionist], [C.Enforcer, C.Undead, C.Rare1, C.Ancestor, C.Spirit, C.Wave2], 10),
new Model('Toshiro the Daimyo', [C.TenThunders, C.Resurrectionist], [C.Henchman, C.Undead, C.Rare1, C.Ancestor, C.Wave2], 9, 4),
new Model('Yin the Penangalan', [C.TenThunders, C.Resurrectionist], [C.Enforcer, C.Undead, C.Rare1, C.Ancestor, C.Horror, C.Wave2], 8),
new Model('Ten Thunders Brother', [C.TenThunders], [C.Minion, C.Living, C.Wave2], 5),
new Model('Mr. Graves', [C.TenThunders, C.Neverborn], [C.Enforcer, C.Living, C.Rare1, C.Nephilim, C.Darkened, C.Mimic, C.Wave2], 8),
new Model('Mr. Tannen', [C.TenThunders, C.Neverborn], [C.Enforcer, C.Living, C.Rare1, C.Woe, C.Darkened, C.Mimic, C.Wave2], 6),
new Model('Shadow Effigy', [C.TenThunders], [C.Minion, C.Construct, C.Rare1, C.Puppet, C.Effigy, C.Wave2], 4),
new Model('Komainu', [C.TenThunders], [C.Minion, C.Construct, C.Spirit, C.Retainer, C.Wave2], 5),
new Model('Sensei Yu', [C.TenThunders], [C.Henchman, C.Living, C.Rare1, C.Wave2], 9, 4),
new Model('Shenlong', [C.TenThunders], [C.Master, C.Living, C.Tyrant, C.Wave2], undefined, 2),
new Model('Peasant', [C.TenThunders], [C.Peon, C.Living, C.TotemFor('Shenlong'), C.Rare2, C.Wave2], 2),
new Model('Fermented River Monk', [C.TenThunders], [C.Minion, C.Living, C.TriChi, C.Wave2], 5),
new Model('Monk of High River', [C.TenThunders], [C.Minion, C.Living, C.Rare3, C.Wave2], 6),
new Model('The Lone Swordsman', [C.TenThunders], [C.Enforcer, C.Living, C.Rare1, C.Wave2], 8),
new Model('Kamaitachi', [C.TenThunders], [C.Minion, C.Totem, C.Oni, C.Wave2], 4),
new Model('Tengu', [C.TenThunders], [C.Minion, C.Spirit, C.Oni, C.Wave2], 4),
new Model('Katanaka Sniper', [C.TenThunders], [C.Minion, C.Living, C.Rare2, C.Wave2], 7),
new Model('Brutal Emissary', [C.Guild], [C.Enforcer, C.Rare1, C.EmissaryOfFate, C.Wave3], 10),
new Model('Master Queeg', [C.Guild], [C.Henchman, C.Living, C.Rare1, C.Guardsman, C.BlackSheep, C.Wave3], 7, 6),
new Model('Dr. Grimwell', [C.Guild], [C.Henchman, C.Living, C.Mercenary, C.Rare1, C.WitchHunter, C.Wave3], 9, 4),
new Model('Nurse Heartsbane', [C.Guild], [C.Enforcer, C.Living, C.Mercenary, C.Rare1, C.WitchHunter, C.Wave3], 8),
new Model('Greed', [C.Guild], [C.Enforcer, C.Living, C.Mercenary, C.Rare1, C.CrossroadsSeven, C.Tormented, C.Wave3], 8),
new Model('Sanctioned Spellcaster', [C.Guild], [C.Minion, C.Living, C.Academic, C.Wave3], 5),
new Model('Orderly', [C.Guild], [C.Minion, C.Living, C.Mercenary, C.Rare2, C.WitchHunter, C.Wave3], 5),
new Model('Mounted Guard', [C.Guild], [C.Minion, C.Living, C.Guardsman, C.Wave3], 7),
new Model('Carrion Emissary', [C.Resurrectionist], [C.Enforcer, C.Rare1, C.EmissaryOfFate, C.Wave3], 10),
new Model('Anna Lovelace', [C.Resurrectionist], [C.Henchman, C.Living, C.Mercenary, C.Rare1, C.Wave3], 9, 4),
new Model('Sloth', [C.Resurrectionist], [C.Enforcer, C.Undead, C.Mercenary, C.Rare1, C.CrossroadsSeven, C.Tormented, C.Horror, C.Wave3], 8),
new Model('The Forgotten Marshal', [C.Resurrectionist], [C.Enforcer, C.Living, C.Rare1, C.Wave3], 7),
new Model('Hayreddin', [C.Resurrectionist], [C.Enforcer, C.Living, C.Rare1, C.Nephilim, C.Wave3], 7),
new Model('Arcane Emissary', [C.Arcanist], [C.Enforcer, C.Rare1, C.EmissaryOfFate, C.Wave3], 10),
new Model('Wind Gamin', [C.Arcanist], [C.Minion, C.Living, C.Gamin, C.Wave3], 4),
new Model('The Scorpius', [C.Arcanist], [C.Minion, C.Living, C.Construct, C.Rare1, C.Beast, C.Wave3], 6),
new Model('Ice Dancer', [C.Arcanist], [C.Minion, C.Living, C.Showgirl, C.Wave3], 6),
new Model('Envy', [C.Arcanist], [C.Enforcer, C.Living, C.Mercenary, C.Rare1, C.CrossroadsSeven, C.Tormented, C.Wave3], 8),
new Model('Mysterious Emissary', [C.Neverborn], [C.Enforcer, C.Rare1, C.EmissaryOfFate, C.Wave3], 10),
new Model('Wrath', [C.Neverborn], [C.Henchman, C.Living, C.Mercenary, C.Rare1, C.CrossroadsSeven, C.Tormented, C.Wave3], 8, 5),
new Model('Angel Eyes', [C.Neverborn], [C.Henchman, C.Living, C.Mercenary, C.Rare1, C.Nephilim, C.Wave3], 9, 4),
new Model('Scion of Black Blood', [C.Neverborn], [C.Enforcer, C.Living, C.Mercenary, C.Rare1, C.Nephilim, C.Wave3], 8),
new Model('Corrupted Hound', [C.Neverborn], [C.Minion, C.Living, C.Rare4, C.Beast, C.Hound, C.Wave3], 3),
new Model('Changeling', [C.Neverborn], [C.Minion, C.Living, C.Rare3, C.Mimic, C.Wave3], 4),
new Model('Bloodwretch', [C.Neverborn], [C.Minion, C.Living, C.Mercenary, C.Rare2, C.Nephilim, C.Wave3], 5),
new Model('Bunraku', [C.Neverborn, C.TenThunders], [C.Minion, C.Construct, C.Puppet, C.Wave3], 6),
new Model('Hodgepodge Emissary', [C.Outcast], [C.Enforcer, C.Rare1, C.EmissaryOfFate, C.Cursed, C.Wave3], 10),
new Model('Scion of the Void', [C.Outcast], [C.Henchman, C.Rare1, C.Wave3], 8, 5),
new Model('Pride', [C.Outcast], [C.Enforcer, C.Living, C.Mercenary, C.Rare1, C.CrossroadsSeven, C.Tormented, C.Wave3], 8),
new Model('Big Jake', [C.Outcast], [C.Enforcer, C.Living, C.Mercenary, C.Rare1, C.Wave3], 5),
new Model('The Winged Plague', [C.Outcast], [C.Minion, C.Living, C.Vermin, C.Wave3], 4),
new Model('Lucky Emissary', [C.Gremlin], [C.Enforcer, C.Rare1, C.EmissaryOfFate, C.Wave3], 10),
new Model('Sparks', [C.Gremlin], [C.Henchman, C.Living, C.Rare1, C.Gremlin, C.Foundry, C.Wave3], 7, 6),
new Model('Gluttony', [C.Gremlin], [C.Enforcer, C.Living, C.Mercenary, C.Rare1, C.CrossroadsSeven, C.Tormented, C.Wave3], 8),
new Model('Survivor', [C.Gremlin], [C.Minion, C.Living, C.Construct, C.Gremlin, C.Wave3], 5),
new Model('Mechanized Porkchop', [C.Gremlin], [C.Minion, C.Construct, C.Pig, C.Foundry, C.Wave3], 7),
new Model('Shadow Emissary', [C.TenThunders], [C.Enforcer, C.Rare1, C.EmissaryOfFate, C.Wave3], 10),
new Model('Lust', [C.TenThunders], [C.Enforcer, C.Living, C.Mercenary, C.Rare1, C.CrossroadsSeven, C.Tormented, C.Wave3], 8),
new Model('Wandering River Monk', [C.TenThunders], [C.Minion, C.Living, C.Wave3], 7),
new Model('Obsidian Oni', [C.TenThunders], [C.Minion, C.Oni, C.Wave3], 6),
new Model('Jorogumo', [C.TenThunders], [C.Minion, C.Oni, C.LastBlossom, C.Wave3], 9),
new Model('Nellie Cochrane', [C.Guild], [C.Master, C.Living, C.Journalist, C.Wave4], undefined, 4),
new Model('The Printing Press', [C.Guild], [C.Peon, C.Construct, C.TotemFor('Nellie Cochrane'), C.Journalist, C.Wave4], 3),
new Model('Phiona Gage', [C.Guild], [C.Henchman, C.Living, C.Rare1, C.Journalist, C.Wave4], 8, 5),
new Model('Allison Dade', [C.Guild], [C.Henchman, C.Living, C.Rare1, C.Journalist, C.Wave4], 8, 5),
new Model('Field Reporter', [C.Guild], [C.Minion, C.Living, C.Journalist, C.Wave4], 4),
new Model('Death Marshal Recruiter', [C.Guild], [C.Enforcer, C.Living, C.Rare2, C.GuildMarshal, C.Wave4], 7),
new Model('Witchling Thrall', [C.Guild], [C.Minion, C.Living, C.WitchHunter, C.Wave4], 9),
new Model('Reva', [C.Resurrectionist], [C.Master, C.Living, C.Revenant, C.Wave4], undefined, 4),
new Model('Corpse Candle', [C.Resurrectionist], [C.Peon, C.Undead, C.TotemFor('Reva'), C.Spirit, C.Revenant, C.Wave4], 2),
new Model('Vincent St. Clair', [C.Resurrectionist], [C.Henchman, C.Living, C.Rare1, C.Revenant, C.Wave4], 8, 5),
new Model('Archie', [C.Resurrectionist], [C.Henchman, C.Undead, C.Rare1, C.Horror, C.Wave4], 13, 0),
new Model('Shieldbearer', [C.Resurrectionist], [C.Minion, C.Living, C.Revenant, C.Wave4], 6),
new Model('Draugr', [C.Resurrectionist], [C.Minion, C.Undead, C.Revenant, C.Horror, C.Wave4], 8),
new Model('Goryo', [C.Resurrectionist], [C.Minion, C.Spirit, C.Retainer, C.Wave4], 7),
new Model('Sandeep Desai', [C.Arcanist], [C.Master, C.Living, C.Academic, C.Wave4], undefined, 4),
new Model('Corpse Candle', [C.Arcanist], [C.Minion, C.TotemFor('Sandeep Desai'), C.Rare1, C.Gamin, C.Wave4], 8),
new Model('Kudra', [C.Arcanist], [C.Henchman, C.Living, C.Rare1, C.Academic, C.Wave4], 7, 6),
new Model('Amina Naidu', [C.Arcanist], [C.Henchman, C.Living, C.Rare1, C.Msu, C.Academic, C.Wave4], 9, 4),
new Model('Carlos Vasquez', [C.Arcanist], [C.Henchman, C.Living, C.Rare1, C.Showgirl, C.Wave4], 9, 4),
new Model('Poison Gamin', [C.Arcanist], [C.Minion, C.Construct, C.Gamin, C.Beast, C.Wave4], 5),
new Model('Shastar Vidiya Guard', [C.Arcanist], [C.Enforcer, C.Living, C.Msu, C.Academic, C.Wave4], 8),
new Model('Titania', [C.Neverborn], [C.Master, C.Undead, C.Fae, C.Wave4], undefined, 4),
new Model('The Gorare', [C.Neverborn], [C.Peon, C.Living, C.TotemFor('Titania'), C.Fae, C.Wave4], 3),
new Model('Aeslin', [C.Neverborn], [C.Henchman, C.Undead, C.Rare1, C.Fae, C.Wave4], 9, 4),
new Model('The Tooth', [C.Neverborn], [C.Minion, C.Undead, C.Rare1, C.Fae, C.Wave4], 7),
new Model('The Claw', [C.Neverborn], [C.Minion, C.Undead, C.Rare1, C.Fae, C.Wave4], 7),
new Model('The Thorn', [C.Neverborn], [C.Minion, C.Undead, C.Rare1, C.Fae, C.Wave4], 7),
new Model('Bandersnatch', [C.Neverborn], [C.Minion, C.Living, C.Rare1, C.Fae, C.Nightmare, C.Spirit, C.Wave4], 5),
new Model('Will O\' the Wisp', [C.Neverborn], [C.Minion, C.Rare3, C.Spirit, C.Swampfiend, C.Wave4], 3),
new Model('Rougarou', [C.Neverborn], [C.Minion, C.Undead, C.Fae, C.Beast, C.Wave4], 8),
new Model('Parker Barrows', [C.Outcast], [C.Master, C.Living, C.Bandit, C.Wave4], undefined, 4),
new Model('Doc Mitchell', [C.Outcast], [C.Minion, C.Living, C.TotemFor('Parker Barrows'), C.Wave4], 3),
new Model('Mad Dog Brackett', [C.Outcast], [C.Henchman, C.Living, C.Rare1, C.Bandit, C.Wave4], 9, 4),
new Model('Aionus', [C.Outcast], [C.Henchman, C.Mercenary, C.Rare1, C.Wave4], 12, 1),
new Model('Bandido', [C.Outcast], [C.Minion, C.Living, C.Bandit, C.Wave4], 5),
new Model('Dead Outland', [C.Outcast], [C.Minion, C.Undead, C.Bandit, C.Tormented, C.Wave4], 6),
new Model('Wokou Raider', [C.Outcast], [C.Minion, C.Living, C.Bandit, C.LastBlossom, C.Wave4], 8),
new Model('Zipp', [C.Gremlin], [C.Master, C.Living, C.Gremlin, C.SkyPirate, C.Wave4], undefined, 4),
new Model('Earl Burns', [C.Gremlin], [C.Minion, C.Living, C.TotemFor('Zipp'), C.Wave4], 3),
new Model('The First Mate', [C.Gremlin], [C.Henchman, C.Living, C.Rare1, C.Swampfiend, C.SkyPirate, C.Wave4], 9, 4),
new Model('Iron Skeeter', [C.Gremlin], [C.Enforcer, C.Living, C.Construct, C.Gremlin, C.SkyPirate, C.Wave4], 6),
new Model('Akaname', [C.Gremlin, C.TenThunders], [C.Minion, C.Rare3, C.Oni, C.TriChi, C.Wave4], 4),
new Model('Banjonista', [C.Gremlin], [C.Minion, C.Living, C.Gremlin, C.Wave4], 5),
new Model('Swine-Cursed', [C.Gremlin], [C.Minion, C.Living, C.Rare2, C.Gremlin, C.Wave4], 7),
new Model('Asami Tanaka', [C.TenThunders], [C.Master, C.Living, C.Oni, C.Wave4], undefined, 3),
new Model('Amanjaku', [C.TenThunders], [C.Peon, C.TotemFor('Asami Tanaka'), C.Oni, C.Wave4], 3),
new Model('Ohaguro Bettari', [C.TenThunders], [C.Henchman, C.Rare1, C.Oni, C.Wave4], 8, 5),
new Model('Yokai', [C.TenThunders], [C.Minion, C.Oni, C.Wave4], 5),
new Model('Terracotta Warrior', [C.TenThunders], [C.Minion, C.Construct, C.Rare3, C.Mimic, C.Wave4], 5),
new Model('Sun Quiang', [C.TenThunders], [C.Enforcer, C.Rare1, C.Living, C.Retainer, C.Wave4], 8)
]
export default ModelList | 145372 | import ModelInterface from './ModelInterface.coffee'
Model = ModelInterface.Model
C = ModelInterface.Attribute
# **Epic props** to rythos42 for saving me having to research and type all this!
# https://github.com/rythos42/MalifauxModels-Web/blob/master/js/app/Mappers/ModelList.js
ModelList = [
new Model('<NAME>', [C.Guild], [C.Master, C.Living, C.GuildMarshal, C.Wave1], undefined, 4),
new Model('<NAME>', [C.Guild], [C.Master, C.Living, C.WitchHunter, C.Wave1], undefined, 3),
new Model('<NAME>', [C.Guild], [C.Master, C.Living, C.Family, C.Wave1], undefined, 2),
new Model('<NAME>', [C.Guild], [C.Henchman, C.Living, C.Family, C.Wave1], 8, 5),
new Model('<NAME>', [C.Guild], [C.Henchman, C.Living, C.WitchHunter, C.Wave1], 9, 4),
new Model('The J<NAME>', [C.Guild], [C.Henchman, C.Living, C.Rare1, C.GuildMarshal, C.Wave1], 9, 4),
new Model('Scales of Justice', [C.Guild], [C.Peon, C.Living, C.TotemFor('Lady Justice'), C.Wave1], 3),
new Model('Purifying Flame', [C.Guild], [C.Peon, C.TotemFor('<NAME>'), C.Spirit, C.Wave1], 3),
new Model('Enslaved Nephilim', [C.Guild], [C.Peon, C.TotemFor('<NAME>'), C.Nephilim, C.Wave1], 3),
new Model('Governor\'s Proxy', [C.Guild], [C.Peon, C.Totem, C.Living, C.Wave1], 3),
new Model('Death Marshal', [C.Guild], [C.Minion, C.Living, C.GuildMarshal, C.Wave1], 6),
new Model('Executioner', [C.Guild], [C.Enforcer, C.Living, C.Rare2, C.Wave1], 9),
new Model('Guild Austringer', [C.Guild], [C.Minion, C.Living, C.Rare2, C.Guardsman, C.Wave1], 6),
new Model('Guild Guard', [C.Guild], [C.Minion, C.Living, C.Guardsman, C.Wave1], 4),
new Model('Peacekeeper', [C.Guild], [C.Enforcer, C.Construct, C.Rare1, C.Wave1], 11),
new Model('The Lone Marshal', [C.Guild], [C.Enforcer, C.Living, C.Rare1, C.GuildMarshal, C.Wave1], 8),
new Model('Witchling Stalker', [C.Guild], [C.Minion, C.Living, C.WitchHunter, C.Wave1], 5),
new Model('<NAME>', [C.Guild], [C.Enforcer, C.Living, C.Rare1, C.Family, C.Wave1], 7),
new Model('<NAME>', [C.Guild], [C.Enforcer, C.Living, C.Rare1, C.Family, C.Tormented, C.Wave1], 7),
new Model('<NAME>', [C.Guild], [C.Enforcer, C.Living, C.Rare1, C.Family, C.Wave1], 7),
new Model('<NAME>', [C.Guild], [C.Master, C.Living, C.Construct, C.Msu, C.Wave2], undefined, 3),
new Model('<NAME>', [C.Guild], [C.Henchman, C.Construct, C.Rare1, C.Msu, C.Wave2], 10, 3),
new Model('Mechanical Attendant', [C.Guild], [C.Peon, C.Construct, C.TotemFor('<NAME>'), C.Wave2], 2),
new Model('<NAME>', [C.Guild], [C.Minion, C.Construct, C.Wave2], 8),
new Model('<NAME>', [C.Guild, C.Neverborn], [C.Master, C.Living, C.Mimic, C.Wave2], undefined, 4),
new Model('<NAME>', [C.Guild], [C.Henchman, C.Living, C.Rare1, C.Guardsman, C.Wave2], 9, 4),
new Model('The Scribe', [C.Guild, C.Neverborn], [C.Peon, C.Living, C.TotemFor('<NAME>'), C.Wave2], 2),
new Model('<NAME>', [C.Guild], [C.Enforcer, C.Living, C.Rare1, C.Family, C.Wave2], 7),
new Model('Guild Hound', [C.Guild], [C.Minion, C.Living, C.Rare4, C.Beast, C.Hound, C.Guardsman, C.Wave2], 3),
new Model('Guard Sergeant', [C.Guild], [C.Enforcer, C.Living, C.Rare2, C.Guardsman, C.Wave2], 6),
new Model('<NAME>', [C.Guild], [C.Minion, C.Construct, C.Rare2, C.Wave2], 7),
new Model('Guild Lawyer', [C.Guild], [C.Minion, C.Living, C.Rare2, C.Mimic, C.Wave2], 6),
new Model('Watcher', [C.Guild], [C.Minion, C.Construct, C.Wave2], 4),
new Model('Exorcist', [C.Guild], [C.Enforcer, C.Living, C.Rare2, C.GuildMarshal, C.Wave2], 7),
new Model('Pistolero De Latigo', [C.Guild], [C.Minion, C.Living, C.Family, C.Wave2], 5),
new Model('Pale Rider', [C.Guild], [C.Enforcer, C.Undead, C.Rare1, C.Horseman, C.Wave2], 12),
new Model('Warden', [C.Guild], [C.Minion, C.Construct, C.Guardsman, C.Wave2], 6),
new Model('Witchling Handler', [C.Guild], [C.Enforcer, C.Living, C.WitchHunter, C.Wave2], 8),
new Model('Brutal Effigy', [C.Guild], [C.Minion, C.Construct, C.Puppet, C.Effigy, C.Rare1, C.Wave2], 4),
new Model('Guild Rifleman', [C.Guild], [C.Minion, C.Living, C.Rare3, C.Guardsman, C.Wave2], 5),
new Model('Clockwork Trap', [C.Guild, C.TenThunders], [C.Peon, C.Rare4, C.Wave2], 2),
new Model('Guild Pathfinder', [C.Guild, C.TenThunders], [C.Minion, C.Living, C.Guardsman, C.Wave2], 6),
new Model('Seamus', [C.Resurrectionist], [C.Master, C.Living, C.Wave1], undefined, 3),
new Model('McMo<NAME>', [C.Resurrectionist, C.Guild], [C.Master, C.Living, C.Wave1], undefined, 4),
new Model('<NAME>', [C.Resurrectionist], [C.Master, C.Living, C.Wave1], undefined, 3),
new Model('<NAME>', [C.Resurrectionist], [C.Henchman, C.Undead, C.Rare1, C.Wave1], 8, 5),
new Model('<NAME>', [C.Resurrectionist], [C.Henchman, C.Living, C.Rare1, C.Wave1], 7, 6),
new Model('Mortimer', [C.Resurrectionist], [C.Henchman, C.Living, C.Rare1, C.Wave1], 9, 4),
new Model('Copycat Killer', [C.Resurrectionist], [C.Peon, C.Living, C.TotemFor('Seamus'), C.Wave1], 3),
new Model('Zombie Chihuahua', [C.Resurrectionist], [C.Peon, C.Undead, C.TotemFor('McMourning'), C.Beast, C.Wave1], 2),
new Model('Vulture', [C.Resurrectionist], [C.Peon, C.Living, C.TotemFor('Nicodem'), C.Beast, C.Wave1], 3),
new Model('Graveyard Spirit', [C.Resurrectionist], [C.Peon, C.Totem, C.Spirit, C.Wave1], 3),
new Model('Bete Noire', [C.Resurrectionist], [C.Enforcer, C.Undead, C.Rare1, C.Wave1], 8),
new Model('Canine Remains', [C.Resurrectionist], [C.Minion, C.Undead, C.Beast, C.Hound, C.Wave1], 4),
new Model('Crooked Man', [C.Resurrectionist], [C.Minion, C.Undead, C.Tormented, C.Wave1], 5),
new Model('Flesh Construct', [C.Resurrectionist], [C.Minion, C.Undead, C.Construct, C.Wave1], 6),
new Model('Mindless Zombie', [C.Resurrectionist], [C.Peon, C.Undead, C.Wave1], 2),
new Model('Necropunk', [C.Resurrectionist], [C.Minion, C.Undead, C.Construct, C.Wave1], 5),
new Model('Nurse', [C.Resurrectionist], [C.Minion, C.Living, C.Tormented, C.Wave1], 5),
new Model('Punk Zombie', [C.Resurrectionist], [C.Minion, C.Undead, C.Horror, C.Wave1], 7),
new Model('Rotten Belle', [C.Resurrectionist], [C.Minion, C.Undead, C.Belle, C.Wave1], 5),
new Model('The Hanged', [C.Resurrectionist], [C.Minion, C.Undead, C.Rare2, C.Spirit, C.Tormented, C.Wave1], 9),
new Model('Molly Squidpiddge', [C.Resurrectionist], [C.Master, C.Undead, C.Belle, C.Horror, C.Wave2], undefined, 3),
new Model('Rogue Necromancy', [C.Resurrectionist], [C.Enforcer, C.Undead, C.Construct, C.Beast, C.Horror, C.Wave2], 10),
new Model('Guild Autopsy', [C.Resurrectionist], [C.Minion, C.Undead, C.Horror, C.Wave2], 4),
new Model('Necrotic Machine', [C.Resurrectionist], [C.Minion, C.Construct, C.TotemFor('Molly Squidpiddge'), C.Rare1, C.Horror, C.Spirit, C.Wave2], 2),
new Model('<NAME>', [C.Resurrectionist], [C.Master, C.Living, C.Wave2], undefined, 3),
new Model('Ikiryo', [C.Resurrectionist], [C.Enforcer, C.Rare1, C.Spirit, C.Wave2], 0),
new Model('Seishin', [C.Resurrectionist], [C.Peon, C.Rare5, C.Spirit, C.Wave2], 0),
new Model('Lost Love', [C.Resurrectionist], [C.Peon, C.Undead, C.TotemFor('Kirai Ankoku'), C.Spirit, C.Wave2], 4),
new Model('D<NAME>ue Ba', [C.Resurrectionist], [C.Henchman, C.Undead, C.Rare1, C.Spirit, C.Wave2], 8, 5),
new Model('Dead Rider', [C.Resurrectionist], [C.Enforcer, C.Undead, C.Rare1, C.Horseman, C.Wave2], 12),
new Model('Gaki', [C.Resurrectionist], [C.Minion, C.Spirit, C.Wave2], 4),
new Model('Night Terror', [C.Resurrectionist], [C.Minion, C.Rare4, C.Beast, C.Spirit, C.Wave2], 3),
new Model('Onryo', [C.Resurrectionist], [C.Minion, C.Spirit, C.Retainer, C.Wave2], 5),
new Model('<NAME>', [C.Resurrectionist], [C.Minion, C.Undead, C.Rare2, C.Beast, C.Spirit, C.Wave2], 8),
new Model('Crooligan', [C.Resurrectionist], [C.Minion, C.Undead, C.Horror, C.Lost, C.Wave2], 4),
new Model('Dead Doxy', [C.Resurrectionist], [C.Minion, C.Undead, C.Belle, C.Wave2], 6),
new Model('The Drowned', [C.Resurrectionist], [C.Minion, C.Undead, C.Horror, C.Spirit, C.Tormented, C.Wave2], 6),
new Model('<NAME>akuna Ubume', [C.Resurrectionist], [C.Enforcer, C.Spirit, C.Tormented, C.Rare1, C.Wave2], 6),
new Model('Rafkin', [C.Resurrectionist], [C.Enforcer, C.Living, C.Rare1, C.Wave2], 7),
new Model('<NAME>', [C.Resurrectionist], [C.Minion, C.Construct, C.Rare1, C.Puppet, C.Effigy, C.Wave2], 4),
new Model('<NAME>', [C.Resurrectionist], [C.Minion, C.Undead, C.Retainer, C.Wave2], 5),
new Model('<NAME> the <NAME>', [C.Resurrectionist], [C.Henchman, C.Undead, C.Rare1, C.Spirit, C.Horror, C.Wave2], 8, 5),
new Model('Student of <NAME>', [C.Resurrectionist], [C.Minion, C.Construct, C.Undead, C.Horror, C.Academic, C.Wave2], 7),
new Model('Student of <NAME>', [C.Resurrectionist], [C.Minion, C.Construct, C.Undead, C.Horror, C.Academic, C.Wave2], 7),
new Model('Student of <NAME>', [C.Resurrectionist], [C.Minion, C.Construct, C.Undead, C.Horror, C.Academic, C.Wave2], 8),
new Model('The <NAME>aled<NAME>', [C.Resurrectionist], [C.Henchman, C.Construct, C.Undead, C.Rare1, C.Horror, C.Academic, C.Wave2], 10, 3),
new Model('<NAME>', [C.Arcanist], [C.Master, C.Living, C.Wave1], undefined, 3),
new Model('<NAME>', [C.Arcanist], [C.Master, C.Living, C.Beast, C.Wave1], undefined, 4),
new Model('<NAME>', [C.Arcanist], [C.Master, C.Living, C.Construct, C.Msu, C.Wave1], undefined, 3),
new Model('<NAME>', [C.Arcanist], [C.Henchman, C.Living, C.Rare1, C.Beast, C.Wave1], 8, 5),
new Model('<NAME>', [C.Arcanist], [C.Henchman, C.Living, C.Construct, C.Rare1, C.Msu, C.Wave1], 10, 3),
new Model('<NAME>', [C.Arcanist], [C.Enforcer, C.Living, C.Rare1, C.Beast, C.Wave1], 8),
new Model('Ice <NAME>', [C.Arcanist], [C.Enforcer, C.Construct, C.Wave1], 10),
new Model('<NAME>', [C.Arcanist], [C.Minion, C.Living, C.TotemFor('Rasputina'), C.Wave1], 3),
new Model('<NAME>', [C.Arcanist], [C.Peon, C.Living, C.TotemFor('<NAME>'), C.Beast, C.Wave1], 2),
new Model('<NAME>', [C.Arcanist], [C.Peon, C.Construct, C.TotemFor('<NAME>'), C.Msu, C.Wave1], 4),
new Model('Essence of Power', [C.Arcanist], [C.Peon, C.Totem, C.Spirit, C.Wave1], 3),
new Model('De<NAME>', [C.Arcanist], [C.Minion, C.Living, C.Wave1], 7),
new Model('Electric Creation', [C.Arcanist], [C.Peon, C.Construct, C.Wave1], 4),
new Model('<NAME>', [C.Arcanist], [C.Minion, C.Living, C.Beast, C.Swarm, C.Wave1], 5),
new Model('<NAME>', [C.Arcanist], [C.Enforcer, C.Construct, C.Living, C.Rare1, C.Msu, C.Wave1], 12),
new Model('Ice Gamin', [C.Arcanist], [C.Minion, C.Construct, C.Gamin, C.Wave1], 4),
new Model('Metal Gamin', [C.Arcanist], [C.Minion, C.Construct, C.Gamin, C.Msu, C.Foundry, C.Wave1], 4),
new Model('<NAME>', [C.Arcanist], [C.Minion, C.Living, C.Beast, C.Wave1], 4),
new Model('Rail Golem', [C.Arcanist], [C.Enforcer, C.Construct, C.Rare1, C.Foundry, C.Wave1], 11),
new Model('Razorspine Rattler', [C.Arcanist], [C.Minion, C.Living, C.Beast, C.Wave1], 7),
new Model('Sabertooth Cerberus', [C.Arcanist], [C.Enforcer, C.Living, C.Beast, C.Wave1], 9),
new Model('Steam Arachnid', [C.Arcanist], [C.Minion, C.Construct, C.Msu, C.Wave1], 4),
new Model('Steam Arachnid Swarm', [C.Arcanist], [C.Minion, C.Construct, C.Swarm, C.Msu, C.Wave1], 8),
new Model('Ironsides', [C.Arcanist], [C.Master, C.Living, C.Msu, C.Wave2], undefined, 5),
new Model('Oxfordian Mage', [C.Arcanist], [C.Enforcer, C.Living, C.Rare3, C.Academic, C.Msu, C.Wave2], 6),
new Model('Mouse', [C.Arcanist], [C.Peon, C.Living, C.TotemFor('Ironsides'), C.Msu, C.Wave2], 4),
new Model('Colette Du Bois', [C.Arcanist], [C.Master, C.Living, C.Showgirl, C.Wave2], undefined, 2),
new Model('Mechanical Dove', [C.Arcanist], [C.Peon, C.Construct, C.TotemFor('Colette Du Bois'), C.Rare3, C.Wave2], 2),
new Model('<NAME>', [C.Arcanist], [C.Henchman, C.Living, C.Rare1, C.Showgirl, C.Wave2], 8, 5),
new Model('<NAME>', [C.Arcanist], [C.Minion, C.Construct, C.Rare2, C.Showgirl, C.Puppet, C.Wave2], 7),
new Model('<NAME>', [C.Arcanist], [C.Enforcer, C.Construct, C.Showgirl, C.Puppet, C.Wave2], 0),
new Model('<NAME>', [C.Arcanist], [C.Minion, C.Living, C.Mercenary, C.Showgirl, C.Wave2], 5),
new Model('<NAME>', [C.Arcanist], [C.Peon, C.Construct, C.Showgirl, C.Puppet, C.Wave2], 4),
new Model('<NAME>', [C.Arcanist], [C.Master, C.Living, C.Msu, C.Wave2], undefined, 4),
new Model('The Firestarter', [C.Arcanist], [C.Henchman, C.Living, C.Rare1, C.Msu, C.Wave2], 7, 6),
new Model('Eternal Flame', [C.Arcanist], [C.Peon, C.Construct, C.TotemFor('Kaeris'), C.Msu, C.Wave2], 2),
new Model('<NAME>', [C.Arcanist], [C.Minion, C.Living, C.Msu, C.Wave2], 7),
new Model('Large Arachnid', [C.Arcanist], [C.Minion, C.Construct, C.Msu, C.Wave2], 6),
new Model('Malifaux Raptor', [C.Arcanist], [C.Peon, C.Living, C.Rare3, C.Beast, C.Wave2], 3),
new Model('Mechanical Rider', [C.Arcanist], [C.Enforcer, C.Construct, C.Rare1, C.Horseman, C.Wave2], 12),
new Model('Silent One', [C.Arcanist], [C.Minion, C.Living, C.Wave2], 6),
new Model('Snow Storm', [C.Arcanist], [C.Henchman, C.Rare1, C.Spirit, C.Wave2], 11, 2),
new Model('Soulstone Miner', [C.Arcanist], [C.Minion, C.Construct, C.Msu, C.Wave2], 6),
new Model('The Captain', [C.Arcanist], [C.Henchman, C.Living, C.Rare1, C.Msu, C.Wave2], 10, 3),
new Model('Angelica', [C.Arcanist], [C.Enforcer, C.Living, C.Rare1, C.Showgirl, C.Wave2], 6),
new Model('Blessed of December', [C.Arcanist], [C.Enforcer, C.Living, C.Rare1, C.Beast, C.Wave2], 9),
new Model('Fire Gamin', [C.Arcanist], [C.Minion, C.Construct, C.Gamin, C.Wave2], 4),
new Model('Slate Ridge Mauler', [C.Arcanist], [C.Minion, C.Living, C.Beast, C.Wave2], 8),
new Model('Union Miner', [C.Arcanist], [C.Minion, C.Living, C.Msu, C.Wave2], 5),
new Model('Willie', [C.Arcanist], [C.Minion, C.Living, C.Rare1, C.Msu, C.Foundry, C.Wave2], 6),
new Model('Arcane Effigy', [C.Arcanist], [C.Minion, C.Construct, C.Rare1, C.Puppet, C.Effigy, C.Wave2], 4),
new Model('Mobile Toolkit', [C.Arcanist], [C.Peon, C.Construct, C.Rare1, C.Msu, C.Wave2], 3),
new Model('<NAME>', ['Neverborn'], [C.Master, C.Living, C.Nephilim, C.Wave1], undefined, 4),
new Model('<NAME>', ['Neverborn'], [C.Master, C.Living, C.Woe, C.Wave1], undefined, 3),
new Model('<NAME>', ['Neverborn', C.Gremlin], [C.Master, C.Living, C.Swampfiend, C.Wave1], undefined, 4),
new Model('<NAME>', ['Neverborn'], [C.Henchman, C.Living, C.Rare1, C.Nephilim, C.Wave1], 10, 3),
new Model('<NAME>', ['Neverborn'], [C.Henchman, C.Living, C.Rare1, C.Woe, C.Mimic, C.Lost, C.Wave1], 9, 4),
new Model('Bad <NAME>', ['Neverborn'], [C.Henchman, C.Rare1, C.Swampfiend, C.Wave1], 8, 5),
new Model('<NAME>', ['Neverborn'], [C.Peon, C.Living, C.TotemFor('Lilith'), C.Nephilim, C.Wave1], 3),
new Model('Poltergeist', ['Neverborn'], [C.Minion, C.TotemFor('Pandora'), C.Woe, C.Spirit, C.Wave1], 5),
new Model('<NAME>', ['Neverborn', C.Gremlin], [C.Peon, C.Construct, C.TotemFor('Zoraida'), C.Puppet, C.Wave1], 3),
new Model('Primordial Magic', ['Neverborn'], [C.Peon, C.Totem, C.Spirit, C.Wave1], 2),
new Model('Baby Kade', ['Neverborn'], [C.Enforcer, C.Living, C.Rare1, C.Woe, C.Lost, C.Wave1], 7),
new Model('Teddy', ['Neverborn'], [C.Enforcer, C.Construct, C.Nightmare, C.Wave1], 11),
new Model('Beckoner', ['Neverborn'], [C.Minion, C.Living, C.Rare2, C.Brilliance, C.Darkened, C.Mimic, C.Wave1], 7),
new Model('Doppleganger', ['Neverborn'], [C.Enforcer, C.Living, C.Rare1, C.Woe, C.Mimic, C.Wave1], 7),
new Model('Mature Nephilim', ['Neverborn'], [C.Enforcer, C.Living, C.Nephilim, C.Wave1], 11),
new Model('Silurid', ['Neverborn'], [C.Minion, C.Living, C.Beast, C.Swampfiend, C.Wave1], 7),
new Model('Sorrow', ['Neverborn'], [C.Minion, C.Woe, C.Spirit, C.Wave1], 5),
new Model('Terror Tot', ['Neverborn'], [C.Minion, C.Living, C.Nephilim, C.Wave1], 4),
new Model('Waldgeist', ['Neverborn'], [C.Minion, C.Living, C.Beast, C.Swampfiend, C.Wave1], 6),
new Model('Young Nephilim', ['Neverborn'], [C.Minion, C.Living, C.Nephilim, C.Wave1], 6),
new Model('The Dreamer', [C.Neverborn], [C.Master, C.Spirit, C.Wave2], undefined, 3),
new Model('Lord Chompy Bits', [C.Neverborn], [C.Henchman, C.Rare1, C.Nightmare, C.Tyrant, C.Wave2], 0),
new Model('Daydream', [C.Neverborn], [C.Peon, C.TotemFor('The Dreamer'), C.Rare3, C.Nightmare, C.Wave2], 2),
new Model('Al<NAME>', [C.Neverborn], [C.Peon, C.Nightmare, C.Wave2], 3),
new Model('<NAME>', [C.Neverborn], [C.Enforcer, C.Rare1, C.Nightmare, C.Wave2], 8),
new Model('<NAME>', [C.Neverborn], [C.Enforcer, C.Rare1, C.Nightmare, C.Nephilim, C.Woe, C.Wave2], 7),
new Model('<NAME>', [C.Neverborn], [C.Enforcer, C.Rare1, C.Nightmare, C.Nephilim, C.Woe, C.Wave2], 7),
new Model('Insidious Madness', [C.Neverborn], [C.Minion, C.Rare3, C.Nightmare, C.Woe, C.Wave2], 5),
new Model('Widow Weaver', [C.Neverborn], [C.Henchman, C.Rare1, C.Nightmare, C.Wave2], 8, 5),
new Model('Black Blood Shaman', [C.Neverborn], [C.Minion, C.Living, C.Rare2, C.Nephilim, C.Wave2], 7),
new Model('<NAME>', [C.Neverborn], [C.Henchman, C.Living, C.Rare1, C.Nephilim, C.Wave2], 13, 0),
new Model('<NAME>', [C.Neverborn], [C.Master, C.Construct, C.Puppet, C.Wave2], undefined, 3),
new Model('<NAME>', [C.Neverborn], [C.Minion, C.Construct, C.TotemFor('Collodi'), C.Rare4, C.Puppet, C.Wave2], 3),
new Model('Stitched Together', [C.Neverborn], [C.Minion, C.Construct, C.Nightmare, C.Puppet, C.Darkened, C.Wave2], 6),
new Model('Wicked Doll', [C.Neverborn], [C.Minion, C.Construct, C.Puppet, C.Wave2], 4),
new Model('Vasilisa', [C.Neverborn], [C.Henchman, C.Construct, C.Rare1, C.Puppet, C.Wave2], 9, 4),
new Model('Iggy', [C.Neverborn], [C.Enforcer, C.Living, C.Rare1, C.Woe, C.Lost, C.Wave2], 5),
new Model('Spawn Mother', [C.Neverborn], [C.Henchman, C.Living, C.Rare1, C.Swampfiend, C.Beast, C.Wave2], 9, 4),
new Model('Gupps', [C.Neverborn], [C.Minion, C.Living, C.Swampfiend, C.Beast, C.Swarm, C.Wave2], 4),
new Model('Tuco', [C.Neverborn], [C.Enforcer, C.Living, C.Rare1, C.Nephilim, C.Wave2], 7),
new Model('Mysterious Effigy', [C.Neverborn], [C.Minion, C.Construct, C.Rare1, C.Puppet, C.Effigy, C.Wave2], 4),
new Model('The Depleted', [C.Neverborn], [C.Minion, C.Living, C.Brilliance, C.Darkened, C.Wave2], 4),
new Model('Hooded Rider', [C.Neverborn], [C.Enforcer, C.Construct, C.Rare1, C.Horseman, C.Wave2], 12),
new Model('<NAME>', [C.Outcast], [C.Master, C.Living, C.Freikorps, C.Wave1], undefined, 1),
new Model('<NAME>', [C.Outcast, C.Resurrectionist], [C.Master, C.Undead, C.Wave1], undefined, 4),
new Model('Viktoria of Ashes', [C.Outcast], [C.Master, C.Living, C.Sister, C.Wave1], undefined, 1),
new Model('<NAME>', [C.Outcast], [C.Henchman, C.Living, C.Rare1, C.Mercenary, C.Freikorps, C.Wave1], 10, 3),
new Model('The Nothing Beast', [C.Outcast], [C.Enforcer, C.Rare1, C.Wave1], 10),
new Model('Viktoria of Blood', [C.Outcast], [C.Henchman, C.Living, C.Rare1, C.Sister, C.Wave1], 0, 3),
new Model('<NAME>', [C.Outcast], [C.Henchman, C.Living, C.Mercenary, C.Rare1, C.Wave1], 10, 3),
new Model('Steam Trunk', [C.Outcast], [C.Peon, C.Construct, C.TotemFor('<NAME>'), C.Wave1], 3),
new Model('<NAME>', [C.Outcast, C.Resurrectionist], [C.Enforcer, C.Living, C.TotemFor('<NAME>'), C.Wave1], 5),
new Model('Student of Conflict', [C.Outcast], [C.Peon, C.Living, C.Totem, C.Mercenary, C.Sister, C.Wave1], 4),
new Model('Malifaux Child', [C.Outcast], [C.Peon, C.Living, C.Totem, C.Mercenary, C.Lost, C.Wave1], 2),
new Model('<NAME>', [C.Outcast], [C.Enforcer, C.Living, C.Mercenary, C.Rare1, C.Wave1], 10),
new Model('<NAME>', [C.Outcast], [C.Enforcer, C.Living, C.Mercenary, C.Rare2, C.Wave1], 7),
new Model('Des<NAME>ercenary', [C.Outcast], [C.Minion, C.Living, C.Mercenary, C.Wave1], 4),
new Model('Freikorps Specialist', [C.Outcast], [C.Living, C.Enforcer, C.Mercenary, C.Freikorps, C.Wave1], 8),
new Model('<NAME>', [C.Outcast], [C.Living, C.Minion, C.Mercenary, C.Freikorps, C.Wave1], 5),
new Model('<NAME>', [C.Outcast], [C.Enforcer, C.Living, C.Mercenary, C.Rare1, C.Wave1], 8),
new Model('<NAME>', [C.Outcast], [C.Enforcer, C.Living, C.Mercenary, C.Rare1, C.Msu, C.Wave1], 6),
new Model('<NAME>', [C.Outcast], [C.Enforcer, C.Undead, C.Mercenary, C.Rare1, C.Horror, C.Wave1], 12),
new Model('<NAME>', [C.Outcast], [C.Minion, C.Living, C.Mercenary, C.Wave1], 6),
new Model('Void <NAME>', [C.Outcast], [C.Minion, C.Wave1], 4),
new Model('<NAME>', [C.Outcast], [C.Master, C.Undead, C.Tormented, C.Spirit, C.Cursed, C.Wave2], undefined, 2),
new Model('The Guilty', [C.Outcast], [C.Minion, C.Undead, C.Tormented, C.Wave2], 5),
new Model('<NAME>', [C.Outcast], [C.Henchman, C.Undead, C.Rare1, C.Tormented, C.Wave2], 9, 4),
new Model('<NAME>', [C.Outcast], [C.Peon, C.TotemFor('<NAME>'), C.Tormented, C.Spirit, C.Wave2], 4),
new Model('<NAME>', [C.Outcast], [C.Master, C.Tyrant, C.Nihilist, C.Wave2], undefined, 1),
new Model('<NAME>', [C.Outcast], [C.Henchman, C.Rare1, C.Nihilist, C.Spirit, C.Wave2], 8, 5),
new Model('Obediant Wretch', [C.Outcast], [C.Minion, C.Living, C.Rare1, C.Nihilist, C.Wave2], 4),
new Model('Rat Catcher', [C.Outcast], [C.Minion, C.Living, C.Rare2, C.Nihilist, C.Wave2], 6),
new Model('<NAME>aux <NAME>', [C.Outcast], [C.Peon, C.Vermin, C.Wave2], 2),
new Model('Rat King', [C.Outcast], [C.Minion, C.Vermin, C.Swarm, C.Wave2], 8),
new Model('The Stolen', [C.Outcast], [C.Peon, C.Living, C.TotemFor('<NAME>'), C.Rare3, C.Nihilist, C.Lost, C.Wave2], 2),
new Model('Ashes and Dust', [C.Outcast], [C.Enforcer, C.Construct, C.Undead, C.Rare1, C.Wave2], 13),
new Model('Ashen Core', [C.Outcast], [C.Enforcer, C.Construct, C.Undead, C.Rare1, C.Wave2], 0),
new Model('Dust Storm', [C.Outcast], [C.Enforcer, C.Construct, C.Undead, C.Rare1, C.Wave2], 6),
new Model('Freikorps Librarian', [C.Outcast], [C.Enforcer, C.Living, C.Mercenary, C.Academic, C.Freikorps, C.Wave2], 7),
new Model('Freikorps Trapper', [C.Outcast], [C.Minion, C.Living, C.Mercenary, C.Rare2, C.Freikorps, C.Wave2], 6),
new Model('Lazarus', [C.Outcast], [C.Enforcer, C.Construct, C.Mercenary, C.Rare1, C.Freikorps, C.Wave2], 10),
new Model('Sue', [C.Outcast], [C.Enforcer, C.Living, C.Mercenary, C.Rare1, C.Wave2], 8),
new Model('Hodgepodge Effigy', [C.Outcast], [C.Minion, C.Construct, C.Rare1, C.Puppet, C.Effigy, C.Wave2], 4),
new Model('Ama No Zako', [C.Outcast, C.TenThunders], [C.Henchman, C.Mercenary, C.Rare1, C.Oni, C.Wave2], 9, 4),
new Model('Strongarm Suit', [C.Outcast], [C.Enforcer, C.Living, C.Mercenary, C.Rare1, C.Freikorps, C.Wave2], 10),
new Model('Vanessa', [C.Outcast], [C.Enforcer, C.Living, C.Rare1, C.Sister, C.Wave2], 8),
new Model('Leveticus', [C.Outcast], [C.Master, C.Living, C.Wave2], undefined, 2),
new Model('<NAME>', [C.Outcast], [C.Henchman, C.Living, C.Rare1, C.Wave2], 10, 3),
new Model('<NAME>', [C.Outcast], [C.Peon, C.Undead, C.TotemFor('Leveticus'), C.Rare3, C.Wave2], 0),
new Model('Abomination', [C.Outcast], [C.Minion, C.Construct, C.Undead, C.Wave2], 4),
new Model('Desolation Engine', [C.Outcast], [C.Enforcer, C.Undead, C.Construct, C.Rare1, C.Wave2], 13),
new Model('<NAME>', [C.Gremlin], [C.Master, C.Living, C.Gremlin, C.Wave1], undefined, 4),
new Model('<NAME>', [C.Gremlin], [C.Master, C.Living, C.Gremlin, C.Kin, C.Wave1], undefined, 3),
new Model('The Brewmaster', [C.Gremlin, C.TenThunders], [C.Master, C.Living, C.Gremlin, C.TriChi, C.Wave1], undefined, 3),
new Model('<NAME>', [C.Gremlin], [C.Henchman, C.Living, C.Rare1, C.Gremlin, C.Kin, C.Wave1], 7, 6),
new Model('Fingers', [C.Gremlin], [C.Henchman, C.Living, C.Rare1, C.Gremlin, C.TriChi, C.Wave1], 10, 3),
new Model('<NAME>', [C.Gremlin], [C.Enforcer, C.Living, C.Rare1, C.Gremlin, C.Wave1], 9),
new Model('Whiskey Golem', [C.Gremlin], [C.Enforcer, C.Construct, C.Rare1, C.TriChi, C.Wave1], 10),
new Model('<NAME>', [C.Gremlin], [C.Peon, C.Living, C.TotemFor('S<NAME>'), C.Wave1], 2),
new Model('<NAME>', [C.Gremlin], [C.Peon, C.Living, C.TotemFor('Op<NAME>'), C.Gremlin, C.Kin, C.Wave1], 2),
new Model('<NAME>', [C.Gremlin], [C.Minion, C.Living, C.TotemFor('The Brewmaster'), C.Gremlin, C.TriChi, C.Wave1], 3),
new Model('Bay<NAME>', [C.Gremlin], [C.Minion, C.Living, C.Gremlin, C.Wave1], 3),
new Model('Hog Whisperer', [C.Gremlin], [C.Minion, C.Living, C.Mercenary, C.Gremlin, C.Wave1], 5),
new Model('Moon Shinobi', [C.Gremlin], [C.Minion, C.Living, C.Gremlin, C.TriChi, C.Wave1], 6),
new Model('Pigapult', [C.Gremlin], [C.Peon, C.Construct, C.Rare1, C.Gremlin, C.Wave1], 8),
new Model('Piglet', [C.Gremlin], [C.Minion, C.Living, C.Beast, C.Pig, C.Wave1], 4),
new Model('Slop Hauler', [C.Gremlin], [C.Minion, C.Living, C.Gremlin, C.Wave1], 5),
new Model('War Pig', [C.Gremlin], [C.Minion, C.Living, C.Beast, C.Pig, C.Wave1], 9),
new Model('Pere Ravage', [C.Gremlin], [C.Enforcer, C.Living, C.Rare1, C.Gremlin, C.Kin, C.Wave1], 6),
new Model('<NAME>', [C.Gremlin], [C.Enforcer, C.Living, C.Rare1, C.Gremlin, C.Kin, C.Wave1], 7),
new Model('<NAME>', [C.Gremlin], [C.Enforcer, C.Living, C.Rare1, C.Gremlin, C.Kin, C.Wave1], 7),
new Model('<NAME>', [C.Gremlin], [C.Master, C.Living, C.Gremlin, C.Wave2], undefined, 4),
new Model('Penelope', [C.Gremlin], [C.Peon, C.Living, C.TotemFor('<NAME>'), C.Hound, C.Wave2], 2),
new Model('The Sow', [C.Gremlin], [C.Minion, C.Living, C.Rare1, C.Beast, C.Pig, C.Wave2], 8),
new Model('Old Major', [C.Gremlin], [C.Henchman, C.Living, C.Rare1, C.Pig, C.Wave2], 9, 4),
new Model('Rooster Rider', [C.Gremlin], [C.Minion, C.Living, C.Gremlin, C.Rooster, C.Wave2], 6),
new Model('Stuffed Piglet', [C.Gremlin], [C.Peon, C.Undead, C.Rare6, C.Pig, C.Wave2], 2),
new Model('<NAME>', [C.Gremlin], [C.Enforcer, C.Living, C.Rare2, C.Gremlin, C.Wave2], 7),
new Model('<NAME>', [C.Gremlin], [C.Master, C.Living, C.Gremlin, C.Wave2], undefined, 4),
new Model('The Little Lass', [C.Gremlin], [C.Peon, C.Living, C.TotemFor('Mah Tucket'), C.Gremlin, C.Wave2], 4),
new Model('<NAME>', [C.Gremlin], [C.Henchman, C.Living, C.Rare1, C.Gremlin, C.Wave2], 8, 5),
new Model('<NAME>', [C.Gremlin], [C.Minion, C.Living, C.Rare3, C.Gremlin, C.Wave2], 6),
new Model('<NAME>', [C.Gremlin], [C.Henchman, C.Living, C.Mercenary, C.Rare1, C.Swampfiend, C.Wave2], 10, 3),
new Model('<NAME>', [C.Gremlin], [C.Henchman, C.Living, C.Rare1, C.Gremlin, C.Wave2], 10, 3),
new Model('<NAME>', [C.Gremlin], [C.Enforcer, C.Living, C.Mercenary, C.Rare1, C.Gremlin, C.Wave2], 7),
new Model('<NAME>', [C.Gremlin], [C.Enforcer, C.Living, C.Mercenary, C.Rare1, C.Pig, C.Wave2], 10),
new Model('<NAME>', [C.Gremlin], [C.Enforcer, C.Living, C.Rare1, C.Gremlin, C.Kin, C.Wave2], 6),
new Model('Wild Boar', [C.Gremlin], [C.Minion, C.Living, C.Beast, C.Pig, C.Swampfiend, C.Wave2], 6),
new Model('Lucky Effigy', [C.Gremlin], [C.Minion, C.Construct, C.Rare1, C.Puppet, C.Effigy, C.Wave2], 4),
new Model('<NAME>', [C.Gremlin], [C.Master, C.Living, C.Gremlin, C.Wave2], undefined, 3),
new Model('Lovely Assistant', [C.Gremlin], [C.Peon, C.Living, C.TotemFor('Wong'), C.Gremlin, C.Showgirl, C.Wave2], 3),
new Model('Lightning Bug', [C.Gremlin], [C.Minion, C.Living, C.Gremlin, C.Wave2], 5),
new Model('<NAME>', [C.Gremlin], [C.Minion, C.Living, C.Swampfiend, C.Wave2], 5),
new Model('<NAME>', [C.Gremlin], [C.Henchman, C.Living, C.Rare1, C.Gremlin, C.Kin, C.Wave2], 7, 6),
new Model('<NAME>', [C.Gremlin], [C.Peon, C.Living, C.Totem, C.Gremlin, C.Wave2], 4),
new Model('<NAME>', [C.TenThunders, C.Outcast], [C.Master, C.Living, C.LastBlossom, C.Wave1], undefined, 2),
new Model('<NAME>', [C.TenThunders, C.Arcanist], [C.Master, C.Living, C.Foundry, C.Wave1], undefined, 3),
new Model('<NAME>', [C.TenThunders, C.Neverborn], [C.Master, C.Living, C.Darkened, C.Wave1], undefined, 1),
new Model('<NAME>', [C.TenThunders], [C.Henchman, C.Living, C.Rare1, C.LastBlossom, C.Wave1], 10, 3),
new Model('<NAME>', [C.TenThunders], [C.Henchman, C.Living, C.Rare1, C.Foundry, C.Wave1], 9, 4),
new Model('<NAME>', [C.TenThunders], [C.Henchman, C.Living, C.Rare1, C.LastBlossom, C.Wave1], 7, 6),
new Model('<NAME>', [C.TenThunders, C.Outcast], [C.Peon, C.Living, C.TotemFor('<NAME>'), C.Wave1], 3),
new Model('<NAME>', [C.TenThunders, C.Arcanist], [C.Minion, C.TotemFor('<NAME>'), C.Spirit, C.Wave1], 3),
new Model('Hungering Darkness', [C.TenThunders, C.Neverborn], [C.Henchman, C.TotemFor('<NAME>'), C.Rare1, C.Spirit, C.Darkened, C.Wave1], 0, 5),
new Model('D<NAME>', [C.TenThunders], [C.Minion, C.Living, C.Rare1, C.Beast, C.Wave1], 10),
new Model('<NAME>', [C.TenThunders], [C.Henchman, C.Living, C.Rare1, C.Wave1], 10, 3),
new Model('Monk of Low River', [C.TenThunders], [C.Minion, C.Living, C.Rare3, C.Wave1], 4),
new Model('<NAME>', [C.TenThunders], [C.Minion, C.Living, C.Mercenary, C.LastBlossom, C.Showgirl, C.Wave1], 5),
new Model('Rail Worker', [C.TenThunders, C.Arcanist], [C.Minion, C.Living, C.Construct, C.Foundry, C.Wave1], 5),
new Model('The Illuminated', [C.TenThunders, C.Neverborn], [C.Minion, C.Living, C.Brilliance, C.Wave1], 7),
new Model('Thunder Archer', [C.TenThunders], [C.Minion, C.Living, C.Wave1], 7),
new Model('<NAME>', [C.TenThunders], [C.Minion, C.Living, C.Mercenary, C.LastBlossom, C.Wave1], 6),
new Model('<NAME>', [C.TenThunders], [C.Enforcer, C.Living, C.Wave1], 8),
new Model('<NAME>', [C.TenThunders, C.Guild], [C.Master, C.Living, C.BlackSheep, C.Wave2], undefined, 2),
new Model('<NAME>', [C.TenThunders, C.Guild], [C.Master, C.Living, C.BlackSheep, C.Wave2], undefined, 0),
new Model('<NAME>', [C.TenThunders, C.Guild], [C.Henchman, C.Living, C.Rare1, C.BlackSheep, C.Wave2], 9, 4),
new Model('<NAME>', [C.TenThunders, C.Guild], [C.Minion, C.Living, C.TotemFor('<NAME>'), C.Beast, C.Hound, C.Wave2], 4),
new Model('<NAME>', [C.TenThunders, C.Guild], [C.Minion, C.Living, C.BlackSheep, C.Wave2], 4),
new Model('<NAME>', [C.TenThunders, C.Resurrectionist], [C.Master, C.Living, C.Ancestor, C.Wave2], undefined, 4),
new Model('S<NAME>er', [C.TenThunders, C.Resurrectionist], [C.Peon, C.TotemFor('Yan Lo'), C.Spirit, C.Wave2], 3),
new Model('<NAME> Niece', [C.TenThunders, C.Resurrectionist], [C.Enforcer, C.Living, C.Rare1, C.Ancestor, C.Wave2], 6),
new Model('Izamu the Armor', [C.TenThunders, C.Resurrectionist], [C.Enforcer, C.Undead, C.Rare1, C.Ancestor, C.Spirit, C.Wave2], 10),
new Model('Toshiro the Daimyo', [C.TenThunders, C.Resurrectionist], [C.Henchman, C.Undead, C.Rare1, C.Ancestor, C.Wave2], 9, 4),
new Model('Yin the Penangalan', [C.TenThunders, C.Resurrectionist], [C.Enforcer, C.Undead, C.Rare1, C.Ancestor, C.Horror, C.Wave2], 8),
new Model('Ten Thunders Brother', [C.TenThunders], [C.Minion, C.Living, C.Wave2], 5),
new Model('Mr. <NAME>', [C.TenThunders, C.Neverborn], [C.Enforcer, C.Living, C.Rare1, C.Nephilim, C.Darkened, C.Mimic, C.Wave2], 8),
new Model('Mr. <NAME>', [C.TenThunders, C.Neverborn], [C.Enforcer, C.Living, C.Rare1, C.Woe, C.Darkened, C.Mimic, C.Wave2], 6),
new Model('Shadow Effigy', [C.TenThunders], [C.Minion, C.Construct, C.Rare1, C.Puppet, C.Effigy, C.Wave2], 4),
new Model('Komainu', [C.TenThunders], [C.Minion, C.Construct, C.Spirit, C.Retainer, C.Wave2], 5),
new Model('Sensei Yu', [C.TenThunders], [C.Henchman, C.Living, C.Rare1, C.Wave2], 9, 4),
new Model('<NAME>', [C.TenThunders], [C.Master, C.Living, C.Tyrant, C.Wave2], undefined, 2),
new Model('Peasant', [C.TenThunders], [C.Peon, C.Living, C.TotemFor('<NAME>'), C.Rare2, C.Wave2], 2),
new Model('Fermented River Monk', [C.TenThunders], [C.Minion, C.Living, C.TriChi, C.Wave2], 5),
new Model('Monk of High River', [C.TenThunders], [C.Minion, C.Living, C.Rare3, C.Wave2], 6),
new Model('The Lone Swordsman', [C.TenThunders], [C.Enforcer, C.Living, C.Rare1, C.Wave2], 8),
new Model('Kamaitachi', [C.TenThunders], [C.Minion, C.Totem, C.Oni, C.Wave2], 4),
new Model('Tengu', [C.TenThunders], [C.Minion, C.Spirit, C.Oni, C.Wave2], 4),
new Model('Katanaka S<NAME>per', [C.TenThunders], [C.Minion, C.Living, C.Rare2, C.Wave2], 7),
new Model('Brutal Emissary', [C.Guild], [C.Enforcer, C.Rare1, C.EmissaryOfFate, C.Wave3], 10),
new Model('Master Queeg', [C.Guild], [C.Henchman, C.Living, C.Rare1, C.Guardsman, C.BlackSheep, C.Wave3], 7, 6),
new Model('Dr. <NAME>', [C.Guild], [C.Henchman, C.Living, C.Mercenary, C.Rare1, C.WitchHunter, C.Wave3], 9, 4),
new Model('Nurse Heartsbane', [C.Guild], [C.Enforcer, C.Living, C.Mercenary, C.Rare1, C.WitchHunter, C.Wave3], 8),
new Model('Greed', [C.Guild], [C.Enforcer, C.Living, C.Mercenary, C.Rare1, C.CrossroadsSeven, C.Tormented, C.Wave3], 8),
new Model('Sanctioned Spellcaster', [C.Guild], [C.Minion, C.Living, C.Academic, C.Wave3], 5),
new Model('Orderly', [C.Guild], [C.Minion, C.Living, C.Mercenary, C.Rare2, C.WitchHunter, C.Wave3], 5),
new Model('Mounted Guard', [C.Guild], [C.Minion, C.Living, C.Guardsman, C.Wave3], 7),
new Model('Carrion Emissary', [C.Resurrectionist], [C.Enforcer, C.Rare1, C.EmissaryOfFate, C.Wave3], 10),
new Model('Anna Lovelace', [C.Resurrectionist], [C.Henchman, C.Living, C.Mercenary, C.Rare1, C.Wave3], 9, 4),
new Model('S<NAME>th', [C.Resurrectionist], [C.Enforcer, C.Undead, C.Mercenary, C.Rare1, C.CrossroadsSeven, C.Tormented, C.Horror, C.Wave3], 8),
new Model('The Forgotten Marshal', [C.Resurrectionist], [C.Enforcer, C.Living, C.Rare1, C.Wave3], 7),
new Model('<NAME>', [C.Resurrectionist], [C.Enforcer, C.Living, C.Rare1, C.Nephilim, C.Wave3], 7),
new Model('Arcane Emissary', [C.Arcanist], [C.Enforcer, C.Rare1, C.EmissaryOfFate, C.Wave3], 10),
new Model('Wind Gamin', [C.Arcanist], [C.Minion, C.Living, C.Gamin, C.Wave3], 4),
new Model('The Scorpius', [C.Arcanist], [C.Minion, C.Living, C.Construct, C.Rare1, C.Beast, C.Wave3], 6),
new Model('Ice Dancer', [C.Arcanist], [C.Minion, C.Living, C.Showgirl, C.Wave3], 6),
new Model('Envy', [C.Arcanist], [C.Enforcer, C.Living, C.Mercenary, C.Rare1, C.CrossroadsSeven, C.Tormented, C.Wave3], 8),
new Model('Mysterious Emissary', [C.Neverborn], [C.Enforcer, C.Rare1, C.EmissaryOfFate, C.Wave3], 10),
new Model('Wrath', [C.Neverborn], [C.Henchman, C.Living, C.Mercenary, C.Rare1, C.CrossroadsSeven, C.Tormented, C.Wave3], 8, 5),
new Model('Angel Eyes', [C.Neverborn], [C.Henchman, C.Living, C.Mercenary, C.Rare1, C.Nephilim, C.Wave3], 9, 4),
new Model('Scion of Black Blood', [C.Neverborn], [C.Enforcer, C.Living, C.Mercenary, C.Rare1, C.Nephilim, C.Wave3], 8),
new Model('Corrupted Hound', [C.Neverborn], [C.Minion, C.Living, C.Rare4, C.Beast, C.Hound, C.Wave3], 3),
new Model('Changeling', [C.Neverborn], [C.Minion, C.Living, C.Rare3, C.Mimic, C.Wave3], 4),
new Model('Bloodwretch', [C.Neverborn], [C.Minion, C.Living, C.Mercenary, C.Rare2, C.Nephilim, C.Wave3], 5),
new Model('Bunraku', [C.Neverborn, C.TenThunders], [C.Minion, C.Construct, C.Puppet, C.Wave3], 6),
new Model('Hodgepodge Emissary', [C.Outcast], [C.Enforcer, C.Rare1, C.EmissaryOfFate, C.Cursed, C.Wave3], 10),
new Model('Scion of the Void', [C.Outcast], [C.Henchman, C.Rare1, C.Wave3], 8, 5),
new Model('Pride', [C.Outcast], [C.Enforcer, C.Living, C.Mercenary, C.Rare1, C.CrossroadsSeven, C.Tormented, C.Wave3], 8),
new Model('Big Jake', [C.Outcast], [C.Enforcer, C.Living, C.Mercenary, C.Rare1, C.Wave3], 5),
new Model('The Winged Plague', [C.Outcast], [C.Minion, C.Living, C.Vermin, C.Wave3], 4),
new Model('Lucky Emissary', [C.Gremlin], [C.Enforcer, C.Rare1, C.EmissaryOfFate, C.Wave3], 10),
new Model('Sparks', [C.Gremlin], [C.Henchman, C.Living, C.Rare1, C.Gremlin, C.Foundry, C.Wave3], 7, 6),
new Model('Gluttony', [C.Gremlin], [C.Enforcer, C.Living, C.Mercenary, C.Rare1, C.CrossroadsSeven, C.Tormented, C.Wave3], 8),
new Model('Survivor', [C.Gremlin], [C.Minion, C.Living, C.Construct, C.Gremlin, C.Wave3], 5),
new Model('Mechanized Porkchop', [C.Gremlin], [C.Minion, C.Construct, C.Pig, C.Foundry, C.Wave3], 7),
new Model('Shadow Emissary', [C.TenThunders], [C.Enforcer, C.Rare1, C.EmissaryOfFate, C.Wave3], 10),
new Model('Lust', [C.TenThunders], [C.Enforcer, C.Living, C.Mercenary, C.Rare1, C.CrossroadsSeven, C.Tormented, C.Wave3], 8),
new Model('Wandering River Monk', [C.TenThunders], [C.Minion, C.Living, C.Wave3], 7),
new Model('Obsidian Oni', [C.TenThunders], [C.Minion, C.Oni, C.Wave3], 6),
new Model('Jor<NAME>o', [C.TenThunders], [C.Minion, C.Oni, C.LastBlossom, C.Wave3], 9),
new Model('<NAME>', [C.Guild], [C.Master, C.Living, C.Journalist, C.Wave4], undefined, 4),
new Model('The Printing Press', [C.Guild], [C.Peon, C.Construct, C.TotemFor('<NAME>'), C.Journalist, C.Wave4], 3),
new Model('<NAME>', [C.Guild], [C.Henchman, C.Living, C.Rare1, C.Journalist, C.Wave4], 8, 5),
new Model('Allison Dade', [C.Guild], [C.Henchman, C.Living, C.Rare1, C.Journalist, C.Wave4], 8, 5),
new Model('Field Reporter', [C.Guild], [C.Minion, C.Living, C.Journalist, C.Wave4], 4),
new Model('Death Marshal Recruiter', [C.Guild], [C.Enforcer, C.Living, C.Rare2, C.GuildMarshal, C.Wave4], 7),
new Model('<NAME>', [C.Guild], [C.Minion, C.Living, C.WitchHunter, C.Wave4], 9),
new Model('<NAME>', [C.Resurrectionist], [C.Master, C.Living, C.Revenant, C.Wave4], undefined, 4),
new Model('<NAME>', [C.Resurrectionist], [C.Peon, C.Undead, C.TotemFor('Reva'), C.Spirit, C.Revenant, C.Wave4], 2),
new Model('<NAME>', [C.Resurrectionist], [C.Henchman, C.Living, C.Rare1, C.Revenant, C.Wave4], 8, 5),
new Model('<NAME>', [C.Resurrectionist], [C.Henchman, C.Undead, C.Rare1, C.Horror, C.Wave4], 13, 0),
new Model('Shield<NAME>', [C.Resurrectionist], [C.Minion, C.Living, C.Revenant, C.Wave4], 6),
new Model('<NAME>', [C.Resurrectionist], [C.Minion, C.Undead, C.Revenant, C.Horror, C.Wave4], 8),
new Model('<NAME>', [C.Resurrectionist], [C.Minion, C.Spirit, C.Retainer, C.Wave4], 7),
new Model('<NAME>', [C.Arcanist], [C.Master, C.Living, C.Academic, C.Wave4], undefined, 4),
new Model('Corpse Candle', [C.Arcanist], [C.Minion, C.TotemFor('<NAME>'), C.Rare1, C.Gamin, C.Wave4], 8),
new Model('<NAME>', [C.Arcanist], [C.Henchman, C.Living, C.Rare1, C.Academic, C.Wave4], 7, 6),
new Model('<NAME>', [C.Arcanist], [C.Henchman, C.Living, C.Rare1, C.Msu, C.Academic, C.Wave4], 9, 4),
new Model('<NAME>', [C.Arcanist], [C.Henchman, C.Living, C.Rare1, C.Showgirl, C.Wave4], 9, 4),
new Model('<NAME>', [C.Arcanist], [C.Minion, C.Construct, C.Gamin, C.Beast, C.Wave4], 5),
new Model('<NAME>', [C.Arcanist], [C.Enforcer, C.Living, C.Msu, C.Academic, C.Wave4], 8),
new Model('<NAME>', [C.Neverborn], [C.Master, C.Undead, C.Fae, C.Wave4], undefined, 4),
new Model('The G<NAME>', [C.Neverborn], [C.Peon, C.Living, C.TotemFor('Titania'), C.Fae, C.Wave4], 3),
new Model('<NAME>', [C.Neverborn], [C.Henchman, C.Undead, C.Rare1, C.Fae, C.Wave4], 9, 4),
new Model('The Tooth', [C.Neverborn], [C.Minion, C.Undead, C.Rare1, C.Fae, C.Wave4], 7),
new Model('The Claw', [C.Neverborn], [C.Minion, C.Undead, C.Rare1, C.Fae, C.Wave4], 7),
new Model('The Thorn', [C.Neverborn], [C.Minion, C.Undead, C.Rare1, C.Fae, C.Wave4], 7),
new Model('<NAME>atch', [C.Neverborn], [C.Minion, C.Living, C.Rare1, C.Fae, C.Nightmare, C.Spirit, C.Wave4], 5),
new Model('Will O\' the Wisp', [C.Neverborn], [C.Minion, C.Rare3, C.Spirit, C.Swampfiend, C.Wave4], 3),
new Model('Rougarou', [C.Neverborn], [C.Minion, C.Undead, C.Fae, C.Beast, C.Wave4], 8),
new Model('<NAME>', [C.Outcast], [C.Master, C.Living, C.Bandit, C.Wave4], undefined, 4),
new Model('<NAME>', [C.Outcast], [C.Minion, C.Living, C.TotemFor('<NAME>'), C.Wave4], 3),
new Model('Mad Dog Brackett', [C.Outcast], [C.Henchman, C.Living, C.Rare1, C.Bandit, C.Wave4], 9, 4),
new Model('<NAME>', [C.Outcast], [C.Henchman, C.Mercenary, C.Rare1, C.Wave4], 12, 1),
new Model('<NAME>', [C.Outcast], [C.Minion, C.Living, C.Bandit, C.Wave4], 5),
new Model('Dead Outland', [C.Outcast], [C.Minion, C.Undead, C.Bandit, C.Tormented, C.Wave4], 6),
new Model('<NAME>', [C.Outcast], [C.Minion, C.Living, C.Bandit, C.LastBlossom, C.Wave4], 8),
new Model('<NAME>', [C.Gremlin], [C.Master, C.Living, C.Gremlin, C.SkyPirate, C.Wave4], undefined, 4),
new Model('<NAME>', [C.Gremlin], [C.Minion, C.Living, C.TotemFor('<NAME>'), C.Wave4], 3),
new Model('The First Mate', [C.Gremlin], [C.Henchman, C.Living, C.Rare1, C.Swampfiend, C.SkyPirate, C.Wave4], 9, 4),
new Model('<NAME>', [C.Gremlin], [C.Enforcer, C.Living, C.Construct, C.Gremlin, C.SkyPirate, C.Wave4], 6),
new Model('<NAME>', [C.Gremlin, C.TenThunders], [C.Minion, C.Rare3, C.Oni, C.TriChi, C.Wave4], 4),
new Model('<NAME>', [C.Gremlin], [C.Minion, C.Living, C.Gremlin, C.Wave4], 5),
new Model('Swine-Cursed', [C.Gremlin], [C.Minion, C.Living, C.Rare2, C.Gremlin, C.Wave4], 7),
new Model('<NAME>', [C.TenThunders], [C.Master, C.Living, C.Oni, C.Wave4], undefined, 3),
new Model('<NAME>', [C.TenThunders], [C.Peon, C.TotemFor('<NAME>'), C.Oni, C.Wave4], 3),
new Model('<NAME>', [C.TenThunders], [C.Henchman, C.Rare1, C.Oni, C.Wave4], 8, 5),
new Model('Yokai', [C.TenThunders], [C.Minion, C.Oni, C.Wave4], 5),
new Model('Terracotta Warrior', [C.TenThunders], [C.Minion, C.Construct, C.Rare3, C.Mimic, C.Wave4], 5),
new Model('<NAME>', [C.TenThunders], [C.Enforcer, C.Rare1, C.Living, C.Retainer, C.Wave4], 8)
]
export default ModelList | true | import ModelInterface from './ModelInterface.coffee'
Model = ModelInterface.Model
C = ModelInterface.Attribute
# **Epic props** to rythos42 for saving me having to research and type all this!
# https://github.com/rythos42/MalifauxModels-Web/blob/master/js/app/Mappers/ModelList.js
ModelList = [
new Model('PI:NAME:<NAME>END_PI', [C.Guild], [C.Master, C.Living, C.GuildMarshal, C.Wave1], undefined, 4),
new Model('PI:NAME:<NAME>END_PI', [C.Guild], [C.Master, C.Living, C.WitchHunter, C.Wave1], undefined, 3),
new Model('PI:NAME:<NAME>END_PI', [C.Guild], [C.Master, C.Living, C.Family, C.Wave1], undefined, 2),
new Model('PI:NAME:<NAME>END_PI', [C.Guild], [C.Henchman, C.Living, C.Family, C.Wave1], 8, 5),
new Model('PI:NAME:<NAME>END_PI', [C.Guild], [C.Henchman, C.Living, C.WitchHunter, C.Wave1], 9, 4),
new Model('The JPI:NAME:<NAME>END_PI', [C.Guild], [C.Henchman, C.Living, C.Rare1, C.GuildMarshal, C.Wave1], 9, 4),
new Model('Scales of Justice', [C.Guild], [C.Peon, C.Living, C.TotemFor('Lady Justice'), C.Wave1], 3),
new Model('Purifying Flame', [C.Guild], [C.Peon, C.TotemFor('PI:NAME:<NAME>END_PI'), C.Spirit, C.Wave1], 3),
new Model('Enslaved Nephilim', [C.Guild], [C.Peon, C.TotemFor('PI:NAME:<NAME>END_PI'), C.Nephilim, C.Wave1], 3),
new Model('Governor\'s Proxy', [C.Guild], [C.Peon, C.Totem, C.Living, C.Wave1], 3),
new Model('Death Marshal', [C.Guild], [C.Minion, C.Living, C.GuildMarshal, C.Wave1], 6),
new Model('Executioner', [C.Guild], [C.Enforcer, C.Living, C.Rare2, C.Wave1], 9),
new Model('Guild Austringer', [C.Guild], [C.Minion, C.Living, C.Rare2, C.Guardsman, C.Wave1], 6),
new Model('Guild Guard', [C.Guild], [C.Minion, C.Living, C.Guardsman, C.Wave1], 4),
new Model('Peacekeeper', [C.Guild], [C.Enforcer, C.Construct, C.Rare1, C.Wave1], 11),
new Model('The Lone Marshal', [C.Guild], [C.Enforcer, C.Living, C.Rare1, C.GuildMarshal, C.Wave1], 8),
new Model('Witchling Stalker', [C.Guild], [C.Minion, C.Living, C.WitchHunter, C.Wave1], 5),
new Model('PI:NAME:<NAME>END_PI', [C.Guild], [C.Enforcer, C.Living, C.Rare1, C.Family, C.Wave1], 7),
new Model('PI:NAME:<NAME>END_PI', [C.Guild], [C.Enforcer, C.Living, C.Rare1, C.Family, C.Tormented, C.Wave1], 7),
new Model('PI:NAME:<NAME>END_PI', [C.Guild], [C.Enforcer, C.Living, C.Rare1, C.Family, C.Wave1], 7),
new Model('PI:NAME:<NAME>END_PI', [C.Guild], [C.Master, C.Living, C.Construct, C.Msu, C.Wave2], undefined, 3),
new Model('PI:NAME:<NAME>END_PI', [C.Guild], [C.Henchman, C.Construct, C.Rare1, C.Msu, C.Wave2], 10, 3),
new Model('Mechanical Attendant', [C.Guild], [C.Peon, C.Construct, C.TotemFor('PI:NAME:<NAME>END_PI'), C.Wave2], 2),
new Model('PI:NAME:<NAME>END_PI', [C.Guild], [C.Minion, C.Construct, C.Wave2], 8),
new Model('PI:NAME:<NAME>END_PI', [C.Guild, C.Neverborn], [C.Master, C.Living, C.Mimic, C.Wave2], undefined, 4),
new Model('PI:NAME:<NAME>END_PI', [C.Guild], [C.Henchman, C.Living, C.Rare1, C.Guardsman, C.Wave2], 9, 4),
new Model('The Scribe', [C.Guild, C.Neverborn], [C.Peon, C.Living, C.TotemFor('PI:NAME:<NAME>END_PI'), C.Wave2], 2),
new Model('PI:NAME:<NAME>END_PI', [C.Guild], [C.Enforcer, C.Living, C.Rare1, C.Family, C.Wave2], 7),
new Model('Guild Hound', [C.Guild], [C.Minion, C.Living, C.Rare4, C.Beast, C.Hound, C.Guardsman, C.Wave2], 3),
new Model('Guard Sergeant', [C.Guild], [C.Enforcer, C.Living, C.Rare2, C.Guardsman, C.Wave2], 6),
new Model('PI:NAME:<NAME>END_PI', [C.Guild], [C.Minion, C.Construct, C.Rare2, C.Wave2], 7),
new Model('Guild Lawyer', [C.Guild], [C.Minion, C.Living, C.Rare2, C.Mimic, C.Wave2], 6),
new Model('Watcher', [C.Guild], [C.Minion, C.Construct, C.Wave2], 4),
new Model('Exorcist', [C.Guild], [C.Enforcer, C.Living, C.Rare2, C.GuildMarshal, C.Wave2], 7),
new Model('Pistolero De Latigo', [C.Guild], [C.Minion, C.Living, C.Family, C.Wave2], 5),
new Model('Pale Rider', [C.Guild], [C.Enforcer, C.Undead, C.Rare1, C.Horseman, C.Wave2], 12),
new Model('Warden', [C.Guild], [C.Minion, C.Construct, C.Guardsman, C.Wave2], 6),
new Model('Witchling Handler', [C.Guild], [C.Enforcer, C.Living, C.WitchHunter, C.Wave2], 8),
new Model('Brutal Effigy', [C.Guild], [C.Minion, C.Construct, C.Puppet, C.Effigy, C.Rare1, C.Wave2], 4),
new Model('Guild Rifleman', [C.Guild], [C.Minion, C.Living, C.Rare3, C.Guardsman, C.Wave2], 5),
new Model('Clockwork Trap', [C.Guild, C.TenThunders], [C.Peon, C.Rare4, C.Wave2], 2),
new Model('Guild Pathfinder', [C.Guild, C.TenThunders], [C.Minion, C.Living, C.Guardsman, C.Wave2], 6),
new Model('Seamus', [C.Resurrectionist], [C.Master, C.Living, C.Wave1], undefined, 3),
new Model('McMoPI:NAME:<NAME>END_PI', [C.Resurrectionist, C.Guild], [C.Master, C.Living, C.Wave1], undefined, 4),
new Model('PI:NAME:<NAME>END_PI', [C.Resurrectionist], [C.Master, C.Living, C.Wave1], undefined, 3),
new Model('PI:NAME:<NAME>END_PI', [C.Resurrectionist], [C.Henchman, C.Undead, C.Rare1, C.Wave1], 8, 5),
new Model('PI:NAME:<NAME>END_PI', [C.Resurrectionist], [C.Henchman, C.Living, C.Rare1, C.Wave1], 7, 6),
new Model('Mortimer', [C.Resurrectionist], [C.Henchman, C.Living, C.Rare1, C.Wave1], 9, 4),
new Model('Copycat Killer', [C.Resurrectionist], [C.Peon, C.Living, C.TotemFor('Seamus'), C.Wave1], 3),
new Model('Zombie Chihuahua', [C.Resurrectionist], [C.Peon, C.Undead, C.TotemFor('McMourning'), C.Beast, C.Wave1], 2),
new Model('Vulture', [C.Resurrectionist], [C.Peon, C.Living, C.TotemFor('Nicodem'), C.Beast, C.Wave1], 3),
new Model('Graveyard Spirit', [C.Resurrectionist], [C.Peon, C.Totem, C.Spirit, C.Wave1], 3),
new Model('Bete Noire', [C.Resurrectionist], [C.Enforcer, C.Undead, C.Rare1, C.Wave1], 8),
new Model('Canine Remains', [C.Resurrectionist], [C.Minion, C.Undead, C.Beast, C.Hound, C.Wave1], 4),
new Model('Crooked Man', [C.Resurrectionist], [C.Minion, C.Undead, C.Tormented, C.Wave1], 5),
new Model('Flesh Construct', [C.Resurrectionist], [C.Minion, C.Undead, C.Construct, C.Wave1], 6),
new Model('Mindless Zombie', [C.Resurrectionist], [C.Peon, C.Undead, C.Wave1], 2),
new Model('Necropunk', [C.Resurrectionist], [C.Minion, C.Undead, C.Construct, C.Wave1], 5),
new Model('Nurse', [C.Resurrectionist], [C.Minion, C.Living, C.Tormented, C.Wave1], 5),
new Model('Punk Zombie', [C.Resurrectionist], [C.Minion, C.Undead, C.Horror, C.Wave1], 7),
new Model('Rotten Belle', [C.Resurrectionist], [C.Minion, C.Undead, C.Belle, C.Wave1], 5),
new Model('The Hanged', [C.Resurrectionist], [C.Minion, C.Undead, C.Rare2, C.Spirit, C.Tormented, C.Wave1], 9),
new Model('Molly Squidpiddge', [C.Resurrectionist], [C.Master, C.Undead, C.Belle, C.Horror, C.Wave2], undefined, 3),
new Model('Rogue Necromancy', [C.Resurrectionist], [C.Enforcer, C.Undead, C.Construct, C.Beast, C.Horror, C.Wave2], 10),
new Model('Guild Autopsy', [C.Resurrectionist], [C.Minion, C.Undead, C.Horror, C.Wave2], 4),
new Model('Necrotic Machine', [C.Resurrectionist], [C.Minion, C.Construct, C.TotemFor('Molly Squidpiddge'), C.Rare1, C.Horror, C.Spirit, C.Wave2], 2),
new Model('PI:NAME:<NAME>END_PI', [C.Resurrectionist], [C.Master, C.Living, C.Wave2], undefined, 3),
new Model('Ikiryo', [C.Resurrectionist], [C.Enforcer, C.Rare1, C.Spirit, C.Wave2], 0),
new Model('Seishin', [C.Resurrectionist], [C.Peon, C.Rare5, C.Spirit, C.Wave2], 0),
new Model('Lost Love', [C.Resurrectionist], [C.Peon, C.Undead, C.TotemFor('Kirai Ankoku'), C.Spirit, C.Wave2], 4),
new Model('DPI:NAME:<NAME>END_PIue Ba', [C.Resurrectionist], [C.Henchman, C.Undead, C.Rare1, C.Spirit, C.Wave2], 8, 5),
new Model('Dead Rider', [C.Resurrectionist], [C.Enforcer, C.Undead, C.Rare1, C.Horseman, C.Wave2], 12),
new Model('Gaki', [C.Resurrectionist], [C.Minion, C.Spirit, C.Wave2], 4),
new Model('Night Terror', [C.Resurrectionist], [C.Minion, C.Rare4, C.Beast, C.Spirit, C.Wave2], 3),
new Model('Onryo', [C.Resurrectionist], [C.Minion, C.Spirit, C.Retainer, C.Wave2], 5),
new Model('PI:NAME:<NAME>END_PI', [C.Resurrectionist], [C.Minion, C.Undead, C.Rare2, C.Beast, C.Spirit, C.Wave2], 8),
new Model('Crooligan', [C.Resurrectionist], [C.Minion, C.Undead, C.Horror, C.Lost, C.Wave2], 4),
new Model('Dead Doxy', [C.Resurrectionist], [C.Minion, C.Undead, C.Belle, C.Wave2], 6),
new Model('The Drowned', [C.Resurrectionist], [C.Minion, C.Undead, C.Horror, C.Spirit, C.Tormented, C.Wave2], 6),
new Model('PI:NAME:<NAME>END_PIakuna Ubume', [C.Resurrectionist], [C.Enforcer, C.Spirit, C.Tormented, C.Rare1, C.Wave2], 6),
new Model('Rafkin', [C.Resurrectionist], [C.Enforcer, C.Living, C.Rare1, C.Wave2], 7),
new Model('PI:NAME:<NAME>END_PI', [C.Resurrectionist], [C.Minion, C.Construct, C.Rare1, C.Puppet, C.Effigy, C.Wave2], 4),
new Model('PI:NAME:<NAME>END_PI', [C.Resurrectionist], [C.Minion, C.Undead, C.Retainer, C.Wave2], 5),
new Model('PI:NAME:<NAME>END_PI the PI:NAME:<NAME>END_PI', [C.Resurrectionist], [C.Henchman, C.Undead, C.Rare1, C.Spirit, C.Horror, C.Wave2], 8, 5),
new Model('Student of PI:NAME:<NAME>END_PI', [C.Resurrectionist], [C.Minion, C.Construct, C.Undead, C.Horror, C.Academic, C.Wave2], 7),
new Model('Student of PI:NAME:<NAME>END_PI', [C.Resurrectionist], [C.Minion, C.Construct, C.Undead, C.Horror, C.Academic, C.Wave2], 7),
new Model('Student of PI:NAME:<NAME>END_PI', [C.Resurrectionist], [C.Minion, C.Construct, C.Undead, C.Horror, C.Academic, C.Wave2], 8),
new Model('The PI:NAME:<NAME>END_PIaledPI:NAME:<NAME>END_PI', [C.Resurrectionist], [C.Henchman, C.Construct, C.Undead, C.Rare1, C.Horror, C.Academic, C.Wave2], 10, 3),
new Model('PI:NAME:<NAME>END_PI', [C.Arcanist], [C.Master, C.Living, C.Wave1], undefined, 3),
new Model('PI:NAME:<NAME>END_PI', [C.Arcanist], [C.Master, C.Living, C.Beast, C.Wave1], undefined, 4),
new Model('PI:NAME:<NAME>END_PI', [C.Arcanist], [C.Master, C.Living, C.Construct, C.Msu, C.Wave1], undefined, 3),
new Model('PI:NAME:<NAME>END_PI', [C.Arcanist], [C.Henchman, C.Living, C.Rare1, C.Beast, C.Wave1], 8, 5),
new Model('PI:NAME:<NAME>END_PI', [C.Arcanist], [C.Henchman, C.Living, C.Construct, C.Rare1, C.Msu, C.Wave1], 10, 3),
new Model('PI:NAME:<NAME>END_PI', [C.Arcanist], [C.Enforcer, C.Living, C.Rare1, C.Beast, C.Wave1], 8),
new Model('Ice PI:NAME:<NAME>END_PI', [C.Arcanist], [C.Enforcer, C.Construct, C.Wave1], 10),
new Model('PI:NAME:<NAME>END_PI', [C.Arcanist], [C.Minion, C.Living, C.TotemFor('Rasputina'), C.Wave1], 3),
new Model('PI:NAME:<NAME>END_PI', [C.Arcanist], [C.Peon, C.Living, C.TotemFor('PI:NAME:<NAME>END_PI'), C.Beast, C.Wave1], 2),
new Model('PI:NAME:<NAME>END_PI', [C.Arcanist], [C.Peon, C.Construct, C.TotemFor('PI:NAME:<NAME>END_PI'), C.Msu, C.Wave1], 4),
new Model('Essence of Power', [C.Arcanist], [C.Peon, C.Totem, C.Spirit, C.Wave1], 3),
new Model('DePI:NAME:<NAME>END_PI', [C.Arcanist], [C.Minion, C.Living, C.Wave1], 7),
new Model('Electric Creation', [C.Arcanist], [C.Peon, C.Construct, C.Wave1], 4),
new Model('PI:NAME:<NAME>END_PI', [C.Arcanist], [C.Minion, C.Living, C.Beast, C.Swarm, C.Wave1], 5),
new Model('PI:NAME:<NAME>END_PI', [C.Arcanist], [C.Enforcer, C.Construct, C.Living, C.Rare1, C.Msu, C.Wave1], 12),
new Model('Ice Gamin', [C.Arcanist], [C.Minion, C.Construct, C.Gamin, C.Wave1], 4),
new Model('Metal Gamin', [C.Arcanist], [C.Minion, C.Construct, C.Gamin, C.Msu, C.Foundry, C.Wave1], 4),
new Model('PI:NAME:<NAME>END_PI', [C.Arcanist], [C.Minion, C.Living, C.Beast, C.Wave1], 4),
new Model('Rail Golem', [C.Arcanist], [C.Enforcer, C.Construct, C.Rare1, C.Foundry, C.Wave1], 11),
new Model('Razorspine Rattler', [C.Arcanist], [C.Minion, C.Living, C.Beast, C.Wave1], 7),
new Model('Sabertooth Cerberus', [C.Arcanist], [C.Enforcer, C.Living, C.Beast, C.Wave1], 9),
new Model('Steam Arachnid', [C.Arcanist], [C.Minion, C.Construct, C.Msu, C.Wave1], 4),
new Model('Steam Arachnid Swarm', [C.Arcanist], [C.Minion, C.Construct, C.Swarm, C.Msu, C.Wave1], 8),
new Model('Ironsides', [C.Arcanist], [C.Master, C.Living, C.Msu, C.Wave2], undefined, 5),
new Model('Oxfordian Mage', [C.Arcanist], [C.Enforcer, C.Living, C.Rare3, C.Academic, C.Msu, C.Wave2], 6),
new Model('Mouse', [C.Arcanist], [C.Peon, C.Living, C.TotemFor('Ironsides'), C.Msu, C.Wave2], 4),
new Model('Colette Du Bois', [C.Arcanist], [C.Master, C.Living, C.Showgirl, C.Wave2], undefined, 2),
new Model('Mechanical Dove', [C.Arcanist], [C.Peon, C.Construct, C.TotemFor('Colette Du Bois'), C.Rare3, C.Wave2], 2),
new Model('PI:NAME:<NAME>END_PI', [C.Arcanist], [C.Henchman, C.Living, C.Rare1, C.Showgirl, C.Wave2], 8, 5),
new Model('PI:NAME:<NAME>END_PI', [C.Arcanist], [C.Minion, C.Construct, C.Rare2, C.Showgirl, C.Puppet, C.Wave2], 7),
new Model('PI:NAME:<NAME>END_PI', [C.Arcanist], [C.Enforcer, C.Construct, C.Showgirl, C.Puppet, C.Wave2], 0),
new Model('PI:NAME:<NAME>END_PI', [C.Arcanist], [C.Minion, C.Living, C.Mercenary, C.Showgirl, C.Wave2], 5),
new Model('PI:NAME:<NAME>END_PI', [C.Arcanist], [C.Peon, C.Construct, C.Showgirl, C.Puppet, C.Wave2], 4),
new Model('PI:NAME:<NAME>END_PI', [C.Arcanist], [C.Master, C.Living, C.Msu, C.Wave2], undefined, 4),
new Model('The Firestarter', [C.Arcanist], [C.Henchman, C.Living, C.Rare1, C.Msu, C.Wave2], 7, 6),
new Model('Eternal Flame', [C.Arcanist], [C.Peon, C.Construct, C.TotemFor('Kaeris'), C.Msu, C.Wave2], 2),
new Model('PI:NAME:<NAME>END_PI', [C.Arcanist], [C.Minion, C.Living, C.Msu, C.Wave2], 7),
new Model('Large Arachnid', [C.Arcanist], [C.Minion, C.Construct, C.Msu, C.Wave2], 6),
new Model('Malifaux Raptor', [C.Arcanist], [C.Peon, C.Living, C.Rare3, C.Beast, C.Wave2], 3),
new Model('Mechanical Rider', [C.Arcanist], [C.Enforcer, C.Construct, C.Rare1, C.Horseman, C.Wave2], 12),
new Model('Silent One', [C.Arcanist], [C.Minion, C.Living, C.Wave2], 6),
new Model('Snow Storm', [C.Arcanist], [C.Henchman, C.Rare1, C.Spirit, C.Wave2], 11, 2),
new Model('Soulstone Miner', [C.Arcanist], [C.Minion, C.Construct, C.Msu, C.Wave2], 6),
new Model('The Captain', [C.Arcanist], [C.Henchman, C.Living, C.Rare1, C.Msu, C.Wave2], 10, 3),
new Model('Angelica', [C.Arcanist], [C.Enforcer, C.Living, C.Rare1, C.Showgirl, C.Wave2], 6),
new Model('Blessed of December', [C.Arcanist], [C.Enforcer, C.Living, C.Rare1, C.Beast, C.Wave2], 9),
new Model('Fire Gamin', [C.Arcanist], [C.Minion, C.Construct, C.Gamin, C.Wave2], 4),
new Model('Slate Ridge Mauler', [C.Arcanist], [C.Minion, C.Living, C.Beast, C.Wave2], 8),
new Model('Union Miner', [C.Arcanist], [C.Minion, C.Living, C.Msu, C.Wave2], 5),
new Model('Willie', [C.Arcanist], [C.Minion, C.Living, C.Rare1, C.Msu, C.Foundry, C.Wave2], 6),
new Model('Arcane Effigy', [C.Arcanist], [C.Minion, C.Construct, C.Rare1, C.Puppet, C.Effigy, C.Wave2], 4),
new Model('Mobile Toolkit', [C.Arcanist], [C.Peon, C.Construct, C.Rare1, C.Msu, C.Wave2], 3),
new Model('PI:NAME:<NAME>END_PI', ['Neverborn'], [C.Master, C.Living, C.Nephilim, C.Wave1], undefined, 4),
new Model('PI:NAME:<NAME>END_PI', ['Neverborn'], [C.Master, C.Living, C.Woe, C.Wave1], undefined, 3),
new Model('PI:NAME:<NAME>END_PI', ['Neverborn', C.Gremlin], [C.Master, C.Living, C.Swampfiend, C.Wave1], undefined, 4),
new Model('PI:NAME:<NAME>END_PI', ['Neverborn'], [C.Henchman, C.Living, C.Rare1, C.Nephilim, C.Wave1], 10, 3),
new Model('PI:NAME:<NAME>END_PI', ['Neverborn'], [C.Henchman, C.Living, C.Rare1, C.Woe, C.Mimic, C.Lost, C.Wave1], 9, 4),
new Model('Bad PI:NAME:<NAME>END_PI', ['Neverborn'], [C.Henchman, C.Rare1, C.Swampfiend, C.Wave1], 8, 5),
new Model('PI:NAME:<NAME>END_PI', ['Neverborn'], [C.Peon, C.Living, C.TotemFor('Lilith'), C.Nephilim, C.Wave1], 3),
new Model('Poltergeist', ['Neverborn'], [C.Minion, C.TotemFor('Pandora'), C.Woe, C.Spirit, C.Wave1], 5),
new Model('PI:NAME:<NAME>END_PI', ['Neverborn', C.Gremlin], [C.Peon, C.Construct, C.TotemFor('Zoraida'), C.Puppet, C.Wave1], 3),
new Model('Primordial Magic', ['Neverborn'], [C.Peon, C.Totem, C.Spirit, C.Wave1], 2),
new Model('Baby Kade', ['Neverborn'], [C.Enforcer, C.Living, C.Rare1, C.Woe, C.Lost, C.Wave1], 7),
new Model('Teddy', ['Neverborn'], [C.Enforcer, C.Construct, C.Nightmare, C.Wave1], 11),
new Model('Beckoner', ['Neverborn'], [C.Minion, C.Living, C.Rare2, C.Brilliance, C.Darkened, C.Mimic, C.Wave1], 7),
new Model('Doppleganger', ['Neverborn'], [C.Enforcer, C.Living, C.Rare1, C.Woe, C.Mimic, C.Wave1], 7),
new Model('Mature Nephilim', ['Neverborn'], [C.Enforcer, C.Living, C.Nephilim, C.Wave1], 11),
new Model('Silurid', ['Neverborn'], [C.Minion, C.Living, C.Beast, C.Swampfiend, C.Wave1], 7),
new Model('Sorrow', ['Neverborn'], [C.Minion, C.Woe, C.Spirit, C.Wave1], 5),
new Model('Terror Tot', ['Neverborn'], [C.Minion, C.Living, C.Nephilim, C.Wave1], 4),
new Model('Waldgeist', ['Neverborn'], [C.Minion, C.Living, C.Beast, C.Swampfiend, C.Wave1], 6),
new Model('Young Nephilim', ['Neverborn'], [C.Minion, C.Living, C.Nephilim, C.Wave1], 6),
new Model('The Dreamer', [C.Neverborn], [C.Master, C.Spirit, C.Wave2], undefined, 3),
new Model('Lord Chompy Bits', [C.Neverborn], [C.Henchman, C.Rare1, C.Nightmare, C.Tyrant, C.Wave2], 0),
new Model('Daydream', [C.Neverborn], [C.Peon, C.TotemFor('The Dreamer'), C.Rare3, C.Nightmare, C.Wave2], 2),
new Model('AlPI:NAME:<NAME>END_PI', [C.Neverborn], [C.Peon, C.Nightmare, C.Wave2], 3),
new Model('PI:NAME:<NAME>END_PI', [C.Neverborn], [C.Enforcer, C.Rare1, C.Nightmare, C.Wave2], 8),
new Model('PI:NAME:<NAME>END_PI', [C.Neverborn], [C.Enforcer, C.Rare1, C.Nightmare, C.Nephilim, C.Woe, C.Wave2], 7),
new Model('PI:NAME:<NAME>END_PI', [C.Neverborn], [C.Enforcer, C.Rare1, C.Nightmare, C.Nephilim, C.Woe, C.Wave2], 7),
new Model('Insidious Madness', [C.Neverborn], [C.Minion, C.Rare3, C.Nightmare, C.Woe, C.Wave2], 5),
new Model('Widow Weaver', [C.Neverborn], [C.Henchman, C.Rare1, C.Nightmare, C.Wave2], 8, 5),
new Model('Black Blood Shaman', [C.Neverborn], [C.Minion, C.Living, C.Rare2, C.Nephilim, C.Wave2], 7),
new Model('PI:NAME:<NAME>END_PI', [C.Neverborn], [C.Henchman, C.Living, C.Rare1, C.Nephilim, C.Wave2], 13, 0),
new Model('PI:NAME:<NAME>END_PI', [C.Neverborn], [C.Master, C.Construct, C.Puppet, C.Wave2], undefined, 3),
new Model('PI:NAME:<NAME>END_PI', [C.Neverborn], [C.Minion, C.Construct, C.TotemFor('Collodi'), C.Rare4, C.Puppet, C.Wave2], 3),
new Model('Stitched Together', [C.Neverborn], [C.Minion, C.Construct, C.Nightmare, C.Puppet, C.Darkened, C.Wave2], 6),
new Model('Wicked Doll', [C.Neverborn], [C.Minion, C.Construct, C.Puppet, C.Wave2], 4),
new Model('Vasilisa', [C.Neverborn], [C.Henchman, C.Construct, C.Rare1, C.Puppet, C.Wave2], 9, 4),
new Model('Iggy', [C.Neverborn], [C.Enforcer, C.Living, C.Rare1, C.Woe, C.Lost, C.Wave2], 5),
new Model('Spawn Mother', [C.Neverborn], [C.Henchman, C.Living, C.Rare1, C.Swampfiend, C.Beast, C.Wave2], 9, 4),
new Model('Gupps', [C.Neverborn], [C.Minion, C.Living, C.Swampfiend, C.Beast, C.Swarm, C.Wave2], 4),
new Model('Tuco', [C.Neverborn], [C.Enforcer, C.Living, C.Rare1, C.Nephilim, C.Wave2], 7),
new Model('Mysterious Effigy', [C.Neverborn], [C.Minion, C.Construct, C.Rare1, C.Puppet, C.Effigy, C.Wave2], 4),
new Model('The Depleted', [C.Neverborn], [C.Minion, C.Living, C.Brilliance, C.Darkened, C.Wave2], 4),
new Model('Hooded Rider', [C.Neverborn], [C.Enforcer, C.Construct, C.Rare1, C.Horseman, C.Wave2], 12),
new Model('PI:NAME:<NAME>END_PI', [C.Outcast], [C.Master, C.Living, C.Freikorps, C.Wave1], undefined, 1),
new Model('PI:NAME:<NAME>END_PI', [C.Outcast, C.Resurrectionist], [C.Master, C.Undead, C.Wave1], undefined, 4),
new Model('Viktoria of Ashes', [C.Outcast], [C.Master, C.Living, C.Sister, C.Wave1], undefined, 1),
new Model('PI:NAME:<NAME>END_PI', [C.Outcast], [C.Henchman, C.Living, C.Rare1, C.Mercenary, C.Freikorps, C.Wave1], 10, 3),
new Model('The Nothing Beast', [C.Outcast], [C.Enforcer, C.Rare1, C.Wave1], 10),
new Model('Viktoria of Blood', [C.Outcast], [C.Henchman, C.Living, C.Rare1, C.Sister, C.Wave1], 0, 3),
new Model('PI:NAME:<NAME>END_PI', [C.Outcast], [C.Henchman, C.Living, C.Mercenary, C.Rare1, C.Wave1], 10, 3),
new Model('Steam Trunk', [C.Outcast], [C.Peon, C.Construct, C.TotemFor('PI:NAME:<NAME>END_PI'), C.Wave1], 3),
new Model('PI:NAME:<NAME>END_PI', [C.Outcast, C.Resurrectionist], [C.Enforcer, C.Living, C.TotemFor('PI:NAME:<NAME>END_PI'), C.Wave1], 5),
new Model('Student of Conflict', [C.Outcast], [C.Peon, C.Living, C.Totem, C.Mercenary, C.Sister, C.Wave1], 4),
new Model('Malifaux Child', [C.Outcast], [C.Peon, C.Living, C.Totem, C.Mercenary, C.Lost, C.Wave1], 2),
new Model('PI:NAME:<NAME>END_PI', [C.Outcast], [C.Enforcer, C.Living, C.Mercenary, C.Rare1, C.Wave1], 10),
new Model('PI:NAME:<NAME>END_PI', [C.Outcast], [C.Enforcer, C.Living, C.Mercenary, C.Rare2, C.Wave1], 7),
new Model('DesPI:NAME:<NAME>END_PIercenary', [C.Outcast], [C.Minion, C.Living, C.Mercenary, C.Wave1], 4),
new Model('Freikorps Specialist', [C.Outcast], [C.Living, C.Enforcer, C.Mercenary, C.Freikorps, C.Wave1], 8),
new Model('PI:NAME:<NAME>END_PI', [C.Outcast], [C.Living, C.Minion, C.Mercenary, C.Freikorps, C.Wave1], 5),
new Model('PI:NAME:<NAME>END_PI', [C.Outcast], [C.Enforcer, C.Living, C.Mercenary, C.Rare1, C.Wave1], 8),
new Model('PI:NAME:<NAME>END_PI', [C.Outcast], [C.Enforcer, C.Living, C.Mercenary, C.Rare1, C.Msu, C.Wave1], 6),
new Model('PI:NAME:<NAME>END_PI', [C.Outcast], [C.Enforcer, C.Undead, C.Mercenary, C.Rare1, C.Horror, C.Wave1], 12),
new Model('PI:NAME:<NAME>END_PI', [C.Outcast], [C.Minion, C.Living, C.Mercenary, C.Wave1], 6),
new Model('Void PI:NAME:<NAME>END_PI', [C.Outcast], [C.Minion, C.Wave1], 4),
new Model('PI:NAME:<NAME>END_PI', [C.Outcast], [C.Master, C.Undead, C.Tormented, C.Spirit, C.Cursed, C.Wave2], undefined, 2),
new Model('The Guilty', [C.Outcast], [C.Minion, C.Undead, C.Tormented, C.Wave2], 5),
new Model('PI:NAME:<NAME>END_PI', [C.Outcast], [C.Henchman, C.Undead, C.Rare1, C.Tormented, C.Wave2], 9, 4),
new Model('PI:NAME:<NAME>END_PI', [C.Outcast], [C.Peon, C.TotemFor('PI:NAME:<NAME>END_PI'), C.Tormented, C.Spirit, C.Wave2], 4),
new Model('PI:NAME:<NAME>END_PI', [C.Outcast], [C.Master, C.Tyrant, C.Nihilist, C.Wave2], undefined, 1),
new Model('PI:NAME:<NAME>END_PI', [C.Outcast], [C.Henchman, C.Rare1, C.Nihilist, C.Spirit, C.Wave2], 8, 5),
new Model('Obediant Wretch', [C.Outcast], [C.Minion, C.Living, C.Rare1, C.Nihilist, C.Wave2], 4),
new Model('Rat Catcher', [C.Outcast], [C.Minion, C.Living, C.Rare2, C.Nihilist, C.Wave2], 6),
new Model('PI:NAME:<NAME>END_PIaux PI:NAME:<NAME>END_PI', [C.Outcast], [C.Peon, C.Vermin, C.Wave2], 2),
new Model('Rat King', [C.Outcast], [C.Minion, C.Vermin, C.Swarm, C.Wave2], 8),
new Model('The Stolen', [C.Outcast], [C.Peon, C.Living, C.TotemFor('PI:NAME:<NAME>END_PI'), C.Rare3, C.Nihilist, C.Lost, C.Wave2], 2),
new Model('Ashes and Dust', [C.Outcast], [C.Enforcer, C.Construct, C.Undead, C.Rare1, C.Wave2], 13),
new Model('Ashen Core', [C.Outcast], [C.Enforcer, C.Construct, C.Undead, C.Rare1, C.Wave2], 0),
new Model('Dust Storm', [C.Outcast], [C.Enforcer, C.Construct, C.Undead, C.Rare1, C.Wave2], 6),
new Model('Freikorps Librarian', [C.Outcast], [C.Enforcer, C.Living, C.Mercenary, C.Academic, C.Freikorps, C.Wave2], 7),
new Model('Freikorps Trapper', [C.Outcast], [C.Minion, C.Living, C.Mercenary, C.Rare2, C.Freikorps, C.Wave2], 6),
new Model('Lazarus', [C.Outcast], [C.Enforcer, C.Construct, C.Mercenary, C.Rare1, C.Freikorps, C.Wave2], 10),
new Model('Sue', [C.Outcast], [C.Enforcer, C.Living, C.Mercenary, C.Rare1, C.Wave2], 8),
new Model('Hodgepodge Effigy', [C.Outcast], [C.Minion, C.Construct, C.Rare1, C.Puppet, C.Effigy, C.Wave2], 4),
new Model('Ama No Zako', [C.Outcast, C.TenThunders], [C.Henchman, C.Mercenary, C.Rare1, C.Oni, C.Wave2], 9, 4),
new Model('Strongarm Suit', [C.Outcast], [C.Enforcer, C.Living, C.Mercenary, C.Rare1, C.Freikorps, C.Wave2], 10),
new Model('Vanessa', [C.Outcast], [C.Enforcer, C.Living, C.Rare1, C.Sister, C.Wave2], 8),
new Model('Leveticus', [C.Outcast], [C.Master, C.Living, C.Wave2], undefined, 2),
new Model('PI:NAME:<NAME>END_PI', [C.Outcast], [C.Henchman, C.Living, C.Rare1, C.Wave2], 10, 3),
new Model('PI:NAME:<NAME>END_PI', [C.Outcast], [C.Peon, C.Undead, C.TotemFor('Leveticus'), C.Rare3, C.Wave2], 0),
new Model('Abomination', [C.Outcast], [C.Minion, C.Construct, C.Undead, C.Wave2], 4),
new Model('Desolation Engine', [C.Outcast], [C.Enforcer, C.Undead, C.Construct, C.Rare1, C.Wave2], 13),
new Model('PI:NAME:<NAME>END_PI', [C.Gremlin], [C.Master, C.Living, C.Gremlin, C.Wave1], undefined, 4),
new Model('PI:NAME:<NAME>END_PI', [C.Gremlin], [C.Master, C.Living, C.Gremlin, C.Kin, C.Wave1], undefined, 3),
new Model('The Brewmaster', [C.Gremlin, C.TenThunders], [C.Master, C.Living, C.Gremlin, C.TriChi, C.Wave1], undefined, 3),
new Model('PI:NAME:<NAME>END_PI', [C.Gremlin], [C.Henchman, C.Living, C.Rare1, C.Gremlin, C.Kin, C.Wave1], 7, 6),
new Model('Fingers', [C.Gremlin], [C.Henchman, C.Living, C.Rare1, C.Gremlin, C.TriChi, C.Wave1], 10, 3),
new Model('PI:NAME:<NAME>END_PI', [C.Gremlin], [C.Enforcer, C.Living, C.Rare1, C.Gremlin, C.Wave1], 9),
new Model('Whiskey Golem', [C.Gremlin], [C.Enforcer, C.Construct, C.Rare1, C.TriChi, C.Wave1], 10),
new Model('PI:NAME:<NAME>END_PI', [C.Gremlin], [C.Peon, C.Living, C.TotemFor('SPI:NAME:<NAME>END_PI'), C.Wave1], 2),
new Model('PI:NAME:<NAME>END_PI', [C.Gremlin], [C.Peon, C.Living, C.TotemFor('OpPI:NAME:<NAME>END_PI'), C.Gremlin, C.Kin, C.Wave1], 2),
new Model('PI:NAME:<NAME>END_PI', [C.Gremlin], [C.Minion, C.Living, C.TotemFor('The Brewmaster'), C.Gremlin, C.TriChi, C.Wave1], 3),
new Model('BayPI:NAME:<NAME>END_PI', [C.Gremlin], [C.Minion, C.Living, C.Gremlin, C.Wave1], 3),
new Model('Hog Whisperer', [C.Gremlin], [C.Minion, C.Living, C.Mercenary, C.Gremlin, C.Wave1], 5),
new Model('Moon Shinobi', [C.Gremlin], [C.Minion, C.Living, C.Gremlin, C.TriChi, C.Wave1], 6),
new Model('Pigapult', [C.Gremlin], [C.Peon, C.Construct, C.Rare1, C.Gremlin, C.Wave1], 8),
new Model('Piglet', [C.Gremlin], [C.Minion, C.Living, C.Beast, C.Pig, C.Wave1], 4),
new Model('Slop Hauler', [C.Gremlin], [C.Minion, C.Living, C.Gremlin, C.Wave1], 5),
new Model('War Pig', [C.Gremlin], [C.Minion, C.Living, C.Beast, C.Pig, C.Wave1], 9),
new Model('Pere Ravage', [C.Gremlin], [C.Enforcer, C.Living, C.Rare1, C.Gremlin, C.Kin, C.Wave1], 6),
new Model('PI:NAME:<NAME>END_PI', [C.Gremlin], [C.Enforcer, C.Living, C.Rare1, C.Gremlin, C.Kin, C.Wave1], 7),
new Model('PI:NAME:<NAME>END_PI', [C.Gremlin], [C.Enforcer, C.Living, C.Rare1, C.Gremlin, C.Kin, C.Wave1], 7),
new Model('PI:NAME:<NAME>END_PI', [C.Gremlin], [C.Master, C.Living, C.Gremlin, C.Wave2], undefined, 4),
new Model('Penelope', [C.Gremlin], [C.Peon, C.Living, C.TotemFor('PI:NAME:<NAME>END_PI'), C.Hound, C.Wave2], 2),
new Model('The Sow', [C.Gremlin], [C.Minion, C.Living, C.Rare1, C.Beast, C.Pig, C.Wave2], 8),
new Model('Old Major', [C.Gremlin], [C.Henchman, C.Living, C.Rare1, C.Pig, C.Wave2], 9, 4),
new Model('Rooster Rider', [C.Gremlin], [C.Minion, C.Living, C.Gremlin, C.Rooster, C.Wave2], 6),
new Model('Stuffed Piglet', [C.Gremlin], [C.Peon, C.Undead, C.Rare6, C.Pig, C.Wave2], 2),
new Model('PI:NAME:<NAME>END_PI', [C.Gremlin], [C.Enforcer, C.Living, C.Rare2, C.Gremlin, C.Wave2], 7),
new Model('PI:NAME:<NAME>END_PI', [C.Gremlin], [C.Master, C.Living, C.Gremlin, C.Wave2], undefined, 4),
new Model('The Little Lass', [C.Gremlin], [C.Peon, C.Living, C.TotemFor('Mah Tucket'), C.Gremlin, C.Wave2], 4),
new Model('PI:NAME:<NAME>END_PI', [C.Gremlin], [C.Henchman, C.Living, C.Rare1, C.Gremlin, C.Wave2], 8, 5),
new Model('PI:NAME:<NAME>END_PI', [C.Gremlin], [C.Minion, C.Living, C.Rare3, C.Gremlin, C.Wave2], 6),
new Model('PI:NAME:<NAME>END_PI', [C.Gremlin], [C.Henchman, C.Living, C.Mercenary, C.Rare1, C.Swampfiend, C.Wave2], 10, 3),
new Model('PI:NAME:<NAME>END_PI', [C.Gremlin], [C.Henchman, C.Living, C.Rare1, C.Gremlin, C.Wave2], 10, 3),
new Model('PI:NAME:<NAME>END_PI', [C.Gremlin], [C.Enforcer, C.Living, C.Mercenary, C.Rare1, C.Gremlin, C.Wave2], 7),
new Model('PI:NAME:<NAME>END_PI', [C.Gremlin], [C.Enforcer, C.Living, C.Mercenary, C.Rare1, C.Pig, C.Wave2], 10),
new Model('PI:NAME:<NAME>END_PI', [C.Gremlin], [C.Enforcer, C.Living, C.Rare1, C.Gremlin, C.Kin, C.Wave2], 6),
new Model('Wild Boar', [C.Gremlin], [C.Minion, C.Living, C.Beast, C.Pig, C.Swampfiend, C.Wave2], 6),
new Model('Lucky Effigy', [C.Gremlin], [C.Minion, C.Construct, C.Rare1, C.Puppet, C.Effigy, C.Wave2], 4),
new Model('PI:NAME:<NAME>END_PI', [C.Gremlin], [C.Master, C.Living, C.Gremlin, C.Wave2], undefined, 3),
new Model('Lovely Assistant', [C.Gremlin], [C.Peon, C.Living, C.TotemFor('Wong'), C.Gremlin, C.Showgirl, C.Wave2], 3),
new Model('Lightning Bug', [C.Gremlin], [C.Minion, C.Living, C.Gremlin, C.Wave2], 5),
new Model('PI:NAME:<NAME>END_PI', [C.Gremlin], [C.Minion, C.Living, C.Swampfiend, C.Wave2], 5),
new Model('PI:NAME:<NAME>END_PI', [C.Gremlin], [C.Henchman, C.Living, C.Rare1, C.Gremlin, C.Kin, C.Wave2], 7, 6),
new Model('PI:NAME:<NAME>END_PI', [C.Gremlin], [C.Peon, C.Living, C.Totem, C.Gremlin, C.Wave2], 4),
new Model('PI:NAME:<NAME>END_PI', [C.TenThunders, C.Outcast], [C.Master, C.Living, C.LastBlossom, C.Wave1], undefined, 2),
new Model('PI:NAME:<NAME>END_PI', [C.TenThunders, C.Arcanist], [C.Master, C.Living, C.Foundry, C.Wave1], undefined, 3),
new Model('PI:NAME:<NAME>END_PI', [C.TenThunders, C.Neverborn], [C.Master, C.Living, C.Darkened, C.Wave1], undefined, 1),
new Model('PI:NAME:<NAME>END_PI', [C.TenThunders], [C.Henchman, C.Living, C.Rare1, C.LastBlossom, C.Wave1], 10, 3),
new Model('PI:NAME:<NAME>END_PI', [C.TenThunders], [C.Henchman, C.Living, C.Rare1, C.Foundry, C.Wave1], 9, 4),
new Model('PI:NAME:<NAME>END_PI', [C.TenThunders], [C.Henchman, C.Living, C.Rare1, C.LastBlossom, C.Wave1], 7, 6),
new Model('PI:NAME:<NAME>END_PI', [C.TenThunders, C.Outcast], [C.Peon, C.Living, C.TotemFor('PI:NAME:<NAME>END_PI'), C.Wave1], 3),
new Model('PI:NAME:<NAME>END_PI', [C.TenThunders, C.Arcanist], [C.Minion, C.TotemFor('PI:NAME:<NAME>END_PI'), C.Spirit, C.Wave1], 3),
new Model('Hungering Darkness', [C.TenThunders, C.Neverborn], [C.Henchman, C.TotemFor('PI:NAME:<NAME>END_PI'), C.Rare1, C.Spirit, C.Darkened, C.Wave1], 0, 5),
new Model('DPI:NAME:<NAME>END_PI', [C.TenThunders], [C.Minion, C.Living, C.Rare1, C.Beast, C.Wave1], 10),
new Model('PI:NAME:<NAME>END_PI', [C.TenThunders], [C.Henchman, C.Living, C.Rare1, C.Wave1], 10, 3),
new Model('Monk of Low River', [C.TenThunders], [C.Minion, C.Living, C.Rare3, C.Wave1], 4),
new Model('PI:NAME:<NAME>END_PI', [C.TenThunders], [C.Minion, C.Living, C.Mercenary, C.LastBlossom, C.Showgirl, C.Wave1], 5),
new Model('Rail Worker', [C.TenThunders, C.Arcanist], [C.Minion, C.Living, C.Construct, C.Foundry, C.Wave1], 5),
new Model('The Illuminated', [C.TenThunders, C.Neverborn], [C.Minion, C.Living, C.Brilliance, C.Wave1], 7),
new Model('Thunder Archer', [C.TenThunders], [C.Minion, C.Living, C.Wave1], 7),
new Model('PI:NAME:<NAME>END_PI', [C.TenThunders], [C.Minion, C.Living, C.Mercenary, C.LastBlossom, C.Wave1], 6),
new Model('PI:NAME:<NAME>END_PI', [C.TenThunders], [C.Enforcer, C.Living, C.Wave1], 8),
new Model('PI:NAME:<NAME>END_PI', [C.TenThunders, C.Guild], [C.Master, C.Living, C.BlackSheep, C.Wave2], undefined, 2),
new Model('PI:NAME:<NAME>END_PI', [C.TenThunders, C.Guild], [C.Master, C.Living, C.BlackSheep, C.Wave2], undefined, 0),
new Model('PI:NAME:<NAME>END_PI', [C.TenThunders, C.Guild], [C.Henchman, C.Living, C.Rare1, C.BlackSheep, C.Wave2], 9, 4),
new Model('PI:NAME:<NAME>END_PI', [C.TenThunders, C.Guild], [C.Minion, C.Living, C.TotemFor('PI:NAME:<NAME>END_PI'), C.Beast, C.Hound, C.Wave2], 4),
new Model('PI:NAME:<NAME>END_PI', [C.TenThunders, C.Guild], [C.Minion, C.Living, C.BlackSheep, C.Wave2], 4),
new Model('PI:NAME:<NAME>END_PI', [C.TenThunders, C.Resurrectionist], [C.Master, C.Living, C.Ancestor, C.Wave2], undefined, 4),
new Model('SPI:NAME:<NAME>END_PIer', [C.TenThunders, C.Resurrectionist], [C.Peon, C.TotemFor('Yan Lo'), C.Spirit, C.Wave2], 3),
new Model('PI:NAME:<NAME>END_PI Niece', [C.TenThunders, C.Resurrectionist], [C.Enforcer, C.Living, C.Rare1, C.Ancestor, C.Wave2], 6),
new Model('Izamu the Armor', [C.TenThunders, C.Resurrectionist], [C.Enforcer, C.Undead, C.Rare1, C.Ancestor, C.Spirit, C.Wave2], 10),
new Model('Toshiro the Daimyo', [C.TenThunders, C.Resurrectionist], [C.Henchman, C.Undead, C.Rare1, C.Ancestor, C.Wave2], 9, 4),
new Model('Yin the Penangalan', [C.TenThunders, C.Resurrectionist], [C.Enforcer, C.Undead, C.Rare1, C.Ancestor, C.Horror, C.Wave2], 8),
new Model('Ten Thunders Brother', [C.TenThunders], [C.Minion, C.Living, C.Wave2], 5),
new Model('Mr. PI:NAME:<NAME>END_PI', [C.TenThunders, C.Neverborn], [C.Enforcer, C.Living, C.Rare1, C.Nephilim, C.Darkened, C.Mimic, C.Wave2], 8),
new Model('Mr. PI:NAME:<NAME>END_PI', [C.TenThunders, C.Neverborn], [C.Enforcer, C.Living, C.Rare1, C.Woe, C.Darkened, C.Mimic, C.Wave2], 6),
new Model('Shadow Effigy', [C.TenThunders], [C.Minion, C.Construct, C.Rare1, C.Puppet, C.Effigy, C.Wave2], 4),
new Model('Komainu', [C.TenThunders], [C.Minion, C.Construct, C.Spirit, C.Retainer, C.Wave2], 5),
new Model('Sensei Yu', [C.TenThunders], [C.Henchman, C.Living, C.Rare1, C.Wave2], 9, 4),
new Model('PI:NAME:<NAME>END_PI', [C.TenThunders], [C.Master, C.Living, C.Tyrant, C.Wave2], undefined, 2),
new Model('Peasant', [C.TenThunders], [C.Peon, C.Living, C.TotemFor('PI:NAME:<NAME>END_PI'), C.Rare2, C.Wave2], 2),
new Model('Fermented River Monk', [C.TenThunders], [C.Minion, C.Living, C.TriChi, C.Wave2], 5),
new Model('Monk of High River', [C.TenThunders], [C.Minion, C.Living, C.Rare3, C.Wave2], 6),
new Model('The Lone Swordsman', [C.TenThunders], [C.Enforcer, C.Living, C.Rare1, C.Wave2], 8),
new Model('Kamaitachi', [C.TenThunders], [C.Minion, C.Totem, C.Oni, C.Wave2], 4),
new Model('Tengu', [C.TenThunders], [C.Minion, C.Spirit, C.Oni, C.Wave2], 4),
new Model('Katanaka SPI:NAME:<NAME>END_PIper', [C.TenThunders], [C.Minion, C.Living, C.Rare2, C.Wave2], 7),
new Model('Brutal Emissary', [C.Guild], [C.Enforcer, C.Rare1, C.EmissaryOfFate, C.Wave3], 10),
new Model('Master Queeg', [C.Guild], [C.Henchman, C.Living, C.Rare1, C.Guardsman, C.BlackSheep, C.Wave3], 7, 6),
new Model('Dr. PI:NAME:<NAME>END_PI', [C.Guild], [C.Henchman, C.Living, C.Mercenary, C.Rare1, C.WitchHunter, C.Wave3], 9, 4),
new Model('Nurse Heartsbane', [C.Guild], [C.Enforcer, C.Living, C.Mercenary, C.Rare1, C.WitchHunter, C.Wave3], 8),
new Model('Greed', [C.Guild], [C.Enforcer, C.Living, C.Mercenary, C.Rare1, C.CrossroadsSeven, C.Tormented, C.Wave3], 8),
new Model('Sanctioned Spellcaster', [C.Guild], [C.Minion, C.Living, C.Academic, C.Wave3], 5),
new Model('Orderly', [C.Guild], [C.Minion, C.Living, C.Mercenary, C.Rare2, C.WitchHunter, C.Wave3], 5),
new Model('Mounted Guard', [C.Guild], [C.Minion, C.Living, C.Guardsman, C.Wave3], 7),
new Model('Carrion Emissary', [C.Resurrectionist], [C.Enforcer, C.Rare1, C.EmissaryOfFate, C.Wave3], 10),
new Model('Anna Lovelace', [C.Resurrectionist], [C.Henchman, C.Living, C.Mercenary, C.Rare1, C.Wave3], 9, 4),
new Model('SPI:NAME:<NAME>END_PIth', [C.Resurrectionist], [C.Enforcer, C.Undead, C.Mercenary, C.Rare1, C.CrossroadsSeven, C.Tormented, C.Horror, C.Wave3], 8),
new Model('The Forgotten Marshal', [C.Resurrectionist], [C.Enforcer, C.Living, C.Rare1, C.Wave3], 7),
new Model('PI:NAME:<NAME>END_PI', [C.Resurrectionist], [C.Enforcer, C.Living, C.Rare1, C.Nephilim, C.Wave3], 7),
new Model('Arcane Emissary', [C.Arcanist], [C.Enforcer, C.Rare1, C.EmissaryOfFate, C.Wave3], 10),
new Model('Wind Gamin', [C.Arcanist], [C.Minion, C.Living, C.Gamin, C.Wave3], 4),
new Model('The Scorpius', [C.Arcanist], [C.Minion, C.Living, C.Construct, C.Rare1, C.Beast, C.Wave3], 6),
new Model('Ice Dancer', [C.Arcanist], [C.Minion, C.Living, C.Showgirl, C.Wave3], 6),
new Model('Envy', [C.Arcanist], [C.Enforcer, C.Living, C.Mercenary, C.Rare1, C.CrossroadsSeven, C.Tormented, C.Wave3], 8),
new Model('Mysterious Emissary', [C.Neverborn], [C.Enforcer, C.Rare1, C.EmissaryOfFate, C.Wave3], 10),
new Model('Wrath', [C.Neverborn], [C.Henchman, C.Living, C.Mercenary, C.Rare1, C.CrossroadsSeven, C.Tormented, C.Wave3], 8, 5),
new Model('Angel Eyes', [C.Neverborn], [C.Henchman, C.Living, C.Mercenary, C.Rare1, C.Nephilim, C.Wave3], 9, 4),
new Model('Scion of Black Blood', [C.Neverborn], [C.Enforcer, C.Living, C.Mercenary, C.Rare1, C.Nephilim, C.Wave3], 8),
new Model('Corrupted Hound', [C.Neverborn], [C.Minion, C.Living, C.Rare4, C.Beast, C.Hound, C.Wave3], 3),
new Model('Changeling', [C.Neverborn], [C.Minion, C.Living, C.Rare3, C.Mimic, C.Wave3], 4),
new Model('Bloodwretch', [C.Neverborn], [C.Minion, C.Living, C.Mercenary, C.Rare2, C.Nephilim, C.Wave3], 5),
new Model('Bunraku', [C.Neverborn, C.TenThunders], [C.Minion, C.Construct, C.Puppet, C.Wave3], 6),
new Model('Hodgepodge Emissary', [C.Outcast], [C.Enforcer, C.Rare1, C.EmissaryOfFate, C.Cursed, C.Wave3], 10),
new Model('Scion of the Void', [C.Outcast], [C.Henchman, C.Rare1, C.Wave3], 8, 5),
new Model('Pride', [C.Outcast], [C.Enforcer, C.Living, C.Mercenary, C.Rare1, C.CrossroadsSeven, C.Tormented, C.Wave3], 8),
new Model('Big Jake', [C.Outcast], [C.Enforcer, C.Living, C.Mercenary, C.Rare1, C.Wave3], 5),
new Model('The Winged Plague', [C.Outcast], [C.Minion, C.Living, C.Vermin, C.Wave3], 4),
new Model('Lucky Emissary', [C.Gremlin], [C.Enforcer, C.Rare1, C.EmissaryOfFate, C.Wave3], 10),
new Model('Sparks', [C.Gremlin], [C.Henchman, C.Living, C.Rare1, C.Gremlin, C.Foundry, C.Wave3], 7, 6),
new Model('Gluttony', [C.Gremlin], [C.Enforcer, C.Living, C.Mercenary, C.Rare1, C.CrossroadsSeven, C.Tormented, C.Wave3], 8),
new Model('Survivor', [C.Gremlin], [C.Minion, C.Living, C.Construct, C.Gremlin, C.Wave3], 5),
new Model('Mechanized Porkchop', [C.Gremlin], [C.Minion, C.Construct, C.Pig, C.Foundry, C.Wave3], 7),
new Model('Shadow Emissary', [C.TenThunders], [C.Enforcer, C.Rare1, C.EmissaryOfFate, C.Wave3], 10),
new Model('Lust', [C.TenThunders], [C.Enforcer, C.Living, C.Mercenary, C.Rare1, C.CrossroadsSeven, C.Tormented, C.Wave3], 8),
new Model('Wandering River Monk', [C.TenThunders], [C.Minion, C.Living, C.Wave3], 7),
new Model('Obsidian Oni', [C.TenThunders], [C.Minion, C.Oni, C.Wave3], 6),
new Model('JorPI:NAME:<NAME>END_PIo', [C.TenThunders], [C.Minion, C.Oni, C.LastBlossom, C.Wave3], 9),
new Model('PI:NAME:<NAME>END_PI', [C.Guild], [C.Master, C.Living, C.Journalist, C.Wave4], undefined, 4),
new Model('The Printing Press', [C.Guild], [C.Peon, C.Construct, C.TotemFor('PI:NAME:<NAME>END_PI'), C.Journalist, C.Wave4], 3),
new Model('PI:NAME:<NAME>END_PI', [C.Guild], [C.Henchman, C.Living, C.Rare1, C.Journalist, C.Wave4], 8, 5),
new Model('Allison Dade', [C.Guild], [C.Henchman, C.Living, C.Rare1, C.Journalist, C.Wave4], 8, 5),
new Model('Field Reporter', [C.Guild], [C.Minion, C.Living, C.Journalist, C.Wave4], 4),
new Model('Death Marshal Recruiter', [C.Guild], [C.Enforcer, C.Living, C.Rare2, C.GuildMarshal, C.Wave4], 7),
new Model('PI:NAME:<NAME>END_PI', [C.Guild], [C.Minion, C.Living, C.WitchHunter, C.Wave4], 9),
new Model('PI:NAME:<NAME>END_PI', [C.Resurrectionist], [C.Master, C.Living, C.Revenant, C.Wave4], undefined, 4),
new Model('PI:NAME:<NAME>END_PI', [C.Resurrectionist], [C.Peon, C.Undead, C.TotemFor('Reva'), C.Spirit, C.Revenant, C.Wave4], 2),
new Model('PI:NAME:<NAME>END_PI', [C.Resurrectionist], [C.Henchman, C.Living, C.Rare1, C.Revenant, C.Wave4], 8, 5),
new Model('PI:NAME:<NAME>END_PI', [C.Resurrectionist], [C.Henchman, C.Undead, C.Rare1, C.Horror, C.Wave4], 13, 0),
new Model('ShieldPI:NAME:<NAME>END_PI', [C.Resurrectionist], [C.Minion, C.Living, C.Revenant, C.Wave4], 6),
new Model('PI:NAME:<NAME>END_PI', [C.Resurrectionist], [C.Minion, C.Undead, C.Revenant, C.Horror, C.Wave4], 8),
new Model('PI:NAME:<NAME>END_PI', [C.Resurrectionist], [C.Minion, C.Spirit, C.Retainer, C.Wave4], 7),
new Model('PI:NAME:<NAME>END_PI', [C.Arcanist], [C.Master, C.Living, C.Academic, C.Wave4], undefined, 4),
new Model('Corpse Candle', [C.Arcanist], [C.Minion, C.TotemFor('PI:NAME:<NAME>END_PI'), C.Rare1, C.Gamin, C.Wave4], 8),
new Model('PI:NAME:<NAME>END_PI', [C.Arcanist], [C.Henchman, C.Living, C.Rare1, C.Academic, C.Wave4], 7, 6),
new Model('PI:NAME:<NAME>END_PI', [C.Arcanist], [C.Henchman, C.Living, C.Rare1, C.Msu, C.Academic, C.Wave4], 9, 4),
new Model('PI:NAME:<NAME>END_PI', [C.Arcanist], [C.Henchman, C.Living, C.Rare1, C.Showgirl, C.Wave4], 9, 4),
new Model('PI:NAME:<NAME>END_PI', [C.Arcanist], [C.Minion, C.Construct, C.Gamin, C.Beast, C.Wave4], 5),
new Model('PI:NAME:<NAME>END_PI', [C.Arcanist], [C.Enforcer, C.Living, C.Msu, C.Academic, C.Wave4], 8),
new Model('PI:NAME:<NAME>END_PI', [C.Neverborn], [C.Master, C.Undead, C.Fae, C.Wave4], undefined, 4),
new Model('The GPI:NAME:<NAME>END_PI', [C.Neverborn], [C.Peon, C.Living, C.TotemFor('Titania'), C.Fae, C.Wave4], 3),
new Model('PI:NAME:<NAME>END_PI', [C.Neverborn], [C.Henchman, C.Undead, C.Rare1, C.Fae, C.Wave4], 9, 4),
new Model('The Tooth', [C.Neverborn], [C.Minion, C.Undead, C.Rare1, C.Fae, C.Wave4], 7),
new Model('The Claw', [C.Neverborn], [C.Minion, C.Undead, C.Rare1, C.Fae, C.Wave4], 7),
new Model('The Thorn', [C.Neverborn], [C.Minion, C.Undead, C.Rare1, C.Fae, C.Wave4], 7),
new Model('PI:NAME:<NAME>END_PIatch', [C.Neverborn], [C.Minion, C.Living, C.Rare1, C.Fae, C.Nightmare, C.Spirit, C.Wave4], 5),
new Model('Will O\' the Wisp', [C.Neverborn], [C.Minion, C.Rare3, C.Spirit, C.Swampfiend, C.Wave4], 3),
new Model('Rougarou', [C.Neverborn], [C.Minion, C.Undead, C.Fae, C.Beast, C.Wave4], 8),
new Model('PI:NAME:<NAME>END_PI', [C.Outcast], [C.Master, C.Living, C.Bandit, C.Wave4], undefined, 4),
new Model('PI:NAME:<NAME>END_PI', [C.Outcast], [C.Minion, C.Living, C.TotemFor('PI:NAME:<NAME>END_PI'), C.Wave4], 3),
new Model('Mad Dog Brackett', [C.Outcast], [C.Henchman, C.Living, C.Rare1, C.Bandit, C.Wave4], 9, 4),
new Model('PI:NAME:<NAME>END_PI', [C.Outcast], [C.Henchman, C.Mercenary, C.Rare1, C.Wave4], 12, 1),
new Model('PI:NAME:<NAME>END_PI', [C.Outcast], [C.Minion, C.Living, C.Bandit, C.Wave4], 5),
new Model('Dead Outland', [C.Outcast], [C.Minion, C.Undead, C.Bandit, C.Tormented, C.Wave4], 6),
new Model('PI:NAME:<NAME>END_PI', [C.Outcast], [C.Minion, C.Living, C.Bandit, C.LastBlossom, C.Wave4], 8),
new Model('PI:NAME:<NAME>END_PI', [C.Gremlin], [C.Master, C.Living, C.Gremlin, C.SkyPirate, C.Wave4], undefined, 4),
new Model('PI:NAME:<NAME>END_PI', [C.Gremlin], [C.Minion, C.Living, C.TotemFor('PI:NAME:<NAME>END_PI'), C.Wave4], 3),
new Model('The First Mate', [C.Gremlin], [C.Henchman, C.Living, C.Rare1, C.Swampfiend, C.SkyPirate, C.Wave4], 9, 4),
new Model('PI:NAME:<NAME>END_PI', [C.Gremlin], [C.Enforcer, C.Living, C.Construct, C.Gremlin, C.SkyPirate, C.Wave4], 6),
new Model('PI:NAME:<NAME>END_PI', [C.Gremlin, C.TenThunders], [C.Minion, C.Rare3, C.Oni, C.TriChi, C.Wave4], 4),
new Model('PI:NAME:<NAME>END_PI', [C.Gremlin], [C.Minion, C.Living, C.Gremlin, C.Wave4], 5),
new Model('Swine-Cursed', [C.Gremlin], [C.Minion, C.Living, C.Rare2, C.Gremlin, C.Wave4], 7),
new Model('PI:NAME:<NAME>END_PI', [C.TenThunders], [C.Master, C.Living, C.Oni, C.Wave4], undefined, 3),
new Model('PI:NAME:<NAME>END_PI', [C.TenThunders], [C.Peon, C.TotemFor('PI:NAME:<NAME>END_PI'), C.Oni, C.Wave4], 3),
new Model('PI:NAME:<NAME>END_PI', [C.TenThunders], [C.Henchman, C.Rare1, C.Oni, C.Wave4], 8, 5),
new Model('Yokai', [C.TenThunders], [C.Minion, C.Oni, C.Wave4], 5),
new Model('Terracotta Warrior', [C.TenThunders], [C.Minion, C.Construct, C.Rare3, C.Mimic, C.Wave4], 5),
new Model('PI:NAME:<NAME>END_PI', [C.TenThunders], [C.Enforcer, C.Rare1, C.Living, C.Retainer, C.Wave4], 8)
]
export default ModelList |
[
{
"context": "esetPassword.from = \"Application Admin Email <admin@application.com>\"\n\n# Set a subject for the reset password email.\n",
"end": 296,
"score": 0.9999276399612427,
"start": 275,
"tag": "EMAIL",
"value": "admin@application.com"
},
{
"context": "u feel something is wrong, please contact support: admin@application.com.\"\n",
"end": 926,
"score": 0.9999276399612427,
"start": 905,
"tag": "EMAIL",
"value": "admin@application.com"
}
] | app/server/email/templates/reset-password.coffee | chrisdamba/offer-market | 1 | ###
Reset Password Email Template
Override Meteor defaults when sending a reset password email.
###
# Set name and from email.
Accounts.emailTemplates.resetPassword.siteName = "Application Name"
Accounts.emailTemplates.resetPassword.from = "Application Admin Email <admin@application.com>"
# Set a subject for the reset password email.
Accounts.emailTemplates.resetPassword.subject = (user) ->
"[Application Name] Reset Your Password"
# Set the body of the reset password email.
Accounts.emailTemplates.resetPassword.text = (user, url) ->
email = user.emails[0].address
removeHash = url.replace('#/', '')
"A password reset has been requested for the account related to this address(#{email}). To reset the password, visit the following link:\n\n #{removeHash}\n\n If you did not request this reset, please ignore this email. If you feel something is wrong, please contact support: admin@application.com."
| 209003 | ###
Reset Password Email Template
Override Meteor defaults when sending a reset password email.
###
# Set name and from email.
Accounts.emailTemplates.resetPassword.siteName = "Application Name"
Accounts.emailTemplates.resetPassword.from = "Application Admin Email <<EMAIL>>"
# Set a subject for the reset password email.
Accounts.emailTemplates.resetPassword.subject = (user) ->
"[Application Name] Reset Your Password"
# Set the body of the reset password email.
Accounts.emailTemplates.resetPassword.text = (user, url) ->
email = user.emails[0].address
removeHash = url.replace('#/', '')
"A password reset has been requested for the account related to this address(#{email}). To reset the password, visit the following link:\n\n #{removeHash}\n\n If you did not request this reset, please ignore this email. If you feel something is wrong, please contact support: <EMAIL>."
| true | ###
Reset Password Email Template
Override Meteor defaults when sending a reset password email.
###
# Set name and from email.
Accounts.emailTemplates.resetPassword.siteName = "Application Name"
Accounts.emailTemplates.resetPassword.from = "Application Admin Email <PI:EMAIL:<EMAIL>END_PI>"
# Set a subject for the reset password email.
Accounts.emailTemplates.resetPassword.subject = (user) ->
"[Application Name] Reset Your Password"
# Set the body of the reset password email.
Accounts.emailTemplates.resetPassword.text = (user, url) ->
email = user.emails[0].address
removeHash = url.replace('#/', '')
"A password reset has been requested for the account related to this address(#{email}). To reset the password, visit the following link:\n\n #{removeHash}\n\n If you did not request this reset, please ignore this email. If you feel something is wrong, please contact support: PI:EMAIL:<EMAIL>END_PI."
|
[
{
"context": "# Copyright (c) ppy Pty Ltd <contact@ppy.sh>. Licensed under the GNU Affero General Public Li",
"end": 43,
"score": 0.9999145269393921,
"start": 29,
"tag": "EMAIL",
"value": "contact@ppy.sh"
},
{
"context": "\n scope.setUser id: currentUser.id, username: currentUser.username\n",
"end": 1176,
"score": 0.9415374398231506,
"start": 1156,
"tag": "USERNAME",
"value": "currentUser.username"
}
] | resources/assets/coffee/_classes/current-user-observer.coffee | osu-katakuna/osu-katakuna-web | 5 | # Copyright (c) ppy Pty Ltd <contact@ppy.sh>. Licensed under the GNU Affero General Public License v3.0.
# See the LICENCE file in the repository root for full licence text.
class @CurrentUserObserver
constructor: ->
@covers = document.getElementsByClassName('js-current-user-cover')
@avatars = document.getElementsByClassName('js-current-user-avatar')
$.subscribe 'user:update', @setData
$(document).on 'turbolinks:load', @reinit
$.subscribe 'osu:page:change', @reinit
reinit: =>
@setAvatars()
@setCovers()
@setSentryUser()
setAvatars: (elements) =>
elements ?= @avatars
bgImage = osu.urlPresence(currentUser.avatar_url) if currentUser.id?
for el in elements
el.style.backgroundImage = bgImage
setCovers: (elements) =>
elements ?= @covers
bgImage = osu.urlPresence(currentUser.cover_url) if currentUser.id?
for el in elements
el.style.backgroundImage = bgImage
setData: (_e, data) =>
window.currentUser = data
@reinit()
setSentryUser: ->
return unless Sentry?
Sentry.configureScope (scope) ->
scope.setUser id: currentUser.id, username: currentUser.username
| 189511 | # Copyright (c) ppy Pty Ltd <<EMAIL>>. Licensed under the GNU Affero General Public License v3.0.
# See the LICENCE file in the repository root for full licence text.
class @CurrentUserObserver
constructor: ->
@covers = document.getElementsByClassName('js-current-user-cover')
@avatars = document.getElementsByClassName('js-current-user-avatar')
$.subscribe 'user:update', @setData
$(document).on 'turbolinks:load', @reinit
$.subscribe 'osu:page:change', @reinit
reinit: =>
@setAvatars()
@setCovers()
@setSentryUser()
setAvatars: (elements) =>
elements ?= @avatars
bgImage = osu.urlPresence(currentUser.avatar_url) if currentUser.id?
for el in elements
el.style.backgroundImage = bgImage
setCovers: (elements) =>
elements ?= @covers
bgImage = osu.urlPresence(currentUser.cover_url) if currentUser.id?
for el in elements
el.style.backgroundImage = bgImage
setData: (_e, data) =>
window.currentUser = data
@reinit()
setSentryUser: ->
return unless Sentry?
Sentry.configureScope (scope) ->
scope.setUser id: currentUser.id, username: currentUser.username
| true | # Copyright (c) ppy Pty Ltd <PI:EMAIL:<EMAIL>END_PI>. Licensed under the GNU Affero General Public License v3.0.
# See the LICENCE file in the repository root for full licence text.
class @CurrentUserObserver
constructor: ->
@covers = document.getElementsByClassName('js-current-user-cover')
@avatars = document.getElementsByClassName('js-current-user-avatar')
$.subscribe 'user:update', @setData
$(document).on 'turbolinks:load', @reinit
$.subscribe 'osu:page:change', @reinit
reinit: =>
@setAvatars()
@setCovers()
@setSentryUser()
setAvatars: (elements) =>
elements ?= @avatars
bgImage = osu.urlPresence(currentUser.avatar_url) if currentUser.id?
for el in elements
el.style.backgroundImage = bgImage
setCovers: (elements) =>
elements ?= @covers
bgImage = osu.urlPresence(currentUser.cover_url) if currentUser.id?
for el in elements
el.style.backgroundImage = bgImage
setData: (_e, data) =>
window.currentUser = data
@reinit()
setSentryUser: ->
return unless Sentry?
Sentry.configureScope (scope) ->
scope.setUser id: currentUser.id, username: currentUser.username
|
[
{
"context": "##############################################\n#\n# Markus 1/23/2017\n#\n#####################################",
"end": 75,
"score": 0.9990363121032715,
"start": 69,
"tag": "NAME",
"value": "Markus"
}
] | server/methods/fields.coffee | agottschalk10/worklearn | 0 | ################################################################
#
# Markus 1/23/2017
#
################################################################
################################################################
Meteor.methods
set_field: (collection_name, item_id, field, data)->
collection = get_collection_save collection_name
return modify_field collection, item_id, field, data
upload_file: (collection_name, item_id, field, data, type)->
collection = get_collection_save collection_name
return upload_file collection, item_id, field, data, type
download_file: (collection_name, item_id, field)->
collection = get_collection_save collection_name
return download_file collection, item_id, field
| 61223 | ################################################################
#
# <NAME> 1/23/2017
#
################################################################
################################################################
Meteor.methods
set_field: (collection_name, item_id, field, data)->
collection = get_collection_save collection_name
return modify_field collection, item_id, field, data
upload_file: (collection_name, item_id, field, data, type)->
collection = get_collection_save collection_name
return upload_file collection, item_id, field, data, type
download_file: (collection_name, item_id, field)->
collection = get_collection_save collection_name
return download_file collection, item_id, field
| true | ################################################################
#
# PI:NAME:<NAME>END_PI 1/23/2017
#
################################################################
################################################################
Meteor.methods
set_field: (collection_name, item_id, field, data)->
collection = get_collection_save collection_name
return modify_field collection, item_id, field, data
upload_file: (collection_name, item_id, field, data, type)->
collection = get_collection_save collection_name
return upload_file collection, item_id, field, data, type
download_file: (collection_name, item_id, field)->
collection = get_collection_save collection_name
return download_file collection, item_id, field
|
[
{
"context": "} = require '../lib/user'\nalice = users().lookup 'test_alice'\nbob = users().lookup 'test_bob'\n\nexports.id_0 = ",
"end": 72,
"score": 0.9988288879394531,
"start": 62,
"tag": "USERNAME",
"value": "test_alice"
},
{
"context": "users().lookup 'test_alice'\nbob = users().lookup 'test_bob'\n\nexports.id_0 = (T,cb) ->\n await bob.id alice, ",
"end": 104,
"score": 0.998617947101593,
"start": 96,
"tag": "USERNAME",
"value": "test_bob"
},
{
"context": ")\n\nexports.follow_0 = (T,cb) ->\n await bob.follow alice, {remote : true }, defer err\n T.no_error err\n c",
"end": 242,
"score": 0.4806903302669525,
"start": 237,
"tag": "NAME",
"value": "alice"
},
{
"context": ")\n\nexports.follow_1 = (T,cb) ->\n await bob.follow alice, {remote : true }, defer err\n T.no_error err\n c",
"end": 444,
"score": 0.5855087637901306,
"start": 439,
"tag": "NAME",
"value": "alice"
}
] | test/files/2_follow.iced | substack/keybase-client | 1 |
{users,User} = require '../lib/user'
alice = users().lookup 'test_alice'
bob = users().lookup 'test_bob'
exports.id_0 = (T,cb) ->
await bob.id alice, defer err
T.no_error err
cb()
exports.follow_0 = (T,cb) ->
await bob.follow alice, {remote : true }, defer err
T.no_error err
cb()
exports.unfollow_1 = (T,cb) ->
await bob.unfollow alice, defer err
T.no_error err
cb()
exports.follow_1 = (T,cb) ->
await bob.follow alice, {remote : true }, defer err
T.no_error err
cb()
| 173255 |
{users,User} = require '../lib/user'
alice = users().lookup 'test_alice'
bob = users().lookup 'test_bob'
exports.id_0 = (T,cb) ->
await bob.id alice, defer err
T.no_error err
cb()
exports.follow_0 = (T,cb) ->
await bob.follow <NAME>, {remote : true }, defer err
T.no_error err
cb()
exports.unfollow_1 = (T,cb) ->
await bob.unfollow alice, defer err
T.no_error err
cb()
exports.follow_1 = (T,cb) ->
await bob.follow <NAME>, {remote : true }, defer err
T.no_error err
cb()
| true |
{users,User} = require '../lib/user'
alice = users().lookup 'test_alice'
bob = users().lookup 'test_bob'
exports.id_0 = (T,cb) ->
await bob.id alice, defer err
T.no_error err
cb()
exports.follow_0 = (T,cb) ->
await bob.follow PI:NAME:<NAME>END_PI, {remote : true }, defer err
T.no_error err
cb()
exports.unfollow_1 = (T,cb) ->
await bob.unfollow alice, defer err
T.no_error err
cb()
exports.follow_1 = (T,cb) ->
await bob.follow PI:NAME:<NAME>END_PI, {remote : true }, defer err
T.no_error err
cb()
|
[
{
"context": "\n @expectedInitialTasksList = [\n name: 'test1'\n departure_point: 'from_test'\n des",
"end": 946,
"score": 0.990178108215332,
"start": 941,
"tag": "NAME",
"value": "test1"
},
{
"context": " resource_uri: 'fake1'\n ,\n name: 'test2'\n departure_point: 'from_test'\n des",
"end": 1111,
"score": 0.9901770353317261,
"start": 1106,
"tag": "NAME",
"value": "test2"
},
{
"context": " resource_uri: 'fake2'\n ,\n name: 'test3'\n departure_point: 'from_test'\n des",
"end": 1276,
"score": 0.9924184679985046,
"start": 1271,
"tag": "NAME",
"value": "test3"
},
{
"context": " resource_uri: 'fake3'\n ,\n name: 'test4'\n departure_point: 'from_test'\n des",
"end": 1441,
"score": 0.994530200958252,
"start": 1436,
"tag": "NAME",
"value": "test4"
},
{
"context": " resource_uri: 'fake4'\n ,\n name: 'test5'\n departure_point: 'from_test'\n des",
"end": 1606,
"score": 0.9905211925506592,
"start": 1601,
"tag": "NAME",
"value": "test5"
},
{
"context": " resource_uri: 'fake5'\n ,\n name: 'test6'\n departure_point: 'from_test'\n des",
"end": 1771,
"score": 0.9827743768692017,
"start": 1766,
"tag": "NAME",
"value": "test6"
},
{
"context": "point: 'from_test'\n destination_point: 'to_test'\n somefield: 'test data'\n resource_",
"end": 1845,
"score": 0.8686805963516235,
"start": 1841,
"tag": "NAME",
"value": "test"
},
{
"context": " resource_uri: 'fake6'\n ,\n name: 'test7'\n departure_point: 'from_test'\n des",
"end": 1936,
"score": 0.974818229675293,
"start": 1931,
"tag": "NAME",
"value": "test7"
},
{
"context": " resource_uri: 'fake7'\n ,\n name: 'test8'\n departure_point: 'from_test'\n des",
"end": 2101,
"score": 0.9790548086166382,
"start": 2096,
"tag": "NAME",
"value": "test8"
},
{
"context": " @expectedTasksList = [\n [\n name: 'test1'\n departure_point: 'from_test'\n ",
"end": 2302,
"score": 0.9855608344078064,
"start": 2297,
"tag": "NAME",
"value": "test1"
},
{
"context": " resource_uri: 'fake1'\n ,\n name: 'test2'\n departure_point: 'from_test'\n ",
"end": 2479,
"score": 0.9888685941696167,
"start": 2474,
"tag": "NAME",
"value": "test2"
},
{
"context": " resource_uri: 'fake2'\n ,\n name: 'test3'\n departure_point: 'from_test'\n ",
"end": 2656,
"score": 0.9873228073120117,
"start": 2651,
"tag": "NAME",
"value": "test3"
},
{
"context": " resource_uri: 'fake3'\n ,\n name: 'test4'\n departure_point: 'from_test'\n ",
"end": 2833,
"score": 0.9852466583251953,
"start": 2828,
"tag": "NAME",
"value": "test4"
},
{
"context": "ce_uri: 'fake4'\n ],\n [\n name: 'test5'\n departure_point: 'from_test'\n ",
"end": 3017,
"score": 0.9877803325653076,
"start": 3012,
"tag": "NAME",
"value": "test5"
},
{
"context": " resource_uri: 'fake5'\n ,\n name: 'test6'\n departure_point: 'from_test'\n ",
"end": 3194,
"score": 0.9860490560531616,
"start": 3189,
"tag": "NAME",
"value": "test6"
},
{
"context": " resource_uri: 'fake6'\n ,\n name: 'test7'\n departure_point: 'from_test'\n ",
"end": 3371,
"score": 0.9715282917022705,
"start": 3366,
"tag": "NAME",
"value": "test7"
},
{
"context": " resource_uri: 'fake7'\n ,\n name: 'test8'\n departure_point: 'from_test'\n ",
"end": 3548,
"score": 0.984070360660553,
"start": 3543,
"tag": "NAME",
"value": "test8"
},
{
"context": "\n # be enough\n testObj =\n name: 'test name'\n resource_uri: 'fake_task_resource'\n\n ",
"end": 6090,
"score": 0.9964747428894043,
"start": 6081,
"tag": "NAME",
"value": "test name"
},
{
"context": "is is a new object\n testObj =\n name: 'test name'\n somefield: 'test data'\n resource_",
"end": 6879,
"score": 0.9958592653274536,
"start": 6870,
"tag": "NAME",
"value": "test name"
},
{
"context": "_uri: ''\n\n extInitialTasksList = angular.copy(@expectedInitialTasksList)\n extTasksList = angular.copy(@expectedTasks",
"end": 7004,
"score": 0.9612289667129517,
"start": 6979,
"tag": "USERNAME",
"value": "@expectedInitialTasksList"
},
{
"context": "tialTasksList)\n extTasksList = angular.copy(@expectedTasksList)\n\n extInitialTasksList.push(testObj)\n e",
"end": 7058,
"score": 0.9647021293640137,
"start": 7041,
"tag": "USERNAME",
"value": "expectedTasksList"
},
{
"context": "urnValue(@$q.when())\n\n task =\n name: 'test'\n resource_uri: 'test'\n is_active: ",
"end": 7967,
"score": 0.9978249073028564,
"start": 7963,
"tag": "NAME",
"value": "test"
},
{
"context": " p.promise\n )\n\n task =\n name: 'test'\n resource_uri: 'test'\n is_active: ",
"end": 8453,
"score": 0.9993879795074463,
"start": 8449,
"tag": "NAME",
"value": "test"
},
{
"context": "urnValue(@$q.when())\n\n task =\n name: 'test'\n resource_uri: 'test'\n is_active: ",
"end": 8913,
"score": 0.9995050430297852,
"start": 8909,
"tag": "NAME",
"value": "test"
},
{
"context": " p.promise\n )\n\n task =\n name: 'test'\n resource_uri: 'test'\n is_active: ",
"end": 9395,
"score": 0.999453067779541,
"start": 9391,
"tag": "NAME",
"value": "test"
},
{
"context": "rnValue(@$q.when(\n data:[\n name: 'test1'\n full_name: 'test1 full'\n code",
"end": 13622,
"score": 0.9981811046600342,
"start": 13617,
"tag": "NAME",
"value": "test1"
},
{
"context": "a:[\n name: 'test1'\n full_name: 'test1 full'\n code: '0'\n ,\n name: 't",
"end": 13656,
"score": 0.9948329329490662,
"start": 13646,
"tag": "NAME",
"value": "test1 full"
},
{
"context": "l'\n code: '0'\n ,\n name: 'test2'\n full_name: 'test2 full'\n code",
"end": 13710,
"score": 0.9984334707260132,
"start": 13705,
"tag": "NAME",
"value": "test2"
},
{
"context": " ,\n name: 'test2'\n full_name: 'test2 full'\n code: '1'\n ,\n name: 't",
"end": 13744,
"score": 0.9817565083503723,
"start": 13734,
"tag": "NAME",
"value": "test2 full"
},
{
"context": "l'\n code: '1'\n ,\n name: 'test3'\n full_name: 'test3 full'\n code",
"end": 13798,
"score": 0.9977457523345947,
"start": 13793,
"tag": "NAME",
"value": "test3"
},
{
"context": " ,\n name: 'test3'\n full_name: 'test3 full'\n code: '2'\n ]\n ))\n\n re",
"end": 13832,
"score": 0.9835155606269836,
"start": 13822,
"tag": "NAME",
"value": "test3 full"
},
{
"context": "()\n\n expect(result).toEqual([\n name: 'test1'\n full_name: 'test1 full'\n code: '0",
"end": 14075,
"score": 0.9985053539276123,
"start": 14070,
"tag": "NAME",
"value": "test1"
},
{
"context": "Equal([\n name: 'test1'\n full_name: 'test1 full'\n code: '0'\n ,\n name: 'test2'\n",
"end": 14107,
"score": 0.9884462356567383,
"start": 14097,
"tag": "NAME",
"value": "test1 full"
},
{
"context": "t1 full'\n code: '0'\n ,\n name: 'test2'\n full_name: 'test2 full'\n code: '1",
"end": 14155,
"score": 0.9979824423789978,
"start": 14150,
"tag": "NAME",
"value": "test2"
},
{
"context": " ,\n name: 'test2'\n full_name: 'test2 full'\n code: '1'\n ,\n name: 'test3'\n",
"end": 14187,
"score": 0.9846377968788147,
"start": 14177,
"tag": "NAME",
"value": "test2 full"
},
{
"context": "t2 full'\n code: '1'\n ,\n name: 'test3'\n full_name: 'test3 full'\n code: '2",
"end": 14235,
"score": 0.9962248802185059,
"start": 14230,
"tag": "NAME",
"value": "test3"
},
{
"context": " ,\n name: 'test3'\n full_name: 'test3 full'\n code: '2'\n ])\n\n describe 'controll",
"end": 14267,
"score": 0.9833285212516785,
"start": 14257,
"tag": "NAME",
"value": "test3 full"
},
{
"context": "ue(@$q.when(\n data:[\n full_name: '123B HOMIEL-MINSK'\n code: '123B'\n ,\n full_",
"end": 14495,
"score": 0.9717757701873779,
"start": 14478,
"tag": "NAME",
"value": "123B HOMIEL-MINSK"
},
{
"context": " code: '123B'\n ,\n full_name: '333C BREST-MINSK'\n code: '333C'\n ,\n full_",
"end": 14568,
"score": 0.9993182420730591,
"start": 14552,
"tag": "NAME",
"value": "333C BREST-MINSK"
},
{
"context": " code: '333C'\n ,\n full_name: '232A MINSK-GRODNO'\n code: '232A'\n ]\n ",
"end": 14629,
"score": 0.99607253074646,
"start": 14625,
"tag": "NAME",
"value": "232A"
},
{
"context": " code: '333C'\n ,\n full_name: '232A MINSK-GRODNO'\n code: '232A'\n ]\n ))\n\n ",
"end": 14642,
"score": 0.9914992451667786,
"start": 14630,
"tag": "NAME",
"value": "MINSK-GRODNO"
},
{
"context": " expect(result).toEqual([\n full_name: '123B HOMIEL-MINSK'\n code: '123B'\n ,\n full_name: ",
"end": 15020,
"score": 0.9818586707115173,
"start": 15003,
"tag": "NAME",
"value": "123B HOMIEL-MINSK"
},
{
"context": "\n code: '123B'\n ,\n full_name: '333C BREST-MINSK'\n code: '333C'\n ,\n full_name: ",
"end": 15087,
"score": 0.9995526075363159,
"start": 15071,
"tag": "NAME",
"value": "333C BREST-MINSK"
},
{
"context": "\n code: '333C'\n ,\n full_name: '232A MINSK-GRODNO'\n code: '232A'\n ])\n",
"end": 15142,
"score": 0.9964948892593384,
"start": 15138,
"tag": "NAME",
"value": "232A"
},
{
"context": " code: '333C'\n ,\n full_name: '232A MINSK-GRODNO'\n code: '232A'\n ])\n",
"end": 15155,
"score": 0.9893441796302795,
"start": 15143,
"tag": "NAME",
"value": "MINSK-GRODNO"
}
] | src/app/pages/tasks/pages.tasks.spec.coffee | pavelkuchin/tracktrains-ui | 0 | describe 'PagesTasksCtrl', () ->
beforeEach(module('trackSeatsApp'))
beforeEach(inject((@$rootScope, $controller, DataService, $httpBackend,
@$q, @ALERTS_TYPE, @NAVIGATION) =>
$httpBackend.when('GET', '/v1/user/session/').respond({})
$httpBackend.when('GET', 'app/pages/landing/pages.landing.template.html')
.respond({})
@stubSession =
user:
resource_uri: 'not_real_user_resource_uri_just_for_test',
tasks_limit: 4
@stubAlertsService = jasmine.createSpyObj('AlertsService', ['showAlert'])
@stubAlertsService.TYPE = @ALERTS_TYPE
@stubDialogsService = jasmine.createSpyObj('DialogsService', ['confirmation'])
@stubDataService = jasmine.createSpyObj('DataService', [
'getTasks',
'saveTask',
'disableTask',
'enableTask',
'deleteTask',
'getStation',
'getTrain'
])
@expectedInitialTasksList = [
name: 'test1'
departure_point: 'from_test'
destination_point: 'to_test'
somefield: 'test data'
resource_uri: 'fake1'
,
name: 'test2'
departure_point: 'from_test'
destination_point: 'to_test'
somefield: 'test data'
resource_uri: 'fake2'
,
name: 'test3'
departure_point: 'from_test'
destination_point: 'to_test'
somefield: 'test data'
resource_uri: 'fake3'
,
name: 'test4'
departure_point: 'from_test'
destination_point: 'to_test'
somefield: 'test data'
resource_uri: 'fake4'
,
name: 'test5'
departure_point: 'from_test'
destination_point: 'to_test'
somefield: 'test data'
resource_uri: 'fake5'
,
name: 'test6'
departure_point: 'from_test'
destination_point: 'to_test'
somefield: 'test data'
resource_uri: 'fake6'
,
name: 'test7'
departure_point: 'from_test'
destination_point: 'to_test'
somefield: 'test data'
resource_uri: 'fake7'
,
name: 'test8'
departure_point: 'from_test'
destination_point: 'to_test'
somefield: 'test data'
resource_uri: 'fake8'
]
@expectedTasksList = [
[
name: 'test1'
departure_point: 'from_test'
destination_point: 'to_test'
somefield: 'test data'
resource_uri: 'fake1'
,
name: 'test2'
departure_point: 'from_test'
destination_point: 'to_test'
somefield: 'test data'
resource_uri: 'fake2'
,
name: 'test3'
departure_point: 'from_test'
destination_point: 'to_test'
somefield: 'test data'
resource_uri: 'fake3'
,
name: 'test4'
departure_point: 'from_test'
destination_point: 'to_test'
somefield: 'test data'
resource_uri: 'fake4'
],
[
name: 'test5'
departure_point: 'from_test'
destination_point: 'to_test'
somefield: 'test data'
resource_uri: 'fake5'
,
name: 'test6'
departure_point: 'from_test'
destination_point: 'to_test'
somefield: 'test data'
resource_uri: 'fake6'
,
name: 'test7'
departure_point: 'from_test'
destination_point: 'to_test'
somefield: 'test data'
resource_uri: 'fake7'
,
name: 'test8'
departure_point: 'from_test'
destination_point: 'to_test'
somefield: 'test data'
resource_uri: 'fake8'
]
]
@stubDataService.getTasks.and.returnValue(@$q.when(
data:
objects: @expectedInitialTasksList
))
@scope = $rootScope.$new()
@controller = $controller('PagesTasksCtrl',
$scope: @scope
AlertsService: @stubAlertsService
DataService: @stubDataService
DialogsService: @stubDialogsService
session: @stubSession
)
))
describe 'controller.constructor', () =>
it 'tasksList and initialTasksList are empty arrays before answer from server', () =>
expect(@controller.initialTasksList).toEqual([])
expect(@controller.tasksList).toEqual([])
it 'after server answered the initialTasksList has the data from server
and tasksList has the data chunked by 4', () =>
@$rootScope.$digest()
expect(@stubDataService.getTasks).toHaveBeenCalled()
expect(@controller.initialTasksList).toEqual(@expectedInitialTasksList)
expect(@controller.tasksList).toEqual(@expectedTasksList)
describe 'controller.createTask', () =>
it 'controller.newTask is a properly initialized task object', () =>
@controller.createTask()
expect(@controller.newTask).toEqual(
resource_uri: ''
departure_date: ''
departure_point: ''
destination_point: ''
train: ''
car: 'ANY'
seat: 'ANY'
is_active: true
owner: @stubSession.user.resource_uri
)
it 'controller.createNewTask is setted to true', () =>
@controller.createTask()
expect(@controller.createNewTask).toEqual(true)
it 'controller.createNewTask shows and error if tasks count exceed the limit', () =>
@$rootScope.$digest()
@controller.createTask()
expect(@stubAlertsService.showAlert).toHaveBeenCalledWith(
"Sorry, but the current system limitation is no more then 4 tasks per user.",
@ALERTS_TYPE.ERROR,
3000
)
expect(@controller.createNewTask).toEqual(false)
describe 'controller.save', () =>
it 'dataService.saveTask(task) was called for edit and alert showed', () =>
# Tatypie by default does not return created object back, lets emulate similar behavior
@stubDataService.saveTask.and.returnValue(@$q.when())
# We do not need the real structure for test, only name and resource_uri will
# be enough
testObj =
name: 'test name'
resource_uri: 'fake_task_resource'
@controller.save(testObj)
@$rootScope.$digest()
expect(@stubDataService.saveTask).toHaveBeenCalledWith(testObj)
expect(@stubAlertsService.showAlert).toHaveBeenCalledWith(
"The task successfully saved!"
@ALERTS_TYPE.SUCCESS,
3000
)
it 'dataService.saveTask(task) was called for creating a new item and alert was showed', () =>
# Tatypie by default does not return created object back, lets emulate similar behavior
@stubDataService.saveTask.and.returnValue(@$q.when())
# We do not need the real structure for test, only name and resource_uri will
# be enough, resource_uri is empty string because this is a new object
testObj =
name: 'test name'
somefield: 'test data'
resource_uri: ''
extInitialTasksList = angular.copy(@expectedInitialTasksList)
extTasksList = angular.copy(@expectedTasksList)
extInitialTasksList.push(testObj)
extTasksList.push([testObj])
@stubDataService.getTasks.and.returnValue(@$q.when(
data:
objects: extInitialTasksList
))
@controller.save(testObj)
@$rootScope.$digest()
expect(@stubDataService.saveTask).toHaveBeenCalledWith(testObj)
expect(@stubAlertsService.showAlert).toHaveBeenCalledWith(
"The task successfully saved!"
@ALERTS_TYPE.SUCCESS,
3000
)
expect(@stubDataService.getTasks).toHaveBeenCalled()
expect(@controller.initialTasksList).toEqual(extInitialTasksList)
expect(@controller.tasksList).toEqual(extTasksList)
describe 'controller.disable(task)', () =>
it 'dataService.disableTask(task) call is success and task.is_active is true', () =>
@stubDataService.disableTask.and.returnValue(@$q.when())
task =
name: 'test'
resource_uri: 'test'
is_active: true
@controller.disable(task)
@$rootScope.$digest()
expect(@stubDataService.disableTask).toHaveBeenCalledWith(task)
expect(task.is_active).toEqual(false)
it 'dataService.disableTask(task) call is failed and task.is_active is not changed', () =>
@stubDataService.disableTask.and.callFake(() =>
p = @$q.defer()
p.reject('')
p.promise
)
task =
name: 'test'
resource_uri: 'test'
is_active: true
@controller.disable(task)
@$rootScope.$digest()
expect(@stubDataService.disableTask).toHaveBeenCalledWith(task)
expect(task.is_active).toEqual(true)
describe 'controller.enable(task)', () =>
it 'dataService.enableTask(task) call is success and task.is_active is true', () =>
@stubDataService.enableTask.and.returnValue(@$q.when())
task =
name: 'test'
resource_uri: 'test'
is_active: false
@controller.enable(task)
@$rootScope.$digest()
expect(@stubDataService.enableTask).toHaveBeenCalledWith(task)
expect(task.is_active).toEqual(true)
it 'dataService.enableTask(task) call is failed and task.is_active is not changed', () =>
@stubDataService.enableTask.and.callFake(() =>
p = @$q.defer()
p.reject('')
p.promise
)
task =
name: 'test'
resource_uri: 'test'
is_active: false
@controller.enable(task)
@$rootScope.$digest()
expect(@stubDataService.enableTask).toHaveBeenCalledWith(task)
expect(task.is_active).toEqual(false)
describe 'controller.delete(task)', () =>
it 'if dataService.deleteTask(task) succesfully completed then remove item
from initialTasksList and re-chunk it to tasksList', () =>
@stubDataService.deleteTask.and.returnValue(@$q.when())
@stubDialogsService.confirmation.and.returnValue(@$q.when())
deletedItem = angular.copy(@expectedInitialTasksList[0])
@$rootScope.$digest()
expect(@controller.initialTasksList[0].name).toEqual('test1')
expect(@controller.tasksList[0][0].name).toEqual('test1')
task = @expectedInitialTasksList[0]
@controller.delete(task)
@$rootScope.$digest()
expect(@stubDialogsService.confirmation).toHaveBeenCalledWith(
"Delete task",
"Do you really want delete the task #{task.departure_point} - #{task.destination_point}"
)
expect(@stubDataService.deleteTask).toHaveBeenCalledWith(deletedItem)
expect(@controller.initialTasksList[0].name).toEqual('test2')
expect(@controller.tasksList[0][0].name).toEqual('test2')
it 'if dataService.deleteTask(task) completed with error then initialTasksList
and tasksList shall not be changed', () =>
@stubDialogsService.confirmation.and.returnValue(@$q.when())
@stubDataService.deleteTask.and.callFake(() =>
p = @$q.defer()
p.reject('')
p.promise
)
deletedItem = angular.copy(@expectedInitialTasksList[0])
@$rootScope.$digest()
expect(@controller.initialTasksList[0].name).toEqual('test1')
expect(@controller.tasksList[0][0].name).toEqual('test1')
@controller.delete(@expectedInitialTasksList[0])
@$rootScope.$digest()
expect(@stubDialogsService.confirmation).toHaveBeenCalled()
expect(@stubDataService.deleteTask).toHaveBeenCalledWith(deletedItem)
expect(@controller.initialTasksList[0].name).toEqual('test1')
expect(@controller.tasksList[0][0].name).toEqual('test1')
it 'if dataService.deleteTask(task) but user pressed no in a confirmation dialog
then the task should not be deleted.', () =>
@stubDataService.deleteTask.and.returnValue(@$q.when())
@stubDialogsService.confirmation.and.returnValue(@$q.when())
deletedItem = angular.copy(@expectedInitialTasksList[0])
@$rootScope.$digest()
expect(@controller.initialTasksList[0].name).toEqual('test1')
expect(@controller.tasksList[0][0].name).toEqual('test1')
task = @expectedInitialTasksList[0]
@controller.delete(task)
@$rootScope.$digest()
expect(@stubDialogsService.confirmation).toHaveBeenCalledWith(
"Delete task",
"Do you really want delete the task #{task.departure_point} - #{task.destination_point}"
)
expect(@stubDataService.deleteTask).toHaveBeenCalledWith(deletedItem)
expect(@controller.initialTasksList[0].name).toEqual('test2')
expect(@controller.tasksList[0][0].name).toEqual('test2')
it 'if dataService.deleteTask(task) completed with error then initialTasksList
and tasksList shall not be changed', () =>
@stubDataService.deleteTask.and.returnValue(@$q.when())
@stubDialogsService.confirmation.and.callFake(() =>
p = @$q.defer()
p.reject('')
p.promise
)
deletedItem = angular.copy(@expectedInitialTasksList[0])
@$rootScope.$digest()
expect(@controller.initialTasksList[0].name).toEqual('test1')
expect(@controller.tasksList[0][0].name).toEqual('test1')
@controller.delete(@expectedInitialTasksList[0])
@$rootScope.$digest()
expect(@stubDialogsService.confirmation).toHaveBeenCalled()
expect(@controller.initialTasksList[0].name).toEqual('test1')
expect(@controller.tasksList[0][0].name).toEqual('test1')
describe 'controller.getStation(station)', () =>
it 'return list of names', () =>
@stubDataService.getStation.and.returnValue(@$q.when(
data:[
name: 'test1'
full_name: 'test1 full'
code: '0'
,
name: 'test2'
full_name: 'test2 full'
code: '1'
,
name: 'test3'
full_name: 'test3 full'
code: '2'
]
))
result = []
stations = @controller.getStation('test')
stations.then (data) ->
result = data
@$rootScope.$digest()
expect(result).toEqual([
name: 'test1'
full_name: 'test1 full'
code: '0'
,
name: 'test2'
full_name: 'test2 full'
code: '1'
,
name: 'test3'
full_name: 'test3 full'
code: '2'
])
describe 'controller.getTrain(params)', () =>
it 'return list of trains', () =>
@stubDataService.getTrain.and.returnValue(@$q.when(
data:[
full_name: '123B HOMIEL-MINSK'
code: '123B'
,
full_name: '333C BREST-MINSK'
code: '333C'
,
full_name: '232A MINSK-GRODNO'
code: '232A'
]
))
result = []
params =
date: '10-10-2015'
departure: 'HOMIEL'
destination: 'MINSK'
train: 'HO'
trains = @controller.getTrains(params)
trains.then (data) ->
result = data
@$rootScope.$digest()
expect(result).toEqual([
full_name: '123B HOMIEL-MINSK'
code: '123B'
,
full_name: '333C BREST-MINSK'
code: '333C'
,
full_name: '232A MINSK-GRODNO'
code: '232A'
])
| 92329 | describe 'PagesTasksCtrl', () ->
beforeEach(module('trackSeatsApp'))
beforeEach(inject((@$rootScope, $controller, DataService, $httpBackend,
@$q, @ALERTS_TYPE, @NAVIGATION) =>
$httpBackend.when('GET', '/v1/user/session/').respond({})
$httpBackend.when('GET', 'app/pages/landing/pages.landing.template.html')
.respond({})
@stubSession =
user:
resource_uri: 'not_real_user_resource_uri_just_for_test',
tasks_limit: 4
@stubAlertsService = jasmine.createSpyObj('AlertsService', ['showAlert'])
@stubAlertsService.TYPE = @ALERTS_TYPE
@stubDialogsService = jasmine.createSpyObj('DialogsService', ['confirmation'])
@stubDataService = jasmine.createSpyObj('DataService', [
'getTasks',
'saveTask',
'disableTask',
'enableTask',
'deleteTask',
'getStation',
'getTrain'
])
@expectedInitialTasksList = [
name: '<NAME>'
departure_point: 'from_test'
destination_point: 'to_test'
somefield: 'test data'
resource_uri: 'fake1'
,
name: '<NAME>'
departure_point: 'from_test'
destination_point: 'to_test'
somefield: 'test data'
resource_uri: 'fake2'
,
name: '<NAME>'
departure_point: 'from_test'
destination_point: 'to_test'
somefield: 'test data'
resource_uri: 'fake3'
,
name: '<NAME>'
departure_point: 'from_test'
destination_point: 'to_test'
somefield: 'test data'
resource_uri: 'fake4'
,
name: '<NAME>'
departure_point: 'from_test'
destination_point: 'to_test'
somefield: 'test data'
resource_uri: 'fake5'
,
name: '<NAME>'
departure_point: 'from_test'
destination_point: 'to_<NAME>'
somefield: 'test data'
resource_uri: 'fake6'
,
name: '<NAME>'
departure_point: 'from_test'
destination_point: 'to_test'
somefield: 'test data'
resource_uri: 'fake7'
,
name: '<NAME>'
departure_point: 'from_test'
destination_point: 'to_test'
somefield: 'test data'
resource_uri: 'fake8'
]
@expectedTasksList = [
[
name: '<NAME>'
departure_point: 'from_test'
destination_point: 'to_test'
somefield: 'test data'
resource_uri: 'fake1'
,
name: '<NAME>'
departure_point: 'from_test'
destination_point: 'to_test'
somefield: 'test data'
resource_uri: 'fake2'
,
name: '<NAME>'
departure_point: 'from_test'
destination_point: 'to_test'
somefield: 'test data'
resource_uri: 'fake3'
,
name: '<NAME>'
departure_point: 'from_test'
destination_point: 'to_test'
somefield: 'test data'
resource_uri: 'fake4'
],
[
name: '<NAME>'
departure_point: 'from_test'
destination_point: 'to_test'
somefield: 'test data'
resource_uri: 'fake5'
,
name: '<NAME>'
departure_point: 'from_test'
destination_point: 'to_test'
somefield: 'test data'
resource_uri: 'fake6'
,
name: '<NAME>'
departure_point: 'from_test'
destination_point: 'to_test'
somefield: 'test data'
resource_uri: 'fake7'
,
name: '<NAME>'
departure_point: 'from_test'
destination_point: 'to_test'
somefield: 'test data'
resource_uri: 'fake8'
]
]
@stubDataService.getTasks.and.returnValue(@$q.when(
data:
objects: @expectedInitialTasksList
))
@scope = $rootScope.$new()
@controller = $controller('PagesTasksCtrl',
$scope: @scope
AlertsService: @stubAlertsService
DataService: @stubDataService
DialogsService: @stubDialogsService
session: @stubSession
)
))
describe 'controller.constructor', () =>
it 'tasksList and initialTasksList are empty arrays before answer from server', () =>
expect(@controller.initialTasksList).toEqual([])
expect(@controller.tasksList).toEqual([])
it 'after server answered the initialTasksList has the data from server
and tasksList has the data chunked by 4', () =>
@$rootScope.$digest()
expect(@stubDataService.getTasks).toHaveBeenCalled()
expect(@controller.initialTasksList).toEqual(@expectedInitialTasksList)
expect(@controller.tasksList).toEqual(@expectedTasksList)
describe 'controller.createTask', () =>
it 'controller.newTask is a properly initialized task object', () =>
@controller.createTask()
expect(@controller.newTask).toEqual(
resource_uri: ''
departure_date: ''
departure_point: ''
destination_point: ''
train: ''
car: 'ANY'
seat: 'ANY'
is_active: true
owner: @stubSession.user.resource_uri
)
it 'controller.createNewTask is setted to true', () =>
@controller.createTask()
expect(@controller.createNewTask).toEqual(true)
it 'controller.createNewTask shows and error if tasks count exceed the limit', () =>
@$rootScope.$digest()
@controller.createTask()
expect(@stubAlertsService.showAlert).toHaveBeenCalledWith(
"Sorry, but the current system limitation is no more then 4 tasks per user.",
@ALERTS_TYPE.ERROR,
3000
)
expect(@controller.createNewTask).toEqual(false)
describe 'controller.save', () =>
it 'dataService.saveTask(task) was called for edit and alert showed', () =>
# Tatypie by default does not return created object back, lets emulate similar behavior
@stubDataService.saveTask.and.returnValue(@$q.when())
# We do not need the real structure for test, only name and resource_uri will
# be enough
testObj =
name: '<NAME>'
resource_uri: 'fake_task_resource'
@controller.save(testObj)
@$rootScope.$digest()
expect(@stubDataService.saveTask).toHaveBeenCalledWith(testObj)
expect(@stubAlertsService.showAlert).toHaveBeenCalledWith(
"The task successfully saved!"
@ALERTS_TYPE.SUCCESS,
3000
)
it 'dataService.saveTask(task) was called for creating a new item and alert was showed', () =>
# Tatypie by default does not return created object back, lets emulate similar behavior
@stubDataService.saveTask.and.returnValue(@$q.when())
# We do not need the real structure for test, only name and resource_uri will
# be enough, resource_uri is empty string because this is a new object
testObj =
name: '<NAME>'
somefield: 'test data'
resource_uri: ''
extInitialTasksList = angular.copy(@expectedInitialTasksList)
extTasksList = angular.copy(@expectedTasksList)
extInitialTasksList.push(testObj)
extTasksList.push([testObj])
@stubDataService.getTasks.and.returnValue(@$q.when(
data:
objects: extInitialTasksList
))
@controller.save(testObj)
@$rootScope.$digest()
expect(@stubDataService.saveTask).toHaveBeenCalledWith(testObj)
expect(@stubAlertsService.showAlert).toHaveBeenCalledWith(
"The task successfully saved!"
@ALERTS_TYPE.SUCCESS,
3000
)
expect(@stubDataService.getTasks).toHaveBeenCalled()
expect(@controller.initialTasksList).toEqual(extInitialTasksList)
expect(@controller.tasksList).toEqual(extTasksList)
describe 'controller.disable(task)', () =>
it 'dataService.disableTask(task) call is success and task.is_active is true', () =>
@stubDataService.disableTask.and.returnValue(@$q.when())
task =
name: '<NAME>'
resource_uri: 'test'
is_active: true
@controller.disable(task)
@$rootScope.$digest()
expect(@stubDataService.disableTask).toHaveBeenCalledWith(task)
expect(task.is_active).toEqual(false)
it 'dataService.disableTask(task) call is failed and task.is_active is not changed', () =>
@stubDataService.disableTask.and.callFake(() =>
p = @$q.defer()
p.reject('')
p.promise
)
task =
name: '<NAME>'
resource_uri: 'test'
is_active: true
@controller.disable(task)
@$rootScope.$digest()
expect(@stubDataService.disableTask).toHaveBeenCalledWith(task)
expect(task.is_active).toEqual(true)
describe 'controller.enable(task)', () =>
it 'dataService.enableTask(task) call is success and task.is_active is true', () =>
@stubDataService.enableTask.and.returnValue(@$q.when())
task =
name: '<NAME>'
resource_uri: 'test'
is_active: false
@controller.enable(task)
@$rootScope.$digest()
expect(@stubDataService.enableTask).toHaveBeenCalledWith(task)
expect(task.is_active).toEqual(true)
it 'dataService.enableTask(task) call is failed and task.is_active is not changed', () =>
@stubDataService.enableTask.and.callFake(() =>
p = @$q.defer()
p.reject('')
p.promise
)
task =
name: '<NAME>'
resource_uri: 'test'
is_active: false
@controller.enable(task)
@$rootScope.$digest()
expect(@stubDataService.enableTask).toHaveBeenCalledWith(task)
expect(task.is_active).toEqual(false)
describe 'controller.delete(task)', () =>
it 'if dataService.deleteTask(task) succesfully completed then remove item
from initialTasksList and re-chunk it to tasksList', () =>
@stubDataService.deleteTask.and.returnValue(@$q.when())
@stubDialogsService.confirmation.and.returnValue(@$q.when())
deletedItem = angular.copy(@expectedInitialTasksList[0])
@$rootScope.$digest()
expect(@controller.initialTasksList[0].name).toEqual('test1')
expect(@controller.tasksList[0][0].name).toEqual('test1')
task = @expectedInitialTasksList[0]
@controller.delete(task)
@$rootScope.$digest()
expect(@stubDialogsService.confirmation).toHaveBeenCalledWith(
"Delete task",
"Do you really want delete the task #{task.departure_point} - #{task.destination_point}"
)
expect(@stubDataService.deleteTask).toHaveBeenCalledWith(deletedItem)
expect(@controller.initialTasksList[0].name).toEqual('test2')
expect(@controller.tasksList[0][0].name).toEqual('test2')
it 'if dataService.deleteTask(task) completed with error then initialTasksList
and tasksList shall not be changed', () =>
@stubDialogsService.confirmation.and.returnValue(@$q.when())
@stubDataService.deleteTask.and.callFake(() =>
p = @$q.defer()
p.reject('')
p.promise
)
deletedItem = angular.copy(@expectedInitialTasksList[0])
@$rootScope.$digest()
expect(@controller.initialTasksList[0].name).toEqual('test1')
expect(@controller.tasksList[0][0].name).toEqual('test1')
@controller.delete(@expectedInitialTasksList[0])
@$rootScope.$digest()
expect(@stubDialogsService.confirmation).toHaveBeenCalled()
expect(@stubDataService.deleteTask).toHaveBeenCalledWith(deletedItem)
expect(@controller.initialTasksList[0].name).toEqual('test1')
expect(@controller.tasksList[0][0].name).toEqual('test1')
it 'if dataService.deleteTask(task) but user pressed no in a confirmation dialog
then the task should not be deleted.', () =>
@stubDataService.deleteTask.and.returnValue(@$q.when())
@stubDialogsService.confirmation.and.returnValue(@$q.when())
deletedItem = angular.copy(@expectedInitialTasksList[0])
@$rootScope.$digest()
expect(@controller.initialTasksList[0].name).toEqual('test1')
expect(@controller.tasksList[0][0].name).toEqual('test1')
task = @expectedInitialTasksList[0]
@controller.delete(task)
@$rootScope.$digest()
expect(@stubDialogsService.confirmation).toHaveBeenCalledWith(
"Delete task",
"Do you really want delete the task #{task.departure_point} - #{task.destination_point}"
)
expect(@stubDataService.deleteTask).toHaveBeenCalledWith(deletedItem)
expect(@controller.initialTasksList[0].name).toEqual('test2')
expect(@controller.tasksList[0][0].name).toEqual('test2')
it 'if dataService.deleteTask(task) completed with error then initialTasksList
and tasksList shall not be changed', () =>
@stubDataService.deleteTask.and.returnValue(@$q.when())
@stubDialogsService.confirmation.and.callFake(() =>
p = @$q.defer()
p.reject('')
p.promise
)
deletedItem = angular.copy(@expectedInitialTasksList[0])
@$rootScope.$digest()
expect(@controller.initialTasksList[0].name).toEqual('test1')
expect(@controller.tasksList[0][0].name).toEqual('test1')
@controller.delete(@expectedInitialTasksList[0])
@$rootScope.$digest()
expect(@stubDialogsService.confirmation).toHaveBeenCalled()
expect(@controller.initialTasksList[0].name).toEqual('test1')
expect(@controller.tasksList[0][0].name).toEqual('test1')
describe 'controller.getStation(station)', () =>
it 'return list of names', () =>
@stubDataService.getStation.and.returnValue(@$q.when(
data:[
name: '<NAME>'
full_name: '<NAME>'
code: '0'
,
name: '<NAME>'
full_name: '<NAME>'
code: '1'
,
name: '<NAME>'
full_name: '<NAME>'
code: '2'
]
))
result = []
stations = @controller.getStation('test')
stations.then (data) ->
result = data
@$rootScope.$digest()
expect(result).toEqual([
name: '<NAME>'
full_name: '<NAME>'
code: '0'
,
name: '<NAME>'
full_name: '<NAME>'
code: '1'
,
name: '<NAME>'
full_name: '<NAME>'
code: '2'
])
describe 'controller.getTrain(params)', () =>
it 'return list of trains', () =>
@stubDataService.getTrain.and.returnValue(@$q.when(
data:[
full_name: '<NAME>'
code: '123B'
,
full_name: '<NAME>'
code: '333C'
,
full_name: '<NAME> <NAME>'
code: '232A'
]
))
result = []
params =
date: '10-10-2015'
departure: 'HOMIEL'
destination: 'MINSK'
train: 'HO'
trains = @controller.getTrains(params)
trains.then (data) ->
result = data
@$rootScope.$digest()
expect(result).toEqual([
full_name: '<NAME>'
code: '123B'
,
full_name: '<NAME>'
code: '333C'
,
full_name: '<NAME> <NAME>'
code: '232A'
])
| true | describe 'PagesTasksCtrl', () ->
beforeEach(module('trackSeatsApp'))
beforeEach(inject((@$rootScope, $controller, DataService, $httpBackend,
@$q, @ALERTS_TYPE, @NAVIGATION) =>
$httpBackend.when('GET', '/v1/user/session/').respond({})
$httpBackend.when('GET', 'app/pages/landing/pages.landing.template.html')
.respond({})
@stubSession =
user:
resource_uri: 'not_real_user_resource_uri_just_for_test',
tasks_limit: 4
@stubAlertsService = jasmine.createSpyObj('AlertsService', ['showAlert'])
@stubAlertsService.TYPE = @ALERTS_TYPE
@stubDialogsService = jasmine.createSpyObj('DialogsService', ['confirmation'])
@stubDataService = jasmine.createSpyObj('DataService', [
'getTasks',
'saveTask',
'disableTask',
'enableTask',
'deleteTask',
'getStation',
'getTrain'
])
@expectedInitialTasksList = [
name: 'PI:NAME:<NAME>END_PI'
departure_point: 'from_test'
destination_point: 'to_test'
somefield: 'test data'
resource_uri: 'fake1'
,
name: 'PI:NAME:<NAME>END_PI'
departure_point: 'from_test'
destination_point: 'to_test'
somefield: 'test data'
resource_uri: 'fake2'
,
name: 'PI:NAME:<NAME>END_PI'
departure_point: 'from_test'
destination_point: 'to_test'
somefield: 'test data'
resource_uri: 'fake3'
,
name: 'PI:NAME:<NAME>END_PI'
departure_point: 'from_test'
destination_point: 'to_test'
somefield: 'test data'
resource_uri: 'fake4'
,
name: 'PI:NAME:<NAME>END_PI'
departure_point: 'from_test'
destination_point: 'to_test'
somefield: 'test data'
resource_uri: 'fake5'
,
name: 'PI:NAME:<NAME>END_PI'
departure_point: 'from_test'
destination_point: 'to_PI:NAME:<NAME>END_PI'
somefield: 'test data'
resource_uri: 'fake6'
,
name: 'PI:NAME:<NAME>END_PI'
departure_point: 'from_test'
destination_point: 'to_test'
somefield: 'test data'
resource_uri: 'fake7'
,
name: 'PI:NAME:<NAME>END_PI'
departure_point: 'from_test'
destination_point: 'to_test'
somefield: 'test data'
resource_uri: 'fake8'
]
@expectedTasksList = [
[
name: 'PI:NAME:<NAME>END_PI'
departure_point: 'from_test'
destination_point: 'to_test'
somefield: 'test data'
resource_uri: 'fake1'
,
name: 'PI:NAME:<NAME>END_PI'
departure_point: 'from_test'
destination_point: 'to_test'
somefield: 'test data'
resource_uri: 'fake2'
,
name: 'PI:NAME:<NAME>END_PI'
departure_point: 'from_test'
destination_point: 'to_test'
somefield: 'test data'
resource_uri: 'fake3'
,
name: 'PI:NAME:<NAME>END_PI'
departure_point: 'from_test'
destination_point: 'to_test'
somefield: 'test data'
resource_uri: 'fake4'
],
[
name: 'PI:NAME:<NAME>END_PI'
departure_point: 'from_test'
destination_point: 'to_test'
somefield: 'test data'
resource_uri: 'fake5'
,
name: 'PI:NAME:<NAME>END_PI'
departure_point: 'from_test'
destination_point: 'to_test'
somefield: 'test data'
resource_uri: 'fake6'
,
name: 'PI:NAME:<NAME>END_PI'
departure_point: 'from_test'
destination_point: 'to_test'
somefield: 'test data'
resource_uri: 'fake7'
,
name: 'PI:NAME:<NAME>END_PI'
departure_point: 'from_test'
destination_point: 'to_test'
somefield: 'test data'
resource_uri: 'fake8'
]
]
@stubDataService.getTasks.and.returnValue(@$q.when(
data:
objects: @expectedInitialTasksList
))
@scope = $rootScope.$new()
@controller = $controller('PagesTasksCtrl',
$scope: @scope
AlertsService: @stubAlertsService
DataService: @stubDataService
DialogsService: @stubDialogsService
session: @stubSession
)
))
describe 'controller.constructor', () =>
it 'tasksList and initialTasksList are empty arrays before answer from server', () =>
expect(@controller.initialTasksList).toEqual([])
expect(@controller.tasksList).toEqual([])
it 'after server answered the initialTasksList has the data from server
and tasksList has the data chunked by 4', () =>
@$rootScope.$digest()
expect(@stubDataService.getTasks).toHaveBeenCalled()
expect(@controller.initialTasksList).toEqual(@expectedInitialTasksList)
expect(@controller.tasksList).toEqual(@expectedTasksList)
describe 'controller.createTask', () =>
it 'controller.newTask is a properly initialized task object', () =>
@controller.createTask()
expect(@controller.newTask).toEqual(
resource_uri: ''
departure_date: ''
departure_point: ''
destination_point: ''
train: ''
car: 'ANY'
seat: 'ANY'
is_active: true
owner: @stubSession.user.resource_uri
)
it 'controller.createNewTask is setted to true', () =>
@controller.createTask()
expect(@controller.createNewTask).toEqual(true)
it 'controller.createNewTask shows and error if tasks count exceed the limit', () =>
@$rootScope.$digest()
@controller.createTask()
expect(@stubAlertsService.showAlert).toHaveBeenCalledWith(
"Sorry, but the current system limitation is no more then 4 tasks per user.",
@ALERTS_TYPE.ERROR,
3000
)
expect(@controller.createNewTask).toEqual(false)
describe 'controller.save', () =>
it 'dataService.saveTask(task) was called for edit and alert showed', () =>
# Tatypie by default does not return created object back, lets emulate similar behavior
@stubDataService.saveTask.and.returnValue(@$q.when())
# We do not need the real structure for test, only name and resource_uri will
# be enough
testObj =
name: 'PI:NAME:<NAME>END_PI'
resource_uri: 'fake_task_resource'
@controller.save(testObj)
@$rootScope.$digest()
expect(@stubDataService.saveTask).toHaveBeenCalledWith(testObj)
expect(@stubAlertsService.showAlert).toHaveBeenCalledWith(
"The task successfully saved!"
@ALERTS_TYPE.SUCCESS,
3000
)
it 'dataService.saveTask(task) was called for creating a new item and alert was showed', () =>
# Tatypie by default does not return created object back, lets emulate similar behavior
@stubDataService.saveTask.and.returnValue(@$q.when())
# We do not need the real structure for test, only name and resource_uri will
# be enough, resource_uri is empty string because this is a new object
testObj =
name: 'PI:NAME:<NAME>END_PI'
somefield: 'test data'
resource_uri: ''
extInitialTasksList = angular.copy(@expectedInitialTasksList)
extTasksList = angular.copy(@expectedTasksList)
extInitialTasksList.push(testObj)
extTasksList.push([testObj])
@stubDataService.getTasks.and.returnValue(@$q.when(
data:
objects: extInitialTasksList
))
@controller.save(testObj)
@$rootScope.$digest()
expect(@stubDataService.saveTask).toHaveBeenCalledWith(testObj)
expect(@stubAlertsService.showAlert).toHaveBeenCalledWith(
"The task successfully saved!"
@ALERTS_TYPE.SUCCESS,
3000
)
expect(@stubDataService.getTasks).toHaveBeenCalled()
expect(@controller.initialTasksList).toEqual(extInitialTasksList)
expect(@controller.tasksList).toEqual(extTasksList)
describe 'controller.disable(task)', () =>
it 'dataService.disableTask(task) call is success and task.is_active is true', () =>
@stubDataService.disableTask.and.returnValue(@$q.when())
task =
name: 'PI:NAME:<NAME>END_PI'
resource_uri: 'test'
is_active: true
@controller.disable(task)
@$rootScope.$digest()
expect(@stubDataService.disableTask).toHaveBeenCalledWith(task)
expect(task.is_active).toEqual(false)
it 'dataService.disableTask(task) call is failed and task.is_active is not changed', () =>
@stubDataService.disableTask.and.callFake(() =>
p = @$q.defer()
p.reject('')
p.promise
)
task =
name: 'PI:NAME:<NAME>END_PI'
resource_uri: 'test'
is_active: true
@controller.disable(task)
@$rootScope.$digest()
expect(@stubDataService.disableTask).toHaveBeenCalledWith(task)
expect(task.is_active).toEqual(true)
describe 'controller.enable(task)', () =>
it 'dataService.enableTask(task) call is success and task.is_active is true', () =>
@stubDataService.enableTask.and.returnValue(@$q.when())
task =
name: 'PI:NAME:<NAME>END_PI'
resource_uri: 'test'
is_active: false
@controller.enable(task)
@$rootScope.$digest()
expect(@stubDataService.enableTask).toHaveBeenCalledWith(task)
expect(task.is_active).toEqual(true)
it 'dataService.enableTask(task) call is failed and task.is_active is not changed', () =>
@stubDataService.enableTask.and.callFake(() =>
p = @$q.defer()
p.reject('')
p.promise
)
task =
name: 'PI:NAME:<NAME>END_PI'
resource_uri: 'test'
is_active: false
@controller.enable(task)
@$rootScope.$digest()
expect(@stubDataService.enableTask).toHaveBeenCalledWith(task)
expect(task.is_active).toEqual(false)
describe 'controller.delete(task)', () =>
it 'if dataService.deleteTask(task) succesfully completed then remove item
from initialTasksList and re-chunk it to tasksList', () =>
@stubDataService.deleteTask.and.returnValue(@$q.when())
@stubDialogsService.confirmation.and.returnValue(@$q.when())
deletedItem = angular.copy(@expectedInitialTasksList[0])
@$rootScope.$digest()
expect(@controller.initialTasksList[0].name).toEqual('test1')
expect(@controller.tasksList[0][0].name).toEqual('test1')
task = @expectedInitialTasksList[0]
@controller.delete(task)
@$rootScope.$digest()
expect(@stubDialogsService.confirmation).toHaveBeenCalledWith(
"Delete task",
"Do you really want delete the task #{task.departure_point} - #{task.destination_point}"
)
expect(@stubDataService.deleteTask).toHaveBeenCalledWith(deletedItem)
expect(@controller.initialTasksList[0].name).toEqual('test2')
expect(@controller.tasksList[0][0].name).toEqual('test2')
it 'if dataService.deleteTask(task) completed with error then initialTasksList
and tasksList shall not be changed', () =>
@stubDialogsService.confirmation.and.returnValue(@$q.when())
@stubDataService.deleteTask.and.callFake(() =>
p = @$q.defer()
p.reject('')
p.promise
)
deletedItem = angular.copy(@expectedInitialTasksList[0])
@$rootScope.$digest()
expect(@controller.initialTasksList[0].name).toEqual('test1')
expect(@controller.tasksList[0][0].name).toEqual('test1')
@controller.delete(@expectedInitialTasksList[0])
@$rootScope.$digest()
expect(@stubDialogsService.confirmation).toHaveBeenCalled()
expect(@stubDataService.deleteTask).toHaveBeenCalledWith(deletedItem)
expect(@controller.initialTasksList[0].name).toEqual('test1')
expect(@controller.tasksList[0][0].name).toEqual('test1')
it 'if dataService.deleteTask(task) but user pressed no in a confirmation dialog
then the task should not be deleted.', () =>
@stubDataService.deleteTask.and.returnValue(@$q.when())
@stubDialogsService.confirmation.and.returnValue(@$q.when())
deletedItem = angular.copy(@expectedInitialTasksList[0])
@$rootScope.$digest()
expect(@controller.initialTasksList[0].name).toEqual('test1')
expect(@controller.tasksList[0][0].name).toEqual('test1')
task = @expectedInitialTasksList[0]
@controller.delete(task)
@$rootScope.$digest()
expect(@stubDialogsService.confirmation).toHaveBeenCalledWith(
"Delete task",
"Do you really want delete the task #{task.departure_point} - #{task.destination_point}"
)
expect(@stubDataService.deleteTask).toHaveBeenCalledWith(deletedItem)
expect(@controller.initialTasksList[0].name).toEqual('test2')
expect(@controller.tasksList[0][0].name).toEqual('test2')
it 'if dataService.deleteTask(task) completed with error then initialTasksList
and tasksList shall not be changed', () =>
@stubDataService.deleteTask.and.returnValue(@$q.when())
@stubDialogsService.confirmation.and.callFake(() =>
p = @$q.defer()
p.reject('')
p.promise
)
deletedItem = angular.copy(@expectedInitialTasksList[0])
@$rootScope.$digest()
expect(@controller.initialTasksList[0].name).toEqual('test1')
expect(@controller.tasksList[0][0].name).toEqual('test1')
@controller.delete(@expectedInitialTasksList[0])
@$rootScope.$digest()
expect(@stubDialogsService.confirmation).toHaveBeenCalled()
expect(@controller.initialTasksList[0].name).toEqual('test1')
expect(@controller.tasksList[0][0].name).toEqual('test1')
describe 'controller.getStation(station)', () =>
it 'return list of names', () =>
@stubDataService.getStation.and.returnValue(@$q.when(
data:[
name: 'PI:NAME:<NAME>END_PI'
full_name: 'PI:NAME:<NAME>END_PI'
code: '0'
,
name: 'PI:NAME:<NAME>END_PI'
full_name: 'PI:NAME:<NAME>END_PI'
code: '1'
,
name: 'PI:NAME:<NAME>END_PI'
full_name: 'PI:NAME:<NAME>END_PI'
code: '2'
]
))
result = []
stations = @controller.getStation('test')
stations.then (data) ->
result = data
@$rootScope.$digest()
expect(result).toEqual([
name: 'PI:NAME:<NAME>END_PI'
full_name: 'PI:NAME:<NAME>END_PI'
code: '0'
,
name: 'PI:NAME:<NAME>END_PI'
full_name: 'PI:NAME:<NAME>END_PI'
code: '1'
,
name: 'PI:NAME:<NAME>END_PI'
full_name: 'PI:NAME:<NAME>END_PI'
code: '2'
])
describe 'controller.getTrain(params)', () =>
it 'return list of trains', () =>
@stubDataService.getTrain.and.returnValue(@$q.when(
data:[
full_name: 'PI:NAME:<NAME>END_PI'
code: '123B'
,
full_name: 'PI:NAME:<NAME>END_PI'
code: '333C'
,
full_name: 'PI:NAME:<NAME>END_PI PI:NAME:<NAME>END_PI'
code: '232A'
]
))
result = []
params =
date: '10-10-2015'
departure: 'HOMIEL'
destination: 'MINSK'
train: 'HO'
trains = @controller.getTrains(params)
trains.then (data) ->
result = data
@$rootScope.$digest()
expect(result).toEqual([
full_name: 'PI:NAME:<NAME>END_PI'
code: '123B'
,
full_name: 'PI:NAME:<NAME>END_PI'
code: '333C'
,
full_name: 'PI:NAME:<NAME>END_PI PI:NAME:<NAME>END_PI'
code: '232A'
])
|
[
{
"context": "lass CustomSearch extends Widget\n constructor: (@name, @parentView, @widgetOpenBool) ->\n # console.d",
"end": 4414,
"score": 0.589633584022522,
"start": 4410,
"tag": "USERNAME",
"value": "name"
},
{
"context": "efreshView: 'conversations'\n keyName: 'kiwi_userPreferences'\n newValue: popupParcel.kiwi_userPrefe",
"end": 19122,
"score": 0.9995174407958984,
"start": 19102,
"tag": "KEY",
"value": "kiwi_userPreferences"
},
{
"context": "efreshView: 'conversations'\n keyName: 'kiwi_userPreferences'\n newValue: popupParcel.kiwi_userPrefe",
"end": 30327,
"score": 0.9995759725570679,
"start": 30307,
"tag": "KEY",
"value": "kiwi_userPreferences"
},
{
"context": " = \", <a target='_blank' href='https://github.com/producthunt/producthunt-api/wiki/Product-Hunt-APIs#algolia-se",
"end": 39903,
"score": 0.9343862533569336,
"start": 39892,
"tag": "USERNAME",
"value": "producthunt"
},
{
"context": "friendly APIs! <a href='https://twitter.com/spencenow' target='_blank'>Tweet me</a> if you're intereste",
"end": 43508,
"score": 0.9995611906051636,
"start": 43499,
"tag": "USERNAME",
"value": "spencenow"
},
{
"context": "shView: 'userPreferences'\n keyName: 'kiwi_servicesInfo'\n newValue: popupParcel.kiwi_service",
"end": 45355,
"score": 0.9993076324462891,
"start": 45338,
"tag": "KEY",
"value": "kiwi_servicesInfo"
},
{
"context": "shView: 'userPreferences'\n keyName: 'kiwi_servicesInfo'\n newValue: popupParcel.kiwi_service",
"end": 45892,
"score": 0.9992901086807251,
"start": 45875,
"tag": "KEY",
"value": "kiwi_servicesInfo"
},
{
"context": "reshView: 'userPreferences'\n keyName: 'kiwi_userPreferences'\n newValue: popupParcel.kiwi_userPrefe",
"end": 47199,
"score": 0.9995412826538086,
"start": 47179,
"tag": "KEY",
"value": "kiwi_userPreferences"
},
{
"context": "reshView: 'userPreferences'\n keyName: 'kiwi_userPreferences'\n newValue: popupParcel.kiwi_userPrefe",
"end": 47934,
"score": 0.999557614326477,
"start": 47914,
"tag": "KEY",
"value": "kiwi_userPreferences"
},
{
"context": "ty @ProductHunt. \"\n # kiwi_author_name: \"Ben Tossell\"\n # kiwi_author_username: \"bentossell\"\n ",
"end": 62936,
"score": 0.9999018311500549,
"start": 62925,
"tag": "NAME",
"value": "Ben Tossell"
},
{
"context": " \"Ben Tossell\"\n # kiwi_author_username: \"bentossell\"\n # kiwi_discussion_url: \"http://www.pro",
"end": 62983,
"score": 0.9996249079704285,
"start": 62973,
"tag": "USERNAME",
"value": "bentossell"
},
{
"context": "ne: \"Co-founder/CEO, Buffer\"\n # name: \"Joel Gascoigne\"\n # profile_url: \"http://www.producthu",
"end": 63200,
"score": 0.9999077916145325,
"start": 63186,
"tag": "NAME",
"value": "Joel Gascoigne"
},
{
"context": " # profile_url: \"http://www.producthunt.com/@joelgascoigne\"\n # username: \"joelgascoigne\"\n ",
"end": 63271,
"score": 0.9699117541313171,
"start": 63257,
"tag": "USERNAME",
"value": "@joelgascoigne"
},
{
"context": "hunt.com/@joelgascoigne\"\n # username: \"joelgascoigne\"\n # website_url: \"http://joel.is\"\n ",
"end": 63311,
"score": 0.9996906518936157,
"start": 63298,
"tag": "USERNAME",
"value": "joelgascoigne"
},
{
"context": " \n if listing.kiwi_author_username == maker.username\n preppedHTMLstring += \" (also submit",
"end": 66023,
"score": 0.6994614005088806,
"start": 66010,
"tag": "USERNAME",
"value": "aker.username"
}
] | coffeescripts--content-scripts/KiwiPopup.coffee | sdailey/kiwi-firefox | 5 |
viewElementId = ''
renderedBool = false
preferencesOnlyPage = false
initialize = (popupParcel) ->
# console.log 'in init'
if getURLParam(window.location, 'optionsOnly') != ''
preferencesOnlyPage = true
switchViews.userPreferences.render(popupParcel)
return 0
for viewName, view of fixedViews
view.init(popupParcel)
# views.userPreferences.render(popupParcel)
if popupParcel.view? and switchViews[popupParcel.view]?
switchViews[popupParcel.view].render(popupParcel)
else
switchViews.conversations.render(popupParcel)
class Widget # basic building block
constructor: (@name, @parentView, @__renderStates__) ->
@elsToUnbind = []
@totalRenders = 0
@DOMselector = @parentView.DOMselector + " #" + @name + "_Widget"
@Widgets = {}
@bindAllGoToViewButtons = (viewData) =>
for _viewName, viewValue of switchViews
# console.log _viewName
# bind to goToView buttons
els_goTo_view = $(@DOMselector + ' .goTo_' + _viewName + 'View')
# console.debug els_goTo_view
@elsToUnbind.push els_goTo_view
bindGoToViewButtons(els_goTo_view, _viewName, viewData)
@unbindWidget = =>
for el in @elsToUnbind
el.unbind()
@elsToUnbind = []
@render = (renderState, popupParcel) =>
@totalRenders++
@unbindWidget(@name)
@renderStates[renderState].paint(popupParcel)
@bindAllGoToViewButtons(popupParcel)
@renderStates[renderState].bind(popupParcel)
@renderStates = @__renderStates__()
return @
class MessageCenter extends Widget
constructor: (@name, @parentView, @widgetOpenBool) ->
# console.debug @__renderStates__
# console.log ' trying '
super @name, @parentView, @__renderStates__
init: (popupParcel) ->
@unbindWidget()
@render('showMessages',popupParcel)
__renderStates__: =>
showMessages:
paint: (popupParcel) =>
# console.log 'messagesHTML = ""
# console.debug popupParcel'
messagesHTML = ""
# console.debug popupParcel
if popupParcel.kiwi_userMessages.length > 0
messagesHTML += '<div style="padding-top:4px; padding-bottom:10px;">'
for messageObj in popupParcel.kiwi_userMessages
messagesHTML += '<div class="bg-warning" style="margin:6px; padding:8px; text-align:justify;">
<button style="float:right; margin:8px; padding:4px; padding-right:6px; padding-left:6px;" class="btn btn-xs btn-default acknowledgeMessage" data-messageToAcknowledge="' + messageObj.name + '" >
<span title="remove" data-messageToAcknowledge="' + messageObj.name + '"
class="glyphicon glyphicon-remove" aria-hidden="true"
style="color:#E65F5F;"
></span>
</button>
' + messageObj.baseValue + '
</div>'
messagesHTML += '<div style="width:100%; text-align:center;"> <b>message priority</b>: urgent.
please acknowledge the message(s) by clicking the "x" button(s). Thanks! :)
</div></div>'
$(@DOMselector).html(messagesHTML)
# $(@DOMselector + " .notFixed").css({'height':fixedHeight + "px"})
bind: (popupParcel) =>
if popupParcel.kiwi_userMessages.length > 0
# console.log 'bind: (popupParcel) =>'
ackMessageButtons = $(@DOMselector + ' .acknowledgeMessage')
@elsToUnbind = @elsToUnbind.concat ackMessageButtons
ackMessageButtons.bind 'click', (ev) =>
console.log "trying for ackMessageButtons.bind 'click', (ev) =>"
messageToAcknowledge = $(ev.target).attr('data-messageToAcknowledge')
console.log 'messageToAcknowledge ' + messageToAcknowledge
# console.debug popupParcel.kiwi_userPreferences.urlSubstring_whitelists.anyMatch
# console.debug whitelistSubString
parcel =
messageToAcknowledge: messageToAcknowledge
msg: 'kiwiPP_acknowledgeMessage'
sendParcel(parcel)
class CustomSearch extends Widget
constructor: (@name, @parentView, @widgetOpenBool) ->
# console.debug @__renderStates__
super @name, @parentView, @__renderStates__
init: (popupParcel) ->
@Widgets = {messageCenter: new MessageCenter 'messageCenter', @, false}
@unbindWidget()
if @widgetOpenBool == false
@render('collapsed',popupParcel)
else
@render('opened',popupParcel)
__renderStates__: =>
collapsed:
paint: (popupParcel) =>
openedCustomSearchHTML = '
<div class="topSearchBar" style="padding-bottom: 14px;">
<div class="evenlySpacedContainer">
<input class="queryInputOpen" id="customSearchQueryInput" type="text" placeholder=" combined search" />
<button class="btn btn-mini btn-default goTo_userPreferencesView">User Options
<span class="glyphicon glyphicon-chevron-right" aria-hidden="true"></span></button>
</div>
'
if popupParcel.kiwi_customSearchResults.queryString? and popupParcel.kiwi_customSearchResults.queryString != ''
openedCustomSearchHTML += "<div style='padding-top: 12px;'><a id='openPreviousSearch'>see custom results for '" + popupParcel.kiwi_customSearchResults.queryString + "'
</a> <a id='clearPreviousSearch'>clear</a></div>"
openedCustomSearchHTML += "
<div id='messageCenter_Widget'></div>
</div>
<div class='notFixed'></div>"
$(@DOMselector).html(openedCustomSearchHTML)
# console?.log 'console.log @DOMselector + " .topSearchBar"' + @DOMselector + " .topSearchBar"
duplicateFixedHeight = =>
fixedElHeight = $(@DOMselector + " .topSearchBar").outerHeight()
# console.log 'console.log fixedElHeight closed'
# console.log fixedElHeight
if popupParcel.kiwi_userMessages? and popupParcel.kiwi_userMessages.length > 0
fixedElHeight += 70 + popupParcel.kiwi_userMessages.length * 60
if fixedElHeight == 0
setTimeout -> # defer to next browser event tick
duplicateFixedHeight()
, 0
else
$(@DOMselector + " .notFixed").css({'height':fixedElHeight + "px"})
duplicateFixedHeight()
@Widgets.messageCenter.render('showMessages', popupParcel)
# $(@DOMselector + " .notFixed").css({'height':fixedHeight + "px"})
bind: (popupParcel) =>
# console.log 'bind: (popupParcel) =>'
inputSearchQueryInput = $("#customSearchQueryInput")
previousSearchLink = $("#openPreviousSearch")
clearPreviousSearch = $("#clearPreviousSearch")
@elsToUnbind = @elsToUnbind.concat inputSearchQueryInput, previousSearchLink, clearPreviousSearch
previousSearchLink.bind 'click', ->
$("#customSearchQueryInput").click()
clearPreviousSearch.bind 'click', ->
parcel =
msg: 'kiwiPP_refreshSearchQuery'
sendParcel(parcel)
inputSearchQueryInput.bind 'click', =>
# console.log '@widgetOpenBool = true'
@widgetOpenBool = true
@render('opened',popupParcel)
opened:
paint: (popupParcel) =>
# console.log 'popupParcel.kiwi_servicesInfo.length'
# console.log popupParcel.kiwi_servicesInfo.length
queryString = if popupParcel.kiwi_customSearchResults.queryString? then popupParcel.kiwi_customSearchResults.queryString else ''
openedCustomSearchHTML = '<div class="topSearchBar">
<div class="evenlySpacedContainer">
<input id="customSearchQueryInput" value="' + queryString + '" type="text" placeholder=" combined search" style="width:234px; margin-right: 10px;" />
<button class="btn btn-mini btn-default" id="customSearchQuerySubmit" style="margin-right: 10px;">Submit</button>
<button style="" class="goTo_userPreferencesView btn btn-mini btn-default"> Options
<span class="glyphicon glyphicon-chevron-right" aria-hidden="true"></span></button>
</div>
<br>
<div class="evenlySpacedContainer" style="position: relative; top: -8px; margin-bottom: 3px;">'
for serviceInfoObject in popupParcel.kiwi_servicesInfo
openedCustomSearchHTML += '<div>'
# console.log 'asdfasdf ' + serviceInfoObject.name
# console.debug serviceInfoObject
if serviceInfoObject.active == 'off'
serviceDisabledAttr = ' disabled title="Service must be active, can be changed in options." '
else
serviceDisabledAttr = ' '
if popupParcel.kiwi_customSearchResults.servicesSearchesRequested? and popupParcel.kiwi_customSearchResults.servicesSearchesRequested[serviceInfoObject.name]?
activeClass = ' active '
ariaPressedState = 'true'
else if !popupParcel.kiwi_customSearchResults.servicesSearchesRequested?
activeClass = if serviceInfoObject.active is 'off' then ' ' else ' active '
ariaPressedState = if serviceInfoObject.active is 'off' then 'false' else 'true'
else
activeClass = ' '
ariaPressedState = 'false'
if serviceInfoObject.customSearchTags? and Object.keys(serviceInfoObject.customSearchTags).length > 0
openedCustomSearchHTML += '<div class="btn-group">
<button data-toggle="button" aria-pressed="' + ariaPressedState + '" autocomplete="off" ' + serviceDisabledAttr + '
class="servicesToSearch btn btn-default btn-mini dropdownLabel ' + activeClass + '" data-serviceName="' + serviceInfoObject.name + '">
' + serviceInfoObject.title + '
</button>
<button ' + serviceDisabledAttr + ' data-toggle="dropdown" class="btn btn-default dropdown-toggle ' + activeClass + '
dropDownPrefs_' + serviceInfoObject.name + '" data-placeholder="false"><span class="caret"></span></button>
<ul class="dropdown-menu">'
for tagName, tagObject of serviceInfoObject.customSearchTags
if popupParcel.kiwi_customSearchResults.servicesSearchesRequested? and popupParcel.kiwi_customSearchResults.servicesSearchesRequested[serviceInfoObject.name]?
if popupParcel.kiwi_customSearchResults.servicesSearchesRequested[serviceInfoObject.name].customSearchTags[tagName]?
tagActiveChecked = ' checked '
else
tagActiveChecked = ''
else
tagActiveChecked = if tagObject.include is true then ' checked ' else ''
tagDisabledAttr = if serviceInfoObject.active is 'off' then ' disabled title="Service must be active, can be changed in options." ' else ''
openedCustomSearchHTML += '<li><input ' + tagActiveChecked + tagDisabledAttr + ' type="checkbox" value="' + tagName + '" class="tagPref tagPref_' + serviceInfoObject.name + '" id="' + serviceInfoObject.name + tagName + '">
<label for="' + serviceInfoObject.name + tagName + '">
' + tagObject.title + '
</label></li>'
openedCustomSearchHTML += '</ul></div>'
else
openedCustomSearchHTML += '<button data-toggle="button" aria-pressed="' + ariaPressedState + '" autocomplete="off"
type="button" class="servicesToSearch btn btn-mini btn-default ' + activeClass + '" data-serviceName="' + serviceInfoObject.name + '">
' + serviceInfoObject.title + '
</button>'
openedCustomSearchHTML += '</div>'
openedCustomSearchHTML += '<div>
<button aria-pressed="false" autocomplete="off" type="button" class="btn btn-mini btn-default"
id="close__' + @name + '"
>
close <span class="glyphicon glyphicon-remove" aria-hidden="true"></span>
</button>
</div>
</div>'
openedCustomSearchHTML += '
<div id="messageCenter_Widget">asdfasd</div>
</div>
<div class="notFixed"></div>
<div id="customSearchResults"></div>
'
resultsSummaryArray = []
customSearchResultsHTML = ""
if popupParcel.kiwi_customSearchResults? and popupParcel.kiwi_customSearchResults.queryString? and
popupParcel.kiwi_customSearchResults.queryString != ''
for serviceInfoObject, index in popupParcel.kiwi_servicesInfo
if popupParcel.kiwi_customSearchResults.servicesSearched[serviceInfoObject.name]?
service_PreppedResults = popupParcel.kiwi_customSearchResults.servicesSearched[serviceInfoObject.name].results
resultsSummaryArray.push("<a class='jumpTo' data-serviceindex='" + index + "'>" + serviceInfoObject.title + " (" + service_PreppedResults.length + ")</a>")
customSearchResultsHTML += tailorResults[serviceInfoObject.name](serviceInfoObject, service_PreppedResults, popupParcel.kiwi_userPreferences)
if service_PreppedResults.length > 14
customSearchResultsHTML += '<div class="listing showHidden" data-servicename="' + serviceInfoObject.name + '"> show remaining ' + (service_PreppedResults.length - 11) + ' results</div>'
else
customSearchResultsHTML += '<br>No results for ' + serviceInfoObject.title + '<br>'
# customSearchResultsHTML += '</div>'
else
customSearchResultsHTML += '<div id="customSearchResultsDrop"><br>No results to show... make a search! :) </div><br>'
customSearchResultsHTML = "<div style='width: 100%; text-align: center;font-size:.9em;'>" + resultsSummaryArray.join(" - ") + "</div>" + customSearchResultsHTML
customSearchResultsHTML += "<br>"
$(@DOMselector).html(openedCustomSearchHTML)
$(@DOMselector + " #customSearchResults").html(customSearchResultsHTML)
$(@DOMselector + " .hidden_listing").hide()
duplicateFixedHeight = =>
fixedElHeight = $(@DOMselector + " .topSearchBar").outerHeight()
# console.log 'console.log fixedElHeight opened'
# console.log fixedElHeight
if popupParcel.kiwi_userMessages? and popupParcel.kiwi_userMessages.length > 0
fixedElHeight += 70 + popupParcel.kiwi_userMessages.length * 60
if fixedElHeight == 0
setTimeout -> # defer to next browser event tick
duplicateFixedHeight()
, 0
else
$(@DOMselector + " .notFixed").css({'height':fixedElHeight + "px"})
duplicateFixedHeight()
@Widgets.messageCenter.render('showMessages', popupParcel)
bind: (popupParcel) =>
customSearchQueryInput = $(@DOMselector + " #customSearchQueryInput")
customSearchQuerySubmit = $(@DOMselector + " #customSearchQuerySubmit")
closeWidget = $(@DOMselector + ' #close__' + @name)
customSearch_sortByPref = $(@DOMselector + " .conversations_sortByPref")
modifySearch = $(@DOMselector + " .customSearchOpen")
elsServicesButtons = $(@DOMselector + " button.servicesToSearch ")
elsServicesActivePrefs = $(@DOMselector + " .customSearchServicePref input")
showHidden = $(@DOMselector + " .showHidden")
jumpToServiceCustomResults = $(@DOMselector + " #customSearchResults .jumpTo")
@elsToUnbind = @elsToUnbind.concat(customSearchQueryInput, closeWidget, customSearchQuerySubmit, elsServicesButtons,
customSearch_sortByPref, showHidden, jumpToServiceCustomResults, modifySearch)
modifySearch.bind 'click', ->
$(@DOMselector + " #customSearchQueryInput").focus()
jumpToServiceCustomResults.bind 'click', (ev) =>
serviceIndex = parseInt($(ev.target).data('serviceindex'))
pxFromTop = $($(@DOMselector + " #customSearchResults .serviceResultJumpTo")[serviceIndex]).offset().top
# offsetBy = $($(@DOMselector + " #customSearchResults .serviceResultJumpTo")[serviceIndex]).outerHeight() + 40
$('body').scrollTop(pxFromTop - 100)
showHidden.bind 'click', (ev) =>
# console.log "showHidden.bind 'click', (ev) ->"
# console.debug ev
serviceName = $(ev.target).data('servicename')
# resultsBox__" + serviceInfoObject.name +
# console.log @DOMselector + " .resultsBox__" + serviceName + " .hidden_listing"
$(@DOMselector + " .resultsBox__" + serviceName + " .hidden_listing").show(1200)
$(ev.target).remove()
elsServicesButtons.bind('click', (ev) =>
if $(ev.target).hasClass("dropdownLabel")
serviceName = $(ev.target).attr('data-serviceName')
# console.log serviceName
# console.debug $(ev.target).attr('aria-pressed')
ariaPressed = $(ev.target).attr('aria-pressed')
if ariaPressed == 'true'
$('button.dropDownPrefs_' + serviceName).removeClass('active')
# console.log 'if ev.target.checked == "false" ' + serviceName
$(@DOMselector + " input.tagPref_" + serviceName ).attr('disabled','disabled')
else
$('button.dropDownPrefs_' + serviceName).addClass('active')
# console.log $(ev.target).attr('aria-pressed') + "asdfasdf"
$(@DOMselector + " input.tagPref_" + serviceName ).removeAttr('disabled')
$(ev.target).blur()
)
customSearch_sortByPref.bind 'change', (ev) ->
# console.log ' customSearch_sortByPref.val()'
# console.log
popupParcel.kiwi_userPreferences.sortByPref = $(ev.target).val()
parcel =
refreshView: 'conversations'
keyName: 'kiwi_userPreferences'
newValue: popupParcel.kiwi_userPreferences
localOrSync: 'sync'
msg: 'kiwiPP_post_save_a_la_carte'
sendParcel(parcel)
sendSearch = =>
queryString = customSearchQueryInput.val()
elsServicesToSearch = $(@DOMselector + ' button.servicesToSearch[aria-pressed="true"]')
# ariaPressed = $(ev.target).attr('aria-pressed')
# if ariaPressed == 'true'
servicesToSearch = {}
for el in elsServicesToSearch
serviceName = $(el).attr('data-serviceName')
servicesToSearch[serviceName] = {}
servicesToSearch[serviceName].customSearchTags = {}
elTagPrefs = $(@DOMselector + " input.tagPref_" + serviceName + ":checked")
for elTagPref in elTagPrefs
tagName = $(elTagPref).val()
servicesToSearch[serviceName].customSearchTags[tagName] = {}
# console.log 'asfdasdfasdf ' + serviceName
# console.debug servicesToSearch
if queryString != ''
parcel =
msg: 'kiwiPP_post_customSearch'
customSearchRequest:
queryString: queryString
servicesToSearch: servicesToSearch
sendParcel(parcel)
customSearchQueryInput.keypress (event) ->
charCode = if event.keyCode then event.keyCode else event.which
if charCode == 13
sendSearch()
customSearchQuerySubmit.bind 'click', =>
sendSearch()
closeWidget.bind 'click', =>
@widgetOpenBool = false
@render('collapsed',popupParcel)
customSearchQueryInput.focus()
# showViewAndBindGoToViewButtons
class View # basic building block
constructor: (@name, @__renderStates__) ->
@elsToUnbind = []
@totalRenders = 0
@DOMselector = "#" + @name + "_View"
@Widgets = {}
@bindAllGoToViewButtons = (viewData) =>
for _viewName, viewValue of switchViews
els_goTo_view = $(@DOMselector + ' .goTo_' + _viewName + 'View')
@elsToUnbind.push els_goTo_view
bindGoToViewButtons(els_goTo_view, _viewName, viewData)
@renderStates = @__renderStates__()
return @
unbindView: =>
# console.log 'unbinding view'
# console.debug @elsToUnbind
# $(".userPreferencesSave").unbind()
for el in @elsToUnbind
el.unbind()
@elsToUnbind = []
for widget in @Widgets
widget.unbindWidget()
render: (popupParcel, renderState = "__normal__") =>
@totalRenders++
@unbindView(@name)
if !renderState? and !@renderStates.__normal__?
console?.log 'ERROR: must declare renderState for view ' + @name + ' since __normal__ undefined'
# console.log 'console.debug renderState ' + @name + renderState
# console.log @totalRenders
# console.debug @renderStates
@renderStates[renderState].paint(popupParcel)
@bindAllGoToViewButtons(popupParcel)
@renderStates[renderState].bind(popupParcel)
class FixedView extends View
constructor: (@name, @__renderStates__, uniqueSelectorPostfix) ->
super @name, @__renderStates__
@DOMselector += uniqueSelectorPostfix
# console.log @DOMselector
class SwitchView extends View
constructor: (@name, @__renderStates__) ->
super @name, @__renderStates__
showView: =>
for _viewName, viewValue of switchViews
if _viewName == @name
# show
# console.log 'showing ' + _viewName
$('#' + _viewName + '_View').css({'display':'block'})
else
# hide
# console.log 'hiding ' + _viewName
$('#' + _viewName + '_View').css({'display':'none'})
render: (popupParcel, renderState = "__normal__") =>
super popupParcel, renderState
@showView()
class Conversations extends SwitchView
constructor: (@name) ->
super @name, @__renderStates__
@Widgets =
customSearch: new CustomSearch 'customSearch', @, false
init: (popupParcel) ->
@unbindWidget()
@render(popupParcel)
__renderStates__: =>
__normal__:
paint: (popupParcel) =>
# console.log ' in conversations view'
# console.log popupParcel
@Widgets['customSearch'].init(popupParcel)
researchModeDisabledButtonsHTML = ''
if popupParcel.urlBlocked == true or popupParcel.kiwi_userPreferences.researchModeOnOff == 'off' or (popupParcel.oldUrl? and popupParcel.oldUrl == true)
researchModeDisabledButtonsHTML += "<br>
<div style='width:100%;text-align: center;'><button class='btn btn-success' style='font-size: 1.1em;display: inline-block;' id='researchUrlOverride'>Research this Url</button></div>
<br>"
if popupParcel.kiwi_userPreferences.researchModeOnOff == 'off'
researchModeDisabledButtonsHTML += "<br>
<div style='width:100%; text-align:center;'>
Research Mode is off:
<button class='goTo_userPreferencesView btn btn-xs btn-default' style='position:relative; bottom:2px;'>
change settings
</button>
</div>"
$("#researchModeDisabledButtons").html(researchModeDisabledButtonsHTML)
resultsSummaryArray = []
resultsHTML = ""
totalResults = 0
for serviceInfoObject, index in popupParcel.kiwi_servicesInfo
if popupParcel.allPreppedResults[serviceInfoObject.name]? and popupParcel.allPreppedResults[serviceInfoObject.name].service_PreppedResults.length > 0
service_PreppedResults = popupParcel.allPreppedResults[serviceInfoObject.name].service_PreppedResults
totalResults += service_PreppedResults.length
resultsSummaryArray.push("<a class='jumpTo' data-serviceindex='" + index + "'>" + serviceInfoObject.title + " (" + service_PreppedResults.length + ")</a>")
resultsHTML += tailorResults[serviceInfoObject.name](serviceInfoObject,service_PreppedResults, popupParcel.kiwi_userPreferences)
if service_PreppedResults.length > 14
resultsHTML += '<div class="listing showHidden" data-servicename="' + serviceInfoObject.name + '"> show remaining ' + (service_PreppedResults.length - 11) + ' results</div>'
else
if serviceInfoObject.submitTitle?
submitUrl = serviceInfoObject.submitUrl
submitTitle = serviceInfoObject.submitTitle
resultsHTML += '<div class="serviceResultJumpTo">No conversation matches for ' + serviceInfoObject.title + '... <br>
<a target="_blank" href="' + submitUrl + '">' + submitTitle + '</a></div><br>'
else
resultsHTML += '<div>No results for ' + serviceInfoObject.title + '</div>'
preppedHTMLstring = ''
if (popupParcel.urlBlocked == true and Object.keys(popupParcel.allPreppedResults).length < 2)
# do nothing
preppedHTMLstring += "<div style='width: 100%; text-align: justify; padding:20px; font-size:.9em; opacity:.9;'>
<em>
Certain super-high traffic URLs
(or weird urls (like 'about:config' and chrome new tab pages)) have been
excluded from auto-search out of respect for the APIs of the conversation sites. you can still manually
search them by hitting the green button
</em>
</div><br>"
else if ((totalResults > 0 and popupParcel.kiwi_userPreferences.researchModeOnOff == 'off') or
popupParcel.kiwi_userPreferences.researchModeOnOff == 'on' or
Object.keys(popupParcel.allPreppedResults).length > 1)
preppedHTMLstring = '<br><h3 style="position:relative; top:-10px;">Results for this URL:</h3>'
preppedHTMLstring += "<div style='width: 100%; text-align: center;font-size:.9em;'>" + resultsSummaryArray.join(" - ") + "</div><br>"
preppedHTMLstring += resultsHTML
$("#resultsByService").html(preppedHTMLstring)
$(@DOMselector + " .hidden_listing").hide()
if totalResults < 4 and @totalRenders < 4
fixedViews.kiwiSlice.render(popupParcel, "open")
setTimeout( -> # to reign in a chrome rendering issue
# renderExtensionHeight(@DOMselector, 1)
$($('input')[0]).blur()
$($('a')[0]).blur()
$($('button')[0]).blur()
, 300
)
# renderExtensionHeight(@DOMselector, 1)
$($('input')[0]).blur()
$($('a')[0]).blur()
$($('button')[0]).blur()
bind: (popupParcel) =>
showHidden = $(@DOMselector + " .showHidden")
researchUrlOverrideButton = $(@DOMselector + " #researchUrlOverride")
conversations_sortByPref = $(@DOMselector + " .conversations_sortByPref")
customSearchOpen = $(@DOMselector + " .customSearchOpen")
jumpToService = $("#resultsByService .jumpTo")
@elsToUnbind = @elsToUnbind.concat(conversations_sortByPref, showHidden, researchUrlOverrideButton, customSearchOpen, jumpToService)
jumpToService.bind 'click', (ev) =>
serviceIndex = parseInt($(ev.target).data('serviceindex'))
# console.log serviceIndex
pxFromTop = parseInt($($(@DOMselector + " #resultsByService .serviceResultJumpTo")[serviceIndex]).offset().top)
# offsetBy = parseInt($($("#resultsByService .serviceResultsHeaderBar")[serviceIndex]).outerHeight()) + 40
$('body,html').scrollTop(pxFromTop - 100)
customSearchOpen.bind 'click', ->
$("#customSearchQueryInput").click()
researchUrlOverrideButton.bind 'click', ->
parcel =
msg: 'kiwiPP_researchUrlOverrideButton'
sendParcel(parcel)
showHidden.bind 'click', (ev) =>
# console.log "showHidden.bind 'click', (ev) -> "
# console.debug ev
serviceName = $(ev.target).data('servicename')
$(@DOMselector + " .resultsBox__" + serviceName + " .hidden_listing").show(1200)
$(ev.target).remove()
conversations_sortByPref.bind 'change', (ev) ->
# console.log "'conversations_sortByPref.bind 'change', (ev) ->"
# console.log $(ev.target).val()
popupParcel.kiwi_userPreferences.sortByPref = $(ev.target).val()
parcel =
refreshView: 'conversations'
keyName: 'kiwi_userPreferences'
newValue: popupParcel.kiwi_userPreferences
localOrSync: 'sync'
msg: 'kiwiPP_post_save_a_la_carte'
sendParcel(parcel)
class UserPreferences extends SwitchView
constructor: (@name) ->
super @name, @__renderStates__
init: (popupParcel) ->
@unbindWidget()
@render(popupParcel)
__renderStates__: =>
__normal__:
paint: (popupParcel) =>
$(@DOMselector + " .userErrMsg").html('')
# console.log 'paint: adsfaeaewfawefawefawef(popupParcel) =># viewName = '
if preferencesOnlyPage is true
$("#menuBar_preferences").hide()
currentTime = Date.now()
if popupParcel.kiwi_userPreferences.researchModeOnOff == "off"
$("#autoOffTimer").html("Research mode is off, so auto-off timer is not set")
else if popupParcel.kiwi_userPreferences.autoOffAtUTCmilliTimestamp? and popupParcel.kiwi_userPreferences.autoOffAtUTCmilliTimestamp > currentTime
$("#autoOffTimer").html("Auto-Off timer expires at: " + formatTime(popupParcel.kiwi_userPreferences.autoOffAtUTCmilliTimestamp) + "<br>")
else if popupParcel.kiwi_userPreferences.researchModeOnOff == 'off' and popupParcel.kiwi_userPreferences.autoOffAtUTCmilliTimestamp?
$("#autoOffTimer").html("Auto-off timer last expired at: " + formatTime(popupParcel.kiwi_userPreferences.autoOffAtUTCmilliTimestamp) + "<br>")
else
$("#autoOffTimer").html("Auto-off timer is not set")
researchModeHtml = ''
if popupParcel.kiwi_userPreferences.researchModeOnOff is "off"
researchOnString = ""
researchOffString = " checked='checked' "
else
researchOnString = " checked='checked' "
researchOffString = ""
autoOffTimerType = popupParcel.kiwi_userPreferences.autoOffTimerType
autoOffTimerValue = popupParcel.kiwi_userPreferences.autoOffTimerValue
`var auto20, auto60, autoAlways, autoCustom, autoCustomValue = '';
if(autoOffTimerType != null){
if(autoOffTimerType == "20"){ auto20 = " checked='checked' " }
else if(autoOffTimerType == "60"){ auto60 = " checked='checked' " }
else if(autoOffTimerType == "always"){ autoAlways = " checked='checked' " }
else if(autoOffTimerType == "custom"){ autoCustom = " checked='checked' "; autoCustomValue = autoOffTimerValue;}
}`
researchModeHtml += 'Research Mode:
<a class="tooltipCustom" style="position: relative;">
<div style="display:inline; font-size:.9em;"><sup><em> ?</em></sup></div>
<span style="bottom:34px; left:-114px;">
When the Research mode is "Off", Kiwi won\'t automatically search URLs as you surf;
instead, you can check URLs on a case-by-case basis (and still be able to do custom searches)
</span>
</a>
<label style="font-weight: normal;" for="researchmodeON"> on </label> <input id="researchmodeON" type="radio" name="research" value="on" ' + researchOnString + '> -
<label style="font-weight: normal;" for="researchmodeOFF"> off </label> <input id="researchmodeOFF" type="radio" name="research" value="off" ' + researchOffString + '>
<button class="btn btn-mini btn-default userPreferencesSave"> save preferences </button><br>'
if popupParcel.kiwi_userPreferences.researchModeOnOff is 'off'
researchModeHtml += ''
timerDisabled = ' disabled '
timerOnlyUsefulWhenMessage = '<br>
<span style="font-size:.8em;"><i>
Note: the auto-off-timer only matters when Research Mode is "on".
</i></span>
<br>'
else
timerDisabled = ' '
researchModeHtml += '<br>
<span style="font-size:.8em;"><i>
Note: The Whitelist only makes a difference when Research mode is turned "off", which it currently isn\'t.
</i></span>
<br>'
timerOnlyUsefulWhenMessage = ''
researchModeHtml += '
<br>
<table class="table table-bordered table-striped whitelistTable">
<thead>
<tr>
<th colspan="3">
<div class="input-group" id="addWhiteListString">
<label class="input-group-addon">
<a class="tooltipCustom" style="position: relative;">
<div style="display:inline; font-size:.9em;">whitelist strings <sup><em> ?</em></sup></div>
<span style="bottom:84px;left:-12px;">
<b>Whitelist strings:</b> <br>
Kiwi will automatically research any URL (upon visiting) that contains a user-provided Whitelist string --
even when Research Mode is "off".
Try it with "github.com" or "bitbucket.org", and then visit the respective site with research mode "off".
</span>
</a>
</label>
<input type="text" class="form-control ignoreSaveButtonListen">
<label class="input-group-addon btn btn-default">
add
</label>
</div>
</th>
</tr>
</thead>
<tbody>
'
for whitelistSubString, index in popupParcel.kiwi_userPreferences.urlSubstring_whitelists.anyMatch
researchModeHtml += '
<tr>
<th scope="row" style="width:35px;"> ' + (index + 1) + ' </th>
<td> ' + whitelistSubString + ' </td>
<td style="width:35px;">
<button title="remove" class="btn btn-xs btn-default removeWhitelistString" data-whitelistStringToRemove="' + whitelistSubString + '" >
<span data-whitelistStringToRemove="' + whitelistSubString + '"
class="glyphicon glyphicon-remove" aria-hidden="true"
style="color:#E65F5F;"
></span>
</button>
</td>
</tr>'
researchModeHtml += '
</tbody>
</table>
<br>Auto-Off Timer set for: ' + timerOnlyUsefulWhenMessage + '
<br> <label><input ' + timerDisabled + ' type="radio" name="researchAutoOffType" ' + auto20 + ' value="20"> 20 min</label>
<br> <label><input ' + timerDisabled + ' type="radio" name="researchAutoOffType" ' + auto60 + ' value="60"> 1 hr</label>
<br> <label><input ' + timerDisabled + ' type="radio" name="researchAutoOffType" ' + autoAlways + ' value="always"> Always On</label>
<br> <label><input ' + timerDisabled + ' type="radio" name="researchAutoOffType" ' + autoCustom + ' value="custom"> Custom</label>
<input ' + timerDisabled + ' id="autoCustomValue" type="text" value="' + autoCustomValue + '" size="4" disabled /> minutes'
$("#researchModeDrop").html(researchModeHtml)
servicesHtml = ''
for service, index in popupParcel.kiwi_servicesInfo
if service.active == "on"
activeCheck = " checked='checked' "
notActiveCheck = ""
else
activeCheck = ""
notActiveCheck = " checked='checked' "
servicesHtml += '<br>
<div class="serviceListing listing">
<table><tbody><tr>
<td class="upDownButtons">'
if index != 0
servicesHtml += '<span title="Move ' + service.title + ' results above ' + popupParcel.kiwi_servicesInfo[index - 1].title + '" class="glyphicon glyphicon-chevron-up" id="' + service.name + '_moveServiceUp" aria-hidden="true"></span>'
if index != 0 and index != popupParcel.kiwi_servicesInfo.length - 1
servicesHtml += '<br><br>'
if index != popupParcel.kiwi_servicesInfo.length - 1
servicesHtml += '<span title="Move ' + service.title + ' results below ' + popupParcel.kiwi_servicesInfo[index + 1].title + '" class="glyphicon glyphicon-chevron-down" id="' + service.name + '_moveServiceDown" aria-hidden="true"></span>'
brandedTitle = if (service.name is 'reddit') then "for " + service.title else service.title
brandingImage = ''
if service.brandingImage?
brandingImage = " <a target='_blank' href='" + service.broughtToYouByURL + "' style='text-decoration:none;'>
<img height='28' src='" + service.brandingImage + "'/></a> "
servicesHtml += '</td>
<td class="serviceInfo">' + brandedTitle + ' - using: ' + brandingImage + ' <a target="_blank" href="' + service.broughtToYouByURL + '">' + service.broughtToYouByTitle + '</a><br>'
if service.name == "productHunt"
specificAPIlink = ", <a target='_blank' href='https://github.com/producthunt/producthunt-api/wiki/Product-Hunt-APIs#algolia-search-api'>for PH</a>"
if service.customSearchBroughtToYouByTitle?
customSearchApiBrandingHTML = "<div class='bg-warning' style='margin:4px; margin-top:10px;padding:6px;'>
<em><div style='padding-bottom:2px;'> custom searches are using: </div>" + '
<div style="padding-bottom:4px;">
<a target="_blank" href="' + service.customSearchBroughtToYouByURL + '">' + service.customSearchBroughtToYouByTitle + '</a>
' + specificAPIlink + '
</em>
</div>
</em>
</div>'
else
customSearchApiBrandingHTML = ""
servicesHtml += '<div style="padding-left:15px;">
status:
<label style="font-weight: normal;" for="' + service.name + '_serviceStatusON"> on </label> <input id="' + service.name + '_serviceStatusON" type="radio" name="' + service.name + '_serviceStatus" value="on" ' + activeCheck + '> -
<label style="font-weight: normal;" for="' + service.name + '_serviceStatusOFF"> off </label> <input id="' + service.name + '_serviceStatusOFF" type="radio" name="' + service.name + '_serviceStatus" value="off" ' + notActiveCheck + '>
<br><br>Results are deemed notable (capitilizes badge letter) if:'
if service.name == 'gnews'
servicesHtml += '<br><br> the topic has had <input id="' + service.name + '_numberOfStoriesFoundWithinTheHoursSincePostedLimit" type="text" size="4" value="' + service.notableConditions.numberOfStoriesFoundWithinTheHoursSincePostedLimit + '"/> or more related stories published within the last <input id="' + service.name + '_hoursNotable" type="text" size="4" value="' + service.notableConditions.hoursSincePosted + '"/> hours <br>
<div style="width:100%; text-align:center;"><span style="padding:7px; margin-right: 280px; display: inline-block;"> - or - </span></div>
number of News Clusters <input id="' + service.name + '_numberOfRelatedItemsWithClusterURL" type="text" size="4" value="' + service.notableConditions.numberOfRelatedItemsWithClusterURL + '"/>
</div>
' + customSearchApiBrandingHTML + '
</td>
</tr></tbody></table>
</div>'
else
servicesHtml += '<br> URL is an exact match, and:
<br> it has been <input id="' + service.name + '_hoursNotable" type="text" size="4" value="' + service.notableConditions.hoursSincePosted + '"/> or fewer hours since posting <br>
<div style="width:100%; text-align:center;"><span style="padding:7px; margin-right: 280px; display: inline-block;"> - or - </span></div>
a post has <input id="' + service.name + '_commentsNotable" type="text" size="4" value="' + service.notableConditions.num_comments + '"/> or more comments
</div>
' + customSearchApiBrandingHTML + '
</td>
</tr></tbody></table>
</div>'
servicesHtml += "<div class='serviceListing listing' style='padding:15px; margin-top: 30px;'>
Wouldn't it be awesome if we could add some more services to opt-in to? All that's needed are friendly APIs! <a href='https://twitter.com/spencenow' target='_blank'>Tweet me</a> if you're interested in adding one!
</div>
<br>"
$("#servicesInfoDrop").html(servicesHtml)
bind: (popupParcel) =>
saveButtons = $(@DOMselector + " .userPreferencesSave")
removeWhitelistStringButtons = $(@DOMselector + " .removeWhitelistString")
autoTimerRadios = $(@DOMselector + " input:radio[name='researchAutoOffType']")
allInputs = $(@DOMselector + ' input:not(.ignoreSaveButtonListen)')
addWhitelistString_button = $(@DOMselector + " #addWhiteListString label")
@elsToUnbind = @elsToUnbind.concat allInputs, saveButtons, autoTimerRadios, removeWhitelistStringButtons, addWhitelistString_button
saveButtons.attr('disabled','disabled')
allInputs.bind 'change', ->
$(".userPreferencesSave").removeAttr('disabled')
allInputs.bind 'focus', ->
$(".userPreferencesSave").removeAttr('disabled')
if $("input:radio[name='researchAutoOffType']:checked").val() is 'custom'
$("#autoCustomValue").removeAttr('disabled')
autoTimerRadios.bind 'change', ->
if $("input:radio[name='researchAutoOffType']:checked").val() is 'custom'
$("#autoCustomValue").removeAttr('disabled')
else
$("#autoCustomValue").attr('disabled','disabled')
_bindDown = (downButton, index) =>
downButton.bind 'click', ->
popupParcel.kiwi_servicesInfo = moveArrayElement(popupParcel.kiwi_servicesInfo, index, index + 1)
parcel =
refreshView: 'userPreferences'
keyName: 'kiwi_servicesInfo'
newValue: popupParcel.kiwi_servicesInfo
localOrSync: 'sync'
msg: 'kiwiPP_post_save_a_la_carte'
sendParcel(parcel)
_bindUp = (upButton, index) =>
upButton.bind 'click', ->
popupParcel.kiwi_servicesInfo = moveArrayElement(popupParcel.kiwi_servicesInfo, index, index - 1 )
parcel =
refreshView: 'userPreferences'
keyName: 'kiwi_servicesInfo'
newValue: popupParcel.kiwi_servicesInfo
localOrSync: 'sync'
msg: 'kiwiPP_post_save_a_la_carte'
sendParcel(parcel)
for service,index in popupParcel.kiwi_servicesInfo
downButton = $("#" + service.name + '_moveServiceDown')
if downButton.length > 0
@elsToUnbind.push downButton
_bindDown(downButton, index)
upButton = $("#" + service.name + '_moveServiceUp')
if upButton.length > 0
@elsToUnbind.push upButton
_bindUp(upButton, index)
postError = (userErrMsg) =>
# console.log 'trying to post error ' + userErrMsg
$(@DOMselector + " .userErrMsg").html("<br>" + userErrMsg)
addWhitelistString_button.bind 'click', (ev) =>
# whitelistSubString = $(ev.target).attr('data-whitelistStringToRemove')
whitelistSubString_toAdd = $(@DOMselector + " #addWhiteListString input").val()
popupParcel.kiwi_userPreferences.urlSubstring_whitelists.anyMatch.push whitelistSubString_toAdd
parcel =
refreshView: 'userPreferences'
keyName: 'kiwi_userPreferences'
newValue: popupParcel.kiwi_userPreferences
localOrSync: 'sync'
msg: 'kiwiPP_post_save_a_la_carte'
sendParcel(parcel)
removeWhitelistStringButtons.bind 'click', (ev) ->
whitelistSubString = $(ev.target).attr('data-whitelistStringToRemove')
newWhitelistAnyMatchArray = _.without(popupParcel.kiwi_userPreferences.urlSubstring_whitelists.anyMatch, whitelistSubString);
popupParcel.kiwi_userPreferences.urlSubstring_whitelists.anyMatch = newWhitelistAnyMatchArray
parcel =
refreshView: 'userPreferences'
keyName: 'kiwi_userPreferences'
newValue: popupParcel.kiwi_userPreferences
localOrSync: 'sync'
msg: 'kiwiPP_post_save_a_la_carte'
sendParcel(parcel)
saveButtons.bind 'click', ->
researchModeHTMLval = $("input:radio[name='research']:checked").val()
# console.log 'researchModeHTMLval is ' + researchModeHTMLval
if researchModeHTMLval != 'on' and researchModeHTMLval != 'off'
postError('research mode must be "on" or "off"'); return 0;
allowedAutoOffTypes = ["20","60","always","custom"]
autoOffTimerType = $("input:radio[name='researchAutoOffType']:checked").val()
autoOffTimerValue = $("#autoCustomValue").val()
if autoOffTimerType in allowedAutoOffTypes
if autoOffTimerType == 'custom' and (autoOffTimerValue == '' or isNaN(autoOffTimerValue))
postError('Must specify a number of minutes for auto-off timer.'); return 0;
else
postError('not acceptable autoOffTimerType'); return 0;
# autoOffAtUTCmilliTimestamp
for service, index in popupParcel.kiwi_servicesInfo
if service.name == 'gnews'
active = $("input:radio[name='" + service.name + "_serviceStatus']:checked").val()
if active != 'on' and active != 'off'
postError('active must be "on" or "off"'); return 0;
numberOfStoriesFoundWithinTheHoursSincePostedLimit = $('#' + service.name + '_numberOfStoriesFoundWithinTheHoursSincePostedLimit').val()
if numberOfStoriesFoundWithinTheHoursSincePostedLimit == '' or isNaN(numberOfStoriesFoundWithinTheHoursSincePostedLimit)
postError('number Of Stories Found Within The Hours Since Posted Limit must be an integer'); return 0;
numberOfRelatedItemsWithClusterURL = $('#' + service.name + '_numberOfRelatedItemsWithClusterURL').val()
if numberOfRelatedItemsWithClusterURL == '' or isNaN(numberOfRelatedItemsWithClusterURL)
postError('number Of Related Items With Cluster URL of comments must be an integer'); return 0;
else
active = $("input:radio[name='" + service.name + "_serviceStatus']:checked").val()
if active != 'on' and active != 'off'
postError('active must be "on" or "off"'); return 0;
hoursSincePosted = $('#' + service.name + '_hoursNotable').val()
if hoursSincePosted == '' or isNaN(hoursSincePosted)
postError('Hours must be an number'); return 0;
num_comments = $('#' + service.name + '_commentsNotable').val()
if num_comments == '' or isNaN(num_comments)
postError('Number of comments must be an integer'); return 0;
# console.log '1234'
popupParcel.kiwi_userPreferences.researchModeOnOff = researchModeHTMLval
if (autoOffTimerType != 'custom')
popupParcel.kiwi_userPreferences.autoOffTimerType = autoOffTimerType
else
popupParcel.kiwi_userPreferences.autoOffTimerType = autoOffTimerType
popupParcel.kiwi_userPreferences.autoOffTimerValue = parseFloat(autoOffTimerValue)
for service, index in popupParcel.kiwi_servicesInfo
active = $("input:radio[name='" + service.name + "_serviceStatus']:checked").val()
popupParcel.kiwi_servicesInfo[index].active = active
# notableSound = $("input:radio[name='" + service.name + "_soundStatus']:checked").val()
# popupParcel.kiwi_servicesInfo[index].notableSound = notableSound
hoursSincePosted = $('#' + service.name + '_hoursNotable').val()
# console.log popupParcel.kiwi_servicesInfo[index].name
# console.log "hoursSincePosted = $('#' + service.name + '_hoursNotable').val() " + hoursSincePosted
popupParcel.kiwi_servicesInfo[index].notableConditions.hoursSincePosted = parseFloat(hoursSincePosted)
if service.name == 'gnews'
numberOfRelatedItemsWithClusterURL = $('#' + service.name + '_numberOfRelatedItemsWithClusterURL').val()
popupParcel.kiwi_servicesInfo[index].notableConditions.numberOfRelatedItemsWithClusterURL = parseInt(numberOfRelatedItemsWithClusterURL)
numberOfStoriesFoundWithinTheHoursSincePostedLimit = $('#' + service.name + '_numberOfStoriesFoundWithinTheHoursSincePostedLimit').val()
popupParcel.kiwi_servicesInfo[index].notableConditions.numberOfStoriesFoundWithinTheHoursSincePostedLimit = parseInt(numberOfStoriesFoundWithinTheHoursSincePostedLimit)
else
num_comments = $('#' + service.name + '_commentsNotable').val()
popupParcel.kiwi_servicesInfo[index].notableConditions.num_comments = parseInt(num_comments)
popupParcel.view = 'userPreferences'
# console.log '4567'
# console.debug popupParcel
parcel =
refreshView: popupParcel.view
newPopupParcel: popupParcel
msg: 'kiwiPP_post_savePopupParcel'
sendParcel(parcel)
class Credits extends SwitchView
constructor: (@name) ->
super @name, @__renderStates__
init: (popupParcel) ->
@unbindWidget()
@render(popupParcel)
__renderStates__: =>
__normal__:
paint: (popupParcel) =>
console?.log 'painting ' + @name
bind: (popupParcel) =>
console?.log 'binding ' + @name
class Loading extends SwitchView
constructor: (@name) ->
super @name, @__renderStates__
init: (popupParcel) ->
@unbindWidget()
@render(popupParcel)
__renderStates__: =>
__normal__:
paint: (popupParcel) =>
console?.log 'painting ' + @name
bind: (popupParcel) =>
console?.log 'binding ' + @name
class KiwiSlice extends FixedView
constructor: (@name, uniqueSelectorPostfix) ->
super @name, @__renderStates__, uniqueSelectorPostfix
init: (popupParcel, renderState = null) =>
@renderStateTransitions = @__renderStateTransitions__()
# console.log 'hehehehee init: (popupParcel, renderState = null) =>'
@unbindView()
renderState = if renderState? then renderstate else "collapsed"
# console.log ' renderState = if renderState? then renderstate else "collapsed" ' + renderState
@render(popupParcel, 'collapsed')
render: (popupParcel, renderState, fromState = null) =>
# console.log 'in render for kiwi'
__renderStates__callback = (popupParcel, renderState) =>
super popupParcel, renderState
if fromState? and @renderStateTransitions[fromState + "__to__" + renderState]?
# console.log 'yep, has renderstate'
@renderStateTransitions[fromState + "__to__" + renderState](popupParcel, renderState, __renderStates__callback)
else
super popupParcel, renderState
__renderStates__: =>
collapsed:
paint: (popupParcel) =>
kiwiSliceHTML = '<div id="sliceActivateTransition" style="position:fixed; bottom: -33px; right: -33px; ">
<img style="width: 66px; height: 66px;" src="symmetricKiwi.png" />
</div>'
$(@DOMselector).html(kiwiSliceHTML)
bind: (popupParcel) =>
elActivateTransition = $(@DOMselector + " #sliceActivateTransition")
@elsToUnbind = @elsToUnbind.concat elActivateTransition
elActivateTransition.bind 'mouseover', (ev) =>
elActivateTransition.addClass('rotateClockwiseFull')
elActivateTransition.bind 'mouseout', (ev) =>
elActivateTransition.removeClass('rotateClockwiseFull')
elActivateTransition.bind 'click', (ev) =>
elActivateTransition.removeClass('rotateClockwiseFull')
@render(popupParcel,'open', 'collapsed')
open:
paint: (popupParcel) =>
# console.log 'painting ' + @name
kiwiSliceHTML = '<div id="transition_open_showMe" class="evenlySpacedContainer kiwiSliceOpenPlatter">
<button type="button" class=" goTo_creditsView btn btn-mini btn-default">credits</button>
<a class="btn btn-mini btn-default" style="font-size:.8em;" target="_blank" href="http://www.metafruit.com/kiwi/">MetaFruit <span class="glyphicon glyphicon-apple"></span></a>
<button class=" btn btn-mini btn-default" id="clearKiwiURLCache">clear cache</button>
<button class=" btn btn-mini btn-default" id="refreshURLresults">refresh</button>
</div>
<div id="sliceActivateTransition" style="position:fixed; bottom: 15px; right: 15px; ">
<img style="width: 66px; height: 66px;" src="symmetricKiwi.png" />
</div>'
$(@DOMselector).html(kiwiSliceHTML)
# console.log kiwiSliceHTML
bind: (popupParcel) =>
# console.log 'binding ' + @name
elActivateTransition = $(@DOMselector + " #sliceActivateTransition")
clearKiwiURLCacheButton = $(@DOMselector + " #clearKiwiURLCache")
refreshURLresultsButton = $(@DOMselector + " #refreshURLresults")
@elsToUnbind = @elsToUnbind.concat elActivateTransition, refreshURLresultsButton, clearKiwiURLCacheButton
refreshURLresultsButton.bind 'click', ->
parcel =
msg: 'kiwiPP_refreshURLresults'
sendParcel(parcel)
$('body').mouseup((e) =>
# console.log 'test test test'
container = $(@DOMselector)
if (!container.is(e.target) && container.has(e.target).length == 0)
$('body').unbind 'mouseup'
@render(popupParcel,'collapsed', 'open')
)
elActivateTransition.bind 'click', (ev) =>
@render(popupParcel,'collapsed', 'open')
clearKiwiURLCacheButton.bind 'click', ->
parcel =
msg: 'kiwiPP_clearAllURLresults'
sendParcel(parcel)
# \/ \/ \/ THIS IS A WORK IN PROGRESS \/ \/ \/
__renderStateTransitions__: =>
'open__to__collapsed': (popupParcel, renderState, __renderStates__callback) =>
$(@DOMselector + " #transition_open_showMe").animate({'opacity':0}, 300)
$(@DOMselector + " #sliceActivateTransition").addClass('rotateClockwise')
$(@DOMselector + " #sliceActivateTransition").animate({"bottom": '-33px', "right": "-33px"}, {
duration: 500,
complete: ->
__renderStates__callback(popupParcel, renderState)
})
# return transitionObj
'collapsed__to__open': (popupParcel, renderState, __renderStates__callback) =>
# console.log "'collapsed__to__open': (popupParcel, renderState, __renderStates__callback) =>"
$(@DOMselector + " #sliceActivateTransition").addClass('rotateCounterClockwise')
$(@DOMselector + " #sliceActivateTransition").animate({"bottom": '15px', "right": "15px"}, {
duration: 500,
complete: ->
# console.log 'we are done with animation'
__renderStates__callback(popupParcel, renderState)
})
$(@DOMselector).prepend('<div id="transition_open_showMe" class="evenlySpacedContainer kiwiSliceOpenPlatter" style="opacity: 0;">
<button type="button" class="goTo_creditsView btn btn-mini btn-default ">credits</button>
<a class=" btn btn-mini btn-default" style="font-size:.8em;" target="_blank" href="http://www.metafruit.com/kiwi/">MetaFruit <span class="glyphicon glyphicon-apple"></span></a>
<button class="btn btn-mini btn-default " id="clearKiwiURLCache">clear cache</button>
<button class="btn btn-mini btn-default " id="refreshURLresults">refresh</button>
</div>')
# setTimeout =>
$(@DOMselector + " #transition_open_showMe").animate({'opacity':1}, 499)
# , 200
fixedViews =
kiwiSlice: new KiwiSlice 'kiwiSlice', 'FixedBottom'
switchViews =
conversations: new Conversations 'conversations'
userPreferences: new UserPreferences 'userPreferences'
credits: new Credits 'credits'
loading: new Loading 'loading'
tailorResults =
productHunt: (serviceInfoObject, service_PreppedResults, kiwi_userPreferences) ->
preppedHTMLstring = ''
currentTime = Date.now()
fuzzyMatchBool = false
brandingDisplay = ''
if serviceInfoObject.brandingImage?
brandingDisplay = '<img style="margin-left:7px;" title="' + serviceInfoObject.title + '" height="28" src="' + serviceInfoObject.brandingImage + '"/>
<span class="serviceResultsTitles" style="color:black; position: relative;top: 6px;"">' + serviceInfoObject.title + '</span>'
else
brandingDisplay = "<span class='serviceResultsTitles'>" + serviceInfoObject.title + '</span>'
preppedHTMLstring += "<div class='serviceResultsBox serviceResultJumpTo resultsBox__" + serviceInfoObject.name + "'>
<div class='serviceResultsHeaderBar'>" + brandingDisplay + "</div>"
# recency doesn't make sense for PH
# if kiwi_userPreferences.sortByPref == 'attention'
# selectedString_attention = 'selected'
# selectedString_recency = ''
# else
# selectedString_attention = ''
# selectedString_recency = 'selected'
if service_PreppedResults.length < 1
preppedHTMLstring += ' no results <br>'
return preppedHTMLstring
else
service_PreppedResults = _.sortBy(service_PreppedResults, 'kiwi_num_comments')
service_PreppedResults.reverse()
for listing, index in service_PreppedResults
listingClass = if (index > 10 and service_PreppedResults.length > 14) then ' hidden_listing ' else ''
if listing.comment_text?
preppedHTMLstring += _tailorHNcomment(listing, serviceInfoObject, listingClass)
else
if (listing.kiwi_created_at? and currentTime - listing.kiwi_created_at < 1000 * 60 * 60 * 4)
recentTag = "<span class='recentListingTag'>Recent: </span>"
else
recentTag = ""
if listing.kiwi_makers.length > 3
gridLayoutBool = false
else
gridLayoutBool = true
preppedHTMLstring += '<div class="listing ' + listingClass + '">'
# kiwi_created_at: 1439471020625
# kiwi_author_headline: "Community @ProductHunt. "
# kiwi_author_name: "Ben Tossell"
# kiwi_author_username: "bentossell"
# kiwi_discussion_url: "http://www.producthunt.com/tech/buffer-for-video"
# kiwi_makers: Array[9]
# headline: "Co-founder/CEO, Buffer"
# name: "Joel Gascoigne"
# profile_url: "http://www.producthunt.com/@joelgascoigne"
# username: "joelgascoigne"
# website_url: "http://joel.is"
# kiwi_num_comments: 30
# kiwi_score: 244
# name: "Buffer for Video"
# tagline: "All-in-one video scheduling & management for social media"
# redirect_url: "http://www.producthunt.com/r/4918f991fdd705/30839?app_id=1674"
# screenshot_url: Object
if gridLayoutBool
preppedHTMLstring += '<div style="display:inline-table; width: 60%; padding-right:8px;">'
else
preppedHTMLstring += '<div>'
preppedHTMLstring += '
<a class="listingTitle" target="_blank" href="' + listing.kiwi_discussion_url + '">
<div style="color:black; padding:4px; padding-bottom: 8px; font-size: 1.1em;">' + recentTag + '
<b>' + listing.name + '</b>
</div>
<div style="color:#4D586F; padding-left:18px;">
<div style="padding-bottom:4px;">"' + listing.tagline + '"</div>'
preppedHTMLstring += '<div style="padding-bottom:4px;">
' + listing.kiwi_num_comments + ' comments, ' + listing.kiwi_score + ' upvotes
</div>'
if listing.kiwi_created_at?
_time = formatTime(listing.kiwi_created_at)
preppedHTMLstring += '' + _time
preppedHTMLstring += '</div></a></div>'
if gridLayoutBool
preppedHTMLstring += '<div style="display:inline-table; width: 39%;">'
else
preppedHTMLstring += '<div style="padding: 8px;">'
makerUsernames = []
if listing.kiwi_makers? and listing.kiwi_makers.length > 0
preppedHTMLstring += '<div><div style="padding-bottom:2px;"><b>made by</b>: </div>'
for maker in listing.kiwi_makers
if gridLayoutBool
preppedHTMLstring += '<div style="padding-bottom: 4px;">'
else
preppedHTMLstring += '<div style="padding-bottom: 4px; padding-left: 10px;">'
preppedHTMLstring += '<a target="_blank" href="' + serviceInfoObject.userPageBaselink + maker.username + '" style="color:#727E98;">' + maker.name
if maker.headline? and maker.headline != ""
preppedHTMLstring += ', "' + maker.headline + '"'
preppedHTMLstring += '</a>'
if maker.website_url?
preppedHTMLstring += ' <a href="' + maker.website_url + '" target="_blank"><span class="glyphicon glyphicon-log-in" style="color:blue;"></span> </a>'
if listing.kiwi_author_username == maker.username
preppedHTMLstring += " (also submitted post)"
preppedHTMLstring += '</div>'
preppedHTMLstring += '</div>'
makerUsernames.push maker.username
if listing.kiwi_author_username not in makerUsernames
if gridLayoutBool
gridLayoutAuthorDiv = '<div style="padding-bottom: 2px;">'
else
gridLayoutAuthorDiv = '<div style="padding-bottom: 2px; margin-left: 10px;">'
preppedHTMLstring += '<div style="">
<div style="padding-bottom:2px;"><b>submitted by:</b></div>
' + gridLayoutAuthorDiv + '<a target="_blank" href="' + serviceInfoObject.userPageBaselink + listing.kiwi_author_username + '"
style="color:#727E98;">' + listing.kiwi_author_name + '
'
if listing.kiwi_author_headline? and listing.kiwi_author_headline != ""
preppedHTMLstring += ', "' + listing.kiwi_author_headline + '"'
preppedHTMLstring += '</a></div></div>'
preppedHTMLstring += '</div></div>'
preppedHTMLstring += "</div>"
return preppedHTMLstring
hackerNews: (serviceInfoObject, service_PreppedResults, kiwi_userPreferences) ->
return tailorRedditAndHNresults_returnHtml(serviceInfoObject, service_PreppedResults, kiwi_userPreferences)
reddit: (serviceInfoObject, service_PreppedResults, kiwi_userPreferences) ->
return tailorRedditAndHNresults_returnHtml(serviceInfoObject, service_PreppedResults, kiwi_userPreferences)
_tailorHNcomment = (listing, serviceInfoObject, listingClass) ->
currentTime = Date.now()
commentHtml = ""
# story_text
# comment_text
# story_id
# story_title
# story_url
recentTag = if (currentTime - listing.kiwi_created_at < 1000 * 60 * 60 * 4) then "<span class='recentListingTag'>Recent: </span>" else ""
commentHtml += '<div class="listing ' + listingClass + ' " style="position:relative;">' + recentTag
if listing.over_18? and listing.over_18 is true
commentHtml += '<span class="nsfw">NSFW</span> For story: ' + listing.story_title + '<br>'
else
commentHtml += "For story: <a target='_blank' href='" + serviceInfoObject.permalinkBase + listing.story_id + "'>" + listing.story_title + '</a><br>'
_time = formatTime(listing.kiwi_created_at)
commentHtml += 'at ' + _time + ',
<a target="_blank" href="' + serviceInfoObject.userPageBaselink + listing.author + '">' + listing.author + '</a> recieved ' + listing.kiwi_score + ' upvotes, by saying:
( <a class="listingTitle" target="_blank" href="' + serviceInfoObject.permalinkBase + listing.kiwi_permaId + '">
comment permalink
</a> , <a class="listingTitle" target="_blank" href="' + serviceInfoObject.permalinkBase + listing.story_id + '"> story permalink </a>
)<br><div class="commentBox">
' + listing.comment_text + '
</div></div>'
return commentHtml
tailorRedditAndHNresults_returnHtml = (serviceInfoObject, service_PreppedResults, kiwi_userPreferences) ->
preppedHTMLstring = ''
currentTime = Date.now()
# kiwi_exact_match
# fuzzy matches
# linkify stuff
fuzzyMatchBool = false
preppedHTMLstring += "<div class='serviceResultsBox serviceResultJumpTo resultsBox__" + serviceInfoObject.name + "'>
<div class='serviceResultsHeaderBar'>"
if serviceInfoObject.name == 'reddit'
preppedHTMLstring += "<span class='serviceResultsTitles'>for " + serviceInfoObject.title + ':</span>'
else
preppedHTMLstring += "<span class='serviceResultsTitles'>" + serviceInfoObject.title + '</span>'
if kiwi_userPreferences.sortByPref == 'attention'
selectedString_attention = 'selected'
selectedString_recency = ''
else
selectedString_attention = ''
selectedString_recency = 'selected'
preppedHTMLstring += '<div style="float:right; padding-top: 9px;">   sorted by: <select class="conversations_sortByPref">
<option ' + selectedString_attention + ' id="_attention" value="attention">attention</option>
<option ' + selectedString_recency + ' id="_recency" value="recency">recency</option>
</select></div>
</div>'
if service_PreppedResults.length < 1
preppedHTMLstring += ' no results <br>'
return preppedHTMLstring
else if !service_PreppedResults[0].comment_text? and kiwi_userPreferences.sortByPref is 'attention'
service_PreppedResults = _.sortBy(service_PreppedResults, 'num_comments')
service_PreppedResults.reverse()
else if kiwi_userPreferences.sortByPref is 'attention'
service_PreppedResults = _.sortBy(service_PreppedResults, 'kiwi_score')
service_PreppedResults.reverse()
else if kiwi_userPreferences.sortByPref is 'recency'
service_PreppedResults = _.sortBy(service_PreppedResults, 'kiwi_created_at')
service_PreppedResults.reverse()
for listing, index in service_PreppedResults
listingClass = if (index > 10 and service_PreppedResults.length > 14) then ' hidden_listing ' else ''
if listing.comment_text?
preppedHTMLstring += _tailorHNcomment(listing, serviceInfoObject, listingClass)
else
recentTag = if (currentTime - listing.kiwi_created_at < 1000 * 60 * 60 * 4) then "<span class='recentListingTag'>Recent: </span>" else ""
if listing.kiwi_exact_match
# preppedHTMLstring += '<div class="listing ' + listingClass + '" style="position:relative;">' + recentTag + '
# <div style="float:right;">
# <a target="_blank" href="' + serviceInfoObject.userPageBaselink + listing.author + '"> by ' + listing.author + '</a>
# </div>
# <a class="listingTitle" target="_blank" href="' + serviceInfoObject.permalinkBase + listing.kiwi_permaId + '">'
preppedHTMLstring += '<div class="listing ' + listingClass + '">'
if serviceInfoObject.name != 'reddit'
preppedHTMLstring += '<div style="float:right;">
<a target="_blank" href="' + serviceInfoObject.userPageBaselink + listing.author + '"> by ' + listing.author + '</a>
</div>'
preppedHTMLstring += '<a class="listingTitle" target="_blank" href="' + serviceInfoObject.permalinkBase + listing.kiwi_permaId + '"><span style="color:black;">' + recentTag
if listing.over_18? and listing.over_18 is true
preppedHTMLstring += '<span class="nsfw">NSFW</span> <b>' + listing.title + '</b><br>'
else
preppedHTMLstring += '<b>' + listing.title + '</b><br>'
_time = formatTime(listing.kiwi_created_at)
preppedHTMLstring += listing.num_comments + ' comments, ' + listing.kiwi_score + ' upvotes -- ' + _time + '</span></a>'
if listing.subreddit?
preppedHTMLstring += '<br><span>
<a target="_blank" href="' + serviceInfoObject.permalinkBase + '/r/' + listing.subreddit + '">
subreddit: ' + listing.subreddit + '</a></span>
<div style="float:right;">
<a target="_blank" href="' + serviceInfoObject.userPageBaselink + listing.author + '"> by ' + listing.author + '
</a>
</div>'
preppedHTMLstring += '<br></div>'
else
fuzzyMatchBool = true
if fuzzyMatchBool
numberOfExactMatches = _.reduce(service_PreppedResults, (memo, obj) ->
if obj.kiwi_exact_match
memo++
return memo
else
memo
)
if (service_PreppedResults.length - numberOfExactMatches) > 10 and service_PreppedResults.length > 14
listingClass = ' hidden_listing '
else
listingClass = ''
# listingClass = if nonFuzzyItemCounter > 10 then ' hidden_listing ' else ''
preppedHTMLstring += '<div class="showFuzzyMatches ' + listingClass + '" style="position:relative;"> fuzzy matches: <br></div>
<span class="fuzzyMatches">'
# console.log 'fuzzy matches 12312312 ' + serviceInfoObject.name
for listing, index in service_PreppedResults
listingClass = if (index > 10 and service_PreppedResults.length > 14) then ' hidden_listing ' else ''
if !listing.kiwi_exact_match
recentTag = if (currentTime - listing.kiwi_created_at < 1000 * 60 * 60 * 4) then "<span class='recentListingTag'>Recent: </span>" else ""
preppedHTMLstring += '<div class="listing ' + listingClass + '">'
if serviceInfoObject.name != 'reddit'
preppedHTMLstring += '<div style="float:right;">
<a target="_blank" href="' + serviceInfoObject.userPageBaselink + listing.author + '"> by ' + listing.author + '</a>
</div>'
preppedHTMLstring += '<a class="listingTitle" target="_blank" href="' + serviceInfoObject.permalinkBase + listing.kiwi_permaId + '"><span style="color:black;">' + recentTag
if listing.over_18? and listing.over_18 is true
preppedHTMLstring += '<span class="nsfw">NSFW</span> <b>' + listing.title + '</b><br>'
else
preppedHTMLstring += '<b>' + listing.title + '</b><br>'
preppedHTMLstring += listing.num_comments + ' comments, ' + listing.kiwi_score + ' upvotes ' + formatTime(listing.kiwi_created_at) + '</span>
<br>
for Url: <span class="altURL">' + listing.url + '</span>
</a>'
if listing.subreddit?
preppedHTMLstring += '<br><span>
<a target="_blank" href="' + serviceInfoObject.permalinkBase + '/r/' + listing.subreddit + '">
subreddit: ' + listing.subreddit + '</a></span>
<div style="float:right;">
<a target="_blank" href="' + serviceInfoObject.userPageBaselink + listing.author + '"> by ' + listing.author + '
</a></div>'
preppedHTMLstring += '<br></div>'
preppedHTMLstring += "</span>"
preppedHTMLstring += "</div>"
return preppedHTMLstring
bindGoToViewButtons = (buttonEls, viewName, viewData) ->
for el in buttonEls
$(el).bind('click', (ev) ->
# console.log 'clicked ' + viewName
switchViews[viewName].render(viewData)
)
moveArrayElement = (array, from, to) ->
array.splice(to, 0, array.splice(from, 1)[0]);
return array
getRandom = (min, max) ->
return min + Math.floor(Math.random() * (max - min + 1))
formatTime = (utcMillisecondTimestamp) ->
a = new Date(utcMillisecondTimestamp)
months = ['Jan','Feb','Mar','Apr','May','Jun','Jul','Aug','Sep','Oct','Nov','Dec']
year = a.getFullYear()
month = months[a.getMonth()]
date = a.getDate()
hour = a.getHours()
min = a.getMinutes()
sec = a.getSeconds()
amOrPm = if hour > 11 then 'pm' else 'am'
if hour > 12
hour = hour - 12
else if parseInt(hour) == 0
hour = 12
if min < 10
min = '0' + min
time = month + ' ' + date + ', ' + year + ' - ' + hour + ':' + min + amOrPm
return time
renderExtensionHeight = (elementSelector, extraPx) ->
if viewElementId is elementSelector
extraPx = 2
extHeight_ = $(elementSelector).outerHeight() + extraPx
if extHeight_ > 590
extHeight_ = 590
# $('html').css('height',extHeight+'px')
$('body').css('height', extHeight_ + 'px')
`heightString = extHeight_.toString() +'px'`
$('html').css('min-height', heightString)
extHeight_--
$('body').css('min-height', heightString)
capitalizeFirstLetter = (string) ->
return string.charAt(0).toUpperCase() + string.slice(1)
# // http://css-tricks.com/snippets/javascript/htmlentities-for-javascript/
htmlEntities = (str) ->
return String(str).replace(/&/g, '&').replace(/</g, '<').replace(/>/g, '>').replace(/"/g, '"');
getURLParam = (oTarget, sVar) ->
return decodeURI(oTarget.search.replace(new RegExp("^(?:.*[&\\?]" + encodeURI(sVar).replace(/[\.\+\*]/g, "\\$&") + "(?:\\=([^&]*))?)?.*$", "i"), "$1"));
algoliaPHclient = null
algoliaPHindex = null
initAlgoliaPHcustomSearch = ->
algoliaPHclient = algoliasearch('0H4SMABBSG', '9670d2d619b9d07859448d7628eea5f3')
algoliaPHindex = algoliaPHclient.initIndex('Post_production')
initAlgoliaPHcustomSearch()
fetchAlgoliaProductHuntResultsFirst = (parcel) ->
# console.log 'yoyoyo here ' + parcel.customSearchRequest.queryString
# console.log parcel
# not ideal because it's blocking, and it'd be better to have persistent index object
# but the restrictions in FF addons force this approach.
if algoliaPHindex?
algoliaPHindex.search(parcel.customSearchRequest.queryString, (err, content) ->
# // err is either `null` or an `Error` object, with a `message` property
# // content is either the result of the command or `undefined`
if (err)
console.error(err)
parcel.customSearchRequest.servicesToSearch.productHunt.rawResults = []
self.port.emit('kiwiPP_post_customSearch', parcel)
return 0
if content? and content.hits?
parcel.customSearchRequest.servicesToSearch.productHunt.rawResults = content.hits
else
parcel.customSearchRequest.servicesToSearch.productHunt.rawResults = []
# console.log 'sending this PH'
# console.log parcel.customSearchRequest.servicesToSearch.productHunt.rawResults
self.port.emit('kiwiPP_post_customSearch', parcel)
)
else
parcel.customSearchRequest.servicesToSearch.productHunt.rawResults = []
self.port.emit('kiwiPP_post_customSearch', parcel)
sendParcel = (parcel) ->
if !parcel.msg?
return false
switch parcel.msg
when 'kiwiPP_acknowledgeMessage'
self.port.emit('kiwiPP_acknowledgeMessage', parcel);
when 'kiwiPP_refreshSearchQuery'
# port.postMessage(parcel)
self.port.emit('kiwiPP_refreshSearchQuery', parcel);
when 'kiwiPP_post_customSearch'
# not ideal because it's blocking, but the restrictions in FF addons force this approach
if parcel.customSearchRequest.servicesToSearch.productHunt?
fetchAlgoliaProductHuntResultsFirst(parcel)
else
port.postMessage(parcel)
when 'kiwiPP_request_popupParcel'
self.port.emit('kiwiPP_request_popupParcel', parcel)
# port.postMessage(parcel)
when 'kiwiPP_post_savePopupParcel'
self.port.emit('kiwiPP_post_savePopupParcel', parcel)
# port.postMessage(parcel)
when 'kiwiPP_post_save_a_la_carte'
self.port.emit('kiwiPP_post_save_a_la_carte', parcel)
# port.postMessage(parcel)
when 'kiwiPP_clearAllURLresults'
self.port.emit('kiwiPP_clearAllURLresults', parcel)
# port.postMessage(parcel)
when 'kiwiPP_refreshURLresults'
self.port.emit('kiwiPP_refreshURLresults', parcel)
# port.postMessage(parcel)
when 'kiwiPP_researchUrlOverrideButton'
self.port.emit('kiwiPP_researchUrlOverrideButton', parcel)
# port.postMessage(parcel)
receiveParcel = (parcel) ->
if !parcel.msg?
return false
switch parcel.msg
when 'kiwiPP_popupParcel_ready'
initialize(parcel.popupParcel)
self.port.on('kiwi_fromBackgroundToPopup', (parcel) ->
receiveParcel(parcel)
)
| 4712 |
viewElementId = ''
renderedBool = false
preferencesOnlyPage = false
initialize = (popupParcel) ->
# console.log 'in init'
if getURLParam(window.location, 'optionsOnly') != ''
preferencesOnlyPage = true
switchViews.userPreferences.render(popupParcel)
return 0
for viewName, view of fixedViews
view.init(popupParcel)
# views.userPreferences.render(popupParcel)
if popupParcel.view? and switchViews[popupParcel.view]?
switchViews[popupParcel.view].render(popupParcel)
else
switchViews.conversations.render(popupParcel)
class Widget # basic building block
constructor: (@name, @parentView, @__renderStates__) ->
@elsToUnbind = []
@totalRenders = 0
@DOMselector = @parentView.DOMselector + " #" + @name + "_Widget"
@Widgets = {}
@bindAllGoToViewButtons = (viewData) =>
for _viewName, viewValue of switchViews
# console.log _viewName
# bind to goToView buttons
els_goTo_view = $(@DOMselector + ' .goTo_' + _viewName + 'View')
# console.debug els_goTo_view
@elsToUnbind.push els_goTo_view
bindGoToViewButtons(els_goTo_view, _viewName, viewData)
@unbindWidget = =>
for el in @elsToUnbind
el.unbind()
@elsToUnbind = []
@render = (renderState, popupParcel) =>
@totalRenders++
@unbindWidget(@name)
@renderStates[renderState].paint(popupParcel)
@bindAllGoToViewButtons(popupParcel)
@renderStates[renderState].bind(popupParcel)
@renderStates = @__renderStates__()
return @
class MessageCenter extends Widget
constructor: (@name, @parentView, @widgetOpenBool) ->
# console.debug @__renderStates__
# console.log ' trying '
super @name, @parentView, @__renderStates__
init: (popupParcel) ->
@unbindWidget()
@render('showMessages',popupParcel)
__renderStates__: =>
showMessages:
paint: (popupParcel) =>
# console.log 'messagesHTML = ""
# console.debug popupParcel'
messagesHTML = ""
# console.debug popupParcel
if popupParcel.kiwi_userMessages.length > 0
messagesHTML += '<div style="padding-top:4px; padding-bottom:10px;">'
for messageObj in popupParcel.kiwi_userMessages
messagesHTML += '<div class="bg-warning" style="margin:6px; padding:8px; text-align:justify;">
<button style="float:right; margin:8px; padding:4px; padding-right:6px; padding-left:6px;" class="btn btn-xs btn-default acknowledgeMessage" data-messageToAcknowledge="' + messageObj.name + '" >
<span title="remove" data-messageToAcknowledge="' + messageObj.name + '"
class="glyphicon glyphicon-remove" aria-hidden="true"
style="color:#E65F5F;"
></span>
</button>
' + messageObj.baseValue + '
</div>'
messagesHTML += '<div style="width:100%; text-align:center;"> <b>message priority</b>: urgent.
please acknowledge the message(s) by clicking the "x" button(s). Thanks! :)
</div></div>'
$(@DOMselector).html(messagesHTML)
# $(@DOMselector + " .notFixed").css({'height':fixedHeight + "px"})
bind: (popupParcel) =>
if popupParcel.kiwi_userMessages.length > 0
# console.log 'bind: (popupParcel) =>'
ackMessageButtons = $(@DOMselector + ' .acknowledgeMessage')
@elsToUnbind = @elsToUnbind.concat ackMessageButtons
ackMessageButtons.bind 'click', (ev) =>
console.log "trying for ackMessageButtons.bind 'click', (ev) =>"
messageToAcknowledge = $(ev.target).attr('data-messageToAcknowledge')
console.log 'messageToAcknowledge ' + messageToAcknowledge
# console.debug popupParcel.kiwi_userPreferences.urlSubstring_whitelists.anyMatch
# console.debug whitelistSubString
parcel =
messageToAcknowledge: messageToAcknowledge
msg: 'kiwiPP_acknowledgeMessage'
sendParcel(parcel)
class CustomSearch extends Widget
constructor: (@name, @parentView, @widgetOpenBool) ->
# console.debug @__renderStates__
super @name, @parentView, @__renderStates__
init: (popupParcel) ->
@Widgets = {messageCenter: new MessageCenter 'messageCenter', @, false}
@unbindWidget()
if @widgetOpenBool == false
@render('collapsed',popupParcel)
else
@render('opened',popupParcel)
__renderStates__: =>
collapsed:
paint: (popupParcel) =>
openedCustomSearchHTML = '
<div class="topSearchBar" style="padding-bottom: 14px;">
<div class="evenlySpacedContainer">
<input class="queryInputOpen" id="customSearchQueryInput" type="text" placeholder=" combined search" />
<button class="btn btn-mini btn-default goTo_userPreferencesView">User Options
<span class="glyphicon glyphicon-chevron-right" aria-hidden="true"></span></button>
</div>
'
if popupParcel.kiwi_customSearchResults.queryString? and popupParcel.kiwi_customSearchResults.queryString != ''
openedCustomSearchHTML += "<div style='padding-top: 12px;'><a id='openPreviousSearch'>see custom results for '" + popupParcel.kiwi_customSearchResults.queryString + "'
</a> <a id='clearPreviousSearch'>clear</a></div>"
openedCustomSearchHTML += "
<div id='messageCenter_Widget'></div>
</div>
<div class='notFixed'></div>"
$(@DOMselector).html(openedCustomSearchHTML)
# console?.log 'console.log @DOMselector + " .topSearchBar"' + @DOMselector + " .topSearchBar"
duplicateFixedHeight = =>
fixedElHeight = $(@DOMselector + " .topSearchBar").outerHeight()
# console.log 'console.log fixedElHeight closed'
# console.log fixedElHeight
if popupParcel.kiwi_userMessages? and popupParcel.kiwi_userMessages.length > 0
fixedElHeight += 70 + popupParcel.kiwi_userMessages.length * 60
if fixedElHeight == 0
setTimeout -> # defer to next browser event tick
duplicateFixedHeight()
, 0
else
$(@DOMselector + " .notFixed").css({'height':fixedElHeight + "px"})
duplicateFixedHeight()
@Widgets.messageCenter.render('showMessages', popupParcel)
# $(@DOMselector + " .notFixed").css({'height':fixedHeight + "px"})
bind: (popupParcel) =>
# console.log 'bind: (popupParcel) =>'
inputSearchQueryInput = $("#customSearchQueryInput")
previousSearchLink = $("#openPreviousSearch")
clearPreviousSearch = $("#clearPreviousSearch")
@elsToUnbind = @elsToUnbind.concat inputSearchQueryInput, previousSearchLink, clearPreviousSearch
previousSearchLink.bind 'click', ->
$("#customSearchQueryInput").click()
clearPreviousSearch.bind 'click', ->
parcel =
msg: 'kiwiPP_refreshSearchQuery'
sendParcel(parcel)
inputSearchQueryInput.bind 'click', =>
# console.log '@widgetOpenBool = true'
@widgetOpenBool = true
@render('opened',popupParcel)
opened:
paint: (popupParcel) =>
# console.log 'popupParcel.kiwi_servicesInfo.length'
# console.log popupParcel.kiwi_servicesInfo.length
queryString = if popupParcel.kiwi_customSearchResults.queryString? then popupParcel.kiwi_customSearchResults.queryString else ''
openedCustomSearchHTML = '<div class="topSearchBar">
<div class="evenlySpacedContainer">
<input id="customSearchQueryInput" value="' + queryString + '" type="text" placeholder=" combined search" style="width:234px; margin-right: 10px;" />
<button class="btn btn-mini btn-default" id="customSearchQuerySubmit" style="margin-right: 10px;">Submit</button>
<button style="" class="goTo_userPreferencesView btn btn-mini btn-default"> Options
<span class="glyphicon glyphicon-chevron-right" aria-hidden="true"></span></button>
</div>
<br>
<div class="evenlySpacedContainer" style="position: relative; top: -8px; margin-bottom: 3px;">'
for serviceInfoObject in popupParcel.kiwi_servicesInfo
openedCustomSearchHTML += '<div>'
# console.log 'asdfasdf ' + serviceInfoObject.name
# console.debug serviceInfoObject
if serviceInfoObject.active == 'off'
serviceDisabledAttr = ' disabled title="Service must be active, can be changed in options." '
else
serviceDisabledAttr = ' '
if popupParcel.kiwi_customSearchResults.servicesSearchesRequested? and popupParcel.kiwi_customSearchResults.servicesSearchesRequested[serviceInfoObject.name]?
activeClass = ' active '
ariaPressedState = 'true'
else if !popupParcel.kiwi_customSearchResults.servicesSearchesRequested?
activeClass = if serviceInfoObject.active is 'off' then ' ' else ' active '
ariaPressedState = if serviceInfoObject.active is 'off' then 'false' else 'true'
else
activeClass = ' '
ariaPressedState = 'false'
if serviceInfoObject.customSearchTags? and Object.keys(serviceInfoObject.customSearchTags).length > 0
openedCustomSearchHTML += '<div class="btn-group">
<button data-toggle="button" aria-pressed="' + ariaPressedState + '" autocomplete="off" ' + serviceDisabledAttr + '
class="servicesToSearch btn btn-default btn-mini dropdownLabel ' + activeClass + '" data-serviceName="' + serviceInfoObject.name + '">
' + serviceInfoObject.title + '
</button>
<button ' + serviceDisabledAttr + ' data-toggle="dropdown" class="btn btn-default dropdown-toggle ' + activeClass + '
dropDownPrefs_' + serviceInfoObject.name + '" data-placeholder="false"><span class="caret"></span></button>
<ul class="dropdown-menu">'
for tagName, tagObject of serviceInfoObject.customSearchTags
if popupParcel.kiwi_customSearchResults.servicesSearchesRequested? and popupParcel.kiwi_customSearchResults.servicesSearchesRequested[serviceInfoObject.name]?
if popupParcel.kiwi_customSearchResults.servicesSearchesRequested[serviceInfoObject.name].customSearchTags[tagName]?
tagActiveChecked = ' checked '
else
tagActiveChecked = ''
else
tagActiveChecked = if tagObject.include is true then ' checked ' else ''
tagDisabledAttr = if serviceInfoObject.active is 'off' then ' disabled title="Service must be active, can be changed in options." ' else ''
openedCustomSearchHTML += '<li><input ' + tagActiveChecked + tagDisabledAttr + ' type="checkbox" value="' + tagName + '" class="tagPref tagPref_' + serviceInfoObject.name + '" id="' + serviceInfoObject.name + tagName + '">
<label for="' + serviceInfoObject.name + tagName + '">
' + tagObject.title + '
</label></li>'
openedCustomSearchHTML += '</ul></div>'
else
openedCustomSearchHTML += '<button data-toggle="button" aria-pressed="' + ariaPressedState + '" autocomplete="off"
type="button" class="servicesToSearch btn btn-mini btn-default ' + activeClass + '" data-serviceName="' + serviceInfoObject.name + '">
' + serviceInfoObject.title + '
</button>'
openedCustomSearchHTML += '</div>'
openedCustomSearchHTML += '<div>
<button aria-pressed="false" autocomplete="off" type="button" class="btn btn-mini btn-default"
id="close__' + @name + '"
>
close <span class="glyphicon glyphicon-remove" aria-hidden="true"></span>
</button>
</div>
</div>'
openedCustomSearchHTML += '
<div id="messageCenter_Widget">asdfasd</div>
</div>
<div class="notFixed"></div>
<div id="customSearchResults"></div>
'
resultsSummaryArray = []
customSearchResultsHTML = ""
if popupParcel.kiwi_customSearchResults? and popupParcel.kiwi_customSearchResults.queryString? and
popupParcel.kiwi_customSearchResults.queryString != ''
for serviceInfoObject, index in popupParcel.kiwi_servicesInfo
if popupParcel.kiwi_customSearchResults.servicesSearched[serviceInfoObject.name]?
service_PreppedResults = popupParcel.kiwi_customSearchResults.servicesSearched[serviceInfoObject.name].results
resultsSummaryArray.push("<a class='jumpTo' data-serviceindex='" + index + "'>" + serviceInfoObject.title + " (" + service_PreppedResults.length + ")</a>")
customSearchResultsHTML += tailorResults[serviceInfoObject.name](serviceInfoObject, service_PreppedResults, popupParcel.kiwi_userPreferences)
if service_PreppedResults.length > 14
customSearchResultsHTML += '<div class="listing showHidden" data-servicename="' + serviceInfoObject.name + '"> show remaining ' + (service_PreppedResults.length - 11) + ' results</div>'
else
customSearchResultsHTML += '<br>No results for ' + serviceInfoObject.title + '<br>'
# customSearchResultsHTML += '</div>'
else
customSearchResultsHTML += '<div id="customSearchResultsDrop"><br>No results to show... make a search! :) </div><br>'
customSearchResultsHTML = "<div style='width: 100%; text-align: center;font-size:.9em;'>" + resultsSummaryArray.join(" - ") + "</div>" + customSearchResultsHTML
customSearchResultsHTML += "<br>"
$(@DOMselector).html(openedCustomSearchHTML)
$(@DOMselector + " #customSearchResults").html(customSearchResultsHTML)
$(@DOMselector + " .hidden_listing").hide()
duplicateFixedHeight = =>
fixedElHeight = $(@DOMselector + " .topSearchBar").outerHeight()
# console.log 'console.log fixedElHeight opened'
# console.log fixedElHeight
if popupParcel.kiwi_userMessages? and popupParcel.kiwi_userMessages.length > 0
fixedElHeight += 70 + popupParcel.kiwi_userMessages.length * 60
if fixedElHeight == 0
setTimeout -> # defer to next browser event tick
duplicateFixedHeight()
, 0
else
$(@DOMselector + " .notFixed").css({'height':fixedElHeight + "px"})
duplicateFixedHeight()
@Widgets.messageCenter.render('showMessages', popupParcel)
bind: (popupParcel) =>
customSearchQueryInput = $(@DOMselector + " #customSearchQueryInput")
customSearchQuerySubmit = $(@DOMselector + " #customSearchQuerySubmit")
closeWidget = $(@DOMselector + ' #close__' + @name)
customSearch_sortByPref = $(@DOMselector + " .conversations_sortByPref")
modifySearch = $(@DOMselector + " .customSearchOpen")
elsServicesButtons = $(@DOMselector + " button.servicesToSearch ")
elsServicesActivePrefs = $(@DOMselector + " .customSearchServicePref input")
showHidden = $(@DOMselector + " .showHidden")
jumpToServiceCustomResults = $(@DOMselector + " #customSearchResults .jumpTo")
@elsToUnbind = @elsToUnbind.concat(customSearchQueryInput, closeWidget, customSearchQuerySubmit, elsServicesButtons,
customSearch_sortByPref, showHidden, jumpToServiceCustomResults, modifySearch)
modifySearch.bind 'click', ->
$(@DOMselector + " #customSearchQueryInput").focus()
jumpToServiceCustomResults.bind 'click', (ev) =>
serviceIndex = parseInt($(ev.target).data('serviceindex'))
pxFromTop = $($(@DOMselector + " #customSearchResults .serviceResultJumpTo")[serviceIndex]).offset().top
# offsetBy = $($(@DOMselector + " #customSearchResults .serviceResultJumpTo")[serviceIndex]).outerHeight() + 40
$('body').scrollTop(pxFromTop - 100)
showHidden.bind 'click', (ev) =>
# console.log "showHidden.bind 'click', (ev) ->"
# console.debug ev
serviceName = $(ev.target).data('servicename')
# resultsBox__" + serviceInfoObject.name +
# console.log @DOMselector + " .resultsBox__" + serviceName + " .hidden_listing"
$(@DOMselector + " .resultsBox__" + serviceName + " .hidden_listing").show(1200)
$(ev.target).remove()
elsServicesButtons.bind('click', (ev) =>
if $(ev.target).hasClass("dropdownLabel")
serviceName = $(ev.target).attr('data-serviceName')
# console.log serviceName
# console.debug $(ev.target).attr('aria-pressed')
ariaPressed = $(ev.target).attr('aria-pressed')
if ariaPressed == 'true'
$('button.dropDownPrefs_' + serviceName).removeClass('active')
# console.log 'if ev.target.checked == "false" ' + serviceName
$(@DOMselector + " input.tagPref_" + serviceName ).attr('disabled','disabled')
else
$('button.dropDownPrefs_' + serviceName).addClass('active')
# console.log $(ev.target).attr('aria-pressed') + "asdfasdf"
$(@DOMselector + " input.tagPref_" + serviceName ).removeAttr('disabled')
$(ev.target).blur()
)
customSearch_sortByPref.bind 'change', (ev) ->
# console.log ' customSearch_sortByPref.val()'
# console.log
popupParcel.kiwi_userPreferences.sortByPref = $(ev.target).val()
parcel =
refreshView: 'conversations'
keyName: '<KEY>'
newValue: popupParcel.kiwi_userPreferences
localOrSync: 'sync'
msg: 'kiwiPP_post_save_a_la_carte'
sendParcel(parcel)
sendSearch = =>
queryString = customSearchQueryInput.val()
elsServicesToSearch = $(@DOMselector + ' button.servicesToSearch[aria-pressed="true"]')
# ariaPressed = $(ev.target).attr('aria-pressed')
# if ariaPressed == 'true'
servicesToSearch = {}
for el in elsServicesToSearch
serviceName = $(el).attr('data-serviceName')
servicesToSearch[serviceName] = {}
servicesToSearch[serviceName].customSearchTags = {}
elTagPrefs = $(@DOMselector + " input.tagPref_" + serviceName + ":checked")
for elTagPref in elTagPrefs
tagName = $(elTagPref).val()
servicesToSearch[serviceName].customSearchTags[tagName] = {}
# console.log 'asfdasdfasdf ' + serviceName
# console.debug servicesToSearch
if queryString != ''
parcel =
msg: 'kiwiPP_post_customSearch'
customSearchRequest:
queryString: queryString
servicesToSearch: servicesToSearch
sendParcel(parcel)
customSearchQueryInput.keypress (event) ->
charCode = if event.keyCode then event.keyCode else event.which
if charCode == 13
sendSearch()
customSearchQuerySubmit.bind 'click', =>
sendSearch()
closeWidget.bind 'click', =>
@widgetOpenBool = false
@render('collapsed',popupParcel)
customSearchQueryInput.focus()
# showViewAndBindGoToViewButtons
class View # basic building block
constructor: (@name, @__renderStates__) ->
@elsToUnbind = []
@totalRenders = 0
@DOMselector = "#" + @name + "_View"
@Widgets = {}
@bindAllGoToViewButtons = (viewData) =>
for _viewName, viewValue of switchViews
els_goTo_view = $(@DOMselector + ' .goTo_' + _viewName + 'View')
@elsToUnbind.push els_goTo_view
bindGoToViewButtons(els_goTo_view, _viewName, viewData)
@renderStates = @__renderStates__()
return @
unbindView: =>
# console.log 'unbinding view'
# console.debug @elsToUnbind
# $(".userPreferencesSave").unbind()
for el in @elsToUnbind
el.unbind()
@elsToUnbind = []
for widget in @Widgets
widget.unbindWidget()
render: (popupParcel, renderState = "__normal__") =>
@totalRenders++
@unbindView(@name)
if !renderState? and !@renderStates.__normal__?
console?.log 'ERROR: must declare renderState for view ' + @name + ' since __normal__ undefined'
# console.log 'console.debug renderState ' + @name + renderState
# console.log @totalRenders
# console.debug @renderStates
@renderStates[renderState].paint(popupParcel)
@bindAllGoToViewButtons(popupParcel)
@renderStates[renderState].bind(popupParcel)
class FixedView extends View
constructor: (@name, @__renderStates__, uniqueSelectorPostfix) ->
super @name, @__renderStates__
@DOMselector += uniqueSelectorPostfix
# console.log @DOMselector
class SwitchView extends View
constructor: (@name, @__renderStates__) ->
super @name, @__renderStates__
showView: =>
for _viewName, viewValue of switchViews
if _viewName == @name
# show
# console.log 'showing ' + _viewName
$('#' + _viewName + '_View').css({'display':'block'})
else
# hide
# console.log 'hiding ' + _viewName
$('#' + _viewName + '_View').css({'display':'none'})
render: (popupParcel, renderState = "__normal__") =>
super popupParcel, renderState
@showView()
class Conversations extends SwitchView
constructor: (@name) ->
super @name, @__renderStates__
@Widgets =
customSearch: new CustomSearch 'customSearch', @, false
init: (popupParcel) ->
@unbindWidget()
@render(popupParcel)
__renderStates__: =>
__normal__:
paint: (popupParcel) =>
# console.log ' in conversations view'
# console.log popupParcel
@Widgets['customSearch'].init(popupParcel)
researchModeDisabledButtonsHTML = ''
if popupParcel.urlBlocked == true or popupParcel.kiwi_userPreferences.researchModeOnOff == 'off' or (popupParcel.oldUrl? and popupParcel.oldUrl == true)
researchModeDisabledButtonsHTML += "<br>
<div style='width:100%;text-align: center;'><button class='btn btn-success' style='font-size: 1.1em;display: inline-block;' id='researchUrlOverride'>Research this Url</button></div>
<br>"
if popupParcel.kiwi_userPreferences.researchModeOnOff == 'off'
researchModeDisabledButtonsHTML += "<br>
<div style='width:100%; text-align:center;'>
Research Mode is off:
<button class='goTo_userPreferencesView btn btn-xs btn-default' style='position:relative; bottom:2px;'>
change settings
</button>
</div>"
$("#researchModeDisabledButtons").html(researchModeDisabledButtonsHTML)
resultsSummaryArray = []
resultsHTML = ""
totalResults = 0
for serviceInfoObject, index in popupParcel.kiwi_servicesInfo
if popupParcel.allPreppedResults[serviceInfoObject.name]? and popupParcel.allPreppedResults[serviceInfoObject.name].service_PreppedResults.length > 0
service_PreppedResults = popupParcel.allPreppedResults[serviceInfoObject.name].service_PreppedResults
totalResults += service_PreppedResults.length
resultsSummaryArray.push("<a class='jumpTo' data-serviceindex='" + index + "'>" + serviceInfoObject.title + " (" + service_PreppedResults.length + ")</a>")
resultsHTML += tailorResults[serviceInfoObject.name](serviceInfoObject,service_PreppedResults, popupParcel.kiwi_userPreferences)
if service_PreppedResults.length > 14
resultsHTML += '<div class="listing showHidden" data-servicename="' + serviceInfoObject.name + '"> show remaining ' + (service_PreppedResults.length - 11) + ' results</div>'
else
if serviceInfoObject.submitTitle?
submitUrl = serviceInfoObject.submitUrl
submitTitle = serviceInfoObject.submitTitle
resultsHTML += '<div class="serviceResultJumpTo">No conversation matches for ' + serviceInfoObject.title + '... <br>
<a target="_blank" href="' + submitUrl + '">' + submitTitle + '</a></div><br>'
else
resultsHTML += '<div>No results for ' + serviceInfoObject.title + '</div>'
preppedHTMLstring = ''
if (popupParcel.urlBlocked == true and Object.keys(popupParcel.allPreppedResults).length < 2)
# do nothing
preppedHTMLstring += "<div style='width: 100%; text-align: justify; padding:20px; font-size:.9em; opacity:.9;'>
<em>
Certain super-high traffic URLs
(or weird urls (like 'about:config' and chrome new tab pages)) have been
excluded from auto-search out of respect for the APIs of the conversation sites. you can still manually
search them by hitting the green button
</em>
</div><br>"
else if ((totalResults > 0 and popupParcel.kiwi_userPreferences.researchModeOnOff == 'off') or
popupParcel.kiwi_userPreferences.researchModeOnOff == 'on' or
Object.keys(popupParcel.allPreppedResults).length > 1)
preppedHTMLstring = '<br><h3 style="position:relative; top:-10px;">Results for this URL:</h3>'
preppedHTMLstring += "<div style='width: 100%; text-align: center;font-size:.9em;'>" + resultsSummaryArray.join(" - ") + "</div><br>"
preppedHTMLstring += resultsHTML
$("#resultsByService").html(preppedHTMLstring)
$(@DOMselector + " .hidden_listing").hide()
if totalResults < 4 and @totalRenders < 4
fixedViews.kiwiSlice.render(popupParcel, "open")
setTimeout( -> # to reign in a chrome rendering issue
# renderExtensionHeight(@DOMselector, 1)
$($('input')[0]).blur()
$($('a')[0]).blur()
$($('button')[0]).blur()
, 300
)
# renderExtensionHeight(@DOMselector, 1)
$($('input')[0]).blur()
$($('a')[0]).blur()
$($('button')[0]).blur()
bind: (popupParcel) =>
showHidden = $(@DOMselector + " .showHidden")
researchUrlOverrideButton = $(@DOMselector + " #researchUrlOverride")
conversations_sortByPref = $(@DOMselector + " .conversations_sortByPref")
customSearchOpen = $(@DOMselector + " .customSearchOpen")
jumpToService = $("#resultsByService .jumpTo")
@elsToUnbind = @elsToUnbind.concat(conversations_sortByPref, showHidden, researchUrlOverrideButton, customSearchOpen, jumpToService)
jumpToService.bind 'click', (ev) =>
serviceIndex = parseInt($(ev.target).data('serviceindex'))
# console.log serviceIndex
pxFromTop = parseInt($($(@DOMselector + " #resultsByService .serviceResultJumpTo")[serviceIndex]).offset().top)
# offsetBy = parseInt($($("#resultsByService .serviceResultsHeaderBar")[serviceIndex]).outerHeight()) + 40
$('body,html').scrollTop(pxFromTop - 100)
customSearchOpen.bind 'click', ->
$("#customSearchQueryInput").click()
researchUrlOverrideButton.bind 'click', ->
parcel =
msg: 'kiwiPP_researchUrlOverrideButton'
sendParcel(parcel)
showHidden.bind 'click', (ev) =>
# console.log "showHidden.bind 'click', (ev) -> "
# console.debug ev
serviceName = $(ev.target).data('servicename')
$(@DOMselector + " .resultsBox__" + serviceName + " .hidden_listing").show(1200)
$(ev.target).remove()
conversations_sortByPref.bind 'change', (ev) ->
# console.log "'conversations_sortByPref.bind 'change', (ev) ->"
# console.log $(ev.target).val()
popupParcel.kiwi_userPreferences.sortByPref = $(ev.target).val()
parcel =
refreshView: 'conversations'
keyName: '<KEY>'
newValue: popupParcel.kiwi_userPreferences
localOrSync: 'sync'
msg: 'kiwiPP_post_save_a_la_carte'
sendParcel(parcel)
class UserPreferences extends SwitchView
constructor: (@name) ->
super @name, @__renderStates__
init: (popupParcel) ->
@unbindWidget()
@render(popupParcel)
__renderStates__: =>
__normal__:
paint: (popupParcel) =>
$(@DOMselector + " .userErrMsg").html('')
# console.log 'paint: adsfaeaewfawefawefawef(popupParcel) =># viewName = '
if preferencesOnlyPage is true
$("#menuBar_preferences").hide()
currentTime = Date.now()
if popupParcel.kiwi_userPreferences.researchModeOnOff == "off"
$("#autoOffTimer").html("Research mode is off, so auto-off timer is not set")
else if popupParcel.kiwi_userPreferences.autoOffAtUTCmilliTimestamp? and popupParcel.kiwi_userPreferences.autoOffAtUTCmilliTimestamp > currentTime
$("#autoOffTimer").html("Auto-Off timer expires at: " + formatTime(popupParcel.kiwi_userPreferences.autoOffAtUTCmilliTimestamp) + "<br>")
else if popupParcel.kiwi_userPreferences.researchModeOnOff == 'off' and popupParcel.kiwi_userPreferences.autoOffAtUTCmilliTimestamp?
$("#autoOffTimer").html("Auto-off timer last expired at: " + formatTime(popupParcel.kiwi_userPreferences.autoOffAtUTCmilliTimestamp) + "<br>")
else
$("#autoOffTimer").html("Auto-off timer is not set")
researchModeHtml = ''
if popupParcel.kiwi_userPreferences.researchModeOnOff is "off"
researchOnString = ""
researchOffString = " checked='checked' "
else
researchOnString = " checked='checked' "
researchOffString = ""
autoOffTimerType = popupParcel.kiwi_userPreferences.autoOffTimerType
autoOffTimerValue = popupParcel.kiwi_userPreferences.autoOffTimerValue
`var auto20, auto60, autoAlways, autoCustom, autoCustomValue = '';
if(autoOffTimerType != null){
if(autoOffTimerType == "20"){ auto20 = " checked='checked' " }
else if(autoOffTimerType == "60"){ auto60 = " checked='checked' " }
else if(autoOffTimerType == "always"){ autoAlways = " checked='checked' " }
else if(autoOffTimerType == "custom"){ autoCustom = " checked='checked' "; autoCustomValue = autoOffTimerValue;}
}`
researchModeHtml += 'Research Mode:
<a class="tooltipCustom" style="position: relative;">
<div style="display:inline; font-size:.9em;"><sup><em> ?</em></sup></div>
<span style="bottom:34px; left:-114px;">
When the Research mode is "Off", Kiwi won\'t automatically search URLs as you surf;
instead, you can check URLs on a case-by-case basis (and still be able to do custom searches)
</span>
</a>
<label style="font-weight: normal;" for="researchmodeON"> on </label> <input id="researchmodeON" type="radio" name="research" value="on" ' + researchOnString + '> -
<label style="font-weight: normal;" for="researchmodeOFF"> off </label> <input id="researchmodeOFF" type="radio" name="research" value="off" ' + researchOffString + '>
<button class="btn btn-mini btn-default userPreferencesSave"> save preferences </button><br>'
if popupParcel.kiwi_userPreferences.researchModeOnOff is 'off'
researchModeHtml += ''
timerDisabled = ' disabled '
timerOnlyUsefulWhenMessage = '<br>
<span style="font-size:.8em;"><i>
Note: the auto-off-timer only matters when Research Mode is "on".
</i></span>
<br>'
else
timerDisabled = ' '
researchModeHtml += '<br>
<span style="font-size:.8em;"><i>
Note: The Whitelist only makes a difference when Research mode is turned "off", which it currently isn\'t.
</i></span>
<br>'
timerOnlyUsefulWhenMessage = ''
researchModeHtml += '
<br>
<table class="table table-bordered table-striped whitelistTable">
<thead>
<tr>
<th colspan="3">
<div class="input-group" id="addWhiteListString">
<label class="input-group-addon">
<a class="tooltipCustom" style="position: relative;">
<div style="display:inline; font-size:.9em;">whitelist strings <sup><em> ?</em></sup></div>
<span style="bottom:84px;left:-12px;">
<b>Whitelist strings:</b> <br>
Kiwi will automatically research any URL (upon visiting) that contains a user-provided Whitelist string --
even when Research Mode is "off".
Try it with "github.com" or "bitbucket.org", and then visit the respective site with research mode "off".
</span>
</a>
</label>
<input type="text" class="form-control ignoreSaveButtonListen">
<label class="input-group-addon btn btn-default">
add
</label>
</div>
</th>
</tr>
</thead>
<tbody>
'
for whitelistSubString, index in popupParcel.kiwi_userPreferences.urlSubstring_whitelists.anyMatch
researchModeHtml += '
<tr>
<th scope="row" style="width:35px;"> ' + (index + 1) + ' </th>
<td> ' + whitelistSubString + ' </td>
<td style="width:35px;">
<button title="remove" class="btn btn-xs btn-default removeWhitelistString" data-whitelistStringToRemove="' + whitelistSubString + '" >
<span data-whitelistStringToRemove="' + whitelistSubString + '"
class="glyphicon glyphicon-remove" aria-hidden="true"
style="color:#E65F5F;"
></span>
</button>
</td>
</tr>'
researchModeHtml += '
</tbody>
</table>
<br>Auto-Off Timer set for: ' + timerOnlyUsefulWhenMessage + '
<br> <label><input ' + timerDisabled + ' type="radio" name="researchAutoOffType" ' + auto20 + ' value="20"> 20 min</label>
<br> <label><input ' + timerDisabled + ' type="radio" name="researchAutoOffType" ' + auto60 + ' value="60"> 1 hr</label>
<br> <label><input ' + timerDisabled + ' type="radio" name="researchAutoOffType" ' + autoAlways + ' value="always"> Always On</label>
<br> <label><input ' + timerDisabled + ' type="radio" name="researchAutoOffType" ' + autoCustom + ' value="custom"> Custom</label>
<input ' + timerDisabled + ' id="autoCustomValue" type="text" value="' + autoCustomValue + '" size="4" disabled /> minutes'
$("#researchModeDrop").html(researchModeHtml)
servicesHtml = ''
for service, index in popupParcel.kiwi_servicesInfo
if service.active == "on"
activeCheck = " checked='checked' "
notActiveCheck = ""
else
activeCheck = ""
notActiveCheck = " checked='checked' "
servicesHtml += '<br>
<div class="serviceListing listing">
<table><tbody><tr>
<td class="upDownButtons">'
if index != 0
servicesHtml += '<span title="Move ' + service.title + ' results above ' + popupParcel.kiwi_servicesInfo[index - 1].title + '" class="glyphicon glyphicon-chevron-up" id="' + service.name + '_moveServiceUp" aria-hidden="true"></span>'
if index != 0 and index != popupParcel.kiwi_servicesInfo.length - 1
servicesHtml += '<br><br>'
if index != popupParcel.kiwi_servicesInfo.length - 1
servicesHtml += '<span title="Move ' + service.title + ' results below ' + popupParcel.kiwi_servicesInfo[index + 1].title + '" class="glyphicon glyphicon-chevron-down" id="' + service.name + '_moveServiceDown" aria-hidden="true"></span>'
brandedTitle = if (service.name is 'reddit') then "for " + service.title else service.title
brandingImage = ''
if service.brandingImage?
brandingImage = " <a target='_blank' href='" + service.broughtToYouByURL + "' style='text-decoration:none;'>
<img height='28' src='" + service.brandingImage + "'/></a> "
servicesHtml += '</td>
<td class="serviceInfo">' + brandedTitle + ' - using: ' + brandingImage + ' <a target="_blank" href="' + service.broughtToYouByURL + '">' + service.broughtToYouByTitle + '</a><br>'
if service.name == "productHunt"
specificAPIlink = ", <a target='_blank' href='https://github.com/producthunt/producthunt-api/wiki/Product-Hunt-APIs#algolia-search-api'>for PH</a>"
if service.customSearchBroughtToYouByTitle?
customSearchApiBrandingHTML = "<div class='bg-warning' style='margin:4px; margin-top:10px;padding:6px;'>
<em><div style='padding-bottom:2px;'> custom searches are using: </div>" + '
<div style="padding-bottom:4px;">
<a target="_blank" href="' + service.customSearchBroughtToYouByURL + '">' + service.customSearchBroughtToYouByTitle + '</a>
' + specificAPIlink + '
</em>
</div>
</em>
</div>'
else
customSearchApiBrandingHTML = ""
servicesHtml += '<div style="padding-left:15px;">
status:
<label style="font-weight: normal;" for="' + service.name + '_serviceStatusON"> on </label> <input id="' + service.name + '_serviceStatusON" type="radio" name="' + service.name + '_serviceStatus" value="on" ' + activeCheck + '> -
<label style="font-weight: normal;" for="' + service.name + '_serviceStatusOFF"> off </label> <input id="' + service.name + '_serviceStatusOFF" type="radio" name="' + service.name + '_serviceStatus" value="off" ' + notActiveCheck + '>
<br><br>Results are deemed notable (capitilizes badge letter) if:'
if service.name == 'gnews'
servicesHtml += '<br><br> the topic has had <input id="' + service.name + '_numberOfStoriesFoundWithinTheHoursSincePostedLimit" type="text" size="4" value="' + service.notableConditions.numberOfStoriesFoundWithinTheHoursSincePostedLimit + '"/> or more related stories published within the last <input id="' + service.name + '_hoursNotable" type="text" size="4" value="' + service.notableConditions.hoursSincePosted + '"/> hours <br>
<div style="width:100%; text-align:center;"><span style="padding:7px; margin-right: 280px; display: inline-block;"> - or - </span></div>
number of News Clusters <input id="' + service.name + '_numberOfRelatedItemsWithClusterURL" type="text" size="4" value="' + service.notableConditions.numberOfRelatedItemsWithClusterURL + '"/>
</div>
' + customSearchApiBrandingHTML + '
</td>
</tr></tbody></table>
</div>'
else
servicesHtml += '<br> URL is an exact match, and:
<br> it has been <input id="' + service.name + '_hoursNotable" type="text" size="4" value="' + service.notableConditions.hoursSincePosted + '"/> or fewer hours since posting <br>
<div style="width:100%; text-align:center;"><span style="padding:7px; margin-right: 280px; display: inline-block;"> - or - </span></div>
a post has <input id="' + service.name + '_commentsNotable" type="text" size="4" value="' + service.notableConditions.num_comments + '"/> or more comments
</div>
' + customSearchApiBrandingHTML + '
</td>
</tr></tbody></table>
</div>'
servicesHtml += "<div class='serviceListing listing' style='padding:15px; margin-top: 30px;'>
Wouldn't it be awesome if we could add some more services to opt-in to? All that's needed are friendly APIs! <a href='https://twitter.com/spencenow' target='_blank'>Tweet me</a> if you're interested in adding one!
</div>
<br>"
$("#servicesInfoDrop").html(servicesHtml)
bind: (popupParcel) =>
saveButtons = $(@DOMselector + " .userPreferencesSave")
removeWhitelistStringButtons = $(@DOMselector + " .removeWhitelistString")
autoTimerRadios = $(@DOMselector + " input:radio[name='researchAutoOffType']")
allInputs = $(@DOMselector + ' input:not(.ignoreSaveButtonListen)')
addWhitelistString_button = $(@DOMselector + " #addWhiteListString label")
@elsToUnbind = @elsToUnbind.concat allInputs, saveButtons, autoTimerRadios, removeWhitelistStringButtons, addWhitelistString_button
saveButtons.attr('disabled','disabled')
allInputs.bind 'change', ->
$(".userPreferencesSave").removeAttr('disabled')
allInputs.bind 'focus', ->
$(".userPreferencesSave").removeAttr('disabled')
if $("input:radio[name='researchAutoOffType']:checked").val() is 'custom'
$("#autoCustomValue").removeAttr('disabled')
autoTimerRadios.bind 'change', ->
if $("input:radio[name='researchAutoOffType']:checked").val() is 'custom'
$("#autoCustomValue").removeAttr('disabled')
else
$("#autoCustomValue").attr('disabled','disabled')
_bindDown = (downButton, index) =>
downButton.bind 'click', ->
popupParcel.kiwi_servicesInfo = moveArrayElement(popupParcel.kiwi_servicesInfo, index, index + 1)
parcel =
refreshView: 'userPreferences'
keyName: '<KEY>'
newValue: popupParcel.kiwi_servicesInfo
localOrSync: 'sync'
msg: 'kiwiPP_post_save_a_la_carte'
sendParcel(parcel)
_bindUp = (upButton, index) =>
upButton.bind 'click', ->
popupParcel.kiwi_servicesInfo = moveArrayElement(popupParcel.kiwi_servicesInfo, index, index - 1 )
parcel =
refreshView: 'userPreferences'
keyName: '<KEY>'
newValue: popupParcel.kiwi_servicesInfo
localOrSync: 'sync'
msg: 'kiwiPP_post_save_a_la_carte'
sendParcel(parcel)
for service,index in popupParcel.kiwi_servicesInfo
downButton = $("#" + service.name + '_moveServiceDown')
if downButton.length > 0
@elsToUnbind.push downButton
_bindDown(downButton, index)
upButton = $("#" + service.name + '_moveServiceUp')
if upButton.length > 0
@elsToUnbind.push upButton
_bindUp(upButton, index)
postError = (userErrMsg) =>
# console.log 'trying to post error ' + userErrMsg
$(@DOMselector + " .userErrMsg").html("<br>" + userErrMsg)
addWhitelistString_button.bind 'click', (ev) =>
# whitelistSubString = $(ev.target).attr('data-whitelistStringToRemove')
whitelistSubString_toAdd = $(@DOMselector + " #addWhiteListString input").val()
popupParcel.kiwi_userPreferences.urlSubstring_whitelists.anyMatch.push whitelistSubString_toAdd
parcel =
refreshView: 'userPreferences'
keyName: '<KEY>'
newValue: popupParcel.kiwi_userPreferences
localOrSync: 'sync'
msg: 'kiwiPP_post_save_a_la_carte'
sendParcel(parcel)
removeWhitelistStringButtons.bind 'click', (ev) ->
whitelistSubString = $(ev.target).attr('data-whitelistStringToRemove')
newWhitelistAnyMatchArray = _.without(popupParcel.kiwi_userPreferences.urlSubstring_whitelists.anyMatch, whitelistSubString);
popupParcel.kiwi_userPreferences.urlSubstring_whitelists.anyMatch = newWhitelistAnyMatchArray
parcel =
refreshView: 'userPreferences'
keyName: '<KEY>'
newValue: popupParcel.kiwi_userPreferences
localOrSync: 'sync'
msg: 'kiwiPP_post_save_a_la_carte'
sendParcel(parcel)
saveButtons.bind 'click', ->
researchModeHTMLval = $("input:radio[name='research']:checked").val()
# console.log 'researchModeHTMLval is ' + researchModeHTMLval
if researchModeHTMLval != 'on' and researchModeHTMLval != 'off'
postError('research mode must be "on" or "off"'); return 0;
allowedAutoOffTypes = ["20","60","always","custom"]
autoOffTimerType = $("input:radio[name='researchAutoOffType']:checked").val()
autoOffTimerValue = $("#autoCustomValue").val()
if autoOffTimerType in allowedAutoOffTypes
if autoOffTimerType == 'custom' and (autoOffTimerValue == '' or isNaN(autoOffTimerValue))
postError('Must specify a number of minutes for auto-off timer.'); return 0;
else
postError('not acceptable autoOffTimerType'); return 0;
# autoOffAtUTCmilliTimestamp
for service, index in popupParcel.kiwi_servicesInfo
if service.name == 'gnews'
active = $("input:radio[name='" + service.name + "_serviceStatus']:checked").val()
if active != 'on' and active != 'off'
postError('active must be "on" or "off"'); return 0;
numberOfStoriesFoundWithinTheHoursSincePostedLimit = $('#' + service.name + '_numberOfStoriesFoundWithinTheHoursSincePostedLimit').val()
if numberOfStoriesFoundWithinTheHoursSincePostedLimit == '' or isNaN(numberOfStoriesFoundWithinTheHoursSincePostedLimit)
postError('number Of Stories Found Within The Hours Since Posted Limit must be an integer'); return 0;
numberOfRelatedItemsWithClusterURL = $('#' + service.name + '_numberOfRelatedItemsWithClusterURL').val()
if numberOfRelatedItemsWithClusterURL == '' or isNaN(numberOfRelatedItemsWithClusterURL)
postError('number Of Related Items With Cluster URL of comments must be an integer'); return 0;
else
active = $("input:radio[name='" + service.name + "_serviceStatus']:checked").val()
if active != 'on' and active != 'off'
postError('active must be "on" or "off"'); return 0;
hoursSincePosted = $('#' + service.name + '_hoursNotable').val()
if hoursSincePosted == '' or isNaN(hoursSincePosted)
postError('Hours must be an number'); return 0;
num_comments = $('#' + service.name + '_commentsNotable').val()
if num_comments == '' or isNaN(num_comments)
postError('Number of comments must be an integer'); return 0;
# console.log '1234'
popupParcel.kiwi_userPreferences.researchModeOnOff = researchModeHTMLval
if (autoOffTimerType != 'custom')
popupParcel.kiwi_userPreferences.autoOffTimerType = autoOffTimerType
else
popupParcel.kiwi_userPreferences.autoOffTimerType = autoOffTimerType
popupParcel.kiwi_userPreferences.autoOffTimerValue = parseFloat(autoOffTimerValue)
for service, index in popupParcel.kiwi_servicesInfo
active = $("input:radio[name='" + service.name + "_serviceStatus']:checked").val()
popupParcel.kiwi_servicesInfo[index].active = active
# notableSound = $("input:radio[name='" + service.name + "_soundStatus']:checked").val()
# popupParcel.kiwi_servicesInfo[index].notableSound = notableSound
hoursSincePosted = $('#' + service.name + '_hoursNotable').val()
# console.log popupParcel.kiwi_servicesInfo[index].name
# console.log "hoursSincePosted = $('#' + service.name + '_hoursNotable').val() " + hoursSincePosted
popupParcel.kiwi_servicesInfo[index].notableConditions.hoursSincePosted = parseFloat(hoursSincePosted)
if service.name == 'gnews'
numberOfRelatedItemsWithClusterURL = $('#' + service.name + '_numberOfRelatedItemsWithClusterURL').val()
popupParcel.kiwi_servicesInfo[index].notableConditions.numberOfRelatedItemsWithClusterURL = parseInt(numberOfRelatedItemsWithClusterURL)
numberOfStoriesFoundWithinTheHoursSincePostedLimit = $('#' + service.name + '_numberOfStoriesFoundWithinTheHoursSincePostedLimit').val()
popupParcel.kiwi_servicesInfo[index].notableConditions.numberOfStoriesFoundWithinTheHoursSincePostedLimit = parseInt(numberOfStoriesFoundWithinTheHoursSincePostedLimit)
else
num_comments = $('#' + service.name + '_commentsNotable').val()
popupParcel.kiwi_servicesInfo[index].notableConditions.num_comments = parseInt(num_comments)
popupParcel.view = 'userPreferences'
# console.log '4567'
# console.debug popupParcel
parcel =
refreshView: popupParcel.view
newPopupParcel: popupParcel
msg: 'kiwiPP_post_savePopupParcel'
sendParcel(parcel)
class Credits extends SwitchView
constructor: (@name) ->
super @name, @__renderStates__
init: (popupParcel) ->
@unbindWidget()
@render(popupParcel)
__renderStates__: =>
__normal__:
paint: (popupParcel) =>
console?.log 'painting ' + @name
bind: (popupParcel) =>
console?.log 'binding ' + @name
class Loading extends SwitchView
constructor: (@name) ->
super @name, @__renderStates__
init: (popupParcel) ->
@unbindWidget()
@render(popupParcel)
__renderStates__: =>
__normal__:
paint: (popupParcel) =>
console?.log 'painting ' + @name
bind: (popupParcel) =>
console?.log 'binding ' + @name
class KiwiSlice extends FixedView
constructor: (@name, uniqueSelectorPostfix) ->
super @name, @__renderStates__, uniqueSelectorPostfix
init: (popupParcel, renderState = null) =>
@renderStateTransitions = @__renderStateTransitions__()
# console.log 'hehehehee init: (popupParcel, renderState = null) =>'
@unbindView()
renderState = if renderState? then renderstate else "collapsed"
# console.log ' renderState = if renderState? then renderstate else "collapsed" ' + renderState
@render(popupParcel, 'collapsed')
render: (popupParcel, renderState, fromState = null) =>
# console.log 'in render for kiwi'
__renderStates__callback = (popupParcel, renderState) =>
super popupParcel, renderState
if fromState? and @renderStateTransitions[fromState + "__to__" + renderState]?
# console.log 'yep, has renderstate'
@renderStateTransitions[fromState + "__to__" + renderState](popupParcel, renderState, __renderStates__callback)
else
super popupParcel, renderState
__renderStates__: =>
collapsed:
paint: (popupParcel) =>
kiwiSliceHTML = '<div id="sliceActivateTransition" style="position:fixed; bottom: -33px; right: -33px; ">
<img style="width: 66px; height: 66px;" src="symmetricKiwi.png" />
</div>'
$(@DOMselector).html(kiwiSliceHTML)
bind: (popupParcel) =>
elActivateTransition = $(@DOMselector + " #sliceActivateTransition")
@elsToUnbind = @elsToUnbind.concat elActivateTransition
elActivateTransition.bind 'mouseover', (ev) =>
elActivateTransition.addClass('rotateClockwiseFull')
elActivateTransition.bind 'mouseout', (ev) =>
elActivateTransition.removeClass('rotateClockwiseFull')
elActivateTransition.bind 'click', (ev) =>
elActivateTransition.removeClass('rotateClockwiseFull')
@render(popupParcel,'open', 'collapsed')
open:
paint: (popupParcel) =>
# console.log 'painting ' + @name
kiwiSliceHTML = '<div id="transition_open_showMe" class="evenlySpacedContainer kiwiSliceOpenPlatter">
<button type="button" class=" goTo_creditsView btn btn-mini btn-default">credits</button>
<a class="btn btn-mini btn-default" style="font-size:.8em;" target="_blank" href="http://www.metafruit.com/kiwi/">MetaFruit <span class="glyphicon glyphicon-apple"></span></a>
<button class=" btn btn-mini btn-default" id="clearKiwiURLCache">clear cache</button>
<button class=" btn btn-mini btn-default" id="refreshURLresults">refresh</button>
</div>
<div id="sliceActivateTransition" style="position:fixed; bottom: 15px; right: 15px; ">
<img style="width: 66px; height: 66px;" src="symmetricKiwi.png" />
</div>'
$(@DOMselector).html(kiwiSliceHTML)
# console.log kiwiSliceHTML
bind: (popupParcel) =>
# console.log 'binding ' + @name
elActivateTransition = $(@DOMselector + " #sliceActivateTransition")
clearKiwiURLCacheButton = $(@DOMselector + " #clearKiwiURLCache")
refreshURLresultsButton = $(@DOMselector + " #refreshURLresults")
@elsToUnbind = @elsToUnbind.concat elActivateTransition, refreshURLresultsButton, clearKiwiURLCacheButton
refreshURLresultsButton.bind 'click', ->
parcel =
msg: 'kiwiPP_refreshURLresults'
sendParcel(parcel)
$('body').mouseup((e) =>
# console.log 'test test test'
container = $(@DOMselector)
if (!container.is(e.target) && container.has(e.target).length == 0)
$('body').unbind 'mouseup'
@render(popupParcel,'collapsed', 'open')
)
elActivateTransition.bind 'click', (ev) =>
@render(popupParcel,'collapsed', 'open')
clearKiwiURLCacheButton.bind 'click', ->
parcel =
msg: 'kiwiPP_clearAllURLresults'
sendParcel(parcel)
# \/ \/ \/ THIS IS A WORK IN PROGRESS \/ \/ \/
__renderStateTransitions__: =>
'open__to__collapsed': (popupParcel, renderState, __renderStates__callback) =>
$(@DOMselector + " #transition_open_showMe").animate({'opacity':0}, 300)
$(@DOMselector + " #sliceActivateTransition").addClass('rotateClockwise')
$(@DOMselector + " #sliceActivateTransition").animate({"bottom": '-33px', "right": "-33px"}, {
duration: 500,
complete: ->
__renderStates__callback(popupParcel, renderState)
})
# return transitionObj
'collapsed__to__open': (popupParcel, renderState, __renderStates__callback) =>
# console.log "'collapsed__to__open': (popupParcel, renderState, __renderStates__callback) =>"
$(@DOMselector + " #sliceActivateTransition").addClass('rotateCounterClockwise')
$(@DOMselector + " #sliceActivateTransition").animate({"bottom": '15px', "right": "15px"}, {
duration: 500,
complete: ->
# console.log 'we are done with animation'
__renderStates__callback(popupParcel, renderState)
})
$(@DOMselector).prepend('<div id="transition_open_showMe" class="evenlySpacedContainer kiwiSliceOpenPlatter" style="opacity: 0;">
<button type="button" class="goTo_creditsView btn btn-mini btn-default ">credits</button>
<a class=" btn btn-mini btn-default" style="font-size:.8em;" target="_blank" href="http://www.metafruit.com/kiwi/">MetaFruit <span class="glyphicon glyphicon-apple"></span></a>
<button class="btn btn-mini btn-default " id="clearKiwiURLCache">clear cache</button>
<button class="btn btn-mini btn-default " id="refreshURLresults">refresh</button>
</div>')
# setTimeout =>
$(@DOMselector + " #transition_open_showMe").animate({'opacity':1}, 499)
# , 200
fixedViews =
kiwiSlice: new KiwiSlice 'kiwiSlice', 'FixedBottom'
switchViews =
conversations: new Conversations 'conversations'
userPreferences: new UserPreferences 'userPreferences'
credits: new Credits 'credits'
loading: new Loading 'loading'
tailorResults =
productHunt: (serviceInfoObject, service_PreppedResults, kiwi_userPreferences) ->
preppedHTMLstring = ''
currentTime = Date.now()
fuzzyMatchBool = false
brandingDisplay = ''
if serviceInfoObject.brandingImage?
brandingDisplay = '<img style="margin-left:7px;" title="' + serviceInfoObject.title + '" height="28" src="' + serviceInfoObject.brandingImage + '"/>
<span class="serviceResultsTitles" style="color:black; position: relative;top: 6px;"">' + serviceInfoObject.title + '</span>'
else
brandingDisplay = "<span class='serviceResultsTitles'>" + serviceInfoObject.title + '</span>'
preppedHTMLstring += "<div class='serviceResultsBox serviceResultJumpTo resultsBox__" + serviceInfoObject.name + "'>
<div class='serviceResultsHeaderBar'>" + brandingDisplay + "</div>"
# recency doesn't make sense for PH
# if kiwi_userPreferences.sortByPref == 'attention'
# selectedString_attention = 'selected'
# selectedString_recency = ''
# else
# selectedString_attention = ''
# selectedString_recency = 'selected'
if service_PreppedResults.length < 1
preppedHTMLstring += ' no results <br>'
return preppedHTMLstring
else
service_PreppedResults = _.sortBy(service_PreppedResults, 'kiwi_num_comments')
service_PreppedResults.reverse()
for listing, index in service_PreppedResults
listingClass = if (index > 10 and service_PreppedResults.length > 14) then ' hidden_listing ' else ''
if listing.comment_text?
preppedHTMLstring += _tailorHNcomment(listing, serviceInfoObject, listingClass)
else
if (listing.kiwi_created_at? and currentTime - listing.kiwi_created_at < 1000 * 60 * 60 * 4)
recentTag = "<span class='recentListingTag'>Recent: </span>"
else
recentTag = ""
if listing.kiwi_makers.length > 3
gridLayoutBool = false
else
gridLayoutBool = true
preppedHTMLstring += '<div class="listing ' + listingClass + '">'
# kiwi_created_at: 1439471020625
# kiwi_author_headline: "Community @ProductHunt. "
# kiwi_author_name: "<NAME>"
# kiwi_author_username: "bentossell"
# kiwi_discussion_url: "http://www.producthunt.com/tech/buffer-for-video"
# kiwi_makers: Array[9]
# headline: "Co-founder/CEO, Buffer"
# name: "<NAME>"
# profile_url: "http://www.producthunt.com/@joelgascoigne"
# username: "joelgascoigne"
# website_url: "http://joel.is"
# kiwi_num_comments: 30
# kiwi_score: 244
# name: "Buffer for Video"
# tagline: "All-in-one video scheduling & management for social media"
# redirect_url: "http://www.producthunt.com/r/4918f991fdd705/30839?app_id=1674"
# screenshot_url: Object
if gridLayoutBool
preppedHTMLstring += '<div style="display:inline-table; width: 60%; padding-right:8px;">'
else
preppedHTMLstring += '<div>'
preppedHTMLstring += '
<a class="listingTitle" target="_blank" href="' + listing.kiwi_discussion_url + '">
<div style="color:black; padding:4px; padding-bottom: 8px; font-size: 1.1em;">' + recentTag + '
<b>' + listing.name + '</b>
</div>
<div style="color:#4D586F; padding-left:18px;">
<div style="padding-bottom:4px;">"' + listing.tagline + '"</div>'
preppedHTMLstring += '<div style="padding-bottom:4px;">
' + listing.kiwi_num_comments + ' comments, ' + listing.kiwi_score + ' upvotes
</div>'
if listing.kiwi_created_at?
_time = formatTime(listing.kiwi_created_at)
preppedHTMLstring += '' + _time
preppedHTMLstring += '</div></a></div>'
if gridLayoutBool
preppedHTMLstring += '<div style="display:inline-table; width: 39%;">'
else
preppedHTMLstring += '<div style="padding: 8px;">'
makerUsernames = []
if listing.kiwi_makers? and listing.kiwi_makers.length > 0
preppedHTMLstring += '<div><div style="padding-bottom:2px;"><b>made by</b>: </div>'
for maker in listing.kiwi_makers
if gridLayoutBool
preppedHTMLstring += '<div style="padding-bottom: 4px;">'
else
preppedHTMLstring += '<div style="padding-bottom: 4px; padding-left: 10px;">'
preppedHTMLstring += '<a target="_blank" href="' + serviceInfoObject.userPageBaselink + maker.username + '" style="color:#727E98;">' + maker.name
if maker.headline? and maker.headline != ""
preppedHTMLstring += ', "' + maker.headline + '"'
preppedHTMLstring += '</a>'
if maker.website_url?
preppedHTMLstring += ' <a href="' + maker.website_url + '" target="_blank"><span class="glyphicon glyphicon-log-in" style="color:blue;"></span> </a>'
if listing.kiwi_author_username == maker.username
preppedHTMLstring += " (also submitted post)"
preppedHTMLstring += '</div>'
preppedHTMLstring += '</div>'
makerUsernames.push maker.username
if listing.kiwi_author_username not in makerUsernames
if gridLayoutBool
gridLayoutAuthorDiv = '<div style="padding-bottom: 2px;">'
else
gridLayoutAuthorDiv = '<div style="padding-bottom: 2px; margin-left: 10px;">'
preppedHTMLstring += '<div style="">
<div style="padding-bottom:2px;"><b>submitted by:</b></div>
' + gridLayoutAuthorDiv + '<a target="_blank" href="' + serviceInfoObject.userPageBaselink + listing.kiwi_author_username + '"
style="color:#727E98;">' + listing.kiwi_author_name + '
'
if listing.kiwi_author_headline? and listing.kiwi_author_headline != ""
preppedHTMLstring += ', "' + listing.kiwi_author_headline + '"'
preppedHTMLstring += '</a></div></div>'
preppedHTMLstring += '</div></div>'
preppedHTMLstring += "</div>"
return preppedHTMLstring
hackerNews: (serviceInfoObject, service_PreppedResults, kiwi_userPreferences) ->
return tailorRedditAndHNresults_returnHtml(serviceInfoObject, service_PreppedResults, kiwi_userPreferences)
reddit: (serviceInfoObject, service_PreppedResults, kiwi_userPreferences) ->
return tailorRedditAndHNresults_returnHtml(serviceInfoObject, service_PreppedResults, kiwi_userPreferences)
_tailorHNcomment = (listing, serviceInfoObject, listingClass) ->
currentTime = Date.now()
commentHtml = ""
# story_text
# comment_text
# story_id
# story_title
# story_url
recentTag = if (currentTime - listing.kiwi_created_at < 1000 * 60 * 60 * 4) then "<span class='recentListingTag'>Recent: </span>" else ""
commentHtml += '<div class="listing ' + listingClass + ' " style="position:relative;">' + recentTag
if listing.over_18? and listing.over_18 is true
commentHtml += '<span class="nsfw">NSFW</span> For story: ' + listing.story_title + '<br>'
else
commentHtml += "For story: <a target='_blank' href='" + serviceInfoObject.permalinkBase + listing.story_id + "'>" + listing.story_title + '</a><br>'
_time = formatTime(listing.kiwi_created_at)
commentHtml += 'at ' + _time + ',
<a target="_blank" href="' + serviceInfoObject.userPageBaselink + listing.author + '">' + listing.author + '</a> recieved ' + listing.kiwi_score + ' upvotes, by saying:
( <a class="listingTitle" target="_blank" href="' + serviceInfoObject.permalinkBase + listing.kiwi_permaId + '">
comment permalink
</a> , <a class="listingTitle" target="_blank" href="' + serviceInfoObject.permalinkBase + listing.story_id + '"> story permalink </a>
)<br><div class="commentBox">
' + listing.comment_text + '
</div></div>'
return commentHtml
tailorRedditAndHNresults_returnHtml = (serviceInfoObject, service_PreppedResults, kiwi_userPreferences) ->
preppedHTMLstring = ''
currentTime = Date.now()
# kiwi_exact_match
# fuzzy matches
# linkify stuff
fuzzyMatchBool = false
preppedHTMLstring += "<div class='serviceResultsBox serviceResultJumpTo resultsBox__" + serviceInfoObject.name + "'>
<div class='serviceResultsHeaderBar'>"
if serviceInfoObject.name == 'reddit'
preppedHTMLstring += "<span class='serviceResultsTitles'>for " + serviceInfoObject.title + ':</span>'
else
preppedHTMLstring += "<span class='serviceResultsTitles'>" + serviceInfoObject.title + '</span>'
if kiwi_userPreferences.sortByPref == 'attention'
selectedString_attention = 'selected'
selectedString_recency = ''
else
selectedString_attention = ''
selectedString_recency = 'selected'
preppedHTMLstring += '<div style="float:right; padding-top: 9px;">   sorted by: <select class="conversations_sortByPref">
<option ' + selectedString_attention + ' id="_attention" value="attention">attention</option>
<option ' + selectedString_recency + ' id="_recency" value="recency">recency</option>
</select></div>
</div>'
if service_PreppedResults.length < 1
preppedHTMLstring += ' no results <br>'
return preppedHTMLstring
else if !service_PreppedResults[0].comment_text? and kiwi_userPreferences.sortByPref is 'attention'
service_PreppedResults = _.sortBy(service_PreppedResults, 'num_comments')
service_PreppedResults.reverse()
else if kiwi_userPreferences.sortByPref is 'attention'
service_PreppedResults = _.sortBy(service_PreppedResults, 'kiwi_score')
service_PreppedResults.reverse()
else if kiwi_userPreferences.sortByPref is 'recency'
service_PreppedResults = _.sortBy(service_PreppedResults, 'kiwi_created_at')
service_PreppedResults.reverse()
for listing, index in service_PreppedResults
listingClass = if (index > 10 and service_PreppedResults.length > 14) then ' hidden_listing ' else ''
if listing.comment_text?
preppedHTMLstring += _tailorHNcomment(listing, serviceInfoObject, listingClass)
else
recentTag = if (currentTime - listing.kiwi_created_at < 1000 * 60 * 60 * 4) then "<span class='recentListingTag'>Recent: </span>" else ""
if listing.kiwi_exact_match
# preppedHTMLstring += '<div class="listing ' + listingClass + '" style="position:relative;">' + recentTag + '
# <div style="float:right;">
# <a target="_blank" href="' + serviceInfoObject.userPageBaselink + listing.author + '"> by ' + listing.author + '</a>
# </div>
# <a class="listingTitle" target="_blank" href="' + serviceInfoObject.permalinkBase + listing.kiwi_permaId + '">'
preppedHTMLstring += '<div class="listing ' + listingClass + '">'
if serviceInfoObject.name != 'reddit'
preppedHTMLstring += '<div style="float:right;">
<a target="_blank" href="' + serviceInfoObject.userPageBaselink + listing.author + '"> by ' + listing.author + '</a>
</div>'
preppedHTMLstring += '<a class="listingTitle" target="_blank" href="' + serviceInfoObject.permalinkBase + listing.kiwi_permaId + '"><span style="color:black;">' + recentTag
if listing.over_18? and listing.over_18 is true
preppedHTMLstring += '<span class="nsfw">NSFW</span> <b>' + listing.title + '</b><br>'
else
preppedHTMLstring += '<b>' + listing.title + '</b><br>'
_time = formatTime(listing.kiwi_created_at)
preppedHTMLstring += listing.num_comments + ' comments, ' + listing.kiwi_score + ' upvotes -- ' + _time + '</span></a>'
if listing.subreddit?
preppedHTMLstring += '<br><span>
<a target="_blank" href="' + serviceInfoObject.permalinkBase + '/r/' + listing.subreddit + '">
subreddit: ' + listing.subreddit + '</a></span>
<div style="float:right;">
<a target="_blank" href="' + serviceInfoObject.userPageBaselink + listing.author + '"> by ' + listing.author + '
</a>
</div>'
preppedHTMLstring += '<br></div>'
else
fuzzyMatchBool = true
if fuzzyMatchBool
numberOfExactMatches = _.reduce(service_PreppedResults, (memo, obj) ->
if obj.kiwi_exact_match
memo++
return memo
else
memo
)
if (service_PreppedResults.length - numberOfExactMatches) > 10 and service_PreppedResults.length > 14
listingClass = ' hidden_listing '
else
listingClass = ''
# listingClass = if nonFuzzyItemCounter > 10 then ' hidden_listing ' else ''
preppedHTMLstring += '<div class="showFuzzyMatches ' + listingClass + '" style="position:relative;"> fuzzy matches: <br></div>
<span class="fuzzyMatches">'
# console.log 'fuzzy matches 12312312 ' + serviceInfoObject.name
for listing, index in service_PreppedResults
listingClass = if (index > 10 and service_PreppedResults.length > 14) then ' hidden_listing ' else ''
if !listing.kiwi_exact_match
recentTag = if (currentTime - listing.kiwi_created_at < 1000 * 60 * 60 * 4) then "<span class='recentListingTag'>Recent: </span>" else ""
preppedHTMLstring += '<div class="listing ' + listingClass + '">'
if serviceInfoObject.name != 'reddit'
preppedHTMLstring += '<div style="float:right;">
<a target="_blank" href="' + serviceInfoObject.userPageBaselink + listing.author + '"> by ' + listing.author + '</a>
</div>'
preppedHTMLstring += '<a class="listingTitle" target="_blank" href="' + serviceInfoObject.permalinkBase + listing.kiwi_permaId + '"><span style="color:black;">' + recentTag
if listing.over_18? and listing.over_18 is true
preppedHTMLstring += '<span class="nsfw">NSFW</span> <b>' + listing.title + '</b><br>'
else
preppedHTMLstring += '<b>' + listing.title + '</b><br>'
preppedHTMLstring += listing.num_comments + ' comments, ' + listing.kiwi_score + ' upvotes ' + formatTime(listing.kiwi_created_at) + '</span>
<br>
for Url: <span class="altURL">' + listing.url + '</span>
</a>'
if listing.subreddit?
preppedHTMLstring += '<br><span>
<a target="_blank" href="' + serviceInfoObject.permalinkBase + '/r/' + listing.subreddit + '">
subreddit: ' + listing.subreddit + '</a></span>
<div style="float:right;">
<a target="_blank" href="' + serviceInfoObject.userPageBaselink + listing.author + '"> by ' + listing.author + '
</a></div>'
preppedHTMLstring += '<br></div>'
preppedHTMLstring += "</span>"
preppedHTMLstring += "</div>"
return preppedHTMLstring
bindGoToViewButtons = (buttonEls, viewName, viewData) ->
for el in buttonEls
$(el).bind('click', (ev) ->
# console.log 'clicked ' + viewName
switchViews[viewName].render(viewData)
)
moveArrayElement = (array, from, to) ->
array.splice(to, 0, array.splice(from, 1)[0]);
return array
getRandom = (min, max) ->
return min + Math.floor(Math.random() * (max - min + 1))
formatTime = (utcMillisecondTimestamp) ->
a = new Date(utcMillisecondTimestamp)
months = ['Jan','Feb','Mar','Apr','May','Jun','Jul','Aug','Sep','Oct','Nov','Dec']
year = a.getFullYear()
month = months[a.getMonth()]
date = a.getDate()
hour = a.getHours()
min = a.getMinutes()
sec = a.getSeconds()
amOrPm = if hour > 11 then 'pm' else 'am'
if hour > 12
hour = hour - 12
else if parseInt(hour) == 0
hour = 12
if min < 10
min = '0' + min
time = month + ' ' + date + ', ' + year + ' - ' + hour + ':' + min + amOrPm
return time
renderExtensionHeight = (elementSelector, extraPx) ->
if viewElementId is elementSelector
extraPx = 2
extHeight_ = $(elementSelector).outerHeight() + extraPx
if extHeight_ > 590
extHeight_ = 590
# $('html').css('height',extHeight+'px')
$('body').css('height', extHeight_ + 'px')
`heightString = extHeight_.toString() +'px'`
$('html').css('min-height', heightString)
extHeight_--
$('body').css('min-height', heightString)
capitalizeFirstLetter = (string) ->
return string.charAt(0).toUpperCase() + string.slice(1)
# // http://css-tricks.com/snippets/javascript/htmlentities-for-javascript/
htmlEntities = (str) ->
return String(str).replace(/&/g, '&').replace(/</g, '<').replace(/>/g, '>').replace(/"/g, '"');
getURLParam = (oTarget, sVar) ->
return decodeURI(oTarget.search.replace(new RegExp("^(?:.*[&\\?]" + encodeURI(sVar).replace(/[\.\+\*]/g, "\\$&") + "(?:\\=([^&]*))?)?.*$", "i"), "$1"));
algoliaPHclient = null
algoliaPHindex = null
initAlgoliaPHcustomSearch = ->
algoliaPHclient = algoliasearch('0H4SMABBSG', '9670d2d619b9d07859448d7628eea5f3')
algoliaPHindex = algoliaPHclient.initIndex('Post_production')
initAlgoliaPHcustomSearch()
fetchAlgoliaProductHuntResultsFirst = (parcel) ->
# console.log 'yoyoyo here ' + parcel.customSearchRequest.queryString
# console.log parcel
# not ideal because it's blocking, and it'd be better to have persistent index object
# but the restrictions in FF addons force this approach.
if algoliaPHindex?
algoliaPHindex.search(parcel.customSearchRequest.queryString, (err, content) ->
# // err is either `null` or an `Error` object, with a `message` property
# // content is either the result of the command or `undefined`
if (err)
console.error(err)
parcel.customSearchRequest.servicesToSearch.productHunt.rawResults = []
self.port.emit('kiwiPP_post_customSearch', parcel)
return 0
if content? and content.hits?
parcel.customSearchRequest.servicesToSearch.productHunt.rawResults = content.hits
else
parcel.customSearchRequest.servicesToSearch.productHunt.rawResults = []
# console.log 'sending this PH'
# console.log parcel.customSearchRequest.servicesToSearch.productHunt.rawResults
self.port.emit('kiwiPP_post_customSearch', parcel)
)
else
parcel.customSearchRequest.servicesToSearch.productHunt.rawResults = []
self.port.emit('kiwiPP_post_customSearch', parcel)
sendParcel = (parcel) ->
if !parcel.msg?
return false
switch parcel.msg
when 'kiwiPP_acknowledgeMessage'
self.port.emit('kiwiPP_acknowledgeMessage', parcel);
when 'kiwiPP_refreshSearchQuery'
# port.postMessage(parcel)
self.port.emit('kiwiPP_refreshSearchQuery', parcel);
when 'kiwiPP_post_customSearch'
# not ideal because it's blocking, but the restrictions in FF addons force this approach
if parcel.customSearchRequest.servicesToSearch.productHunt?
fetchAlgoliaProductHuntResultsFirst(parcel)
else
port.postMessage(parcel)
when 'kiwiPP_request_popupParcel'
self.port.emit('kiwiPP_request_popupParcel', parcel)
# port.postMessage(parcel)
when 'kiwiPP_post_savePopupParcel'
self.port.emit('kiwiPP_post_savePopupParcel', parcel)
# port.postMessage(parcel)
when 'kiwiPP_post_save_a_la_carte'
self.port.emit('kiwiPP_post_save_a_la_carte', parcel)
# port.postMessage(parcel)
when 'kiwiPP_clearAllURLresults'
self.port.emit('kiwiPP_clearAllURLresults', parcel)
# port.postMessage(parcel)
when 'kiwiPP_refreshURLresults'
self.port.emit('kiwiPP_refreshURLresults', parcel)
# port.postMessage(parcel)
when 'kiwiPP_researchUrlOverrideButton'
self.port.emit('kiwiPP_researchUrlOverrideButton', parcel)
# port.postMessage(parcel)
receiveParcel = (parcel) ->
if !parcel.msg?
return false
switch parcel.msg
when 'kiwiPP_popupParcel_ready'
initialize(parcel.popupParcel)
self.port.on('kiwi_fromBackgroundToPopup', (parcel) ->
receiveParcel(parcel)
)
| true |
viewElementId = ''
renderedBool = false
preferencesOnlyPage = false
initialize = (popupParcel) ->
# console.log 'in init'
if getURLParam(window.location, 'optionsOnly') != ''
preferencesOnlyPage = true
switchViews.userPreferences.render(popupParcel)
return 0
for viewName, view of fixedViews
view.init(popupParcel)
# views.userPreferences.render(popupParcel)
if popupParcel.view? and switchViews[popupParcel.view]?
switchViews[popupParcel.view].render(popupParcel)
else
switchViews.conversations.render(popupParcel)
class Widget # basic building block
constructor: (@name, @parentView, @__renderStates__) ->
@elsToUnbind = []
@totalRenders = 0
@DOMselector = @parentView.DOMselector + " #" + @name + "_Widget"
@Widgets = {}
@bindAllGoToViewButtons = (viewData) =>
for _viewName, viewValue of switchViews
# console.log _viewName
# bind to goToView buttons
els_goTo_view = $(@DOMselector + ' .goTo_' + _viewName + 'View')
# console.debug els_goTo_view
@elsToUnbind.push els_goTo_view
bindGoToViewButtons(els_goTo_view, _viewName, viewData)
@unbindWidget = =>
for el in @elsToUnbind
el.unbind()
@elsToUnbind = []
@render = (renderState, popupParcel) =>
@totalRenders++
@unbindWidget(@name)
@renderStates[renderState].paint(popupParcel)
@bindAllGoToViewButtons(popupParcel)
@renderStates[renderState].bind(popupParcel)
@renderStates = @__renderStates__()
return @
class MessageCenter extends Widget
constructor: (@name, @parentView, @widgetOpenBool) ->
# console.debug @__renderStates__
# console.log ' trying '
super @name, @parentView, @__renderStates__
init: (popupParcel) ->
@unbindWidget()
@render('showMessages',popupParcel)
__renderStates__: =>
showMessages:
paint: (popupParcel) =>
# console.log 'messagesHTML = ""
# console.debug popupParcel'
messagesHTML = ""
# console.debug popupParcel
if popupParcel.kiwi_userMessages.length > 0
messagesHTML += '<div style="padding-top:4px; padding-bottom:10px;">'
for messageObj in popupParcel.kiwi_userMessages
messagesHTML += '<div class="bg-warning" style="margin:6px; padding:8px; text-align:justify;">
<button style="float:right; margin:8px; padding:4px; padding-right:6px; padding-left:6px;" class="btn btn-xs btn-default acknowledgeMessage" data-messageToAcknowledge="' + messageObj.name + '" >
<span title="remove" data-messageToAcknowledge="' + messageObj.name + '"
class="glyphicon glyphicon-remove" aria-hidden="true"
style="color:#E65F5F;"
></span>
</button>
' + messageObj.baseValue + '
</div>'
messagesHTML += '<div style="width:100%; text-align:center;"> <b>message priority</b>: urgent.
please acknowledge the message(s) by clicking the "x" button(s). Thanks! :)
</div></div>'
$(@DOMselector).html(messagesHTML)
# $(@DOMselector + " .notFixed").css({'height':fixedHeight + "px"})
bind: (popupParcel) =>
if popupParcel.kiwi_userMessages.length > 0
# console.log 'bind: (popupParcel) =>'
ackMessageButtons = $(@DOMselector + ' .acknowledgeMessage')
@elsToUnbind = @elsToUnbind.concat ackMessageButtons
ackMessageButtons.bind 'click', (ev) =>
console.log "trying for ackMessageButtons.bind 'click', (ev) =>"
messageToAcknowledge = $(ev.target).attr('data-messageToAcknowledge')
console.log 'messageToAcknowledge ' + messageToAcknowledge
# console.debug popupParcel.kiwi_userPreferences.urlSubstring_whitelists.anyMatch
# console.debug whitelistSubString
parcel =
messageToAcknowledge: messageToAcknowledge
msg: 'kiwiPP_acknowledgeMessage'
sendParcel(parcel)
class CustomSearch extends Widget
constructor: (@name, @parentView, @widgetOpenBool) ->
# console.debug @__renderStates__
super @name, @parentView, @__renderStates__
init: (popupParcel) ->
@Widgets = {messageCenter: new MessageCenter 'messageCenter', @, false}
@unbindWidget()
if @widgetOpenBool == false
@render('collapsed',popupParcel)
else
@render('opened',popupParcel)
__renderStates__: =>
collapsed:
paint: (popupParcel) =>
openedCustomSearchHTML = '
<div class="topSearchBar" style="padding-bottom: 14px;">
<div class="evenlySpacedContainer">
<input class="queryInputOpen" id="customSearchQueryInput" type="text" placeholder=" combined search" />
<button class="btn btn-mini btn-default goTo_userPreferencesView">User Options
<span class="glyphicon glyphicon-chevron-right" aria-hidden="true"></span></button>
</div>
'
if popupParcel.kiwi_customSearchResults.queryString? and popupParcel.kiwi_customSearchResults.queryString != ''
openedCustomSearchHTML += "<div style='padding-top: 12px;'><a id='openPreviousSearch'>see custom results for '" + popupParcel.kiwi_customSearchResults.queryString + "'
</a> <a id='clearPreviousSearch'>clear</a></div>"
openedCustomSearchHTML += "
<div id='messageCenter_Widget'></div>
</div>
<div class='notFixed'></div>"
$(@DOMselector).html(openedCustomSearchHTML)
# console?.log 'console.log @DOMselector + " .topSearchBar"' + @DOMselector + " .topSearchBar"
duplicateFixedHeight = =>
fixedElHeight = $(@DOMselector + " .topSearchBar").outerHeight()
# console.log 'console.log fixedElHeight closed'
# console.log fixedElHeight
if popupParcel.kiwi_userMessages? and popupParcel.kiwi_userMessages.length > 0
fixedElHeight += 70 + popupParcel.kiwi_userMessages.length * 60
if fixedElHeight == 0
setTimeout -> # defer to next browser event tick
duplicateFixedHeight()
, 0
else
$(@DOMselector + " .notFixed").css({'height':fixedElHeight + "px"})
duplicateFixedHeight()
@Widgets.messageCenter.render('showMessages', popupParcel)
# $(@DOMselector + " .notFixed").css({'height':fixedHeight + "px"})
bind: (popupParcel) =>
# console.log 'bind: (popupParcel) =>'
inputSearchQueryInput = $("#customSearchQueryInput")
previousSearchLink = $("#openPreviousSearch")
clearPreviousSearch = $("#clearPreviousSearch")
@elsToUnbind = @elsToUnbind.concat inputSearchQueryInput, previousSearchLink, clearPreviousSearch
previousSearchLink.bind 'click', ->
$("#customSearchQueryInput").click()
clearPreviousSearch.bind 'click', ->
parcel =
msg: 'kiwiPP_refreshSearchQuery'
sendParcel(parcel)
inputSearchQueryInput.bind 'click', =>
# console.log '@widgetOpenBool = true'
@widgetOpenBool = true
@render('opened',popupParcel)
opened:
paint: (popupParcel) =>
# console.log 'popupParcel.kiwi_servicesInfo.length'
# console.log popupParcel.kiwi_servicesInfo.length
queryString = if popupParcel.kiwi_customSearchResults.queryString? then popupParcel.kiwi_customSearchResults.queryString else ''
openedCustomSearchHTML = '<div class="topSearchBar">
<div class="evenlySpacedContainer">
<input id="customSearchQueryInput" value="' + queryString + '" type="text" placeholder=" combined search" style="width:234px; margin-right: 10px;" />
<button class="btn btn-mini btn-default" id="customSearchQuerySubmit" style="margin-right: 10px;">Submit</button>
<button style="" class="goTo_userPreferencesView btn btn-mini btn-default"> Options
<span class="glyphicon glyphicon-chevron-right" aria-hidden="true"></span></button>
</div>
<br>
<div class="evenlySpacedContainer" style="position: relative; top: -8px; margin-bottom: 3px;">'
for serviceInfoObject in popupParcel.kiwi_servicesInfo
openedCustomSearchHTML += '<div>'
# console.log 'asdfasdf ' + serviceInfoObject.name
# console.debug serviceInfoObject
if serviceInfoObject.active == 'off'
serviceDisabledAttr = ' disabled title="Service must be active, can be changed in options." '
else
serviceDisabledAttr = ' '
if popupParcel.kiwi_customSearchResults.servicesSearchesRequested? and popupParcel.kiwi_customSearchResults.servicesSearchesRequested[serviceInfoObject.name]?
activeClass = ' active '
ariaPressedState = 'true'
else if !popupParcel.kiwi_customSearchResults.servicesSearchesRequested?
activeClass = if serviceInfoObject.active is 'off' then ' ' else ' active '
ariaPressedState = if serviceInfoObject.active is 'off' then 'false' else 'true'
else
activeClass = ' '
ariaPressedState = 'false'
if serviceInfoObject.customSearchTags? and Object.keys(serviceInfoObject.customSearchTags).length > 0
openedCustomSearchHTML += '<div class="btn-group">
<button data-toggle="button" aria-pressed="' + ariaPressedState + '" autocomplete="off" ' + serviceDisabledAttr + '
class="servicesToSearch btn btn-default btn-mini dropdownLabel ' + activeClass + '" data-serviceName="' + serviceInfoObject.name + '">
' + serviceInfoObject.title + '
</button>
<button ' + serviceDisabledAttr + ' data-toggle="dropdown" class="btn btn-default dropdown-toggle ' + activeClass + '
dropDownPrefs_' + serviceInfoObject.name + '" data-placeholder="false"><span class="caret"></span></button>
<ul class="dropdown-menu">'
for tagName, tagObject of serviceInfoObject.customSearchTags
if popupParcel.kiwi_customSearchResults.servicesSearchesRequested? and popupParcel.kiwi_customSearchResults.servicesSearchesRequested[serviceInfoObject.name]?
if popupParcel.kiwi_customSearchResults.servicesSearchesRequested[serviceInfoObject.name].customSearchTags[tagName]?
tagActiveChecked = ' checked '
else
tagActiveChecked = ''
else
tagActiveChecked = if tagObject.include is true then ' checked ' else ''
tagDisabledAttr = if serviceInfoObject.active is 'off' then ' disabled title="Service must be active, can be changed in options." ' else ''
openedCustomSearchHTML += '<li><input ' + tagActiveChecked + tagDisabledAttr + ' type="checkbox" value="' + tagName + '" class="tagPref tagPref_' + serviceInfoObject.name + '" id="' + serviceInfoObject.name + tagName + '">
<label for="' + serviceInfoObject.name + tagName + '">
' + tagObject.title + '
</label></li>'
openedCustomSearchHTML += '</ul></div>'
else
openedCustomSearchHTML += '<button data-toggle="button" aria-pressed="' + ariaPressedState + '" autocomplete="off"
type="button" class="servicesToSearch btn btn-mini btn-default ' + activeClass + '" data-serviceName="' + serviceInfoObject.name + '">
' + serviceInfoObject.title + '
</button>'
openedCustomSearchHTML += '</div>'
openedCustomSearchHTML += '<div>
<button aria-pressed="false" autocomplete="off" type="button" class="btn btn-mini btn-default"
id="close__' + @name + '"
>
close <span class="glyphicon glyphicon-remove" aria-hidden="true"></span>
</button>
</div>
</div>'
openedCustomSearchHTML += '
<div id="messageCenter_Widget">asdfasd</div>
</div>
<div class="notFixed"></div>
<div id="customSearchResults"></div>
'
resultsSummaryArray = []
customSearchResultsHTML = ""
if popupParcel.kiwi_customSearchResults? and popupParcel.kiwi_customSearchResults.queryString? and
popupParcel.kiwi_customSearchResults.queryString != ''
for serviceInfoObject, index in popupParcel.kiwi_servicesInfo
if popupParcel.kiwi_customSearchResults.servicesSearched[serviceInfoObject.name]?
service_PreppedResults = popupParcel.kiwi_customSearchResults.servicesSearched[serviceInfoObject.name].results
resultsSummaryArray.push("<a class='jumpTo' data-serviceindex='" + index + "'>" + serviceInfoObject.title + " (" + service_PreppedResults.length + ")</a>")
customSearchResultsHTML += tailorResults[serviceInfoObject.name](serviceInfoObject, service_PreppedResults, popupParcel.kiwi_userPreferences)
if service_PreppedResults.length > 14
customSearchResultsHTML += '<div class="listing showHidden" data-servicename="' + serviceInfoObject.name + '"> show remaining ' + (service_PreppedResults.length - 11) + ' results</div>'
else
customSearchResultsHTML += '<br>No results for ' + serviceInfoObject.title + '<br>'
# customSearchResultsHTML += '</div>'
else
customSearchResultsHTML += '<div id="customSearchResultsDrop"><br>No results to show... make a search! :) </div><br>'
customSearchResultsHTML = "<div style='width: 100%; text-align: center;font-size:.9em;'>" + resultsSummaryArray.join(" - ") + "</div>" + customSearchResultsHTML
customSearchResultsHTML += "<br>"
$(@DOMselector).html(openedCustomSearchHTML)
$(@DOMselector + " #customSearchResults").html(customSearchResultsHTML)
$(@DOMselector + " .hidden_listing").hide()
duplicateFixedHeight = =>
fixedElHeight = $(@DOMselector + " .topSearchBar").outerHeight()
# console.log 'console.log fixedElHeight opened'
# console.log fixedElHeight
if popupParcel.kiwi_userMessages? and popupParcel.kiwi_userMessages.length > 0
fixedElHeight += 70 + popupParcel.kiwi_userMessages.length * 60
if fixedElHeight == 0
setTimeout -> # defer to next browser event tick
duplicateFixedHeight()
, 0
else
$(@DOMselector + " .notFixed").css({'height':fixedElHeight + "px"})
duplicateFixedHeight()
@Widgets.messageCenter.render('showMessages', popupParcel)
bind: (popupParcel) =>
customSearchQueryInput = $(@DOMselector + " #customSearchQueryInput")
customSearchQuerySubmit = $(@DOMselector + " #customSearchQuerySubmit")
closeWidget = $(@DOMselector + ' #close__' + @name)
customSearch_sortByPref = $(@DOMselector + " .conversations_sortByPref")
modifySearch = $(@DOMselector + " .customSearchOpen")
elsServicesButtons = $(@DOMselector + " button.servicesToSearch ")
elsServicesActivePrefs = $(@DOMselector + " .customSearchServicePref input")
showHidden = $(@DOMselector + " .showHidden")
jumpToServiceCustomResults = $(@DOMselector + " #customSearchResults .jumpTo")
@elsToUnbind = @elsToUnbind.concat(customSearchQueryInput, closeWidget, customSearchQuerySubmit, elsServicesButtons,
customSearch_sortByPref, showHidden, jumpToServiceCustomResults, modifySearch)
modifySearch.bind 'click', ->
$(@DOMselector + " #customSearchQueryInput").focus()
jumpToServiceCustomResults.bind 'click', (ev) =>
serviceIndex = parseInt($(ev.target).data('serviceindex'))
pxFromTop = $($(@DOMselector + " #customSearchResults .serviceResultJumpTo")[serviceIndex]).offset().top
# offsetBy = $($(@DOMselector + " #customSearchResults .serviceResultJumpTo")[serviceIndex]).outerHeight() + 40
$('body').scrollTop(pxFromTop - 100)
showHidden.bind 'click', (ev) =>
# console.log "showHidden.bind 'click', (ev) ->"
# console.debug ev
serviceName = $(ev.target).data('servicename')
# resultsBox__" + serviceInfoObject.name +
# console.log @DOMselector + " .resultsBox__" + serviceName + " .hidden_listing"
$(@DOMselector + " .resultsBox__" + serviceName + " .hidden_listing").show(1200)
$(ev.target).remove()
elsServicesButtons.bind('click', (ev) =>
if $(ev.target).hasClass("dropdownLabel")
serviceName = $(ev.target).attr('data-serviceName')
# console.log serviceName
# console.debug $(ev.target).attr('aria-pressed')
ariaPressed = $(ev.target).attr('aria-pressed')
if ariaPressed == 'true'
$('button.dropDownPrefs_' + serviceName).removeClass('active')
# console.log 'if ev.target.checked == "false" ' + serviceName
$(@DOMselector + " input.tagPref_" + serviceName ).attr('disabled','disabled')
else
$('button.dropDownPrefs_' + serviceName).addClass('active')
# console.log $(ev.target).attr('aria-pressed') + "asdfasdf"
$(@DOMselector + " input.tagPref_" + serviceName ).removeAttr('disabled')
$(ev.target).blur()
)
customSearch_sortByPref.bind 'change', (ev) ->
# console.log ' customSearch_sortByPref.val()'
# console.log
popupParcel.kiwi_userPreferences.sortByPref = $(ev.target).val()
parcel =
refreshView: 'conversations'
keyName: 'PI:KEY:<KEY>END_PI'
newValue: popupParcel.kiwi_userPreferences
localOrSync: 'sync'
msg: 'kiwiPP_post_save_a_la_carte'
sendParcel(parcel)
sendSearch = =>
queryString = customSearchQueryInput.val()
elsServicesToSearch = $(@DOMselector + ' button.servicesToSearch[aria-pressed="true"]')
# ariaPressed = $(ev.target).attr('aria-pressed')
# if ariaPressed == 'true'
servicesToSearch = {}
for el in elsServicesToSearch
serviceName = $(el).attr('data-serviceName')
servicesToSearch[serviceName] = {}
servicesToSearch[serviceName].customSearchTags = {}
elTagPrefs = $(@DOMselector + " input.tagPref_" + serviceName + ":checked")
for elTagPref in elTagPrefs
tagName = $(elTagPref).val()
servicesToSearch[serviceName].customSearchTags[tagName] = {}
# console.log 'asfdasdfasdf ' + serviceName
# console.debug servicesToSearch
if queryString != ''
parcel =
msg: 'kiwiPP_post_customSearch'
customSearchRequest:
queryString: queryString
servicesToSearch: servicesToSearch
sendParcel(parcel)
customSearchQueryInput.keypress (event) ->
charCode = if event.keyCode then event.keyCode else event.which
if charCode == 13
sendSearch()
customSearchQuerySubmit.bind 'click', =>
sendSearch()
closeWidget.bind 'click', =>
@widgetOpenBool = false
@render('collapsed',popupParcel)
customSearchQueryInput.focus()
# showViewAndBindGoToViewButtons
class View # basic building block
constructor: (@name, @__renderStates__) ->
@elsToUnbind = []
@totalRenders = 0
@DOMselector = "#" + @name + "_View"
@Widgets = {}
@bindAllGoToViewButtons = (viewData) =>
for _viewName, viewValue of switchViews
els_goTo_view = $(@DOMselector + ' .goTo_' + _viewName + 'View')
@elsToUnbind.push els_goTo_view
bindGoToViewButtons(els_goTo_view, _viewName, viewData)
@renderStates = @__renderStates__()
return @
unbindView: =>
# console.log 'unbinding view'
# console.debug @elsToUnbind
# $(".userPreferencesSave").unbind()
for el in @elsToUnbind
el.unbind()
@elsToUnbind = []
for widget in @Widgets
widget.unbindWidget()
render: (popupParcel, renderState = "__normal__") =>
@totalRenders++
@unbindView(@name)
if !renderState? and !@renderStates.__normal__?
console?.log 'ERROR: must declare renderState for view ' + @name + ' since __normal__ undefined'
# console.log 'console.debug renderState ' + @name + renderState
# console.log @totalRenders
# console.debug @renderStates
@renderStates[renderState].paint(popupParcel)
@bindAllGoToViewButtons(popupParcel)
@renderStates[renderState].bind(popupParcel)
class FixedView extends View
constructor: (@name, @__renderStates__, uniqueSelectorPostfix) ->
super @name, @__renderStates__
@DOMselector += uniqueSelectorPostfix
# console.log @DOMselector
class SwitchView extends View
constructor: (@name, @__renderStates__) ->
super @name, @__renderStates__
showView: =>
for _viewName, viewValue of switchViews
if _viewName == @name
# show
# console.log 'showing ' + _viewName
$('#' + _viewName + '_View').css({'display':'block'})
else
# hide
# console.log 'hiding ' + _viewName
$('#' + _viewName + '_View').css({'display':'none'})
render: (popupParcel, renderState = "__normal__") =>
super popupParcel, renderState
@showView()
class Conversations extends SwitchView
constructor: (@name) ->
super @name, @__renderStates__
@Widgets =
customSearch: new CustomSearch 'customSearch', @, false
init: (popupParcel) ->
@unbindWidget()
@render(popupParcel)
__renderStates__: =>
__normal__:
paint: (popupParcel) =>
# console.log ' in conversations view'
# console.log popupParcel
@Widgets['customSearch'].init(popupParcel)
researchModeDisabledButtonsHTML = ''
if popupParcel.urlBlocked == true or popupParcel.kiwi_userPreferences.researchModeOnOff == 'off' or (popupParcel.oldUrl? and popupParcel.oldUrl == true)
researchModeDisabledButtonsHTML += "<br>
<div style='width:100%;text-align: center;'><button class='btn btn-success' style='font-size: 1.1em;display: inline-block;' id='researchUrlOverride'>Research this Url</button></div>
<br>"
if popupParcel.kiwi_userPreferences.researchModeOnOff == 'off'
researchModeDisabledButtonsHTML += "<br>
<div style='width:100%; text-align:center;'>
Research Mode is off:
<button class='goTo_userPreferencesView btn btn-xs btn-default' style='position:relative; bottom:2px;'>
change settings
</button>
</div>"
$("#researchModeDisabledButtons").html(researchModeDisabledButtonsHTML)
resultsSummaryArray = []
resultsHTML = ""
totalResults = 0
for serviceInfoObject, index in popupParcel.kiwi_servicesInfo
if popupParcel.allPreppedResults[serviceInfoObject.name]? and popupParcel.allPreppedResults[serviceInfoObject.name].service_PreppedResults.length > 0
service_PreppedResults = popupParcel.allPreppedResults[serviceInfoObject.name].service_PreppedResults
totalResults += service_PreppedResults.length
resultsSummaryArray.push("<a class='jumpTo' data-serviceindex='" + index + "'>" + serviceInfoObject.title + " (" + service_PreppedResults.length + ")</a>")
resultsHTML += tailorResults[serviceInfoObject.name](serviceInfoObject,service_PreppedResults, popupParcel.kiwi_userPreferences)
if service_PreppedResults.length > 14
resultsHTML += '<div class="listing showHidden" data-servicename="' + serviceInfoObject.name + '"> show remaining ' + (service_PreppedResults.length - 11) + ' results</div>'
else
if serviceInfoObject.submitTitle?
submitUrl = serviceInfoObject.submitUrl
submitTitle = serviceInfoObject.submitTitle
resultsHTML += '<div class="serviceResultJumpTo">No conversation matches for ' + serviceInfoObject.title + '... <br>
<a target="_blank" href="' + submitUrl + '">' + submitTitle + '</a></div><br>'
else
resultsHTML += '<div>No results for ' + serviceInfoObject.title + '</div>'
preppedHTMLstring = ''
if (popupParcel.urlBlocked == true and Object.keys(popupParcel.allPreppedResults).length < 2)
# do nothing
preppedHTMLstring += "<div style='width: 100%; text-align: justify; padding:20px; font-size:.9em; opacity:.9;'>
<em>
Certain super-high traffic URLs
(or weird urls (like 'about:config' and chrome new tab pages)) have been
excluded from auto-search out of respect for the APIs of the conversation sites. you can still manually
search them by hitting the green button
</em>
</div><br>"
else if ((totalResults > 0 and popupParcel.kiwi_userPreferences.researchModeOnOff == 'off') or
popupParcel.kiwi_userPreferences.researchModeOnOff == 'on' or
Object.keys(popupParcel.allPreppedResults).length > 1)
preppedHTMLstring = '<br><h3 style="position:relative; top:-10px;">Results for this URL:</h3>'
preppedHTMLstring += "<div style='width: 100%; text-align: center;font-size:.9em;'>" + resultsSummaryArray.join(" - ") + "</div><br>"
preppedHTMLstring += resultsHTML
$("#resultsByService").html(preppedHTMLstring)
$(@DOMselector + " .hidden_listing").hide()
if totalResults < 4 and @totalRenders < 4
fixedViews.kiwiSlice.render(popupParcel, "open")
setTimeout( -> # to reign in a chrome rendering issue
# renderExtensionHeight(@DOMselector, 1)
$($('input')[0]).blur()
$($('a')[0]).blur()
$($('button')[0]).blur()
, 300
)
# renderExtensionHeight(@DOMselector, 1)
$($('input')[0]).blur()
$($('a')[0]).blur()
$($('button')[0]).blur()
bind: (popupParcel) =>
showHidden = $(@DOMselector + " .showHidden")
researchUrlOverrideButton = $(@DOMselector + " #researchUrlOverride")
conversations_sortByPref = $(@DOMselector + " .conversations_sortByPref")
customSearchOpen = $(@DOMselector + " .customSearchOpen")
jumpToService = $("#resultsByService .jumpTo")
@elsToUnbind = @elsToUnbind.concat(conversations_sortByPref, showHidden, researchUrlOverrideButton, customSearchOpen, jumpToService)
jumpToService.bind 'click', (ev) =>
serviceIndex = parseInt($(ev.target).data('serviceindex'))
# console.log serviceIndex
pxFromTop = parseInt($($(@DOMselector + " #resultsByService .serviceResultJumpTo")[serviceIndex]).offset().top)
# offsetBy = parseInt($($("#resultsByService .serviceResultsHeaderBar")[serviceIndex]).outerHeight()) + 40
$('body,html').scrollTop(pxFromTop - 100)
customSearchOpen.bind 'click', ->
$("#customSearchQueryInput").click()
researchUrlOverrideButton.bind 'click', ->
parcel =
msg: 'kiwiPP_researchUrlOverrideButton'
sendParcel(parcel)
showHidden.bind 'click', (ev) =>
# console.log "showHidden.bind 'click', (ev) -> "
# console.debug ev
serviceName = $(ev.target).data('servicename')
$(@DOMselector + " .resultsBox__" + serviceName + " .hidden_listing").show(1200)
$(ev.target).remove()
conversations_sortByPref.bind 'change', (ev) ->
# console.log "'conversations_sortByPref.bind 'change', (ev) ->"
# console.log $(ev.target).val()
popupParcel.kiwi_userPreferences.sortByPref = $(ev.target).val()
parcel =
refreshView: 'conversations'
keyName: 'PI:KEY:<KEY>END_PI'
newValue: popupParcel.kiwi_userPreferences
localOrSync: 'sync'
msg: 'kiwiPP_post_save_a_la_carte'
sendParcel(parcel)
class UserPreferences extends SwitchView
constructor: (@name) ->
super @name, @__renderStates__
init: (popupParcel) ->
@unbindWidget()
@render(popupParcel)
__renderStates__: =>
__normal__:
paint: (popupParcel) =>
$(@DOMselector + " .userErrMsg").html('')
# console.log 'paint: adsfaeaewfawefawefawef(popupParcel) =># viewName = '
if preferencesOnlyPage is true
$("#menuBar_preferences").hide()
currentTime = Date.now()
if popupParcel.kiwi_userPreferences.researchModeOnOff == "off"
$("#autoOffTimer").html("Research mode is off, so auto-off timer is not set")
else if popupParcel.kiwi_userPreferences.autoOffAtUTCmilliTimestamp? and popupParcel.kiwi_userPreferences.autoOffAtUTCmilliTimestamp > currentTime
$("#autoOffTimer").html("Auto-Off timer expires at: " + formatTime(popupParcel.kiwi_userPreferences.autoOffAtUTCmilliTimestamp) + "<br>")
else if popupParcel.kiwi_userPreferences.researchModeOnOff == 'off' and popupParcel.kiwi_userPreferences.autoOffAtUTCmilliTimestamp?
$("#autoOffTimer").html("Auto-off timer last expired at: " + formatTime(popupParcel.kiwi_userPreferences.autoOffAtUTCmilliTimestamp) + "<br>")
else
$("#autoOffTimer").html("Auto-off timer is not set")
researchModeHtml = ''
if popupParcel.kiwi_userPreferences.researchModeOnOff is "off"
researchOnString = ""
researchOffString = " checked='checked' "
else
researchOnString = " checked='checked' "
researchOffString = ""
autoOffTimerType = popupParcel.kiwi_userPreferences.autoOffTimerType
autoOffTimerValue = popupParcel.kiwi_userPreferences.autoOffTimerValue
`var auto20, auto60, autoAlways, autoCustom, autoCustomValue = '';
if(autoOffTimerType != null){
if(autoOffTimerType == "20"){ auto20 = " checked='checked' " }
else if(autoOffTimerType == "60"){ auto60 = " checked='checked' " }
else if(autoOffTimerType == "always"){ autoAlways = " checked='checked' " }
else if(autoOffTimerType == "custom"){ autoCustom = " checked='checked' "; autoCustomValue = autoOffTimerValue;}
}`
researchModeHtml += 'Research Mode:
<a class="tooltipCustom" style="position: relative;">
<div style="display:inline; font-size:.9em;"><sup><em> ?</em></sup></div>
<span style="bottom:34px; left:-114px;">
When the Research mode is "Off", Kiwi won\'t automatically search URLs as you surf;
instead, you can check URLs on a case-by-case basis (and still be able to do custom searches)
</span>
</a>
<label style="font-weight: normal;" for="researchmodeON"> on </label> <input id="researchmodeON" type="radio" name="research" value="on" ' + researchOnString + '> -
<label style="font-weight: normal;" for="researchmodeOFF"> off </label> <input id="researchmodeOFF" type="radio" name="research" value="off" ' + researchOffString + '>
<button class="btn btn-mini btn-default userPreferencesSave"> save preferences </button><br>'
if popupParcel.kiwi_userPreferences.researchModeOnOff is 'off'
researchModeHtml += ''
timerDisabled = ' disabled '
timerOnlyUsefulWhenMessage = '<br>
<span style="font-size:.8em;"><i>
Note: the auto-off-timer only matters when Research Mode is "on".
</i></span>
<br>'
else
timerDisabled = ' '
researchModeHtml += '<br>
<span style="font-size:.8em;"><i>
Note: The Whitelist only makes a difference when Research mode is turned "off", which it currently isn\'t.
</i></span>
<br>'
timerOnlyUsefulWhenMessage = ''
researchModeHtml += '
<br>
<table class="table table-bordered table-striped whitelistTable">
<thead>
<tr>
<th colspan="3">
<div class="input-group" id="addWhiteListString">
<label class="input-group-addon">
<a class="tooltipCustom" style="position: relative;">
<div style="display:inline; font-size:.9em;">whitelist strings <sup><em> ?</em></sup></div>
<span style="bottom:84px;left:-12px;">
<b>Whitelist strings:</b> <br>
Kiwi will automatically research any URL (upon visiting) that contains a user-provided Whitelist string --
even when Research Mode is "off".
Try it with "github.com" or "bitbucket.org", and then visit the respective site with research mode "off".
</span>
</a>
</label>
<input type="text" class="form-control ignoreSaveButtonListen">
<label class="input-group-addon btn btn-default">
add
</label>
</div>
</th>
</tr>
</thead>
<tbody>
'
for whitelistSubString, index in popupParcel.kiwi_userPreferences.urlSubstring_whitelists.anyMatch
researchModeHtml += '
<tr>
<th scope="row" style="width:35px;"> ' + (index + 1) + ' </th>
<td> ' + whitelistSubString + ' </td>
<td style="width:35px;">
<button title="remove" class="btn btn-xs btn-default removeWhitelistString" data-whitelistStringToRemove="' + whitelistSubString + '" >
<span data-whitelistStringToRemove="' + whitelistSubString + '"
class="glyphicon glyphicon-remove" aria-hidden="true"
style="color:#E65F5F;"
></span>
</button>
</td>
</tr>'
researchModeHtml += '
</tbody>
</table>
<br>Auto-Off Timer set for: ' + timerOnlyUsefulWhenMessage + '
<br> <label><input ' + timerDisabled + ' type="radio" name="researchAutoOffType" ' + auto20 + ' value="20"> 20 min</label>
<br> <label><input ' + timerDisabled + ' type="radio" name="researchAutoOffType" ' + auto60 + ' value="60"> 1 hr</label>
<br> <label><input ' + timerDisabled + ' type="radio" name="researchAutoOffType" ' + autoAlways + ' value="always"> Always On</label>
<br> <label><input ' + timerDisabled + ' type="radio" name="researchAutoOffType" ' + autoCustom + ' value="custom"> Custom</label>
<input ' + timerDisabled + ' id="autoCustomValue" type="text" value="' + autoCustomValue + '" size="4" disabled /> minutes'
$("#researchModeDrop").html(researchModeHtml)
servicesHtml = ''
for service, index in popupParcel.kiwi_servicesInfo
if service.active == "on"
activeCheck = " checked='checked' "
notActiveCheck = ""
else
activeCheck = ""
notActiveCheck = " checked='checked' "
servicesHtml += '<br>
<div class="serviceListing listing">
<table><tbody><tr>
<td class="upDownButtons">'
if index != 0
servicesHtml += '<span title="Move ' + service.title + ' results above ' + popupParcel.kiwi_servicesInfo[index - 1].title + '" class="glyphicon glyphicon-chevron-up" id="' + service.name + '_moveServiceUp" aria-hidden="true"></span>'
if index != 0 and index != popupParcel.kiwi_servicesInfo.length - 1
servicesHtml += '<br><br>'
if index != popupParcel.kiwi_servicesInfo.length - 1
servicesHtml += '<span title="Move ' + service.title + ' results below ' + popupParcel.kiwi_servicesInfo[index + 1].title + '" class="glyphicon glyphicon-chevron-down" id="' + service.name + '_moveServiceDown" aria-hidden="true"></span>'
brandedTitle = if (service.name is 'reddit') then "for " + service.title else service.title
brandingImage = ''
if service.brandingImage?
brandingImage = " <a target='_blank' href='" + service.broughtToYouByURL + "' style='text-decoration:none;'>
<img height='28' src='" + service.brandingImage + "'/></a> "
servicesHtml += '</td>
<td class="serviceInfo">' + brandedTitle + ' - using: ' + brandingImage + ' <a target="_blank" href="' + service.broughtToYouByURL + '">' + service.broughtToYouByTitle + '</a><br>'
if service.name == "productHunt"
specificAPIlink = ", <a target='_blank' href='https://github.com/producthunt/producthunt-api/wiki/Product-Hunt-APIs#algolia-search-api'>for PH</a>"
if service.customSearchBroughtToYouByTitle?
customSearchApiBrandingHTML = "<div class='bg-warning' style='margin:4px; margin-top:10px;padding:6px;'>
<em><div style='padding-bottom:2px;'> custom searches are using: </div>" + '
<div style="padding-bottom:4px;">
<a target="_blank" href="' + service.customSearchBroughtToYouByURL + '">' + service.customSearchBroughtToYouByTitle + '</a>
' + specificAPIlink + '
</em>
</div>
</em>
</div>'
else
customSearchApiBrandingHTML = ""
servicesHtml += '<div style="padding-left:15px;">
status:
<label style="font-weight: normal;" for="' + service.name + '_serviceStatusON"> on </label> <input id="' + service.name + '_serviceStatusON" type="radio" name="' + service.name + '_serviceStatus" value="on" ' + activeCheck + '> -
<label style="font-weight: normal;" for="' + service.name + '_serviceStatusOFF"> off </label> <input id="' + service.name + '_serviceStatusOFF" type="radio" name="' + service.name + '_serviceStatus" value="off" ' + notActiveCheck + '>
<br><br>Results are deemed notable (capitilizes badge letter) if:'
if service.name == 'gnews'
servicesHtml += '<br><br> the topic has had <input id="' + service.name + '_numberOfStoriesFoundWithinTheHoursSincePostedLimit" type="text" size="4" value="' + service.notableConditions.numberOfStoriesFoundWithinTheHoursSincePostedLimit + '"/> or more related stories published within the last <input id="' + service.name + '_hoursNotable" type="text" size="4" value="' + service.notableConditions.hoursSincePosted + '"/> hours <br>
<div style="width:100%; text-align:center;"><span style="padding:7px; margin-right: 280px; display: inline-block;"> - or - </span></div>
number of News Clusters <input id="' + service.name + '_numberOfRelatedItemsWithClusterURL" type="text" size="4" value="' + service.notableConditions.numberOfRelatedItemsWithClusterURL + '"/>
</div>
' + customSearchApiBrandingHTML + '
</td>
</tr></tbody></table>
</div>'
else
servicesHtml += '<br> URL is an exact match, and:
<br> it has been <input id="' + service.name + '_hoursNotable" type="text" size="4" value="' + service.notableConditions.hoursSincePosted + '"/> or fewer hours since posting <br>
<div style="width:100%; text-align:center;"><span style="padding:7px; margin-right: 280px; display: inline-block;"> - or - </span></div>
a post has <input id="' + service.name + '_commentsNotable" type="text" size="4" value="' + service.notableConditions.num_comments + '"/> or more comments
</div>
' + customSearchApiBrandingHTML + '
</td>
</tr></tbody></table>
</div>'
servicesHtml += "<div class='serviceListing listing' style='padding:15px; margin-top: 30px;'>
Wouldn't it be awesome if we could add some more services to opt-in to? All that's needed are friendly APIs! <a href='https://twitter.com/spencenow' target='_blank'>Tweet me</a> if you're interested in adding one!
</div>
<br>"
$("#servicesInfoDrop").html(servicesHtml)
bind: (popupParcel) =>
saveButtons = $(@DOMselector + " .userPreferencesSave")
removeWhitelistStringButtons = $(@DOMselector + " .removeWhitelistString")
autoTimerRadios = $(@DOMselector + " input:radio[name='researchAutoOffType']")
allInputs = $(@DOMselector + ' input:not(.ignoreSaveButtonListen)')
addWhitelistString_button = $(@DOMselector + " #addWhiteListString label")
@elsToUnbind = @elsToUnbind.concat allInputs, saveButtons, autoTimerRadios, removeWhitelistStringButtons, addWhitelistString_button
saveButtons.attr('disabled','disabled')
allInputs.bind 'change', ->
$(".userPreferencesSave").removeAttr('disabled')
allInputs.bind 'focus', ->
$(".userPreferencesSave").removeAttr('disabled')
if $("input:radio[name='researchAutoOffType']:checked").val() is 'custom'
$("#autoCustomValue").removeAttr('disabled')
autoTimerRadios.bind 'change', ->
if $("input:radio[name='researchAutoOffType']:checked").val() is 'custom'
$("#autoCustomValue").removeAttr('disabled')
else
$("#autoCustomValue").attr('disabled','disabled')
_bindDown = (downButton, index) =>
downButton.bind 'click', ->
popupParcel.kiwi_servicesInfo = moveArrayElement(popupParcel.kiwi_servicesInfo, index, index + 1)
parcel =
refreshView: 'userPreferences'
keyName: 'PI:KEY:<KEY>END_PI'
newValue: popupParcel.kiwi_servicesInfo
localOrSync: 'sync'
msg: 'kiwiPP_post_save_a_la_carte'
sendParcel(parcel)
_bindUp = (upButton, index) =>
upButton.bind 'click', ->
popupParcel.kiwi_servicesInfo = moveArrayElement(popupParcel.kiwi_servicesInfo, index, index - 1 )
parcel =
refreshView: 'userPreferences'
keyName: 'PI:KEY:<KEY>END_PI'
newValue: popupParcel.kiwi_servicesInfo
localOrSync: 'sync'
msg: 'kiwiPP_post_save_a_la_carte'
sendParcel(parcel)
for service,index in popupParcel.kiwi_servicesInfo
downButton = $("#" + service.name + '_moveServiceDown')
if downButton.length > 0
@elsToUnbind.push downButton
_bindDown(downButton, index)
upButton = $("#" + service.name + '_moveServiceUp')
if upButton.length > 0
@elsToUnbind.push upButton
_bindUp(upButton, index)
postError = (userErrMsg) =>
# console.log 'trying to post error ' + userErrMsg
$(@DOMselector + " .userErrMsg").html("<br>" + userErrMsg)
addWhitelistString_button.bind 'click', (ev) =>
# whitelistSubString = $(ev.target).attr('data-whitelistStringToRemove')
whitelistSubString_toAdd = $(@DOMselector + " #addWhiteListString input").val()
popupParcel.kiwi_userPreferences.urlSubstring_whitelists.anyMatch.push whitelistSubString_toAdd
parcel =
refreshView: 'userPreferences'
keyName: 'PI:KEY:<KEY>END_PI'
newValue: popupParcel.kiwi_userPreferences
localOrSync: 'sync'
msg: 'kiwiPP_post_save_a_la_carte'
sendParcel(parcel)
removeWhitelistStringButtons.bind 'click', (ev) ->
whitelistSubString = $(ev.target).attr('data-whitelistStringToRemove')
newWhitelistAnyMatchArray = _.without(popupParcel.kiwi_userPreferences.urlSubstring_whitelists.anyMatch, whitelistSubString);
popupParcel.kiwi_userPreferences.urlSubstring_whitelists.anyMatch = newWhitelistAnyMatchArray
parcel =
refreshView: 'userPreferences'
keyName: 'PI:KEY:<KEY>END_PI'
newValue: popupParcel.kiwi_userPreferences
localOrSync: 'sync'
msg: 'kiwiPP_post_save_a_la_carte'
sendParcel(parcel)
saveButtons.bind 'click', ->
researchModeHTMLval = $("input:radio[name='research']:checked").val()
# console.log 'researchModeHTMLval is ' + researchModeHTMLval
if researchModeHTMLval != 'on' and researchModeHTMLval != 'off'
postError('research mode must be "on" or "off"'); return 0;
allowedAutoOffTypes = ["20","60","always","custom"]
autoOffTimerType = $("input:radio[name='researchAutoOffType']:checked").val()
autoOffTimerValue = $("#autoCustomValue").val()
if autoOffTimerType in allowedAutoOffTypes
if autoOffTimerType == 'custom' and (autoOffTimerValue == '' or isNaN(autoOffTimerValue))
postError('Must specify a number of minutes for auto-off timer.'); return 0;
else
postError('not acceptable autoOffTimerType'); return 0;
# autoOffAtUTCmilliTimestamp
for service, index in popupParcel.kiwi_servicesInfo
if service.name == 'gnews'
active = $("input:radio[name='" + service.name + "_serviceStatus']:checked").val()
if active != 'on' and active != 'off'
postError('active must be "on" or "off"'); return 0;
numberOfStoriesFoundWithinTheHoursSincePostedLimit = $('#' + service.name + '_numberOfStoriesFoundWithinTheHoursSincePostedLimit').val()
if numberOfStoriesFoundWithinTheHoursSincePostedLimit == '' or isNaN(numberOfStoriesFoundWithinTheHoursSincePostedLimit)
postError('number Of Stories Found Within The Hours Since Posted Limit must be an integer'); return 0;
numberOfRelatedItemsWithClusterURL = $('#' + service.name + '_numberOfRelatedItemsWithClusterURL').val()
if numberOfRelatedItemsWithClusterURL == '' or isNaN(numberOfRelatedItemsWithClusterURL)
postError('number Of Related Items With Cluster URL of comments must be an integer'); return 0;
else
active = $("input:radio[name='" + service.name + "_serviceStatus']:checked").val()
if active != 'on' and active != 'off'
postError('active must be "on" or "off"'); return 0;
hoursSincePosted = $('#' + service.name + '_hoursNotable').val()
if hoursSincePosted == '' or isNaN(hoursSincePosted)
postError('Hours must be an number'); return 0;
num_comments = $('#' + service.name + '_commentsNotable').val()
if num_comments == '' or isNaN(num_comments)
postError('Number of comments must be an integer'); return 0;
# console.log '1234'
popupParcel.kiwi_userPreferences.researchModeOnOff = researchModeHTMLval
if (autoOffTimerType != 'custom')
popupParcel.kiwi_userPreferences.autoOffTimerType = autoOffTimerType
else
popupParcel.kiwi_userPreferences.autoOffTimerType = autoOffTimerType
popupParcel.kiwi_userPreferences.autoOffTimerValue = parseFloat(autoOffTimerValue)
for service, index in popupParcel.kiwi_servicesInfo
active = $("input:radio[name='" + service.name + "_serviceStatus']:checked").val()
popupParcel.kiwi_servicesInfo[index].active = active
# notableSound = $("input:radio[name='" + service.name + "_soundStatus']:checked").val()
# popupParcel.kiwi_servicesInfo[index].notableSound = notableSound
hoursSincePosted = $('#' + service.name + '_hoursNotable').val()
# console.log popupParcel.kiwi_servicesInfo[index].name
# console.log "hoursSincePosted = $('#' + service.name + '_hoursNotable').val() " + hoursSincePosted
popupParcel.kiwi_servicesInfo[index].notableConditions.hoursSincePosted = parseFloat(hoursSincePosted)
if service.name == 'gnews'
numberOfRelatedItemsWithClusterURL = $('#' + service.name + '_numberOfRelatedItemsWithClusterURL').val()
popupParcel.kiwi_servicesInfo[index].notableConditions.numberOfRelatedItemsWithClusterURL = parseInt(numberOfRelatedItemsWithClusterURL)
numberOfStoriesFoundWithinTheHoursSincePostedLimit = $('#' + service.name + '_numberOfStoriesFoundWithinTheHoursSincePostedLimit').val()
popupParcel.kiwi_servicesInfo[index].notableConditions.numberOfStoriesFoundWithinTheHoursSincePostedLimit = parseInt(numberOfStoriesFoundWithinTheHoursSincePostedLimit)
else
num_comments = $('#' + service.name + '_commentsNotable').val()
popupParcel.kiwi_servicesInfo[index].notableConditions.num_comments = parseInt(num_comments)
popupParcel.view = 'userPreferences'
# console.log '4567'
# console.debug popupParcel
parcel =
refreshView: popupParcel.view
newPopupParcel: popupParcel
msg: 'kiwiPP_post_savePopupParcel'
sendParcel(parcel)
class Credits extends SwitchView
constructor: (@name) ->
super @name, @__renderStates__
init: (popupParcel) ->
@unbindWidget()
@render(popupParcel)
__renderStates__: =>
__normal__:
paint: (popupParcel) =>
console?.log 'painting ' + @name
bind: (popupParcel) =>
console?.log 'binding ' + @name
class Loading extends SwitchView
constructor: (@name) ->
super @name, @__renderStates__
init: (popupParcel) ->
@unbindWidget()
@render(popupParcel)
__renderStates__: =>
__normal__:
paint: (popupParcel) =>
console?.log 'painting ' + @name
bind: (popupParcel) =>
console?.log 'binding ' + @name
class KiwiSlice extends FixedView
constructor: (@name, uniqueSelectorPostfix) ->
super @name, @__renderStates__, uniqueSelectorPostfix
init: (popupParcel, renderState = null) =>
@renderStateTransitions = @__renderStateTransitions__()
# console.log 'hehehehee init: (popupParcel, renderState = null) =>'
@unbindView()
renderState = if renderState? then renderstate else "collapsed"
# console.log ' renderState = if renderState? then renderstate else "collapsed" ' + renderState
@render(popupParcel, 'collapsed')
render: (popupParcel, renderState, fromState = null) =>
# console.log 'in render for kiwi'
__renderStates__callback = (popupParcel, renderState) =>
super popupParcel, renderState
if fromState? and @renderStateTransitions[fromState + "__to__" + renderState]?
# console.log 'yep, has renderstate'
@renderStateTransitions[fromState + "__to__" + renderState](popupParcel, renderState, __renderStates__callback)
else
super popupParcel, renderState
__renderStates__: =>
collapsed:
paint: (popupParcel) =>
kiwiSliceHTML = '<div id="sliceActivateTransition" style="position:fixed; bottom: -33px; right: -33px; ">
<img style="width: 66px; height: 66px;" src="symmetricKiwi.png" />
</div>'
$(@DOMselector).html(kiwiSliceHTML)
bind: (popupParcel) =>
elActivateTransition = $(@DOMselector + " #sliceActivateTransition")
@elsToUnbind = @elsToUnbind.concat elActivateTransition
elActivateTransition.bind 'mouseover', (ev) =>
elActivateTransition.addClass('rotateClockwiseFull')
elActivateTransition.bind 'mouseout', (ev) =>
elActivateTransition.removeClass('rotateClockwiseFull')
elActivateTransition.bind 'click', (ev) =>
elActivateTransition.removeClass('rotateClockwiseFull')
@render(popupParcel,'open', 'collapsed')
open:
paint: (popupParcel) =>
# console.log 'painting ' + @name
kiwiSliceHTML = '<div id="transition_open_showMe" class="evenlySpacedContainer kiwiSliceOpenPlatter">
<button type="button" class=" goTo_creditsView btn btn-mini btn-default">credits</button>
<a class="btn btn-mini btn-default" style="font-size:.8em;" target="_blank" href="http://www.metafruit.com/kiwi/">MetaFruit <span class="glyphicon glyphicon-apple"></span></a>
<button class=" btn btn-mini btn-default" id="clearKiwiURLCache">clear cache</button>
<button class=" btn btn-mini btn-default" id="refreshURLresults">refresh</button>
</div>
<div id="sliceActivateTransition" style="position:fixed; bottom: 15px; right: 15px; ">
<img style="width: 66px; height: 66px;" src="symmetricKiwi.png" />
</div>'
$(@DOMselector).html(kiwiSliceHTML)
# console.log kiwiSliceHTML
bind: (popupParcel) =>
# console.log 'binding ' + @name
elActivateTransition = $(@DOMselector + " #sliceActivateTransition")
clearKiwiURLCacheButton = $(@DOMselector + " #clearKiwiURLCache")
refreshURLresultsButton = $(@DOMselector + " #refreshURLresults")
@elsToUnbind = @elsToUnbind.concat elActivateTransition, refreshURLresultsButton, clearKiwiURLCacheButton
refreshURLresultsButton.bind 'click', ->
parcel =
msg: 'kiwiPP_refreshURLresults'
sendParcel(parcel)
$('body').mouseup((e) =>
# console.log 'test test test'
container = $(@DOMselector)
if (!container.is(e.target) && container.has(e.target).length == 0)
$('body').unbind 'mouseup'
@render(popupParcel,'collapsed', 'open')
)
elActivateTransition.bind 'click', (ev) =>
@render(popupParcel,'collapsed', 'open')
clearKiwiURLCacheButton.bind 'click', ->
parcel =
msg: 'kiwiPP_clearAllURLresults'
sendParcel(parcel)
# \/ \/ \/ THIS IS A WORK IN PROGRESS \/ \/ \/
__renderStateTransitions__: =>
'open__to__collapsed': (popupParcel, renderState, __renderStates__callback) =>
$(@DOMselector + " #transition_open_showMe").animate({'opacity':0}, 300)
$(@DOMselector + " #sliceActivateTransition").addClass('rotateClockwise')
$(@DOMselector + " #sliceActivateTransition").animate({"bottom": '-33px', "right": "-33px"}, {
duration: 500,
complete: ->
__renderStates__callback(popupParcel, renderState)
})
# return transitionObj
'collapsed__to__open': (popupParcel, renderState, __renderStates__callback) =>
# console.log "'collapsed__to__open': (popupParcel, renderState, __renderStates__callback) =>"
$(@DOMselector + " #sliceActivateTransition").addClass('rotateCounterClockwise')
$(@DOMselector + " #sliceActivateTransition").animate({"bottom": '15px', "right": "15px"}, {
duration: 500,
complete: ->
# console.log 'we are done with animation'
__renderStates__callback(popupParcel, renderState)
})
$(@DOMselector).prepend('<div id="transition_open_showMe" class="evenlySpacedContainer kiwiSliceOpenPlatter" style="opacity: 0;">
<button type="button" class="goTo_creditsView btn btn-mini btn-default ">credits</button>
<a class=" btn btn-mini btn-default" style="font-size:.8em;" target="_blank" href="http://www.metafruit.com/kiwi/">MetaFruit <span class="glyphicon glyphicon-apple"></span></a>
<button class="btn btn-mini btn-default " id="clearKiwiURLCache">clear cache</button>
<button class="btn btn-mini btn-default " id="refreshURLresults">refresh</button>
</div>')
# setTimeout =>
$(@DOMselector + " #transition_open_showMe").animate({'opacity':1}, 499)
# , 200
fixedViews =
kiwiSlice: new KiwiSlice 'kiwiSlice', 'FixedBottom'
switchViews =
conversations: new Conversations 'conversations'
userPreferences: new UserPreferences 'userPreferences'
credits: new Credits 'credits'
loading: new Loading 'loading'
tailorResults =
productHunt: (serviceInfoObject, service_PreppedResults, kiwi_userPreferences) ->
preppedHTMLstring = ''
currentTime = Date.now()
fuzzyMatchBool = false
brandingDisplay = ''
if serviceInfoObject.brandingImage?
brandingDisplay = '<img style="margin-left:7px;" title="' + serviceInfoObject.title + '" height="28" src="' + serviceInfoObject.brandingImage + '"/>
<span class="serviceResultsTitles" style="color:black; position: relative;top: 6px;"">' + serviceInfoObject.title + '</span>'
else
brandingDisplay = "<span class='serviceResultsTitles'>" + serviceInfoObject.title + '</span>'
preppedHTMLstring += "<div class='serviceResultsBox serviceResultJumpTo resultsBox__" + serviceInfoObject.name + "'>
<div class='serviceResultsHeaderBar'>" + brandingDisplay + "</div>"
# recency doesn't make sense for PH
# if kiwi_userPreferences.sortByPref == 'attention'
# selectedString_attention = 'selected'
# selectedString_recency = ''
# else
# selectedString_attention = ''
# selectedString_recency = 'selected'
if service_PreppedResults.length < 1
preppedHTMLstring += ' no results <br>'
return preppedHTMLstring
else
service_PreppedResults = _.sortBy(service_PreppedResults, 'kiwi_num_comments')
service_PreppedResults.reverse()
for listing, index in service_PreppedResults
listingClass = if (index > 10 and service_PreppedResults.length > 14) then ' hidden_listing ' else ''
if listing.comment_text?
preppedHTMLstring += _tailorHNcomment(listing, serviceInfoObject, listingClass)
else
if (listing.kiwi_created_at? and currentTime - listing.kiwi_created_at < 1000 * 60 * 60 * 4)
recentTag = "<span class='recentListingTag'>Recent: </span>"
else
recentTag = ""
if listing.kiwi_makers.length > 3
gridLayoutBool = false
else
gridLayoutBool = true
preppedHTMLstring += '<div class="listing ' + listingClass + '">'
# kiwi_created_at: 1439471020625
# kiwi_author_headline: "Community @ProductHunt. "
# kiwi_author_name: "PI:NAME:<NAME>END_PI"
# kiwi_author_username: "bentossell"
# kiwi_discussion_url: "http://www.producthunt.com/tech/buffer-for-video"
# kiwi_makers: Array[9]
# headline: "Co-founder/CEO, Buffer"
# name: "PI:NAME:<NAME>END_PI"
# profile_url: "http://www.producthunt.com/@joelgascoigne"
# username: "joelgascoigne"
# website_url: "http://joel.is"
# kiwi_num_comments: 30
# kiwi_score: 244
# name: "Buffer for Video"
# tagline: "All-in-one video scheduling & management for social media"
# redirect_url: "http://www.producthunt.com/r/4918f991fdd705/30839?app_id=1674"
# screenshot_url: Object
if gridLayoutBool
preppedHTMLstring += '<div style="display:inline-table; width: 60%; padding-right:8px;">'
else
preppedHTMLstring += '<div>'
preppedHTMLstring += '
<a class="listingTitle" target="_blank" href="' + listing.kiwi_discussion_url + '">
<div style="color:black; padding:4px; padding-bottom: 8px; font-size: 1.1em;">' + recentTag + '
<b>' + listing.name + '</b>
</div>
<div style="color:#4D586F; padding-left:18px;">
<div style="padding-bottom:4px;">"' + listing.tagline + '"</div>'
preppedHTMLstring += '<div style="padding-bottom:4px;">
' + listing.kiwi_num_comments + ' comments, ' + listing.kiwi_score + ' upvotes
</div>'
if listing.kiwi_created_at?
_time = formatTime(listing.kiwi_created_at)
preppedHTMLstring += '' + _time
preppedHTMLstring += '</div></a></div>'
if gridLayoutBool
preppedHTMLstring += '<div style="display:inline-table; width: 39%;">'
else
preppedHTMLstring += '<div style="padding: 8px;">'
makerUsernames = []
if listing.kiwi_makers? and listing.kiwi_makers.length > 0
preppedHTMLstring += '<div><div style="padding-bottom:2px;"><b>made by</b>: </div>'
for maker in listing.kiwi_makers
if gridLayoutBool
preppedHTMLstring += '<div style="padding-bottom: 4px;">'
else
preppedHTMLstring += '<div style="padding-bottom: 4px; padding-left: 10px;">'
preppedHTMLstring += '<a target="_blank" href="' + serviceInfoObject.userPageBaselink + maker.username + '" style="color:#727E98;">' + maker.name
if maker.headline? and maker.headline != ""
preppedHTMLstring += ', "' + maker.headline + '"'
preppedHTMLstring += '</a>'
if maker.website_url?
preppedHTMLstring += ' <a href="' + maker.website_url + '" target="_blank"><span class="glyphicon glyphicon-log-in" style="color:blue;"></span> </a>'
if listing.kiwi_author_username == maker.username
preppedHTMLstring += " (also submitted post)"
preppedHTMLstring += '</div>'
preppedHTMLstring += '</div>'
makerUsernames.push maker.username
if listing.kiwi_author_username not in makerUsernames
if gridLayoutBool
gridLayoutAuthorDiv = '<div style="padding-bottom: 2px;">'
else
gridLayoutAuthorDiv = '<div style="padding-bottom: 2px; margin-left: 10px;">'
preppedHTMLstring += '<div style="">
<div style="padding-bottom:2px;"><b>submitted by:</b></div>
' + gridLayoutAuthorDiv + '<a target="_blank" href="' + serviceInfoObject.userPageBaselink + listing.kiwi_author_username + '"
style="color:#727E98;">' + listing.kiwi_author_name + '
'
if listing.kiwi_author_headline? and listing.kiwi_author_headline != ""
preppedHTMLstring += ', "' + listing.kiwi_author_headline + '"'
preppedHTMLstring += '</a></div></div>'
preppedHTMLstring += '</div></div>'
preppedHTMLstring += "</div>"
return preppedHTMLstring
hackerNews: (serviceInfoObject, service_PreppedResults, kiwi_userPreferences) ->
return tailorRedditAndHNresults_returnHtml(serviceInfoObject, service_PreppedResults, kiwi_userPreferences)
reddit: (serviceInfoObject, service_PreppedResults, kiwi_userPreferences) ->
return tailorRedditAndHNresults_returnHtml(serviceInfoObject, service_PreppedResults, kiwi_userPreferences)
_tailorHNcomment = (listing, serviceInfoObject, listingClass) ->
currentTime = Date.now()
commentHtml = ""
# story_text
# comment_text
# story_id
# story_title
# story_url
recentTag = if (currentTime - listing.kiwi_created_at < 1000 * 60 * 60 * 4) then "<span class='recentListingTag'>Recent: </span>" else ""
commentHtml += '<div class="listing ' + listingClass + ' " style="position:relative;">' + recentTag
if listing.over_18? and listing.over_18 is true
commentHtml += '<span class="nsfw">NSFW</span> For story: ' + listing.story_title + '<br>'
else
commentHtml += "For story: <a target='_blank' href='" + serviceInfoObject.permalinkBase + listing.story_id + "'>" + listing.story_title + '</a><br>'
_time = formatTime(listing.kiwi_created_at)
commentHtml += 'at ' + _time + ',
<a target="_blank" href="' + serviceInfoObject.userPageBaselink + listing.author + '">' + listing.author + '</a> recieved ' + listing.kiwi_score + ' upvotes, by saying:
( <a class="listingTitle" target="_blank" href="' + serviceInfoObject.permalinkBase + listing.kiwi_permaId + '">
comment permalink
</a> , <a class="listingTitle" target="_blank" href="' + serviceInfoObject.permalinkBase + listing.story_id + '"> story permalink </a>
)<br><div class="commentBox">
' + listing.comment_text + '
</div></div>'
return commentHtml
tailorRedditAndHNresults_returnHtml = (serviceInfoObject, service_PreppedResults, kiwi_userPreferences) ->
preppedHTMLstring = ''
currentTime = Date.now()
# kiwi_exact_match
# fuzzy matches
# linkify stuff
fuzzyMatchBool = false
preppedHTMLstring += "<div class='serviceResultsBox serviceResultJumpTo resultsBox__" + serviceInfoObject.name + "'>
<div class='serviceResultsHeaderBar'>"
if serviceInfoObject.name == 'reddit'
preppedHTMLstring += "<span class='serviceResultsTitles'>for " + serviceInfoObject.title + ':</span>'
else
preppedHTMLstring += "<span class='serviceResultsTitles'>" + serviceInfoObject.title + '</span>'
if kiwi_userPreferences.sortByPref == 'attention'
selectedString_attention = 'selected'
selectedString_recency = ''
else
selectedString_attention = ''
selectedString_recency = 'selected'
preppedHTMLstring += '<div style="float:right; padding-top: 9px;">   sorted by: <select class="conversations_sortByPref">
<option ' + selectedString_attention + ' id="_attention" value="attention">attention</option>
<option ' + selectedString_recency + ' id="_recency" value="recency">recency</option>
</select></div>
</div>'
if service_PreppedResults.length < 1
preppedHTMLstring += ' no results <br>'
return preppedHTMLstring
else if !service_PreppedResults[0].comment_text? and kiwi_userPreferences.sortByPref is 'attention'
service_PreppedResults = _.sortBy(service_PreppedResults, 'num_comments')
service_PreppedResults.reverse()
else if kiwi_userPreferences.sortByPref is 'attention'
service_PreppedResults = _.sortBy(service_PreppedResults, 'kiwi_score')
service_PreppedResults.reverse()
else if kiwi_userPreferences.sortByPref is 'recency'
service_PreppedResults = _.sortBy(service_PreppedResults, 'kiwi_created_at')
service_PreppedResults.reverse()
for listing, index in service_PreppedResults
listingClass = if (index > 10 and service_PreppedResults.length > 14) then ' hidden_listing ' else ''
if listing.comment_text?
preppedHTMLstring += _tailorHNcomment(listing, serviceInfoObject, listingClass)
else
recentTag = if (currentTime - listing.kiwi_created_at < 1000 * 60 * 60 * 4) then "<span class='recentListingTag'>Recent: </span>" else ""
if listing.kiwi_exact_match
# preppedHTMLstring += '<div class="listing ' + listingClass + '" style="position:relative;">' + recentTag + '
# <div style="float:right;">
# <a target="_blank" href="' + serviceInfoObject.userPageBaselink + listing.author + '"> by ' + listing.author + '</a>
# </div>
# <a class="listingTitle" target="_blank" href="' + serviceInfoObject.permalinkBase + listing.kiwi_permaId + '">'
preppedHTMLstring += '<div class="listing ' + listingClass + '">'
if serviceInfoObject.name != 'reddit'
preppedHTMLstring += '<div style="float:right;">
<a target="_blank" href="' + serviceInfoObject.userPageBaselink + listing.author + '"> by ' + listing.author + '</a>
</div>'
preppedHTMLstring += '<a class="listingTitle" target="_blank" href="' + serviceInfoObject.permalinkBase + listing.kiwi_permaId + '"><span style="color:black;">' + recentTag
if listing.over_18? and listing.over_18 is true
preppedHTMLstring += '<span class="nsfw">NSFW</span> <b>' + listing.title + '</b><br>'
else
preppedHTMLstring += '<b>' + listing.title + '</b><br>'
_time = formatTime(listing.kiwi_created_at)
preppedHTMLstring += listing.num_comments + ' comments, ' + listing.kiwi_score + ' upvotes -- ' + _time + '</span></a>'
if listing.subreddit?
preppedHTMLstring += '<br><span>
<a target="_blank" href="' + serviceInfoObject.permalinkBase + '/r/' + listing.subreddit + '">
subreddit: ' + listing.subreddit + '</a></span>
<div style="float:right;">
<a target="_blank" href="' + serviceInfoObject.userPageBaselink + listing.author + '"> by ' + listing.author + '
</a>
</div>'
preppedHTMLstring += '<br></div>'
else
fuzzyMatchBool = true
if fuzzyMatchBool
numberOfExactMatches = _.reduce(service_PreppedResults, (memo, obj) ->
if obj.kiwi_exact_match
memo++
return memo
else
memo
)
if (service_PreppedResults.length - numberOfExactMatches) > 10 and service_PreppedResults.length > 14
listingClass = ' hidden_listing '
else
listingClass = ''
# listingClass = if nonFuzzyItemCounter > 10 then ' hidden_listing ' else ''
preppedHTMLstring += '<div class="showFuzzyMatches ' + listingClass + '" style="position:relative;"> fuzzy matches: <br></div>
<span class="fuzzyMatches">'
# console.log 'fuzzy matches 12312312 ' + serviceInfoObject.name
for listing, index in service_PreppedResults
listingClass = if (index > 10 and service_PreppedResults.length > 14) then ' hidden_listing ' else ''
if !listing.kiwi_exact_match
recentTag = if (currentTime - listing.kiwi_created_at < 1000 * 60 * 60 * 4) then "<span class='recentListingTag'>Recent: </span>" else ""
preppedHTMLstring += '<div class="listing ' + listingClass + '">'
if serviceInfoObject.name != 'reddit'
preppedHTMLstring += '<div style="float:right;">
<a target="_blank" href="' + serviceInfoObject.userPageBaselink + listing.author + '"> by ' + listing.author + '</a>
</div>'
preppedHTMLstring += '<a class="listingTitle" target="_blank" href="' + serviceInfoObject.permalinkBase + listing.kiwi_permaId + '"><span style="color:black;">' + recentTag
if listing.over_18? and listing.over_18 is true
preppedHTMLstring += '<span class="nsfw">NSFW</span> <b>' + listing.title + '</b><br>'
else
preppedHTMLstring += '<b>' + listing.title + '</b><br>'
preppedHTMLstring += listing.num_comments + ' comments, ' + listing.kiwi_score + ' upvotes ' + formatTime(listing.kiwi_created_at) + '</span>
<br>
for Url: <span class="altURL">' + listing.url + '</span>
</a>'
if listing.subreddit?
preppedHTMLstring += '<br><span>
<a target="_blank" href="' + serviceInfoObject.permalinkBase + '/r/' + listing.subreddit + '">
subreddit: ' + listing.subreddit + '</a></span>
<div style="float:right;">
<a target="_blank" href="' + serviceInfoObject.userPageBaselink + listing.author + '"> by ' + listing.author + '
</a></div>'
preppedHTMLstring += '<br></div>'
preppedHTMLstring += "</span>"
preppedHTMLstring += "</div>"
return preppedHTMLstring
bindGoToViewButtons = (buttonEls, viewName, viewData) ->
for el in buttonEls
$(el).bind('click', (ev) ->
# console.log 'clicked ' + viewName
switchViews[viewName].render(viewData)
)
moveArrayElement = (array, from, to) ->
array.splice(to, 0, array.splice(from, 1)[0]);
return array
getRandom = (min, max) ->
return min + Math.floor(Math.random() * (max - min + 1))
formatTime = (utcMillisecondTimestamp) ->
a = new Date(utcMillisecondTimestamp)
months = ['Jan','Feb','Mar','Apr','May','Jun','Jul','Aug','Sep','Oct','Nov','Dec']
year = a.getFullYear()
month = months[a.getMonth()]
date = a.getDate()
hour = a.getHours()
min = a.getMinutes()
sec = a.getSeconds()
amOrPm = if hour > 11 then 'pm' else 'am'
if hour > 12
hour = hour - 12
else if parseInt(hour) == 0
hour = 12
if min < 10
min = '0' + min
time = month + ' ' + date + ', ' + year + ' - ' + hour + ':' + min + amOrPm
return time
renderExtensionHeight = (elementSelector, extraPx) ->
if viewElementId is elementSelector
extraPx = 2
extHeight_ = $(elementSelector).outerHeight() + extraPx
if extHeight_ > 590
extHeight_ = 590
# $('html').css('height',extHeight+'px')
$('body').css('height', extHeight_ + 'px')
`heightString = extHeight_.toString() +'px'`
$('html').css('min-height', heightString)
extHeight_--
$('body').css('min-height', heightString)
capitalizeFirstLetter = (string) ->
return string.charAt(0).toUpperCase() + string.slice(1)
# // http://css-tricks.com/snippets/javascript/htmlentities-for-javascript/
htmlEntities = (str) ->
return String(str).replace(/&/g, '&').replace(/</g, '<').replace(/>/g, '>').replace(/"/g, '"');
getURLParam = (oTarget, sVar) ->
return decodeURI(oTarget.search.replace(new RegExp("^(?:.*[&\\?]" + encodeURI(sVar).replace(/[\.\+\*]/g, "\\$&") + "(?:\\=([^&]*))?)?.*$", "i"), "$1"));
algoliaPHclient = null
algoliaPHindex = null
initAlgoliaPHcustomSearch = ->
algoliaPHclient = algoliasearch('0H4SMABBSG', '9670d2d619b9d07859448d7628eea5f3')
algoliaPHindex = algoliaPHclient.initIndex('Post_production')
initAlgoliaPHcustomSearch()
fetchAlgoliaProductHuntResultsFirst = (parcel) ->
# console.log 'yoyoyo here ' + parcel.customSearchRequest.queryString
# console.log parcel
# not ideal because it's blocking, and it'd be better to have persistent index object
# but the restrictions in FF addons force this approach.
if algoliaPHindex?
algoliaPHindex.search(parcel.customSearchRequest.queryString, (err, content) ->
# // err is either `null` or an `Error` object, with a `message` property
# // content is either the result of the command or `undefined`
if (err)
console.error(err)
parcel.customSearchRequest.servicesToSearch.productHunt.rawResults = []
self.port.emit('kiwiPP_post_customSearch', parcel)
return 0
if content? and content.hits?
parcel.customSearchRequest.servicesToSearch.productHunt.rawResults = content.hits
else
parcel.customSearchRequest.servicesToSearch.productHunt.rawResults = []
# console.log 'sending this PH'
# console.log parcel.customSearchRequest.servicesToSearch.productHunt.rawResults
self.port.emit('kiwiPP_post_customSearch', parcel)
)
else
parcel.customSearchRequest.servicesToSearch.productHunt.rawResults = []
self.port.emit('kiwiPP_post_customSearch', parcel)
sendParcel = (parcel) ->
if !parcel.msg?
return false
switch parcel.msg
when 'kiwiPP_acknowledgeMessage'
self.port.emit('kiwiPP_acknowledgeMessage', parcel);
when 'kiwiPP_refreshSearchQuery'
# port.postMessage(parcel)
self.port.emit('kiwiPP_refreshSearchQuery', parcel);
when 'kiwiPP_post_customSearch'
# not ideal because it's blocking, but the restrictions in FF addons force this approach
if parcel.customSearchRequest.servicesToSearch.productHunt?
fetchAlgoliaProductHuntResultsFirst(parcel)
else
port.postMessage(parcel)
when 'kiwiPP_request_popupParcel'
self.port.emit('kiwiPP_request_popupParcel', parcel)
# port.postMessage(parcel)
when 'kiwiPP_post_savePopupParcel'
self.port.emit('kiwiPP_post_savePopupParcel', parcel)
# port.postMessage(parcel)
when 'kiwiPP_post_save_a_la_carte'
self.port.emit('kiwiPP_post_save_a_la_carte', parcel)
# port.postMessage(parcel)
when 'kiwiPP_clearAllURLresults'
self.port.emit('kiwiPP_clearAllURLresults', parcel)
# port.postMessage(parcel)
when 'kiwiPP_refreshURLresults'
self.port.emit('kiwiPP_refreshURLresults', parcel)
# port.postMessage(parcel)
when 'kiwiPP_researchUrlOverrideButton'
self.port.emit('kiwiPP_researchUrlOverrideButton', parcel)
# port.postMessage(parcel)
receiveParcel = (parcel) ->
if !parcel.msg?
return false
switch parcel.msg
when 'kiwiPP_popupParcel_ready'
initialize(parcel.popupParcel)
self.port.on('kiwi_fromBackgroundToPopup', (parcel) ->
receiveParcel(parcel)
)
|
[
{
"context": "# @author mrdoob / http://mrdoob.com/\n# @author aladjev.andrew@gma",
"end": 16,
"score": 0.9996249675750732,
"start": 10,
"tag": "USERNAME",
"value": "mrdoob"
},
{
"context": "# @author mrdoob / http://mrdoob.com/\n# @author aladjev.andrew@gmail.com\n\n#= require new_src/loaders/loader\n#= require new",
"end": 72,
"score": 0.9999088644981384,
"start": 48,
"tag": "EMAIL",
"value": "aladjev.andrew@gmail.com"
}
] | source/javascripts/new_src/loaders/obj.coffee | andrew-aladev/three.js | 0 | # @author mrdoob / http://mrdoob.com/
# @author aladjev.andrew@gmail.com
#= require new_src/loaders/loader
#= require new_src/core/geometry
#= require new_src/core/object_3d
#= require new_src/core/vector_3
#= require new_src/core/face_3
#= require new_src/core/face_4
#= require new_src/core/uv
class OBJLoader extends THREE.Loader
load: (url, callback) ->
xhr = new XMLHttpRequest()
xhr.onreadystatechange = =>
if xhr.readyState is 4
if xhr.status is 200 or xhr.status is 0
callback @parse(xhr.responseText)
else
console.error "THREE.OBJLoader: Couldn't load ", url, " (", xhr.status, ")"
xhr.open "GET", url, true
xhr.send null
parse: (data) ->
group = new THREE.Object3D()
vertices = []
normals = []
uvs = []
# v float float float
pattern = /v( [\d|\.|\+|\-|e]+)( [\d|\.|\+|\-|e]+)( [\d|\.|\+|\-|e]+)/g
# ["v 1.0 2.0 3.0", "1.0", "2.0", "3.0"]
while (result = pattern.exec(data))?
vertices.push new THREE.Vector3(
parseFloat result[1]
parseFloat result[2]
parseFloat result[3]
)
# vn float float float
pattern = /vn( [\d|\.|\+|\-|e]+)( [\d|\.|\+|\-|e]+)( [\d|\.|\+|\-|e]+)/g
# ["vn 1.0 2.0 3.0", "1.0", "2.0", "3.0"]
while (result = pattern.exec(data))?
normals.push new THREE.Vector3(
parseFloat result[1]
parseFloat result[2]
parseFloat result[3]
)
# vt float float
pattern = /vt( [\d|\.|\+|\-|e]+)( [\d|\.|\+|\-|e]+)/g
# ["vt 0.1 0.2", "0.1", "0.2"]
while (result = pattern.exec(data))?
uvs.push new THREE.UV(
parseFloat(result[1]), 1.0 - parseFloat(result[2])
)
data = data.split("\no ")
length = data.length
for i in [0...length]
object = data[i]
obj_model = new OBJModel object, vertices, normals, uvs
group.add new THREE.Mesh(obj_model, new THREE.MeshLambertMaterial())
group
class OBJModel extends THREE.Geometry
constructor: (object, vertices, normals, uvs) ->
super()
@vertices = vertices
@normals = normals
@object = object
@uvs = uvs
@parseModel()
parseModel: ->
# f vertex vertex vertex ...
pattern = /f( [\d]+)( [\d]+)( [\d]+)( [\d]+)?/g
while (result = pattern.exec(@object))?
# ["f 1 2 3", "1", "2", "3", undefined]
unless result[4]
@faces.push new THREE.Face3(
parseInt(result[1]) - 1
parseInt(result[2]) - 1
parseInt(result[3]) - 1
)
else
@faces.push new THREE.Face4(
parseInt(result[1]) - 1
parseInt(result[2]) - 1
parseInt(result[3]) - 1
parseInt(result[4]) - 1
)
# f vertex/uv vertex/uv vertex/uv ...
pattern = /f( ([\d]+)\/([\d]+))( ([\d]+)\/([\d]+))( ([\d]+)\/([\d]+))( ([\d]+)\/([\d]+))?/g
while (result = pattern.exec(@object))?
# ["f 1/1 2/2 3/3", " 1/1", "1", "1", " 2/2", "2", "2", " 3/3", "3", "3", undefined, undefined, undefined]
unless result[10]?
@faces.push new THREE.Face3(
parseInt(result[2]) - 1
parseInt(result[5]) - 1
parseInt(result[8]) - 1
)
@faceVertexUvs[0].push [
@uvs[parseInt(result[3]) - 1]
@uvs[parseInt(result[6]) - 1]
@uvs[parseInt(result[9]) - 1]
]
else
@faces.push new THREE.Face4(
parseInt(result[2]) - 1
parseInt(result[5]) - 1
parseInt(result[8]) - 1
parseInt(result[11]) - 1
)
@faceVertexUvs[0].push [
@uvs[parseInt(result[3]) - 1]
@uvs[parseInt(result[6]) - 1]
@uvs[parseInt(result[9]) - 1]
@uvs[parseInt(result[12]) - 1]
]
# f vertex/uv/normal vertex/uv/normal vertex/uv/normal ...
pattern = /f( ([\d]+)\/([\d]+)\/([\d]+))( ([\d]+)\/([\d]+)\/([\d]+))( ([\d]+)\/([\d]+)\/([\d]+))( ([\d]+)\/([\d]+)\/([\d]+))?/g
while (result = pattern.exec(@object))?
# ["f 1/1/1 2/2/2 3/3/3", " 1/1/1", "1", "1", "1", " 2/2/2", "2", "2", "2", " 3/3/3", "3", "3", "3", undefined, undefined, undefined, undefined]
unless result[13]?
@faces.push new THREE.Face3(
parseInt(result[2]) - 1
parseInt(result[6]) - 1
parseInt(result[10]) - 1
[
@normals[parseInt(result[4]) - 1]
@normals[parseInt(result[8]) - 1]
@normals[parseInt(result[12]) - 1]
]
)
@faceVertexUvs[0].push [
@uvs[parseInt(result[3]) - 1]
@uvs[parseInt(result[7]) - 1]
@uvs[parseInt(result[11]) - 1]
]
else
@faces.push new THREE.Face4(
parseInt(result[2]) - 1
parseInt(result[6]) - 1
parseInt(result[10]) - 1
parseInt(result[14]) - 1
[
@normals[parseInt(result[4]) - 1]
@normals[parseInt(result[8]) - 1]
@normals[parseInt(result[12]) - 1]
@normals[parseInt(result[16]) - 1]
]
)
@faceVertexUvs[0].push [
@uvs[parseInt(result[3]) - 1]
@uvs[parseInt(result[7]) - 1]
@uvs[parseInt(result[11]) - 1]
@uvs[parseInt(result[15]) - 1]
]
# f vertex//normal vertex//normal vertex//normal ...
pattern = /f( ([\d]+)\/\/([\d]+))( ([\d]+)\/\/([\d]+))( ([\d]+)\/\/([\d]+))( ([\d]+)\/\/([\d]+))?/g
while (result = pattern.exec(@object))?
# ["f 1//1 2//2 3//3", " 1//1", "1", "1", " 2//2", "2", "2", " 3//3", "3", "3", undefined, undefined, undefined]
unless result[10]?
@faces.push new THREE.Face3(
parseInt(result[2]) - 1
parseInt(result[5]) - 1
parseInt(result[8]) - 1
[
@normals[parseInt(result[3]) - 1]
@normals[parseInt(result[6]) - 1]
@normals[parseInt(result[9]) - 1]
]
)
else
@faces.push new THREE.Face4(
parseInt(result[2]) - 1
parseInt(result[5]) - 1
parseInt(result[8]) - 1
parseInt(result[11]) - 1
[
@normals[parseInt(result[3]) - 1]
@normals[parseInt(result[6]) - 1]
@normals[parseInt(result[9]) - 1]
@normals[parseInt(result[12]) - 1]
]
)
@computeCentroids()
namespace "THREE", (exports) ->
exports.OBJLoader = OBJLoader
exports.OBJModel = OBJModel | 212093 | # @author mrdoob / http://mrdoob.com/
# @author <EMAIL>
#= require new_src/loaders/loader
#= require new_src/core/geometry
#= require new_src/core/object_3d
#= require new_src/core/vector_3
#= require new_src/core/face_3
#= require new_src/core/face_4
#= require new_src/core/uv
class OBJLoader extends THREE.Loader
load: (url, callback) ->
xhr = new XMLHttpRequest()
xhr.onreadystatechange = =>
if xhr.readyState is 4
if xhr.status is 200 or xhr.status is 0
callback @parse(xhr.responseText)
else
console.error "THREE.OBJLoader: Couldn't load ", url, " (", xhr.status, ")"
xhr.open "GET", url, true
xhr.send null
parse: (data) ->
group = new THREE.Object3D()
vertices = []
normals = []
uvs = []
# v float float float
pattern = /v( [\d|\.|\+|\-|e]+)( [\d|\.|\+|\-|e]+)( [\d|\.|\+|\-|e]+)/g
# ["v 1.0 2.0 3.0", "1.0", "2.0", "3.0"]
while (result = pattern.exec(data))?
vertices.push new THREE.Vector3(
parseFloat result[1]
parseFloat result[2]
parseFloat result[3]
)
# vn float float float
pattern = /vn( [\d|\.|\+|\-|e]+)( [\d|\.|\+|\-|e]+)( [\d|\.|\+|\-|e]+)/g
# ["vn 1.0 2.0 3.0", "1.0", "2.0", "3.0"]
while (result = pattern.exec(data))?
normals.push new THREE.Vector3(
parseFloat result[1]
parseFloat result[2]
parseFloat result[3]
)
# vt float float
pattern = /vt( [\d|\.|\+|\-|e]+)( [\d|\.|\+|\-|e]+)/g
# ["vt 0.1 0.2", "0.1", "0.2"]
while (result = pattern.exec(data))?
uvs.push new THREE.UV(
parseFloat(result[1]), 1.0 - parseFloat(result[2])
)
data = data.split("\no ")
length = data.length
for i in [0...length]
object = data[i]
obj_model = new OBJModel object, vertices, normals, uvs
group.add new THREE.Mesh(obj_model, new THREE.MeshLambertMaterial())
group
class OBJModel extends THREE.Geometry
constructor: (object, vertices, normals, uvs) ->
super()
@vertices = vertices
@normals = normals
@object = object
@uvs = uvs
@parseModel()
parseModel: ->
# f vertex vertex vertex ...
pattern = /f( [\d]+)( [\d]+)( [\d]+)( [\d]+)?/g
while (result = pattern.exec(@object))?
# ["f 1 2 3", "1", "2", "3", undefined]
unless result[4]
@faces.push new THREE.Face3(
parseInt(result[1]) - 1
parseInt(result[2]) - 1
parseInt(result[3]) - 1
)
else
@faces.push new THREE.Face4(
parseInt(result[1]) - 1
parseInt(result[2]) - 1
parseInt(result[3]) - 1
parseInt(result[4]) - 1
)
# f vertex/uv vertex/uv vertex/uv ...
pattern = /f( ([\d]+)\/([\d]+))( ([\d]+)\/([\d]+))( ([\d]+)\/([\d]+))( ([\d]+)\/([\d]+))?/g
while (result = pattern.exec(@object))?
# ["f 1/1 2/2 3/3", " 1/1", "1", "1", " 2/2", "2", "2", " 3/3", "3", "3", undefined, undefined, undefined]
unless result[10]?
@faces.push new THREE.Face3(
parseInt(result[2]) - 1
parseInt(result[5]) - 1
parseInt(result[8]) - 1
)
@faceVertexUvs[0].push [
@uvs[parseInt(result[3]) - 1]
@uvs[parseInt(result[6]) - 1]
@uvs[parseInt(result[9]) - 1]
]
else
@faces.push new THREE.Face4(
parseInt(result[2]) - 1
parseInt(result[5]) - 1
parseInt(result[8]) - 1
parseInt(result[11]) - 1
)
@faceVertexUvs[0].push [
@uvs[parseInt(result[3]) - 1]
@uvs[parseInt(result[6]) - 1]
@uvs[parseInt(result[9]) - 1]
@uvs[parseInt(result[12]) - 1]
]
# f vertex/uv/normal vertex/uv/normal vertex/uv/normal ...
pattern = /f( ([\d]+)\/([\d]+)\/([\d]+))( ([\d]+)\/([\d]+)\/([\d]+))( ([\d]+)\/([\d]+)\/([\d]+))( ([\d]+)\/([\d]+)\/([\d]+))?/g
while (result = pattern.exec(@object))?
# ["f 1/1/1 2/2/2 3/3/3", " 1/1/1", "1", "1", "1", " 2/2/2", "2", "2", "2", " 3/3/3", "3", "3", "3", undefined, undefined, undefined, undefined]
unless result[13]?
@faces.push new THREE.Face3(
parseInt(result[2]) - 1
parseInt(result[6]) - 1
parseInt(result[10]) - 1
[
@normals[parseInt(result[4]) - 1]
@normals[parseInt(result[8]) - 1]
@normals[parseInt(result[12]) - 1]
]
)
@faceVertexUvs[0].push [
@uvs[parseInt(result[3]) - 1]
@uvs[parseInt(result[7]) - 1]
@uvs[parseInt(result[11]) - 1]
]
else
@faces.push new THREE.Face4(
parseInt(result[2]) - 1
parseInt(result[6]) - 1
parseInt(result[10]) - 1
parseInt(result[14]) - 1
[
@normals[parseInt(result[4]) - 1]
@normals[parseInt(result[8]) - 1]
@normals[parseInt(result[12]) - 1]
@normals[parseInt(result[16]) - 1]
]
)
@faceVertexUvs[0].push [
@uvs[parseInt(result[3]) - 1]
@uvs[parseInt(result[7]) - 1]
@uvs[parseInt(result[11]) - 1]
@uvs[parseInt(result[15]) - 1]
]
# f vertex//normal vertex//normal vertex//normal ...
pattern = /f( ([\d]+)\/\/([\d]+))( ([\d]+)\/\/([\d]+))( ([\d]+)\/\/([\d]+))( ([\d]+)\/\/([\d]+))?/g
while (result = pattern.exec(@object))?
# ["f 1//1 2//2 3//3", " 1//1", "1", "1", " 2//2", "2", "2", " 3//3", "3", "3", undefined, undefined, undefined]
unless result[10]?
@faces.push new THREE.Face3(
parseInt(result[2]) - 1
parseInt(result[5]) - 1
parseInt(result[8]) - 1
[
@normals[parseInt(result[3]) - 1]
@normals[parseInt(result[6]) - 1]
@normals[parseInt(result[9]) - 1]
]
)
else
@faces.push new THREE.Face4(
parseInt(result[2]) - 1
parseInt(result[5]) - 1
parseInt(result[8]) - 1
parseInt(result[11]) - 1
[
@normals[parseInt(result[3]) - 1]
@normals[parseInt(result[6]) - 1]
@normals[parseInt(result[9]) - 1]
@normals[parseInt(result[12]) - 1]
]
)
@computeCentroids()
namespace "THREE", (exports) ->
exports.OBJLoader = OBJLoader
exports.OBJModel = OBJModel | true | # @author mrdoob / http://mrdoob.com/
# @author PI:EMAIL:<EMAIL>END_PI
#= require new_src/loaders/loader
#= require new_src/core/geometry
#= require new_src/core/object_3d
#= require new_src/core/vector_3
#= require new_src/core/face_3
#= require new_src/core/face_4
#= require new_src/core/uv
class OBJLoader extends THREE.Loader
load: (url, callback) ->
xhr = new XMLHttpRequest()
xhr.onreadystatechange = =>
if xhr.readyState is 4
if xhr.status is 200 or xhr.status is 0
callback @parse(xhr.responseText)
else
console.error "THREE.OBJLoader: Couldn't load ", url, " (", xhr.status, ")"
xhr.open "GET", url, true
xhr.send null
parse: (data) ->
group = new THREE.Object3D()
vertices = []
normals = []
uvs = []
# v float float float
pattern = /v( [\d|\.|\+|\-|e]+)( [\d|\.|\+|\-|e]+)( [\d|\.|\+|\-|e]+)/g
# ["v 1.0 2.0 3.0", "1.0", "2.0", "3.0"]
while (result = pattern.exec(data))?
vertices.push new THREE.Vector3(
parseFloat result[1]
parseFloat result[2]
parseFloat result[3]
)
# vn float float float
pattern = /vn( [\d|\.|\+|\-|e]+)( [\d|\.|\+|\-|e]+)( [\d|\.|\+|\-|e]+)/g
# ["vn 1.0 2.0 3.0", "1.0", "2.0", "3.0"]
while (result = pattern.exec(data))?
normals.push new THREE.Vector3(
parseFloat result[1]
parseFloat result[2]
parseFloat result[3]
)
# vt float float
pattern = /vt( [\d|\.|\+|\-|e]+)( [\d|\.|\+|\-|e]+)/g
# ["vt 0.1 0.2", "0.1", "0.2"]
while (result = pattern.exec(data))?
uvs.push new THREE.UV(
parseFloat(result[1]), 1.0 - parseFloat(result[2])
)
data = data.split("\no ")
length = data.length
for i in [0...length]
object = data[i]
obj_model = new OBJModel object, vertices, normals, uvs
group.add new THREE.Mesh(obj_model, new THREE.MeshLambertMaterial())
group
class OBJModel extends THREE.Geometry
constructor: (object, vertices, normals, uvs) ->
super()
@vertices = vertices
@normals = normals
@object = object
@uvs = uvs
@parseModel()
parseModel: ->
# f vertex vertex vertex ...
pattern = /f( [\d]+)( [\d]+)( [\d]+)( [\d]+)?/g
while (result = pattern.exec(@object))?
# ["f 1 2 3", "1", "2", "3", undefined]
unless result[4]
@faces.push new THREE.Face3(
parseInt(result[1]) - 1
parseInt(result[2]) - 1
parseInt(result[3]) - 1
)
else
@faces.push new THREE.Face4(
parseInt(result[1]) - 1
parseInt(result[2]) - 1
parseInt(result[3]) - 1
parseInt(result[4]) - 1
)
# f vertex/uv vertex/uv vertex/uv ...
pattern = /f( ([\d]+)\/([\d]+))( ([\d]+)\/([\d]+))( ([\d]+)\/([\d]+))( ([\d]+)\/([\d]+))?/g
while (result = pattern.exec(@object))?
# ["f 1/1 2/2 3/3", " 1/1", "1", "1", " 2/2", "2", "2", " 3/3", "3", "3", undefined, undefined, undefined]
unless result[10]?
@faces.push new THREE.Face3(
parseInt(result[2]) - 1
parseInt(result[5]) - 1
parseInt(result[8]) - 1
)
@faceVertexUvs[0].push [
@uvs[parseInt(result[3]) - 1]
@uvs[parseInt(result[6]) - 1]
@uvs[parseInt(result[9]) - 1]
]
else
@faces.push new THREE.Face4(
parseInt(result[2]) - 1
parseInt(result[5]) - 1
parseInt(result[8]) - 1
parseInt(result[11]) - 1
)
@faceVertexUvs[0].push [
@uvs[parseInt(result[3]) - 1]
@uvs[parseInt(result[6]) - 1]
@uvs[parseInt(result[9]) - 1]
@uvs[parseInt(result[12]) - 1]
]
# f vertex/uv/normal vertex/uv/normal vertex/uv/normal ...
pattern = /f( ([\d]+)\/([\d]+)\/([\d]+))( ([\d]+)\/([\d]+)\/([\d]+))( ([\d]+)\/([\d]+)\/([\d]+))( ([\d]+)\/([\d]+)\/([\d]+))?/g
while (result = pattern.exec(@object))?
# ["f 1/1/1 2/2/2 3/3/3", " 1/1/1", "1", "1", "1", " 2/2/2", "2", "2", "2", " 3/3/3", "3", "3", "3", undefined, undefined, undefined, undefined]
unless result[13]?
@faces.push new THREE.Face3(
parseInt(result[2]) - 1
parseInt(result[6]) - 1
parseInt(result[10]) - 1
[
@normals[parseInt(result[4]) - 1]
@normals[parseInt(result[8]) - 1]
@normals[parseInt(result[12]) - 1]
]
)
@faceVertexUvs[0].push [
@uvs[parseInt(result[3]) - 1]
@uvs[parseInt(result[7]) - 1]
@uvs[parseInt(result[11]) - 1]
]
else
@faces.push new THREE.Face4(
parseInt(result[2]) - 1
parseInt(result[6]) - 1
parseInt(result[10]) - 1
parseInt(result[14]) - 1
[
@normals[parseInt(result[4]) - 1]
@normals[parseInt(result[8]) - 1]
@normals[parseInt(result[12]) - 1]
@normals[parseInt(result[16]) - 1]
]
)
@faceVertexUvs[0].push [
@uvs[parseInt(result[3]) - 1]
@uvs[parseInt(result[7]) - 1]
@uvs[parseInt(result[11]) - 1]
@uvs[parseInt(result[15]) - 1]
]
# f vertex//normal vertex//normal vertex//normal ...
pattern = /f( ([\d]+)\/\/([\d]+))( ([\d]+)\/\/([\d]+))( ([\d]+)\/\/([\d]+))( ([\d]+)\/\/([\d]+))?/g
while (result = pattern.exec(@object))?
# ["f 1//1 2//2 3//3", " 1//1", "1", "1", " 2//2", "2", "2", " 3//3", "3", "3", undefined, undefined, undefined]
unless result[10]?
@faces.push new THREE.Face3(
parseInt(result[2]) - 1
parseInt(result[5]) - 1
parseInt(result[8]) - 1
[
@normals[parseInt(result[3]) - 1]
@normals[parseInt(result[6]) - 1]
@normals[parseInt(result[9]) - 1]
]
)
else
@faces.push new THREE.Face4(
parseInt(result[2]) - 1
parseInt(result[5]) - 1
parseInt(result[8]) - 1
parseInt(result[11]) - 1
[
@normals[parseInt(result[3]) - 1]
@normals[parseInt(result[6]) - 1]
@normals[parseInt(result[9]) - 1]
@normals[parseInt(result[12]) - 1]
]
)
@computeCentroids()
namespace "THREE", (exports) ->
exports.OBJLoader = OBJLoader
exports.OBJModel = OBJModel |
[
{
"context": "\n# Commands:\n#\n# Author:\n# Symphony Integration by Vinay Mistry\nEntities = require('html-entities').XmlEntities\ne",
"end": 1407,
"score": 0.9997658133506775,
"start": 1395,
"tag": "NAME",
"value": "Vinay Mistry"
},
{
"context": "= process.env.HUBOT_JIRA_USERNAME\n jiraPassword = process.env.HUBOT_JIRA_PASSWORD\n\n if jiraUsername != unde",
"end": 1783,
"score": 0.7760342359542847,
"start": 1776,
"tag": "PASSWORD",
"value": "process"
},
{
"context": "ndefined && jiraUsername.length > 0\n auth = \"#{jiraUsername}:#{jiraPassword}\"\n\n jiraIgnoreUsers = process.en",
"end": 1893,
"score": 0.9220390319824219,
"start": 1881,
"tag": "USERNAME",
"value": "jiraUsername"
}
] | src/scripts/jira.coffee | mcleo-d/bot-butler | 3 | #
#
#
# Copyright 2016 Symphony Communication Services, LLC
#
# Licensed to Symphony Communication Services, LLC under one
# or more contributor license agreements. See the NOTICE file
# distributed with this work for additional information
# regarding copyright ownership. The ASF licenses this file
# to you under the Apache License, Version 2.0 (the
# "License"); you may not use this file except in compliance
# with the License. You may obtain a copy of the License at
#
# http://www.apache.org/licenses/LICENSE-2.0
#
# Unless required by applicable law or agreed to in writing,
# software distributed under the License is distributed on an
# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
# KIND, either express or implied. See the License for the
# specific language governing permissions and limitations
# under the License.
#
#
#
# Description:
# Looks up jira issues when they're mentioned in chat
#
# Will ignore users set in HUBOT_JIRA_ISSUES_IGNORE_USERS (by default, JIRA and GitHub).
#
# Dependencies:
# None
#
# Configuration:
# HUBOT_JIRA_URL (format: "https://jira-domain.com:9090")
# HUBOT_JIRA_IGNORECASE (optional; default is "true")
# HUBOT_JIRA_USERNAME (optional)
# HUBOT_JIRA_PASSWORD (optional)
# HUBOT_JIRA_ISSUES_IGNORE_USERS (optional, format: "user1|user2", default is "jira|github")
#
# Commands:
#
# Author:
# Symphony Integration by Vinay Mistry
Entities = require('html-entities').XmlEntities
entities = new Entities()
module.exports = (robot) ->
cache = []
# In case someone upgrades form the previous version, we'll default to the
# previous behavior.
jiraUrl = process.env.HUBOT_JIRA_URL || "https://#{process.env.HUBOT_JIRA_DOMAIN}"
jiraUsername = process.env.HUBOT_JIRA_USERNAME
jiraPassword = process.env.HUBOT_JIRA_PASSWORD
if jiraUsername != undefined && jiraUsername.length > 0
auth = "#{jiraUsername}:#{jiraPassword}"
jiraIgnoreUsers = process.env.HUBOT_JIRA_ISSUES_IGNORE_USERS
if jiraIgnoreUsers == undefined
jiraIgnoreUsers = "jira|github"
if auth != undefined
robot.http(jiraUrl + "/rest/api/2/project")
.auth(auth)
.get() (err, res, body) ->
json = JSON.parse(body)
jiraPrefixes = ( entry.key for entry in json )
reducedPrefixes = jiraPrefixes.reduce (x,y) -> x + "-|" + y
jiraPattern = "/\\b(" + reducedPrefixes + "-)(\\d+)\\b/g"
ic = process.env.HUBOT_JIRA_IGNORECASE
if ic == undefined || ic == "true"
jiraPattern += "i"
robot.hear eval(jiraPattern), (msg) ->
# return if msg.message.user.name.match(new RegExp(jiraIgnoreUsers, "gi"))
for i in msg.match
issue = i.toUpperCase()
now = new Date().getTime()
if cache.length > 0
cache.shift() until cache.length is 0 or cache[0].expires >= now
msg.send item.message for item in cache when item.issue is issue
if cache.length == 0 or (item for item in cache when item.issue is issue).length == 0
robot.http(jiraUrl + "/rest/api/2/issue/" + issue)
.auth(auth)
.get() (err, res, body) ->
try
json = JSON.parse(body)
key = json.key
# Return Cache Results
message = "[ Cache" + key + "] " + json.fields.summary
message += '\n Cache Status: ' + json.fields.status.name
# Return API Results
msg.send "<messageML><card iconSrc=\"http://www.icone-png.com/png/52/51835.png\" accent=\"tempo-bg-color--blue\"><header><b
>#{key}</b> <b>#{json.fields.summary}</b></header><body>#{json.fields.description}<br/><a href=\"#{entities.encode(jiraUrl)}/browse/#{key}\"/
></body></card></messageML>"
# <messageML><card iconSrc="https://symphony.foundation/images/SymphonyLlcSymbol.png" accent="tempo-bg-color--purple"><header><a href="https://perzoinc.atlassian.net/browse/ESS-984">ESS-984</a> Checklist: WebRTC settings for s40<i>(header)</i></header><body>d<br/><br/><i>(body)</i></body></card></messageML>
# msg.send {
# format: 'MESSAGEML'
# text: "<messageML><b>#{key}</b> <b>#{json.fields.summary}</b><br/><i>Status: #{json.fields.status.name.toUpperCase()} Priority: #{json.fields.priority.name.toUpperCase()}</i><br/><i>Assignee: #{json.fields.assignee.displayName} Reported By: #{json.fields.reporter.displayName}</i><br/><a href=\"#{entities.encode(jiraUrl)}/browse/#{key}\"/></messageML>"
# }
# cache.push({issue: issue, expires: now + 120000, message: message})
catch error
try
msg.send "[*ERROR*] " + json.errorMessages[0]
catch reallyError
msg.send "[*ERROR*] " + reallyError
| 56603 | #
#
#
# Copyright 2016 Symphony Communication Services, LLC
#
# Licensed to Symphony Communication Services, LLC under one
# or more contributor license agreements. See the NOTICE file
# distributed with this work for additional information
# regarding copyright ownership. The ASF licenses this file
# to you under the Apache License, Version 2.0 (the
# "License"); you may not use this file except in compliance
# with the License. You may obtain a copy of the License at
#
# http://www.apache.org/licenses/LICENSE-2.0
#
# Unless required by applicable law or agreed to in writing,
# software distributed under the License is distributed on an
# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
# KIND, either express or implied. See the License for the
# specific language governing permissions and limitations
# under the License.
#
#
#
# Description:
# Looks up jira issues when they're mentioned in chat
#
# Will ignore users set in HUBOT_JIRA_ISSUES_IGNORE_USERS (by default, JIRA and GitHub).
#
# Dependencies:
# None
#
# Configuration:
# HUBOT_JIRA_URL (format: "https://jira-domain.com:9090")
# HUBOT_JIRA_IGNORECASE (optional; default is "true")
# HUBOT_JIRA_USERNAME (optional)
# HUBOT_JIRA_PASSWORD (optional)
# HUBOT_JIRA_ISSUES_IGNORE_USERS (optional, format: "user1|user2", default is "jira|github")
#
# Commands:
#
# Author:
# Symphony Integration by <NAME>
Entities = require('html-entities').XmlEntities
entities = new Entities()
module.exports = (robot) ->
cache = []
# In case someone upgrades form the previous version, we'll default to the
# previous behavior.
jiraUrl = process.env.HUBOT_JIRA_URL || "https://#{process.env.HUBOT_JIRA_DOMAIN}"
jiraUsername = process.env.HUBOT_JIRA_USERNAME
jiraPassword = <PASSWORD>.env.HUBOT_JIRA_PASSWORD
if jiraUsername != undefined && jiraUsername.length > 0
auth = "#{jiraUsername}:#{jiraPassword}"
jiraIgnoreUsers = process.env.HUBOT_JIRA_ISSUES_IGNORE_USERS
if jiraIgnoreUsers == undefined
jiraIgnoreUsers = "jira|github"
if auth != undefined
robot.http(jiraUrl + "/rest/api/2/project")
.auth(auth)
.get() (err, res, body) ->
json = JSON.parse(body)
jiraPrefixes = ( entry.key for entry in json )
reducedPrefixes = jiraPrefixes.reduce (x,y) -> x + "-|" + y
jiraPattern = "/\\b(" + reducedPrefixes + "-)(\\d+)\\b/g"
ic = process.env.HUBOT_JIRA_IGNORECASE
if ic == undefined || ic == "true"
jiraPattern += "i"
robot.hear eval(jiraPattern), (msg) ->
# return if msg.message.user.name.match(new RegExp(jiraIgnoreUsers, "gi"))
for i in msg.match
issue = i.toUpperCase()
now = new Date().getTime()
if cache.length > 0
cache.shift() until cache.length is 0 or cache[0].expires >= now
msg.send item.message for item in cache when item.issue is issue
if cache.length == 0 or (item for item in cache when item.issue is issue).length == 0
robot.http(jiraUrl + "/rest/api/2/issue/" + issue)
.auth(auth)
.get() (err, res, body) ->
try
json = JSON.parse(body)
key = json.key
# Return Cache Results
message = "[ Cache" + key + "] " + json.fields.summary
message += '\n Cache Status: ' + json.fields.status.name
# Return API Results
msg.send "<messageML><card iconSrc=\"http://www.icone-png.com/png/52/51835.png\" accent=\"tempo-bg-color--blue\"><header><b
>#{key}</b> <b>#{json.fields.summary}</b></header><body>#{json.fields.description}<br/><a href=\"#{entities.encode(jiraUrl)}/browse/#{key}\"/
></body></card></messageML>"
# <messageML><card iconSrc="https://symphony.foundation/images/SymphonyLlcSymbol.png" accent="tempo-bg-color--purple"><header><a href="https://perzoinc.atlassian.net/browse/ESS-984">ESS-984</a> Checklist: WebRTC settings for s40<i>(header)</i></header><body>d<br/><br/><i>(body)</i></body></card></messageML>
# msg.send {
# format: 'MESSAGEML'
# text: "<messageML><b>#{key}</b> <b>#{json.fields.summary}</b><br/><i>Status: #{json.fields.status.name.toUpperCase()} Priority: #{json.fields.priority.name.toUpperCase()}</i><br/><i>Assignee: #{json.fields.assignee.displayName} Reported By: #{json.fields.reporter.displayName}</i><br/><a href=\"#{entities.encode(jiraUrl)}/browse/#{key}\"/></messageML>"
# }
# cache.push({issue: issue, expires: now + 120000, message: message})
catch error
try
msg.send "[*ERROR*] " + json.errorMessages[0]
catch reallyError
msg.send "[*ERROR*] " + reallyError
| true | #
#
#
# Copyright 2016 Symphony Communication Services, LLC
#
# Licensed to Symphony Communication Services, LLC under one
# or more contributor license agreements. See the NOTICE file
# distributed with this work for additional information
# regarding copyright ownership. The ASF licenses this file
# to you under the Apache License, Version 2.0 (the
# "License"); you may not use this file except in compliance
# with the License. You may obtain a copy of the License at
#
# http://www.apache.org/licenses/LICENSE-2.0
#
# Unless required by applicable law or agreed to in writing,
# software distributed under the License is distributed on an
# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
# KIND, either express or implied. See the License for the
# specific language governing permissions and limitations
# under the License.
#
#
#
# Description:
# Looks up jira issues when they're mentioned in chat
#
# Will ignore users set in HUBOT_JIRA_ISSUES_IGNORE_USERS (by default, JIRA and GitHub).
#
# Dependencies:
# None
#
# Configuration:
# HUBOT_JIRA_URL (format: "https://jira-domain.com:9090")
# HUBOT_JIRA_IGNORECASE (optional; default is "true")
# HUBOT_JIRA_USERNAME (optional)
# HUBOT_JIRA_PASSWORD (optional)
# HUBOT_JIRA_ISSUES_IGNORE_USERS (optional, format: "user1|user2", default is "jira|github")
#
# Commands:
#
# Author:
# Symphony Integration by PI:NAME:<NAME>END_PI
Entities = require('html-entities').XmlEntities
entities = new Entities()
module.exports = (robot) ->
cache = []
# In case someone upgrades form the previous version, we'll default to the
# previous behavior.
jiraUrl = process.env.HUBOT_JIRA_URL || "https://#{process.env.HUBOT_JIRA_DOMAIN}"
jiraUsername = process.env.HUBOT_JIRA_USERNAME
jiraPassword = PI:PASSWORD:<PASSWORD>END_PI.env.HUBOT_JIRA_PASSWORD
if jiraUsername != undefined && jiraUsername.length > 0
auth = "#{jiraUsername}:#{jiraPassword}"
jiraIgnoreUsers = process.env.HUBOT_JIRA_ISSUES_IGNORE_USERS
if jiraIgnoreUsers == undefined
jiraIgnoreUsers = "jira|github"
if auth != undefined
robot.http(jiraUrl + "/rest/api/2/project")
.auth(auth)
.get() (err, res, body) ->
json = JSON.parse(body)
jiraPrefixes = ( entry.key for entry in json )
reducedPrefixes = jiraPrefixes.reduce (x,y) -> x + "-|" + y
jiraPattern = "/\\b(" + reducedPrefixes + "-)(\\d+)\\b/g"
ic = process.env.HUBOT_JIRA_IGNORECASE
if ic == undefined || ic == "true"
jiraPattern += "i"
robot.hear eval(jiraPattern), (msg) ->
# return if msg.message.user.name.match(new RegExp(jiraIgnoreUsers, "gi"))
for i in msg.match
issue = i.toUpperCase()
now = new Date().getTime()
if cache.length > 0
cache.shift() until cache.length is 0 or cache[0].expires >= now
msg.send item.message for item in cache when item.issue is issue
if cache.length == 0 or (item for item in cache when item.issue is issue).length == 0
robot.http(jiraUrl + "/rest/api/2/issue/" + issue)
.auth(auth)
.get() (err, res, body) ->
try
json = JSON.parse(body)
key = json.key
# Return Cache Results
message = "[ Cache" + key + "] " + json.fields.summary
message += '\n Cache Status: ' + json.fields.status.name
# Return API Results
msg.send "<messageML><card iconSrc=\"http://www.icone-png.com/png/52/51835.png\" accent=\"tempo-bg-color--blue\"><header><b
>#{key}</b> <b>#{json.fields.summary}</b></header><body>#{json.fields.description}<br/><a href=\"#{entities.encode(jiraUrl)}/browse/#{key}\"/
></body></card></messageML>"
# <messageML><card iconSrc="https://symphony.foundation/images/SymphonyLlcSymbol.png" accent="tempo-bg-color--purple"><header><a href="https://perzoinc.atlassian.net/browse/ESS-984">ESS-984</a> Checklist: WebRTC settings for s40<i>(header)</i></header><body>d<br/><br/><i>(body)</i></body></card></messageML>
# msg.send {
# format: 'MESSAGEML'
# text: "<messageML><b>#{key}</b> <b>#{json.fields.summary}</b><br/><i>Status: #{json.fields.status.name.toUpperCase()} Priority: #{json.fields.priority.name.toUpperCase()}</i><br/><i>Assignee: #{json.fields.assignee.displayName} Reported By: #{json.fields.reporter.displayName}</i><br/><a href=\"#{entities.encode(jiraUrl)}/browse/#{key}\"/></messageML>"
# }
# cache.push({issue: issue, expires: now + 120000, message: message})
catch error
try
msg.send "[*ERROR*] " + json.errorMessages[0]
catch reallyError
msg.send "[*ERROR*] " + reallyError
|
[
{
"context": " \"mailto:#{@get('email')}?subject=#{subject}&cc=inquiries@artsy.net\"\n\n getSimpleWebsite: ->\n return \"\" unless @ha",
"end": 1542,
"score": 0.9971751570701599,
"start": 1523,
"tag": "EMAIL",
"value": "inquiries@artsy.net"
}
] | src/desktop/models/partner.coffee | mikehrom/force | 1 | _ = require 'underscore'
sd = require('sharify').data
Backbone = require 'backbone'
Icon = require './icon.coffee'
Relations = require './mixins/relations/partner.coffee'
module.exports = class Partner extends Backbone.Model
_.extend @prototype, Relations
urlRoot: "#{sd.API_URL}/api/v1/partner"
@types:
'Auction': 'Auction House'
'Demo': 'Demo'
'Gallery': 'Gallery'
'Private Collector': 'Private Collector'
'Private Dealer': 'Gallery'
displayType: ->
@constructor.types[@get 'type'] or 'Gallery'
icon: ->
new Icon @get('icon'), profileId: @get('id')
isLinkable: -> @get('default_profile_id') and @get('default_profile_public')
alphaSortKey: ->
@get('sortable_id')
href: ->
"/partner/#{@get('id')}"
displayName: ->
@get('name')
defaultIconInitials: ->
iconInitials = ''
reduceFunction = (result, name) ->
return result unless name[0] and /\w/.test name[0]
result + name[0]
iconInitials = _.reduce(@displayName()?.split(' '), reduceFunction, '')[0..1]
iconInitials
displayNameAndLocation: ->
_.compact([
@displayName()
@displayLocations()
]).join(', ')
# @param {String} preferredCity (optional)
displayLocations: (preferredCity) ->
@related().locations.displayLocations(preferredCity)
getMailTo: ->
return "" unless @has('email') && @get('email').length > 0
subject = encodeURIComponent "Connecting with #{@get('name')} via Artsy"
"mailto:#{@get('email')}?subject=#{subject}&cc=inquiries@artsy.net"
getSimpleWebsite: ->
return "" unless @has('website') && @get('website').length > 0
@get('website').replace('http://', '').replace(/\/$/g, '')
typeName: ->
if @get('type') is 'Gallery' then 'Gallery' else 'Institution'
claimed: -> @get('claimed')
| 112213 | _ = require 'underscore'
sd = require('sharify').data
Backbone = require 'backbone'
Icon = require './icon.coffee'
Relations = require './mixins/relations/partner.coffee'
module.exports = class Partner extends Backbone.Model
_.extend @prototype, Relations
urlRoot: "#{sd.API_URL}/api/v1/partner"
@types:
'Auction': 'Auction House'
'Demo': 'Demo'
'Gallery': 'Gallery'
'Private Collector': 'Private Collector'
'Private Dealer': 'Gallery'
displayType: ->
@constructor.types[@get 'type'] or 'Gallery'
icon: ->
new Icon @get('icon'), profileId: @get('id')
isLinkable: -> @get('default_profile_id') and @get('default_profile_public')
alphaSortKey: ->
@get('sortable_id')
href: ->
"/partner/#{@get('id')}"
displayName: ->
@get('name')
defaultIconInitials: ->
iconInitials = ''
reduceFunction = (result, name) ->
return result unless name[0] and /\w/.test name[0]
result + name[0]
iconInitials = _.reduce(@displayName()?.split(' '), reduceFunction, '')[0..1]
iconInitials
displayNameAndLocation: ->
_.compact([
@displayName()
@displayLocations()
]).join(', ')
# @param {String} preferredCity (optional)
displayLocations: (preferredCity) ->
@related().locations.displayLocations(preferredCity)
getMailTo: ->
return "" unless @has('email') && @get('email').length > 0
subject = encodeURIComponent "Connecting with #{@get('name')} via Artsy"
"mailto:#{@get('email')}?subject=#{subject}&cc=<EMAIL>"
getSimpleWebsite: ->
return "" unless @has('website') && @get('website').length > 0
@get('website').replace('http://', '').replace(/\/$/g, '')
typeName: ->
if @get('type') is 'Gallery' then 'Gallery' else 'Institution'
claimed: -> @get('claimed')
| true | _ = require 'underscore'
sd = require('sharify').data
Backbone = require 'backbone'
Icon = require './icon.coffee'
Relations = require './mixins/relations/partner.coffee'
module.exports = class Partner extends Backbone.Model
_.extend @prototype, Relations
urlRoot: "#{sd.API_URL}/api/v1/partner"
@types:
'Auction': 'Auction House'
'Demo': 'Demo'
'Gallery': 'Gallery'
'Private Collector': 'Private Collector'
'Private Dealer': 'Gallery'
displayType: ->
@constructor.types[@get 'type'] or 'Gallery'
icon: ->
new Icon @get('icon'), profileId: @get('id')
isLinkable: -> @get('default_profile_id') and @get('default_profile_public')
alphaSortKey: ->
@get('sortable_id')
href: ->
"/partner/#{@get('id')}"
displayName: ->
@get('name')
defaultIconInitials: ->
iconInitials = ''
reduceFunction = (result, name) ->
return result unless name[0] and /\w/.test name[0]
result + name[0]
iconInitials = _.reduce(@displayName()?.split(' '), reduceFunction, '')[0..1]
iconInitials
displayNameAndLocation: ->
_.compact([
@displayName()
@displayLocations()
]).join(', ')
# @param {String} preferredCity (optional)
displayLocations: (preferredCity) ->
@related().locations.displayLocations(preferredCity)
getMailTo: ->
return "" unless @has('email') && @get('email').length > 0
subject = encodeURIComponent "Connecting with #{@get('name')} via Artsy"
"mailto:#{@get('email')}?subject=#{subject}&cc=PI:EMAIL:<EMAIL>END_PI"
getSimpleWebsite: ->
return "" unless @has('website') && @get('website').length > 0
@get('website').replace('http://', '').replace(/\/$/g, '')
typeName: ->
if @get('type') is 'Gallery' then 'Gallery' else 'Institution'
claimed: -> @get('claimed')
|
[
{
"context": "tion for Backbone.Marionette\n#\n# Copyright (C)2012 Derick Bailey, Muted Solutions, LLC\n# Distributed Under MIT Lic",
"end": 108,
"score": 0.9998266696929932,
"start": 95,
"tag": "NAME",
"value": "Derick Bailey"
},
{
"context": "nd Full License Available at:\n# http://github.com/derickbailey/backbone.bbclonemail\n# http://github.com/derickba",
"end": 244,
"score": 0.9994946122169495,
"start": 232,
"tag": "USERNAME",
"value": "derickbailey"
},
{
"context": "ckbailey/backbone.bbclonemail\n# http://github.com/derickbailey/backbone.marionette\n#\n# BBCloneMail Models And Co",
"end": 298,
"score": 0.9996500611305237,
"start": 286,
"tag": "USERNAME",
"value": "derickbailey"
}
] | client/01-main/collection.coffee | zhangcheng/bbclonemail-meteor | 1 | # Backbone.BBCloneMail
# A reference application for Backbone.Marionette
#
# Copyright (C)2012 Derick Bailey, Muted Solutions, LLC
# Distributed Under MIT License
#
# Documentation and Full License Available at:
# http://github.com/derickbailey/backbone.bbclonemail
# http://github.com/derickbailey/backbone.marionette
#
# BBCloneMail Models And Collections
# ----------------------------------
# Provide a guaranteed execution of a "reset" event for
# collections so I can find an item in the collection after
# the collection has been loaded.
BBCloneMail.Collection = Backbone.Collection.extend
constructor: ->
args = Array::slice.call(arguments)
Backbone.Collection::constructor.apply @, args
@onResetCallbacks = new Backbone.Marionette.Callbacks()
@on "reset", @runOnResetCallbacks, @
onReset: (callback) ->
@onResetCallbacks.add callback
runOnResetCallbacks: ->
@onResetCallbacks.run @, @
| 194089 | # Backbone.BBCloneMail
# A reference application for Backbone.Marionette
#
# Copyright (C)2012 <NAME>, Muted Solutions, LLC
# Distributed Under MIT License
#
# Documentation and Full License Available at:
# http://github.com/derickbailey/backbone.bbclonemail
# http://github.com/derickbailey/backbone.marionette
#
# BBCloneMail Models And Collections
# ----------------------------------
# Provide a guaranteed execution of a "reset" event for
# collections so I can find an item in the collection after
# the collection has been loaded.
BBCloneMail.Collection = Backbone.Collection.extend
constructor: ->
args = Array::slice.call(arguments)
Backbone.Collection::constructor.apply @, args
@onResetCallbacks = new Backbone.Marionette.Callbacks()
@on "reset", @runOnResetCallbacks, @
onReset: (callback) ->
@onResetCallbacks.add callback
runOnResetCallbacks: ->
@onResetCallbacks.run @, @
| true | # Backbone.BBCloneMail
# A reference application for Backbone.Marionette
#
# Copyright (C)2012 PI:NAME:<NAME>END_PI, Muted Solutions, LLC
# Distributed Under MIT License
#
# Documentation and Full License Available at:
# http://github.com/derickbailey/backbone.bbclonemail
# http://github.com/derickbailey/backbone.marionette
#
# BBCloneMail Models And Collections
# ----------------------------------
# Provide a guaranteed execution of a "reset" event for
# collections so I can find an item in the collection after
# the collection has been loaded.
BBCloneMail.Collection = Backbone.Collection.extend
constructor: ->
args = Array::slice.call(arguments)
Backbone.Collection::constructor.apply @, args
@onResetCallbacks = new Backbone.Marionette.Callbacks()
@on "reset", @runOnResetCallbacks, @
onReset: (callback) ->
@onResetCallbacks.add callback
runOnResetCallbacks: ->
@onResetCallbacks.run @, @
|
[
{
"context": " at the start', ->\n expect(_.regexIndexOf('Mr. Smith', /Mr./, 0)).toBe 0\n\n it 'should allow startpo",
"end": 1468,
"score": 0.9383359551429749,
"start": 1459,
"tag": "NAME",
"value": "Mr. Smith"
},
{
"context": "o be optional', ->\n expect(_.regexIndexOf('Mr. Smith', /Mr./)).toBe 0\n\n it 'should return the locat",
"end": 1580,
"score": 0.8201470971107483,
"start": 1571,
"tag": "NAME",
"value": "Mr. Smith"
},
{
"context": "ch at the end', ->\n expect(_.regexIndexOf('Mr. Smith Jr.', /Jr./)).toBe 10\n\n it 'should return the ",
"end": 1701,
"score": 0.6706042289733887,
"start": 1692,
"tag": "NAME",
"value": "Mr. Smith"
}
] | cyclotron-site/test/unit/mixins-spec.coffee | baumandm/cyclotron | 1,657 | ###
# Copyright (c) 2013-2018 the original author or authors.
#
# Licensed under the MIT License (the "License");
# you may not use this file except in compliance with the License.
# You may obtain a copy of the License at
#
# http://www.opensource.org/licenses/mit-license.php
#
# Unless required by applicable law or agreed to in writing,
# software distributed under the License is distributed on an
# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND,
# either express or implied. See the License for the specific
# language governing permissions and limitations under the License.
###
# jasmine specs for Mixins go here */
describe 'Unit: _.false', ->
it 'should return false', ->
expect(_.false()).toBeFalse()
describe 'Unit: _.isNullOrUndefined', ->
it 'should return true for undefined', ->
expect(_.isNullOrUndefined(undefined)).toBeTrue()
it 'should return true for null', ->
expect(_.isNullOrUndefined(null)).toBeTrue()
it 'should return false for an object', ->
expect(_.isNullOrUndefined(new Object())).toBeFalse()
it 'should return false for a number', ->
expect(_.isNullOrUndefined(99)).toBeFalse()
describe 'Unit: _.regexIndexOf', ->
it 'should return -1 if the regex cannot be found', ->
expect(_.regexIndexOf('a string', /regex/, 0)).toBe -1
it 'should return the location of a match at the start', ->
expect(_.regexIndexOf('Mr. Smith', /Mr./, 0)).toBe 0
it 'should allow startpos to be optional', ->
expect(_.regexIndexOf('Mr. Smith', /Mr./)).toBe 0
it 'should return the location of a match at the end', ->
expect(_.regexIndexOf('Mr. Smith Jr.', /Jr./)).toBe 10
it 'should return the location of a match in the middle', ->
expect(_.regexIndexOf('405 Parc Ave Apt 445, Seattle', /Apt \d+/)).toBe 13
it 'should return the location of the first match of multiple', ->
expect(_.regexIndexOf('450 NE 445 SE 304.3 SW 33 NW', /[A-Z]{2}/)).toBe 4
it 'should return the location of the first match of multiple afte the startpos', ->
expect(_.regexIndexOf('450 NE 445 SE 304.3 SW 33 NW', /[A-Z]{2}/, 6)).toBe 11
describe 'Unit: _.titleCase', ->
it 'should return null if given null', ->
expect(_.titleCase(null)).toBeNull()
it 'should return undefined if given undefined', ->
expect(_.titleCase(undefined)).toBeUndefined()
it 'should return empty string if given an empty string', ->
expect(_.titleCase('')).toBeEmptyString()
it 'should capitalize the first letter of a single word', ->
expect(_.titleCase('gyro')).toBe 'Gyro'
it 'should capitalize the first letter of each word', ->
expect(_.titleCase('gyro sandwich')).toBe 'Gyro Sandwich'
it 'should ignore the case of the rest of the word', ->
expect(_.titleCase('GYRO SANDWICH')).toBe 'GYRO SANDWICH'
expect(_.titleCase('Expedia EU')).toBe 'Expedia EU'
describe 'Unit: _.fromCamelCase', ->
it 'should return null if given null', ->
expect(_.fromCamelCase(null)).toBeNull()
it 'should return undefined if given undefined', ->
expect(_.fromCamelCase(undefined)).toBeUndefined()
it 'should return empty string if given an empty string', ->
expect(_.fromCamelCase('')).toBeEmptyString()
it 'should capitalize the first letter of a single word', ->
expect(_.fromCamelCase('gyro')).toBe 'Gyro'
it 'should capitalize the first letter of each word', ->
expect(_.fromCamelCase('gyro sandwich')).toBe 'Gyro Sandwich'
it 'should split multiple words camel-cased together', ->
expect(_.fromCamelCase('gyroSandwich')).toBe 'Gyro Sandwich'
expect(_.fromCamelCase('tastyGyroSandwich')).toBe 'Tasty Gyro Sandwich'
expect(_.fromCamelCase('5tastyGyroSandwiches')).toBe '5 Tasty Gyro Sandwiches'
it 'should operate on multiple camel-case words', ->
expect(_.fromCamelCase('mochaLatte & gyroSandwich')).toBe 'Mocha Latte & Gyro Sandwich'
describe 'Unit: _.replaceInside', ->
it 'should do nothing if given null', ->
expect(_.replaceInside(null, null)).toEqual null
original = {x: 1}
expect(_.replaceInside(original, null)).toEqual null
expect(original).toEqual original
it 'should return empty object if given that', ->
original = {}
expect(_.replaceInside(original, {})).toEqual {}
expect(original).toEqual {}
it 'should replace an object with an empty object', ->
original = {x: 1}
expect(_.replaceInside(original, {})).toEqual {}
expect(original).toEqual {}
it 'should return the replacement object if original is null', ->
original = null
expect(_.replaceInside(original, {a: 1, b: 2})).toEqual {a: 1, b: 2}
expect(original).toEqual null
it 'should replace all keys of the original', ->
original = {c: 5, d: 6, e: 8}
expect(_.replaceInside(original, {a: 1, b: 2})).toEqual {a: 1, b: 2}
expect(original).toEqual {a: 1, b: 2}
it 'should replace with nested objects', ->
original = {widget: [{id: 1}]}
expect(_.replaceInside(original, {pages: [{duration: 40}]})).toEqual {pages: [{duration: 40}]}
expect(original).toEqual {pages: [{duration: 40}]}
describe 'Unit: _.numeralformat', ->
it 'should return null if given null', ->
expect(_.numeralformat('0.0', null)).toBeNull()
it 'should return null if given undefined', ->
expect(_.numeralformat('0.0', undefined)).toBeNull()
it 'should return the number if format is null', ->
expect(_.numeralformat(null, 20.20512)).toBe 20.20512
it 'should return the number if format is empty', ->
expect(_.numeralformat('', 20.20512)).toBe 20.20512
it 'should return NaN if number is NaN', ->
expect(_.numeralformat('0.0', 0/0)).toBe 'NaN'
it 'should apply format correctly', ->
expect(_.numeralformat('0.0', 20.20512)).toBe '20.2'
it 'should apply format correctly to strings', ->
expect(_.numeralformat('0,0.0', '2002.041')).toBe '2,002.0'
it 'should return the string if a non-numeric string is provided', ->
expect(_.numeralformat('0,0.0', 'null')).toBe 'null'
describe 'Unit: _.ngApply', ->
actual = null
mockScope = {
$apply: (f) ->
actual = f()
return 1
}
mockFunction = -> 2
it 'should call $apply on the scope and pass the function', ->
x = _.ngApply(mockScope, mockFunction)()
expect(x).toBe 1
expect(actual).toBe 2
describe 'Unit: _.ngNonPropagatingHandler', ->
oracle = { a: 0, b: 0, c: 0 }
mockScope = {
$apply: (f) ->
actual = f()
return 1
}
mockFunctionA = ->
oracle.a = 1
mockFunctionB = ->
oracle.b = 2
return true
mockFunctionC = ->
oracle.c = 3
return 'OK'
it 'should return a function', ->
a = _.ngNonPropagatingHandler(mockScope, mockFunctionA)
expect(a).toBeFunction()
it 'should call the function A and return false', ->
a = _.ngNonPropagatingHandler(mockScope, mockFunctionA)()
expect(a).toBeFalse()
expect(oracle.a).toBe 1
it 'should call the function B and return false', ->
b = _.ngNonPropagatingHandler(mockScope, mockFunctionB)()
expect(b).toBeFalse()
expect(oracle.b).toBe 2
it 'should call the function C and return false', ->
c = _.ngNonPropagatingHandler(mockScope, mockFunctionC)()
expect(c).toBeFalse()
expect(oracle.c).toBe 3
| 62126 | ###
# Copyright (c) 2013-2018 the original author or authors.
#
# Licensed under the MIT License (the "License");
# you may not use this file except in compliance with the License.
# You may obtain a copy of the License at
#
# http://www.opensource.org/licenses/mit-license.php
#
# Unless required by applicable law or agreed to in writing,
# software distributed under the License is distributed on an
# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND,
# either express or implied. See the License for the specific
# language governing permissions and limitations under the License.
###
# jasmine specs for Mixins go here */
describe 'Unit: _.false', ->
it 'should return false', ->
expect(_.false()).toBeFalse()
describe 'Unit: _.isNullOrUndefined', ->
it 'should return true for undefined', ->
expect(_.isNullOrUndefined(undefined)).toBeTrue()
it 'should return true for null', ->
expect(_.isNullOrUndefined(null)).toBeTrue()
it 'should return false for an object', ->
expect(_.isNullOrUndefined(new Object())).toBeFalse()
it 'should return false for a number', ->
expect(_.isNullOrUndefined(99)).toBeFalse()
describe 'Unit: _.regexIndexOf', ->
it 'should return -1 if the regex cannot be found', ->
expect(_.regexIndexOf('a string', /regex/, 0)).toBe -1
it 'should return the location of a match at the start', ->
expect(_.regexIndexOf('<NAME>', /Mr./, 0)).toBe 0
it 'should allow startpos to be optional', ->
expect(_.regexIndexOf('<NAME>', /Mr./)).toBe 0
it 'should return the location of a match at the end', ->
expect(_.regexIndexOf('<NAME> Jr.', /Jr./)).toBe 10
it 'should return the location of a match in the middle', ->
expect(_.regexIndexOf('405 Parc Ave Apt 445, Seattle', /Apt \d+/)).toBe 13
it 'should return the location of the first match of multiple', ->
expect(_.regexIndexOf('450 NE 445 SE 304.3 SW 33 NW', /[A-Z]{2}/)).toBe 4
it 'should return the location of the first match of multiple afte the startpos', ->
expect(_.regexIndexOf('450 NE 445 SE 304.3 SW 33 NW', /[A-Z]{2}/, 6)).toBe 11
describe 'Unit: _.titleCase', ->
it 'should return null if given null', ->
expect(_.titleCase(null)).toBeNull()
it 'should return undefined if given undefined', ->
expect(_.titleCase(undefined)).toBeUndefined()
it 'should return empty string if given an empty string', ->
expect(_.titleCase('')).toBeEmptyString()
it 'should capitalize the first letter of a single word', ->
expect(_.titleCase('gyro')).toBe 'Gyro'
it 'should capitalize the first letter of each word', ->
expect(_.titleCase('gyro sandwich')).toBe 'Gyro Sandwich'
it 'should ignore the case of the rest of the word', ->
expect(_.titleCase('GYRO SANDWICH')).toBe 'GYRO SANDWICH'
expect(_.titleCase('Expedia EU')).toBe 'Expedia EU'
describe 'Unit: _.fromCamelCase', ->
it 'should return null if given null', ->
expect(_.fromCamelCase(null)).toBeNull()
it 'should return undefined if given undefined', ->
expect(_.fromCamelCase(undefined)).toBeUndefined()
it 'should return empty string if given an empty string', ->
expect(_.fromCamelCase('')).toBeEmptyString()
it 'should capitalize the first letter of a single word', ->
expect(_.fromCamelCase('gyro')).toBe 'Gyro'
it 'should capitalize the first letter of each word', ->
expect(_.fromCamelCase('gyro sandwich')).toBe 'Gyro Sandwich'
it 'should split multiple words camel-cased together', ->
expect(_.fromCamelCase('gyroSandwich')).toBe 'Gyro Sandwich'
expect(_.fromCamelCase('tastyGyroSandwich')).toBe 'Tasty Gyro Sandwich'
expect(_.fromCamelCase('5tastyGyroSandwiches')).toBe '5 Tasty Gyro Sandwiches'
it 'should operate on multiple camel-case words', ->
expect(_.fromCamelCase('mochaLatte & gyroSandwich')).toBe 'Mocha Latte & Gyro Sandwich'
describe 'Unit: _.replaceInside', ->
it 'should do nothing if given null', ->
expect(_.replaceInside(null, null)).toEqual null
original = {x: 1}
expect(_.replaceInside(original, null)).toEqual null
expect(original).toEqual original
it 'should return empty object if given that', ->
original = {}
expect(_.replaceInside(original, {})).toEqual {}
expect(original).toEqual {}
it 'should replace an object with an empty object', ->
original = {x: 1}
expect(_.replaceInside(original, {})).toEqual {}
expect(original).toEqual {}
it 'should return the replacement object if original is null', ->
original = null
expect(_.replaceInside(original, {a: 1, b: 2})).toEqual {a: 1, b: 2}
expect(original).toEqual null
it 'should replace all keys of the original', ->
original = {c: 5, d: 6, e: 8}
expect(_.replaceInside(original, {a: 1, b: 2})).toEqual {a: 1, b: 2}
expect(original).toEqual {a: 1, b: 2}
it 'should replace with nested objects', ->
original = {widget: [{id: 1}]}
expect(_.replaceInside(original, {pages: [{duration: 40}]})).toEqual {pages: [{duration: 40}]}
expect(original).toEqual {pages: [{duration: 40}]}
describe 'Unit: _.numeralformat', ->
it 'should return null if given null', ->
expect(_.numeralformat('0.0', null)).toBeNull()
it 'should return null if given undefined', ->
expect(_.numeralformat('0.0', undefined)).toBeNull()
it 'should return the number if format is null', ->
expect(_.numeralformat(null, 20.20512)).toBe 20.20512
it 'should return the number if format is empty', ->
expect(_.numeralformat('', 20.20512)).toBe 20.20512
it 'should return NaN if number is NaN', ->
expect(_.numeralformat('0.0', 0/0)).toBe 'NaN'
it 'should apply format correctly', ->
expect(_.numeralformat('0.0', 20.20512)).toBe '20.2'
it 'should apply format correctly to strings', ->
expect(_.numeralformat('0,0.0', '2002.041')).toBe '2,002.0'
it 'should return the string if a non-numeric string is provided', ->
expect(_.numeralformat('0,0.0', 'null')).toBe 'null'
describe 'Unit: _.ngApply', ->
actual = null
mockScope = {
$apply: (f) ->
actual = f()
return 1
}
mockFunction = -> 2
it 'should call $apply on the scope and pass the function', ->
x = _.ngApply(mockScope, mockFunction)()
expect(x).toBe 1
expect(actual).toBe 2
describe 'Unit: _.ngNonPropagatingHandler', ->
oracle = { a: 0, b: 0, c: 0 }
mockScope = {
$apply: (f) ->
actual = f()
return 1
}
mockFunctionA = ->
oracle.a = 1
mockFunctionB = ->
oracle.b = 2
return true
mockFunctionC = ->
oracle.c = 3
return 'OK'
it 'should return a function', ->
a = _.ngNonPropagatingHandler(mockScope, mockFunctionA)
expect(a).toBeFunction()
it 'should call the function A and return false', ->
a = _.ngNonPropagatingHandler(mockScope, mockFunctionA)()
expect(a).toBeFalse()
expect(oracle.a).toBe 1
it 'should call the function B and return false', ->
b = _.ngNonPropagatingHandler(mockScope, mockFunctionB)()
expect(b).toBeFalse()
expect(oracle.b).toBe 2
it 'should call the function C and return false', ->
c = _.ngNonPropagatingHandler(mockScope, mockFunctionC)()
expect(c).toBeFalse()
expect(oracle.c).toBe 3
| true | ###
# Copyright (c) 2013-2018 the original author or authors.
#
# Licensed under the MIT License (the "License");
# you may not use this file except in compliance with the License.
# You may obtain a copy of the License at
#
# http://www.opensource.org/licenses/mit-license.php
#
# Unless required by applicable law or agreed to in writing,
# software distributed under the License is distributed on an
# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND,
# either express or implied. See the License for the specific
# language governing permissions and limitations under the License.
###
# jasmine specs for Mixins go here */
describe 'Unit: _.false', ->
it 'should return false', ->
expect(_.false()).toBeFalse()
describe 'Unit: _.isNullOrUndefined', ->
it 'should return true for undefined', ->
expect(_.isNullOrUndefined(undefined)).toBeTrue()
it 'should return true for null', ->
expect(_.isNullOrUndefined(null)).toBeTrue()
it 'should return false for an object', ->
expect(_.isNullOrUndefined(new Object())).toBeFalse()
it 'should return false for a number', ->
expect(_.isNullOrUndefined(99)).toBeFalse()
describe 'Unit: _.regexIndexOf', ->
it 'should return -1 if the regex cannot be found', ->
expect(_.regexIndexOf('a string', /regex/, 0)).toBe -1
it 'should return the location of a match at the start', ->
expect(_.regexIndexOf('PI:NAME:<NAME>END_PI', /Mr./, 0)).toBe 0
it 'should allow startpos to be optional', ->
expect(_.regexIndexOf('PI:NAME:<NAME>END_PI', /Mr./)).toBe 0
it 'should return the location of a match at the end', ->
expect(_.regexIndexOf('PI:NAME:<NAME>END_PI Jr.', /Jr./)).toBe 10
it 'should return the location of a match in the middle', ->
expect(_.regexIndexOf('405 Parc Ave Apt 445, Seattle', /Apt \d+/)).toBe 13
it 'should return the location of the first match of multiple', ->
expect(_.regexIndexOf('450 NE 445 SE 304.3 SW 33 NW', /[A-Z]{2}/)).toBe 4
it 'should return the location of the first match of multiple afte the startpos', ->
expect(_.regexIndexOf('450 NE 445 SE 304.3 SW 33 NW', /[A-Z]{2}/, 6)).toBe 11
describe 'Unit: _.titleCase', ->
it 'should return null if given null', ->
expect(_.titleCase(null)).toBeNull()
it 'should return undefined if given undefined', ->
expect(_.titleCase(undefined)).toBeUndefined()
it 'should return empty string if given an empty string', ->
expect(_.titleCase('')).toBeEmptyString()
it 'should capitalize the first letter of a single word', ->
expect(_.titleCase('gyro')).toBe 'Gyro'
it 'should capitalize the first letter of each word', ->
expect(_.titleCase('gyro sandwich')).toBe 'Gyro Sandwich'
it 'should ignore the case of the rest of the word', ->
expect(_.titleCase('GYRO SANDWICH')).toBe 'GYRO SANDWICH'
expect(_.titleCase('Expedia EU')).toBe 'Expedia EU'
describe 'Unit: _.fromCamelCase', ->
it 'should return null if given null', ->
expect(_.fromCamelCase(null)).toBeNull()
it 'should return undefined if given undefined', ->
expect(_.fromCamelCase(undefined)).toBeUndefined()
it 'should return empty string if given an empty string', ->
expect(_.fromCamelCase('')).toBeEmptyString()
it 'should capitalize the first letter of a single word', ->
expect(_.fromCamelCase('gyro')).toBe 'Gyro'
it 'should capitalize the first letter of each word', ->
expect(_.fromCamelCase('gyro sandwich')).toBe 'Gyro Sandwich'
it 'should split multiple words camel-cased together', ->
expect(_.fromCamelCase('gyroSandwich')).toBe 'Gyro Sandwich'
expect(_.fromCamelCase('tastyGyroSandwich')).toBe 'Tasty Gyro Sandwich'
expect(_.fromCamelCase('5tastyGyroSandwiches')).toBe '5 Tasty Gyro Sandwiches'
it 'should operate on multiple camel-case words', ->
expect(_.fromCamelCase('mochaLatte & gyroSandwich')).toBe 'Mocha Latte & Gyro Sandwich'
describe 'Unit: _.replaceInside', ->
it 'should do nothing if given null', ->
expect(_.replaceInside(null, null)).toEqual null
original = {x: 1}
expect(_.replaceInside(original, null)).toEqual null
expect(original).toEqual original
it 'should return empty object if given that', ->
original = {}
expect(_.replaceInside(original, {})).toEqual {}
expect(original).toEqual {}
it 'should replace an object with an empty object', ->
original = {x: 1}
expect(_.replaceInside(original, {})).toEqual {}
expect(original).toEqual {}
it 'should return the replacement object if original is null', ->
original = null
expect(_.replaceInside(original, {a: 1, b: 2})).toEqual {a: 1, b: 2}
expect(original).toEqual null
it 'should replace all keys of the original', ->
original = {c: 5, d: 6, e: 8}
expect(_.replaceInside(original, {a: 1, b: 2})).toEqual {a: 1, b: 2}
expect(original).toEqual {a: 1, b: 2}
it 'should replace with nested objects', ->
original = {widget: [{id: 1}]}
expect(_.replaceInside(original, {pages: [{duration: 40}]})).toEqual {pages: [{duration: 40}]}
expect(original).toEqual {pages: [{duration: 40}]}
describe 'Unit: _.numeralformat', ->
it 'should return null if given null', ->
expect(_.numeralformat('0.0', null)).toBeNull()
it 'should return null if given undefined', ->
expect(_.numeralformat('0.0', undefined)).toBeNull()
it 'should return the number if format is null', ->
expect(_.numeralformat(null, 20.20512)).toBe 20.20512
it 'should return the number if format is empty', ->
expect(_.numeralformat('', 20.20512)).toBe 20.20512
it 'should return NaN if number is NaN', ->
expect(_.numeralformat('0.0', 0/0)).toBe 'NaN'
it 'should apply format correctly', ->
expect(_.numeralformat('0.0', 20.20512)).toBe '20.2'
it 'should apply format correctly to strings', ->
expect(_.numeralformat('0,0.0', '2002.041')).toBe '2,002.0'
it 'should return the string if a non-numeric string is provided', ->
expect(_.numeralformat('0,0.0', 'null')).toBe 'null'
describe 'Unit: _.ngApply', ->
actual = null
mockScope = {
$apply: (f) ->
actual = f()
return 1
}
mockFunction = -> 2
it 'should call $apply on the scope and pass the function', ->
x = _.ngApply(mockScope, mockFunction)()
expect(x).toBe 1
expect(actual).toBe 2
describe 'Unit: _.ngNonPropagatingHandler', ->
oracle = { a: 0, b: 0, c: 0 }
mockScope = {
$apply: (f) ->
actual = f()
return 1
}
mockFunctionA = ->
oracle.a = 1
mockFunctionB = ->
oracle.b = 2
return true
mockFunctionC = ->
oracle.c = 3
return 'OK'
it 'should return a function', ->
a = _.ngNonPropagatingHandler(mockScope, mockFunctionA)
expect(a).toBeFunction()
it 'should call the function A and return false', ->
a = _.ngNonPropagatingHandler(mockScope, mockFunctionA)()
expect(a).toBeFalse()
expect(oracle.a).toBe 1
it 'should call the function B and return false', ->
b = _.ngNonPropagatingHandler(mockScope, mockFunctionB)()
expect(b).toBeFalse()
expect(oracle.b).toBe 2
it 'should call the function C and return false', ->
c = _.ngNonPropagatingHandler(mockScope, mockFunctionC)()
expect(c).toBeFalse()
expect(oracle.c).toBe 3
|
[
{
"context": "@fileoverview Tests for complexity rule.\n# @author Gyandeep Singh\n###\n\n'use strict'\n\n#-----------------------------",
"end": 72,
"score": 0.9998620748519897,
"start": 58,
"tag": "NAME",
"value": "Gyandeep Singh"
},
{
"context": "WithoutGet: no\n # ]\n # https://github.com/eslint/eslint/issues/3262\n 'o = set: ->'\n 'Object.",
"end": 1340,
"score": 0.9371088147163391,
"start": 1334,
"tag": "USERNAME",
"value": "eslint"
}
] | src/tests/rules/accessor-pairs.coffee | danielbayley/eslint-plugin-coffee | 21 | ###*
# @fileoverview Tests for complexity rule.
# @author Gyandeep Singh
###
'use strict'
#------------------------------------------------------------------------------
# Requirements
#------------------------------------------------------------------------------
rule = require 'eslint/lib/rules/accessor-pairs'
{RuleTester} = require 'eslint'
path = require 'path'
#------------------------------------------------------------------------------
# Helpers
#------------------------------------------------------------------------------
ruleTester = new RuleTester parser: path.join __dirname, '../../..'
missingGetterInPropertyDescriptorError =
messageId: 'missingGetterInPropertyDescriptor'
# setterError = messageId: 'setter'
ruleTester.run 'accessor-pairs', rule,
valid: [
'o = { a: 1 }'
# 'o = {\n get a() {\n return val \n} \n}'
# 'o = {\n set a(value) {\n val = value \n},\n get a() {\n return val \n} \n}'
'''
o = {a: 1}
Object.defineProperty(o, 'b', {
set: (value) -> val = value
get: -> val
})
'''
# ,
# code: "expr = 'foo' o = { set [expr](value) { val = value }, get [expr]() { return val } }"
# ,
# code: 'o = {\n set a(value) {\n val = value \n} \n}'
# options: [
# setWithoutGet: no
# ]
# https://github.com/eslint/eslint/issues/3262
'o = set: ->'
'Object.defineProperties obj, set: value: ->'
'Object.create null, set: value: ->'
,
code: 'o = get: ->', options: [getWithoutSet: yes]
,
code: 'o = {[set]: ->}'
,
code: '''
set = 'value'
Object.defineProperty(obj, 'foo', {[set]: (value) ->})
'''
]
invalid: [
# code: 'o = {\n set a(value) {\n val = value \n} \n}'
# errors: [getterError]
# ,
# code: 'o = {\n get a() {\n return val \n} \n}'
# options: [
# getWithoutSet: yes
# ]
# errors: [setterError]
# ,
code: '''
o = {d: 1}
Object.defineProperty o, 'c',
set: (value) -> val = value
'''
errors: [missingGetterInPropertyDescriptorError]
,
code: '''
Reflect.defineProperty obj, 'foo',
set: (value) ->
'''
errors: [missingGetterInPropertyDescriptorError]
,
code: '''
Object.defineProperties obj,
foo:
set: (value) ->
'''
errors: [missingGetterInPropertyDescriptorError]
,
code: '''
Object.create null,
foo: set: (value) ->
'''
errors: [missingGetterInPropertyDescriptorError]
# ,
# code: "expr = 'foo' o = { set [expr](value) { val = value } }"
# parserOptions: ecmaVersion: 6
# errors: [getterError]
]
| 147344 | ###*
# @fileoverview Tests for complexity rule.
# @author <NAME>
###
'use strict'
#------------------------------------------------------------------------------
# Requirements
#------------------------------------------------------------------------------
rule = require 'eslint/lib/rules/accessor-pairs'
{RuleTester} = require 'eslint'
path = require 'path'
#------------------------------------------------------------------------------
# Helpers
#------------------------------------------------------------------------------
ruleTester = new RuleTester parser: path.join __dirname, '../../..'
missingGetterInPropertyDescriptorError =
messageId: 'missingGetterInPropertyDescriptor'
# setterError = messageId: 'setter'
ruleTester.run 'accessor-pairs', rule,
valid: [
'o = { a: 1 }'
# 'o = {\n get a() {\n return val \n} \n}'
# 'o = {\n set a(value) {\n val = value \n},\n get a() {\n return val \n} \n}'
'''
o = {a: 1}
Object.defineProperty(o, 'b', {
set: (value) -> val = value
get: -> val
})
'''
# ,
# code: "expr = 'foo' o = { set [expr](value) { val = value }, get [expr]() { return val } }"
# ,
# code: 'o = {\n set a(value) {\n val = value \n} \n}'
# options: [
# setWithoutGet: no
# ]
# https://github.com/eslint/eslint/issues/3262
'o = set: ->'
'Object.defineProperties obj, set: value: ->'
'Object.create null, set: value: ->'
,
code: 'o = get: ->', options: [getWithoutSet: yes]
,
code: 'o = {[set]: ->}'
,
code: '''
set = 'value'
Object.defineProperty(obj, 'foo', {[set]: (value) ->})
'''
]
invalid: [
# code: 'o = {\n set a(value) {\n val = value \n} \n}'
# errors: [getterError]
# ,
# code: 'o = {\n get a() {\n return val \n} \n}'
# options: [
# getWithoutSet: yes
# ]
# errors: [setterError]
# ,
code: '''
o = {d: 1}
Object.defineProperty o, 'c',
set: (value) -> val = value
'''
errors: [missingGetterInPropertyDescriptorError]
,
code: '''
Reflect.defineProperty obj, 'foo',
set: (value) ->
'''
errors: [missingGetterInPropertyDescriptorError]
,
code: '''
Object.defineProperties obj,
foo:
set: (value) ->
'''
errors: [missingGetterInPropertyDescriptorError]
,
code: '''
Object.create null,
foo: set: (value) ->
'''
errors: [missingGetterInPropertyDescriptorError]
# ,
# code: "expr = 'foo' o = { set [expr](value) { val = value } }"
# parserOptions: ecmaVersion: 6
# errors: [getterError]
]
| true | ###*
# @fileoverview Tests for complexity rule.
# @author PI:NAME:<NAME>END_PI
###
'use strict'
#------------------------------------------------------------------------------
# Requirements
#------------------------------------------------------------------------------
rule = require 'eslint/lib/rules/accessor-pairs'
{RuleTester} = require 'eslint'
path = require 'path'
#------------------------------------------------------------------------------
# Helpers
#------------------------------------------------------------------------------
ruleTester = new RuleTester parser: path.join __dirname, '../../..'
missingGetterInPropertyDescriptorError =
messageId: 'missingGetterInPropertyDescriptor'
# setterError = messageId: 'setter'
ruleTester.run 'accessor-pairs', rule,
valid: [
'o = { a: 1 }'
# 'o = {\n get a() {\n return val \n} \n}'
# 'o = {\n set a(value) {\n val = value \n},\n get a() {\n return val \n} \n}'
'''
o = {a: 1}
Object.defineProperty(o, 'b', {
set: (value) -> val = value
get: -> val
})
'''
# ,
# code: "expr = 'foo' o = { set [expr](value) { val = value }, get [expr]() { return val } }"
# ,
# code: 'o = {\n set a(value) {\n val = value \n} \n}'
# options: [
# setWithoutGet: no
# ]
# https://github.com/eslint/eslint/issues/3262
'o = set: ->'
'Object.defineProperties obj, set: value: ->'
'Object.create null, set: value: ->'
,
code: 'o = get: ->', options: [getWithoutSet: yes]
,
code: 'o = {[set]: ->}'
,
code: '''
set = 'value'
Object.defineProperty(obj, 'foo', {[set]: (value) ->})
'''
]
invalid: [
# code: 'o = {\n set a(value) {\n val = value \n} \n}'
# errors: [getterError]
# ,
# code: 'o = {\n get a() {\n return val \n} \n}'
# options: [
# getWithoutSet: yes
# ]
# errors: [setterError]
# ,
code: '''
o = {d: 1}
Object.defineProperty o, 'c',
set: (value) -> val = value
'''
errors: [missingGetterInPropertyDescriptorError]
,
code: '''
Reflect.defineProperty obj, 'foo',
set: (value) ->
'''
errors: [missingGetterInPropertyDescriptorError]
,
code: '''
Object.defineProperties obj,
foo:
set: (value) ->
'''
errors: [missingGetterInPropertyDescriptorError]
,
code: '''
Object.create null,
foo: set: (value) ->
'''
errors: [missingGetterInPropertyDescriptorError]
# ,
# code: "expr = 'foo' o = { set [expr](value) { val = value } }"
# parserOptions: ecmaVersion: 6
# errors: [getterError]
]
|
[
{
"context": "# Copyright (c) 2015 Riceball LEE, MIT License\nltgt = require('ltg",
"end": 33,
"score": 0.9998031854629517,
"start": 21,
"tag": "NAME",
"value": "Riceball LEE"
}
] | src/subkey-iterator.coffee | marwahaha/node-nosql-subkey | 0 | # Copyright (c) 2015 Riceball LEE, MIT License
ltgt = require('ltgt')
EncodingIterator = require("encoding-iterator")
inherits = require("abstract-object/lib/util/inherits")
isArray = require("abstract-object/lib/util/isArray")
extend = require("abstract-object/lib/util/_extend")
Codec = require('buffer-codec')
codec = require("./codec")
consts = require("./consts")
lowerBound = codec.lowerBound
upperBound = codec.upperBound
encodeKey = codec.encodeKey
decodeKey = codec.decodeKey
toLtgt = ltgt.toLtgt
GET_OP = consts.GET_OP
module.exports = class SubkeyIterator
inherits SubkeyIterator, EncodingIterator
encodeOptions: (options)->
vOptions = extend {}, options
vPath = options.path || []
options.valueEncoding = Codec(options.valueEncoding)
options.keyEncoding = keyEncoding = Codec(options.keyEncoding)
#the key is lowerBound or upperBound.
#if opts.start is exists then lowBound key is opt.start
encodeKeyPath = (key) ->
encoding = if key is lowerBound or key is upperBound then null else keyEncoding
vOptions.path = options.path
encodeKey(vPath, key, encoding, vOptions)
#convert the lower/upper bounds to real lower/upper bounds.
#codec.lowerBound, codec.upperBound are default bounds in case of the options have no bounds.
toLtgt(options, options, encodeKeyPath, lowerBound, upperBound) if options.bounded isnt false
options.keyAsBuffer = options.valueAsBuffer = false
if isArray options.range
result = []
for k in options.range
vOptions.path = options.path
k = encodeKey vPath, k, keyEncoding, vOptions, GET_OP
result.push k if k isnt false
options.range = result
#console.log("it:opts:", options)
options
decodeResult: (result)->
keyEncoding = @options.keyEncoding
valueEncoding = @options.valueEncoding
result[0] = decodeKey result[0], keyEncoding, @options if result[0]?
result[1] = valueEncoding.decode(result[1], @options) if result[1]? and valueEncoding
result
| 7844 | # Copyright (c) 2015 <NAME>, MIT License
ltgt = require('ltgt')
EncodingIterator = require("encoding-iterator")
inherits = require("abstract-object/lib/util/inherits")
isArray = require("abstract-object/lib/util/isArray")
extend = require("abstract-object/lib/util/_extend")
Codec = require('buffer-codec')
codec = require("./codec")
consts = require("./consts")
lowerBound = codec.lowerBound
upperBound = codec.upperBound
encodeKey = codec.encodeKey
decodeKey = codec.decodeKey
toLtgt = ltgt.toLtgt
GET_OP = consts.GET_OP
module.exports = class SubkeyIterator
inherits SubkeyIterator, EncodingIterator
encodeOptions: (options)->
vOptions = extend {}, options
vPath = options.path || []
options.valueEncoding = Codec(options.valueEncoding)
options.keyEncoding = keyEncoding = Codec(options.keyEncoding)
#the key is lowerBound or upperBound.
#if opts.start is exists then lowBound key is opt.start
encodeKeyPath = (key) ->
encoding = if key is lowerBound or key is upperBound then null else keyEncoding
vOptions.path = options.path
encodeKey(vPath, key, encoding, vOptions)
#convert the lower/upper bounds to real lower/upper bounds.
#codec.lowerBound, codec.upperBound are default bounds in case of the options have no bounds.
toLtgt(options, options, encodeKeyPath, lowerBound, upperBound) if options.bounded isnt false
options.keyAsBuffer = options.valueAsBuffer = false
if isArray options.range
result = []
for k in options.range
vOptions.path = options.path
k = encodeKey vPath, k, keyEncoding, vOptions, GET_OP
result.push k if k isnt false
options.range = result
#console.log("it:opts:", options)
options
decodeResult: (result)->
keyEncoding = @options.keyEncoding
valueEncoding = @options.valueEncoding
result[0] = decodeKey result[0], keyEncoding, @options if result[0]?
result[1] = valueEncoding.decode(result[1], @options) if result[1]? and valueEncoding
result
| true | # Copyright (c) 2015 PI:NAME:<NAME>END_PI, MIT License
ltgt = require('ltgt')
EncodingIterator = require("encoding-iterator")
inherits = require("abstract-object/lib/util/inherits")
isArray = require("abstract-object/lib/util/isArray")
extend = require("abstract-object/lib/util/_extend")
Codec = require('buffer-codec')
codec = require("./codec")
consts = require("./consts")
lowerBound = codec.lowerBound
upperBound = codec.upperBound
encodeKey = codec.encodeKey
decodeKey = codec.decodeKey
toLtgt = ltgt.toLtgt
GET_OP = consts.GET_OP
module.exports = class SubkeyIterator
inherits SubkeyIterator, EncodingIterator
encodeOptions: (options)->
vOptions = extend {}, options
vPath = options.path || []
options.valueEncoding = Codec(options.valueEncoding)
options.keyEncoding = keyEncoding = Codec(options.keyEncoding)
#the key is lowerBound or upperBound.
#if opts.start is exists then lowBound key is opt.start
encodeKeyPath = (key) ->
encoding = if key is lowerBound or key is upperBound then null else keyEncoding
vOptions.path = options.path
encodeKey(vPath, key, encoding, vOptions)
#convert the lower/upper bounds to real lower/upper bounds.
#codec.lowerBound, codec.upperBound are default bounds in case of the options have no bounds.
toLtgt(options, options, encodeKeyPath, lowerBound, upperBound) if options.bounded isnt false
options.keyAsBuffer = options.valueAsBuffer = false
if isArray options.range
result = []
for k in options.range
vOptions.path = options.path
k = encodeKey vPath, k, keyEncoding, vOptions, GET_OP
result.push k if k isnt false
options.range = result
#console.log("it:opts:", options)
options
decodeResult: (result)->
keyEncoding = @options.keyEncoding
valueEncoding = @options.valueEncoding
result[0] = decodeKey result[0], keyEncoding, @options if result[0]?
result[1] = valueEncoding.decode(result[1], @options) if result[1]? and valueEncoding
result
|
[
{
"context": "time('import')\n\t\t\t\t# 辽河区域中心/中国石油抚顺石化公司/石油三厂/分子筛车间,aicfscfzs@petrochina.com.cn,艾长飞,3\n\t\t\t\troot_org = db.organizations.findOne({sp",
"end": 1406,
"score": 0.9999324083328247,
"start": 1379,
"tag": "EMAIL",
"value": "aicfscfzs@petrochina.com.cn"
},
{
"context": "3] == 0 then false else true\n\n\t\t\t\t\t\t# 新建user, 默认密码123456\n\t\t\t\t\t\tuser_id = null\n\t\t\t\t\t\tuq = db.users.find({\"e",
"end": 1918,
"score": 0.9979269504547119,
"start": 1912,
"tag": "PASSWORD",
"value": "123456"
},
{
"context": "\n\t\t\t\t\t\t\tudoc.steedos_id = email\n\t\t\t\t\t\t\tudoc.name = name\n\t\t\t\t\t\t\tudoc.locale = \"zh-cn\"\n\t\t\t\t\t\t\tudoc.is_delet",
"end": 2173,
"score": 0.5212746858596802,
"start": 2169,
"tag": "NAME",
"value": "name"
},
{
"context": " true}]\n\t\t\t\t\t\t\tudoc.services = {password: {bcrypt: \"$2a$10$o2qrOKUtfICH/c3ATkxrwu11h5u5I.Mc4ANU6pMbBjUaNs6C3f2sG\"}}\n\t\t\t\t\t\t\tudoc.created = now\n\t\t\t\t\t\t\tudoc.modified",
"end": 2394,
"score": 0.9986768960952759,
"start": 2333,
"tag": "PASSWORD",
"value": "\"$2a$10$o2qrOKUtfICH/c3ATkxrwu11h5u5I.Mc4ANU6pMbBjUaNs6C3f2sG"
},
{
"context": "u_doc.user_accepted = accept\n\t\t\t\t\t\t\t\tsu_doc.name = name\n\t\t\t\t\t\t\t\tsu_doc.email = email\n\t\t\t\t\t\t\t\tsu_doc.creat",
"end": 4491,
"score": 0.9870633482933044,
"start": 4487,
"tag": "NAME",
"value": "name"
},
{
"context": " = Package.email.Email\n\t\t\t\t\tEmail.send\n\t\t\t\t\t\tto: 'support@steedos.com'\n\t\t\t\t\t\tfrom: Accounts.emailTemplates.from\n\t\t\t\t\t\ts",
"end": 6081,
"score": 0.9999226331710815,
"start": 6062,
"tag": "EMAIL",
"value": "support@steedos.com"
}
] | packages/steedos-api/routes/import.coffee | steedos/creator | 42 | # FSSH数据导入规则
# 需要将csv文件 用notepad++ 转为utf-8无bom编码格式
# 在列名行（第一行）前增加符号 井号 用于注释掉列名行
# 需要参数space_id
csv = require('csv')
Cookies = require("cookies")
JsonRoutes.add "post", "/api/import/space_org_users", (req, res, next) ->
console.log '====api/import'
console.log req.query
query = req.query
# TODO 用户登录验证
cookies = new Cookies( req, res );
# first check request body
if req.body
userId = req.body["X-User-Id"]
authToken = req.body["X-Auth-Token"]
# then check cookie
if !userId or !authToken
userId = cookies.get("X-User-Id")
authToken = cookies.get("X-Auth-Token")
if !(userId and authToken)
JsonRoutes.sendResult res,
code: 401,
data:
"error": "Validate Request -- Missing X-Auth-Token",
"success": false
return;
if !query || !query.space_id
JsonRoutes.sendResult res, data:
msg: '缺少参数space_id'
return;
space_id = query.space_id
space = db.spaces.findOne(space_id)
if !space || !space?.admins.includes(userId)
JsonRoutes.sendResult res, data:
msg: '参数space_id非法'
return;
owner_id = space.owner
JsonRoutes.parseFiles req, res, ()->
if req.files and req.files[0]
console.log req.files[0]
f = req.files[0]
dataStr = f.data.toString()
csv.parse dataStr, {comment: '#'}, Meteor.bindEnvironment(((err, data) ->
console.log data.length
console.time('import')
# 辽河区域中心/中国石油抚顺石化公司/石油三厂/分子筛车间,aicfscfzs@petrochina.com.cn,艾长飞,3
root_org = db.organizations.findOne({space: space_id, is_company: true, parent: null})
root_org_name = root_org.name
root_org_id = root_org._id
now = new Date()
result = []
data.forEach (row, index)->
try
dept_fullname = row[0]
depts = dept_fullname.split('/')
depts_length = depts.length
email = row[1]
name = if row[2] then row[2] else "未命名"
# 0表示禁用 ，非0表示启用
accept = if row[3] == 0 then false else true
# 新建user, 默认密码123456
user_id = null
uq = db.users.find({"emails.address": email})
if uq.count() > 0
user_id = uq.fetch()[0]._id
else
udoc = {}
udoc._id = db.users._makeNewID()
udoc.steedos_id = email
udoc.name = name
udoc.locale = "zh-cn"
udoc.is_deleted = false
udoc.emails = [{address: email, verified: true}]
udoc.services = {password: {bcrypt: "$2a$10$o2qrOKUtfICH/c3ATkxrwu11h5u5I.Mc4ANU6pMbBjUaNs6C3f2sG"}}
udoc.created = now
udoc.modified = now
udoc.utcOffset = 8
if row.length >= 7
udoc.username = row[6]
user_id = db.users.direct.insert(udoc)
if row.length >= 6
Accounts.setPassword(user_id, row[5], {logout: false})
# 新建organization
# if depts[0] == '所有用户组'
# i = 1
# else
i = 2
fullname = root_org_name
parent_org_id = root_org_id
while i < depts_length
dept_name = depts[i]
fullname = fullname + '/' + dept_name
co = db.organizations.find({space: space_id, fullname: fullname})
if co.count() > 0
org = co.fetch()[0]
parent_org_id = org._id
else
org_doc = {}
org_doc._id = db.organizations._makeNewID()
org_doc.space = space_id
org_doc.name = dept_name
org_doc.parent = parent_org_id
org_doc.created = now
org_doc.created_by = owner_id
org_doc.modified = now
org_doc.modified_by = owner_id
org_id = db.organizations.direct.insert(org_doc)
if org_id
org = db.organizations.findOne(org_id)
updateFields = {}
updateFields.parents = org.calculateParents()
updateFields.fullname = org.calculateFullname()
if !_.isEmpty(updateFields)
db.organizations.direct.update(org._id, {$set: updateFields})
if org.parent
parent = db.organizations.findOne(org.parent)
db.organizations.direct.update(parent._id, {$set: {children: parent.calculateChildren()}})
parent_org_id = org_id
i++
# 新建space_user ,并将space_user放入所属组织
suq = db.space_users.findOne({space: space_id, user: user_id})
space_user_org = db.organizations.findOne({space: space_id, fullname: fullname})
if !suq
if space_user_org
space_user_org_id = space_user_org._id
su_doc = {}
su_doc._id = db.space_users._makeNewID()
su_doc.user = user_id
su_doc.space = space_id
su_doc.user_accepted = accept
su_doc.name = name
su_doc.email = email
su_doc.created = now
su_doc.created_by = owner_id
su_doc.organization = space_user_org_id
su_doc.organizations = [su_doc.organization]
if row.length >= 5
su_doc.sort_no = row[4]
space_user_id = db.space_users.direct.insert(su_doc)
if space_user_id
# update org users
space_user_org.updateUsers()
# users_changelogs
ucl_doc = {}
ucl_doc.change_date = moment().format('YYYYMMDD')
ucl_doc.operator = owner_id
ucl_doc.space = space_id
ucl_doc.operation = "add"
ucl_doc.user = user_id
ucl_doc.created = now
ucl_doc.created_by = owner_id
count = db.space_users.direct.find({space: space_id}).count()
ucl_doc.user_count = count
db.users_changelogs.direct.insert(ucl_doc)
else
if space_user_org
if !suq.organizations
suq.organizations = []
suq.organizations.push(space_user_org._id)
db.space_users.direct.update({space: space_id, user: user_id}, {$set: {organizations: _.uniq(suq.organizations)}})
if row.length >= 6
Accounts.setPassword(user_id, row[5], {logout: false})
space_user_org.updateUsers()
catch e
# ...
console.error email
console.error e
r = {}
r.email = email
r.error = e.message
result.push(r)
console.timeEnd('import')
if result.length > 0
console.error result
Email = Package.email.Email
Email.send
to: 'support@steedos.com'
from: Accounts.emailTemplates.from
subject: 'steedos import result'
text: JSON.stringify({'result': result})
), (err)->
console.error 'Failed to bind environment'
console.error err
)
res.end();
else
res.statusCode = 500;
res.end();
| 90137 | # FSSH数据导入规则
# 需要将csv文件 用notepad++ 转为utf-8无bom编码格式
# 在列名行（第一行）前增加符号 井号 用于注释掉列名行
# 需要参数space_id
csv = require('csv')
Cookies = require("cookies")
JsonRoutes.add "post", "/api/import/space_org_users", (req, res, next) ->
console.log '====api/import'
console.log req.query
query = req.query
# TODO 用户登录验证
cookies = new Cookies( req, res );
# first check request body
if req.body
userId = req.body["X-User-Id"]
authToken = req.body["X-Auth-Token"]
# then check cookie
if !userId or !authToken
userId = cookies.get("X-User-Id")
authToken = cookies.get("X-Auth-Token")
if !(userId and authToken)
JsonRoutes.sendResult res,
code: 401,
data:
"error": "Validate Request -- Missing X-Auth-Token",
"success": false
return;
if !query || !query.space_id
JsonRoutes.sendResult res, data:
msg: '缺少参数space_id'
return;
space_id = query.space_id
space = db.spaces.findOne(space_id)
if !space || !space?.admins.includes(userId)
JsonRoutes.sendResult res, data:
msg: '参数space_id非法'
return;
owner_id = space.owner
JsonRoutes.parseFiles req, res, ()->
if req.files and req.files[0]
console.log req.files[0]
f = req.files[0]
dataStr = f.data.toString()
csv.parse dataStr, {comment: '#'}, Meteor.bindEnvironment(((err, data) ->
console.log data.length
console.time('import')
# 辽河区域中心/中国石油抚顺石化公司/石油三厂/分子筛车间,<EMAIL>,艾长飞,3
root_org = db.organizations.findOne({space: space_id, is_company: true, parent: null})
root_org_name = root_org.name
root_org_id = root_org._id
now = new Date()
result = []
data.forEach (row, index)->
try
dept_fullname = row[0]
depts = dept_fullname.split('/')
depts_length = depts.length
email = row[1]
name = if row[2] then row[2] else "未命名"
# 0表示禁用 ，非0表示启用
accept = if row[3] == 0 then false else true
# 新建user, 默认密码<PASSWORD>
user_id = null
uq = db.users.find({"emails.address": email})
if uq.count() > 0
user_id = uq.fetch()[0]._id
else
udoc = {}
udoc._id = db.users._makeNewID()
udoc.steedos_id = email
udoc.name = <NAME>
udoc.locale = "zh-cn"
udoc.is_deleted = false
udoc.emails = [{address: email, verified: true}]
udoc.services = {password: {bcrypt: <PASSWORD>"}}
udoc.created = now
udoc.modified = now
udoc.utcOffset = 8
if row.length >= 7
udoc.username = row[6]
user_id = db.users.direct.insert(udoc)
if row.length >= 6
Accounts.setPassword(user_id, row[5], {logout: false})
# 新建organization
# if depts[0] == '所有用户组'
# i = 1
# else
i = 2
fullname = root_org_name
parent_org_id = root_org_id
while i < depts_length
dept_name = depts[i]
fullname = fullname + '/' + dept_name
co = db.organizations.find({space: space_id, fullname: fullname})
if co.count() > 0
org = co.fetch()[0]
parent_org_id = org._id
else
org_doc = {}
org_doc._id = db.organizations._makeNewID()
org_doc.space = space_id
org_doc.name = dept_name
org_doc.parent = parent_org_id
org_doc.created = now
org_doc.created_by = owner_id
org_doc.modified = now
org_doc.modified_by = owner_id
org_id = db.organizations.direct.insert(org_doc)
if org_id
org = db.organizations.findOne(org_id)
updateFields = {}
updateFields.parents = org.calculateParents()
updateFields.fullname = org.calculateFullname()
if !_.isEmpty(updateFields)
db.organizations.direct.update(org._id, {$set: updateFields})
if org.parent
parent = db.organizations.findOne(org.parent)
db.organizations.direct.update(parent._id, {$set: {children: parent.calculateChildren()}})
parent_org_id = org_id
i++
# 新建space_user ,并将space_user放入所属组织
suq = db.space_users.findOne({space: space_id, user: user_id})
space_user_org = db.organizations.findOne({space: space_id, fullname: fullname})
if !suq
if space_user_org
space_user_org_id = space_user_org._id
su_doc = {}
su_doc._id = db.space_users._makeNewID()
su_doc.user = user_id
su_doc.space = space_id
su_doc.user_accepted = accept
su_doc.name = <NAME>
su_doc.email = email
su_doc.created = now
su_doc.created_by = owner_id
su_doc.organization = space_user_org_id
su_doc.organizations = [su_doc.organization]
if row.length >= 5
su_doc.sort_no = row[4]
space_user_id = db.space_users.direct.insert(su_doc)
if space_user_id
# update org users
space_user_org.updateUsers()
# users_changelogs
ucl_doc = {}
ucl_doc.change_date = moment().format('YYYYMMDD')
ucl_doc.operator = owner_id
ucl_doc.space = space_id
ucl_doc.operation = "add"
ucl_doc.user = user_id
ucl_doc.created = now
ucl_doc.created_by = owner_id
count = db.space_users.direct.find({space: space_id}).count()
ucl_doc.user_count = count
db.users_changelogs.direct.insert(ucl_doc)
else
if space_user_org
if !suq.organizations
suq.organizations = []
suq.organizations.push(space_user_org._id)
db.space_users.direct.update({space: space_id, user: user_id}, {$set: {organizations: _.uniq(suq.organizations)}})
if row.length >= 6
Accounts.setPassword(user_id, row[5], {logout: false})
space_user_org.updateUsers()
catch e
# ...
console.error email
console.error e
r = {}
r.email = email
r.error = e.message
result.push(r)
console.timeEnd('import')
if result.length > 0
console.error result
Email = Package.email.Email
Email.send
to: '<EMAIL>'
from: Accounts.emailTemplates.from
subject: 'steedos import result'
text: JSON.stringify({'result': result})
), (err)->
console.error 'Failed to bind environment'
console.error err
)
res.end();
else
res.statusCode = 500;
res.end();
| true | # FSSH数据导入规则
# 需要将csv文件 用notepad++ 转为utf-8无bom编码格式
# 在列名行（第一行）前增加符号 井号 用于注释掉列名行
# 需要参数space_id
csv = require('csv')
Cookies = require("cookies")
JsonRoutes.add "post", "/api/import/space_org_users", (req, res, next) ->
console.log '====api/import'
console.log req.query
query = req.query
# TODO 用户登录验证
cookies = new Cookies( req, res );
# first check request body
if req.body
userId = req.body["X-User-Id"]
authToken = req.body["X-Auth-Token"]
# then check cookie
if !userId or !authToken
userId = cookies.get("X-User-Id")
authToken = cookies.get("X-Auth-Token")
if !(userId and authToken)
JsonRoutes.sendResult res,
code: 401,
data:
"error": "Validate Request -- Missing X-Auth-Token",
"success": false
return;
if !query || !query.space_id
JsonRoutes.sendResult res, data:
msg: '缺少参数space_id'
return;
space_id = query.space_id
space = db.spaces.findOne(space_id)
if !space || !space?.admins.includes(userId)
JsonRoutes.sendResult res, data:
msg: '参数space_id非法'
return;
owner_id = space.owner
JsonRoutes.parseFiles req, res, ()->
if req.files and req.files[0]
console.log req.files[0]
f = req.files[0]
dataStr = f.data.toString()
csv.parse dataStr, {comment: '#'}, Meteor.bindEnvironment(((err, data) ->
console.log data.length
console.time('import')
# 辽河区域中心/中国石油抚顺石化公司/石油三厂/分子筛车间,PI:EMAIL:<EMAIL>END_PI,艾长飞,3
root_org = db.organizations.findOne({space: space_id, is_company: true, parent: null})
root_org_name = root_org.name
root_org_id = root_org._id
now = new Date()
result = []
data.forEach (row, index)->
try
dept_fullname = row[0]
depts = dept_fullname.split('/')
depts_length = depts.length
email = row[1]
name = if row[2] then row[2] else "未命名"
# 0表示禁用 ，非0表示启用
accept = if row[3] == 0 then false else true
# 新建user, 默认密码PI:PASSWORD:<PASSWORD>END_PI
user_id = null
uq = db.users.find({"emails.address": email})
if uq.count() > 0
user_id = uq.fetch()[0]._id
else
udoc = {}
udoc._id = db.users._makeNewID()
udoc.steedos_id = email
udoc.name = PI:NAME:<NAME>END_PI
udoc.locale = "zh-cn"
udoc.is_deleted = false
udoc.emails = [{address: email, verified: true}]
udoc.services = {password: {bcrypt: PI:PASSWORD:<PASSWORD>END_PI"}}
udoc.created = now
udoc.modified = now
udoc.utcOffset = 8
if row.length >= 7
udoc.username = row[6]
user_id = db.users.direct.insert(udoc)
if row.length >= 6
Accounts.setPassword(user_id, row[5], {logout: false})
# 新建organization
# if depts[0] == '所有用户组'
# i = 1
# else
i = 2
fullname = root_org_name
parent_org_id = root_org_id
while i < depts_length
dept_name = depts[i]
fullname = fullname + '/' + dept_name
co = db.organizations.find({space: space_id, fullname: fullname})
if co.count() > 0
org = co.fetch()[0]
parent_org_id = org._id
else
org_doc = {}
org_doc._id = db.organizations._makeNewID()
org_doc.space = space_id
org_doc.name = dept_name
org_doc.parent = parent_org_id
org_doc.created = now
org_doc.created_by = owner_id
org_doc.modified = now
org_doc.modified_by = owner_id
org_id = db.organizations.direct.insert(org_doc)
if org_id
org = db.organizations.findOne(org_id)
updateFields = {}
updateFields.parents = org.calculateParents()
updateFields.fullname = org.calculateFullname()
if !_.isEmpty(updateFields)
db.organizations.direct.update(org._id, {$set: updateFields})
if org.parent
parent = db.organizations.findOne(org.parent)
db.organizations.direct.update(parent._id, {$set: {children: parent.calculateChildren()}})
parent_org_id = org_id
i++
# 新建space_user ,并将space_user放入所属组织
suq = db.space_users.findOne({space: space_id, user: user_id})
space_user_org = db.organizations.findOne({space: space_id, fullname: fullname})
if !suq
if space_user_org
space_user_org_id = space_user_org._id
su_doc = {}
su_doc._id = db.space_users._makeNewID()
su_doc.user = user_id
su_doc.space = space_id
su_doc.user_accepted = accept
su_doc.name = PI:NAME:<NAME>END_PI
su_doc.email = email
su_doc.created = now
su_doc.created_by = owner_id
su_doc.organization = space_user_org_id
su_doc.organizations = [su_doc.organization]
if row.length >= 5
su_doc.sort_no = row[4]
space_user_id = db.space_users.direct.insert(su_doc)
if space_user_id
# update org users
space_user_org.updateUsers()
# users_changelogs
ucl_doc = {}
ucl_doc.change_date = moment().format('YYYYMMDD')
ucl_doc.operator = owner_id
ucl_doc.space = space_id
ucl_doc.operation = "add"
ucl_doc.user = user_id
ucl_doc.created = now
ucl_doc.created_by = owner_id
count = db.space_users.direct.find({space: space_id}).count()
ucl_doc.user_count = count
db.users_changelogs.direct.insert(ucl_doc)
else
if space_user_org
if !suq.organizations
suq.organizations = []
suq.organizations.push(space_user_org._id)
db.space_users.direct.update({space: space_id, user: user_id}, {$set: {organizations: _.uniq(suq.organizations)}})
if row.length >= 6
Accounts.setPassword(user_id, row[5], {logout: false})
space_user_org.updateUsers()
catch e
# ...
console.error email
console.error e
r = {}
r.email = email
r.error = e.message
result.push(r)
console.timeEnd('import')
if result.length > 0
console.error result
Email = Package.email.Email
Email.send
to: 'PI:EMAIL:<EMAIL>END_PI'
from: Accounts.emailTemplates.from
subject: 'steedos import result'
text: JSON.stringify({'result': result})
), (err)->
console.error 'Failed to bind environment'
console.error err
)
res.end();
else
res.statusCode = 500;
res.end();
|
[
{
"context": "_pages = \"/\":\n key: \"/\"\n name: \"Hello World\"\n link: \"http://facebook.github.io/react\"\n logo",
"end": 45,
"score": 0.9989219903945923,
"start": 34,
"tag": "NAME",
"value": "Hello World"
}
] | app/stores/PageStore.coffee | arthurpark/brunch-react-skeleton | 0 | _pages = "/":
key: "/"
name: "Hello World"
link: "http://facebook.github.io/react"
logo: "images/react.png"
PageStore =
getPageFromKey: (key) ->
return null unless _pages.hasOwnProperty(key)
_pages[key]
getAll: ->
_pages
module.exports = PageStore
| 43220 | _pages = "/":
key: "/"
name: "<NAME>"
link: "http://facebook.github.io/react"
logo: "images/react.png"
PageStore =
getPageFromKey: (key) ->
return null unless _pages.hasOwnProperty(key)
_pages[key]
getAll: ->
_pages
module.exports = PageStore
| true | _pages = "/":
key: "/"
name: "PI:NAME:<NAME>END_PI"
link: "http://facebook.github.io/react"
logo: "images/react.png"
PageStore =
getPageFromKey: (key) ->
return null unless _pages.hasOwnProperty(key)
_pages[key]
getAll: ->
_pages
module.exports = PageStore
|
[
{
"context": "ror} = require '../errors'\n\nJSONBlobStorageKey = 'task-queue'\n\nif not NylasEnv.isWorkWindow() and not NylasEnv",
"end": 422,
"score": 0.9878225922584534,
"start": 412,
"tag": "KEY",
"value": "task-queue"
}
] | app/src/flux/stores/task-queue.coffee | immershy/nodemail | 0 | _ = require 'underscore'
fs = require 'fs-plus'
path = require 'path'
{Listener, Publisher} = require '../modules/reflux-coffee'
CoffeeHelpers = require '../coffee-helpers'
Task = require "../tasks/task"
Utils = require "../models/utils"
Reflux = require 'reflux'
Actions = require '../actions'
DatabaseStore = require './database-store'
{APIError,
TimeoutError} = require '../errors'
JSONBlobStorageKey = 'task-queue'
if not NylasEnv.isWorkWindow() and not NylasEnv.inSpecMode()
module.exports = {JSONBlobStorageKey}
return
###
Public: The TaskQueue is a Flux-compatible Store that manages a queue of {Task}
objects. Each {Task} represents an individual API action, like sending a draft
or marking a thread as "read". Tasks optimistically make changes to the app's
local cache and encapsulate logic for performing changes on the server, rolling
back in case of failure, and waiting on dependent tasks.
The TaskQueue is essential to offline mode in N1. It automatically pauses
when the user's internet connection is unavailable and resumes when online.
The task queue is persisted to disk, ensuring that tasks are executed later,
even if the user quits N1.
The TaskQueue is only available in the app's main window. Rather than directly
queuing tasks, you should use the {Actions} to interact with the {TaskQueue}.
Tasks queued from secondary windows are serialized and sent to the application's
main window via IPC.
## Queueing a Task
```coffee
if @_thread && @_thread.unread
Actions.queueTask(new ChangeStarredTask(thread: @_thread, starred: true))
```
## Dequeueing a Task
```coffee
Actions.dequeueMatchingTask({
type: 'DestroyCategoryTask',
matching: {
categoryId: 'bla'
}
})
```
## Creating Tasks
Support for creating custom {Task} subclasses in third-party packages is coming soon.
This is currently blocked by the ActionBridge, which is responsible for sending actions
between windows, since it's JSON serializer is not extensible.
Section: Stores
###
class TaskQueue
@include: CoffeeHelpers.includeModule
@include Publisher
@include Listener
constructor: ->
@_queue = []
@_completed = []
@_updatePeriodicallyTimeout = null
@_currentSequentialId = Date.now()
@_restoreQueue()
@listenTo Actions.queueTask, @enqueue
@listenTo Actions.queueTasks, (tasks) =>
return unless tasks and tasks.length > 0
@enqueue(t) for t in tasks
@listenTo Actions.undoTaskId, @enqueueUndoOfTaskId
@listenTo Actions.dequeueTask, @dequeue
@listenTo Actions.dequeueAllTasks, @dequeueAll
@listenTo Actions.dequeueMatchingTask, @dequeueMatching
@listenTo Actions.clearDeveloperConsole, @clearCompleted
queue: =>
@_queue
###
Public: Returns an existing task in the queue that matches the type you provide,
and any other match properties. Useful for checking to see if something, like
a "SendDraft" task is in-flight.
- `type`: The string name of the task class, or the Task class itself. (ie:
{SaveDraftTask} or 'SaveDraftTask')
- `matching`: Optional An {Object} with criteria to pass to _.isMatch. For a
SaveDraftTask, this could be {draftClientId: "123123"}
Returns a matching {Task}, or null.
###
findTask: (type, matching = {}) ->
type = type.name unless _.isString(type)
match = _.find @_queue, (task) -> task.constructor.name is type and _.isMatch(task, matching)
match ? null
enqueue: (task) =>
if not (task instanceof Task)
throw new Error("You must queue a `Task` instance")
if not task.id
throw new Error("Tasks must have an ID prior to being queued. Check that your Task constructor is calling `super`")
if not task.queueState
throw new Error("Tasks must have a queueState prior to being queued. Check that your Task constructor is calling `super`")
task.sequentialId = ++@_currentSequentialId
@_dequeueObsoleteTasks(task)
task.runLocal().then =>
@_queue.push(task)
@_updateSoon()
enqueueUndoOfTaskId: (taskId) =>
task = _.findWhere(@_queue, {id: taskId})
task ?= _.findWhere(@_completed, {id: taskId})
if task
@enqueue(task.createUndoTask())
dequeue: (taskOrId) =>
task = @_resolveTaskArgument(taskOrId)
if not task
throw new Error("Couldn't find task in queue to dequeue")
if task.queueState.isProcessing
# We cannot remove a task from the queue while it's running and pretend
# things have stopped. Ask the task to cancel. It's promise will resolve
# or reject, and then we'll end up back here.
task.cancel()
else
@_queue.splice(@_queue.indexOf(task), 1)
@_completed.push(task)
@_completed.shift() if @_completed.length > 1000
@_updateSoon()
dequeueTaskAndDependents: (taskOrId) ->
task = @_resolveTaskArgument(taskOrId)
if not task
throw new Error("Couldn't find task in queue to dequeue")
dequeueAll: =>
for task in @_queue by -1
@dequeue(task)
dequeueMatching: ({type, matching}) =>
task = @findTask(type, matching)
if not task
console.warn("Could not find matching task: #{type}", matching)
return
@dequeue(task)
clearCompleted: =>
@_completed = []
@trigger()
# Helper Methods
_processQueue: =>
started = 0
if @_processQueueTimeout
clearTimeout(@_processQueueTimeout)
@_processQueueTimeout = null
now = Date.now()
reprocessIn = Number.MAX_VALUE
for task in @_queue by -1
if @_taskIsBlocked(task)
task.queueState.debugStatus = Task.DebugStatus.WaitingOnDependency
continue
if task.queueState.retryAfter and task.queueState.retryAfter > now
reprocessIn = Math.min(task.queueState.retryAfter - now, reprocessIn)
task.queueState.debugStatus = Task.DebugStatus.WaitingToRetry
continue
@_processTask(task)
started += 1
if started > 0
@trigger()
if reprocessIn isnt Number.MAX_VALUE
@_processQueueTimeout = setTimeout(@_processQueue, reprocessIn + 500)
_processTask: (task) =>
return if task.queueState.isProcessing
task.queueState.isProcessing = true
task.runRemote()
.finally =>
task.queueState.isProcessing = false
@trigger()
.then (status) =>
if status is Task.Status.Retry
task.queueState.retryDelay = Math.round(Math.min((task.queueState.retryDelay ? 1000) * 1.2, 30000))
task.queueState.retryAfter = Date.now() + task.queueState.retryDelay
else
@dequeue(task)
@_updateSoon()
.catch (err) =>
@_seenDownstream = {}
@_notifyOfDependentError(task, err)
.then (responses) =>
@_dequeueDownstreamTasks(responses)
@dequeue(task)
# When we `_notifyOfDependentError`s, we collect a nested array of
# responses of the tasks we notified. We need to responses to determine
# whether or not we should dequeue that task.
_dequeueDownstreamTasks: (responses=[]) ->
# Responses are nested arrays due to the recursion
responses = _.flatten(responses)
# A response may be `null` if it hit our infinite recursion check.
responses = _.filter responses, (r) -> r?
responses.forEach (resp) =>
resp.downstreamTask.queueState.status = Task.Status.Continue
resp.downstreamTask.queueState.debugStatus = Task.DebugStatus.DequeuedDependency
@dequeue(resp.downstreamTask)
# Recursively notifies tasks of dependent errors
_notifyOfDependentError: (failedTask, err) ->
downstream = @_tasksDependingOn(failedTask) ? []
Promise.map downstream, (downstreamTask) =>
return Promise.resolve(null) unless downstreamTask
# Infinte recursion check!
# These will get removed later
return Promise.resolve(null) if @_seenDownstream[downstreamTask.id]
@_seenDownstream[downstreamTask.id] = true
responseHash = Promise.props
returnValue: downstreamTask.onDependentTaskError(failedTask, err)
downstreamTask: downstreamTask
return Promise.all([
responseHash
@_notifyOfDependentError(downstreamTask, err)
])
_dequeueObsoleteTasks: (task) =>
obsolete = _.filter @_queue, (otherTask) =>
# Do not interrupt tasks which are currently processing
return false if otherTask.queueState.isProcessing
# Do not remove ourselves from the queue
return false if otherTask is task
# Dequeue tasks which our new task indicates it makes obsolete
return task.shouldDequeueOtherTask(otherTask)
for otherTask in obsolete
otherTask.queueState.status = Task.Status.Continue
otherTask.queueState.debugStatus = Task.DebugStatus.DequeuedObsolete
@dequeue(otherTask)
_tasksDependingOn: (task) ->
_.filter @_queue, (otherTask) ->
otherTask.isDependentOnTask(task) and task isnt otherTask
_taskIsBlocked: (task) =>
_.any @_queue, (otherTask) ->
task.isDependentOnTask(otherTask) and task isnt otherTask
_resolveTaskArgument: (taskOrId) =>
if not taskOrId
return null
else if taskOrId instanceof Task
return _.find @_queue, (task) -> task is taskOrId
else
return _.findWhere(@_queue, id: taskOrId)
_restoreQueue: =>
DatabaseStore.findJSONBlob(JSONBlobStorageKey).then (queue = []) =>
# We need to set the processing bit back to false so it gets
# re-retried upon inflation
for task in queue
task.queueState ?= {}
task.queueState.isProcessing = false
delete task.queueState['retryAfter']
delete task.queueState['retryDelay']
@_queue = queue
@_updateSoon()
_updateSoon: =>
@_updateSoonThrottled ?= _.throttle =>
DatabaseStore.inTransaction (t) =>
t.persistJSONBlob(JSONBlobStorageKey, @_queue ? [])
_.defer =>
@_processQueue()
@_ensurePeriodicUpdates()
, 10
@_updateSoonThrottled()
_ensurePeriodicUpdates: =>
anyIsProcessing = _.any @_queue, (task) -> task.queueState.isProcessing
# The task queue triggers periodically as tasks are processed, even if no
# major events have occurred. This allows tasks which have state, like
# SendDraftTask.progress to be propogated through the app and inspected.
if anyIsProcessing and not @_updatePeriodicallyTimeout
@_updatePeriodicallyTimeout = setInterval =>
@_updateSoon()
, 1000
else if not anyIsProcessing and @_updatePeriodicallyTimeout
clearTimeout(@_updatePeriodicallyTimeout)
@_updatePeriodicallyTimeout = null
module.exports = new TaskQueue()
module.exports.JSONBlobStorageKey = JSONBlobStorageKey
| 98164 | _ = require 'underscore'
fs = require 'fs-plus'
path = require 'path'
{Listener, Publisher} = require '../modules/reflux-coffee'
CoffeeHelpers = require '../coffee-helpers'
Task = require "../tasks/task"
Utils = require "../models/utils"
Reflux = require 'reflux'
Actions = require '../actions'
DatabaseStore = require './database-store'
{APIError,
TimeoutError} = require '../errors'
JSONBlobStorageKey = '<KEY>'
if not NylasEnv.isWorkWindow() and not NylasEnv.inSpecMode()
module.exports = {JSONBlobStorageKey}
return
###
Public: The TaskQueue is a Flux-compatible Store that manages a queue of {Task}
objects. Each {Task} represents an individual API action, like sending a draft
or marking a thread as "read". Tasks optimistically make changes to the app's
local cache and encapsulate logic for performing changes on the server, rolling
back in case of failure, and waiting on dependent tasks.
The TaskQueue is essential to offline mode in N1. It automatically pauses
when the user's internet connection is unavailable and resumes when online.
The task queue is persisted to disk, ensuring that tasks are executed later,
even if the user quits N1.
The TaskQueue is only available in the app's main window. Rather than directly
queuing tasks, you should use the {Actions} to interact with the {TaskQueue}.
Tasks queued from secondary windows are serialized and sent to the application's
main window via IPC.
## Queueing a Task
```coffee
if @_thread && @_thread.unread
Actions.queueTask(new ChangeStarredTask(thread: @_thread, starred: true))
```
## Dequeueing a Task
```coffee
Actions.dequeueMatchingTask({
type: 'DestroyCategoryTask',
matching: {
categoryId: 'bla'
}
})
```
## Creating Tasks
Support for creating custom {Task} subclasses in third-party packages is coming soon.
This is currently blocked by the ActionBridge, which is responsible for sending actions
between windows, since it's JSON serializer is not extensible.
Section: Stores
###
class TaskQueue
@include: CoffeeHelpers.includeModule
@include Publisher
@include Listener
constructor: ->
@_queue = []
@_completed = []
@_updatePeriodicallyTimeout = null
@_currentSequentialId = Date.now()
@_restoreQueue()
@listenTo Actions.queueTask, @enqueue
@listenTo Actions.queueTasks, (tasks) =>
return unless tasks and tasks.length > 0
@enqueue(t) for t in tasks
@listenTo Actions.undoTaskId, @enqueueUndoOfTaskId
@listenTo Actions.dequeueTask, @dequeue
@listenTo Actions.dequeueAllTasks, @dequeueAll
@listenTo Actions.dequeueMatchingTask, @dequeueMatching
@listenTo Actions.clearDeveloperConsole, @clearCompleted
queue: =>
@_queue
###
Public: Returns an existing task in the queue that matches the type you provide,
and any other match properties. Useful for checking to see if something, like
a "SendDraft" task is in-flight.
- `type`: The string name of the task class, or the Task class itself. (ie:
{SaveDraftTask} or 'SaveDraftTask')
- `matching`: Optional An {Object} with criteria to pass to _.isMatch. For a
SaveDraftTask, this could be {draftClientId: "123123"}
Returns a matching {Task}, or null.
###
findTask: (type, matching = {}) ->
type = type.name unless _.isString(type)
match = _.find @_queue, (task) -> task.constructor.name is type and _.isMatch(task, matching)
match ? null
enqueue: (task) =>
if not (task instanceof Task)
throw new Error("You must queue a `Task` instance")
if not task.id
throw new Error("Tasks must have an ID prior to being queued. Check that your Task constructor is calling `super`")
if not task.queueState
throw new Error("Tasks must have a queueState prior to being queued. Check that your Task constructor is calling `super`")
task.sequentialId = ++@_currentSequentialId
@_dequeueObsoleteTasks(task)
task.runLocal().then =>
@_queue.push(task)
@_updateSoon()
enqueueUndoOfTaskId: (taskId) =>
task = _.findWhere(@_queue, {id: taskId})
task ?= _.findWhere(@_completed, {id: taskId})
if task
@enqueue(task.createUndoTask())
dequeue: (taskOrId) =>
task = @_resolveTaskArgument(taskOrId)
if not task
throw new Error("Couldn't find task in queue to dequeue")
if task.queueState.isProcessing
# We cannot remove a task from the queue while it's running and pretend
# things have stopped. Ask the task to cancel. It's promise will resolve
# or reject, and then we'll end up back here.
task.cancel()
else
@_queue.splice(@_queue.indexOf(task), 1)
@_completed.push(task)
@_completed.shift() if @_completed.length > 1000
@_updateSoon()
dequeueTaskAndDependents: (taskOrId) ->
task = @_resolveTaskArgument(taskOrId)
if not task
throw new Error("Couldn't find task in queue to dequeue")
dequeueAll: =>
for task in @_queue by -1
@dequeue(task)
dequeueMatching: ({type, matching}) =>
task = @findTask(type, matching)
if not task
console.warn("Could not find matching task: #{type}", matching)
return
@dequeue(task)
clearCompleted: =>
@_completed = []
@trigger()
# Helper Methods
_processQueue: =>
started = 0
if @_processQueueTimeout
clearTimeout(@_processQueueTimeout)
@_processQueueTimeout = null
now = Date.now()
reprocessIn = Number.MAX_VALUE
for task in @_queue by -1
if @_taskIsBlocked(task)
task.queueState.debugStatus = Task.DebugStatus.WaitingOnDependency
continue
if task.queueState.retryAfter and task.queueState.retryAfter > now
reprocessIn = Math.min(task.queueState.retryAfter - now, reprocessIn)
task.queueState.debugStatus = Task.DebugStatus.WaitingToRetry
continue
@_processTask(task)
started += 1
if started > 0
@trigger()
if reprocessIn isnt Number.MAX_VALUE
@_processQueueTimeout = setTimeout(@_processQueue, reprocessIn + 500)
_processTask: (task) =>
return if task.queueState.isProcessing
task.queueState.isProcessing = true
task.runRemote()
.finally =>
task.queueState.isProcessing = false
@trigger()
.then (status) =>
if status is Task.Status.Retry
task.queueState.retryDelay = Math.round(Math.min((task.queueState.retryDelay ? 1000) * 1.2, 30000))
task.queueState.retryAfter = Date.now() + task.queueState.retryDelay
else
@dequeue(task)
@_updateSoon()
.catch (err) =>
@_seenDownstream = {}
@_notifyOfDependentError(task, err)
.then (responses) =>
@_dequeueDownstreamTasks(responses)
@dequeue(task)
# When we `_notifyOfDependentError`s, we collect a nested array of
# responses of the tasks we notified. We need to responses to determine
# whether or not we should dequeue that task.
_dequeueDownstreamTasks: (responses=[]) ->
# Responses are nested arrays due to the recursion
responses = _.flatten(responses)
# A response may be `null` if it hit our infinite recursion check.
responses = _.filter responses, (r) -> r?
responses.forEach (resp) =>
resp.downstreamTask.queueState.status = Task.Status.Continue
resp.downstreamTask.queueState.debugStatus = Task.DebugStatus.DequeuedDependency
@dequeue(resp.downstreamTask)
# Recursively notifies tasks of dependent errors
_notifyOfDependentError: (failedTask, err) ->
downstream = @_tasksDependingOn(failedTask) ? []
Promise.map downstream, (downstreamTask) =>
return Promise.resolve(null) unless downstreamTask
# Infinte recursion check!
# These will get removed later
return Promise.resolve(null) if @_seenDownstream[downstreamTask.id]
@_seenDownstream[downstreamTask.id] = true
responseHash = Promise.props
returnValue: downstreamTask.onDependentTaskError(failedTask, err)
downstreamTask: downstreamTask
return Promise.all([
responseHash
@_notifyOfDependentError(downstreamTask, err)
])
_dequeueObsoleteTasks: (task) =>
obsolete = _.filter @_queue, (otherTask) =>
# Do not interrupt tasks which are currently processing
return false if otherTask.queueState.isProcessing
# Do not remove ourselves from the queue
return false if otherTask is task
# Dequeue tasks which our new task indicates it makes obsolete
return task.shouldDequeueOtherTask(otherTask)
for otherTask in obsolete
otherTask.queueState.status = Task.Status.Continue
otherTask.queueState.debugStatus = Task.DebugStatus.DequeuedObsolete
@dequeue(otherTask)
_tasksDependingOn: (task) ->
_.filter @_queue, (otherTask) ->
otherTask.isDependentOnTask(task) and task isnt otherTask
_taskIsBlocked: (task) =>
_.any @_queue, (otherTask) ->
task.isDependentOnTask(otherTask) and task isnt otherTask
_resolveTaskArgument: (taskOrId) =>
if not taskOrId
return null
else if taskOrId instanceof Task
return _.find @_queue, (task) -> task is taskOrId
else
return _.findWhere(@_queue, id: taskOrId)
_restoreQueue: =>
DatabaseStore.findJSONBlob(JSONBlobStorageKey).then (queue = []) =>
# We need to set the processing bit back to false so it gets
# re-retried upon inflation
for task in queue
task.queueState ?= {}
task.queueState.isProcessing = false
delete task.queueState['retryAfter']
delete task.queueState['retryDelay']
@_queue = queue
@_updateSoon()
_updateSoon: =>
@_updateSoonThrottled ?= _.throttle =>
DatabaseStore.inTransaction (t) =>
t.persistJSONBlob(JSONBlobStorageKey, @_queue ? [])
_.defer =>
@_processQueue()
@_ensurePeriodicUpdates()
, 10
@_updateSoonThrottled()
_ensurePeriodicUpdates: =>
anyIsProcessing = _.any @_queue, (task) -> task.queueState.isProcessing
# The task queue triggers periodically as tasks are processed, even if no
# major events have occurred. This allows tasks which have state, like
# SendDraftTask.progress to be propogated through the app and inspected.
if anyIsProcessing and not @_updatePeriodicallyTimeout
@_updatePeriodicallyTimeout = setInterval =>
@_updateSoon()
, 1000
else if not anyIsProcessing and @_updatePeriodicallyTimeout
clearTimeout(@_updatePeriodicallyTimeout)
@_updatePeriodicallyTimeout = null
module.exports = new TaskQueue()
module.exports.JSONBlobStorageKey = JSONBlobStorageKey
| true | _ = require 'underscore'
fs = require 'fs-plus'
path = require 'path'
{Listener, Publisher} = require '../modules/reflux-coffee'
CoffeeHelpers = require '../coffee-helpers'
Task = require "../tasks/task"
Utils = require "../models/utils"
Reflux = require 'reflux'
Actions = require '../actions'
DatabaseStore = require './database-store'
{APIError,
TimeoutError} = require '../errors'
JSONBlobStorageKey = 'PI:KEY:<KEY>END_PI'
if not NylasEnv.isWorkWindow() and not NylasEnv.inSpecMode()
module.exports = {JSONBlobStorageKey}
return
###
Public: The TaskQueue is a Flux-compatible Store that manages a queue of {Task}
objects. Each {Task} represents an individual API action, like sending a draft
or marking a thread as "read". Tasks optimistically make changes to the app's
local cache and encapsulate logic for performing changes on the server, rolling
back in case of failure, and waiting on dependent tasks.
The TaskQueue is essential to offline mode in N1. It automatically pauses
when the user's internet connection is unavailable and resumes when online.
The task queue is persisted to disk, ensuring that tasks are executed later,
even if the user quits N1.
The TaskQueue is only available in the app's main window. Rather than directly
queuing tasks, you should use the {Actions} to interact with the {TaskQueue}.
Tasks queued from secondary windows are serialized and sent to the application's
main window via IPC.
## Queueing a Task
```coffee
if @_thread && @_thread.unread
Actions.queueTask(new ChangeStarredTask(thread: @_thread, starred: true))
```
## Dequeueing a Task
```coffee
Actions.dequeueMatchingTask({
type: 'DestroyCategoryTask',
matching: {
categoryId: 'bla'
}
})
```
## Creating Tasks
Support for creating custom {Task} subclasses in third-party packages is coming soon.
This is currently blocked by the ActionBridge, which is responsible for sending actions
between windows, since it's JSON serializer is not extensible.
Section: Stores
###
class TaskQueue
@include: CoffeeHelpers.includeModule
@include Publisher
@include Listener
constructor: ->
@_queue = []
@_completed = []
@_updatePeriodicallyTimeout = null
@_currentSequentialId = Date.now()
@_restoreQueue()
@listenTo Actions.queueTask, @enqueue
@listenTo Actions.queueTasks, (tasks) =>
return unless tasks and tasks.length > 0
@enqueue(t) for t in tasks
@listenTo Actions.undoTaskId, @enqueueUndoOfTaskId
@listenTo Actions.dequeueTask, @dequeue
@listenTo Actions.dequeueAllTasks, @dequeueAll
@listenTo Actions.dequeueMatchingTask, @dequeueMatching
@listenTo Actions.clearDeveloperConsole, @clearCompleted
queue: =>
@_queue
###
Public: Returns an existing task in the queue that matches the type you provide,
and any other match properties. Useful for checking to see if something, like
a "SendDraft" task is in-flight.
- `type`: The string name of the task class, or the Task class itself. (ie:
{SaveDraftTask} or 'SaveDraftTask')
- `matching`: Optional An {Object} with criteria to pass to _.isMatch. For a
SaveDraftTask, this could be {draftClientId: "123123"}
Returns a matching {Task}, or null.
###
findTask: (type, matching = {}) ->
type = type.name unless _.isString(type)
match = _.find @_queue, (task) -> task.constructor.name is type and _.isMatch(task, matching)
match ? null
enqueue: (task) =>
if not (task instanceof Task)
throw new Error("You must queue a `Task` instance")
if not task.id
throw new Error("Tasks must have an ID prior to being queued. Check that your Task constructor is calling `super`")
if not task.queueState
throw new Error("Tasks must have a queueState prior to being queued. Check that your Task constructor is calling `super`")
task.sequentialId = ++@_currentSequentialId
@_dequeueObsoleteTasks(task)
task.runLocal().then =>
@_queue.push(task)
@_updateSoon()
enqueueUndoOfTaskId: (taskId) =>
task = _.findWhere(@_queue, {id: taskId})
task ?= _.findWhere(@_completed, {id: taskId})
if task
@enqueue(task.createUndoTask())
dequeue: (taskOrId) =>
task = @_resolveTaskArgument(taskOrId)
if not task
throw new Error("Couldn't find task in queue to dequeue")
if task.queueState.isProcessing
# We cannot remove a task from the queue while it's running and pretend
# things have stopped. Ask the task to cancel. It's promise will resolve
# or reject, and then we'll end up back here.
task.cancel()
else
@_queue.splice(@_queue.indexOf(task), 1)
@_completed.push(task)
@_completed.shift() if @_completed.length > 1000
@_updateSoon()
dequeueTaskAndDependents: (taskOrId) ->
task = @_resolveTaskArgument(taskOrId)
if not task
throw new Error("Couldn't find task in queue to dequeue")
dequeueAll: =>
for task in @_queue by -1
@dequeue(task)
dequeueMatching: ({type, matching}) =>
task = @findTask(type, matching)
if not task
console.warn("Could not find matching task: #{type}", matching)
return
@dequeue(task)
clearCompleted: =>
@_completed = []
@trigger()
# Helper Methods
_processQueue: =>
started = 0
if @_processQueueTimeout
clearTimeout(@_processQueueTimeout)
@_processQueueTimeout = null
now = Date.now()
reprocessIn = Number.MAX_VALUE
for task in @_queue by -1
if @_taskIsBlocked(task)
task.queueState.debugStatus = Task.DebugStatus.WaitingOnDependency
continue
if task.queueState.retryAfter and task.queueState.retryAfter > now
reprocessIn = Math.min(task.queueState.retryAfter - now, reprocessIn)
task.queueState.debugStatus = Task.DebugStatus.WaitingToRetry
continue
@_processTask(task)
started += 1
if started > 0
@trigger()
if reprocessIn isnt Number.MAX_VALUE
@_processQueueTimeout = setTimeout(@_processQueue, reprocessIn + 500)
_processTask: (task) =>
return if task.queueState.isProcessing
task.queueState.isProcessing = true
task.runRemote()
.finally =>
task.queueState.isProcessing = false
@trigger()
.then (status) =>
if status is Task.Status.Retry
task.queueState.retryDelay = Math.round(Math.min((task.queueState.retryDelay ? 1000) * 1.2, 30000))
task.queueState.retryAfter = Date.now() + task.queueState.retryDelay
else
@dequeue(task)
@_updateSoon()
.catch (err) =>
@_seenDownstream = {}
@_notifyOfDependentError(task, err)
.then (responses) =>
@_dequeueDownstreamTasks(responses)
@dequeue(task)
# When we `_notifyOfDependentError`s, we collect a nested array of
# responses of the tasks we notified. We need to responses to determine
# whether or not we should dequeue that task.
_dequeueDownstreamTasks: (responses=[]) ->
# Responses are nested arrays due to the recursion
responses = _.flatten(responses)
# A response may be `null` if it hit our infinite recursion check.
responses = _.filter responses, (r) -> r?
responses.forEach (resp) =>
resp.downstreamTask.queueState.status = Task.Status.Continue
resp.downstreamTask.queueState.debugStatus = Task.DebugStatus.DequeuedDependency
@dequeue(resp.downstreamTask)
# Recursively notifies tasks of dependent errors
_notifyOfDependentError: (failedTask, err) ->
downstream = @_tasksDependingOn(failedTask) ? []
Promise.map downstream, (downstreamTask) =>
return Promise.resolve(null) unless downstreamTask
# Infinte recursion check!
# These will get removed later
return Promise.resolve(null) if @_seenDownstream[downstreamTask.id]
@_seenDownstream[downstreamTask.id] = true
responseHash = Promise.props
returnValue: downstreamTask.onDependentTaskError(failedTask, err)
downstreamTask: downstreamTask
return Promise.all([
responseHash
@_notifyOfDependentError(downstreamTask, err)
])
_dequeueObsoleteTasks: (task) =>
obsolete = _.filter @_queue, (otherTask) =>
# Do not interrupt tasks which are currently processing
return false if otherTask.queueState.isProcessing
# Do not remove ourselves from the queue
return false if otherTask is task
# Dequeue tasks which our new task indicates it makes obsolete
return task.shouldDequeueOtherTask(otherTask)
for otherTask in obsolete
otherTask.queueState.status = Task.Status.Continue
otherTask.queueState.debugStatus = Task.DebugStatus.DequeuedObsolete
@dequeue(otherTask)
_tasksDependingOn: (task) ->
_.filter @_queue, (otherTask) ->
otherTask.isDependentOnTask(task) and task isnt otherTask
_taskIsBlocked: (task) =>
_.any @_queue, (otherTask) ->
task.isDependentOnTask(otherTask) and task isnt otherTask
_resolveTaskArgument: (taskOrId) =>
if not taskOrId
return null
else if taskOrId instanceof Task
return _.find @_queue, (task) -> task is taskOrId
else
return _.findWhere(@_queue, id: taskOrId)
_restoreQueue: =>
DatabaseStore.findJSONBlob(JSONBlobStorageKey).then (queue = []) =>
# We need to set the processing bit back to false so it gets
# re-retried upon inflation
for task in queue
task.queueState ?= {}
task.queueState.isProcessing = false
delete task.queueState['retryAfter']
delete task.queueState['retryDelay']
@_queue = queue
@_updateSoon()
_updateSoon: =>
@_updateSoonThrottled ?= _.throttle =>
DatabaseStore.inTransaction (t) =>
t.persistJSONBlob(JSONBlobStorageKey, @_queue ? [])
_.defer =>
@_processQueue()
@_ensurePeriodicUpdates()
, 10
@_updateSoonThrottled()
_ensurePeriodicUpdates: =>
anyIsProcessing = _.any @_queue, (task) -> task.queueState.isProcessing
# The task queue triggers periodically as tasks are processed, even if no
# major events have occurred. This allows tasks which have state, like
# SendDraftTask.progress to be propogated through the app and inspected.
if anyIsProcessing and not @_updatePeriodicallyTimeout
@_updatePeriodicallyTimeout = setInterval =>
@_updateSoon()
, 1000
else if not anyIsProcessing and @_updatePeriodicallyTimeout
clearTimeout(@_updatePeriodicallyTimeout)
@_updatePeriodicallyTimeout = null
module.exports = new TaskQueue()
module.exports.JSONBlobStorageKey = JSONBlobStorageKey
|
[
{
"context": "text onto HTML canvas elements\n\nWritten in 2013 by Karl Naylor <kpn103@yahoo.com>\n\nTo the extent possible under ",
"end": 106,
"score": 0.9998903274536133,
"start": 95,
"tag": "NAME",
"value": "Karl Naylor"
},
{
"context": " canvas elements\n\nWritten in 2013 by Karl Naylor <kpn103@yahoo.com>\n\nTo the extent possible under law, the author(s)",
"end": 124,
"score": 0.9999279379844666,
"start": 108,
"tag": "EMAIL",
"value": "kpn103@yahoo.com"
}
] | src/content/coffee/handywriteOnCanvas/boxes.coffee | karlorg/phonetify | 1 | ###
handywriteOnCanvas - renders handywrite text onto HTML canvas elements
Written in 2013 by Karl Naylor <kpn103@yahoo.com>
To the extent possible under law, the author(s) have dedicated all
copyright and related and neighboring rights to this software to the
public domain worldwide. This software is distributed without any
warranty.
You should have received a copy of the CC0 Public Domain Dedication
along with this software. If not, see
<http://creativecommons.org/publicdomain/zero/1.0/>.
###
define ->
'use strict'
boxes = {}
boxes.BoundingBox = class BoundingBox
constructor: (@_left, @_top, @_right, @_bottom, @_transformed=false) ->
# @transformed should be false if this bounding box is in the default
# grapheme co-ordinate system, true otherwise
left: -> @_left
top: -> @_top
right: -> @_right
bottom: -> @_bottom
scale: (sx, sy) -> new BoundingBox(
@_left * sx, @_top * sy,
@_right * sx, @_bottom * sy,
true)
translate: (dx, dy) -> new BoundingBox(
@_left + dx, @_top + dy,
@_right + dx, @_bottom + dy,
true)
boxes.boxFromPoints = (pointList) ->
unless pointList.length then return new BoundingBox(0, 0, 0, 0)
left = Math.min((point.x for point in pointList)...)
top = Math.min((point.y for point in pointList)...)
right = Math.max((point.x for point in pointList)...)
bottom = Math.max((point.y for point in pointList)...)
return new BoundingBox(left, top, right, bottom)
boxes.combineBoundingBoxes = (boxList) ->
unless boxList.length then return new BoundingBox(0, 0, 0, 0)
left = Math.min((box.left() for box in boxList)...)
top = Math.min((box.top() for box in boxList)...)
right = Math.max((box.right() for box in boxList)...)
bottom = Math.max((box.bottom() for box in boxList)...)
return new BoundingBox(left, top, right, bottom, boxList[0]._transformed)
return boxes
| 175141 | ###
handywriteOnCanvas - renders handywrite text onto HTML canvas elements
Written in 2013 by <NAME> <<EMAIL>>
To the extent possible under law, the author(s) have dedicated all
copyright and related and neighboring rights to this software to the
public domain worldwide. This software is distributed without any
warranty.
You should have received a copy of the CC0 Public Domain Dedication
along with this software. If not, see
<http://creativecommons.org/publicdomain/zero/1.0/>.
###
define ->
'use strict'
boxes = {}
boxes.BoundingBox = class BoundingBox
constructor: (@_left, @_top, @_right, @_bottom, @_transformed=false) ->
# @transformed should be false if this bounding box is in the default
# grapheme co-ordinate system, true otherwise
left: -> @_left
top: -> @_top
right: -> @_right
bottom: -> @_bottom
scale: (sx, sy) -> new BoundingBox(
@_left * sx, @_top * sy,
@_right * sx, @_bottom * sy,
true)
translate: (dx, dy) -> new BoundingBox(
@_left + dx, @_top + dy,
@_right + dx, @_bottom + dy,
true)
boxes.boxFromPoints = (pointList) ->
unless pointList.length then return new BoundingBox(0, 0, 0, 0)
left = Math.min((point.x for point in pointList)...)
top = Math.min((point.y for point in pointList)...)
right = Math.max((point.x for point in pointList)...)
bottom = Math.max((point.y for point in pointList)...)
return new BoundingBox(left, top, right, bottom)
boxes.combineBoundingBoxes = (boxList) ->
unless boxList.length then return new BoundingBox(0, 0, 0, 0)
left = Math.min((box.left() for box in boxList)...)
top = Math.min((box.top() for box in boxList)...)
right = Math.max((box.right() for box in boxList)...)
bottom = Math.max((box.bottom() for box in boxList)...)
return new BoundingBox(left, top, right, bottom, boxList[0]._transformed)
return boxes
| true | ###
handywriteOnCanvas - renders handywrite text onto HTML canvas elements
Written in 2013 by PI:NAME:<NAME>END_PI <PI:EMAIL:<EMAIL>END_PI>
To the extent possible under law, the author(s) have dedicated all
copyright and related and neighboring rights to this software to the
public domain worldwide. This software is distributed without any
warranty.
You should have received a copy of the CC0 Public Domain Dedication
along with this software. If not, see
<http://creativecommons.org/publicdomain/zero/1.0/>.
###
define ->
'use strict'
boxes = {}
boxes.BoundingBox = class BoundingBox
constructor: (@_left, @_top, @_right, @_bottom, @_transformed=false) ->
# @transformed should be false if this bounding box is in the default
# grapheme co-ordinate system, true otherwise
left: -> @_left
top: -> @_top
right: -> @_right
bottom: -> @_bottom
scale: (sx, sy) -> new BoundingBox(
@_left * sx, @_top * sy,
@_right * sx, @_bottom * sy,
true)
translate: (dx, dy) -> new BoundingBox(
@_left + dx, @_top + dy,
@_right + dx, @_bottom + dy,
true)
boxes.boxFromPoints = (pointList) ->
unless pointList.length then return new BoundingBox(0, 0, 0, 0)
left = Math.min((point.x for point in pointList)...)
top = Math.min((point.y for point in pointList)...)
right = Math.max((point.x for point in pointList)...)
bottom = Math.max((point.y for point in pointList)...)
return new BoundingBox(left, top, right, bottom)
boxes.combineBoundingBoxes = (boxList) ->
unless boxList.length then return new BoundingBox(0, 0, 0, 0)
left = Math.min((box.left() for box in boxList)...)
top = Math.min((box.top() for box in boxList)...)
right = Math.max((box.right() for box in boxList)...)
bottom = Math.max((box.bottom() for box in boxList)...)
return new BoundingBox(left, top, right, bottom, boxList[0]._transformed)
return boxes
|
[
{
"context": "images/yokohama/neg-z.jpg'\n # ]);\n # runPrefix('storforsen');\n # runPrefix('Lycksele2');\n # runPrefix('Fja",
"end": 9792,
"score": 0.9937788844108582,
"start": 9782,
"tag": "USERNAME",
"value": "storforsen"
},
{
"context": "# ]);\n # runPrefix('storforsen');\n # runPrefix('Lycksele2');\n # runPrefix('Fjaderholmarna');\n # runPrefix",
"end": 9820,
"score": 0.9706819653511047,
"start": 9811,
"tag": "USERNAME",
"value": "Lycksele2"
},
{
"context": "sen');\n # runPrefix('Lycksele2');\n # runPrefix('Fjaderholmarna');\n # runPrefix(\"GoldenGateBridge\");",
"end": 9841,
"score": 0.5807069540023804,
"start": 9839,
"tag": "USERNAME",
"value": "Fj"
},
{
"context": "n');\n # runPrefix('Lycksele2');\n # runPrefix('Fjaderholmarna');\n # runPrefix(\"GoldenGateBridge\");\n\n ts = new",
"end": 9853,
"score": 0.9081048965454102,
"start": 9841,
"tag": "NAME",
"value": "aderholmarna"
}
] | oldsrc/threesixty.coffee | TeamTrumpet/trumpet-auditorium | 0 | class ThreeSixty
# The interval of movement for keyboard movements
interval: Math.PI / 200
# When the drift speed is smaller than this number, drifting stops
driftSpeedCutoff: 0.01
# The amount that is multipled by the speed every frame that there isn't any
# movement from the mouse
driftSlowdownRate: 0.90
# Vertial angle that is cut off from exceeding
verticalAngleCutOff: Math.PI / 4
# Constant
twoPI: (2 * Math.PI)
# The direction keys that are mapped
arrowDirections: [
'left'
'right'
'up'
'down'
'w'
'a'
's'
'd'
]
keyboardAliases:
'left': 37
'up': 38
'right': 39
'down': 40
constructor: (images)->
# This source is the javascript needed to build a sky box in **three.js**
# It is the source about this [blog post](/blog/2011/08/15/lets-do-a-sky/).
# Now lets start
# declare a bunch of variable we will need later
@camera = undefined
@scene = undefined
@renderer = undefined
@keyboard = undefined
@alpha = 0
@beta = 0
@gamma = 0
@keys =
pressed: {}
active: false
@events = 'mouse':
active: false
panning: false
position:
x: 0
y: 0
@run images
initEventHandlers: ->
# Create the keyboard monitor
document.addEventListener 'keydown', @onKeyDown, false
# Setup handlers for all the arrow direction id's if they exist
@arrowDirections.forEach (direction) =>
directionElement = document.getElementById(direction)
@events[direction] = false
if directionElement
directionElement.addEventListener 'mousedown', =>
@events[direction] = true
return
directionElement.addEventListener 'click', (e) ->
e.preventDefault()
return
directionElement.addEventListener 'mouseup', =>
@events[direction] = false
return
return
document.addEventListener 'mouseup', =>
@arrowDirections.forEach (direction) =>
@events[direction] = false
return
@events['mouse'].active = false
document.body.style.cursor = 'auto'
return
document.addEventListener 'mousemove', (event) =>
if @events['mouse'].active
@events['mouse'].position.x = event.movementX
@events['mouse'].position.y = event.movementY
return
@renderer.domElement.addEventListener 'mousedown', =>
@events['mouse'].active = true
@events['mouse'].panning = true
document.body.style.cursor = 'move'
return
# when the window is resized, we need to change our camera and renderer
window.addEventListener 'resize', @onWindowResize, false
degToRad = (degrees) ->
degrees * Math.PI / 180
deviceOrientationChanged = (event) ->
# Or rotation about Z
@alpha = degToRad(event.alpha)
# Or rotation about X
@beta = degToRad(event.beta) - (Math.PI / 2)
# Or rotation about Y
@gamma = degToRad(event.gamma)
# Set the data to json
document.getElementById('debug').innerHTML = JSON.stringify({
alpha: @alpha
beta: @beta
gamma: @gamma
}, null, 2)
return
# window.ondeviceorientation = _.throttle(deviceOrientationChanged, 300);
return
# Initialize everything
init: (images) ->
# Create the scene
@scene = new (THREE.Scene)
# Create the camera
@camera = new (THREE.PerspectiveCamera)(70, window.innerWidth / window.innerHeight, 1, 1000)
# Because we don't rotate in the Z direction, this will be a natural rotation order
@camera.rotation.order = 'YXZ'
# Load them
THREE.ImageUtils.loadTextureCube(images, null, @onTextureLoad)
onTextureLoad: (textureCube) =>
# init the cube shadder
shader = THREE.ShaderLib['cube']
# Setup the uniform
uniforms = THREE.UniformsUtils.clone(shader.uniforms)
uniforms['tCube'].value = textureCube
# camerate the material
material = new (THREE.ShaderMaterial)(
fragmentShader: shader.fragmentShader
vertexShader: shader.vertexShader
uniforms: uniforms
side: THREE.BackSide)
# Generate a sphere geometry
meshGeometry = new (THREE.SphereGeometry)(1000, 32, 32)
# build the skybox Mesh using the texture cube
skyBox = new (THREE.Mesh)(meshGeometry, material)
# and add it to the scene
@scene.add skyBox
# create the container element
@renderer = new (THREE.WebGLRenderer)(antialias: true)
# Set it to match the window
@renderer.setSize window.innerWidth, window.innerHeight
# Add it to the document body
document.body.appendChild @renderer.domElement
# Add event handlers
@initEventHandlers()
# make it move!
@render()
return
onKeyDown: (event) =>
# Get the key pressed
key = event.keyCode
console.log "onKeyDown: #{key}"
@keyPressed key
return
keyPressed: (key) =>
# Check if a keyboard key was pressed
if @camera.keys(ThreeSixty::keyboardAliases).indexOf(key) != -1
@keys.pressed[key] = true
@keys.active = true
@move ThreeSixty::keyboardAliases[key]
else
# Check to see if a keyboard direction was pressed
ThreeSixty::arrowDirections.some (direction) =>
# If it was pressed
if direction.toUpperCase().charCodeAt(0) == key
@keys.pressed[key] = true
@keys.active = true
# Move
@move direction
# And return true to kill the loop
return true
return
onWindowResize: ->
@camera.aspect = window.innerWidth / window.innerHeight
@camera.updateProjectionMatrix()
@renderer.setSize window.innerWidth, window.innerHeight
return
# Execute the move in the direction indicated
move: (action) ->
console.log "Moving #{action}"
@move@camera action, @camera
@render()
return
move@camera: (action, @camera) ->
@move@cameraAt action, @camera, ThreeSixty::interval
if action == 'up' or action == 'down' or action == 'w' or action == 's'
@correctMovement @camera
return
clearDebug: ->
document.getElementById('debug').innerHTML = null
return
addDebug: (obj) ->
document.getElementById('debug').appendChild(document.createTextNode(JSON.stringify(obj, null, 2)))
return
# Move the @camera in the direction indicated at the rate indicated as well
move@cameraAt: (action, @camera, rate) ->
switch action
when 'left', 'a'
@camera.rotation.y = (@camera.rotation.y + rate) % ThreeSixty::twoPI
when 'right', 'd'
@camera.rotation.y = (@camera.rotation.y - rate) % ThreeSixty::twoPI
when 'up', 'w'
@camera.rotation.x = (@camera.rotation.x + rate) % ThreeSixty::twoPI
when 'down', 's'
@camera.rotation.x = (@camera.rotation.x - rate) % ThreeSixty::twoPI
else
break
return
# Correct the over and under rotation to prevent us from going upside down
correctMovement: (@camera) ->
# If we are going up or down
if @camera.rotation.x < -ThreeSixty::verticalAngleCutOff
@camera.rotation.x = -ThreeSixty::verticalAngleCutOff
else if @camera.rotation.x > ThreeSixty::verticalAngleCutOff
@camera.rotation.x = ThreeSixty::verticalAngleCutOff
return
# Animate all the camera actions for the mouse
animateCameraFromMouse: ->
xMovement = @events['mouse'].position.y / 400
yMovement = @events['mouse'].position.x / 400
console.log "Mouse moving x: #{}"
@camera.rotation.x += xMovement
@camera.rotation.y += yMovement
@correctMovement @camera
# Stop drift
@events['mouse'].position.x *= @driftSlowdownRate
@events['mouse'].position.y *= @driftSlowdownRate
if !@events['mouse'].active and Math.abs(@events['mouse'].position.x) < @driftSpeedCutoff and Math.abs(@events['mouse'].position.y) < @driftSpeedCutoff
# Stop the movement
@events['mouse'].position.x = 0
@events['mouse'].position.y = 0
# Stop the panning
@events['mouse'].panning = false
return
# Render the scene (called every frame)
render: ->
# Request this to be re-run
if @events['mouse'].panning
requestAnimationFrame ThreeSixty::render.bind(this)
# If we are still panning
@animateCameraFromMouse()
# # If the mouse is not in use
# if !@events['mouse'].active
# # Then check buttons + keyboard
# @arrowDirections.forEach (direction) =>
# if @keyboard.pressed(direction) or @events[direction]
# @move direction
# return
# # Set the gyro
# camera.rotation.x = beta;
# camera.rotation.y = alpha;
# # Set the data to json
# document.getElementById('debug').innerHTML = JSON.stringify(@camera.rotation, null, 2)
# Actually render the scene
@renderer.render @scene, @camera
return
run: (images) ->
# bootstrap functions
# initialiaze everything
@init images
return
document.addEventListener 'DOMContentLoaded', ->
prefixData = (prefix) ->
[
'images/' + prefix + '/posx.jpg'
'images/' + prefix + '/negx.jpg'
'images/' + prefix + '/posy.jpg'
'images/' + prefix + '/negy.jpg'
'images/' + prefix + '/posz.jpg'
'images/' + prefix + '/negz.jpg'
]
# run([
# 'images/canary/pos-x.png',
# 'images/canary/neg-x.png',
# 'images/canary/pos-y.png',
# 'images/canary/neg-y.png',
# 'images/canary/pos-z.png',
# 'images/canary/neg-z.png'
# ]);
# run([
# 'images/yokohama/pos-x.jpg',
# 'images/yokohama/neg-x.jpg',
# 'images/yokohama/pos-y.jpg',
# 'images/yokohama/neg-y.jpg',
# 'images/yokohama/pos-z.jpg',
# 'images/yokohama/neg-z.jpg'
# ]);
# runPrefix('storforsen');
# runPrefix('Lycksele2');
# runPrefix('Fjaderholmarna');
# runPrefix("GoldenGateBridge");
ts = new ThreeSixty prefixData('storforsen')
return
| 58273 | class ThreeSixty
# The interval of movement for keyboard movements
interval: Math.PI / 200
# When the drift speed is smaller than this number, drifting stops
driftSpeedCutoff: 0.01
# The amount that is multipled by the speed every frame that there isn't any
# movement from the mouse
driftSlowdownRate: 0.90
# Vertial angle that is cut off from exceeding
verticalAngleCutOff: Math.PI / 4
# Constant
twoPI: (2 * Math.PI)
# The direction keys that are mapped
arrowDirections: [
'left'
'right'
'up'
'down'
'w'
'a'
's'
'd'
]
keyboardAliases:
'left': 37
'up': 38
'right': 39
'down': 40
constructor: (images)->
# This source is the javascript needed to build a sky box in **three.js**
# It is the source about this [blog post](/blog/2011/08/15/lets-do-a-sky/).
# Now lets start
# declare a bunch of variable we will need later
@camera = undefined
@scene = undefined
@renderer = undefined
@keyboard = undefined
@alpha = 0
@beta = 0
@gamma = 0
@keys =
pressed: {}
active: false
@events = 'mouse':
active: false
panning: false
position:
x: 0
y: 0
@run images
initEventHandlers: ->
# Create the keyboard monitor
document.addEventListener 'keydown', @onKeyDown, false
# Setup handlers for all the arrow direction id's if they exist
@arrowDirections.forEach (direction) =>
directionElement = document.getElementById(direction)
@events[direction] = false
if directionElement
directionElement.addEventListener 'mousedown', =>
@events[direction] = true
return
directionElement.addEventListener 'click', (e) ->
e.preventDefault()
return
directionElement.addEventListener 'mouseup', =>
@events[direction] = false
return
return
document.addEventListener 'mouseup', =>
@arrowDirections.forEach (direction) =>
@events[direction] = false
return
@events['mouse'].active = false
document.body.style.cursor = 'auto'
return
document.addEventListener 'mousemove', (event) =>
if @events['mouse'].active
@events['mouse'].position.x = event.movementX
@events['mouse'].position.y = event.movementY
return
@renderer.domElement.addEventListener 'mousedown', =>
@events['mouse'].active = true
@events['mouse'].panning = true
document.body.style.cursor = 'move'
return
# when the window is resized, we need to change our camera and renderer
window.addEventListener 'resize', @onWindowResize, false
degToRad = (degrees) ->
degrees * Math.PI / 180
deviceOrientationChanged = (event) ->
# Or rotation about Z
@alpha = degToRad(event.alpha)
# Or rotation about X
@beta = degToRad(event.beta) - (Math.PI / 2)
# Or rotation about Y
@gamma = degToRad(event.gamma)
# Set the data to json
document.getElementById('debug').innerHTML = JSON.stringify({
alpha: @alpha
beta: @beta
gamma: @gamma
}, null, 2)
return
# window.ondeviceorientation = _.throttle(deviceOrientationChanged, 300);
return
# Initialize everything
init: (images) ->
# Create the scene
@scene = new (THREE.Scene)
# Create the camera
@camera = new (THREE.PerspectiveCamera)(70, window.innerWidth / window.innerHeight, 1, 1000)
# Because we don't rotate in the Z direction, this will be a natural rotation order
@camera.rotation.order = 'YXZ'
# Load them
THREE.ImageUtils.loadTextureCube(images, null, @onTextureLoad)
onTextureLoad: (textureCube) =>
# init the cube shadder
shader = THREE.ShaderLib['cube']
# Setup the uniform
uniforms = THREE.UniformsUtils.clone(shader.uniforms)
uniforms['tCube'].value = textureCube
# camerate the material
material = new (THREE.ShaderMaterial)(
fragmentShader: shader.fragmentShader
vertexShader: shader.vertexShader
uniforms: uniforms
side: THREE.BackSide)
# Generate a sphere geometry
meshGeometry = new (THREE.SphereGeometry)(1000, 32, 32)
# build the skybox Mesh using the texture cube
skyBox = new (THREE.Mesh)(meshGeometry, material)
# and add it to the scene
@scene.add skyBox
# create the container element
@renderer = new (THREE.WebGLRenderer)(antialias: true)
# Set it to match the window
@renderer.setSize window.innerWidth, window.innerHeight
# Add it to the document body
document.body.appendChild @renderer.domElement
# Add event handlers
@initEventHandlers()
# make it move!
@render()
return
onKeyDown: (event) =>
# Get the key pressed
key = event.keyCode
console.log "onKeyDown: #{key}"
@keyPressed key
return
keyPressed: (key) =>
# Check if a keyboard key was pressed
if @camera.keys(ThreeSixty::keyboardAliases).indexOf(key) != -1
@keys.pressed[key] = true
@keys.active = true
@move ThreeSixty::keyboardAliases[key]
else
# Check to see if a keyboard direction was pressed
ThreeSixty::arrowDirections.some (direction) =>
# If it was pressed
if direction.toUpperCase().charCodeAt(0) == key
@keys.pressed[key] = true
@keys.active = true
# Move
@move direction
# And return true to kill the loop
return true
return
onWindowResize: ->
@camera.aspect = window.innerWidth / window.innerHeight
@camera.updateProjectionMatrix()
@renderer.setSize window.innerWidth, window.innerHeight
return
# Execute the move in the direction indicated
move: (action) ->
console.log "Moving #{action}"
@move@camera action, @camera
@render()
return
move@camera: (action, @camera) ->
@move@cameraAt action, @camera, ThreeSixty::interval
if action == 'up' or action == 'down' or action == 'w' or action == 's'
@correctMovement @camera
return
clearDebug: ->
document.getElementById('debug').innerHTML = null
return
addDebug: (obj) ->
document.getElementById('debug').appendChild(document.createTextNode(JSON.stringify(obj, null, 2)))
return
# Move the @camera in the direction indicated at the rate indicated as well
move@cameraAt: (action, @camera, rate) ->
switch action
when 'left', 'a'
@camera.rotation.y = (@camera.rotation.y + rate) % ThreeSixty::twoPI
when 'right', 'd'
@camera.rotation.y = (@camera.rotation.y - rate) % ThreeSixty::twoPI
when 'up', 'w'
@camera.rotation.x = (@camera.rotation.x + rate) % ThreeSixty::twoPI
when 'down', 's'
@camera.rotation.x = (@camera.rotation.x - rate) % ThreeSixty::twoPI
else
break
return
# Correct the over and under rotation to prevent us from going upside down
correctMovement: (@camera) ->
# If we are going up or down
if @camera.rotation.x < -ThreeSixty::verticalAngleCutOff
@camera.rotation.x = -ThreeSixty::verticalAngleCutOff
else if @camera.rotation.x > ThreeSixty::verticalAngleCutOff
@camera.rotation.x = ThreeSixty::verticalAngleCutOff
return
# Animate all the camera actions for the mouse
animateCameraFromMouse: ->
xMovement = @events['mouse'].position.y / 400
yMovement = @events['mouse'].position.x / 400
console.log "Mouse moving x: #{}"
@camera.rotation.x += xMovement
@camera.rotation.y += yMovement
@correctMovement @camera
# Stop drift
@events['mouse'].position.x *= @driftSlowdownRate
@events['mouse'].position.y *= @driftSlowdownRate
if !@events['mouse'].active and Math.abs(@events['mouse'].position.x) < @driftSpeedCutoff and Math.abs(@events['mouse'].position.y) < @driftSpeedCutoff
# Stop the movement
@events['mouse'].position.x = 0
@events['mouse'].position.y = 0
# Stop the panning
@events['mouse'].panning = false
return
# Render the scene (called every frame)
render: ->
# Request this to be re-run
if @events['mouse'].panning
requestAnimationFrame ThreeSixty::render.bind(this)
# If we are still panning
@animateCameraFromMouse()
# # If the mouse is not in use
# if !@events['mouse'].active
# # Then check buttons + keyboard
# @arrowDirections.forEach (direction) =>
# if @keyboard.pressed(direction) or @events[direction]
# @move direction
# return
# # Set the gyro
# camera.rotation.x = beta;
# camera.rotation.y = alpha;
# # Set the data to json
# document.getElementById('debug').innerHTML = JSON.stringify(@camera.rotation, null, 2)
# Actually render the scene
@renderer.render @scene, @camera
return
run: (images) ->
# bootstrap functions
# initialiaze everything
@init images
return
document.addEventListener 'DOMContentLoaded', ->
prefixData = (prefix) ->
[
'images/' + prefix + '/posx.jpg'
'images/' + prefix + '/negx.jpg'
'images/' + prefix + '/posy.jpg'
'images/' + prefix + '/negy.jpg'
'images/' + prefix + '/posz.jpg'
'images/' + prefix + '/negz.jpg'
]
# run([
# 'images/canary/pos-x.png',
# 'images/canary/neg-x.png',
# 'images/canary/pos-y.png',
# 'images/canary/neg-y.png',
# 'images/canary/pos-z.png',
# 'images/canary/neg-z.png'
# ]);
# run([
# 'images/yokohama/pos-x.jpg',
# 'images/yokohama/neg-x.jpg',
# 'images/yokohama/pos-y.jpg',
# 'images/yokohama/neg-y.jpg',
# 'images/yokohama/pos-z.jpg',
# 'images/yokohama/neg-z.jpg'
# ]);
# runPrefix('storforsen');
# runPrefix('Lycksele2');
# runPrefix('Fj<NAME>');
# runPrefix("GoldenGateBridge");
ts = new ThreeSixty prefixData('storforsen')
return
| true | class ThreeSixty
# The interval of movement for keyboard movements
interval: Math.PI / 200
# When the drift speed is smaller than this number, drifting stops
driftSpeedCutoff: 0.01
# The amount that is multipled by the speed every frame that there isn't any
# movement from the mouse
driftSlowdownRate: 0.90
# Vertial angle that is cut off from exceeding
verticalAngleCutOff: Math.PI / 4
# Constant
twoPI: (2 * Math.PI)
# The direction keys that are mapped
arrowDirections: [
'left'
'right'
'up'
'down'
'w'
'a'
's'
'd'
]
keyboardAliases:
'left': 37
'up': 38
'right': 39
'down': 40
constructor: (images)->
# This source is the javascript needed to build a sky box in **three.js**
# It is the source about this [blog post](/blog/2011/08/15/lets-do-a-sky/).
# Now lets start
# declare a bunch of variable we will need later
@camera = undefined
@scene = undefined
@renderer = undefined
@keyboard = undefined
@alpha = 0
@beta = 0
@gamma = 0
@keys =
pressed: {}
active: false
@events = 'mouse':
active: false
panning: false
position:
x: 0
y: 0
@run images
initEventHandlers: ->
# Create the keyboard monitor
document.addEventListener 'keydown', @onKeyDown, false
# Setup handlers for all the arrow direction id's if they exist
@arrowDirections.forEach (direction) =>
directionElement = document.getElementById(direction)
@events[direction] = false
if directionElement
directionElement.addEventListener 'mousedown', =>
@events[direction] = true
return
directionElement.addEventListener 'click', (e) ->
e.preventDefault()
return
directionElement.addEventListener 'mouseup', =>
@events[direction] = false
return
return
document.addEventListener 'mouseup', =>
@arrowDirections.forEach (direction) =>
@events[direction] = false
return
@events['mouse'].active = false
document.body.style.cursor = 'auto'
return
document.addEventListener 'mousemove', (event) =>
if @events['mouse'].active
@events['mouse'].position.x = event.movementX
@events['mouse'].position.y = event.movementY
return
@renderer.domElement.addEventListener 'mousedown', =>
@events['mouse'].active = true
@events['mouse'].panning = true
document.body.style.cursor = 'move'
return
# when the window is resized, we need to change our camera and renderer
window.addEventListener 'resize', @onWindowResize, false
degToRad = (degrees) ->
degrees * Math.PI / 180
deviceOrientationChanged = (event) ->
# Or rotation about Z
@alpha = degToRad(event.alpha)
# Or rotation about X
@beta = degToRad(event.beta) - (Math.PI / 2)
# Or rotation about Y
@gamma = degToRad(event.gamma)
# Set the data to json
document.getElementById('debug').innerHTML = JSON.stringify({
alpha: @alpha
beta: @beta
gamma: @gamma
}, null, 2)
return
# window.ondeviceorientation = _.throttle(deviceOrientationChanged, 300);
return
# Initialize everything
init: (images) ->
# Create the scene
@scene = new (THREE.Scene)
# Create the camera
@camera = new (THREE.PerspectiveCamera)(70, window.innerWidth / window.innerHeight, 1, 1000)
# Because we don't rotate in the Z direction, this will be a natural rotation order
@camera.rotation.order = 'YXZ'
# Load them
THREE.ImageUtils.loadTextureCube(images, null, @onTextureLoad)
onTextureLoad: (textureCube) =>
# init the cube shadder
shader = THREE.ShaderLib['cube']
# Setup the uniform
uniforms = THREE.UniformsUtils.clone(shader.uniforms)
uniforms['tCube'].value = textureCube
# camerate the material
material = new (THREE.ShaderMaterial)(
fragmentShader: shader.fragmentShader
vertexShader: shader.vertexShader
uniforms: uniforms
side: THREE.BackSide)
# Generate a sphere geometry
meshGeometry = new (THREE.SphereGeometry)(1000, 32, 32)
# build the skybox Mesh using the texture cube
skyBox = new (THREE.Mesh)(meshGeometry, material)
# and add it to the scene
@scene.add skyBox
# create the container element
@renderer = new (THREE.WebGLRenderer)(antialias: true)
# Set it to match the window
@renderer.setSize window.innerWidth, window.innerHeight
# Add it to the document body
document.body.appendChild @renderer.domElement
# Add event handlers
@initEventHandlers()
# make it move!
@render()
return
onKeyDown: (event) =>
# Get the key pressed
key = event.keyCode
console.log "onKeyDown: #{key}"
@keyPressed key
return
keyPressed: (key) =>
# Check if a keyboard key was pressed
if @camera.keys(ThreeSixty::keyboardAliases).indexOf(key) != -1
@keys.pressed[key] = true
@keys.active = true
@move ThreeSixty::keyboardAliases[key]
else
# Check to see if a keyboard direction was pressed
ThreeSixty::arrowDirections.some (direction) =>
# If it was pressed
if direction.toUpperCase().charCodeAt(0) == key
@keys.pressed[key] = true
@keys.active = true
# Move
@move direction
# And return true to kill the loop
return true
return
onWindowResize: ->
@camera.aspect = window.innerWidth / window.innerHeight
@camera.updateProjectionMatrix()
@renderer.setSize window.innerWidth, window.innerHeight
return
# Execute the move in the direction indicated
move: (action) ->
console.log "Moving #{action}"
@move@camera action, @camera
@render()
return
move@camera: (action, @camera) ->
@move@cameraAt action, @camera, ThreeSixty::interval
if action == 'up' or action == 'down' or action == 'w' or action == 's'
@correctMovement @camera
return
clearDebug: ->
document.getElementById('debug').innerHTML = null
return
addDebug: (obj) ->
document.getElementById('debug').appendChild(document.createTextNode(JSON.stringify(obj, null, 2)))
return
# Move the @camera in the direction indicated at the rate indicated as well
move@cameraAt: (action, @camera, rate) ->
switch action
when 'left', 'a'
@camera.rotation.y = (@camera.rotation.y + rate) % ThreeSixty::twoPI
when 'right', 'd'
@camera.rotation.y = (@camera.rotation.y - rate) % ThreeSixty::twoPI
when 'up', 'w'
@camera.rotation.x = (@camera.rotation.x + rate) % ThreeSixty::twoPI
when 'down', 's'
@camera.rotation.x = (@camera.rotation.x - rate) % ThreeSixty::twoPI
else
break
return
# Correct the over and under rotation to prevent us from going upside down
correctMovement: (@camera) ->
# If we are going up or down
if @camera.rotation.x < -ThreeSixty::verticalAngleCutOff
@camera.rotation.x = -ThreeSixty::verticalAngleCutOff
else if @camera.rotation.x > ThreeSixty::verticalAngleCutOff
@camera.rotation.x = ThreeSixty::verticalAngleCutOff
return
# Animate all the camera actions for the mouse
animateCameraFromMouse: ->
xMovement = @events['mouse'].position.y / 400
yMovement = @events['mouse'].position.x / 400
console.log "Mouse moving x: #{}"
@camera.rotation.x += xMovement
@camera.rotation.y += yMovement
@correctMovement @camera
# Stop drift
@events['mouse'].position.x *= @driftSlowdownRate
@events['mouse'].position.y *= @driftSlowdownRate
if !@events['mouse'].active and Math.abs(@events['mouse'].position.x) < @driftSpeedCutoff and Math.abs(@events['mouse'].position.y) < @driftSpeedCutoff
# Stop the movement
@events['mouse'].position.x = 0
@events['mouse'].position.y = 0
# Stop the panning
@events['mouse'].panning = false
return
# Render the scene (called every frame)
render: ->
# Request this to be re-run
if @events['mouse'].panning
requestAnimationFrame ThreeSixty::render.bind(this)
# If we are still panning
@animateCameraFromMouse()
# # If the mouse is not in use
# if !@events['mouse'].active
# # Then check buttons + keyboard
# @arrowDirections.forEach (direction) =>
# if @keyboard.pressed(direction) or @events[direction]
# @move direction
# return
# # Set the gyro
# camera.rotation.x = beta;
# camera.rotation.y = alpha;
# # Set the data to json
# document.getElementById('debug').innerHTML = JSON.stringify(@camera.rotation, null, 2)
# Actually render the scene
@renderer.render @scene, @camera
return
run: (images) ->
# bootstrap functions
# initialiaze everything
@init images
return
document.addEventListener 'DOMContentLoaded', ->
prefixData = (prefix) ->
[
'images/' + prefix + '/posx.jpg'
'images/' + prefix + '/negx.jpg'
'images/' + prefix + '/posy.jpg'
'images/' + prefix + '/negy.jpg'
'images/' + prefix + '/posz.jpg'
'images/' + prefix + '/negz.jpg'
]
# run([
# 'images/canary/pos-x.png',
# 'images/canary/neg-x.png',
# 'images/canary/pos-y.png',
# 'images/canary/neg-y.png',
# 'images/canary/pos-z.png',
# 'images/canary/neg-z.png'
# ]);
# run([
# 'images/yokohama/pos-x.jpg',
# 'images/yokohama/neg-x.jpg',
# 'images/yokohama/pos-y.jpg',
# 'images/yokohama/neg-y.jpg',
# 'images/yokohama/pos-z.jpg',
# 'images/yokohama/neg-z.jpg'
# ]);
# runPrefix('storforsen');
# runPrefix('Lycksele2');
# runPrefix('FjPI:NAME:<NAME>END_PI');
# runPrefix("GoldenGateBridge");
ts = new ThreeSixty prefixData('storforsen')
return
|
[
{
"context": "TF-8 <=> UTF-16 convertion\n# \n# Copyright (C) 1999 Masanao Izumo <iz@onicos.co.jp>\n# Version: 1.0\n# LastModified: ",
"end": 142,
"score": 0.9998875260353088,
"start": 129,
"tag": "NAME",
"value": "Masanao Izumo"
},
{
"context": "convertion\n# \n# Copyright (C) 1999 Masanao Izumo <iz@onicos.co.jp>\n# Version: 1.0\n# LastModified: Dec 25 1999\n# Thi",
"end": 159,
"score": 0.9999332427978516,
"start": 144,
"tag": "EMAIL",
"value": "iz@onicos.co.jp"
}
] | runtime/u8a_to_string.coffee | cheery/better_web_language | 0 | # http://www.onicos.com/staff/iz/amuse/javascript/expert/utf.txt
# utf.js - UTF-8 <=> UTF-16 convertion
#
# Copyright (C) 1999 Masanao Izumo <iz@onicos.co.jp>
# Version: 1.0
# LastModified: Dec 25 1999
# This library is free. You can redistribute it and/or modify it.
#
# Translated to coffeescript.
# Added choice to pick range to translate from.
# If this was C, it would have potential overflow bug. btw.
betterweb.utf8ToString = (array, start=0, stop=array.length) ->
out = ""
i = start
while i < stop
c = array[i++]
d = c >> 4
if c < 128 # 0xxxxxxx
out += String.fromCharCode(c)
else if d == 12 or d == 13 # 110x xxxx 10xx xxxx
char2 = array[i++]
out += String.fromCharCode(((c & 0x1F) << 6) | (char2 & 0x3F))
else if d == 14
# 1110 xxxx 10xx xxxx 10xx xxxx
char2 = array[i++]
char3 = array[i++]
out += String.fromCharCode(((c & 0x0F) << 12) |
((char2 & 0x3F) << 6) |
((char3 & 0x3F) << 0))
else
throw "XXX: utf-8 decoding error?"
return out
| 163505 | # http://www.onicos.com/staff/iz/amuse/javascript/expert/utf.txt
# utf.js - UTF-8 <=> UTF-16 convertion
#
# Copyright (C) 1999 <NAME> <<EMAIL>>
# Version: 1.0
# LastModified: Dec 25 1999
# This library is free. You can redistribute it and/or modify it.
#
# Translated to coffeescript.
# Added choice to pick range to translate from.
# If this was C, it would have potential overflow bug. btw.
betterweb.utf8ToString = (array, start=0, stop=array.length) ->
out = ""
i = start
while i < stop
c = array[i++]
d = c >> 4
if c < 128 # 0xxxxxxx
out += String.fromCharCode(c)
else if d == 12 or d == 13 # 110x xxxx 10xx xxxx
char2 = array[i++]
out += String.fromCharCode(((c & 0x1F) << 6) | (char2 & 0x3F))
else if d == 14
# 1110 xxxx 10xx xxxx 10xx xxxx
char2 = array[i++]
char3 = array[i++]
out += String.fromCharCode(((c & 0x0F) << 12) |
((char2 & 0x3F) << 6) |
((char3 & 0x3F) << 0))
else
throw "XXX: utf-8 decoding error?"
return out
| true | # http://www.onicos.com/staff/iz/amuse/javascript/expert/utf.txt
# utf.js - UTF-8 <=> UTF-16 convertion
#
# Copyright (C) 1999 PI:NAME:<NAME>END_PI <PI:EMAIL:<EMAIL>END_PI>
# Version: 1.0
# LastModified: Dec 25 1999
# This library is free. You can redistribute it and/or modify it.
#
# Translated to coffeescript.
# Added choice to pick range to translate from.
# If this was C, it would have potential overflow bug. btw.
betterweb.utf8ToString = (array, start=0, stop=array.length) ->
out = ""
i = start
while i < stop
c = array[i++]
d = c >> 4
if c < 128 # 0xxxxxxx
out += String.fromCharCode(c)
else if d == 12 or d == 13 # 110x xxxx 10xx xxxx
char2 = array[i++]
out += String.fromCharCode(((c & 0x1F) << 6) | (char2 & 0x3F))
else if d == 14
# 1110 xxxx 10xx xxxx 10xx xxxx
char2 = array[i++]
char3 = array[i++]
out += String.fromCharCode(((c & 0x0F) << 12) |
((char2 & 0x3F) << 6) |
((char3 & 0x3F) << 0))
else
throw "XXX: utf-8 decoding error?"
return out
|
[
{
"context": "(@els[0], {})\n if Type.isString key\n key = camelCase key\n if arguments.length < 2\n return ",
"end": 480,
"score": 0.745714545249939,
"start": 471,
"tag": "KEY",
"value": "camelCase"
}
] | src/coffee/kernel/cache/cache.coffee | oatw/luda | 183 | import luda from '../base/luda.coffee'
import camelCase from '../base/camel-case.coffee'
import Type from '../base/type.coffee'
import {access, _access} from './helpers/access.coffee'
import './remove-cache.coffee'
luda.extend
cache: (isPrivate) -> if isPrivate then _access() else access()
luda.include
cache: (key, value) ->
unless key
return unless @els[0]
return access(@els[0]) or access(@els[0], {})
if Type.isString key
key = camelCase key
if arguments.length < 2
return unless @els[0]
access(@els[0], {}) unless access(@els[0])
return access @els[0], key
return this if value is undefined
return @removeCache key if value is null
@els.forEach (el) ->
access(el, {}) unless access(el)
access el, key, value
return this
@cache k, v for k, v of key
this | 91787 | import luda from '../base/luda.coffee'
import camelCase from '../base/camel-case.coffee'
import Type from '../base/type.coffee'
import {access, _access} from './helpers/access.coffee'
import './remove-cache.coffee'
luda.extend
cache: (isPrivate) -> if isPrivate then _access() else access()
luda.include
cache: (key, value) ->
unless key
return unless @els[0]
return access(@els[0]) or access(@els[0], {})
if Type.isString key
key = <KEY> key
if arguments.length < 2
return unless @els[0]
access(@els[0], {}) unless access(@els[0])
return access @els[0], key
return this if value is undefined
return @removeCache key if value is null
@els.forEach (el) ->
access(el, {}) unless access(el)
access el, key, value
return this
@cache k, v for k, v of key
this | true | import luda from '../base/luda.coffee'
import camelCase from '../base/camel-case.coffee'
import Type from '../base/type.coffee'
import {access, _access} from './helpers/access.coffee'
import './remove-cache.coffee'
luda.extend
cache: (isPrivate) -> if isPrivate then _access() else access()
luda.include
cache: (key, value) ->
unless key
return unless @els[0]
return access(@els[0]) or access(@els[0], {})
if Type.isString key
key = PI:KEY:<KEY>END_PI key
if arguments.length < 2
return unless @els[0]
access(@els[0], {}) unless access(@els[0])
return access @els[0], key
return this if value is undefined
return @removeCache key if value is null
@els.forEach (el) ->
access(el, {}) unless access(el)
access el, key, value
return this
@cache k, v for k, v of key
this |
[
{
"context": "e- Generates default rule template\n#\n# Author:\n# Scott J Roberts - @sroberts\n\nmodule.exports = (robot) ->\n robot.",
"end": 209,
"score": 0.9998759031295776,
"start": 194,
"tag": "NAME",
"value": "Scott J Roberts"
},
{
"context": "lt rule template\n#\n# Author:\n# Scott J Roberts - @sroberts\n\nmodule.exports = (robot) ->\n robot.respond /yar",
"end": 221,
"score": 0.9992750883102417,
"start": 212,
"tag": "USERNAME",
"value": "@sroberts"
}
] | src/scripts/yara.coffee | 3ch01c/hubot-vtr-scripts | 47 | # Description:
# Generate Yara Rule with strings
#
# Dependencies:
# None
#
# Configuration:
# None…
#
# Commands:
# hubot yara template- Generates default rule template
#
# Author:
# Scott J Roberts - @sroberts
module.exports = (robot) ->
robot.respond /yara template/i, (msg) ->
# Default Values
yara_rule_name = "rule_name"
yara_rule_category = "category"
yara_meta_author = "Hubot"
yara_meta_date = "2013-01-01"
yara_meta_description = "Default Rule Template"
yara_strings_list = ['foo', 'bar', 'baz']
# If there's strings generate rule with strings
# Generate Strings Section
# yara_conditions = 0
# yara_strings_parsed = ""
#
# for yara_string in yara_strings_list
# yara_strings_parsed += " string#{yara_conditions} '#{yara_string}'\n"
# yara_conditions++
new_rule = """
rule #{yara_rule_name} : #{yara_rule_category}
{
meta:
author = '#{yara_meta_author}'
date = '#{yara_meta_date}'
description = '#{yara_meta_description}'
strings:
$string0 = "foo"
$string1 = "bar"
$string2 = "baz" wide
condition:
3 of them
}
"""
msg.send new_rule
| 24327 | # Description:
# Generate Yara Rule with strings
#
# Dependencies:
# None
#
# Configuration:
# None…
#
# Commands:
# hubot yara template- Generates default rule template
#
# Author:
# <NAME> - @sroberts
module.exports = (robot) ->
robot.respond /yara template/i, (msg) ->
# Default Values
yara_rule_name = "rule_name"
yara_rule_category = "category"
yara_meta_author = "Hubot"
yara_meta_date = "2013-01-01"
yara_meta_description = "Default Rule Template"
yara_strings_list = ['foo', 'bar', 'baz']
# If there's strings generate rule with strings
# Generate Strings Section
# yara_conditions = 0
# yara_strings_parsed = ""
#
# for yara_string in yara_strings_list
# yara_strings_parsed += " string#{yara_conditions} '#{yara_string}'\n"
# yara_conditions++
new_rule = """
rule #{yara_rule_name} : #{yara_rule_category}
{
meta:
author = '#{yara_meta_author}'
date = '#{yara_meta_date}'
description = '#{yara_meta_description}'
strings:
$string0 = "foo"
$string1 = "bar"
$string2 = "baz" wide
condition:
3 of them
}
"""
msg.send new_rule
| true | # Description:
# Generate Yara Rule with strings
#
# Dependencies:
# None
#
# Configuration:
# None…
#
# Commands:
# hubot yara template- Generates default rule template
#
# Author:
# PI:NAME:<NAME>END_PI - @sroberts
module.exports = (robot) ->
robot.respond /yara template/i, (msg) ->
# Default Values
yara_rule_name = "rule_name"
yara_rule_category = "category"
yara_meta_author = "Hubot"
yara_meta_date = "2013-01-01"
yara_meta_description = "Default Rule Template"
yara_strings_list = ['foo', 'bar', 'baz']
# If there's strings generate rule with strings
# Generate Strings Section
# yara_conditions = 0
# yara_strings_parsed = ""
#
# for yara_string in yara_strings_list
# yara_strings_parsed += " string#{yara_conditions} '#{yara_string}'\n"
# yara_conditions++
new_rule = """
rule #{yara_rule_name} : #{yara_rule_category}
{
meta:
author = '#{yara_meta_author}'
date = '#{yara_meta_date}'
description = '#{yara_meta_description}'
strings:
$string0 = "foo"
$string1 = "bar"
$string2 = "baz" wide
condition:
3 of them
}
"""
msg.send new_rule
|
[
{
"context": "# Copyright Joyent, Inc. and other Node contributors.\n#\n# Permission",
"end": 18,
"score": 0.9986030459403992,
"start": 12,
"tag": "NAME",
"value": "Joyent"
},
{
"context": "eq.resume()\n return\n\nserver.listen common.PORT, \"127.0.0.1\", ->\n i = 0\n\n while i < 10\n connections++\n ",
"end": 1810,
"score": 0.9932437539100647,
"start": 1801,
"tag": "IP_ADDRESS",
"value": "127.0.0.1"
}
] | test/pummel/test-http-upload-timeout.coffee | lxe/io.coffee | 0 | # Copyright Joyent, Inc. and other Node contributors.
#
# Permission is hereby granted, free of charge, to any person obtaining a
# copy of this software and associated documentation files (the
# "Software"), to deal in the Software without restriction, including
# without limitation the rights to use, copy, modify, merge, publish,
# distribute, sublicense, and/or sell copies of the Software, and to permit
# persons to whom the Software is furnished to do so, subject to the
# following conditions:
#
# The above copyright notice and this permission notice shall be included
# in all copies or substantial portions of the Software.
#
# THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS
# OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF
# MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN
# NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM,
# DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR
# OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE
# USE OR OTHER DEALINGS IN THE SOFTWARE.
# This tests setTimeout() by having multiple clients connecting and sending
# data in random intervals. Clients are also randomly disconnecting until there
# are no more clients left. If no false timeout occurs, this test has passed.
common = require("../common")
assert = require("assert")
http = require("http")
server = http.createServer()
connections = 0
server.on "request", (req, res) ->
req.socket.setTimeout 1000
req.socket.on "timeout", ->
throw new Error("Unexpected timeout")return
req.on "end", ->
connections--
res.writeHead 200
res.end "done\n"
server.close() if connections is 0
return
req.resume()
return
server.listen common.PORT, "127.0.0.1", ->
i = 0
while i < 10
connections++
setTimeout (->
ping = ->
nextPing = (Math.random() * 900).toFixed()
if nextPing > 600
request.end()
return
request.write "ping"
setTimeout ping, nextPing
return
request = http.request(
port: common.PORT
method: "POST"
path: "/"
)
ping()
return
), i * 50
i++
return
| 54054 | # Copyright <NAME>, Inc. and other Node contributors.
#
# Permission is hereby granted, free of charge, to any person obtaining a
# copy of this software and associated documentation files (the
# "Software"), to deal in the Software without restriction, including
# without limitation the rights to use, copy, modify, merge, publish,
# distribute, sublicense, and/or sell copies of the Software, and to permit
# persons to whom the Software is furnished to do so, subject to the
# following conditions:
#
# The above copyright notice and this permission notice shall be included
# in all copies or substantial portions of the Software.
#
# THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS
# OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF
# MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN
# NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM,
# DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR
# OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE
# USE OR OTHER DEALINGS IN THE SOFTWARE.
# This tests setTimeout() by having multiple clients connecting and sending
# data in random intervals. Clients are also randomly disconnecting until there
# are no more clients left. If no false timeout occurs, this test has passed.
common = require("../common")
assert = require("assert")
http = require("http")
server = http.createServer()
connections = 0
server.on "request", (req, res) ->
req.socket.setTimeout 1000
req.socket.on "timeout", ->
throw new Error("Unexpected timeout")return
req.on "end", ->
connections--
res.writeHead 200
res.end "done\n"
server.close() if connections is 0
return
req.resume()
return
server.listen common.PORT, "127.0.0.1", ->
i = 0
while i < 10
connections++
setTimeout (->
ping = ->
nextPing = (Math.random() * 900).toFixed()
if nextPing > 600
request.end()
return
request.write "ping"
setTimeout ping, nextPing
return
request = http.request(
port: common.PORT
method: "POST"
path: "/"
)
ping()
return
), i * 50
i++
return
| true | # Copyright PI:NAME:<NAME>END_PI, Inc. and other Node contributors.
#
# Permission is hereby granted, free of charge, to any person obtaining a
# copy of this software and associated documentation files (the
# "Software"), to deal in the Software without restriction, including
# without limitation the rights to use, copy, modify, merge, publish,
# distribute, sublicense, and/or sell copies of the Software, and to permit
# persons to whom the Software is furnished to do so, subject to the
# following conditions:
#
# The above copyright notice and this permission notice shall be included
# in all copies or substantial portions of the Software.
#
# THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS
# OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF
# MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN
# NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM,
# DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR
# OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE
# USE OR OTHER DEALINGS IN THE SOFTWARE.
# This tests setTimeout() by having multiple clients connecting and sending
# data in random intervals. Clients are also randomly disconnecting until there
# are no more clients left. If no false timeout occurs, this test has passed.
common = require("../common")
assert = require("assert")
http = require("http")
server = http.createServer()
connections = 0
server.on "request", (req, res) ->
req.socket.setTimeout 1000
req.socket.on "timeout", ->
throw new Error("Unexpected timeout")return
req.on "end", ->
connections--
res.writeHead 200
res.end "done\n"
server.close() if connections is 0
return
req.resume()
return
server.listen common.PORT, "127.0.0.1", ->
i = 0
while i < 10
connections++
setTimeout (->
ping = ->
nextPing = (Math.random() * 900).toFixed()
if nextPing > 600
request.end()
return
request.write "ping"
setTimeout ping, nextPing
return
request = http.request(
port: common.PORT
method: "POST"
path: "/"
)
ping()
return
), i * 50
i++
return
|
[
{
"context": "module.exports =\n\n\tuser:\n\t\tpassword:\t\t\"bacerocks\"\n\t\ttimeoutMins:\t\"30\"\n\n\t\ttheme: \t\t\t'dawn'\n\n\t\ttypeC",
"end": 48,
"score": 0.9990426898002625,
"start": 39,
"tag": "PASSWORD",
"value": "bacerocks"
}
] | src/server/default-settings.coffee | mark-hahn/bace | 1 | module.exports =
user:
password: "bacerocks"
timeoutMins: "30"
theme: 'dawn'
typeColors:
text: ['white', 'black']
| 217244 | module.exports =
user:
password: "<PASSWORD>"
timeoutMins: "30"
theme: 'dawn'
typeColors:
text: ['white', 'black']
| true | module.exports =
user:
password: "PI:PASSWORD:<PASSWORD>END_PI"
timeoutMins: "30"
theme: 'dawn'
typeColors:
text: ['white', 'black']
|
Subsets and Splits
No community queries yet
The top public SQL queries from the community will appear here once available.